1 2000-10-10 Allan Rae <rae@lyx.org>
3 * src/BufferView_pimpl.C (buffer): don't call upadteBufferDependent
4 unless there really is a buffer. hideBufferDependent is called
7 * Makefile.in.in (POTFILES.in): one little tweak to ensure POTFILES.in
10 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
12 * lib/lyxrc.example: Few changes.
14 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
16 * src/BufferView_pimpl.C (buffer): only need one the
17 updateBufferDependent signal to be emitted once! Moved to the end of
18 the method to allow bv_->text to be updated first.
20 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
21 and hSignal_ with Dialogs * and BufferDependency variables.
22 New Buffer * parent_, initialised when the dialog is launched. Used to
23 check whether to update() or hide() dialog in the new, private
24 updateOrHide() method that is connected to the updateBufferDependent
25 signal. Daughter classes dictate what to do using the
26 ChangedBufferAction enum, passed to the c-tor.
28 * src/frontends/xforms/FormCitation.C:
29 * src/frontends/xforms/FormCommand.C:
30 * src/frontends/xforms/FormCopyright.C:
31 * src/frontends/xforms/FormDocument.C:
32 * src/frontends/xforms/FormError.C:
33 * src/frontends/xforms/FormIndex.C:
34 * src/frontends/xforms/FormPreferences.C:
35 * src/frontends/xforms/FormPrint.C:
36 * src/frontends/xforms/FormRef.C:
37 * src/frontends/xforms/FormToc.C:
38 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
41 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
42 ChangedBufferAction enum.
44 * src/frontends/xforms/FormParagraph.[Ch]
45 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
48 * src/frontends/xforms/FormToc.h (updateOrHide): override default
49 behaviour. Calls update() only.
51 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
53 * lib/bind/cua.bind: fix a bit.
54 * lib/bind/emacs.bind: ditto.
56 * lib/bind/menus.bind: remove real menu entries from there.
58 * src/spellchecker.C: make sure we only include strings.h when
61 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
63 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
64 function. It enlarges the maximum number of pup when needed.
65 (add_toc2): Open a new menu if maximum number of items per menu has
68 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
70 * src/frontends/kde/FormPrint.C: fix error reporting
72 * src/frontends/xforms/FormDocument.C: fix compiler
75 * lib/.cvsignore: add Literate.nw
77 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
80 * bufferview_funcs.[Ch]
83 * text2.C: Add support for numbers in RTL text.
85 2000-10-06 Allan Rae <rae@lyx.org>
87 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
88 to be gettext.m4 friendly again. ext_l10n.h is now
89 generated into $top_srcdir instead of $top_builddir
90 so that lyx.pot will be built correctly -- without
91 duplicate parsing of ext_l10n.h.
93 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
95 * src/frontends/kde/FormCitation.C: make the dialog
98 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
100 * config/kde.m4: fix consecutive ./configure runs,
101 look for qtarch, fix library order
103 * src/frontends/kde/Makefile.am: tidy up,
104 add Print dialog, add .dlg dependencies
106 * src/frontends/kde/FormPrint.C:
107 * src/frontends/kde/FormPrint.h:
108 * src/frontends/kde/formprintdialog.C:
109 * src/frontends/kde/formprintdialog.h:
110 * src/frontends/kde/formprintdialogdata.C:
111 * src/frontends/kde/formprintdialogdata.h:
112 * src/frontends/kde/dlg/formprintdialog.dlg: add
115 * src/frontends/kde/dlg/README: Added explanatory readme
117 * src/frontends/kde/dlg/checkinitorder.pl: small perl
118 script to double-check qtarch's output
120 * src/frontends/kde/formindexdialog.C:
121 * src/frontends/kde/formindexdialogdata.C:
122 * src/frontends/kde/formindexdialogdata.h:
123 * src/frontends/kde/dlg/formindexdialog.dlg: update
124 for qtarch, minor fixes
126 2000-10-05 Allan Rae <rae@lyx.org>
128 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
129 dialogs when switching buffers update them instead. It's up to each
130 dialog to decide if it should still be visible or not.
131 update() should return a bool to control visiblity within show().
132 Or perhaps better to set a member variable and use that to control
135 * lib/build-listerrors: create an empty "listerrors" file just to stop
136 make trying to regenerate it all the time if you don't have noweb
139 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
141 * po/Makefile.in.in (ext_l10n.h): added a rule to build
142 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
143 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
144 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
145 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
147 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
149 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
151 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
152 deleting buffer. Closes all buffer-dependent dialogs.
154 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
156 * src/frontends/xforms/FormCitation.[Ch]:
157 * src/frontends/xforms/FormPreferences.[Ch]:
158 * src/frontends/xforms/FormPrint.[Ch]:
159 * src/frontends/xforms/FormRef.[Ch]:
160 * src/frontends/xforms/FormUrl.[Ch]: ditto
162 * src/frontends/xforms/FormDocument.[Ch]:
163 * src/frontends/xforms/forms/form_document.C.patch:
164 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
165 pass through a single input() function.
167 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
169 * lib/build-listerrors: return status as OK
171 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
173 * lib/lyxrc.example: Updated to new export code
175 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
177 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
180 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
183 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
185 * lib/layouts/amsbook.layout: ditto.
187 * boost/Makefile.am: fix typo.
189 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
191 (add_lastfiles): removed.
192 (add_documents): removed.
193 (add_formats): removed.
195 * src/frontends/Menubar.C: remove useless "using" directive.
197 * src/MenuBackend.h: add a new MenuItem constructor.
199 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
202 2000-10-04 Allan Rae <rae@lyx.org>
204 * lib/Makefile.am (listerrors):
205 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
206 I haven't got notangle installed so Kayvan please test. The output
207 should end up in $builddir. This also allows people who don't have
208 noweb installed to complete the make process without error.
210 * src/frontends/xforms/FormCommand.[Ch] (showInset):
211 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
212 by JMarc's picky compiler.
214 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
217 * src/insets/insettabular.C (setPos): change for loop to not use
218 sequencing operator. Please check this Jürgen.
220 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
222 * src/insets/insetcite.C (getScreenLabel): ditto
223 * src/support/filetools.C (QuoteName): ditto
224 (ChangeExtension): ditto
226 * src/BufferView_pimpl.C (scrollCB): make heigt int
228 * src/BufferView2.C (insertInset): comment out unused arg
230 * boost/Makefile.am (EXTRADIST): new variable
232 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
234 * src/exporter.C (IsExportable): Fixed
236 * lib/configure.m4: Small fix
238 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
240 * src/insets/insetbutton.C (width): Changed to work with no GUI.
241 * src/insets/insetbib.C (bibitemWidest): ditto.
242 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
244 2000-10-03 Juergen Vigna <jug@sad.it>
246 * src/BufferView2.C (theLockingInset): removed const because of
247 Agnus's compile problems.
249 * src/insets/insettext.C (LocalDispatch): set the language of the
250 surronding paragraph on inserting the first character.
252 * various files: changed use of BufferView::the_locking_inset.
254 * src/BufferView2.C (theLockingInset):
255 (theLockingInset): new functions.
257 * src/BufferView.h: removed the_locking_inset.
259 * src/lyxtext.h: added the_locking_inset
261 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
263 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
265 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
267 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
268 * src/mathed/math_cursor.C (IsAlpha): ditto.
269 * src/mathed/math_inset.C (strnew): ditto.
270 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
271 (IMetrics): cxp set but never used; removed.
272 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
273 that the variable in question has been removed also!
276 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
277 using the Buffer * passed to Latex(), using the BufferView * passed to
278 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
280 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
281 Linuxdoc() and DocBook() rather than the stored Buffer * master.
283 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
284 * src/buffer.C (readInset): used new InsetBibtex c-tor
285 * (getBibkeyList): used new InsetBibtex::getKeys
287 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
290 * lib/build-listerrors
292 * src/exporter.C: Add literate programming support to the export code
295 * src/lyx_cb.C: Remove old literate code.
297 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
300 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
301 * src/converter.C (View, Convert): Use QuoteName.
303 * src/insets/figinset.C (Preview): Use Formats::View.
305 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
307 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
309 * src/lyxfunc.C (Dispatch): move declaration of text variable at
310 the top of the function, because compaq cxx complains that the
311 "goto exit_with_message" when the function is disabled bypasses
313 (MenuNew): try a better fix for the generation of new file names.
314 This time, I used AddName() instead of AddPath(), hoping Juergen
317 2000-10-03 Allan Rae <rae@lyx.org>
319 * src/frontends/xforms/forms/form_preferences.fd:
320 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
321 nested tabfolders has begun. The old "Miscellaneous" was renamed as
322 "Look and Feel"->"General" but will need to be split up further into
323 general output and general input tabs. Current plan is for four outer
324 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
325 stuff; "Inputs" for input and import configuration; "Outputs" for
326 output and export configuration; and one more whatever is left over
327 called "General". The leftovers at present look like being which
328 viewers to use, spellchecker, language support and might be better
329 named "Support". I've put "Paths" in "Inputs" for the moment as this
330 seems reasonable for now at least.
331 One problem remains: X error kills LyX when you close Preferences.
333 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
335 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
336 qualifier from form()
337 * src/frontends/xforms/FormCitation.[Ch]:
338 * src/frontends/xforms/FormCopyright.[Ch]:
339 * src/frontends/xforms/FormDocument.[Ch]:
340 * src/frontends/xforms/FormError.[Ch]:
341 * src/frontends/xforms/FormIndex.[Ch]:
342 * src/frontends/xforms/FormPreferences.[Ch]:
343 * src/frontends/xforms/FormPrint.[Ch]:
344 * src/frontends/xforms/FormRef.[Ch]:
345 * src/frontends/xforms/FormToc.[Ch]:
346 * src/frontends/xforms/FormUrl.[Ch]: ditto.
348 * src/frontends/xforms/FormCitation.[Ch]:
349 * src/frontends/xforms/FormIndex.[Ch]:
350 * src/frontends/xforms/FormRef.[Ch]:
351 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
352 with Allan's naming policy
354 * src/frontends/xforms/FormCitation.C: some static casts to remove
357 2000-10-02 Juergen Vigna <jug@sad.it>
359 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
360 now you can type or do stuff inside the table-cell also when in dummy
361 position, fixed visible cursor.
363 * src/insets/insettext.C (Edit): fixing cursor-view position.
365 * src/lyxfunc.C (Dispatch): use * text variable so that it can
366 be used for equal functions in lyxfunc and insettext.
368 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
370 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
372 * src/frontends/gnome/FormCitation.h:
373 * src/frontends/gnome/FormCopyright.h:
374 * src/frontends/gnome/FormIndex.h:
375 * src/frontends/gnome/FormPrint.h:
376 * src/frontends/gnome/FormToc.h:
377 * src/frontends/gnome/FormUrl.h:
378 * src/frontends/kde/FormCitation.h:
379 * src/frontends/kde/FormCopyright.h:
380 * src/frontends/kde/FormIndex.h:
381 * src/frontends/kde/FormRef.h:
382 * src/frontends/kde/FormToc.h:
383 * src/frontends/kde/FormUrl.h: fix remaining users of
386 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
388 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
390 (DocBookHandleCaption): ditto.
391 (DocBookHandleFootnote): ditto.
392 (SimpleDocBookOnePar): ditto.
394 * src/frontends/xforms/FormDocument.h (form): remove extra
395 FormDocument:: qualifier.
397 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
399 * sigc++/handle.h: ditto.
401 * src/lyx_gui_misc.C: add "using" directive.
403 * src/cheaders/cstddef: new file, needed by the boost library (for
406 2000-10-02 Juergen Vigna <jug@sad.it>
408 * src/insets/insettext.C (SetFont): better support.
410 * src/insets/insettabular.C (draw): fixed drawing of single cell.
412 * src/screen.C (DrawOneRow): some uint refixes!
414 2000-10-02 Allan Rae <rae@lyx.org>
416 * boost/.cvsignore: ignore Makefile as well
418 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
419 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
421 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
422 Left this one out by accident.
424 * src/frontends/xforms/FormBase.h (restore): default to calling
425 update() since that will restore the original/currently-applied values.
426 Any input() triggered error messages will require the derived classes
427 to redefine restore().
429 * src/frontends/xforms/FormDocument.C: initialize a few variables to
430 avoid a segfault. combo_doc_class is the main concern.
432 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
434 * Simplify build-listerrors in view of GUI-less export ability!
436 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
438 * src/lyx_main.C (easyParse): Disable gui when exporting
440 * src/insets/figinset.C:
444 * src/tabular.C: Changes to allow no-gui.
446 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
448 * src/support/utility.hpp: removed file
449 * src/support/block.h: removed file
451 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
454 * src/mathed/formula.C: add support/lyxlib.h
455 * src/mathed/formulamacro.C: ditto
457 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
458 * src/lyxparagraph.h: ditto
460 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
461 * src/frontends/Makefile.am (INCLUDES): ditto
462 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
463 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
464 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
465 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
466 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
467 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
469 * src/BufferView.h: use boost/utility.hpp
470 * src/LColor.h: ditto
472 * src/LyXAction.h: ditto
473 * src/LyXView.h: ditto
474 * src/bufferlist.h: ditto
475 * src/lastfiles.h: ditto
476 * src/layout.h: ditto
477 * src/lyx_gui.h: ditto
478 * src/lyx_main.h: ditto
479 * src/lyxlex.h: ditto
481 * src/frontends/ButtonPolicies.h: ditto
482 * src/frontends/Dialogs.h: ditto
483 * src/frontends/xforms/FormBase.h: ditto
484 * src/frontends/xforms/FormGraphics.h: ditto
485 * src/frontends/xforms/FormParagraph.h: ditto
486 * src/frontends/xforms/FormTabular.h: ditto
487 * src/graphics/GraphicsCache.h: ditto
488 * src/graphics/Renderer.h: ditto
489 * src/insets/ExternalTemplate.h: ditto
490 * src/insets/insetcommand.h: ditto
491 * src/support/path.h: ditto
493 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
494 and introduce clause for 2.97.
496 * boost/libs/README: new file
498 * boost/boost/utility.hpp: new file
500 * boost/boost/config.hpp: new file
502 * boost/boost/array.hpp: new file
504 * boost/Makefile.am: new file
506 * boost/.cvsignore: new file
508 * configure.in (AC_OUTPUT): add boost/Makefile
510 * Makefile.am (SUBDIRS): add boost
512 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
514 * src/support/lstrings.C (suffixIs): Fixed.
516 2000-10-01 Allan Rae <rae@lyx.org>
518 * src/PrinterParams.h: moved things around to avoid the "can't
519 inline call" warning.
521 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
522 into doc++ documentation.
524 * src/frontends/xforms/FormCommand.[Ch]: support button policy
526 * src/frontends/xforms/FormRef.C: make use of button controller
527 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
528 cleaned up button controller usage.
529 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
530 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
531 use the button controller
533 * src/frontends/xforms/forms/*.fd: and associated generated files
534 updated to reflect changes to FormBase. Some other FormXxxx files
535 also got minor updates to reflect changes to FormBase.
537 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
538 (hide): made virtual.
539 (input): return a bool. true == valid input
540 (RestoreCB, restore): new
541 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
542 Changes to allow derived dialogs to use a ButtonController and
543 make sense when doing so: OK button calls ok() and so on.
545 * src/frontends/xforms/ButtonController.h (class ButtonController):
546 Switch from template implementation to taking Policy parameter.
547 Allows FormBase to provide a ButtonController for any dialog.
549 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
550 Probably should rename connect and disconnect.
551 (apply): use the radio button groups
552 (form): needed by FormBase
553 (build): setup the radio button groups
555 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
557 * several files: type changes to reduce the number of warnings and
558 to unify type hangling a bit. Still much to do.
560 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
562 * lib/images/*: rename a bunch of icons to match Dekel converter
565 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
568 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
570 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
572 * sigc++/handle.h: ditto for class Handle.
574 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
576 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
578 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
580 * src/intl.C (InitKeyMapper): Correct the value of n due to the
581 removal of the "default" language.
583 * src/combox.h (getline): Check that sel > 0
585 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
587 * lib/examples/docbook_example.lyx
588 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
590 * lib/layouts/docbook-book.layout: new docbook book layout.
592 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
594 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
596 * src/insets/figinset.C (DocBook):fixed small typo.
598 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
600 * src/insets/insetinclude.h: string include_label doesn't need to be
603 2000-09-29 Allan Rae <rae@lyx.org>
605 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
606 Allow derived type to control connection and disconnection from signals
607 of its choice if desired.
609 2000-09-28 Juergen Vigna <jug@sad.it>
611 * src/insets/insettabular.C (update): fixed cursor setting when
612 the_locking_inset changed.
613 (draw): made this a bit cleaner.
614 (InsetButtonPress): fixed!
616 * various files: added LyXText Parameter to fitCursor call.
618 * src/BufferView.C (fitCursor): added LyXText parameter.
620 * src/insets/insettabular.C (draw): small draw fix.
622 * src/tabular.C: right setting of left/right celllines.
624 * src/tabular.[Ch]: fixed various types in funcions and structures.
625 * src/insets/insettabular.C: ditto
626 * src/frontends/xforms/FormTabular.C: ditto
628 2000-09-28 Allan Rae <rae@lyx.org>
630 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
631 that the #ifdef's had been applied to part of what should have been
632 a complete condition. It's possible there are other tests that
633 were specific to tables that are also wrong now that InsetTabular is
634 being used. Now we need to fix the output of '\n' after a table in a
635 float for the same reason as the original condition:
636 "don't insert this if we would be adding it before or after a table
637 in a float. This little trick is needed in order to allow use of
638 tables in \subfigures or \subtables."
639 Juergen can you check this?
641 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
643 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
644 outputed to the ostream.
646 * several files: fixed types based on warnings from cxx
648 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
650 * src/frontends/kde/Makefile.am: fix rule for
651 formindexdialogdata_moc.C
653 * src/.cvsignore: add ext_l10n.h to ignore
655 * acconfig.h: stop messing with __STRICT_ANSI__
656 * config/gnome.m4: remove option to set -ansi
657 * config/kde.m4: remove option to set -ansi
658 * config/lyxinclude.m4: don't set -ansi
660 2000-09-27 Juergen Vigna <jug@sad.it>
662 * various files: remove "default" language check.
664 * src/insets/insetquotes.C: removed use of current_view.
666 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
667 the one should have red ears by now!
669 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
670 in more then one paragraph. Fixed cursor-movement/selection.
672 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
673 paragraphs inside a text inset.
675 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
676 text-inset if this owner is an inset.
678 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
680 * src/Bullet.h: changed type of font, character and size to int
682 * src/buffer.C (asciiParagraph): remove actcell and fname1.
684 * src/insets/inseturl.[Ch]:
685 * src/insets/insetref.[Ch]:
686 * src/insets/insetlabel.[Ch]: add linelen to Ascii
688 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
690 * src/buffer.C (readFile): block-if statement rearranged to minimise
691 bloat. Patch does not reverse Jean-Marc's change ;-)
693 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
694 Class rewritten to store pointers to hide/update signals directly,
695 rather than Dialogs *. Also defined an enum to ease use. All xforms
696 forms can now be derived from this class.
698 * src/frontends/xforms/FormCommand.[Ch]
699 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
701 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
704 * src/frontends/xforms/forms/form_citation.fd
705 * src/frontends/xforms/forms/form_copyright.fd
706 * src/frontends/xforms/forms/form_error.fd
707 * src/frontends/xforms/forms/form_index.fd
708 * src/frontends/xforms/forms/form_ref.fd
709 * src/frontends/xforms/forms/form_toc.fd
710 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
712 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
714 * src/insets/insetfoot.C: removed redundent using directive.
716 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
718 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
719 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
721 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
722 created in the constructors in different groups. Then set() just
723 have to show the groups as needed. This fixes the redraw problems
724 (and is how the old menu code worked).
726 * src/support/lyxlib.h: declare the methods as static when we do
729 2000-09-26 Juergen Vigna <jug@sad.it>
731 * src/buffer.C (asciiParagraph): new function.
732 (writeFileAscii): new function with parameter ostream.
733 (writeFileAscii): use now asciiParagraph.
735 * various inset files: added the linelen parameter to the Ascii-func.
737 * src/tabular.C (Write): fixed error in writing file introduced by
738 the last changes from Lars.
740 * lib/bind/menus.bind: removed not supported functions.
742 * src/insets/insettext.C (Ascii): implemented this function.
744 * src/insets/lyxinset.h (Ascii): added linelen parameter.
746 * src/tabular.C (write_attribute[int,string,bool]): new functions.
747 (Write): use of the write_attribute functions.
749 * src/bufferlist.C (close): fixed reasking question!
751 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
753 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
754 new files use the everwhere possible.
757 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
758 src/log_form.C src/lyx.C:
761 * src/buffer.C (runLaTeX): remove func
763 * src/PaperLayout.C: removed file
764 * src/ParagraphExtra.C: likewise
765 * src/bullet_forms.C: likewise
766 * src/bullet_forms.h: likewise
767 * src/bullet_forms_cb.C: likewise
769 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
770 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
773 * several files: remove all traces of the old fd_form_paragraph,
774 and functions belonging to that.
776 * several files: remove all traces of the old fd_form_document,
777 and functions belonging to that.
779 * several files: constify local variables were possible.
781 * several files: remove all code that was dead when NEW_EXPORT was
784 * several files: removed string::c_str in as many places as
787 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
788 (e): be a bit more outspoken when patching
789 (updatesrc): only move files if changed.
791 * forms/layout_forms.h.patch: regenerated
793 * forms/layout_forms.fd: remove form_document and form_paragraph
794 and form_quotes and form_paper and form_table_options and
797 * forms/form1.fd: remove form_table
799 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
800 the fdui->... rewrite. Update some comments to xforms 0.88
802 * forms/bullet_forms.C.patch: removed file
803 * forms/bullet_forms.fd: likewise
804 * forms/bullet_forms.h.patch: likewise
806 * development/Code_rules/Rules: added a section on switch
807 statements. Updated some comment to xforms 0.88.
809 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
811 * src/buffer.C (readFile): make sure that the whole version number
812 is read after \lyxformat (even when it contains a comma)
814 * lib/ui/default.ui: change shortcut of math menu to M-a.
816 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
818 * src/vspace.C (nextToken): use isStrDbl() to check for proper
821 * src/LyXView.C (updateWindowTitle): show the full files name in
822 window title, limited to 30 characters.
824 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
825 When a number of characters has been given, we should not assume
826 that the string is 0-terminated.
828 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
829 calls (fixes some memory leaks)
831 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
832 trans member on exit.
834 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
836 * src/converter.C (GetReachable): fix typo.
838 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
839 understand ',' instead of '.'.
840 (GetInteger): rewrite to use strToInt().
842 2000-09-26 Juergen Vigna <jug@sad.it>
844 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
845 better visibility and error-message on wrong VSpace input.
847 * src/language.C (initL): added english again.
849 2000-09-25 Juergen Vigna <jug@sad.it>
851 * src/frontends/kde/Dialogs.C (Dialogs):
852 * src/frontends/gnome/Dialogs.C (Dialogs):
853 * src/frontends/kde/Makefile.am:
854 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
856 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
858 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
860 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
862 * src/frontends/xforms/FormParagraph.C:
863 * src/frontends/xforms/FormParagraph.h:
864 * src/frontends/xforms/form_paragraph.C:
865 * src/frontends/xforms/form_paragraph.h:
866 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
869 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
871 * src/tabular.C (OldFormatRead): forgot to delete the temporary
872 Paragraph-Data after use.
874 * src/insets/insettext.C (LocalDispatch): don't set the layout on
875 non breakable paragraphs.
877 2000-09-25 Garst R. Reese <reese@isn.net>
879 * src/language.C (initL): added missing language_country codes.
881 2000-09-25 Juergen Vigna <jug@sad.it>
883 * src/insets/insettext.C (InsetText):
884 (deleteLyXText): remove the not released LyXText structure!
886 2000-09-24 Marko Vendelin <markov@ioc.ee>
888 * src/frontends/gnome/mainapp.C
889 * src/frontends/gnome/mainapp.h: added support for keyboard
892 * src/frontends/gnome/FormCitation.C
893 * src/frontends/gnome/FormCitation.h
894 * src/frontends/gnome/Makefile.am
895 * src/frontends/gnome/pixbutton.h: completed the rewrite of
896 FormCitation to use "action area" in mainapp window
898 * src/frontends/gnome/Menubar_pimpl.C
899 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
902 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
904 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
905 width/descent/ascent values if name is empty.
906 (mathed_string_height): Use std::max.
908 2000-09-25 Allan Rae <rae@lyx.org>
910 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
911 segfault. This will be completely redesigned soon.
913 * sigc++: updated libsigc++. Fixes struct timespec bug.
915 * development/tools/makeLyXsigc.sh: .cvsignore addition
917 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
919 * several files: removed almost all traces of the old table
922 * src/TableLayout.C: removed file
924 2000-09-22 Juergen Vigna <jug@sad.it>
926 * src/frontends/kde/Dialogs.C: added credits forms.
928 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
930 * src/frontends/gnome/Dialogs.C: added some forms.
932 * src/spellchecker.C (init_spell_checker): set language in pspell code
933 (RunSpellChecker): some modifications for setting language string.
935 * src/language.[Ch]: added language_country code.
937 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
939 * src/frontends/Dialogs.h: added new signal showError.
940 Rearranged existing signals in some sort of alphabetical order.
942 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
943 FormError.[Ch], form_error.[Ch]
944 * src/frontends/xforms/forms/makefile: added new file form_error.fd
945 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
947 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
948 dialogs. I think that this can be used as the base to all these
951 * src/frontends/xforms/FormError.[Ch]
952 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
953 implementation of InsetError dialog.
955 * src/insets/inseterror.[Ch]: rendered GUI-independent.
957 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
958 * src/frontends/kde/Makefile.am: ditto
960 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
962 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
963 macrobf. This fixes a bug of invisible text.
965 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
967 * lib/doc/LaTeXConfig.lyx.in: updated.
969 * src/language.C (initL): remove language "francais" and change a
970 bit the names of the two other french variations.
972 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
973 string that may not be 0-terminated.
975 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
977 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
979 2000-09-20 Marko Vendelin <markov@ioc.ee>
981 * src/frontends/gnome/FormCitation.C
982 * src/frontends/gnome/FormIndex.C
983 * src/frontends/gnome/FormToc.C
984 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
985 the variable initialization to shut up the warnings
987 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
989 * src/table.[Ch]: deleted files
991 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
994 2000-09-18 Juergen Vigna <jug@sad.it>
996 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
997 problems with selection. Inserted new LFUN_PASTESELECTION.
998 (InsetButtonPress): inserted handling of middle mouse-button paste.
1000 * src/spellchecker.C: changed word to word.c_str().
1002 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
1004 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
1005 included in the ``make dist'' tarball.
1007 2000-09-15 Juergen Vigna <jug@sad.it>
1009 * src/CutAndPaste.C (cutSelection): small fix return the right
1010 end position after cut inside one paragraph only.
1012 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
1013 we are locked as otherwise we don't have a valid cursor position!
1015 * src/insets/figinset.C (draw): small bugfix but why is this needed???
1017 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
1019 * src/frontends/kde/FormRef.C: added using directive.
1020 * src/frontends/kde/FormToc.C: ditto
1022 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
1024 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
1026 2000-09-19 Marko Vendelin <markov@ioc.ee>
1028 * src/frontends/gnome/Menubar_pimpl.C
1029 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
1030 Toc, ViewFormats, UpdateFormats, and ExportFormats.
1032 * src/frontends/gnome/mainapp.C
1033 * src/frontends/gnome/mainapp.h: support for menu update used
1036 * src/frontends/gnome/mainapp.C
1037 * src/frontends/gnome/mainapp.h: support for "action" area in the
1038 main window. This area is used by small simple dialogs, such as
1041 * src/frontends/gnome/FormIndex.C
1042 * src/frontends/gnome/FormIndex.h
1043 * src/frontends/gnome/FormUrl.C
1044 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
1047 * src/frontends/gnome/FormCitation.C
1048 * src/frontends/gnome/FormCitation.h: rewrite to use main window
1049 action area. Only "Insert new citation" is implemented.
1051 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1053 * src/buffer.C (Dispatch): fix call to Dispatch
1054 * src/insets/insetref.C (Edit): likewise
1055 * src/insets/insetparent.C (Edit): likewise
1056 * src/insets/insetinclude.C (include_cb): likewise
1057 * src/frontends/xforms/FormUrl.C (apply): likewise
1058 * src/frontends/xforms/FormToc.C (apply): likewise
1059 * src/frontends/xforms/FormRef.C (apply): likewise
1060 * src/frontends/xforms/FormIndex.C (apply): likewise
1061 * src/frontends/xforms/FormCitation.C (apply): likewise
1062 * src/lyxserver.C (callback): likewise
1063 * src/lyxfunc.C (processKeySym): likewise
1064 (Dispatch): likewise
1065 (Dispatch): likewise
1066 * src/lyx_cb.C (LayoutsCB): likewise
1068 * Makefile.am (sourcedoc): small change
1070 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1072 * src/main.C (main): Don't make an empty GUIRunTime object. all
1073 methods are static. constify a bit remove unneded using + headers.
1075 * src/tabular.C: some more const to local vars move some loop vars
1077 * src/spellchecker.C: added some c_str after some word for pspell
1079 * src/frontends/GUIRunTime.h: add new static method setDefaults
1080 * src/frontends/xforms/GUIRunTime.C (setDefaults):
1081 * src/frontends/kde/GUIRunTime.C (setDefaults):
1082 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
1084 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
1085 with strnew in arg, use correct emptystring when calling SetName.
1087 * several files: remove all commented code with relation to
1088 HAVE_SSTREAM beeing false. We now only support stringstream and
1091 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1093 * src/lyxfunc.C: construct correctly the automatic new file
1096 * src/text2.C (IsStringInText): change type of variable i to shut
1099 * src/support/sstream.h: do not use namespaces if the compiler
1100 does not support them.
1102 2000-09-15 Marko Vendelin <markov@ioc.ee>
1103 * src/frontends/gnome/FormCitation.C
1104 * src/frontends/gnome/FormCitation.h
1105 * src/frontends/gnome/diainsertcitation_interface.c
1106 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
1107 regexp support to FormCitation [Gnome].
1109 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
1112 * configure.in: remove unused KDE/GTKGUI define
1114 * src/frontends/kde/FormRef.C
1115 * src/frontends/kde/FormRef.h
1116 * src/frontends/kde/formrefdialog.C
1117 * src/frontends/kde/formrefdialog.h: double click will
1118 go to reference, now it is possible to change a cross-ref
1121 * src/frontends/kde/FormToc.C
1122 * src/frontends/kde/FormToc.h
1123 * src/frontends/kde/formtocdialog.C
1124 * src/frontends/kde/formtocdialog.h: add a depth
1127 * src/frontends/kde/Makefile.am: add QtLyXView.h
1130 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
1132 * src/frontends/kde/FormCitation.h: added some using directives.
1134 * src/frontends/kde/FormToc.h: corrected definition of doTree.
1136 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
1139 * src/mathed/math_defs.h: redefine SetAlign to use string rather
1142 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1144 * src/buffer.C (pop_tag): revert for the second time a change by
1145 Lars, who seems to really hate having non-local loop variables :)
1147 * src/Lsstream.h: add "using" statements.
1149 * src/support/copy.C (copy): add a bunch of std:: qualifiers
1150 * src/buffer.C (writeFile): ditto
1152 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1154 * src/buffer.C (writeFile): try to fix the locale modified format
1155 number to always be as we want it.
1157 * src/WorkArea.C (work_area_handler): try to workaround the bugs
1158 in XForms 0.89. C-space is now working again.
1160 * src/Lsstream.h src/support/sstream.h: new files.
1162 * also commented out all cases where strstream were used.
1164 * src/Bullet.h (c_str): remove method.
1166 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
1168 * a lot of files: get rid of "char const *" and "char *" is as
1169 many places as possible. We only want to use them in interaction
1170 with system of other libraries, not inside lyx.
1172 * a lot of files: return const object is not of pod type. This
1173 helps ensure that temporary objects is not modified. And fits well
1174 with "programming by contract".
1176 * configure.in: check for the locale header too
1178 * Makefile.am (sourcedoc): new tag for generation of doc++
1181 2000-09-14 Juergen Vigna <jug@sad.it>
1183 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
1184 callback to check which combo called it and do the right action.
1186 * src/combox.C (combo_cb): added combo * to the callbacks.
1187 (Hide): moved call of callback after Ungrab of the pointer.
1189 * src/intl.h: removed LCombo2 function.
1191 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
1192 function as this can now be handled in one function.
1194 * src/combox.h: added Combox * to callback prototype.
1196 * src/frontends/xforms/Toolbar_pimpl.C:
1197 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
1199 2000-09-14 Garst Reese <reese@isn.net>
1201 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
1202 moved usepackage{xxx}'s to beginning of file. Changed left margin
1203 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
1204 underlining from title. Thanks to John Culleton for useful suggestions.
1206 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1208 * src/lyxlex_pimpl.C (setFile): change error message to debug
1211 2000-09-13 Juergen Vigna <jug@sad.it>
1213 * src/frontends/xforms/FormDocument.C: implemented choice_class
1214 as combox and give callback to combo_language so OK/Apply is activated
1217 * src/bufferlist.C (newFile): small fix so already named files
1218 (via an open call) are not requested to be named again on the
1221 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
1223 * src/frontends/kde/Makefile.am
1224 * src/frontends/kde/FormRef.C
1225 * src/frontends/kde/FormRef.h
1226 * src/frontends/kde/formrefdialog.C
1227 * src/frontends/kde/formrefdialog.h: implement
1230 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
1232 * src/frontends/kde/formtocdialog.C
1233 * src/frontends/kde/formtocdialog.h
1234 * src/frontends/kde/FormToc.C
1235 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
1237 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
1239 * src/frontends/kde/FormCitation.C: fix thinko
1240 where we didn't always display the reference text
1243 * src/frontends/kde/formurldialog.C
1244 * src/frontends/kde/formurldialog.h
1245 * src/frontends/kde/FormUrl.C
1246 * src/frontends/kde/FormUrl.h: minor cleanups
1248 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
1250 * src/frontends/kde/Makefile.am
1251 * src/frontends/kde/FormToc.C
1252 * src/frontends/kde/FormToc.h
1253 * src/frontends/kde/FormCitation.C
1254 * src/frontends/kde/FormCitation.h
1255 * src/frontends/kde/FormIndex.C
1256 * src/frontends/kde/FormIndex.h
1257 * src/frontends/kde/formtocdialog.C
1258 * src/frontends/kde/formtocdialog.h
1259 * src/frontends/kde/formcitationdialog.C
1260 * src/frontends/kde/formcitationdialog.h
1261 * src/frontends/kde/formindexdialog.C
1262 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
1264 2000-09-12 Juergen Vigna <jug@sad.it>
1266 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
1269 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1271 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
1274 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
1276 * src/converter.C (Add, Convert): Added support for converter flags:
1277 needaux, resultdir, resultfile.
