1 2000-10-02 Juergen Vigna <jug@sad.it>
3 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
4 now you can type or do stuff inside the table-cell also when in dummy
5 position, fixed visible cursor.
7 * src/insets/insettext.C (Edit): fixing cursor-view position.
9 * src/lyxfunc.C (Dispatch): use * text variable so that it can
10 be used for equal functions in lyxfunc and insettext.
12 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
14 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
16 * src/frontends/gnome/FormCitation.h:
17 * src/frontends/gnome/FormCopyright.h:
18 * src/frontends/gnome/FormIndex.h:
19 * src/frontends/gnome/FormPrint.h:
20 * src/frontends/gnome/FormToc.h:
21 * src/frontends/gnome/FormUrl.h:
22 * src/frontends/kde/FormCitation.h:
23 * src/frontends/kde/FormCopyright.h:
24 * src/frontends/kde/FormIndex.h:
25 * src/frontends/kde/FormRef.h:
26 * src/frontends/kde/FormToc.h:
27 * src/frontends/kde/FormUrl.h: fix remaining users of
30 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
32 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
34 (DocBookHandleCaption): ditto.
35 (DocBookHandleFootnote): ditto.
36 (SimpleDocBookOnePar): ditto.
38 * src/frontends/xforms/FormDocument.h (form): remove extra
39 FormDocument:: qualifier.
41 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
43 * sigc++/handle.h: ditto.
45 * src/lyx_gui_misc.C: add "using" directive.
47 * src/cheaders/cstddef: new file, needed by the boost library (for
50 2000-10-02 Juergen Vigna <jug@sad.it>
52 * src/insets/insettext.C (SetFont): better support.
54 * src/insets/insettabular.C (draw): fixed drawing of single cell.
56 * src/screen.C (DrawOneRow): some uint refixes!
58 2000-10-02 Allan Rae <rae@lyx.org>
60 * boost/.cvsignore: ignore Makefile as well
62 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
63 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
65 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
66 Left this one out by accident.
68 * src/frontends/xforms/FormBase.h (restore): default to calling
69 update() since that will restore the original/currently-applied values.
70 Any input() triggered error messages will require the derived classes
71 to redefine restore().
73 * src/frontends/xforms/FormDocument.C: initialize a few variables to
74 avoid a segfault. combo_doc_class is the main concern.
76 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
78 * Simplify build-listerrors in view of GUI-less export ability!
80 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
82 * src/lyx_main.C (easyParse): Disable gui when exporting
84 * src/insets/figinset.C:
88 * src/tabular.C: Changes to allow no-gui.
90 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
92 * src/support/utility.hpp: removed file
93 * src/support/block.h: removed file
95 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
98 * src/mathed/formula.C: add support/lyxlib.h
99 * src/mathed/formulamacro.C: ditto
101 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
102 * src/lyxparagraph.h: ditto
104 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
105 * src/frontends/Makefile.am (INCLUDES): ditto
106 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
107 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
108 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
109 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
110 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
111 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
113 * src/BufferView.h: use boost/utility.hpp
114 * src/LColor.h: ditto
116 * src/LyXAction.h: ditto
117 * src/LyXView.h: ditto
118 * src/bufferlist.h: ditto
119 * src/lastfiles.h: ditto
120 * src/layout.h: ditto
121 * src/lyx_gui.h: ditto
122 * src/lyx_main.h: ditto
123 * src/lyxlex.h: ditto
125 * src/frontends/ButtonPolicies.h: ditto
126 * src/frontends/Dialogs.h: ditto
127 * src/frontends/xforms/FormBase.h: ditto
128 * src/frontends/xforms/FormGraphics.h: ditto
129 * src/frontends/xforms/FormParagraph.h: ditto
130 * src/frontends/xforms/FormTabular.h: ditto
131 * src/graphics/GraphicsCache.h: ditto
132 * src/graphics/Renderer.h: ditto
133 * src/insets/ExternalTemplate.h: ditto
134 * src/insets/insetcommand.h: ditto
135 * src/support/path.h: ditto
137 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
138 and introduce clause for 2.97.
140 * boost/libs/README: new file
142 * boost/boost/utility.hpp: new file
144 * boost/boost/config.hpp: new file
146 * boost/boost/array.hpp: new file
148 * boost/Makefile.am: new file
150 * boost/.cvsignore: new file
152 * configure.in (AC_OUTPUT): add boost/Makefile
154 * Makefile.am (SUBDIRS): add boost
156 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
158 * src/support/lstrings.C (suffixIs): Fixed.
160 2000-10-01 Allan Rae <rae@lyx.org>
162 * src/PrinterParams.h: moved things around to avoid the "can't
163 inline call" warning.
165 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
166 into doc++ documentation.
168 * src/frontends/xforms/FormCommand.[Ch]: support button policy
170 * src/frontends/xforms/FormRef.C: make use of button controller
171 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
172 cleaned up button controller usage.
173 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
174 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
175 use the button controller
177 * src/frontends/xforms/forms/*.fd: and associated generated files
178 updated to reflect changes to FormBase. Some other FormXxxx files
179 also got minor updates to reflect changes to FormBase.
181 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
182 (hide): made virtual.
183 (input): return a bool. true == valid input
184 (RestoreCB, restore): new
185 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
186 Changes to allow derived dialogs to use a ButtonController and
187 make sense when doing so: OK button calls ok() and so on.
189 * src/frontends/xforms/ButtonController.h (class ButtonController):
190 Switch from template implementation to taking Policy parameter.
191 Allows FormBase to provide a ButtonController for any dialog.
193 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
194 Probably should rename connect and disconnect.
195 (apply): use the radio button groups
196 (form): needed by FormBase
197 (build): setup the radio button groups
199 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
201 * several files: type canges to reduce the number of warnings and
202 to unify type hangling a bit. Still much to do.
204 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
206 * lib/images/*: rename a bunch of icons to match Dekel converter
209 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
212 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
214 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
216 * sigc++/handle.h: ditto for class Handle.
218 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
220 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
222 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
224 * src/intl.C (InitKeyMapper): Correct the value of n due to the
225 removal of the "default" language.
227 * src/combox.h (getline): Check that sel > 0
229 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
231 * lib/examples/docbook_example.lyx
232 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
234 * lib/layouts/docbook-book.layout: new docbook book layout.
236 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
238 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
240 * src/insets/figinset.C (DocBook):fixed small typo.
242 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
244 * src/insets/insetinclude.h: string include_label doesn't need to be
247 2000-09-29 Allan Rae <rae@lyx.org>
249 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
250 Allow derived type to control connection and disconnection from signals
251 of its choice if desired.
253 2000-09-28 Juergen Vigna <jug@sad.it>
255 * src/insets/insettabular.C (update): fixed cursor setting when
256 the_locking_inset changed.
