1 2000-10-02 Allan Rae <rae@lyx.org>
3 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
4 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
6 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
7 Left this one out by accident.
9 * src/frontends/xforms/FormBase.h (restore): default to calling
10 update() since that will restore the original/currently-applied values.
11 Any input() triggered error messages will require the derived classes
12 to redefine restore().
14 * src/frontends/xforms/FormDocument.C: initialize a few variables to
15 avoid a segfault. combo_doc_class is the main concern.
17 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
19 * Simplify build-listerrors in view of GUI-less export ability!
21 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
23 * src/lyx_main.C (easyParse): Disable gui when exporting
25 * src/insets/figinset.C:
29 * src/tabular.C: Changes to allow no-gui.
31 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
33 * src/support/utility.hpp: removed file
34 * src/support/block.h: removed file
36 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
39 * src/mathed/formula.C: add support/lyxlib.h
40 * src/mathed/formulamacro.C: ditto
42 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
43 * src/lyxparagraph.h: ditto
45 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
46 * src/frontends/Makefile.am (INCLUDES): ditto
47 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
48 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
49 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
50 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
51 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
52 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
54 * src/BufferView.h: use boost/utility.hpp
57 * src/LyXAction.h: ditto
58 * src/LyXView.h: ditto
59 * src/bufferlist.h: ditto
60 * src/lastfiles.h: ditto
62 * src/lyx_gui.h: ditto
63 * src/lyx_main.h: ditto
66 * src/frontends/ButtonPolicies.h: ditto
67 * src/frontends/Dialogs.h: ditto
68 * src/frontends/xforms/FormBase.h: ditto
69 * src/frontends/xforms/FormGraphics.h: ditto
70 * src/frontends/xforms/FormParagraph.h: ditto
71 * src/frontends/xforms/FormTabular.h: ditto
72 * src/graphics/GraphicsCache.h: ditto
73 * src/graphics/Renderer.h: ditto
74 * src/insets/ExternalTemplate.h: ditto
75 * src/insets/insetcommand.h: ditto
76 * src/support/path.h: ditto
78 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
79 and introduce clause for 2.97.
81 * boost/libs/README: new file
83 * boost/boost/utility.hpp: new file
85 * boost/boost/config.hpp: new file
87 * boost/boost/array.hpp: new file
89 * boost/Makefile.am: new file
91 * boost/.cvsignore: new file
93 * configure.in (AC_OUTPUT): add boost/Makefile
95 * Makefile.am (SUBDIRS): add boost
97 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
99 * src/support/lstrings.C (suffixIs): Fixed.
101 2000-10-01 Allan Rae <rae@lyx.org>
103 * src/PrinterParams.h: moved things around to avoid the "can't
104 inline call" warning.
106 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
107 into doc++ documentation.
109 * src/frontends/xforms/FormCommand.[Ch]: support button policy
111 * src/frontends/xforms/FormRef.C: make use of button controller
112 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
113 cleaned up button controller usage.
114 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
115 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
116 use the button controller
118 * src/frontends/xforms/forms/*.fd: and associated generated files
119 updated to reflect changes to FormBase. Some other FormXxxx files
120 also got minor updates to reflect changes to FormBase.
122 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
123 (hide): made virtual.
124 (input): return a bool. true == valid input
125 (RestoreCB, restore): new
126 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
127 Changes to allow derived dialogs to use a ButtonController and
128 make sense when doing so: OK button calls ok() and so on.
130 * src/frontends/xforms/ButtonController.h (class ButtonController):
131 Switch from template implementation to taking Policy parameter.
132 Allows FormBase to provide a ButtonController for any dialog.
134 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
135 Probably should rename connect and disconnect.
136 (apply): use the radio button groups
137 (form): needed by FormBase
138 (build): setup the radio button groups
140 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
142 * several files: type canges to reduce the number of warnings and
143 to unify type hangling a bit. Still much to do.
145 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
147 * lib/images/*: rename a bunch of icons to match Dekel converter
150 * src/buffer.C (SimpleLinuxDocOnePar): add a const qualifier to
153 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
155 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
157 * sigc++/handle.h: ditto for class Handle.
159 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
161 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
163 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
165 * src/intl.C (InitKeyMapper): Correct the value of n due to the
166 removal of the "default" language.
168 * src/combox.h (getline): Check that sel > 0
170 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
172 * lib/examples/docbook_example.lyx
173 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
175 * lib/layouts/docbook-book.layout: new docbook book layout.
177 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
179 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
181 * src/insets/figinset.C (DocBook):fixed small typo.
183 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
185 * src/insets/insetinclude.h: string include_label doesn't need to be
188 2000-09-29 Allan Rae <rae@lyx.org>
190 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
191 Allow derived type to control connection and disconnection from signals
192 of its choice if desired.
194 2000-09-28 Juergen Vigna <jug@sad.it>
196 * src/insets/insettabular.C (update): fixed cursor setting when
197 the_locking_inset changed.
198 (draw): made this a bit cleaner.
199 (InsetButtonPress): fixed!
201 * various files: added LyXText Parameter to fitCursor call.
203 * src/BufferView.C (fitCursor): added LyXText parameter.
205 * src/insets/insettabular.C (draw): small draw fix.
207 * src/tabular.C: right setting of left/right celllines.
209 * src/tabular.[Ch]: fixed various types in funcions and structures.
210 * src/insets/insettabular.C: ditto
211 * src/frontends/xforms/FormTabular.C: ditto
213 2000-09-28 Allan Rae <rae@lyx.org>
215 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
216 that the #ifdef's had been applied to part of what should have been
217 a complete condition. It's possible there are other tests that
218 were specific to tables that are also wrong now that InsetTabular is
219 being used. Now we need to fix the output of '\n' after a table in a
220 float for the same reason as the original condition:
221 "don't insert this if we would be adding it before or after a table
222 in a float. This little trick is needed in order to allow use of
223 tables in \subfigures or \subtables."
224 Juergen can you check this?
226 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
228 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
229 outputed to the ostream.
231 * several files: fixed types based on warnings from cxx
233 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
235 * src/frontends/kde/Makefile.am: fix rule for
236 formindexdialogdata_moc.C
238 * src/.cvsignore: add ext_l10n.h to ignore
240 * acconfig.h: stop messing with __STRICT_ANSI__
241 * config/gnome.m4: remove option to set -ansi
242 * config/kde.m4: remove option to set -ansi
243 * config/lyxinclude.m4: don't set -ansi
245 2000-09-27 Juergen Vigna <jug@sad.it>
247 * various files: remove "default" language check.
249 * src/insets/insetquotes.C: removed use of current_view.
251 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
252 the one should have red ears by now!
254 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
255 in more then one paragraph. Fixed cursor-movement/selection.
257 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
258 paragraphs inside a text inset.
260 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
261 text-inset if this owner is an inset.
263 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
265 * src/Bullet.h: changed type of font, character and size to int
267 * src/buffer.C (asciiParagraph): remove actcell and fname1.
269 * src/insets/inseturl.[Ch]:
270 * src/insets/insetref.[Ch]:
271 * src/insets/insetlabel.[Ch]: add linelen to Ascii
273 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
275 * src/buffer.C (readFile): block-if statement rearranged to minimise
276 bloat. Patch does not reverse Jean-Marc's change ;-)
278 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
279 Class rewritten to store pointers to hide/update signals directly,
280 rather than Dialogs *. Also defined an enum to ease use. All xforms
281 forms can now be derived from this class.
283 * src/frontends/xforms/FormCommand.[Ch]
284 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
286 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
289 * src/frontends/xforms/forms/form_citation.fd
290 * src/frontends/xforms/forms/form_copyright.fd
291 * src/frontends/xforms/forms/form_error.fd
292 * src/frontends/xforms/forms/form_index.fd
293 * src/frontends/xforms/forms/form_ref.fd
294 * src/frontends/xforms/forms/form_toc.fd
295 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
297 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
299 * src/insets/insetfoot.C: removed redundent using directive.
301 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
303 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
304 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
306 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
307 created in the constructors in different groups. Then set() just
308 have to show the groups as needed. This fixes the redraw problems
309 (and is how the old menu code worked).
311 * src/support/lyxlib.h: declare the methods as static when we do
314 2000-09-26 Juergen Vigna <jug@sad.it>
316 * src/buffer.C (asciiParagraph): new function.
317 (writeFileAscii): new function with parameter ostream.
318 (writeFileAscii): use now asciiParagraph.
320 * various inset files: added the linelen parameter to the Ascii-func.
322 * src/tabular.C (Write): fixed error in writing file introduced by
323 the last changes from Lars.
325 * lib/bind/menus.bind: removed not supported functions.
327 * src/insets/insettext.C (Ascii): implemented this function.
329 * src/insets/lyxinset.h (Ascii): added linelen parameter.
331 * src/tabular.C (write_attribute[int,string,bool]): new functions.
332 (Write): use of the write_attribute functions.
334 * src/bufferlist.C (close): fixed reasking question!
336 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
338 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
339 new files use the everwhere possible.
342 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
343 src/log_form.C src/lyx.C:
346 * src/buffer.C (runLaTeX): remove func
348 * src/PaperLayout.C: removed file
349 * src/ParagraphExtra.C: likewise
350 * src/bullet_forms.C: likewise
351 * src/bullet_forms.h: likewise
352 * src/bullet_forms_cb.C: likewise
354 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
355 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
358 * several files: remove all traces of the old fd_form_paragraph,
359 and functions belonging to that.
361 * several files: remove all traces of the old fd_form_document,
362 and functions belonging to that.
364 * several files: constify local variables were possible.
366 * several files: remove all code that was dead when NEW_EXPORT was
369 * several files: removed string::c_str in as many places as
372 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
373 (e): be a bit more outspoken when patching
374 (updatesrc): only move files if changed.
376 * forms/layout_forms.h.patch: regenerated
378 * forms/layout_forms.fd: remove form_document and form_paragraph
379 and form_quotes and form_paper and form_table_options and
382 * forms/form1.fd: remove form_table
384 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
385 the fdui->... rewrite. Update some comments to xforms 0.88
387 * forms/bullet_forms.C.patch: removed file
388 * forms/bullet_forms.fd: likewise
389 * forms/bullet_forms.h.patch: likewise
391 * development/Code_rules/Rules: added a section on switch
392 statements. Updated some comment to xforms 0.88.
394 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
396 * src/buffer.C (readFile): make sure that the whole version number
397 is read after \lyxformat (even when it contains a comma)
399 * lib/ui/default.ui: change shortcut of math menu to M-a.
401 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
403 * src/vspace.C (nextToken): use isStrDbl() to check for proper
406 * src/LyXView.C (updateWindowTitle): show the full files name in
407 window title, limited to 30 characters.
409 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
410 When a number of characters has been given, we should not assume
411 that the string is 0-terminated.
413 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
414 calls (fixes some memory leaks)
416 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
417 trans member on exit.
419 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
421 * src/converter.C (GetReachable): fix typo.
423 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
424 understand ',' instead of '.'.
425 (GetInteger): rewrite to use strToInt().
427 2000-09-26 Juergen Vigna <jug@sad.it>
429 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
430 better visibility and error-message on wrong VSpace input.
432 * src/language.C (initL): added english again.
434 2000-09-25 Juergen Vigna <jug@sad.it>
436 * src/frontends/kde/Dialogs.C (Dialogs):
437 * src/frontends/gnome/Dialogs.C (Dialogs):
438 * src/frontends/kde/Makefile.am:
439 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
441 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
443 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
445 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
447 * src/frontends/xforms/FormParagraph.C:
448 * src/frontends/xforms/FormParagraph.h:
449 * src/frontends/xforms/form_paragraph.C:
450 * src/frontends/xforms/form_paragraph.h:
451 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
454 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
456 * src/tabular.C (OldFormatRead): forgot to delete the temporary
457 Paragraph-Data after use.
459 * src/insets/insettext.C (LocalDispatch): don't set the layout on
460 non breakable paragraphs.
462 2000-09-25 Garst R. Reese <reese@isn.net>
464 * src/language.C (initL): added missing language_country codes.
466 2000-09-25 Juergen Vigna <jug@sad.it>
468 * src/insets/insettext.C (InsetText):
469 (deleteLyXText): remove the not released LyXText structure!
471 2000-09-24 Marko Vendelin <markov@ioc.ee>
473 * src/frontends/gnome/mainapp.C
474 * src/frontends/gnome/mainapp.h: added support for keyboard
477 * src/frontends/gnome/FormCitation.C
478 * src/frontends/gnome/FormCitation.h
479 * src/frontends/gnome/Makefile.am
480 * src/frontends/gnome/pixbutton.h: completed the rewrite of
481 FormCitation to use "action area" in mainapp window
483 * src/frontends/gnome/Menubar_pimpl.C
484 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
487 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
489 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
490 width/descent/ascent values if name is empty.
491 (mathed_string_height): Use std::max.
493 2000-09-25 Allan Rae <rae@lyx.org>
495 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
496 segfault. This will be completely redesigned soon.
498 * sigc++: updated libsigc++. Fixes struct timespec bug.
500 * development/tools/makeLyXsigc.sh: .cvsignore addition
502 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
504 * several files: removed almost all traces of the old table
507 * src/TableLayout.C: removed file
509 2000-09-22 Juergen Vigna <jug@sad.it>
511 * src/frontends/kde/Dialogs.C: added credits forms.
513 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
515 * src/frontends/gnome/Dialogs.C: added some forms.
517 * src/spellchecker.C (init_spell_checker): set language in pspell code
518 (RunSpellChecker): some modifications for setting language string.
520 * src/language.[Ch]: added language_country code.
522 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
524 * src/frontends/Dialogs.h: added new signal showError.
525 Rearranged existing signals in some sort of alphabetical order.
527 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
528 FormError.[Ch], form_error.[Ch]
529 * src/frontends/xforms/forms/makefile: added new file form_error.fd
530 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
532 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
533 dialogs. I think that this can be used as the base to all these
536 * src/frontends/xforms/FormError.[Ch]
537 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
538 implementation of InsetError dialog.
540 * src/insets/inseterror.[Ch]: rendered GUI-independent.
542 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
543 * src/frontends/kde/Makefile.am: ditto
545 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
547 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
548 macrobf. This fixes a bug of invisible text.
550 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
552 * lib/doc/LaTeXConfig.lyx.in: updated.
554 * src/language.C (initL): remove language "francais" and change a
555 bit the names of the two other french variations.
557 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
558 string that may not be 0-terminated.
560 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
562 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
564 2000-09-20 Marko Vendelin <markov@ioc.ee>
566 * src/frontends/gnome/FormCitation.C
567 * src/frontends/gnome/FormIndex.C
568 * src/frontends/gnome/FormToc.C
569 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
570 the variable initialization to shut up the warnings
572 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
574 * src/table.[Ch]: deleted files
576 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
579 2000-09-18 Juergen Vigna <jug@sad.it>
581 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
582 problems with selection. Inserted new LFUN_PASTESELECTION.
583 (InsetButtonPress): inserted handling of middle mouse-button paste.
585 * src/spellchecker.C: changed word to word.c_str().
587 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
589 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
590 included in the ``make dist'' tarball.
592 2000-09-15 Juergen Vigna <jug@sad.it>
594 * src/CutAndPaste.C (cutSelection): small fix return the right
595 end position after cut inside one paragraph only.
597 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
598 we are locked as otherwise we don't have a valid cursor position!
600 * src/insets/figinset.C (draw): small bugfix but why is this needed???
602 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
604 * src/frontends/kde/FormRef.C: added using directive.
605 * src/frontends/kde/FormToc.C: ditto
607 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
609 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
611 2000-09-19 Marko Vendelin <markov@ioc.ee>
613 * src/frontends/gnome/Menubar_pimpl.C
614 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
615 Toc, ViewFormats, UpdateFormats, and ExportFormats.
617 * src/frontends/gnome/mainapp.C
618 * src/frontends/gnome/mainapp.h: support for menu update used
621 * src/frontends/gnome/mainapp.C
622 * src/frontends/gnome/mainapp.h: support for "action" area in the
623 main window. This area is used by small simple dialogs, such as
626 * src/frontends/gnome/FormIndex.C
627 * src/frontends/gnome/FormIndex.h
628 * src/frontends/gnome/FormUrl.C
629 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
632 * src/frontends/gnome/FormCitation.C
633 * src/frontends/gnome/FormCitation.h: rewrite to use main window
634 action area. Only "Insert new citation" is implemented.
636 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
638 * src/buffer.C (Dispatch): fix call to Dispatch
639 * src/insets/insetref.C (Edit): likewise
640 * src/insets/insetparent.C (Edit): likewise
641 * src/insets/insetinclude.C (include_cb): likewise
642 * src/frontends/xforms/FormUrl.C (apply): likewise
643 * src/frontends/xforms/FormToc.C (apply): likewise
644 * src/frontends/xforms/FormRef.C (apply): likewise
645 * src/frontends/xforms/FormIndex.C (apply): likewise
646 * src/frontends/xforms/FormCitation.C (apply): likewise
647 * src/lyxserver.C (callback): likewise
648 * src/lyxfunc.C (processKeySym): likewise
651 * src/lyx_cb.C (LayoutsCB): likewise
653 * Makefile.am (sourcedoc): small change
655 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
657 * src/main.C (main): Don't make an empty GUIRunTime object. all
658 methods are static. constify a bit remove unneded using + headers.
660 * src/tabular.C: some more const to local vars move some loop vars
662 * src/spellchecker.C: added some c_str after some word for pspell
664 * src/frontends/GUIRunTime.h: add new static method setDefaults
665 * src/frontends/xforms/GUIRunTime.C (setDefaults):
666 * src/frontends/kde/GUIRunTime.C (setDefaults):
667 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
669 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
670 with strnew in arg, use correct emptystring when calling SetName.
672 * several files: remove all commented code with relation to
673 HAVE_SSTREAM beeing false. We now only support stringstream and
676 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
678 * src/lyxfunc.C: construct correctly the automatic new file
681 * src/text2.C (IsStringInText): change type of variable i to shut
684 * src/support/sstream.h: do not use namespaces if the compiler
685 does not support them.
687 2000-09-15 Marko Vendelin <markov@ioc.ee>
688 * src/frontends/gnome/FormCitation.C
689 * src/frontends/gnome/FormCitation.h
690 * src/frontends/gnome/diainsertcitation_interface.c
691 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
692 regexp support to FormCitation [Gnome].
694 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
697 * configure.in: remove unused KDE/GTKGUI define
699 * src/frontends/kde/FormRef.C
700 * src/frontends/kde/FormRef.h
701 * src/frontends/kde/formrefdialog.C
702 * src/frontends/kde/formrefdialog.h: double click will
703 go to reference, now it is possible to change a cross-ref
706 * src/frontends/kde/FormToc.C
707 * src/frontends/kde/FormToc.h
708 * src/frontends/kde/formtocdialog.C
709 * src/frontends/kde/formtocdialog.h: add a depth
712 * src/frontends/kde/Makefile.am: add QtLyXView.h
715 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
717 * src/frontends/kde/FormCitation.h: added some using directives.
719 * src/frontends/kde/FormToc.h: corrected definition of doTree.
721 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
724 * src/mathed/math_defs.h: redefine SetAlign to use string rather
727 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
729 * src/buffer.C (pop_tag): revert for the second time a change by
730 Lars, who seems to really hate having non-local loop variables :)
732 * src/Lsstream.h: add "using" statements.
734 * src/support/copy.C (copy): add a bunch of std:: qualifiers
735 * src/buffer.C (writeFile): ditto
737 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
739 * src/buffer.C (writeFile): try to fix the locale modified format
740 number to always be as we want it.
742 * src/WorkArea.C (work_area_handler): try to workaround the bugs
743 in XForms 0.89. C-space is now working again.
745 * src/Lsstream.h src/support/sstream.h: new files.
747 * also commented out all cases where strstream were used.
749 * src/Bullet.h (c_str): remove method.
751 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
753 * a lot of files: get rid of "char const *" and "char *" is as
754 many places as possible. We only want to use them in interaction
755 with system of other libraries, not inside lyx.
757 * a lot of files: return const object is not of pod type. This
758 helps ensure that temporary objects is not modified. And fits well
759 with "programming by contract".
761 * configure.in: check for the locale header too
763 * Makefile.am (sourcedoc): new tag for generation of doc++
766 2000-09-14 Juergen Vigna <jug@sad.it>
768 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
769 callback to check which combo called it and do the right action.
771 * src/combox.C (combo_cb): added combo * to the callbacks.
772 (Hide): moved call of callback after Ungrab of the pointer.
774 * src/intl.h: removed LCombo2 function.
776 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
777 function as this can now be handled in one function.
779 * src/combox.h: added Combox * to callback prototype.
781 * src/frontends/xforms/Toolbar_pimpl.C:
782 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
784 2000-09-14 Garst Reese <reese@isn.net>
786 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
787 moved usepackage{xxx}'s to beginning of file. Changed left margin
788 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
789 underlining from title. Thanks to John Culleton for useful suggestions.
791 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
793 * src/lyxlex_pimpl.C (setFile): change error message to debug
796 2000-09-13 Juergen Vigna <jug@sad.it>
798 * src/frontends/xforms/FormDocument.C: implemented choice_class
799 as combox and give callback to combo_language so OK/Apply is activated
802 * src/bufferlist.C (newFile): small fix so already named files
803 (via an open call) are not requested to be named again on the
806 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
808 * src/frontends/kde/Makefile.am
809 * src/frontends/kde/FormRef.C
810 * src/frontends/kde/FormRef.h
811 * src/frontends/kde/formrefdialog.C
812 * src/frontends/kde/formrefdialog.h: implement
815 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
817 * src/frontends/kde/formtocdialog.C
818 * src/frontends/kde/formtocdialog.h
819 * src/frontends/kde/FormToc.C
820 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
822 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
824 * src/frontends/kde/FormCitation.C: fix thinko
825 where we didn't always display the reference text
828 * src/frontends/kde/formurldialog.C
829 * src/frontends/kde/formurldialog.h
830 * src/frontends/kde/FormUrl.C
831 * src/frontends/kde/FormUrl.h: minor cleanups
833 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
835 * src/frontends/kde/Makefile.am
836 * src/frontends/kde/FormToc.C
837 * src/frontends/kde/FormToc.h
838 * src/frontends/kde/FormCitation.C
839 * src/frontends/kde/FormCitation.h
840 * src/frontends/kde/FormIndex.C
841 * src/frontends/kde/FormIndex.h
842 * src/frontends/kde/formtocdialog.C
843 * src/frontends/kde/formtocdialog.h
844 * src/frontends/kde/formcitationdialog.C
845 * src/frontends/kde/formcitationdialog.h
846 * src/frontends/kde/formindexdialog.C
847 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
849 2000-09-12 Juergen Vigna <jug@sad.it>
851 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
854 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
856 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
859 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
861 * src/converter.C (Add, Convert): Added support for converter flags:
862 needaux, resultdir, resultfile.
863 (Convert): Added new parameter view_file.
864 (dvips_options): Fixed letter paper option.
866 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
867 (Export, GetExportableFormats, GetViewableFormats): Added support
870 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
872 (easyParse): Fixed to work with new export code.
874 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
877 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
879 * lib/bind/*.bind: Replaced
880 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
881 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
883 2000-09-11 Juergen Vigna <jug@sad.it>
885 * src/lyx_gui.C (runTime): uses global guiruntime variable.
887 * src/main.C (main): now GUII defines global guiruntime!
889 * src/frontends/gnome/GUIRunTime.C (initApplication):
890 * src/frontends/kde/GUIRunTime.C (initApplication):
891 * src/frontends/xforms/GUIRunTime.C (initApplication):
892 * src/frontends/GUIRunTime.h: added new function initApplication.
894 * src/spellchecker.C (sc_accept_word): change to add_to_session.
896 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
898 2000-09-08 Juergen Vigna <jug@sad.it>
900 * src/lyx_gui.C (create_forms): don't display the "default" entry as
901 we have already "Reset".
903 * src/language.C (initL): inserted "default" language and made this
904 THE default language (and not american!)
906 * src/paragraph.C: inserted handling of "default" language!
908 * src/lyxfont.C: ditto
912 * src/paragraph.C: output the \\par only if we have a following
913 paragraph otherwise it's not needed.
915 2000-09-05 Juergen Vigna <jug@sad.it>
917 * config/pspell.m4: added entry to lyx-flags
919 * src/spellchecker.C: modified version from Kevin for using pspell
921 2000-09-01 Marko Vendelin <markov@ioc.ee>
922 * src/frontends/gnome/Makefile.am
923 * src/frontends/gnome/FormCitation.C
924 * src/frontends/gnome/FormCitation.h
925 * src/frontends/gnome/diainsertcitation_callbacks.c
926 * src/frontends/gnome/diainsertcitation_callbacks.h
927 * src/frontends/gnome/diainsertcitation_interface.c
928 * src/frontends/gnome/diainsertcitation_interface.h
929 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
930 dialog for Gnome frontend
932 * src/main.C: Gnome libraries require keeping application name
933 and its version as strings
935 * src/frontends/gnome/mainapp.C: Change the name of the main window
936 from GnomeLyX to PACKAGE
938 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
940 * src/frontends/Liason.C: add "using: declaration.
942 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
944 * src/mathed/math_macro.C (Metrics): Set the size of the template
946 * src/mathed/formulamacro.C (Latex): Fixed the returned value
948 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
950 * src/converter.C (add_options): New function.
951 (SetViewer): Change $$FName into '$$FName'.
952 (View): Add options when running xdvi
953 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
954 (Convert): The 3rd parameter is now the desired filename. Converts
955 calls to lyx::rename if necessary.
956 Add options when running dvips.
957 (dvi_papersize,dvips_options): New methods.
959 * src/exporter.C (Export): Use getLatexName() instead of fileName().
961 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
962 using a call to Converter::dvips_options.
963 Fixed to work with nex export code.
966 * src/support/rename.C: New files
968 * src/support/syscall.h
969 * src/support/syscall.C: Added Starttype SystemDontWait.
971 * lib/ui/default.ui: Changed to work with new export code
973 * lib/configure.m4: Changed to work with new export code
975 * src/encoding.C: Changed latex name for iso8859_7 encoding.
977 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
979 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
980 so that code compiles with DEC cxx.
982 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
983 to work correctly! Also now supports the additional elements
986 2000-09-01 Allan Rae <rae@lyx.org>
988 * src/frontends/ButtonPolicies.C: renamed all the references to
989 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
991 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
992 since it's a const not a type.
994 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
996 2000-08-31 Juergen Vigna <jug@sad.it>
998 * src/insets/figinset.C: Various changes to look if the filename has
999 an extension and if not add it for inline previewing.
1001 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1003 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
1004 make buttonStatus and isReadOnly be const methods. (also reflect
1005 this in derived classes.)
1007 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
1008 (nextState): change to be static inline, pass the StateMachine as
1010 (PreferencesPolicy): remove casts
1011 (OkCancelPolicy): remvoe casts
1012 (OkCancelReadOnlyPolicy): remove casts
1013 (NoRepeatedApplyReadOnlyPolicy): remove casts
1014 (OkApplyCancelReadOnlyPolicy): remove casts
1015 (OkApplyCancelPolicy): remove casts
1016 (NoRepeatedApplyPolicy): remove casts
1018 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
1020 * src/converter.C: added some using directives
1022 * src/frontends/ButtonPolicies.C: changes to overcome
1023 "need lvalue" error with DEC c++
1025 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
1026 to WMHideCB for DEC c++
1028 * src/frontends/xforms/Menubar_pimpl.C: added using directive
1030 * src/frontends/xforms/forms/form_document.C.patch: use C callback
1031 to BulletBMTableCB for DEC c++
1033 2000-08-31 Allan Rae <rae@lyx.org>
1035 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
1036 character dialog separately from old document dialogs combo_language.
1039 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
1041 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
1042 Removed LFUN_REF_CREATE.
1044 * src/MenuBackend.C: Added new tags: toc and references
1046 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
1047 (add_lastfiles, add_documents, add_formats): Removed the unused smn
1049 (add_toc, add_references): New methods.
1050 (create_submenu): Handle correctly the case when there is a
1051 seperator after optional menu items.
1053 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
1054 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
1055 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
1057 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
1059 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
1061 * src/converter.[Ch]: New file for converting between different
1064 * src/export.[Ch]: New file for exporting a LyX file to different
1067 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
1068 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
1069 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
1070 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
1071 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
1072 RunDocBook, MenuExport.
1074 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
1075 Exporter::Preview methods if NEW_EXPORT is defined.
1077 * src/buffer.C (Dispatch): Use Exporter::Export.
1079 * src/lyxrc.C: Added new tags: \converter and \viewer.
1082 * src/LyXAction.C: Define new lyx-function: buffer-update.
1083 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
1084 when NEW_EXPORT is defined.
1086 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
1088 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
1090 * lib/ui/default.ui: Added submenus "view" and "update" to the
1093 * src/filetools.C (GetExtension): New function.
1095 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
1097 2000-08-29 Allan Rae <rae@lyx.org>
1099 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
1101 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
1102 (EnableDocumentLayout): removed
1103 (DisableDocumentLayout): removed
1104 (build): make use of ButtonController's read-only handling to
1105 de/activate various objects. Replaces both of the above functions.
1107 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
1108 (readOnly): was read_only
1109 (refresh): fixed dumb mistakes with read_only_ handling
1111 * src/frontends/xforms/forms/form_document.fd:
1112 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
1113 tabbed dialogs so the tabs look more like tabs and so its easier to
1114 work out which is the current tab.
1116 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
1117 segfault with form_table
1119 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
1121 2000-08-28 Juergen Vigna <jug@sad.it>
1123 * acconfig.h: added USE_PSPELL.
1125 * src/config.h.in: added USE_PSPELL.
1127 * autogen.sh: added pspell.m4
1129 * config/pspell.m4: new file.
1131 * src/spellchecker.C: implemented support for pspell libary.
1133 2000-08-25 Juergen Vigna <jug@sad.it>
1135 * src/LyXAction.C (init): renamed LFUN_TABLE to
1136 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
1138 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
1140 * src/lyxscreen.h: add force_clear variable and fuction to force
1141 a clear area when redrawing in LyXText.
1143 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
1145 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1147 * some whitespace and comment changes.
1149 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
1151 * src/buffer.C: up te LYX_FORMAT to 2.17
1153 2000-08-23 Juergen Vigna <jug@sad.it>
1155 * src/BufferView_pimpl.C (tripleClick): disable this when in a
1158 * src/insets/insettabular.C (pasteSelection): delete the insets
1159 LyXText as it is not valid anymore.
1160 (copySelection): new function.
1161 (pasteSelection): new function.
1162 (cutSelection): new function.
1163 (LocalDispatch): implemented cut/copy/paste of cell selections.
1165 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
1166 don't have a LyXText.
1168 * src/LyXAction.C (init): a NEW_TABULAR define too much.
1170 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
1173 2000-08-22 Juergen Vigna <jug@sad.it>
1175 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
1176 ifdef form_table out if NEW_TABULAR.
1178 2000-08-21 Juergen Vigna <jug@sad.it>
1180 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
1181 (draw): fixed draw position so that the cursor is positioned in the
1183 (InsetMotionNotify): hide/show cursor so the position is updated.
1184 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
1185 using cellstart() function where it should be used.
1187 * src/insets/insettext.C (draw): ditto.
1189 * src/tabular.C: fixed initialization of some missing variables and
1190 made BoxType into an enum.
1192 2000-08-22 Marko Vendelin <markov@ioc.ee>
1193 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
1194 stock menu item using action numerical value, not its string
1198 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
1200 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
1201 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
1203 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
1205 * src/frontends/xforms/GUIRunTime.C: new file
1207 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
1208 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1210 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
1212 * src/frontends/kde/GUIRunTime.C: new file
1214 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
1215 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1217 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
1219 * src/frontends/gnome/GUIRunTime.C: new file
1221 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
1224 * src/frontends/GUIRunTime.h: removed constructor and destructor,
1225 small change to documetentation.
1227 * src/frontends/GUIRunTime.C: removed file
1229 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
1231 * src/lyxparagraph.h: enable NEW_TABULAR as default
1233 * src/lyxfunc.C (processKeySym): remove some commented code
1235 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
1236 NEW_TABULAR around the fd_form_table_options.
1238 * src/lyx_gui.C (runTime): call the static member function as
1239 GUIRunTime::runTime().
1241 2000-08-21 Allan Rae <rae@lyx.org>
1243 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
1246 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
1248 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
1250 2000-08-21 Allan Rae <rae@lyx.org>
1252 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
1253 keep Garst happy ;-)
1254 * src/frontends/xforms/FormPreferences.C (build): use setOK
1255 * src/frontends/xforms/FormDocument.C (build): use setOK
1256 (FormDocument): use the appropriate policy.
1258 2000-08-21 Allan Rae <rae@lyx.org>
1260 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
1261 automatic [de]activation of arbitrary objects when in a read-only state.