1278 (Convert): Added new parameter view_file.
1279 (dvips_options): Fixed letter paper option.
1281 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
1282 (Export, GetExportableFormats, GetViewableFormats): Added support
1285 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
1287 (easyParse): Fixed to work with new export code.
1289 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
1292 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
1294 * lib/bind/*.bind: Replaced
1295 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
1296 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
1298 2000-09-11 Juergen Vigna <jug@sad.it>
1300 * src/lyx_gui.C (runTime): uses global guiruntime variable.
1302 * src/main.C (main): now GUII defines global guiruntime!
1304 * src/frontends/gnome/GUIRunTime.C (initApplication):
1305 * src/frontends/kde/GUIRunTime.C (initApplication):
1306 * src/frontends/xforms/GUIRunTime.C (initApplication):
1307 * src/frontends/GUIRunTime.h: added new function initApplication.
1309 * src/spellchecker.C (sc_accept_word): change to add_to_session.
1311 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
1313 2000-09-08 Juergen Vigna <jug@sad.it>
1315 * src/lyx_gui.C (create_forms): don't display the "default" entry as
1316 we have already "Reset".
1318 * src/language.C (initL): inserted "default" language and made this
1319 THE default language (and not american!)
1321 * src/paragraph.C: inserted handling of "default" language!
1323 * src/lyxfont.C: ditto
1327 * src/paragraph.C: output the \\par only if we have a following
1328 paragraph otherwise it's not needed.
1330 2000-09-05 Juergen Vigna <jug@sad.it>
1332 * config/pspell.m4: added entry to lyx-flags
1334 * src/spellchecker.C: modified version from Kevin for using pspell
1336 2000-09-01 Marko Vendelin <markov@ioc.ee>
1337 * src/frontends/gnome/Makefile.am
1338 * src/frontends/gnome/FormCitation.C
1339 * src/frontends/gnome/FormCitation.h
1340 * src/frontends/gnome/diainsertcitation_callbacks.c
1341 * src/frontends/gnome/diainsertcitation_callbacks.h
1342 * src/frontends/gnome/diainsertcitation_interface.c
1343 * src/frontends/gnome/diainsertcitation_interface.h
1344 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
1345 dialog for Gnome frontend
1347 * src/main.C: Gnome libraries require keeping application name
1348 and its version as strings
1350 * src/frontends/gnome/mainapp.C: Change the name of the main window
1351 from GnomeLyX to PACKAGE
1353 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1355 * src/frontends/Liason.C: add "using: declaration.
1357 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
1359 * src/mathed/math_macro.C (Metrics): Set the size of the template
1361 * src/mathed/formulamacro.C (Latex): Fixed the returned value
1363 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
1365 * src/converter.C (add_options): New function.
1366 (SetViewer): Change $$FName into '$$FName'.
1367 (View): Add options when running xdvi
1368 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
1369 (Convert): The 3rd parameter is now the desired filename. Converts
1370 calls to lyx::rename if necessary.
1371 Add options when running dvips.
1372 (dvi_papersize,dvips_options): New methods.
1374 * src/exporter.C (Export): Use getLatexName() instead of fileName().
1376 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
1377 using a call to Converter::dvips_options.
1378 Fixed to work with nex export code.
1380 * src/support/copy.C
1381 * src/support/rename.C: New files
1383 * src/support/syscall.h
1384 * src/support/syscall.C: Added Starttype SystemDontWait.
1386 * lib/ui/default.ui: Changed to work with new export code
1388 * lib/configure.m4: Changed to work with new export code
1390 * src/encoding.C: Changed latex name for iso8859_7 encoding.
1392 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
1394 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
1395 so that code compiles with DEC cxx.
1397 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
1398 to work correctly! Also now supports the additional elements
1401 2000-09-01 Allan Rae <rae@lyx.org>
1403 * src/frontends/ButtonPolicies.C: renamed all the references to
1404 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
1406 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
1407 since it's a const not a type.
1409 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
1411 2000-08-31 Juergen Vigna <jug@sad.it>
1413 * src/insets/figinset.C: Various changes to look if the filename has
1414 an extension and if not add it for inline previewing.
1416 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1418 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
1419 make buttonStatus and isReadOnly be const methods. (also reflect
1420 this in derived classes.)
1422 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
1423 (nextState): change to be static inline, pass the StateMachine as
1425 (PreferencesPolicy): remove casts
1426 (OkCancelPolicy): remvoe casts
1427 (OkCancelReadOnlyPolicy): remove casts
1428 (NoRepeatedApplyReadOnlyPolicy): remove casts
1429 (OkApplyCancelReadOnlyPolicy): remove casts
1430 (OkApplyCancelPolicy): remove casts
1431 (NoRepeatedApplyPolicy): remove casts
1433 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
1435 * src/converter.C: added some using directives
1437 * src/frontends/ButtonPolicies.C: changes to overcome
1438 "need lvalue" error with DEC c++
1440 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
1441 to WMHideCB for DEC c++
1443 * src/frontends/xforms/Menubar_pimpl.C: added using directive
1445 * src/frontends/xforms/forms/form_document.C.patch: use C callback
1446 to BulletBMTableCB for DEC c++
1448 2000-08-31 Allan Rae <rae@lyx.org>
1450 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
1451 character dialog separately from old document dialogs combo_language.
1454 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
1456 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
1457 Removed LFUN_REF_CREATE.
1459 * src/MenuBackend.C: Added new tags: toc and references
1461 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
1462 (add_lastfiles, add_documents, add_formats): Removed the unused smn
1464 (add_toc, add_references): New methods.
1465 (create_submenu): Handle correctly the case when there is a
1466 seperator after optional menu items.
1468 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
1469 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
1470 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
1472 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
1474 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
1476 * src/converter.[Ch]: New file for converting between different
1479 * src/export.[Ch]: New file for exporting a LyX file to different
1482 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
1483 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
1484 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
1485 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
1486 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
1487 RunDocBook, MenuExport.
1489 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
1490 Exporter::Preview methods if NEW_EXPORT is defined.
1492 * src/buffer.C (Dispatch): Use Exporter::Export.
1494 * src/lyxrc.C: Added new tags: \converter and \viewer.
1497 * src/LyXAction.C: Define new lyx-function: buffer-update.
1498 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
1499 when NEW_EXPORT is defined.
1501 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
1503 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
1505 * lib/ui/default.ui: Added submenus "view" and "update" to the
1508 * src/filetools.C (GetExtension): New function.
1510 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
1512 2000-08-29 Allan Rae <rae@lyx.org>
1514 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
1516 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
1517 (EnableDocumentLayout): removed
1518 (DisableDocumentLayout): removed
1519 (build): make use of ButtonController's read-only handling to
1520 de/activate various objects. Replaces both of the above functions.
1522 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
1523 (readOnly): was read_only
1524 (refresh): fixed dumb mistakes with read_only_ handling
1526 * src/frontends/xforms/forms/form_document.fd:
1527 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
1528 tabbed dialogs so the tabs look more like tabs and so its easier to
1529 work out which is the current tab.
1531 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
1532 segfault with form_table
1534 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
1536 2000-08-28 Juergen Vigna <jug@sad.it>
1538 * acconfig.h: added USE_PSPELL.
1540 * src/config.h.in: added USE_PSPELL.
1542 * autogen.sh: added pspell.m4
1544 * config/pspell.m4: new file.
1546 * src/spellchecker.C: implemented support for pspell libary.
1548 2000-08-25 Juergen Vigna <jug@sad.it>
1550 * src/LyXAction.C (init): renamed LFUN_TABLE to
1551 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
1553 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
1555 * src/lyxscreen.h: add force_clear variable and fuction to force
1556 a clear area when redrawing in LyXText.
1558 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
1560 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1562 * some whitespace and comment changes.
1564 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
1566 * src/buffer.C: up te LYX_FORMAT to 2.17
1568 2000-08-23 Juergen Vigna <jug@sad.it>
1570 * src/BufferView_pimpl.C (tripleClick): disable this when in a
1573 * src/insets/insettabular.C (pasteSelection): delete the insets
1574 LyXText as it is not valid anymore.
1575 (copySelection): new function.
1576 (pasteSelection): new function.
1577 (cutSelection): new function.
1578 (LocalDispatch): implemented cut/copy/paste of cell selections.
1580 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
1581 don't have a LyXText.
1583 * src/LyXAction.C (init): a NEW_TABULAR define too much.
1585 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
1588 2000-08-22 Juergen Vigna <jug@sad.it>
1590 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
1591 ifdef form_table out if NEW_TABULAR.
1593 2000-08-21 Juergen Vigna <jug@sad.it>
1595 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
1596 (draw): fixed draw position so that the cursor is positioned in the
1598 (InsetMotionNotify): hide/show cursor so the position is updated.
1599 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
1600 using cellstart() function where it should be used.
1602 * src/insets/insettext.C (draw): ditto.
1604 * src/tabular.C: fixed initialization of some missing variables and
1605 made BoxType into an enum.
1607 2000-08-22 Marko Vendelin <markov@ioc.ee>
1608 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
1609 stock menu item using action numerical value, not its string
1613 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
1615 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
1616 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
1618 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
1620 * src/frontends/xforms/GUIRunTime.C: new file
1622 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
1623 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1625 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
1627 * src/frontends/kde/GUIRunTime.C: new file
1629 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
1630 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1632 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
1634 * src/frontends/gnome/GUIRunTime.C: new file
1636 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
1639 * src/frontends/GUIRunTime.h: removed constructor and destructor,
1640 small change to documetentation.
1642 * src/frontends/GUIRunTime.C: removed file
1644 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
1646 * src/lyxparagraph.h: enable NEW_TABULAR as default
1648 * src/lyxfunc.C (processKeySym): remove some commented code
1650 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
1651 NEW_TABULAR around the fd_form_table_options.
1653 * src/lyx_gui.C (runTime): call the static member function as
1654 GUIRunTime::runTime().
1656 2000-08-21 Allan Rae <rae@lyx.org>
1658 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
1661 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
1663 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
1665 2000-08-21 Allan Rae <rae@lyx.org>
1667 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
1668 keep Garst happy ;-)
1669 * src/frontends/xforms/FormPreferences.C (build): use setOK
1670 * src/frontends/xforms/FormDocument.C (build): use setOK
1671 (FormDocument): use the appropriate policy.
1673 2000-08-21 Allan Rae <rae@lyx.org>
1675 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
1676 automatic [de]activation of arbitrary objects when in a read-only state.
1678 * src/frontends/ButtonPolicies.h: More documentation
1679 (isReadOnly): added to support the above.
1681 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
1683 2000-08-18 Juergen Vigna <jug@sad.it>
1685 * src/insets/insettabular.C (getStatus): changed to return func_status.
1687 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
1688 display toggle menu entries if they are.
1690 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
1691 new document layout now.
1693 * src/lyxfunc.C: ditto
1695 * src/lyx_gui_misc.C: ditto
1697 * src/lyx_gui.C: ditto
1699 * lib/ui/default.ui: removed paper and quotes layout as they are now
1700 all in the document layout tabbed folder.
1702 * src/frontends/xforms/forms/form_document.fd: added Restore
1703 button and callbacks for all inputs for Allan's ButtonPolicy.
1705 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
1706 (CheckChoiceClass): added missing params setting on class change.
1707 (UpdateLayoutDocument): added for updating the layout on params.
1708 (build): forgot to RETURN_ALWAYS input_doc_spacing.
1709 (FormDocument): Implemented Allan's ButtonPolicy with the
1712 2000-08-17 Allan Rae <rae@lyx.org>
1714 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
1715 so we can at least see the credits again.
1717 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
1718 controller calls for the appropriate callbacks. Note that since Ok
1719 calls apply followed by cancel, and apply isn't a valid input for the
1720 APPLIED state, the bc_ calls have to be made in the static callback not
1721 within each of the real callbacks.
1723 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
1724 (setOk): renamed from setOkay()
1726 2000-08-17 Juergen Vigna <jug@sad.it>
1728 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
1729 in the implementation part.
1730 (composeUIInfo): don't show optional menu-items.
1732 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
1734 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
1736 * src/bufferview_funcs.C (CurrentState): fixed to show also the
1737 text-state when in a text-inset.
1739 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
1741 2000-08-17 Marko Vendelin <markov@ioc.ee>
1742 * src/frontends/gnome/FormIndex.C
1743 * src/frontends/gnome/FormIndex.h
1744 * src/frontends/gnome/FormToc.C
1745 * src/frontends/gnome/FormToc.h
1746 * src/frontends/gnome/dialogs
1747 * src/frontends/gnome/diatoc_callbacks.c
1748 * src/frontends/gnome/diatoc_callbacks.h
1749 * src/frontends/gnome/diainsertindex_callbacks.h
1750 * src/frontends/gnome/diainsertindex_callbacks.c
1751 * src/frontends/gnome/diainsertindex_interface.c
1752 * src/frontends/gnome/diainsertindex_interface.h
1753 * src/frontends/gnome/diatoc_interface.h
1754 * src/frontends/gnome/diatoc_interface.c
1755 * src/frontends/gnome/Makefile.am: Table of Contents and
1756 Insert Index dialogs implementation for Gnome frontend
1758 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
1760 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
1762 * src/frontends/gnome/diainserturl_interface.c: make the dialog
1765 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1767 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
1768 destructor. Don't definde if you don't need it
1769 (processEvents): made static, non-blocking events processing for
1771 (runTime): static method. event loop for xforms
1772 * similar as above for kde and gnome.
1774 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
1775 new Pimpl is correct
1776 (runTime): new method calss the real frontends runtime func.
1778 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
1780 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1782 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
1784 2000-08-16 Juergen Vigna <jug@sad.it>
1786 * src/lyx_gui.C (runTime): added GUII RunTime support.
1788 * src/frontends/Makefile.am:
1789 * src/frontends/GUIRunTime.[Ch]:
1790 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
1791 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
1792 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
1794 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
1796 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
1797 as this is already set in ${FRONTEND_INCLUDE} if needed.
1799 * configure.in (CPPFLAGS): setting the include dir for the frontend
1800 directory and don't set FRONTEND=xforms for now as this is executed
1803 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
1805 * src/frontends/kde/Makefile.am:
1806 * src/frontends/kde/FormUrl.C:
1807 * src/frontends/kde/FormUrl.h:
1808 * src/frontends/kde/formurldialog.h:
1809 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
1811 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
1813 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
1815 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1817 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
1820 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
1822 * src/WorkArea.C (work_area_handler): more work to get te
1823 FL_KEYBOARD to work with xforms 0.88 too, please test.
1825 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
1827 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
1829 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
1832 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1834 * src/Timeout.h: remove Qt::emit hack.
1836 * several files: changes to allo doc++ compilation
1838 * src/lyxfunc.C (processKeySym): new method
1839 (processKeyEvent): comment out if FL_REVISION < 89
1841 * src/WorkArea.C: change some debugging levels.
1842 (WorkArea): set wantkey to FL_KEY_ALL
1843 (work_area_handler): enable the FL_KEYBOARD clause, this enables
1844 clearer code and the use of compose with XForms 0.89. Change to
1845 use signals instead of calling methods in bufferview directly.
1847 * src/Painter.C: change some debugging levels.
1849 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
1852 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
1853 (workAreaKeyPress): new method
1855 2000-08-14 Juergen Vigna <jug@sad.it>
1857 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
1859 * config/kde.m4: addes some features
1861 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
1862 include missing xforms dialogs.
1864 * src/Timeout.h: a hack to be able to compile with qt/kde.
1866 * sigc++/.cvsignore: added acinclude.m4
1868 * lib/.cvsignore: added listerros
1870 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
1871 xforms tree as objects are needed for other frontends.
1873 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
1874 linking with not yet implemented xforms objects.
1876 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
1878 2000-08-14 Baruch Even <baruch.even@writeme.com>
1880 * src/frontends/xforms/FormGraphics.h:
1881 * src/frontends/xforms/FormGraphics.C:
1882 * src/frontends/xforms/RadioButtonGroup.h:
1883 * src/frontends/xforms/RadioButtonGroup.C:
1884 * src/insets/insetgraphics.h:
1885 * src/insets/insetgraphics.C:
1886 * src/insets/insetgraphicsParams.h:
1887 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
1888 instead of spaces, and various other indentation issues to make the
1889 sources more consistent.
1891 2000-08-14 Marko Vendelin <markov@ioc.ee>
1893 * src/frontends/gnome/dialogs/diaprint.glade
1894 * src/frontends/gnome/FormPrint.C
1895 * src/frontends/gnome/FormPrint.h
1896 * src/frontends/gnome/diaprint_callbacks.c
1897 * src/frontends/gnome/diaprint_callbacks.h
1898 * src/frontends/gnome/diaprint_interface.c
1899 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
1902 * src/frontends/gnome/dialogs/diainserturl.glade
1903 * src/frontends/gnome/FormUrl.C
1904 * src/frontends/gnome/FormUrl.h
1905 * src/frontends/gnome/diainserturl_callbacks.c
1906 * src/frontends/gnome/diainserturl_callbacks.h
1907 * src/frontends/gnome/diainserturl_interface.c
1908 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
1909 Gnome implementation
1911 * src/frontends/gnome/Dialogs.C
1912 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
1913 all other dialogs. Copy all unimplemented dialogs from Xforms
1916 * src/frontends/gnome/support.c
1917 * src/frontends/gnome/support.h: support files generated by Glade
1921 * config/gnome.m4: Gnome configuration scripts
1923 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
1924 configure --help message
1926 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
1927 only if there are no events pendling in Gnome/Gtk. This enhances
1928 the performance of menus.
1931 2000-08-14 Allan Rae <rae@lyx.org>
1933 * lib/Makefile.am: listerrors cleaning
1935 * lib/listerrors: removed -- generated file
1936 * acinclude.m4: ditto
1937 * sigc++/acinclude.m4: ditto
1939 * src/frontends/xforms/forms/form_citation.fd:
1940 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
1943 * src/frontends/xforms/forms/makefile: I renamed the `install` target
1944 `updatesrc` and now we have a `test` target that does what `updatesrc`
1945 used to do. I didn't like having an install target that wasn't related
1948 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
1949 on all except FormGraphics. This may yet happen. Followed by a major
1950 cleanup including using FL_TRANSIENT for most of the dialogs. More
1951 changes to come when the ButtonController below is introduced.
1953 * src/frontends/xforms/ButtonController.h: New file for managing up to
1954 four buttons on a dialog according to an externally defined policy.
1955 * src/frontends/xforms/Makefile.am: added above
1957 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
1958 Apply and Cancel/Close buttons and everything in between and beyond.
1959 * src/frontends/Makefile.am: added above.
1961 * src/frontends/xforms/forms/form_preferences.fd:
1962 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
1963 and removed variable 'status' as a result. Fixed the set_minsize thing.
1964 Use the new screen-font-update after checking screen fonts were changed
1965 Added a "Restore" button to restore the original lyxrc values while
1966 editing. This restores everything not just the last input changed.
1967 That's still a tricky one. As is the "LyX: this shouldn't happen..."
1969 * src/LyXAction.C: screen-font-update added for updating buffers after
1970 screen font settings have been changed.
1971 * src/commandtags.h: ditto
1972 * src/lyxfunc.C: ditto
1974 * forms/lyx.fd: removed screen fonts dialog.
1975 * src/lyx_gui.C: ditto
1976 * src/menus.[Ch]: ditto
1977 * src/lyx.[Ch]: ditto
1978 * src/lyx_cb.C: ditto + code from here moved to make
1979 screen-font-update. And people wonder why progress on GUII is
1980 slow. Look at how scattered this stuff was! It takes forever
1983 * forms/fdfix.sh: Fixup the spacing after commas.
1984 * forms/makefile: Remove date from generated files. Fewer clashes now.
1985 * forms/bullet_forms.C.patch: included someones handwritten changes
1987 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
1988 once I've discovered why LyXRC was made noncopyable.
1989 * src/lyx_main.C: ditto
1991 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
1993 * src/frontends/xforms/forms/fdfix.sh:
1994 * src/frontends/xforms/forms/fdfixh.sed:
1995 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
1996 * src/frontends/xforms/Form*.[hC]:
1997 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
1998 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
1999 provide a destructor for the struct FD_form_xxxx. Another version of
2000 the set_[max|min]size workaround and a few other cleanups. Actually,
2001 Angus' patch from 20000809.
2003 2000-08-13 Baruch Even <baruch.even@writeme.com>
2005 * src/insets/insetgraphics.C (Clone): Added several fields that needed
2008 2000-08-11 Juergen Vigna <jug@sad.it>
2010 * src/insets/insetgraphics.C (InsetGraphics): changing init
2011 order because of warnings.
2013 * src/frontends/xforms/forms/makefile: adding patching .C with
2016 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
2017 from .C.patch to .c.patch
2019 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
2020 order because of warning.
2022 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
2024 * src/frontends/Liason.C (setMinibuffer): new helper function
2026 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
2028 * src/lyxfunc.C (Dispatch): calling new Document-Layout
2030 * lib/ui/default.ui: commented out PaperLayout entry
2032 * src/frontends/xforms/form_document.[Ch]: new added files
2034 * src/frontends/xforms/FormDocument.[Ch]: ditto
2036 * src/frontends/xforms/forms/form_document.fd: ditto
2038 * src/frontends/xforms/forms/form_document.C.patch: ditto
2040 2000-08-10 Juergen Vigna <jug@sad.it>
2042 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
2043 (InsetGraphics): initialized cacheHandle to 0.
2044 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
2046 2000-08-10 Baruch Even <baruch.even@writeme.com>
2048 * src/graphics/GraphicsCache.h:
2049 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
2050 correctly as a cache.
2052 * src/graphics/GraphicsCacheItem.h:
2053 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
2056 * src/graphics/GraphicsCacheItem_pimpl.h:
2057 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
2060 * src/insets/insetgraphics.h:
2061 * src/insets/insetgraphics.C: Changed from using a signal notification
2062 to polling when image is not loaded.
2064 2000-08-10 Allan Rae <rae@lyx.org>
2066 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
2067 that there are two functions that have to been taken out of line by
2068 hand and aren't taken care of in the script. (Just a reminder note)
2070 * sigc++/macros/*.h.m4: Updated as above.
2072 2000-08-09 Juergen Vigna <jug@sad.it>
2074 * src/insets/insettext.C (draw): small fix for clearing rectangle.
2076 * src/insets/insettabular.C: make drawing of single cell smarter.
2078 2000-08-09 Marko Vendelin <markov@ioc.ee>
2079 * src/frontends/gnome/Menubar_pimpl.C
2080 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
2081 implementation: new files
2083 * src/frontends/gnome/mainapp.C
2084 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
2087 * src/main.C: create Gnome main window
2089 * src/frontends/xforms/Menubar_pimpl.h
2090 * src/frontends/Menubar.C
2091 * src/frontends/Menubar.h: added method Menubar::update that calls
2092 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
2094 * src/LyXView.C: calls Menubar::update to update the state
2097 * src/frontends/gnome/Makefile.am: added new files
2099 * src/frontends/Makefile.am: added frontend compiler options
2101 2000-08-08 Juergen Vigna <jug@sad.it>
2103 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
2105 * src/bufferlist.C (close):
2106 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
2107 documents if exiting without saving.
2109 * src/buffer.C (save): use removeAutosaveFile()
2111 * src/support/filetools.C (removeAutosaveFile): new function.
2113 * src/lyx_cb.C (MenuWrite): returns a bool now.
2114 (MenuWriteAs): check if file could really be saved and revert to the
2116 (MenuWriteAs): removing old autosavefile if existant.
2118 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
2119 before Goto toggle declaration, because of compiler warning.
2121 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
2123 * src/lyxfunc.C (MenuNew): small fix.
2125 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
2127 * src/bufferlist.C (newFile):
2128 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
2130 * src/lyxrc.C: added new_ask_filename tag
2132 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
2134 * src/lyx.fd: removed code pertaining to form_ref
2135 * src/lyx.[Ch]: ditto
2136 * src/lyx_cb.C: ditto
2137 * src/lyx_gui.C: ditto
2138 * src/lyx_gui_misc.C: ditto
2140 * src/BufferView_pimpl.C (restorePosition): update buffer only
2143 * src/commandtags.h (LFUN_REFTOGGLE): removed
2144 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
2145 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
2146 (LFUN_REFBACK): renamed LFUN_REF_BACK
2148 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
2149 * src/menus.C: ditto
2150 * src/lyxfunc.C (Dispatch): ditto.
2151 InsertRef dialog is now GUI-independent.
2153 * src/texrow.C: added using std::endl;
2155 * src/insets/insetref.[Ch]: strip out large amounts of code.
2156 The inset is now a container and this functionality is now
2157 managed by a new FormRef dialog
2159 * src/frontends/Dialogs.h (showRef, createRef): new signals
2161 * src/frontends/xforms/FormIndex.[Ch],
2162 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
2163 when setting dialog's min/max size
2164 * src/frontends/xforms/FormIndex.[Ch]: ditto
2166 * src/frontends/xforms/FormRef.[Ch],
2167 src/frontends/xforms/forms/form_ref.fd: new xforms
2168 implementation of an InsetRef dialog
2170 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
2173 * src/graphics/XPM_Renderer.C (isImageFormatOK):
2174 ios::nocreate is not part of the standard. Removed.
2176 2000-08-07 Baruch Even <baruch.even@writeme.com>
2178 * src/graphics/Renderer.h:
2179 * src/graphics/Renderer.C: Added base class for rendering of different
2180 image formats into Pixmaps.
2182 * src/graphics/XPM_Renderer.h:
2183 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
2184 in a different class.
2186 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
2187 easily add support for other formats.
2189 * src/insets/figinset.C: plugged a leak of an X resource.
2191 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
2193 * src/CutAndPaste.[Ch]: make all metods static.
2195 * development/Code_rules/Rules: more work, added section on
2196 Exceptions, and a References section.
2198 * a lot of header files: work to make doc++ able to generate the
2199 source documentation, some workarounds of doc++ problems. Doc++ is
2200 now able to generate the documentation.
2202 2000-08-07 Juergen Vigna <jug@sad.it>
2204 * src/insets/insettabular.C (recomputeTextInsets): removed function
2206 * src/tabular.C (SetWidthOfMulticolCell):
2208 (calculate_width_of_column_NMC): fixed return value so that it really
2209 only returns true if the column-width has changed (there where
2210 problems with muliticolumn-cells in this column).
2212 2000-08-04 Juergen Vigna <jug@sad.it>
2214 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
2215 also on the scrollstatus of the inset.
2216 (workAreaMotionNotify): ditto.
2218 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
2220 2000-08-01 Juergen Vigna <jug@sad.it>
2222 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
2224 * src/commandtags.h:
2225 * src/LyXAction.C (init):
2226 * src/insets/inset.C (LocalDispatch): added support for
2229 * src/insets/inset.C (scroll): new functions.
2231 * src/insets/insettext.C (removeNewlines): new function.
2232 (SetAutoBreakRows): removes forced newlines in the text of the
2233 paragraph if autoBreakRows is set to false.
2235 * src/tabular.C (Latex): generates a parbox around the cell contents
2238 * src/frontends/xforms/FormTabular.C (local_update): removed
2239 the radio_useparbox button.
2241 * src/tabular.C (UseParbox): new function
2243 2000-08-06 Baruch Even <baruch.even@writeme.com>
2245 * src/graphics/GraphicsCache.h:
2246 * src/graphics/GraphicsCache.C:
2247 * src/graphics/GraphicsCacheItem.h:
2248 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
2251 * src/insets/insetgraphics.h:
2252 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
2253 drawing of the inline image.
2255 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
2256 into the wrong position.
2258 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
2261 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
2263 * src/support/translator.h: move all typedefs to public section
2265 * src/support/filetools.C (MakeLatexName): return string const
2267 (TmpFileName): ditto
2268 (FileOpenSearch): ditto
2270 (LibFileSearch): ditto
2271 (i18nLibFileSearch): ditto
2274 (CreateTmpDir): ditto
2275 (CreateBufferTmpDir): ditto
2276 (CreateLyXTmpDir): ditto
2279 (MakeAbsPath): ditto
2281 (OnlyFilename): ditto
2283 (NormalizePath): ditto
2284 (CleanupPath): ditto
2285 (GetFileContents): ditto
2286 (ReplaceEnvironmentPath): ditto
2287 (MakeRelPath): ditto
2289 (ChangeExtension): ditto
2290 (MakeDisplayPath): ditto
2291 (do_popen): return cmdret const
2292 (findtexfile): return string const
2294 * src/support/DebugStream.h: add some /// to please doc++
2296 * src/frontends/DialogBase.h (endif): add some /// to please doc++
2298 * src/texrow.C (same_rownumber): functor to use with find_if
2299 (getIdFromRow): rewritten to use find_if and to not update the
2300 positions. return true if row is found
2301 (increasePos): new method, use to update positions
2303 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
2305 * src/lyxlex_pimpl.C (verifyTable): new method
2308 (GetString): return string const
2309 (pushTable): rewrite to use std::stack
2311 (setFile): better check
2314 * src/lyxlex.h: make LyXLex noncopyable
2316 * src/lyxlex.C (text): return char const * const
2317 (GetString): return string const
2318 (getLongString): return string const
2320 * src/lyx_gui_misc.C (askForText): return pair<...> const
2322 * src/lastfiles.[Ch] (operator): return string const
2324 * src/buffer.C (parseSingleLyXformat2Token): pass string to
2325 istringstream not char const *.
2326 move token.end() out of loop.
2327 (readFile): move initializaton of token
2329 * src/BufferView2.C (insertErrors): run texrow.increasePos if
2330 getIdFromRow is successful.
2332 * lib/bind/emacs.bind: don't include menus bind
2334 * development/Code_rules/Rules: the beginnings of making this
2335 better and covering more of the unwritten rules that we have.
2337 * development/Code_rules/Recommendations: a couple of wording
2340 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2342 * src/support/strerror.c: remove C++ comment.
2344 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
2346 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
2347 LFUN_INDEX_INSERT_LAST
2349 * src/texrow.C (getIdFromRow): changed from const_iterator to
2350 iterator, allowing code to compile with DEC cxx
2352 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
2353 stores part of the class, as suggested by Allan. Will allow
2355 (apply): test to apply uses InsetCommandParams operator!=
2357 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
2358 (apply): test to apply uses InsetCommandParams operator!=
2360 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
2361 stores part of the class.
2362 (update): removed limits on min/max size.
2364 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
2365 (apply): test to apply uses InsetCommandParams operator!=
2367 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
2368 (Read, Write, scanCommand, getCommand): moved functionality
2369 into InsetCommandParams.
2371 (getScreenLabel): made pure virtual
2372 new InsetCommandParams operators== and !=
2374 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
2375 c-tors based on InsetCommandParams. Removed others.
2376 * src/insets/insetinclude.[Ch]: ditto
2377 * src/insets/insetlabel.[Ch]: ditto
2378 * src/insets/insetparent.[Ch]: ditto
2379 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
2381 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
2382 insets derived from InsetCommand created using similar c-tors
2383 based on InsetCommandParams
2384 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
2385 * src/menus.C (ShowRefsMenu): ditto
2386 * src/paragraph.C (Clone): ditto
2387 * src/text2.C (SetCounter): ditto
2388 * src/lyxfunc.C (Dispatch) ditto
2389 Also recreated old InsetIndex behaviour exactly. Can now
2390 index-insert at the start of a paragraph and index-insert-last
2391 without launching the pop-up.
2393 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2395 * lib/lyxrc.example: mark te pdf options as non functional.
2397 * src/support/lstrings.C (strToInt): move initalization of tmpstr
2398 (isStrDbl): move tmpstr.end() out of loop.
2399 (strToDbl): move intialization of tmpstr
2400 (lowercase): return string const and move tmp.end() out of loop.
2401 (uppercase): return string const and move tmp.edn() out of loop.
2402 (prefixIs): add assertion
2407 (containsOnly): ditto
2408 (containsOnly): ditto
2409 (containsOnly): ditto
2410 (countChar): make last arg char not char const
2411 (token): return string const
2412 (subst): return string const, move tmp.end() out of loop.
2413 (subst): return string const, add assertion
2414 (strip): return string const
2415 (frontStrip): return string const, add assertion
2416 (frontStrip): return string const
2421 * src/support/lstrings.C: add inclde "LAssert.h"
2422 (isStrInt): move tmpstr.end() out of loop.
2424 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
2425 toollist.end() out of loop.
2426 (deactivate): move toollist.end() out of loop.
2427 (update): move toollist.end() out of loop.
2428 (updateLayoutList): move tc.end() out of loop.
2429 (add): move toollist.end() out of loop.
2431 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
2432 md.end() out of loop.
2434 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
2436 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
2439 * src/paragraph.C (Erase): move fontlist.end() out of loop.
2440 (Erase): move insetlist.end() out of loop.
2442 * src/lyx_sendfax_main.C: make show_logfile static and to take a
2443 ref to const string as first arg. Move initialization of some
2444 variables, whitespace changes.
2446 * src/kbmap.C (defkey): move table.end() out of loop.
2447 (kb_keymap): move table.end() out of loop.
2448 (findbinding): move table.end() out of loop.
2450 * src/MenuBackend.C (hasMenu): move end() out of loop.
2451 (getMenu): move end() out of loop.
2452 (getMenu): move menulist_.end() out of loop.
2454 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
2456 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
2459 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
2460 (getFromLyXName): move infotab.end() out of loop.