257 (draw): made this a bit cleaner.
258 (InsetButtonPress): fixed!
260 * various files: added LyXText Parameter to fitCursor call.
262 * src/BufferView.C (fitCursor): added LyXText parameter.
264 * src/insets/insettabular.C (draw): small draw fix.
266 * src/tabular.C: right setting of left/right celllines.
268 * src/tabular.[Ch]: fixed various types in funcions and structures.
269 * src/insets/insettabular.C: ditto
270 * src/frontends/xforms/FormTabular.C: ditto
272 2000-09-28 Allan Rae <rae@lyx.org>
274 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
275 that the #ifdef's had been applied to part of what should have been
276 a complete condition. It's possible there are other tests that
277 were specific to tables that are also wrong now that InsetTabular is
278 being used. Now we need to fix the output of '\n' after a table in a
279 float for the same reason as the original condition:
280 "don't insert this if we would be adding it before or after a table
281 in a float. This little trick is needed in order to allow use of
282 tables in \subfigures or \subtables."
283 Juergen can you check this?
285 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
287 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
288 outputed to the ostream.
290 * several files: fixed types based on warnings from cxx
292 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
294 * src/frontends/kde/Makefile.am: fix rule for
295 formindexdialogdata_moc.C
297 * src/.cvsignore: add ext_l10n.h to ignore
299 * acconfig.h: stop messing with __STRICT_ANSI__
300 * config/gnome.m4: remove option to set -ansi
301 * config/kde.m4: remove option to set -ansi
302 * config/lyxinclude.m4: don't set -ansi
304 2000-09-27 Juergen Vigna <jug@sad.it>
306 * various files: remove "default" language check.
308 * src/insets/insetquotes.C: removed use of current_view.
310 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
311 the one should have red ears by now!
313 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
314 in more then one paragraph. Fixed cursor-movement/selection.
316 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
317 paragraphs inside a text inset.
319 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
320 text-inset if this owner is an inset.
322 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
324 * src/Bullet.h: changed type of font, character and size to int
326 * src/buffer.C (asciiParagraph): remove actcell and fname1.
328 * src/insets/inseturl.[Ch]:
329 * src/insets/insetref.[Ch]:
330 * src/insets/insetlabel.[Ch]: add linelen to Ascii
332 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
334 * src/buffer.C (readFile): block-if statement rearranged to minimise
335 bloat. Patch does not reverse Jean-Marc's change ;-)
337 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
338 Class rewritten to store pointers to hide/update signals directly,
339 rather than Dialogs *. Also defined an enum to ease use. All xforms
340 forms can now be derived from this class.
342 * src/frontends/xforms/FormCommand.[Ch]
343 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
345 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
348 * src/frontends/xforms/forms/form_citation.fd
349 * src/frontends/xforms/forms/form_copyright.fd
350 * src/frontends/xforms/forms/form_error.fd
351 * src/frontends/xforms/forms/form_index.fd
352 * src/frontends/xforms/forms/form_ref.fd
353 * src/frontends/xforms/forms/form_toc.fd
354 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
356 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
358 * src/insets/insetfoot.C: removed redundent using directive.
360 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
362 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
363 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
365 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
366 created in the constructors in different groups. Then set() just
367 have to show the groups as needed. This fixes the redraw problems
368 (and is how the old menu code worked).
370 * src/support/lyxlib.h: declare the methods as static when we do
373 2000-09-26 Juergen Vigna <jug@sad.it>
375 * src/buffer.C (asciiParagraph): new function.
376 (writeFileAscii): new function with parameter ostream.
377 (writeFileAscii): use now asciiParagraph.
379 * various inset files: added the linelen parameter to the Ascii-func.
381 * src/tabular.C (Write): fixed error in writing file introduced by
382 the last changes from Lars.
384 * lib/bind/menus.bind: removed not supported functions.
386 * src/insets/insettext.C (Ascii): implemented this function.
388 * src/insets/lyxinset.h (Ascii): added linelen parameter.
390 * src/tabular.C (write_attribute[int,string,bool]): new functions.
391 (Write): use of the write_attribute functions.
393 * src/bufferlist.C (close): fixed reasking question!
395 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
397 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
398 new files use the everwhere possible.
401 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
402 src/log_form.C src/lyx.C:
405 * src/buffer.C (runLaTeX): remove func
407 * src/PaperLayout.C: removed file
408 * src/ParagraphExtra.C: likewise
409 * src/bullet_forms.C: likewise
410 * src/bullet_forms.h: likewise
411 * src/bullet_forms_cb.C: likewise
413 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
414 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
417 * several files: remove all traces of the old fd_form_paragraph,
418 and functions belonging to that.
420 * several files: remove all traces of the old fd_form_document,
421 and functions belonging to that.
423 * several files: constify local variables were possible.
425 * several files: remove all code that was dead when NEW_EXPORT was
428 * several files: removed string::c_str in as many places as
431 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
432 (e): be a bit more outspoken when patching
433 (updatesrc): only move files if changed.
435 * forms/layout_forms.h.patch: regenerated
437 * forms/layout_forms.fd: remove form_document and form_paragraph
438 and form_quotes and form_paper and form_table_options and
441 * forms/form1.fd: remove form_table
443 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
444 the fdui->... rewrite. Update some comments to xforms 0.88
446 * forms/bullet_forms.C.patch: removed file
447 * forms/bullet_forms.fd: likewise
448 * forms/bullet_forms.h.patch: likewise
450 * development/Code_rules/Rules: added a section on switch
451 statements. Updated some comment to xforms 0.88.
453 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
455 * src/buffer.C (readFile): make sure that the whole version number
456 is read after \lyxformat (even when it contains a comma)
458 * lib/ui/default.ui: change shortcut of math menu to M-a.
460 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
462 * src/vspace.C (nextToken): use isStrDbl() to check for proper
465 * src/LyXView.C (updateWindowTitle): show the full files name in
466 window title, limited to 30 characters.
468 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
469 When a number of characters has been given, we should not assume
470 that the string is 0-terminated.
472 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
473 calls (fixes some memory leaks)
475 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
476 trans member on exit.
478 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
480 * src/converter.C (GetReachable): fix typo.
482 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
483 understand ',' instead of '.'.
484 (GetInteger): rewrite to use strToInt().
486 2000-09-26 Juergen Vigna <jug@sad.it>
488 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
489 better visibility and error-message on wrong VSpace input.
491 * src/language.C (initL): added english again.
