1 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3 * src/minibuffer.C (peek_event): retun 1 when there has been a
4 mouseclick in the minibuffer.
8 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
10 * src/frontends/xforms/FormParagraph.C: more space above/below
13 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
15 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
16 a char only if real_current_font was changed.
18 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
20 * NEWS: update somewhat for 1.1.6
22 * lib/ui/default.ui: clean up.
24 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
26 * lib/CREDITS: clean up
28 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
30 * src/combox.[Ch] (select): changed argument back to int
31 * src/combox.C (peek_event): removed num_bytes as it is declared but
34 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
35 modified calls to Combox::select() to remove warnings about type
38 * src/insets/insetbutton.C (width): explicit cast to remove warning
39 about type conversion.
41 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
44 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
45 sel_pos_end, refering to cursor position are changed to
46 LyXParagraph::size_type.
48 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
49 consistent with LyXCursor::pos().
50 (inset_pos): changed to LyXParagraph::size_type for same reason.
52 * src/insets/insettext.C (resizeLyXText): changed some temporary
53 variables refing to cursor position to LyXParagraph::size_type.
55 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
57 * src/frontends/kde/<various>: The Great Renaming,
60 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
62 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
64 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
66 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
67 0 when there are no arguments.
69 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
71 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
72 to segfaults when pressing Ok in InsetBibtex dialog.
74 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
76 * forms/layout_forms.fd:
77 * src/layout_forms.C (create_form_form_character): small change to use
78 labelframe rather than engraved frame + text
80 * src/lyx_gui.C (create_forms): initialise choice_language with some
81 arbitrary value to prevent segfault when dialog is shown.
83 2000-10-16 Baruch Even <baruch.even@writeme.com>
85 * src/converter.C (runLaTeX, scanLog): Added a warning when there
86 is no resulting file. This pertains only to LaTeX output.
88 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
90 * src/text.C (Backspace): Make sure that the row of the cursor is
93 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
96 * src/lyx_gui.C (init): Prevent a crash when only one font from
97 menu/popup fonts is not found.
99 * lib/lyxrc.example: Add an example for binding a key for language
102 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
104 * src/converter.C (GetReachable): Changed the returned type to
106 (IsReachable): New method
108 * src/MenuBackend.C (expand): Handle formats that appear more
111 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
113 * src/frontends/support/Makefile.am
114 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
117 * lib/CREDITS: add Garst Reese.
119 * src/support/snprintf.h: add extern "C" {} around the definitions.
121 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
123 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
126 * src/frontends/xforms/FormDocument.C:
127 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
128 compile without "conversion to integral type of smaller size"
131 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
133 * src/text.C (GetColumnNearX): Fixed disabled code.
135 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
137 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
140 * src/support/snprintf.[ch]: new files
142 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
144 * src/frontends/kde/formprintdialog.C: add
145 file browser for selecting postscript output
147 * src/frontends/kde/formprintdialogdata.C:
148 * src/frontends/kde/formprintdialogdata.h: re-generate
151 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
153 * src/frontends/gnome/Makefile.am:
154 * src/frontends/kde/Makefile.am: FormCommand.C
155 disappeared from xforms
157 * src/frontends/kde/FormCitation.C:
158 * src/frontends/kde/FormIndex.C: read-only
161 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
163 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
166 * src/bufferlist.C: add using directive.
168 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
170 * src/support/lyxfunctional.h: version of class_fun for void
171 returns added, const versions of back_inseter_fun and compare_fun
174 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
176 * src/frontends/xforms/FormInset.C (showInset): fix typo.
178 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
180 * ChangeLog: cleanup.
182 * lib/CREDITS: update to add all the contributors we've forgotten.
183 I have obviously missed some, so tell me whether there were
186 2000-10-13 Marko Vendelin <markov@ioc.ee>
188 * src/frontends/gnome/FormCitation.C
189 * src/frontends/gnome/FormCitation.h
190 * src/frontends/gnome/FormError.C
191 * src/frontends/gnome/FormIndex.C
192 * src/frontends/gnome/FormRef.C
193 * src/frontends/gnome/FormRef.h
194 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
196 * src/frontends/gnome/FormCitation.C
197 * src/frontends/gnome/FormCopyright.C
198 * src/frontends/gnome/FormError.C
199 * src/frontends/gnome/FormIndex.C
200 * src/frontends/gnome/FormRef.C
201 * src/frontends/gnome/FormToc.C
202 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
205 * src/frontends/gnome/Menubar_pimpl.C
206 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
209 2000-10-11 Baruch Even <baruch.even@writeme.com>
212 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
213 to convey its real action.
215 * src/minibuffer.C (peek_event): Added action when mouse clicks to
216 clear the minibuffer and prepare to enter a command.
218 * src/mathed/formula.C (LocalDispatch): Changed to conform with
219 the rename from ExecCommand to PrepareForCommand.
220 * src/lyxfunc.C (Dispatch): ditto.
222 2000-10-11 Baruch Even <baruch.even@writeme.com>
224 * src/buffer.C (writeFile): Added test for errors on writing, this
225 catches all errors and not only file system full errors as intended.
227 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
229 * src/lyx_gui.C (create_forms): better fix for crash with
230 translated interface.
232 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
234 * src/frontends/kde/Makefile.am:
235 * src/frontends/kde/FormCopyright.C:
236 * src/frontends/kde/formcopyrightdialog.C:
237 * src/frontends/kde/formcopyrightdialog.h:
238 * src/frontends/kde/formcopyrightdialogdata.C:
239 * src/frontends/kde/formcopyrightdialogdata.h:
240 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
241 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
242 copyright to use qtarch
244 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
246 * src/encoding.C (read): Fixed bug that caused an error message at
249 * po/Makefile.in.in: Fixed rule for ext_l10n.h
251 * lib/lyxrc.example: Fixed hebrew example.
253 2000-10-13 Allan Rae <rae@lyx.org>
255 * src/frontends/xforms/FormPreferences.C (input): reworking the
257 (build, update, apply): New inputs in various tabfolders
259 * src/frontends/xforms/FormToc.C: use new button policy.
260 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
261 dialogs that either can't use any existing policy or where it just
264 * src/frontends/xforms/FormTabular.h: removed copyright notice that
267 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
268 added a bool parameter which is ignored.
270 * src/buffer.C (setReadonly):
271 * src/BufferView_pimpl.C (buffer):
272 * src/frontends/kde/FormCopyright.h (update):
273 * src/frontends/kde/FormCitation.[Ch] (update):
274 * src/frontends/kde/FormIndex.[Ch] (update):
275 * src/frontends/kde/FormPrint.[Ch] (update):
276 * src/frontends/kde/FormRef.[Ch] (update):
277 * src/frontends/kde/FormToc.[Ch] (update):
278 * src/frontends/kde/FormUrl.[Ch] (update):
279 * src/frontends/gnome/FormCopyright.h (update):
280 * src/frontends/gnome/FormCitation.[Ch] (update):
281 * src/frontends/gnome/FormError.[Ch] (update):
282 * src/frontends/gnome/FormIndex.[Ch] (update):
283 * src/frontends/gnome/FormPrint.[Ch] (update):
284 * src/frontends/gnome/FormRef.h (update):
285 * src/frontends/gnome/FormToc.[Ch] (update):
286 * src/frontends/gnome/FormUrl.[Ch] (update):
287 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
288 to updateBufferDependent and DialogBase
290 * src/frontends/xforms/FormCitation.[hC]:
291 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
292 * src/frontends/xforms/FormError.[Ch]:
293 * src/frontends/xforms/FormGraphics.[Ch]:
294 * src/frontends/xforms/FormIndex.[Ch]:
295 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
296 and fixed readOnly handling.
297 * src/frontends/xforms/FormPrint.[Ch]:
298 * src/frontends/xforms/FormRef.[Ch]:
299 * src/frontends/xforms/FormTabular.[Ch]:
300 * src/frontends/xforms/FormToc.[Ch]:
301 * src/frontends/xforms/FormUrl.[Ch]:
302 * src/frontends/xforms/FormInset.[Ch]:
303 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
304 form of updateBufferDependent.
306 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
307 if form()->visible just in case someone does stuff to the form in a
310 * src/frontends/DialogBase.h (enum): removed enum since we can now use
311 the buttoncontroller for everything the enum used to be used for.
312 (update) It would seem we need to force all dialogs to use a bool
313 parameter or have two update functions. I chose to go with one.
314 I did try removing update() from here and FormBase and defining the
315 appropriate update signatures in FormBaseB[DI] but then ran into the
316 problem of the update() call in FormBase::show(). Whatever I did
317 to get around that would require another function and that just
318 got more confusing. Hence the decision to make everyone have an
319 update(bool). An alternative might have been to override show() in
320 FormBaseB[DI] and that would allow the different and appropriate
323 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
324 true == buffer change occurred. I decided against using a default
325 template parameter since not all compilers support that at present.
327 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
329 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
330 army knife" by removing functionality.
331 (clearStore): removed. All such housekeeping on hide()ing the dialog
332 is to be carried out by overloaded disconnect() methods.
333 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
334 superceded by Baruch's neat test (FormGraphics) to update an existing
335 dialog if a new signal is recieved rather than block all new signals
337 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
338 only to Inset dialogs.
339 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
340 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
342 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
344 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
345 as a base class to all inset dialogs. Used solely to connect/disconnect
346 the Inset::hide signal and to define what action to take on receipt of
347 a UpdateBufferDependent signal.
348 (FormCommand): now derived from FormInset.
350 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
353 * src/frontends/xforms/FormCopyright.[Ch]:
354 * src/frontends/xforms/FormPreferences.[Ch]:
355 now derived from FormBaseBI.
357 * src/frontends/xforms/FormDocument.[Ch]:
358 * src/frontends/xforms/FormParagraph.[Ch]:
359 * src/frontends/xforms/FormPrint.[Ch]:
360 now derived from FormBaseBD.
362 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
364 * src/frontends/xforms/FormCitation.[Ch]:
365 * src/frontends/xforms/FormError.[Ch]:
366 * src/frontends/xforms/FormRef.[Ch]:
367 * src/frontends/xforms/FormToc.[Ch]:
368 (clearStore): reworked as disconnect().
370 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
373 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
375 * src/converter.C (runLaTeX): constify buffer argument
378 * src/frontends/support/Makefile.am (INCLUDES): fix.
380 * src/buffer.h: add std:: qualifier
381 * src/insets/figinset.C (addpidwait): ditto
382 * src/MenuBackend.C: ditto
383 * src/buffer.C: ditto
384 * src/bufferlist.C: ditto
385 * src/layout.C: ditto
386 * src/lyxfunc.C: ditto
388 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
390 * src/lyxtext.h (bidi_level): change return type to
391 LyXParagraph::size_type.
393 * src/lyxparagraph.h: change size_type to
394 TextContainer::difference_type. This should really be
395 TextContainer::size_type, but we need currently to support signed
398 2000-10-11 Marko Vendelin <markov@ioc.ee>
399 * src/frontends/gnome/FormError.h
400 * src/frontends/gnome/FormRef.C
401 * src/frontends/gnome/FormRef.h
402 * src/frontends/gnome/FormError.C
403 * src/frontends/gnome/Makefile.am
404 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
405 to Gnome frontend. Both dialogs use "action" area.
407 2000-10-12 Baruch Even <baruch.even@writeme.com>
409 * src/graphics/GraphicsCacheItem_pimpl.C:
410 * src/graphics/Renderer.C:
411 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
414 2000-10-12 Juergen Vigna <jug@sad.it>
416 * src/insets/insettext.C (draw): fixed drawing bug (specifically
417 visible when selecting).
419 * development/Code_rules/Rules: fixed some typos.
421 2000-10-09 Baruch Even <baruch.even@writeme.com>
423 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
424 compiling on egcs 1.1.2 possible.
426 * src/filedlg.C (comp_direntry::operator() ): ditto.
428 2000-08-31 Baruch Even <baruch.even@writeme.com>
430 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
433 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
434 transient it now only gets freed when the object is destructed.
436 2000-08-24 Baruch Even <baruch.even@writeme.com>
438 * src/frontends/FormGraphics.h:
439 * src/frontends/FormGraphics.C: Changed to use ButtonController and
442 2000-08-20 Baruch Even <baruch.even@writeme.com>
444 * src/insets/insetgraphics.C:
445 (draw): Added messages to the drawn rectangle to report status.
446 (updateInset): Disabled the use of the inline graphics,
449 2000-08-17 Baruch Even <baruch.even@writeme.com>
451 * src/frontends/support: Directory added for the support of GUII LyX.
453 * src/frontends/support/LyXImage.h:
454 * src/frontends/support/LyXImage.C: Base class for GUII holding of
457 * src/frontends/support/LyXImage_X.h:
458 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
459 version of LyXImage, this uses the Xlib Pixmap.
464 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
465 replacement to Pixmap.
467 * src/insets/insetgraphics.h:
468 * src/insets/insetgraphics.C:
469 * src/graphics/GraphicsCacheItem.h:
470 * src/graphics/GraphicsCacheItem.C:
471 * src/graphics/GraphicsCacheItem_pimpl.h:
472 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
475 * src/graphics/GraphicsCacheItem.h:
476 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
477 another copy of the object.
479 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
480 of cacheHandle, this fixed a bug that sent LyX crashing.
482 * src/graphics/XPM_Renderer.h:
483 * src/graphics/XPM_Renderer.C:
484 * src/graphics/EPS_Renderer.h:
485 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
487 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
489 * src/lyxfunc.C (processKeySym): only handle the
490 lockinginset/inset stuff if we have a buffer and text loaded...
492 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
494 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
496 * src/support/lyxfunctional.h: add operator= that takes a reference
498 * src/lyxserver.C (mkfifo): make first arg const
500 * src/layout.h: renamed name(...) to setName(...) to work around
503 * src/buffer.C (setFileName): had to change name of function to
504 work around bugs in egcs. (renamed from fileName)
506 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
508 * src/support/translator.h: move helper template classes to
509 lyxfunctional.h, include "support/lyxfunctional.h"
511 * src/support/lyxmanip.h: add delaration of fmt
513 * src/support/lyxfunctional.h: new file
514 (class_fun_t): new template class
515 (class_fun): helper template function
516 (back_insert_fun_iterator): new template class
517 (back_inserter_fun): helper template function
518 (compare_memfun_t): new template class
519 (compare_memfun): helper template function
520 (equal_1st_in_pair): moved here from translator
521 (equal_2nd_in_pair): moved here from translator
523 * src/support/fmt.C: new file
524 (fmt): new func, can be used for a printf substitute when still
525 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
527 * src/support/StrPool.C: add some comments
529 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
532 * src/insets/figinset.C (addpidwait): use std::copy with
533 ostream_iterator to fill the pidwaitlist
535 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
537 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
540 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
543 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
545 * src/frontends/xforms/FormDocument.C (build): remove c_str()
546 (class_update): ditto
548 (CheckChoiceClass): move initialization of tc and tct
550 * src/tabular.C: remove current_view
551 (OldFormatRead): similar to right below [istream::ignore]
553 * src/lyxlex_pimpl.C (next): add code for faster skipping of
554 chars, unfortunately this is buggy on gcc 2.95.2, so currently
555 unused [istream::ignore]
557 * src/lyxfunc.C: include "support/lyxfunctional.h"
558 (getInsetByCode): use std::find_if and compare_memfun
560 * src/lyxfont.C (stateText): remove c_str()
562 * src/lyx_main.C (setDebuggingLevel): make static
563 (commandLineHelp): make static
565 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
566 Screen* together with fl_get_display() and fl_screen
568 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
569 togheter with fl_get_display() and fl_screen
570 (create_forms): remove c_str()
572 * src/layout.C: include "support/lyxfunctional.h"
573 (hasLayout): use std::find_if and compare_memfun
574 (GetLayout): use std::find_if and comapre_memfun
575 (delete_layout): use std::remove_if and compare_memfun
576 (NumberOfClass): use std:.find_if and compare_memfun
578 * src/gettext.h: change for the new functions
580 * src/gettext.C: new file, make _(char const * str) and _(string
581 const & str) real functions.
583 * src/font.C (width): rewrite slightly to avoid one extra variable
585 * src/debug.C: initialize Debug::ANY here
587 * src/commandtags.h: update number comments
589 * src/combox.h (get): make const func
591 (getline): make const
593 * src/combox.C (input_cb): handle case where fl_get_input can
596 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
597 "support/lyxfunctional.h", remove current_view variable.
598 (resize): use std::for_each with std::mem_fun
599 (getFileNames): use std::copy with back_inserter_fun
600 (getBuffer): change arg type to unsigned int
601 (emergencyWriteAll): call emergencyWrite with std::for_each and
603 (emergencyWrite): new method, the for loop in emergencyWriteAll
605 (exists): use std::find_if with compare_memfun
606 (getBuffer): use std::find_if and compare_memfun
608 * src/buffer.h: add typedefs for iterator_category, value_type
609 difference_type, pointer and reference for inset_iterator
610 add postfix ++ for inset_iterator
611 make inset_iterator::getPos() const
613 * src/buffer.C: added support/lyxmanip.h
614 (readFile): use lyxerr << fmt instead of printf
615 (makeLaTeXFile): use std::copy to write out encodings
617 * src/Painter.C (text): rewrite slightly to avoid extra font variable
619 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
620 free and the char * temp.
621 (hasMenu): use std::find_if and compare_memfun
624 * src/Makefile.am (lyx_SOURCES): added gettext.C
626 * src/LyXAction.C (retrieveActionArg): clear the arg, use
627 string::insert small change to avoid temporary
629 * src/LColor.C (getGUIName): remove c_str()
631 * several files: change all occurrences of fl_display to
634 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
635 that -pedantic is not used for gcc 2.97 (cvs gcc)
637 * boost/Makefile.am: begin slowly to prepare for a real boost lib
639 2000-10-11 Allan Rae <rae@lyx.org>
641 * src/frontends/xforms/FormPreferences.C (input): template path must be
642 a readable directory. It doesn't need to be writeable.
643 (build, delete, update, apply): New inputs in the various tabfolders
645 * src/frontends/xforms/forms/form_preferences.fd:
646 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
647 several new entries to existing folders. Shuffled some existing stuff
650 * src/frontends/xforms/forms/form_print.fd:
651 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
652 Should probably rework PrinterParams as well. Note that the switch to
653 collated is effectively the same as !unsorted so changing PrinterParams
654 will require a lot of fiddly changes to reverse the existing logic.
656 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
658 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
660 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
662 2000-10-10 Allan Rae <rae@lyx.org>
665 * src/lyxfunc.C (Dispatch):
667 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
670 * src/lyxrc.C (output): Only write the differences between system lyxrc
671 and the users settings.
674 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
676 I'll rewrite this later, after 1.1.6 probably, to keep a single
677 LyXRC but two instances of a LyXRCStruct.
679 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
681 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
683 * src/tabular.h: add a few std:: qualifiers.
685 * src/encoding.C: add using directive.
686 * src/language.C: ditto.
688 * src/insets/insetquotes.C (Validate): use languages->lang()
689 instead of only language.
691 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
693 * lib/languages: New file.
695 * lib/encodings: New file.
697 * src/language.C (Languages): New class.
698 (read): New method. Reads the languages from the 'languages' file.
700 * src/encoding.C (Encodings): New class.
701 (read): New method. Reads the encodings from the 'encodings' file.
703 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
706 * src/bufferparams.h and a lot of files: Deleted the member language,
707 and renamed language_info to language
709 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
710 * src/lyxfont.C (latexWriteStartChanges): ditto.
711 * src/paragraph.C (validate,TeXOnePar): ditto.
713 * src/lyxfont.C (update): Restored deleted code.
715 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
717 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
719 * src/BufferView_pimpl.C (buffer): cleaned up a little.
721 * src/insets/figinset.[Ch]:
722 * src/insets/insetinclude.[Ch]:
723 * src/insets/insetinclude.[Ch]:
724 * src/insets/insetparent.[Ch]:
725 * src/insets/insetref.[Ch]:
726 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
729 * src/mathed/formula.[Ch]:
730 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
732 * src/buffer.C (parseSingleLyXformat2Token, readInset):
733 * src/lyx_cb.C (FigureApplyCB):
734 * src/lyxfunc.C (getStatus, Dispatch):
735 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
738 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
740 * src/converter.[Ch] (Formats::View):
741 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
743 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
744 *current_view->buffer(). This will change later, but this patch is way
747 2000-10-09 Juergen Vigna <jug@sad.it>
749 * src/text.C (GetRow): small fix.
751 * src/BufferView_pimpl.C (cursorPrevious):
752 (cursorNext): added LyXText parameter to function.
754 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
755 keypress depending on cursor position.
757 2000-10-06 Juergen Vigna <jug@sad.it>
759 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
760 (copySelection): redone this function and also copy ascii representa-
763 * src/tabular.C (Ascii):
767 (print_n_chars): new functions to realize the ascii export of tabulars.
769 2000-10-05 Juergen Vigna <jug@sad.it>
771 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
772 if we don't have a buffer.
774 2000-10-10 Allan Rae <rae@lyx.org>
776 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
777 with closing dialog. It seems that nested tabfolders require hiding
778 of inner tabfolders before hiding the dialog itself. Actually all I
779 did was hide the active outer folder.
781 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
782 unless there really is a buffer. hideBufferDependent is called
785 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
786 POTFILES.in stays in $(srcdir).
788 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
790 * lib/lyxrc.example: Few changes.
792 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
794 * src/BufferView_pimpl.C (buffer): only need one the
795 updateBufferDependent signal to be emitted once! Moved to the end of
796 the method to allow bv_->text to be updated first.
798 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
799 and hSignal_ with Dialogs * and BufferDependency variables.
800 New Buffer * parent_, initialised when the dialog is launched. Used to
801 check whether to update() or hide() dialog in the new, private
802 updateOrHide() method that is connected to the updateBufferDependent
803 signal. Daughter classes dictate what to do using the
804 ChangedBufferAction enum, passed to the c-tor.
806 * src/frontends/xforms/FormCitation.C:
807 * src/frontends/xforms/FormCommand.C:
808 * src/frontends/xforms/FormCopyright.C:
809 * src/frontends/xforms/FormDocument.C:
810 * src/frontends/xforms/FormError.C:
811 * src/frontends/xforms/FormIndex.C:
812 * src/frontends/xforms/FormPreferences.C:
813 * src/frontends/xforms/FormPrint.C:
814 * src/frontends/xforms/FormRef.C:
815 * src/frontends/xforms/FormToc.C:
816 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
819 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
820 ChangedBufferAction enum.
822 * src/frontends/xforms/FormParagraph.[Ch]
823 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
826 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
828 * lib/bind/cua.bind: fix a bit.
829 * lib/bind/emacs.bind: ditto.
831 * lib/bind/menus.bind: remove real menu entries from there.
833 * src/spellchecker.C: make sure we only include strings.h when
836 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
838 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
839 function. It enlarges the maximum number of pup when needed.
840 (add_toc2): Open a new menu if maximum number of items per menu has
843 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
845 * src/frontends/kde/FormPrint.C: fix error reporting
847 * src/frontends/xforms/FormDocument.C: fix compiler
850 * lib/.cvsignore: add Literate.nw
852 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
855 * bufferview_funcs.[Ch]
858 * text2.C: Add support for numbers in RTL text.
860 2000-10-06 Allan Rae <rae@lyx.org>
862 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
863 to be gettext.m4 friendly again. ext_l10n.h is now
864 generated into $top_srcdir instead of $top_builddir
865 so that lyx.pot will be built correctly -- without
866 duplicate parsing of ext_l10n.h.
868 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
870 * src/frontends/kde/FormCitation.C: make the dialog
873 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
875 * config/kde.m4: fix consecutive ./configure runs,
876 look for qtarch, fix library order
878 * src/frontends/kde/Makefile.am: tidy up,
879 add Print dialog, add .dlg dependencies
881 * src/frontends/kde/FormPrint.C:
882 * src/frontends/kde/FormPrint.h:
883 * src/frontends/kde/formprintdialog.C:
884 * src/frontends/kde/formprintdialog.h:
885 * src/frontends/kde/formprintdialogdata.C:
886 * src/frontends/kde/formprintdialogdata.h:
887 * src/frontends/kde/dlg/formprintdialog.dlg: add
890 * src/frontends/kde/dlg/README: Added explanatory readme
892 * src/frontends/kde/dlg/checkinitorder.pl: small perl
893 script to double-check qtarch's output
895 * src/frontends/kde/formindexdialog.C:
896 * src/frontends/kde/formindexdialogdata.C:
897 * src/frontends/kde/formindexdialogdata.h:
898 * src/frontends/kde/dlg/formindexdialog.dlg: update
899 for qtarch, minor fixes
901 2000-10-05 Allan Rae <rae@lyx.org>
903 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
904 dialogs when switching buffers update them instead. It's up to each
905 dialog to decide if it should still be visible or not.
906 update() should return a bool to control visiblity within show().
907 Or perhaps better to set a member variable and use that to control
910 * lib/build-listerrors: create an empty "listerrors" file just to stop
911 make trying to regenerate it all the time if you don't have noweb
914 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
916 * po/Makefile.in.in (ext_l10n.h): added a rule to build
917 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
918 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
919 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
920 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
922 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
924 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
926 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
927 deleting buffer. Closes all buffer-dependent dialogs.
929 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
931 * src/frontends/xforms/FormCitation.[Ch]:
932 * src/frontends/xforms/FormPreferences.[Ch]:
933 * src/frontends/xforms/FormPrint.[Ch]:
934 * src/frontends/xforms/FormRef.[Ch]:
935 * src/frontends/xforms/FormUrl.[Ch]: ditto
937 * src/frontends/xforms/FormDocument.[Ch]:
938 * src/frontends/xforms/forms/form_document.C.patch:
939 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
940 pass through a single input() function.
942 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
944 * lib/build-listerrors: return status as OK
946 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
948 * lib/lyxrc.example: Updated to new export code
950 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
952 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
955 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
958 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
960 * lib/layouts/amsbook.layout: ditto.
962 * boost/Makefile.am: fix typo.
964 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
966 (add_lastfiles): removed.
967 (add_documents): removed.
968 (add_formats): removed.
970 * src/frontends/Menubar.C: remove useless "using" directive.
972 * src/MenuBackend.h: add a new MenuItem constructor.
974 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
977 2000-10-04 Allan Rae <rae@lyx.org>
979 * lib/Makefile.am (listerrors):
980 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
981 I haven't got notangle installed so Kayvan please test. The output
982 should end up in $builddir. This also allows people who don't have
983 noweb installed to complete the make process without error.
985 * src/frontends/xforms/FormCommand.[Ch] (showInset):
986 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
987 by JMarc's picky compiler.
989 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
992 * src/insets/insettabular.C (setPos): change for loop to not use
993 sequencing operator. Please check this Jürgen.
995 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
997 * src/insets/insetcite.C (getScreenLabel): ditto
998 * src/support/filetools.C (QuoteName): ditto
999 (ChangeExtension): ditto
1001 * src/BufferView_pimpl.C (scrollCB): make heigt int
1003 * src/BufferView2.C (insertInset): comment out unused arg
1005 * boost/Makefile.am (EXTRADIST): new variable
1007 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1009 * src/exporter.C (IsExportable): Fixed
1011 * lib/configure.m4: Small fix
1013 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1015 * src/insets/insetbutton.C (width): Changed to work with no GUI.
1016 * src/insets/insetbib.C (bibitemWidest): ditto.
1017 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
1019 2000-10-03 Juergen Vigna <jug@sad.it>
1021 * src/BufferView2.C (theLockingInset): removed const because of
1022 Agnus's compile problems.
1024 * src/insets/insettext.C (LocalDispatch): set the language of the
1025 surronding paragraph on inserting the first character.
1027 * various files: changed use of BufferView::the_locking_inset.
1029 * src/BufferView2.C (theLockingInset):
1030 (theLockingInset): new functions.
1032 * src/BufferView.h: removed the_locking_inset.
1034 * src/lyxtext.h: added the_locking_inset
1036 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
1038 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
1040 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1042 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
1043 * src/mathed/math_cursor.C (IsAlpha): ditto.
1044 * src/mathed/math_inset.C (strnew): ditto.
1045 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
1046 (IMetrics): cxp set but never used; removed.
1047 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
1048 that the variable in question has been removed also!
1051 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
1052 using the Buffer * passed to Latex(), using the BufferView * passed to
1053 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
1055 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
1056 Linuxdoc() and DocBook() rather than the stored Buffer * master.
1058 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
1059 * src/buffer.C (readInset): used new InsetBibtex c-tor
1060 * (getBibkeyList): used new InsetBibtex::getKeys
1062 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1065 * lib/build-listerrors
1067 * src/exporter.C: Add literate programming support to the export code
1070 * src/lyx_cb.C: Remove old literate code.
1072 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
1075 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
1076 * src/converter.C (View, Convert): Use QuoteName.
1078 * src/insets/figinset.C (Preview): Use Formats::View.
1080 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
1082 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1084 * src/lyxfunc.C (Dispatch): move declaration of text variable at
1085 the top of the function, because compaq cxx complains that the
1086 "goto exit_with_message" when the function is disabled bypasses
1088 (MenuNew): try a better fix for the generation of new file names.
1089 This time, I used AddName() instead of AddPath(), hoping Juergen
1092 2000-10-03 Allan Rae <rae@lyx.org>
1094 * src/frontends/xforms/forms/form_preferences.fd:
1095 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
1096 nested tabfolders has begun. The old "Miscellaneous" was renamed as
1097 "Look and Feel"->"General" but will need to be split up further into
1098 general output and general input tabs. Current plan is for four outer
1099 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
1100 stuff; "Inputs" for input and import configuration; "Outputs" for
1101 output and export configuration; and one more whatever is left over
1102 called "General". The leftovers at present look like being which
1103 viewers to use, spellchecker, language support and might be better
1104 named "Support". I've put "Paths" in "Inputs" for the moment as this
1105 seems reasonable for now at least.
1106 One problem remains: X error kills LyX when you close Preferences.
1108 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1110 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
1111 qualifier from form()
1112 * src/frontends/xforms/FormCitation.[Ch]:
1113 * src/frontends/xforms/FormCopyright.[Ch]:
1114 * src/frontends/xforms/FormDocument.[Ch]:
1115 * src/frontends/xforms/FormError.[Ch]:
1116 * src/frontends/xforms/FormIndex.[Ch]:
1117 * src/frontends/xforms/FormPreferences.[Ch]:
1118 * src/frontends/xforms/FormPrint.[Ch]:
1119 * src/frontends/xforms/FormRef.[Ch]:
1120 * src/frontends/xforms/FormToc.[Ch]:
1121 * src/frontends/xforms/FormUrl.[Ch]: ditto.
1123 * src/frontends/xforms/FormCitation.[Ch]:
1124 * src/frontends/xforms/FormIndex.[Ch]:
1125 * src/frontends/xforms/FormRef.[Ch]:
1126 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
1127 with Allan's naming policy
1129 * src/frontends/xforms/FormCitation.C: some static casts to remove
1132 2000-10-02 Juergen Vigna <jug@sad.it>
1134 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
1135 now you can type or do stuff inside the table-cell also when in dummy
1136 position, fixed visible cursor.
1138 * src/insets/insettext.C (Edit): fixing cursor-view position.
1140 * src/lyxfunc.C (Dispatch): use * text variable so that it can
1141 be used for equal functions in lyxfunc and insettext.
1143 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
1145 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
1147 * src/frontends/gnome/FormCitation.h:
1148 * src/frontends/gnome/FormCopyright.h:
1149 * src/frontends/gnome/FormIndex.h:
1150 * src/frontends/gnome/FormPrint.h:
1151 * src/frontends/gnome/FormToc.h:
1152 * src/frontends/gnome/FormUrl.h:
1153 * src/frontends/kde/FormCitation.h:
1154 * src/frontends/kde/FormCopyright.h:
1155 * src/frontends/kde/FormIndex.h:
1156 * src/frontends/kde/FormRef.h:
1157 * src/frontends/kde/FormToc.h:
1158 * src/frontends/kde/FormUrl.h: fix remaining users of
1161 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1163 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
1164 from depth argument.
1165 (DocBookHandleCaption): ditto.
1166 (DocBookHandleFootnote): ditto.
1167 (SimpleDocBookOnePar): ditto.
1169 * src/frontends/xforms/FormDocument.h (form): remove extra
1170 FormDocument:: qualifier.
1172 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
1174 * sigc++/handle.h: ditto.
1176 * src/lyx_gui_misc.C: add "using" directive.
1178 * src/cheaders/cstddef: new file, needed by the boost library (for
1181 2000-10-02 Juergen Vigna <jug@sad.it>
1183 * src/insets/insettext.C (SetFont): better support.
1185 * src/insets/insettabular.C (draw): fixed drawing of single cell.
1187 * src/screen.C (DrawOneRow): some uint refixes!
1189 2000-10-02 Allan Rae <rae@lyx.org>
1191 * boost/.cvsignore: ignore Makefile as well
1193 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
1194 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
1196 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
1197 Left this one out by accident.
1199 * src/frontends/xforms/FormBase.h (restore): default to calling
1200 update() since that will restore the original/currently-applied values.
1201 Any input() triggered error messages will require the derived classes
1202 to redefine restore().
1204 * src/frontends/xforms/FormDocument.C: initialize a few variables to
1205 avoid a segfault. combo_doc_class is the main concern.
1207 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
1209 * Simplify build-listerrors in view of GUI-less export ability!
1211 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1213 * src/lyx_main.C (easyParse): Disable gui when exporting
1215 * src/insets/figinset.C:
1218 * src/lyx_gui_misc.C
1219 * src/tabular.C: Changes to allow no-gui.
1221 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1223 * src/support/utility.hpp: removed file
1224 * src/support/block.h: removed file
1226 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
1229 * src/mathed/formula.C: add support/lyxlib.h
1230 * src/mathed/formulamacro.C: ditto
1232 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
1233 * src/lyxparagraph.h: ditto
1235 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
1236 * src/frontends/Makefile.am (INCLUDES): ditto
1237 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
1238 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
1239 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
1240 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
1241 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
1242 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
1244 * src/BufferView.h: use boost/utility.hpp
1245 * src/LColor.h: ditto
1246 * src/LaTeX.h: ditto
1247 * src/LyXAction.h: ditto
1248 * src/LyXView.h: ditto
1249 * src/bufferlist.h: ditto
1250 * src/lastfiles.h: ditto
1251 * src/layout.h: ditto
1252 * src/lyx_gui.h: ditto
1253 * src/lyx_main.h: ditto
1254 * src/lyxlex.h: ditto
1255 * src/lyxrc.h: ditto
1256 * src/frontends/ButtonPolicies.h: ditto
1257 * src/frontends/Dialogs.h: ditto
1258 * src/frontends/xforms/FormBase.h: ditto
1259 * src/frontends/xforms/FormGraphics.h: ditto
1260 * src/frontends/xforms/FormParagraph.h: ditto
1261 * src/frontends/xforms/FormTabular.h: ditto
1262 * src/graphics/GraphicsCache.h: ditto
1263 * src/graphics/Renderer.h: ditto
1264 * src/insets/ExternalTemplate.h: ditto
1265 * src/insets/insetcommand.h: ditto
1266 * src/support/path.h: ditto
1268 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
1269 and introduce clause for 2.97.
1271 * boost/libs/README: new file
1273 * boost/boost/utility.hpp: new file
1275 * boost/boost/config.hpp: new file
1277 * boost/boost/array.hpp: new file
1279 * boost/Makefile.am: new file
1281 * boost/.cvsignore: new file
1283 * configure.in (AC_OUTPUT): add boost/Makefile
1285 * Makefile.am (SUBDIRS): add boost
1287 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1289 * src/support/lstrings.C (suffixIs): Fixed.
1291 2000-10-01 Allan Rae <rae@lyx.org>
1293 * src/PrinterParams.h: moved things around to avoid the "can't
1294 inline call" warning.
1296 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
1297 into doc++ documentation.
1299 * src/frontends/xforms/FormCommand.[Ch]: support button policy
1301 * src/frontends/xforms/FormRef.C: make use of button controller
1302 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
1303 cleaned up button controller usage.
1304 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
1305 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
1306 use the button controller
1308 * src/frontends/xforms/forms/*.fd: and associated generated files
1309 updated to reflect changes to FormBase. Some other FormXxxx files
1310 also got minor updates to reflect changes to FormBase.
1312 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
1313 (hide): made virtual.
1314 (input): return a bool. true == valid input
1315 (RestoreCB, restore): new
1316 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
1317 Changes to allow derived dialogs to use a ButtonController and
1318 make sense when doing so: OK button calls ok() and so on.
1320 * src/frontends/xforms/ButtonController.h (class ButtonController):
1321 Switch from template implementation to taking Policy parameter.
1322 Allows FormBase to provide a ButtonController for any dialog.
1324 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
1325 Probably should rename connect and disconnect.
1326 (apply): use the radio button groups
1327 (form): needed by FormBase
1328 (build): setup the radio button groups
1330 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
1332 * several files: type changes to reduce the number of warnings and
1333 to unify type hangling a bit. Still much to do.
1335 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1337 * lib/images/*: rename a bunch of icons to match Dekel converter
1340 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
1343 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
1345 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
1347 * sigc++/handle.h: ditto for class Handle.