2462 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
2463 -fvtable-thunks -ffunction-sections -fdata-sections
2465 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
2467 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
2470 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
2472 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
2474 * src/frontends/xforms/FormCitation.[Ch],
2475 src/frontends/xforms/FormIndex.[Ch],
2476 src/frontends/xforms/FormToc.[Ch],
2477 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
2479 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
2481 * src/commandtags.h: renamed, created some flags for citation
2484 * src/lyx_gui_misc.C: stripped out old FD_index_form code
2486 * src/lyxfunc.C (dispatch): use signals to insert index entry
2488 * src/frontends/Dialogs.h: new signal createIndex
2490 * src/frontends/xforms/FormCommand.[Ch],
2491 src/frontends/xforms/FormCitation.[Ch],
2492 src/frontends/xforms/FormToc.[Ch],
2493 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
2495 * src/insets/insetindex.[Ch]: GUI-independent
2497 * src/frontends/xforms/FormIndex.[Ch],
2498 * src/frontends/xforms/forms/form_index.fd: xforms implementation
2501 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
2503 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
2504 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
2506 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2508 * src/insets/insetref.C (Latex): rewrite so that there is now
2509 question that a initialization is requested.
2511 * src/insets/insetcommand.h: reenable the hide signal
2513 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2515 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
2516 fix handling of shortcuts (many bugs :)
2517 (add_lastfiles): ditto.
2519 * lib/ui/default.ui: fix a few shortcuts.
2521 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
2523 * Makefile.am: Fix ``rpmdist'' target to return the exit
2524 status of the ``rpm'' command, instead of the last command in
2525 the chain (the ``rm lyx.xpm'' command, which always returns
2528 2000-08-02 Allan Rae <rae@lyx.org>
2530 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
2531 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
2532 * src/frontends/xforms/FormToc.C (FormToc): ditto
2534 * src/frontends/xforms/Makefile.am: A few forgotten files
2536 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
2537 Signals-not-copyable-problem Lars' started commenting out.
2539 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
2541 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2543 * src/insets/insetcommand.h: Signals is not copyable so anoter
2544 scheme for automatic hiding of forms must be used.
2546 * src/frontends/xforms/FormCitation.h: don't inerit from
2547 noncopyable, FormCommand already does that.
2548 * src/frontends/xforms/FormToc.h: ditto
2549 * src/frontends/xforms/FormUrl.h: ditto
2551 * src/frontends/xforms/FormCitation.C: add include <algorithm>
2553 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
2555 * src/insets/insetcommand.h (hide): new SigC::Signal0
2556 (d-tor) new virtual destructor emits hide signal
2558 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
2559 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
2561 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
2562 LOF and LOT. Inset is now GUI-independent
2564 * src/insets/insetloa.[Ch]: redundant
2565 * src/insets/insetlof.[Ch]: ditto
2566 * src/insets/insetlot.[Ch]: ditto
2568 * src/frontends/xforms/forms/form_url.fd: tweaked!
2569 * src/frontends/xforms/forms/form_citation.fd: ditto
2571 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
2572 dialogs dealing with InsetCommand insets
2574 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
2575 FormCommand base class
2576 * src/frontends/xforms/FormUrl.[Ch]: ditto
2578 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
2580 * src/frontends/xforms/FormToc.[Ch]: ditto
2582 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
2583 passed a generic InsetCommand pointer
2584 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
2586 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
2587 and modified InsetTOC class
2588 * src/buffer.C: ditto
2590 * forms/lyx.fd: strip out old FD_form_toc code
2591 * src/lyx_gui_misc.C: ditto
2592 * src/lyx_gui.C: ditto
2593 * src/lyx_cb.C: ditto
2594 * src/lyx.[Ch]: ditto
2596 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2598 * src/support/utility.hpp: tr -d '\r'
2600 2000-08-01 Juergen Vigna <jug@sad.it>
2602 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
2604 * src/commandtags.h:
2605 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
2606 LFUN_TABULAR_FEATURES.
2608 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
2609 LFUN_LAYOUT_TABULAR.
2611 * src/insets/insettabular.C (getStatus): implemented helper function.
2613 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
2615 2000-07-31 Juergen Vigna <jug@sad.it>
2617 * src/text.C (draw): fixed screen update problem for text-insets.
2619 * src/text2.C (SetParagrpah): call an update of the inset-owner when
2620 something changed probably this has to be added in various other
2623 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
2625 2000-07-31 Baruch Even <baruch.even@writeme.com>
2627 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
2628 templates to satisfy compaq cxx.
2631 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2633 * src/support/translator.h (equal_1st_in_pair::operator()): take
2634 const ref pair_type as arg.
2635 (equal_2nd_in_pair::operator()): ditto
2636 (Translator::~Translator): remove empty d-tor.
2638 * src/graphics/GraphicsCache.C: move include config.h to top, also
2639 put initialization of GraphicsCache::singleton here.
2640 (~GraphicsCache): move here
2641 (addFile): take const ref as arg
2644 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
2646 * src/BufferView2.C (insertLyXFile): change te with/without header
2649 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2651 * src/frontends/xforms/FormGraphics.C (apply): add some
2652 static_cast. Not very nice, but required by compaq cxx.
2654 * src/frontends/xforms/RadioButtonGroup.h: include header
2655 <utility> instead of <pair.h>
2657 * src/insets/insetgraphicsParams.C: add using directive.
2658 (readResize): change return type to void.
2659 (readOrigin): ditto.
2661 * src/lyxfunc.C (getStatus): add missing break for build-program
2662 function; add test for Literate for export functions.
2664 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
2665 entries in Options menu.
2667 2000-07-31 Baruch Even <baruch.even@writeme.com>
2669 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
2670 protect against auto-allocation; release icon when needed.
2672 2000-07-31 Matej Cepl <CeplM@seznam.cz>
2674 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
2675 on usual typewriter.
2677 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
2678 earlier czech.kmap), useful only for programming.
2680 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2682 * src/frontends/xforms/FormCitation.h: fix conditioning around
2685 2000-07-31 Juergen Vigna <jug@sad.it>
2687 * src/frontends/xforms/FormTabular.C (local_update): changed
2688 radio_linebreaks to radio_useparbox and added radio_useminipage.
2690 * src/tabular.C: made support for using minipages/parboxes.
2692 * src/bufferlist.C (QwriteAll): small fix for asking for save.
2694 * src/insets/insetgraphics.C (draw): just draw the inset so that the
2696 (descent): so the cursor is in the middle.
2697 (width): bit smaller box.
2699 * src/insets/insetgraphics.h: added display() function.
2701 2000-07-31 Baruch Even <baruch.even@writeme.com>
2703 * src/frontends/Dialogs.h: Added showGraphics signals.
2705 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
2706 xforms form definition of the graphics dialog.
2708 * src/frontends/xforms/FormGraphics.h:
2709 * src/frontends/xforms/FormGraphics.C: Added files, the
2710 GUIndependent code of InsetGraphics
2712 * src/insets/insetgraphics.h:
2713 * src/insets/insetgraphics.C: Major writing to make it work.
2715 * src/insets/insetgraphicsParams.h:
2716 * src/insets/insetgraphicsParams.C: Added files, parameter passing
2717 struct between InsetGraphics and GUI.
2719 * src/LaTeXFeatures.h:
2720 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
2721 support for graphicx package.
2723 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
2724 for the graphics inset.
2726 * src/support/translator.h: Added file, used in
2727 InsetGraphicsParams. this is a template to translate between two
2730 * src/frontends/xforms/RadioButtonGroup.h:
2731 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
2732 way to easily control a radio button group.
2734 2000-07-28 Juergen Vigna <jug@sad.it>
2736 * src/insets/insettabular.C (LocalDispatch):
2737 (TabularFeatures): added support for lyx-functions of tabular features.
2738 (cellstart): refixed this function after someone wrongly changed it.
2740 * src/commandtags.h:
2741 * src/LyXAction.C (init): added support for tabular-features
2743 2000-07-28 Allan Rae <rae@lyx.org>
2745 * src/frontends/xforms/FormPreferences.C (build): Setup input return
2746 checking. NOTE: It seems that pressing ESC to cancel the dialog also
2747 triggers the callback for input checking. As a result we sometimes get
2748 "LyX: This shouldn't happen..." printed to cerr.
2749 (input): Started using status variable since I only free() on
2750 destruction. Some input checking for paths and font sizes.
2752 * src/frontends/xforms/FormPreferences.h: Use status to control
2753 activation of Ok and Apply
2755 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
2756 callback. Also resized to stop segfaults with 0.88. The problem is
2757 that xforms-0.88 requires the folder to be wide enough to fit all the
2758 tabs. If it isn't it causes all sorts of problems.
2760 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
2762 * src/frontends/xforms/forms/README: Reflect reality.
2764 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
2765 * src/frontends/xforms/forms/makefile: ditto.
2767 * src/commandtags.h: Get access to new Preferences dialog
2768 * src/LyXAction.C: ditto
2769 * src/lyxfunc.C: ditto
2770 * lib/ui/default.ui: ditto
2772 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2774 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
2776 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
2779 * src/frontends/xforms/form_url.[Ch]: added.
2781 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2783 * src/insets/insetbib.h: fixed bug in previous commit
2785 * src/frontends/xforms/FormUrl.h: ditto
2787 * src/frontends/xforms/FormPrint.h: ditto
2789 * src/frontends/xforms/FormPreferences.h: ditto
2791 * src/frontends/xforms/FormCopyright.h: ditto
2793 * src/frontends/xforms/FormCitation.C: ditto
2795 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
2796 private copyconstructor and private default contructor
2798 * src/support/Makefile.am: add utility.hpp
2800 * src/support/utility.hpp: new file from boost
2802 * src/insets/insetbib.h: set owner in clone
2804 * src/frontends/xforms/FormCitation.C: added missing include
2807 * src/insets/form_url.[Ch]: removed
2809 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
2811 * development/lyx.spec.in
2812 * Makefile.am: Fix buglet for LyX RPM generation resulting from
2813 file/directory re-organization.
2815 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
2817 * src/insets/insetcommand.[Ch]: moved the string data and
2818 associated manipulation methods into a new stand-alone class
2819 InsetCommandParams. This class has two additional methods
2820 getAsString() and setFromString() allowing the contents to be
2821 moved around as a single string.
2822 (addContents) method removed.
2823 (setContents) method no longer virtual.
2825 * src/buffer.C (readInset): made use of new InsetCitation,
2826 InsetUrl constructors based on InsetCommandParams.
2828 * src/commandtags.h: add LFUN_INSERT_URL
2830 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
2831 independent InsetUrl and use InsetCommandParams to extract
2832 string info and create new Insets.
2834 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
2836 * src/frontends/xforms/FormCitation.C (apply): uses
2839 * src/frontends/xforms/form_url.C
2840 * src/frontends/xforms/form_url.h
2841 * src/frontends/xforms/FormUrl.h
2842 * src/frontends/xforms/FormUrl.C
2843 * src/frontends/xforms/forms/form_url.fd: new files
2845 * src/insets/insetcite.[Ch]: removed unused constructors.
2847 * src/insets/insetinclude.[Ch]: no longer store filename
2849 * src/insets/inseturl.[Ch]: GUI-independent.
2851 2000-07-26 Juergen Vigna <jug@sad.it>
2852 * renamed frontend from gtk to gnome as it is that what is realized
2853 and did the necessary changes in the files.
2855 2000-07-26 Marko Vendelin <markov@ioc.ee>
2857 * configure.in: cleaning up gnome configuration scripts
2859 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2861 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
2862 shortcuts syndrom by redrawing them explicitely (a better solution
2863 would be appreciated).
2865 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
2867 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
2870 * src/lyx_cb.C (MenuExport): change html export to do the right
2871 thing depending of the document type (instead of having
2872 html-linuxdoc and html-docbook).
2873 * src/lyxfunc.C (getStatus): update for html
2874 * lib/ui/default.ui: simplify due to the above change.
2875 * src/menus.C (ShowFileMenu): update too (in case we need it).
2877 * src/MenuBackend.C (read): if a menu is defined twice, add the
2878 new entries to the exiting one.
2880 2000-07-26 Juergen Vigna <jug@sad.it>
2882 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
2884 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
2885 and return a bool if it did actual save the file.
2886 (AutoSave): don't autosave a unnamed doc.
2888 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
2889 check if this is an UNNAMED new file and react to it.
2890 (newFile): set buffer to unnamed and change to not mark a new
2891 buffer dirty if I didn't do anything with it.
2893 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
2895 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2897 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
2898 friend as per Angus's patch posted to lyx-devel.
2900 * src/ext_l10n.h: updated
2902 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
2903 gettext on the style string right before inserting them into the
2906 * autogen.sh: add code to extract style strings form layout files,
2907 not good enough yet.
2909 * src/frontends/gtk/.cvsignore: add MAKEFILE
2911 * src/MenuBackend.C (read): run the label strings through gettext
2912 before storing them in the containers.
2914 * src/ext_l10n.h: new file
2916 * autogen.sh : generate the ext_l10n.h file here
2918 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2920 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
2923 * lib/ui/default.ui: fix a couple of typos.
2925 * config/gnome/gtk.m4: added (and added to the list of files in
2928 * src/insets/insetinclude.C (unique_id): fix when we are using
2929 lyxstring instead of basic_string<>.
2930 * src/insets/insettext.C (LocalDispatch): ditto.
2931 * src/support/filetools.C: ditto.
2933 * lib/configure.m4: create the ui/ directory if necessary.
2935 * src/LyXView.[Ch] (updateToolbar): new method.
2937 * src/BufferView_pimpl.C (buffer): update the toolbar when
2938 opening/closing buffer.
2940 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2942 * src/LyXAction.C (getActionName): enhance to return also the name
2943 and options of pseudo-actions.
2944 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
2946 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
2947 as an example of what is possible). Used in File->Build too (more
2948 useful) and in the import/export menus (to mimick the complicated
2949 handling of linuxdoc and friends). Try to update all the entries.
2951 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
2954 * src/MenuBackend.C (read): Parse the new OptItem tag.
2956 * src/MenuBackend.h: Add a new optional_ data member (used if the
2957 entry should be omitted when the lyxfunc is disabled).
2959 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
2960 function, used as a shortcut.
2961 (create_submenu): align correctly the shortcuts on the widest
2964 * src/MenuBackend.h: MenuItem.label() only returns the label of
2965 the menu without shortcut; new method shortcut().
2967 2000-07-14 Marko Vendelin <markov@ioc.ee>
2969 * src/frontends/gtk/Dialogs.C:
2970 * src/frontends/gtk/FormCopyright.C:
2971 * src/frontends/gtk/FormCopyright.h:
2972 * src/frontends/gtk/Makefile.am: added these source-files for the
2973 Gtk/Gnome support of the Copyright-Dialog.
2975 * src/main.C: added Gnome::Main initialization if using
2976 Gtk/Gnome frontend-GUI.
2978 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
2980 * config/gnome/aclocal-include.m4
2981 * config/gnome/compiler-flags.m4
2982 * config/gnome/curses.m4
2983 * config/gnome/gnome--.m4
2984 * config/gnome/gnome-bonobo-check.m4
2985 * config/gnome/gnome-common.m4
2986 * config/gnome/gnome-fileutils.m4
2987 * config/gnome/gnome-ghttp-check.m4
2988 * config/gnome/gnome-gnorba-check.m4
2989 * config/gnome/gnome-guile-checks.m4
2990 * config/gnome/gnome-libgtop-check.m4
2991 * config/gnome/gnome-objc-checks.m4
2992 * config/gnome/gnome-orbit-check.m4
2993 * config/gnome/gnome-print-check.m4
2994 * config/gnome/gnome-pthread-check.m4
2995 * config/gnome/gnome-support.m4
2996 * config/gnome/gnome-undelfs.m4
2997 * config/gnome/gnome-vfs.m4
2998 * config/gnome/gnome-x-checks.m4
2999 * config/gnome/gnome-xml-check.m4
3000 * config/gnome/gnome.m4
3001 * config/gnome/gperf-check.m4
3002 * config/gnome/gtk--.m4
3003 * config/gnome/linger.m4
3004 * config/gnome/need-declaration.m4: added configuration scripts
3005 for Gtk/Gnome frontend-GUI
3007 * configure.in: added support for the --with-frontend=gtk option
3009 * autogen.sh: added config/gnome/* to list of config-files
3011 * acconfig.h: added define for GTKGUI-support
3013 * config/lyxinclude.m4: added --with-frontend[=value] option value
3014 for Gtk/Gnome frontend-GUI support.
3016 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3018 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
3022 * src/paragraph.C (GetChar): remove non-const version
3024 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
3025 (search_kw): use it.
3027 * src/lyx_main.C (init): if "preferences" exist, read that instead
3029 (ReadRcFile): return bool if the file could be read ok.
3030 (ReadUIFile): add a check to see if lex file is set ok.
3032 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
3033 bastring can be used instead of lyxstring (still uses the old code
3034 if std::string is good enough or if lyxstring is used.)
3036 * src/encoding.C: make the arrays static, move ininle functions
3038 * src/encoding.h: from here.
3040 * src/buffer.C: have last_isnet_read as a file scope variable for now.
3041 (parseSingleLyXformat2Token): move inset parsing to separate method
3042 (readInset): new private method
3044 * src/Variables.h: remove virtual from get().
3046 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
3047 access to NEW_INSETS and NEW_TABULAR
3049 * src/MenuBackend.h: remove superfluous forward declaration of
3050 MenuItem. Add documentations tags "///", remove empty MenuItem
3051 destructor, remove private default contructor.
3053 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
3055 (read): more string mlabel and mname to where they are used
3056 (read): remove unused variables mlabel and mname
3057 (defaults): unconditional clear, make menusetup take advantage of
3058 add returning Menu &.
3060 * src/LyXView.h: define NEW_MENUBAR as default
3062 * src/LyXAction.C: include lyxparagraph.h temporary to get access
3063 to NEW_INSETS and NEW_TABULAR.
3064 (init): commetn out some funcs that is obsolete when NEW_INSETS is
3065 defined. Change some of the "xxxx-inset-insert" functions names to
3068 * several files: more enahncements to NEW_INSETS and the resulting
3071 * lib/lyxrc.example (\date_insert_format): move to misc section
3073 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
3074 bastring and use AC_CACHE_CHECK.
3075 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
3076 the system have the newest methods. uses AC_CACHE_CHECK
3077 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
3078 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
3079 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
3081 * configure.in: add LYX_CXX_GOOD_STD_STRING
3083 * acinclude.m4: recreated
3085 2000-07-24 Amir Karger
3087 * README: add Hebrew, Arabic kmaps
3090 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3092 * src/buffer.C (writeFileAscii): Define actcell as an int instead
3095 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3097 * Lot of files: add pragma interface/implementation.
3099 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
3101 * lib/ui/default.ui: new file (ans new directory). Contains the
3102 default menu and toolbar.
3104 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
3105 global space. Toolbars are now read (as menus) in ui files.
3107 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
3109 * src/lyxfunc.C (getStatus): do not exit immediately if a command
3110 is disabled because the document is read-only. We want to have the
3111 toggle state of the function anyway.
3112 (getStatus): add code for LFUN_VC* functions (mimicking what is
3113 done in old-style menus)
3115 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
3116 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
3118 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
3119 * src/BufferView_pimpl.C: ditto.
3120 * src/lyxfunc.C: ditto.
3122 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
3123 default). This replaces old-style menus by new ones.
3125 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
3126 MenuItem. Contain the data structure of a menu.
3128 * src/insets/insettext.C: use LyXView::setLayout instead of
3129 accessing directly the toolbar combox.
3130 * src/lyxfunc.C (Dispatch): ditto.
3132 * src/LyXView.C (setLayout): new method, which just calls
3133 Toolbar::setLayout().
3134 (updateLayoutChoice): move part of this method in Toolbar.
3136 * src/toolbar.[Ch]: removed.
3138 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
3139 implementation the toolbar.
3141 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
3142 the toolbar. It might make sense to merge it with ToolbarDefaults
3144 (setLayout): new function.
3145 (updateLayoutList): ditto.
3146 (openLayoutList): ditto.
3148 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
3149 xforms implementation of the toolbar.
3150 (get_toolbar_func): comment out, since I do not
3151 know what it is good for.
3153 * src/ToolbarDefaults.h: Add the ItemType enum.
3155 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
3156 for a list of allocated C strings. Used in Menubar xforms
3157 implementation to avoid memory leaks.
3159 * src/support/lstrings.[Ch] (uppercase): new version taking and
3163 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
3164 * lib/bind/emacs.bind: ditto.
3166 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3168 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
3169 forward decl of LyXView.
3171 * src/toolbar.C (toolbarItem): moved from toolbar.h
3172 (toolbarItem::clean): ditto
3173 (toolbarItem::~toolbarItem): ditto
3174 (toolbarItem::operator): ditto
3176 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
3178 * src/paragraph.h: control the NEW_TABULAR define from here
3180 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
3181 USE_TABULAR_INSETS to NEW_TABULAR
3183 * src/ToolbarDefaults.C: add include "lyxlex.h"
3185 * files using the old table/tabular: use NEW_TABULAR to control
3186 compilation of old tabular stuff.
3188 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
3191 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
3192 planemet in reading of old style floats, fix the \end_deeper
3193 problem when reading old style floats.
3195 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3197 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
3199 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
3201 * lib/bind/sciword.bind: updated.
3203 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3205 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
3206 layout write problem
3208 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3210 * src/Makefile.am (INCLUDES): remove image directory from include
3213 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
3214 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
3216 * src/LyXView.C (create_form_form_main): read the application icon
3219 * lib/images/*.xpm: change the icons to use transparent color for
3222 * src/toolbar.C (update): change the color of the button when it
3225 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3227 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
3228 setting explicitely the minibuffer.
3229 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
3231 * src/LyXView.C (showState): new function. Shows font information
3232 in minibuffer and update toolbar state.
3233 (LyXView): call Toolbar::update after creating the
3236 * src/toolbar.C: change toollist to be a vector instead of a
3238 (BubbleTimerCB): get help string directly from the callback
3239 argument of the corresponding icon (which is the action)
3240 (set): remove unnecessary ugliness.
3241 (update): new function. update the icons (depressed, disabled)
3242 depending of the status of the corresponding action.
3244 * src/toolbar.h: remove help in toolbarItem
3246 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
3248 * src/Painter.C (text): Added code for using symbol glyphs from
3249 iso10646 fonts. Currently diabled.
3251 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
3254 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
3255 magyar,turkish and usorbian.
3257 * src/paragraph.C (isMultiLingual): Made more efficient.
3259 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
3262 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
3263 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
3264 Also changed the prototype to "bool math_insert_greek(char)".
3266 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3268 * lots of files: apply the NEW_INSETS on all code that will not be
3269 needed when we move to use the new insets. Enable the define in
3270 lyxparagrah.h to try it.
3272 * src/insets/insettabular.C (cellstart): change to be a static
3274 (InsetTabular): initialize buffer in the initializer list.
3276 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
3278 * src/frontends/xforms/FormPrint.[Ch] : moved #include
3279 form_print.h out of the header file. Replaced with forward
3280 declarations of the relevant struct.
3282 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
3285 * src/commandtags.h: do not include "debug.h" which does not
3286 belong there. #include it in some other places because of this
3289 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3291 * src/insets/insetcaption.C: add a couple "using" directives.
3293 * src/toolbar.C (add): get the help text directly from lyxaction.
3295 (setPixmap): new function. Loads from disk and sets a pixmap on a
3296 botton; the name of the pixmap file is derived from the command
3299 * src/toolbar.h: remove members isBitmap and pixmap from
3302 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
3303 * lib/images/: move many files from images/banner.xpm.
3305 * src/lyx_gui.C (create_forms): read banner pixmap from file.
3307 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
3308 * src/toolbar.C: ditto.
3309 * configure.in: ditto.
3310 * INSTALL: document.
3312 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
3313 the spellchecker popup is closed from the WM.
3315 2000-07-19 Juergen Vigna <jug@sad.it>
3317 * src/insets/insetfloat.C (Write): small fix because we use the
3318 insetname for the type now!
3320 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
3322 * src/frontends/xforms/forms/form_citation.fd: object sizes are
3325 * src/frontends/Dialogs.h: removed hideCitation signal
3327 * src/insets/insetcite.h: added hide signal
3329 * src/insets/insetcite.C (~InsetCitation): emits new signal
3330 (getScreenLabel): "intelligent" label should now fit on the screen!
3332 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
3334 * src/frontends/xforms/FormCitation.C (showInset): connects
3335 hide() to the inset's hide signal
3336 (show): modified to use fl_set_object_position rather than
3337 fl_set_object_geometry wherever possible
3339 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3341 * src/insets/lyxinset.h: add caption code
3343 * src/insets/insetfloat.C (type): new method
3345 * src/insets/insetcaption.C (Write): new method
3347 (LyxCode): new method
3349 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
3350 to get it right together with using the FloatList.
3352 * src/commandtags.h: add LFUN_INSET_CAPTION
3353 * src/lyxfunc.C (Dispatch): handle it
3355 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
3358 * src/Variables.[Ch]: make expand take a const reference, remove
3359 the destructor, some whitespace changes.
3361 * src/LyXAction.C (init): add caption-inset-insert
3363 * src/FloatList.C (FloatList): update the default floats a bit.
3365 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3367 * src/Variables.[Ch]: new files. Intended to be used for language
3368 specific strings (like \chaptername) and filename substitution in
3371 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
3373 * lib/kbd/american.kmap: update
3375 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
3377 * src/bufferparams.[Ch]: remove member allowAccents.
3379 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
3381 * src/LaTeXLog.C: use the log_form.h header.
3382 * src/lyx_gui.C: ditto.
3383 * src/lyx_gui_misc.C: ditto.
3384 * src/lyxvc.h: ditto.
3386 * forms/log_form.fd: new file, created from latexoptions.fd. I
3387 kept the log popup and nuked the options form.
3389 * src/{la,}texoptions.[Ch]: removed.
3390 * src/lyx_cb.C (LaTeXOptions): ditto
3392 * src/lyx_gui.C (create_forms): do not handle the
3393 fd_latex_options form.
3395 2000-07-18 Juergen Vigna <jug@sad.it>
3397 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
3398 name of the inset so that it can be requested outside (text2.C).
3400 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
3403 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3405 * src/mathed/formula.h (ConvertFont): constify
3407 * src/mathed/formula.C (Read): add warning if \end_inset is not
3408 found on expected place.
3410 * src/insets/lyxinset.h (ConvertFont): consify
3412 * src/insets/insetquotes.C (ConvertFont): constify
3413 * src/insets/insetquotes.h: ditto
3415 * src/insets/insetinfo.h: add labelfont
3417 * src/insets/insetinfo.C (InsetInfo): set the labelfont
3418 (ascent): use labelfont
3422 (Write): make .lyx file a bit nicer
3424 * src/insets/insetfloat.C (Write): simplify somewhat...
3425 (Read): add warning if arg is not found
3427 * src/insets/insetcollapsable.C: add using std::max
3428 (Read): move string token and add warning in arg is not found
3429 (draw): use std::max to get the right ty
3430 (getMaxWidth): simplify by using std::max
3432 * src/insets/insetsection.h: new file
3433 * src/insets/insetsection.C: new file
3434 * src/insets/insetcaption.h: new file
3435 * src/insets/insetcaption.C: new file
3437 * src/insets/inset.C (ConvertFont): constify signature
3439 * src/insets/Makefile.am (libinsets_la_SOURCES): add
3440 insetcaption.[Ch] and insetsection.[Ch]
3442 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
3443 uses to use LABEL_COUNTER_CHAPTER instead.
3444 * src/text2.C (SetCounter): here
3446 * src/counters.h: new file
3447 * src/counters.C: new file
3448 * src/Sectioning.h: new file
3449 * src/Sectioning.C: new file
3451 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
3453 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3455 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
3458 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
3461 2000-07-17 Juergen Vigna <jug@sad.it>
3463 * src/tabular.C (Validate): check if array-package is needed.
3464 (SetVAlignment): added support for vertical alignment.
3465 (SetLTFoot): better support for longtable header/footers
3466 (Latex): modified to support added features.
3468 * src/LaTeXFeatures.[Ch]: added array-package.
3470 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
3472 * src/lyx_gui.C (LyXGUI): make sure that the height is large
3475 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
3477 * configure.in: do not forget to put a space after -isystem.
3479 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
3481 * lib/kbd/arabic.kmap: a few fixes.
3483 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3485 * some whitespace chagnes to a number of files.
3487 * src/support/DebugStream.h: change to make it easier for
3488 doc++ to parse correctly.
3489 * src/support/lyxstring.h: ditto
3491 * src/mathed/math_utils.C (compara): change to have only one
3493 (MathedLookupBOP): change because of the above.
3495 * src/mathed/math_delim.C (math_deco_compare): change to have only
3497 (search_deco): change becasue of the above.
3499 * src/insets/insettabular.C (DrawCellSelection): use std::swap
3500 instead of manually coded one.
3502 * src/insets/insetquotes.C (Read): read the \end_inset too
3504 * src/insets/insetlatex.h: remove file
3505 * src/insets/insetlatex.C: remove file
3507 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
3509 (InsetPrintIndex): remove destructor
3511 * src/insets/insetinclude.h: remove default constructor
3513 * src/insets/insetfloat.C: work to make it work better
3515 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
3517 * src/insets/insetcite.h (InsetCitation): remove default constructor
3519 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
3521 * src/text.C (GetColumnNearX): comment out some currently unused code.
3523 * src/paragraph.C (writeFile): move some initializations closer to
3525 (CutIntoMinibuffer): small change to use new matchIT operator
3529 (InsertInset): ditto
3532 (InsetIterator): ditto
3533 (Erase): small change to use new matchFT operator
3535 (GetFontSettings): ditto
3536 (HighestFontInRange): ditto
3539 * src/lyxparagraph.h: some chars changed to value_type
3540 (matchIT): because of some stronger checking (perhaps too strong)
3541 in SGI STL, the two operator() unified to one.
3544 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
3546 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
3547 the last inset read added
3548 (parseSingleLyXformat2Token): some more (future) compability code added
3549 (parseSingleLyXformat2Token): warning about solitary \end_inset added
3550 (parseSingleLyXformat2Token): set last_inset_read
3551 (parseSingleLyXformat2Token): more code to read new "Float" correctly
3552 (parseSingleLyXformat2Token): don't double intializw string next_token
3554 * src/TextCache.C (text_fits::operator()): add const's to the signature
3555 (has_buffer::operator()): ditto
3557 * src/Floating.h: add some comments on the class
3559 * src/FloatList.[Ch] (typeExist): new method
3562 * src/BackStack.h: added default constructor, wanted by Gcc.
3564 2000-07-14 Juergen Vigna <jug@sad.it>
3566 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
3568 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
3570 * src/insets/insettabular.C (resizeLyXText): need this to be able to
3571 do a redraw when the window is resized!
3572 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
3574 * src/insets/insettext.C (resizeLyXText): added function to correctly
3575 being able to resize the LyXWindow.
3577 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
3579 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
3581 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
3582 crashes when closing dialog to a deleted inset.
3584 * src/insets/insetcite.[Ch] (Edit) : the return of this former
3585 method! Now similar to other insets.
3587 2000-07-13 Juergen Vigna <jug@sad.it>
3589 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
3591 * lib/examples/Literate.lyx: small patch!
3593 * src/insets/insetbib.C (Read): added this function because of wrong
3594 Write (without [begin|end]_inset).
3596 2000-07-11 Juergen Vigna <jug@sad.it>
3598 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
3599 as the insertInset could not be good!
3601 * src/screen.C (ToggleSelection): fixed toggle selection bug as
3602 the bool param should not be last.
3604 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3606 * sigc++/configure.in: fix bug in threading-related code (Yes, I
3607 did submit that to Karl).
3609 * configure.in: use -isystem instead of -I for X headers. This
3610 fixes a problem on solaris with a recent gcc;
3611 put the front-end code after the X detection code;
3612 configure in sigc++ before lib/
3614 * src/lyx_main.C (commandLineHelp): remove -display from command
3617 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
3619 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
3620 Also put in Makefile rules for building the ``listerrors''
3621 program for parsing errors from literate programs written in LyX.
3623 * lib/build-listerrors: Added small shell script as part of compile
3624 process. This builds a working ``listerrors'' binary if noweb is
3625 installed and either 1) the VNC X server is installed on the machine,
3626 or 2) the user is compiling from within a GUI. The existence of a GUI
3627 is necessary to use the ``lyx --export'' feature for now. This
3628 hack can be removed once ``lyx --export'' no longer requires a GUI to
3631 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
3633 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
3634 now passed back correctly from gcc and placed "under" error
3635 buttons in a Literate LyX source.
3637 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3639 * src/text.C (GetColumnNearX): Better behavior when a RTL
3640 paragraph is ended by LTR text.
3642 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
3645 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3647 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
3648 true when clipboard is empty.
3650 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3652 * text.C (Backspace): Prevent rebreaking of a row if it is the last
3653 row of the paragraph.
3654 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
3655 to prevent calculation of bidi tables
3657 2000-07-07 Juergen Vigna <jug@sad.it>
3659 * src/screen.C (ToggleSelection): added y_offset and x_offset
3662 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
3665 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
3667 * src/insets/insettext.C: fixed Layout-Display!
3669 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3671 * configure.in: add check for strings.h header.
3673 * src/spellchecker.C: include <strings.h> in order to have a
3674 definition for bzero().
3676 2000-07-07 Juergen Vigna <jug@sad.it>
3678 * src/insets/insettext.C (draw): set the status of the bv->text to
3679 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
3681 * src/screen.C (DrawOneRow):
3682 (DrawFromTo): redraw the actual row if something has changed in it
3685 * src/text.C (draw): call an update of the toplevel-inset if something
3686 has changed inside while drawing.
3688 * src/lyxtext.h: added CHANGED_IN_DRAW status.
3690 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
3692 * src/insets/insetbib.[Ch] (callback) new method, moving callback
3693 processing inside class.
3695 * src/insets/insetindex.[Ch] (callback) new method, moving callback
3696 processing inside class.
3698 * src/insets/insetindex.h new struct Holder, consistent with other
3701 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
3702 citation dialog from main code and placed it in src/frontends/xforms.
3703 Dialog launched through signals instead of callbacks
3705 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
3707 * lyx.man: update the options description.
3709 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
3711 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
3712 handle neg values, set min width to 590, add doc about -display
3714 2000-07-05 Juergen Vigna <jug@sad.it>
3716 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
3717 calls to BufferView *.
3719 * src/insets/insettext.C (checkAndActivateInset): small fix non
3720 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
3722 * src/insets/insetcommand.C (Read): Fixed as insets should read till
3723 their \end_inset token!
3725 2000-07-04 edscott <edscott@imp.mx>
3727 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
3728 lib/lyxrc.example: added option \wheel_jump
3730 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
3732 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
3733 remove support for -width,-height,-xpos and -ypos.
3735 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
3737 * src/encoding.[Ch]: New files.