493 2000-09-25 Juergen Vigna <jug@sad.it>
495 * src/frontends/kde/Dialogs.C (Dialogs):
496 * src/frontends/gnome/Dialogs.C (Dialogs):
497 * src/frontends/kde/Makefile.am:
498 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
500 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
502 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
504 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
506 * src/frontends/xforms/FormParagraph.C:
507 * src/frontends/xforms/FormParagraph.h:
508 * src/frontends/xforms/form_paragraph.C:
509 * src/frontends/xforms/form_paragraph.h:
510 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
513 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
515 * src/tabular.C (OldFormatRead): forgot to delete the temporary
516 Paragraph-Data after use.
518 * src/insets/insettext.C (LocalDispatch): don't set the layout on
519 non breakable paragraphs.
521 2000-09-25 Garst R. Reese <reese@isn.net>
523 * src/language.C (initL): added missing language_country codes.
525 2000-09-25 Juergen Vigna <jug@sad.it>
527 * src/insets/insettext.C (InsetText):
528 (deleteLyXText): remove the not released LyXText structure!
530 2000-09-24 Marko Vendelin <markov@ioc.ee>
532 * src/frontends/gnome/mainapp.C
533 * src/frontends/gnome/mainapp.h: added support for keyboard
536 * src/frontends/gnome/FormCitation.C
537 * src/frontends/gnome/FormCitation.h
538 * src/frontends/gnome/Makefile.am
539 * src/frontends/gnome/pixbutton.h: completed the rewrite of
540 FormCitation to use "action area" in mainapp window
542 * src/frontends/gnome/Menubar_pimpl.C
543 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
546 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
548 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
549 width/descent/ascent values if name is empty.
550 (mathed_string_height): Use std::max.
552 2000-09-25 Allan Rae <rae@lyx.org>
554 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
555 segfault. This will be completely redesigned soon.
557 * sigc++: updated libsigc++. Fixes struct timespec bug.
559 * development/tools/makeLyXsigc.sh: .cvsignore addition
561 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
563 * several files: removed almost all traces of the old table
566 * src/TableLayout.C: removed file
568 2000-09-22 Juergen Vigna <jug@sad.it>
570 * src/frontends/kde/Dialogs.C: added credits forms.
572 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
574 * src/frontends/gnome/Dialogs.C: added some forms.
576 * src/spellchecker.C (init_spell_checker): set language in pspell code
577 (RunSpellChecker): some modifications for setting language string.
579 * src/language.[Ch]: added language_country code.
581 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
583 * src/frontends/Dialogs.h: added new signal showError.
584 Rearranged existing signals in some sort of alphabetical order.
586 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
587 FormError.[Ch], form_error.[Ch]
588 * src/frontends/xforms/forms/makefile: added new file form_error.fd
589 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
591 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
592 dialogs. I think that this can be used as the base to all these
595 * src/frontends/xforms/FormError.[Ch]
596 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
597 implementation of InsetError dialog.
599 * src/insets/inseterror.[Ch]: rendered GUI-independent.
601 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
602 * src/frontends/kde/Makefile.am: ditto
604 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
606 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
607 macrobf. This fixes a bug of invisible text.
609 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
611 * lib/doc/LaTeXConfig.lyx.in: updated.
613 * src/language.C (initL): remove language "francais" and change a
614 bit the names of the two other french variations.
616 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
617 string that may not be 0-terminated.
619 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
621 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
623 2000-09-20 Marko Vendelin <markov@ioc.ee>
625 * src/frontends/gnome/FormCitation.C
626 * src/frontends/gnome/FormIndex.C
627 * src/frontends/gnome/FormToc.C
628 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
629 the variable initialization to shut up the warnings
631 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
633 * src/table.[Ch]: deleted files
635 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
638 2000-09-18 Juergen Vigna <jug@sad.it>
640 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
641 problems with selection. Inserted new LFUN_PASTESELECTION.
642 (InsetButtonPress): inserted handling of middle mouse-button paste.
644 * src/spellchecker.C: changed word to word.c_str().
646 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
648 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
649 included in the ``make dist'' tarball.
651 2000-09-15 Juergen Vigna <jug@sad.it>
653 * src/CutAndPaste.C (cutSelection): small fix return the right
654 end position after cut inside one paragraph only.
656 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
657 we are locked as otherwise we don't have a valid cursor position!
659 * src/insets/figinset.C (draw): small bugfix but why is this needed???
661 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
663 * src/frontends/kde/FormRef.C: added using directive.
664 * src/frontends/kde/FormToc.C: ditto
666 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
668 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
670 2000-09-19 Marko Vendelin <markov@ioc.ee>
672 * src/frontends/gnome/Menubar_pimpl.C
673 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
674 Toc, ViewFormats, UpdateFormats, and ExportFormats.
676 * src/frontends/gnome/mainapp.C
677 * src/frontends/gnome/mainapp.h: support for menu update used
680 * src/frontends/gnome/mainapp.C
681 * src/frontends/gnome/mainapp.h: support for "action" area in the
682 main window. This area is used by small simple dialogs, such as
685 * src/frontends/gnome/FormIndex.C
686 * src/frontends/gnome/FormIndex.h
687 * src/frontends/gnome/FormUrl.C
688 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
691 * src/frontends/gnome/FormCitation.C
692 * src/frontends/gnome/FormCitation.h: rewrite to use main window
693 action area. Only "Insert new citation" is implemented.
695 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
697 * src/buffer.C (Dispatch): fix call to Dispatch
698 * src/insets/insetref.C (Edit): likewise
699 * src/insets/insetparent.C (Edit): likewise
700 * src/insets/insetinclude.C (include_cb): likewise
701 * src/frontends/xforms/FormUrl.C (apply): likewise
702 * src/frontends/xforms/FormToc.C (apply): likewise
703 * src/frontends/xforms/FormRef.C (apply): likewise
704 * src/frontends/xforms/FormIndex.C (apply): likewise
705 * src/frontends/xforms/FormCitation.C (apply): likewise
706 * src/lyxserver.C (callback): likewise
707 * src/lyxfunc.C (processKeySym): likewise
710 * src/lyx_cb.C (LayoutsCB): likewise
712 * Makefile.am (sourcedoc): small change
714 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
716 * src/main.C (main): Don't make an empty GUIRunTime object. all
717 methods are static. constify a bit remove unneded using + headers.
719 * src/tabular.C: some more const to local vars move some loop vars
721 * src/spellchecker.C: added some c_str after some word for pspell
723 * src/frontends/GUIRunTime.h: add new static method setDefaults
724 * src/frontends/xforms/GUIRunTime.C (setDefaults):
725 * src/frontends/kde/GUIRunTime.C (setDefaults):
726 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
728 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
729 with strnew in arg, use correct emptystring when calling SetName.