1263 * src/frontends/ButtonPolicies.h: More documentation
1264 (isReadOnly): added to support the above.
1266 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
1268 2000-08-18 Juergen Vigna <jug@sad.it>
1270 * src/insets/insettabular.C (getStatus): changed to return func_status.
1272 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
1273 display toggle menu entries if they are.
1275 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
1276 new document layout now.
1278 * src/lyxfunc.C: ditto
1280 * src/lyx_gui_misc.C: ditto
1282 * src/lyx_gui.C: ditto
1284 * lib/ui/default.ui: removed paper and quotes layout as they are now
1285 all in the document layout tabbed folder.
1287 * src/frontends/xforms/forms/form_document.fd: added Restore
1288 button and callbacks for all inputs for Allan's ButtonPolicy.
1290 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
1291 (CheckChoiceClass): added missing params setting on class change.
1292 (UpdateLayoutDocument): added for updating the layout on params.
1293 (build): forgot to RETURN_ALWAYS input_doc_spacing.
1294 (FormDocument): Implemented Allan's ButtonPolicy with the
1297 2000-08-17 Allan Rae <rae@lyx.org>
1299 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
1300 so we can at least see the credits again.
1302 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
1303 controller calls for the appropriate callbacks. Note that since Ok
1304 calls apply followed by cancel, and apply isn't a valid input for the
1305 APPLIED state, the bc_ calls have to be made in the static callback not
1306 within each of the real callbacks.
1308 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
1309 (setOk): renamed from setOkay()
1311 2000-08-17 Juergen Vigna <jug@sad.it>
1313 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
1314 in the implementation part.
1315 (composeUIInfo): don't show optional menu-items.
1317 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
1319 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
1321 * src/bufferview_funcs.C (CurrentState): fixed to show also the
1322 text-state when in a text-inset.
1324 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
1326 2000-08-17 Marko Vendelin <markov@ioc.ee>
1327 * src/frontends/gnome/FormIndex.C
1328 * src/frontends/gnome/FormIndex.h
1329 * src/frontends/gnome/FormToc.C
1330 * src/frontends/gnome/FormToc.h
1331 * src/frontends/gnome/dialogs
1332 * src/frontends/gnome/diatoc_callbacks.c
1333 * src/frontends/gnome/diatoc_callbacks.h
1334 * src/frontends/gnome/diainsertindex_callbacks.h
1335 * src/frontends/gnome/diainsertindex_callbacks.c
1336 * src/frontends/gnome/diainsertindex_interface.c
1337 * src/frontends/gnome/diainsertindex_interface.h
1338 * src/frontends/gnome/diatoc_interface.h
1339 * src/frontends/gnome/diatoc_interface.c
1340 * src/frontends/gnome/Makefile.am: Table of Contents and
1341 Insert Index dialogs implementation for Gnome frontend
1343 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
1345 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
1347 * src/frontends/gnome/diainserturl_interface.c: make the dialog
1350 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1352 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
1353 destructor. Don't definde if you don't need it
1354 (processEvents): made static, non-blocking events processing for
1356 (runTime): static method. event loop for xforms
1357 * similar as above for kde and gnome.
1359 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
1360 new Pimpl is correct
1361 (runTime): new method calss the real frontends runtime func.
1363 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
1365 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1367 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
1369 2000-08-16 Juergen Vigna <jug@sad.it>
1371 * src/lyx_gui.C (runTime): added GUII RunTime support.
1373 * src/frontends/Makefile.am:
1374 * src/frontends/GUIRunTime.[Ch]:
1375 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
1376 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
1377 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
1379 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
1381 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
1382 as this is already set in ${FRONTEND_INCLUDE} if needed.
1384 * configure.in (CPPFLAGS): setting the include dir for the frontend
1385 directory and don't set FRONTEND=xforms for now as this is executed
1388 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
1390 * src/frontends/kde/Makefile.am:
1391 * src/frontends/kde/FormUrl.C:
1392 * src/frontends/kde/FormUrl.h:
1393 * src/frontends/kde/formurldialog.h:
1394 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
1396 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
1398 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
1400 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1402 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
1405 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
1407 * src/WorkArea.C (work_area_handler): more work to get te
1408 FL_KEYBOARD to work with xforms 0.88 too, please test.
1410 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
1412 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
1414 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
1417 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1419 * src/Timeout.h: remove Qt::emit hack.
1421 * several files: changes to allo doc++ compilation
1423 * src/lyxfunc.C (processKeySym): new method
1424 (processKeyEvent): comment out if FL_REVISION < 89
1426 * src/WorkArea.C: change some debugging levels.
1427 (WorkArea): set wantkey to FL_KEY_ALL
1428 (work_area_handler): enable the FL_KEYBOARD clause, this enables
1429 clearer code and the use of compose with XForms 0.89. Change to
1430 use signals instead of calling methods in bufferview directly.
1432 * src/Painter.C: change some debugging levels.
1434 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
1437 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
1438 (workAreaKeyPress): new method
1440 2000-08-14 Juergen Vigna <jug@sad.it>
1442 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
1444 * config/kde.m4: addes some features
1446 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
1447 include missing xforms dialogs.
1449 * src/Timeout.h: a hack to be able to compile with qt/kde.
1451 * sigc++/.cvsignore: added acinclude.m4
1453 * lib/.cvsignore: added listerros
1455 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
1456 xforms tree as objects are needed for other frontends.
1458 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
1459 linking with not yet implemented xforms objects.
1461 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
1463 2000-08-14 Baruch Even <baruch.even@writeme.com>
1465 * src/frontends/xforms/FormGraphics.h:
1466 * src/frontends/xforms/FormGraphics.C:
1467 * src/frontends/xforms/RadioButtonGroup.h:
1468 * src/frontends/xforms/RadioButtonGroup.C:
1469 * src/insets/insetgraphics.h:
1470 * src/insets/insetgraphics.C:
1471 * src/insets/insetgraphicsParams.h:
1472 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
1473 instead of spaces, and various other indentation issues to make the
1474 sources more consistent.
1476 2000-08-14 Marko Vendelin <markov@ioc.ee>
1478 * src/frontends/gnome/dialogs/diaprint.glade
1479 * src/frontends/gnome/FormPrint.C
1480 * src/frontends/gnome/FormPrint.h
1481 * src/frontends/gnome/diaprint_callbacks.c
1482 * src/frontends/gnome/diaprint_callbacks.h
1483 * src/frontends/gnome/diaprint_interface.c
1484 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
1487 * src/frontends/gnome/dialogs/diainserturl.glade
1488 * src/frontends/gnome/FormUrl.C
1489 * src/frontends/gnome/FormUrl.h
1490 * src/frontends/gnome/diainserturl_callbacks.c
1491 * src/frontends/gnome/diainserturl_callbacks.h
1492 * src/frontends/gnome/diainserturl_interface.c
1493 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
1494 Gnome implementation
1496 * src/frontends/gnome/Dialogs.C
1497 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
1498 all other dialogs. Copy all unimplemented dialogs from Xforms
1501 * src/frontends/gnome/support.c
1502 * src/frontends/gnome/support.h: support files generated by Glade
1506 * config/gnome.m4: Gnome configuration scripts
1508 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
1509 configure --help message
1511 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
1512 only if there are no events pendling in Gnome/Gtk. This enhances
1513 the performance of menus.
1516 2000-08-14 Allan Rae <rae@lyx.org>
1518 * lib/Makefile.am: listerrors cleaning
1520 * lib/listerrors: removed -- generated file
1521 * acinclude.m4: ditto
1522 * sigc++/acinclude.m4: ditto
1524 * src/frontends/xforms/forms/form_citation.fd:
1525 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
1528 * src/frontends/xforms/forms/makefile: I renamed the `install` target
1529 `updatesrc` and now we have a `test` target that does what `updatesrc`
1530 used to do. I didn't like having an install target that wasn't related
1533 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
1534 on all except FormGraphics. This may yet happen. Followed by a major
1535 cleanup including using FL_TRANSIENT for most of the dialogs. More
1536 changes to come when the ButtonController below is introduced.
1538 * src/frontends/xforms/ButtonController.h: New file for managing up to
1539 four buttons on a dialog according to an externally defined policy.
1540 * src/frontends/xforms/Makefile.am: added above
1542 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
1543 Apply and Cancel/Close buttons and everything in between and beyond.
1544 * src/frontends/Makefile.am: added above.
1546 * src/frontends/xforms/forms/form_preferences.fd:
1547 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
1548 and removed variable 'status' as a result. Fixed the set_minsize thing.
1549 Use the new screen-font-update after checking screen fonts were changed
1550 Added a "Restore" button to restore the original lyxrc values while
1551 editing. This restores everything not just the last input changed.
1552 That's still a tricky one. As is the "LyX: this shouldn't happen..."
1554 * src/LyXAction.C: screen-font-update added for updating buffers after
1555 screen font settings have been changed.
1556 * src/commandtags.h: ditto
1557 * src/lyxfunc.C: ditto
1559 * forms/lyx.fd: removed screen fonts dialog.
1560 * src/lyx_gui.C: ditto
1561 * src/menus.[Ch]: ditto
1562 * src/lyx.[Ch]: ditto
1563 * src/lyx_cb.C: ditto + code from here moved to make
1564 screen-font-update. And people wonder why progress on GUII is
1565 slow. Look at how scattered this stuff was! It takes forever
1568 * forms/fdfix.sh: Fixup the spacing after commas.
1569 * forms/makefile: Remove date from generated files. Fewer clashes now.
1570 * forms/bullet_forms.C.patch: included someones handwritten changes
1572 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
1573 once I've discovered why LyXRC was made noncopyable.
1574 * src/lyx_main.C: ditto
1576 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
1578 * src/frontends/xforms/forms/fdfix.sh:
1579 * src/frontends/xforms/forms/fdfixh.sed:
1580 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
1581 * src/frontends/xforms/Form*.[hC]:
1582 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
1583 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
1584 provide a destructor for the struct FD_form_xxxx. Another version of
1585 the set_[max|min]size workaround and a few other cleanups. Actually,
1586 Angus' patch from 20000809.
1588 2000-08-13 Baruch Even <baruch.even@writeme.com>
1590 * src/insets/insetgraphics.C (Clone): Added several fields that needed
1593 2000-08-11 Juergen Vigna <jug@sad.it>
1595 * src/insets/insetgraphics.C (InsetGraphics): changing init
1596 order because of warnings.
1598 * src/frontends/xforms/forms/makefile: adding patching .C with
1601 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
1602 from .C.patch to .c.patch
1604 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
1605 order because of warning.
1607 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
1609 * src/frontends/Liason.C (setMinibuffer): new helper function
1611 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
1613 * src/lyxfunc.C (Dispatch): calling new Document-Layout
1615 * lib/ui/default.ui: commented out PaperLayout entry
1617 * src/frontends/xforms/form_document.[Ch]: new added files
1619 * src/frontends/xforms/FormDocument.[Ch]: ditto
1621 * src/frontends/xforms/forms/form_document.fd: ditto
1623 * src/frontends/xforms/forms/form_document.C.patch: ditto
1625 2000-08-10 Juergen Vigna <jug@sad.it>
1627 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
1628 (InsetGraphics): initialized cacheHandle to 0.
1629 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
1631 2000-08-10 Baruch Even <baruch.even@writeme.com>
1633 * src/graphics/GraphicsCache.h:
1634 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
1635 correctly as a cache.
1637 * src/graphics/GraphicsCacheItem.h:
1638 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
1641 * src/graphics/GraphicsCacheItem_pimpl.h:
1642 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
1645 * src/insets/insetgraphics.h:
1646 * src/insets/insetgraphics.C: Changed from using a signal notification
1647 to polling when image is not loaded.
1649 2000-08-10 Allan Rae <rae@lyx.org>
1651 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
1652 that there are two functions that have to been taken out of line by
1653 hand and aren't taken care of in the script. (Just a reminder note)
1655 * sigc++/macros/*.h.m4: Updated as above.
1657 2000-08-09 Juergen Vigna <jug@sad.it>
1659 * src/insets/insettext.C (draw): small fix for clearing rectangle.
1661 * src/insets/insettabular.C: make drawing of single cell smarter.
1663 2000-08-09 Marko Vendelin <markov@ioc.ee>
1664 * src/frontends/gnome/Menubar_pimpl.C
1665 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
1666 implementation: new files
1668 * src/frontends/gnome/mainapp.C
1669 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
1672 * src/main.C: create Gnome main window
1674 * src/frontends/xforms/Menubar_pimpl.h
1675 * src/frontends/Menubar.C
1676 * src/frontends/Menubar.h: added method Menubar::update that calls
1677 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
1679 * src/LyXView.C: calls Menubar::update to update the state
1682 * src/frontends/gnome/Makefile.am: added new files
1684 * src/frontends/Makefile.am: added frontend compiler options
1686 2000-08-08 Juergen Vigna <jug@sad.it>
1688 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
1690 * src/bufferlist.C (close):
1691 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
1692 documents if exiting without saving.
1694 * src/buffer.C (save): use removeAutosaveFile()
1696 * src/support/filetools.C (removeAutosaveFile): new function.
1698 * src/lyx_cb.C (MenuWrite): returns a bool now.
1699 (MenuWriteAs): check if file could really be saved and revert to the
1701 (MenuWriteAs): removing old autosavefile if existant.
1703 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
1704 before Goto toggle declaration, because of compiler warning.
1706 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
1708 * src/lyxfunc.C (MenuNew): small fix.
1710 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
1712 * src/bufferlist.C (newFile):
1713 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
1715 * src/lyxrc.C: added new_ask_filename tag
1717 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
1719 * src/lyx.fd: removed code pertaining to form_ref
1720 * src/lyx.[Ch]: ditto
1721 * src/lyx_cb.C: ditto
1722 * src/lyx_gui.C: ditto
1723 * src/lyx_gui_misc.C: ditto
1725 * src/BufferView_pimpl.C (restorePosition): update buffer only
1728 * src/commandtags.h (LFUN_REFTOGGLE): removed
1729 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
1730 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
1731 (LFUN_REFBACK): renamed LFUN_REF_BACK
1733 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
1734 * src/menus.C: ditto
1735 * src/lyxfunc.C (Dispatch): ditto.
1736 InsertRef dialog is now GUI-independent.
1738 * src/texrow.C: added using std::endl;
1740 * src/insets/insetref.[Ch]: strip out large amounts of code.
1741 The inset is now a container and this functionality is now
1742 managed by a new FormRef dialog
1744 * src/frontends/Dialogs.h (showRef, createRef): new signals
1746 * src/frontends/xforms/FormIndex.[Ch],
1747 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
1748 when setting dialog's min/max size
1749 * src/frontends/xforms/FormIndex.[Ch]: ditto
1751 * src/frontends/xforms/FormRef.[Ch],
1752 src/frontends/xforms/forms/form_ref.fd: new xforms
1753 implementation of an InsetRef dialog
1755 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
1758 * src/graphics/XPM_Renderer.C (isImageFormatOK):
1759 ios::nocreate is not part of the standard. Removed.
1761 2000-08-07 Baruch Even <baruch.even@writeme.com>
1763 * src/graphics/Renderer.h:
1764 * src/graphics/Renderer.C: Added base class for rendering of different
1765 image formats into Pixmaps.
1767 * src/graphics/XPM_Renderer.h:
1768 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
1769 in a different class.
1771 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
1772 easily add support for other formats.
1774 * src/insets/figinset.C: plugged a leak of an X resource.
1776 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1778 * src/CutAndPaste.[Ch]: make all metods static.
1780 * development/Code_rules/Rules: more work, added section on
1781 Exceptions, and a References section.
1783 * a lot of header files: work to make doc++ able to generate the
1784 source documentation, some workarounds of doc++ problems. Doc++ is
1785 now able to generate the documentation.
1787 2000-08-07 Juergen Vigna <jug@sad.it>
1789 * src/insets/insettabular.C (recomputeTextInsets): removed function
1791 * src/tabular.C (SetWidthOfMulticolCell):
1793 (calculate_width_of_column_NMC): fixed return value so that it really
1794 only returns true if the column-width has changed (there where
1795 problems with muliticolumn-cells in this column).
1797 2000-08-04 Juergen Vigna <jug@sad.it>
1799 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
1800 also on the scrollstatus of the inset.
1801 (workAreaMotionNotify): ditto.
1803 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
1805 2000-08-01 Juergen Vigna <jug@sad.it>
1807 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
1809 * src/commandtags.h:
1810 * src/LyXAction.C (init):
1811 * src/insets/inset.C (LocalDispatch): added support for
1814 * src/insets/inset.C (scroll): new functions.
1816 * src/insets/insettext.C (removeNewlines): new function.
1817 (SetAutoBreakRows): removes forced newlines in the text of the
1818 paragraph if autoBreakRows is set to false.
1820 * src/tabular.C (Latex): generates a parbox around the cell contents
1823 * src/frontends/xforms/FormTabular.C (local_update): removed
1824 the radio_useparbox button.
1826 * src/tabular.C (UseParbox): new function
1828 2000-08-06 Baruch Even <baruch.even@writeme.com>
1830 * src/graphics/GraphicsCache.h:
1831 * src/graphics/GraphicsCache.C:
1832 * src/graphics/GraphicsCacheItem.h:
1833 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
1836 * src/insets/insetgraphics.h:
1837 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
1838 drawing of the inline image.
1840 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
1841 into the wrong position.
1843 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
1846 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
1848 * src/support/translator.h: move all typedefs to public section
1850 * src/support/filetools.C (MakeLatexName): return string const
1852 (TmpFileName): ditto
1853 (FileOpenSearch): ditto
1855 (LibFileSearch): ditto
1856 (i18nLibFileSearch): ditto
1859 (CreateTmpDir): ditto
1860 (CreateBufferTmpDir): ditto
1861 (CreateLyXTmpDir): ditto
1864 (MakeAbsPath): ditto
1866 (OnlyFilename): ditto
1868 (NormalizePath): ditto
1869 (CleanupPath): ditto
1870 (GetFileContents): ditto
1871 (ReplaceEnvironmentPath): ditto
1872 (MakeRelPath): ditto
1874 (ChangeExtension): ditto
1875 (MakeDisplayPath): ditto
1876 (do_popen): return cmdret const
1877 (findtexfile): return string const
1879 * src/support/DebugStream.h: add some /// to please doc++
1881 * src/frontends/DialogBase.h (endif): add some /// to please doc++
1883 * src/texrow.C (same_rownumber): functor to use with find_if
1884 (getIdFromRow): rewritten to use find_if and to not update the
1885 positions. return true if row is found
1886 (increasePos): new method, use to update positions
1888 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
1890 * src/lyxlex_pimpl.C (verifyTable): new method
1893 (GetString): return string const
1894 (pushTable): rewrite to use std::stack
1896 (setFile): better check
1899 * src/lyxlex.h: make LyXLex noncopyable
1901 * src/lyxlex.C (text): return char const * const
1902 (GetString): return string const
1903 (getLongString): return string const
1905 * src/lyx_gui_misc.C (askForText): return pair<...> const
1907 * src/lastfiles.[Ch] (operator): return string const
1909 * src/buffer.C (parseSingleLyXformat2Token): pass string to
1910 istringstream not char const *.
1911 move token.end() out of loop.
1912 (readFile): move initializaton of token
1914 * src/BufferView2.C (insertErrors): run texrow.increasePos if
1915 getIdFromRow is successful.
1917 * lib/bind/emacs.bind: don't include menus bind
1919 * development/Code_rules/Rules: the beginnings of making this
1920 better and covering more of the unwritten rules that we have.
1922 * development/Code_rules/Recommendations: a couple of wording
1925 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1927 * src/support/strerror.c: remove C++ comment.
1929 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
1931 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
1932 LFUN_INDEX_INSERT_LAST
1934 * src/texrow.C (getIdFromRow): changed from const_iterator to
1935 iterator, allowing code to compile with DEC cxx
1937 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
1938 stores part of the class, as suggested by Allan. Will allow
1940 (apply): test to apply uses InsetCommandParams operator!=
1942 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
1943 (apply): test to apply uses InsetCommandParams operator!=
1945 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
1946 stores part of the class.
1947 (update): removed limits on min/max size.
1949 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
1950 (apply): test to apply uses InsetCommandParams operator!=
1952 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
1953 (Read, Write, scanCommand, getCommand): moved functionality
1954 into InsetCommandParams.
1956 (getScreenLabel): made pure virtual
1957 new InsetCommandParams operators== and !=
1959 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
1960 c-tors based on InsetCommandParams. Removed others.
1961 * src/insets/insetinclude.[Ch]: ditto
1962 * src/insets/insetlabel.[Ch]: ditto
1963 * src/insets/insetparent.[Ch]: ditto
1964 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
1966 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
1967 insets derived from InsetCommand created using similar c-tors
1968 based on InsetCommandParams
1969 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
1970 * src/menus.C (ShowRefsMenu): ditto
1971 * src/paragraph.C (Clone): ditto
1972 * src/text2.C (SetCounter): ditto
1973 * src/lyxfunc.C (Dispatch) ditto
1974 Also recreated old InsetIndex behaviour exactly. Can now
1975 index-insert at the start of a paragraph and index-insert-last
1976 without launching the pop-up.
1978 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1980 * lib/lyxrc.example: mark te pdf options as non functional.
1982 * src/support/lstrings.C (strToInt): move initalization of tmpstr
1983 (isStrDbl): move tmpstr.end() out of loop.
1984 (strToDbl): move intialization of tmpstr
1985 (lowercase): return string const and move tmp.end() out of loop.
1986 (uppercase): return string const and move tmp.edn() out of loop.
1987 (prefixIs): add assertion
1992 (containsOnly): ditto
1993 (containsOnly): ditto
1994 (containsOnly): ditto
1995 (countChar): make last arg char not char const
1996 (token): return string const
1997 (subst): return string const, move tmp.end() out of loop.
1998 (subst): return string const, add assertion
1999 (strip): return string const
2000 (frontStrip): return string const, add assertion
2001 (frontStrip): return string const
2006 * src/support/lstrings.C: add inclde "LAssert.h"
2007 (isStrInt): move tmpstr.end() out of loop.
2009 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
2010 toollist.end() out of loop.
2011 (deactivate): move toollist.end() out of loop.
2012 (update): move toollist.end() out of loop.
2013 (updateLayoutList): move tc.end() out of loop.
2014 (add): move toollist.end() out of loop.
2016 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
2017 md.end() out of loop.
2019 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
2021 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
2024 * src/paragraph.C (Erase): move fontlist.end() out of loop.
2025 (Erase): move insetlist.end() out of loop.
2027 * src/lyx_sendfax_main.C: make show_logfile static and to take a
2028 ref to const string as first arg. Move initialization of some
2029 variables, whitespace changes.
2031 * src/kbmap.C (defkey): move table.end() out of loop.
2032 (kb_keymap): move table.end() out of loop.
2033 (findbinding): move table.end() out of loop.
2035 * src/MenuBackend.C (hasMenu): move end() out of loop.
2036 (getMenu): move end() out of loop.
2037 (getMenu): move menulist_.end() out of loop.
2039 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
2041 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
2044 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
2045 (getFromLyXName): move infotab.end() out of loop.
2047 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
2048 -fvtable-thunks -ffunction-sections -fdata-sections
2050 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
2052 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
2055 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
2057 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
2059 * src/frontends/xforms/FormCitation.[Ch],
2060 src/frontends/xforms/FormIndex.[Ch],
2061 src/frontends/xforms/FormToc.[Ch],
2062 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
2064 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
2066 * src/commandtags.h: renamed, created some flags for citation
2069 * src/lyx_gui_misc.C: stripped out old FD_index_form code
2071 * src/lyxfunc.C (dispatch): use signals to insert index entry
2073 * src/frontends/Dialogs.h: new signal createIndex
2075 * src/frontends/xforms/FormCommand.[Ch],
2076 src/frontends/xforms/FormCitation.[Ch],
2077 src/frontends/xforms/FormToc.[Ch],
2078 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
2080 * src/insets/insetindex.[Ch]: GUI-independent
2082 * src/frontends/xforms/FormIndex.[Ch],
2083 * src/frontends/xforms/forms/form_index.fd: xforms implementation
2086 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
2088 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
2089 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
2091 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2093 * src/insets/insetref.C (Latex): rewrite so that there is now
2094 question that a initialization is requested.
2096 * src/insets/insetcommand.h: reenable the hide signal
2098 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2100 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
2101 fix handling of shortcuts (many bugs :)
2102 (add_lastfiles): ditto.
2104 * lib/ui/default.ui: fix a few shortcuts.
2106 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
2108 * Makefile.am: Fix ``rpmdist'' target to return the exit
2109 status of the ``rpm'' command, instead of the last command in
2110 the chain (the ``rm lyx.xpm'' command, which always returns
2113 2000-08-02 Allan Rae <rae@lyx.org>
2115 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
2116 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
2117 * src/frontends/xforms/FormToc.C (FormToc): ditto
2119 * src/frontends/xforms/Makefile.am: A few forgotten files
2121 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
2122 Signals-not-copyable-problem Lars' started commenting out.
2124 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
2126 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2128 * src/insets/insetcommand.h: Signals is not copyable so anoter
2129 scheme for automatic hiding of forms must be used.
2131 * src/frontends/xforms/FormCitation.h: don't inerit from
2132 noncopyable, FormCommand already does that.
2133 * src/frontends/xforms/FormToc.h: ditto
2134 * src/frontends/xforms/FormUrl.h: ditto
2136 * src/frontends/xforms/FormCitation.C: add include <algorithm>
2138 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
2140 * src/insets/insetcommand.h (hide): new SigC::Signal0
2141 (d-tor) new virtual destructor emits hide signal
2143 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
2144 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
2146 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
2147 LOF and LOT. Inset is now GUI-independent
2149 * src/insets/insetloa.[Ch]: redundant
2150 * src/insets/insetlof.[Ch]: ditto
2151 * src/insets/insetlot.[Ch]: ditto
2153 * src/frontends/xforms/forms/form_url.fd: tweaked!
2154 * src/frontends/xforms/forms/form_citation.fd: ditto
2156 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
2157 dialogs dealing with InsetCommand insets
2159 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
2160 FormCommand base class
2161 * src/frontends/xforms/FormUrl.[Ch]: ditto
2163 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
2165 * src/frontends/xforms/FormToc.[Ch]: ditto
2167 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
2168 passed a generic InsetCommand pointer
2169 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
2171 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
2172 and modified InsetTOC class
2173 * src/buffer.C: ditto
2175 * forms/lyx.fd: strip out old FD_form_toc code
2176 * src/lyx_gui_misc.C: ditto
2177 * src/lyx_gui.C: ditto
2178 * src/lyx_cb.C: ditto
2179 * src/lyx.[Ch]: ditto
2181 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2183 * src/support/utility.hpp: tr -d '\r'
2185 2000-08-01 Juergen Vigna <jug@sad.it>
2187 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
2189 * src/commandtags.h:
2190 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
2191 LFUN_TABULAR_FEATURES.
2193 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
2194 LFUN_LAYOUT_TABULAR.
2196 * src/insets/insettabular.C (getStatus): implemented helper function.
2198 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
2200 2000-07-31 Juergen Vigna <jug@sad.it>
2202 * src/text.C (draw): fixed screen update problem for text-insets.
2204 * src/text2.C (SetParagrpah): call an update of the inset-owner when
2205 something changed probably this has to be added in various other
2208 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
2210 2000-07-31 Baruch Even <baruch.even@writeme.com>
2212 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
2213 templates to satisfy compaq cxx.
2216 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2218 * src/support/translator.h (equal_1st_in_pair::operator()): take
2219 const ref pair_type as arg.
2220 (equal_2nd_in_pair::operator()): ditto
2221 (Translator::~Translator): remove empty d-tor.
2223 * src/graphics/GraphicsCache.C: move include config.h to top, also
2224 put initialization of GraphicsCache::singleton here.
2225 (~GraphicsCache): move here
2226 (addFile): take const ref as arg
2229 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
2231 * src/BufferView2.C (insertLyXFile): change te with/without header
2234 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2236 * src/frontends/xforms/FormGraphics.C (apply): add some
2237 static_cast. Not very nice, but required by compaq cxx.
2239 * src/frontends/xforms/RadioButtonGroup.h: include header
2240 <utility> instead of <pair.h>
2242 * src/insets/insetgraphicsParams.C: add using directive.
2243 (readResize): change return type to void.
2244 (readOrigin): ditto.
2246 * src/lyxfunc.C (getStatus): add missing break for build-program
2247 function; add test for Literate for export functions.
2249 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
2250 entries in Options menu.
2252 2000-07-31 Baruch Even <baruch.even@writeme.com>
2254 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
2255 protect against auto-allocation; release icon when needed.
2257 2000-07-31 Matej Cepl <CeplM@seznam.cz>
2259 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
2260 on usual typewriter.
2262 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
2263 earlier czech.kmap), useful only for programming.
2265 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2267 * src/frontends/xforms/FormCitation.h: fix conditioning around
2270 2000-07-31 Juergen Vigna <jug@sad.it>
2272 * src/frontends/xforms/FormTabular.C (local_update): changed
2273 radio_linebreaks to radio_useparbox and added radio_useminipage.
2275 * src/tabular.C: made support for using minipages/parboxes.
2277 * src/bufferlist.C (QwriteAll): small fix for asking for save.
2279 * src/insets/insetgraphics.C (draw): just draw the inset so that the
2281 (descent): so the cursor is in the middle.
2282 (width): bit smaller box.
2284 * src/insets/insetgraphics.h: added display() function.
2286 2000-07-31 Baruch Even <baruch.even@writeme.com>
2288 * src/frontends/Dialogs.h: Added showGraphics signals.
2290 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
2291 xforms form definition of the graphics dialog.
2293 * src/frontends/xforms/FormGraphics.h:
2294 * src/frontends/xforms/FormGraphics.C: Added files, the
2295 GUIndependent code of InsetGraphics
2297 * src/insets/insetgraphics.h:
2298 * src/insets/insetgraphics.C: Major writing to make it work.
2300 * src/insets/insetgraphicsParams.h:
2301 * src/insets/insetgraphicsParams.C: Added files, parameter passing
2302 struct between InsetGraphics and GUI.
2304 * src/LaTeXFeatures.h:
2305 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
2306 support for graphicx package.
2308 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
2309 for the graphics inset.
2311 * src/support/translator.h: Added file, used in
2312 InsetGraphicsParams. this is a template to translate between two
2315 * src/frontends/xforms/RadioButtonGroup.h:
2316 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
2317 way to easily control a radio button group.
2319 2000-07-28 Juergen Vigna <jug@sad.it>
2321 * src/insets/insettabular.C (LocalDispatch):
2322 (TabularFeatures): added support for lyx-functions of tabular features.
2323 (cellstart): refixed this function after someone wrongly changed it.
2325 * src/commandtags.h:
2326 * src/LyXAction.C (init): added support for tabular-features
2328 2000-07-28 Allan Rae <rae@lyx.org>
2330 * src/frontends/xforms/FormPreferences.C (build): Setup input return
2331 checking. NOTE: It seems that pressing ESC to cancel the dialog also
2332 triggers the callback for input checking. As a result we sometimes get
2333 "LyX: This shouldn't happen..." printed to cerr.
2334 (input): Started using status variable since I only free() on
2335 destruction. Some input checking for paths and font sizes.
2337 * src/frontends/xforms/FormPreferences.h: Use status to control
2338 activation of Ok and Apply
2340 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
2341 callback. Also resized to stop segfaults with 0.88. The problem is
2342 that xforms-0.88 requires the folder to be wide enough to fit all the
2343 tabs. If it isn't it causes all sorts of problems.
2345 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
2347 * src/frontends/xforms/forms/README: Reflect reality.
2349 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
2350 * src/frontends/xforms/forms/makefile: ditto.
2352 * src/commandtags.h: Get access to new Preferences dialog
2353 * src/LyXAction.C: ditto
2354 * src/lyxfunc.C: ditto
2355 * lib/ui/default.ui: ditto
2357 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2359 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
2361 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
2364 * src/frontends/xforms/form_url.[Ch]: added.
2366 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2368 * src/insets/insetbib.h: fixed bug in previous commit
2370 * src/frontends/xforms/FormUrl.h: ditto
2372 * src/frontends/xforms/FormPrint.h: ditto
2374 * src/frontends/xforms/FormPreferences.h: ditto
2376 * src/frontends/xforms/FormCopyright.h: ditto
2378 * src/frontends/xforms/FormCitation.C: ditto
2380 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
2381 private copyconstructor and private default contructor
2383 * src/support/Makefile.am: add utility.hpp
2385 * src/support/utility.hpp: new file from boost
2387 * src/insets/insetbib.h: set owner in clone
2389 * src/frontends/xforms/FormCitation.C: added missing include
2392 * src/insets/form_url.[Ch]: removed
2394 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
2396 * development/lyx.spec.in
2397 * Makefile.am: Fix buglet for LyX RPM generation resulting from
2398 file/directory re-organization.