3739 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
3740 (text): Call to the underline() method only when needed.
3742 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
3744 * src/buffer.C (makeLaTeXFile): Compute automatically the input
3745 encoding(s) for the document.
3747 * src/bufferparams.C (BufferParams): Changed default value of
3750 * src/language.C (newLang): Removed.
3751 (items[]): Added encoding information for all defined languages.
3753 * src/lyx_gui.C (create_forms): Added "auto" option to the input
3754 encoding choice button.
3756 * src/lyxrc.h (font_norm_type): New member variable.
3757 (set_font_norm_type): New method.
3759 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
3760 paragraphs with different encodings.
3762 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
3763 (TransformChar): Changed to work correctly with Arabic points.
3764 (draw): Added support for drawing Arabic points.
3765 (draw): Removed code for drawing underbars (this is done by
3768 * src/support/textutils.h (IsPrintableNonspace): New function.
3770 * src/BufferView_pimpl.h: Added "using SigC::Object".
3771 * src/LyXView.h: ditto.
3773 * src/insets/insetinclude.h (include_label): Changed to mutable.
3775 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3777 * src/mathed/math_iter.h: remove empty destructor
3779 * src/mathed/math_cursor.h: remove empty destructor
3781 * src/insets/lyxinset.h: add THEOREM_CODE
3783 * src/insets/insettheorem.[Ch]: new files
3785 * src/insets/insetminipage.C: (InsertInset): remove
3787 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
3789 (InsertInset): remove
3791 * src/insets/insetlist.C: (InsertList): remove
3793 * src/insets/insetfootlike.[Ch]: new files
3795 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
3798 (InsertInset): ditto
3800 * src/insets/insetert.C: remove include Painter.h, reindent
3801 (InsertInset): move to header
3803 * src/insets/insetcollapsable.h: remove explicit from default
3804 contructor, remove empty destructor, add InsertInset
3806 * src/insets/insetcollapsable.C (InsertInset): new func
3808 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3810 * src/vspace.h: add explicit to constructor
3812 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
3813 \textcompwordmark, please test this.
3815 * src/lyxrc.C: set ascii_linelen to 65 by default
3817 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
3819 * src/commandtags.h: add LFUN_INSET_THEOREM
3821 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
3822 (makeLinuxDocFile): remove _some_ of the nice logic
3823 (makeDocBookFile): ditto
3825 * src/Painter.[Ch]: (~Painter): removed
3827 * src/LyXAction.C (init): entry for insettheorem added
3829 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
3831 (deplog): code to detect files generated by LaTeX, needs testing
3834 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3836 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
3838 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3840 * src/LaTeX.C (deplog): Add a check for files that are going to be
3841 created by the first latex run, part of the project to remove the
3844 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
3845 contents to the extension list.
3847 2000-07-04 Juergen Vigna <jug@sad.it>
3849 * src/text.C (NextBreakPoint): added support for needFullRow()
3851 * src/insets/lyxinset.h: added needFullRow()
3853 * src/insets/insetcollapsable.C: redone now this uses a text-inset
3856 * src/insets/insettext.C: lots of changes for update!
3858 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
3860 * src/LaTeXFeatures.h: add a missing std:: qualifier.
3862 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
3864 * src/insets/insetinclude.C (InsetInclude): fixed
3865 initialization of include_label.
3866 (unique_id): now returns a string.
3868 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
3870 * src/LaTeXFeatures.h: new member IncludedFiles, for
3871 a map of key, included file name.
3873 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
3874 with the included files for inclusion in SGML preamble,
3875 i. e., linuxdoc and docbook.
3878 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
3879 nice (is the generated linuxdoc code to be exported?), that
3880 allows to remove column, and only_body that will be true for
3881 slave documents. Insets are allowed inside SGML font type.
3882 New handling of the SGML preamble for included files.
3883 (makeDocBookFile): the same for docbook.
3885 * src/insets/insetinclude.h:
3886 * src/insets/insetinclude.C (Validate): keeps a list of included files.
3888 (DocBook): new export methods.
3890 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
3891 and makeDocBookFile.
3893 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
3894 formats to export with command line argument -x.
3896 2000-06-29 Juergen Vigna <jug@sad.it>
3898 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
3899 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
3901 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
3902 region could already been cleared by an inset!
3904 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3906 * src/BufferView_pimpl.h: remove member variables lyx_focus and
3909 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
3911 (cursorToggle): remove special handling of lyx focus.
3913 2000-06-28 Juergen Vigna <jug@sad.it>
3915 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
3918 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3920 * src/insets/insetindex.C (Edit): add a callback when popup is
3923 * src/insets/insettext.C (LocalDispatch):
3924 * src/insets/insetmarginal.h:
3925 * src/insets/insetlist.h:
3926 * src/insets/insetfoot.h:
3927 * src/insets/insetfloat.h:
3928 * src/insets/insetert.h: add a missing std:: qualifier.
3930 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3932 * src/support/lyxsum.C (sum): '\0' teminate file read when using
3935 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
3937 * src/insets/insettext.C (Read): remove tmptok unused variable
3938 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
3939 (InsertInset): change for new InsetInset code
3941 * src/insets/insettext.h: add TEXT inline method
3943 * src/insets/insettext.C: remove TEXT macro
3945 * src/insets/insetmarginal.C (Write): new method
3946 (Latex): change output slightly
3948 * src/insets/insetfoot.C (Write): new method
3949 (Latex): change output slightly (don't use endl when no need)
3951 * src/insets/insetert.C (Write): new method
3953 * src/insets/insetcollapsable.h: make button_length, button_top_y
3954 and button_bottm_y protected.
3956 * src/insets/insetcollapsable.C (Write): simplify code by using
3957 tostr. Also do not output the float name, the children class
3958 should to that to get control over own arguments
3960 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
3961 src/insets/insetminipage.[Ch]:
3964 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3966 * src/lyxfunc.C (Dispatch): cases for new insets/commands
3968 * src/Makefile.am (lyx_SOURCES): add the new files
3970 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
3971 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
3972 * src/commandtags.h: ditto
3974 * src/LaTeXFeatures.h: add a std::set of used floattypes
3976 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
3978 * src/FloatList.[Ch] src/Floating.h: new files
3980 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
3982 * src/lyx_cb.C (TableApplyCB): ditto
3984 * src/text2.C: ditto
3985 * src/buffer.C (SimpleLinuxDocOnePar): ditto
3986 (parseSingleLyXformat2Token): ditto + add code for
3987 backwards compability for old float styles + add code for new insets
3989 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
3991 (InsertInset(size_type, Inset *, LyXFont)): new method
3992 (InsetChar(size_type, char)): changed to use the other InsetChar
3993 with a LyXFont(ALL_INHERIT).
3994 (InsetInset(size_type, Inset*)): changed to use InsetChar to
3995 insert the META_INSET.
3997 * sigc++/thread.cc (Privete<int>::operator int&): move definition
3999 * sigc++/thread.h (Threads): from here
4001 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
4002 definition out of line
4003 * sigc++/scope.h: from here
4005 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4007 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
4008 is specified (adapted from a patch from edscott <edscott@imp.mx>).
4010 * Makefile.am (bindist): new target.
4012 * INSTALL: add instructions for doing a binary distribution.
4014 * development/tools/README.bin.example: update a bit.
4016 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
4019 * lib/lyxrc.example: new lyxrc tag \set_color.
4021 * src/lyxfunc.C (Dispatch):
4022 * src/commandtags.h:
4023 * src/LyXAction.C: new lyxfunc "set-color".
4025 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
4026 and an x11name given as strings.
4028 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
4029 cache when a color is changed.
4031 2000-06-26 Juergen Vigna <jug@sad.it>
4033 * src/lyxrow.C (width): added this functions and variable.
4035 * src/insets/insetcite.C (create_form_citation_form): some Gravity
4038 * src/text.C (SetHeightOfRow): fixed calcualting of width.
4040 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4042 * images/undo_bw.xpm: new icon.
4043 * images/redo_bw.xpm: ditto.
4045 * configure.in (INSTALL_SCRIPT): change value to
4046 ${INSTALL} to avoid failures of install-script target.
4047 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
4049 * src/BufferView.h: add a magic "friend" declaration to please
4052 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
4054 * forms/cite.fd: modified to allow resizing without messing
4057 * src/insetcite.C: Uses code from cite.fd almost without
4059 User can now resize dialog in the x-direction.
4060 Resizing the dialog in the y-direction is prevented, as the
4061 code does this intelligently already.
4063 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4065 * INSTALL: remove obsolete entry in "problems" section.
4067 * lib/examples/sl_*.lyx: update of the slovenian examples.
4069 * src/support/FileInfo.[Ch] (getBlockSize): remove.
4071 2000-06-23 Juergen Vigna <jug@sad.it>
4073 * src/lyxtext.h: added a 'cleared' flag to draw() function.
4075 * src/buffer.C (resize): delete the LyXText of textinsets.
4077 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
4079 * src/insets/lyxinset.h: added another parameter 'cleared' to
4080 the draw() function.
4082 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
4083 unlocking inset in inset.
4085 2000-06-22 Juergen Vigna <jug@sad.it>
4087 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
4088 of insets and moved first to LyXText.
4090 * src/mathed/formulamacro.[Ch]:
4091 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
4093 2000-06-21 Juergen Vigna <jug@sad.it>
4095 * src/text.C (GetVisibleRow): look if I should clear the area or not
4096 using Inset::doClearArea() function.
4098 * src/insets/lyxinset.h: added doClearArea() function and
4099 modified draw(Painter &, ...) to draw(BufferView *, ...)
4101 * src/text2.C (UpdateInset): return bool insted of int
4103 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
4105 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
4106 combox in the character popup
4108 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
4109 BufferParams const & params
4111 2000-06-20 Juergen Vigna <jug@sad.it>
4113 * src/insets/insettext.C (SetParagraphData): set insetowner on
4116 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4118 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
4119 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
4121 (form_main_): remove
4123 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
4124 (create_form_form_main): remove FD_form_main stuff, connect to
4125 autosave_timeout signal
4127 * src/LyXView.[Ch] (getMainForm): remove
4128 (UpdateTimerCB): remove
4129 * src/BufferView_pimpl.h: inherit from SigC::Object
4131 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
4132 signal instead of callback
4134 * src/BufferView.[Ch] (cursorToggleCB): remove
4136 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4138 * src/BufferView_pimpl.C: changes because of the one below
4140 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
4141 instead of storing a pointer to a LyXText.
4143 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
4145 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
4147 * src/lyxparagraph.h
4149 * src/paragraph.C: Changed fontlist to a sorted vector.
4151 2000-06-19 Juergen Vigna <jug@sad.it>
4153 * src/BufferView.h: added screen() function.
4155 * src/insets/insettext.C (LocalDispatch): some selection code
4158 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
4160 * src/insets/insettext.C (SetParagraphData):
4162 (InsetText): fixes for multiple paragraphs.
4164 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
4166 * development/lyx.spec.in: Call configure with ``--without-warnings''
4167 to work around a bug with the Makefiles when doing ``make lyxrpm''.
4168 This should be fine, however, since we generally don't want to be
4169 verbose when making an RPM.
4171 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
4173 * lib/scripts/fig2pstex.py: New file
4175 2000-06-16 Juergen Vigna <jug@sad.it>
4177 * src/insets/insettabular.C (UpdateLocal):
4178 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
4179 (LocalDispatch): Changed all functions to use LyXText.
4181 2000-06-15 Juergen Vigna <jug@sad.it>
4183 * src/text.C (SetHeightOfRow): call inset::update before requesting
4186 * src/insets/insettext.C (update):
4187 * src/insets/insettabular.C (update): added implementation
4189 * src/insets/lyxinset.h: added update function
4191 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4193 * src/text.C (SelectNextWord): protect against null pointers with
4194 old-style string streams. (fix from Paul Theo Gonciari
4197 * src/cite.[Ch]: remove erroneous files.
4199 * lib/configure.m4: update the list of created directories.
4201 * src/lyxrow.C: include <config.h>
4202 * src/lyxcursor.C: ditto.
4204 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4206 * lib/examples/decimal.lyx: new example file from Mike.
4208 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
4209 to find template definitions (from Dekel)
4211 * src/frontends/.cvsignore: add a few things.
4213 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
4215 * src/Timeout.C (TimeOut): remove default argument.
4217 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
4220 * src/insets/ExternalTemplate.C: add a "using" directive.
4222 * src/lyx_main.h: remove the act_ struct, which seems unused
4225 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4227 * LyX Developers Meeting: All files changed, due to random C++ (by
4228 coincidence) code generator script.
4230 - external inset (cool!)
4231 - initial online editing of preferences
4232 - insettabular breaks insettext(s contents)
4234 - some DocBook fixes
4235 - example files update
4236 - other cool stuff, create a diff and look for yourself.
4238 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
4240 * src/insets/insettext.C (computeTextRows): if the maxWidth is
4241 -1 this is a non-line-breaking textinset.
4243 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
4244 if there is no width set.
4246 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4248 * Lots of files: Merged the dialogbase branch.
4250 2000-06-09 Allan Rae <rae@lyx.org>
4252 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
4253 and the Dispatch methods that used it.
4255 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
4256 access to functions formerly kept in Dispatch.
4258 2000-05-19 Allan Rae <rae@lyx.org>
4260 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
4261 made to_page and count_copies integers again. from_page remains a
4262 string however because I want to allow entry of a print range like
4263 "1,4,22-25" using this field.
4265 * src/LyXAction.C: added action info and commands for buffer-print-xtl
4266 and printer-params-get. These aren't useful from the minibuffer but
4267 could be used by a script/LyXServer app provided it passes a suitable
4268 auto_mem_buffer. I guess I should take a look at how the LyXServer
4269 works and make it support xtl buffers.
4271 * sigc++/: updated to libsigc++-1.0.1
4273 * src/xtl/: updated to xtl-1.3.pl.11
4275 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
4276 those changes done to the files in src/ are actually recreated when
4277 they get regenerated. Please don't ever accept a patch that changes a
4278 dialog unless that patch includes the changes to the corresponding *.fd
4281 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
4282 stringOnlyContains, renamed it and generalised it.
4284 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
4285 branch. Removed the remaining old form_print code.
4287 2000-04-26 Allan Rae <rae@lyx.org>
4289 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
4290 trap I was trying to fix with the ID: fields in src/xtl/ :-)
4292 2000-04-25 Allan Rae <rae@lyx.org>
4294 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
4295 against a base of xtl-1.3.pl.4
4297 * development/tools/lxtl.sh: fixed a couple of silly typos and now
4298 filter the Id: entries so they still show the xtl version number
4301 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
4302 into the src/xtl code. Patch still pending with José (XTL)
4304 2000-04-24 Allan Rae <rae@lyx.org>
4306 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
4307 both more generic and much safer. Use the new template functions.
4308 * src/buffer.[Ch] (Dispatch): ditto.
4310 * src/frontends/xforms/FormPrint.C (update): Use new template functions
4311 and mem buffer more intelligently. Also a little general cleanup.
4314 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
4315 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
4316 * src/xtl/Makefile.am: ditto.
4317 * src/xtl/.cvsignore: ditto.
4318 * src/Makefile.am: ditto.
4320 * src/PrinterParams.h: Removed the macros member functions. Added a
4321 testInvariant member function. A bit of tidying up and commenting.
4322 Included Angus's idea for fixing operation with egcs-1.1.2.
4324 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
4325 cool expansion of XTL's mem_buffer to support automatic memory
4326 management within the buffer itself. Removed the various macros and
4327 replaced them with template functions that use either auto_mem_buffer
4328 or mem_buffer depending on a #define. The mem_buffer support will
4329 disappear as soon as the auto_mem_buffer is confirmed to be good on
4330 other platforms/compilers. That is, it's there so you've got something
4333 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
4334 effectively forked XTL. However I expect José will include my code
4335 into the next major release. Also fixed a memory leak.
4336 * src/xtl/text.h: ditto.
4337 * src/xtl/xdr.h: ditto.
4338 * src/xtl/giop.h: ditto.
4340 2000-04-16 Allan Rae <rae@lyx.org>
4342 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
4343 by autogen.sh and removed by maintainer-clean anyway.
4344 * .cvsignore, sigc++/.cvsignore: Support the above.
4346 * sigc++/.cvsignore: Forgot that retbind.h was generated.
4348 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
4350 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
4351 macros, renamed static callback-target member functions to suit new
4352 scheme and made them public.
4353 * src/frontends/xforms/forms/form_print.fd: ditto.
4354 * src/frontends/xforms/forms/form_copyright.fd: ditto.
4356 * src/support/lxtl.h: small cleanup to use typedef instead of #define
4359 * src/xtl/: New directory containing a minimal distribution of XTL.
4360 This is XTL-1.3.pl.4.
4362 * development/tools/lxtl.sh: A script to generate the above mini-dist.
4364 2000-04-15 Allan Rae <rae@lyx.org>
4366 * development/tools/makeLyXsigc.sh: Remove the library version numbers
4368 * sigc++/: Updated to libsigc++-1.0.0
4370 2000-04-14 Allan Rae <rae@lyx.org>
4372 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
4373 use the generic ones in future. I'll modify my conversion script.
4375 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
4377 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
4378 (CloseAllBufferRelatedDialogs): Renamed.
4379 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
4381 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
4382 of the generic ones. These are the same ones my conversion script
4385 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
4386 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
4387 * src/buffer.C (Dispatch): ditto
4389 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
4390 functions for updating and hiding buffer dependent dialogs.
4391 * src/BufferView.C (buffer): ditto
4392 * src/buffer.C (setReadonly): ditto
4393 * src/lyxfunc.C (CloseBuffer): ditto
4395 * src/buffer.h: Take setReadonly() out of line so I don't have to include
4396 Dialogs.h, and hence all the SigC stuff, into every file that includes
4397 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
4399 * src/BufferView2.C: reduce the number of headers included by buffer.h
4401 2000-04-11 Allan Rae <rae@lyx.org>
4403 * src/frontends/xforms/xform_macros.h: A small collection of macros
4404 for building C callbacks.
4406 * src/frontends/xforms/Makefile.am: Added above file.
4408 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
4409 scheme again. This time it should work for JMarc. If this is
4410 successful I'll revise my conversion script to automate some of this.
4411 The static member functions in the class also have to be public for
4412 this scheme will work. If the scheme works (it's almost identical to
4413 the way BufferView::cursorToggleCB is handled so it should work) then
4414 FormCopyright and FormPrint will be ready for inclusion into the main
4415 trunk immediately after 1.1.5 is released -- provided we're prepared
4416 for complaints about lame compilers not handling XTL.
4418 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
4420 2000-04-07 Allan Rae <rae@lyx.org>
4422 * config/lyxinclude.m4: A bit more tidying up (Angus)
4424 * src/LString.h: JMarc's <string> header fix
4426 * src/PrinterParams.h: Used string for most data to remove some
4427 ugly code in the Print dialog and avoid even uglier code when
4428 appending the ints to a string for output.
4430 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
4431 and moved "default:" back to the end of switch statement. Cleaned
4432 up the printing so it uses the right function calls and so the
4433 "print to file" option actually puts the file in the right directory.
4435 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
4437 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
4438 and Ok+Apply button control into a separate method: input (Angus).
4439 (input) Cleaned it up and improved it to be very thorough now.
4440 (All CB) static_cast used instead of C style cast (Angus). This will
4441 probably change again once we've worked out how to keep gcc-2.8.1 happy
4442 with real C callbacks.
4443 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
4444 ignore some of the bool settings and has random numbers instead. Needs
4445 some more investigation. Added other input length checks and checking
4446 of file and printer names.
4448 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
4449 would link (Angus). Seems the old code doesn't compile with the pragma
4450 statement either. Separated callback entries from internal methods.
4452 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
4454 2000-03-17 Allan Rae <rae@lyx.org>
4456 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
4457 need it? Maybe it could go in Dialogs instead? I could make it a
4458 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
4459 values to get the bool return value.
4460 (Dispatch): New overloaded method for xtl support.
4462 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
4463 extern "C" callback instead of static member functions. Hopefully,
4464 JMarc will be able to compile this. I haven't changed
4465 forms/form_copyright.fd yet. Breaking one of my own rules already.
4467 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
4468 because they aren't useful from the minibuffer. Maybe a LyXServer
4469 might want a help message though?
4471 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
4473 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
4474 xtl which needs both rtti and exceptions.
4476 * src/support/Makefile.am:
4477 * src/support/lxtl.h: New file. Some helper macros for using XTL.
4479 * src/frontends/xforms/input_validators.[ch]: input filters and
4480 validators. These conrol what keys are valid in input boxes.
4481 Use them and write some more. Much better idea than waiting till
4482 after the user has pressed Ok to say that the input fields don't make
4485 * src/frontends/xforms/Makefile.am:
4486 * src/frontends/xforms/forms/form_print.fd:
4487 * src/frontends/xforms/forms/makefile:
4488 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
4489 new scheme. Still have to make sure I haven't missed anything from
4490 the current implementation.
4492 * src/Makefile.am, src/PrinterParams.h: New data store.
4494 * other files: Added a couple of copyright notices.
4496 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4498 * src/insets/insetbib.h: move Holder struct in public space.
4500 * src/frontends/include/DialogBase.h: use SigC:: only when
4501 SIGC_CXX_NAMESPACES is defined.
4502 * src/frontends/include/Dialogs.h: ditto.
4504 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
4506 * src/frontends/xforms/FormCopyright.[Ch]: do not
4507 mention SigC:: explicitely.
4509 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4511 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
4512 deals with testing KDE in main configure.in
4513 * configure.in: ditto.
4515 2000-02-22 Allan Rae <rae@lyx.org>
4517 * Lots of files: Merged from HEAD
4519 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
4520 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
4522 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
4524 * sigc++/: new minidist.
4526 2000-02-14 Allan Rae <rae@lyx.org>
4528 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
4530 2000-02-08 Juergen Vigna <jug@sad.it>
4532 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
4533 file for the buildin GUI builder of KDevelop of the copyright-dialog.
4535 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
4536 for this port and so it is much easier for other people to port
4537 dialogs in a common development environment.
4539 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
4540 the QT/KDE implementation.
4542 * src/frontends/kde/Dialogs.C:
4543 * src/frontends/kde/FormCopyright.C:
4544 * src/frontends/kde/FormCopyright.h:
4545 * src/frontends/kde/Makefile.am:
4546 * src/frontends/kde/formcopyrightdialog.C:
4547 * src/frontends/kde/formcopyrightdialog.h:
4548 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
4549 for the kde support of the Copyright-Dialog.
4551 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
4552 subdir-substitution instead of hardcoded 'xforms' as we now have also
4555 * src/frontends/include/DialogBase.h (Object): just commented the
4556 label after #endif (nasty warning and I don't like warnings ;)
4558 * src/main.C (main): added KApplication initialization if using
4561 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
4562 For now only the KDE event-loop is added if frontend==kde.
4564 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
4566 * configure.in: added support for the --with-frontend[=value] option
4568 * autogen.sh: added kde.m4 file to list of config-files
4570 * acconfig.h: added define for KDEGUI-support
4572 * config/kde.m4: added configuration functions for KDE-port
4574 * config/lyxinclude.m4: added --with-frontend[=value] option with
4575 support for xforms and KDE.
4577 2000-02-08 Allan Rae <rae@lyx.org>
4579 * all Makefile.am: Fixed up so the make targets dist, distclean,
4580 install and uninstall all work even if builddir != srcdir. Still
4581 have a new sigc++ minidist update to come.
4583 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
4585 2000-02-01 Allan Rae <rae@lyx.org>
4587 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
4588 Many mods to get builddir != srcdir working.
4590 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
4591 for building on NT and so we can do the builddir != srcdir stuff.
4593 2000-01-30 Allan Rae <rae@lyx.org>
4595 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
4596 This will stay in "rae" branch. We probably don't really need it in
4597 the main trunk as anyone who wants to help programming it should get
4598 a full library installed also. So they can check both included and
4599 system supplied library compilation.
4601 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
4602 Added a 'mini' distribution of libsigc++. If you feel the urge to
4603 change something in these directories - Resist it. If you can't
4604 resist the urge then you should modify the following script and rebuild
4605 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
4606 all happen. Still uses a hacked version of libsigc++'s configure.in.
4607 I'm quite happy with the results. I'm not sure the extra work to turn
4608 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
4609 worth the trouble and would probably lead to extra maintenance
4611 I haven't tested the following important make targets: install, dist.
4612 Not ready for prime time but very close. Maybe 1.1.5.
4614 * development/tools/makeLyXsigc.sh: A shell script to automatically
4615 generate our mini-dist of libsigc++. It can only be used with a CVS
4616 checkout of libsigc++ not a tarball distribution. It's well commented.
4617 This will end up as part of the libsigc++ distribution so other apps
4618 can easily have an included mini-dist. If someone makes mods to the
4619 sigc++ subpackage without modifying this script to generate those
4620 changes I'll be very upset!
4622 * src/frontends/: Started the gui/system indep structure.
4624 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
4625 to access the gui-indep dialogs are in this class. Much improved
4626 design compared to previous revision. Lars, please refrain from
4627 moving this header into src/ like you did with Popups.h last time.
4629 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
4631 * src/frontends/xforms/: Started the gui-indep system with a single
4632 dialog: FormCopyright. Initial testing of use of libsigc++ was very
4635 * src/frontends/xforms/forms: Repository for the xforms .fd files.
4636 Here you'll find a very useful makefile and automated fdfix.sh that
4637 makes updating dailogs a no-brainer -- provided you follow the rules
4638 set out in the README. I'm thinking about adding another script to
4639 automatically generate skeleton code for a new dialog given just the
4642 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
4643 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
4644 Made FormCopyright gui-indep and added a lyxfunc to get to it.
4646 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4648 * src/support/LSubstring.C (operator): simplify
4650 * src/lyxtext.h: removed bparams, use buffer_->params instead
4652 * src/lyxrow.h: make Row a real class, move all variables to
4653 private and use accessors.
4655 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
4657 (isRightToLeftPar): ditto
4658 (ChangeLanguage): ditto
4659 (isMultiLingual): ditto
4662 (SimpleTeXOnePar): ditto
4663 (TeXEnvironment): ditto
4664 (GetEndLabel): ditto
4666 (SetOnlyLayout): ditto
4667 (BreakParagraph): ditto
4668 (BreakParagraphConservative): ditto
4669 (GetFontSettings): ditto
4671 (CopyIntoMinibuffer): ditto
4672 (CutIntoMinibuffer): ditto
4673 (PasteParagraph): ditto
4674 (SetPExtraType): ditto
4675 (UnsetPExtraType): ditto
4676 (DocBookContTableRows): ditto
4677 (SimpleDocBookOneTablePar): ditto
4679 (TeXFootnote): ditto
4680 (SimpleTeXOneTablePar): ditto
4681 (TeXContTableRows): ditto
4682 (SimpleTeXSpecialChars): ditto
4685 * src/lyxcursor.h: make LyXCursor a real class, move all variables
4686 to private and use accessors.
4688 * src/lyx_cb.C: remove char updatetimer, and all code that uses
4689 this, we did not use it anymore and has not been for ages. Just a
4690 waste of cpu cycles.
4692 * src/language.h: make Language a real class, move all variables
4693 to private and use accessors.
4695 * src/BufferView_pimpl.C (Pimpl): use new timer code.
4696 (create_view): remove
4697 (update): some changes for new timer
4698 (cursorToggle): use new timer
4699 (beforeChange): change for new timer
4701 * src/BufferView.h (cursorToggleCB): removed last paramter because
4704 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
4705 (cursorToggleCB): change because of new timer code
4707 * lib/CREDITS: updated own mailaddress
4709 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4711 * src/support/filetools.C (PutEnv): fix the code in case neither
4712 putenv() nor setenv() have been found.
4714 * INSTALL: mention the install-strip Makefile target.
4716 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
4717 read-only documents.
4719 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4721 * lib/reLyX/configure.in (VERSION): avoid using a previously
4722 generated reLyX wrapper to find out $prefix.
4724 * lib/examples/eu_adibide_lyx-atua.lyx:
4725 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
4726 translation of the Tutorial (Dooteo)
4728 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
4730 * forms/cite.fd: new citation dialog
4732 * src/insetcite.[Ch]: the new citation dialog is moved into
4735 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
4738 * src/insets/insetcommand.h: data members made private.
4740 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4742 * LyX 1.1.5 released
4744 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4746 * src/version.h (LYX_RELEASE): to 1.1.5
4748 * src/spellchecker.C (RunSpellChecker): return false if the
4749 spellchecker dies upon creation.
4751 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4753 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
4754 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
4758 * lib/CREDITS: update entry for Martin Vermeer.
4760 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
4762 * src/text.C (draw): Draw foreign language bars at the bottom of
4763 the row instead of at the baseline.
4765 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
4767 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4769 * lib/bind/de_menus.bind: updated
4771 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4773 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
4775 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4777 * src/menus.C (Limit_string_length): New function
4778 (ShowTocMenu): Limit the number of items/length of items in the
4781 * src/paragraph.C (String): Correct result for a paragraph inside
4784 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4786 * src/bufferlist.C (close): test of buf->getuser() == NULL
4788 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
4790 * src/BufferView2.C (removeAutoInsets): Fix a bug:
4791 Do not call to SetCursor when the paragraph is a closed footnote!
4793 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
4795 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
4798 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
4800 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4803 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
4804 reference popup, that activates the reference-back action
4806 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
4808 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
4809 the menus. Also fixed a bug.
4811 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
4812 the math panels when switching buffers (unless new buffer is readonly).
4814 * src/BufferView.C (NoSavedPositions)
4815 * src/BufferView_pimpl.C (NoSavedPositions): New methods
4817 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4819 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
4820 less of dvi dirty or not.
4822 * src/trans_mgr.[Ch] (insert): change first parameter to string
4825 * src/chset.[Ch] (encodeString): add const to first parameter
4827 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4829 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
4833 * src/LaTeX.C (deplog): better searching for dependency files in
4834 the latex log. Uses now regexps.
4836 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
4837 instead of the box hack or \hfill.
4839 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4841 * src/lyxfunc.C (doImportHelper): do not create the file before
4842 doing the actual import.
4843 (doImportASCIIasLines): create a new file before doing the insert.
4844 (doImportASCIIasParagraphs): ditto.
4846 * lib/lyxrc.example: remove mention of non-existing commands
4848 * lyx.man: remove mention of color-related switches.
4850 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
4852 * src/lyx_gui.C: remove all the color-related ressources, which
4853 are not used anymore.
4855 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
4858 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4860 * src/lyxrc.C (read): Add a missing break in the switch
4862 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
4864 * src/text2.C (InsertStringA): Fix a bug with insertion into table
4866 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
4869 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4871 * src/text.C (draw): draw bars under foreign language words.
4873 * src/LColor.[Ch]: add LColor::language
4875 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4877 * src/lyxcursor.h (boundary): New member variable
4879 * src/text.C (IsBoundary): New methods
4881 * src/text.C: Use the above for currect cursor movement when there
4882 is both RTL & LTR text.
4884 * src/text2.C: ditto
4886 * src/bufferview_funcs.C (ToggleAndShow): ditto
4888 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4890 * src/text.C (DeleteLineForward): set selection to true to avoid
4891 that DeleteEmptyParagraphMechanism does some magic. This is how it
4892 is done in all other functions, and seems reasonable.
4893 (DeleteWordForward): do not jump over non-word stuff, since
4894 CursorRightOneWord() already does it.
4896 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
4897 DeleteWordBackward, since they seem safe to me (since selection is
4898 set to "true") DeleteEmptyParagraphMechanism does nothing.
4900 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4902 * src/lyx_main.C (easyParse): simplify the code by factoring the
4903 part that removes parameters from the command line.
4904 (LyX): check wether wrong command line options have been given.
4906 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
4908 * src/lyx_main.C : add support for specifying user LyX
4909 directory via command line option -userdir.
4911 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
4913 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
4914 the number of items per popup.
4915 (Add_to_refs_menu): Ditto.
4917 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4919 * src/lyxparagraph.h: renamed ClearParagraph() to
4920 StripLeadingSpaces() and moved it to paragraph.C. We pass the
4921 textclass as parameter, and do nothing if free_spacing is
4922 true. This fixes part of the line-delete-forward problems.
4924 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
4925 (pasteSelection): ditto.
4926 (SwitchLayoutsBetweenClasses): more translatable strings.
4928 * src/text2.C (CutSelection): use StripLeadingSpaces.
4929 (PasteSelection): ditto.
4930 (DeleteEmptyParagraphMechanism): ditto.
4932 2000-05-26 Juergen Vigna <jug@sad.it>
4934 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
4935 is not needed in tabular insets.
4937 * src/insets/insettabular.C (TabularFeatures): added missing features.
4939 * src/tabular.C (DeleteColumn):
4941 (AppendRow): implemented this functions
4942 (cellsturct::operator=): clone the inset too;
4944 2000-05-23 Juergen Vigna <jug@sad.it>
4946 * src/insets/insettabular.C (LocalDispatch): better selection support
4947 when having multicolumn-cells.
4949 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4951 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
4953 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4955 * src/ColorHandler.C (getGCForeground): put more test into _()
4957 * lib/examples/eu_splash.lyx: new file (Basque translation) from
4960 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
4963 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
4965 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
4966 there are no labels, or when buffer is readonly.
4968 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
4969 there are no labels, buffer is SGML, or when buffer is readonly.
4971 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4973 * src/LColor.C (LColor): change a couple of grey40 to grey60
4974 (LColor): rewore initalization to make compiles go some magnitude
4976 (getGUIName): don't use gettext until we need the string.
4978 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
4980 * src/Bullet.[Ch]: Fixed a small bug.
4982 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
4984 * src/paragraph.C (String): Several fixes/improvements
4986 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
4988 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4990 * src/paragraph.C (String): give more correct output.
4992 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
4994 * src/lyxfont.C (stateText) Do not output the language if it is
4995 eqaul to the language of the document.
4997 * src/paragraph.C (TeXOnePar): Do not put language switch commands
4998 between two paragraphs with the same language.
5000 * src/paragraph.C (getParLanguage) Return a correct answer for an
5001 empty dummy paragraph.
5003 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
5006 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
5009 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
5010 the menus/popup, if requested fonts are unavailable.
5012 2000-05-22 Juergen Vigna <jug@sad.it>
5014 * src/insets/insettabular.C (LocalDispatch): added some more cursor
5015 movement support (Up/Down/Tab/Shift-Tab).