1349 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
1351 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
1353 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
1355 * src/intl.C (InitKeyMapper): Correct the value of n due to the
1356 removal of the "default" language.
1358 * src/combox.h (getline): Check that sel > 0
1360 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
1362 * lib/examples/docbook_example.lyx
1363 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
1365 * lib/layouts/docbook-book.layout: new docbook book layout.
1367 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
1369 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
1371 * src/insets/figinset.C (DocBook):fixed small typo.
1373 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
1375 * src/insets/insetinclude.h: string include_label doesn't need to be
1378 2000-09-29 Allan Rae <rae@lyx.org>
1380 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
1381 Allow derived type to control connection and disconnection from signals
1382 of its choice if desired.
1384 2000-09-28 Juergen Vigna <jug@sad.it>
1386 * src/insets/insettabular.C (update): fixed cursor setting when
1387 the_locking_inset changed.
1388 (draw): made this a bit cleaner.
1389 (InsetButtonPress): fixed!
1391 * various files: added LyXText Parameter to fitCursor call.
1393 * src/BufferView.C (fitCursor): added LyXText parameter.
1395 * src/insets/insettabular.C (draw): small draw fix.
1397 * src/tabular.C: right setting of left/right celllines.
1399 * src/tabular.[Ch]: fixed various types in funcions and structures.
1400 * src/insets/insettabular.C: ditto
1401 * src/frontends/xforms/FormTabular.C: ditto
1403 2000-09-28 Allan Rae <rae@lyx.org>
1405 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
1406 that the #ifdef's had been applied to part of what should have been
1407 a complete condition. It's possible there are other tests that
1408 were specific to tables that are also wrong now that InsetTabular is
1409 being used. Now we need to fix the output of '\n' after a table in a
1410 float for the same reason as the original condition:
1411 "don't insert this if we would be adding it before or after a table
1412 in a float. This little trick is needed in order to allow use of
1413 tables in \subfigures or \subtables."
1414 Juergen can you check this?
1416 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1418 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
1419 outputed to the ostream.
1421 * several files: fixed types based on warnings from cxx
1423 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
1425 * src/frontends/kde/Makefile.am: fix rule for
1426 formindexdialogdata_moc.C
1428 * src/.cvsignore: add ext_l10n.h to ignore
1430 * acconfig.h: stop messing with __STRICT_ANSI__
1431 * config/gnome.m4: remove option to set -ansi
1432 * config/kde.m4: remove option to set -ansi
1433 * config/lyxinclude.m4: don't set -ansi
1435 2000-09-27 Juergen Vigna <jug@sad.it>
1437 * various files: remove "default" language check.
1439 * src/insets/insetquotes.C: removed use of current_view.
1441 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
1442 the one should have red ears by now!
1444 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
1445 in more then one paragraph. Fixed cursor-movement/selection.
1447 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
1448 paragraphs inside a text inset.
1450 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
1451 text-inset if this owner is an inset.
1453 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1455 * src/Bullet.h: changed type of font, character and size to int
1457 * src/buffer.C (asciiParagraph): remove actcell and fname1.
1459 * src/insets/inseturl.[Ch]:
1460 * src/insets/insetref.[Ch]:
1461 * src/insets/insetlabel.[Ch]: add linelen to Ascii
1463 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
1465 * src/buffer.C (readFile): block-if statement rearranged to minimise
1466 bloat. Patch does not reverse Jean-Marc's change ;-)
1468 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
1469 Class rewritten to store pointers to hide/update signals directly,
1470 rather than Dialogs *. Also defined an enum to ease use. All xforms
1471 forms can now be derived from this class.
1473 * src/frontends/xforms/FormCommand.[Ch]
1474 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
1476 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
1479 * src/frontends/xforms/forms/form_citation.fd
1480 * src/frontends/xforms/forms/form_copyright.fd
1481 * src/frontends/xforms/forms/form_error.fd
1482 * src/frontends/xforms/forms/form_index.fd
1483 * src/frontends/xforms/forms/form_ref.fd
1484 * src/frontends/xforms/forms/form_toc.fd
1485 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
1487 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
1489 * src/insets/insetfoot.C: removed redundent using directive.
1491 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1493 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
1494 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
1496 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
1497 created in the constructors in different groups. Then set() just
1498 have to show the groups as needed. This fixes the redraw problems
1499 (and is how the old menu code worked).
1501 * src/support/lyxlib.h: declare the methods as static when we do
1502 not have namespaces.
1504 2000-09-26 Juergen Vigna <jug@sad.it>
1506 * src/buffer.C (asciiParagraph): new function.
1507 (writeFileAscii): new function with parameter ostream.
1508 (writeFileAscii): use now asciiParagraph.
1510 * various inset files: added the linelen parameter to the Ascii-func.
1512 * src/tabular.C (Write): fixed error in writing file introduced by
1513 the last changes from Lars.
1515 * lib/bind/menus.bind: removed not supported functions.
1517 * src/insets/insettext.C (Ascii): implemented this function.
1519 * src/insets/lyxinset.h (Ascii): added linelen parameter.
1521 * src/tabular.C (write_attribute[int,string,bool]): new functions.
1522 (Write): use of the write_attribute functions.
1524 * src/bufferlist.C (close): fixed reasking question!
1526 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1528 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
1529 new files use the everwhere possible.
1532 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
1533 src/log_form.C src/lyx.C:
1536 * src/buffer.C (runLaTeX): remove func
1538 * src/PaperLayout.C: removed file
1539 * src/ParagraphExtra.C: likewise
1540 * src/bullet_forms.C: likewise
1541 * src/bullet_forms.h: likewise
1542 * src/bullet_forms_cb.C: likewise
1544 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
1545 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
1548 * several files: remove all traces of the old fd_form_paragraph,
1549 and functions belonging to that.
1551 * several files: remove all traces of the old fd_form_document,
1552 and functions belonging to that.
1554 * several files: constify local variables were possible.
1556 * several files: remove all code that was dead when NEW_EXPORT was
1559 * several files: removed string::c_str in as many places as
1562 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
1563 (e): be a bit more outspoken when patching
1564 (updatesrc): only move files if changed.
1566 * forms/layout_forms.h.patch: regenerated
1568 * forms/layout_forms.fd: remove form_document and form_paragraph
1569 and form_quotes and form_paper and form_table_options and
1570 form_paragraph_extra
1572 * forms/form1.fd: remove form_table
1574 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
1575 the fdui->... rewrite. Update some comments to xforms 0.88
1577 * forms/bullet_forms.C.patch: removed file
1578 * forms/bullet_forms.fd: likewise
1579 * forms/bullet_forms.h.patch: likewise
1581 * development/Code_rules/Rules: added a section on switch
1582 statements. Updated some comment to xforms 0.88.
1584 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1586 * src/buffer.C (readFile): make sure that the whole version number
1587 is read after \lyxformat (even when it contains a comma)
1589 * lib/ui/default.ui: change shortcut of math menu to M-a.
1591 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1593 * src/vspace.C (nextToken): use isStrDbl() to check for proper
1596 * src/LyXView.C (updateWindowTitle): show the full files name in
1597 window title, limited to 30 characters.
1599 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
1600 When a number of characters has been given, we should not assume
1601 that the string is 0-terminated.
1603 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
1604 calls (fixes some memory leaks)
1606 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
1607 trans member on exit.
1609 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1611 * src/converter.C (GetReachable): fix typo.
1613 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
1614 understand ',' instead of '.'.
1615 (GetInteger): rewrite to use strToInt().
1617 2000-09-26 Juergen Vigna <jug@sad.it>
1619 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
1620 better visibility and error-message on wrong VSpace input.
1622 * src/language.C (initL): added english again.
1624 2000-09-25 Juergen Vigna <jug@sad.it>
1626 * src/frontends/kde/Dialogs.C (Dialogs):
1627 * src/frontends/gnome/Dialogs.C (Dialogs):
1628 * src/frontends/kde/Makefile.am:
1629 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
1631 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
1633 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
1635 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
1637 * src/frontends/xforms/FormParagraph.C:
1638 * src/frontends/xforms/FormParagraph.h:
1639 * src/frontends/xforms/form_paragraph.C:
1640 * src/frontends/xforms/form_paragraph.h:
1641 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
1644 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
1646 * src/tabular.C (OldFormatRead): forgot to delete the temporary
1647 Paragraph-Data after use.
1649 * src/insets/insettext.C (LocalDispatch): don't set the layout on
1650 non breakable paragraphs.
1652 2000-09-25 Garst R. Reese <reese@isn.net>
1654 * src/language.C (initL): added missing language_country codes.
1656 2000-09-25 Juergen Vigna <jug@sad.it>
1658 * src/insets/insettext.C (InsetText):
1659 (deleteLyXText): remove the not released LyXText structure!
1661 2000-09-24 Marko Vendelin <markov@ioc.ee>
1663 * src/frontends/gnome/mainapp.C
1664 * src/frontends/gnome/mainapp.h: added support for keyboard
1667 * src/frontends/gnome/FormCitation.C
1668 * src/frontends/gnome/FormCitation.h
1669 * src/frontends/gnome/Makefile.am
1670 * src/frontends/gnome/pixbutton.h: completed the rewrite of
1671 FormCitation to use "action area" in mainapp window
1673 * src/frontends/gnome/Menubar_pimpl.C
1674 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
1677 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
1679 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
1680 width/descent/ascent values if name is empty.
1681 (mathed_string_height): Use std::max.
1683 2000-09-25 Allan Rae <rae@lyx.org>
1685 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
1686 segfault. This will be completely redesigned soon.
1688 * sigc++: updated libsigc++. Fixes struct timespec bug.
1690 * development/tools/makeLyXsigc.sh: .cvsignore addition
1692 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
1694 * several files: removed almost all traces of the old table
1697 * src/TableLayout.C: removed file
1699 2000-09-22 Juergen Vigna <jug@sad.it>
1701 * src/frontends/kde/Dialogs.C: added credits forms.
1703 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
1705 * src/frontends/gnome/Dialogs.C: added some forms.
1707 * src/spellchecker.C (init_spell_checker): set language in pspell code
1708 (RunSpellChecker): some modifications for setting language string.
1710 * src/language.[Ch]: added language_country code.
1712 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
1714 * src/frontends/Dialogs.h: added new signal showError.
1715 Rearranged existing signals in some sort of alphabetical order.
1717 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
1718 FormError.[Ch], form_error.[Ch]
1719 * src/frontends/xforms/forms/makefile: added new file form_error.fd
1720 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
1722 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
1723 dialogs. I think that this can be used as the base to all these
1726 * src/frontends/xforms/FormError.[Ch]
1727 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
1728 implementation of InsetError dialog.
1730 * src/insets/inseterror.[Ch]: rendered GUI-independent.
1732 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
1733 * src/frontends/kde/Makefile.am: ditto
1735 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
1737 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
1738 macrobf. This fixes a bug of invisible text.
1740 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1742 * lib/doc/LaTeXConfig.lyx.in: updated.
1744 * src/language.C (initL): remove language "francais" and change a
1745 bit the names of the two other french variations.
1747 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
1748 string that may not be 0-terminated.
1750 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1752 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
1754 2000-09-20 Marko Vendelin <markov@ioc.ee>
1756 * src/frontends/gnome/FormCitation.C
1757 * src/frontends/gnome/FormIndex.C
1758 * src/frontends/gnome/FormToc.C
1759 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
1760 the variable initialization to shut up the warnings
1762 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1764 * src/table.[Ch]: deleted files
1766 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
1769 2000-09-18 Juergen Vigna <jug@sad.it>
1771 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
1772 problems with selection. Inserted new LFUN_PASTESELECTION.
1773 (InsetButtonPress): inserted handling of middle mouse-button paste.
1775 * src/spellchecker.C: changed word to word.c_str().
1777 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
1779 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
1780 included in the ``make dist'' tarball.
1782 2000-09-15 Juergen Vigna <jug@sad.it>
1784 * src/CutAndPaste.C (cutSelection): small fix return the right
1785 end position after cut inside one paragraph only.
1787 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
1788 we are locked as otherwise we don't have a valid cursor position!
1790 * src/insets/figinset.C (draw): small bugfix but why is this needed???
1792 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
1794 * src/frontends/kde/FormRef.C: added using directive.
1795 * src/frontends/kde/FormToc.C: ditto
1797 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
1799 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
1801 2000-09-19 Marko Vendelin <markov@ioc.ee>
1803 * src/frontends/gnome/Menubar_pimpl.C
1804 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
1805 Toc, ViewFormats, UpdateFormats, and ExportFormats.
1807 * src/frontends/gnome/mainapp.C
1808 * src/frontends/gnome/mainapp.h: support for menu update used
1811 * src/frontends/gnome/mainapp.C
1812 * src/frontends/gnome/mainapp.h: support for "action" area in the
1813 main window. This area is used by small simple dialogs, such as
1816 * src/frontends/gnome/FormIndex.C
1817 * src/frontends/gnome/FormIndex.h
1818 * src/frontends/gnome/FormUrl.C
1819 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
1822 * src/frontends/gnome/FormCitation.C
1823 * src/frontends/gnome/FormCitation.h: rewrite to use main window
1824 action area. Only "Insert new citation" is implemented.
1826 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1828 * src/buffer.C (Dispatch): fix call to Dispatch
1829 * src/insets/insetref.C (Edit): likewise
1830 * src/insets/insetparent.C (Edit): likewise
1831 * src/insets/insetinclude.C (include_cb): likewise
1832 * src/frontends/xforms/FormUrl.C (apply): likewise
1833 * src/frontends/xforms/FormToc.C (apply): likewise
1834 * src/frontends/xforms/FormRef.C (apply): likewise
1835 * src/frontends/xforms/FormIndex.C (apply): likewise
1836 * src/frontends/xforms/FormCitation.C (apply): likewise
1837 * src/lyxserver.C (callback): likewise
1838 * src/lyxfunc.C (processKeySym): likewise
1839 (Dispatch): likewise
1840 (Dispatch): likewise
1841 * src/lyx_cb.C (LayoutsCB): likewise
1843 * Makefile.am (sourcedoc): small change
1845 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1847 * src/main.C (main): Don't make an empty GUIRunTime object. all
1848 methods are static. constify a bit remove unneded using + headers.
1850 * src/tabular.C: some more const to local vars move some loop vars
1852 * src/spellchecker.C: added some c_str after some word for pspell
1854 * src/frontends/GUIRunTime.h: add new static method setDefaults
1855 * src/frontends/xforms/GUIRunTime.C (setDefaults):
1856 * src/frontends/kde/GUIRunTime.C (setDefaults):
1857 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
1859 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
1860 with strnew in arg, use correct emptystring when calling SetName.
1862 * several files: remove all commented code with relation to
1863 HAVE_SSTREAM beeing false. We now only support stringstream and
1866 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1868 * src/lyxfunc.C: construct correctly the automatic new file
1871 * src/text2.C (IsStringInText): change type of variable i to shut
1874 * src/support/sstream.h: do not use namespaces if the compiler
1875 does not support them.
1877 2000-09-15 Marko Vendelin <markov@ioc.ee>
1878 * src/frontends/gnome/FormCitation.C
1879 * src/frontends/gnome/FormCitation.h
1880 * src/frontends/gnome/diainsertcitation_interface.c
1881 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
1882 regexp support to FormCitation [Gnome].
1884 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
1887 * configure.in: remove unused KDE/GTKGUI define
1889 * src/frontends/kde/FormRef.C
1890 * src/frontends/kde/FormRef.h
1891 * src/frontends/kde/formrefdialog.C
1892 * src/frontends/kde/formrefdialog.h: double click will
1893 go to reference, now it is possible to change a cross-ref
1896 * src/frontends/kde/FormToc.C
1897 * src/frontends/kde/FormToc.h
1898 * src/frontends/kde/formtocdialog.C
1899 * src/frontends/kde/formtocdialog.h: add a depth
1902 * src/frontends/kde/Makefile.am: add QtLyXView.h
1905 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
1907 * src/frontends/kde/FormCitation.h: added some using directives.
1909 * src/frontends/kde/FormToc.h: corrected definition of doTree.
1911 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
1914 * src/mathed/math_defs.h: redefine SetAlign to use string rather
1917 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1919 * src/buffer.C (pop_tag): revert for the second time a change by
1920 Lars, who seems to really hate having non-local loop variables :)
1922 * src/Lsstream.h: add "using" statements.
1924 * src/support/copy.C (copy): add a bunch of std:: qualifiers
1925 * src/buffer.C (writeFile): ditto
1927 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1929 * src/buffer.C (writeFile): try to fix the locale modified format
1930 number to always be as we want it.
1932 * src/WorkArea.C (work_area_handler): try to workaround the bugs
1933 in XForms 0.89. C-space is now working again.
1935 * src/Lsstream.h src/support/sstream.h: new files.
1937 * also commented out all cases where strstream were used.
1939 * src/Bullet.h (c_str): remove method.
1941 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
1943 * a lot of files: get rid of "char const *" and "char *" is as
1944 many places as possible. We only want to use them in interaction
1945 with system of other libraries, not inside lyx.
1947 * a lot of files: return const object is not of pod type. This
1948 helps ensure that temporary objects is not modified. And fits well
1949 with "programming by contract".
1951 * configure.in: check for the locale header too
1953 * Makefile.am (sourcedoc): new tag for generation of doc++
1956 2000-09-14 Juergen Vigna <jug@sad.it>
1958 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
1959 callback to check which combo called it and do the right action.
1961 * src/combox.C (combo_cb): added combo * to the callbacks.
1962 (Hide): moved call of callback after Ungrab of the pointer.
1964 * src/intl.h: removed LCombo2 function.
1966 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
1967 function as this can now be handled in one function.
1969 * src/combox.h: added Combox * to callback prototype.
1971 * src/frontends/xforms/Toolbar_pimpl.C:
1972 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
1974 2000-09-14 Garst Reese <reese@isn.net>
1976 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
1977 moved usepackage{xxx}'s to beginning of file. Changed left margin
1978 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
1979 underlining from title. Thanks to John Culleton for useful suggestions.
1981 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1983 * src/lyxlex_pimpl.C (setFile): change error message to debug
1986 2000-09-13 Juergen Vigna <jug@sad.it>
1988 * src/frontends/xforms/FormDocument.C: implemented choice_class
1989 as combox and give callback to combo_language so OK/Apply is activated
1992 * src/bufferlist.C (newFile): small fix so already named files
1993 (via an open call) are not requested to be named again on the
1996 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
1998 * src/frontends/kde/Makefile.am
1999 * src/frontends/kde/FormRef.C
2000 * src/frontends/kde/FormRef.h
2001 * src/frontends/kde/formrefdialog.C
2002 * src/frontends/kde/formrefdialog.h: implement
2005 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2007 * src/frontends/kde/formtocdialog.C
2008 * src/frontends/kde/formtocdialog.h
2009 * src/frontends/kde/FormToc.C
2010 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
2012 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
2014 * src/frontends/kde/FormCitation.C: fix thinko
2015 where we didn't always display the reference text
2018 * src/frontends/kde/formurldialog.C
2019 * src/frontends/kde/formurldialog.h
2020 * src/frontends/kde/FormUrl.C
2021 * src/frontends/kde/FormUrl.h: minor cleanups
2023 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
2025 * src/frontends/kde/Makefile.am
2026 * src/frontends/kde/FormToc.C
2027 * src/frontends/kde/FormToc.h
2028 * src/frontends/kde/FormCitation.C
2029 * src/frontends/kde/FormCitation.h
2030 * src/frontends/kde/FormIndex.C
2031 * src/frontends/kde/FormIndex.h
2032 * src/frontends/kde/formtocdialog.C
2033 * src/frontends/kde/formtocdialog.h
2034 * src/frontends/kde/formcitationdialog.C
2035 * src/frontends/kde/formcitationdialog.h
2036 * src/frontends/kde/formindexdialog.C
2037 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
2039 2000-09-12 Juergen Vigna <jug@sad.it>
2041 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
2044 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2046 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
2049 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
2051 * src/converter.C (Add, Convert): Added support for converter flags:
2052 needaux, resultdir, resultfile.
2053 (Convert): Added new parameter view_file.
2054 (dvips_options): Fixed letter paper option.
2056 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
2057 (Export, GetExportableFormats, GetViewableFormats): Added support
2060 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
2062 (easyParse): Fixed to work with new export code.
2064 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
2067 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
2069 * lib/bind/*.bind: Replaced
2070 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
2071 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
2073 2000-09-11 Juergen Vigna <jug@sad.it>
2075 * src/lyx_gui.C (runTime): uses global guiruntime variable.
2077 * src/main.C (main): now GUII defines global guiruntime!
2079 * src/frontends/gnome/GUIRunTime.C (initApplication):
2080 * src/frontends/kde/GUIRunTime.C (initApplication):
2081 * src/frontends/xforms/GUIRunTime.C (initApplication):
2082 * src/frontends/GUIRunTime.h: added new function initApplication.
2084 * src/spellchecker.C (sc_accept_word): change to add_to_session.
2086 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
2088 2000-09-08 Juergen Vigna <jug@sad.it>
2090 * src/lyx_gui.C (create_forms): don't display the "default" entry as
2091 we have already "Reset".
2093 * src/language.C (initL): inserted "default" language and made this
2094 THE default language (and not american!)
2096 * src/paragraph.C: inserted handling of "default" language!
2098 * src/lyxfont.C: ditto
2102 * src/paragraph.C: output the \\par only if we have a following
2103 paragraph otherwise it's not needed.
2105 2000-09-05 Juergen Vigna <jug@sad.it>
2107 * config/pspell.m4: added entry to lyx-flags
2109 * src/spellchecker.C: modified version from Kevin for using pspell
2111 2000-09-01 Marko Vendelin <markov@ioc.ee>
2112 * src/frontends/gnome/Makefile.am
2113 * src/frontends/gnome/FormCitation.C
2114 * src/frontends/gnome/FormCitation.h
2115 * src/frontends/gnome/diainsertcitation_callbacks.c
2116 * src/frontends/gnome/diainsertcitation_callbacks.h
2117 * src/frontends/gnome/diainsertcitation_interface.c
2118 * src/frontends/gnome/diainsertcitation_interface.h
2119 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
2120 dialog for Gnome frontend
2122 * src/main.C: Gnome libraries require keeping application name
2123 and its version as strings
2125 * src/frontends/gnome/mainapp.C: Change the name of the main window
2126 from GnomeLyX to PACKAGE
2128 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2130 * src/frontends/Liason.C: add "using: declaration.
2132 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
2134 * src/mathed/math_macro.C (Metrics): Set the size of the template
2136 * src/mathed/formulamacro.C (Latex): Fixed the returned value
2138 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
2140 * src/converter.C (add_options): New function.
2141 (SetViewer): Change $$FName into '$$FName'.
2142 (View): Add options when running xdvi
2143 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
2144 (Convert): The 3rd parameter is now the desired filename. Converts
2145 calls to lyx::rename if necessary.
2146 Add options when running dvips.
2147 (dvi_papersize,dvips_options): New methods.
2149 * src/exporter.C (Export): Use getLatexName() instead of fileName().
2151 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
2152 using a call to Converter::dvips_options.
2153 Fixed to work with nex export code.
2155 * src/support/copy.C
2156 * src/support/rename.C: New files
2158 * src/support/syscall.h
2159 * src/support/syscall.C: Added Starttype SystemDontWait.
2161 * lib/ui/default.ui: Changed to work with new export code
2163 * lib/configure.m4: Changed to work with new export code
2165 * src/encoding.C: Changed latex name for iso8859_7 encoding.
2167 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
2169 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
2170 so that code compiles with DEC cxx.
2172 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
2173 to work correctly! Also now supports the additional elements
2176 2000-09-01 Allan Rae <rae@lyx.org>
2178 * src/frontends/ButtonPolicies.C: renamed all the references to
2179 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
2181 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
2182 since it's a const not a type.
2184 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
2186 2000-08-31 Juergen Vigna <jug@sad.it>
2188 * src/insets/figinset.C: Various changes to look if the filename has
2189 an extension and if not add it for inline previewing.
2191 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2193 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
2194 make buttonStatus and isReadOnly be const methods. (also reflect
2195 this in derived classes.)
2197 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
2198 (nextState): change to be static inline, pass the StateMachine as
2200 (PreferencesPolicy): remove casts
2201 (OkCancelPolicy): remvoe casts
2202 (OkCancelReadOnlyPolicy): remove casts
2203 (NoRepeatedApplyReadOnlyPolicy): remove casts
2204 (OkApplyCancelReadOnlyPolicy): remove casts
2205 (OkApplyCancelPolicy): remove casts
2206 (NoRepeatedApplyPolicy): remove casts
2208 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
2210 * src/converter.C: added some using directives
2212 * src/frontends/ButtonPolicies.C: changes to overcome
2213 "need lvalue" error with DEC c++
2215 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
2216 to WMHideCB for DEC c++
2218 * src/frontends/xforms/Menubar_pimpl.C: added using directive
2220 * src/frontends/xforms/forms/form_document.C.patch: use C callback
2221 to BulletBMTableCB for DEC c++
2223 2000-08-31 Allan Rae <rae@lyx.org>
2225 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
2226 character dialog separately from old document dialogs combo_language.
2229 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2231 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
2232 Removed LFUN_REF_CREATE.
2234 * src/MenuBackend.C: Added new tags: toc and references
2236 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
2237 (add_lastfiles, add_documents, add_formats): Removed the unused smn
2239 (add_toc, add_references): New methods.
2240 (create_submenu): Handle correctly the case when there is a
2241 seperator after optional menu items.
2243 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
2244 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
2245 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
2247 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
2249 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2251 * src/converter.[Ch]: New file for converting between different
2254 * src/export.[Ch]: New file for exporting a LyX file to different
2257 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
2258 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
2259 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
2260 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
2261 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
2262 RunDocBook, MenuExport.
2264 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
2265 Exporter::Preview methods if NEW_EXPORT is defined.
2267 * src/buffer.C (Dispatch): Use Exporter::Export.
2269 * src/lyxrc.C: Added new tags: \converter and \viewer.
2272 * src/LyXAction.C: Define new lyx-function: buffer-update.
2273 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
2274 when NEW_EXPORT is defined.
2276 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
2278 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
2280 * lib/ui/default.ui: Added submenus "view" and "update" to the
2283 * src/filetools.C (GetExtension): New function.
2285 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
2287 2000-08-29 Allan Rae <rae@lyx.org>
2289 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
2291 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
2292 (EnableDocumentLayout): removed
2293 (DisableDocumentLayout): removed
2294 (build): make use of ButtonController's read-only handling to
2295 de/activate various objects. Replaces both of the above functions.
2297 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
2298 (readOnly): was read_only
2299 (refresh): fixed dumb mistakes with read_only_ handling
2301 * src/frontends/xforms/forms/form_document.fd:
2302 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
2303 tabbed dialogs so the tabs look more like tabs and so its easier to
2304 work out which is the current tab.
2306 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
2307 segfault with form_table
2309 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
2311 2000-08-28 Juergen Vigna <jug@sad.it>
2313 * acconfig.h: added USE_PSPELL.
2315 * src/config.h.in: added USE_PSPELL.
2317 * autogen.sh: added pspell.m4
2319 * config/pspell.m4: new file.
2321 * src/spellchecker.C: implemented support for pspell libary.
2323 2000-08-25 Juergen Vigna <jug@sad.it>
2325 * src/LyXAction.C (init): renamed LFUN_TABLE to
2326 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
2328 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
2330 * src/lyxscreen.h: add force_clear variable and fuction to force
2331 a clear area when redrawing in LyXText.
2333 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
2335 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2337 * some whitespace and comment changes.
2339 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
2341 * src/buffer.C: up te LYX_FORMAT to 2.17
2343 2000-08-23 Juergen Vigna <jug@sad.it>
2345 * src/BufferView_pimpl.C (tripleClick): disable this when in a
2348 * src/insets/insettabular.C (pasteSelection): delete the insets
2349 LyXText as it is not valid anymore.
2350 (copySelection): new function.
2351 (pasteSelection): new function.
2352 (cutSelection): new function.
2353 (LocalDispatch): implemented cut/copy/paste of cell selections.
2355 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
2356 don't have a LyXText.
2358 * src/LyXAction.C (init): a NEW_TABULAR define too much.
2360 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
2363 2000-08-22 Juergen Vigna <jug@sad.it>
2365 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
2366 ifdef form_table out if NEW_TABULAR.
2368 2000-08-21 Juergen Vigna <jug@sad.it>
2370 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
2371 (draw): fixed draw position so that the cursor is positioned in the
2373 (InsetMotionNotify): hide/show cursor so the position is updated.
2374 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
2375 using cellstart() function where it should be used.
2377 * src/insets/insettext.C (draw): ditto.
2379 * src/tabular.C: fixed initialization of some missing variables and
2380 made BoxType into an enum.
2382 2000-08-22 Marko Vendelin <markov@ioc.ee>
2383 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
2384 stock menu item using action numerical value, not its string
2388 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
2390 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
2391 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
2393 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
2395 * src/frontends/xforms/GUIRunTime.C: new file
2397 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
2398 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2400 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
2402 * src/frontends/kde/GUIRunTime.C: new file
2404 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
2405 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2407 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
2409 * src/frontends/gnome/GUIRunTime.C: new file
2411 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
2414 * src/frontends/GUIRunTime.h: removed constructor and destructor,
2415 small change to documetentation.
2417 * src/frontends/GUIRunTime.C: removed file
2419 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
2421 * src/lyxparagraph.h: enable NEW_TABULAR as default
2423 * src/lyxfunc.C (processKeySym): remove some commented code
2425 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
2426 NEW_TABULAR around the fd_form_table_options.
2428 * src/lyx_gui.C (runTime): call the static member function as
2429 GUIRunTime::runTime().
2431 2000-08-21 Allan Rae <rae@lyx.org>
2433 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
2436 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
2438 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
2440 2000-08-21 Allan Rae <rae@lyx.org>
2442 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
2443 keep Garst happy ;-)
2444 * src/frontends/xforms/FormPreferences.C (build): use setOK
2445 * src/frontends/xforms/FormDocument.C (build): use setOK
2446 (FormDocument): use the appropriate policy.
2448 2000-08-21 Allan Rae <rae@lyx.org>
2450 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
2451 automatic [de]activation of arbitrary objects when in a read-only state.
2453 * src/frontends/ButtonPolicies.h: More documentation
2454 (isReadOnly): added to support the above.
2456 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
2458 2000-08-18 Juergen Vigna <jug@sad.it>
2460 * src/insets/insettabular.C (getStatus): changed to return func_status.
2462 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
2463 display toggle menu entries if they are.
2465 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
2466 new document layout now.
2468 * src/lyxfunc.C: ditto
2470 * src/lyx_gui_misc.C: ditto
2472 * src/lyx_gui.C: ditto
2474 * lib/ui/default.ui: removed paper and quotes layout as they are now
2475 all in the document layout tabbed folder.
2477 * src/frontends/xforms/forms/form_document.fd: added Restore
2478 button and callbacks for all inputs for Allan's ButtonPolicy.
2480 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
2481 (CheckChoiceClass): added missing params setting on class change.
2482 (UpdateLayoutDocument): added for updating the layout on params.
2483 (build): forgot to RETURN_ALWAYS input_doc_spacing.
2484 (FormDocument): Implemented Allan's ButtonPolicy with the
2487 2000-08-17 Allan Rae <rae@lyx.org>
2489 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
2490 so we can at least see the credits again.
2492 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
2493 controller calls for the appropriate callbacks. Note that since Ok
2494 calls apply followed by cancel, and apply isn't a valid input for the
2495 APPLIED state, the bc_ calls have to be made in the static callback not
2496 within each of the real callbacks.
2498 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
2499 (setOk): renamed from setOkay()
2501 2000-08-17 Juergen Vigna <jug@sad.it>
2503 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
2504 in the implementation part.
2505 (composeUIInfo): don't show optional menu-items.
2507 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
2509 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
2511 * src/bufferview_funcs.C (CurrentState): fixed to show also the
2512 text-state when in a text-inset.
2514 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
2516 2000-08-17 Marko Vendelin <markov@ioc.ee>
2517 * src/frontends/gnome/FormIndex.C
2518 * src/frontends/gnome/FormIndex.h
2519 * src/frontends/gnome/FormToc.C
2520 * src/frontends/gnome/FormToc.h
2521 * src/frontends/gnome/dialogs
2522 * src/frontends/gnome/diatoc_callbacks.c
2523 * src/frontends/gnome/diatoc_callbacks.h
2524 * src/frontends/gnome/diainsertindex_callbacks.h
2525 * src/frontends/gnome/diainsertindex_callbacks.c
2526 * src/frontends/gnome/diainsertindex_interface.c
2527 * src/frontends/gnome/diainsertindex_interface.h
2528 * src/frontends/gnome/diatoc_interface.h
2529 * src/frontends/gnome/diatoc_interface.c
2530 * src/frontends/gnome/Makefile.am: Table of Contents and
2531 Insert Index dialogs implementation for Gnome frontend
2533 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
2535 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
2537 * src/frontends/gnome/diainserturl_interface.c: make the dialog
2540 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2542 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
2543 destructor. Don't definde if you don't need it
2544 (processEvents): made static, non-blocking events processing for
2546 (runTime): static method. event loop for xforms
2547 * similar as above for kde and gnome.
2549 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
2550 new Pimpl is correct
2551 (runTime): new method calss the real frontends runtime func.
2553 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
2555 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2557 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
2559 2000-08-16 Juergen Vigna <jug@sad.it>
2561 * src/lyx_gui.C (runTime): added GUII RunTime support.
2563 * src/frontends/Makefile.am:
2564 * src/frontends/GUIRunTime.[Ch]:
2565 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
2566 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
2567 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
2569 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
2571 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
2572 as this is already set in ${FRONTEND_INCLUDE} if needed.
2574 * configure.in (CPPFLAGS): setting the include dir for the frontend
2575 directory and don't set FRONTEND=xforms for now as this is executed
2578 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
2580 * src/frontends/kde/Makefile.am:
2581 * src/frontends/kde/FormUrl.C:
2582 * src/frontends/kde/FormUrl.h:
2583 * src/frontends/kde/formurldialog.h:
2584 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
2586 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
2588 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
2590 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2592 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
2595 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
2597 * src/WorkArea.C (work_area_handler): more work to get te
2598 FL_KEYBOARD to work with xforms 0.88 too, please test.
2600 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
2602 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
2604 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
2607 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2609 * src/Timeout.h: remove Qt::emit hack.
2611 * several files: changes to allo doc++ compilation
2613 * src/lyxfunc.C (processKeySym): new method
2614 (processKeyEvent): comment out if FL_REVISION < 89
2616 * src/WorkArea.C: change some debugging levels.
2617 (WorkArea): set wantkey to FL_KEY_ALL
2618 (work_area_handler): enable the FL_KEYBOARD clause, this enables
2619 clearer code and the use of compose with XForms 0.89. Change to
2620 use signals instead of calling methods in bufferview directly.
2622 * src/Painter.C: change some debugging levels.
2624 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
2627 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
2628 (workAreaKeyPress): new method
2630 2000-08-14 Juergen Vigna <jug@sad.it>
2632 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
2634 * config/kde.m4: addes some features
2636 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
2637 include missing xforms dialogs.
2639 * src/Timeout.h: a hack to be able to compile with qt/kde.
2641 * sigc++/.cvsignore: added acinclude.m4
2643 * lib/.cvsignore: added listerros
2645 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
2646 xforms tree as objects are needed for other frontends.
2648 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
2649 linking with not yet implemented xforms objects.
2651 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
2653 2000-08-14 Baruch Even <baruch.even@writeme.com>
2655 * src/frontends/xforms/FormGraphics.h:
2656 * src/frontends/xforms/FormGraphics.C:
2657 * src/frontends/xforms/RadioButtonGroup.h:
2658 * src/frontends/xforms/RadioButtonGroup.C:
2659 * src/insets/insetgraphics.h:
2660 * src/insets/insetgraphics.C:
2661 * src/insets/insetgraphicsParams.h:
2662 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
2663 instead of spaces, and various other indentation issues to make the
2664 sources more consistent.
2666 2000-08-14 Marko Vendelin <markov@ioc.ee>
2668 * src/frontends/gnome/dialogs/diaprint.glade
2669 * src/frontends/gnome/FormPrint.C
2670 * src/frontends/gnome/FormPrint.h
2671 * src/frontends/gnome/diaprint_callbacks.c
2672 * src/frontends/gnome/diaprint_callbacks.h
2673 * src/frontends/gnome/diaprint_interface.c
2674 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
2677 * src/frontends/gnome/dialogs/diainserturl.glade
2678 * src/frontends/gnome/FormUrl.C
2679 * src/frontends/gnome/FormUrl.h
2680 * src/frontends/gnome/diainserturl_callbacks.c
2681 * src/frontends/gnome/diainserturl_callbacks.h
2682 * src/frontends/gnome/diainserturl_interface.c
2683 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
2684 Gnome implementation
2686 * src/frontends/gnome/Dialogs.C
2687 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
2688 all other dialogs. Copy all unimplemented dialogs from Xforms
2691 * src/frontends/gnome/support.c
2692 * src/frontends/gnome/support.h: support files generated by Glade
2696 * config/gnome.m4: Gnome configuration scripts
2698 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
2699 configure --help message
2701 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
2702 only if there are no events pendling in Gnome/Gtk. This enhances
2703 the performance of menus.