2400 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
2402 * src/insets/insetcommand.[Ch]: moved the string data and
2403 associated manipulation methods into a new stand-alone class
2404 InsetCommandParams. This class has two additional methods
2405 getAsString() and setFromString() allowing the contents to be
2406 moved around as a single string.
2407 (addContents) method removed.
2408 (setContents) method no longer virtual.
2410 * src/buffer.C (readInset): made use of new InsetCitation,
2411 InsetUrl constructors based on InsetCommandParams.
2413 * src/commandtags.h: add LFUN_INSERT_URL
2415 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
2416 independent InsetUrl and use InsetCommandParams to extract
2417 string info and create new Insets.
2419 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
2421 * src/frontends/xforms/FormCitation.C (apply): uses
2424 * src/frontends/xforms/form_url.C
2425 * src/frontends/xforms/form_url.h
2426 * src/frontends/xforms/FormUrl.h
2427 * src/frontends/xforms/FormUrl.C
2428 * src/frontends/xforms/forms/form_url.fd: new files
2430 * src/insets/insetcite.[Ch]: removed unused constructors.
2432 * src/insets/insetinclude.[Ch]: no longer store filename
2434 * src/insets/inseturl.[Ch]: GUI-independent.
2436 2000-07-26 Juergen Vigna <jug@sad.it>
2437 * renamed frontend from gtk to gnome as it is that what is realized
2438 and did the necessary changes in the files.
2440 2000-07-26 Marko Vendelin <markov@ioc.ee>
2442 * configure.in: cleaning up gnome configuration scripts
2444 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2446 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
2447 shortcuts syndrom by redrawing them explicitely (a better solution
2448 would be appreciated).
2450 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
2452 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
2455 * src/lyx_cb.C (MenuExport): change html export to do the right
2456 thing depending of the document type (instead of having
2457 html-linuxdoc and html-docbook).
2458 * src/lyxfunc.C (getStatus): update for html
2459 * lib/ui/default.ui: simplify due to the above change.
2460 * src/menus.C (ShowFileMenu): update too (in case we need it).
2462 * src/MenuBackend.C (read): if a menu is defined twice, add the
2463 new entries to the exiting one.
2465 2000-07-26 Juergen Vigna <jug@sad.it>
2467 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
2469 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
2470 and return a bool if it did actual save the file.
2471 (AutoSave): don't autosave a unnamed doc.
2473 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
2474 check if this is an UNNAMED new file and react to it.
2475 (newFile): set buffer to unnamed and change to not mark a new
2476 buffer dirty if I didn't do anything with it.
2478 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
2480 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2482 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
2483 friend as per Angus's patch posted to lyx-devel.
2485 * src/ext_l10n.h: updated
2487 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
2488 gettext on the style string right before inserting them into the
2491 * autogen.sh: add code to extract style strings form layout files,
2492 not good enough yet.
2494 * src/frontends/gtk/.cvsignore: add MAKEFILE
2496 * src/MenuBackend.C (read): run the label strings through gettext
2497 before storing them in the containers.
2499 * src/ext_l10n.h: new file
2501 * autogen.sh : generate the ext_l10n.h file here
2503 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2505 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
2508 * lib/ui/default.ui: fix a couple of typos.
2510 * config/gnome/gtk.m4: added (and added to the list of files in
2513 * src/insets/insetinclude.C (unique_id): fix when we are using
2514 lyxstring instead of basic_string<>.
2515 * src/insets/insettext.C (LocalDispatch): ditto.
2516 * src/support/filetools.C: ditto.
2518 * lib/configure.m4: create the ui/ directory if necessary.
2520 * src/LyXView.[Ch] (updateToolbar): new method.
2522 * src/BufferView_pimpl.C (buffer): update the toolbar when
2523 opening/closing buffer.
2525 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2527 * src/LyXAction.C (getActionName): enhance to return also the name
2528 and options of pseudo-actions.
2529 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
2531 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
2532 as an example of what is possible). Used in File->Build too (more
2533 useful) and in the import/export menus (to mimick the complicated
2534 handling of linuxdoc and friends). Try to update all the entries.
2536 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
2539 * src/MenuBackend.C (read): Parse the new OptItem tag.
2541 * src/MenuBackend.h: Add a new optional_ data member (used if the
2542 entry should be omitted when the lyxfunc is disabled).
2544 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
2545 function, used as a shortcut.
2546 (create_submenu): align correctly the shortcuts on the widest
2549 * src/MenuBackend.h: MenuItem.label() only returns the label of
2550 the menu without shortcut; new method shortcut().
2552 2000-07-14 Marko Vendelin <markov@ioc.ee>
2554 * src/frontends/gtk/Dialogs.C:
2555 * src/frontends/gtk/FormCopyright.C:
2556 * src/frontends/gtk/FormCopyright.h:
2557 * src/frontends/gtk/Makefile.am: added these source-files for the
2558 Gtk/Gnome support of the Copyright-Dialog.
2560 * src/main.C: added Gnome::Main initialization if using
2561 Gtk/Gnome frontend-GUI.
2563 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
2565 * config/gnome/aclocal-include.m4
2566 * config/gnome/compiler-flags.m4
2567 * config/gnome/curses.m4
2568 * config/gnome/gnome--.m4
2569 * config/gnome/gnome-bonobo-check.m4
2570 * config/gnome/gnome-common.m4
2571 * config/gnome/gnome-fileutils.m4
2572 * config/gnome/gnome-ghttp-check.m4
2573 * config/gnome/gnome-gnorba-check.m4
2574 * config/gnome/gnome-guile-checks.m4
2575 * config/gnome/gnome-libgtop-check.m4
2576 * config/gnome/gnome-objc-checks.m4
2577 * config/gnome/gnome-orbit-check.m4
2578 * config/gnome/gnome-print-check.m4
2579 * config/gnome/gnome-pthread-check.m4
2580 * config/gnome/gnome-support.m4
2581 * config/gnome/gnome-undelfs.m4
2582 * config/gnome/gnome-vfs.m4
2583 * config/gnome/gnome-x-checks.m4
2584 * config/gnome/gnome-xml-check.m4
2585 * config/gnome/gnome.m4
2586 * config/gnome/gperf-check.m4
2587 * config/gnome/gtk--.m4
2588 * config/gnome/linger.m4
2589 * config/gnome/need-declaration.m4: added configuration scripts
2590 for Gtk/Gnome frontend-GUI
2592 * configure.in: added support for the --with-frontend=gtk option
2594 * autogen.sh: added config/gnome/* to list of config-files
2596 * acconfig.h: added define for GTKGUI-support
2598 * config/lyxinclude.m4: added --with-frontend[=value] option value
2599 for Gtk/Gnome frontend-GUI support.
2601 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2603 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
2607 * src/paragraph.C (GetChar): remove non-const version
2609 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
2610 (search_kw): use it.
2612 * src/lyx_main.C (init): if "preferences" exist, read that instead
2614 (ReadRcFile): return bool if the file could be read ok.
2615 (ReadUIFile): add a check to see if lex file is set ok.
2617 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
2618 bastring can be used instead of lyxstring (still uses the old code
2619 if std::string is good enough or if lyxstring is used.)
2621 * src/encoding.C: make the arrays static, move ininle functions
2623 * src/encoding.h: from here.
2625 * src/buffer.C: have last_isnet_read as a file scope variable for now.
2626 (parseSingleLyXformat2Token): move inset parsing to separate method
2627 (readInset): new private method
2629 * src/Variables.h: remove virtual from get().
2631 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
2632 access to NEW_INSETS and NEW_TABULAR
2634 * src/MenuBackend.h: remove superfluous forward declaration of
2635 MenuItem. Add documentations tags "///", remove empty MenuItem
2636 destructor, remove private default contructor.
2638 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
2640 (read): more string mlabel and mname to where they are used
2641 (read): remove unused variables mlabel and mname
2642 (defaults): unconditional clear, make menusetup take advantage of
2643 add returning Menu &.
2645 * src/LyXView.h: define NEW_MENUBAR as default
2647 * src/LyXAction.C: include lyxparagraph.h temporary to get access
2648 to NEW_INSETS and NEW_TABULAR.
2649 (init): commetn out some funcs that is obsolete when NEW_INSETS is
2650 defined. Change some of the "xxxx-inset-insert" functions names to
2653 * several files: more enahncements to NEW_INSETS and the resulting
2656 * lib/lyxrc.example (\date_insert_format): move to misc section
2658 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
2659 bastring and use AC_CACHE_CHECK.
2660 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
2661 the system have the newest methods. uses AC_CACHE_CHECK
2662 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
2663 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
2664 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
2666 * configure.in: add LYX_CXX_GOOD_STD_STRING
2668 * acinclude.m4: recreated
2670 2000-07-24 Amir Karger
2672 * README: add Hebrew, Arabic kmaps
2675 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2677 * src/buffer.C (writeFileAscii): Define actcell as an int instead
2680 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2682 * Lot of files: add pragma interface/implementation.
2684 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
2686 * lib/ui/default.ui: new file (ans new directory). Contains the
2687 default menu and toolbar.
2689 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
2690 global space. Toolbars are now read (as menus) in ui files.
2692 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
2694 * src/lyxfunc.C (getStatus): do not exit immediately if a command
2695 is disabled because the document is read-only. We want to have the
2696 toggle state of the function anyway.
2697 (getStatus): add code for LFUN_VC* functions (mimicking what is
2698 done in old-style menus)
2700 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
2701 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
2703 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
2704 * src/BufferView_pimpl.C: ditto.
2705 * src/lyxfunc.C: ditto.
2707 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
2708 default). This replaces old-style menus by new ones.
2710 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
2711 MenuItem. Contain the data structure of a menu.
2713 * src/insets/insettext.C: use LyXView::setLayout instead of
2714 accessing directly the toolbar combox.
2715 * src/lyxfunc.C (Dispatch): ditto.
2717 * src/LyXView.C (setLayout): new method, which just calls
2718 Toolbar::setLayout().
2719 (updateLayoutChoice): move part of this method in Toolbar.
2721 * src/toolbar.[Ch]: removed.
2723 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
2724 implementation the toolbar.
2726 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
2727 the toolbar. It might make sense to merge it with ToolbarDefaults
2729 (setLayout): new function.
2730 (updateLayoutList): ditto.
2731 (openLayoutList): ditto.
2733 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
2734 xforms implementation of the toolbar.
2735 (get_toolbar_func): comment out, since I do not
2736 know what it is good for.
2738 * src/ToolbarDefaults.h: Add the ItemType enum.
2740 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
2741 for a list of allocated C strings. Used in Menubar xforms
2742 implementation to avoid memory leaks.
2744 * src/support/lstrings.[Ch] (uppercase): new version taking and
2748 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
2749 * lib/bind/emacs.bind: ditto.
2751 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2753 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
2754 forward decl of LyXView.
2756 * src/toolbar.C (toolbarItem): moved from toolbar.h
2757 (toolbarItem::clean): ditto
2758 (toolbarItem::~toolbarItem): ditto
2759 (toolbarItem::operator): ditto
2761 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
2763 * src/paragraph.h: control the NEW_TABULAR define from here
2765 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
2766 USE_TABULAR_INSETS to NEW_TABULAR
2768 * src/ToolbarDefaults.C: add include "lyxlex.h"
2770 * files using the old table/tabular: use NEW_TABULAR to control
2771 compilation of old tabular stuff.
2773 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
2776 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
2777 planemet in reading of old style floats, fix the \end_deeper
2778 problem when reading old style floats.
2780 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2782 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
2784 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
2786 * lib/bind/sciword.bind: updated.
2788 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2790 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
2791 layout write problem
2793 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2795 * src/Makefile.am (INCLUDES): remove image directory from include
2798 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
2799 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
2801 * src/LyXView.C (create_form_form_main): read the application icon
2804 * lib/images/*.xpm: change the icons to use transparent color for
2807 * src/toolbar.C (update): change the color of the button when it
2810 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2812 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
2813 setting explicitely the minibuffer.
2814 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
2816 * src/LyXView.C (showState): new function. Shows font information
2817 in minibuffer and update toolbar state.
2818 (LyXView): call Toolbar::update after creating the
2821 * src/toolbar.C: change toollist to be a vector instead of a
2823 (BubbleTimerCB): get help string directly from the callback
2824 argument of the corresponding icon (which is the action)
2825 (set): remove unnecessary ugliness.
2826 (update): new function. update the icons (depressed, disabled)
2827 depending of the status of the corresponding action.
2829 * src/toolbar.h: remove help in toolbarItem
2831 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
2833 * src/Painter.C (text): Added code for using symbol glyphs from
2834 iso10646 fonts. Currently diabled.
2836 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
2839 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
2840 magyar,turkish and usorbian.
2842 * src/paragraph.C (isMultiLingual): Made more efficient.
2844 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
2847 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
2848 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
2849 Also changed the prototype to "bool math_insert_greek(char)".
2851 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2853 * lots of files: apply the NEW_INSETS on all code that will not be
2854 needed when we move to use the new insets. Enable the define in
2855 lyxparagrah.h to try it.
2857 * src/insets/insettabular.C (cellstart): change to be a static
2859 (InsetTabular): initialize buffer in the initializer list.
2861 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
2863 * src/frontends/xforms/FormPrint.[Ch] : moved #include
2864 form_print.h out of the header file. Replaced with forward
2865 declarations of the relevant struct.
2867 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
2870 * src/commandtags.h: do not include "debug.h" which does not
2871 belong there. #include it in some other places because of this
2874 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2876 * src/insets/insetcaption.C: add a couple "using" directives.
2878 * src/toolbar.C (add): get the help text directly from lyxaction.
2880 (setPixmap): new function. Loads from disk and sets a pixmap on a
2881 botton; the name of the pixmap file is derived from the command
2884 * src/toolbar.h: remove members isBitmap and pixmap from
2887 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
2888 * lib/images/: move many files from images/banner.xpm.
2890 * src/lyx_gui.C (create_forms): read banner pixmap from file.
2892 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
2893 * src/toolbar.C: ditto.
2894 * configure.in: ditto.
2895 * INSTALL: document.
2897 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
2898 the spellchecker popup is closed from the WM.
2900 2000-07-19 Juergen Vigna <jug@sad.it>
2902 * src/insets/insetfloat.C (Write): small fix because we use the
2903 insetname for the type now!
2905 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
2907 * src/frontends/xforms/forms/form_citation.fd: object sizes are
2910 * src/frontends/Dialogs.h: removed hideCitation signal
2912 * src/insets/insetcite.h: added hide signal
2914 * src/insets/insetcite.C (~InsetCitation): emits new signal
2915 (getScreenLabel): "intelligent" label should now fit on the screen!
2917 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
2919 * src/frontends/xforms/FormCitation.C (showInset): connects
2920 hide() to the inset's hide signal
2921 (show): modified to use fl_set_object_position rather than
2922 fl_set_object_geometry wherever possible
2924 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2926 * src/insets/lyxinset.h: add caption code
2928 * src/insets/insetfloat.C (type): new method
2930 * src/insets/insetcaption.C (Write): new method
2932 (LyxCode): new method
2934 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
2935 to get it right together with using the FloatList.
2937 * src/commandtags.h: add LFUN_INSET_CAPTION
2938 * src/lyxfunc.C (Dispatch): handle it
2940 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
2943 * src/Variables.[Ch]: make expand take a const reference, remove
2944 the destructor, some whitespace changes.
2946 * src/LyXAction.C (init): add caption-inset-insert
2948 * src/FloatList.C (FloatList): update the default floats a bit.
2950 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2952 * src/Variables.[Ch]: new files. Intended to be used for language
2953 specific strings (like \chaptername) and filename substitution in
2956 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
2958 * lib/kbd/american.kmap: update
2960 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
2962 * src/bufferparams.[Ch]: remove member allowAccents.
2964 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
2966 * src/LaTeXLog.C: use the log_form.h header.
2967 * src/lyx_gui.C: ditto.
2968 * src/lyx_gui_misc.C: ditto.
2969 * src/lyxvc.h: ditto.
2971 * forms/log_form.fd: new file, created from latexoptions.fd. I
2972 kept the log popup and nuked the options form.
2974 * src/{la,}texoptions.[Ch]: removed.
2975 * src/lyx_cb.C (LaTeXOptions): ditto
2977 * src/lyx_gui.C (create_forms): do not handle the
2978 fd_latex_options form.
2980 2000-07-18 Juergen Vigna <jug@sad.it>
2982 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
2983 name of the inset so that it can be requested outside (text2.C).
2985 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
2988 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2990 * src/mathed/formula.h (ConvertFont): constify
2992 * src/mathed/formula.C (Read): add warning if \end_inset is not
2993 found on expected place.
2995 * src/insets/lyxinset.h (ConvertFont): consify
2997 * src/insets/insetquotes.C (ConvertFont): constify
2998 * src/insets/insetquotes.h: ditto
3000 * src/insets/insetinfo.h: add labelfont
3002 * src/insets/insetinfo.C (InsetInfo): set the labelfont
3003 (ascent): use labelfont
3007 (Write): make .lyx file a bit nicer
3009 * src/insets/insetfloat.C (Write): simplify somewhat...
3010 (Read): add warning if arg is not found
3012 * src/insets/insetcollapsable.C: add using std::max
3013 (Read): move string token and add warning in arg is not found
3014 (draw): use std::max to get the right ty
3015 (getMaxWidth): simplify by using std::max
3017 * src/insets/insetsection.h: new file
3018 * src/insets/insetsection.C: new file
3019 * src/insets/insetcaption.h: new file
3020 * src/insets/insetcaption.C: new file
3022 * src/insets/inset.C (ConvertFont): constify signature
3024 * src/insets/Makefile.am (libinsets_la_SOURCES): add
3025 insetcaption.[Ch] and insetsection.[Ch]
3027 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
3028 uses to use LABEL_COUNTER_CHAPTER instead.
3029 * src/text2.C (SetCounter): here
3031 * src/counters.h: new file
3032 * src/counters.C: new file
3033 * src/Sectioning.h: new file
3034 * src/Sectioning.C: new file
3036 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
3038 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3040 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
3043 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
3046 2000-07-17 Juergen Vigna <jug@sad.it>
3048 * src/tabular.C (Validate): check if array-package is needed.
3049 (SetVAlignment): added support for vertical alignment.
3050 (SetLTFoot): better support for longtable header/footers
3051 (Latex): modified to support added features.
3053 * src/LaTeXFeatures.[Ch]: added array-package.
3055 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
3057 * src/lyx_gui.C (LyXGUI): make sure that the height is large
3060 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
3062 * configure.in: do not forget to put a space after -isystem.
3064 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
3066 * lib/kbd/arabic.kmap: a few fixes.
3068 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3070 * some whitespace chagnes to a number of files.
3072 * src/support/DebugStream.h: change to make it easier for
3073 doc++ to parse correctly.
3074 * src/support/lyxstring.h: ditto
3076 * src/mathed/math_utils.C (compara): change to have only one
3078 (MathedLookupBOP): change because of the above.
3080 * src/mathed/math_delim.C (math_deco_compare): change to have only
3082 (search_deco): change becasue of the above.
3084 * src/insets/insettabular.C (DrawCellSelection): use std::swap
3085 instead of manually coded one.
3087 * src/insets/insetquotes.C (Read): read the \end_inset too
3089 * src/insets/insetlatex.h: remove file
3090 * src/insets/insetlatex.C: remove file
3092 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
3094 (InsetPrintIndex): remove destructor
3096 * src/insets/insetinclude.h: remove default constructor
3098 * src/insets/insetfloat.C: work to make it work better
3100 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
3102 * src/insets/insetcite.h (InsetCitation): remove default constructor
3104 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
3106 * src/text.C (GetColumnNearX): comment out some currently unused code.
3108 * src/paragraph.C (writeFile): move some initializations closer to
3110 (CutIntoMinibuffer): small change to use new matchIT operator
3114 (InsertInset): ditto
3117 (InsetIterator): ditto
3118 (Erase): small change to use new matchFT operator
3120 (GetFontSettings): ditto
3121 (HighestFontInRange): ditto
3124 * src/lyxparagraph.h: some chars changed to value_type
3125 (matchIT): because of some stronger checking (perhaps too strong)
3126 in SGI STL, the two operator() unified to one.
3129 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
3131 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
3132 the last inset read added
3133 (parseSingleLyXformat2Token): some more (future) compability code added
3134 (parseSingleLyXformat2Token): warning about solitary \end_inset added
3135 (parseSingleLyXformat2Token): set last_inset_read
3136 (parseSingleLyXformat2Token): more code to read new "Float" correctly
3137 (parseSingleLyXformat2Token): don't double intializw string next_token
3139 * src/TextCache.C (text_fits::operator()): add const's to the signature
3140 (has_buffer::operator()): ditto
3142 * src/Floating.h: add some comments on the class
3144 * src/FloatList.[Ch] (typeExist): new method
3147 * src/BackStack.h: added default constructor, wanted by Gcc.
3149 2000-07-14 Juergen Vigna <jug@sad.it>
3151 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
3153 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
3155 * src/insets/insettabular.C (resizeLyXText): need this to be able to
3156 do a redraw when the window is resized!
3157 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
3159 * src/insets/insettext.C (resizeLyXText): added function to correctly
3160 being able to resize the LyXWindow.
3162 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
3164 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
3166 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
3167 crashes when closing dialog to a deleted inset.
3169 * src/insets/insetcite.[Ch] (Edit) : the return of this former
3170 method! Now similar to other insets.
3172 2000-07-13 Juergen Vigna <jug@sad.it>
3174 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
3176 * lib/examples/Literate.lyx: small patch!
3178 * src/insets/insetbib.C (Read): added this function because of wrong
3179 Write (without [begin|end]_inset).
3181 2000-07-11 Juergen Vigna <jug@sad.it>
3183 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
3184 as the insertInset could not be good!
3186 * src/screen.C (ToggleSelection): fixed toggle selection bug as
3187 the bool param should not be last.
3189 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3191 * sigc++/configure.in: fix bug in threading-related code (Yes, I
3192 did submit that to Karl).
3194 * configure.in: use -isystem instead of -I for X headers. This
3195 fixes a problem on solaris with a recent gcc;
3196 put the front-end code after the X detection code;
3197 configure in sigc++ before lib/
3199 * src/lyx_main.C (commandLineHelp): remove -display from command
3202 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
3204 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
3205 Also put in Makefile rules for building the ``listerrors''
3206 program for parsing errors from literate programs written in LyX.
3208 * lib/build-listerrors: Added small shell script as part of compile
3209 process. This builds a working ``listerrors'' binary if noweb is
3210 installed and either 1) the VNC X server is installed on the machine,
3211 or 2) the user is compiling from within a GUI. The existence of a GUI
3212 is necessary to use the ``lyx --export'' feature for now. This
3213 hack can be removed once ``lyx --export'' no longer requires a GUI to
3216 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
3218 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
3219 now passed back correctly from gcc and placed "under" error
3220 buttons in a Literate LyX source.
3222 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3224 * src/text.C (GetColumnNearX): Better behavior when a RTL
3225 paragraph is ended by LTR text.
3227 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
3230 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3232 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
3233 true when clipboard is empty.
3235 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3237 * text.C (Backspace): Prevent rebreaking of a row if it is the last
3238 row of the paragraph.
3239 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
3240 to prevent calculation of bidi tables
3242 2000-07-07 Juergen Vigna <jug@sad.it>
3244 * src/screen.C (ToggleSelection): added y_offset and x_offset
3247 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
3250 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
3252 * src/insets/insettext.C: fixed Layout-Display!
3254 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3256 * configure.in: add check for strings.h header.
3258 * src/spellchecker.C: include <strings.h> in order to have a
3259 definition for bzero().
3261 2000-07-07 Juergen Vigna <jug@sad.it>
3263 * src/insets/insettext.C (draw): set the status of the bv->text to
3264 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
3266 * src/screen.C (DrawOneRow):
3267 (DrawFromTo): redraw the actual row if something has changed in it
3270 * src/text.C (draw): call an update of the toplevel-inset if something
3271 has changed inside while drawing.
3273 * src/lyxtext.h: added CHANGED_IN_DRAW status.
3275 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
3277 * src/insets/insetbib.[Ch] (callback) new method, moving callback
3278 processing inside class.
3280 * src/insets/insetindex.[Ch] (callback) new method, moving callback
3281 processing inside class.
3283 * src/insets/insetindex.h new struct Holder, consistent with other
3286 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
3287 citation dialog from main code and placed it in src/frontends/xforms.
3288 Dialog launched through signals instead of callbacks
3290 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
3292 * lyx.man: update the options description.
3294 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
3296 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
3297 handle neg values, set min width to 590, add doc about -display
3299 2000-07-05 Juergen Vigna <jug@sad.it>
3301 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
3302 calls to BufferView *.
3304 * src/insets/insettext.C (checkAndActivateInset): small fix non
3305 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
3307 * src/insets/insetcommand.C (Read): Fixed as insets should read till
3308 their \end_inset token!
3310 2000-07-04 edscott <edscott@imp.mx>
3312 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
3313 lib/lyxrc.example: added option \wheel_jump
3315 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
3317 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
3318 remove support for -width,-height,-xpos and -ypos.
3320 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
3322 * src/encoding.[Ch]: New files.
3324 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
3325 (text): Call to the underline() method only when needed.
3327 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
3329 * src/buffer.C (makeLaTeXFile): Compute automatically the input
3330 encoding(s) for the document.
3332 * src/bufferparams.C (BufferParams): Changed default value of
3335 * src/language.C (newLang): Removed.
3336 (items[]): Added encoding information for all defined languages.
3338 * src/lyx_gui.C (create_forms): Added "auto" option to the input
3339 encoding choice button.
3341 * src/lyxrc.h (font_norm_type): New member variable.
3342 (set_font_norm_type): New method.
3344 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
3345 paragraphs with different encodings.
3347 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
3348 (TransformChar): Changed to work correctly with Arabic points.
3349 (draw): Added support for drawing Arabic points.
3350 (draw): Removed code for drawing underbars (this is done by
3353 * src/support/textutils.h (IsPrintableNonspace): New function.
3355 * src/BufferView_pimpl.h: Added "using SigC::Object".
3356 * src/LyXView.h: ditto.
3358 * src/insets/insetinclude.h (include_label): Changed to mutable.
3360 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3362 * src/mathed/math_iter.h: remove empty destructor
3364 * src/mathed/math_cursor.h: remove empty destructor
3366 * src/insets/lyxinset.h: add THEOREM_CODE
3368 * src/insets/insettheorem.[Ch]: new files
3370 * src/insets/insetminipage.C: (InsertInset): remove
3372 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
3374 (InsertInset): remove
3376 * src/insets/insetlist.C: (InsertList): remove
3378 * src/insets/insetfootlike.[Ch]: new files
3380 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
3383 (InsertInset): ditto
3385 * src/insets/insetert.C: remove include Painter.h, reindent
3386 (InsertInset): move to header
3388 * src/insets/insetcollapsable.h: remove explicit from default
3389 contructor, remove empty destructor, add InsertInset
3391 * src/insets/insetcollapsable.C (InsertInset): new func
3393 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3395 * src/vspace.h: add explicit to constructor
3397 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
3398 \textcompwordmark, please test this.
3400 * src/lyxrc.C: set ascii_linelen to 65 by default
3402 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
3404 * src/commandtags.h: add LFUN_INSET_THEOREM
3406 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
3407 (makeLinuxDocFile): remove _some_ of the nice logic
3408 (makeDocBookFile): ditto
3410 * src/Painter.[Ch]: (~Painter): removed
3412 * src/LyXAction.C (init): entry for insettheorem added
3414 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
3416 (deplog): code to detect files generated by LaTeX, needs testing
3419 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3421 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
3423 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3425 * src/LaTeX.C (deplog): Add a check for files that are going to be
3426 created by the first latex run, part of the project to remove the
3429 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
3430 contents to the extension list.
3432 2000-07-04 Juergen Vigna <jug@sad.it>
3434 * src/text.C (NextBreakPoint): added support for needFullRow()
3436 * src/insets/lyxinset.h: added needFullRow()
3438 * src/insets/insetcollapsable.C: redone now this uses a text-inset
3441 * src/insets/insettext.C: lots of changes for update!
3443 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
3445 * src/LaTeXFeatures.h: add a missing std:: qualifier.
3447 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
3449 * src/insets/insetinclude.C (InsetInclude): fixed
3450 initialization of include_label.
3451 (unique_id): now returns a string.
3453 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
3455 * src/LaTeXFeatures.h: new member IncludedFiles, for
3456 a map of key, included file name.
3458 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
3459 with the included files for inclusion in SGML preamble,
3460 i. e., linuxdoc and docbook.
3463 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
3464 nice (is the generated linuxdoc code to be exported?), that
3465 allows to remove column, and only_body that will be true for
3466 slave documents. Insets are allowed inside SGML font type.
3467 New handling of the SGML preamble for included files.
3468 (makeDocBookFile): the same for docbook.
3470 * src/insets/insetinclude.h:
3471 * src/insets/insetinclude.C (Validate): keeps a list of included files.
3473 (DocBook): new export methods.
3475 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
3476 and makeDocBookFile.
3478 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
3479 formats to export with command line argument -x.
3481 2000-06-29 Juergen Vigna <jug@sad.it>
3483 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
3484 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
3486 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
3487 region could already been cleared by an inset!
3489 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3491 * src/BufferView_pimpl.h: remove member variables lyx_focus and
3494 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
3496 (cursorToggle): remove special handling of lyx focus.
3498 2000-06-28 Juergen Vigna <jug@sad.it>
3500 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
3503 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3505 * src/insets/insetindex.C (Edit): add a callback when popup is
3508 * src/insets/insettext.C (LocalDispatch):
3509 * src/insets/insetmarginal.h:
3510 * src/insets/insetlist.h:
3511 * src/insets/insetfoot.h:
3512 * src/insets/insetfloat.h:
3513 * src/insets/insetert.h: add a missing std:: qualifier.
3515 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3517 * src/support/lyxsum.C (sum): '\0' teminate file read when using
3520 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
3522 * src/insets/insettext.C (Read): remove tmptok unused variable
3523 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
3524 (InsertInset): change for new InsetInset code
3526 * src/insets/insettext.h: add TEXT inline method
3528 * src/insets/insettext.C: remove TEXT macro
3530 * src/insets/insetmarginal.C (Write): new method
3531 (Latex): change output slightly
3533 * src/insets/insetfoot.C (Write): new method
3534 (Latex): change output slightly (don't use endl when no need)
3536 * src/insets/insetert.C (Write): new method
3538 * src/insets/insetcollapsable.h: make button_length, button_top_y
3539 and button_bottm_y protected.
3541 * src/insets/insetcollapsable.C (Write): simplify code by using
3542 tostr. Also do not output the float name, the children class
3543 should to that to get control over own arguments
3545 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
3546 src/insets/insetminipage.[Ch]:
3549 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3551 * src/lyxfunc.C (Dispatch): cases for new insets/commands
3553 * src/Makefile.am (lyx_SOURCES): add the new files
3555 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
3556 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
3557 * src/commandtags.h: ditto
3559 * src/LaTeXFeatures.h: add a std::set of used floattypes
3561 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
3563 * src/FloatList.[Ch] src/Floating.h: new files
3565 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
3567 * src/lyx_cb.C (TableApplyCB): ditto
3569 * src/text2.C: ditto
3570 * src/buffer.C (SimpleLinuxDocOnePar): ditto
3571 (parseSingleLyXformat2Token): ditto + add code for
3572 backwards compability for old float styles + add code for new insets
3574 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
3576 (InsertInset(size_type, Inset *, LyXFont)): new method
3577 (InsetChar(size_type, char)): changed to use the other InsetChar
3578 with a LyXFont(ALL_INHERIT).
3579 (InsetInset(size_type, Inset*)): changed to use InsetChar to
3580 insert the META_INSET.
3582 * sigc++/thread.cc (Privete<int>::operator int&): move definition
3584 * sigc++/thread.h (Threads): from here
3586 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
3587 definition out of line
3588 * sigc++/scope.h: from here
3590 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3592 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
3593 is specified (adapted from a patch from edscott <edscott@imp.mx>).
3595 * Makefile.am (bindist): new target.
3597 * INSTALL: add instructions for doing a binary distribution.
3599 * development/tools/README.bin.example: update a bit.
3601 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
3604 * lib/lyxrc.example: new lyxrc tag \set_color.
3606 * src/lyxfunc.C (Dispatch):
3607 * src/commandtags.h:
3608 * src/LyXAction.C: new lyxfunc "set-color".
3610 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
3611 and an x11name given as strings.
3613 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
3614 cache when a color is changed.
3616 2000-06-26 Juergen Vigna <jug@sad.it>
3618 * src/lyxrow.C (width): added this functions and variable.
3620 * src/insets/insetcite.C (create_form_citation_form): some Gravity
3623 * src/text.C (SetHeightOfRow): fixed calcualting of width.