731 * several files: remove all commented code with relation to
732 HAVE_SSTREAM beeing false. We now only support stringstream and
735 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
737 * src/lyxfunc.C: construct correctly the automatic new file
740 * src/text2.C (IsStringInText): change type of variable i to shut
743 * src/support/sstream.h: do not use namespaces if the compiler
744 does not support them.
746 2000-09-15 Marko Vendelin <markov@ioc.ee>
747 * src/frontends/gnome/FormCitation.C
748 * src/frontends/gnome/FormCitation.h
749 * src/frontends/gnome/diainsertcitation_interface.c
750 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
751 regexp support to FormCitation [Gnome].
753 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
756 * configure.in: remove unused KDE/GTKGUI define
758 * src/frontends/kde/FormRef.C
759 * src/frontends/kde/FormRef.h
760 * src/frontends/kde/formrefdialog.C
761 * src/frontends/kde/formrefdialog.h: double click will
762 go to reference, now it is possible to change a cross-ref
765 * src/frontends/kde/FormToc.C
766 * src/frontends/kde/FormToc.h
767 * src/frontends/kde/formtocdialog.C
768 * src/frontends/kde/formtocdialog.h: add a depth
771 * src/frontends/kde/Makefile.am: add QtLyXView.h
774 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
776 * src/frontends/kde/FormCitation.h: added some using directives.
778 * src/frontends/kde/FormToc.h: corrected definition of doTree.
780 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
783 * src/mathed/math_defs.h: redefine SetAlign to use string rather
786 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
788 * src/buffer.C (pop_tag): revert for the second time a change by
789 Lars, who seems to really hate having non-local loop variables :)
791 * src/Lsstream.h: add "using" statements.
793 * src/support/copy.C (copy): add a bunch of std:: qualifiers
794 * src/buffer.C (writeFile): ditto
796 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
798 * src/buffer.C (writeFile): try to fix the locale modified format
799 number to always be as we want it.
801 * src/WorkArea.C (work_area_handler): try to workaround the bugs
802 in XForms 0.89. C-space is now working again.
804 * src/Lsstream.h src/support/sstream.h: new files.
806 * also commented out all cases where strstream were used.
808 * src/Bullet.h (c_str): remove method.
810 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
812 * a lot of files: get rid of "char const *" and "char *" is as
813 many places as possible. We only want to use them in interaction
814 with system of other libraries, not inside lyx.
816 * a lot of files: return const object is not of pod type. This
817 helps ensure that temporary objects is not modified. And fits well
818 with "programming by contract".
820 * configure.in: check for the locale header too
822 * Makefile.am (sourcedoc): new tag for generation of doc++
825 2000-09-14 Juergen Vigna <jug@sad.it>
827 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
828 callback to check which combo called it and do the right action.
830 * src/combox.C (combo_cb): added combo * to the callbacks.
831 (Hide): moved call of callback after Ungrab of the pointer.
833 * src/intl.h: removed LCombo2 function.
835 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
836 function as this can now be handled in one function.
838 * src/combox.h: added Combox * to callback prototype.
840 * src/frontends/xforms/Toolbar_pimpl.C:
841 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
843 2000-09-14 Garst Reese <reese@isn.net>
845 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
846 moved usepackage{xxx}'s to beginning of file. Changed left margin
847 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
848 underlining from title. Thanks to John Culleton for useful suggestions.
850 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
852 * src/lyxlex_pimpl.C (setFile): change error message to debug
855 2000-09-13 Juergen Vigna <jug@sad.it>
857 * src/frontends/xforms/FormDocument.C: implemented choice_class
858 as combox and give callback to combo_language so OK/Apply is activated
861 * src/bufferlist.C (newFile): small fix so already named files
862 (via an open call) are not requested to be named again on the
865 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
867 * src/frontends/kde/Makefile.am
868 * src/frontends/kde/FormRef.C
869 * src/frontends/kde/FormRef.h
870 * src/frontends/kde/formrefdialog.C
871 * src/frontends/kde/formrefdialog.h: implement
874 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
876 * src/frontends/kde/formtocdialog.C
877 * src/frontends/kde/formtocdialog.h
878 * src/frontends/kde/FormToc.C
879 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
881 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
883 * src/frontends/kde/FormCitation.C: fix thinko
884 where we didn't always display the reference text
887 * src/frontends/kde/formurldialog.C
888 * src/frontends/kde/formurldialog.h
889 * src/frontends/kde/FormUrl.C
890 * src/frontends/kde/FormUrl.h: minor cleanups
892 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
894 * src/frontends/kde/Makefile.am
895 * src/frontends/kde/FormToc.C
896 * src/frontends/kde/FormToc.h
897 * src/frontends/kde/FormCitation.C
898 * src/frontends/kde/FormCitation.h
899 * src/frontends/kde/FormIndex.C
900 * src/frontends/kde/FormIndex.h
901 * src/frontends/kde/formtocdialog.C
902 * src/frontends/kde/formtocdialog.h
903 * src/frontends/kde/formcitationdialog.C
904 * src/frontends/kde/formcitationdialog.h
905 * src/frontends/kde/formindexdialog.C
906 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
908 2000-09-12 Juergen Vigna <jug@sad.it>
910 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
913 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
915 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
918 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
920 * src/converter.C (Add, Convert): Added support for converter flags:
921 needaux, resultdir, resultfile.
922 (Convert): Added new parameter view_file.
923 (dvips_options): Fixed letter paper option.
925 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
926 (Export, GetExportableFormats, GetViewableFormats): Added support
929 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
931 (easyParse): Fixed to work with new export code.
933 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
936 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
938 * lib/bind/*.bind: Replaced
939 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
940 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
942 2000-09-11 Juergen Vigna <jug@sad.it>
944 * src/lyx_gui.C (runTime): uses global guiruntime variable.
946 * src/main.C (main): now GUII defines global guiruntime!
948 * src/frontends/gnome/GUIRunTime.C (initApplication):
949 * src/frontends/kde/GUIRunTime.C (initApplication):
950 * src/frontends/xforms/GUIRunTime.C (initApplication):
951 * src/frontends/GUIRunTime.h: added new function initApplication.
953 * src/spellchecker.C (sc_accept_word): change to add_to_session.
955 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
957 2000-09-08 Juergen Vigna <jug@sad.it>
959 * src/lyx_gui.C (create_forms): don't display the "default" entry as
960 we have already "Reset".
962 * src/language.C (initL): inserted "default" language and made this
963 THE default language (and not american!)
965 * src/paragraph.C: inserted handling of "default" language!
967 * src/lyxfont.C: ditto
971 * src/paragraph.C: output the \\par only if we have a following
972 paragraph otherwise it's not needed.