2706 2000-08-14 Allan Rae <rae@lyx.org>
2708 * lib/Makefile.am: listerrors cleaning
2710 * lib/listerrors: removed -- generated file
2711 * acinclude.m4: ditto
2712 * sigc++/acinclude.m4: ditto
2714 * src/frontends/xforms/forms/form_citation.fd:
2715 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
2718 * src/frontends/xforms/forms/makefile: I renamed the `install` target
2719 `updatesrc` and now we have a `test` target that does what `updatesrc`
2720 used to do. I didn't like having an install target that wasn't related
2723 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
2724 on all except FormGraphics. This may yet happen. Followed by a major
2725 cleanup including using FL_TRANSIENT for most of the dialogs. More
2726 changes to come when the ButtonController below is introduced.
2728 * src/frontends/xforms/ButtonController.h: New file for managing up to
2729 four buttons on a dialog according to an externally defined policy.
2730 * src/frontends/xforms/Makefile.am: added above
2732 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
2733 Apply and Cancel/Close buttons and everything in between and beyond.
2734 * src/frontends/Makefile.am: added above.
2736 * src/frontends/xforms/forms/form_preferences.fd:
2737 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
2738 and removed variable 'status' as a result. Fixed the set_minsize thing.
2739 Use the new screen-font-update after checking screen fonts were changed
2740 Added a "Restore" button to restore the original lyxrc values while
2741 editing. This restores everything not just the last input changed.
2742 That's still a tricky one. As is the "LyX: this shouldn't happen..."
2744 * src/LyXAction.C: screen-font-update added for updating buffers after
2745 screen font settings have been changed.
2746 * src/commandtags.h: ditto
2747 * src/lyxfunc.C: ditto
2749 * forms/lyx.fd: removed screen fonts dialog.
2750 * src/lyx_gui.C: ditto
2751 * src/menus.[Ch]: ditto
2752 * src/lyx.[Ch]: ditto
2753 * src/lyx_cb.C: ditto + code from here moved to make
2754 screen-font-update. And people wonder why progress on GUII is
2755 slow. Look at how scattered this stuff was! It takes forever
2758 * forms/fdfix.sh: Fixup the spacing after commas.
2759 * forms/makefile: Remove date from generated files. Fewer clashes now.
2760 * forms/bullet_forms.C.patch: included someones handwritten changes
2762 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
2763 once I've discovered why LyXRC was made noncopyable.
2764 * src/lyx_main.C: ditto
2766 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
2768 * src/frontends/xforms/forms/fdfix.sh:
2769 * src/frontends/xforms/forms/fdfixh.sed:
2770 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
2771 * src/frontends/xforms/Form*.[hC]:
2772 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
2773 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
2774 provide a destructor for the struct FD_form_xxxx. Another version of
2775 the set_[max|min]size workaround and a few other cleanups. Actually,
2776 Angus' patch from 20000809.
2778 2000-08-13 Baruch Even <baruch.even@writeme.com>
2780 * src/insets/insetgraphics.C (Clone): Added several fields that needed
2783 2000-08-11 Juergen Vigna <jug@sad.it>
2785 * src/insets/insetgraphics.C (InsetGraphics): changing init
2786 order because of warnings.
2788 * src/frontends/xforms/forms/makefile: adding patching .C with
2791 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
2792 from .C.patch to .c.patch
2794 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
2795 order because of warning.
2797 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
2799 * src/frontends/Liason.C (setMinibuffer): new helper function
2801 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
2803 * src/lyxfunc.C (Dispatch): calling new Document-Layout
2805 * lib/ui/default.ui: commented out PaperLayout entry
2807 * src/frontends/xforms/form_document.[Ch]: new added files
2809 * src/frontends/xforms/FormDocument.[Ch]: ditto
2811 * src/frontends/xforms/forms/form_document.fd: ditto
2813 * src/frontends/xforms/forms/form_document.C.patch: ditto
2815 2000-08-10 Juergen Vigna <jug@sad.it>
2817 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
2818 (InsetGraphics): initialized cacheHandle to 0.
2819 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
2821 2000-08-10 Baruch Even <baruch.even@writeme.com>
2823 * src/graphics/GraphicsCache.h:
2824 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
2825 correctly as a cache.
2827 * src/graphics/GraphicsCacheItem.h:
2828 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
2831 * src/graphics/GraphicsCacheItem_pimpl.h:
2832 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
2835 * src/insets/insetgraphics.h:
2836 * src/insets/insetgraphics.C: Changed from using a signal notification
2837 to polling when image is not loaded.
2839 2000-08-10 Allan Rae <rae@lyx.org>
2841 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
2842 that there are two functions that have to been taken out of line by
2843 hand and aren't taken care of in the script. (Just a reminder note)
2845 * sigc++/macros/*.h.m4: Updated as above.
2847 2000-08-09 Juergen Vigna <jug@sad.it>
2849 * src/insets/insettext.C (draw): small fix for clearing rectangle.
2851 * src/insets/insettabular.C: make drawing of single cell smarter.
2853 2000-08-09 Marko Vendelin <markov@ioc.ee>
2854 * src/frontends/gnome/Menubar_pimpl.C
2855 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
2856 implementation: new files
2858 * src/frontends/gnome/mainapp.C
2859 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
2862 * src/main.C: create Gnome main window
2864 * src/frontends/xforms/Menubar_pimpl.h
2865 * src/frontends/Menubar.C
2866 * src/frontends/Menubar.h: added method Menubar::update that calls
2867 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
2869 * src/LyXView.C: calls Menubar::update to update the state
2872 * src/frontends/gnome/Makefile.am: added new files
2874 * src/frontends/Makefile.am: added frontend compiler options
2876 2000-08-08 Juergen Vigna <jug@sad.it>
2878 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
2880 * src/bufferlist.C (close):
2881 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
2882 documents if exiting without saving.
2884 * src/buffer.C (save): use removeAutosaveFile()
2886 * src/support/filetools.C (removeAutosaveFile): new function.
2888 * src/lyx_cb.C (MenuWrite): returns a bool now.
2889 (MenuWriteAs): check if file could really be saved and revert to the
2891 (MenuWriteAs): removing old autosavefile if existant.
2893 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
2894 before Goto toggle declaration, because of compiler warning.
2896 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
2898 * src/lyxfunc.C (MenuNew): small fix.
2900 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
2902 * src/bufferlist.C (newFile):
2903 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
2905 * src/lyxrc.C: added new_ask_filename tag
2907 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
2909 * src/lyx.fd: removed code pertaining to form_ref
2910 * src/lyx.[Ch]: ditto
2911 * src/lyx_cb.C: ditto
2912 * src/lyx_gui.C: ditto
2913 * src/lyx_gui_misc.C: ditto
2915 * src/BufferView_pimpl.C (restorePosition): update buffer only
2918 * src/commandtags.h (LFUN_REFTOGGLE): removed
2919 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
2920 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
2921 (LFUN_REFBACK): renamed LFUN_REF_BACK
2923 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
2924 * src/menus.C: ditto
2925 * src/lyxfunc.C (Dispatch): ditto.
2926 InsertRef dialog is now GUI-independent.
2928 * src/texrow.C: added using std::endl;
2930 * src/insets/insetref.[Ch]: strip out large amounts of code.
2931 The inset is now a container and this functionality is now
2932 managed by a new FormRef dialog
2934 * src/frontends/Dialogs.h (showRef, createRef): new signals
2936 * src/frontends/xforms/FormIndex.[Ch],
2937 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
2938 when setting dialog's min/max size
2939 * src/frontends/xforms/FormIndex.[Ch]: ditto
2941 * src/frontends/xforms/FormRef.[Ch],
2942 src/frontends/xforms/forms/form_ref.fd: new xforms
2943 implementation of an InsetRef dialog
2945 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
2948 * src/graphics/XPM_Renderer.C (isImageFormatOK):
2949 ios::nocreate is not part of the standard. Removed.
2951 2000-08-07 Baruch Even <baruch.even@writeme.com>
2953 * src/graphics/Renderer.h:
2954 * src/graphics/Renderer.C: Added base class for rendering of different
2955 image formats into Pixmaps.
2957 * src/graphics/XPM_Renderer.h:
2958 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
2959 in a different class.
2961 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
2962 easily add support for other formats.
2964 * src/insets/figinset.C: plugged a leak of an X resource.
2966 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
2968 * src/CutAndPaste.[Ch]: make all metods static.
2970 * development/Code_rules/Rules: more work, added section on
2971 Exceptions, and a References section.
2973 * a lot of header files: work to make doc++ able to generate the
2974 source documentation, some workarounds of doc++ problems. Doc++ is
2975 now able to generate the documentation.
2977 2000-08-07 Juergen Vigna <jug@sad.it>
2979 * src/insets/insettabular.C (recomputeTextInsets): removed function
2981 * src/tabular.C (SetWidthOfMulticolCell):
2983 (calculate_width_of_column_NMC): fixed return value so that it really
2984 only returns true if the column-width has changed (there where
2985 problems with muliticolumn-cells in this column).
2987 2000-08-04 Juergen Vigna <jug@sad.it>
2989 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
2990 also on the scrollstatus of the inset.
2991 (workAreaMotionNotify): ditto.
2993 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
2995 2000-08-01 Juergen Vigna <jug@sad.it>
2997 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
2999 * src/commandtags.h:
3000 * src/LyXAction.C (init):
3001 * src/insets/inset.C (LocalDispatch): added support for
3004 * src/insets/inset.C (scroll): new functions.
3006 * src/insets/insettext.C (removeNewlines): new function.
3007 (SetAutoBreakRows): removes forced newlines in the text of the
3008 paragraph if autoBreakRows is set to false.
3010 * src/tabular.C (Latex): generates a parbox around the cell contents
3013 * src/frontends/xforms/FormTabular.C (local_update): removed
3014 the radio_useparbox button.
3016 * src/tabular.C (UseParbox): new function
3018 2000-08-06 Baruch Even <baruch.even@writeme.com>
3020 * src/graphics/GraphicsCache.h:
3021 * src/graphics/GraphicsCache.C:
3022 * src/graphics/GraphicsCacheItem.h:
3023 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
3026 * src/insets/insetgraphics.h:
3027 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
3028 and the drawing of the inline image.
3030 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
3031 loaded into the wrong position.
3033 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
3036 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3038 * src/support/translator.h: move all typedefs to public section
3040 * src/support/filetools.C (MakeLatexName): return string const
3042 (TmpFileName): ditto
3043 (FileOpenSearch): ditto
3045 (LibFileSearch): ditto
3046 (i18nLibFileSearch): ditto
3049 (CreateTmpDir): ditto
3050 (CreateBufferTmpDir): ditto
3051 (CreateLyXTmpDir): ditto
3054 (MakeAbsPath): ditto
3056 (OnlyFilename): ditto
3058 (NormalizePath): ditto
3059 (CleanupPath): ditto
3060 (GetFileContents): ditto
3061 (ReplaceEnvironmentPath): ditto
3062 (MakeRelPath): ditto
3064 (ChangeExtension): ditto
3065 (MakeDisplayPath): ditto
3066 (do_popen): return cmdret const
3067 (findtexfile): return string const
3069 * src/support/DebugStream.h: add some /// to please doc++
3071 * src/frontends/DialogBase.h (endif): add some /// to please doc++
3073 * src/texrow.C (same_rownumber): functor to use with find_if
3074 (getIdFromRow): rewritten to use find_if and to not update the
3075 positions. return true if row is found
3076 (increasePos): new method, use to update positions
3078 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
3080 * src/lyxlex_pimpl.C (verifyTable): new method
3083 (GetString): return string const
3084 (pushTable): rewrite to use std::stack
3086 (setFile): better check
3089 * src/lyxlex.h: make LyXLex noncopyable
3091 * src/lyxlex.C (text): return char const * const
3092 (GetString): return string const
3093 (getLongString): return string const
3095 * src/lyx_gui_misc.C (askForText): return pair<...> const
3097 * src/lastfiles.[Ch] (operator): return string const
3099 * src/buffer.C (parseSingleLyXformat2Token): pass string to
3100 istringstream not char const *.
3101 move token.end() out of loop.
3102 (readFile): move initializaton of token
3104 * src/BufferView2.C (insertErrors): run texrow.increasePos if
3105 getIdFromRow is successful.
3107 * lib/bind/emacs.bind: don't include menus bind
3109 * development/Code_rules/Rules: the beginnings of making this
3110 better and covering more of the unwritten rules that we have.
3112 * development/Code_rules/Recommendations: a couple of wording
3115 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3117 * src/support/strerror.c: remove C++ comment.
3119 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
3121 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
3122 LFUN_INDEX_INSERT_LAST
3124 * src/texrow.C (getIdFromRow): changed from const_iterator to
3125 iterator, allowing code to compile with DEC cxx
3127 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
3128 stores part of the class, as suggested by Allan. Will allow
3130 (apply): test to apply uses InsetCommandParams operator!=
3132 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
3133 (apply): test to apply uses InsetCommandParams operator!=
3135 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
3136 stores part of the class.
3137 (update): removed limits on min/max size.
3139 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
3140 (apply): test to apply uses InsetCommandParams operator!=
3142 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
3143 (Read, Write, scanCommand, getCommand): moved functionality
3144 into InsetCommandParams.
3146 (getScreenLabel): made pure virtual
3147 new InsetCommandParams operators== and !=
3149 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
3150 c-tors based on InsetCommandParams. Removed others.
3151 * src/insets/insetinclude.[Ch]: ditto
3152 * src/insets/insetlabel.[Ch]: ditto
3153 * src/insets/insetparent.[Ch]: ditto
3154 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
3156 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
3157 insets derived from InsetCommand created using similar c-tors
3158 based on InsetCommandParams
3159 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
3160 * src/menus.C (ShowRefsMenu): ditto
3161 * src/paragraph.C (Clone): ditto
3162 * src/text2.C (SetCounter): ditto
3163 * src/lyxfunc.C (Dispatch) ditto
3164 Also recreated old InsetIndex behaviour exactly. Can now
3165 index-insert at the start of a paragraph and index-insert-last
3166 without launching the pop-up.
3168 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3170 * lib/lyxrc.example: mark te pdf options as non functional.
3172 * src/support/lstrings.C (strToInt): move initalization of tmpstr
3173 (isStrDbl): move tmpstr.end() out of loop.
3174 (strToDbl): move intialization of tmpstr
3175 (lowercase): return string const and move tmp.end() out of loop.
3176 (uppercase): return string const and move tmp.edn() out of loop.
3177 (prefixIs): add assertion
3182 (containsOnly): ditto
3183 (containsOnly): ditto
3184 (containsOnly): ditto
3185 (countChar): make last arg char not char const
3186 (token): return string const
3187 (subst): return string const, move tmp.end() out of loop.
3188 (subst): return string const, add assertion
3189 (strip): return string const
3190 (frontStrip): return string const, add assertion
3191 (frontStrip): return string const
3196 * src/support/lstrings.C: add inclde "LAssert.h"
3197 (isStrInt): move tmpstr.end() out of loop.
3199 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
3200 toollist.end() out of loop.
3201 (deactivate): move toollist.end() out of loop.
3202 (update): move toollist.end() out of loop.
3203 (updateLayoutList): move tc.end() out of loop.
3204 (add): move toollist.end() out of loop.
3206 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
3207 md.end() out of loop.
3209 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
3211 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
3214 * src/paragraph.C (Erase): move fontlist.end() out of loop.
3215 (Erase): move insetlist.end() out of loop.
3217 * src/lyx_sendfax_main.C: make show_logfile static and to take a
3218 ref to const string as first arg. Move initialization of some
3219 variables, whitespace changes.
3221 * src/kbmap.C (defkey): move table.end() out of loop.
3222 (kb_keymap): move table.end() out of loop.
3223 (findbinding): move table.end() out of loop.
3225 * src/MenuBackend.C (hasMenu): move end() out of loop.
3226 (getMenu): move end() out of loop.
3227 (getMenu): move menulist_.end() out of loop.
3229 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
3231 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
3234 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
3235 (getFromLyXName): move infotab.end() out of loop.
3237 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
3238 -fvtable-thunks -ffunction-sections -fdata-sections
3240 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
3242 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
3245 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3247 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
3249 * src/frontends/xforms/FormCitation.[Ch],
3250 src/frontends/xforms/FormIndex.[Ch],
3251 src/frontends/xforms/FormToc.[Ch],
3252 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
3254 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3256 * src/commandtags.h: renamed, created some flags for citation
3259 * src/lyx_gui_misc.C: stripped out old FD_index_form code
3261 * src/lyxfunc.C (dispatch): use signals to insert index entry
3263 * src/frontends/Dialogs.h: new signal createIndex
3265 * src/frontends/xforms/FormCommand.[Ch],
3266 src/frontends/xforms/FormCitation.[Ch],
3267 src/frontends/xforms/FormToc.[Ch],
3268 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
3270 * src/insets/insetindex.[Ch]: GUI-independent
3272 * src/frontends/xforms/FormIndex.[Ch],
3273 * src/frontends/xforms/forms/form_index.fd: xforms implementation
3276 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
3278 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
3279 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
3281 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3283 * src/insets/insetref.C (Latex): rewrite so that there is now
3284 question that a initialization is requested.
3286 * src/insets/insetcommand.h: reenable the hide signal
3288 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3290 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
3291 fix handling of shortcuts (many bugs :)
3292 (add_lastfiles): ditto.
3294 * lib/ui/default.ui: fix a few shortcuts.
3296 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
3298 * Makefile.am: Fix ``rpmdist'' target to return the exit
3299 status of the ``rpm'' command, instead of the last command in
3300 the chain (the ``rm lyx.xpm'' command, which always returns
3303 2000-08-02 Allan Rae <rae@lyx.org>
3305 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
3306 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
3307 * src/frontends/xforms/FormToc.C (FormToc): ditto
3309 * src/frontends/xforms/Makefile.am: A few forgotten files
3311 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
3312 Signals-not-copyable-problem Lars' started commenting out.
3314 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
3316 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3318 * src/insets/insetcommand.h: Signals is not copyable so anoter
3319 scheme for automatic hiding of forms must be used.
3321 * src/frontends/xforms/FormCitation.h: don't inerit from
3322 noncopyable, FormCommand already does that.
3323 * src/frontends/xforms/FormToc.h: ditto
3324 * src/frontends/xforms/FormUrl.h: ditto
3326 * src/frontends/xforms/FormCitation.C: add include <algorithm>
3328 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
3330 * src/insets/insetcommand.h (hide): new SigC::Signal0
3331 (d-tor) new virtual destructor emits hide signal
3333 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
3334 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
3336 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
3337 LOF and LOT. Inset is now GUI-independent
3339 * src/insets/insetloa.[Ch]: redundant
3340 * src/insets/insetlof.[Ch]: ditto
3341 * src/insets/insetlot.[Ch]: ditto
3343 * src/frontends/xforms/forms/form_url.fd: tweaked!
3344 * src/frontends/xforms/forms/form_citation.fd: ditto
3346 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
3347 dialogs dealing with InsetCommand insets
3349 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
3350 FormCommand base class
3351 * src/frontends/xforms/FormUrl.[Ch]: ditto
3353 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
3355 * src/frontends/xforms/FormToc.[Ch]: ditto
3357 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
3358 passed a generic InsetCommand pointer
3359 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
3361 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
3362 and modified InsetTOC class
3363 * src/buffer.C: ditto
3365 * forms/lyx.fd: strip out old FD_form_toc code
3366 * src/lyx_gui_misc.C: ditto
3367 * src/lyx_gui.C: ditto
3368 * src/lyx_cb.C: ditto
3369 * src/lyx.[Ch]: ditto
3371 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3373 * src/support/utility.hpp: tr -d '\r'
3375 2000-08-01 Juergen Vigna <jug@sad.it>
3377 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
3379 * src/commandtags.h:
3380 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
3381 LFUN_TABULAR_FEATURES.
3383 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
3384 LFUN_LAYOUT_TABULAR.
3386 * src/insets/insettabular.C (getStatus): implemented helper function.
3388 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
3390 2000-07-31 Juergen Vigna <jug@sad.it>
3392 * src/text.C (draw): fixed screen update problem for text-insets.
3394 * src/text2.C (SetParagrpah): call an update of the inset-owner when
3395 something changed probably this has to be added in various other
3398 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
3400 2000-07-31 Baruch Even <baruch.even@writeme.com>
3402 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
3403 templates to satisfy compaq cxx.
3406 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3408 * src/support/translator.h (equal_1st_in_pair::operator()): take
3409 const ref pair_type as arg.
3410 (equal_2nd_in_pair::operator()): ditto
3411 (Translator::~Translator): remove empty d-tor.
3413 * src/graphics/GraphicsCache.C: move include config.h to top, also
3414 put initialization of GraphicsCache::singleton here.
3415 (~GraphicsCache): move here
3416 (addFile): take const ref as arg
3419 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
3421 * src/BufferView2.C (insertLyXFile): change te with/without header
3424 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3426 * src/frontends/xforms/FormGraphics.C (apply): add some
3427 static_cast. Not very nice, but required by compaq cxx.
3429 * src/frontends/xforms/RadioButtonGroup.h: include header
3430 <utility> instead of <pair.h>
3432 * src/insets/insetgraphicsParams.C: add using directive.
3433 (readResize): change return type to void.
3434 (readOrigin): ditto.
3436 * src/lyxfunc.C (getStatus): add missing break for build-program
3437 function; add test for Literate for export functions.
3439 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
3440 entries in Options menu.
3442 2000-07-31 Baruch Even <baruch.even@writeme.com>
3444 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
3445 protect against auto-allocation; release icon when needed.
3447 2000-07-31 Matej Cepl <CeplM@seznam.cz>
3449 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
3450 on usual typewriter.
3452 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
3453 earlier czech.kmap), useful only for programming.
3455 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3457 * src/frontends/xforms/FormCitation.h: fix conditioning around
3460 2000-07-31 Juergen Vigna <jug@sad.it>
3462 * src/frontends/xforms/FormTabular.C (local_update): changed
3463 radio_linebreaks to radio_useparbox and added radio_useminipage.
3465 * src/tabular.C: made support for using minipages/parboxes.
3467 * src/bufferlist.C (QwriteAll): small fix for asking for save.
3469 * src/insets/insetgraphics.C (draw): just draw the inset so that the
3471 (descent): so the cursor is in the middle.
3472 (width): bit smaller box.
3474 * src/insets/insetgraphics.h: added display() function.
3476 2000-07-31 Baruch Even <baruch.even@writeme.com>
3478 * src/frontends/Dialogs.h: Added showGraphics signals.
3480 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
3481 xforms form definition of the graphics dialog.
3483 * src/frontends/xforms/FormGraphics.h:
3484 * src/frontends/xforms/FormGraphics.C: Added files, the
3485 GUIndependent code of InsetGraphics
3487 * src/insets/insetgraphics.h:
3488 * src/insets/insetgraphics.C: Major writing to make it work.
3490 * src/insets/insetgraphicsParams.h:
3491 * src/insets/insetgraphicsParams.C: Added files, parameter passing
3492 struct between InsetGraphics and GUI.
3494 * src/LaTeXFeatures.h:
3495 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
3496 support for graphicx package.
3498 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
3499 for the graphics inset.
3501 * src/support/translator.h: Added file, used in
3502 InsetGraphicsParams. this is a template to translate between two
3505 * src/frontends/xforms/RadioButtonGroup.h:
3506 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
3507 way to easily control a radio button group.
3509 2000-07-28 Juergen Vigna <jug@sad.it>
3511 * src/insets/insettabular.C (LocalDispatch):
3512 (TabularFeatures): added support for lyx-functions of tabular features.
3513 (cellstart): refixed this function after someone wrongly changed it.
3515 * src/commandtags.h:
3516 * src/LyXAction.C (init): added support for tabular-features
3518 2000-07-28 Allan Rae <rae@lyx.org>
3520 * src/frontends/xforms/FormPreferences.C (build): Setup input return
3521 checking. NOTE: It seems that pressing ESC to cancel the dialog also
3522 triggers the callback for input checking. As a result we sometimes get
3523 "LyX: This shouldn't happen..." printed to cerr.
3524 (input): Started using status variable since I only free() on
3525 destruction. Some input checking for paths and font sizes.
3527 * src/frontends/xforms/FormPreferences.h: Use status to control
3528 activation of Ok and Apply
3530 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
3531 callback. Also resized to stop segfaults with 0.88. The problem is
3532 that xforms-0.88 requires the folder to be wide enough to fit all the
3533 tabs. If it isn't it causes all sorts of problems.
3535 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
3537 * src/frontends/xforms/forms/README: Reflect reality.
3539 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
3540 * src/frontends/xforms/forms/makefile: ditto.
3542 * src/commandtags.h: Get access to new Preferences dialog
3543 * src/LyXAction.C: ditto
3544 * src/lyxfunc.C: ditto
3545 * lib/ui/default.ui: ditto
3547 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3549 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
3551 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
3554 * src/frontends/xforms/form_url.[Ch]: added.
3556 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3558 * src/insets/insetbib.h: fixed bug in previous commit
3560 * src/frontends/xforms/FormUrl.h: ditto
3562 * src/frontends/xforms/FormPrint.h: ditto
3564 * src/frontends/xforms/FormPreferences.h: ditto
3566 * src/frontends/xforms/FormCopyright.h: ditto
3568 * src/frontends/xforms/FormCitation.C: ditto
3570 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
3571 private copyconstructor and private default contructor
3573 * src/support/Makefile.am: add utility.hpp
3575 * src/support/utility.hpp: new file from boost
3577 * src/insets/insetbib.h: set owner in clone
3579 * src/frontends/xforms/FormCitation.C: added missing include
3582 * src/insets/form_url.[Ch]: removed
3584 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
3586 * development/lyx.spec.in
3587 * Makefile.am: Fix buglet for LyX RPM generation resulting from
3588 file/directory re-organization.
3590 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
3592 * src/insets/insetcommand.[Ch]: moved the string data and
3593 associated manipulation methods into a new stand-alone class
3594 InsetCommandParams. This class has two additional methods
3595 getAsString() and setFromString() allowing the contents to be
3596 moved around as a single string.
3597 (addContents) method removed.
3598 (setContents) method no longer virtual.
3600 * src/buffer.C (readInset): made use of new InsetCitation,
3601 InsetUrl constructors based on InsetCommandParams.
3603 * src/commandtags.h: add LFUN_INSERT_URL
3605 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
3606 independent InsetUrl and use InsetCommandParams to extract
3607 string info and create new Insets.
3609 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
3611 * src/frontends/xforms/FormCitation.C (apply): uses
3614 * src/frontends/xforms/form_url.C
3615 * src/frontends/xforms/form_url.h
3616 * src/frontends/xforms/FormUrl.h
3617 * src/frontends/xforms/FormUrl.C
3618 * src/frontends/xforms/forms/form_url.fd: new files
3620 * src/insets/insetcite.[Ch]: removed unused constructors.
3622 * src/insets/insetinclude.[Ch]: no longer store filename
3624 * src/insets/inseturl.[Ch]: GUI-independent.
3626 2000-07-26 Juergen Vigna <jug@sad.it>
3627 * renamed frontend from gtk to gnome as it is that what is realized
3628 and did the necessary changes in the files.
3630 2000-07-26 Marko Vendelin <markov@ioc.ee>
3632 * configure.in: cleaning up gnome configuration scripts
3634 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3636 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
3637 shortcuts syndrom by redrawing them explicitely (a better solution
3638 would be appreciated).
3640 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
3642 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
3645 * src/lyx_cb.C (MenuExport): change html export to do the right
3646 thing depending of the document type (instead of having
3647 html-linuxdoc and html-docbook).
3648 * src/lyxfunc.C (getStatus): update for html
3649 * lib/ui/default.ui: simplify due to the above change.
3650 * src/menus.C (ShowFileMenu): update too (in case we need it).
3652 * src/MenuBackend.C (read): if a menu is defined twice, add the
3653 new entries to the exiting one.
3655 2000-07-26 Juergen Vigna <jug@sad.it>
3657 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
3659 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
3660 and return a bool if it did actual save the file.
3661 (AutoSave): don't autosave a unnamed doc.
3663 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
3664 check if this is an UNNAMED new file and react to it.
3665 (newFile): set buffer to unnamed and change to not mark a new
3666 buffer dirty if I didn't do anything with it.
3668 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
3670 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3672 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
3673 friend as per Angus's patch posted to lyx-devel.
3675 * src/ext_l10n.h: updated
3677 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
3678 gettext on the style string right before inserting them into the
3681 * autogen.sh: add code to extract style strings form layout files,
3682 not good enough yet.
3684 * src/frontends/gtk/.cvsignore: add MAKEFILE
3686 * src/MenuBackend.C (read): run the label strings through gettext
3687 before storing them in the containers.
3689 * src/ext_l10n.h: new file
3691 * autogen.sh : generate the ext_l10n.h file here
3693 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3695 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
3698 * lib/ui/default.ui: fix a couple of typos.
3700 * config/gnome/gtk.m4: added (and added to the list of files in
3703 * src/insets/insetinclude.C (unique_id): fix when we are using
3704 lyxstring instead of basic_string<>.
3705 * src/insets/insettext.C (LocalDispatch): ditto.
3706 * src/support/filetools.C: ditto.
3708 * lib/configure.m4: create the ui/ directory if necessary.
3710 * src/LyXView.[Ch] (updateToolbar): new method.
3712 * src/BufferView_pimpl.C (buffer): update the toolbar when
3713 opening/closing buffer.
3715 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3717 * src/LyXAction.C (getActionName): enhance to return also the name
3718 and options of pseudo-actions.
3719 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
3721 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
3722 as an example of what is possible). Used in File->Build too (more
3723 useful) and in the import/export menus (to mimick the complicated
3724 handling of linuxdoc and friends). Try to update all the entries.
3726 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
3729 * src/MenuBackend.C (read): Parse the new OptItem tag.
3731 * src/MenuBackend.h: Add a new optional_ data member (used if the
3732 entry should be omitted when the lyxfunc is disabled).
3734 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
3735 function, used as a shortcut.
3736 (create_submenu): align correctly the shortcuts on the widest
3739 * src/MenuBackend.h: MenuItem.label() only returns the label of
3740 the menu without shortcut; new method shortcut().
3742 2000-07-14 Marko Vendelin <markov@ioc.ee>
3744 * src/frontends/gtk/Dialogs.C:
3745 * src/frontends/gtk/FormCopyright.C:
3746 * src/frontends/gtk/FormCopyright.h:
3747 * src/frontends/gtk/Makefile.am: added these source-files for the
3748 Gtk/Gnome support of the Copyright-Dialog.
3750 * src/main.C: added Gnome::Main initialization if using
3751 Gtk/Gnome frontend-GUI.
3753 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
3755 * config/gnome/aclocal-include.m4
3756 * config/gnome/compiler-flags.m4
3757 * config/gnome/curses.m4
3758 * config/gnome/gnome--.m4
3759 * config/gnome/gnome-bonobo-check.m4
3760 * config/gnome/gnome-common.m4
3761 * config/gnome/gnome-fileutils.m4
3762 * config/gnome/gnome-ghttp-check.m4
3763 * config/gnome/gnome-gnorba-check.m4
3764 * config/gnome/gnome-guile-checks.m4
3765 * config/gnome/gnome-libgtop-check.m4
3766 * config/gnome/gnome-objc-checks.m4
3767 * config/gnome/gnome-orbit-check.m4
3768 * config/gnome/gnome-print-check.m4
3769 * config/gnome/gnome-pthread-check.m4
3770 * config/gnome/gnome-support.m4
3771 * config/gnome/gnome-undelfs.m4
3772 * config/gnome/gnome-vfs.m4
3773 * config/gnome/gnome-x-checks.m4
3774 * config/gnome/gnome-xml-check.m4
3775 * config/gnome/gnome.m4
3776 * config/gnome/gperf-check.m4
3777 * config/gnome/gtk--.m4
3778 * config/gnome/linger.m4
3779 * config/gnome/need-declaration.m4: added configuration scripts
3780 for Gtk/Gnome frontend-GUI
3782 * configure.in: added support for the --with-frontend=gtk option
3784 * autogen.sh: added config/gnome/* to list of config-files
3786 * acconfig.h: added define for GTKGUI-support
3788 * config/lyxinclude.m4: added --with-frontend[=value] option value
3789 for Gtk/Gnome frontend-GUI support.
3791 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3793 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
3797 * src/paragraph.C (GetChar): remove non-const version
3799 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
3800 (search_kw): use it.
3802 * src/lyx_main.C (init): if "preferences" exist, read that instead
3804 (ReadRcFile): return bool if the file could be read ok.
3805 (ReadUIFile): add a check to see if lex file is set ok.
3807 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
3808 bastring can be used instead of lyxstring (still uses the old code
3809 if std::string is good enough or if lyxstring is used.)
3811 * src/encoding.C: make the arrays static, move ininle functions
3813 * src/encoding.h: from here.
3815 * src/buffer.C: have last_isnet_read as a file scope variable for now.
3816 (parseSingleLyXformat2Token): move inset parsing to separate method
3817 (readInset): new private method
3819 * src/Variables.h: remove virtual from get().
3821 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
3822 access to NEW_INSETS and NEW_TABULAR
3824 * src/MenuBackend.h: remove superfluous forward declaration of
3825 MenuItem. Add documentations tags "///", remove empty MenuItem
3826 destructor, remove private default contructor.
3828 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
3830 (read): more string mlabel and mname to where they are used
3831 (read): remove unused variables mlabel and mname
3832 (defaults): unconditional clear, make menusetup take advantage of
3833 add returning Menu &.
3835 * src/LyXView.h: define NEW_MENUBAR as default
3837 * src/LyXAction.C: include lyxparagraph.h temporary to get access
3838 to NEW_INSETS and NEW_TABULAR.
3839 (init): commetn out some funcs that is obsolete when NEW_INSETS is
3840 defined. Change some of the "xxxx-inset-insert" functions names to
3843 * several files: more enahncements to NEW_INSETS and the resulting
3846 * lib/lyxrc.example (\date_insert_format): move to misc section
3848 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
3849 bastring and use AC_CACHE_CHECK.
3850 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
3851 the system have the newest methods. uses AC_CACHE_CHECK
3852 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
3853 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
3854 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
3856 * configure.in: add LYX_CXX_GOOD_STD_STRING
3858 * acinclude.m4: recreated
3860 2000-07-24 Amir Karger <karger@lyx.org>
3862 * README: add Hebrew, Arabic kmaps
3865 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3867 * src/buffer.C (writeFileAscii): Define actcell as an int instead
3870 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3872 * Lot of files: add pragma interface/implementation.
3874 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
3876 * lib/ui/default.ui: new file (ans new directory). Contains the
3877 default menu and toolbar.
3879 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
3880 global space. Toolbars are now read (as menus) in ui files.
3882 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
3884 * src/lyxfunc.C (getStatus): do not exit immediately if a command
3885 is disabled because the document is read-only. We want to have the
3886 toggle state of the function anyway.
3887 (getStatus): add code for LFUN_VC* functions (mimicking what is
3888 done in old-style menus)
3890 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
3891 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
3893 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
3894 * src/BufferView_pimpl.C: ditto.
3895 * src/lyxfunc.C: ditto.
3897 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
3898 default). This replaces old-style menus by new ones.
3900 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
3901 MenuItem. Contain the data structure of a menu.
3903 * src/insets/insettext.C: use LyXView::setLayout instead of
3904 accessing directly the toolbar combox.
3905 * src/lyxfunc.C (Dispatch): ditto.
3907 * src/LyXView.C (setLayout): new method, which just calls
3908 Toolbar::setLayout().
3909 (updateLayoutChoice): move part of this method in Toolbar.
3911 * src/toolbar.[Ch]: removed.
3913 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
3914 implementation the toolbar.
3916 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
3917 the toolbar. It might make sense to merge it with ToolbarDefaults
3919 (setLayout): new function.
3920 (updateLayoutList): ditto.
3921 (openLayoutList): ditto.
3923 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
3924 xforms implementation of the toolbar.
3925 (get_toolbar_func): comment out, since I do not
3926 know what it is good for.
3928 * src/ToolbarDefaults.h: Add the ItemType enum.
3930 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
3931 for a list of allocated C strings. Used in Menubar xforms
3932 implementation to avoid memory leaks.
3934 * src/support/lstrings.[Ch] (uppercase): new version taking and
3938 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
3939 * lib/bind/emacs.bind: ditto.
3941 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3943 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
3944 forward decl of LyXView.
3946 * src/toolbar.C (toolbarItem): moved from toolbar.h
3947 (toolbarItem::clean): ditto
3948 (toolbarItem::~toolbarItem): ditto
3949 (toolbarItem::operator): ditto
3951 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
3953 * src/paragraph.h: control the NEW_TABULAR define from here
3955 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
3956 USE_TABULAR_INSETS to NEW_TABULAR
3958 * src/ToolbarDefaults.C: add include "lyxlex.h"
3960 * files using the old table/tabular: use NEW_TABULAR to control
3961 compilation of old tabular stuff.