3625 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3627 * images/undo_bw.xpm: new icon.
3628 * images/redo_bw.xpm: ditto.
3630 * configure.in (INSTALL_SCRIPT): change value to
3631 ${INSTALL} to avoid failures of install-script target.
3632 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
3634 * src/BufferView.h: add a magic "friend" declaration to please
3637 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
3639 * forms/cite.fd: modified to allow resizing without messing
3642 * src/insetcite.C: Uses code from cite.fd almost without
3644 User can now resize dialog in the x-direction.
3645 Resizing the dialog in the y-direction is prevented, as the
3646 code does this intelligently already.
3648 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3650 * INSTALL: remove obsolete entry in "problems" section.
3652 * lib/examples/sl_*.lyx: update of the slovenian examples.
3654 * src/support/FileInfo.[Ch] (getBlockSize): remove.
3656 2000-06-23 Juergen Vigna <jug@sad.it>
3658 * src/lyxtext.h: added a 'cleared' flag to draw() function.
3660 * src/buffer.C (resize): delete the LyXText of textinsets.
3662 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
3664 * src/insets/lyxinset.h: added another parameter 'cleared' to
3665 the draw() function.
3667 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
3668 unlocking inset in inset.
3670 2000-06-22 Juergen Vigna <jug@sad.it>
3672 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
3673 of insets and moved first to LyXText.
3675 * src/mathed/formulamacro.[Ch]:
3676 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
3678 2000-06-21 Juergen Vigna <jug@sad.it>
3680 * src/text.C (GetVisibleRow): look if I should clear the area or not
3681 using Inset::doClearArea() function.
3683 * src/insets/lyxinset.h: added doClearArea() function and
3684 modified draw(Painter &, ...) to draw(BufferView *, ...)
3686 * src/text2.C (UpdateInset): return bool insted of int
3688 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
3690 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
3691 combox in the character popup
3693 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
3694 BufferParams const & params
3696 2000-06-20 Juergen Vigna <jug@sad.it>
3698 * src/insets/insettext.C (SetParagraphData): set insetowner on
3701 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3703 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
3704 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
3706 (form_main_): remove
3708 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
3709 (create_form_form_main): remove FD_form_main stuff, connect to
3710 autosave_timeout signal
3712 * src/LyXView.[Ch] (getMainForm): remove
3713 (UpdateTimerCB): remove
3714 * src/BufferView_pimpl.h: inherit from SigC::Object
3716 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
3717 signal instead of callback
3719 * src/BufferView.[Ch] (cursorToggleCB): remove
3721 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3723 * src/BufferView_pimpl.C: changes because of the one below
3725 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
3726 instead of storing a pointer to a LyXText.
3728 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
3730 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
3732 * src/lyxparagraph.h
3734 * src/paragraph.C: Changed fontlist to a sorted vector.
3736 2000-06-19 Juergen Vigna <jug@sad.it>
3738 * src/BufferView.h: added screen() function.
3740 * src/insets/insettext.C (LocalDispatch): some selection code
3743 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
3745 * src/insets/insettext.C (SetParagraphData):
3747 (InsetText): fixes for multiple paragraphs.
3749 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
3751 * development/lyx.spec.in: Call configure with ``--without-warnings''
3752 to work around a bug with the Makefiles when doing ``make lyxrpm''.
3753 This should be fine, however, since we generally don't want to be
3754 verbose when making an RPM.
3756 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
3758 * lib/scripts/fig2pstex.py: New file
3760 2000-06-16 Juergen Vigna <jug@sad.it>
3762 * src/insets/insettabular.C (UpdateLocal):
3763 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
3764 (LocalDispatch): Changed all functions to use LyXText.
3766 2000-06-15 Juergen Vigna <jug@sad.it>
3768 * src/text.C (SetHeightOfRow): call inset::update before requesting
3771 * src/insets/insettext.C (update):
3772 * src/insets/insettabular.C (update): added implementation
3774 * src/insets/lyxinset.h: added update function
3776 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3778 * src/text.C (SelectNextWord): protect against null pointers with
3779 old-style string streams. (fix from Paul Theo Gonciari
3782 * src/cite.[Ch]: remove erroneous files.
3784 * lib/configure.m4: update the list of created directories.
3786 * src/lyxrow.C: include <config.h>
3787 * src/lyxcursor.C: ditto.
3789 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3791 * lib/examples/decimal.lyx: new example file from Mike.
3793 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
3794 to find template definitions (from Dekel)
3796 * src/frontends/.cvsignore: add a few things.
3798 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
3800 * src/Timeout.C (TimeOut): remove default argument.
3802 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
3805 * src/insets/ExternalTemplate.C: add a "using" directive.
3807 * src/lyx_main.h: remove the act_ struct, which seems unused
3810 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
3812 * LyX Developers Meeting: All files changed, due to random C++ (by
3813 coincidence) code generator script.
3815 - external inset (cool!)
3816 - initial online editing of preferences
3817 - insettabular breaks insettext(s contents)
3819 - some DocBook fixes
3820 - example files update
3821 - other cool stuff, create a diff and look for yourself.
3823 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
3825 * src/insets/insettext.C (computeTextRows): if the maxWidth is
3826 -1 this is a non-line-breaking textinset.
3828 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
3829 if there is no width set.
3831 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
3833 * Lots of files: Merged the dialogbase branch.
3835 2000-06-09 Allan Rae <rae@lyx.org>
3837 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
3838 and the Dispatch methods that used it.
3840 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
3841 access to functions formerly kept in Dispatch.
3843 2000-05-19 Allan Rae <rae@lyx.org>
3845 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
3846 made to_page and count_copies integers again. from_page remains a
3847 string however because I want to allow entry of a print range like
3848 "1,4,22-25" using this field.
3850 * src/LyXAction.C: added action info and commands for buffer-print-xtl
3851 and printer-params-get. These aren't useful from the minibuffer but
3852 could be used by a script/LyXServer app provided it passes a suitable
3853 auto_mem_buffer. I guess I should take a look at how the LyXServer
3854 works and make it support xtl buffers.
3856 * sigc++/: updated to libsigc++-1.0.1
3858 * src/xtl/: updated to xtl-1.3.pl.11
3860 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
3861 those changes done to the files in src/ are actually recreated when
3862 they get regenerated. Please don't ever accept a patch that changes a
3863 dialog unless that patch includes the changes to the corresponding *.fd
3866 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
3867 stringOnlyContains, renamed it and generalised it.
3869 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
3870 branch. Removed the remaining old form_print code.
3872 2000-04-26 Allan Rae <rae@lyx.org>
3874 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
3875 trap I was trying to fix with the ID: fields in src/xtl/ :-)
3877 2000-04-25 Allan Rae <rae@lyx.org>
3879 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
3880 against a base of xtl-1.3.pl.4
3882 * development/tools/lxtl.sh: fixed a couple of silly typos and now
3883 filter the Id: entries so they still show the xtl version number
3886 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
3887 into the src/xtl code. Patch still pending with José (XTL)
3889 2000-04-24 Allan Rae <rae@lyx.org>
3891 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
3892 both more generic and much safer. Use the new template functions.
3893 * src/buffer.[Ch] (Dispatch): ditto.
3895 * src/frontends/xforms/FormPrint.C (update): Use new template functions
3896 and mem buffer more intelligently. Also a little general cleanup.
3899 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
3900 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
3901 * src/xtl/Makefile.am: ditto.
3902 * src/xtl/.cvsignore: ditto.
3903 * src/Makefile.am: ditto.
3905 * src/PrinterParams.h: Removed the macros member functions. Added a
3906 testInvariant member function. A bit of tidying up and commenting.
3907 Included Angus's idea for fixing operation with egcs-1.1.2.
3909 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
3910 cool expansion of XTL's mem_buffer to support automatic memory
3911 management within the buffer itself. Removed the various macros and
3912 replaced them with template functions that use either auto_mem_buffer
3913 or mem_buffer depending on a #define. The mem_buffer support will
3914 disappear as soon as the auto_mem_buffer is confirmed to be good on
3915 other platforms/compilers. That is, it's there so you've got something
3918 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
3919 effectively forked XTL. However I expect José will include my code
3920 into the next major release. Also fixed a memory leak.
3921 * src/xtl/text.h: ditto.
3922 * src/xtl/xdr.h: ditto.
3923 * src/xtl/giop.h: ditto.
3925 2000-04-16 Allan Rae <rae@lyx.org>
3927 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
3928 by autogen.sh and removed by maintainer-clean anyway.
3929 * .cvsignore, sigc++/.cvsignore: Support the above.
3931 * sigc++/.cvsignore: Forgot that retbind.h was generated.
3933 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
3935 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
3936 macros, renamed static callback-target member functions to suit new
3937 scheme and made them public.
3938 * src/frontends/xforms/forms/form_print.fd: ditto.
3939 * src/frontends/xforms/forms/form_copyright.fd: ditto.
3941 * src/support/lxtl.h: small cleanup to use typedef instead of #define
3944 * src/xtl/: New directory containing a minimal distribution of XTL.
3945 This is XTL-1.3.pl.4.
3947 * development/tools/lxtl.sh: A script to generate the above mini-dist.
3949 2000-04-15 Allan Rae <rae@lyx.org>
3951 * development/tools/makeLyXsigc.sh: Remove the library version numbers
3953 * sigc++/: Updated to libsigc++-1.0.0
3955 2000-04-14 Allan Rae <rae@lyx.org>
3957 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
3958 use the generic ones in future. I'll modify my conversion script.
3960 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
3962 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
3963 (CloseAllBufferRelatedDialogs): Renamed.
3964 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
3966 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
3967 of the generic ones. These are the same ones my conversion script
3970 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
3971 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
3972 * src/buffer.C (Dispatch): ditto
3974 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
3975 functions for updating and hiding buffer dependent dialogs.
3976 * src/BufferView.C (buffer): ditto
3977 * src/buffer.C (setReadonly): ditto
3978 * src/lyxfunc.C (CloseBuffer): ditto
3980 * src/buffer.h: Take setReadonly() out of line so I don't have to include
3981 Dialogs.h, and hence all the SigC stuff, into every file that includes
3982 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
3984 * src/BufferView2.C: reduce the number of headers included by buffer.h
3986 2000-04-11 Allan Rae <rae@lyx.org>
3988 * src/frontends/xforms/xform_macros.h: A small collection of macros
3989 for building C callbacks.
3991 * src/frontends/xforms/Makefile.am: Added above file.
3993 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
3994 scheme again. This time it should work for JMarc. If this is
3995 successful I'll revise my conversion script to automate some of this.
3996 The static member functions in the class also have to be public for
3997 this scheme will work. If the scheme works (it's almost identical to
3998 the way BufferView::cursorToggleCB is handled so it should work) then
3999 FormCopyright and FormPrint will be ready for inclusion into the main
4000 trunk immediately after 1.1.5 is released -- provided we're prepared
4001 for complaints about lame compilers not handling XTL.
4003 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
4005 2000-04-07 Allan Rae <rae@lyx.org>
4007 * config/lyxinclude.m4: A bit more tidying up (Angus)
4009 * src/LString.h: JMarc's <string> header fix
4011 * src/PrinterParams.h: Used string for most data to remove some
4012 ugly code in the Print dialog and avoid even uglier code when
4013 appending the ints to a string for output.
4015 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
4016 and moved "default:" back to the end of switch statement. Cleaned
4017 up the printing so it uses the right function calls and so the
4018 "print to file" option actually puts the file in the right directory.
4020 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
4022 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
4023 and Ok+Apply button control into a separate method: input (Angus).
4024 (input) Cleaned it up and improved it to be very thorough now.
4025 (All CB) static_cast used instead of C style cast (Angus). This will
4026 probably change again once we've worked out how to keep gcc-2.8.1 happy
4027 with real C callbacks.
4028 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
4029 ignore some of the bool settings and has random numbers instead. Needs
4030 some more investigation. Added other input length checks and checking
4031 of file and printer names.
4033 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
4034 would link (Angus). Seems the old code doesn't compile with the pragma
4035 statement either. Separated callback entries from internal methods.
4037 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
4039 2000-03-17 Allan Rae <rae@lyx.org>
4041 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
4042 need it? Maybe it could go in Dialogs instead? I could make it a
4043 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
4044 values to get the bool return value.
4045 (Dispatch): New overloaded method for xtl support.
4047 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
4048 extern "C" callback instead of static member functions. Hopefully,
4049 JMarc will be able to compile this. I haven't changed
4050 forms/form_copyright.fd yet. Breaking one of my own rules already.
4052 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
4053 because they aren't useful from the minibuffer. Maybe a LyXServer
4054 might want a help message though?
4056 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
4058 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
4059 xtl which needs both rtti and exceptions.
4061 * src/support/Makefile.am:
4062 * src/support/lxtl.h: New file. Some helper macros for using XTL.
4064 * src/frontends/xforms/input_validators.[ch]: input filters and
4065 validators. These conrol what keys are valid in input boxes.
4066 Use them and write some more. Much better idea than waiting till
4067 after the user has pressed Ok to say that the input fields don't make
4070 * src/frontends/xforms/Makefile.am:
4071 * src/frontends/xforms/forms/form_print.fd:
4072 * src/frontends/xforms/forms/makefile:
4073 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
4074 new scheme. Still have to make sure I haven't missed anything from
4075 the current implementation.
4077 * src/Makefile.am, src/PrinterParams.h: New data store.
4079 * other files: Added a couple of copyright notices.
4081 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4083 * src/insets/insetbib.h: move Holder struct in public space.
4085 * src/frontends/include/DialogBase.h: use SigC:: only when
4086 SIGC_CXX_NAMESPACES is defined.
4087 * src/frontends/include/Dialogs.h: ditto.
4089 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
4091 * src/frontends/xforms/FormCopyright.[Ch]: do not
4092 mention SigC:: explicitely.
4094 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4096 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
4097 deals with testing KDE in main configure.in
4098 * configure.in: ditto.
4100 2000-02-22 Allan Rae <rae@lyx.org>
4102 * Lots of files: Merged from HEAD
4104 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
4105 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
4107 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
4109 * sigc++/: new minidist.
4111 2000-02-14 Allan Rae <rae@lyx.org>
4113 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
4115 2000-02-08 Juergen Vigna <jug@sad.it>
4117 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
4118 file for the buildin GUI builder of KDevelop of the copyright-dialog.
4120 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
4121 for this port and so it is much easier for other people to port
4122 dialogs in a common development environment.
4124 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
4125 the QT/KDE implementation.
4127 * src/frontends/kde/Dialogs.C:
4128 * src/frontends/kde/FormCopyright.C:
4129 * src/frontends/kde/FormCopyright.h:
4130 * src/frontends/kde/Makefile.am:
4131 * src/frontends/kde/formcopyrightdialog.C:
4132 * src/frontends/kde/formcopyrightdialog.h:
4133 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
4134 for the kde support of the Copyright-Dialog.
4136 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
4137 subdir-substitution instead of hardcoded 'xforms' as we now have also
4140 * src/frontends/include/DialogBase.h (Object): just commented the
4141 label after #endif (nasty warning and I don't like warnings ;)
4143 * src/main.C (main): added KApplication initialization if using
4146 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
4147 For now only the KDE event-loop is added if frontend==kde.
4149 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
4151 * configure.in: added support for the --with-frontend[=value] option
4153 * autogen.sh: added kde.m4 file to list of config-files
4155 * acconfig.h: added define for KDEGUI-support
4157 * config/kde.m4: added configuration functions for KDE-port
4159 * config/lyxinclude.m4: added --with-frontend[=value] option with
4160 support for xforms and KDE.
4162 2000-02-08 Allan Rae <rae@lyx.org>
4164 * all Makefile.am: Fixed up so the make targets dist, distclean,
4165 install and uninstall all work even if builddir != srcdir. Still
4166 have a new sigc++ minidist update to come.
4168 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
4170 2000-02-01 Allan Rae <rae@lyx.org>
4172 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
4173 Many mods to get builddir != srcdir working.
4175 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
4176 for building on NT and so we can do the builddir != srcdir stuff.
4178 2000-01-30 Allan Rae <rae@lyx.org>
4180 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
4181 This will stay in "rae" branch. We probably don't really need it in
4182 the main trunk as anyone who wants to help programming it should get
4183 a full library installed also. So they can check both included and
4184 system supplied library compilation.
4186 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
4187 Added a 'mini' distribution of libsigc++. If you feel the urge to
4188 change something in these directories - Resist it. If you can't
4189 resist the urge then you should modify the following script and rebuild
4190 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
4191 all happen. Still uses a hacked version of libsigc++'s configure.in.
4192 I'm quite happy with the results. I'm not sure the extra work to turn
4193 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
4194 worth the trouble and would probably lead to extra maintenance
4196 I haven't tested the following important make targets: install, dist.
4197 Not ready for prime time but very close. Maybe 1.1.5.
4199 * development/tools/makeLyXsigc.sh: A shell script to automatically
4200 generate our mini-dist of libsigc++. It can only be used with a CVS
4201 checkout of libsigc++ not a tarball distribution. It's well commented.
4202 This will end up as part of the libsigc++ distribution so other apps
4203 can easily have an included mini-dist. If someone makes mods to the
4204 sigc++ subpackage without modifying this script to generate those
4205 changes I'll be very upset!
4207 * src/frontends/: Started the gui/system indep structure.
4209 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
4210 to access the gui-indep dialogs are in this class. Much improved
4211 design compared to previous revision. Lars, please refrain from
4212 moving this header into src/ like you did with Popups.h last time.
4214 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
4216 * src/frontends/xforms/: Started the gui-indep system with a single
4217 dialog: FormCopyright. Initial testing of use of libsigc++ was very
4220 * src/frontends/xforms/forms: Repository for the xforms .fd files.
4221 Here you'll find a very useful makefile and automated fdfix.sh that
4222 makes updating dailogs a no-brainer -- provided you follow the rules
4223 set out in the README. I'm thinking about adding another script to
4224 automatically generate skeleton code for a new dialog given just the
4227 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
4228 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
4229 Made FormCopyright gui-indep and added a lyxfunc to get to it.
4231 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4233 * src/support/LSubstring.C (operator): simplify
4235 * src/lyxtext.h: removed bparams, use buffer_->params instead
4237 * src/lyxrow.h: make Row a real class, move all variables to
4238 private and use accessors.
4240 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
4242 (isRightToLeftPar): ditto
4243 (ChangeLanguage): ditto
4244 (isMultiLingual): ditto
4247 (SimpleTeXOnePar): ditto
4248 (TeXEnvironment): ditto
4249 (GetEndLabel): ditto
4251 (SetOnlyLayout): ditto
4252 (BreakParagraph): ditto
4253 (BreakParagraphConservative): ditto
4254 (GetFontSettings): ditto
4256 (CopyIntoMinibuffer): ditto
4257 (CutIntoMinibuffer): ditto
4258 (PasteParagraph): ditto
4259 (SetPExtraType): ditto
4260 (UnsetPExtraType): ditto
4261 (DocBookContTableRows): ditto
4262 (SimpleDocBookOneTablePar): ditto
4264 (TeXFootnote): ditto
4265 (SimpleTeXOneTablePar): ditto
4266 (TeXContTableRows): ditto
4267 (SimpleTeXSpecialChars): ditto
4270 * src/lyxcursor.h: make LyXCursor a real class, move all variables
4271 to private and use accessors.
4273 * src/lyx_cb.C: remove char updatetimer, and all code that uses
4274 this, we did not use it anymore and has not been for ages. Just a
4275 waste of cpu cycles.
4277 * src/language.h: make Language a real class, move all variables
4278 to private and use accessors.
4280 * src/BufferView_pimpl.C (Pimpl): use new timer code.
4281 (create_view): remove
4282 (update): some changes for new timer
4283 (cursorToggle): use new timer
4284 (beforeChange): change for new timer
4286 * src/BufferView.h (cursorToggleCB): removed last paramter because
4289 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
4290 (cursorToggleCB): change because of new timer code
4292 * lib/CREDITS: updated own mailaddress
4294 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4296 * src/support/filetools.C (PutEnv): fix the code in case neither
4297 putenv() nor setenv() have been found.
4299 * INSTALL: mention the install-strip Makefile target.
4301 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
4302 read-only documents.
4304 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4306 * lib/reLyX/configure.in (VERSION): avoid using a previously
4307 generated reLyX wrapper to find out $prefix.
4309 * lib/examples/eu_adibide_lyx-atua.lyx:
4310 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
4311 translation of the Tutorial (Dooteo)
4313 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
4315 * forms/cite.fd: new citation dialog
4317 * src/insetcite.[Ch]: the new citation dialog is moved into
4320 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
4323 * src/insets/insetcommand.h: data members made private.
4325 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4327 * LyX 1.1.5 released
4329 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4331 * src/version.h (LYX_RELEASE): to 1.1.5
4333 * src/spellchecker.C (RunSpellChecker): return false if the
4334 spellchecker dies upon creation.
4336 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4338 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
4339 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
4343 * lib/CREDITS: update entry for Martin Vermeer.
4345 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
4347 * src/text.C (draw): Draw foreign language bars at the bottom of
4348 the row instead of at the baseline.
4350 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
4352 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4354 * lib/bind/de_menus.bind: updated
4356 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4358 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
4360 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4362 * src/menus.C (Limit_string_length): New function
4363 (ShowTocMenu): Limit the number of items/length of items in the
4366 * src/paragraph.C (String): Correct result for a paragraph inside
4369 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4371 * src/bufferlist.C (close): test of buf->getuser() == NULL
4373 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
4375 * src/BufferView2.C (removeAutoInsets): Fix a bug:
4376 Do not call to SetCursor when the paragraph is a closed footnote!
4378 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
4380 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
4383 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
4385 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4388 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
4389 reference popup, that activates the reference-back action
4391 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
4393 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
4394 the menus. Also fixed a bug.
4396 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
4397 the math panels when switching buffers (unless new buffer is readonly).
4399 * src/BufferView.C (NoSavedPositions)
4400 * src/BufferView_pimpl.C (NoSavedPositions): New methods
4402 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4404 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
4405 less of dvi dirty or not.
4407 * src/trans_mgr.[Ch] (insert): change first parameter to string
4410 * src/chset.[Ch] (encodeString): add const to first parameter
4412 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4414 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
4418 * src/LaTeX.C (deplog): better searching for dependency files in
4419 the latex log. Uses now regexps.
4421 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
4422 instead of the box hack or \hfill.
4424 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4426 * src/lyxfunc.C (doImportHelper): do not create the file before
4427 doing the actual import.
4428 (doImportASCIIasLines): create a new file before doing the insert.
4429 (doImportASCIIasParagraphs): ditto.
4431 * lib/lyxrc.example: remove mention of non-existing commands
4433 * lyx.man: remove mention of color-related switches.
4435 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
4437 * src/lyx_gui.C: remove all the color-related ressources, which
4438 are not used anymore.
4440 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
4443 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4445 * src/lyxrc.C (read): Add a missing break in the switch
4447 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
4449 * src/text2.C (InsertStringA): Fix a bug with insertion into table
4451 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
4454 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4456 * src/text.C (draw): draw bars under foreign language words.
4458 * src/LColor.[Ch]: add LColor::language
4460 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4462 * src/lyxcursor.h (boundary): New member variable
4464 * src/text.C (IsBoundary): New methods
4466 * src/text.C: Use the above for currect cursor movement when there
4467 is both RTL & LTR text.
4469 * src/text2.C: ditto
4471 * src/bufferview_funcs.C (ToggleAndShow): ditto
4473 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4475 * src/text.C (DeleteLineForward): set selection to true to avoid
4476 that DeleteEmptyParagraphMechanism does some magic. This is how it
4477 is done in all other functions, and seems reasonable.
4478 (DeleteWordForward): do not jump over non-word stuff, since
4479 CursorRightOneWord() already does it.
4481 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
4482 DeleteWordBackward, since they seem safe to me (since selection is
4483 set to "true") DeleteEmptyParagraphMechanism does nothing.
4485 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4487 * src/lyx_main.C (easyParse): simplify the code by factoring the
4488 part that removes parameters from the command line.
4489 (LyX): check wether wrong command line options have been given.
4491 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
4493 * src/lyx_main.C : add support for specifying user LyX
4494 directory via command line option -userdir.
4496 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
4498 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
4499 the number of items per popup.
4500 (Add_to_refs_menu): Ditto.
4502 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4504 * src/lyxparagraph.h: renamed ClearParagraph() to
4505 StripLeadingSpaces() and moved it to paragraph.C. We pass the
4506 textclass as parameter, and do nothing if free_spacing is
4507 true. This fixes part of the line-delete-forward problems.
4509 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
4510 (pasteSelection): ditto.
4511 (SwitchLayoutsBetweenClasses): more translatable strings.
4513 * src/text2.C (CutSelection): use StripLeadingSpaces.
4514 (PasteSelection): ditto.
4515 (DeleteEmptyParagraphMechanism): ditto.
4517 2000-05-26 Juergen Vigna <jug@sad.it>
4519 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
4520 is not needed in tabular insets.
4522 * src/insets/insettabular.C (TabularFeatures): added missing features.
4524 * src/tabular.C (DeleteColumn):
4526 (AppendRow): implemented this functions
4527 (cellsturct::operator=): clone the inset too;
4529 2000-05-23 Juergen Vigna <jug@sad.it>
4531 * src/insets/insettabular.C (LocalDispatch): better selection support
4532 when having multicolumn-cells.
4534 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4536 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
4538 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4540 * src/ColorHandler.C (getGCForeground): put more test into _()
4542 * lib/examples/eu_splash.lyx: new file (Basque translation) from
4545 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
4548 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
4550 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
4551 there are no labels, or when buffer is readonly.
4553 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
4554 there are no labels, buffer is SGML, or when buffer is readonly.
4556 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4558 * src/LColor.C (LColor): change a couple of grey40 to grey60
4559 (LColor): rewore initalization to make compiles go some magnitude
4561 (getGUIName): don't use gettext until we need the string.
4563 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
4565 * src/Bullet.[Ch]: Fixed a small bug.
4567 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
4569 * src/paragraph.C (String): Several fixes/improvements
4571 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
4573 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4575 * src/paragraph.C (String): give more correct output.
4577 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
4579 * src/lyxfont.C (stateText) Do not output the language if it is
4580 eqaul to the language of the document.
4582 * src/paragraph.C (TeXOnePar): Do not put language switch commands
4583 between two paragraphs with the same language.
4585 * src/paragraph.C (getParLanguage) Return a correct answer for an
4586 empty dummy paragraph.
4588 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
4591 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
4594 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
4595 the menus/popup, if requested fonts are unavailable.
4597 2000-05-22 Juergen Vigna <jug@sad.it>
4599 * src/insets/insettabular.C (LocalDispatch): added some more cursor
4600 movement support (Up/Down/Tab/Shift-Tab).
4601 (LocalDispatch): added also preliminari cursor-selection.
4603 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
4605 * src/paragraph.C (PasteParagraph): Hopefully now right!
4607 2000-05-22 Garst R. Reese <reese@isn.net>
4609 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
4610 of list, change all references to Environment to Command
4611 * tex/hollywood.cls : rewrite environments as commands, add
4612 \uppercase to interiorshot and exteriorshot to force uppecase.
4613 * tex/broadway.cls : rewrite environments as commands. Tweak
4616 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4618 * src/menus.C (Add_to_toc_menu): fix the code which limits the
4619 size of items: use a constant intead of the hardcoded 40, and more
4620 importantly do not remove the %m and %x tags added at the end.
4621 (Add_to_refs_menu): use vector::size_type instead of
4622 unsigned int as basic types for the variables. _Please_ do not
4623 assume that size_t is equal to unsigned int. On an alpha, this is
4624 unsigned long, which is _not_ the same.
4626 * src/language.C (initL): remove language "hungarian", since it
4627 seems that "magyar" is better.
4629 2000-05-22 Juergen Vigna <jug@sad.it>
4631 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
4633 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
4636 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
4637 next was deleted but not set to 0.
4639 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4641 * src/language.C (initL): change the initialization of languages
4642 so that compiles goes _fast_.
4644 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
4647 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
4649 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4653 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4655 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
4657 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
4661 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
4664 * src/insets/insetlo*.[Ch]: Made editable
4666 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4668 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
4669 the current selection.
4671 * src/BufferView_pimpl.C (stuffClipboard): new method
4673 * src/BufferView.C (stuffClipboard): new method
4675 * src/paragraph.C (String): new method
4677 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
4678 LColor::ignore when lyxname is not found.
4680 * src/BufferView.C (pasteSelection): new method
4682 * src/BufferView_pimpl.C (pasteSelection): new method
4684 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
4686 * src/WorkArea.C (request_clipboard_cb): new static function
4687 (getClipboard): new method
4688 (putClipboard): new method
4690 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4692 * LyX 1.1.5pre2 released
4694 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4696 * src/vspace.C (operator=): removed
4697 (operator=): removed
4699 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
4701 * src/layout.C (NumberOfClass): manually set the type in make_pair
4702 (NumberOfLayout): ditto
4704 * src/language.C: use the Language constructor for ignore_lang
4706 * src/language.h: add constructors to struct Language
4708 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
4710 * src/text2.C (SetCursorIntern): comment out #warning
4712 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
4714 * src/mathed/math_iter.h: initialize sx and sw to 0
4716 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4718 * forms/lyx.fd: Redesign of form_ref
4720 * src/LaTeXFeatures.[Ch]
4724 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
4727 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
4728 and Buffer::inset_iterator.
4730 * src/menus.C: Added new menus: TOC and Refs.
4732 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
4734 * src/buffer.C (getTocList): New method.
4736 * src/BufferView2.C (ChangeRefs): New method.
4738 * src/buffer.C (getLabelList): New method. It replaces the old
4739 getReferenceList. The return type is vector<string> instead of
4742 * src/insets/insetinclude.C (getLabelList): New method. Replaces
4743 the old getLabel() and GetNumberOfLabels() methods.
4744 * src/insets/insetlabel.C (getLabelList): ditto
4745 * src/mathed/formula.C (getLabelList): ditto
4747 * src/paragraph.C (String): New method.
4749 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
4750 Uses the new getTocList() method.
4751 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
4752 which automatically updates the contents of the browser.
4753 (RefUpdateCB): Use the new getLabelList method.
4755 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
4757 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
4759 * src/spellchecker.C: Added using std::reverse;
4761 2000-05-19 Juergen Vigna <jug@sad.it>
4763 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
4765 * src/insets/insettext.C (computeTextRows): small fix for display of
4766 1 character after a newline.
4768 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
4771 2000-05-18 Juergen Vigna <jug@sad.it>
4773 * src/insets/insettabular.C (TabularFeatures): fixed update of display
4774 when changing width of column.
4776 * src/tabular.C (set_row_column_number_info): setting of
4777 autobreak rows if necessary.
4779 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4781 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
4783 * src/vc-backend.*: renamed stat() to status() and vcstat to
4784 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
4785 compilation broke. The new name seems more relevant, anyway.
4787 2000-05-17 Juergen Vigna <jug@sad.it>
4789 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
4790 which was wrong if the removing caused removing of rows!
4792 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
4793 (pushToken): new function.
4795 * src/text2.C (CutSelection): fix problem discovered with purify
4797 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4799 * src/debug.C (showTags): enlarge the first column, now that we
4800 have 6-digits debug codes.
4802 * lib/layouts/hollywood.layout:
4803 * lib/tex/hollywood.cls:
4804 * lib/tex/brodway.cls:
4805 * lib/layouts/brodway.layout: more commands and fewer
4806 environments. Preambles moved in the .cls files. Broadway now has
4807 more options on scene numbering and less whitespace (from Garst)
4809 * src/insets/insetbib.C (getKeys): make sure that we are in the
4810 document directory, in case the bib file is there.
4812 * src/insets/insetbib.C (Latex): revert bogus change.
4814 2000-05-16 Juergen Vigna <jug@sad.it>
4816 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
4817 the TabularLayout on cursor move.
4819 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
4821 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
4824 (draw): fixed cursor position and drawing so that the cursor is
4825 visible when before the tabular-inset.
4827 * src/insets/insettext.C (init): drawLockedFrame was not initialized
4828 when creating from old insettext.
4830 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
4832 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4834 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
4835 * lib/tex/brodway.cls: ditto
4837 * lib/layouts/brodway.layout: change alignment of parenthical
4840 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4842 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
4843 versions 0.88 and 0.89 are supported.
4845 2000-05-15 Juergen Vigna <jug@sad.it>
4847 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
4850 * src/insets/insettext.C (computeTextRows): redone completely this
4851 function in a much cleaner way, because of problems when having a
4853 (draw): added a frame border when the inset is locked.
4854 (SetDrawLockedFrame): this sets if we draw the border or not.
4855 (SetFrameColor): this sets the frame color (default=insetframe).
4857 * src/insets/lyxinset.h: added x() and y() functions which return
4858 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
4859 function which is needed to see if we have a locking inset of some
4860 type in this inset (needed for now in insettabular).