974 2000-09-05 Juergen Vigna <jug@sad.it>
976 * config/pspell.m4: added entry to lyx-flags
978 * src/spellchecker.C: modified version from Kevin for using pspell
980 2000-09-01 Marko Vendelin <markov@ioc.ee>
981 * src/frontends/gnome/Makefile.am
982 * src/frontends/gnome/FormCitation.C
983 * src/frontends/gnome/FormCitation.h
984 * src/frontends/gnome/diainsertcitation_callbacks.c
985 * src/frontends/gnome/diainsertcitation_callbacks.h
986 * src/frontends/gnome/diainsertcitation_interface.c
987 * src/frontends/gnome/diainsertcitation_interface.h
988 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
989 dialog for Gnome frontend
991 * src/main.C: Gnome libraries require keeping application name
992 and its version as strings
994 * src/frontends/gnome/mainapp.C: Change the name of the main window
995 from GnomeLyX to PACKAGE
997 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
999 * src/frontends/Liason.C: add "using: declaration.
1001 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
1003 * src/mathed/math_macro.C (Metrics): Set the size of the template
1005 * src/mathed/formulamacro.C (Latex): Fixed the returned value
1007 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
1009 * src/converter.C (add_options): New function.
1010 (SetViewer): Change $$FName into '$$FName'.
1011 (View): Add options when running xdvi
1012 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
1013 (Convert): The 3rd parameter is now the desired filename. Converts
1014 calls to lyx::rename if necessary.
1015 Add options when running dvips.
1016 (dvi_papersize,dvips_options): New methods.
1018 * src/exporter.C (Export): Use getLatexName() instead of fileName().
1020 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
1021 using a call to Converter::dvips_options.
1022 Fixed to work with nex export code.
1024 * src/support/copy.C
1025 * src/support/rename.C: New files
1027 * src/support/syscall.h
1028 * src/support/syscall.C: Added Starttype SystemDontWait.
1030 * lib/ui/default.ui: Changed to work with new export code
1032 * lib/configure.m4: Changed to work with new export code
1034 * src/encoding.C: Changed latex name for iso8859_7 encoding.
1036 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
1038 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
1039 so that code compiles with DEC cxx.
1041 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
1042 to work correctly! Also now supports the additional elements
1045 2000-09-01 Allan Rae <rae@lyx.org>
1047 * src/frontends/ButtonPolicies.C: renamed all the references to
1048 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
1050 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
1051 since it's a const not a type.
1053 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
1055 2000-08-31 Juergen Vigna <jug@sad.it>
1057 * src/insets/figinset.C: Various changes to look if the filename has
1058 an extension and if not add it for inline previewing.
1060 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1062 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
1063 make buttonStatus and isReadOnly be const methods. (also reflect
1064 this in derived classes.)
1066 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
1067 (nextState): change to be static inline, pass the StateMachine as
1069 (PreferencesPolicy): remove casts
1070 (OkCancelPolicy): remvoe casts
1071 (OkCancelReadOnlyPolicy): remove casts
1072 (NoRepeatedApplyReadOnlyPolicy): remove casts
1073 (OkApplyCancelReadOnlyPolicy): remove casts
1074 (OkApplyCancelPolicy): remove casts
1075 (NoRepeatedApplyPolicy): remove casts
1077 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
1079 * src/converter.C: added some using directives
1081 * src/frontends/ButtonPolicies.C: changes to overcome
1082 "need lvalue" error with DEC c++
1084 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
1085 to WMHideCB for DEC c++
1087 * src/frontends/xforms/Menubar_pimpl.C: added using directive
1089 * src/frontends/xforms/forms/form_document.C.patch: use C callback
1090 to BulletBMTableCB for DEC c++
1092 2000-08-31 Allan Rae <rae@lyx.org>
1094 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
1095 character dialog separately from old document dialogs combo_language.
1098 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
1100 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
1101 Removed LFUN_REF_CREATE.
1103 * src/MenuBackend.C: Added new tags: toc and references
1105 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
1106 (add_lastfiles, add_documents, add_formats): Removed the unused smn
1108 (add_toc, add_references): New methods.
1109 (create_submenu): Handle correctly the case when there is a
1110 seperator after optional menu items.
1112 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
1113 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
1114 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
1116 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
1118 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
1120 * src/converter.[Ch]: New file for converting between different
1123 * src/export.[Ch]: New file for exporting a LyX file to different
1126 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
1127 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
1128 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
1129 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
1130 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
1131 RunDocBook, MenuExport.
1133 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
1134 Exporter::Preview methods if NEW_EXPORT is defined.
1136 * src/buffer.C (Dispatch): Use Exporter::Export.
1138 * src/lyxrc.C: Added new tags: \converter and \viewer.
1141 * src/LyXAction.C: Define new lyx-function: buffer-update.
1142 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
1143 when NEW_EXPORT is defined.
1145 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
1147 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
1149 * lib/ui/default.ui: Added submenus "view" and "update" to the
1152 * src/filetools.C (GetExtension): New function.
1154 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
1156 2000-08-29 Allan Rae <rae@lyx.org>
1158 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
1160 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
1161 (EnableDocumentLayout): removed
1162 (DisableDocumentLayout): removed
1163 (build): make use of ButtonController's read-only handling to
1164 de/activate various objects. Replaces both of the above functions.
1166 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
1167 (readOnly): was read_only
1168 (refresh): fixed dumb mistakes with read_only_ handling
1170 * src/frontends/xforms/forms/form_document.fd:
1171 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
1172 tabbed dialogs so the tabs look more like tabs and so its easier to
1173 work out which is the current tab.
1175 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
1176 segfault with form_table
1178 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
1180 2000-08-28 Juergen Vigna <jug@sad.it>
1182 * acconfig.h: added USE_PSPELL.
1184 * src/config.h.in: added USE_PSPELL.
1186 * autogen.sh: added pspell.m4
1188 * config/pspell.m4: new file.
1190 * src/spellchecker.C: implemented support for pspell libary.
1192 2000-08-25 Juergen Vigna <jug@sad.it>
1194 * src/LyXAction.C (init): renamed LFUN_TABLE to
1195 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
1197 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
1199 * src/lyxscreen.h: add force_clear variable and fuction to force
1200 a clear area when redrawing in LyXText.
1202 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
1204 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1206 * some whitespace and comment changes.
1208 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
1210 * src/buffer.C: up te LYX_FORMAT to 2.17
1212 2000-08-23 Juergen Vigna <jug@sad.it>
1214 * src/BufferView_pimpl.C (tripleClick): disable this when in a
1217 * src/insets/insettabular.C (pasteSelection): delete the insets
1218 LyXText as it is not valid anymore.
1219 (copySelection): new function.
1220 (pasteSelection): new function.
1221 (cutSelection): new function.
1222 (LocalDispatch): implemented cut/copy/paste of cell selections.
1224 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
1225 don't have a LyXText.