3963 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
3966 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
3967 planemet in reading of old style floats, fix the \end_deeper
3968 problem when reading old style floats.
3970 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3972 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
3974 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
3976 * lib/bind/sciword.bind: updated.
3978 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3980 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
3981 layout write problem
3983 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3985 * src/Makefile.am (INCLUDES): remove image directory from include
3988 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
3989 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
3991 * src/LyXView.C (create_form_form_main): read the application icon
3994 * lib/images/*.xpm: change the icons to use transparent color for
3997 * src/toolbar.C (update): change the color of the button when it
4000 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4002 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
4003 setting explicitely the minibuffer.
4004 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
4006 * src/LyXView.C (showState): new function. Shows font information
4007 in minibuffer and update toolbar state.
4008 (LyXView): call Toolbar::update after creating the
4011 * src/toolbar.C: change toollist to be a vector instead of a
4013 (BubbleTimerCB): get help string directly from the callback
4014 argument of the corresponding icon (which is the action)
4015 (set): remove unnecessary ugliness.
4016 (update): new function. update the icons (depressed, disabled)
4017 depending of the status of the corresponding action.
4019 * src/toolbar.h: remove help in toolbarItem
4021 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
4023 * src/Painter.C (text): Added code for using symbol glyphs from
4024 iso10646 fonts. Currently diabled.
4026 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
4029 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
4030 magyar,turkish and usorbian.
4032 * src/paragraph.C (isMultiLingual): Made more efficient.
4034 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
4037 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
4038 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
4039 Also changed the prototype to "bool math_insert_greek(char)".
4041 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4043 * lots of files: apply the NEW_INSETS on all code that will not be
4044 needed when we move to use the new insets. Enable the define in
4045 lyxparagrah.h to try it.
4047 * src/insets/insettabular.C (cellstart): change to be a static
4049 (InsetTabular): initialize buffer in the initializer list.
4051 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
4053 * src/frontends/xforms/FormPrint.[Ch] : moved #include
4054 form_print.h out of the header file. Replaced with forward
4055 declarations of the relevant struct.
4057 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
4060 * src/commandtags.h: do not include "debug.h" which does not
4061 belong there. #include it in some other places because of this
4064 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4066 * src/insets/insetcaption.C: add a couple "using" directives.
4068 * src/toolbar.C (add): get the help text directly from lyxaction.
4070 (setPixmap): new function. Loads from disk and sets a pixmap on a
4071 botton; the name of the pixmap file is derived from the command
4074 * src/toolbar.h: remove members isBitmap and pixmap from
4077 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
4078 * lib/images/: move many files from images/banner.xpm.
4080 * src/lyx_gui.C (create_forms): read banner pixmap from file.
4082 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
4083 * src/toolbar.C: ditto.
4084 * configure.in: ditto.
4085 * INSTALL: document.
4087 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
4088 the spellchecker popup is closed from the WM.
4090 2000-07-19 Juergen Vigna <jug@sad.it>
4092 * src/insets/insetfloat.C (Write): small fix because we use the
4093 insetname for the type now!
4095 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
4097 * src/frontends/xforms/forms/form_citation.fd: object sizes are
4100 * src/frontends/Dialogs.h: removed hideCitation signal
4102 * src/insets/insetcite.h: added hide signal
4104 * src/insets/insetcite.C (~InsetCitation): emits new signal
4105 (getScreenLabel): "intelligent" label should now fit on the screen!
4107 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
4109 * src/frontends/xforms/FormCitation.C (showInset): connects
4110 hide() to the inset's hide signal
4111 (show): modified to use fl_set_object_position rather than
4112 fl_set_object_geometry wherever possible
4114 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4116 * src/insets/lyxinset.h: add caption code
4118 * src/insets/insetfloat.C (type): new method
4120 * src/insets/insetcaption.C (Write): new method
4122 (LyxCode): new method
4124 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
4125 to get it right together with using the FloatList.
4127 * src/commandtags.h: add LFUN_INSET_CAPTION
4128 * src/lyxfunc.C (Dispatch): handle it
4130 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
4133 * src/Variables.[Ch]: make expand take a const reference, remove
4134 the destructor, some whitespace changes.
4136 * src/LyXAction.C (init): add caption-inset-insert
4138 * src/FloatList.C (FloatList): update the default floats a bit.
4140 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4142 * src/Variables.[Ch]: new files. Intended to be used for language
4143 specific strings (like \chaptername) and filename substitution in
4146 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
4148 * lib/kbd/american.kmap: update
4150 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
4152 * src/bufferparams.[Ch]: remove member allowAccents.
4154 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
4156 * src/LaTeXLog.C: use the log_form.h header.
4157 * src/lyx_gui.C: ditto.
4158 * src/lyx_gui_misc.C: ditto.
4159 * src/lyxvc.h: ditto.
4161 * forms/log_form.fd: new file, created from latexoptions.fd. I
4162 kept the log popup and nuked the options form.
4164 * src/{la,}texoptions.[Ch]: removed.
4165 * src/lyx_cb.C (LaTeXOptions): ditto
4167 * src/lyx_gui.C (create_forms): do not handle the
4168 fd_latex_options form.
4170 2000-07-18 Juergen Vigna <jug@sad.it>
4172 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
4173 name of the inset so that it can be requested outside (text2.C).
4175 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
4178 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4180 * src/mathed/formula.h (ConvertFont): constify
4182 * src/mathed/formula.C (Read): add warning if \end_inset is not
4183 found on expected place.
4185 * src/insets/lyxinset.h (ConvertFont): consify
4187 * src/insets/insetquotes.C (ConvertFont): constify
4188 * src/insets/insetquotes.h: ditto
4190 * src/insets/insetinfo.h: add labelfont
4192 * src/insets/insetinfo.C (InsetInfo): set the labelfont
4193 (ascent): use labelfont
4197 (Write): make .lyx file a bit nicer
4199 * src/insets/insetfloat.C (Write): simplify somewhat...
4200 (Read): add warning if arg is not found
4202 * src/insets/insetcollapsable.C: add using std::max
4203 (Read): move string token and add warning in arg is not found
4204 (draw): use std::max to get the right ty
4205 (getMaxWidth): simplify by using std::max
4207 * src/insets/insetsection.h: new file
4208 * src/insets/insetsection.C: new file
4209 * src/insets/insetcaption.h: new file
4210 * src/insets/insetcaption.C: new file
4212 * src/insets/inset.C (ConvertFont): constify signature
4214 * src/insets/Makefile.am (libinsets_la_SOURCES): add
4215 insetcaption.[Ch] and insetsection.[Ch]
4217 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
4218 uses to use LABEL_COUNTER_CHAPTER instead.
4219 * src/text2.C (SetCounter): here
4221 * src/counters.h: new file
4222 * src/counters.C: new file
4223 * src/Sectioning.h: new file
4224 * src/Sectioning.C: new file
4226 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
4228 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4230 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
4233 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
4236 2000-07-17 Juergen Vigna <jug@sad.it>
4238 * src/tabular.C (Validate): check if array-package is needed.
4239 (SetVAlignment): added support for vertical alignment.
4240 (SetLTFoot): better support for longtable header/footers
4241 (Latex): modified to support added features.
4243 * src/LaTeXFeatures.[Ch]: added array-package.
4245 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
4247 * src/lyx_gui.C (LyXGUI): make sure that the height is large
4250 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
4252 * configure.in: do not forget to put a space after -isystem.
4254 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
4256 * lib/kbd/arabic.kmap: a few fixes.
4258 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4260 * some whitespace chagnes to a number of files.
4262 * src/support/DebugStream.h: change to make it easier for
4263 doc++ to parse correctly.
4264 * src/support/lyxstring.h: ditto
4266 * src/mathed/math_utils.C (compara): change to have only one
4268 (MathedLookupBOP): change because of the above.
4270 * src/mathed/math_delim.C (math_deco_compare): change to have only
4272 (search_deco): change becasue of the above.
4274 * src/insets/insettabular.C (DrawCellSelection): use std::swap
4275 instead of manually coded one.
4277 * src/insets/insetquotes.C (Read): read the \end_inset too
4279 * src/insets/insetlatex.h: remove file
4280 * src/insets/insetlatex.C: remove file
4282 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
4284 (InsetPrintIndex): remove destructor
4286 * src/insets/insetinclude.h: remove default constructor
4288 * src/insets/insetfloat.C: work to make it work better
4290 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
4292 * src/insets/insetcite.h (InsetCitation): remove default constructor
4294 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
4296 * src/text.C (GetColumnNearX): comment out some currently unused code.
4298 * src/paragraph.C (writeFile): move some initializations closer to
4300 (CutIntoMinibuffer): small change to use new matchIT operator
4304 (InsertInset): ditto
4307 (InsetIterator): ditto
4308 (Erase): small change to use new matchFT operator
4310 (GetFontSettings): ditto
4311 (HighestFontInRange): ditto
4314 * src/lyxparagraph.h: some chars changed to value_type
4315 (matchIT): because of some stronger checking (perhaps too strong)
4316 in SGI STL, the two operator() unified to one.
4319 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
4321 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
4322 the last inset read added
4323 (parseSingleLyXformat2Token): some more (future) compability code added
4324 (parseSingleLyXformat2Token): warning about solitary \end_inset added
4325 (parseSingleLyXformat2Token): set last_inset_read
4326 (parseSingleLyXformat2Token): more code to read new "Float" correctly
4327 (parseSingleLyXformat2Token): don't double intializw string next_token
4329 * src/TextCache.C (text_fits::operator()): add const's to the signature
4330 (has_buffer::operator()): ditto
4332 * src/Floating.h: add some comments on the class
4334 * src/FloatList.[Ch] (typeExist): new method
4337 * src/BackStack.h: added default constructor, wanted by Gcc.
4339 2000-07-14 Juergen Vigna <jug@sad.it>
4341 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
4343 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
4345 * src/insets/insettabular.C (resizeLyXText): need this to be able to
4346 do a redraw when the window is resized!
4347 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
4349 * src/insets/insettext.C (resizeLyXText): added function to correctly
4350 being able to resize the LyXWindow.
4352 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
4354 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
4356 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
4357 crashes when closing dialog to a deleted inset.
4359 * src/insets/insetcite.[Ch] (Edit) : the return of this former
4360 method! Now similar to other insets.
4362 2000-07-13 Juergen Vigna <jug@sad.it>
4364 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
4366 * lib/examples/Literate.lyx: small patch!
4368 * src/insets/insetbib.C (Read): added this function because of wrong
4369 Write (without [begin|end]_inset).
4371 2000-07-11 Juergen Vigna <jug@sad.it>
4373 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
4374 as the insertInset could not be good!
4376 * src/screen.C (ToggleSelection): fixed toggle selection bug as
4377 the bool param should not be last.
4379 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4381 * sigc++/configure.in: fix bug in threading-related code (Yes, I
4382 did submit that to Karl).
4384 * configure.in: use -isystem instead of -I for X headers. This
4385 fixes a problem on solaris with a recent gcc;
4386 put the front-end code after the X detection code;
4387 configure in sigc++ before lib/
4389 * src/lyx_main.C (commandLineHelp): remove -display from command
4392 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
4394 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
4395 Also put in Makefile rules for building the ``listerrors''
4396 program for parsing errors from literate programs written in LyX.
4398 * lib/build-listerrors: Added small shell script as part of compile
4399 process. This builds a working ``listerrors'' binary if noweb is
4400 installed and either 1) the VNC X server is installed on the machine,
4401 or 2) the user is compiling from within a GUI. The existence of a GUI
4402 is necessary to use the ``lyx --export'' feature for now. This
4403 hack can be removed once ``lyx --export'' no longer requires a GUI to
4406 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
4408 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
4409 now passed back correctly from gcc and placed "under" error
4410 buttons in a Literate LyX source.
4412 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4414 * src/text.C (GetColumnNearX): Better behavior when a RTL
4415 paragraph is ended by LTR text.
4417 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
4420 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4422 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
4423 true when clipboard is empty.
4425 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4427 * text.C (Backspace): Prevent rebreaking of a row if it is the last
4428 row of the paragraph.
4429 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
4430 to prevent calculation of bidi tables
4432 2000-07-07 Juergen Vigna <jug@sad.it>
4434 * src/screen.C (ToggleSelection): added y_offset and x_offset
4437 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
4440 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
4442 * src/insets/insettext.C: fixed Layout-Display!
4444 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4446 * configure.in: add check for strings.h header.
4448 * src/spellchecker.C: include <strings.h> in order to have a
4449 definition for bzero().
4451 2000-07-07 Juergen Vigna <jug@sad.it>
4453 * src/insets/insettext.C (draw): set the status of the bv->text to
4454 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
4456 * src/screen.C (DrawOneRow):
4457 (DrawFromTo): redraw the actual row if something has changed in it
4460 * src/text.C (draw): call an update of the toplevel-inset if something
4461 has changed inside while drawing.
4463 * src/lyxtext.h: added CHANGED_IN_DRAW status.
4465 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
4467 * src/insets/insetbib.[Ch] (callback) new method, moving callback
4468 processing inside class.
4470 * src/insets/insetindex.[Ch] (callback) new method, moving callback
4471 processing inside class.
4473 * src/insets/insetindex.h new struct Holder, consistent with other
4476 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
4477 citation dialog from main code and placed it in src/frontends/xforms.
4478 Dialog launched through signals instead of callbacks
4480 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
4482 * lyx.man: update the options description.
4484 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
4486 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
4487 handle neg values, set min width to 590, add doc about -display
4489 2000-07-05 Juergen Vigna <jug@sad.it>
4491 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
4492 calls to BufferView *.
4494 * src/insets/insettext.C (checkAndActivateInset): small fix non
4495 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
4497 * src/insets/insetcommand.C (Read): Fixed as insets should read till
4498 their \end_inset token!
4500 2000-07-04 edscott <edscott@imp.mx>
4502 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
4503 lib/lyxrc.example: added option \wheel_jump
4505 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
4507 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
4508 remove support for -width,-height,-xpos and -ypos.
4510 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
4512 * src/encoding.[Ch]: New files.
4514 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
4515 (text): Call to the underline() method only when needed.
4517 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
4519 * src/buffer.C (makeLaTeXFile): Compute automatically the input
4520 encoding(s) for the document.
4522 * src/bufferparams.C (BufferParams): Changed default value of
4525 * src/language.C (newLang): Removed.
4526 (items[]): Added encoding information for all defined languages.
4528 * src/lyx_gui.C (create_forms): Added "auto" option to the input
4529 encoding choice button.
4531 * src/lyxrc.h (font_norm_type): New member variable.
4532 (set_font_norm_type): New method.
4534 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
4535 paragraphs with different encodings.
4537 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
4538 (TransformChar): Changed to work correctly with Arabic points.
4539 (draw): Added support for drawing Arabic points.
4540 (draw): Removed code for drawing underbars (this is done by
4543 * src/support/textutils.h (IsPrintableNonspace): New function.
4545 * src/BufferView_pimpl.h: Added "using SigC::Object".
4546 * src/LyXView.h: ditto.
4548 * src/insets/insetinclude.h (include_label): Changed to mutable.
4550 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4552 * src/mathed/math_iter.h: remove empty destructor
4554 * src/mathed/math_cursor.h: remove empty destructor
4556 * src/insets/lyxinset.h: add THEOREM_CODE
4558 * src/insets/insettheorem.[Ch]: new files
4560 * src/insets/insetminipage.C: (InsertInset): remove
4562 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
4564 (InsertInset): remove
4566 * src/insets/insetlist.C: (InsertList): remove
4568 * src/insets/insetfootlike.[Ch]: new files
4570 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
4573 (InsertInset): ditto
4575 * src/insets/insetert.C: remove include Painter.h, reindent
4576 (InsertInset): move to header
4578 * src/insets/insetcollapsable.h: remove explicit from default
4579 contructor, remove empty destructor, add InsertInset
4581 * src/insets/insetcollapsable.C (InsertInset): new func
4583 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
4585 * src/vspace.h: add explicit to constructor
4587 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
4588 \textcompwordmark, please test this.
4590 * src/lyxrc.C: set ascii_linelen to 65 by default
4592 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
4594 * src/commandtags.h: add LFUN_INSET_THEOREM
4596 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
4597 (makeLinuxDocFile): remove _some_ of the nice logic
4598 (makeDocBookFile): ditto
4600 * src/Painter.[Ch]: (~Painter): removed
4602 * src/LyXAction.C (init): entry for insettheorem added
4604 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
4606 (deplog): code to detect files generated by LaTeX, needs testing
4609 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4611 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
4613 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4615 * src/LaTeX.C (deplog): Add a check for files that are going to be
4616 created by the first latex run, part of the project to remove the
4619 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
4620 contents to the extension list.
4622 2000-07-04 Juergen Vigna <jug@sad.it>
4624 * src/text.C (NextBreakPoint): added support for needFullRow()
4626 * src/insets/lyxinset.h: added needFullRow()
4628 * src/insets/insetcollapsable.C: redone now this uses a text-inset
4631 * src/insets/insettext.C: lots of changes for update!
4633 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
4635 * src/LaTeXFeatures.h: add a missing std:: qualifier.
4637 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
4639 * src/insets/insetinclude.C (InsetInclude): fixed
4640 initialization of include_label.
4641 (unique_id): now returns a string.
4643 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
4645 * src/LaTeXFeatures.h: new member IncludedFiles, for
4646 a map of key, included file name.
4648 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
4649 with the included files for inclusion in SGML preamble,
4650 i. e., linuxdoc and docbook.
4653 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
4654 nice (is the generated linuxdoc code to be exported?), that
4655 allows to remove column, and only_body that will be true for
4656 slave documents. Insets are allowed inside SGML font type.
4657 New handling of the SGML preamble for included files.
4658 (makeDocBookFile): the same for docbook.
4660 * src/insets/insetinclude.h:
4661 * src/insets/insetinclude.C (Validate): keeps a list of included files.
4663 (DocBook): new export methods.
4665 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
4666 and makeDocBookFile.
4668 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
4669 formats to export with command line argument -x.
4671 2000-06-29 Juergen Vigna <jug@sad.it>
4673 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
4674 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
4676 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
4677 region could already been cleared by an inset!
4679 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4681 * src/BufferView_pimpl.h: remove member variables lyx_focus and
4684 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
4686 (cursorToggle): remove special handling of lyx focus.
4688 2000-06-28 Juergen Vigna <jug@sad.it>
4690 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
4693 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4695 * src/insets/insetindex.C (Edit): add a callback when popup is
4698 * src/insets/insettext.C (LocalDispatch):
4699 * src/insets/insetmarginal.h:
4700 * src/insets/insetlist.h:
4701 * src/insets/insetfoot.h:
4702 * src/insets/insetfloat.h:
4703 * src/insets/insetert.h: add a missing std:: qualifier.
4705 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4707 * src/support/lyxsum.C (sum): '\0' teminate file read when using
4710 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
4712 * src/insets/insettext.C (Read): remove tmptok unused variable
4713 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
4714 (InsertInset): change for new InsetInset code
4716 * src/insets/insettext.h: add TEXT inline method
4718 * src/insets/insettext.C: remove TEXT macro
4720 * src/insets/insetmarginal.C (Write): new method
4721 (Latex): change output slightly
4723 * src/insets/insetfoot.C (Write): new method
4724 (Latex): change output slightly (don't use endl when no need)
4726 * src/insets/insetert.C (Write): new method
4728 * src/insets/insetcollapsable.h: make button_length, button_top_y
4729 and button_bottm_y protected.
4731 * src/insets/insetcollapsable.C (Write): simplify code by using
4732 tostr. Also do not output the float name, the children class
4733 should to that to get control over own arguments
4735 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
4736 src/insets/insetminipage.[Ch]:
4739 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
4741 * src/lyxfunc.C (Dispatch): cases for new insets/commands
4743 * src/Makefile.am (lyx_SOURCES): add the new files
4745 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
4746 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
4747 * src/commandtags.h: ditto
4749 * src/LaTeXFeatures.h: add a std::set of used floattypes
4751 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
4753 * src/FloatList.[Ch] src/Floating.h: new files
4755 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
4757 * src/lyx_cb.C (TableApplyCB): ditto
4759 * src/text2.C: ditto
4760 * src/buffer.C (SimpleLinuxDocOnePar): ditto
4761 (parseSingleLyXformat2Token): ditto + add code for
4762 backwards compability for old float styles + add code for new insets
4764 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
4766 (InsertInset(size_type, Inset *, LyXFont)): new method
4767 (InsetChar(size_type, char)): changed to use the other InsetChar
4768 with a LyXFont(ALL_INHERIT).
4769 (InsetInset(size_type, Inset*)): changed to use InsetChar to
4770 insert the META_INSET.
4772 * sigc++/thread.cc (Privete<int>::operator int&): move definition
4774 * sigc++/thread.h (Threads): from here
4776 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
4777 definition out of line
4778 * sigc++/scope.h: from here
4780 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4782 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
4783 is specified (adapted from a patch from edscott <edscott@imp.mx>).
4785 * Makefile.am (bindist): new target.
4787 * INSTALL: add instructions for doing a binary distribution.
4789 * development/tools/README.bin.example: update a bit.
4791 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
4794 * lib/lyxrc.example: new lyxrc tag \set_color.
4796 * src/lyxfunc.C (Dispatch):
4797 * src/commandtags.h:
4798 * src/LyXAction.C: new lyxfunc "set-color".
4800 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
4801 and an x11name given as strings.
4803 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
4804 cache when a color is changed.
4806 2000-06-26 Juergen Vigna <jug@sad.it>
4808 * src/lyxrow.C (width): added this functions and variable.
4810 * src/insets/insetcite.C (create_form_citation_form): some Gravity
4813 * src/text.C (SetHeightOfRow): fixed calcualting of width.
4815 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4817 * images/undo_bw.xpm: new icon.
4818 * images/redo_bw.xpm: ditto.
4820 * configure.in (INSTALL_SCRIPT): change value to
4821 ${INSTALL} to avoid failures of install-script target.
4822 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
4824 * src/BufferView.h: add a magic "friend" declaration to please
4827 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
4829 * forms/cite.fd: modified to allow resizing without messing
4832 * src/insetcite.C: Uses code from cite.fd almost without
4834 User can now resize dialog in the x-direction.
4835 Resizing the dialog in the y-direction is prevented, as the
4836 code does this intelligently already.
4838 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4840 * INSTALL: remove obsolete entry in "problems" section.
4842 * lib/examples/sl_*.lyx: update of the slovenian examples.
4844 * src/support/FileInfo.[Ch] (getBlockSize): remove.
4846 2000-06-23 Juergen Vigna <jug@sad.it>
4848 * src/lyxtext.h: added a 'cleared' flag to draw() function.
4850 * src/buffer.C (resize): delete the LyXText of textinsets.
4852 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
4854 * src/insets/lyxinset.h: added another parameter 'cleared' to
4855 the draw() function.
4857 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
4858 unlocking inset in inset.
4860 2000-06-22 Juergen Vigna <jug@sad.it>
4862 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
4863 of insets and moved first to LyXText.
4865 * src/mathed/formulamacro.[Ch]:
4866 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
4868 2000-06-21 Juergen Vigna <jug@sad.it>
4870 * src/text.C (GetVisibleRow): look if I should clear the area or not
4871 using Inset::doClearArea() function.
4873 * src/insets/lyxinset.h: added doClearArea() function and
4874 modified draw(Painter &, ...) to draw(BufferView *, ...)
4876 * src/text2.C (UpdateInset): return bool insted of int
4878 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
4880 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
4881 combox in the character popup
4883 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
4884 BufferParams const & params
4886 2000-06-20 Juergen Vigna <jug@sad.it>
4888 * src/insets/insettext.C (SetParagraphData): set insetowner on
4891 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4893 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
4894 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
4896 (form_main_): remove
4898 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
4899 (create_form_form_main): remove FD_form_main stuff, connect to
4900 autosave_timeout signal
4902 * src/LyXView.[Ch] (getMainForm): remove
4903 (UpdateTimerCB): remove
4904 * src/BufferView_pimpl.h: inherit from SigC::Object
4906 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
4907 signal instead of callback
4909 * src/BufferView.[Ch] (cursorToggleCB): remove
4911 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4913 * src/BufferView_pimpl.C: changes because of the one below
4915 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
4916 instead of storing a pointer to a LyXText.
4918 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
4920 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
4922 * src/lyxparagraph.h
4924 * src/paragraph.C: Changed fontlist to a sorted vector.
4926 2000-06-19 Juergen Vigna <jug@sad.it>
4928 * src/BufferView.h: added screen() function.
4930 * src/insets/insettext.C (LocalDispatch): some selection code
4933 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
4935 * src/insets/insettext.C (SetParagraphData):
4937 (InsetText): fixes for multiple paragraphs.
4939 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
4941 * development/lyx.spec.in: Call configure with ``--without-warnings''
4942 to work around a bug with the Makefiles when doing ``make lyxrpm''.
4943 This should be fine, however, since we generally don't want to be
4944 verbose when making an RPM.
4946 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
4948 * lib/scripts/fig2pstex.py: New file
4950 2000-06-16 Juergen Vigna <jug@sad.it>
4952 * src/insets/insettabular.C (UpdateLocal):
4953 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
4954 (LocalDispatch): Changed all functions to use LyXText.
4956 2000-06-15 Juergen Vigna <jug@sad.it>
4958 * src/text.C (SetHeightOfRow): call inset::update before requesting
4961 * src/insets/insettext.C (update):
4962 * src/insets/insettabular.C (update): added implementation
4964 * src/insets/lyxinset.h: added update function
4966 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4968 * src/text.C (SelectNextWord): protect against null pointers with
4969 old-style string streams. (fix from Paul Theo Gonciari
4972 * src/cite.[Ch]: remove erroneous files.
4974 * lib/configure.m4: update the list of created directories.
4976 * src/lyxrow.C: include <config.h>
4977 * src/lyxcursor.C: ditto.
4979 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4981 * lib/examples/decimal.lyx: new example file from Mike.
4983 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
4984 to find template definitions (from Dekel)
4986 * src/frontends/.cvsignore: add a few things.
4988 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
4990 * src/Timeout.C (TimeOut): remove default argument.
4992 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
4995 * src/insets/ExternalTemplate.C: add a "using" directive.
4997 * src/lyx_main.h: remove the act_ struct, which seems unused
5000 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5002 * LyX Developers Meeting: All files changed, due to random C++ (by
5003 coincidence) code generator script.
5005 - external inset (cool!)
5006 - initial online editing of preferences
5007 - insettabular breaks insettext(s contents)
5009 - some DocBook fixes
5010 - example files update
5011 - other cool stuff, create a diff and look for yourself.
5013 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
5015 * src/insets/insettext.C (computeTextRows): if the maxWidth is
5016 -1 this is a non-line-breaking textinset.
5018 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
5019 if there is no width set.
5021 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5023 * Lots of files: Merged the dialogbase branch.
5025 2000-06-09 Allan Rae <rae@lyx.org>
5027 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
5028 and the Dispatch methods that used it.
5030 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
5031 access to functions formerly kept in Dispatch.
5033 2000-05-19 Allan Rae <rae@lyx.org>
5035 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
5036 made to_page and count_copies integers again. from_page remains a
5037 string however because I want to allow entry of a print range like
5038 "1,4,22-25" using this field.
5040 * src/LyXAction.C: added action info and commands for buffer-print-xtl
5041 and printer-params-get. These aren't useful from the minibuffer but
5042 could be used by a script/LyXServer app provided it passes a suitable
5043 auto_mem_buffer. I guess I should take a look at how the LyXServer
5044 works and make it support xtl buffers.
5046 * sigc++/: updated to libsigc++-1.0.1
5048 * src/xtl/: updated to xtl-1.3.pl.11
5050 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
5051 those changes done to the files in src/ are actually recreated when
5052 they get regenerated. Please don't ever accept a patch that changes a
5053 dialog unless that patch includes the changes to the corresponding *.fd
5056 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
5057 stringOnlyContains, renamed it and generalised it.
5059 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
5060 branch. Removed the remaining old form_print code.
5062 2000-04-26 Allan Rae <rae@lyx.org>
5064 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
5065 trap I was trying to fix with the ID: fields in src/xtl/ :-)
5067 2000-04-25 Allan Rae <rae@lyx.org>
5069 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
5070 against a base of xtl-1.3.pl.4
5072 * development/tools/lxtl.sh: fixed a couple of silly typos and now
5073 filter the Id: entries so they still show the xtl version number
5076 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
5077 into the src/xtl code. Patch still pending with José (XTL)
5079 2000-04-24 Allan Rae <rae@lyx.org>
5081 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
5082 both more generic and much safer. Use the new template functions.
5083 * src/buffer.[Ch] (Dispatch): ditto.
5085 * src/frontends/xforms/FormPrint.C (update): Use new template functions
5086 and mem buffer more intelligently. Also a little general cleanup.
5089 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
5090 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
5091 * src/xtl/Makefile.am: ditto.
5092 * src/xtl/.cvsignore: ditto.
5093 * src/Makefile.am: ditto.
5095 * src/PrinterParams.h: Removed the macros member functions. Added a
5096 testInvariant member function. A bit of tidying up and commenting.
5097 Included Angus's idea for fixing operation with egcs-1.1.2.
5099 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
5100 cool expansion of XTL's mem_buffer to support automatic memory
5101 management within the buffer itself. Removed the various macros and
5102 replaced them with template functions that use either auto_mem_buffer
5103 or mem_buffer depending on a #define. The mem_buffer support will
5104 disappear as soon as the auto_mem_buffer is confirmed to be good on
5105 other platforms/compilers. That is, it's there so you've got something
5108 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
5109 effectively forked XTL. However I expect José will include my code
5110 into the next major release. Also fixed a memory leak.
5111 * src/xtl/text.h: ditto.
5112 * src/xtl/xdr.h: ditto.
5113 * src/xtl/giop.h: ditto.
5115 2000-04-16 Allan Rae <rae@lyx.org>
5117 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
5118 by autogen.sh and removed by maintainer-clean anyway.
5119 * .cvsignore, sigc++/.cvsignore: Support the above.
5121 * sigc++/.cvsignore: Forgot that retbind.h was generated.
5123 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
5125 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
5126 macros, renamed static callback-target member functions to suit new
5127 scheme and made them public.
5128 * src/frontends/xforms/forms/form_print.fd: ditto.
5129 * src/frontends/xforms/forms/form_copyright.fd: ditto.
5131 * src/support/lxtl.h: small cleanup to use typedef instead of #define
5134 * src/xtl/: New directory containing a minimal distribution of XTL.
5135 This is XTL-1.3.pl.4.
5137 * development/tools/lxtl.sh: A script to generate the above mini-dist.
5139 2000-04-15 Allan Rae <rae@lyx.org>
5141 * development/tools/makeLyXsigc.sh: Remove the library version numbers
5143 * sigc++/: Updated to libsigc++-1.0.0
5145 2000-04-14 Allan Rae <rae@lyx.org>
5147 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
5148 use the generic ones in future. I'll modify my conversion script.
5150 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
5152 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
5153 (CloseAllBufferRelatedDialogs): Renamed.
5154 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
5156 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
5157 of the generic ones. These are the same ones my conversion script
5160 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
5161 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
5162 * src/buffer.C (Dispatch): ditto
5164 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
5165 functions for updating and hiding buffer dependent dialogs.
5166 * src/BufferView.C (buffer): ditto
5167 * src/buffer.C (setReadonly): ditto
5168 * src/lyxfunc.C (CloseBuffer): ditto
5170 * src/buffer.h: Take setReadonly() out of line so I don't have to include
5171 Dialogs.h, and hence all the SigC stuff, into every file that includes
5172 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
5174 * src/BufferView2.C: reduce the number of headers included by buffer.h
5176 2000-04-11 Allan Rae <rae@lyx.org>
5178 * src/frontends/xforms/xform_macros.h: A small collection of macros
5179 for building C callbacks.
5181 * src/frontends/xforms/Makefile.am: Added above file.
5183 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
5184 scheme again. This time it should work for JMarc. If this is
5185 successful I'll revise my conversion script to automate some of this.
5186 The static member functions in the class also have to be public for
5187 this scheme will work. If the scheme works (it's almost identical to
5188 the way BufferView::cursorToggleCB is handled so it should work) then
5189 FormCopyright and FormPrint will be ready for inclusion into the main
5190 trunk immediately after 1.1.5 is released -- provided we're prepared
5191 for complaints about lame compilers not handling XTL.
5193 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
5195 2000-04-07 Allan Rae <rae@lyx.org>
5197 * config/lyxinclude.m4: A bit more tidying up (Angus)
5199 * src/LString.h: JMarc's <string> header fix
5201 * src/PrinterParams.h: Used string for most data to remove some
5202 ugly code in the Print dialog and avoid even uglier code when
5203 appending the ints to a string for output.
5205 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
5206 and moved "default:" back to the end of switch statement. Cleaned
5207 up the printing so it uses the right function calls and so the
5208 "print to file" option actually puts the file in the right directory.
5210 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
5212 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
5213 and Ok+Apply button control into a separate method: input (Angus).
5214 (input) Cleaned it up and improved it to be very thorough now.
5215 (All CB) static_cast used instead of C style cast (Angus). This will
5216 probably change again once we've worked out how to keep gcc-2.8.1 happy
5217 with real C callbacks.
5218 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
5219 ignore some of the bool settings and has random numbers instead. Needs
5220 some more investigation. Added other input length checks and checking
5221 of file and printer names.
5223 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
5224 would link (Angus). Seems the old code doesn't compile with the pragma
5225 statement either. Separated callback entries from internal methods.
5227 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
5229 2000-03-17 Allan Rae <rae@lyx.org>
5231 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
5232 need it? Maybe it could go in Dialogs instead? I could make it a
5233 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
5234 values to get the bool return value.
5235 (Dispatch): New overloaded method for xtl support.
5237 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
5238 extern "C" callback instead of static member functions. Hopefully,
5239 JMarc will be able to compile this. I haven't changed
5240 forms/form_copyright.fd yet. Breaking one of my own rules already.
5242 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
5243 because they aren't useful from the minibuffer. Maybe a LyXServer
5244 might want a help message though?
5246 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
5248 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
5249 xtl which needs both rtti and exceptions.
5251 * src/support/Makefile.am:
5252 * src/support/lxtl.h: New file. Some helper macros for using XTL.
5254 * src/frontends/xforms/input_validators.[ch]: input filters and
5255 validators. These conrol what keys are valid in input boxes.
5256 Use them and write some more. Much better idea than waiting till
5257 after the user has pressed Ok to say that the input fields don't make
5260 * src/frontends/xforms/Makefile.am:
5261 * src/frontends/xforms/forms/form_print.fd:
5262 * src/frontends/xforms/forms/makefile:
5263 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
5264 new scheme. Still have to make sure I haven't missed anything from
5265 the current implementation.
5267 * src/Makefile.am, src/PrinterParams.h: New data store.
5269 * other files: Added a couple of copyright notices.
5271 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5273 * src/insets/insetbib.h: move Holder struct in public space.
5275 * src/frontends/include/DialogBase.h: use SigC:: only when
5276 SIGC_CXX_NAMESPACES is defined.
5277 * src/frontends/include/Dialogs.h: ditto.
5279 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
5281 * src/frontends/xforms/FormCopyright.[Ch]: do not
5282 mention SigC:: explicitely.
5284 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5286 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
5287 deals with testing KDE in main configure.in
5288 * configure.in: ditto.
5290 2000-02-22 Allan Rae <rae@lyx.org>
5292 * Lots of files: Merged from HEAD
5294 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
5295 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
5297 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
5299 * sigc++/: new minidist.
5301 2000-02-14 Allan Rae <rae@lyx.org>
5303 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
5305 2000-02-08 Juergen Vigna <jug@sad.it>
5307 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
5308 file for the buildin GUI builder of KDevelop of the copyright-dialog.
5310 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
5311 for this port and so it is much easier for other people to port
5312 dialogs in a common development environment.
5314 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
5315 the QT/KDE implementation.
5317 * src/frontends/kde/Dialogs.C:
5318 * src/frontends/kde/FormCopyright.C:
5319 * src/frontends/kde/FormCopyright.h:
5320 * src/frontends/kde/Makefile.am:
5321 * src/frontends/kde/formcopyrightdialog.C:
5322 * src/frontends/kde/formcopyrightdialog.h:
5323 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
5324 for the kde support of the Copyright-Dialog.
5326 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
5327 subdir-substitution instead of hardcoded 'xforms' as we now have also
5330 * src/frontends/include/DialogBase.h (Object): just commented the
5331 label after #endif (nasty warning and I don't like warnings ;)
5333 * src/main.C (main): added KApplication initialization if using
5336 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
5337 For now only the KDE event-loop is added if frontend==kde.
5339 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
5341 * configure.in: added support for the --with-frontend[=value] option
5343 * autogen.sh: added kde.m4 file to list of config-files
5345 * acconfig.h: added define for KDEGUI-support
5347 * config/kde.m4: added configuration functions for KDE-port
5349 * config/lyxinclude.m4: added --with-frontend[=value] option with
5350 support for xforms and KDE.
5352 2000-02-08 Allan Rae <rae@lyx.org>
5354 * all Makefile.am: Fixed up so the make targets dist, distclean,
5355 install and uninstall all work even if builddir != srcdir. Still
5356 have a new sigc++ minidist update to come.