5016 (LocalDispatch): added also preliminari cursor-selection.
5018 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
5020 * src/paragraph.C (PasteParagraph): Hopefully now right!
5022 2000-05-22 Garst R. Reese <reese@isn.net>
5024 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
5025 of list, change all references to Environment to Command
5026 * tex/hollywood.cls : rewrite environments as commands, add
5027 \uppercase to interiorshot and exteriorshot to force uppecase.
5028 * tex/broadway.cls : rewrite environments as commands. Tweak
5031 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5033 * src/menus.C (Add_to_toc_menu): fix the code which limits the
5034 size of items: use a constant intead of the hardcoded 40, and more
5035 importantly do not remove the %m and %x tags added at the end.
5036 (Add_to_refs_menu): use vector::size_type instead of
5037 unsigned int as basic types for the variables. _Please_ do not
5038 assume that size_t is equal to unsigned int. On an alpha, this is
5039 unsigned long, which is _not_ the same.
5041 * src/language.C (initL): remove language "hungarian", since it
5042 seems that "magyar" is better.
5044 2000-05-22 Juergen Vigna <jug@sad.it>
5046 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
5048 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
5051 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
5052 next was deleted but not set to 0.
5054 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5056 * src/language.C (initL): change the initialization of languages
5057 so that compiles goes _fast_.
5059 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
5062 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
5064 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5068 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5070 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
5072 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
5076 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
5079 * src/insets/insetlo*.[Ch]: Made editable
5081 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5083 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
5084 the current selection.
5086 * src/BufferView_pimpl.C (stuffClipboard): new method
5088 * src/BufferView.C (stuffClipboard): new method
5090 * src/paragraph.C (String): new method
5092 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
5093 LColor::ignore when lyxname is not found.
5095 * src/BufferView.C (pasteSelection): new method
5097 * src/BufferView_pimpl.C (pasteSelection): new method
5099 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
5101 * src/WorkArea.C (request_clipboard_cb): new static function
5102 (getClipboard): new method
5103 (putClipboard): new method
5105 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5107 * LyX 1.1.5pre2 released
5109 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5111 * src/vspace.C (operator=): removed
5112 (operator=): removed
5114 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
5116 * src/layout.C (NumberOfClass): manually set the type in make_pair
5117 (NumberOfLayout): ditto
5119 * src/language.C: use the Language constructor for ignore_lang
5121 * src/language.h: add constructors to struct Language
5123 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
5125 * src/text2.C (SetCursorIntern): comment out #warning
5127 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
5129 * src/mathed/math_iter.h: initialize sx and sw to 0
5131 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
5133 * forms/lyx.fd: Redesign of form_ref
5135 * src/LaTeXFeatures.[Ch]
5139 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
5142 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
5143 and Buffer::inset_iterator.
5145 * src/menus.C: Added new menus: TOC and Refs.
5147 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
5149 * src/buffer.C (getTocList): New method.
5151 * src/BufferView2.C (ChangeRefs): New method.
5153 * src/buffer.C (getLabelList): New method. It replaces the old
5154 getReferenceList. The return type is vector<string> instead of
5157 * src/insets/insetinclude.C (getLabelList): New method. Replaces
5158 the old getLabel() and GetNumberOfLabels() methods.
5159 * src/insets/insetlabel.C (getLabelList): ditto
5160 * src/mathed/formula.C (getLabelList): ditto
5162 * src/paragraph.C (String): New method.
5164 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
5165 Uses the new getTocList() method.
5166 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
5167 which automatically updates the contents of the browser.
5168 (RefUpdateCB): Use the new getLabelList method.
5170 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
5172 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
5174 * src/spellchecker.C: Added using std::reverse;
5176 2000-05-19 Juergen Vigna <jug@sad.it>
5178 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
5180 * src/insets/insettext.C (computeTextRows): small fix for display of
5181 1 character after a newline.
5183 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
5186 2000-05-18 Juergen Vigna <jug@sad.it>
5188 * src/insets/insettabular.C (TabularFeatures): fixed update of display
5189 when changing width of column.
5191 * src/tabular.C (set_row_column_number_info): setting of
5192 autobreak rows if necessary.
5194 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5196 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
5198 * src/vc-backend.*: renamed stat() to status() and vcstat to
5199 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
5200 compilation broke. The new name seems more relevant, anyway.
5202 2000-05-17 Juergen Vigna <jug@sad.it>
5204 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
5205 which was wrong if the removing caused removing of rows!
5207 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
5208 (pushToken): new function.
5210 * src/text2.C (CutSelection): fix problem discovered with purify
5212 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5214 * src/debug.C (showTags): enlarge the first column, now that we
5215 have 6-digits debug codes.
5217 * lib/layouts/hollywood.layout:
5218 * lib/tex/hollywood.cls:
5219 * lib/tex/brodway.cls:
5220 * lib/layouts/brodway.layout: more commands and fewer
5221 environments. Preambles moved in the .cls files. Broadway now has
5222 more options on scene numbering and less whitespace (from Garst)
5224 * src/insets/insetbib.C (getKeys): make sure that we are in the
5225 document directory, in case the bib file is there.
5227 * src/insets/insetbib.C (Latex): revert bogus change.
5229 2000-05-16 Juergen Vigna <jug@sad.it>
5231 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
5232 the TabularLayout on cursor move.
5234 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
5236 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
5239 (draw): fixed cursor position and drawing so that the cursor is
5240 visible when before the tabular-inset.
5242 * src/insets/insettext.C (init): drawLockedFrame was not initialized
5243 when creating from old insettext.
5245 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
5247 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5249 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
5250 * lib/tex/brodway.cls: ditto
5252 * lib/layouts/brodway.layout: change alignment of parenthical
5255 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5257 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
5258 versions 0.88 and 0.89 are supported.
5260 2000-05-15 Juergen Vigna <jug@sad.it>
5262 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
5265 * src/insets/insettext.C (computeTextRows): redone completely this
5266 function in a much cleaner way, because of problems when having a
5268 (draw): added a frame border when the inset is locked.
5269 (SetDrawLockedFrame): this sets if we draw the border or not.
5270 (SetFrameColor): this sets the frame color (default=insetframe).
5272 * src/insets/lyxinset.h: added x() and y() functions which return
5273 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
5274 function which is needed to see if we have a locking inset of some
5275 type in this inset (needed for now in insettabular).
5277 * src/vspace.C (inPixels): the same function also without a BufferView
5278 parameter as so it is easier to use it in some ocasions.
5280 * src/lyxfunc.C: changed all places where insertInset was used so
5281 that now if it couldn't be inserted it is deleted!
5283 * src/TabularLayout.C:
5284 * src/TableLayout.C: added support for new tabular-inset!
5286 * src/BufferView2.C (insertInset): this now returns a bool if the
5287 inset was really inserted!!!
5289 * src/tabular.C (GetLastCellInRow):
5290 (GetFirstCellInRow): new helper functions.
5291 (Latex): implemented for new tabular class.
5295 (TeXTopHLine): new Latex() helper functions.
5297 2000-05-12 Juergen Vigna <jug@sad.it>
5299 * src/mathed/formulamacro.C (Read):
5300 * src/mathed/formula.C (Read): read also the \end_inset here!
5302 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
5304 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
5305 crush when saving formulae with unbalanced parenthesis.
5307 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
5309 * src/layout.C: Add new keyword "endlabelstring" to layout file
5311 * src/text.C (GetVisibleRow): Draw endlabel string.
5313 * lib/layouts/broadway.layout
5314 * lib/layouts/hollywood.layout: Added endlabel for the
5315 Parenthetical layout.
5317 * lib/layouts/heb-article.layout: Do not use slanted font shape
5318 for Theorem like environments.
5320 * src/buffer.C (makeLaTeXFile): Always add "american" to
5321 the UsedLanguages list if document language is RTL.
5323 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5325 * add addendum to README.OS2 and small patch (from SMiyata)
5327 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5329 * many files: correct the calls to ChangeExtension().
5331 * src/support/filetools.C (ChangeExtension): remove the no_path
5332 argument, which does not belong there. Use OnlyFileName() instead.
5334 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
5335 files when LaTeXing a non-nice latex file.
5337 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
5338 a chain of "if". Return false when deadkeys are not handled.
5340 * src/lyx_main.C (LyX): adapted the code for default bindings.
5342 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
5343 bindings for basic functionality (except deadkeys).
5344 (deadKeyBindings): new method. Performs the bindings of deadkeys.
5346 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
5347 several methods: handle override_x_deadkeys.
5349 * src/lyxrc.h: remove the "bindings" map, which did not make much
5350 sense anyway. New variable override_x_deadkeys, defaulting to "true".
5352 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5354 * src/lyxfont.C (stateText): use a saner method to determine
5355 whether the font is "default". Seems to fix the crash with DEC
5358 * src/Bullet.[Ch] (Bullet): remove const on parameters.
5360 2000-05-08 Juergen Vigna <jug@sad.it>
5362 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
5363 TabularLayoutMenu with mouse-button-3
5364 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
5366 * src/TabularLayout.C: added this file for having a Layout for
5369 2000-05-05 Juergen Vigna <jug@sad.it>
5371 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
5372 recalculating inset-widths.
5373 (TabularFeatures): activated this function so that I can change
5374 tabular-features via menu.
5376 * src/menus.C (ShowEditMenu): inserted support for insettabular so
5377 that I can test some functions with the Table menu.
5379 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5381 * src/lyxfont.C (stateText): guard against stupid c++libs.
5383 * src/tabular.C: add using std::vector
5384 some whitespace changes, + removed som autogenerated code.
5386 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
5388 2000-05-05 Juergen Vigna <jug@sad.it>
5390 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
5391 row, columns and cellstructures.
5393 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5395 * lib/lyxrc.example: remove obsolete entries.
5397 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
5398 reading of protected_separator for free_spacing.
5400 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5402 * src/text.C (draw): do not display an exclamation mark in the
5403 margin for margin notes. This is confusing, ugly and
5406 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
5407 AMS math' is checked.
5409 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
5410 name to see whether including the amsmath package is needed.
5412 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
5414 * src/paragraph.C (validate): Compute UsedLanguages correctly
5415 (don't insert the american language if it doesn't appear in the
5418 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
5419 The argument of \thanks{} command is considered moving argument
5421 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
5424 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
5426 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
5427 for appendix/minipage/depth. The lines can be now both in the footnote
5428 frame, and outside the frame.
5430 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
5433 2000-05-05 Juergen Vigna <jug@sad.it>
5435 * src/table.[Ch]: removed the inset and buffer stuff as this is now
5436 neede only in tabular.[Ch].
5438 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5440 * src/insets/insetspecialchar.C (Read): allow command == '~' for
5442 (Write): write '~' for PROTECTED_SEPARATOR
5444 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5446 * src/lyxparagraph.h: add a friend struct matchIT after the struct
5449 * src/mathed/formula.C (drawStr): rename size to siz.
5451 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
5452 possibly fix a bug by not changing the pflags = flags to piflags =
5455 2000-05-05 Juergen Vigna <jug@sad.it>
5457 * src/insets/insetbib.C: moved using directive
5459 * src/ImportNoweb.C: small fix for being able to compile (missing
5462 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5464 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
5465 to use clear, since we don't depend on this in the code. Add test
5468 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5470 * (various *.C files): add using std::foo directives to please dec
5473 * replace calls to string::clear() to string::erase() (Angus)
5475 * src/cheaders/cmath: modified to provide std::abs.
5477 2000-05-04 Juergen Vigna <jug@sad.it>
5479 * src/insets/insettext.C: Prepared all for inserting of multiple
5480 paragraphs. Still display stuff to do (alignment and other things),
5481 but I would like to use LyXText to do this when we cleaned out the
5482 table-support stuff.
5484 * src/insets/insettabular.C: Changed lot of stuff and added lots
5485 of functionality still a lot to do.
5487 * src/tabular.C: Various functions changed name and moved to be
5488 const functions. Added new Read and Write functions and changed
5489 lots of things so it works good with tabular-insets (also removed
5490 some stuff which is not needed anymore * hacks *).
5492 * src/lyxcursor.h: added operators == and != which just look if
5493 par and pos are (not) equal.
5495 * src/buffer.C (latexParagraphs): inserted this function to latex
5496 all paragraphs form par to endpar as then I can use this too for
5499 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
5500 so that I can call this to from text insets with their own cursor.
5502 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
5503 output off all paragraphs (because of the fix below)!
5505 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
5506 the very last paragraph (this could be also the last paragraph of an
5509 * src/texrow.h: added rows() call which returns the count-variable.
5511 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
5513 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
5515 * lib/configure.m4: better autodetection of DocBook tools.
5517 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5519 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
5521 * src/lyx_cb.C: add using std::reverse;
5523 * src/LaTeX.C (run): on error always run deleteFilesOnError before
5526 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
5527 selected files. Should fix repeated errors from generated files.
5529 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
5531 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
5533 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
5534 the spellchecker popup.
5536 * lib/lyxrc.example: Removed the \number_inset section
5538 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5540 * src/insets/figinset.C (various): Use IsFileReadable() to make
5541 sure that the file actually exist. Relying on ghostscripts errors
5542 is a bad idea since they can lead to X server crashes.
5544 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
5546 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
5549 * lib/lyxrc.example: smallish typo in description of
5550 \view_dvi_paper_option
5552 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5555 * src/lyxfunc.C: doImportHelper to factor out common code of the
5556 various import methods. New functions doImportASCIIasLines,
5557 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
5558 doImportLinuxDoc for the format specific parts.
5561 * buffer.C: Dispatch returns now a bool to indicate success
5564 * lyx_gui.C: Add getLyXView() for member access
5566 * lyx_main.C: Change logic for batch commands: First try
5567 Buffer::Dispatch (possibly without GUI), if that fails, use
5570 * lyx_main.C: Add support for --import command line switch.
5571 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
5572 Available Formats: Everything accepted by 'buffer-import <format>'
5574 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5576 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
5579 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
5580 documents will be reformatted upon reentry.
5582 2000-04-27 Juergen Vigna <jug@sad.it>
5584 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
5585 correctly only last pos this was a bug.
5587 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5589 * release of lyx-1.1.5pre1
5591 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5593 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
5595 * src/menus.C: revert the change of naming (Figure->Graphic...)
5596 from 2000-04-11. It was incomplete and bad.
5598 * src/LColor.[Ch]: add LColor::depthbar.
5599 * src/text.C (GetVisibleRow): use it.
5601 * README: update the languages list.
5603 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5605 * src/text.C (GetVisibleRow): show the depth of paragraphs using
5608 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5610 * README: remove sections that were just wrong.
5612 * src/text2.C (GetRowNearY): remove currentrow code
5614 * src/text.C (GetRow): remove currentrow code
5616 * src/screen.C (Update): rewritten a bit.
5617 (SmallUpdate): removed func
5619 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
5621 (FullRebreak): return bool
5622 (currentrow): remove var
5623 (currentrow_y): ditto
5625 * src/lyxscreen.h (Draw): change arg to unsigned long
5626 (FitCursor): return bool
5627 (FitManualCursor): ditto
5628 (Smallpdate): remove func
5629 (first): change to unsigned long
5630 (DrawOneRow): change second arg to long (from long &)
5631 (screen_refresh_y): remove var
5632 (scree_refresh_row): ditto
5634 * src/lyxrow.h: change baseline to usigned int from unsigned
5635 short, this brings some implicit/unsigned issues out in the open.
5637 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
5639 (Dispatch): don't call updateScrollbar after fitCursor. Use update
5640 instead of smallUpdate.
5642 * src/lyxcursor.h: change y to unsigned long
5644 * src/buffer.h: don't call updateScrollbar after fitcursor
5646 * src/buffer.C (parseSingleLyXformat2Token): move variables to
5647 where they are used. Removed "\\direction", this was not present
5648 in 1.1.4 and is already obsolete. Commented out some code that I
5649 believe to never be called.
5650 (runLiterate): don't call updateScrollbar after fitCursor
5652 (buildProgram): ditto
5655 * src/WorkArea.h (workWidth): change return val to unsigned
5658 (redraw): remove the button redraws
5659 (setScrollbarValue): change for scrollbar
5660 (getScrollbarValue): change for scrollbar
5661 (getScrollbarBounds): change for scrollbar
5663 * src/WorkArea.C (C_WorkArea_up_cb): removed func
5664 (C_WorkArea_down_cb): removed func
5665 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
5666 (resize): change for scrollbar
5667 (setScrollbar): ditto
5668 (setScrollbarBounds): ditto
5669 (setScrollbarIncrements): ditto
5670 (up_cb): removed func
5671 (down_cb): removed func
5672 (scroll_cb): change for scrollbar
5673 (work_area_handler): ditto
5675 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
5676 when FitCursor did something.
5677 (updateScrollbar): some unsigned changes
5678 (downCB): removed func
5679 (scrollUpOnePage): removed func
5680 (scrollDownOnePage): remvoed func
5681 (workAreaMotionNotify): don't call screen->FitCursor but use
5682 fitCursor instead. and bool return val
5683 (workAreaButtonPress): ditto
5684 (workAreaButtonRelease): some unsigned changes
5685 (checkInsetHit): ditto
5686 (workAreaExpose): ditto
5687 (update): parts rewritten, comments about the signed char arg added
5688 (smallUpdate): removed func
5689 (cursorPrevious): call needed updateScrollbar
5692 * src/BufferView2.C (allFloats): don't call updateScrollbar after
5695 * src/BufferView.[Ch] (upCB): removed func
5696 (downCB): removed func
5697 (smallUpdate): removed func
5699 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5701 * src/lyxtext.h src/text.C src/text2.C: removed support for the
5702 currentrow, currentrow_y optimization. This did not help a lot and
5703 if we want to do this kind of optimization we should rather use
5704 cursor.row instead of the currentrow.
5706 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
5707 buffer spacing and klyx spacing support.
5709 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5711 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
5714 2000-04-26 Juergen Vigna <jug@sad.it>
5716 * src/insets/figinset.C: fixes to Lars sstream changes!
5718 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
5720 * A lot of files: Added Ascii(ostream &) methods to all inset
5721 classes. Used when exporting to ASCII.
5723 * src/buffer.C (writeFileAscii,RoffAsciiTable)
5724 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
5727 * src/text2.C (ToggleFree): Disabled implicit word selection when
5728 there is a change in the language
5730 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
5731 no output was generated for end-of-sentence inset.
5733 * src/insets/lyxinset.h
5736 * src/paragraph.C: Removed the insetnumber code
5738 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
5740 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5742 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
5743 no_babel and no_epsfig completely from the file.
5744 (parseSingleLyXformat2Token): add handling for per-paragraph
5745 spacing as written by klyx.
5747 * src/insets/figinset.C: applied patch by Andre. Made it work with
5750 2000-04-20 Juergen Vigna <jug@sad.it>
5752 * src/insets/insettext.C (cutSelection):
5753 (copySelection): Fixed with selection from right to left.
5754 (draw): now the rows are not recalculated at every draw.
5755 (computeTextRows): for now reset the inset-owner here (this is
5756 important for an undo or copy where the inset-owner is not set
5759 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
5760 motion to the_locking_inset screen->first was forgotten, this was
5761 not important till we got multiline insets.
5763 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5765 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
5766 code seems to be alright (it is code changed by Dekel, and the
5767 intent is indeed that all macros should be defined \protect'ed)
5769 * NEWS: a bit of reorganisation of the new user-visible features.
5771 2000-04-19 Juergen Vigna <jug@sad.it>
5773 * src/insets/insettext.C (init): using a LyXCursor now for cursor
5774 position. Set the inset_owner of the used paragraph so that it knows
5775 that it is inside an inset. Fixed cursor handling with mouse and
5776 cursor keys. Fixed wrong timed inset redraws and lots of other changes
5777 and cleanups to make TextInsets work better.
5779 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
5780 Changed parameters of various functions and added LockInsetInInset().
5782 * src/insets/insettext.C:
5784 * src/insets/insetcollapsable.h:
5785 * src/insets/insetcollapsable.C:
5786 * src/insets/insetfoot.h:
5787 * src/insets/insetfoot.C:
5788 * src/insets/insetert.h:
5789 * src/insets/insetert.C: cleaned up the code so that it works now
5790 correctly with insettext.
5792 * src/insets/inset.C:
5793 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
5794 that insets in insets are supported right.
5797 * src/table.C: lots of changes for use with inset tabular (and cleanup)
5799 * src/paragraph.C: some small fixes
5801 * src/debug.h: inserted INSETS debug info
5803 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
5804 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
5806 * src/commandtags.h:
5807 * src/LyXAction.C: insert code for InsetTabular.
5809 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
5810 not Button1MotionMask.
5811 (workAreaButtonRelease): send always a InsetButtonRelease event to
5813 (checkInsetHit): some setCursor fixes (always with insets).
5815 * src/BufferView2.C (lockInset): returns a bool now and extended for
5816 locking insets inside insets.
5817 (showLockedInsetCursor): it is important to have the cursor always
5818 before the locked inset.
5819 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
5821 * src/BufferView.h: made lockInset return a bool.
5823 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
5825 * src/text2.C (SetCursor): This now has a version with a LyXCursor
5826 that is used also internally but can be called as public to have back
5827 a cursor pos which is not set internally.
5828 (SetCursorIntern): Changed to use above function.
5830 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
5832 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5837 * NEWS: updated for prerelease of 1.1.5. Please comment and send
5838 patches for things that should be in or should be changed.
5840 * src/* [insetfiles]: change "usigned char fragile" to bool
5841 fragile. There was only one point that could that be questioned
5842 and that is commented in formulamacro.C. Grep for "CHECK".
5844 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
5845 (DeleteBuffer): take it out of CutAndPaste and make it static.
5847 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5849 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
5850 output the spacing envir commands. Also the new commands used in
5851 the LaTeX output makes the result better.
5853 * src/Spacing.C (writeEnvirBegin): new method
5854 (writeEnvirEnd): new method
5856 2000-04-18 Juergen Vigna <jug@sad.it>
5858 * src/CutAndPaste.C: made textclass a static member of the class
5859 as otherwise it is not accesed right!!!
5861 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
5863 * forms/layout_forms.fd
5864 * src/layout_forms.h
5865 * src/layout_forms.C (create_form_form_character)
5866 * src/lyx_cb.C (UserFreeFont)
5867 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
5868 documents (in the layout->character popup).
5870 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5872 * src/spellchecker.C (create_ispell_pipe): fix a bug where
5873 \spell_command was in fact not honored (from Kevin Atkinson).
5875 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
5878 * src/lyx_gui.h: make lyxViews private (Angus)
5880 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
5882 * src/mathed/math_write.C
5883 (MathMatrixInset::Write) Put \protect before \begin{array} and
5884 \end{array} if fragile
5885 (MathParInset::Write): Put \protect before \\ if fragile
5887 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5889 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
5890 initialization if the LyXColorHandler must be done after the
5891 connections to the XServer has been established.
5893 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
5894 get the background pixel from the lyxColorhandler so that the
5895 figures are rendered with the correct background color.
5896 (NextToken): removed functions.
5897 (GetPSSizes): use ifs >> string instead of NextToken.
5899 * src/Painter.[Ch]: the color cache moved out of this file.
5901 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
5904 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5906 * src/WorkArea.C (work_area_handler): call BufferView::enterView
5907 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
5909 * src/BufferView.C (enterView): new func
5910 (leaveView): new func
5912 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
5914 (leaveView): new func, undefines xterm cursor when approp.
5916 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
5917 (AllowInput): delete the Workarea cursor handling from this func.
5919 * src/Painter.C (underline): draw a slimer underline in most cases.
5921 * src/lyx_main.C (error_handler): use extern "C"
5923 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5925 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
5926 sent directly to me.
5928 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
5929 to the list by Dekel.
5931 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
5934 * src/bufferview_funcs.[Ch]: two new files, moved several of the
5935 methods from lyx_cb.here.
5937 * src/lyx_cb.C: in addition to the above; removed input_prohibited
5940 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5942 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
5943 instead of using current_view directly.
5945 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
5947 * src/LyXAction.C (init): add the paragraph-spacing command.
5949 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
5951 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
5953 * src/lyx_cb.C (CurrentState): output a string when the spacing is
5954 different from the documents.
5956 * src/text.C (SetHeightOfRow): take paragraph spacing into
5957 account, paragraph spacing takes precedence over buffer spacing
5958 (GetVisibleRow): ditto
5960 * src/paragraph.C (writeFile): output the spacing parameter too.
5961 (validate): set the correct features if spacing is used in the
5963 (Clear): set spacing to default
5964 (MakeSameLayout): spacing too
5965 (HasSameLayout): spacing too
5966 (SetLayout): spacing too
5967 (TeXOnePar): output the spacing commands
5969 * src/lyxparagraph.h: added a spacing variable for use with
5970 per-paragraph spacing.
5972 * src/Spacing.h: add a Default spacing and a method to check if
5973 the current spacing is default. also added an operator==
5975 * src/text2.C (DeleteEmptyParagraphMechanism): added a
5978 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5980 * src/lyxserver.C (callback): fix dispatch of functions
5982 * src/insets/insetlatexaccent.C (checkContents): turn bogus
5983 printf() into lyxerr call.
5985 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
5988 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
5989 "Table" to "Table Box", "Float" to "Floating Material"; deletes
5990 the "Float" from each of the subitems.
5991 (ShowHelpMenu): add entry for "FAQ" and "TOC".
5993 * src/support/DebugStream.h: add an #ifdef to work around a gcc
5994 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
5995 documented the change so that the workaround can be nuked later.
5997 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
6000 * src/lyxlex_pimpl.C (next): do not re-declare the default value
6002 * src/buffer.C (getLatexName): ditto
6003 (setReadonly): ditto
6005 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6007 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
6008 avoid some uses of current_view. Added also a bufferParams()
6009 method to get at this.
6011 * src/lyxtext.h: changed params->buffer and paramters->bparams.
6013 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6015 * src/lyxparagraph.[Ch]: removed
6016 operator<(LyXParagraph::InsetTable..., added a struct matchIT
6017 with operators used by lower_bound and
6018 upper_bound in InsetTable's
6019 Make struct InsetTable private again. Used matchpos.
6021 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
6023 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
6024 document, the language of existing text is changed (unless the
6025 document is multi-lingual)
6027 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
6029 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
6031 * A lot of files: A rewrite of the Right-to-Left support.
6033 2000-04-10 Juergen Vigna <jug@sad.it>
6035 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
6036 misplaced cursor when inset in inset is locked.
6038 * src/insets/insettext.C (LocalDispatch): small fix so that a
6039 BREAKLINE is not inserted if we don't permit it with autBreakRows.
6041 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
6042 footnote font should be decreased in size twice when displaying.
6044 * src/insets/insettext.C (GetDrawFont): inserted this function as
6045 the drawing-font may differ from the real paragraph font.
6047 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
6048 insets (inset in inset!).
6050 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
6051 function here because we don't want footnotes inside footnotes.
6053 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
6055 (init): now set the inset_owner in paragraph.C
6056 (LocalDispatch): added some resetPos() in the right position
6059 (pasteSelection): changed to use the new CutAndPaste-Class.
6061 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
6062 which tells if it is allowed to insert another inset inside this one.
6064 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
6065 SwitchLayoutsBetweenClasses.
6067 * src/text2.C (InsertInset): checking of the new paragraph-function
6069 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
6070 is not needed anymore here!
6073 (PasteSelection): redone (also with #ifdef) so that now this uses
6074 the CutAndPaste-Class.
6075 (SwitchLayoutsBetweenClasses): removed here and implemented in the
6078 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
6079 from/to text/insets.
6081 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
6082 so that the paragraph knows if it is inside an (text)-inset.
6083 (InsertFromMinibuffer): changed return-value to bool as now it
6084 may happen that an inset is not inserted in the paragraph.
6085 (InsertInsetAllowed): this checks if it is allowed to insert an
6086 inset in this paragraph.
6088 (BreakParagraphConservative):
6089 (BreakParagraph) : small change for the above change of the return
6090 value of InsertFromMinibuffer.
6092 * src/lyxparagraph.h: added inset_owner and the functions to handle
6093 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
6095 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6097 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
6098 functions from BufferView to BufferView::Pimpl to ease maintence.
6100 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
6101 correctly. Also use SetCursorIntern instead of SetCursor.
6103 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
6106 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6108 * src/WorkArea.C (belowMouse): manually implement below mouse.
6110 * src/*: Add "explicit" on several constructors, I added probably
6111 some unneeded ones. A couple of changes to code because of this.
6113 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
6114 implementation and private parts from the users of BufferView. Not
6117 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
6118 implementation and private parts from the users of LyXLex. Not
6121 * src/BufferView_pimpl.[Ch]: new files
6123 * src/lyxlex_pimpl.[Ch]: new files
6125 * src/LyXView.[Ch]: some inline functions move out-of-line
6127 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6129 * src/lyxparagraph.h: make struct InsetTable public.
6131 * src/support/lyxstring.h: change lyxstring::difference_type to be
6132 ptrdiff_t. Add std:: modifiers to streams.
6134 * src/font.C: include the <cctype> header, for islower() and
6137 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6139 * src/font.[Ch]: new files. Contains the metric functions for
6140 fonts, takes a LyXFont as parameter. Better separation of concepts.
6142 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
6143 changes because of this.
6145 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
6147 * src/*: compile with -Winline and move functions that don't
6150 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
6153 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6155 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
6156 (various files changed because of this)
6158 * src/Painter.C (text): fixed the drawing of smallcaps.
6160 * src/lyxfont.[Ch] (drawText): removed unused member func.
6163 * src/*.C: added needed "using" statements and "std::" qualifiers.
6165 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6167 * src/*.h: removed all use of "using" from header files use
6168 qualifier std:: instead.
6170 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6172 * src/text.C (Backspace): some additional cleanups (we already
6173 know whether cursor.pos is 0 or not).
6175 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
6176 automake does not provide one).
6178 * src/bmtable.h: replace C++ comments with C comments.
6180 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
6182 * src/screen.C (ShowCursor): Change the shape of the cursor if
6183 the current language is not equal to the language of the document.
6184 (If the cursor change its shape unexpectedly, then you've found a bug)
6186 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
6189 * src/insets/insetnumber.[Ch]: New files.
6191 * src/LyXAction.C (init)
6192 * src/lyxfunc.C (dispatch): Add command number-inset-insert
6195 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
6197 * src/lyxparagraph.h
6198 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
6199 (the vector is kept sorted).
6201 * src/text.C (GetVisibleRow): Draw selection correctly when there
6202 is both LTR and RTL text.
6204 * src/paragraph.C (Clone): Use the assignment operator for cloning,
6205 which is much faster.
6207 * src/text.C (GetVisibleRow and other): Do not draw the last space
6208 in a row if the direction of the last letter is not equal to the
6209 direction of the paragraph.
6211 * src/lyxfont.C (latexWriteStartChanges):
6212 Check that font language is not equal to basefont language.
6213 (latexWriteEndChanges): ditto
6215 * src/lyx_cb.C (StyleReset): Don't change the language while using
6216 the font-default command.
6218 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
6219 empty paragraph before a footnote.
6221 * src/insets/insetcommand.C (draw): Increase x correctly.
6223 * src/screen.C (ShowCursor): Change cursor shape if
6224 current language != document language.
6226 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
6228 2000-03-31 Juergen Vigna <jug@sad.it>
6230 * src/paragraph.C (GetInset): commented out text[pos] = ' '
6231 (Clone): changed mode how the paragraph-data is copied to the
6232 new clone-paragraph.
6234 * src/lyxfunc.C (Dispatch): fixed small problem when calling
6235 GetInset(pos) with no inset anymore there (in inset UNDO)
6237 * src/insets/insetcommand.C (draw): small fix as here x is
6238 incremented not as much as width() returns (2 before, 2 behind = 4)
6240 2000-03-30 Juergen Vigna <jug@sad.it>
6242 * src/insets/insettext.C (InsetText): small fix in initialize
6243 widthOffset (should not be done in the init() function)
6245 2000-03-29 Amir Karger <karger@lyx.org>
6247 * lib/examples/it_ItemizeBullets.lyx: translation by
6250 * Implemented \textasciitilde and fixed a tiny bug in reLyX
6252 2000-03-29 Juergen Vigna <jug@sad.it>
6254 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
6256 * src/insets/insetfoot.C (Clone): small change as for the below
6257 new init function in the text-inset
6259 * src/insets/insettext.C (init): new function as I've seen that
6260 clone did not copy the Paragraph-Data!
6261 (LocalDispatch): Added code so that now we have some sort of Undo
6262 functionality (well actually we HAVE Undo ;)
6264 * src/text.C (Backspace): Small fix for the a | a Backspace problem
6266 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
6268 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
6271 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6273 * src/main.C: added a runtime check that verifies that the xforms
6274 header used when building LyX and the library used when running
6275 LyX match. Exit with a message if they don't match. This is a
6276 version number check only.
6278 * src/buffer.C (save): Don't allocate memory on the heap for
6279 struct utimbuf times.
6281 * *: some using changes, use iosfwd instead of the real headers.
6283 * src/lyxfont.C use char const * instead of string for the static
6284 strings. Rewrite some functions to use sstream.
6286 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6288 * src/text.C (Backspace): hopefully fix the dreaded backaspace
6291 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6293 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
6294 of Geodesy (from Martin Vermeer)
6296 * lib/layouts/svjour.inc: include file for the Springer svjour
6297 class. It can be used to support journals other than JoG.
6299 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
6300 Miskiewicz <misiek@pld.org.pl>)
6301 * lib/reLyX/Makefile.am: ditto.
6303 2000-03-27 Juergen Vigna <jug@sad.it>
6305 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
6306 also some modifications with operations on selected text.
6308 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
6309 problems with clicking on insets (last famous words ;)
6311 * src/insets/insetcommand.C (draw):
6312 (width): Changed to have a bit of space before and after the inset so
6313 that the blinking cursor can be seen (otherwise it was hidden)
6315 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6317 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
6318 would not be added to the link list when an installed gettext (not
6319 part of libc) is found.
6321 2000-03-24 Juergen Vigna <jug@sad.it>
6323 * src/insets/insetcollapsable.C (Edit):
6324 * src/mathed/formula.C (InsetButtonRelease):
6325 (InsetButtonPress): fixed for new handling of ButtonPress/Release
6328 * src/BufferView.C (workAreaButtonPress):
6329 (workAreaButtonRelease):
6330 (checkInsetHit): Finally fixed the clicking on insets be handled
6333 * src/insets/insetert.C (Edit): inserted this call so that ERT
6334 insets work always with LaTeX-font
6336 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6338 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
6339 caused lyx to startup with no GUI in place, causing in a crash
6340 upon startup when called with arguments.