1227 * src/LyXAction.C (init): a NEW_TABULAR define too much.
1229 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
1232 2000-08-22 Juergen Vigna <jug@sad.it>
1234 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
1235 ifdef form_table out if NEW_TABULAR.
1237 2000-08-21 Juergen Vigna <jug@sad.it>
1239 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
1240 (draw): fixed draw position so that the cursor is positioned in the
1242 (InsetMotionNotify): hide/show cursor so the position is updated.
1243 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
1244 using cellstart() function where it should be used.
1246 * src/insets/insettext.C (draw): ditto.
1248 * src/tabular.C: fixed initialization of some missing variables and
1249 made BoxType into an enum.
1251 2000-08-22 Marko Vendelin <markov@ioc.ee>
1252 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
1253 stock menu item using action numerical value, not its string
1257 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
1259 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
1260 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
1262 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
1264 * src/frontends/xforms/GUIRunTime.C: new file
1266 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
1267 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1269 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
1271 * src/frontends/kde/GUIRunTime.C: new file
1273 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
1274 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1276 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
1278 * src/frontends/gnome/GUIRunTime.C: new file
1280 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
1283 * src/frontends/GUIRunTime.h: removed constructor and destructor,
1284 small change to documetentation.
1286 * src/frontends/GUIRunTime.C: removed file
1288 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
1290 * src/lyxparagraph.h: enable NEW_TABULAR as default
1292 * src/lyxfunc.C (processKeySym): remove some commented code
1294 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
1295 NEW_TABULAR around the fd_form_table_options.
1297 * src/lyx_gui.C (runTime): call the static member function as
1298 GUIRunTime::runTime().
1300 2000-08-21 Allan Rae <rae@lyx.org>
1302 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
1305 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
1307 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
1309 2000-08-21 Allan Rae <rae@lyx.org>
1311 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
1312 keep Garst happy ;-)
1313 * src/frontends/xforms/FormPreferences.C (build): use setOK
1314 * src/frontends/xforms/FormDocument.C (build): use setOK
1315 (FormDocument): use the appropriate policy.
1317 2000-08-21 Allan Rae <rae@lyx.org>
1319 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
1320 automatic [de]activation of arbitrary objects when in a read-only state.
1322 * src/frontends/ButtonPolicies.h: More documentation
1323 (isReadOnly): added to support the above.
1325 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
1327 2000-08-18 Juergen Vigna <jug@sad.it>
1329 * src/insets/insettabular.C (getStatus): changed to return func_status.
1331 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
1332 display toggle menu entries if they are.
1334 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
1335 new document layout now.
1337 * src/lyxfunc.C: ditto
1339 * src/lyx_gui_misc.C: ditto
1341 * src/lyx_gui.C: ditto
1343 * lib/ui/default.ui: removed paper and quotes layout as they are now
1344 all in the document layout tabbed folder.
1346 * src/frontends/xforms/forms/form_document.fd: added Restore
1347 button and callbacks for all inputs for Allan's ButtonPolicy.
1349 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
1350 (CheckChoiceClass): added missing params setting on class change.
1351 (UpdateLayoutDocument): added for updating the layout on params.
1352 (build): forgot to RETURN_ALWAYS input_doc_spacing.
1353 (FormDocument): Implemented Allan's ButtonPolicy with the
1356 2000-08-17 Allan Rae <rae@lyx.org>
1358 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
1359 so we can at least see the credits again.
1361 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
1362 controller calls for the appropriate callbacks. Note that since Ok
1363 calls apply followed by cancel, and apply isn't a valid input for the
1364 APPLIED state, the bc_ calls have to be made in the static callback not
1365 within each of the real callbacks.
1367 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
1368 (setOk): renamed from setOkay()
1370 2000-08-17 Juergen Vigna <jug@sad.it>
1372 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
1373 in the implementation part.
1374 (composeUIInfo): don't show optional menu-items.
1376 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
1378 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
1380 * src/bufferview_funcs.C (CurrentState): fixed to show also the
1381 text-state when in a text-inset.
1383 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
1385 2000-08-17 Marko Vendelin <markov@ioc.ee>
1386 * src/frontends/gnome/FormIndex.C
1387 * src/frontends/gnome/FormIndex.h
1388 * src/frontends/gnome/FormToc.C
1389 * src/frontends/gnome/FormToc.h
1390 * src/frontends/gnome/dialogs
1391 * src/frontends/gnome/diatoc_callbacks.c
1392 * src/frontends/gnome/diatoc_callbacks.h
1393 * src/frontends/gnome/diainsertindex_callbacks.h
1394 * src/frontends/gnome/diainsertindex_callbacks.c
1395 * src/frontends/gnome/diainsertindex_interface.c
1396 * src/frontends/gnome/diainsertindex_interface.h
1397 * src/frontends/gnome/diatoc_interface.h
1398 * src/frontends/gnome/diatoc_interface.c
1399 * src/frontends/gnome/Makefile.am: Table of Contents and
1400 Insert Index dialogs implementation for Gnome frontend
1402 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
1404 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
1406 * src/frontends/gnome/diainserturl_interface.c: make the dialog
1409 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1411 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
1412 destructor. Don't definde if you don't need it
1413 (processEvents): made static, non-blocking events processing for
1415 (runTime): static method. event loop for xforms
1416 * similar as above for kde and gnome.
1418 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
1419 new Pimpl is correct
1420 (runTime): new method calss the real frontends runtime func.
1422 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
1424 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1426 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
1428 2000-08-16 Juergen Vigna <jug@sad.it>
1430 * src/lyx_gui.C (runTime): added GUII RunTime support.
1432 * src/frontends/Makefile.am:
1433 * src/frontends/GUIRunTime.[Ch]:
1434 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
1435 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
1436 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
1438 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
1440 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
1441 as this is already set in ${FRONTEND_INCLUDE} if needed.
1443 * configure.in (CPPFLAGS): setting the include dir for the frontend
1444 directory and don't set FRONTEND=xforms for now as this is executed
1447 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
1449 * src/frontends/kde/Makefile.am:
1450 * src/frontends/kde/FormUrl.C:
1451 * src/frontends/kde/FormUrl.h:
1452 * src/frontends/kde/formurldialog.h:
1453 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
1455 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
1457 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
1459 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1461 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
1464 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
1466 * src/WorkArea.C (work_area_handler): more work to get te
1467 FL_KEYBOARD to work with xforms 0.88 too, please test.
1469 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
1471 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
1473 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
1476 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1478 * src/Timeout.h: remove Qt::emit hack.
1480 * several files: changes to allo doc++ compilation
1482 * src/lyxfunc.C (processKeySym): new method
1483 (processKeyEvent): comment out if FL_REVISION < 89
1485 * src/WorkArea.C: change some debugging levels.