5358 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
5360 2000-02-01 Allan Rae <rae@lyx.org>
5362 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
5363 Many mods to get builddir != srcdir working.
5365 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
5366 for building on NT and so we can do the builddir != srcdir stuff.
5368 2000-01-30 Allan Rae <rae@lyx.org>
5370 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
5371 This will stay in "rae" branch. We probably don't really need it in
5372 the main trunk as anyone who wants to help programming it should get
5373 a full library installed also. So they can check both included and
5374 system supplied library compilation.
5376 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
5377 Added a 'mini' distribution of libsigc++. If you feel the urge to
5378 change something in these directories - Resist it. If you can't
5379 resist the urge then you should modify the following script and rebuild
5380 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
5381 all happen. Still uses a hacked version of libsigc++'s configure.in.
5382 I'm quite happy with the results. I'm not sure the extra work to turn
5383 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
5384 worth the trouble and would probably lead to extra maintenance
5386 I haven't tested the following important make targets: install, dist.
5387 Not ready for prime time but very close. Maybe 1.1.5.
5389 * development/tools/makeLyXsigc.sh: A shell script to automatically
5390 generate our mini-dist of libsigc++. It can only be used with a CVS
5391 checkout of libsigc++ not a tarball distribution. It's well commented.
5392 This will end up as part of the libsigc++ distribution so other apps
5393 can easily have an included mini-dist. If someone makes mods to the
5394 sigc++ subpackage without modifying this script to generate those
5395 changes I'll be very upset!
5397 * src/frontends/: Started the gui/system indep structure.
5399 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
5400 to access the gui-indep dialogs are in this class. Much improved
5401 design compared to previous revision. Lars, please refrain from
5402 moving this header into src/ like you did with Popups.h last time.
5404 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
5406 * src/frontends/xforms/: Started the gui-indep system with a single
5407 dialog: FormCopyright. Initial testing of use of libsigc++ was very
5410 * src/frontends/xforms/forms: Repository for the xforms .fd files.
5411 Here you'll find a very useful makefile and automated fdfix.sh that
5412 makes updating dailogs a no-brainer -- provided you follow the rules
5413 set out in the README. I'm thinking about adding another script to
5414 automatically generate skeleton code for a new dialog given just the
5417 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
5418 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
5419 Made FormCopyright gui-indep and added a lyxfunc to get to it.
5421 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5423 * src/support/LSubstring.C (operator): simplify
5425 * src/lyxtext.h: removed bparams, use buffer_->params instead
5427 * src/lyxrow.h: make Row a real class, move all variables to
5428 private and use accessors.
5430 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
5432 (isRightToLeftPar): ditto
5433 (ChangeLanguage): ditto
5434 (isMultiLingual): ditto
5437 (SimpleTeXOnePar): ditto
5438 (TeXEnvironment): ditto
5439 (GetEndLabel): ditto
5441 (SetOnlyLayout): ditto
5442 (BreakParagraph): ditto
5443 (BreakParagraphConservative): ditto
5444 (GetFontSettings): ditto
5446 (CopyIntoMinibuffer): ditto
5447 (CutIntoMinibuffer): ditto
5448 (PasteParagraph): ditto
5449 (SetPExtraType): ditto
5450 (UnsetPExtraType): ditto
5451 (DocBookContTableRows): ditto
5452 (SimpleDocBookOneTablePar): ditto
5454 (TeXFootnote): ditto
5455 (SimpleTeXOneTablePar): ditto
5456 (TeXContTableRows): ditto
5457 (SimpleTeXSpecialChars): ditto
5460 * src/lyxcursor.h: make LyXCursor a real class, move all variables
5461 to private and use accessors.
5463 * src/lyx_cb.C: remove char updatetimer, and all code that uses
5464 this, we did not use it anymore and has not been for ages. Just a
5465 waste of cpu cycles.
5467 * src/language.h: make Language a real class, move all variables
5468 to private and use accessors.
5470 * src/BufferView_pimpl.C (Pimpl): use new timer code.
5471 (create_view): remove
5472 (update): some changes for new timer
5473 (cursorToggle): use new timer
5474 (beforeChange): change for new timer
5476 * src/BufferView.h (cursorToggleCB): removed last paramter because
5479 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
5480 (cursorToggleCB): change because of new timer code
5482 * lib/CREDITS: updated own mailaddress
5484 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5486 * src/support/filetools.C (PutEnv): fix the code in case neither
5487 putenv() nor setenv() have been found.
5489 * INSTALL: mention the install-strip Makefile target.
5491 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
5492 read-only documents.
5494 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5496 * lib/reLyX/configure.in (VERSION): avoid using a previously
5497 generated reLyX wrapper to find out $prefix.
5499 * lib/examples/eu_adibide_lyx-atua.lyx:
5500 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
5501 translation of the Tutorial (Dooteo)
5503 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
5505 * forms/cite.fd: new citation dialog
5507 * src/insetcite.[Ch]: the new citation dialog is moved into
5510 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
5513 * src/insets/insetcommand.h: data members made private.
5515 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5517 * LyX 1.1.5 released
5519 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5521 * src/version.h (LYX_RELEASE): to 1.1.5
5523 * src/spellchecker.C (RunSpellChecker): return false if the
5524 spellchecker dies upon creation.
5526 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5528 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
5529 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
5533 * lib/CREDITS: update entry for Martin Vermeer.
5535 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
5537 * src/text.C (draw): Draw foreign language bars at the bottom of
5538 the row instead of at the baseline.
5540 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
5542 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5544 * lib/bind/de_menus.bind: updated
5546 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5548 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
5550 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5552 * src/menus.C (Limit_string_length): New function
5553 (ShowTocMenu): Limit the number of items/length of items in the
5556 * src/paragraph.C (String): Correct result for a paragraph inside
5559 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5561 * src/bufferlist.C (close): test of buf->getuser() == NULL
5563 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
5565 * src/BufferView2.C (removeAutoInsets): Fix a bug:
5566 Do not call to SetCursor when the paragraph is a closed footnote!
5568 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
5570 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
5573 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
5575 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5578 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
5579 reference popup, that activates the reference-back action
5581 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
5583 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
5584 the menus. Also fixed a bug.
5586 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
5587 the math panels when switching buffers (unless new buffer is readonly).
5589 * src/BufferView.C (NoSavedPositions)
5590 * src/BufferView_pimpl.C (NoSavedPositions): New methods
5592 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5594 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
5595 less of dvi dirty or not.
5597 * src/trans_mgr.[Ch] (insert): change first parameter to string
5600 * src/chset.[Ch] (encodeString): add const to first parameter
5602 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5604 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
5608 * src/LaTeX.C (deplog): better searching for dependency files in
5609 the latex log. Uses now regexps.
5611 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
5612 instead of the box hack or \hfill.
5614 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5616 * src/lyxfunc.C (doImportHelper): do not create the file before
5617 doing the actual import.
5618 (doImportASCIIasLines): create a new file before doing the insert.
5619 (doImportASCIIasParagraphs): ditto.
5621 * lib/lyxrc.example: remove mention of non-existing commands
5623 * lyx.man: remove mention of color-related switches.
5625 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
5627 * src/lyx_gui.C: remove all the color-related ressources, which
5628 are not used anymore.
5630 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
5633 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5635 * src/lyxrc.C (read): Add a missing break in the switch
5637 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
5639 * src/text2.C (InsertStringA): Fix a bug with insertion into table
5641 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
5644 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
5646 * src/text.C (draw): draw bars under foreign language words.
5648 * src/LColor.[Ch]: add LColor::language
5650 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
5652 * src/lyxcursor.h (boundary): New member variable
5654 * src/text.C (IsBoundary): New methods
5656 * src/text.C: Use the above for currect cursor movement when there
5657 is both RTL & LTR text.
5659 * src/text2.C: ditto
5661 * src/bufferview_funcs.C (ToggleAndShow): ditto
5663 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5665 * src/text.C (DeleteLineForward): set selection to true to avoid
5666 that DeleteEmptyParagraphMechanism does some magic. This is how it
5667 is done in all other functions, and seems reasonable.
5668 (DeleteWordForward): do not jump over non-word stuff, since
5669 CursorRightOneWord() already does it.
5671 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
5672 DeleteWordBackward, since they seem safe to me (since selection is
5673 set to "true") DeleteEmptyParagraphMechanism does nothing.
5675 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5677 * src/lyx_main.C (easyParse): simplify the code by factoring the
5678 part that removes parameters from the command line.
5679 (LyX): check wether wrong command line options have been given.
5681 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
5683 * src/lyx_main.C : add support for specifying user LyX
5684 directory via command line option -userdir.
5686 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
5688 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
5689 the number of items per popup.
5690 (Add_to_refs_menu): Ditto.
5692 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5694 * src/lyxparagraph.h: renamed ClearParagraph() to
5695 StripLeadingSpaces() and moved it to paragraph.C. We pass the
5696 textclass as parameter, and do nothing if free_spacing is
5697 true. This fixes part of the line-delete-forward problems.
5699 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
5700 (pasteSelection): ditto.
5701 (SwitchLayoutsBetweenClasses): more translatable strings.
5703 * src/text2.C (CutSelection): use StripLeadingSpaces.
5704 (PasteSelection): ditto.
5705 (DeleteEmptyParagraphMechanism): ditto.
5707 2000-05-26 Juergen Vigna <jug@sad.it>
5709 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
5710 is not needed in tabular insets.
5712 * src/insets/insettabular.C (TabularFeatures): added missing features.
5714 * src/tabular.C (DeleteColumn):
5716 (AppendRow): implemented this functions
5717 (cellsturct::operator=): clone the inset too;
5719 2000-05-23 Juergen Vigna <jug@sad.it>
5721 * src/insets/insettabular.C (LocalDispatch): better selection support
5722 when having multicolumn-cells.
5724 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
5726 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
5728 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5730 * src/ColorHandler.C (getGCForeground): put more test into _()
5732 * lib/examples/eu_splash.lyx: new file (Basque translation) from
5735 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
5738 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
5740 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
5741 there are no labels, or when buffer is readonly.
5743 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
5744 there are no labels, buffer is SGML, or when buffer is readonly.
5746 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5748 * src/LColor.C (LColor): change a couple of grey40 to grey60
5749 (LColor): rewore initalization to make compiles go some magnitude
5751 (getGUIName): don't use gettext until we need the string.
5753 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
5755 * src/Bullet.[Ch]: Fixed a small bug.
5757 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
5759 * src/paragraph.C (String): Several fixes/improvements
5761 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
5763 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5765 * src/paragraph.C (String): give more correct output.
5767 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
5769 * src/lyxfont.C (stateText) Do not output the language if it is
5770 eqaul to the language of the document.
5772 * src/paragraph.C (TeXOnePar): Do not put language switch commands
5773 between two paragraphs with the same language.
5775 * src/paragraph.C (getParLanguage) Return a correct answer for an
5776 empty dummy paragraph.
5778 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
5781 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
5784 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
5785 the menus/popup, if requested fonts are unavailable.
5787 2000-05-22 Juergen Vigna <jug@sad.it>
5789 * src/insets/insettabular.C (LocalDispatch): added some more cursor
5790 movement support (Up/Down/Tab/Shift-Tab).
5791 (LocalDispatch): added also preliminari cursor-selection.
5793 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
5795 * src/paragraph.C (PasteParagraph): Hopefully now right!
5797 2000-05-22 Garst R. Reese <reese@isn.net>
5799 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
5800 of list, change all references to Environment to Command
5801 * tex/hollywood.cls : rewrite environments as commands, add
5802 \uppercase to interiorshot and exteriorshot to force uppecase.
5803 * tex/broadway.cls : rewrite environments as commands. Tweak
5806 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5808 * src/menus.C (Add_to_toc_menu): fix the code which limits the
5809 size of items: use a constant intead of the hardcoded 40, and more
5810 importantly do not remove the %m and %x tags added at the end.
5811 (Add_to_refs_menu): use vector::size_type instead of
5812 unsigned int as basic types for the variables. _Please_ do not
5813 assume that size_t is equal to unsigned int. On an alpha, this is
5814 unsigned long, which is _not_ the same.
5816 * src/language.C (initL): remove language "hungarian", since it
5817 seems that "magyar" is better.
5819 2000-05-22 Juergen Vigna <jug@sad.it>
5821 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
5823 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
5826 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
5827 next was deleted but not set to 0.
5829 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5831 * src/language.C (initL): change the initialization of languages
5832 so that compiles goes _fast_.
5834 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
5837 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
5839 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5843 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5845 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
5847 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
5851 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
5854 * src/insets/insetlo*.[Ch]: Made editable
5856 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5858 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
5859 the current selection.
5861 * src/BufferView_pimpl.C (stuffClipboard): new method
5863 * src/BufferView.C (stuffClipboard): new method
5865 * src/paragraph.C (String): new method
5867 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
5868 LColor::ignore when lyxname is not found.
5870 * src/BufferView.C (pasteSelection): new method
5872 * src/BufferView_pimpl.C (pasteSelection): new method
5874 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
5876 * src/WorkArea.C (request_clipboard_cb): new static function
5877 (getClipboard): new method
5878 (putClipboard): new method
5880 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5882 * LyX 1.1.5pre2 released
5884 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5886 * src/vspace.C (operator=): removed
5887 (operator=): removed
5889 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
5891 * src/layout.C (NumberOfClass): manually set the type in make_pair
5892 (NumberOfLayout): ditto
5894 * src/language.C: use the Language constructor for ignore_lang
5896 * src/language.h: add constructors to struct Language
5898 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
5900 * src/text2.C (SetCursorIntern): comment out #warning
5902 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
5904 * src/mathed/math_iter.h: initialize sx and sw to 0
5906 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
5908 * forms/lyx.fd: Redesign of form_ref
5910 * src/LaTeXFeatures.[Ch]
5914 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
5917 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
5918 and Buffer::inset_iterator.
5920 * src/menus.C: Added new menus: TOC and Refs.
5922 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
5924 * src/buffer.C (getTocList): New method.
5926 * src/BufferView2.C (ChangeRefs): New method.
5928 * src/buffer.C (getLabelList): New method. It replaces the old
5929 getReferenceList. The return type is vector<string> instead of
5932 * src/insets/insetinclude.C (getLabelList): New method. Replaces
5933 the old getLabel() and GetNumberOfLabels() methods.
5934 * src/insets/insetlabel.C (getLabelList): ditto
5935 * src/mathed/formula.C (getLabelList): ditto
5937 * src/paragraph.C (String): New method.
5939 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
5940 Uses the new getTocList() method.
5941 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
5942 which automatically updates the contents of the browser.
5943 (RefUpdateCB): Use the new getLabelList method.
5945 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
5947 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
5949 * src/spellchecker.C: Added using std::reverse;
5951 2000-05-19 Juergen Vigna <jug@sad.it>
5953 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
5955 * src/insets/insettext.C (computeTextRows): small fix for display of
5956 1 character after a newline.
5958 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
5961 2000-05-18 Juergen Vigna <jug@sad.it>
5963 * src/insets/insettabular.C (TabularFeatures): fixed update of display
5964 when changing width of column.
5966 * src/tabular.C (set_row_column_number_info): setting of
5967 autobreak rows if necessary.
5969 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5971 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
5973 * src/vc-backend.*: renamed stat() to status() and vcstat to
5974 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
5975 compilation broke. The new name seems more relevant, anyway.
5977 2000-05-17 Juergen Vigna <jug@sad.it>
5979 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
5980 which was wrong if the removing caused removing of rows!
5982 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
5983 (pushToken): new function.
5985 * src/text2.C (CutSelection): fix problem discovered with purify
5987 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5989 * src/debug.C (showTags): enlarge the first column, now that we
5990 have 6-digits debug codes.
5992 * lib/layouts/hollywood.layout:
5993 * lib/tex/hollywood.cls:
5994 * lib/tex/brodway.cls:
5995 * lib/layouts/brodway.layout: more commands and fewer
5996 environments. Preambles moved in the .cls files. Broadway now has
5997 more options on scene numbering and less whitespace (from Garst)
5999 * src/insets/insetbib.C (getKeys): make sure that we are in the
6000 document directory, in case the bib file is there.
6002 * src/insets/insetbib.C (Latex): revert bogus change.
6004 2000-05-16 Juergen Vigna <jug@sad.it>
6006 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
6007 the TabularLayout on cursor move.
6009 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
6011 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
6014 (draw): fixed cursor position and drawing so that the cursor is
6015 visible when before the tabular-inset.
6017 * src/insets/insettext.C (init): drawLockedFrame was not initialized
6018 when creating from old insettext.
6020 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
6022 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6024 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
6025 * lib/tex/brodway.cls: ditto
6027 * lib/layouts/brodway.layout: change alignment of parenthical
6030 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6032 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
6033 versions 0.88 and 0.89 are supported.
6035 2000-05-15 Juergen Vigna <jug@sad.it>
6037 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
6040 * src/insets/insettext.C (computeTextRows): redone completely this
6041 function in a much cleaner way, because of problems when having a
6043 (draw): added a frame border when the inset is locked.
6044 (SetDrawLockedFrame): this sets if we draw the border or not.
6045 (SetFrameColor): this sets the frame color (default=insetframe).
6047 * src/insets/lyxinset.h: added x() and y() functions which return
6048 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
6049 function which is needed to see if we have a locking inset of some
6050 type in this inset (needed for now in insettabular).
6052 * src/vspace.C (inPixels): the same function also without a BufferView
6053 parameter as so it is easier to use it in some ocasions.
6055 * src/lyxfunc.C: changed all places where insertInset was used so
6056 that now if it couldn't be inserted it is deleted!
6058 * src/TabularLayout.C:
6059 * src/TableLayout.C: added support for new tabular-inset!
6061 * src/BufferView2.C (insertInset): this now returns a bool if the
6062 inset was really inserted!!!
6064 * src/tabular.C (GetLastCellInRow):
6065 (GetFirstCellInRow): new helper functions.
6066 (Latex): implemented for new tabular class.
6070 (TeXTopHLine): new Latex() helper functions.
6072 2000-05-12 Juergen Vigna <jug@sad.it>
6074 * src/mathed/formulamacro.C (Read):
6075 * src/mathed/formula.C (Read): read also the \end_inset here!
6077 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6079 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
6080 crush when saving formulae with unbalanced parenthesis.
6082 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
6084 * src/layout.C: Add new keyword "endlabelstring" to layout file
6086 * src/text.C (GetVisibleRow): Draw endlabel string.
6088 * lib/layouts/broadway.layout
6089 * lib/layouts/hollywood.layout: Added endlabel for the
6090 Parenthetical layout.
6092 * lib/layouts/heb-article.layout: Do not use slanted font shape
6093 for Theorem like environments.
6095 * src/buffer.C (makeLaTeXFile): Always add "american" to
6096 the UsedLanguages list if document language is RTL.
6098 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6100 * add addendum to README.OS2 and small patch (from SMiyata)
6102 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6104 * many files: correct the calls to ChangeExtension().
6106 * src/support/filetools.C (ChangeExtension): remove the no_path
6107 argument, which does not belong there. Use OnlyFileName() instead.
6109 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
6110 files when LaTeXing a non-nice latex file.
6112 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
6113 a chain of "if". Return false when deadkeys are not handled.
6115 * src/lyx_main.C (LyX): adapted the code for default bindings.
6117 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
6118 bindings for basic functionality (except deadkeys).
6119 (deadKeyBindings): new method. Performs the bindings of deadkeys.
6121 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
6122 several methods: handle override_x_deadkeys.
6124 * src/lyxrc.h: remove the "bindings" map, which did not make much
6125 sense anyway. New variable override_x_deadkeys, defaulting to "true".
6127 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6129 * src/lyxfont.C (stateText): use a saner method to determine
6130 whether the font is "default". Seems to fix the crash with DEC
6133 * src/Bullet.[Ch] (Bullet): remove const on parameters.
6135 2000-05-08 Juergen Vigna <jug@sad.it>
6137 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
6138 TabularLayoutMenu with mouse-button-3
6139 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
6141 * src/TabularLayout.C: added this file for having a Layout for
6144 2000-05-05 Juergen Vigna <jug@sad.it>
6146 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
6147 recalculating inset-widths.
6148 (TabularFeatures): activated this function so that I can change
6149 tabular-features via menu.
6151 * src/menus.C (ShowEditMenu): inserted support for insettabular so
6152 that I can test some functions with the Table menu.
6154 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6156 * src/lyxfont.C (stateText): guard against stupid c++libs.
6158 * src/tabular.C: add using std::vector
6159 some whitespace changes, + removed som autogenerated code.
6161 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
6163 2000-05-05 Juergen Vigna <jug@sad.it>
6165 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
6166 row, columns and cellstructures.
6168 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6170 * lib/lyxrc.example: remove obsolete entries.
6172 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
6173 reading of protected_separator for free_spacing.
6175 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6177 * src/text.C (draw): do not display an exclamation mark in the
6178 margin for margin notes. This is confusing, ugly and
6181 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
6182 AMS math' is checked.
6184 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
6185 name to see whether including the amsmath package is needed.
6187 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
6189 * src/paragraph.C (validate): Compute UsedLanguages correctly
6190 (don't insert the american language if it doesn't appear in the
6193 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
6194 The argument of \thanks{} command is considered moving argument
6196 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
6199 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
6201 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
6202 for appendix/minipage/depth. The lines can be now both in the footnote
6203 frame, and outside the frame.
6205 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
6208 2000-05-05 Juergen Vigna <jug@sad.it>
6210 * src/table.[Ch]: removed the inset and buffer stuff as this is now
6211 neede only in tabular.[Ch].
6213 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6215 * src/insets/insetspecialchar.C (Read): allow command == '~' for
6217 (Write): write '~' for PROTECTED_SEPARATOR
6219 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6221 * src/lyxparagraph.h: add a friend struct matchIT after the struct
6224 * src/mathed/formula.C (drawStr): rename size to siz.
6226 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
6227 possibly fix a bug by not changing the pflags = flags to piflags =
6230 2000-05-05 Juergen Vigna <jug@sad.it>
6232 * src/insets/insetbib.C: moved using directive
6234 * src/ImportNoweb.C: small fix for being able to compile (missing
6237 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6239 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
6240 to use clear, since we don't depend on this in the code. Add test
6243 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6245 * (various *.C files): add using std::foo directives to please dec
6248 * replace calls to string::clear() to string::erase() (Angus)
6250 * src/cheaders/cmath: modified to provide std::abs.
6252 2000-05-04 Juergen Vigna <jug@sad.it>
6254 * src/insets/insettext.C: Prepared all for inserting of multiple
6255 paragraphs. Still display stuff to do (alignment and other things),
6256 but I would like to use LyXText to do this when we cleaned out the
6257 table-support stuff.
6259 * src/insets/insettabular.C: Changed lot of stuff and added lots
6260 of functionality still a lot to do.
6262 * src/tabular.C: Various functions changed name and moved to be
6263 const functions. Added new Read and Write functions and changed
6264 lots of things so it works good with tabular-insets (also removed
6265 some stuff which is not needed anymore * hacks *).
6267 * src/lyxcursor.h: added operators == and != which just look if
6268 par and pos are (not) equal.
6270 * src/buffer.C (latexParagraphs): inserted this function to latex
6271 all paragraphs form par to endpar as then I can use this too for
6274 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
6275 so that I can call this to from text insets with their own cursor.
6277 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
6278 output off all paragraphs (because of the fix below)!
6280 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
6281 the very last paragraph (this could be also the last paragraph of an
6284 * src/texrow.h: added rows() call which returns the count-variable.
6286 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6288 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
6290 * lib/configure.m4: better autodetection of DocBook tools.
6292 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6294 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
6296 * src/lyx_cb.C: add using std::reverse;
6298 * src/LaTeX.C (run): on error always run deleteFilesOnError before
6301 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
6302 selected files. Should fix repeated errors from generated files.
6304 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
6306 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
6308 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
6309 the spellchecker popup.
6311 * lib/lyxrc.example: Removed the \number_inset section
6313 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6315 * src/insets/figinset.C (various): Use IsFileReadable() to make
6316 sure that the file actually exist. Relying on ghostscripts errors
6317 is a bad idea since they can lead to X server crashes.
6319 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
6321 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
6324 * lib/lyxrc.example: smallish typo in description of
6325 \view_dvi_paper_option
6327 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6330 * src/lyxfunc.C: doImportHelper to factor out common code of the
6331 various import methods. New functions doImportASCIIasLines,
6332 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
6333 doImportLinuxDoc for the format specific parts.
6336 * buffer.C: Dispatch returns now a bool to indicate success
6339 * lyx_gui.C: Add getLyXView() for member access
6341 * lyx_main.C: Change logic for batch commands: First try
6342 Buffer::Dispatch (possibly without GUI), if that fails, use
6345 * lyx_main.C: Add support for --import command line switch.
6346 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
6347 Available Formats: Everything accepted by 'buffer-import <format>'
6349 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6351 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
6354 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
6355 documents will be reformatted upon reentry.
6357 2000-04-27 Juergen Vigna <jug@sad.it>
6359 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
6360 correctly only last pos this was a bug.
6362 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6364 * release of lyx-1.1.5pre1
6366 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6368 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
6370 * src/menus.C: revert the change of naming (Figure->Graphic...)
6371 from 2000-04-11. It was incomplete and bad.
6373 * src/LColor.[Ch]: add LColor::depthbar.
6374 * src/text.C (GetVisibleRow): use it.
6376 * README: update the languages list.
6378 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6380 * src/text.C (GetVisibleRow): show the depth of paragraphs using
6383 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6385 * README: remove sections that were just wrong.
6387 * src/text2.C (GetRowNearY): remove currentrow code
6389 * src/text.C (GetRow): remove currentrow code
6391 * src/screen.C (Update): rewritten a bit.
6392 (SmallUpdate): removed func
6394 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
6396 (FullRebreak): return bool
6397 (currentrow): remove var
6398 (currentrow_y): ditto
6400 * src/lyxscreen.h (Draw): change arg to unsigned long
6401 (FitCursor): return bool
6402 (FitManualCursor): ditto
6403 (Smallpdate): remove func
6404 (first): change to unsigned long
6405 (DrawOneRow): change second arg to long (from long &)
6406 (screen_refresh_y): remove var
6407 (scree_refresh_row): ditto
6409 * src/lyxrow.h: change baseline to usigned int from unsigned
6410 short, this brings some implicit/unsigned issues out in the open.
6412 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
6414 (Dispatch): don't call updateScrollbar after fitCursor. Use update
6415 instead of smallUpdate.
6417 * src/lyxcursor.h: change y to unsigned long
6419 * src/buffer.h: don't call updateScrollbar after fitcursor
6421 * src/buffer.C (parseSingleLyXformat2Token): move variables to
6422 where they are used. Removed "\\direction", this was not present
6423 in 1.1.4 and is already obsolete. Commented out some code that I
6424 believe to never be called.
6425 (runLiterate): don't call updateScrollbar after fitCursor
6427 (buildProgram): ditto
6430 * src/WorkArea.h (workWidth): change return val to unsigned
6433 (redraw): remove the button redraws
6434 (setScrollbarValue): change for scrollbar
6435 (getScrollbarValue): change for scrollbar
6436 (getScrollbarBounds): change for scrollbar
6438 * src/WorkArea.C (C_WorkArea_up_cb): removed func
6439 (C_WorkArea_down_cb): removed func
6440 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
6441 (resize): change for scrollbar
6442 (setScrollbar): ditto
6443 (setScrollbarBounds): ditto
6444 (setScrollbarIncrements): ditto
6445 (up_cb): removed func
6446 (down_cb): removed func
6447 (scroll_cb): change for scrollbar
6448 (work_area_handler): ditto
6450 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
6451 when FitCursor did something.
6452 (updateScrollbar): some unsigned changes
6453 (downCB): removed func
6454 (scrollUpOnePage): removed func
6455 (scrollDownOnePage): remvoed func
6456 (workAreaMotionNotify): don't call screen->FitCursor but use
6457 fitCursor instead. and bool return val
6458 (workAreaButtonPress): ditto
6459 (workAreaButtonRelease): some unsigned changes
6460 (checkInsetHit): ditto
6461 (workAreaExpose): ditto
6462 (update): parts rewritten, comments about the signed char arg added
6463 (smallUpdate): removed func
6464 (cursorPrevious): call needed updateScrollbar
6467 * src/BufferView2.C (allFloats): don't call updateScrollbar after
6470 * src/BufferView.[Ch] (upCB): removed func
6471 (downCB): removed func
6472 (smallUpdate): removed func
6474 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6476 * src/lyxtext.h src/text.C src/text2.C: removed support for the
6477 currentrow, currentrow_y optimization. This did not help a lot and
6478 if we want to do this kind of optimization we should rather use
6479 cursor.row instead of the currentrow.
6481 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
6482 buffer spacing and klyx spacing support.
6484 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6486 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
6489 2000-04-26 Juergen Vigna <jug@sad.it>
6491 * src/insets/figinset.C: fixes to Lars sstream changes!
6493 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
6495 * A lot of files: Added Ascii(ostream &) methods to all inset
6496 classes. Used when exporting to ASCII.
6498 * src/buffer.C (writeFileAscii,RoffAsciiTable)
6499 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
6502 * src/text2.C (ToggleFree): Disabled implicit word selection when
6503 there is a change in the language
6505 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
6506 no output was generated for end-of-sentence inset.
6508 * src/insets/lyxinset.h
6511 * src/paragraph.C: Removed the insetnumber code
6513 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
6515 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6517 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
6518 no_babel and no_epsfig completely from the file.
6519 (parseSingleLyXformat2Token): add handling for per-paragraph
6520 spacing as written by klyx.
6522 * src/insets/figinset.C: applied patch by Andre. Made it work with
6525 2000-04-20 Juergen Vigna <jug@sad.it>
6527 * src/insets/insettext.C (cutSelection):
6528 (copySelection): Fixed with selection from right to left.
6529 (draw): now the rows are not recalculated at every draw.
6530 (computeTextRows): for now reset the inset-owner here (this is
6531 important for an undo or copy where the inset-owner is not set
6534 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
6535 motion to the_locking_inset screen->first was forgotten, this was
6536 not important till we got multiline insets.
6538 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6540 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
6541 code seems to be alright (it is code changed by Dekel, and the
6542 intent is indeed that all macros should be defined \protect'ed)
6544 * NEWS: a bit of reorganisation of the new user-visible features.
6546 2000-04-19 Juergen Vigna <jug@sad.it>
6548 * src/insets/insettext.C (init): using a LyXCursor now for cursor
6549 position. Set the inset_owner of the used paragraph so that it knows
6550 that it is inside an inset. Fixed cursor handling with mouse and
6551 cursor keys. Fixed wrong timed inset redraws and lots of other changes
6552 and cleanups to make TextInsets work better.
6554 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
6555 Changed parameters of various functions and added LockInsetInInset().
6557 * src/insets/insettext.C:
6559 * src/insets/insetcollapsable.h:
6560 * src/insets/insetcollapsable.C:
6561 * src/insets/insetfoot.h:
6562 * src/insets/insetfoot.C:
6563 * src/insets/insetert.h:
6564 * src/insets/insetert.C: cleaned up the code so that it works now
6565 correctly with insettext.
6567 * src/insets/inset.C:
6568 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
6569 that insets in insets are supported right.
6572 * src/table.C: lots of changes for use with inset tabular (and cleanup)
6574 * src/paragraph.C: some small fixes
6576 * src/debug.h: inserted INSETS debug info
6578 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
6579 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
6581 * src/commandtags.h:
6582 * src/LyXAction.C: insert code for InsetTabular.
6584 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
6585 not Button1MotionMask.
6586 (workAreaButtonRelease): send always a InsetButtonRelease event to
6588 (checkInsetHit): some setCursor fixes (always with insets).
6590 * src/BufferView2.C (lockInset): returns a bool now and extended for
6591 locking insets inside insets.
6592 (showLockedInsetCursor): it is important to have the cursor always
6593 before the locked inset.
6594 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
6596 * src/BufferView.h: made lockInset return a bool.
6598 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
6600 * src/text2.C (SetCursor): This now has a version with a LyXCursor
6601 that is used also internally but can be called as public to have back
6602 a cursor pos which is not set internally.
6603 (SetCursorIntern): Changed to use above function.
6605 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
6607 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6612 * NEWS: updated for prerelease of 1.1.5. Please comment and send
6613 patches for things that should be in or should be changed.
6615 * src/* [insetfiles]: change "usigned char fragile" to bool
6616 fragile. There was only one point that could that be questioned
6617 and that is commented in formulamacro.C. Grep for "CHECK".
6619 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
6620 (DeleteBuffer): take it out of CutAndPaste and make it static.
6622 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6624 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
6625 output the spacing envir commands. Also the new commands used in
6626 the LaTeX output makes the result better.
6628 * src/Spacing.C (writeEnvirBegin): new method
6629 (writeEnvirEnd): new method
6631 2000-04-18 Juergen Vigna <jug@sad.it>
6633 * src/CutAndPaste.C: made textclass a static member of the class
6634 as otherwise it is not accesed right!!!
6636 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
6638 * forms/layout_forms.fd
6639 * src/layout_forms.h
6640 * src/layout_forms.C (create_form_form_character)
6641 * src/lyx_cb.C (UserFreeFont)
6642 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
6643 documents (in the layout->character popup).
6645 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6647 * src/spellchecker.C (create_ispell_pipe): fix a bug where
6648 \spell_command was in fact not honored (from Kevin Atkinson).
6650 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
6653 * src/lyx_gui.h: make lyxViews private (Angus)
6655 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
6657 * src/mathed/math_write.C
6658 (MathMatrixInset::Write) Put \protect before \begin{array} and
6659 \end{array} if fragile
6660 (MathParInset::Write): Put \protect before \\ if fragile
6662 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6664 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
6665 initialization if the LyXColorHandler must be done after the
6666 connections to the XServer has been established.
6668 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
6669 get the background pixel from the lyxColorhandler so that the
6670 figures are rendered with the correct background color.
6671 (NextToken): removed functions.
6672 (GetPSSizes): use ifs >> string instead of NextToken.
6674 * src/Painter.[Ch]: the color cache moved out of this file.
6676 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
6679 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6681 * src/WorkArea.C (work_area_handler): call BufferView::enterView
6682 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
6684 * src/BufferView.C (enterView): new func
6685 (leaveView): new func
6687 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
6689 (leaveView): new func, undefines xterm cursor when approp.
6691 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
6692 (AllowInput): delete the Workarea cursor handling from this func.
6694 * src/Painter.C (underline): draw a slimer underline in most cases.
6696 * src/lyx_main.C (error_handler): use extern "C"
6698 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6700 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
6701 sent directly to me.
6703 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
6704 to the list by Dekel.
6706 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
6709 * src/bufferview_funcs.[Ch]: two new files, moved several of the
6710 methods from lyx_cb.here.
6712 * src/lyx_cb.C: in addition to the above; removed input_prohibited
6715 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6717 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
6718 instead of using current_view directly.
6720 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
6722 * src/LyXAction.C (init): add the paragraph-spacing command.
6724 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
6726 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
6728 * src/lyx_cb.C (CurrentState): output a string when the spacing is
6729 different from the documents.
6731 * src/text.C (SetHeightOfRow): take paragraph spacing into
6732 account, paragraph spacing takes precedence over buffer spacing
6733 (GetVisibleRow): ditto
6735 * src/paragraph.C (writeFile): output the spacing parameter too.
6736 (validate): set the correct features if spacing is used in the
6738 (Clear): set spacing to default
6739 (MakeSameLayout): spacing too
6740 (HasSameLayout): spacing too
6741 (SetLayout): spacing too
6742 (TeXOnePar): output the spacing commands
6744 * src/lyxparagraph.h: added a spacing variable for use with
6745 per-paragraph spacing.
6747 * src/Spacing.h: add a Default spacing and a method to check if
6748 the current spacing is default. also added an operator==
6750 * src/text2.C (DeleteEmptyParagraphMechanism): added a
6753 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6755 * src/lyxserver.C (callback): fix dispatch of functions
6757 * src/insets/insetlatexaccent.C (checkContents): turn bogus
6758 printf() into lyxerr call.
6760 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
6763 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
6764 "Table" to "Table Box", "Float" to "Floating Material"; deletes
6765 the "Float" from each of the subitems.
6766 (ShowHelpMenu): add entry for "FAQ" and "TOC".
6768 * src/support/DebugStream.h: add an #ifdef to work around a gcc
6769 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
6770 documented the change so that the workaround can be nuked later.
6772 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
6775 * src/lyxlex_pimpl.C (next): do not re-declare the default value
6777 * src/buffer.C (getLatexName): ditto
6778 (setReadonly): ditto
6780 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6782 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
6783 avoid some uses of current_view. Added also a bufferParams()
6784 method to get at this.
6786 * src/lyxtext.h: changed params->buffer and paramters->bparams.
6788 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6790 * src/lyxparagraph.[Ch]: removed
6791 operator<(LyXParagraph::InsetTable..., added a struct matchIT
6792 with operators used by lower_bound and
6793 upper_bound in InsetTable's
6794 Make struct InsetTable private again. Used matchpos.
6796 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
6798 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
6799 document, the language of existing text is changed (unless the
6800 document is multi-lingual)
6802 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
6804 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
6806 * A lot of files: A rewrite of the Right-to-Left support.