6342 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6344 * src/FontLoader.C: better initialization of dummyXFontStruct.
6346 2000-03-20 José Abílio Matos <jamatos@lyx.org>
6348 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
6349 for linuxdoc and docbook import and export format options.
6351 * lib/lyxrc.example Example of default values for the previous flags.
6353 * src/lyx_cb.C Use those flags instead of the hardwired values for
6354 linuxdoc and docbook export.
6356 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
6359 * src/menus.C Added menus entries for the new import/exports formats.
6361 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6363 * src/lyxrc.*: Added support for running without Gui
6366 * src/FontLoader.C: sensible defaults if no fonts are needed
6368 * src/lyx_cb.C: New function ShowMessage (writes either to the
6369 minibuffer or cout in case of no gui
6370 New function AskOverwrite for common stuff
6371 Consequently various changes to call these functions
6373 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
6374 wild guess at sensible screen resolution when having no gui
6376 * src/lyxfont.C: no gui, no fonts... set some defaults
6378 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6380 * src/LColor.C: made the command inset background a bit lighter.
6382 2000-03-20 Hartmut Goebel <goebel@noris.net>
6384 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
6385 stdstruct.inc. Koma-Script added some title elements which
6386 otherwise have been listed below "bibliography". This split allows
6387 adding title elements to where they belong.
6389 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
6390 define the additional tilte elements and then include
6393 * many other layout files: changed to include stdtitle.inc just
6394 before stdstruct.inc.
6396 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
6398 * src/buffer.C: (save) Added the option to store all backup files
6399 in a single directory
6401 * src/lyxrc.[Ch]: Added variable \backupdir_path
6403 * lib/lyxrc.example: Added descriptions of recently added variables
6405 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
6406 bibtex inset, not closing the bibtex popup when deleting the inset)
6408 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6410 * src/lyx_cb.C: add a couple using directives.
6412 2000-03-17 José Abílio Matos <jamatos@lyx.org>
6413 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
6414 import based on the filename.
6416 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
6417 file would be imported at start, if the filename where of a sgml file.
6419 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
6421 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
6423 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
6424 * src/lyxfont.h Replaced the member variable bits.direction by the
6425 member variable lang. Made many changes in other files.
6426 This allows having a multi-lingual document
6428 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
6429 that change the current language to <l>.
6430 Removed the command "font-rtl"
6432 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
6433 format for Hebrew documents)
6435 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
6436 When auto_mathmode is "true", pressing a digit key in normal mode
6437 will cause entering into mathmode.
6438 If auto_mathmode is "rtl" then this behavior will be active only
6439 when writing right-to-left text.
6441 * src/text2.C (InsertStringA) The string is inserted using the
6444 * src/paragraph.C (GetEndLabel) Gives a correct result for
6445 footnote paragraphs.
6447 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
6449 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6451 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
6452 front of PasteParagraph. Never insert a ' '. This should at least
6453 fix some cause for the segfaults that we have been experiencing,
6454 it also fixes backspace behaviour slightly. (Phu!)
6456 * src/support/lstrings.C (compare_no_case): some change to make it
6457 compile with gcc 2.95.2 and stdlibc++-v3
6459 * src/text2.C (MeltFootnoteEnvironment): change type o
6460 first_footnote_par_is_not_empty to bool.
6462 * src/lyxparagraph.h: make text private. Changes in other files
6464 (fitToSize): new function
6465 (setContentsFromPar): new function
6466 (clearContents): new function
6467 (SetChar): new function
6469 * src/paragraph.C (readSimpleWholeFile): deleted.
6471 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
6472 the file, just use a simple string instead. Also read the file in
6473 a more maintainable manner.
6475 * src/text2.C (InsertStringA): deleted.
6476 (InsertStringB): deleted.
6478 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6480 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
6481 RedoParagraphs from the doublespace handling part, just set status
6482 to NEED_MORE_REFRESH. Also don't update cursor position (should be
6483 done, but perhaps not like this.)
6485 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6487 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
6488 character when inserting an inset.
6490 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6492 * src/bufferparams.C (readLanguage): now takes "default" into
6495 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
6496 also initialize the toplevel_keymap with the default bindings from
6499 * src/buffer.C (Buffer): remove lyxrc from the parameters.
6501 * all files using lyxrc: have lyxrc as a real variable and not a
6502 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
6505 * src/lyxrc.C: remove double call to defaultKeyBindings
6507 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
6508 toolbar defauls using lyxlex. Remove enums, structs, functions
6511 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
6512 toolbar defaults. Also store default keybindings in a map.
6514 * src/ToolbarDefaults.[Ch]: New file. This class is used for
6515 storing the toolbar defaults without any xforms dependencies.
6517 * src/insets/figinset.C: patch posted to list by Andre Poenitz
6518 applied. Changed to use iterators.
6520 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
6522 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
6523 systems that don't have LINGUAS set to begin with.
6525 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6527 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
6528 the list by Dekel Tsur.
6530 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6532 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
6533 * src/insets/form_graphics.C: ditto.
6535 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
6537 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6539 * src/bufferparams.C (readLanguage): use the new language map
6541 * src/intl.C (InitKeyMapper): use the new language map
6543 * src/lyx_gui.C (create_forms): use the new language map
6545 * src/language.[Ch]: New files. Used for holding the information
6546 about each language. Now! Use this new language map enhance it and
6547 make it really usable for our needs.
6549 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
6551 * screen.C (ShowCursor): Removed duplicate code.
6552 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
6553 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
6555 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
6558 * src/text.C Added TransformChar method. Used for rendering Arabic
6559 text correctly (change the glyphs of the letter according to the
6560 position in the word)
6565 * src/lyxrc.C Added lyxrc command {language_command_begin,
6566 language_command_end,language_command_ltr,language_command_rtl,
6567 language_package} which allows the use of either arabtex or Omega
6570 * src/lyx_gui.C (init)
6572 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
6573 to use encoding for menu fonts which is different than the encoding
6576 * src/buffer.C (makeLaTeXFile): If params.language = "default",
6577 do not load the babel package.
6578 To write an English document with Hebrew/Arabic, change the document
6579 language to "english".
6581 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
6582 (alphaCounter): changed to return char
6583 (loweralphaCounter, hebrewCounter, romanCounter): New functions
6585 * lib/lyxrc.example Added examples for Hebrew/Arabic
6588 * src/layout.C Added layout command endlabeltype
6590 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
6592 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
6594 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6596 * src/mathed/math_delim.C (search_deco): return a
6597 math_deco_struct* instead of index.
6599 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6601 * All files with a USE_OSTREAM_ONLY within: removed all code that
6602 was unused when USE_OSTREAM_ONLY is defined.
6604 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
6605 of any less. Removed header and using.
6607 * src/text.C (GetVisibleRow): draw the string "Page Break
6608 (top/bottom)" on screen when drawing a pagebreak line.
6610 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6612 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
6614 * src/mathed/math_macro.C (draw): do some cast magic.
6617 * src/mathed/math_defs.h: change byte* argument to byte const*.
6619 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
6621 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
6622 know it is right to return InsetFoot* too, but cxx does not like
6625 * src/insets/insetcollapsable.[Ch] (Clone): make const.
6627 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
6629 * src/mathed/math_delim.C: change == to proper assignment.
6631 2000-03-09 Juergen Vigna <jug@sad.it>
6633 * src/insets/insettext.C (setPos): fixed various cursor positioning
6634 problems (via mouse and cursor-keys)
6635 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
6636 inset (still a small display problem but it works ;)
6638 * src/insets/insetcollapsable.C (draw): added button_top_y and
6639 button_bottom_y to have correct values for clicking on the inset.
6641 * src/support/lyxalgo.h: commented out 'using std::less'
6643 2000-03-08 Juergen Vigna <jug@sad.it>
6645 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
6646 Button-Release event closes as it is alos the Release-Event
6649 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
6651 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6653 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
6654 can add multiple spaces in Scrap (literate programming) styles...
6655 which, by the way, is how I got hooked on LyX to begin with.
6657 * src/mathed/formula.C (Write): Added dummy variable to an
6658 inset::Latex() call.
6659 (Latex): Add free_spacing boolean to inset::Latex()
6661 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
6663 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
6664 virtual function to include the free_spacing boolean from
6665 the containing paragraph's style.
6667 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
6668 Added free_spacing boolean arg to match inset.h
6670 * src/insets/insettext.C, src/insets/insettext.h (Latex):
6671 Added free_spacing boolean arg to match inset.h
6673 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
6674 Added free_spacing boolean and made sure that if in a free_spacing
6675 paragraph, that we output normal space if there is a protected space.
6677 * src/insets/insetref.C, src/insets/insetref.h (Latex):
6678 Added free_spacing boolean arg to match inset.h
6680 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
6681 Added free_spacing boolean arg to match inset.h
6683 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
6684 Added free_spacing boolean arg to match inset.h
6686 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
6687 Added free_spacing boolean arg to match inset.h
6689 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
6690 Added free_spacing boolean arg to match inset.h
6692 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
6693 free_spacing boolean arg to match inset.h
6695 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
6696 Added free_spacing boolean arg to match inset.h
6698 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
6699 Added free_spacing boolean arg to match inset.h
6701 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
6702 Added free_spacing boolean arg to match inset.h
6704 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
6705 Added free_spacing boolean arg to match inset.h
6707 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
6708 Added free_spacing boolean arg to match inset.h
6710 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
6711 free_spacing boolean arg to match inset.h
6713 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
6714 free_spacing boolean arg to match inset.h
6716 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
6717 ignore free_spacing paragraphs. The user's spaces are left
6720 * src/text.C (InsertChar): Fixed the free_spacing layout
6721 attribute behavior. Now, if free_spacing is set, you can
6722 add multiple spaces in a paragraph with impunity (and they
6723 get output verbatim).
6724 (SelectSelectedWord): Added dummy argument to inset::Latex()
6727 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
6730 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
6731 paragraph layouts now only input a simple space instead.
6732 Special character insets don't make any sense in free-spacing
6735 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
6736 hard-spaces in the *input* file to simple spaces if the layout
6737 is free-spacing. This converts old files which had to have
6738 hard-spaces in free-spacing layouts where a simple space was
6740 (writeFileAscii): Added free_spacing check to pass to the newly
6741 reworked inset::Latex(...) methods. The inset::Latex() code
6742 ensures that hard-spaces in free-spacing paragraphs get output
6743 as spaces (rather than "~").
6745 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6747 * src/mathed/math_delim.C (draw): draw the empty placeholder
6748 delims with a onoffdash line.
6749 (struct math_deco_compare): struct that holds the "functors" used
6750 for the sort and the binary search in math_deco_table.
6751 (class init_deco_table): class used for initial sort of the
6753 (search_deco): use lower_bound to do a binary search in the
6756 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6758 * src/lyxrc.C: a small secret thingie...
6760 * src/lyxlex.C (printTable): changed to take a ostream as paramter
6761 and to not flush the stream as often as it used to.
6763 * src/support/lyxalgo.h: new file
6764 (sorted): template function used for checking if a sequence is
6765 sorted or not. Two versions with and without user supplied
6766 compare. Uses same compare as std::sort.
6768 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
6769 it and give warning on lyxerr.
6771 (struct compare_tags): struct with function operators used for
6772 checking if sorted, sorting and lower_bound.
6773 (search_kw): use lower_bound instead of manually implemented
6776 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6778 * src/insets/insetcollapsable.h: fix Clone() declaration.
6779 * src/insets/insetfoot.h: ditto.
6781 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
6783 2000-03-08 Juergen Vigna <jug@sad.it>
6785 * src/insets/lyxinset.h: added owner call which tells us if
6786 this inset is inside another inset. Changed also the return-type
6787 of Editable to an enum so it tells clearer what the return-value is.
6789 * src/insets/insettext.C (computeTextRows): fixed computing of
6790 textinsets which split automatically on more rows.
6792 * src/insets/insetert.[Ch]: changed this to be of BaseType
6795 * src/insets/insetfoot.[Ch]: added footnote inset
6797 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
6798 collapsable insets (like footnote, ert, ...)
6800 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6802 * src/lyxdraw.h: remvoe file
6804 * src/lyxdraw.C: remove file
6806 * src/insets/insettext.C: added <algorithm>.
6808 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6810 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
6811 (matrix_cb): case MM_OK use string stream
6813 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
6816 * src/mathed/math_macro.C (draw): use string stream
6817 (Metrics): use string stream
6819 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
6820 directly to the ostream.
6822 * src/vspace.C (asString): use string stream.
6823 (asString): use string stream
6824 (asLatexString): use string stream
6826 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
6827 setting Spacing::Other.
6829 * src/LaTeXFeatures.C (getPackages): use string stream instead of
6830 sprintf when creating the stretch vale.
6832 * src/text2.C (alphaCounter): changed to return a string and to
6833 not use a static variable internally. Also fixed a one-off bug.
6834 (SetCounter): changed the drawing of the labels to use string
6835 streams instead of sprintf.
6837 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
6838 manipulator to use a scheme that does not require library support.
6839 This is also the way it is done in the new GNU libstdc++. Should
6840 work with DEC cxx now.
6842 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6844 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
6845 end. This fixes a bug.
6847 * src/mathed (all files concerned with file writing): apply the
6848 USE_OSTREAM_ONLY changes to mathed too.
6850 * src/support/DebugStream.h: make the constructor explicit.
6852 * src/lyxfont.C (latexWriteStartChanges): small bug related to
6853 count and ostream squashed.
6855 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6857 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
6859 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
6860 ostringstream uses STL strings, and we might not.
6862 * src/insets/insetspecialchar.C: add using directive.
6863 * src/insets/insettext.C: ditto.
6865 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6867 * lib/layouts/seminar.layout: feeble attempt at a layout for
6868 seminar.cls, far from completet and could really use some looking
6869 at from people used to write layout files.
6871 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
6872 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
6873 a lot nicer and works nicely with ostreams.
6875 * src/mathed/formula.C (draw): a slightly different solution that
6876 the one posted to the list, but I think this one works too. (font
6877 size wrong in headers.)
6879 * src/insets/insettext.C (computeTextRows): some fiddling on
6880 Jürgens turf, added some comments that he should read.
6882 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
6883 used and it gave compiler warnings.
6884 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
6887 * src/lyx_gui.C (create_forms): do the right thing when
6888 show_banner is true/false.
6890 * src/lyx_cb.C (TimerCB): no need to close or do anything if
6891 show_banner is false.
6893 * most file writing files: Now use iostreams to do almost all of
6894 the writing. Also instead of passing string &, we now use
6895 stringstreams. mathed output is still not adapted to iostreams.
6896 This change can be turned off by commenting out all the occurences
6897 of the "#define USE_OSTREAM_ONLY 1" lines.
6899 * src/WorkArea.C (createPixmap): don't output debug messages.
6900 (WorkArea): don't output debug messages.
6902 * lib/lyxrc.example: added a comment about the new variable
6905 * development/Code_rules/Rules: Added some more commente about how
6906 to build class interfaces and on how better encapsulation can be
6909 2000-03-03 Juergen Vigna <jug@sad.it>
6911 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
6912 automatically with the width of the LyX-Window
6914 * src/insets/insettext.C (computeTextRows): fixed update bug in
6915 displaying text-insets (scrollvalues where not initialized!)
6917 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6919 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
6920 id in the check of the result from lower_bound is not enough since
6921 lower_bound can return last too, and then res->id will not be a
6924 * all insets and some code that use them: I have conditionalized
6925 removed the Latex(string & out, ...) this means that only the
6926 Latex(ostream &, ...) will be used. This is a work in progress to
6927 move towards using streams for all output of files.
6929 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
6932 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6934 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
6935 routine (this fixes bug where greek letters were surrounded by too
6938 * src/support/filetools.C (findtexfile): change a bit the search
6939 algorithm, to fix bug introduced in 1.1.4. Note that --format is
6940 no longer passed to kpsewhich, we may have to change that later.
6942 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
6943 warning options to avoid problems with X header files (from Angus
6945 * acinclude.m4: regenerated.
6947 2000-03-02 Juergen Vigna <jug@sad.it>
6949 * src/insets/insettext.C (WriteParagraphData): Using the
6950 par->writeFile() function for writing paragraph-data.
6951 (Read): Using buffer->parseSingleLyXformat2Token()-function
6952 for parsing paragraph data!
6954 * src/buffer.C (readLyXformat2): removed all parse data and using
6955 the new parseSingleLyXformat2Token()-function.
6956 (parseSingleLyXformat2Token): added this function to parse (read)
6957 lyx-file-format (this is called also from text-insets now!)
6959 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6961 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
6964 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
6965 directly instead of going through a func. One very bad thing: a
6966 static LyXFindReplace, but I don't know where to place it.
6968 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
6969 string instead of char[]. Also changed to static.
6970 (GetSelectionOrWordAtCursor): changed to static inline
6971 (SetSelectionOverLenChars): ditto.
6973 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
6974 current_view and global variables. both classes has changed names
6975 and LyXFindReplace is not inherited from SearchForm.
6977 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
6978 fl_form_search form.
6980 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
6982 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6984 * lib/bind/*.bind: make sure 'buffer-previous' function is not
6985 bound (from Kayvan).
6987 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
6989 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
6991 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6993 * some things that I should comment but the local pub says head to
6996 * comment out all code that belongs to the Roff code for Ascii
6997 export of tables. (this is unused)
6999 * src/LyXView.C: use correct type for global variable
7000 current_layout. (LyXTextClass::size_type)
7002 * some code to get the new insetgraphics closer to working I'd be
7003 grateful for any help.
7005 * src/BufferView2.C (insertInset): use the return type of
7006 NumberOfLayout properly. (also changes in other files)
7008 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
7009 this as a test. I want to know what breaks because of this.
7011 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
7013 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7015 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
7016 to use a \makebox in the label, this allows proper justification
7017 with out using protected spaces or multiple hfills. Now it is
7018 "label" for left justified, "\hfill label\hfill" for center, and
7019 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
7020 should be changed accordingly.
7022 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7024 * src/lyxtext.h: change SetLayout() to take a
7025 LyXTextClass::size_type instead of a char (when there is more than
7026 127 layouts in a class); also change type of copylayouttype.
7027 * src/text2.C (SetLayout): ditto.
7028 * src/LyXView.C (updateLayoutChoice): ditto.
7030 * src/LaTeX.C (scanLogFile): errors where the line number was not
7031 given just after the '!'-line were ignored (from Dekel Tsur).
7033 * lib/lyxrc.example: fix description of \date_insert_format
7035 * lib/layouts/llncs.layout: new layout, contributed by Martin
7038 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7040 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
7041 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
7042 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
7043 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
7044 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
7045 paragraph.C, text.C, text2.C)
7047 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7049 * src/insets/insettext.C (LocalDispatch): remove extra break
7052 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
7053 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
7055 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
7056 * src/insets/insettext.[Ch] (GetCursorPos): ditto
7058 * src/insets/insetbib.h: move InsetBibkey::Holder and
7059 InsetCitation::Holder in public space.
7061 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7063 * src/insets/insettext.h: small change to get the new files from
7064 Juergen to compile (use "string", not "class string").
7066 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
7067 const & as parameter to LocalDispatch, use LyXFont const & as
7068 paramter to some other func. This also had impacto on lyxinsets.h
7069 and the two mathed insets.
7071 2000-02-24 Juergen Vigna <jug@sad.it>
7074 * src/commandtags.h:
7076 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
7080 * src/BufferView2.C: added/updated code for various inset-functions
7082 * src/insets/insetert.[Ch]: added implementation of InsetERT
7084 * src/insets/insettext.[Ch]: added implementation of InsetText
7086 * src/insets/inset.C (Edit): added "unsigned int button" parameter
7087 (draw): added preliminary code for inset scrolling not finshed yet
7089 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
7090 as it is in lyxfunc.C now
7092 * src/insets/lyxinset.h: Added functions for text-insets
7094 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7096 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
7097 BufferView and reimplement the list as a queue put inside its own
7100 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
7102 * several files: use the new interface to the "updateinsetlist"
7104 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
7106 (work_area_handler): call BufferView::trippleClick on trippleclick.
7108 * src/BufferView.C (doubleClick): new function, selects word on
7110 (trippleClick): new function, selects line on trippleclick.
7112 2000-02-22 Allan Rae <rae@lyx.org>
7114 * lib/bind/xemacs.bind: buffer-previous not supported
7116 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7118 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
7121 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7123 * src/bufferlist.C: get rid of current_view from this file
7125 * src/spellchecker.C: get rid of current_view from this file
7127 * src/vspace.C: get rid of current_view from this file
7128 (inPixels): added BufferView parameter for this func
7129 (asLatexCommand): added a BufferParams for this func
7131 * src/text.C src/text2.C: get rid of current_view from these
7134 * src/lyxfont.C (getFontDirection): move this function here from
7137 * src/bufferparams.C (getDocumentDirection): move this function
7140 * src/paragraph.C (getParDirection): move this function here from
7142 (getLetterDirection): ditto
7144 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
7146 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
7147 resize due to wrong pixmap beeing used. Also took the opurtunity
7148 to make the LyXScreen stateless on regard to WorkArea and some
7149 general cleanup in the same files.
7151 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7153 * src/Makefile.am: add missing direction.h
7155 * src/PainterBase.h: made the width functions const.
7157 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
7160 * src/insets/insetcommand.C (draw): draw Editable as buttons.
7162 * src/insets/insetlatexaccent.C (draw): make the accents draw
7163 better, at present this will only work well with iso8859-1.
7165 * several files: remove the old drawing code, now we use the new
7168 * several files: remove support for mono_video, reverse_video and
7171 2000-02-17 Juergen Vigna <jug@sad.it>
7173 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
7174 int ** as we have to return the pointer, otherwise we have only
7175 NULL pointers in the returning function.
7177 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7179 * src/LaTeX.C (operator()): quote file name when running latex.
7181 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7183 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
7184 (bubble tip), this removes our special handling of this.
7186 * Remove all code that is unused now that we have the new
7187 workarea. (Code that are not active when NEW_WA is defined.)
7189 * Make the uses of XSync not conditionalized on define USE_XSYNC.
7191 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7193 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
7194 nonexisting layout; correctly redirect obsoleted layouts.
7196 * lib/lyxrc.example: document \view_dvi_paper_option
7198 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
7201 * src/lyx_cb.C (RunScript): handle $$FName for command names.
7202 (PreviewDVI): handle the view_dvi_paper_option variable.
7203 [Both from Roland Krause]
7205 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7207 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
7208 char const *, int, LyXFont)
7209 (text(int, int, string, LyXFont)): ditto
7211 * src/text.C (InsertCharInTable): attempt to fix the double-space
7212 feature in tables too.
7213 (BackspaceInTable): ditto.
7214 (GetVisibleRow): make bottom pagebreak line be a onoff line.
7216 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7218 * src/text2.C (owner): only complain if owner_ is set and bv != 0
7220 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
7221 newly found text in textcache to this.
7222 (buffer): set the owner of the text put into the textcache to 0
7224 * src/insets/figinset.C (draw): fixed the drawing of figures with
7227 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
7228 drawing of mathframe, hfills, protected space, table lines. I have
7229 now no outstanding drawing problems with the new Painter code.
7231 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7233 * src/PainterBase.C (ellipse, circle): do not specify the default
7236 * src/LColor.h: add using directive.
7238 * src/Painter.[Ch]: change return type of methods from Painter& to
7239 PainterBase&. Add a using directive.
7241 * src/WorkArea.C: wrap xforms callbacks in C functions
7244 * lib/layouts/foils.layout: font fix and simplifications from Carl
7247 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7249 * a lot of files: The Painter, LColor and WorkArea from the old
7250 devel branch has been ported to lyx-devel. Some new files and a
7251 lot of #ifdeffed code. The new workarea is enabled by default, but
7252 if you want to test the new Painter and LColor you have to compile
7253 with USE_PAINTER defined (do this in config.h f.ex.) There are
7254 still some rought edges, and I'd like some help to clear those
7255 out. It looks stable (loads and displays the Userguide very well).
7258 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7260 * src/buffer.C (pop_tag): revert to the previous implementation
7261 (use a global variable for both loops).
7263 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
7265 * src/lyxrc.C (LyXRC): change slightly default date format.
7267 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
7268 there is an English text with a footnote that starts with a Hebrew
7269 paragraph, or vice versa.
7270 (TeXFootnote): ditto.
7272 * src/text.C (LeftMargin): allow for negative values for
7273 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
7276 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
7277 for input encoding (cyrillic)
7279 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7281 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
7284 * src/toolbar.C (set): ditto
7285 * src/insets/insetbib.C (create_form_citation_form): ditto
7287 * lib/CREDITS: added Dekel Tsur.
7289 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
7290 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
7291 hebrew supports files from Dekel Tsur.
7293 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
7294 <tzafrir@technion.ac.il>
7296 * src/lyxrc.C: put \date_insert_format at the right place.
7298 * src/buffer.C (makeLaTeXFile): fix the handling of
7299 BufferParams::sides when writing out latex files.
7301 * src/BufferView2.C: add a "using" directive.
7303 * src/support/lyxsum.C (sum): when we use lyxstring,
7304 ostringstream::str needs an additional .c_str().
7306 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7308 * src/support/filetools.C (ChangeExtension): patch from Etienne
7311 * src/TextCache.C (show): remove const_cast and make second
7312 parameter non-const LyXText *.
7314 * src/TextCache.h: use non const LyXText in show.
7316 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
7319 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7321 * src/support/lyxsum.C: rework to be more flexible.
7323 * several places: don't check if a pointer is 0 if you are going
7326 * src/text.C: remove some dead code.
7328 * src/insets/figinset.C: remove some dead code
7330 * src/buffer.C: move the BufferView funcs to BufferView2.C
7331 remove all support for insetlatexdel
7332 remove support for oldpapersize stuff
7333 made some member funcs const
7335 * src/kbmap.C: use a std::list to store the bindings in.
7337 * src/BufferView2.C: new file
7339 * src/kbsequence.[Ch]: new files
7341 * src/LyXAction.C + others: remove all trace of buffer-previous
7343 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
7344 only have one copy in the binary of this table.
7346 * hebrew patch: moved some functions from LyXText to more
7347 appropriate places. (LyXParagraph, BufferParams, LyXFont)
7349 * several files: remove support for XForms older than 0.88
7351 remove some #if 0 #endif code
7353 * src/TextCache.[Ch]: new file. Holds the textcache.
7355 * src/BufferView.C: changes to use the new TextCache interface.
7356 (waitForX): remove the now unused code.
7358 * src/BackStack.h: remove some commented code
7360 * lib/bind/emacs.bind: remove binding for buffer-previous
7362 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7364 * applied the hebrew patch.
7366 * src/lyxrow.h: make sure that all Row variables are initialized.
7368 * src/text2.C (TextHandleUndo): comment out a delete, this might
7369 introduce a memory leak, but should also help us to not try to
7370 read freed memory. We need to look at this one.
7372 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
7373 (LyXParagraph): initalize footnotekind.
7375 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
7376 forgot this when applying the patch. Please heed the warnings.
7378 * src/BufferView.C (buffer): a fix for the buffer-reload problem
7379 (aka. reformat problem)
7381 * src/bufferlist.C (exists): made const, and use const_iterator
7382 (isLoaded): new func.
7383 (release): use std::find to find the correct buffer.
7385 * src/bufferlist.h: made getState a const func.
7386 made empty a const func.
7387 made exists a const func.
7390 2000-02-01 Juergen Vigna <jug@sad.it>
7392 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
7394 * po/it.po: updated a bit the italian po file and also changed the
7395 'file nuovo' for newfile to 'filenuovo' without a space, this did
7398 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
7399 for the new insert_date command.
7401 * src/lyxfunc.C (Dispatch): added support for a insert_date function
7402 from jdblair, to insert a date into the current text conforming to
7403 a strftime format (for now only considering the locale-set and not
7404 the document-language).
7406 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7408 * src/lyxfont.C (textWidth): hopefully better fix for the Array
7409 Bounds Read error seen by purify. The problem was that islower is
7410 a macros which takes an unsigned char and uses it as an index for
7411 in array of characters properties (and is thus subject to the
7415 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
7416 correctly the paper sides radio buttons.
7417 (UpdateDocumentButtons): ditto.
7419 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7421 * src/kbmap.C (getsym + others): change to return unsigned int,
7422 returning a long can give problems on 64 bit systems. (I assume
7423 that int is 32bit on 64bit systems)
7425 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7427 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
7428 LyXLookupString to be zero-terminated. Really fixes problems seen
7431 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7433 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
7434 write a (char*)0 to the lyxerr stream.
7436 * src/lastfiles.C: move algorithm before the using statemets.
7438 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7440 * src/lastfiles.C: move using directives in global scope (egcs 1.x
7441 complains otherwise).
7442 * src/table.C: ditto
7444 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
7447 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
7448 that I removed earlier... It is really needed.
7450 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
7452 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7454 * INSTALL: update xforms home page URL.
7456 * lib/configure.m4: fix a bug with unreadable layout files.
7458 * src/table.C (calculate_width_of_column): add "using std::max"
7461 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7463 * several files: marked several lines with "DEL LINE", this is
7464 lines that can be deleted without changing anything.
7465 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
7466 checks this anyway */
7469 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
7471 * src/DepTable.C (update): add a "+" at the end when the checksum
7472 is different. (debugging string only)
7474 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
7475 the next inset to not be displayed. This should also fix the list
7476 of labels in the "Insert Crossreference" dialog.
7478 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7480 * src/support/LSubstring.C (LSubstring): set pos to string::npos
7481 when regex was not found.
7483 * src/support/lstrings.C (lowercase): use handcoded transform always.
7486 * src/text.C (Delete): fixed the crash. cursor.par->prev and
7487 old_cursor.par->prev could be 0.
7489 * several files: changed post inc/dec to pre inc/dec
7491 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
7492 write the lastfiles to file.
7494 * src/BufferView.C (buffer): only show TextCache info when debugging
7496 (resizeCurrentBuffer): ditto
7497 (workAreaExpose): ditto
7499 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
7501 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
7503 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
7504 a bit better by removing the special case for \i and \j.
7506 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7508 * src/lyx_main.C (easyParse): remove test for bad comand line
7509 options, since this broke all xforms-related parsing.
7511 * src/kbmap.C (getsym): set return type to unsigned long, as
7512 declared in header. On an alpha, long is _not_ the same as int.
7514 * src/support/LOstream.h: add a "using std::flush;"
7516 * src/insets/figinset.C: ditto.
7518 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7520 * src/bufferlist.C (write): use blinding fast file copy instead of
7521 "a char at a time", now we are doing it the C++ way.
7523 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
7524 std::list<int> instead.
7525 (addpidwait): reflect move to std::list<int>
7526 (sigchldchecker): ditto
7528 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
7531 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
7532 that obviously was wrong...
7534 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
7535 c, this avoids warnings with purify and islower.
7537 * src/insets/figinset.C: rename struct queue to struct
7538 queue_element and rewrite to use a std::queue. gsqueue is now a
7539 std::queue<queue_element>
7540 (runqueue): reflect move to std::queue
7543 * src/support/lstrings.h (tostr): specialize for bool, otherwise
7544 we would get "1" "0" instead of "true" "false. Also make the tostr
7547 2000-01-21 Juergen Vigna <jug@sad.it>
7549 * src/buffer.C (writeFileAscii): Disabled code for special groff
7550 handling of tabulars till I fix this in table.C
7552 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7554 * src/support/mkdir.C (mkdir): change second argument of mkdir to
7556 * src/support/lyxlib.h: ditto.
7558 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7560 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
7561 and 'j' look better. This might fix the "macron" bug that has been
7564 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
7565 functions as one template function. Delete the old versions.
7567 * src/support/lyxsum.C: move using std::ifstream inside
7570 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
7573 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
7575 * src/mathed/formula.C: delete #include "bufferlist.h" never used
7577 * src/insets/figinset.C (InitFigures): use new instead of malloc
7578 to allocate memory for figures and bitmaps.
7579 (DoneFigures): use delete[] instead of free to deallocate memory
7580 for figures and bitmaps.
7581 (runqueue): use new to allocate
7582 (getfigdata): use new/delete[] instead of malloc/free
7583 (RegisterFigure): ditto
7585 * some files: moved some declarations closer to first use, small
7586 whitespace changes use preincrement instead of postincrement where
7587 it does not make a difference.
7589 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
7590 step on the way to use stl::containers for key maps.
7592 * src/bufferlist.h: add a typedef for const_iterator and const
7593 versions of begin and end.
7595 * src/bufferlist.[Ch]: change name of member variable _state to
7596 state_. (avoid reserved names)
7598 (getFileNames): returns the filenames of the buffers in a vector.
7600 * configure.in (ALL_LINGUAS): added ro
7602 * src/support/putenv.C: new file
7604 * src/support/mkdir.C: new file
7606 2000-01-20 Allan Rae <rae@lyx.org>
7608 * lib/layouts/IEEEtran.layout: Added several theorem environments
7610 * lib/templates/IEEEtran.lyx: Example theorem environments and a
7611 couple of minor additions.
7613 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
7614 (except for those in footnotes of course)
7616 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7618 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
7620 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
7621 std::sort and std::lower_bound instead of qsort and handwritten
7623 (struct compara): struct that holds the functors used by std::sort
7624 and std::lower_bound in MathedLookupBOP.
7626 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7628 * src/support/LAssert.h: do not do partial specialization. We do
7631 * src/support/lyxlib.h: note that lyx::getUserName() and
7632 lyx::date() are not in use right now. Should these be suppressed?
7634 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
7635 (makeLinuxDocFile): do not put date and user name in linuxdoc
7638 * src/support/lyxlib.h (kill): change first argument to long int,
7639 since that's what solaris uses.
7641 * src/support/kill.C (kill): fix declaration to match prototype.
7643 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
7644 actually check whether namespaces are supported. This is not what
7647 * src/support/lyxsum.C: add a using directive.
7649 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7651 * src/support/kill.C: if we have namespace support we don't have
7652 to include lyxlib.h.
7654 * src/support/lyxlib.h: use namespace lyx if supported.