1486 (WorkArea): set wantkey to FL_KEY_ALL
1487 (work_area_handler): enable the FL_KEYBOARD clause, this enables
1488 clearer code and the use of compose with XForms 0.89. Change to
1489 use signals instead of calling methods in bufferview directly.
1491 * src/Painter.C: change some debugging levels.
1493 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
1496 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
1497 (workAreaKeyPress): new method
1499 2000-08-14 Juergen Vigna <jug@sad.it>
1501 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
1503 * config/kde.m4: addes some features
1505 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
1506 include missing xforms dialogs.
1508 * src/Timeout.h: a hack to be able to compile with qt/kde.
1510 * sigc++/.cvsignore: added acinclude.m4
1512 * lib/.cvsignore: added listerros
1514 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
1515 xforms tree as objects are needed for other frontends.
1517 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
1518 linking with not yet implemented xforms objects.
1520 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
1522 2000-08-14 Baruch Even <baruch.even@writeme.com>
1524 * src/frontends/xforms/FormGraphics.h:
1525 * src/frontends/xforms/FormGraphics.C:
1526 * src/frontends/xforms/RadioButtonGroup.h:
1527 * src/frontends/xforms/RadioButtonGroup.C:
1528 * src/insets/insetgraphics.h:
1529 * src/insets/insetgraphics.C:
1530 * src/insets/insetgraphicsParams.h:
1531 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
1532 instead of spaces, and various other indentation issues to make the
1533 sources more consistent.
1535 2000-08-14 Marko Vendelin <markov@ioc.ee>
1537 * src/frontends/gnome/dialogs/diaprint.glade
1538 * src/frontends/gnome/FormPrint.C
1539 * src/frontends/gnome/FormPrint.h
1540 * src/frontends/gnome/diaprint_callbacks.c
1541 * src/frontends/gnome/diaprint_callbacks.h
1542 * src/frontends/gnome/diaprint_interface.c
1543 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
1546 * src/frontends/gnome/dialogs/diainserturl.glade
1547 * src/frontends/gnome/FormUrl.C
1548 * src/frontends/gnome/FormUrl.h
1549 * src/frontends/gnome/diainserturl_callbacks.c
1550 * src/frontends/gnome/diainserturl_callbacks.h
1551 * src/frontends/gnome/diainserturl_interface.c
1552 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
1553 Gnome implementation
1555 * src/frontends/gnome/Dialogs.C
1556 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
1557 all other dialogs. Copy all unimplemented dialogs from Xforms
1560 * src/frontends/gnome/support.c
1561 * src/frontends/gnome/support.h: support files generated by Glade
1565 * config/gnome.m4: Gnome configuration scripts
1567 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
1568 configure --help message
1570 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
1571 only if there are no events pendling in Gnome/Gtk. This enhances
1572 the performance of menus.
1575 2000-08-14 Allan Rae <rae@lyx.org>
1577 * lib/Makefile.am: listerrors cleaning
1579 * lib/listerrors: removed -- generated file
1580 * acinclude.m4: ditto
1581 * sigc++/acinclude.m4: ditto
1583 * src/frontends/xforms/forms/form_citation.fd:
1584 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
1587 * src/frontends/xforms/forms/makefile: I renamed the `install` target
1588 `updatesrc` and now we have a `test` target that does what `updatesrc`
1589 used to do. I didn't like having an install target that wasn't related
1592 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
1593 on all except FormGraphics. This may yet happen. Followed by a major
1594 cleanup including using FL_TRANSIENT for most of the dialogs. More
1595 changes to come when the ButtonController below is introduced.
1597 * src/frontends/xforms/ButtonController.h: New file for managing up to
1598 four buttons on a dialog according to an externally defined policy.
1599 * src/frontends/xforms/Makefile.am: added above
1601 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
1602 Apply and Cancel/Close buttons and everything in between and beyond.
1603 * src/frontends/Makefile.am: added above.
1605 * src/frontends/xforms/forms/form_preferences.fd:
1606 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
1607 and removed variable 'status' as a result. Fixed the set_minsize thing.
1608 Use the new screen-font-update after checking screen fonts were changed
1609 Added a "Restore" button to restore the original lyxrc values while
1610 editing. This restores everything not just the last input changed.
1611 That's still a tricky one. As is the "LyX: this shouldn't happen..."
1613 * src/LyXAction.C: screen-font-update added for updating buffers after
1614 screen font settings have been changed.
1615 * src/commandtags.h: ditto
1616 * src/lyxfunc.C: ditto
1618 * forms/lyx.fd: removed screen fonts dialog.
1619 * src/lyx_gui.C: ditto
1620 * src/menus.[Ch]: ditto
1621 * src/lyx.[Ch]: ditto
1622 * src/lyx_cb.C: ditto + code from here moved to make
1623 screen-font-update. And people wonder why progress on GUII is
1624 slow. Look at how scattered this stuff was! It takes forever
1627 * forms/fdfix.sh: Fixup the spacing after commas.
1628 * forms/makefile: Remove date from generated files. Fewer clashes now.
1629 * forms/bullet_forms.C.patch: included someones handwritten changes
1631 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
1632 once I've discovered why LyXRC was made noncopyable.
1633 * src/lyx_main.C: ditto
1635 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
1637 * src/frontends/xforms/forms/fdfix.sh:
1638 * src/frontends/xforms/forms/fdfixh.sed:
1639 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
1640 * src/frontends/xforms/Form*.[hC]:
1641 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
1642 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
1643 provide a destructor for the struct FD_form_xxxx. Another version of
1644 the set_[max|min]size workaround and a few other cleanups. Actually,
1645 Angus' patch from 20000809.
1647 2000-08-13 Baruch Even <baruch.even@writeme.com>
1649 * src/insets/insetgraphics.C (Clone): Added several fields that needed
1652 2000-08-11 Juergen Vigna <jug@sad.it>
1654 * src/insets/insetgraphics.C (InsetGraphics): changing init
1655 order because of warnings.
1657 * src/frontends/xforms/forms/makefile: adding patching .C with
1660 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
1661 from .C.patch to .c.patch
1663 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
1664 order because of warning.
1666 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
1668 * src/frontends/Liason.C (setMinibuffer): new helper function
1670 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
1672 * src/lyxfunc.C (Dispatch): calling new Document-Layout
1674 * lib/ui/default.ui: commented out PaperLayout entry
1676 * src/frontends/xforms/form_document.[Ch]: new added files
1678 * src/frontends/xforms/FormDocument.[Ch]: ditto
1680 * src/frontends/xforms/forms/form_document.fd: ditto
1682 * src/frontends/xforms/forms/form_document.C.patch: ditto
1684 2000-08-10 Juergen Vigna <jug@sad.it>
1686 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
1687 (InsetGraphics): initialized cacheHandle to 0.