6808 2000-04-10 Juergen Vigna <jug@sad.it>
6810 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
6811 misplaced cursor when inset in inset is locked.
6813 * src/insets/insettext.C (LocalDispatch): small fix so that a
6814 BREAKLINE is not inserted if we don't permit it with autBreakRows.
6816 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
6817 footnote font should be decreased in size twice when displaying.
6819 * src/insets/insettext.C (GetDrawFont): inserted this function as
6820 the drawing-font may differ from the real paragraph font.
6822 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
6823 insets (inset in inset!).
6825 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
6826 function here because we don't want footnotes inside footnotes.
6828 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
6830 (init): now set the inset_owner in paragraph.C
6831 (LocalDispatch): added some resetPos() in the right position
6834 (pasteSelection): changed to use the new CutAndPaste-Class.
6836 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
6837 which tells if it is allowed to insert another inset inside this one.
6839 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
6840 SwitchLayoutsBetweenClasses.
6842 * src/text2.C (InsertInset): checking of the new paragraph-function
6844 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
6845 is not needed anymore here!
6848 (PasteSelection): redone (also with #ifdef) so that now this uses
6849 the CutAndPaste-Class.
6850 (SwitchLayoutsBetweenClasses): removed here and implemented in the
6853 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
6854 from/to text/insets.
6856 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
6857 so that the paragraph knows if it is inside an (text)-inset.
6858 (InsertFromMinibuffer): changed return-value to bool as now it
6859 may happen that an inset is not inserted in the paragraph.
6860 (InsertInsetAllowed): this checks if it is allowed to insert an
6861 inset in this paragraph.
6863 (BreakParagraphConservative):
6864 (BreakParagraph) : small change for the above change of the return
6865 value of InsertFromMinibuffer.
6867 * src/lyxparagraph.h: added inset_owner and the functions to handle
6868 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
6870 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6872 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
6873 functions from BufferView to BufferView::Pimpl to ease maintence.
6875 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
6876 correctly. Also use SetCursorIntern instead of SetCursor.
6878 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
6881 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6883 * src/WorkArea.C (belowMouse): manually implement below mouse.
6885 * src/*: Add "explicit" on several constructors, I added probably
6886 some unneeded ones. A couple of changes to code because of this.
6888 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
6889 implementation and private parts from the users of BufferView. Not
6892 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
6893 implementation and private parts from the users of LyXLex. Not
6896 * src/BufferView_pimpl.[Ch]: new files
6898 * src/lyxlex_pimpl.[Ch]: new files
6900 * src/LyXView.[Ch]: some inline functions move out-of-line
6902 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6904 * src/lyxparagraph.h: make struct InsetTable public.
6906 * src/support/lyxstring.h: change lyxstring::difference_type to be
6907 ptrdiff_t. Add std:: modifiers to streams.
6909 * src/font.C: include the <cctype> header, for islower() and
6912 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6914 * src/font.[Ch]: new files. Contains the metric functions for
6915 fonts, takes a LyXFont as parameter. Better separation of concepts.
6917 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
6918 changes because of this.
6920 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
6922 * src/*: compile with -Winline and move functions that don't
6925 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
6928 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6930 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
6931 (various files changed because of this)
6933 * src/Painter.C (text): fixed the drawing of smallcaps.
6935 * src/lyxfont.[Ch] (drawText): removed unused member func.
6938 * src/*.C: added needed "using" statements and "std::" qualifiers.
6940 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6942 * src/*.h: removed all use of "using" from header files use
6943 qualifier std:: instead.
6945 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6947 * src/text.C (Backspace): some additional cleanups (we already
6948 know whether cursor.pos is 0 or not).
6950 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
6951 automake does not provide one).
6953 * src/bmtable.h: replace C++ comments with C comments.
6955 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
6957 * src/screen.C (ShowCursor): Change the shape of the cursor if
6958 the current language is not equal to the language of the document.
6959 (If the cursor change its shape unexpectedly, then you've found a bug)
6961 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
6964 * src/insets/insetnumber.[Ch]: New files.
6966 * src/LyXAction.C (init)
6967 * src/lyxfunc.C (dispatch): Add command number-inset-insert
6970 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
6972 * src/lyxparagraph.h
6973 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
6974 (the vector is kept sorted).
6976 * src/text.C (GetVisibleRow): Draw selection correctly when there
6977 is both LTR and RTL text.
6979 * src/paragraph.C (Clone): Use the assignment operator for cloning,
6980 which is much faster.
6982 * src/text.C (GetVisibleRow and other): Do not draw the last space
6983 in a row if the direction of the last letter is not equal to the
6984 direction of the paragraph.
6986 * src/lyxfont.C (latexWriteStartChanges):
6987 Check that font language is not equal to basefont language.
6988 (latexWriteEndChanges): ditto
6990 * src/lyx_cb.C (StyleReset): Don't change the language while using
6991 the font-default command.
6993 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
6994 empty paragraph before a footnote.
6996 * src/insets/insetcommand.C (draw): Increase x correctly.
6998 * src/screen.C (ShowCursor): Change cursor shape if
6999 current language != document language.
7001 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
7003 2000-03-31 Juergen Vigna <jug@sad.it>
7005 * src/paragraph.C (GetInset): commented out text[pos] = ' '
7006 (Clone): changed mode how the paragraph-data is copied to the
7007 new clone-paragraph.
7009 * src/lyxfunc.C (Dispatch): fixed small problem when calling
7010 GetInset(pos) with no inset anymore there (in inset UNDO)
7012 * src/insets/insetcommand.C (draw): small fix as here x is
7013 incremented not as much as width() returns (2 before, 2 behind = 4)
7015 2000-03-30 Juergen Vigna <jug@sad.it>
7017 * src/insets/insettext.C (InsetText): small fix in initialize
7018 widthOffset (should not be done in the init() function)
7020 2000-03-29 Amir Karger <karger@lyx.org>
7022 * lib/examples/it_ItemizeBullets.lyx: translation by
7025 * Implemented \textasciitilde and fixed a tiny bug in reLyX
7027 2000-03-29 Juergen Vigna <jug@sad.it>
7029 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
7031 * src/insets/insetfoot.C (Clone): small change as for the below
7032 new init function in the text-inset
7034 * src/insets/insettext.C (init): new function as I've seen that
7035 clone did not copy the Paragraph-Data!
7036 (LocalDispatch): Added code so that now we have some sort of Undo
7037 functionality (well actually we HAVE Undo ;)
7039 * src/text.C (Backspace): Small fix for the a | a Backspace problem
7041 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
7043 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
7046 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7048 * src/main.C: added a runtime check that verifies that the xforms
7049 header used when building LyX and the library used when running
7050 LyX match. Exit with a message if they don't match. This is a
7051 version number check only.
7053 * src/buffer.C (save): Don't allocate memory on the heap for
7054 struct utimbuf times.
7056 * *: some using changes, use iosfwd instead of the real headers.
7058 * src/lyxfont.C use char const * instead of string for the static
7059 strings. Rewrite some functions to use sstream.
7061 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7063 * src/text.C (Backspace): hopefully fix the dreaded backaspace
7066 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7068 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
7069 of Geodesy (from Martin Vermeer)
7071 * lib/layouts/svjour.inc: include file for the Springer svjour
7072 class. It can be used to support journals other than JoG.
7074 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
7075 Miskiewicz <misiek@pld.org.pl>)
7076 * lib/reLyX/Makefile.am: ditto.
7078 2000-03-27 Juergen Vigna <jug@sad.it>
7080 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
7081 also some modifications with operations on selected text.
7083 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
7084 problems with clicking on insets (last famous words ;)
7086 * src/insets/insetcommand.C (draw):
7087 (width): Changed to have a bit of space before and after the inset so
7088 that the blinking cursor can be seen (otherwise it was hidden)
7090 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7092 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
7093 would not be added to the link list when an installed gettext (not
7094 part of libc) is found.
7096 2000-03-24 Juergen Vigna <jug@sad.it>
7098 * src/insets/insetcollapsable.C (Edit):
7099 * src/mathed/formula.C (InsetButtonRelease):
7100 (InsetButtonPress): fixed for new handling of ButtonPress/Release
7103 * src/BufferView.C (workAreaButtonPress):
7104 (workAreaButtonRelease):
7105 (checkInsetHit): Finally fixed the clicking on insets be handled
7108 * src/insets/insetert.C (Edit): inserted this call so that ERT
7109 insets work always with LaTeX-font
7111 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7113 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
7114 caused lyx to startup with no GUI in place, causing in a crash
7115 upon startup when called with arguments.
7117 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7119 * src/FontLoader.C: better initialization of dummyXFontStruct.
7121 2000-03-20 José Abílio Matos <jamatos@lyx.org>
7123 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
7124 for linuxdoc and docbook import and export format options.
7126 * lib/lyxrc.example Example of default values for the previous flags.
7128 * src/lyx_cb.C Use those flags instead of the hardwired values for
7129 linuxdoc and docbook export.
7131 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
7134 * src/menus.C Added menus entries for the new import/exports formats.
7136 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7138 * src/lyxrc.*: Added support for running without Gui
7141 * src/FontLoader.C: sensible defaults if no fonts are needed
7143 * src/lyx_cb.C: New function ShowMessage (writes either to the
7144 minibuffer or cout in case of no gui
7145 New function AskOverwrite for common stuff
7146 Consequently various changes to call these functions
7148 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
7149 wild guess at sensible screen resolution when having no gui
7151 * src/lyxfont.C: no gui, no fonts... set some defaults
7153 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7155 * src/LColor.C: made the command inset background a bit lighter.
7157 2000-03-20 Hartmut Goebel <goebel@noris.net>
7159 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
7160 stdstruct.inc. Koma-Script added some title elements which
7161 otherwise have been listed below "bibliography". This split allows
7162 adding title elements to where they belong.
7164 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
7165 define the additional title elements and then include
7168 * many other layout files: changed to include stdtitle.inc just
7169 before stdstruct.inc.
7171 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
7173 * src/buffer.C: (save) Added the option to store all backup files
7174 in a single directory
7176 * src/lyxrc.[Ch]: Added variable \backupdir_path
7178 * lib/lyxrc.example: Added descriptions of recently added variables
7180 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
7181 bibtex inset, not closing the bibtex popup when deleting the inset)
7183 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7185 * src/lyx_cb.C: add a couple using directives.
7187 2000-03-17 José Abílio Matos <jamatos@lyx.org>
7188 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
7189 import based on the filename.
7191 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
7192 file would be imported at start, if the filename where of a sgml file.
7194 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
7196 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
7198 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
7199 * src/lyxfont.h Replaced the member variable bits.direction by the
7200 member variable lang. Made many changes in other files.
7201 This allows having a multi-lingual document
7203 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
7204 that change the current language to <l>.
7205 Removed the command "font-rtl"
7207 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
7208 format for Hebrew documents)
7210 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
7211 When auto_mathmode is "true", pressing a digit key in normal mode
7212 will cause entering into mathmode.
7213 If auto_mathmode is "rtl" then this behavior will be active only
7214 when writing right-to-left text.
7216 * src/text2.C (InsertStringA) The string is inserted using the
7219 * src/paragraph.C (GetEndLabel) Gives a correct result for
7220 footnote paragraphs.
7222 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
7224 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7226 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
7227 front of PasteParagraph. Never insert a ' '. This should at least
7228 fix some cause for the segfaults that we have been experiencing,
7229 it also fixes backspace behaviour slightly. (Phu!)
7231 * src/support/lstrings.C (compare_no_case): some change to make it
7232 compile with gcc 2.95.2 and stdlibc++-v3
7234 * src/text2.C (MeltFootnoteEnvironment): change type o
7235 first_footnote_par_is_not_empty to bool.
7237 * src/lyxparagraph.h: make text private. Changes in other files
7239 (fitToSize): new function
7240 (setContentsFromPar): new function
7241 (clearContents): new function
7242 (SetChar): new function
7244 * src/paragraph.C (readSimpleWholeFile): deleted.
7246 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
7247 the file, just use a simple string instead. Also read the file in
7248 a more maintainable manner.
7250 * src/text2.C (InsertStringA): deleted.
7251 (InsertStringB): deleted.
7253 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7255 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
7256 RedoParagraphs from the doublespace handling part, just set status
7257 to NEED_MORE_REFRESH. Also don't update cursor position (should be
7258 done, but perhaps not like this.)
7260 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7262 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
7263 character when inserting an inset.
7265 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7267 * src/bufferparams.C (readLanguage): now takes "default" into
7270 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
7271 also initialize the toplevel_keymap with the default bindings from
7274 * src/buffer.C (Buffer): remove lyxrc from the parameters.
7276 * all files using lyxrc: have lyxrc as a real variable and not a
7277 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
7280 * src/lyxrc.C: remove double call to defaultKeyBindings
7282 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
7283 toolbar defauls using lyxlex. Remove enums, structs, functions
7286 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
7287 toolbar defaults. Also store default keybindings in a map.
7289 * src/ToolbarDefaults.[Ch]: New file. This class is used for
7290 storing the toolbar defaults without any xforms dependencies.
7292 * src/insets/figinset.C: patch posted to list by Andre Poenitz
7293 applied. Changed to use iterators.
7295 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7297 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
7298 systems that don't have LINGUAS set to begin with.
7300 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7302 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
7303 the list by Dekel Tsur.
7305 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7307 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
7308 * src/insets/form_graphics.C: ditto.
7310 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
7312 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7314 * src/bufferparams.C (readLanguage): use the new language map
7316 * src/intl.C (InitKeyMapper): use the new language map
7318 * src/lyx_gui.C (create_forms): use the new language map
7320 * src/language.[Ch]: New files. Used for holding the information
7321 about each language. Now! Use this new language map enhance it and
7322 make it really usable for our needs.
7324 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
7326 * screen.C (ShowCursor): Removed duplicate code.
7327 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
7328 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
7330 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
7333 * src/text.C Added TransformChar method. Used for rendering Arabic
7334 text correctly (change the glyphs of the letter according to the
7335 position in the word)
7340 * src/lyxrc.C Added lyxrc command {language_command_begin,
7341 language_command_end,language_command_ltr,language_command_rtl,
7342 language_package} which allows the use of either arabtex or Omega
7345 * src/lyx_gui.C (init)
7347 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
7348 to use encoding for menu fonts which is different than the encoding
7351 * src/buffer.C (makeLaTeXFile): If params.language = "default",
7352 do not load the babel package.
7353 To write an English document with Hebrew/Arabic, change the document
7354 language to "english".
7356 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
7357 (alphaCounter): changed to return char
7358 (loweralphaCounter, hebrewCounter, romanCounter): New functions
7360 * lib/lyxrc.example Added examples for Hebrew/Arabic
7363 * src/layout.C Added layout command endlabeltype
7365 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
7367 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
7369 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7371 * src/mathed/math_delim.C (search_deco): return a
7372 math_deco_struct* instead of index.
7374 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7376 * All files with a USE_OSTREAM_ONLY within: removed all code that
7377 was unused when USE_OSTREAM_ONLY is defined.
7379 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
7380 of any less. Removed header and using.
7382 * src/text.C (GetVisibleRow): draw the string "Page Break
7383 (top/bottom)" on screen when drawing a pagebreak line.
7385 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7387 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
7389 * src/mathed/math_macro.C (draw): do some cast magic.
7392 * src/mathed/math_defs.h: change byte* argument to byte const*.
7394 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
7396 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
7397 know it is right to return InsetFoot* too, but cxx does not like
7400 * src/insets/insetcollapsable.[Ch] (Clone): make const.
7402 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
7404 * src/mathed/math_delim.C: change == to proper assignment.
7406 2000-03-09 Juergen Vigna <jug@sad.it>
7408 * src/insets/insettext.C (setPos): fixed various cursor positioning
7409 problems (via mouse and cursor-keys)
7410 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
7411 inset (still a small display problem but it works ;)
7413 * src/insets/insetcollapsable.C (draw): added button_top_y and
7414 button_bottom_y to have correct values for clicking on the inset.
7416 * src/support/lyxalgo.h: commented out 'using std::less'
7418 2000-03-08 Juergen Vigna <jug@sad.it>
7420 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
7421 Button-Release event closes as it is alos the Release-Event
7424 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
7426 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7428 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
7429 can add multiple spaces in Scrap (literate programming) styles...
7430 which, by the way, is how I got hooked on LyX to begin with.
7432 * src/mathed/formula.C (Write): Added dummy variable to an
7433 inset::Latex() call.
7434 (Latex): Add free_spacing boolean to inset::Latex()
7436 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
7438 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
7439 virtual function to include the free_spacing boolean from
7440 the containing paragraph's style.
7442 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
7443 Added free_spacing boolean arg to match inset.h
7445 * src/insets/insettext.C, src/insets/insettext.h (Latex):
7446 Added free_spacing boolean arg to match inset.h
7448 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
7449 Added free_spacing boolean and made sure that if in a free_spacing
7450 paragraph, that we output normal space if there is a protected space.
7452 * src/insets/insetref.C, src/insets/insetref.h (Latex):
7453 Added free_spacing boolean arg to match inset.h
7455 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
7456 Added free_spacing boolean arg to match inset.h
7458 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
7459 Added free_spacing boolean arg to match inset.h
7461 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
7462 Added free_spacing boolean arg to match inset.h
7464 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
7465 Added free_spacing boolean arg to match inset.h
7467 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
7468 free_spacing boolean arg to match inset.h
7470 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
7471 Added free_spacing boolean arg to match inset.h
7473 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
7474 Added free_spacing boolean arg to match inset.h
7476 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
7477 Added free_spacing boolean arg to match inset.h
7479 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
7480 Added free_spacing boolean arg to match inset.h
7482 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
7483 Added free_spacing boolean arg to match inset.h
7485 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
7486 free_spacing boolean arg to match inset.h
7488 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
7489 free_spacing boolean arg to match inset.h
7491 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
7492 ignore free_spacing paragraphs. The user's spaces are left
7495 * src/text.C (InsertChar): Fixed the free_spacing layout
7496 attribute behavior. Now, if free_spacing is set, you can
7497 add multiple spaces in a paragraph with impunity (and they
7498 get output verbatim).
7499 (SelectSelectedWord): Added dummy argument to inset::Latex()
7502 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
7505 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
7506 paragraph layouts now only input a simple space instead.
7507 Special character insets don't make any sense in free-spacing
7510 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
7511 hard-spaces in the *input* file to simple spaces if the layout
7512 is free-spacing. This converts old files which had to have
7513 hard-spaces in free-spacing layouts where a simple space was
7515 (writeFileAscii): Added free_spacing check to pass to the newly
7516 reworked inset::Latex(...) methods. The inset::Latex() code
7517 ensures that hard-spaces in free-spacing paragraphs get output
7518 as spaces (rather than "~").
7520 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7522 * src/mathed/math_delim.C (draw): draw the empty placeholder
7523 delims with a onoffdash line.
7524 (struct math_deco_compare): struct that holds the "functors" used
7525 for the sort and the binary search in math_deco_table.
7526 (class init_deco_table): class used for initial sort of the
7528 (search_deco): use lower_bound to do a binary search in the
7531 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7533 * src/lyxrc.C: a small secret thingie...
7535 * src/lyxlex.C (printTable): changed to take a ostream as paramter
7536 and to not flush the stream as often as it used to.
7538 * src/support/lyxalgo.h: new file
7539 (sorted): template function used for checking if a sequence is
7540 sorted or not. Two versions with and without user supplied
7541 compare. Uses same compare as std::sort.
7543 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
7544 it and give warning on lyxerr.
7546 (struct compare_tags): struct with function operators used for
7547 checking if sorted, sorting and lower_bound.
7548 (search_kw): use lower_bound instead of manually implemented
7551 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7553 * src/insets/insetcollapsable.h: fix Clone() declaration.
7554 * src/insets/insetfoot.h: ditto.
7556 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
7558 2000-03-08 Juergen Vigna <jug@sad.it>
7560 * src/insets/lyxinset.h: added owner call which tells us if
7561 this inset is inside another inset. Changed also the return-type
7562 of Editable to an enum so it tells clearer what the return-value is.
7564 * src/insets/insettext.C (computeTextRows): fixed computing of
7565 textinsets which split automatically on more rows.
7567 * src/insets/insetert.[Ch]: changed this to be of BaseType
7570 * src/insets/insetfoot.[Ch]: added footnote inset
7572 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
7573 collapsable insets (like footnote, ert, ...)
7575 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7577 * src/lyxdraw.h: remvoe file
7579 * src/lyxdraw.C: remove file
7581 * src/insets/insettext.C: added <algorithm>.
7583 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7585 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
7586 (matrix_cb): case MM_OK use string stream
7588 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
7591 * src/mathed/math_macro.C (draw): use string stream
7592 (Metrics): use string stream
7594 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
7595 directly to the ostream.
7597 * src/vspace.C (asString): use string stream.
7598 (asString): use string stream
7599 (asLatexString): use string stream
7601 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
7602 setting Spacing::Other.
7604 * src/LaTeXFeatures.C (getPackages): use string stream instead of
7605 sprintf when creating the stretch vale.
7607 * src/text2.C (alphaCounter): changed to return a string and to
7608 not use a static variable internally. Also fixed a one-off bug.
7609 (SetCounter): changed the drawing of the labels to use string
7610 streams instead of sprintf.
7612 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
7613 manipulator to use a scheme that does not require library support.
7614 This is also the way it is done in the new GNU libstdc++. Should
7615 work with DEC cxx now.
7617 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7619 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
7620 end. This fixes a bug.
7622 * src/mathed (all files concerned with file writing): apply the
7623 USE_OSTREAM_ONLY changes to mathed too.
7625 * src/support/DebugStream.h: make the constructor explicit.
7627 * src/lyxfont.C (latexWriteStartChanges): small bug related to
7628 count and ostream squashed.
7630 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7632 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
7634 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
7635 ostringstream uses STL strings, and we might not.
7637 * src/insets/insetspecialchar.C: add using directive.
7638 * src/insets/insettext.C: ditto.
7640 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7642 * lib/layouts/seminar.layout: feeble attempt at a layout for
7643 seminar.cls, far from completet and could really use some looking
7644 at from people used to write layout files.
7646 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
7647 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
7648 a lot nicer and works nicely with ostreams.
7650 * src/mathed/formula.C (draw): a slightly different solution that
7651 the one posted to the list, but I think this one works too. (font
7652 size wrong in headers.)
7654 * src/insets/insettext.C (computeTextRows): some fiddling on
7655 Jürgens turf, added some comments that he should read.
7657 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
7658 used and it gave compiler warnings.
7659 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
7662 * src/lyx_gui.C (create_forms): do the right thing when
7663 show_banner is true/false.
7665 * src/lyx_cb.C (TimerCB): no need to close or do anything if
7666 show_banner is false.
7668 * most file writing files: Now use iostreams to do almost all of
7669 the writing. Also instead of passing string &, we now use
7670 stringstreams. mathed output is still not adapted to iostreams.
7671 This change can be turned off by commenting out all the occurences
7672 of the "#define USE_OSTREAM_ONLY 1" lines.
7674 * src/WorkArea.C (createPixmap): don't output debug messages.
7675 (WorkArea): don't output debug messages.
7677 * lib/lyxrc.example: added a comment about the new variable
7680 * development/Code_rules/Rules: Added some more commente about how
7681 to build class interfaces and on how better encapsulation can be
7684 2000-03-03 Juergen Vigna <jug@sad.it>
7686 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
7687 automatically with the width of the LyX-Window
7689 * src/insets/insettext.C (computeTextRows): fixed update bug in
7690 displaying text-insets (scrollvalues where not initialized!)
7692 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7694 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
7695 id in the check of the result from lower_bound is not enough since
7696 lower_bound can return last too, and then res->id will not be a
7699 * all insets and some code that use them: I have conditionalized
7700 removed the Latex(string & out, ...) this means that only the
7701 Latex(ostream &, ...) will be used. This is a work in progress to
7702 move towards using streams for all output of files.
7704 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
7707 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7709 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
7710 routine (this fixes bug where greek letters were surrounded by too
7713 * src/support/filetools.C (findtexfile): change a bit the search
7714 algorithm, to fix bug introduced in 1.1.4. Note that --format is
7715 no longer passed to kpsewhich, we may have to change that later.
7717 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
7718 warning options to avoid problems with X header files (from Angus
7720 * acinclude.m4: regenerated.
7722 2000-03-02 Juergen Vigna <jug@sad.it>
7724 * src/insets/insettext.C (WriteParagraphData): Using the
7725 par->writeFile() function for writing paragraph-data.
7726 (Read): Using buffer->parseSingleLyXformat2Token()-function
7727 for parsing paragraph data!
7729 * src/buffer.C (readLyXformat2): removed all parse data and using
7730 the new parseSingleLyXformat2Token()-function.
7731 (parseSingleLyXformat2Token): added this function to parse (read)
7732 lyx-file-format (this is called also from text-insets now!)
7734 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7736 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
7739 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
7740 directly instead of going through a func. One very bad thing: a
7741 static LyXFindReplace, but I don't know where to place it.
7743 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
7744 string instead of char[]. Also changed to static.
7745 (GetSelectionOrWordAtCursor): changed to static inline
7746 (SetSelectionOverLenChars): ditto.
7748 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
7749 current_view and global variables. both classes has changed names
7750 and LyXFindReplace is not inherited from SearchForm.
7752 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
7753 fl_form_search form.
7755 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
7757 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7759 * lib/bind/*.bind: make sure 'buffer-previous' function is not
7760 bound (from Kayvan).
7762 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
7764 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
7766 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7768 * some things that I should comment but the local pub says head to
7771 * comment out all code that belongs to the Roff code for Ascii
7772 export of tables. (this is unused)
7774 * src/LyXView.C: use correct type for global variable
7775 current_layout. (LyXTextClass::size_type)
7777 * some code to get the new insetgraphics closer to working I'd be
7778 grateful for any help.
7780 * src/BufferView2.C (insertInset): use the return type of
7781 NumberOfLayout properly. (also changes in other files)
7783 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
7784 this as a test. I want to know what breaks because of this.
7786 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
7788 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7790 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
7791 to use a \makebox in the label, this allows proper justification
7792 with out using protected spaces or multiple hfills. Now it is
7793 "label" for left justified, "\hfill label\hfill" for center, and
7794 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
7795 should be changed accordingly.
7797 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7799 * src/lyxtext.h: change SetLayout() to take a
7800 LyXTextClass::size_type instead of a char (when there is more than
7801 127 layouts in a class); also change type of copylayouttype.
7802 * src/text2.C (SetLayout): ditto.
7803 * src/LyXView.C (updateLayoutChoice): ditto.
7805 * src/LaTeX.C (scanLogFile): errors where the line number was not
7806 given just after the '!'-line were ignored (from Dekel Tsur).
7808 * lib/lyxrc.example: fix description of \date_insert_format
7810 * lib/layouts/llncs.layout: new layout, contributed by Martin
7813 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7815 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
7816 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
7817 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
7818 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
7819 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
7820 paragraph.C, text.C, text2.C)
7822 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7824 * src/insets/insettext.C (LocalDispatch): remove extra break
7827 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
7828 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
7830 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
7831 * src/insets/insettext.[Ch] (GetCursorPos): ditto
7833 * src/insets/insetbib.h: move InsetBibkey::Holder and
7834 InsetCitation::Holder in public space.
7836 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7838 * src/insets/insettext.h: small change to get the new files from
7839 Juergen to compile (use "string", not "class string").
7841 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
7842 const & as parameter to LocalDispatch, use LyXFont const & as
7843 paramter to some other func. This also had impacto on lyxinsets.h
7844 and the two mathed insets.
7846 2000-02-24 Juergen Vigna <jug@sad.it>
7849 * src/commandtags.h:
7851 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
7855 * src/BufferView2.C: added/updated code for various inset-functions
7857 * src/insets/insetert.[Ch]: added implementation of InsetERT
7859 * src/insets/insettext.[Ch]: added implementation of InsetText
7861 * src/insets/inset.C (Edit): added "unsigned int button" parameter
7862 (draw): added preliminary code for inset scrolling not finshed yet
7864 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
7865 as it is in lyxfunc.C now
7867 * src/insets/lyxinset.h: Added functions for text-insets
7869 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7871 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
7872 BufferView and reimplement the list as a queue put inside its own
7875 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
7877 * several files: use the new interface to the "updateinsetlist"
7879 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
7881 (work_area_handler): call BufferView::trippleClick on trippleclick.
7883 * src/BufferView.C (doubleClick): new function, selects word on
7885 (trippleClick): new function, selects line on trippleclick.
7887 2000-02-22 Allan Rae <rae@lyx.org>
7889 * lib/bind/xemacs.bind: buffer-previous not supported
7891 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7893 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
7896 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7898 * src/bufferlist.C: get rid of current_view from this file
7900 * src/spellchecker.C: get rid of current_view from this file
7902 * src/vspace.C: get rid of current_view from this file
7903 (inPixels): added BufferView parameter for this func
7904 (asLatexCommand): added a BufferParams for this func
7906 * src/text.C src/text2.C: get rid of current_view from these
7909 * src/lyxfont.C (getFontDirection): move this function here from
7912 * src/bufferparams.C (getDocumentDirection): move this function
7915 * src/paragraph.C (getParDirection): move this function here from
7917 (getLetterDirection): ditto
7919 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
7921 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
7922 resize due to wrong pixmap beeing used. Also took the opurtunity
7923 to make the LyXScreen stateless on regard to WorkArea and some
7924 general cleanup in the same files.
7926 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7928 * src/Makefile.am: add missing direction.h
7930 * src/PainterBase.h: made the width functions const.
7932 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
7935 * src/insets/insetcommand.C (draw): draw Editable as buttons.
7937 * src/insets/insetlatexaccent.C (draw): make the accents draw
7938 better, at present this will only work well with iso8859-1.
7940 * several files: remove the old drawing code, now we use the new
7943 * several files: remove support for mono_video, reverse_video and
7946 2000-02-17 Juergen Vigna <jug@sad.it>
7948 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
7949 int ** as we have to return the pointer, otherwise we have only
7950 NULL pointers in the returning function.
7952 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7954 * src/LaTeX.C (operator()): quote file name when running latex.
7956 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7958 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
7959 (bubble tip), this removes our special handling of this.
7961 * Remove all code that is unused now that we have the new
7962 workarea. (Code that are not active when NEW_WA is defined.)
7964 * Make the uses of XSync not conditionalized on define USE_XSYNC.
7966 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7968 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
7969 nonexisting layout; correctly redirect obsoleted layouts.
7971 * lib/lyxrc.example: document \view_dvi_paper_option
7973 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
7976 * src/lyx_cb.C (RunScript): handle $$FName for command names.
7977 (PreviewDVI): handle the view_dvi_paper_option variable.
7978 [Both from Roland Krause]
7980 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7982 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
7983 char const *, int, LyXFont)
7984 (text(int, int, string, LyXFont)): ditto
7986 * src/text.C (InsertCharInTable): attempt to fix the double-space
7987 feature in tables too.
7988 (BackspaceInTable): ditto.
7989 (GetVisibleRow): make bottom pagebreak line be a onoff line.
7991 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7993 * src/text2.C (owner): only complain if owner_ is set and bv != 0
7995 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
7996 newly found text in textcache to this.
7997 (buffer): set the owner of the text put into the textcache to 0
7999 * src/insets/figinset.C (draw): fixed the drawing of figures with
8002 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
8003 drawing of mathframe, hfills, protected space, table lines. I have
8004 now no outstanding drawing problems with the new Painter code.
8006 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8008 * src/PainterBase.C (ellipse, circle): do not specify the default
8011 * src/LColor.h: add using directive.
8013 * src/Painter.[Ch]: change return type of methods from Painter& to
8014 PainterBase&. Add a using directive.
8016 * src/WorkArea.C: wrap xforms callbacks in C functions
8019 * lib/layouts/foils.layout: font fix and simplifications from Carl
8022 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8024 * a lot of files: The Painter, LColor and WorkArea from the old
8025 devel branch has been ported to lyx-devel. Some new files and a
8026 lot of #ifdeffed code. The new workarea is enabled by default, but
8027 if you want to test the new Painter and LColor you have to compile
8028 with USE_PAINTER defined (do this in config.h f.ex.) There are
8029 still some rought edges, and I'd like some help to clear those
8030 out. It looks stable (loads and displays the Userguide very well).
8033 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8035 * src/buffer.C (pop_tag): revert to the previous implementation
8036 (use a global variable for both loops).
8038 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
8040 * src/lyxrc.C (LyXRC): change slightly default date format.
8042 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
8043 there is an English text with a footnote that starts with a Hebrew
8044 paragraph, or vice versa.
8045 (TeXFootnote): ditto.
8047 * src/text.C (LeftMargin): allow for negative values for
8048 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
8051 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
8052 for input encoding (cyrillic)
8054 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8056 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
8059 * src/toolbar.C (set): ditto
8060 * src/insets/insetbib.C (create_form_citation_form): ditto
8062 * lib/CREDITS: added Dekel Tsur.
8064 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
8065 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
8066 hebrew supports files from Dekel Tsur.
8068 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
8069 <tzafrir@technion.ac.il>
8071 * src/lyxrc.C: put \date_insert_format at the right place.
8073 * src/buffer.C (makeLaTeXFile): fix the handling of
8074 BufferParams::sides when writing out latex files.
8076 * src/BufferView2.C: add a "using" directive.
8078 * src/support/lyxsum.C (sum): when we use lyxstring,
8079 ostringstream::str needs an additional .c_str().
8081 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8083 * src/support/filetools.C (ChangeExtension): patch from Etienne
8086 * src/TextCache.C (show): remove const_cast and make second
8087 parameter non-const LyXText *.
8089 * src/TextCache.h: use non const LyXText in show.
8091 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
8094 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8096 * src/support/lyxsum.C: rework to be more flexible.
8098 * several places: don't check if a pointer is 0 if you are going
8101 * src/text.C: remove some dead code.
8103 * src/insets/figinset.C: remove some dead code
8105 * src/buffer.C: move the BufferView funcs to BufferView2.C
8106 remove all support for insetlatexdel
8107 remove support for oldpapersize stuff
8108 made some member funcs const
8110 * src/kbmap.C: use a std::list to store the bindings in.
8112 * src/BufferView2.C: new file
8114 * src/kbsequence.[Ch]: new files
8116 * src/LyXAction.C + others: remove all trace of buffer-previous
8118 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
8119 only have one copy in the binary of this table.
8121 * hebrew patch: moved some functions from LyXText to more
8122 appropriate places. (LyXParagraph, BufferParams, LyXFont)
8124 * several files: remove support for XForms older than 0.88
8126 remove some #if 0 #endif code
8128 * src/TextCache.[Ch]: new file. Holds the textcache.
8130 * src/BufferView.C: changes to use the new TextCache interface.
8131 (waitForX): remove the now unused code.
8133 * src/BackStack.h: remove some commented code
8135 * lib/bind/emacs.bind: remove binding for buffer-previous
8137 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8139 * applied the hebrew patch.
8141 * src/lyxrow.h: make sure that all Row variables are initialized.
8143 * src/text2.C (TextHandleUndo): comment out a delete, this might
8144 introduce a memory leak, but should also help us to not try to
8145 read freed memory. We need to look at this one.
8147 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
8148 (LyXParagraph): initalize footnotekind.
8150 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
8151 forgot this when applying the patch. Please heed the warnings.
8153 * src/BufferView.C (buffer): a fix for the buffer-reload problem
8154 (aka. reformat problem)
8156 * src/bufferlist.C (exists): made const, and use const_iterator
8157 (isLoaded): new func.
8158 (release): use std::find to find the correct buffer.
8160 * src/bufferlist.h: made getState a const func.
8161 made empty a const func.
8162 made exists a const func.
8165 2000-02-01 Juergen Vigna <jug@sad.it>
8167 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
8169 * po/it.po: updated a bit the italian po file and also changed the
8170 'file nuovo' for newfile to 'filenuovo' without a space, this did
8173 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
8174 for the new insert_date command.
8176 * src/lyxfunc.C (Dispatch): added support for a insert_date function
8177 from jdblair, to insert a date into the current text conforming to
8178 a strftime format (for now only considering the locale-set and not
8179 the document-language).
8181 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8183 * src/lyxfont.C (textWidth): hopefully better fix for the Array
8184 Bounds Read error seen by purify. The problem was that islower is
8185 a macros which takes an unsigned char and uses it as an index for
8186 in array of characters properties (and is thus subject to the
8190 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
8191 correctly the paper sides radio buttons.
8192 (UpdateDocumentButtons): ditto.
8194 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8196 * src/kbmap.C (getsym + others): change to return unsigned int,
8197 returning a long can give problems on 64 bit systems. (I assume
8198 that int is 32bit on 64bit systems)
8200 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8202 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
8203 LyXLookupString to be zero-terminated. Really fixes problems seen
8206 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8208 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
8209 write a (char*)0 to the lyxerr stream.
8211 * src/lastfiles.C: move algorithm before the using statemets.
8213 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8215 * src/lastfiles.C: move using directives in global scope (egcs 1.x
8216 complains otherwise).
8217 * src/table.C: ditto
8219 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
8222 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
8223 that I removed earlier... It is really needed.
8225 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
8227 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8229 * INSTALL: update xforms home page URL.