4862 * src/vspace.C (inPixels): the same function also without a BufferView
4863 parameter as so it is easier to use it in some ocasions.
4865 * src/lyxfunc.C: changed all places where insertInset was used so
4866 that now if it couldn't be inserted it is deleted!
4868 * src/TabularLayout.C:
4869 * src/TableLayout.C: added support for new tabular-inset!
4871 * src/BufferView2.C (insertInset): this now returns a bool if the
4872 inset was really inserted!!!
4874 * src/tabular.C (GetLastCellInRow):
4875 (GetFirstCellInRow): new helper functions.
4876 (Latex): implemented for new tabular class.
4880 (TeXTopHLine): new Latex() helper functions.
4882 2000-05-12 Juergen Vigna <jug@sad.it>
4884 * src/mathed/formulamacro.C (Read):
4885 * src/mathed/formula.C (Read): read also the \end_inset here!
4887 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4889 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
4890 crush when saving formulae with unbalanced parenthesis.
4892 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
4894 * src/layout.C: Add new keyword "endlabelstring" to layout file
4896 * src/text.C (GetVisibleRow): Draw endlabel string.
4898 * lib/layouts/broadway.layout
4899 * lib/layouts/hollywood.layout: Added endlabel for the
4900 Parenthetical layout.
4902 * lib/layouts/heb-article.layout: Do not use slanted font shape
4903 for Theorem like environments.
4905 * src/buffer.C (makeLaTeXFile): Always add "american" to
4906 the UsedLanguages list if document language is RTL.
4908 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4910 * add addendum to README.OS2 and small patch (from SMiyata)
4912 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4914 * many files: correct the calls to ChangeExtension().
4916 * src/support/filetools.C (ChangeExtension): remove the no_path
4917 argument, which does not belong there. Use OnlyFileName() instead.
4919 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
4920 files when LaTeXing a non-nice latex file.
4922 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
4923 a chain of "if". Return false when deadkeys are not handled.
4925 * src/lyx_main.C (LyX): adapted the code for default bindings.
4927 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
4928 bindings for basic functionality (except deadkeys).
4929 (deadKeyBindings): new method. Performs the bindings of deadkeys.
4931 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
4932 several methods: handle override_x_deadkeys.
4934 * src/lyxrc.h: remove the "bindings" map, which did not make much
4935 sense anyway. New variable override_x_deadkeys, defaulting to "true".
4937 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4939 * src/lyxfont.C (stateText): use a saner method to determine
4940 whether the font is "default". Seems to fix the crash with DEC
4943 * src/Bullet.[Ch] (Bullet): remove const on parameters.
4945 2000-05-08 Juergen Vigna <jug@sad.it>
4947 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
4948 TabularLayoutMenu with mouse-button-3
4949 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
4951 * src/TabularLayout.C: added this file for having a Layout for
4954 2000-05-05 Juergen Vigna <jug@sad.it>
4956 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
4957 recalculating inset-widths.
4958 (TabularFeatures): activated this function so that I can change
4959 tabular-features via menu.
4961 * src/menus.C (ShowEditMenu): inserted support for insettabular so
4962 that I can test some functions with the Table menu.
4964 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4966 * src/lyxfont.C (stateText): guard against stupid c++libs.
4968 * src/tabular.C: add using std::vector
4969 some whitespace changes, + removed som autogenerated code.
4971 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
4973 2000-05-05 Juergen Vigna <jug@sad.it>
4975 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
4976 row, columns and cellstructures.
4978 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4980 * lib/lyxrc.example: remove obsolete entries.
4982 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
4983 reading of protected_separator for free_spacing.
4985 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4987 * src/text.C (draw): do not display an exclamation mark in the
4988 margin for margin notes. This is confusing, ugly and
4991 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
4992 AMS math' is checked.
4994 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
4995 name to see whether including the amsmath package is needed.
4997 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
4999 * src/paragraph.C (validate): Compute UsedLanguages correctly
5000 (don't insert the american language if it doesn't appear in the
5003 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
5004 The argument of \thanks{} command is considered moving argument
5006 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
5009 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
5011 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
5012 for appendix/minipage/depth. The lines can be now both in the footnote
5013 frame, and outside the frame.
5015 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
5018 2000-05-05 Juergen Vigna <jug@sad.it>
5020 * src/table.[Ch]: removed the inset and buffer stuff as this is now
5021 neede only in tabular.[Ch].
5023 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5025 * src/insets/insetspecialchar.C (Read): allow command == '~' for
5027 (Write): write '~' for PROTECTED_SEPARATOR
5029 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5031 * src/lyxparagraph.h: add a friend struct matchIT after the struct
5034 * src/mathed/formula.C (drawStr): rename size to siz.
5036 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
5037 possibly fix a bug by not changing the pflags = flags to piflags =
5040 2000-05-05 Juergen Vigna <jug@sad.it>
5042 * src/insets/insetbib.C: moved using directive
5044 * src/ImportNoweb.C: small fix for being able to compile (missing
5047 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5049 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
5050 to use clear, since we don't depend on this in the code. Add test
5053 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5055 * (various *.C files): add using std::foo directives to please dec
5058 * replace calls to string::clear() to string::erase() (Angus)
5060 * src/cheaders/cmath: modified to provide std::abs.
5062 2000-05-04 Juergen Vigna <jug@sad.it>
5064 * src/insets/insettext.C: Prepared all for inserting of multiple
5065 paragraphs. Still display stuff to do (alignment and other things),
5066 but I would like to use LyXText to do this when we cleaned out the
5067 table-support stuff.
5069 * src/insets/insettabular.C: Changed lot of stuff and added lots
5070 of functionality still a lot to do.
5072 * src/tabular.C: Various functions changed name and moved to be
5073 const functions. Added new Read and Write functions and changed
5074 lots of things so it works good with tabular-insets (also removed
5075 some stuff which is not needed anymore * hacks *).
5077 * src/lyxcursor.h: added operators == and != which just look if
5078 par and pos are (not) equal.
5080 * src/buffer.C (latexParagraphs): inserted this function to latex
5081 all paragraphs form par to endpar as then I can use this too for
5084 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
5085 so that I can call this to from text insets with their own cursor.
5087 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
5088 output off all paragraphs (because of the fix below)!
5090 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
5091 the very last paragraph (this could be also the last paragraph of an
5094 * src/texrow.h: added rows() call which returns the count-variable.
5096 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
5098 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
5100 * lib/configure.m4: better autodetection of DocBook tools.
5102 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5104 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
5106 * src/lyx_cb.C: add using std::reverse;
5108 * src/LaTeX.C (run): on error always run deleteFilesOnError before
5111 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
5112 selected files. Should fix repeated errors from generated files.
5114 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
5116 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
5118 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
5119 the spellchecker popup.
5121 * lib/lyxrc.example: Removed the \number_inset section
5123 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5125 * src/insets/figinset.C (various): Use IsFileReadable() to make
5126 sure that the file actually exist. Relying on ghostscripts errors
5127 is a bad idea since they can lead to X server crashes.
5129 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
5131 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
5134 * lib/lyxrc.example: smallish typo in description of
5135 \view_dvi_paper_option
5137 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5140 * src/lyxfunc.C: doImportHelper to factor out common code of the
5141 various import methods. New functions doImportASCIIasLines,
5142 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
5143 doImportLinuxDoc for the format specific parts.
5146 * buffer.C: Dispatch returns now a bool to indicate success
5149 * lyx_gui.C: Add getLyXView() for member access
5151 * lyx_main.C: Change logic for batch commands: First try
5152 Buffer::Dispatch (possibly without GUI), if that fails, use
5155 * lyx_main.C: Add support for --import command line switch.
5156 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
5157 Available Formats: Everything accepted by 'buffer-import <format>'
5159 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5161 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
5164 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
5165 documents will be reformatted upon reentry.
5167 2000-04-27 Juergen Vigna <jug@sad.it>
5169 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
5170 correctly only last pos this was a bug.
5172 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5174 * release of lyx-1.1.5pre1
5176 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5178 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
5180 * src/menus.C: revert the change of naming (Figure->Graphic...)
5181 from 2000-04-11. It was incomplete and bad.
5183 * src/LColor.[Ch]: add LColor::depthbar.
5184 * src/text.C (GetVisibleRow): use it.
5186 * README: update the languages list.
5188 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5190 * src/text.C (GetVisibleRow): show the depth of paragraphs using
5193 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5195 * README: remove sections that were just wrong.
5197 * src/text2.C (GetRowNearY): remove currentrow code
5199 * src/text.C (GetRow): remove currentrow code
5201 * src/screen.C (Update): rewritten a bit.
5202 (SmallUpdate): removed func
5204 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
5206 (FullRebreak): return bool
5207 (currentrow): remove var
5208 (currentrow_y): ditto
5210 * src/lyxscreen.h (Draw): change arg to unsigned long
5211 (FitCursor): return bool
5212 (FitManualCursor): ditto
5213 (Smallpdate): remove func
5214 (first): change to unsigned long
5215 (DrawOneRow): change second arg to long (from long &)
5216 (screen_refresh_y): remove var
5217 (scree_refresh_row): ditto
5219 * src/lyxrow.h: change baseline to usigned int from unsigned
5220 short, this brings some implicit/unsigned issues out in the open.
5222 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
5224 (Dispatch): don't call updateScrollbar after fitCursor. Use update
5225 instead of smallUpdate.
5227 * src/lyxcursor.h: change y to unsigned long
5229 * src/buffer.h: don't call updateScrollbar after fitcursor
5231 * src/buffer.C (parseSingleLyXformat2Token): move variables to
5232 where they are used. Removed "\\direction", this was not present
5233 in 1.1.4 and is already obsolete. Commented out some code that I
5234 believe to never be called.
5235 (runLiterate): don't call updateScrollbar after fitCursor
5237 (buildProgram): ditto
5240 * src/WorkArea.h (workWidth): change return val to unsigned
5243 (redraw): remove the button redraws
5244 (setScrollbarValue): change for scrollbar
5245 (getScrollbarValue): change for scrollbar
5246 (getScrollbarBounds): change for scrollbar
5248 * src/WorkArea.C (C_WorkArea_up_cb): removed func
5249 (C_WorkArea_down_cb): removed func
5250 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
5251 (resize): change for scrollbar
5252 (setScrollbar): ditto
5253 (setScrollbarBounds): ditto
5254 (setScrollbarIncrements): ditto
5255 (up_cb): removed func
5256 (down_cb): removed func
5257 (scroll_cb): change for scrollbar
5258 (work_area_handler): ditto
5260 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
5261 when FitCursor did something.
5262 (updateScrollbar): some unsigned changes
5263 (downCB): removed func
5264 (scrollUpOnePage): removed func
5265 (scrollDownOnePage): remvoed func
5266 (workAreaMotionNotify): don't call screen->FitCursor but use
5267 fitCursor instead. and bool return val
5268 (workAreaButtonPress): ditto
5269 (workAreaButtonRelease): some unsigned changes
5270 (checkInsetHit): ditto
5271 (workAreaExpose): ditto
5272 (update): parts rewritten, comments about the signed char arg added
5273 (smallUpdate): removed func
5274 (cursorPrevious): call needed updateScrollbar
5277 * src/BufferView2.C (allFloats): don't call updateScrollbar after
5280 * src/BufferView.[Ch] (upCB): removed func
5281 (downCB): removed func
5282 (smallUpdate): removed func
5284 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5286 * src/lyxtext.h src/text.C src/text2.C: removed support for the
5287 currentrow, currentrow_y optimization. This did not help a lot and
5288 if we want to do this kind of optimization we should rather use
5289 cursor.row instead of the currentrow.
5291 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
5292 buffer spacing and klyx spacing support.
5294 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5296 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
5299 2000-04-26 Juergen Vigna <jug@sad.it>
5301 * src/insets/figinset.C: fixes to Lars sstream changes!
5303 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
5305 * A lot of files: Added Ascii(ostream &) methods to all inset
5306 classes. Used when exporting to ASCII.
5308 * src/buffer.C (writeFileAscii,RoffAsciiTable)
5309 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
5312 * src/text2.C (ToggleFree): Disabled implicit word selection when
5313 there is a change in the language
5315 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
5316 no output was generated for end-of-sentence inset.
5318 * src/insets/lyxinset.h
5321 * src/paragraph.C: Removed the insetnumber code
5323 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
5325 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5327 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
5328 no_babel and no_epsfig completely from the file.
5329 (parseSingleLyXformat2Token): add handling for per-paragraph
5330 spacing as written by klyx.
5332 * src/insets/figinset.C: applied patch by Andre. Made it work with
5335 2000-04-20 Juergen Vigna <jug@sad.it>
5337 * src/insets/insettext.C (cutSelection):
5338 (copySelection): Fixed with selection from right to left.
5339 (draw): now the rows are not recalculated at every draw.
5340 (computeTextRows): for now reset the inset-owner here (this is
5341 important for an undo or copy where the inset-owner is not set
5344 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
5345 motion to the_locking_inset screen->first was forgotten, this was
5346 not important till we got multiline insets.
5348 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5350 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
5351 code seems to be alright (it is code changed by Dekel, and the
5352 intent is indeed that all macros should be defined \protect'ed)
5354 * NEWS: a bit of reorganisation of the new user-visible features.
5356 2000-04-19 Juergen Vigna <jug@sad.it>
5358 * src/insets/insettext.C (init): using a LyXCursor now for cursor
5359 position. Set the inset_owner of the used paragraph so that it knows
5360 that it is inside an inset. Fixed cursor handling with mouse and
5361 cursor keys. Fixed wrong timed inset redraws and lots of other changes
5362 and cleanups to make TextInsets work better.
5364 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
5365 Changed parameters of various functions and added LockInsetInInset().
5367 * src/insets/insettext.C:
5369 * src/insets/insetcollapsable.h:
5370 * src/insets/insetcollapsable.C:
5371 * src/insets/insetfoot.h:
5372 * src/insets/insetfoot.C:
5373 * src/insets/insetert.h:
5374 * src/insets/insetert.C: cleaned up the code so that it works now
5375 correctly with insettext.
5377 * src/insets/inset.C:
5378 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
5379 that insets in insets are supported right.
5382 * src/table.C: lots of changes for use with inset tabular (and cleanup)
5384 * src/paragraph.C: some small fixes
5386 * src/debug.h: inserted INSETS debug info
5388 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
5389 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
5391 * src/commandtags.h:
5392 * src/LyXAction.C: insert code for InsetTabular.
5394 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
5395 not Button1MotionMask.
5396 (workAreaButtonRelease): send always a InsetButtonRelease event to
5398 (checkInsetHit): some setCursor fixes (always with insets).
5400 * src/BufferView2.C (lockInset): returns a bool now and extended for
5401 locking insets inside insets.
5402 (showLockedInsetCursor): it is important to have the cursor always
5403 before the locked inset.
5404 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
5406 * src/BufferView.h: made lockInset return a bool.
5408 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
5410 * src/text2.C (SetCursor): This now has a version with a LyXCursor
5411 that is used also internally but can be called as public to have back
5412 a cursor pos which is not set internally.
5413 (SetCursorIntern): Changed to use above function.
5415 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
5417 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5422 * NEWS: updated for prerelease of 1.1.5. Please comment and send
5423 patches for things that should be in or should be changed.
5425 * src/* [insetfiles]: change "usigned char fragile" to bool
5426 fragile. There was only one point that could that be questioned
5427 and that is commented in formulamacro.C. Grep for "CHECK".
5429 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
5430 (DeleteBuffer): take it out of CutAndPaste and make it static.
5432 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5434 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
5435 output the spacing envir commands. Also the new commands used in
5436 the LaTeX output makes the result better.
5438 * src/Spacing.C (writeEnvirBegin): new method
5439 (writeEnvirEnd): new method
5441 2000-04-18 Juergen Vigna <jug@sad.it>
5443 * src/CutAndPaste.C: made textclass a static member of the class
5444 as otherwise it is not accesed right!!!
5446 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
5448 * forms/layout_forms.fd
5449 * src/layout_forms.h
5450 * src/layout_forms.C (create_form_form_character)
5451 * src/lyx_cb.C (UserFreeFont)
5452 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
5453 documents (in the layout->character popup).
5455 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5457 * src/spellchecker.C (create_ispell_pipe): fix a bug where
5458 \spell_command was in fact not honored (from Kevin Atkinson).
5460 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
5463 * src/lyx_gui.h: make lyxViews private (Angus)
5465 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
5467 * src/mathed/math_write.C
5468 (MathMatrixInset::Write) Put \protect before \begin{array} and
5469 \end{array} if fragile
5470 (MathParInset::Write): Put \protect before \\ if fragile
5472 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5474 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
5475 initialization if the LyXColorHandler must be done after the
5476 connections to the XServer has been established.
5478 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
5479 get the background pixel from the lyxColorhandler so that the
5480 figures are rendered with the correct background color.
5481 (NextToken): removed functions.
5482 (GetPSSizes): use ifs >> string instead of NextToken.
5484 * src/Painter.[Ch]: the color cache moved out of this file.
5486 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
5489 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5491 * src/WorkArea.C (work_area_handler): call BufferView::enterView
5492 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
5494 * src/BufferView.C (enterView): new func
5495 (leaveView): new func
5497 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
5499 (leaveView): new func, undefines xterm cursor when approp.
5501 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
5502 (AllowInput): delete the Workarea cursor handling from this func.
5504 * src/Painter.C (underline): draw a slimer underline in most cases.
5506 * src/lyx_main.C (error_handler): use extern "C"
5508 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5510 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
5511 sent directly to me.
5513 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
5514 to the list by Dekel.
5516 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
5519 * src/bufferview_funcs.[Ch]: two new files, moved several of the
5520 methods from lyx_cb.here.
5522 * src/lyx_cb.C: in addition to the above; removed input_prohibited
5525 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5527 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
5528 instead of using current_view directly.
5530 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
5532 * src/LyXAction.C (init): add the paragraph-spacing command.
5534 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
5536 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
5538 * src/lyx_cb.C (CurrentState): output a string when the spacing is
5539 different from the documents.
5541 * src/text.C (SetHeightOfRow): take paragraph spacing into
5542 account, paragraph spacing takes precedence over buffer spacing
5543 (GetVisibleRow): ditto
5545 * src/paragraph.C (writeFile): output the spacing parameter too.
5546 (validate): set the correct features if spacing is used in the
5548 (Clear): set spacing to default
5549 (MakeSameLayout): spacing too
5550 (HasSameLayout): spacing too
5551 (SetLayout): spacing too
5552 (TeXOnePar): output the spacing commands
5554 * src/lyxparagraph.h: added a spacing variable for use with
5555 per-paragraph spacing.
5557 * src/Spacing.h: add a Default spacing and a method to check if
5558 the current spacing is default. also added an operator==
5560 * src/text2.C (DeleteEmptyParagraphMechanism): added a
5563 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5565 * src/lyxserver.C (callback): fix dispatch of functions
5567 * src/insets/insetlatexaccent.C (checkContents): turn bogus
5568 printf() into lyxerr call.
5570 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
5573 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
5574 "Table" to "Table Box", "Float" to "Floating Material"; deletes
5575 the "Float" from each of the subitems.
5576 (ShowHelpMenu): add entry for "FAQ" and "TOC".
5578 * src/support/DebugStream.h: add an #ifdef to work around a gcc
5579 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
5580 documented the change so that the workaround can be nuked later.
5582 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
5585 * src/lyxlex_pimpl.C (next): do not re-declare the default value
5587 * src/buffer.C (getLatexName): ditto
5588 (setReadonly): ditto
5590 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5592 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
5593 avoid some uses of current_view. Added also a bufferParams()
5594 method to get at this.
5596 * src/lyxtext.h: changed params->buffer and paramters->bparams.
5598 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5600 * src/lyxparagraph.[Ch]: removed
5601 operator<(LyXParagraph::InsetTable..., added a struct matchIT
5602 with operators used by lower_bound and
5603 upper_bound in InsetTable's
5604 Make struct InsetTable private again. Used matchpos.
5606 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
5608 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
5609 document, the language of existing text is changed (unless the
5610 document is multi-lingual)
5612 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
5614 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
5616 * A lot of files: A rewrite of the Right-to-Left support.
5618 2000-04-10 Juergen Vigna <jug@sad.it>
5620 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
5621 misplaced cursor when inset in inset is locked.
5623 * src/insets/insettext.C (LocalDispatch): small fix so that a
5624 BREAKLINE is not inserted if we don't permit it with autBreakRows.
5626 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
5627 footnote font should be decreased in size twice when displaying.
5629 * src/insets/insettext.C (GetDrawFont): inserted this function as
5630 the drawing-font may differ from the real paragraph font.
5632 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
5633 insets (inset in inset!).
5635 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
5636 function here because we don't want footnotes inside footnotes.
5638 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
5640 (init): now set the inset_owner in paragraph.C
5641 (LocalDispatch): added some resetPos() in the right position
5644 (pasteSelection): changed to use the new CutAndPaste-Class.
5646 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
5647 which tells if it is allowed to insert another inset inside this one.
5649 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
5650 SwitchLayoutsBetweenClasses.
5652 * src/text2.C (InsertInset): checking of the new paragraph-function
5654 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
5655 is not needed anymore here!
5658 (PasteSelection): redone (also with #ifdef) so that now this uses
5659 the CutAndPaste-Class.
5660 (SwitchLayoutsBetweenClasses): removed here and implemented in the
5663 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
5664 from/to text/insets.
5666 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
5667 so that the paragraph knows if it is inside an (text)-inset.
5668 (InsertFromMinibuffer): changed return-value to bool as now it
5669 may happen that an inset is not inserted in the paragraph.
5670 (InsertInsetAllowed): this checks if it is allowed to insert an
5671 inset in this paragraph.
5673 (BreakParagraphConservative):
5674 (BreakParagraph) : small change for the above change of the return
5675 value of InsertFromMinibuffer.
5677 * src/lyxparagraph.h: added inset_owner and the functions to handle
5678 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
5680 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5682 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
5683 functions from BufferView to BufferView::Pimpl to ease maintence.
5685 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
5686 correctly. Also use SetCursorIntern instead of SetCursor.
5688 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
5691 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5693 * src/WorkArea.C (belowMouse): manually implement below mouse.
5695 * src/*: Add "explicit" on several constructors, I added probably
5696 some unneeded ones. A couple of changes to code because of this.
5698 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
5699 implementation and private parts from the users of BufferView. Not
5702 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
5703 implementation and private parts from the users of LyXLex. Not
5706 * src/BufferView_pimpl.[Ch]: new files
5708 * src/lyxlex_pimpl.[Ch]: new files
5710 * src/LyXView.[Ch]: some inline functions move out-of-line
5712 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5714 * src/lyxparagraph.h: make struct InsetTable public.
5716 * src/support/lyxstring.h: change lyxstring::difference_type to be
5717 ptrdiff_t. Add std:: modifiers to streams.
5719 * src/font.C: include the <cctype> header, for islower() and
5722 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5724 * src/font.[Ch]: new files. Contains the metric functions for
5725 fonts, takes a LyXFont as parameter. Better separation of concepts.
5727 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
5728 changes because of this.
5730 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
5732 * src/*: compile with -Winline and move functions that don't
5735 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
5738 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5740 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
5741 (various files changed because of this)
5743 * src/Painter.C (text): fixed the drawing of smallcaps.
5745 * src/lyxfont.[Ch] (drawText): removed unused member func.
5748 * src/*.C: added needed "using" statements and "std::" qualifiers.
5750 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5752 * src/*.h: removed all use of "using" from header files use
5753 qualifier std:: instead.
5755 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5757 * src/text.C (Backspace): some additional cleanups (we already
5758 know whether cursor.pos is 0 or not).
5760 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
5761 automake does not provide one).
5763 * src/bmtable.h: replace C++ comments with C comments.
5765 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
5767 * src/screen.C (ShowCursor): Change the shape of the cursor if
5768 the current language is not equal to the language of the document.
5769 (If the cursor change its shape unexpectedly, then you've found a bug)
5771 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
5774 * src/insets/insetnumber.[Ch]: New files.
5776 * src/LyXAction.C (init)
5777 * src/lyxfunc.C (dispatch): Add command number-inset-insert
5780 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
5782 * src/lyxparagraph.h
5783 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
5784 (the vector is kept sorted).
5786 * src/text.C (GetVisibleRow): Draw selection correctly when there
5787 is both LTR and RTL text.
5789 * src/paragraph.C (Clone): Use the assignment operator for cloning,
5790 which is much faster.
5792 * src/text.C (GetVisibleRow and other): Do not draw the last space
5793 in a row if the direction of the last letter is not equal to the
5794 direction of the paragraph.
5796 * src/lyxfont.C (latexWriteStartChanges):
5797 Check that font language is not equal to basefont language.
5798 (latexWriteEndChanges): ditto
5800 * src/lyx_cb.C (StyleReset): Don't change the language while using
5801 the font-default command.
5803 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
5804 empty paragraph before a footnote.
5806 * src/insets/insetcommand.C (draw): Increase x correctly.
5808 * src/screen.C (ShowCursor): Change cursor shape if
5809 current language != document language.
5811 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
5813 2000-03-31 Juergen Vigna <jug@sad.it>
5815 * src/paragraph.C (GetInset): commented out text[pos] = ' '
5816 (Clone): changed mode how the paragraph-data is copied to the
5817 new clone-paragraph.
5819 * src/lyxfunc.C (Dispatch): fixed small problem when calling
5820 GetInset(pos) with no inset anymore there (in inset UNDO)
5822 * src/insets/insetcommand.C (draw): small fix as here x is
5823 incremented not as much as width() returns (2 before, 2 behind = 4)
5825 2000-03-30 Juergen Vigna <jug@sad.it>
5827 * src/insets/insettext.C (InsetText): small fix in initialize
5828 widthOffset (should not be done in the init() function)
5830 2000-03-29 Amir Karger <karger@lyx.org>
5832 * lib/examples/it_ItemizeBullets.lyx: translation by
5835 * Implemented \textasciitilde and fixed a tiny bug in reLyX
5837 2000-03-29 Juergen Vigna <jug@sad.it>
5839 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
5841 * src/insets/insetfoot.C (Clone): small change as for the below
5842 new init function in the text-inset
5844 * src/insets/insettext.C (init): new function as I've seen that
5845 clone did not copy the Paragraph-Data!
5846 (LocalDispatch): Added code so that now we have some sort of Undo
5847 functionality (well actually we HAVE Undo ;)
5849 * src/text.C (Backspace): Small fix for the a | a Backspace problem
5851 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
5853 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
5856 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5858 * src/main.C: added a runtime check that verifies that the xforms
5859 header used when building LyX and the library used when running
5860 LyX match. Exit with a message if they don't match. This is a
5861 version number check only.
5863 * src/buffer.C (save): Don't allocate memory on the heap for
5864 struct utimbuf times.
5866 * *: some using changes, use iosfwd instead of the real headers.
5868 * src/lyxfont.C use char const * instead of string for the static
5869 strings. Rewrite some functions to use sstream.
5871 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5873 * src/text.C (Backspace): hopefully fix the dreaded backaspace
5876 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5878 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
5879 of Geodesy (from Martin Vermeer)
5881 * lib/layouts/svjour.inc: include file for the Springer svjour
5882 class. It can be used to support journals other than JoG.
5884 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
5885 Miskiewicz <misiek@pld.org.pl>)
5886 * lib/reLyX/Makefile.am: ditto.
5888 2000-03-27 Juergen Vigna <jug@sad.it>
5890 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
5891 also some modifications with operations on selected text.
5893 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
5894 problems with clicking on insets (last famous words ;)
5896 * src/insets/insetcommand.C (draw):
5897 (width): Changed to have a bit of space before and after the inset so
5898 that the blinking cursor can be seen (otherwise it was hidden)
5900 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5902 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
5903 would not be added to the link list when an installed gettext (not
5904 part of libc) is found.
5906 2000-03-24 Juergen Vigna <jug@sad.it>
5908 * src/insets/insetcollapsable.C (Edit):
5909 * src/mathed/formula.C (InsetButtonRelease):
5910 (InsetButtonPress): fixed for new handling of ButtonPress/Release
5913 * src/BufferView.C (workAreaButtonPress):
5914 (workAreaButtonRelease):
5915 (checkInsetHit): Finally fixed the clicking on insets be handled
5918 * src/insets/insetert.C (Edit): inserted this call so that ERT
5919 insets work always with LaTeX-font
5921 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5923 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
5924 caused lyx to startup with no GUI in place, causing in a crash
5925 upon startup when called with arguments.
5927 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5929 * src/FontLoader.C: better initialization of dummyXFontStruct.
5931 2000-03-20 José Abílio Matos <jamatos@lyx.org>
5933 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
5934 for linuxdoc and docbook import and export format options.
5936 * lib/lyxrc.example Example of default values for the previous flags.
5938 * src/lyx_cb.C Use those flags instead of the hardwired values for
5939 linuxdoc and docbook export.
5941 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
5944 * src/menus.C Added menus entries for the new import/exports formats.
5946 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5948 * src/lyxrc.*: Added support for running without Gui
5951 * src/FontLoader.C: sensible defaults if no fonts are needed
5953 * src/lyx_cb.C: New function ShowMessage (writes either to the
5954 minibuffer or cout in case of no gui
5955 New function AskOverwrite for common stuff
5956 Consequently various changes to call these functions
5958 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
5959 wild guess at sensible screen resolution when having no gui
5961 * src/lyxfont.C: no gui, no fonts... set some defaults
5963 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5965 * src/LColor.C: made the command inset background a bit lighter.
5967 2000-03-20 Hartmut Goebel <goebel@noris.net>
5969 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
5970 stdstruct.inc. Koma-Script added some title elements which
5971 otherwise have been listed below "bibliography". This split allows
5972 adding title elements to where they belong.
5974 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
5975 define the additional tilte elements and then include
5978 * many other layout files: changed to include stdtitle.inc just
5979 before stdstruct.inc.
5981 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
5983 * src/buffer.C: (save) Added the option to store all backup files
5984 in a single directory
5986 * src/lyxrc.[Ch]: Added variable \backupdir_path
5988 * lib/lyxrc.example: Added descriptions of recently added variables
5990 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
5991 bibtex inset, not closing the bibtex popup when deleting the inset)
5993 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5995 * src/lyx_cb.C: add a couple using directives.
5997 2000-03-17 José Abílio Matos <jamatos@lyx.org>
5998 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
5999 import based on the filename.
6001 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
6002 file would be imported at start, if the filename where of a sgml file.
6004 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
6006 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
6008 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
6009 * src/lyxfont.h Replaced the member variable bits.direction by the
6010 member variable lang. Made many changes in other files.
6011 This allows having a multi-lingual document
6013 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
6014 that change the current language to <l>.
6015 Removed the command "font-rtl"
6017 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
6018 format for Hebrew documents)
6020 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
6021 When auto_mathmode is "true", pressing a digit key in normal mode
6022 will cause entering into mathmode.
6023 If auto_mathmode is "rtl" then this behavior will be active only
6024 when writing right-to-left text.
6026 * src/text2.C (InsertStringA) The string is inserted using the
6029 * src/paragraph.C (GetEndLabel) Gives a correct result for
6030 footnote paragraphs.
6032 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
6034 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6036 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
6037 front of PasteParagraph. Never insert a ' '. This should at least
6038 fix some cause for the segfaults that we have been experiencing,
6039 it also fixes backspace behaviour slightly. (Phu!)
6041 * src/support/lstrings.C (compare_no_case): some change to make it
6042 compile with gcc 2.95.2 and stdlibc++-v3
6044 * src/text2.C (MeltFootnoteEnvironment): change type o
6045 first_footnote_par_is_not_empty to bool.
6047 * src/lyxparagraph.h: make text private. Changes in other files
6049 (fitToSize): new function
6050 (setContentsFromPar): new function
6051 (clearContents): new function
6052 (SetChar): new function
6054 * src/paragraph.C (readSimpleWholeFile): deleted.
6056 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
6057 the file, just use a simple string instead. Also read the file in
6058 a more maintainable manner.
6060 * src/text2.C (InsertStringA): deleted.
6061 (InsertStringB): deleted.
6063 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6065 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
6066 RedoParagraphs from the doublespace handling part, just set status
6067 to NEED_MORE_REFRESH. Also don't update cursor position (should be
6068 done, but perhaps not like this.)
6070 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6072 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
6073 character when inserting an inset.
6075 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6077 * src/bufferparams.C (readLanguage): now takes "default" into
6080 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
6081 also initialize the toplevel_keymap with the default bindings from
6084 * src/buffer.C (Buffer): remove lyxrc from the parameters.
6086 * all files using lyxrc: have lyxrc as a real variable and not a
6087 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
6090 * src/lyxrc.C: remove double call to defaultKeyBindings
6092 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
6093 toolbar defauls using lyxlex. Remove enums, structs, functions
6096 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
6097 toolbar defaults. Also store default keybindings in a map.