7656 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7658 * src/support/date.C: new file
7660 * src/support/chdir.C: new file
7662 * src/support/getUserName.C: new file
7664 * src/support/getcwd.C: new file
7666 * src/support/abort.C: new file
7668 * src/support/kill.C: new file
7670 * src/support/lyxlib.h: moved all the functions in this file
7671 insede struct lyx. Added also kill and abort to this struct. This
7672 is a way to avoid the "kill is not defined in <csignal>", we make
7673 C++ wrappers for functions that are not ANSI C or ANSI C++.
7675 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
7676 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
7677 lyx it has been renamed to sum.
7679 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7681 * src/text.C: add using directives for std::min and std::max.
7683 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7685 * src/texrow.C (getIdFromRow): actually return something useful in
7686 id and pos. Hopefully fixes the bug with positionning of errorbox
7689 * src/lyx_main.C (easyParse): output an error and exit if an
7690 incorrect command line option has been given.
7692 * src/spellchecker.C (ispell_check_word): document a memory leak.
7694 * src/bufferlist.C (write): fix mismatched allocation/deletion,
7695 where a "struct utimbuf" is allocated with "new" and deleted with
7698 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
7700 * src/text2.C (CutSelection): don't delete double spaces.
7701 (PasteSelection): ditto
7702 (CopySelection): ditto
7704 * src/text.C (Backspace): don't delete double spaces.
7706 * src/lyxlex.C (next): fix a bug that were only present with
7707 conformant std::istream::get to read comment lines, use
7708 std::istream::getline instead. This seems to fix the problem.
7710 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7712 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
7713 allowed to insert space before space" editing problem. Please read
7714 commends at the beginning of the function. Comments about usage
7717 * src/text.C (InsertChar): fix for the "not allowed to insert
7718 space before space" editing problem.
7720 * src/text2.C (DeleteEmptyParagraphMechanism): when
7721 IsEmptyTableRow can only return false this last "else if" will
7722 always be a no-op. Commented out.
7724 * src/text.C (RedoParagraph): As far as I can understand tmp
7725 cursor is not really needed.
7727 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
7728 present it could only return false anyway.
7729 (several functions): Did something not so smart...added a const
7730 specifier on a lot of methods.
7732 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
7733 and add a tmp->text.resize. The LyXParagraph constructor does the
7735 (BreakParagraphConservative): ditto
7737 * src/support/path.h (Path): add a define so that the wrong usage
7738 "Path("/tmp") will be flagged as a compilation error:
7739 "`unnamed_Path' undeclared (first use this function)"
7741 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7743 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
7744 which was bogus for several reasons.
7746 * src/LaTeX.C (scanAux): fix the regular expression used to scan
7750 * autogen.sh: do not use "type -path" (what's that anyway?).
7752 * src/support/filetools.C (findtexfile): remove extraneous space
7753 which caused a kpsewhich warning (at least with kpathsea version
7756 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7758 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
7760 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
7762 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
7764 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7766 * src/paragraph.C (BreakParagraph): do not reserve space on text
7767 if we don't need to (otherwise, if pos_end < pos, we end up
7768 reserving huge amounts of memory due to bad unsigned karma).
7769 (BreakParagraphConservative): ditto, although I have not seen
7770 evidence the bug can happen here.
7772 * src/lyxparagraph.h: add a using std::list.
7774 2000-01-11 Juergen Vigna <jug@sad.it>
7776 * src/menus.C (MenuDocu): output an Alert if the documentation-file
7779 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7781 * src/vc-backend.C (doVCCommand): change to be static and take one
7782 more parameter: the path to chdir too be fore executing the command.
7783 (retrive): new function equiv to "co -r"
7785 * src/bufferlist.C (loadLyXFile): implement the missing parts if
7786 file_not_found_hook is true.
7788 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
7790 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
7791 if a file is readwrite,readonly...anything else.
7793 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7795 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
7796 (CreatePostscript): name change from MenuRunDVIPS (or something)
7797 (PreviewPostscript): name change from MenuPreviewPS
7798 (PreviewDVI): name change from MenuPreviewDVI
7800 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
7801 \view_pdf_command., \pdf_to_ps_command
7803 * lib/configure.m4: added search for PDF viewer, and search for
7804 PDF to PS converter.
7805 (lyxrc.defaults output): add \pdflatex_command,
7806 \view_pdf_command and \pdf_to_ps_command.
7808 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
7810 * src/bufferlist.C (write): we don't use blocksize for anything so
7813 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7815 * src/support/block.h: disable operator T* (), since it causes
7816 problems with both compilers I tried. See comments in the file.
7818 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
7821 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
7822 variable LYX_DIR_10x to LYX_DIR_11x.
7824 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
7826 * INSTALL: document --with-lyxname.
7829 * configure.in: new configure flag --with-lyxname which allows to
7830 choose the name under which lyx is installed. Default is "lyx", of
7831 course. It used to be possible to do this with --program-suffix,
7832 but the later has in fact a different meaning for autoconf.
7834 * src/support/lstrings.h (lstrchr): reformat a bit.
7836 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
7837 * src/mathed/math_defs.h: ditto.
7839 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7841 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
7842 true, decides if we create a backup file or not when saving. New
7843 tag and variable \pdf_mode, defaults to false. New tag and
7844 variable \pdflatex_command, defaults to pdflatex. New tag and
7845 variable \view_pdf_command, defaults to xpdf. New tag and variable
7846 \pdf_to_ps_command, defaults to pdf2ps.
7848 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7850 * src/bufferlist.C (close): don't call insetUnlock if the buffer
7851 does not have a BufferView.
7852 (unlockInset): ditto + don't access the_locking_inset if the
7853 buffer does not have a BufferView.
7855 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
7856 certain circumstances so that we don't continue a keyboard
7857 operation long after the key was released. Try f.ex. to load a
7858 large document, press PageDown for some seconds and then release
7859 it. Before this change the document would contine to scroll for
7860 some time, with this change it stops imidiatly.
7862 * src/support/block.h: don't allocate more space than needed. As
7863 long as we don't try to write to the arr[x] in a array_type arr[x]
7864 it is perfectly ok. (if you write to it you might segfault).
7865 added operator value_type*() so that is possible to pass the array
7866 to functions expecting a C-pointer.
7868 * lib/Makefile.am (dist-hook): don't fail completely if unable to
7871 * intl/*: updated to gettext 0.10.35, tried to add our own
7872 required modifications. Please verify.
7874 * po/*: updated to gettext 0.10.35, tried to add our own required
7875 modifications. Please verify.
7877 * src/support/lstrings.C (tostr): go at fixing the problem with
7878 cxx and stringstream. When stringstream is used return
7879 oss.str().c_str() so that problems with lyxstring and basic_string
7880 are avoided. Note that the best solution would be for cxx to use
7881 basic_string all the way, but it is not conformant yet. (it seems)
7883 * src/lyx_cb.C + other files: moved several global functions to
7884 class BufferView, some have been moved to BufferView.[Ch] others
7885 are still located in lyx_cb.C. Code changes because of this. (part
7886 of "get rid of current_view project".)
7888 * src/buffer.C + other files: moved several Buffer functions to
7889 class BufferView, the functions are still present in buffer.C.
7890 Code changes because of this.
7892 * config/lcmessage.m4: updated to most recent. used when creating
7895 * config/progtest.m4: updated to most recent. used when creating
7898 * config/gettext.m4: updated to most recent. applied patch for
7901 * config/gettext.m4.patch: new file that shows what changes we
7902 have done to the local copy of gettext.m4.
7904 * config/libtool.m4: new file, used in creation of acinclude.m4
7906 * config/lyxinclude.m4: new file, this is the lyx created m4
7907 macros, used in making acinclude.m4.
7909 * autogen.sh: GNU m4 discovered as a separate task not as part of
7910 the lib/configure creation.
7911 Generate acinlucde from files in config. Actually cat
7912 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
7913 easier to upgrade .m4 files that really are external.
7915 * src/Spacing.h: moved using std::istringstream to right after
7916 <sstream>. This should fix the problem seen with some compilers.
7918 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7920 * src/lyx_cb.C: began some work to remove the dependency a lot of
7921 functions have on BufferView::text, even if not really needed.
7922 (GetCurrentTextClass): removed this func, it only hid the
7925 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
7926 forgot this in last commit.
7928 * src/Bullet.C (bulletEntry): use static char const *[] for the
7929 tables, becuase of this the return arg had to change to string.
7931 (~Bullet): removed unneeded destructor
7933 * src/BufferView.C (beforeChange): moved from lyx_cb.C
7934 (insetSleep): moved from Buffer
7935 (insetWakeup): moved from Buffer
7936 (insetUnlock): moved from Buffer
7938 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
7939 from Buffer to BufferView.
7941 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
7943 * config/ltmain.sh: updated to version 1.3.4 of libtool
7945 * config/ltconfig: updated to version 1.3.4 of libtool
7947 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7950 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
7951 Did I get that right?
7953 * src/lyxlex.h: add a "using" directive or two.
7954 * src/Spacing.h: ditto.
7955 * src/insets/figinset.C: ditto.
7956 * src/support/filetools.C: ditto.
7957 * src/support/lstrings.C: ditto.
7958 * src/BufferView.C: ditto.
7959 * src/bufferlist.C: ditto.
7960 * src/lyx_cb.C: ditto.
7961 * src/lyxlex.C: ditto.
7963 * NEWS: add some changes for 1.1.4.
7965 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7967 * src/BufferView.C: first go at a TextCache to speed up switching
7970 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7972 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
7973 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
7974 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
7975 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
7978 * src/mathed/math_defs.h (MathedRowSt): make sure that all
7979 members of the struct are correctly initialized to 0 (detected by
7981 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
7982 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
7984 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
7985 pidwait, since it was allocated with "new". This was potentially
7986 very bad. Thanks to Michael Schmitt for running purify for us.
7989 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7991 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
7993 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
7995 1999-12-30 Allan Rae <rae@lyx.org>
7997 * lib/templates/IEEEtran.lyx: minor change
7999 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
8000 src/mathed/formula.C (LocalDispatch): askForText changes
8002 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
8003 know when a user has cancelled input. Fixes annoying problems with
8004 inserting labels and version control.
8006 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8008 * src/support/lstrings.C (tostr): rewritten to use strstream and
8011 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8013 * src/support/filetools.C (IsFileWriteable): use fstream to check
8014 (IsDirWriteable): use fileinfo to check
8016 * src/support/filetools.h (FilePtr): whole class deleted
8018 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
8020 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
8022 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
8024 * src/bufferlist.C (write): use ifstream and ofstream instead of
8027 * src/Spacing.h: use istrstream instead of sscanf
8029 * src/mathed/math_defs.h: change first arg to istream from FILE*
8031 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
8033 * src/mathed/math_parser.C: have yyis to be an istream
8034 (LexGetArg): use istream (yyis)
8036 (mathed_parse): ditto
8037 (mathed_parser_file): first arg istream instead of FILE*, set yyis
8039 * src/mathed/formula.C (Read): rewritten to use istream
8041 * src/mathed/formulamacro.C (Read): rewritten to use istream
8043 * src/lyxlex.h (~LyXLex): deleted desturctor
8044 (getStream): new function, returns an istream
8045 (getFile): deleted funtion
8046 (IsOK): return is.good();
8048 * src/lyxlex.C (LyXLex): delete file and owns_file
8049 (setFile): open an filebuf and assign that to a istream instead of
8051 (setStream): new function, takes an istream as arg.
8052 (setFile): deleted function
8053 (EatLine): rewritten us use istream instead of FILE*
8057 * src/table.C (LyXTable): use istream instead of FILE*
8058 (Read): rewritten to take an istream instead of FILE*
8060 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8062 * src/buffer.C (Dispatch): remove an extraneous break statement.
8064 * src/support/filetools.C (QuoteName): change to do simple
8065 'quoting'. More work is necessary. Also changed to do nothing
8066 under emx (needs fix too).
8067 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
8069 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
8070 config.h.in to the AC_DEFINE_UNQUOTED() call.
8071 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
8072 needs char * as argument (because Solaris 7 declares it like
8075 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
8076 remove definition of BZERO.
8078 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8080 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
8081 defined, "lyxregex.h" if not.
8083 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
8085 (REGEX): new variable that is set to regex.c lyxregex.h when
8086 AM_CONDITIONAL USE_REGEX is set.
8087 (libsupport_la_SOURCES): add $(REGEX)
8089 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
8092 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
8095 * configure.in: add call to LYX_REGEX
8097 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
8098 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
8100 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8102 * lib/bind/fi_menus.bind: new file, from
8103 pauli.virtanen@saunalahti.fi.
8105 * src/buffer.C (getBibkeyList): pass the parameter delim to
8106 InsetInclude::getKeys and InsetBibtex::getKeys.
8108 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
8109 is passed to Buffer::getBibkeyList
8111 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
8112 instead of the hardcoded comma.
8114 * src/insets/insetbib.C (getKeys): make sure that there are not
8115 leading blanks in bibtex keys. Normal latex does not care, but
8116 harvard.sty seems to dislike blanks at the beginning of citation
8117 keys. In particular, the retturn value of the function is
8119 * INSTALL: make it clear that libstdc++ is needed and that gcc
8120 2.7.x probably does not work.
8122 * src/support/filetools.C (findtexfile): make debug message go to
8124 * src/insets/insetbib.C (getKeys): ditto
8126 * src/debug.C (showTags): make sure that the output is correctly
8129 * configure.in: add a comment for TWO_COLOR_ICON define.
8131 * acconfig.h: remove all the entries that already defined in
8132 configure.in or acinclude.m4.
8134 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
8135 to avoid user name, date and copyright.
8137 1999-12-21 Juergen Vigna <jug@sad.it>
8139 * src/table.C (Read): Now read bogus row format informations
8140 if the format is < 5 so that afterwards the table can
8141 be read by lyx but without any format-info. Fixed the
8142 crash we experienced when not doing this.
8144 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8146 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
8147 (RedoDrawingOfParagraph): ditto
8148 (RedoParagraphs): ditto
8149 (RemoveTableRow): ditto
8151 * src/text.C (Fill): rename arg paperwidth -> paper_width
8153 * src/buffer.C (insertLyXFile): rename var filename -> fname
8154 (writeFile): rename arg filename -> fname
8155 (writeFileAscii): ditto
8156 (makeLaTeXFile): ditto
8157 (makeLinuxDocFile): ditto
8158 (makeDocBookFile): ditto
8160 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
8163 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
8165 * src/bmtable.h: add extern "C" on this file when __cplusplus is
8168 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
8169 compiled by a C compiler not C++.
8171 * src/layout.h (LyXTextClass): added typedef for const_iterator
8172 (LyXTextClassList): added typedef for const_iterator + member
8173 functions begin and end.
8175 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
8176 iterators to fill the choice_class.
8177 (updateLayoutChoice): rewritten to use iterators to fill the
8178 layoutlist in the toolbar.
8180 * src/BufferView.h (BufferView::work_area_width): removed unused
8183 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
8185 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
8186 (sgmlCloseTag): ditto
8188 * src/support/lstrings.h: return type of countChar changed to
8191 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
8192 what version of this func to use. Also made to return unsigned int.
8194 * configure.in: call LYX_STD_COUNT
8196 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
8197 conforming std::count.
8199 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8201 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
8202 and a subscript would give bad display (patch from Dekel Tsur
8203 <dekel@math.tau.ac.il>).
8205 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
8207 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
8210 * src/chset.h: add a few 'using' directives
8212 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
8213 triggered when no buffer is active
8215 * src/layout.C: removed `break' after `return' in switch(), since
8218 * src/lyx_main.C (init): make sure LyX can be ran in place even
8219 when libtool has done its magic with shared libraries. Fix the
8220 test for the case when the system directory has not been found.
8222 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
8223 name for the latex file.
8224 (MenuMakeHTML): ditto
8226 * src/buffer.h: add an optional boolean argument, which is passed
8229 1999-12-20 Allan Rae <rae@lyx.org>
8231 * lib/templates/IEEEtran.lyx: small correction and update.
8233 * configure.in: Attempted to use LYX_PATH_HEADER
8235 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
8237 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
8238 input from JMarc. Now use preprocessor to find the header.
8239 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
8240 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
8241 LYX_STL_STRING_FWD. See comments in file.
8243 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
8245 * The global MiniBuffer * minibuffer variable is dead.
8247 * The global FD_form_main * fd_form_main variable is dead.
8249 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8251 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
8253 * src/table.h: add the LOstream.h header
8254 * src/debug.h: ditto
8256 * src/LyXAction.h: change the explaination of the ReadOnly
8257 attribute: is indicates that the function _can_ be used.
8259 * src/LyXAction.C (init): find-replace _can_ be used in read-only
8262 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8264 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
8270 * src/paragraph.C (GetWord): assert on pos>=0
8273 * src/support/lyxstring.C: condition the use of an invariant on
8275 * src/support/lyxstring.h: ditto
8277 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
8278 Use LAssert.h instead of plain assert().
8280 * src/support/lstrings.h: add LAssert.h, in case it is needed.
8282 * src/lyxfunc.C: do not include LAssert.h, it is not used.
8283 * src/support/filetools.C: ditto
8285 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
8288 * INSTALL: document the new configure flags
8290 * configure.in: suppress --with-debug; add --enable-assertions
8292 * acinclude.m4: various changes in alignment of help strings.
8294 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8296 * src/kbmap.C: commented out the use of the hash map in kb_map,
8297 beginning of movement to a stl::container.
8299 * several files: removed code that was not in effect when
8300 MOVE_TEXT was defined.
8302 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
8303 for escaping should not be used. We can discuss if the string
8304 should be enclosed in f.ex. [] instead of "".
8306 * src/trans_mgr.C (insert): use the new returned value from
8307 encodeString to get deadkeys and keymaps done correctly.
8309 * src/chset.C (encodeString): changed to return a pair, to tell
8310 what to use if we know the string.
8312 * src/lyxscreen.h (fillArc): new function.
8314 * src/FontInfo.C (resize): rewritten to use more std::string like
8315 structore, especially string::replace.
8317 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
8320 * configure.in (chmod +x some scripts): remove config/gcc-hack
8322 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8324 * src/buffer.C (writeFile): change once again the top comment in a
8325 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
8326 instead of an hardcoded version number.
8327 (makeDocBookFile): ditto
8329 * src/version.h: add new define LYX_DOCVERSION
8331 * po/de.po: update from Pit Sütterlin
8332 * lib/bind/de_menus.bind: ditto.
8334 * src/lyxfunc.C (Dispatch): call MenuExport()
8335 * src/buffer.C (Dispatch): ditto
8337 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
8338 LyXFunc::Dispatch().
8339 (MenuExport): new function, moved from
8340 LyXFunc::Dispatch().
8342 * src/trans_mgr.C (insert): small cleanup
8343 * src/chset.C (loadFile): ditto
8345 * lib/kbd/iso8859-1.cdef: add missing backslashes
8347 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8349 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
8350 help with placing the manually drawn accents better.
8352 (Draw): x2 and hg changed to float to minimize rounding errors and
8353 help place the accents better.
8355 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
8356 unsigned short to char is just wrong...cast the char to unsigned
8357 char instead so that the two values can compare sanely. This
8358 should also make the display of insetlatexaccents better and
8359 perhaps also some other insets.
8361 (lbearing): new function
8364 1999-12-15 Allan Rae <rae@lyx.org>
8366 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
8367 header that provides a wrapper around the very annoying SGI STL header
8370 * src/support/lyxstring.C, src/LString.h:
8371 removed old SGI-STL-compatability attempts.
8373 * configure.in: Use LYX_STL_STRING_FWD.
8375 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
8376 stl_string_fwd.h is around and try to determine it's location.
8377 Major improvement over previous SGI STL 3.2 compatability.
8378 Three small problems remain with this function due to my zero
8379 knowledge of autoconf. JMarc and lgb see the comments in the code.
8381 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8383 * src/broken_const.h, config/hack-gcc, config/README: removed
8385 * configure.in: remove --with-gcc-hack option; do not call
8388 * INSTALL: remove documentation of --with-broken-const and
8391 * acconfig.h: remove all trace of BROKEN_CONST define
8393 * src/buffer.C (makeDocBookFile): update version number in output
8395 (SimpleDocBookOnePar): fix an assert when trying to a character
8396 access beyond string length
8399 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8401 * po/de.po: fix the Export menu
8403 * lyx.man: update the description of -dbg
8405 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
8406 (commandLineHelp): updated
8407 (easyParse): show list of available debug levels if -dbg is passed
8410 * src/Makefile.am: add debug.C
8412 * src/debug.h: moved some code to debug.C
8414 * src/debug.C: new file. Contains code to set and show debug
8417 * src/layout.C: remove 'break' after 'continue' in switch
8418 statements, since these cannot be reached.
8420 1999-12-13 Allan Rae <rae@lyx.org>
8422 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
8423 (in_word_set): hash() -> math_hash()
8425 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
8427 * acconfig.h: Added a test for whether we are using exceptions in the
8428 current compilation run. If so USING_EXCEPTIONS is defined.
8430 * config.in: Check for existance of stl_string_fwd.h
8431 * src/LString.h: If compiling --with-included-string and SGI's
8432 STL version 3.2 is present (see above test) we need to block their
8433 forward declaration of string and supply a __get_c_string().
8434 However, it turns out this is only necessary if compiling with
8435 exceptions enabled so I've a bit more to add yet.
8437 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
8438 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
8439 src/support/LRegex.h, src/undo.h:
8440 Shuffle the order of the included files a little to ensure that
8441 LString.h gets included before anything that includes stl_string_fwd.h
8443 * src/support/lyxstring.C: We need to #include LString.h instead of
8444 lyxstring.h to get the necessary definition of __get_c_string.
8445 (__get_c_string): New function. This is defined static just like SGI's
8446 although why they need to do this I'm not sure. Perhaps it should be
8447 in lstrings.C instead.
8449 * lib/templates/IEEEtran.lyx: New template file.
8451 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8453 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
8454 * intl/Makefile.in (MKINSTALLDIRS): ditto
8456 * src/LyXAction.C (init): changed to hold the LFUN data in a
8457 automatic array in stead of in callso to newFunc, this speeds up
8458 compilation a lot. Also all the memory used by the array is
8459 returned when the init is completed.
8461 * a lot of files: compiled with -Wold-style-cast, changed most of
8462 the reported offenders to C++ style casts. Did not change the
8463 offenders in C files.
8465 * src/trans.h (Match): change argument type to unsigned int.
8467 * src/support/DebugStream.C: fix some types on the streambufs so
8468 that it works on a conforming implementation.
8470 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8472 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
8474 * src/support/lyxstring.C: remove the inline added earlier since
8475 they cause a bunch of unsatisfied symbols when linking with dec
8476 cxx. Cxx likes to have the body of inlines at the place where they
8479 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
8480 accessing negative bounds in array. This fixes the crash when
8481 inserting accented characters.
8482 * src/trans.h (Match): ditto
8484 * src/buffer.C (Dispatch): since this is a void, it should not try
8485 to return anything...
8487 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8489 * src/buffer.h: removed the two friends from Buffer. Some changes
8490 because of this. Buffer::getFileName and Buffer::setFileName
8491 renamed to Buffer::fileName() and Buffer::fileName(...).
8493 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8495 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
8496 and Buffer::update(short) to BufferView. This move is currently
8497 controlled by a define MOVE_TEXT, this will be removed when all
8498 shows to be ok. This move paves the way for better separation
8499 between buffer contents and buffer view. One side effect is that
8500 the BufferView needs a rebreak when swiching buffers, if we want
8501 to avoid this we can add a cache that holds pointers to LyXText's
8502 that is not currently in use.
8504 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
8507 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8509 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
8511 * lyx_main.C: new command line option -x (or --execute) and
8512 -e (or --export). Now direct conversion from .lyx to .tex
8513 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
8514 Unfortunately, X is still needed and the GUI pops up during the
8517 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8519 * src/Spacing.C: add a using directive to bring stream stuff into
8521 * src/paragraph.C: ditto
8522 * src/buffer.C: ditto
8524 * NEWS: updated a bit the new features of 1.1.3 (took a few things
8525 from Lars' announcement).
8527 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
8528 example files from Tino Meinen.
8530 1999-12-06 Allan Rae <rae@lyx.org>
8532 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
8534 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8536 * src/support/lyxstring.C: added a lot of inline for no good
8539 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
8540 latexWriteEndChanges, they were not used.
8542 * src/layout.h (operator<<): output operator for PageSides
8544 * src/mathed/math_iter.C (my_memcpy): slightly changed.
8546 * some example files: loaded in LyX 1.0.4 and saved again to update
8547 certain constructs (table format)
8549 * a lot of files: did the change to use fstream/iostream for all
8550 writing of files. Done with a close look at Andre Poenitz's patch.
8552 * some files: whitespace changes.
8554 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8556 * src/mathed/math_iter.C (my_memcpy): new function. Since the
8557 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
8558 architecture, we provide our own. It is used unconditionnally, but
8559 I do not think this is a performance problem. Thanks to Angus
8560 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
8561 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
8563 (GetInset): use my_memcpy.
8567 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
8568 it is easier to understand, but it uses less TeX-only constructs now.
8570 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
8571 elements contain spaces
8573 * lib/configure: regenerated
8575 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
8576 elements contain spaces; display the list of programs that are
8579 * autogen.sh: make sure lib/configure is executable
8581 * lib/examples/*: rename the tutorial examples to begin with the
8582 two-letters language code.
8584 * src/lyxfunc.C (getStatus): do not query current font if no
8587 * src/lyx_cb.C (RunScript): use QuoteName
8588 (MenuRunDvips): ditto
8589 (PrintApplyCB): ditto
8591 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
8592 around argument, so that it works well with the current shell.
8593 Does not work properly with OS/2 shells currently.
8595 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
8596 * src/LyXSendto.C (SendtoApplyCB): ditto
8597 * src/lyxfunc.C (Dispatch): ditto
8598 * src/buffer.C (runLaTeX): ditto
8599 (runLiterate): ditto
8600 (buildProgram): ditto
8602 * src/lyx_cb.C (RunScript): ditto
8603 (MenuMakeLaTeX): ditto
8605 * src/buffer.h (getLatexName): new method
8607 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
8609 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8611 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
8612 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
8613 (create_math_panel): ditto
8615 * src/lyxfunc.C (getStatus): re-activate the code which gets
8616 current font and cursor; add test for export to html.
8618 * src/lyxrc.C (read): remove unreachable break statements; add a
8621 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
8623 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8625 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
8626 introduced by faulty regex.
8627 * src/buffer.C: ditto
8628 * src/lastfiles.C: ditto
8629 * src/paragraph.C: ditto
8630 * src/table.C: ditto
8631 * src/vspace.C: ditto
8632 * src/insets/figinset.C: ditto
8633 Note: most of these is absolutely harmless, except the one in
8634 src/mathed formula.C.
8636 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8638 * src/ImportNoweb.C (documentclass): fixed bounds for substr
8639 operation, yielding correct results for the reLyX command.
8641 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8643 * src/support/filetools.C (ExpandPath): removed an over eager
8645 (ReplaceEnvironmentPath): ditto
8647 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
8648 shows that we are doing something fishy in our code...
8652 * src/lyxrc.C (read): use a double switch trick to get more help
8653 from the compiler. (the same trick is used in layout.C)
8654 (write): new function. opens a ofstream and pass that to output
8655 (output): new function, takes a ostream and writes the lyxrc
8656 elemts to it. uses a dummy switch to make sure no elements are
8659 * src/lyxlex.h: added a struct pushpophelper for use in functions
8660 with more than one exit point.
8662 * src/lyxlex.[Ch] (GetInteger): made it const
8666 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
8668 * src/layout.[hC] : LayoutTags splitted into several enums, new
8669 methods created, better error handling cleaner use of lyxlex. Read
8672 * src/bmtable.[Ch]: change some member prototypes because of the
8673 image const changes.
8675 * commandtags.h, src/LyXAction.C (init): new function:
8676 "preferences-save", saves the lyxrc entries into .lyx/preferences.
8677 This file is not read automatically but you can add \input
8678 preferences to your lyxrc if you want to. We need to discuss how
8681 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
8682 in .aux, also remove .bib and .bst files from dependencies when
8685 * src/BufferView.C, src/LyXView.C: add const_cast several places
8686 because of changes to images.
8688 * lib/images/*: same change as for images/*
8690 * lib/lyxrc.example: Default for accept_compound is false not no.
8692 * images/*: changed to be const, however I have som misgivings
8693 about this change so it might be changed back.
8695 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8697 * lib/configure, po/POTFILES.in: regenerated
8699 * autogen.sh: autogenerate lib/configure from lib/configure.m4
8701 * config/lib_configure.m4: removed
8703 * lib/configure.m4: new file (was config/lib_configure.m4)
8705 * configure.in: do not test for rtti, since we do not use it.
8707 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8709 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
8710 doubling of allocated space scheme. This makes it faster for large
8711 strings end to use less memory for small strings. xtra rememoved.
8713 * src/insets/figinset.C (waitalarm): commented out.
8714 (GhostscriptMsg): use static_cast
8715 (GhostscriptMsg): use new instead of malloc to allocate memory for
8716 cmap. also delete the memory after use.
8718 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
8720 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
8721 for changes in bibtex database or style.
8722 (runBibTeX): remove all .bib and .bst files from dep before we
8724 (run): use scanAuc in when dep file already exist.
8726 * src/DepTable.C (remove_files_with_extension): new method
8729 * src/DepTable.[Ch]: made many of the methods const.
8731 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8733 * src/bufferparams.C: make sure that the default textclass is
8734 "article". It used to be the first one by description order, but
8735 now the first one is "docbook".
8737 * src/lyx_main.C (setDebuggingLevel): change type of argument to
8738 string; call Debug::value.
8739 (easyParse): pass complete argument to setDebuggingLevel().
8741 * src/debug.h (value): fix the code that parses debug levels.
8743 * src/debug.h: add new debug type ACTION, reserved for LyXAction
8746 * src/LyXAction.C: use Debug::ACTION as debug channel.
8748 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
8750 * NEWS: updated for the future 1.1.3 release.
8752 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
8753 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
8754 it should. This is of course a controversial change (since many
8755 people will find that their lyx workscreen is suddenly full of
8756 red), but done for the sake of correctness.
8758 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
8759 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
8761 * src/insets/inseterror.h, src/insets/inseturl.h,
8762 src/insets/insetinfo.h, src/insets/figinset.h,
8763 src/mathed/formulamacro.h, src/mathed/math_macro.h
8764 (EditMessage): add a missing const and add _() to make sure that
8767 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
8768 src/insets/insetbib.C, src/support/filetools.C: add `using'
8771 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
8772 doing 'Insert index of last word' at the beginning of a paragraph.
8774 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8776 * several files: white-space changes.
8778 * src/mathed/formula.C: removed IsAlpha and IsDigit
8780 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
8781 .bib file. use a ifstream instead of FilePtr when parsing the .bib
8784 * src/insets/figinset.C (GetPSSizes): don't break when
8785 "EndComments" is seen. But break when a boundingbox is read.
8787 * all classes inherited from Inset: return value of Clone
8788 changed back to Inset *.
8790 * all classes inherited form MathInset: return value of Clone
8791 changed back to MathedInset *.
8793 * src/insets/figinset.C (runqueue): use a ofstream to output the
8794 gs/ps file. Might need some setpresicion or setw. However I can
8795 see no problem with the current code.
8796 (runqueue): use sleep instead of the alarm/signal code. I just
8797 can't see the difference.
8799 * src/paragraph.C (LyXParagraph): reserve space in the new
8800 paragraph and resize the inserted paragraph to just fit.
8802 * src/lyxfunc.h (operator|=): added operator for func_status.
8804 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
8805 check for readable file.
8807 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
8808 check for readable file.
8809 (MenuMakeLinuxDoc): ditto
8810 (MenuMakeDocBook): ditto
8811 (MenuMakeAscii): ditto
8812 (InsertAsciiFile): split the test for openable and readable
8814 * src/bmtable.C (draw_bitmaptable): use
8815 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
8817 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
8818 findtexfile from LaTeX to filetools.
8820 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
8821 instead of FilePtr. Needs to be verified by a literate user.
8823 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8825 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
8826 (EditMessage): likewise.
8828 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
8829 respectively as \textasciitilde and \textasciicircum.
8831 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8833 * src/support/lyxstring.h: made the methods that take iterators
8836 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
8837 (regexMatch): made is use the real regex class.
8839 * src/support/Makefile.am: changed to use libtool
8841 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
8843 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
8845 (MathIsInset ++): changed several macros to be inline functions
8848 * src/mathed/Makefile.am: changed to use libtool
8850 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
8852 * src/insets/inset* : Clone changed to const and return type is
8853 the true insettype not just Inset*.
8855 * src/insets/Makefile.am: changed to use libtool
8857 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
8859 * src/undo.[Ch] : added empty() and changed some of the method
8862 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
8864 * src/lyxparagraph.h: use id() and id(...) instead of getID and
8865 setID use block<> for the bullets array, added const several places.
8867 * src/lyxfunc.C (getStatus): new function
8869 * src/lyxfunc.[Ch] : small changes to take advantage of the new
8870 LyXAction, added const to several funtions.
8872 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
8873 a std::map, and to store the dir items in a vector.
8875 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
8878 * src/LyXView.[Ch] + other files : changed currentView to view.
8880 * src/LyXAction.[Ch] : ported from the old devel branch.
8882 * src/.cvsignore: added .libs and a.out
8884 * configure.in : changes to use libtool.
8886 * acinclude.m4 : inserted libtool.m4
8888 * .cvsignore: added libtool
8890 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8892 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
8893 file name in insets and mathed directories (otherwise the
8894 dependency is not taken in account under cygwin).
8896 * src/text2.C (InsertString[AB]): make sure that we do not try to
8897 read characters past the string length.
8899 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8901 * lib/doc/LaTeXConfig.lyx.in,
8902 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
8904 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
8905 file saying who created them and when this heppened; this is
8906 useless and annoys tools like cvs.
8908 * lib/layouts/g-brief-{en,de}.layout,
8909 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
8910 from Thomas Hartkens <thomas@hartkens.de>.
8912 * src/{insets,mathed}/Makefile.am: do not declare an empty
8913 LDFLAGS, so that it can be set at configure time (useful on Irix
8916 * lib/reLyX/configure.in: make sure that the prefix is set
8917 correctly in LYX_DIR.
8919 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8921 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
8922 be used by 'command-sequence' this allows to bind a key to a
8923 sequence of LyX-commands
8924 (Example: 'command-sequence math-insert alpha; math-insert beta;")
8926 * src/LyXAction.C: add "command-sequence"
8928 * src/LyXFunction.C: handling of "command-sequence"
8930 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
8931 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
8933 * src/lyxserver.C, src/minibuffer.C: Use this new interface
8935 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8937 * src/buffer.C (writeFile): Do not output a comment giving user
8938 and date at the beginning of a .lyx file. This is useless and
8939 annoys cvs anyway; update version number to 1.1.