8231 * lib/configure.m4: fix a bug with unreadable layout files.
8233 * src/table.C (calculate_width_of_column): add "using std::max"
8236 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8238 * several files: marked several lines with "DEL LINE", this is
8239 lines that can be deleted without changing anything.
8240 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
8241 checks this anyway */
8244 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
8246 * src/DepTable.C (update): add a "+" at the end when the checksum
8247 is different. (debugging string only)
8249 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
8250 the next inset to not be displayed. This should also fix the list
8251 of labels in the "Insert Crossreference" dialog.
8253 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8255 * src/support/LSubstring.C (LSubstring): set pos to string::npos
8256 when regex was not found.
8258 * src/support/lstrings.C (lowercase): use handcoded transform always.
8261 * src/text.C (Delete): fixed the crash. cursor.par->prev and
8262 old_cursor.par->prev could be 0.
8264 * several files: changed post inc/dec to pre inc/dec
8266 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
8267 write the lastfiles to file.
8269 * src/BufferView.C (buffer): only show TextCache info when debugging
8271 (resizeCurrentBuffer): ditto
8272 (workAreaExpose): ditto
8274 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
8276 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
8278 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
8279 a bit better by removing the special case for \i and \j.
8281 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8283 * src/lyx_main.C (easyParse): remove test for bad comand line
8284 options, since this broke all xforms-related parsing.
8286 * src/kbmap.C (getsym): set return type to unsigned long, as
8287 declared in header. On an alpha, long is _not_ the same as int.
8289 * src/support/LOstream.h: add a "using std::flush;"
8291 * src/insets/figinset.C: ditto.
8293 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8295 * src/bufferlist.C (write): use blinding fast file copy instead of
8296 "a char at a time", now we are doing it the C++ way.
8298 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
8299 std::list<int> instead.
8300 (addpidwait): reflect move to std::list<int>
8301 (sigchldchecker): ditto
8303 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
8306 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
8307 that obviously was wrong...
8309 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
8310 c, this avoids warnings with purify and islower.
8312 * src/insets/figinset.C: rename struct queue to struct
8313 queue_element and rewrite to use a std::queue. gsqueue is now a
8314 std::queue<queue_element>
8315 (runqueue): reflect move to std::queue
8318 * src/support/lstrings.h (tostr): specialize for bool, otherwise
8319 we would get "1" "0" instead of "true" "false. Also make the tostr
8322 2000-01-21 Juergen Vigna <jug@sad.it>
8324 * src/buffer.C (writeFileAscii): Disabled code for special groff
8325 handling of tabulars till I fix this in table.C
8327 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8329 * src/support/mkdir.C (mkdir): change second argument of mkdir to
8331 * src/support/lyxlib.h: ditto.
8333 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8335 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
8336 and 'j' look better. This might fix the "macron" bug that has been
8339 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
8340 functions as one template function. Delete the old versions.
8342 * src/support/lyxsum.C: move using std::ifstream inside
8345 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
8348 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
8350 * src/mathed/formula.C: delete #include "bufferlist.h" never used
8352 * src/insets/figinset.C (InitFigures): use new instead of malloc
8353 to allocate memory for figures and bitmaps.
8354 (DoneFigures): use delete[] instead of free to deallocate memory
8355 for figures and bitmaps.
8356 (runqueue): use new to allocate
8357 (getfigdata): use new/delete[] instead of malloc/free
8358 (RegisterFigure): ditto
8360 * some files: moved some declarations closer to first use, small
8361 whitespace changes use preincrement instead of postincrement where
8362 it does not make a difference.
8364 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
8365 step on the way to use stl::containers for key maps.
8367 * src/bufferlist.h: add a typedef for const_iterator and const
8368 versions of begin and end.
8370 * src/bufferlist.[Ch]: change name of member variable _state to
8371 state_. (avoid reserved names)
8373 (getFileNames): returns the filenames of the buffers in a vector.
8375 * configure.in (ALL_LINGUAS): added ro
8377 * src/support/putenv.C: new file
8379 * src/support/mkdir.C: new file
8381 2000-01-20 Allan Rae <rae@lyx.org>
8383 * lib/layouts/IEEEtran.layout: Added several theorem environments
8385 * lib/templates/IEEEtran.lyx: Example theorem environments and a
8386 couple of minor additions.
8388 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
8389 (except for those in footnotes of course)
8391 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8393 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
8395 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
8396 std::sort and std::lower_bound instead of qsort and handwritten
8398 (struct compara): struct that holds the functors used by std::sort
8399 and std::lower_bound in MathedLookupBOP.
8401 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8403 * src/support/LAssert.h: do not do partial specialization. We do
8406 * src/support/lyxlib.h: note that lyx::getUserName() and
8407 lyx::date() are not in use right now. Should these be suppressed?
8409 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
8410 (makeLinuxDocFile): do not put date and user name in linuxdoc
8413 * src/support/lyxlib.h (kill): change first argument to long int,
8414 since that's what solaris uses.
8416 * src/support/kill.C (kill): fix declaration to match prototype.
8418 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
8419 actually check whether namespaces are supported. This is not what
8422 * src/support/lyxsum.C: add a using directive.
8424 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8426 * src/support/kill.C: if we have namespace support we don't have
8427 to include lyxlib.h.
8429 * src/support/lyxlib.h: use namespace lyx if supported.
8431 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8433 * src/support/date.C: new file
8435 * src/support/chdir.C: new file
8437 * src/support/getUserName.C: new file
8439 * src/support/getcwd.C: new file
8441 * src/support/abort.C: new file
8443 * src/support/kill.C: new file
8445 * src/support/lyxlib.h: moved all the functions in this file
8446 insede struct lyx. Added also kill and abort to this struct. This
8447 is a way to avoid the "kill is not defined in <csignal>", we make
8448 C++ wrappers for functions that are not ANSI C or ANSI C++.
8450 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
8451 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
8452 lyx it has been renamed to sum.
8454 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8456 * src/text.C: add using directives for std::min and std::max.
8458 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8460 * src/texrow.C (getIdFromRow): actually return something useful in
8461 id and pos. Hopefully fixes the bug with positionning of errorbox
8464 * src/lyx_main.C (easyParse): output an error and exit if an
8465 incorrect command line option has been given.
8467 * src/spellchecker.C (ispell_check_word): document a memory leak.
8469 * src/bufferlist.C (write): fix mismatched allocation/deletion,
8470 where a "struct utimbuf" is allocated with "new" and deleted with
8473 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8475 * src/text2.C (CutSelection): don't delete double spaces.
8476 (PasteSelection): ditto
8477 (CopySelection): ditto
8479 * src/text.C (Backspace): don't delete double spaces.
8481 * src/lyxlex.C (next): fix a bug that were only present with
8482 conformant std::istream::get to read comment lines, use
8483 std::istream::getline instead. This seems to fix the problem.
8485 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8487 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
8488 allowed to insert space before space" editing problem. Please read
8489 commends at the beginning of the function. Comments about usage
8492 * src/text.C (InsertChar): fix for the "not allowed to insert
8493 space before space" editing problem.
8495 * src/text2.C (DeleteEmptyParagraphMechanism): when
8496 IsEmptyTableRow can only return false this last "else if" will
8497 always be a no-op. Commented out.
8499 * src/text.C (RedoParagraph): As far as I can understand tmp
8500 cursor is not really needed.
8502 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
8503 present it could only return false anyway.
8504 (several functions): Did something not so smart...added a const
8505 specifier on a lot of methods.
8507 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
8508 and add a tmp->text.resize. The LyXParagraph constructor does the
8510 (BreakParagraphConservative): ditto
8512 * src/support/path.h (Path): add a define so that the wrong usage
8513 "Path("/tmp") will be flagged as a compilation error:
8514 "`unnamed_Path' undeclared (first use this function)"
8516 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8518 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
8519 which was bogus for several reasons.
8521 * src/LaTeX.C (scanAux): fix the regular expression used to scan
8525 * autogen.sh: do not use "type -path" (what's that anyway?).
8527 * src/support/filetools.C (findtexfile): remove extraneous space
8528 which caused a kpsewhich warning (at least with kpathsea version
8531 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8533 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
8535 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
8537 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
8539 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8541 * src/paragraph.C (BreakParagraph): do not reserve space on text
8542 if we don't need to (otherwise, if pos_end < pos, we end up
8543 reserving huge amounts of memory due to bad unsigned karma).
8544 (BreakParagraphConservative): ditto, although I have not seen
8545 evidence the bug can happen here.
8547 * src/lyxparagraph.h: add a using std::list.
8549 2000-01-11 Juergen Vigna <jug@sad.it>
8551 * src/menus.C (MenuDocu): output an Alert if the documentation-file
8554 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8556 * src/vc-backend.C (doVCCommand): change to be static and take one
8557 more parameter: the path to chdir too be fore executing the command.
8558 (retrive): new function equiv to "co -r"
8560 * src/bufferlist.C (loadLyXFile): implement the missing parts if
8561 file_not_found_hook is true.
8563 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
8565 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
8566 if a file is readwrite,readonly...anything else.
8568 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8570 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
8571 (CreatePostscript): name change from MenuRunDVIPS (or something)
8572 (PreviewPostscript): name change from MenuPreviewPS
8573 (PreviewDVI): name change from MenuPreviewDVI
8575 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
8576 \view_pdf_command., \pdf_to_ps_command
8578 * lib/configure.m4: added search for PDF viewer, and search for
8579 PDF to PS converter.
8580 (lyxrc.defaults output): add \pdflatex_command,
8581 \view_pdf_command and \pdf_to_ps_command.
8583 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
8585 * src/bufferlist.C (write): we don't use blocksize for anything so
8588 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8590 * src/support/block.h: disable operator T* (), since it causes
8591 problems with both compilers I tried. See comments in the file.
8593 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
8596 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
8597 variable LYX_DIR_10x to LYX_DIR_11x.
8599 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
8601 * INSTALL: document --with-lyxname.
8604 * configure.in: new configure flag --with-lyxname which allows to
8605 choose the name under which lyx is installed. Default is "lyx", of
8606 course. It used to be possible to do this with --program-suffix,
8607 but the later has in fact a different meaning for autoconf.
8609 * src/support/lstrings.h (lstrchr): reformat a bit.
8611 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
8612 * src/mathed/math_defs.h: ditto.
8614 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8616 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
8617 true, decides if we create a backup file or not when saving. New
8618 tag and variable \pdf_mode, defaults to false. New tag and
8619 variable \pdflatex_command, defaults to pdflatex. New tag and
8620 variable \view_pdf_command, defaults to xpdf. New tag and variable
8621 \pdf_to_ps_command, defaults to pdf2ps.
8623 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8625 * src/bufferlist.C (close): don't call insetUnlock if the buffer
8626 does not have a BufferView.
8627 (unlockInset): ditto + don't access the_locking_inset if the
8628 buffer does not have a BufferView.
8630 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
8631 certain circumstances so that we don't continue a keyboard
8632 operation long after the key was released. Try f.ex. to load a
8633 large document, press PageDown for some seconds and then release
8634 it. Before this change the document would contine to scroll for
8635 some time, with this change it stops imidiatly.
8637 * src/support/block.h: don't allocate more space than needed. As
8638 long as we don't try to write to the arr[x] in a array_type arr[x]
8639 it is perfectly ok. (if you write to it you might segfault).
8640 added operator value_type*() so that is possible to pass the array
8641 to functions expecting a C-pointer.
8643 * lib/Makefile.am (dist-hook): don't fail completely if unable to
8646 * intl/*: updated to gettext 0.10.35, tried to add our own
8647 required modifications. Please verify.
8649 * po/*: updated to gettext 0.10.35, tried to add our own required
8650 modifications. Please verify.
8652 * src/support/lstrings.C (tostr): go at fixing the problem with
8653 cxx and stringstream. When stringstream is used return
8654 oss.str().c_str() so that problems with lyxstring and basic_string
8655 are avoided. Note that the best solution would be for cxx to use
8656 basic_string all the way, but it is not conformant yet. (it seems)
8658 * src/lyx_cb.C + other files: moved several global functions to
8659 class BufferView, some have been moved to BufferView.[Ch] others
8660 are still located in lyx_cb.C. Code changes because of this. (part
8661 of "get rid of current_view project".)
8663 * src/buffer.C + other files: moved several Buffer functions to
8664 class BufferView, the functions are still present in buffer.C.
8665 Code changes because of this.
8667 * config/lcmessage.m4: updated to most recent. used when creating
8670 * config/progtest.m4: updated to most recent. used when creating
8673 * config/gettext.m4: updated to most recent. applied patch for
8676 * config/gettext.m4.patch: new file that shows what changes we
8677 have done to the local copy of gettext.m4.
8679 * config/libtool.m4: new file, used in creation of acinclude.m4
8681 * config/lyxinclude.m4: new file, this is the lyx created m4
8682 macros, used in making acinclude.m4.
8684 * autogen.sh: GNU m4 discovered as a separate task not as part of
8685 the lib/configure creation.
8686 Generate acinlucde from files in config. Actually cat
8687 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
8688 easier to upgrade .m4 files that really are external.
8690 * src/Spacing.h: moved using std::istringstream to right after
8691 <sstream>. This should fix the problem seen with some compilers.
8693 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8695 * src/lyx_cb.C: began some work to remove the dependency a lot of
8696 functions have on BufferView::text, even if not really needed.
8697 (GetCurrentTextClass): removed this func, it only hid the
8700 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
8701 forgot this in last commit.
8703 * src/Bullet.C (bulletEntry): use static char const *[] for the
8704 tables, becuase of this the return arg had to change to string.
8706 (~Bullet): removed unneeded destructor
8708 * src/BufferView.C (beforeChange): moved from lyx_cb.C
8709 (insetSleep): moved from Buffer
8710 (insetWakeup): moved from Buffer
8711 (insetUnlock): moved from Buffer
8713 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
8714 from Buffer to BufferView.
8716 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
8718 * config/ltmain.sh: updated to version 1.3.4 of libtool
8720 * config/ltconfig: updated to version 1.3.4 of libtool
8722 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8725 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
8726 Did I get that right?
8728 * src/lyxlex.h: add a "using" directive or two.
8729 * src/Spacing.h: ditto.
8730 * src/insets/figinset.C: ditto.
8731 * src/support/filetools.C: ditto.
8732 * src/support/lstrings.C: ditto.
8733 * src/BufferView.C: ditto.
8734 * src/bufferlist.C: ditto.
8735 * src/lyx_cb.C: ditto.
8736 * src/lyxlex.C: ditto.
8738 * NEWS: add some changes for 1.1.4.
8740 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8742 * src/BufferView.C: first go at a TextCache to speed up switching
8745 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8747 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
8748 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
8749 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
8750 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
8753 * src/mathed/math_defs.h (MathedRowSt): make sure that all
8754 members of the struct are correctly initialized to 0 (detected by
8756 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
8757 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
8759 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
8760 pidwait, since it was allocated with "new". This was potentially
8761 very bad. Thanks to Michael Schmitt for running purify for us.
8764 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8766 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
8768 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
8770 1999-12-30 Allan Rae <rae@lyx.org>
8772 * lib/templates/IEEEtran.lyx: minor change
8774 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
8775 src/mathed/formula.C (LocalDispatch): askForText changes
8777 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
8778 know when a user has cancelled input. Fixes annoying problems with
8779 inserting labels and version control.
8781 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8783 * src/support/lstrings.C (tostr): rewritten to use strstream and
8786 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8788 * src/support/filetools.C (IsFileWriteable): use fstream to check
8789 (IsDirWriteable): use fileinfo to check
8791 * src/support/filetools.h (FilePtr): whole class deleted
8793 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
8795 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
8797 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
8799 * src/bufferlist.C (write): use ifstream and ofstream instead of
8802 * src/Spacing.h: use istrstream instead of sscanf
8804 * src/mathed/math_defs.h: change first arg to istream from FILE*
8806 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
8808 * src/mathed/math_parser.C: have yyis to be an istream
8809 (LexGetArg): use istream (yyis)
8811 (mathed_parse): ditto
8812 (mathed_parser_file): first arg istream instead of FILE*, set yyis
8814 * src/mathed/formula.C (Read): rewritten to use istream
8816 * src/mathed/formulamacro.C (Read): rewritten to use istream
8818 * src/lyxlex.h (~LyXLex): deleted desturctor
8819 (getStream): new function, returns an istream
8820 (getFile): deleted funtion
8821 (IsOK): return is.good();
8823 * src/lyxlex.C (LyXLex): delete file and owns_file
8824 (setFile): open an filebuf and assign that to a istream instead of
8826 (setStream): new function, takes an istream as arg.
8827 (setFile): deleted function
8828 (EatLine): rewritten us use istream instead of FILE*
8832 * src/table.C (LyXTable): use istream instead of FILE*
8833 (Read): rewritten to take an istream instead of FILE*
8835 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8837 * src/buffer.C (Dispatch): remove an extraneous break statement.
8839 * src/support/filetools.C (QuoteName): change to do simple
8840 'quoting'. More work is necessary. Also changed to do nothing
8841 under emx (needs fix too).
8842 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
8844 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
8845 config.h.in to the AC_DEFINE_UNQUOTED() call.
8846 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
8847 needs char * as argument (because Solaris 7 declares it like
8850 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
8851 remove definition of BZERO.
8853 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8855 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
8856 defined, "lyxregex.h" if not.
8858 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
8860 (REGEX): new variable that is set to regex.c lyxregex.h when
8861 AM_CONDITIONAL USE_REGEX is set.
8862 (libsupport_la_SOURCES): add $(REGEX)
8864 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
8867 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
8870 * configure.in: add call to LYX_REGEX
8872 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
8873 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
8875 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8877 * lib/bind/fi_menus.bind: new file, from
8878 pauli.virtanen@saunalahti.fi.
8880 * src/buffer.C (getBibkeyList): pass the parameter delim to
8881 InsetInclude::getKeys and InsetBibtex::getKeys.
8883 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
8884 is passed to Buffer::getBibkeyList
8886 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
8887 instead of the hardcoded comma.
8889 * src/insets/insetbib.C (getKeys): make sure that there are not
8890 leading blanks in bibtex keys. Normal latex does not care, but
8891 harvard.sty seems to dislike blanks at the beginning of citation
8892 keys. In particular, the retturn value of the function is
8894 * INSTALL: make it clear that libstdc++ is needed and that gcc
8895 2.7.x probably does not work.
8897 * src/support/filetools.C (findtexfile): make debug message go to
8899 * src/insets/insetbib.C (getKeys): ditto
8901 * src/debug.C (showTags): make sure that the output is correctly
8904 * configure.in: add a comment for TWO_COLOR_ICON define.
8906 * acconfig.h: remove all the entries that already defined in
8907 configure.in or acinclude.m4.
8909 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
8910 to avoid user name, date and copyright.
8912 1999-12-21 Juergen Vigna <jug@sad.it>
8914 * src/table.C (Read): Now read bogus row format informations
8915 if the format is < 5 so that afterwards the table can
8916 be read by lyx but without any format-info. Fixed the
8917 crash we experienced when not doing this.
8919 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8921 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
8922 (RedoDrawingOfParagraph): ditto
8923 (RedoParagraphs): ditto
8924 (RemoveTableRow): ditto
8926 * src/text.C (Fill): rename arg paperwidth -> paper_width
8928 * src/buffer.C (insertLyXFile): rename var filename -> fname
8929 (writeFile): rename arg filename -> fname
8930 (writeFileAscii): ditto
8931 (makeLaTeXFile): ditto
8932 (makeLinuxDocFile): ditto
8933 (makeDocBookFile): ditto
8935 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
8938 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
8940 * src/bmtable.h: add extern "C" on this file when __cplusplus is
8943 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
8944 compiled by a C compiler not C++.
8946 * src/layout.h (LyXTextClass): added typedef for const_iterator
8947 (LyXTextClassList): added typedef for const_iterator + member
8948 functions begin and end.
8950 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
8951 iterators to fill the choice_class.
8952 (updateLayoutChoice): rewritten to use iterators to fill the
8953 layoutlist in the toolbar.
8955 * src/BufferView.h (BufferView::work_area_width): removed unused
8958 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
8960 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
8961 (sgmlCloseTag): ditto
8963 * src/support/lstrings.h: return type of countChar changed to
8966 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
8967 what version of this func to use. Also made to return unsigned int.
8969 * configure.in: call LYX_STD_COUNT
8971 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
8972 conforming std::count.
8974 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8976 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
8977 and a subscript would give bad display (patch from Dekel Tsur
8978 <dekel@math.tau.ac.il>).
8980 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
8982 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
8985 * src/chset.h: add a few 'using' directives
8987 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
8988 triggered when no buffer is active
8990 * src/layout.C: removed `break' after `return' in switch(), since
8993 * src/lyx_main.C (init): make sure LyX can be ran in place even
8994 when libtool has done its magic with shared libraries. Fix the
8995 test for the case when the system directory has not been found.
8997 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
8998 name for the latex file.
8999 (MenuMakeHTML): ditto
9001 * src/buffer.h: add an optional boolean argument, which is passed
9004 1999-12-20 Allan Rae <rae@lyx.org>
9006 * lib/templates/IEEEtran.lyx: small correction and update.
9008 * configure.in: Attempted to use LYX_PATH_HEADER
9010 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
9012 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
9013 input from JMarc. Now use preprocessor to find the header.
9014 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
9015 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
9016 LYX_STL_STRING_FWD. See comments in file.
9018 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
9020 * The global MiniBuffer * minibuffer variable is dead.
9022 * The global FD_form_main * fd_form_main variable is dead.
9024 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9026 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
9028 * src/table.h: add the LOstream.h header
9029 * src/debug.h: ditto
9031 * src/LyXAction.h: change the explaination of the ReadOnly
9032 attribute: is indicates that the function _can_ be used.
9034 * src/LyXAction.C (init): find-replace _can_ be used in read-only
9037 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9039 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
9045 * src/paragraph.C (GetWord): assert on pos>=0
9048 * src/support/lyxstring.C: condition the use of an invariant on
9050 * src/support/lyxstring.h: ditto
9052 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
9053 Use LAssert.h instead of plain assert().
9055 * src/support/lstrings.h: add LAssert.h, in case it is needed.
9057 * src/lyxfunc.C: do not include LAssert.h, it is not used.
9058 * src/support/filetools.C: ditto
9060 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
9063 * INSTALL: document the new configure flags
9065 * configure.in: suppress --with-debug; add --enable-assertions
9067 * acinclude.m4: various changes in alignment of help strings.
9069 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9071 * src/kbmap.C: commented out the use of the hash map in kb_map,
9072 beginning of movement to a stl::container.
9074 * several files: removed code that was not in effect when
9075 MOVE_TEXT was defined.
9077 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
9078 for escaping should not be used. We can discuss if the string
9079 should be enclosed in f.ex. [] instead of "".
9081 * src/trans_mgr.C (insert): use the new returned value from
9082 encodeString to get deadkeys and keymaps done correctly.
9084 * src/chset.C (encodeString): changed to return a pair, to tell
9085 what to use if we know the string.
9087 * src/lyxscreen.h (fillArc): new function.
9089 * src/FontInfo.C (resize): rewritten to use more std::string like
9090 structore, especially string::replace.
9092 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
9095 * configure.in (chmod +x some scripts): remove config/gcc-hack
9097 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9099 * src/buffer.C (writeFile): change once again the top comment in a
9100 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
9101 instead of an hardcoded version number.
9102 (makeDocBookFile): ditto
9104 * src/version.h: add new define LYX_DOCVERSION
9106 * po/de.po: update from Pit Sütterlin
9107 * lib/bind/de_menus.bind: ditto.
9109 * src/lyxfunc.C (Dispatch): call MenuExport()
9110 * src/buffer.C (Dispatch): ditto
9112 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
9113 LyXFunc::Dispatch().
9114 (MenuExport): new function, moved from
9115 LyXFunc::Dispatch().
9117 * src/trans_mgr.C (insert): small cleanup
9118 * src/chset.C (loadFile): ditto
9120 * lib/kbd/iso8859-1.cdef: add missing backslashes
9122 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9124 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
9125 help with placing the manually drawn accents better.
9127 (Draw): x2 and hg changed to float to minimize rounding errors and
9128 help place the accents better.
9130 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
9131 unsigned short to char is just wrong...cast the char to unsigned
9132 char instead so that the two values can compare sanely. This
9133 should also make the display of insetlatexaccents better and
9134 perhaps also some other insets.
9136 (lbearing): new function
9139 1999-12-15 Allan Rae <rae@lyx.org>
9141 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
9142 header that provides a wrapper around the very annoying SGI STL header
9145 * src/support/lyxstring.C, src/LString.h:
9146 removed old SGI-STL-compatability attempts.
9148 * configure.in: Use LYX_STL_STRING_FWD.
9150 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
9151 stl_string_fwd.h is around and try to determine it's location.
9152 Major improvement over previous SGI STL 3.2 compatability.
9153 Three small problems remain with this function due to my zero
9154 knowledge of autoconf. JMarc and lgb see the comments in the code.
9156 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9158 * src/broken_const.h, config/hack-gcc, config/README: removed
9160 * configure.in: remove --with-gcc-hack option; do not call
9163 * INSTALL: remove documentation of --with-broken-const and
9166 * acconfig.h: remove all trace of BROKEN_CONST define
9168 * src/buffer.C (makeDocBookFile): update version number in output
9170 (SimpleDocBookOnePar): fix an assert when trying to a character
9171 access beyond string length
9174 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9176 * po/de.po: fix the Export menu
9178 * lyx.man: update the description of -dbg
9180 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
9181 (commandLineHelp): updated
9182 (easyParse): show list of available debug levels if -dbg is passed
9185 * src/Makefile.am: add debug.C
9187 * src/debug.h: moved some code to debug.C
9189 * src/debug.C: new file. Contains code to set and show debug
9192 * src/layout.C: remove 'break' after 'continue' in switch
9193 statements, since these cannot be reached.
9195 1999-12-13 Allan Rae <rae@lyx.org>
9197 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
9198 (in_word_set): hash() -> math_hash()
9200 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
9202 * acconfig.h: Added a test for whether we are using exceptions in the
9203 current compilation run. If so USING_EXCEPTIONS is defined.
9205 * config.in: Check for existance of stl_string_fwd.h
9206 * src/LString.h: If compiling --with-included-string and SGI's
9207 STL version 3.2 is present (see above test) we need to block their
9208 forward declaration of string and supply a __get_c_string().
9209 However, it turns out this is only necessary if compiling with
9210 exceptions enabled so I've a bit more to add yet.
9212 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
9213 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
9214 src/support/LRegex.h, src/undo.h:
9215 Shuffle the order of the included files a little to ensure that
9216 LString.h gets included before anything that includes stl_string_fwd.h
9218 * src/support/lyxstring.C: We need to #include LString.h instead of
9219 lyxstring.h to get the necessary definition of __get_c_string.
9220 (__get_c_string): New function. This is defined static just like SGI's
9221 although why they need to do this I'm not sure. Perhaps it should be
9222 in lstrings.C instead.
9224 * lib/templates/IEEEtran.lyx: New template file.
9226 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9228 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
9229 * intl/Makefile.in (MKINSTALLDIRS): ditto
9231 * src/LyXAction.C (init): changed to hold the LFUN data in a
9232 automatic array in stead of in callso to newFunc, this speeds up
9233 compilation a lot. Also all the memory used by the array is
9234 returned when the init is completed.
9236 * a lot of files: compiled with -Wold-style-cast, changed most of
9237 the reported offenders to C++ style casts. Did not change the
9238 offenders in C files.
9240 * src/trans.h (Match): change argument type to unsigned int.
9242 * src/support/DebugStream.C: fix some types on the streambufs so
9243 that it works on a conforming implementation.
9245 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9247 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
9249 * src/support/lyxstring.C: remove the inline added earlier since
9250 they cause a bunch of unsatisfied symbols when linking with dec
9251 cxx. Cxx likes to have the body of inlines at the place where they
9254 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
9255 accessing negative bounds in array. This fixes the crash when
9256 inserting accented characters.
9257 * src/trans.h (Match): ditto
9259 * src/buffer.C (Dispatch): since this is a void, it should not try
9260 to return anything...
9262 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9264 * src/buffer.h: removed the two friends from Buffer. Some changes
9265 because of this. Buffer::getFileName and Buffer::setFileName
9266 renamed to Buffer::fileName() and Buffer::fileName(...).
9268 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9270 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
9271 and Buffer::update(short) to BufferView. This move is currently
9272 controlled by a define MOVE_TEXT, this will be removed when all
9273 shows to be ok. This move paves the way for better separation
9274 between buffer contents and buffer view. One side effect is that
9275 the BufferView needs a rebreak when swiching buffers, if we want
9276 to avoid this we can add a cache that holds pointers to LyXText's
9277 that is not currently in use.
9279 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
9282 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9284 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
9286 * lyx_main.C: new command line option -x (or --execute) and
9287 -e (or --export). Now direct conversion from .lyx to .tex
9288 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
9289 Unfortunately, X is still needed and the GUI pops up during the
9292 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9294 * src/Spacing.C: add a using directive to bring stream stuff into
9296 * src/paragraph.C: ditto
9297 * src/buffer.C: ditto
9299 * NEWS: updated a bit the new features of 1.1.3 (took a few things
9300 from Lars' announcement).
9302 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
9303 example files from Tino Meinen.
9305 1999-12-06 Allan Rae <rae@lyx.org>
9307 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
9309 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9311 * src/support/lyxstring.C: added a lot of inline for no good
9314 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
9315 latexWriteEndChanges, they were not used.
9317 * src/layout.h (operator<<): output operator for PageSides
9319 * src/mathed/math_iter.C (my_memcpy): slightly changed.
9321 * some example files: loaded in LyX 1.0.4 and saved again to update
9322 certain constructs (table format)
9324 * a lot of files: did the change to use fstream/iostream for all
9325 writing of files. Done with a close look at Andre Poenitz's patch.
9327 * some files: whitespace changes.
9329 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9331 * src/mathed/math_iter.C (my_memcpy): new function. Since the
9332 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
9333 architecture, we provide our own. It is used unconditionnally, but
9334 I do not think this is a performance problem. Thanks to Angus
9335 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
9336 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
9338 (GetInset): use my_memcpy.
9342 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
9343 it is easier to understand, but it uses less TeX-only constructs now.
9345 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
9346 elements contain spaces
9348 * lib/configure: regenerated
9350 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
9351 elements contain spaces; display the list of programs that are
9354 * autogen.sh: make sure lib/configure is executable
9356 * lib/examples/*: rename the tutorial examples to begin with the
9357 two-letters language code.
9359 * src/lyxfunc.C (getStatus): do not query current font if no
9362 * src/lyx_cb.C (RunScript): use QuoteName
9363 (MenuRunDvips): ditto
9364 (PrintApplyCB): ditto
9366 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
9367 around argument, so that it works well with the current shell.
9368 Does not work properly with OS/2 shells currently.
9370 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
9371 * src/LyXSendto.C (SendtoApplyCB): ditto
9372 * src/lyxfunc.C (Dispatch): ditto
9373 * src/buffer.C (runLaTeX): ditto
9374 (runLiterate): ditto
9375 (buildProgram): ditto
9377 * src/lyx_cb.C (RunScript): ditto
9378 (MenuMakeLaTeX): ditto
9380 * src/buffer.h (getLatexName): new method
9382 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
9384 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9386 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
9387 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
9388 (create_math_panel): ditto
9390 * src/lyxfunc.C (getStatus): re-activate the code which gets
9391 current font and cursor; add test for export to html.
9393 * src/lyxrc.C (read): remove unreachable break statements; add a
9396 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
9398 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9400 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
9401 introduced by faulty regex.
9402 * src/buffer.C: ditto
9403 * src/lastfiles.C: ditto
9404 * src/paragraph.C: ditto
9405 * src/table.C: ditto
9406 * src/vspace.C: ditto
9407 * src/insets/figinset.C: ditto
9408 Note: most of these is absolutely harmless, except the one in
9409 src/mathed formula.C.
9411 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9413 * src/ImportNoweb.C (documentclass): fixed bounds for substr
9414 operation, yielding correct results for the reLyX command.
9416 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9418 * src/support/filetools.C (ExpandPath): removed an over eager
9420 (ReplaceEnvironmentPath): ditto
9422 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
9423 shows that we are doing something fishy in our code...
9427 * src/lyxrc.C (read): use a double switch trick to get more help
9428 from the compiler. (the same trick is used in layout.C)
9429 (write): new function. opens a ofstream and pass that to output
9430 (output): new function, takes a ostream and writes the lyxrc
9431 elemts to it. uses a dummy switch to make sure no elements are
9434 * src/lyxlex.h: added a struct pushpophelper for use in functions
9435 with more than one exit point.
9437 * src/lyxlex.[Ch] (GetInteger): made it const
9441 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
9443 * src/layout.[hC] : LayoutTags splitted into several enums, new
9444 methods created, better error handling cleaner use of lyxlex. Read
9447 * src/bmtable.[Ch]: change some member prototypes because of the
9448 image const changes.
9450 * commandtags.h, src/LyXAction.C (init): new function:
9451 "preferences-save", saves the lyxrc entries into .lyx/preferences.
9452 This file is not read automatically but you can add \input
9453 preferences to your lyxrc if you want to. We need to discuss how
9456 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
9457 in .aux, also remove .bib and .bst files from dependencies when
9460 * src/BufferView.C, src/LyXView.C: add const_cast several places
9461 because of changes to images.
9463 * lib/images/*: same change as for images/*
9465 * lib/lyxrc.example: Default for accept_compound is false not no.
9467 * images/*: changed to be const, however I have som misgivings
9468 about this change so it might be changed back.
9470 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9472 * lib/configure, po/POTFILES.in: regenerated
9474 * autogen.sh: autogenerate lib/configure from lib/configure.m4
9476 * config/lib_configure.m4: removed
9478 * lib/configure.m4: new file (was config/lib_configure.m4)
9480 * configure.in: do not test for rtti, since we do not use it.
9482 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9484 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
9485 doubling of allocated space scheme. This makes it faster for large
9486 strings end to use less memory for small strings. xtra rememoved.
9488 * src/insets/figinset.C (waitalarm): commented out.
9489 (GhostscriptMsg): use static_cast
9490 (GhostscriptMsg): use new instead of malloc to allocate memory for
9491 cmap. also delete the memory after use.
9493 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
9495 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
9496 for changes in bibtex database or style.
9497 (runBibTeX): remove all .bib and .bst files from dep before we
9499 (run): use scanAuc in when dep file already exist.
9501 * src/DepTable.C (remove_files_with_extension): new method
9504 * src/DepTable.[Ch]: made many of the methods const.
9506 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9508 * src/bufferparams.C: make sure that the default textclass is
9509 "article". It used to be the first one by description order, but
9510 now the first one is "docbook".
9512 * src/lyx_main.C (setDebuggingLevel): change type of argument to
9513 string; call Debug::value.
9514 (easyParse): pass complete argument to setDebuggingLevel().
9516 * src/debug.h (value): fix the code that parses debug levels.
9518 * src/debug.h: add new debug type ACTION, reserved for LyXAction
9521 * src/LyXAction.C: use Debug::ACTION as debug channel.
9523 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
9525 * NEWS: updated for the future 1.1.3 release.
9527 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
9528 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
9529 it should. This is of course a controversial change (since many
9530 people will find that their lyx workscreen is suddenly full of
9531 red), but done for the sake of correctness.
9533 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
9534 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
9536 * src/insets/inseterror.h, src/insets/inseturl.h,
9537 src/insets/insetinfo.h, src/insets/figinset.h,
9538 src/mathed/formulamacro.h, src/mathed/math_macro.h
9539 (EditMessage): add a missing const and add _() to make sure that
9542 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
9543 src/insets/insetbib.C, src/support/filetools.C: add `using'
9546 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
9547 doing 'Insert index of last word' at the beginning of a paragraph.
9549 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9551 * several files: white-space changes.
9553 * src/mathed/formula.C: removed IsAlpha and IsDigit
9555 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
9556 .bib file. use a ifstream instead of FilePtr when parsing the .bib
9559 * src/insets/figinset.C (GetPSSizes): don't break when
9560 "EndComments" is seen. But break when a boundingbox is read.
9562 * all classes inherited from Inset: return value of Clone
9563 changed back to Inset *.
9565 * all classes inherited form MathInset: return value of Clone
9566 changed back to MathedInset *.
9568 * src/insets/figinset.C (runqueue): use a ofstream to output the
9569 gs/ps file. Might need some setpresicion or setw. However I can
9570 see no problem with the current code.
9571 (runqueue): use sleep instead of the alarm/signal code. I just
9572 can't see the difference.
9574 * src/paragraph.C (LyXParagraph): reserve space in the new
9575 paragraph and resize the inserted paragraph to just fit.
9577 * src/lyxfunc.h (operator|=): added operator for func_status.
9579 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
9580 check for readable file.
9582 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
9583 check for readable file.
9584 (MenuMakeLinuxDoc): ditto
9585 (MenuMakeDocBook): ditto
9586 (MenuMakeAscii): ditto
9587 (InsertAsciiFile): split the test for openable and readable
9589 * src/bmtable.C (draw_bitmaptable): use
9590 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
9592 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
9593 findtexfile from LaTeX to filetools.