6099 * src/ToolbarDefaults.[Ch]: New file. This class is used for
6100 storing the toolbar defaults without any xforms dependencies.
6102 * src/insets/figinset.C: patch posted to list by Andre Poenitz
6103 applied. Changed to use iterators.
6105 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
6107 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
6108 systems that don't have LINGUAS set to begin with.
6110 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6112 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
6113 the list by Dekel Tsur.
6115 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6117 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
6118 * src/insets/form_graphics.C: ditto.
6120 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
6122 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6124 * src/bufferparams.C (readLanguage): use the new language map
6126 * src/intl.C (InitKeyMapper): use the new language map
6128 * src/lyx_gui.C (create_forms): use the new language map
6130 * src/language.[Ch]: New files. Used for holding the information
6131 about each language. Now! Use this new language map enhance it and
6132 make it really usable for our needs.
6134 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
6136 * screen.C (ShowCursor): Removed duplicate code.
6137 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
6138 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
6140 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
6143 * src/text.C Added TransformChar method. Used for rendering Arabic
6144 text correctly (change the glyphs of the letter according to the
6145 position in the word)
6150 * src/lyxrc.C Added lyxrc command {language_command_begin,
6151 language_command_end,language_command_ltr,language_command_rtl,
6152 language_package} which allows the use of either arabtex or Omega
6155 * src/lyx_gui.C (init)
6157 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
6158 to use encoding for menu fonts which is different than the encoding
6161 * src/buffer.C (makeLaTeXFile): If params.language = "default",
6162 do not load the babel package.
6163 To write an English document with Hebrew/Arabic, change the document
6164 language to "english".
6166 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
6167 (alphaCounter): changed to return char
6168 (loweralphaCounter, hebrewCounter, romanCounter): New functions
6170 * lib/lyxrc.example Added examples for Hebrew/Arabic
6173 * src/layout.C Added layout command endlabeltype
6175 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
6177 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
6179 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6181 * src/mathed/math_delim.C (search_deco): return a
6182 math_deco_struct* instead of index.
6184 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6186 * All files with a USE_OSTREAM_ONLY within: removed all code that
6187 was unused when USE_OSTREAM_ONLY is defined.
6189 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
6190 of any less. Removed header and using.
6192 * src/text.C (GetVisibleRow): draw the string "Page Break
6193 (top/bottom)" on screen when drawing a pagebreak line.
6195 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6197 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
6199 * src/mathed/math_macro.C (draw): do some cast magic.
6202 * src/mathed/math_defs.h: change byte* argument to byte const*.
6204 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
6206 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
6207 know it is right to return InsetFoot* too, but cxx does not like
6210 * src/insets/insetcollapsable.[Ch] (Clone): make const.
6212 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
6214 * src/mathed/math_delim.C: change == to proper assignment.
6216 2000-03-09 Juergen Vigna <jug@sad.it>
6218 * src/insets/insettext.C (setPos): fixed various cursor positioning
6219 problems (via mouse and cursor-keys)
6220 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
6221 inset (still a small display problem but it works ;)
6223 * src/insets/insetcollapsable.C (draw): added button_top_y and
6224 button_bottom_y to have correct values for clicking on the inset.
6226 * src/support/lyxalgo.h: commented out 'using std::less'
6228 2000-03-08 Juergen Vigna <jug@sad.it>
6230 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
6231 Button-Release event closes as it is alos the Release-Event
6234 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
6236 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6238 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
6239 can add multiple spaces in Scrap (literate programming) styles...
6240 which, by the way, is how I got hooked on LyX to begin with.
6242 * src/mathed/formula.C (Write): Added dummy variable to an
6243 inset::Latex() call.
6244 (Latex): Add free_spacing boolean to inset::Latex()
6246 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
6248 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
6249 virtual function to include the free_spacing boolean from
6250 the containing paragraph's style.
6252 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
6253 Added free_spacing boolean arg to match inset.h
6255 * src/insets/insettext.C, src/insets/insettext.h (Latex):
6256 Added free_spacing boolean arg to match inset.h
6258 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
6259 Added free_spacing boolean and made sure that if in a free_spacing
6260 paragraph, that we output normal space if there is a protected space.
6262 * src/insets/insetref.C, src/insets/insetref.h (Latex):
6263 Added free_spacing boolean arg to match inset.h
6265 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
6266 Added free_spacing boolean arg to match inset.h
6268 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
6269 Added free_spacing boolean arg to match inset.h
6271 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
6272 Added free_spacing boolean arg to match inset.h
6274 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
6275 Added free_spacing boolean arg to match inset.h
6277 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
6278 free_spacing boolean arg to match inset.h
6280 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
6281 Added free_spacing boolean arg to match inset.h
6283 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
6284 Added free_spacing boolean arg to match inset.h
6286 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
6287 Added free_spacing boolean arg to match inset.h
6289 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
6290 Added free_spacing boolean arg to match inset.h
6292 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
6293 Added free_spacing boolean arg to match inset.h
6295 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
6296 free_spacing boolean arg to match inset.h
6298 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
6299 free_spacing boolean arg to match inset.h
6301 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
6302 ignore free_spacing paragraphs. The user's spaces are left
6305 * src/text.C (InsertChar): Fixed the free_spacing layout
6306 attribute behavior. Now, if free_spacing is set, you can
6307 add multiple spaces in a paragraph with impunity (and they
6308 get output verbatim).
6309 (SelectSelectedWord): Added dummy argument to inset::Latex()
6312 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
6315 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
6316 paragraph layouts now only input a simple space instead.
6317 Special character insets don't make any sense in free-spacing
6320 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
6321 hard-spaces in the *input* file to simple spaces if the layout
6322 is free-spacing. This converts old files which had to have
6323 hard-spaces in free-spacing layouts where a simple space was
6325 (writeFileAscii): Added free_spacing check to pass to the newly
6326 reworked inset::Latex(...) methods. The inset::Latex() code
6327 ensures that hard-spaces in free-spacing paragraphs get output
6328 as spaces (rather than "~").
6330 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6332 * src/mathed/math_delim.C (draw): draw the empty placeholder
6333 delims with a onoffdash line.
6334 (struct math_deco_compare): struct that holds the "functors" used
6335 for the sort and the binary search in math_deco_table.
6336 (class init_deco_table): class used for initial sort of the
6338 (search_deco): use lower_bound to do a binary search in the
6341 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6343 * src/lyxrc.C: a small secret thingie...
6345 * src/lyxlex.C (printTable): changed to take a ostream as paramter
6346 and to not flush the stream as often as it used to.
6348 * src/support/lyxalgo.h: new file
6349 (sorted): template function used for checking if a sequence is
6350 sorted or not. Two versions with and without user supplied
6351 compare. Uses same compare as std::sort.
6353 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
6354 it and give warning on lyxerr.
6356 (struct compare_tags): struct with function operators used for
6357 checking if sorted, sorting and lower_bound.
6358 (search_kw): use lower_bound instead of manually implemented
6361 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6363 * src/insets/insetcollapsable.h: fix Clone() declaration.
6364 * src/insets/insetfoot.h: ditto.
6366 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
6368 2000-03-08 Juergen Vigna <jug@sad.it>
6370 * src/insets/lyxinset.h: added owner call which tells us if
6371 this inset is inside another inset. Changed also the return-type
6372 of Editable to an enum so it tells clearer what the return-value is.
6374 * src/insets/insettext.C (computeTextRows): fixed computing of
6375 textinsets which split automatically on more rows.
6377 * src/insets/insetert.[Ch]: changed this to be of BaseType
6380 * src/insets/insetfoot.[Ch]: added footnote inset
6382 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
6383 collapsable insets (like footnote, ert, ...)
6385 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6387 * src/lyxdraw.h: remvoe file
6389 * src/lyxdraw.C: remove file
6391 * src/insets/insettext.C: added <algorithm>.
6393 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6395 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
6396 (matrix_cb): case MM_OK use string stream
6398 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
6401 * src/mathed/math_macro.C (draw): use string stream
6402 (Metrics): use string stream
6404 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
6405 directly to the ostream.
6407 * src/vspace.C (asString): use string stream.
6408 (asString): use string stream
6409 (asLatexString): use string stream
6411 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
6412 setting Spacing::Other.
6414 * src/LaTeXFeatures.C (getPackages): use string stream instead of
6415 sprintf when creating the stretch vale.
6417 * src/text2.C (alphaCounter): changed to return a string and to
6418 not use a static variable internally. Also fixed a one-off bug.
6419 (SetCounter): changed the drawing of the labels to use string
6420 streams instead of sprintf.
6422 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
6423 manipulator to use a scheme that does not require library support.
6424 This is also the way it is done in the new GNU libstdc++. Should
6425 work with DEC cxx now.
6427 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6429 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
6430 end. This fixes a bug.
6432 * src/mathed (all files concerned with file writing): apply the
6433 USE_OSTREAM_ONLY changes to mathed too.
6435 * src/support/DebugStream.h: make the constructor explicit.
6437 * src/lyxfont.C (latexWriteStartChanges): small bug related to
6438 count and ostream squashed.
6440 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6442 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
6444 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
6445 ostringstream uses STL strings, and we might not.
6447 * src/insets/insetspecialchar.C: add using directive.
6448 * src/insets/insettext.C: ditto.
6450 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6452 * lib/layouts/seminar.layout: feeble attempt at a layout for
6453 seminar.cls, far from completet and could really use some looking
6454 at from people used to write layout files.
6456 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
6457 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
6458 a lot nicer and works nicely with ostreams.
6460 * src/mathed/formula.C (draw): a slightly different solution that
6461 the one posted to the list, but I think this one works too. (font
6462 size wrong in headers.)
6464 * src/insets/insettext.C (computeTextRows): some fiddling on
6465 Jürgens turf, added some comments that he should read.
6467 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
6468 used and it gave compiler warnings.
6469 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
6472 * src/lyx_gui.C (create_forms): do the right thing when
6473 show_banner is true/false.
6475 * src/lyx_cb.C (TimerCB): no need to close or do anything if
6476 show_banner is false.
6478 * most file writing files: Now use iostreams to do almost all of
6479 the writing. Also instead of passing string &, we now use
6480 stringstreams. mathed output is still not adapted to iostreams.
6481 This change can be turned off by commenting out all the occurences
6482 of the "#define USE_OSTREAM_ONLY 1" lines.
6484 * src/WorkArea.C (createPixmap): don't output debug messages.
6485 (WorkArea): don't output debug messages.
6487 * lib/lyxrc.example: added a comment about the new variable
6490 * development/Code_rules/Rules: Added some more commente about how
6491 to build class interfaces and on how better encapsulation can be
6494 2000-03-03 Juergen Vigna <jug@sad.it>
6496 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
6497 automatically with the width of the LyX-Window
6499 * src/insets/insettext.C (computeTextRows): fixed update bug in
6500 displaying text-insets (scrollvalues where not initialized!)
6502 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6504 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
6505 id in the check of the result from lower_bound is not enough since
6506 lower_bound can return last too, and then res->id will not be a
6509 * all insets and some code that use them: I have conditionalized
6510 removed the Latex(string & out, ...) this means that only the
6511 Latex(ostream &, ...) will be used. This is a work in progress to
6512 move towards using streams for all output of files.
6514 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
6517 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6519 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
6520 routine (this fixes bug where greek letters were surrounded by too
6523 * src/support/filetools.C (findtexfile): change a bit the search
6524 algorithm, to fix bug introduced in 1.1.4. Note that --format is
6525 no longer passed to kpsewhich, we may have to change that later.
6527 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
6528 warning options to avoid problems with X header files (from Angus
6530 * acinclude.m4: regenerated.
6532 2000-03-02 Juergen Vigna <jug@sad.it>
6534 * src/insets/insettext.C (WriteParagraphData): Using the
6535 par->writeFile() function for writing paragraph-data.
6536 (Read): Using buffer->parseSingleLyXformat2Token()-function
6537 for parsing paragraph data!
6539 * src/buffer.C (readLyXformat2): removed all parse data and using
6540 the new parseSingleLyXformat2Token()-function.
6541 (parseSingleLyXformat2Token): added this function to parse (read)
6542 lyx-file-format (this is called also from text-insets now!)
6544 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6546 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
6549 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
6550 directly instead of going through a func. One very bad thing: a
6551 static LyXFindReplace, but I don't know where to place it.
6553 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
6554 string instead of char[]. Also changed to static.
6555 (GetSelectionOrWordAtCursor): changed to static inline
6556 (SetSelectionOverLenChars): ditto.
6558 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
6559 current_view and global variables. both classes has changed names
6560 and LyXFindReplace is not inherited from SearchForm.
6562 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
6563 fl_form_search form.
6565 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
6567 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6569 * lib/bind/*.bind: make sure 'buffer-previous' function is not
6570 bound (from Kayvan).
6572 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
6574 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
6576 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6578 * some things that I should comment but the local pub says head to
6581 * comment out all code that belongs to the Roff code for Ascii
6582 export of tables. (this is unused)
6584 * src/LyXView.C: use correct type for global variable
6585 current_layout. (LyXTextClass::size_type)
6587 * some code to get the new insetgraphics closer to working I'd be
6588 grateful for any help.
6590 * src/BufferView2.C (insertInset): use the return type of
6591 NumberOfLayout properly. (also changes in other files)
6593 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
6594 this as a test. I want to know what breaks because of this.
6596 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
6598 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6600 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
6601 to use a \makebox in the label, this allows proper justification
6602 with out using protected spaces or multiple hfills. Now it is
6603 "label" for left justified, "\hfill label\hfill" for center, and
6604 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
6605 should be changed accordingly.
6607 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6609 * src/lyxtext.h: change SetLayout() to take a
6610 LyXTextClass::size_type instead of a char (when there is more than
6611 127 layouts in a class); also change type of copylayouttype.
6612 * src/text2.C (SetLayout): ditto.
6613 * src/LyXView.C (updateLayoutChoice): ditto.
6615 * src/LaTeX.C (scanLogFile): errors where the line number was not
6616 given just after the '!'-line were ignored (from Dekel Tsur).
6618 * lib/lyxrc.example: fix description of \date_insert_format
6620 * lib/layouts/llncs.layout: new layout, contributed by Martin
6623 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6625 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
6626 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
6627 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
6628 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
6629 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
6630 paragraph.C, text.C, text2.C)
6632 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6634 * src/insets/insettext.C (LocalDispatch): remove extra break
6637 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
6638 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
6640 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
6641 * src/insets/insettext.[Ch] (GetCursorPos): ditto
6643 * src/insets/insetbib.h: move InsetBibkey::Holder and
6644 InsetCitation::Holder in public space.
6646 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6648 * src/insets/insettext.h: small change to get the new files from
6649 Juergen to compile (use "string", not "class string").
6651 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
6652 const & as parameter to LocalDispatch, use LyXFont const & as
6653 paramter to some other func. This also had impacto on lyxinsets.h
6654 and the two mathed insets.
6656 2000-02-24 Juergen Vigna <jug@sad.it>
6659 * src/commandtags.h:
6661 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
6665 * src/BufferView2.C: added/updated code for various inset-functions
6667 * src/insets/insetert.[Ch]: added implementation of InsetERT
6669 * src/insets/insettext.[Ch]: added implementation of InsetText
6671 * src/insets/inset.C (Edit): added "unsigned int button" parameter
6672 (draw): added preliminary code for inset scrolling not finshed yet
6674 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
6675 as it is in lyxfunc.C now
6677 * src/insets/lyxinset.h: Added functions for text-insets
6679 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6681 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
6682 BufferView and reimplement the list as a queue put inside its own
6685 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
6687 * several files: use the new interface to the "updateinsetlist"
6689 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
6691 (work_area_handler): call BufferView::trippleClick on trippleclick.
6693 * src/BufferView.C (doubleClick): new function, selects word on
6695 (trippleClick): new function, selects line on trippleclick.
6697 2000-02-22 Allan Rae <rae@lyx.org>
6699 * lib/bind/xemacs.bind: buffer-previous not supported
6701 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6703 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
6706 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6708 * src/bufferlist.C: get rid of current_view from this file
6710 * src/spellchecker.C: get rid of current_view from this file
6712 * src/vspace.C: get rid of current_view from this file
6713 (inPixels): added BufferView parameter for this func
6714 (asLatexCommand): added a BufferParams for this func
6716 * src/text.C src/text2.C: get rid of current_view from these
6719 * src/lyxfont.C (getFontDirection): move this function here from
6722 * src/bufferparams.C (getDocumentDirection): move this function
6725 * src/paragraph.C (getParDirection): move this function here from
6727 (getLetterDirection): ditto
6729 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6731 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
6732 resize due to wrong pixmap beeing used. Also took the opurtunity
6733 to make the LyXScreen stateless on regard to WorkArea and some
6734 general cleanup in the same files.
6736 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6738 * src/Makefile.am: add missing direction.h
6740 * src/PainterBase.h: made the width functions const.
6742 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
6745 * src/insets/insetcommand.C (draw): draw Editable as buttons.
6747 * src/insets/insetlatexaccent.C (draw): make the accents draw
6748 better, at present this will only work well with iso8859-1.
6750 * several files: remove the old drawing code, now we use the new
6753 * several files: remove support for mono_video, reverse_video and
6756 2000-02-17 Juergen Vigna <jug@sad.it>
6758 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
6759 int ** as we have to return the pointer, otherwise we have only
6760 NULL pointers in the returning function.
6762 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6764 * src/LaTeX.C (operator()): quote file name when running latex.
6766 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6768 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
6769 (bubble tip), this removes our special handling of this.
6771 * Remove all code that is unused now that we have the new
6772 workarea. (Code that are not active when NEW_WA is defined.)
6774 * Make the uses of XSync not conditionalized on define USE_XSYNC.
6776 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6778 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
6779 nonexisting layout; correctly redirect obsoleted layouts.
6781 * lib/lyxrc.example: document \view_dvi_paper_option
6783 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
6786 * src/lyx_cb.C (RunScript): handle $$FName for command names.
6787 (PreviewDVI): handle the view_dvi_paper_option variable.
6788 [Both from Roland Krause]
6790 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6792 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
6793 char const *, int, LyXFont)
6794 (text(int, int, string, LyXFont)): ditto
6796 * src/text.C (InsertCharInTable): attempt to fix the double-space
6797 feature in tables too.
6798 (BackspaceInTable): ditto.
6799 (GetVisibleRow): make bottom pagebreak line be a onoff line.
6801 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6803 * src/text2.C (owner): only complain if owner_ is set and bv != 0
6805 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
6806 newly found text in textcache to this.
6807 (buffer): set the owner of the text put into the textcache to 0
6809 * src/insets/figinset.C (draw): fixed the drawing of figures with
6812 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
6813 drawing of mathframe, hfills, protected space, table lines. I have
6814 now no outstanding drawing problems with the new Painter code.
6816 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6818 * src/PainterBase.C (ellipse, circle): do not specify the default
6821 * src/LColor.h: add using directive.
6823 * src/Painter.[Ch]: change return type of methods from Painter& to
6824 PainterBase&. Add a using directive.
6826 * src/WorkArea.C: wrap xforms callbacks in C functions
6829 * lib/layouts/foils.layout: font fix and simplifications from Carl
6832 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6834 * a lot of files: The Painter, LColor and WorkArea from the old
6835 devel branch has been ported to lyx-devel. Some new files and a
6836 lot of #ifdeffed code. The new workarea is enabled by default, but
6837 if you want to test the new Painter and LColor you have to compile
6838 with USE_PAINTER defined (do this in config.h f.ex.) There are
6839 still some rought edges, and I'd like some help to clear those
6840 out. It looks stable (loads and displays the Userguide very well).
6843 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6845 * src/buffer.C (pop_tag): revert to the previous implementation
6846 (use a global variable for both loops).
6848 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
6850 * src/lyxrc.C (LyXRC): change slightly default date format.
6852 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
6853 there is an English text with a footnote that starts with a Hebrew
6854 paragraph, or vice versa.
6855 (TeXFootnote): ditto.
6857 * src/text.C (LeftMargin): allow for negative values for
6858 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
6861 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
6862 for input encoding (cyrillic)
6864 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6866 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
6869 * src/toolbar.C (set): ditto
6870 * src/insets/insetbib.C (create_form_citation_form): ditto
6872 * lib/CREDITS: added Dekel Tsur.
6874 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
6875 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
6876 hebrew supports files from Dekel Tsur.
6878 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
6879 <tzafrir@technion.ac.il>
6881 * src/lyxrc.C: put \date_insert_format at the right place.
6883 * src/buffer.C (makeLaTeXFile): fix the handling of
6884 BufferParams::sides when writing out latex files.
6886 * src/BufferView2.C: add a "using" directive.
6888 * src/support/lyxsum.C (sum): when we use lyxstring,
6889 ostringstream::str needs an additional .c_str().
6891 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6893 * src/support/filetools.C (ChangeExtension): patch from Etienne
6896 * src/TextCache.C (show): remove const_cast and make second
6897 parameter non-const LyXText *.
6899 * src/TextCache.h: use non const LyXText in show.
6901 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
6904 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6906 * src/support/lyxsum.C: rework to be more flexible.
6908 * several places: don't check if a pointer is 0 if you are going
6911 * src/text.C: remove some dead code.
6913 * src/insets/figinset.C: remove some dead code
6915 * src/buffer.C: move the BufferView funcs to BufferView2.C
6916 remove all support for insetlatexdel
6917 remove support for oldpapersize stuff
6918 made some member funcs const
6920 * src/kbmap.C: use a std::list to store the bindings in.
6922 * src/BufferView2.C: new file
6924 * src/kbsequence.[Ch]: new files
6926 * src/LyXAction.C + others: remove all trace of buffer-previous
6928 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
6929 only have one copy in the binary of this table.
6931 * hebrew patch: moved some functions from LyXText to more
6932 appropriate places. (LyXParagraph, BufferParams, LyXFont)
6934 * several files: remove support for XForms older than 0.88
6936 remove some #if 0 #endif code
6938 * src/TextCache.[Ch]: new file. Holds the textcache.
6940 * src/BufferView.C: changes to use the new TextCache interface.
6941 (waitForX): remove the now unused code.
6943 * src/BackStack.h: remove some commented code
6945 * lib/bind/emacs.bind: remove binding for buffer-previous
6947 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6949 * applied the hebrew patch.
6951 * src/lyxrow.h: make sure that all Row variables are initialized.
6953 * src/text2.C (TextHandleUndo): comment out a delete, this might
6954 introduce a memory leak, but should also help us to not try to
6955 read freed memory. We need to look at this one.
6957 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
6958 (LyXParagraph): initalize footnotekind.
6960 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
6961 forgot this when applying the patch. Please heed the warnings.
6963 * src/BufferView.C (buffer): a fix for the buffer-reload problem
6964 (aka. reformat problem)
6966 * src/bufferlist.C (exists): made const, and use const_iterator
6967 (isLoaded): new func.
6968 (release): use std::find to find the correct buffer.
6970 * src/bufferlist.h: made getState a const func.
6971 made empty a const func.
6972 made exists a const func.
6975 2000-02-01 Juergen Vigna <jug@sad.it>
6977 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
6979 * po/it.po: updated a bit the italian po file and also changed the
6980 'file nuovo' for newfile to 'filenuovo' without a space, this did
6983 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
6984 for the new insert_date command.
6986 * src/lyxfunc.C (Dispatch): added support for a insert_date function
6987 from jdblair, to insert a date into the current text conforming to
6988 a strftime format (for now only considering the locale-set and not
6989 the document-language).
6991 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6993 * src/lyxfont.C (textWidth): hopefully better fix for the Array
6994 Bounds Read error seen by purify. The problem was that islower is
6995 a macros which takes an unsigned char and uses it as an index for
6996 in array of characters properties (and is thus subject to the
7000 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
7001 correctly the paper sides radio buttons.
7002 (UpdateDocumentButtons): ditto.
7004 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7006 * src/kbmap.C (getsym + others): change to return unsigned int,
7007 returning a long can give problems on 64 bit systems. (I assume
7008 that int is 32bit on 64bit systems)
7010 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7012 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
7013 LyXLookupString to be zero-terminated. Really fixes problems seen
7016 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7018 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
7019 write a (char*)0 to the lyxerr stream.
7021 * src/lastfiles.C: move algorithm before the using statemets.
7023 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7025 * src/lastfiles.C: move using directives in global scope (egcs 1.x
7026 complains otherwise).
7027 * src/table.C: ditto
7029 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
7032 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
7033 that I removed earlier... It is really needed.
7035 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
7037 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7039 * INSTALL: update xforms home page URL.
7041 * lib/configure.m4: fix a bug with unreadable layout files.
7043 * src/table.C (calculate_width_of_column): add "using std::max"
7046 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7048 * several files: marked several lines with "DEL LINE", this is
7049 lines that can be deleted without changing anything.
7050 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
7051 checks this anyway */
7054 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
7056 * src/DepTable.C (update): add a "+" at the end when the checksum
7057 is different. (debugging string only)
7059 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
7060 the next inset to not be displayed. This should also fix the list
7061 of labels in the "Insert Crossreference" dialog.
7063 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7065 * src/support/LSubstring.C (LSubstring): set pos to string::npos
7066 when regex was not found.
7068 * src/support/lstrings.C (lowercase): use handcoded transform always.
7071 * src/text.C (Delete): fixed the crash. cursor.par->prev and
7072 old_cursor.par->prev could be 0.
7074 * several files: changed post inc/dec to pre inc/dec
7076 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
7077 write the lastfiles to file.
7079 * src/BufferView.C (buffer): only show TextCache info when debugging
7081 (resizeCurrentBuffer): ditto
7082 (workAreaExpose): ditto
7084 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
7086 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
7088 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
7089 a bit better by removing the special case for \i and \j.
7091 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7093 * src/lyx_main.C (easyParse): remove test for bad comand line
7094 options, since this broke all xforms-related parsing.
7096 * src/kbmap.C (getsym): set return type to unsigned long, as
7097 declared in header. On an alpha, long is _not_ the same as int.
7099 * src/support/LOstream.h: add a "using std::flush;"
7101 * src/insets/figinset.C: ditto.
7103 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7105 * src/bufferlist.C (write): use blinding fast file copy instead of
7106 "a char at a time", now we are doing it the C++ way.
7108 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
7109 std::list<int> instead.
7110 (addpidwait): reflect move to std::list<int>
7111 (sigchldchecker): ditto
7113 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
7116 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
7117 that obviously was wrong...
7119 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
7120 c, this avoids warnings with purify and islower.
7122 * src/insets/figinset.C: rename struct queue to struct
7123 queue_element and rewrite to use a std::queue. gsqueue is now a
7124 std::queue<queue_element>
7125 (runqueue): reflect move to std::queue
7128 * src/support/lstrings.h (tostr): specialize for bool, otherwise
7129 we would get "1" "0" instead of "true" "false. Also make the tostr
7132 2000-01-21 Juergen Vigna <jug@sad.it>
7134 * src/buffer.C (writeFileAscii): Disabled code for special groff
7135 handling of tabulars till I fix this in table.C
7137 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7139 * src/support/mkdir.C (mkdir): change second argument of mkdir to
7141 * src/support/lyxlib.h: ditto.
7143 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7145 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
7146 and 'j' look better. This might fix the "macron" bug that has been
7149 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
7150 functions as one template function. Delete the old versions.
7152 * src/support/lyxsum.C: move using std::ifstream inside
7155 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
7158 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
7160 * src/mathed/formula.C: delete #include "bufferlist.h" never used
7162 * src/insets/figinset.C (InitFigures): use new instead of malloc
7163 to allocate memory for figures and bitmaps.
7164 (DoneFigures): use delete[] instead of free to deallocate memory
7165 for figures and bitmaps.
7166 (runqueue): use new to allocate
7167 (getfigdata): use new/delete[] instead of malloc/free
7168 (RegisterFigure): ditto
7170 * some files: moved some declarations closer to first use, small
7171 whitespace changes use preincrement instead of postincrement where
7172 it does not make a difference.
7174 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
7175 step on the way to use stl::containers for key maps.
7177 * src/bufferlist.h: add a typedef for const_iterator and const
7178 versions of begin and end.
7180 * src/bufferlist.[Ch]: change name of member variable _state to
7181 state_. (avoid reserved names)
7183 (getFileNames): returns the filenames of the buffers in a vector.
7185 * configure.in (ALL_LINGUAS): added ro
7187 * src/support/putenv.C: new file
7189 * src/support/mkdir.C: new file
7191 2000-01-20 Allan Rae <rae@lyx.org>
7193 * lib/layouts/IEEEtran.layout: Added several theorem environments
7195 * lib/templates/IEEEtran.lyx: Example theorem environments and a
7196 couple of minor additions.
7198 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
7199 (except for those in footnotes of course)
7201 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7203 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
7205 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
7206 std::sort and std::lower_bound instead of qsort and handwritten
7208 (struct compara): struct that holds the functors used by std::sort
7209 and std::lower_bound in MathedLookupBOP.
7211 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7213 * src/support/LAssert.h: do not do partial specialization. We do
7216 * src/support/lyxlib.h: note that lyx::getUserName() and
7217 lyx::date() are not in use right now. Should these be suppressed?
7219 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
7220 (makeLinuxDocFile): do not put date and user name in linuxdoc
7223 * src/support/lyxlib.h (kill): change first argument to long int,
7224 since that's what solaris uses.
7226 * src/support/kill.C (kill): fix declaration to match prototype.
7228 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
7229 actually check whether namespaces are supported. This is not what
7232 * src/support/lyxsum.C: add a using directive.
7234 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7236 * src/support/kill.C: if we have namespace support we don't have
7237 to include lyxlib.h.
7239 * src/support/lyxlib.h: use namespace lyx if supported.
7241 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7243 * src/support/date.C: new file
7245 * src/support/chdir.C: new file
7247 * src/support/getUserName.C: new file
7249 * src/support/getcwd.C: new file
7251 * src/support/abort.C: new file
7253 * src/support/kill.C: new file
7255 * src/support/lyxlib.h: moved all the functions in this file
7256 insede struct lyx. Added also kill and abort to this struct. This
7257 is a way to avoid the "kill is not defined in <csignal>", we make
7258 C++ wrappers for functions that are not ANSI C or ANSI C++.
7260 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
7261 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
7262 lyx it has been renamed to sum.
7264 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7266 * src/text.C: add using directives for std::min and std::max.
7268 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7270 * src/texrow.C (getIdFromRow): actually return something useful in
7271 id and pos. Hopefully fixes the bug with positionning of errorbox
7274 * src/lyx_main.C (easyParse): output an error and exit if an
7275 incorrect command line option has been given.
7277 * src/spellchecker.C (ispell_check_word): document a memory leak.
7279 * src/bufferlist.C (write): fix mismatched allocation/deletion,
7280 where a "struct utimbuf" is allocated with "new" and deleted with
7283 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
7285 * src/text2.C (CutSelection): don't delete double spaces.
7286 (PasteSelection): ditto
7287 (CopySelection): ditto
7289 * src/text.C (Backspace): don't delete double spaces.
7291 * src/lyxlex.C (next): fix a bug that were only present with
7292 conformant std::istream::get to read comment lines, use
7293 std::istream::getline instead. This seems to fix the problem.
7295 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7297 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
7298 allowed to insert space before space" editing problem. Please read
7299 commends at the beginning of the function. Comments about usage
7302 * src/text.C (InsertChar): fix for the "not allowed to insert
7303 space before space" editing problem.
7305 * src/text2.C (DeleteEmptyParagraphMechanism): when
7306 IsEmptyTableRow can only return false this last "else if" will
7307 always be a no-op. Commented out.
7309 * src/text.C (RedoParagraph): As far as I can understand tmp
7310 cursor is not really needed.
7312 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
7313 present it could only return false anyway.
7314 (several functions): Did something not so smart...added a const
7315 specifier on a lot of methods.
7317 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
7318 and add a tmp->text.resize. The LyXParagraph constructor does the
7320 (BreakParagraphConservative): ditto
7322 * src/support/path.h (Path): add a define so that the wrong usage
7323 "Path("/tmp") will be flagged as a compilation error:
7324 "`unnamed_Path' undeclared (first use this function)"
7326 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7328 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
7329 which was bogus for several reasons.
7331 * src/LaTeX.C (scanAux): fix the regular expression used to scan
7335 * autogen.sh: do not use "type -path" (what's that anyway?).
7337 * src/support/filetools.C (findtexfile): remove extraneous space
7338 which caused a kpsewhich warning (at least with kpathsea version
7341 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7343 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
7345 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
7347 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
7349 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7351 * src/paragraph.C (BreakParagraph): do not reserve space on text
7352 if we don't need to (otherwise, if pos_end < pos, we end up
7353 reserving huge amounts of memory due to bad unsigned karma).
7354 (BreakParagraphConservative): ditto, although I have not seen
7355 evidence the bug can happen here.
7357 * src/lyxparagraph.h: add a using std::list.