8941 * src/Makefile.am (LYX_DIR): add this definition, so that a
8942 default path is hardcoded in LyX.
8944 * configure.in: Use LYX_GNU_GETTEXT.
8946 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
8947 AM_GNU_GETTEXT with a bug fixed.
8949 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
8951 * src/chset.C: add "using std::ifstream;" to please dec cxx.
8953 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
8954 which is used to point to LyX data is now LYX_DIR_11x.
8956 * lyx.man: convert to a unix text file; small updates.
8958 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8960 * src/support/LSubstring.[Ch]: made the second arg of most of the
8961 constructors be a const reference.
8963 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
8966 * src/support/lyxstring.[Ch] (swap): added missing member function
8967 and specialization of swap(str, str);
8969 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
8971 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
8972 trace of the old one.
8974 * src/undo.[Ch]: made the undostack use std::list to store undo's in
8975 put the member definitions in undo.C.
8977 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
8978 NEW_TEXT and have now only code that was included when this was
8981 * src/intl.C (LCombo): use static_cast
8983 (DispatchCallback): ditto
8985 * src/definitions.h: removed whole file
8987 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
8989 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
8990 parsing and stores in a std:map. a regex defines the file format.
8991 removed unneeded members.
8993 * src/bufferparams.h: added several enums from definitions.h here.
8994 Removed unsused destructor. Changed some types to use proper enum
8995 types. use block to have the temp_bullets and user_defined_bullets
8996 and to make the whole class assignable.
8998 * src/bufferparams.C (Copy): removed this functions, use a default
9001 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
9004 * src/buffer.C (readLyXformat2): commend out all that have with
9005 oldpapersize to do. also comment out all that hve to do with
9006 insetlatex and insetlatexdel.
9007 (setOldPaperStuff): commented out
9009 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
9011 * src/LyXAction.C: remove use of inset-latex-insert
9013 * src/mathed/math_panel.C (button_cb): use static_cast
9015 * src/insets/Makefile.am (insets_o_SOURCES): removed
9018 * src/support/lyxstring.C (helper): use the unsigned long
9019 specifier, UL, instead of a static_cast.
9021 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
9023 * src/support/block.h: new file. to be used as a c-style array in
9024 classes, so that the class can be assignable.
9026 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9028 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
9029 NULL, make sure to return an empty string (it is not possible to
9030 set a string to NULL).
9032 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9034 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
9036 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
9038 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
9039 link line, so that Irix users (for example) can set it explicitely to
9042 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
9043 it can be overidden at make time (static or dynamic link, for
9046 * src/vc-backend.C, src/LaTeXFeatures.h,
9047 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
9048 statements to bring templates to global namespace.
9050 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9052 * src/support/lyxstring.C (operator[] const): make it standard
9055 * src/minibuffer.C (Init): changed to reflect that more
9056 information is given from the lyxvc and need not be provided here.
9058 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
9060 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
9062 * src/LyXView.C (UpdateTimerCB): use static_cast
9063 (KeyPressMask_raw_callback): ditto
9065 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
9066 buffer_, a lot of changes because of this. currentBuffer() ->
9067 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
9068 also changes to other files because of this.
9070 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9072 * src/vc-backend.[Ch]: new files. The backends for vc handling,
9073 have no support for RCS and partial support for CVS, will be
9076 * src/insets/ several files: changes because of function name
9077 changes in Bufferview and LyXView.
9079 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
9081 * src/support/LSubstring.[Ch]: new files. These implement a
9082 Substring that can be very convenient to use. i.e. is this
9084 string a = "Mary had a little sheep";
9085 Substring(a, "sheep") = "lamb";
9086 a is now "Mary has a little lamb".
9088 * src/support/LRegex.[Ch]: a regex class that can be used to pick
9089 out patterns and subpatterns of strings. It is used by LSubstring
9090 and also by vc-backend.C
9092 * src/support/lyxstring.C: went over all the assertions used and
9093 tried to correct the wrong ones and flag which of them is required
9094 by the standard. some bugs found because of this. Also removed a
9095 couple of assertions.
9097 * src/support/Makefile.am (libsupport_a_SOURCES): added
9098 LSubstring.[Ch] and LRegex.[Ch]
9100 * src/support/FileInfo.h: have struct stat buf as an object and
9101 not a pointer to one, some changes because of this.
9103 * src/LaTeXFeatures.C (getTClassPreamble): also use the
9104 information in layout when adding the layouts preamble to the
9107 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
9110 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
9111 because of bug in OS/2.
9113 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9115 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
9116 \verbatim@font instead of \ttfamily, so that it can be redefined.
9118 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
9119 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
9120 src/layout.h, src/text2.C: add 'using' directive to bring the
9121 STL templates we need from the std:: namespace to the global one.
9122 Needed by DEC cxx in strict ansi mode.
9124 * src/support/LIstream.h,src/support/LOstream.h,
9125 src/support/lyxstring.h,src/table.h,
9126 src/lyxlookup.h: do not include <config.h> in header
9127 files. This should be done in the .C files only.
9129 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
9133 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9135 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
9136 from Kayvan to fix the tth invokation.
9138 * development/lyx.spec.in: updates from Kayvan to reflect the
9139 changes of file names.
9141 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9143 * src/text2.C (InsertStringB): use std::copy
9144 (InsertStringA): use std::copy
9146 * src/bufferlist.C: use a vector to store the buffers in. This is
9147 an internal change and should not affect any other thing.
9149 * src/BufferView.C (waitForX): use XSync instead of the lengthy
9152 * src/text.C (Fill): fix potential bug, one off bug.
9154 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9156 * src/Makefile.am (lyx_main.o): add more files it depends on.
9158 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
9160 * src/support/lyxstring.C: use size_t for the reference count,
9161 size, reserved memory and xtra.
9162 (internal_compare): new private member function. Now the compare
9163 functions should work for std::strings that have embedded '\0'
9165 (compare): all compare functions rewritten to use
9168 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9170 * src/support/lyxstring.C (compare): pass c_str()
9171 (compare): pass c_str
9172 (compare): pass c_str
9174 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9176 * src/support/DebugStream.C: <config.h> was not included correctly.
9178 * lib/configure: forgot to re-generate it :( I'll make this file
9179 auto generated soon.
9181 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9183 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
9186 * src/support/lyxstring.C: some changes from length() to rep->sz.
9187 avoids a function call.
9189 * src/support/filetools.C (SpaceLess): yet another version of the
9190 algorithm...now per Jean-Marc's suggestions.
9192 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9194 * src/layout.C (less_textclass_desc): functor for use in sorting
9196 (LyXTextClass::Read): sort the textclasses after reading.
9198 * src/support/filetools.C (SpaceLess): new version of the
9199 SpaceLess functions. What problems does this one give? Please
9202 * images/banner_bw.xbm: made the arrays unsigned char *
9204 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9206 * src/support/lyxstring.C (find): remove bogus assertion in the
9207 two versions of find where this has not been done yet.
9209 * src/support/lyxlib.h: add missing int return type to
9212 * src/menus.C (ShowFileMenu): disable exporting to html if no
9213 html export command is present.
9215 * config/lib_configure.m4: add a test for an HTML converter. The
9216 programs checked for are, in this order: tth, latex2html and
9219 * lib/configure: generated from config/lib_configure.m4.
9221 * src/lyxfunc.C (Dispatch): update and improve the execution of an
9222 html converter. The parameters are now passed through $$FName and
9223 $$OutName, instead of standard input/output.
9225 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
9227 * lib/lyxrc.example: update description of \html_command.
9228 add "quotes" around \screen_font_xxx font setting examples to help
9229 people who use fonts with spaces in their names.
9231 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9233 * Distribution files: updates for v1.1.2
9235 * src/support/lyxstring.C (find): remove bogus assert and return
9236 npos for the same condition.
9238 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9240 * added patch for OS/2 from SMiyata.
9242 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9244 * src/text2.C (CutSelection): make space_wrapped a bool
9245 (CutSelection): dont declare int i until we have to.
9246 (alphaCounter): return a char const *.
9248 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9250 * src/support/syscall.C (Systemcalls::kill):
9251 src/support/filetools.C (PutEnv, PutEnvPath):
9252 src/lyx_cb.C (addNewlineAndDepth):
9253 src/FontInfo.C (FontInfo::resize): condition some #warning
9254 directives with WITH_WARNINGS.
9257 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9259 * src/layout.[Ch] + several files: access to class variables
9260 limited and made accessor functions instead a lot of code changed
9261 becuase of this. Also instead of returning pointers often a const
9262 reference is returned instead.
9264 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
9266 * src/Makefile.am (dist-hook): added used to remove the CVS from
9267 cheaders upon creating a dist
9268 (EXTRA_DIST): added cheaders
9270 * src/support/lstrings.C (tostr(char)): fix it to handle param as
9271 a character not as a small integer.
9273 * src/support/lyxstring.C (find): removed Assert and added i >=
9274 rep->sz to the first if.
9276 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9278 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
9279 src/LyXView.C src/buffer.C src/bufferparams.C
9280 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
9281 src/text2.C src/insets/insetinclude.C:
9282 lyxlayout renamed to textclasslist.
9284 * src/layout.C: some lyxerr changes.
9286 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
9287 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
9288 (LyXLayoutList): removed all traces of this class.
9289 (LyXTextClass::Read): rewrote LT_STYLE
9290 (LyXTextClass::hasLayout): new function
9291 (LyXTextClass::GetLayout): rewritten to return an iterator + has
9292 both const and nonconst version.
9293 (LyXTextClass::delete_layout): new function.
9294 (LyXTextClassList::Style): bug fix. do the right thing if layout
9296 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
9297 (LyXTextClassList::NameOfLayout): ditto
9298 (LyXTextClassList::Load): ditto
9300 * src/buffer.C (makeLaTeXFile): new access to layoutlist
9302 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
9304 * src/LyXAction.C (LookupFunc): added a workaround for sun
9305 compiler, on the other hand...we don't know if the current code
9306 compiles on sun at all...
9308 * src/support/filetools.C (CleanupPath): subst fix
9310 * src/insets/insetbib.C (delDatabase): subst fix, this looks
9313 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
9314 complained about this one?
9316 * src/insets/insetinclude.C (Latex): subst fix
9318 * src/insets/insetbib.C (getKeys): subst fix
9320 * src/LyXSendto.C (SendtoApplyCB): subst fix
9322 * src/lyx_main.C (init): subst fix
9324 * src/layout.C (Read): subst fix
9326 * src/lyx_sendfax_main.C (button_send): subst fix
9328 * src/buffer.C (RoffAsciiTable): subst fix
9330 * src/lyx_cb.C (MenuFax): subst fix
9331 (PrintApplyCB): subst fix
9333 1999-10-26 Juergen Vigna <jug@sad.it>
9335 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
9337 (Read): Cleaned up this code so now we read only format vestion >= 5
9339 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9341 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
9342 come nobody has complained about this one?
9344 * src/insets/insetinclude.C (Latex): subst fix
9346 * src/insets/insetbib.C (getKeys): subst fix
9348 * src/lyx_main.C (init): subst fix
9350 * src/layout.C (Read): subst fix
9352 * src/buffer.C (RoffAsciiTable): subst fix
9354 * src/lyx_cb.C (MenuFax): subst fix.
9356 * src/layout.[hC] + some other files: rewrote to use
9357 std::container to store textclasses and layouts in.
9358 Simplified, removed a lot of code. Make all classes
9359 assignable. Further simplifications and review of type
9360 use still to be one.
9362 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
9363 lastfiles to create the lastfiles partr of the menu.
9365 * src/lastfiles.[Ch]: rewritten to use deque to store the
9366 lastfiles in. Uses fstream for reading and writing. Simplifies
9369 * src/support/syscall.C: remove explicit cast.
9371 * src/BufferView.C (CursorToggleCB): removed code snippets that
9373 use explicat C++ style casts instead of C style casts. also use
9374 u_vdata instea of passing pointers in longs.
9376 * src/PaperLayout.C: removed code snippets that were commented out.
9378 * src/lyx_gui_misc.C: removed code snippets that were commented out.
9380 * src/lyx_main.C: removed code snippets that wer commented out.
9382 * src/paragraph.C: removed code snippets that were commented out.
9384 * src/lyxvc.C (logClose): use static_cast
9386 (viewLog): remove explicit cast to void*
9387 (showLog): removed old commented code
9389 * src/menus.C: use static_cast instead of C style casts. use
9390 u_vdata instead of u_ldata. remove explicit cast to (long) for
9391 pointers. Removed old code that was commented out.
9393 * src/insets/inset.C: removed old commented func
9395 * src/insets/insetref.C (InsetRef): removed old code that had been
9396 commented out for a long time.
9398 (escape): removed C style cast
9400 * src/insets/insetlatexaccent.C (Draw): removed old commented code
9402 * src/insets/insetlatex.C (Draw): removed old commented code
9403 (Read): rewritten to use string
9405 * src/insets/insetlabel.C (escape): removed C style cast
9407 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
9409 * src/insets/insetindex.C: use static_cast and u_vdata, removed
9412 * src/insets/insetinclude.h: removed a couple of stupid bools
9414 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
9415 (Clone): remove C style cast
9416 (getKeys): changed list to lst because of std::list
9418 * src/insets/inseterror.C (Draw): removed som old commented code.
9420 * src/insets/insetcommand.C (Draw): removed some old commented code.
9422 * src/insets/insetbib.C (bibitem_cb): removed code that has been
9423 commented out forever.
9424 (bibitem_cb): use static_cast instead of C style cast
9425 use of vdata changed to u_vdata.
9427 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
9429 (CloseUrlCB): use static_cast instead of C style cast.
9430 (CloseUrlCB): added a fl_free form...it seemed to be missing.
9432 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
9433 (C_InsetInfo_CloseInfoCB): forward the ob parameter
9434 (CloseInfoCB): static_cast from ob->u_vdata instead.
9435 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
9438 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
9439 (C_InsetError_CloseErrorCB): forward the ob parameter
9440 (CloseErrorCB): static_cast from ob->u_vdata instead.
9442 * src/vspace.h: include LString.h since we use string in this class.
9444 * src/vspace.C (lyx_advance): changed name from advance because of
9445 nameclash with stl. And since we cannot use namespaces yet...I
9446 used a lyx_ prefix instead. Expect this to change when we begin
9449 * src/BufferView.[Ch] (BufferView::~BufferView): removed
9451 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
9452 and removed now defunct constructor and deconstructor.
9454 * src/BufferView.h: have backstack as a object not as a pointer.
9455 removed initialization from constructor. added include for BackStack
9457 * development/lyx.spec.in (%build): add CFLAGS also.
9459 * src/screen.C (drawFrame): removed another warning.
9461 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9463 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
9464 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
9465 README and ANNOUNCE a bit for the next release. More work is
9468 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
9469 unbreakable if we are in freespacing mode (LyX-Code), but not in
9472 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9474 * src/BackStack.h: fixed initialization order in constructor
9476 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
9478 * acinclude.m4 (VERSION): new rules for when a version is
9479 development, added also a variable for prerelease.
9480 (warnings): we set with_warnings=yes for prereleases
9481 (lyx_opt): prereleases compile with same optimization as development
9482 (CXXFLAGS): only use pedantic if we are a development version
9484 * src/BufferView.C (restorePosition): don't do anything if the
9487 * src/BackStack.h: added member empty, use this to test if there
9488 is anything to pop...
9490 1999-10-25 Juergen Vigna <jug@sad.it>
9493 * forms/layout_forms.fd +
9494 * forms/latexoptions.fd +
9495 * lyx.fd: changed for various form resize issues
9497 * src/mathed/math_panel.C +
9498 * src/insets/inseterror.C +
9499 * src/insets/insetinfo.C +
9500 * src/insets/inseturl.C +
9501 * src/insets/inseturl.h +
9504 * src/PaperLayout.C +
9505 * src/ParagraphExtra.C +
9506 * src/TableLayout.C +
9508 * src/layout_forms.C +
9515 * src/menus.C: fixed various resize issues. So now forms can be
9516 resized savely or not be resized at all.
9518 * forms/form_url.fd +
9519 * src/insets/form_url.[Ch]: added because it's cleaner and easier
9522 * src/insets/Makefile.am: added files form_url.[Ch]
9524 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9526 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
9527 (and presumably 6.2).
9529 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
9530 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
9531 remaining static member callbacks.
9533 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
9536 * src/support/lyxstring.h: declare struct Srep as friend of
9537 lyxstring, since DEC cxx complains otherwise.
9539 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9541 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9543 * src/LaTeX.C (run): made run_bibtex also depend on files with
9545 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
9546 are put into the dependency file.
9548 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
9549 the code has shown itself to work
9550 (create_ispell_pipe): removed another warning, added a comment
9553 * src/minibuffer.C (ExecutingCB): removed code that has been
9554 commented out a long time
9556 * src/lyxfunc.C (processKeyEvent): removed some very old commented
9557 out code + a warning.
9559 * src/support/lyxstring.h: comment out the three private
9560 operators, when compiling with string ansi conforming compilers
9563 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
9565 (pixmapFromBitmapData): change type of bdata to be unsigned char *
9566 (pixmapFromBitmapData): add a reinterpret_cast in the call to
9569 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
9572 * src/mathed/math_panel.C (create_math_panel): remove explicit
9575 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
9578 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
9579 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
9580 to XCreatePixmapFromBitmapData
9581 (fl_set_bmtable_data): change the last argument to be unsigned
9583 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
9584 and bh to be unsigned int, remove explicit casts in call to
9585 XReadBitmapFileData.
9587 * images/arrows.xbm: made the arrays unsigned char *
9588 * images/varsz.xbm: ditto
9589 * images/misc.xbm: ditto
9590 * images/greek.xbm: ditto
9591 * images/dots.xbm: ditto
9592 * images/brel.xbm: ditto
9593 * images/bop.xbm: ditto
9595 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
9597 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
9598 (LYX_PROG_CXX): added -pedantic to g++ compile options when
9599 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
9601 (LYX_CXX_CHEADERS): added <clocale> to the test.
9603 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
9605 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
9607 * src/support/lyxstring.C (append): fixed something that must be a
9608 bug, rep->assign was used instead of rep->append.
9610 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
9613 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
9614 lyx insert double chars. Fix spotted by Kayvan.
9616 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9618 * Fixed the tth support. I messed up with the Emacs patch apply feature
9619 and omitted the changes in lyxrc.C.
9621 1999-10-22 Juergen Vigna <jug@sad.it>
9623 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
9625 * src/lyx_cb.C (MenuInsertRef) +
9626 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
9627 the form cannot be resized under it limits (fixes a segfault)
9629 * src/lyx.C (create_form_form_ref) +
9630 * forms/lyx.fd: Changed Gravity on name input field so that it is
9633 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9635 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
9636 <ostream> and <istream>.
9638 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
9639 whether <fstream> provides the latest standard features, or if we
9640 have an oldstyle library (like in egcs).
9641 (LYX_CXX_STL_STRING): fix the test.
9643 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
9644 code on MODERN_STL_STREAM.
9646 * src/support/lyxstring.h: use L{I,O}stream.h.
9648 * src/support/L{I,O}stream.h: new files, designed to setup
9649 correctly streams for our use
9650 - includes the right header depending on STL capabilities
9651 - puts std::ostream and std::endl (for LOStream.h) or
9652 std::istream (LIStream.h) in toplevel namespace.
9654 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9656 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
9657 was a bib file that had been changed we ensure that bibtex is run.
9658 (runBibTeX): enhanced to extract the names of the bib files and
9659 getting their absolute path and enter them into the dep file.
9660 (findtexfile): static func that is used to look for tex-files,
9661 checks for absolute patchs and tries also with kpsewhich.
9662 Alternative ways of finding the correct files are wanted. Will
9664 (do_popen): function that runs a command using popen and returns
9665 the whole output of that command in a string. Should be moved to
9668 * src/DepTable.[Ch] (extchanged): new function that returns true if a
9669 file with extension ext has changed.
9671 * src/insets/figinset.C: added ifdef guards around the fl_free
9672 code that jug commented out. Now it is commented out when
9673 compiling with XForms == 0.89.
9675 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
9676 to lyxstring.C, and only keep a forward declaration in
9677 lyxstring.h. Simplifies the header file a bit and should help a
9678 bit on compile time too. Also changes to Srep will not mandate a
9679 recompile of code just using string.
9680 (~lyxstring): definition moved here since it uses srep.
9681 (size): definition moved here since it uses srep.
9683 * src/support/lyxstring.h: removed a couple of "inline" that should
9686 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9688 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
9691 1999-10-21 Juergen Vigna <jug@sad.it>
9693 * src/table.C (SetPWidth): Just a small fix so the alignment is not
9694 set to left if I just remove the width entry (or it is empty).
9696 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
9697 paragraph when having dummy paragraphs.
9699 1999-10-20 Juergen Vigna <jug@sad.it>
9701 * src/insets/figinset.C: just commented some fl_free_form calls
9702 and added warnings so that this calls should be activated later
9703 again. This avoids for now a segfault, but we have a memory leak!
9705 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
9706 'const char * argument' to 'string argument', this should
9707 fix some Asserts() in lyxstring.C.
9709 * src/lyxfunc.h: Removed the function argAsString(const char *)
9710 as it is not used anymore.
9712 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9714 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
9717 * src/Literate.h: some funcs moved from public to private to make
9718 interface clearer. Unneeded args removed.
9720 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
9722 (scanBuildLogFile): ditto
9724 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
9725 normal TeX Error. Still room for improvement.
9727 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
9729 * src/buffer.C (insertErrors): changes to make the error
9730 desctription show properly.
9732 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
9735 * src/support/lyxstring.C (helper): changed to use
9736 sizeof(object->rep->ref).
9737 (operator>>): changed to use a pointer instead.
9739 * src/support/lyxstring.h: changed const reference & to value_type
9740 const & lets see if that helps.
9742 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9744 * Makefile.am (rpmdist): fixed to have non static package and
9747 * src/support/lyxstring.C: removed the compilation guards
9749 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
9752 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
9753 conditional compile of lyxstring.Ch
9755 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
9756 stupid check, but it is a lot better than the bastring hack.
9757 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
9759 * several files: changed string::erase into string::clear. Not
9762 * src/chset.C (encodeString): use a char temporary instead
9764 * src/table.C (TexEndOfCell): added tostr around
9765 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
9766 (TexEndOfCell): ditto
9767 (TexEndOfCell): ditto
9768 (TexEndOfCell): ditto
9769 (DocBookEndOfCell): ditto
9770 (DocBookEndOfCell): ditto
9771 (DocBookEndOfCell): ditto
9772 (DocBookEndOfCell): ditto
9774 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
9776 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
9778 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
9779 (MenuBuildProg): added tostr around ret
9780 (MenuRunChktex): added tostr around ret
9781 (DocumentApplyCB): added tostr around ret
9783 * src/chset.C (encodeString): added tostr around t->ic
9785 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
9786 (makeLaTeXFile): added tostr around tocdepth
9787 (makeLaTeXFile): added tostr around ftcound - 1
9789 * src/insets/insetbib.C (setCounter): added tostr around counter.
9791 * src/support/lyxstring.h: added an operator+=(int) to catch more
9794 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
9795 (lyxstring): We DON'T allow NULL pointers.
9797 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9799 * src/mathed/math_macro.C (MathMacroArgument::Write,
9800 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
9801 when writing them out.
9803 * src/LString.C: remove, since it is not used anymore.
9805 * src/support/lyxstring.C: condition the content to
9806 USE_INCLUDED_STRING macro.
9808 * src/mathed/math_symbols.C, src/support/lstrings.C,
9809 src/support/lyxstring.C: add `using' directive to specify what
9810 we need in <algorithm>. I do not think that we need to
9811 conditionalize this, but any thought is appreciated.
9813 * many files: change all callback functions to "C" linkage
9814 functions to please strict C++ compilers like DEC cxx 6.1 in mode
9815 strict_ansi. Those who were static are now global.
9816 The case of callbacks which are static class members is
9817 trickier, since we have to make C wrappers around them (see
9818 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
9819 did not finish this yet, since it defeats the purpose of
9820 encapsulation, and I am not sure what the best route is.
9822 1999-10-19 Juergen Vigna <jug@sad.it>
9824 * src/support/lyxstring.C (lyxstring): we permit to have a null
9825 pointer as assignment value and just don't assign it.
9827 * src/vspace.C (nextToken): corrected this function substituting
9828 find_first(_not)_of with find_last_of.
9830 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
9831 (TableOptCloseCB) (TableSpeCloseCB):
9832 inserted fl_set_focus call for problem with fl_hide_form() in
9835 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9837 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
9840 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9842 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
9843 LyXLex::next() and not eatline() to get its argument.
9845 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9847 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
9848 instead, use fstreams for io of the depfile, removed unneeded
9849 functions and variables.
9851 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
9852 vector instead, removed all functions and variables that is not in
9855 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9857 * src/buffer.C (insertErrors): use new interface to TeXError
9859 * Makefile.am (rpmdist): added a rpmdist target
9861 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
9862 per Kayvan's instructions.
9864 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9866 * src/Makefile.am: add a definition for localedir, so that locales
9867 are found after installation (Kayvan)
9869 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9871 * development/.cvsignore: new file.
9873 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9875 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
9876 C++ compiler provides wrappers for C headers and use our alternate
9879 * configure.in: use LYX_CXX_CHEADERS.
9881 * src/cheader/: new directory, populated with cname headers from
9882 libstdc++-2.8.1. They are a bit old, but probably good enough for
9883 what we want (support compilers who lack them).
9885 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
9886 from includes. It turns out is was stupid.
9888 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9890 * lib/Makefile.am (install-data-local): forgot a ';'
9891 (install-data-local): forgot a '\'
9892 (libinstalldirs): needed after all. reintroduced.
9894 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9896 * configure.in (AC_OUTPUT): added lyx.spec
9898 * development/lyx.spec: removed file
9900 * development/lyx.spec.in: new file
9902 * po/*.po: merged with lyx.pot becuase of make distcheck
9904 * lib/Makefile.am (dist-hook): added dist-hook so that
9905 documentation files will be included when doing a make
9906 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
9907 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
9909 more: tried to make install do the right thing, exclude CVS dirs
9912 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
9913 Path would fit in more nicely.
9915 * all files that used to use pathstack: uses now Path instead.
9916 This change was a lot easier than expected.
9918 * src/support/path.h: new file
9920 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
9922 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
9924 * src/support/lyxstring.C (getline): Default arg was given for
9927 * Configure.cmd: removed file
9929 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9931 * src/support/DebugStream.[Ch]: remove the explicit std:: before
9932 streams classes and types, add the proper 'using' statements when
9933 MODERN_STL is defined.
9935 * src/debug.h: move the << operator definition after the inclusion
9938 * src/support/filetools.C: include "LAssert.h", which is needed
9941 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
9944 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
9945 include "debug.h" to define a proper ostream.
9947 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9949 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
9950 method to the SystemCall class which can kill a process, but it's
9951 not fully implemented yet.
9953 * src/*.C: Changed Systemcalls::Startscript() to startscript()
9955 * src/support/FileInfo.h: Better documentation
9957 * src/lyxfunc.C: Added support for buffer-export html
9959 * src/menus.C: Added Export->As HTML...
9961 * lib/bind/*.bind: Added short-cut for buffer-export html
9963 * src/lyxrc.*: Added support for new \tth_command
9965 * lib/lyxrc.example: Added stuff for new \tth_command
9967 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9969 * lib/Makefile.am (IMAGES): removed images/README
9970 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
9971 installes in correct place. Check permisions is installed
9974 * src/LaTeX.C: some no-op changes moved declaration of some
9977 * src/LaTeX.h (LATEX_H): changed include guard name
9979 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9981 * lib/reLyX/Makefile.am: install noweb2lyx.
9983 * lib/Makefile.am: install configure.
9985 * lib/reLyX/configure.in: declare a config aux dir; set package
9986 name to lyx (not sure what the best solution is); generate noweb2lyx.
9988 * lib/layouts/egs.layout: fix the bibliography layout.
9990 1999-10-08 Jürgen Vigna <jug@sad.it>
9992 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
9993 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
9994 it returned without continuing to search the path.
9996 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9998 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
9999 also fixes a bug. It is not allowed to do tricks with std::strings
10000 like: string a("hei"); &a[e]; this will not give what you
10001 think... Any reason for the complexity in this func?
10003 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
10005 * Updated README and INSTALL a bit, mostly to check that my
10006 CVS rights are correctly set up.
10008 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10010 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
10011 does not allow '\0' chars but lyxstring and std::string does.
10013 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10015 * autogen.sh (AUTOCONF): let the autogen script create the
10016 POTFILES.in file too. POTFILES.in should perhaps now not be
10017 included in the cvs module.
10019 * some more files changed to use C++ includes instead of C ones.
10021 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
10023 (Reread): added tostr to nlink. buggy output otherwise.
10024 (Reread): added a string() around szMode when assigning to Buffer,
10025 without this I got a log of garbled info strings.
10027 * acconfig.h: commented out the PTR_AS_INT macros. They should not
10030 * I have added several ostream & operator<<(ostream &, some_type)
10031 functions. This has been done to avoid casting and warnings when
10032 outputting enums to lyxerr. This as thus eliminated a lot of
10033 explicit casts and has made the code clearer. Among the enums
10034 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
10035 mathed enums, some font enum the Debug::type enum.
10037 * src/support/lyxstring.h (clear): missing method. equivalent of
10040 * all files that contained "stderr": rewrote constructs that used
10041 stderr to use lyxerr instead. (except bmtable)
10043 * src/support/DebugStream.h (level): and the passed t with
10044 Debug::ANY to avoid spurious bits set.
10046 * src/debug.h (Debug::type value): made it accept strings of the
10047 type INFO,INIT,KEY.
10049 * configure.in (Check for programs): Added a check for kpsewhich,
10050 the latex generation will use this later to better the dicovery of
10053 * src/BufferView.C (create_view): we don't need to cast this to
10054 (void*) that is done automatically.
10055 (WorkAreaButtonPress): removed some dead code.
10057 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10059 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
10060 is not overwritten when translated (David Sua'rez de Lis).
10062 * lib/CREDITS: Added David Sua'rez de Lis
10064 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
10066 * src/bufferparams.C (BufferParams): default input encoding is now
10069 * acinclude.m4 (cross_compiling): comment out macro
10070 LYX_GXX_STRENGTH_REDUCE.
10072 * acconfig.h: make sure that const is not defined (to empty) when
10073 we are compiling C++. Remove commented out code using SIZEOF_xx
10076 * configure.in : move the test for const and inline as late as
10077 possible so that these C tests do not interefere with C++ ones.
10078 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
10079 has not been proven.
10081 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10083 * src/table.C (getDocBookAlign): remove bad default value for
10084 isColumn parameter.
10086 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
10088 (ShowFileMenu2): ditto.
10090 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
10091 of files to ignore.
10093 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10095 * Most files: finished the change from the old error code to use
10096 DebugStream for all lyxerr debugging. Only minor changes remain
10097 (e.g. the setting of debug levels using strings instead of number)
10099 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10101 * src/layout.C (Add): Changed to use compare_no_case instead of
10104 * src/FontInfo.C: changed loop variable type too string::size_type.
10106 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10108 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
10109 set ETAGS_ARGS to --c++
10111 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
10113 * src/table.C (DocBookEndOfCell): commented out two unused variables
10115 * src/paragraph.C: commented out four unused variables.
10117 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
10118 insed a if clause with type string::size_type.
10120 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
10123 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
10125 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
10126 variable, also changed loop to go from 0 to lenght + 1, instead of
10127 -1 to length. This should be correct.
10129 * src/LaTeX.C (scanError): use string::size_type as loop variable
10132 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
10133 (l.896) since y_tmp and row was not used anyway.
10135 * src/insets/insetref.C (escape): use string::size_type as loop
10138 * src/insets/insetquotes.C (Width): use string::size_type as loop
10140 (Draw): use string::size_type as loop variable type.
10142 * src/insets/insetlatexaccent.C (checkContents): use
10143 string::size_type as loop variable type.
10145 * src/insets/insetlabel.C (escape): use string::size_type as loop
10148 * src/insets/insetinfo.C: added an extern for current_view.
10150 * src/insets/insetcommand.C (scanCommand): use string::size_type
10151 as loop variable type.
10153 * most files: removed the RCS tags. With them we had to recompile
10154 a lot of files after a simple cvs commit. Also we have never used
10155 them for anything meaningful.
10157 * most files: tags-query-replace NULL 0. As adviced several plases
10158 we now use "0" instead of "NULL" in our code.
10160 * src/support/filetools.C (SpaceLess): use string::size_type as
10161 loop variable type.
10163 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10165 * src/paragraph.C: fixed up some more string stuff.
10167 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10169 * src/support/filetools.h: make modestr a std::string.
10171 * src/filetools.C (GetEnv): made ch really const.
10173 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
10174 made code that used these use max/min from <algorithm> instead.
10176 * changed several c library include files to their equivalent c++
10177 library include files. All is not changed yet.
10179 * created a support subdir in src, put lyxstring and lstrings
10180 there + the extra files atexit, fileblock, strerror. Created
10181 Makefile.am. edited configure.in and src/Makefile.am to use this
10182 new subdir. More files moved to support.
10184 * imported som of the functions from repository lyx, filetools
10186 * ran tags-query-replace on LString -> string, corrected the bogus
10187 cases. Tried to make use of lstrings.[hC], debugged a lot. There
10188 is still some errors in there. This is errors where too much or
10189 too litle get deleted from strings (string::erase, string::substr,
10190 string::replace), there can also be some off by one errors, or
10191 just plain wrong use of functions from lstrings. Viewing of quotes
10194 * LyX is now running fairly well with string, but there are
10195 certainly some bugs yet (see above) also string is quite different
10196 from LString among others in that it does not allow null pointers
10197 passed in and will abort if it gets any.
10199 * Added the revtex4 files I forgot when setting up the repository.
10201 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10203 * All over: Tried to clean everything up so that only the files
10204 that we really need are included in the cvs repository.
10205 * Switched to use automake.
10206 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
10207 * Install has not been checked.
10209 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10211 * po/pt.po: Three errors:
10212 l.533 and l.538 format specification error
10213 l. 402 duplicate entry, I just deleted it.