9595 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
9596 instead of FilePtr. Needs to be verified by a literate user.
9598 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9600 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
9601 (EditMessage): likewise.
9603 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
9604 respectively as \textasciitilde and \textasciicircum.
9606 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9608 * src/support/lyxstring.h: made the methods that take iterators
9611 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
9612 (regexMatch): made is use the real regex class.
9614 * src/support/Makefile.am: changed to use libtool
9616 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
9618 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
9620 (MathIsInset ++): changed several macros to be inline functions
9623 * src/mathed/Makefile.am: changed to use libtool
9625 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
9627 * src/insets/inset* : Clone changed to const and return type is
9628 the true insettype not just Inset*.
9630 * src/insets/Makefile.am: changed to use libtool
9632 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
9634 * src/undo.[Ch] : added empty() and changed some of the method
9637 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
9639 * src/lyxparagraph.h: use id() and id(...) instead of getID and
9640 setID use block<> for the bullets array, added const several places.
9642 * src/lyxfunc.C (getStatus): new function
9644 * src/lyxfunc.[Ch] : small changes to take advantage of the new
9645 LyXAction, added const to several funtions.
9647 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
9648 a std::map, and to store the dir items in a vector.
9650 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
9653 * src/LyXView.[Ch] + other files : changed currentView to view.
9655 * src/LyXAction.[Ch] : ported from the old devel branch.
9657 * src/.cvsignore: added .libs and a.out
9659 * configure.in : changes to use libtool.
9661 * acinclude.m4 : inserted libtool.m4
9663 * .cvsignore: added libtool
9665 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9667 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
9668 file name in insets and mathed directories (otherwise the
9669 dependency is not taken in account under cygwin).
9671 * src/text2.C (InsertString[AB]): make sure that we do not try to
9672 read characters past the string length.
9674 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9676 * lib/doc/LaTeXConfig.lyx.in,
9677 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
9679 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
9680 file saying who created them and when this heppened; this is
9681 useless and annoys tools like cvs.
9683 * lib/layouts/g-brief-{en,de}.layout,
9684 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
9685 from Thomas Hartkens <thomas@hartkens.de>.
9687 * src/{insets,mathed}/Makefile.am: do not declare an empty
9688 LDFLAGS, so that it can be set at configure time (useful on Irix
9691 * lib/reLyX/configure.in: make sure that the prefix is set
9692 correctly in LYX_DIR.
9694 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9696 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
9697 be used by 'command-sequence' this allows to bind a key to a
9698 sequence of LyX-commands
9699 (Example: 'command-sequence math-insert alpha; math-insert beta;")
9701 * src/LyXAction.C: add "command-sequence"
9703 * src/LyXFunction.C: handling of "command-sequence"
9705 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
9706 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
9708 * src/lyxserver.C, src/minibuffer.C: Use this new interface
9710 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9712 * src/buffer.C (writeFile): Do not output a comment giving user
9713 and date at the beginning of a .lyx file. This is useless and
9714 annoys cvs anyway; update version number to 1.1.
9716 * src/Makefile.am (LYX_DIR): add this definition, so that a
9717 default path is hardcoded in LyX.
9719 * configure.in: Use LYX_GNU_GETTEXT.
9721 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
9722 AM_GNU_GETTEXT with a bug fixed.
9724 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
9726 * src/chset.C: add "using std::ifstream;" to please dec cxx.
9728 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
9729 which is used to point to LyX data is now LYX_DIR_11x.
9731 * lyx.man: convert to a unix text file; small updates.
9733 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9735 * src/support/LSubstring.[Ch]: made the second arg of most of the
9736 constructors be a const reference.
9738 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
9741 * src/support/lyxstring.[Ch] (swap): added missing member function
9742 and specialization of swap(str, str);
9744 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
9746 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
9747 trace of the old one.
9749 * src/undo.[Ch]: made the undostack use std::list to store undo's in
9750 put the member definitions in undo.C.
9752 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
9753 NEW_TEXT and have now only code that was included when this was
9756 * src/intl.C (LCombo): use static_cast
9758 (DispatchCallback): ditto
9760 * src/definitions.h: removed whole file
9762 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
9764 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
9765 parsing and stores in a std:map. a regex defines the file format.
9766 removed unneeded members.
9768 * src/bufferparams.h: added several enums from definitions.h here.
9769 Removed unsused destructor. Changed some types to use proper enum
9770 types. use block to have the temp_bullets and user_defined_bullets
9771 and to make the whole class assignable.
9773 * src/bufferparams.C (Copy): removed this functions, use a default
9776 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
9779 * src/buffer.C (readLyXformat2): commend out all that have with
9780 oldpapersize to do. also comment out all that hve to do with
9781 insetlatex and insetlatexdel.
9782 (setOldPaperStuff): commented out
9784 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
9786 * src/LyXAction.C: remove use of inset-latex-insert
9788 * src/mathed/math_panel.C (button_cb): use static_cast
9790 * src/insets/Makefile.am (insets_o_SOURCES): removed
9793 * src/support/lyxstring.C (helper): use the unsigned long
9794 specifier, UL, instead of a static_cast.
9796 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
9798 * src/support/block.h: new file. to be used as a c-style array in
9799 classes, so that the class can be assignable.
9801 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9803 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
9804 NULL, make sure to return an empty string (it is not possible to
9805 set a string to NULL).
9807 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9809 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
9811 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
9813 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
9814 link line, so that Irix users (for example) can set it explicitely to
9817 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
9818 it can be overidden at make time (static or dynamic link, for
9821 * src/vc-backend.C, src/LaTeXFeatures.h,
9822 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
9823 statements to bring templates to global namespace.
9825 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9827 * src/support/lyxstring.C (operator[] const): make it standard
9830 * src/minibuffer.C (Init): changed to reflect that more
9831 information is given from the lyxvc and need not be provided here.
9833 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
9835 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
9837 * src/LyXView.C (UpdateTimerCB): use static_cast
9838 (KeyPressMask_raw_callback): ditto
9840 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
9841 buffer_, a lot of changes because of this. currentBuffer() ->
9842 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
9843 also changes to other files because of this.
9845 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9847 * src/vc-backend.[Ch]: new files. The backends for vc handling,
9848 have no support for RCS and partial support for CVS, will be
9851 * src/insets/ several files: changes because of function name
9852 changes in Bufferview and LyXView.
9854 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
9856 * src/support/LSubstring.[Ch]: new files. These implement a
9857 Substring that can be very convenient to use. i.e. is this
9859 string a = "Mary had a little sheep";
9860 Substring(a, "sheep") = "lamb";
9861 a is now "Mary has a little lamb".
9863 * src/support/LRegex.[Ch]: a regex class that can be used to pick
9864 out patterns and subpatterns of strings. It is used by LSubstring
9865 and also by vc-backend.C
9867 * src/support/lyxstring.C: went over all the assertions used and
9868 tried to correct the wrong ones and flag which of them is required
9869 by the standard. some bugs found because of this. Also removed a
9870 couple of assertions.
9872 * src/support/Makefile.am (libsupport_a_SOURCES): added
9873 LSubstring.[Ch] and LRegex.[Ch]
9875 * src/support/FileInfo.h: have struct stat buf as an object and
9876 not a pointer to one, some changes because of this.
9878 * src/LaTeXFeatures.C (getTClassPreamble): also use the
9879 information in layout when adding the layouts preamble to the
9882 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
9885 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
9886 because of bug in OS/2.
9888 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9890 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
9891 \verbatim@font instead of \ttfamily, so that it can be redefined.
9893 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
9894 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
9895 src/layout.h, src/text2.C: add 'using' directive to bring the
9896 STL templates we need from the std:: namespace to the global one.
9897 Needed by DEC cxx in strict ansi mode.
9899 * src/support/LIstream.h,src/support/LOstream.h,
9900 src/support/lyxstring.h,src/table.h,
9901 src/lyxlookup.h: do not include <config.h> in header
9902 files. This should be done in the .C files only.
9904 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
9908 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9910 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
9911 from Kayvan to fix the tth invokation.
9913 * development/lyx.spec.in: updates from Kayvan to reflect the
9914 changes of file names.
9916 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9918 * src/text2.C (InsertStringB): use std::copy
9919 (InsertStringA): use std::copy
9921 * src/bufferlist.C: use a vector to store the buffers in. This is
9922 an internal change and should not affect any other thing.
9924 * src/BufferView.C (waitForX): use XSync instead of the lengthy
9927 * src/text.C (Fill): fix potential bug, one off bug.
9929 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9931 * src/Makefile.am (lyx_main.o): add more files it depends on.
9933 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
9935 * src/support/lyxstring.C: use size_t for the reference count,
9936 size, reserved memory and xtra.
9937 (internal_compare): new private member function. Now the compare
9938 functions should work for std::strings that have embedded '\0'
9940 (compare): all compare functions rewritten to use
9943 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9945 * src/support/lyxstring.C (compare): pass c_str()
9946 (compare): pass c_str
9947 (compare): pass c_str
9949 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9951 * src/support/DebugStream.C: <config.h> was not included correctly.
9953 * lib/configure: forgot to re-generate it :( I'll make this file
9954 auto generated soon.
9956 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9958 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
9961 * src/support/lyxstring.C: some changes from length() to rep->sz.
9962 avoids a function call.
9964 * src/support/filetools.C (SpaceLess): yet another version of the
9965 algorithm...now per Jean-Marc's suggestions.
9967 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9969 * src/layout.C (less_textclass_desc): functor for use in sorting
9971 (LyXTextClass::Read): sort the textclasses after reading.
9973 * src/support/filetools.C (SpaceLess): new version of the
9974 SpaceLess functions. What problems does this one give? Please
9977 * images/banner_bw.xbm: made the arrays unsigned char *
9979 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9981 * src/support/lyxstring.C (find): remove bogus assertion in the
9982 two versions of find where this has not been done yet.
9984 * src/support/lyxlib.h: add missing int return type to
9987 * src/menus.C (ShowFileMenu): disable exporting to html if no
9988 html export command is present.
9990 * config/lib_configure.m4: add a test for an HTML converter. The
9991 programs checked for are, in this order: tth, latex2html and
9994 * lib/configure: generated from config/lib_configure.m4.
9996 * src/lyxfunc.C (Dispatch): update and improve the execution of an
9997 html converter. The parameters are now passed through $$FName and
9998 $$OutName, instead of standard input/output.
10000 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
10002 * lib/lyxrc.example: update description of \html_command.
10003 add "quotes" around \screen_font_xxx font setting examples to help
10004 people who use fonts with spaces in their names.
10006 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10008 * Distribution files: updates for v1.1.2
10010 * src/support/lyxstring.C (find): remove bogus assert and return
10011 npos for the same condition.
10013 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10015 * added patch for OS/2 from SMiyata.
10017 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10019 * src/text2.C (CutSelection): make space_wrapped a bool
10020 (CutSelection): dont declare int i until we have to.
10021 (alphaCounter): return a char const *.
10023 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10025 * src/support/syscall.C (Systemcalls::kill):
10026 src/support/filetools.C (PutEnv, PutEnvPath):
10027 src/lyx_cb.C (addNewlineAndDepth):
10028 src/FontInfo.C (FontInfo::resize): condition some #warning
10029 directives with WITH_WARNINGS.
10032 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10034 * src/layout.[Ch] + several files: access to class variables
10035 limited and made accessor functions instead a lot of code changed
10036 becuase of this. Also instead of returning pointers often a const
10037 reference is returned instead.
10039 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
10041 * src/Makefile.am (dist-hook): added used to remove the CVS from
10042 cheaders upon creating a dist
10043 (EXTRA_DIST): added cheaders
10045 * src/support/lstrings.C (tostr(char)): fix it to handle param as
10046 a character not as a small integer.
10048 * src/support/lyxstring.C (find): removed Assert and added i >=
10049 rep->sz to the first if.
10051 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10053 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
10054 src/LyXView.C src/buffer.C src/bufferparams.C
10055 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
10056 src/text2.C src/insets/insetinclude.C:
10057 lyxlayout renamed to textclasslist.
10059 * src/layout.C: some lyxerr changes.
10061 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
10062 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
10063 (LyXLayoutList): removed all traces of this class.
10064 (LyXTextClass::Read): rewrote LT_STYLE
10065 (LyXTextClass::hasLayout): new function
10066 (LyXTextClass::GetLayout): rewritten to return an iterator + has
10067 both const and nonconst version.
10068 (LyXTextClass::delete_layout): new function.
10069 (LyXTextClassList::Style): bug fix. do the right thing if layout
10071 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
10072 (LyXTextClassList::NameOfLayout): ditto
10073 (LyXTextClassList::Load): ditto
10075 * src/buffer.C (makeLaTeXFile): new access to layoutlist
10077 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
10079 * src/LyXAction.C (LookupFunc): added a workaround for sun
10080 compiler, on the other hand...we don't know if the current code
10081 compiles on sun at all...
10083 * src/support/filetools.C (CleanupPath): subst fix
10085 * src/insets/insetbib.C (delDatabase): subst fix, this looks
10088 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
10089 complained about this one?
10091 * src/insets/insetinclude.C (Latex): subst fix
10093 * src/insets/insetbib.C (getKeys): subst fix
10095 * src/LyXSendto.C (SendtoApplyCB): subst fix
10097 * src/lyx_main.C (init): subst fix
10099 * src/layout.C (Read): subst fix
10101 * src/lyx_sendfax_main.C (button_send): subst fix
10103 * src/buffer.C (RoffAsciiTable): subst fix
10105 * src/lyx_cb.C (MenuFax): subst fix
10106 (PrintApplyCB): subst fix
10108 1999-10-26 Juergen Vigna <jug@sad.it>
10110 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
10112 (Read): Cleaned up this code so now we read only format vestion >= 5
10114 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10116 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
10117 come nobody has complained about this one?
10119 * src/insets/insetinclude.C (Latex): subst fix
10121 * src/insets/insetbib.C (getKeys): subst fix
10123 * src/lyx_main.C (init): subst fix
10125 * src/layout.C (Read): subst fix
10127 * src/buffer.C (RoffAsciiTable): subst fix
10129 * src/lyx_cb.C (MenuFax): subst fix.
10131 * src/layout.[hC] + some other files: rewrote to use
10132 std::container to store textclasses and layouts in.
10133 Simplified, removed a lot of code. Make all classes
10134 assignable. Further simplifications and review of type
10135 use still to be one.
10137 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
10138 lastfiles to create the lastfiles partr of the menu.
10140 * src/lastfiles.[Ch]: rewritten to use deque to store the
10141 lastfiles in. Uses fstream for reading and writing. Simplifies
10144 * src/support/syscall.C: remove explicit cast.
10146 * src/BufferView.C (CursorToggleCB): removed code snippets that
10147 were commented out.
10148 use explicat C++ style casts instead of C style casts. also use
10149 u_vdata instea of passing pointers in longs.
10151 * src/PaperLayout.C: removed code snippets that were commented out.
10153 * src/lyx_gui_misc.C: removed code snippets that were commented out.
10155 * src/lyx_main.C: removed code snippets that wer commented out.
10157 * src/paragraph.C: removed code snippets that were commented out.
10159 * src/lyxvc.C (logClose): use static_cast
10161 (viewLog): remove explicit cast to void*
10162 (showLog): removed old commented code
10164 * src/menus.C: use static_cast instead of C style casts. use
10165 u_vdata instead of u_ldata. remove explicit cast to (long) for
10166 pointers. Removed old code that was commented out.
10168 * src/insets/inset.C: removed old commented func
10170 * src/insets/insetref.C (InsetRef): removed old code that had been
10171 commented out for a long time.
10173 (escape): removed C style cast
10175 * src/insets/insetlatexaccent.C (Draw): removed old commented code
10177 * src/insets/insetlatex.C (Draw): removed old commented code
10178 (Read): rewritten to use string
10180 * src/insets/insetlabel.C (escape): removed C style cast
10182 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
10184 * src/insets/insetindex.C: use static_cast and u_vdata, removed
10185 old commented code.
10187 * src/insets/insetinclude.h: removed a couple of stupid bools
10189 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
10190 (Clone): remove C style cast
10191 (getKeys): changed list to lst because of std::list
10193 * src/insets/inseterror.C (Draw): removed som old commented code.
10195 * src/insets/insetcommand.C (Draw): removed some old commented code.
10197 * src/insets/insetbib.C (bibitem_cb): removed code that has been
10198 commented out forever.
10199 (bibitem_cb): use static_cast instead of C style cast
10200 use of vdata changed to u_vdata.
10202 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
10204 (CloseUrlCB): use static_cast instead of C style cast.
10205 (CloseUrlCB): added a fl_free form...it seemed to be missing.
10207 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
10208 (C_InsetInfo_CloseInfoCB): forward the ob parameter
10209 (CloseInfoCB): static_cast from ob->u_vdata instead.
10210 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
10213 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
10214 (C_InsetError_CloseErrorCB): forward the ob parameter
10215 (CloseErrorCB): static_cast from ob->u_vdata instead.
10217 * src/vspace.h: include LString.h since we use string in this class.
10219 * src/vspace.C (lyx_advance): changed name from advance because of
10220 nameclash with stl. And since we cannot use namespaces yet...I
10221 used a lyx_ prefix instead. Expect this to change when we begin
10224 * src/BufferView.[Ch] (BufferView::~BufferView): removed
10226 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
10227 and removed now defunct constructor and deconstructor.
10229 * src/BufferView.h: have backstack as a object not as a pointer.
10230 removed initialization from constructor. added include for BackStack
10232 * development/lyx.spec.in (%build): add CFLAGS also.
10234 * src/screen.C (drawFrame): removed another warning.
10236 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10238 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
10239 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
10240 README and ANNOUNCE a bit for the next release. More work is
10243 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
10244 unbreakable if we are in freespacing mode (LyX-Code), but not in
10247 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10249 * src/BackStack.h: fixed initialization order in constructor
10251 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
10253 * acinclude.m4 (VERSION): new rules for when a version is
10254 development, added also a variable for prerelease.
10255 (warnings): we set with_warnings=yes for prereleases
10256 (lyx_opt): prereleases compile with same optimization as development
10257 (CXXFLAGS): only use pedantic if we are a development version
10259 * src/BufferView.C (restorePosition): don't do anything if the
10260 backstack is empty.
10262 * src/BackStack.h: added member empty, use this to test if there
10263 is anything to pop...
10265 1999-10-25 Juergen Vigna <jug@sad.it>
10268 * forms/layout_forms.fd +
10269 * forms/latexoptions.fd +
10270 * lyx.fd: changed for various form resize issues
10272 * src/mathed/math_panel.C +
10273 * src/insets/inseterror.C +
10274 * src/insets/insetinfo.C +
10275 * src/insets/inseturl.C +
10276 * src/insets/inseturl.h +
10278 * src/LyXSendto.C +
10279 * src/PaperLayout.C +
10280 * src/ParagraphExtra.C +
10281 * src/TableLayout.C +
10283 * src/layout_forms.C +
10290 * src/menus.C: fixed various resize issues. So now forms can be
10291 resized savely or not be resized at all.
10293 * forms/form_url.fd +
10294 * src/insets/form_url.[Ch]: added because it's cleaner and easier
10297 * src/insets/Makefile.am: added files form_url.[Ch]
10299 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10301 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
10302 (and presumably 6.2).
10304 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
10305 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
10306 remaining static member callbacks.
10308 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
10311 * src/support/lyxstring.h: declare struct Srep as friend of
10312 lyxstring, since DEC cxx complains otherwise.
10314 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10316 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10318 * src/LaTeX.C (run): made run_bibtex also depend on files with
10320 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
10321 are put into the dependency file.
10323 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
10324 the code has shown itself to work
10325 (create_ispell_pipe): removed another warning, added a comment
10328 * src/minibuffer.C (ExecutingCB): removed code that has been
10329 commented out a long time
10331 * src/lyxfunc.C (processKeyEvent): removed some very old commented
10332 out code + a warning.
10334 * src/support/lyxstring.h: comment out the three private
10335 operators, when compiling with string ansi conforming compilers
10336 they make problems.
10338 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
10340 (pixmapFromBitmapData): change type of bdata to be unsigned char *
10341 (pixmapFromBitmapData): add a reinterpret_cast in the call to
10344 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
10347 * src/mathed/math_panel.C (create_math_panel): remove explicit
10350 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
10353 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
10354 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
10355 to XCreatePixmapFromBitmapData
10356 (fl_set_bmtable_data): change the last argument to be unsigned
10358 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
10359 and bh to be unsigned int, remove explicit casts in call to
10360 XReadBitmapFileData.
10362 * images/arrows.xbm: made the arrays unsigned char *
10363 * images/varsz.xbm: ditto
10364 * images/misc.xbm: ditto
10365 * images/greek.xbm: ditto
10366 * images/dots.xbm: ditto
10367 * images/brel.xbm: ditto
10368 * images/bop.xbm: ditto
10370 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
10372 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
10373 (LYX_PROG_CXX): added -pedantic to g++ compile options when
10374 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
10376 (LYX_CXX_CHEADERS): added <clocale> to the test.
10378 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
10380 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
10382 * src/support/lyxstring.C (append): fixed something that must be a
10383 bug, rep->assign was used instead of rep->append.
10385 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
10388 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
10389 lyx insert double chars. Fix spotted by Kayvan.
10391 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10393 * Fixed the tth support. I messed up with the Emacs patch apply feature
10394 and omitted the changes in lyxrc.C.
10396 1999-10-22 Juergen Vigna <jug@sad.it>
10398 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
10400 * src/lyx_cb.C (MenuInsertRef) +
10401 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
10402 the form cannot be resized under it limits (fixes a segfault)
10404 * src/lyx.C (create_form_form_ref) +
10405 * forms/lyx.fd: Changed Gravity on name input field so that it is
10408 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10410 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
10411 <ostream> and <istream>.
10413 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
10414 whether <fstream> provides the latest standard features, or if we
10415 have an oldstyle library (like in egcs).
10416 (LYX_CXX_STL_STRING): fix the test.
10418 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
10419 code on MODERN_STL_STREAM.
10421 * src/support/lyxstring.h: use L{I,O}stream.h.
10423 * src/support/L{I,O}stream.h: new files, designed to setup
10424 correctly streams for our use
10425 - includes the right header depending on STL capabilities
10426 - puts std::ostream and std::endl (for LOStream.h) or
10427 std::istream (LIStream.h) in toplevel namespace.
10429 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10431 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
10432 was a bib file that had been changed we ensure that bibtex is run.
10433 (runBibTeX): enhanced to extract the names of the bib files and
10434 getting their absolute path and enter them into the dep file.
10435 (findtexfile): static func that is used to look for tex-files,
10436 checks for absolute patchs and tries also with kpsewhich.
10437 Alternative ways of finding the correct files are wanted. Will
10439 (do_popen): function that runs a command using popen and returns
10440 the whole output of that command in a string. Should be moved to
10443 * src/DepTable.[Ch] (extchanged): new function that returns true if a
10444 file with extension ext has changed.
10446 * src/insets/figinset.C: added ifdef guards around the fl_free
10447 code that jug commented out. Now it is commented out when
10448 compiling with XForms == 0.89.
10450 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
10451 to lyxstring.C, and only keep a forward declaration in
10452 lyxstring.h. Simplifies the header file a bit and should help a
10453 bit on compile time too. Also changes to Srep will not mandate a
10454 recompile of code just using string.
10455 (~lyxstring): definition moved here since it uses srep.
10456 (size): definition moved here since it uses srep.
10458 * src/support/lyxstring.h: removed a couple of "inline" that should
10461 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10463 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
10466 1999-10-21 Juergen Vigna <jug@sad.it>
10468 * src/table.C (SetPWidth): Just a small fix so the alignment is not
10469 set to left if I just remove the width entry (or it is empty).
10471 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
10472 paragraph when having dummy paragraphs.
10474 1999-10-20 Juergen Vigna <jug@sad.it>
10476 * src/insets/figinset.C: just commented some fl_free_form calls
10477 and added warnings so that this calls should be activated later
10478 again. This avoids for now a segfault, but we have a memory leak!
10480 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
10481 'const char * argument' to 'string argument', this should
10482 fix some Asserts() in lyxstring.C.
10484 * src/lyxfunc.h: Removed the function argAsString(const char *)
10485 as it is not used anymore.
10487 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10489 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
10492 * src/Literate.h: some funcs moved from public to private to make
10493 interface clearer. Unneeded args removed.
10495 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
10497 (scanBuildLogFile): ditto
10499 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
10500 normal TeX Error. Still room for improvement.
10502 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
10504 * src/buffer.C (insertErrors): changes to make the error
10505 desctription show properly.
10507 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
10510 * src/support/lyxstring.C (helper): changed to use
10511 sizeof(object->rep->ref).
10512 (operator>>): changed to use a pointer instead.
10514 * src/support/lyxstring.h: changed const reference & to value_type
10515 const & lets see if that helps.
10517 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10519 * Makefile.am (rpmdist): fixed to have non static package and
10522 * src/support/lyxstring.C: removed the compilation guards
10524 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
10527 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
10528 conditional compile of lyxstring.Ch
10530 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
10531 stupid check, but it is a lot better than the bastring hack.
10532 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
10534 * several files: changed string::erase into string::clear. Not
10537 * src/chset.C (encodeString): use a char temporary instead
10539 * src/table.C (TexEndOfCell): added tostr around
10540 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
10541 (TexEndOfCell): ditto
10542 (TexEndOfCell): ditto
10543 (TexEndOfCell): ditto
10544 (DocBookEndOfCell): ditto
10545 (DocBookEndOfCell): ditto
10546 (DocBookEndOfCell): ditto
10547 (DocBookEndOfCell): ditto
10549 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
10551 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
10553 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
10554 (MenuBuildProg): added tostr around ret
10555 (MenuRunChktex): added tostr around ret
10556 (DocumentApplyCB): added tostr around ret
10558 * src/chset.C (encodeString): added tostr around t->ic
10560 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
10561 (makeLaTeXFile): added tostr around tocdepth
10562 (makeLaTeXFile): added tostr around ftcound - 1
10564 * src/insets/insetbib.C (setCounter): added tostr around counter.
10566 * src/support/lyxstring.h: added an operator+=(int) to catch more
10569 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
10570 (lyxstring): We DON'T allow NULL pointers.
10572 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10574 * src/mathed/math_macro.C (MathMacroArgument::Write,
10575 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
10576 when writing them out.
10578 * src/LString.C: remove, since it is not used anymore.
10580 * src/support/lyxstring.C: condition the content to
10581 USE_INCLUDED_STRING macro.
10583 * src/mathed/math_symbols.C, src/support/lstrings.C,
10584 src/support/lyxstring.C: add `using' directive to specify what
10585 we need in <algorithm>. I do not think that we need to
10586 conditionalize this, but any thought is appreciated.
10588 * many files: change all callback functions to "C" linkage
10589 functions to please strict C++ compilers like DEC cxx 6.1 in mode
10590 strict_ansi. Those who were static are now global.
10591 The case of callbacks which are static class members is
10592 trickier, since we have to make C wrappers around them (see
10593 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
10594 did not finish this yet, since it defeats the purpose of
10595 encapsulation, and I am not sure what the best route is.
10597 1999-10-19 Juergen Vigna <jug@sad.it>
10599 * src/support/lyxstring.C (lyxstring): we permit to have a null
10600 pointer as assignment value and just don't assign it.
10602 * src/vspace.C (nextToken): corrected this function substituting
10603 find_first(_not)_of with find_last_of.
10605 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
10606 (TableOptCloseCB) (TableSpeCloseCB):
10607 inserted fl_set_focus call for problem with fl_hide_form() in
10610 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10612 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
10615 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10617 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
10618 LyXLex::next() and not eatline() to get its argument.
10620 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10622 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
10623 instead, use fstreams for io of the depfile, removed unneeded
10624 functions and variables.
10626 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
10627 vector instead, removed all functions and variables that is not in
10630 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10632 * src/buffer.C (insertErrors): use new interface to TeXError
10634 * Makefile.am (rpmdist): added a rpmdist target
10636 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
10637 per Kayvan's instructions.
10639 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10641 * src/Makefile.am: add a definition for localedir, so that locales
10642 are found after installation (Kayvan)
10644 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10646 * development/.cvsignore: new file.
10648 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10650 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
10651 C++ compiler provides wrappers for C headers and use our alternate
10654 * configure.in: use LYX_CXX_CHEADERS.
10656 * src/cheader/: new directory, populated with cname headers from
10657 libstdc++-2.8.1. They are a bit old, but probably good enough for
10658 what we want (support compilers who lack them).
10660 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
10661 from includes. It turns out is was stupid.
10663 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10665 * lib/Makefile.am (install-data-local): forgot a ';'
10666 (install-data-local): forgot a '\'
10667 (libinstalldirs): needed after all. reintroduced.
10669 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10671 * configure.in (AC_OUTPUT): added lyx.spec
10673 * development/lyx.spec: removed file
10675 * development/lyx.spec.in: new file
10677 * po/*.po: merged with lyx.pot becuase of make distcheck
10679 * lib/Makefile.am (dist-hook): added dist-hook so that
10680 documentation files will be included when doing a make
10681 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
10682 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
10684 more: tried to make install do the right thing, exclude CVS dirs
10687 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
10688 Path would fit in more nicely.
10690 * all files that used to use pathstack: uses now Path instead.
10691 This change was a lot easier than expected.
10693 * src/support/path.h: new file
10695 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
10697 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
10699 * src/support/lyxstring.C (getline): Default arg was given for
10702 * Configure.cmd: removed file
10704 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10706 * src/support/DebugStream.[Ch]: remove the explicit std:: before
10707 streams classes and types, add the proper 'using' statements when
10708 MODERN_STL is defined.
10710 * src/debug.h: move the << operator definition after the inclusion
10713 * src/support/filetools.C: include "LAssert.h", which is needed
10716 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
10719 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
10720 include "debug.h" to define a proper ostream.
10722 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10724 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
10725 method to the SystemCall class which can kill a process, but it's
10726 not fully implemented yet.
10728 * src/*.C: Changed Systemcalls::Startscript() to startscript()
10730 * src/support/FileInfo.h: Better documentation
10732 * src/lyxfunc.C: Added support for buffer-export html
10734 * src/menus.C: Added Export->As HTML...
10736 * lib/bind/*.bind: Added short-cut for buffer-export html
10738 * src/lyxrc.*: Added support for new \tth_command
10740 * lib/lyxrc.example: Added stuff for new \tth_command
10742 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10744 * lib/Makefile.am (IMAGES): removed images/README
10745 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
10746 installes in correct place. Check permisions is installed
10749 * src/LaTeX.C: some no-op changes moved declaration of some
10752 * src/LaTeX.h (LATEX_H): changed include guard name
10754 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10756 * lib/reLyX/Makefile.am: install noweb2lyx.
10758 * lib/Makefile.am: install configure.
10760 * lib/reLyX/configure.in: declare a config aux dir; set package
10761 name to lyx (not sure what the best solution is); generate noweb2lyx.
10763 * lib/layouts/egs.layout: fix the bibliography layout.
10765 1999-10-08 Jürgen Vigna <jug@sad.it>
10767 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
10768 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
10769 it returned without continuing to search the path.
10771 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10773 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
10774 also fixes a bug. It is not allowed to do tricks with std::strings
10775 like: string a("hei"); &a[e]; this will not give what you
10776 think... Any reason for the complexity in this func?
10778 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
10780 * Updated README and INSTALL a bit, mostly to check that my
10781 CVS rights are correctly set up.
10783 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10785 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
10786 does not allow '\0' chars but lyxstring and std::string does.
10788 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10790 * autogen.sh (AUTOCONF): let the autogen script create the
10791 POTFILES.in file too. POTFILES.in should perhaps now not be
10792 included in the cvs module.
10794 * some more files changed to use C++ includes instead of C ones.
10796 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
10798 (Reread): added tostr to nlink. buggy output otherwise.
10799 (Reread): added a string() around szMode when assigning to Buffer,
10800 without this I got a log of garbled info strings.
10802 * acconfig.h: commented out the PTR_AS_INT macros. They should not
10805 * I have added several ostream & operator<<(ostream &, some_type)
10806 functions. This has been done to avoid casting and warnings when
10807 outputting enums to lyxerr. This as thus eliminated a lot of
10808 explicit casts and has made the code clearer. Among the enums
10809 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
10810 mathed enums, some font enum the Debug::type enum.
10812 * src/support/lyxstring.h (clear): missing method. equivalent of
10815 * all files that contained "stderr": rewrote constructs that used
10816 stderr to use lyxerr instead. (except bmtable)
10818 * src/support/DebugStream.h (level): and the passed t with
10819 Debug::ANY to avoid spurious bits set.
10821 * src/debug.h (Debug::type value): made it accept strings of the
10822 type INFO,INIT,KEY.
10824 * configure.in (Check for programs): Added a check for kpsewhich,
10825 the latex generation will use this later to better the dicovery of
10828 * src/BufferView.C (create_view): we don't need to cast this to
10829 (void*) that is done automatically.
10830 (WorkAreaButtonPress): removed some dead code.
10832 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10834 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
10835 is not overwritten when translated (David Sua'rez de Lis).
10837 * lib/CREDITS: Added David Sua'rez de Lis
10839 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
10841 * src/bufferparams.C (BufferParams): default input encoding is now
10844 * acinclude.m4 (cross_compiling): comment out macro
10845 LYX_GXX_STRENGTH_REDUCE.
10847 * acconfig.h: make sure that const is not defined (to empty) when
10848 we are compiling C++. Remove commented out code using SIZEOF_xx
10851 * configure.in : move the test for const and inline as late as
10852 possible so that these C tests do not interefere with C++ ones.
10853 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
10854 has not been proven.
10856 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10858 * src/table.C (getDocBookAlign): remove bad default value for
10859 isColumn parameter.
10861 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
10863 (ShowFileMenu2): ditto.
10865 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
10866 of files to ignore.
10868 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10870 * Most files: finished the change from the old error code to use
10871 DebugStream for all lyxerr debugging. Only minor changes remain
10872 (e.g. the setting of debug levels using strings instead of number)
10874 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10876 * src/layout.C (Add): Changed to use compare_no_case instead of
10879 * src/FontInfo.C: changed loop variable type too string::size_type.
10881 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10883 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
10884 set ETAGS_ARGS to --c++
10886 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
10888 * src/table.C (DocBookEndOfCell): commented out two unused variables
10890 * src/paragraph.C: commented out four unused variables.
10892 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
10893 insed a if clause with type string::size_type.
10895 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
10898 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
10900 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
10901 variable, also changed loop to go from 0 to lenght + 1, instead of
10902 -1 to length. This should be correct.
10904 * src/LaTeX.C (scanError): use string::size_type as loop variable
10907 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
10908 (l.896) since y_tmp and row was not used anyway.
10910 * src/insets/insetref.C (escape): use string::size_type as loop
10913 * src/insets/insetquotes.C (Width): use string::size_type as loop
10915 (Draw): use string::size_type as loop variable type.
10917 * src/insets/insetlatexaccent.C (checkContents): use
10918 string::size_type as loop variable type.
10920 * src/insets/insetlabel.C (escape): use string::size_type as loop
10923 * src/insets/insetinfo.C: added an extern for current_view.
10925 * src/insets/insetcommand.C (scanCommand): use string::size_type
10926 as loop variable type.
10928 * most files: removed the RCS tags. With them we had to recompile
10929 a lot of files after a simple cvs commit. Also we have never used
10930 them for anything meaningful.
10932 * most files: tags-query-replace NULL 0. As adviced several plases
10933 we now use "0" instead of "NULL" in our code.
10935 * src/support/filetools.C (SpaceLess): use string::size_type as
10936 loop variable type.
10938 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10940 * src/paragraph.C: fixed up some more string stuff.
10942 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10944 * src/support/filetools.h: make modestr a std::string.
10946 * src/filetools.C (GetEnv): made ch really const.
10948 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
10949 made code that used these use max/min from <algorithm> instead.
10951 * changed several c library include files to their equivalent c++
10952 library include files. All is not changed yet.
10954 * created a support subdir in src, put lyxstring and lstrings
10955 there + the extra files atexit, fileblock, strerror. Created
10956 Makefile.am. edited configure.in and src/Makefile.am to use this
10957 new subdir. More files moved to support.
10959 * imported som of the functions from repository lyx, filetools
10961 * ran tags-query-replace on LString -> string, corrected the bogus
10962 cases. Tried to make use of lstrings.[hC], debugged a lot. There
10963 is still some errors in there. This is errors where too much or
10964 too litle get deleted from strings (string::erase, string::substr,
10965 string::replace), there can also be some off by one errors, or
10966 just plain wrong use of functions from lstrings. Viewing of quotes
10969 * LyX is now running fairly well with string, but there are
10970 certainly some bugs yet (see above) also string is quite different
10971 from LString among others in that it does not allow null pointers
10972 passed in and will abort if it gets any.
10974 * Added the revtex4 files I forgot when setting up the repository.
10976 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10978 * All over: Tried to clean everything up so that only the files
10979 that we really need are included in the cvs repository.
10980 * Switched to use automake.
10981 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
10982 * Install has not been checked.
10984 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10986 * po/pt.po: Three errors:
10987 l.533 and l.538 format specification error
10988 l. 402 duplicate entry, I just deleted it.