7359 2000-01-11 Juergen Vigna <jug@sad.it>
7361 * src/menus.C (MenuDocu): output an Alert if the documentation-file
7364 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7366 * src/vc-backend.C (doVCCommand): change to be static and take one
7367 more parameter: the path to chdir too be fore executing the command.
7368 (retrive): new function equiv to "co -r"
7370 * src/bufferlist.C (loadLyXFile): implement the missing parts if
7371 file_not_found_hook is true.
7373 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
7375 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
7376 if a file is readwrite,readonly...anything else.
7378 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7380 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
7381 (CreatePostscript): name change from MenuRunDVIPS (or something)
7382 (PreviewPostscript): name change from MenuPreviewPS
7383 (PreviewDVI): name change from MenuPreviewDVI
7385 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
7386 \view_pdf_command., \pdf_to_ps_command
7388 * lib/configure.m4: added search for PDF viewer, and search for
7389 PDF to PS converter.
7390 (lyxrc.defaults output): add \pdflatex_command,
7391 \view_pdf_command and \pdf_to_ps_command.
7393 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
7395 * src/bufferlist.C (write): we don't use blocksize for anything so
7398 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7400 * src/support/block.h: disable operator T* (), since it causes
7401 problems with both compilers I tried. See comments in the file.
7403 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
7406 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
7407 variable LYX_DIR_10x to LYX_DIR_11x.
7409 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
7411 * INSTALL: document --with-lyxname.
7414 * configure.in: new configure flag --with-lyxname which allows to
7415 choose the name under which lyx is installed. Default is "lyx", of
7416 course. It used to be possible to do this with --program-suffix,
7417 but the later has in fact a different meaning for autoconf.
7419 * src/support/lstrings.h (lstrchr): reformat a bit.
7421 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
7422 * src/mathed/math_defs.h: ditto.
7424 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7426 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
7427 true, decides if we create a backup file or not when saving. New
7428 tag and variable \pdf_mode, defaults to false. New tag and
7429 variable \pdflatex_command, defaults to pdflatex. New tag and
7430 variable \view_pdf_command, defaults to xpdf. New tag and variable
7431 \pdf_to_ps_command, defaults to pdf2ps.
7433 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7435 * src/bufferlist.C (close): don't call insetUnlock if the buffer
7436 does not have a BufferView.
7437 (unlockInset): ditto + don't access the_locking_inset if the
7438 buffer does not have a BufferView.
7440 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
7441 certain circumstances so that we don't continue a keyboard
7442 operation long after the key was released. Try f.ex. to load a
7443 large document, press PageDown for some seconds and then release
7444 it. Before this change the document would contine to scroll for
7445 some time, with this change it stops imidiatly.
7447 * src/support/block.h: don't allocate more space than needed. As
7448 long as we don't try to write to the arr[x] in a array_type arr[x]
7449 it is perfectly ok. (if you write to it you might segfault).
7450 added operator value_type*() so that is possible to pass the array
7451 to functions expecting a C-pointer.
7453 * lib/Makefile.am (dist-hook): don't fail completely if unable to
7456 * intl/*: updated to gettext 0.10.35, tried to add our own
7457 required modifications. Please verify.
7459 * po/*: updated to gettext 0.10.35, tried to add our own required
7460 modifications. Please verify.
7462 * src/support/lstrings.C (tostr): go at fixing the problem with
7463 cxx and stringstream. When stringstream is used return
7464 oss.str().c_str() so that problems with lyxstring and basic_string
7465 are avoided. Note that the best solution would be for cxx to use
7466 basic_string all the way, but it is not conformant yet. (it seems)
7468 * src/lyx_cb.C + other files: moved several global functions to
7469 class BufferView, some have been moved to BufferView.[Ch] others
7470 are still located in lyx_cb.C. Code changes because of this. (part
7471 of "get rid of current_view project".)
7473 * src/buffer.C + other files: moved several Buffer functions to
7474 class BufferView, the functions are still present in buffer.C.
7475 Code changes because of this.
7477 * config/lcmessage.m4: updated to most recent. used when creating
7480 * config/progtest.m4: updated to most recent. used when creating
7483 * config/gettext.m4: updated to most recent. applied patch for
7486 * config/gettext.m4.patch: new file that shows what changes we
7487 have done to the local copy of gettext.m4.
7489 * config/libtool.m4: new file, used in creation of acinclude.m4
7491 * config/lyxinclude.m4: new file, this is the lyx created m4
7492 macros, used in making acinclude.m4.
7494 * autogen.sh: GNU m4 discovered as a separate task not as part of
7495 the lib/configure creation.
7496 Generate acinlucde from files in config. Actually cat
7497 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
7498 easier to upgrade .m4 files that really are external.
7500 * src/Spacing.h: moved using std::istringstream to right after
7501 <sstream>. This should fix the problem seen with some compilers.
7503 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7505 * src/lyx_cb.C: began some work to remove the dependency a lot of
7506 functions have on BufferView::text, even if not really needed.
7507 (GetCurrentTextClass): removed this func, it only hid the
7510 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
7511 forgot this in last commit.
7513 * src/Bullet.C (bulletEntry): use static char const *[] for the
7514 tables, becuase of this the return arg had to change to string.
7516 (~Bullet): removed unneeded destructor
7518 * src/BufferView.C (beforeChange): moved from lyx_cb.C
7519 (insetSleep): moved from Buffer
7520 (insetWakeup): moved from Buffer
7521 (insetUnlock): moved from Buffer
7523 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
7524 from Buffer to BufferView.
7526 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
7528 * config/ltmain.sh: updated to version 1.3.4 of libtool
7530 * config/ltconfig: updated to version 1.3.4 of libtool
7532 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7535 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
7536 Did I get that right?
7538 * src/lyxlex.h: add a "using" directive or two.
7539 * src/Spacing.h: ditto.
7540 * src/insets/figinset.C: ditto.
7541 * src/support/filetools.C: ditto.
7542 * src/support/lstrings.C: ditto.
7543 * src/BufferView.C: ditto.
7544 * src/bufferlist.C: ditto.
7545 * src/lyx_cb.C: ditto.
7546 * src/lyxlex.C: ditto.
7548 * NEWS: add some changes for 1.1.4.
7550 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7552 * src/BufferView.C: first go at a TextCache to speed up switching
7555 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7557 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
7558 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
7559 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
7560 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
7563 * src/mathed/math_defs.h (MathedRowSt): make sure that all
7564 members of the struct are correctly initialized to 0 (detected by
7566 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
7567 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
7569 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
7570 pidwait, since it was allocated with "new". This was potentially
7571 very bad. Thanks to Michael Schmitt for running purify for us.
7574 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7576 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
7578 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
7580 1999-12-30 Allan Rae <rae@lyx.org>
7582 * lib/templates/IEEEtran.lyx: minor change
7584 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
7585 src/mathed/formula.C (LocalDispatch): askForText changes
7587 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
7588 know when a user has cancelled input. Fixes annoying problems with
7589 inserting labels and version control.
7591 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7593 * src/support/lstrings.C (tostr): rewritten to use strstream and
7596 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7598 * src/support/filetools.C (IsFileWriteable): use fstream to check
7599 (IsDirWriteable): use fileinfo to check
7601 * src/support/filetools.h (FilePtr): whole class deleted
7603 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
7605 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
7607 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
7609 * src/bufferlist.C (write): use ifstream and ofstream instead of
7612 * src/Spacing.h: use istrstream instead of sscanf
7614 * src/mathed/math_defs.h: change first arg to istream from FILE*
7616 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
7618 * src/mathed/math_parser.C: have yyis to be an istream
7619 (LexGetArg): use istream (yyis)
7621 (mathed_parse): ditto
7622 (mathed_parser_file): first arg istream instead of FILE*, set yyis
7624 * src/mathed/formula.C (Read): rewritten to use istream
7626 * src/mathed/formulamacro.C (Read): rewritten to use istream
7628 * src/lyxlex.h (~LyXLex): deleted desturctor
7629 (getStream): new function, returns an istream
7630 (getFile): deleted funtion
7631 (IsOK): return is.good();
7633 * src/lyxlex.C (LyXLex): delete file and owns_file
7634 (setFile): open an filebuf and assign that to a istream instead of
7636 (setStream): new function, takes an istream as arg.
7637 (setFile): deleted function
7638 (EatLine): rewritten us use istream instead of FILE*
7642 * src/table.C (LyXTable): use istream instead of FILE*
7643 (Read): rewritten to take an istream instead of FILE*
7645 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7647 * src/buffer.C (Dispatch): remove an extraneous break statement.
7649 * src/support/filetools.C (QuoteName): change to do simple
7650 'quoting'. More work is necessary. Also changed to do nothing
7651 under emx (needs fix too).
7652 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
7654 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
7655 config.h.in to the AC_DEFINE_UNQUOTED() call.
7656 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
7657 needs char * as argument (because Solaris 7 declares it like
7660 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
7661 remove definition of BZERO.
7663 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7665 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
7666 defined, "lyxregex.h" if not.
7668 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
7670 (REGEX): new variable that is set to regex.c lyxregex.h when
7671 AM_CONDITIONAL USE_REGEX is set.
7672 (libsupport_la_SOURCES): add $(REGEX)
7674 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
7677 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
7680 * configure.in: add call to LYX_REGEX
7682 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
7683 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
7685 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7687 * lib/bind/fi_menus.bind: new file, from
7688 pauli.virtanen@saunalahti.fi.
7690 * src/buffer.C (getBibkeyList): pass the parameter delim to
7691 InsetInclude::getKeys and InsetBibtex::getKeys.
7693 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
7694 is passed to Buffer::getBibkeyList
7696 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
7697 instead of the hardcoded comma.
7699 * src/insets/insetbib.C (getKeys): make sure that there are not
7700 leading blanks in bibtex keys. Normal latex does not care, but
7701 harvard.sty seems to dislike blanks at the beginning of citation
7702 keys. In particular, the retturn value of the function is
7704 * INSTALL: make it clear that libstdc++ is needed and that gcc
7705 2.7.x probably does not work.
7707 * src/support/filetools.C (findtexfile): make debug message go to
7709 * src/insets/insetbib.C (getKeys): ditto
7711 * src/debug.C (showTags): make sure that the output is correctly
7714 * configure.in: add a comment for TWO_COLOR_ICON define.
7716 * acconfig.h: remove all the entries that already defined in
7717 configure.in or acinclude.m4.
7719 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
7720 to avoid user name, date and copyright.
7722 1999-12-21 Juergen Vigna <jug@sad.it>
7724 * src/table.C (Read): Now read bogus row format informations
7725 if the format is < 5 so that afterwards the table can
7726 be read by lyx but without any format-info. Fixed the
7727 crash we experienced when not doing this.
7729 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7731 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
7732 (RedoDrawingOfParagraph): ditto
7733 (RedoParagraphs): ditto
7734 (RemoveTableRow): ditto
7736 * src/text.C (Fill): rename arg paperwidth -> paper_width
7738 * src/buffer.C (insertLyXFile): rename var filename -> fname
7739 (writeFile): rename arg filename -> fname
7740 (writeFileAscii): ditto
7741 (makeLaTeXFile): ditto
7742 (makeLinuxDocFile): ditto
7743 (makeDocBookFile): ditto
7745 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
7748 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
7750 * src/bmtable.h: add extern "C" on this file when __cplusplus is
7753 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
7754 compiled by a C compiler not C++.
7756 * src/layout.h (LyXTextClass): added typedef for const_iterator
7757 (LyXTextClassList): added typedef for const_iterator + member
7758 functions begin and end.
7760 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
7761 iterators to fill the choice_class.
7762 (updateLayoutChoice): rewritten to use iterators to fill the
7763 layoutlist in the toolbar.
7765 * src/BufferView.h (BufferView::work_area_width): removed unused
7768 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
7770 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
7771 (sgmlCloseTag): ditto
7773 * src/support/lstrings.h: return type of countChar changed to
7776 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
7777 what version of this func to use. Also made to return unsigned int.
7779 * configure.in: call LYX_STD_COUNT
7781 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
7782 conforming std::count.
7784 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7786 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
7787 and a subscript would give bad display (patch from Dekel Tsur
7788 <dekel@math.tau.ac.il>).
7790 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
7792 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
7795 * src/chset.h: add a few 'using' directives
7797 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
7798 triggered when no buffer is active
7800 * src/layout.C: removed `break' after `return' in switch(), since
7803 * src/lyx_main.C (init): make sure LyX can be ran in place even
7804 when libtool has done its magic with shared libraries. Fix the
7805 test for the case when the system directory has not been found.
7807 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
7808 name for the latex file.
7809 (MenuMakeHTML): ditto
7811 * src/buffer.h: add an optional boolean argument, which is passed
7814 1999-12-20 Allan Rae <rae@lyx.org>
7816 * lib/templates/IEEEtran.lyx: small correction and update.
7818 * configure.in: Attempted to use LYX_PATH_HEADER
7820 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
7822 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
7823 input from JMarc. Now use preprocessor to find the header.
7824 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
7825 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
7826 LYX_STL_STRING_FWD. See comments in file.
7828 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
7830 * The global MiniBuffer * minibuffer variable is dead.
7832 * The global FD_form_main * fd_form_main variable is dead.
7834 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7836 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
7838 * src/table.h: add the LOstream.h header
7839 * src/debug.h: ditto
7841 * src/LyXAction.h: change the explaination of the ReadOnly
7842 attribute: is indicates that the function _can_ be used.
7844 * src/LyXAction.C (init): find-replace _can_ be used in read-only
7847 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7849 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
7855 * src/paragraph.C (GetWord): assert on pos>=0
7858 * src/support/lyxstring.C: condition the use of an invariant on
7860 * src/support/lyxstring.h: ditto
7862 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
7863 Use LAssert.h instead of plain assert().
7865 * src/support/lstrings.h: add LAssert.h, in case it is needed.
7867 * src/lyxfunc.C: do not include LAssert.h, it is not used.
7868 * src/support/filetools.C: ditto
7870 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
7873 * INSTALL: document the new configure flags
7875 * configure.in: suppress --with-debug; add --enable-assertions
7877 * acinclude.m4: various changes in alignment of help strings.
7879 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7881 * src/kbmap.C: commented out the use of the hash map in kb_map,
7882 beginning of movement to a stl::container.
7884 * several files: removed code that was not in effect when
7885 MOVE_TEXT was defined.
7887 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
7888 for escaping should not be used. We can discuss if the string
7889 should be enclosed in f.ex. [] instead of "".
7891 * src/trans_mgr.C (insert): use the new returned value from
7892 encodeString to get deadkeys and keymaps done correctly.
7894 * src/chset.C (encodeString): changed to return a pair, to tell
7895 what to use if we know the string.
7897 * src/lyxscreen.h (fillArc): new function.
7899 * src/FontInfo.C (resize): rewritten to use more std::string like
7900 structore, especially string::replace.
7902 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
7905 * configure.in (chmod +x some scripts): remove config/gcc-hack
7907 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7909 * src/buffer.C (writeFile): change once again the top comment in a
7910 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
7911 instead of an hardcoded version number.
7912 (makeDocBookFile): ditto
7914 * src/version.h: add new define LYX_DOCVERSION
7916 * po/de.po: update from Pit Sütterlin
7917 * lib/bind/de_menus.bind: ditto.
7919 * src/lyxfunc.C (Dispatch): call MenuExport()
7920 * src/buffer.C (Dispatch): ditto
7922 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
7923 LyXFunc::Dispatch().
7924 (MenuExport): new function, moved from
7925 LyXFunc::Dispatch().
7927 * src/trans_mgr.C (insert): small cleanup
7928 * src/chset.C (loadFile): ditto
7930 * lib/kbd/iso8859-1.cdef: add missing backslashes
7932 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7934 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
7935 help with placing the manually drawn accents better.
7937 (Draw): x2 and hg changed to float to minimize rounding errors and
7938 help place the accents better.
7940 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
7941 unsigned short to char is just wrong...cast the char to unsigned
7942 char instead so that the two values can compare sanely. This
7943 should also make the display of insetlatexaccents better and
7944 perhaps also some other insets.
7946 (lbearing): new function
7949 1999-12-15 Allan Rae <rae@lyx.org>
7951 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
7952 header that provides a wrapper around the very annoying SGI STL header
7955 * src/support/lyxstring.C, src/LString.h:
7956 removed old SGI-STL-compatability attempts.
7958 * configure.in: Use LYX_STL_STRING_FWD.
7960 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
7961 stl_string_fwd.h is around and try to determine it's location.
7962 Major improvement over previous SGI STL 3.2 compatability.
7963 Three small problems remain with this function due to my zero
7964 knowledge of autoconf. JMarc and lgb see the comments in the code.
7966 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7968 * src/broken_const.h, config/hack-gcc, config/README: removed
7970 * configure.in: remove --with-gcc-hack option; do not call
7973 * INSTALL: remove documentation of --with-broken-const and
7976 * acconfig.h: remove all trace of BROKEN_CONST define
7978 * src/buffer.C (makeDocBookFile): update version number in output
7980 (SimpleDocBookOnePar): fix an assert when trying to a character
7981 access beyond string length
7984 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7986 * po/de.po: fix the Export menu
7988 * lyx.man: update the description of -dbg
7990 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
7991 (commandLineHelp): updated
7992 (easyParse): show list of available debug levels if -dbg is passed
7995 * src/Makefile.am: add debug.C
7997 * src/debug.h: moved some code to debug.C
7999 * src/debug.C: new file. Contains code to set and show debug
8002 * src/layout.C: remove 'break' after 'continue' in switch
8003 statements, since these cannot be reached.
8005 1999-12-13 Allan Rae <rae@lyx.org>
8007 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
8008 (in_word_set): hash() -> math_hash()
8010 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
8012 * acconfig.h: Added a test for whether we are using exceptions in the
8013 current compilation run. If so USING_EXCEPTIONS is defined.
8015 * config.in: Check for existance of stl_string_fwd.h
8016 * src/LString.h: If compiling --with-included-string and SGI's
8017 STL version 3.2 is present (see above test) we need to block their
8018 forward declaration of string and supply a __get_c_string().
8019 However, it turns out this is only necessary if compiling with
8020 exceptions enabled so I've a bit more to add yet.
8022 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
8023 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
8024 src/support/LRegex.h, src/undo.h:
8025 Shuffle the order of the included files a little to ensure that
8026 LString.h gets included before anything that includes stl_string_fwd.h
8028 * src/support/lyxstring.C: We need to #include LString.h instead of
8029 lyxstring.h to get the necessary definition of __get_c_string.
8030 (__get_c_string): New function. This is defined static just like SGI's
8031 although why they need to do this I'm not sure. Perhaps it should be
8032 in lstrings.C instead.
8034 * lib/templates/IEEEtran.lyx: New template file.
8036 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8038 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
8039 * intl/Makefile.in (MKINSTALLDIRS): ditto
8041 * src/LyXAction.C (init): changed to hold the LFUN data in a
8042 automatic array in stead of in callso to newFunc, this speeds up
8043 compilation a lot. Also all the memory used by the array is
8044 returned when the init is completed.
8046 * a lot of files: compiled with -Wold-style-cast, changed most of
8047 the reported offenders to C++ style casts. Did not change the
8048 offenders in C files.
8050 * src/trans.h (Match): change argument type to unsigned int.
8052 * src/support/DebugStream.C: fix some types on the streambufs so
8053 that it works on a conforming implementation.
8055 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8057 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
8059 * src/support/lyxstring.C: remove the inline added earlier since
8060 they cause a bunch of unsatisfied symbols when linking with dec
8061 cxx. Cxx likes to have the body of inlines at the place where they
8064 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
8065 accessing negative bounds in array. This fixes the crash when
8066 inserting accented characters.
8067 * src/trans.h (Match): ditto
8069 * src/buffer.C (Dispatch): since this is a void, it should not try
8070 to return anything...
8072 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8074 * src/buffer.h: removed the two friends from Buffer. Some changes
8075 because of this. Buffer::getFileName and Buffer::setFileName
8076 renamed to Buffer::fileName() and Buffer::fileName(...).
8078 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8080 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
8081 and Buffer::update(short) to BufferView. This move is currently
8082 controlled by a define MOVE_TEXT, this will be removed when all
8083 shows to be ok. This move paves the way for better separation
8084 between buffer contents and buffer view. One side effect is that
8085 the BufferView needs a rebreak when swiching buffers, if we want
8086 to avoid this we can add a cache that holds pointers to LyXText's
8087 that is not currently in use.
8089 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
8092 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8094 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
8096 * lyx_main.C: new command line option -x (or --execute) and
8097 -e (or --export). Now direct conversion from .lyx to .tex
8098 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
8099 Unfortunately, X is still needed and the GUI pops up during the
8102 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8104 * src/Spacing.C: add a using directive to bring stream stuff into
8106 * src/paragraph.C: ditto
8107 * src/buffer.C: ditto
8109 * NEWS: updated a bit the new features of 1.1.3 (took a few things
8110 from Lars' announcement).
8112 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
8113 example files from Tino Meinen.
8115 1999-12-06 Allan Rae <rae@lyx.org>
8117 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
8119 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8121 * src/support/lyxstring.C: added a lot of inline for no good
8124 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
8125 latexWriteEndChanges, they were not used.
8127 * src/layout.h (operator<<): output operator for PageSides
8129 * src/mathed/math_iter.C (my_memcpy): slightly changed.
8131 * some example files: loaded in LyX 1.0.4 and saved again to update
8132 certain constructs (table format)
8134 * a lot of files: did the change to use fstream/iostream for all
8135 writing of files. Done with a close look at Andre Poenitz's patch.
8137 * some files: whitespace changes.
8139 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8141 * src/mathed/math_iter.C (my_memcpy): new function. Since the
8142 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
8143 architecture, we provide our own. It is used unconditionnally, but
8144 I do not think this is a performance problem. Thanks to Angus
8145 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
8146 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
8148 (GetInset): use my_memcpy.
8152 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
8153 it is easier to understand, but it uses less TeX-only constructs now.
8155 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
8156 elements contain spaces
8158 * lib/configure: regenerated
8160 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
8161 elements contain spaces; display the list of programs that are
8164 * autogen.sh: make sure lib/configure is executable
8166 * lib/examples/*: rename the tutorial examples to begin with the
8167 two-letters language code.
8169 * src/lyxfunc.C (getStatus): do not query current font if no
8172 * src/lyx_cb.C (RunScript): use QuoteName
8173 (MenuRunDvips): ditto
8174 (PrintApplyCB): ditto
8176 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
8177 around argument, so that it works well with the current shell.
8178 Does not work properly with OS/2 shells currently.
8180 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
8181 * src/LyXSendto.C (SendtoApplyCB): ditto
8182 * src/lyxfunc.C (Dispatch): ditto
8183 * src/buffer.C (runLaTeX): ditto
8184 (runLiterate): ditto
8185 (buildProgram): ditto
8187 * src/lyx_cb.C (RunScript): ditto
8188 (MenuMakeLaTeX): ditto
8190 * src/buffer.h (getLatexName): new method
8192 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
8194 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8196 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
8197 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
8198 (create_math_panel): ditto
8200 * src/lyxfunc.C (getStatus): re-activate the code which gets
8201 current font and cursor; add test for export to html.
8203 * src/lyxrc.C (read): remove unreachable break statements; add a
8206 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
8208 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8210 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
8211 introduced by faulty regex.
8212 * src/buffer.C: ditto
8213 * src/lastfiles.C: ditto
8214 * src/paragraph.C: ditto
8215 * src/table.C: ditto
8216 * src/vspace.C: ditto
8217 * src/insets/figinset.C: ditto
8218 Note: most of these is absolutely harmless, except the one in
8219 src/mathed formula.C.
8221 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8223 * src/ImportNoweb.C (documentclass): fixed bounds for substr
8224 operation, yielding correct results for the reLyX command.
8226 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8228 * src/support/filetools.C (ExpandPath): removed an over eager
8230 (ReplaceEnvironmentPath): ditto
8232 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
8233 shows that we are doing something fishy in our code...
8237 * src/lyxrc.C (read): use a double switch trick to get more help
8238 from the compiler. (the same trick is used in layout.C)
8239 (write): new function. opens a ofstream and pass that to output
8240 (output): new function, takes a ostream and writes the lyxrc
8241 elemts to it. uses a dummy switch to make sure no elements are
8244 * src/lyxlex.h: added a struct pushpophelper for use in functions
8245 with more than one exit point.
8247 * src/lyxlex.[Ch] (GetInteger): made it const
8251 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
8253 * src/layout.[hC] : LayoutTags splitted into several enums, new
8254 methods created, better error handling cleaner use of lyxlex. Read
8257 * src/bmtable.[Ch]: change some member prototypes because of the
8258 image const changes.
8260 * commandtags.h, src/LyXAction.C (init): new function:
8261 "preferences-save", saves the lyxrc entries into .lyx/preferences.
8262 This file is not read automatically but you can add \input
8263 preferences to your lyxrc if you want to. We need to discuss how
8266 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
8267 in .aux, also remove .bib and .bst files from dependencies when
8270 * src/BufferView.C, src/LyXView.C: add const_cast several places
8271 because of changes to images.
8273 * lib/images/*: same change as for images/*
8275 * lib/lyxrc.example: Default for accept_compound is false not no.
8277 * images/*: changed to be const, however I have som misgivings
8278 about this change so it might be changed back.
8280 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8282 * lib/configure, po/POTFILES.in: regenerated
8284 * autogen.sh: autogenerate lib/configure from lib/configure.m4
8286 * config/lib_configure.m4: removed
8288 * lib/configure.m4: new file (was config/lib_configure.m4)
8290 * configure.in: do not test for rtti, since we do not use it.
8292 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8294 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
8295 doubling of allocated space scheme. This makes it faster for large
8296 strings end to use less memory for small strings. xtra rememoved.
8298 * src/insets/figinset.C (waitalarm): commented out.
8299 (GhostscriptMsg): use static_cast
8300 (GhostscriptMsg): use new instead of malloc to allocate memory for
8301 cmap. also delete the memory after use.
8303 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
8305 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
8306 for changes in bibtex database or style.
8307 (runBibTeX): remove all .bib and .bst files from dep before we
8309 (run): use scanAuc in when dep file already exist.
8311 * src/DepTable.C (remove_files_with_extension): new method
8314 * src/DepTable.[Ch]: made many of the methods const.
8316 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8318 * src/bufferparams.C: make sure that the default textclass is
8319 "article". It used to be the first one by description order, but
8320 now the first one is "docbook".
8322 * src/lyx_main.C (setDebuggingLevel): change type of argument to
8323 string; call Debug::value.
8324 (easyParse): pass complete argument to setDebuggingLevel().
8326 * src/debug.h (value): fix the code that parses debug levels.
8328 * src/debug.h: add new debug type ACTION, reserved for LyXAction
8331 * src/LyXAction.C: use Debug::ACTION as debug channel.
8333 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
8335 * NEWS: updated for the future 1.1.3 release.
8337 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
8338 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
8339 it should. This is of course a controversial change (since many
8340 people will find that their lyx workscreen is suddenly full of
8341 red), but done for the sake of correctness.
8343 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
8344 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
8346 * src/insets/inseterror.h, src/insets/inseturl.h,
8347 src/insets/insetinfo.h, src/insets/figinset.h,
8348 src/mathed/formulamacro.h, src/mathed/math_macro.h
8349 (EditMessage): add a missing const and add _() to make sure that
8352 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
8353 src/insets/insetbib.C, src/support/filetools.C: add `using'
8356 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
8357 doing 'Insert index of last word' at the beginning of a paragraph.
8359 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8361 * several files: white-space changes.
8363 * src/mathed/formula.C: removed IsAlpha and IsDigit
8365 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
8366 .bib file. use a ifstream instead of FilePtr when parsing the .bib
8369 * src/insets/figinset.C (GetPSSizes): don't break when
8370 "EndComments" is seen. But break when a boundingbox is read.
8372 * all classes inherited from Inset: return value of Clone
8373 changed back to Inset *.
8375 * all classes inherited form MathInset: return value of Clone
8376 changed back to MathedInset *.
8378 * src/insets/figinset.C (runqueue): use a ofstream to output the
8379 gs/ps file. Might need some setpresicion or setw. However I can
8380 see no problem with the current code.
8381 (runqueue): use sleep instead of the alarm/signal code. I just
8382 can't see the difference.
8384 * src/paragraph.C (LyXParagraph): reserve space in the new
8385 paragraph and resize the inserted paragraph to just fit.
8387 * src/lyxfunc.h (operator|=): added operator for func_status.
8389 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
8390 check for readable file.
8392 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
8393 check for readable file.
8394 (MenuMakeLinuxDoc): ditto
8395 (MenuMakeDocBook): ditto
8396 (MenuMakeAscii): ditto
8397 (InsertAsciiFile): split the test for openable and readable
8399 * src/bmtable.C (draw_bitmaptable): use
8400 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
8402 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
8403 findtexfile from LaTeX to filetools.
8405 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
8406 instead of FilePtr. Needs to be verified by a literate user.
8408 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8410 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
8411 (EditMessage): likewise.
8413 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
8414 respectively as \textasciitilde and \textasciicircum.
8416 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8418 * src/support/lyxstring.h: made the methods that take iterators
8421 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
8422 (regexMatch): made is use the real regex class.
8424 * src/support/Makefile.am: changed to use libtool
8426 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
8428 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
8430 (MathIsInset ++): changed several macros to be inline functions
8433 * src/mathed/Makefile.am: changed to use libtool
8435 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
8437 * src/insets/inset* : Clone changed to const and return type is
8438 the true insettype not just Inset*.
8440 * src/insets/Makefile.am: changed to use libtool
8442 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
8444 * src/undo.[Ch] : added empty() and changed some of the method
8447 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
8449 * src/lyxparagraph.h: use id() and id(...) instead of getID and
8450 setID use block<> for the bullets array, added const several places.
8452 * src/lyxfunc.C (getStatus): new function
8454 * src/lyxfunc.[Ch] : small changes to take advantage of the new
8455 LyXAction, added const to several funtions.
8457 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
8458 a std::map, and to store the dir items in a vector.
8460 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
8463 * src/LyXView.[Ch] + other files : changed currentView to view.
8465 * src/LyXAction.[Ch] : ported from the old devel branch.
8467 * src/.cvsignore: added .libs and a.out
8469 * configure.in : changes to use libtool.
8471 * acinclude.m4 : inserted libtool.m4
8473 * .cvsignore: added libtool
8475 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8477 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
8478 file name in insets and mathed directories (otherwise the
8479 dependency is not taken in account under cygwin).
8481 * src/text2.C (InsertString[AB]): make sure that we do not try to
8482 read characters past the string length.
8484 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8486 * lib/doc/LaTeXConfig.lyx.in,
8487 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
8489 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
8490 file saying who created them and when this heppened; this is
8491 useless and annoys tools like cvs.
8493 * lib/layouts/g-brief-{en,de}.layout,
8494 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
8495 from Thomas Hartkens <thomas@hartkens.de>.
8497 * src/{insets,mathed}/Makefile.am: do not declare an empty
8498 LDFLAGS, so that it can be set at configure time (useful on Irix
8501 * lib/reLyX/configure.in: make sure that the prefix is set
8502 correctly in LYX_DIR.
8504 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8506 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
8507 be used by 'command-sequence' this allows to bind a key to a
8508 sequence of LyX-commands
8509 (Example: 'command-sequence math-insert alpha; math-insert beta;")
8511 * src/LyXAction.C: add "command-sequence"
8513 * src/LyXFunction.C: handling of "command-sequence"
8515 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
8516 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
8518 * src/lyxserver.C, src/minibuffer.C: Use this new interface
8520 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8522 * src/buffer.C (writeFile): Do not output a comment giving user
8523 and date at the beginning of a .lyx file. This is useless and
8524 annoys cvs anyway; update version number to 1.1.
8526 * src/Makefile.am (LYX_DIR): add this definition, so that a
8527 default path is hardcoded in LyX.
8529 * configure.in: Use LYX_GNU_GETTEXT.
8531 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
8532 AM_GNU_GETTEXT with a bug fixed.
8534 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
8536 * src/chset.C: add "using std::ifstream;" to please dec cxx.
8538 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
8539 which is used to point to LyX data is now LYX_DIR_11x.
8541 * lyx.man: convert to a unix text file; small updates.
8543 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8545 * src/support/LSubstring.[Ch]: made the second arg of most of the
8546 constructors be a const reference.
8548 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
8551 * src/support/lyxstring.[Ch] (swap): added missing member function
8552 and specialization of swap(str, str);
8554 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
8556 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
8557 trace of the old one.
8559 * src/undo.[Ch]: made the undostack use std::list to store undo's in
8560 put the member definitions in undo.C.
8562 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
8563 NEW_TEXT and have now only code that was included when this was
8566 * src/intl.C (LCombo): use static_cast
8568 (DispatchCallback): ditto
8570 * src/definitions.h: removed whole file
8572 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
8574 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
8575 parsing and stores in a std:map. a regex defines the file format.
8576 removed unneeded members.
8578 * src/bufferparams.h: added several enums from definitions.h here.
8579 Removed unsused destructor. Changed some types to use proper enum
8580 types. use block to have the temp_bullets and user_defined_bullets
8581 and to make the whole class assignable.
8583 * src/bufferparams.C (Copy): removed this functions, use a default
8586 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
8589 * src/buffer.C (readLyXformat2): commend out all that have with
8590 oldpapersize to do. also comment out all that hve to do with
8591 insetlatex and insetlatexdel.
8592 (setOldPaperStuff): commented out
8594 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
8596 * src/LyXAction.C: remove use of inset-latex-insert
8598 * src/mathed/math_panel.C (button_cb): use static_cast
8600 * src/insets/Makefile.am (insets_o_SOURCES): removed
8603 * src/support/lyxstring.C (helper): use the unsigned long
8604 specifier, UL, instead of a static_cast.
8606 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
8608 * src/support/block.h: new file. to be used as a c-style array in
8609 classes, so that the class can be assignable.
8611 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8613 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
8614 NULL, make sure to return an empty string (it is not possible to
8615 set a string to NULL).
8617 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8619 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
8621 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
8623 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
8624 link line, so that Irix users (for example) can set it explicitely to
8627 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
8628 it can be overidden at make time (static or dynamic link, for
8631 * src/vc-backend.C, src/LaTeXFeatures.h,
8632 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
8633 statements to bring templates to global namespace.
8635 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8637 * src/support/lyxstring.C (operator[] const): make it standard
8640 * src/minibuffer.C (Init): changed to reflect that more
8641 information is given from the lyxvc and need not be provided here.
8643 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
8645 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
8647 * src/LyXView.C (UpdateTimerCB): use static_cast
8648 (KeyPressMask_raw_callback): ditto
8650 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
8651 buffer_, a lot of changes because of this. currentBuffer() ->
8652 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
8653 also changes to other files because of this.
8655 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8657 * src/vc-backend.[Ch]: new files. The backends for vc handling,
8658 have no support for RCS and partial support for CVS, will be
8661 * src/insets/ several files: changes because of function name
8662 changes in Bufferview and LyXView.
8664 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
8666 * src/support/LSubstring.[Ch]: new files. These implement a
8667 Substring that can be very convenient to use. i.e. is this
8669 string a = "Mary had a little sheep";
8670 Substring(a, "sheep") = "lamb";
8671 a is now "Mary has a little lamb".
8673 * src/support/LRegex.[Ch]: a regex class that can be used to pick
8674 out patterns and subpatterns of strings. It is used by LSubstring
8675 and also by vc-backend.C
8677 * src/support/lyxstring.C: went over all the assertions used and
8678 tried to correct the wrong ones and flag which of them is required
8679 by the standard. some bugs found because of this. Also removed a
8680 couple of assertions.
8682 * src/support/Makefile.am (libsupport_a_SOURCES): added
8683 LSubstring.[Ch] and LRegex.[Ch]
8685 * src/support/FileInfo.h: have struct stat buf as an object and
8686 not a pointer to one, some changes because of this.
8688 * src/LaTeXFeatures.C (getTClassPreamble): also use the
8689 information in layout when adding the layouts preamble to the
8692 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
8695 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
8696 because of bug in OS/2.
8698 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8700 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
8701 \verbatim@font instead of \ttfamily, so that it can be redefined.
8703 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
8704 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
8705 src/layout.h, src/text2.C: add 'using' directive to bring the
8706 STL templates we need from the std:: namespace to the global one.
8707 Needed by DEC cxx in strict ansi mode.
8709 * src/support/LIstream.h,src/support/LOstream.h,
8710 src/support/lyxstring.h,src/table.h,
8711 src/lyxlookup.h: do not include <config.h> in header
8712 files. This should be done in the .C files only.
8714 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
8718 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8720 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
8721 from Kayvan to fix the tth invokation.
8723 * development/lyx.spec.in: updates from Kayvan to reflect the
8724 changes of file names.
8726 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8728 * src/text2.C (InsertStringB): use std::copy
8729 (InsertStringA): use std::copy
8731 * src/bufferlist.C: use a vector to store the buffers in. This is
8732 an internal change and should not affect any other thing.
8734 * src/BufferView.C (waitForX): use XSync instead of the lengthy
8737 * src/text.C (Fill): fix potential bug, one off bug.
8739 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8741 * src/Makefile.am (lyx_main.o): add more files it depends on.
8743 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
8745 * src/support/lyxstring.C: use size_t for the reference count,
8746 size, reserved memory and xtra.
8747 (internal_compare): new private member function. Now the compare
8748 functions should work for std::strings that have embedded '\0'
8750 (compare): all compare functions rewritten to use
8753 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8755 * src/support/lyxstring.C (compare): pass c_str()
8756 (compare): pass c_str
8757 (compare): pass c_str
8759 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8761 * src/support/DebugStream.C: <config.h> was not included correctly.
8763 * lib/configure: forgot to re-generate it :( I'll make this file
8764 auto generated soon.
8766 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8768 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
8771 * src/support/lyxstring.C: some changes from length() to rep->sz.
8772 avoids a function call.
8774 * src/support/filetools.C (SpaceLess): yet another version of the
8775 algorithm...now per Jean-Marc's suggestions.
8777 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8779 * src/layout.C (less_textclass_desc): functor for use in sorting
8781 (LyXTextClass::Read): sort the textclasses after reading.
8783 * src/support/filetools.C (SpaceLess): new version of the
8784 SpaceLess functions. What problems does this one give? Please
8787 * images/banner_bw.xbm: made the arrays unsigned char *
8789 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8791 * src/support/lyxstring.C (find): remove bogus assertion in the
8792 two versions of find where this has not been done yet.
8794 * src/support/lyxlib.h: add missing int return type to
8797 * src/menus.C (ShowFileMenu): disable exporting to html if no
8798 html export command is present.
8800 * config/lib_configure.m4: add a test for an HTML converter. The
8801 programs checked for are, in this order: tth, latex2html and
8804 * lib/configure: generated from config/lib_configure.m4.
8806 * src/lyxfunc.C (Dispatch): update and improve the execution of an
8807 html converter. The parameters are now passed through $$FName and
8808 $$OutName, instead of standard input/output.
8810 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
8812 * lib/lyxrc.example: update description of \html_command.
8813 add "quotes" around \screen_font_xxx font setting examples to help
8814 people who use fonts with spaces in their names.
8816 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8818 * Distribution files: updates for v1.1.2
8820 * src/support/lyxstring.C (find): remove bogus assert and return
8821 npos for the same condition.
8823 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8825 * added patch for OS/2 from SMiyata.
8827 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8829 * src/text2.C (CutSelection): make space_wrapped a bool
8830 (CutSelection): dont declare int i until we have to.
8831 (alphaCounter): return a char const *.
8833 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8835 * src/support/syscall.C (Systemcalls::kill):
8836 src/support/filetools.C (PutEnv, PutEnvPath):
8837 src/lyx_cb.C (addNewlineAndDepth):
8838 src/FontInfo.C (FontInfo::resize): condition some #warning
8839 directives with WITH_WARNINGS.
8842 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8844 * src/layout.[Ch] + several files: access to class variables
8845 limited and made accessor functions instead a lot of code changed
8846 becuase of this. Also instead of returning pointers often a const
8847 reference is returned instead.
8849 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
8851 * src/Makefile.am (dist-hook): added used to remove the CVS from
8852 cheaders upon creating a dist
8853 (EXTRA_DIST): added cheaders
8855 * src/support/lstrings.C (tostr(char)): fix it to handle param as
8856 a character not as a small integer.
8858 * src/support/lyxstring.C (find): removed Assert and added i >=
8859 rep->sz to the first if.
8861 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8863 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
8864 src/LyXView.C src/buffer.C src/bufferparams.C
8865 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
8866 src/text2.C src/insets/insetinclude.C:
8867 lyxlayout renamed to textclasslist.
8869 * src/layout.C: some lyxerr changes.
8871 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
8872 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
8873 (LyXLayoutList): removed all traces of this class.
8874 (LyXTextClass::Read): rewrote LT_STYLE
8875 (LyXTextClass::hasLayout): new function
8876 (LyXTextClass::GetLayout): rewritten to return an iterator + has
8877 both const and nonconst version.
8878 (LyXTextClass::delete_layout): new function.
8879 (LyXTextClassList::Style): bug fix. do the right thing if layout
8881 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
8882 (LyXTextClassList::NameOfLayout): ditto
8883 (LyXTextClassList::Load): ditto
8885 * src/buffer.C (makeLaTeXFile): new access to layoutlist
8887 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
8889 * src/LyXAction.C (LookupFunc): added a workaround for sun
8890 compiler, on the other hand...we don't know if the current code
8891 compiles on sun at all...
8893 * src/support/filetools.C (CleanupPath): subst fix
8895 * src/insets/insetbib.C (delDatabase): subst fix, this looks
8898 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
8899 complained about this one?
8901 * src/insets/insetinclude.C (Latex): subst fix
8903 * src/insets/insetbib.C (getKeys): subst fix
8905 * src/LyXSendto.C (SendtoApplyCB): subst fix
8907 * src/lyx_main.C (init): subst fix
8909 * src/layout.C (Read): subst fix
8911 * src/lyx_sendfax_main.C (button_send): subst fix
8913 * src/buffer.C (RoffAsciiTable): subst fix
8915 * src/lyx_cb.C (MenuFax): subst fix
8916 (PrintApplyCB): subst fix
8918 1999-10-26 Juergen Vigna <jug@sad.it>
8920 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
8922 (Read): Cleaned up this code so now we read only format vestion >= 5
8924 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8926 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
8927 come nobody has complained about this one?
8929 * src/insets/insetinclude.C (Latex): subst fix
8931 * src/insets/insetbib.C (getKeys): subst fix
8933 * src/lyx_main.C (init): subst fix
8935 * src/layout.C (Read): subst fix
8937 * src/buffer.C (RoffAsciiTable): subst fix
8939 * src/lyx_cb.C (MenuFax): subst fix.
8941 * src/layout.[hC] + some other files: rewrote to use
8942 std::container to store textclasses and layouts in.
8943 Simplified, removed a lot of code. Make all classes
8944 assignable. Further simplifications and review of type
8945 use still to be one.
8947 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
8948 lastfiles to create the lastfiles partr of the menu.
8950 * src/lastfiles.[Ch]: rewritten to use deque to store the
8951 lastfiles in. Uses fstream for reading and writing. Simplifies
8954 * src/support/syscall.C: remove explicit cast.
8956 * src/BufferView.C (CursorToggleCB): removed code snippets that
8958 use explicat C++ style casts instead of C style casts. also use
8959 u_vdata instea of passing pointers in longs.
8961 * src/PaperLayout.C: removed code snippets that were commented out.
8963 * src/lyx_gui_misc.C: removed code snippets that were commented out.
8965 * src/lyx_main.C: removed code snippets that wer commented out.
8967 * src/paragraph.C: removed code snippets that were commented out.
8969 * src/lyxvc.C (logClose): use static_cast
8971 (viewLog): remove explicit cast to void*
8972 (showLog): removed old commented code
8974 * src/menus.C: use static_cast instead of C style casts. use
8975 u_vdata instead of u_ldata. remove explicit cast to (long) for
8976 pointers. Removed old code that was commented out.
8978 * src/insets/inset.C: removed old commented func
8980 * src/insets/insetref.C (InsetRef): removed old code that had been
8981 commented out for a long time.
8983 (escape): removed C style cast
8985 * src/insets/insetlatexaccent.C (Draw): removed old commented code
8987 * src/insets/insetlatex.C (Draw): removed old commented code
8988 (Read): rewritten to use string
8990 * src/insets/insetlabel.C (escape): removed C style cast
8992 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
8994 * src/insets/insetindex.C: use static_cast and u_vdata, removed
8997 * src/insets/insetinclude.h: removed a couple of stupid bools
8999 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
9000 (Clone): remove C style cast
9001 (getKeys): changed list to lst because of std::list
9003 * src/insets/inseterror.C (Draw): removed som old commented code.
9005 * src/insets/insetcommand.C (Draw): removed some old commented code.
9007 * src/insets/insetbib.C (bibitem_cb): removed code that has been
9008 commented out forever.
9009 (bibitem_cb): use static_cast instead of C style cast
9010 use of vdata changed to u_vdata.
9012 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
9014 (CloseUrlCB): use static_cast instead of C style cast.
9015 (CloseUrlCB): added a fl_free form...it seemed to be missing.
9017 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
9018 (C_InsetInfo_CloseInfoCB): forward the ob parameter
9019 (CloseInfoCB): static_cast from ob->u_vdata instead.
9020 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
9023 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
9024 (C_InsetError_CloseErrorCB): forward the ob parameter
9025 (CloseErrorCB): static_cast from ob->u_vdata instead.
9027 * src/vspace.h: include LString.h since we use string in this class.
9029 * src/vspace.C (lyx_advance): changed name from advance because of
9030 nameclash with stl. And since we cannot use namespaces yet...I
9031 used a lyx_ prefix instead. Expect this to change when we begin
9034 * src/BufferView.[Ch] (BufferView::~BufferView): removed
9036 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
9037 and removed now defunct constructor and deconstructor.
9039 * src/BufferView.h: have backstack as a object not as a pointer.
9040 removed initialization from constructor. added include for BackStack
9042 * development/lyx.spec.in (%build): add CFLAGS also.
9044 * src/screen.C (drawFrame): removed another warning.
9046 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9048 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
9049 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
9050 README and ANNOUNCE a bit for the next release. More work is
9053 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
9054 unbreakable if we are in freespacing mode (LyX-Code), but not in
9057 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9059 * src/BackStack.h: fixed initialization order in constructor
9061 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
9063 * acinclude.m4 (VERSION): new rules for when a version is
9064 development, added also a variable for prerelease.
9065 (warnings): we set with_warnings=yes for prereleases
9066 (lyx_opt): prereleases compile with same optimization as development
9067 (CXXFLAGS): only use pedantic if we are a development version
9069 * src/BufferView.C (restorePosition): don't do anything if the
9072 * src/BackStack.h: added member empty, use this to test if there
9073 is anything to pop...
9075 1999-10-25 Juergen Vigna <jug@sad.it>
9078 * forms/layout_forms.fd +
9079 * forms/latexoptions.fd +
9080 * lyx.fd: changed for various form resize issues
9082 * src/mathed/math_panel.C +
9083 * src/insets/inseterror.C +
9084 * src/insets/insetinfo.C +
9085 * src/insets/inseturl.C +
9086 * src/insets/inseturl.h +
9089 * src/PaperLayout.C +
9090 * src/ParagraphExtra.C +
9091 * src/TableLayout.C +
9093 * src/layout_forms.C +
9100 * src/menus.C: fixed various resize issues. So now forms can be
9101 resized savely or not be resized at all.
9103 * forms/form_url.fd +
9104 * src/insets/form_url.[Ch]: added because it's cleaner and easier
9107 * src/insets/Makefile.am: added files form_url.[Ch]
9109 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9111 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
9112 (and presumably 6.2).
9114 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
9115 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
9116 remaining static member callbacks.
9118 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
9121 * src/support/lyxstring.h: declare struct Srep as friend of
9122 lyxstring, since DEC cxx complains otherwise.
9124 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9126 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9128 * src/LaTeX.C (run): made run_bibtex also depend on files with
9130 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
9131 are put into the dependency file.
9133 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
9134 the code has shown itself to work
9135 (create_ispell_pipe): removed another warning, added a comment
9138 * src/minibuffer.C (ExecutingCB): removed code that has been
9139 commented out a long time
9141 * src/lyxfunc.C (processKeyEvent): removed some very old commented
9142 out code + a warning.
9144 * src/support/lyxstring.h: comment out the three private
9145 operators, when compiling with string ansi conforming compilers
9148 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
9150 (pixmapFromBitmapData): change type of bdata to be unsigned char *
9151 (pixmapFromBitmapData): add a reinterpret_cast in the call to
9154 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
9157 * src/mathed/math_panel.C (create_math_panel): remove explicit
9160 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
9163 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
9164 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
9165 to XCreatePixmapFromBitmapData
9166 (fl_set_bmtable_data): change the last argument to be unsigned
9168 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
9169 and bh to be unsigned int, remove explicit casts in call to
9170 XReadBitmapFileData.
9172 * images/arrows.xbm: made the arrays unsigned char *
9173 * images/varsz.xbm: ditto
9174 * images/misc.xbm: ditto
9175 * images/greek.xbm: ditto
9176 * images/dots.xbm: ditto
9177 * images/brel.xbm: ditto
9178 * images/bop.xbm: ditto
9180 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
9182 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
9183 (LYX_PROG_CXX): added -pedantic to g++ compile options when
9184 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
9186 (LYX_CXX_CHEADERS): added <clocale> to the test.
9188 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
9190 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
9192 * src/support/lyxstring.C (append): fixed something that must be a
9193 bug, rep->assign was used instead of rep->append.
9195 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
9198 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
9199 lyx insert double chars. Fix spotted by Kayvan.
9201 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9203 * Fixed the tth support. I messed up with the Emacs patch apply feature
9204 and omitted the changes in lyxrc.C.
9206 1999-10-22 Juergen Vigna <jug@sad.it>
9208 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
9210 * src/lyx_cb.C (MenuInsertRef) +
9211 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
9212 the form cannot be resized under it limits (fixes a segfault)
9214 * src/lyx.C (create_form_form_ref) +
9215 * forms/lyx.fd: Changed Gravity on name input field so that it is
9218 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9220 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
9221 <ostream> and <istream>.
9223 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
9224 whether <fstream> provides the latest standard features, or if we
9225 have an oldstyle library (like in egcs).
9226 (LYX_CXX_STL_STRING): fix the test.
9228 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
9229 code on MODERN_STL_STREAM.
9231 * src/support/lyxstring.h: use L{I,O}stream.h.
9233 * src/support/L{I,O}stream.h: new files, designed to setup
9234 correctly streams for our use
9235 - includes the right header depending on STL capabilities
9236 - puts std::ostream and std::endl (for LOStream.h) or
9237 std::istream (LIStream.h) in toplevel namespace.
9239 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9241 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
9242 was a bib file that had been changed we ensure that bibtex is run.
9243 (runBibTeX): enhanced to extract the names of the bib files and
9244 getting their absolute path and enter them into the dep file.
9245 (findtexfile): static func that is used to look for tex-files,
9246 checks for absolute patchs and tries also with kpsewhich.
9247 Alternative ways of finding the correct files are wanted. Will
9249 (do_popen): function that runs a command using popen and returns
9250 the whole output of that command in a string. Should be moved to
9253 * src/DepTable.[Ch] (extchanged): new function that returns true if a
9254 file with extension ext has changed.
9256 * src/insets/figinset.C: added ifdef guards around the fl_free
9257 code that jug commented out. Now it is commented out when
9258 compiling with XForms == 0.89.
9260 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
9261 to lyxstring.C, and only keep a forward declaration in
9262 lyxstring.h. Simplifies the header file a bit and should help a
9263 bit on compile time too. Also changes to Srep will not mandate a
9264 recompile of code just using string.
9265 (~lyxstring): definition moved here since it uses srep.
9266 (size): definition moved here since it uses srep.
9268 * src/support/lyxstring.h: removed a couple of "inline" that should
9271 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9273 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
9276 1999-10-21 Juergen Vigna <jug@sad.it>
9278 * src/table.C (SetPWidth): Just a small fix so the alignment is not
9279 set to left if I just remove the width entry (or it is empty).
9281 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
9282 paragraph when having dummy paragraphs.
9284 1999-10-20 Juergen Vigna <jug@sad.it>
9286 * src/insets/figinset.C: just commented some fl_free_form calls
9287 and added warnings so that this calls should be activated later
9288 again. This avoids for now a segfault, but we have a memory leak!
9290 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
9291 'const char * argument' to 'string argument', this should
9292 fix some Asserts() in lyxstring.C.
9294 * src/lyxfunc.h: Removed the function argAsString(const char *)
9295 as it is not used anymore.
9297 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9299 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
9302 * src/Literate.h: some funcs moved from public to private to make
9303 interface clearer. Unneeded args removed.
9305 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
9307 (scanBuildLogFile): ditto
9309 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
9310 normal TeX Error. Still room for improvement.
9312 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
9314 * src/buffer.C (insertErrors): changes to make the error
9315 desctription show properly.
9317 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
9320 * src/support/lyxstring.C (helper): changed to use
9321 sizeof(object->rep->ref).
9322 (operator>>): changed to use a pointer instead.
9324 * src/support/lyxstring.h: changed const reference & to value_type
9325 const & lets see if that helps.
9327 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9329 * Makefile.am (rpmdist): fixed to have non static package and
9332 * src/support/lyxstring.C: removed the compilation guards
9334 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
9337 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
9338 conditional compile of lyxstring.Ch
9340 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
9341 stupid check, but it is a lot better than the bastring hack.
9342 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
9344 * several files: changed string::erase into string::clear. Not
9347 * src/chset.C (encodeString): use a char temporary instead
9349 * src/table.C (TexEndOfCell): added tostr around
9350 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
9351 (TexEndOfCell): ditto
9352 (TexEndOfCell): ditto
9353 (TexEndOfCell): ditto
9354 (DocBookEndOfCell): ditto
9355 (DocBookEndOfCell): ditto
9356 (DocBookEndOfCell): ditto
9357 (DocBookEndOfCell): ditto
9359 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
9361 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
9363 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
9364 (MenuBuildProg): added tostr around ret
9365 (MenuRunChktex): added tostr around ret
9366 (DocumentApplyCB): added tostr around ret
9368 * src/chset.C (encodeString): added tostr around t->ic
9370 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
9371 (makeLaTeXFile): added tostr around tocdepth
9372 (makeLaTeXFile): added tostr around ftcound - 1
9374 * src/insets/insetbib.C (setCounter): added tostr around counter.
9376 * src/support/lyxstring.h: added an operator+=(int) to catch more
9379 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
9380 (lyxstring): We DON'T allow NULL pointers.
9382 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9384 * src/mathed/math_macro.C (MathMacroArgument::Write,
9385 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
9386 when writing them out.
9388 * src/LString.C: remove, since it is not used anymore.
9390 * src/support/lyxstring.C: condition the content to
9391 USE_INCLUDED_STRING macro.
9393 * src/mathed/math_symbols.C, src/support/lstrings.C,
9394 src/support/lyxstring.C: add `using' directive to specify what
9395 we need in <algorithm>. I do not think that we need to
9396 conditionalize this, but any thought is appreciated.
9398 * many files: change all callback functions to "C" linkage
9399 functions to please strict C++ compilers like DEC cxx 6.1 in mode
9400 strict_ansi. Those who were static are now global.
9401 The case of callbacks which are static class members is
9402 trickier, since we have to make C wrappers around them (see
9403 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
9404 did not finish this yet, since it defeats the purpose of
9405 encapsulation, and I am not sure what the best route is.
9407 1999-10-19 Juergen Vigna <jug@sad.it>
9409 * src/support/lyxstring.C (lyxstring): we permit to have a null
9410 pointer as assignment value and just don't assign it.
9412 * src/vspace.C (nextToken): corrected this function substituting
9413 find_first(_not)_of with find_last_of.
9415 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
9416 (TableOptCloseCB) (TableSpeCloseCB):
9417 inserted fl_set_focus call for problem with fl_hide_form() in
9420 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9422 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
9425 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9427 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
9428 LyXLex::next() and not eatline() to get its argument.
9430 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9432 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
9433 instead, use fstreams for io of the depfile, removed unneeded
9434 functions and variables.
9436 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
9437 vector instead, removed all functions and variables that is not in
9440 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9442 * src/buffer.C (insertErrors): use new interface to TeXError
9444 * Makefile.am (rpmdist): added a rpmdist target
9446 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
9447 per Kayvan's instructions.
9449 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9451 * src/Makefile.am: add a definition for localedir, so that locales
9452 are found after installation (Kayvan)
9454 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9456 * development/.cvsignore: new file.
9458 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9460 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
9461 C++ compiler provides wrappers for C headers and use our alternate
9464 * configure.in: use LYX_CXX_CHEADERS.
9466 * src/cheader/: new directory, populated with cname headers from
9467 libstdc++-2.8.1. They are a bit old, but probably good enough for
9468 what we want (support compilers who lack them).
9470 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
9471 from includes. It turns out is was stupid.
9473 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9475 * lib/Makefile.am (install-data-local): forgot a ';'
9476 (install-data-local): forgot a '\'
9477 (libinstalldirs): needed after all. reintroduced.
9479 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9481 * configure.in (AC_OUTPUT): added lyx.spec
9483 * development/lyx.spec: removed file
9485 * development/lyx.spec.in: new file
9487 * po/*.po: merged with lyx.pot becuase of make distcheck
9489 * lib/Makefile.am (dist-hook): added dist-hook so that
9490 documentation files will be included when doing a make
9491 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
9492 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
9494 more: tried to make install do the right thing, exclude CVS dirs
9497 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
9498 Path would fit in more nicely.
9500 * all files that used to use pathstack: uses now Path instead.
9501 This change was a lot easier than expected.
9503 * src/support/path.h: new file
9505 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
9507 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
9509 * src/support/lyxstring.C (getline): Default arg was given for
9512 * Configure.cmd: removed file
9514 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9516 * src/support/DebugStream.[Ch]: remove the explicit std:: before
9517 streams classes and types, add the proper 'using' statements when
9518 MODERN_STL is defined.
9520 * src/debug.h: move the << operator definition after the inclusion
9523 * src/support/filetools.C: include "LAssert.h", which is needed
9526 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
9529 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
9530 include "debug.h" to define a proper ostream.
9532 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9534 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
9535 method to the SystemCall class which can kill a process, but it's
9536 not fully implemented yet.
9538 * src/*.C: Changed Systemcalls::Startscript() to startscript()
9540 * src/support/FileInfo.h: Better documentation
9542 * src/lyxfunc.C: Added support for buffer-export html
9544 * src/menus.C: Added Export->As HTML...
9546 * lib/bind/*.bind: Added short-cut for buffer-export html
9548 * src/lyxrc.*: Added support for new \tth_command
9550 * lib/lyxrc.example: Added stuff for new \tth_command
9552 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9554 * lib/Makefile.am (IMAGES): removed images/README
9555 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
9556 installes in correct place. Check permisions is installed
9559 * src/LaTeX.C: some no-op changes moved declaration of some
9562 * src/LaTeX.h (LATEX_H): changed include guard name
9564 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9566 * lib/reLyX/Makefile.am: install noweb2lyx.
9568 * lib/Makefile.am: install configure.
9570 * lib/reLyX/configure.in: declare a config aux dir; set package
9571 name to lyx (not sure what the best solution is); generate noweb2lyx.
9573 * lib/layouts/egs.layout: fix the bibliography layout.
9575 1999-10-08 Jürgen Vigna <jug@sad.it>
9577 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
9578 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
9579 it returned without continuing to search the path.
9581 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9583 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
9584 also fixes a bug. It is not allowed to do tricks with std::strings
9585 like: string a("hei"); &a[e]; this will not give what you
9586 think... Any reason for the complexity in this func?
9588 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
9590 * Updated README and INSTALL a bit, mostly to check that my
9591 CVS rights are correctly set up.
9593 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9595 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
9596 does not allow '\0' chars but lyxstring and std::string does.
9598 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9600 * autogen.sh (AUTOCONF): let the autogen script create the
9601 POTFILES.in file too. POTFILES.in should perhaps now not be
9602 included in the cvs module.
9604 * some more files changed to use C++ includes instead of C ones.
9606 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
9608 (Reread): added tostr to nlink. buggy output otherwise.
9609 (Reread): added a string() around szMode when assigning to Buffer,
9610 without this I got a log of garbled info strings.
9612 * acconfig.h: commented out the PTR_AS_INT macros. They should not
9615 * I have added several ostream & operator<<(ostream &, some_type)
9616 functions. This has been done to avoid casting and warnings when
9617 outputting enums to lyxerr. This as thus eliminated a lot of
9618 explicit casts and has made the code clearer. Among the enums
9619 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
9620 mathed enums, some font enum the Debug::type enum.
9622 * src/support/lyxstring.h (clear): missing method. equivalent of
9625 * all files that contained "stderr": rewrote constructs that used
9626 stderr to use lyxerr instead. (except bmtable)
9628 * src/support/DebugStream.h (level): and the passed t with
9629 Debug::ANY to avoid spurious bits set.
9631 * src/debug.h (Debug::type value): made it accept strings of the
9634 * configure.in (Check for programs): Added a check for kpsewhich,
9635 the latex generation will use this later to better the dicovery of
9638 * src/BufferView.C (create_view): we don't need to cast this to
9639 (void*) that is done automatically.
9640 (WorkAreaButtonPress): removed some dead code.
9642 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9644 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
9645 is not overwritten when translated (David Sua'rez de Lis).
9647 * lib/CREDITS: Added David Sua'rez de Lis
9649 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
9651 * src/bufferparams.C (BufferParams): default input encoding is now
9654 * acinclude.m4 (cross_compiling): comment out macro
9655 LYX_GXX_STRENGTH_REDUCE.
9657 * acconfig.h: make sure that const is not defined (to empty) when
9658 we are compiling C++. Remove commented out code using SIZEOF_xx
9661 * configure.in : move the test for const and inline as late as
9662 possible so that these C tests do not interefere with C++ ones.
9663 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
9664 has not been proven.
9666 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9668 * src/table.C (getDocBookAlign): remove bad default value for
9671 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
9673 (ShowFileMenu2): ditto.
9675 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
9678 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9680 * Most files: finished the change from the old error code to use
9681 DebugStream for all lyxerr debugging. Only minor changes remain
9682 (e.g. the setting of debug levels using strings instead of number)
9684 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9686 * src/layout.C (Add): Changed to use compare_no_case instead of
9689 * src/FontInfo.C: changed loop variable type too string::size_type.
9691 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9693 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
9694 set ETAGS_ARGS to --c++
9696 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
9698 * src/table.C (DocBookEndOfCell): commented out two unused variables
9700 * src/paragraph.C: commented out four unused variables.
9702 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
9703 insed a if clause with type string::size_type.
9705 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
9708 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
9710 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
9711 variable, also changed loop to go from 0 to lenght + 1, instead of
9712 -1 to length. This should be correct.
9714 * src/LaTeX.C (scanError): use string::size_type as loop variable
9717 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
9718 (l.896) since y_tmp and row was not used anyway.
9720 * src/insets/insetref.C (escape): use string::size_type as loop
9723 * src/insets/insetquotes.C (Width): use string::size_type as loop
9725 (Draw): use string::size_type as loop variable type.
9727 * src/insets/insetlatexaccent.C (checkContents): use
9728 string::size_type as loop variable type.
9730 * src/insets/insetlabel.C (escape): use string::size_type as loop
9733 * src/insets/insetinfo.C: added an extern for current_view.
9735 * src/insets/insetcommand.C (scanCommand): use string::size_type
9736 as loop variable type.
9738 * most files: removed the RCS tags. With them we had to recompile
9739 a lot of files after a simple cvs commit. Also we have never used
9740 them for anything meaningful.
9742 * most files: tags-query-replace NULL 0. As adviced several plases
9743 we now use "0" instead of "NULL" in our code.
9745 * src/support/filetools.C (SpaceLess): use string::size_type as
9748 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9750 * src/paragraph.C: fixed up some more string stuff.
9752 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9754 * src/support/filetools.h: make modestr a std::string.
9756 * src/filetools.C (GetEnv): made ch really const.
9758 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
9759 made code that used these use max/min from <algorithm> instead.
9761 * changed several c library include files to their equivalent c++
9762 library include files. All is not changed yet.
9764 * created a support subdir in src, put lyxstring and lstrings
9765 there + the extra files atexit, fileblock, strerror. Created
9766 Makefile.am. edited configure.in and src/Makefile.am to use this
9767 new subdir. More files moved to support.
9769 * imported som of the functions from repository lyx, filetools
9771 * ran tags-query-replace on LString -> string, corrected the bogus
9772 cases. Tried to make use of lstrings.[hC], debugged a lot. There
9773 is still some errors in there. This is errors where too much or
9774 too litle get deleted from strings (string::erase, string::substr,
9775 string::replace), there can also be some off by one errors, or
9776 just plain wrong use of functions from lstrings. Viewing of quotes
9779 * LyX is now running fairly well with string, but there are
9780 certainly some bugs yet (see above) also string is quite different
9781 from LString among others in that it does not allow null pointers
9782 passed in and will abort if it gets any.
9784 * Added the revtex4 files I forgot when setting up the repository.
9786 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9788 * All over: Tried to clean everything up so that only the files
9789 that we really need are included in the cvs repository.
9790 * Switched to use automake.
9791 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
9792 * Install has not been checked.
9794 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9796 * po/pt.po: Three errors:
9797 l.533 and l.538 format specification error
9798 l. 402 duplicate entry, I just deleted it.