1688 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
1690 2000-08-10 Baruch Even <baruch.even@writeme.com>
1692 * src/graphics/GraphicsCache.h:
1693 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
1694 correctly as a cache.
1696 * src/graphics/GraphicsCacheItem.h:
1697 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
1700 * src/graphics/GraphicsCacheItem_pimpl.h:
1701 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
1704 * src/insets/insetgraphics.h:
1705 * src/insets/insetgraphics.C: Changed from using a signal notification
1706 to polling when image is not loaded.
1708 2000-08-10 Allan Rae <rae@lyx.org>
1710 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
1711 that there are two functions that have to been taken out of line by
1712 hand and aren't taken care of in the script. (Just a reminder note)
1714 * sigc++/macros/*.h.m4: Updated as above.
1716 2000-08-09 Juergen Vigna <jug@sad.it>
1718 * src/insets/insettext.C (draw): small fix for clearing rectangle.
1720 * src/insets/insettabular.C: make drawing of single cell smarter.
1722 2000-08-09 Marko Vendelin <markov@ioc.ee>
1723 * src/frontends/gnome/Menubar_pimpl.C
1724 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
1725 implementation: new files
1727 * src/frontends/gnome/mainapp.C
1728 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
1731 * src/main.C: create Gnome main window
1733 * src/frontends/xforms/Menubar_pimpl.h
1734 * src/frontends/Menubar.C
1735 * src/frontends/Menubar.h: added method Menubar::update that calls
1736 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
1738 * src/LyXView.C: calls Menubar::update to update the state
1741 * src/frontends/gnome/Makefile.am: added new files
1743 * src/frontends/Makefile.am: added frontend compiler options
1745 2000-08-08 Juergen Vigna <jug@sad.it>
1747 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
1749 * src/bufferlist.C (close):
1750 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
1751 documents if exiting without saving.
1753 * src/buffer.C (save): use removeAutosaveFile()
1755 * src/support/filetools.C (removeAutosaveFile): new function.
1757 * src/lyx_cb.C (MenuWrite): returns a bool now.
1758 (MenuWriteAs): check if file could really be saved and revert to the
1760 (MenuWriteAs): removing old autosavefile if existant.
1762 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
1763 before Goto toggle declaration, because of compiler warning.
1765 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
1767 * src/lyxfunc.C (MenuNew): small fix.
1769 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
1771 * src/bufferlist.C (newFile):
1772 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
1774 * src/lyxrc.C: added new_ask_filename tag
1776 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
1778 * src/lyx.fd: removed code pertaining to form_ref
1779 * src/lyx.[Ch]: ditto
1780 * src/lyx_cb.C: ditto
1781 * src/lyx_gui.C: ditto
1782 * src/lyx_gui_misc.C: ditto
1784 * src/BufferView_pimpl.C (restorePosition): update buffer only
1787 * src/commandtags.h (LFUN_REFTOGGLE): removed
1788 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
1789 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
1790 (LFUN_REFBACK): renamed LFUN_REF_BACK
1792 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
1793 * src/menus.C: ditto
1794 * src/lyxfunc.C (Dispatch): ditto.
1795 InsertRef dialog is now GUI-independent.
1797 * src/texrow.C: added using std::endl;
1799 * src/insets/insetref.[Ch]: strip out large amounts of code.
1800 The inset is now a container and this functionality is now
1801 managed by a new FormRef dialog
1803 * src/frontends/Dialogs.h (showRef, createRef): new signals
1805 * src/frontends/xforms/FormIndex.[Ch],
1806 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
1807 when setting dialog's min/max size
1808 * src/frontends/xforms/FormIndex.[Ch]: ditto
1810 * src/frontends/xforms/FormRef.[Ch],
1811 src/frontends/xforms/forms/form_ref.fd: new xforms
1812 implementation of an InsetRef dialog
1814 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
1817 * src/graphics/XPM_Renderer.C (isImageFormatOK):
1818 ios::nocreate is not part of the standard. Removed.
1820 2000-08-07 Baruch Even <baruch.even@writeme.com>
1822 * src/graphics/Renderer.h:
1823 * src/graphics/Renderer.C: Added base class for rendering of different
1824 image formats into Pixmaps.
1826 * src/graphics/XPM_Renderer.h:
1827 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
1828 in a different class.
1830 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
1831 easily add support for other formats.
1833 * src/insets/figinset.C: plugged a leak of an X resource.
1835 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1837 * src/CutAndPaste.[Ch]: make all metods static.
1839 * development/Code_rules/Rules: more work, added section on
1840 Exceptions, and a References section.
1842 * a lot of header files: work to make doc++ able to generate the
1843 source documentation, some workarounds of doc++ problems. Doc++ is
1844 now able to generate the documentation.
1846 2000-08-07 Juergen Vigna <jug@sad.it>
1848 * src/insets/insettabular.C (recomputeTextInsets): removed function
1850 * src/tabular.C (SetWidthOfMulticolCell):
1852 (calculate_width_of_column_NMC): fixed return value so that it really
1853 only returns true if the column-width has changed (there where
1854 problems with muliticolumn-cells in this column).
1856 2000-08-04 Juergen Vigna <jug@sad.it>
1858 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
1859 also on the scrollstatus of the inset.
1860 (workAreaMotionNotify): ditto.
1862 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
1864 2000-08-01 Juergen Vigna <jug@sad.it>
1866 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
1868 * src/commandtags.h:
1869 * src/LyXAction.C (init):
1870 * src/insets/inset.C (LocalDispatch): added support for
1873 * src/insets/inset.C (scroll): new functions.
1875 * src/insets/insettext.C (removeNewlines): new function.
1876 (SetAutoBreakRows): removes forced newlines in the text of the
1877 paragraph if autoBreakRows is set to false.
1879 * src/tabular.C (Latex): generates a parbox around the cell contents
1882 * src/frontends/xforms/FormTabular.C (local_update): removed
1883 the radio_useparbox button.
1885 * src/tabular.C (UseParbox): new function
1887 2000-08-06 Baruch Even <baruch.even@writeme.com>
1889 * src/graphics/GraphicsCache.h:
1890 * src/graphics/GraphicsCache.C:
1891 * src/graphics/GraphicsCacheItem.h:
1892 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
1895 * src/insets/insetgraphics.h:
1896 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
1897 drawing of the inline image.
1899 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
1900 into the wrong position.
1902 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
1905 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
1907 * src/support/translator.h: move all typedefs to public section
1909 * src/support/filetools.C (MakeLatexName): return string const
1911 (TmpFileName): ditto
1912 (FileOpenSearch): ditto
1914 (LibFileSearch): ditto
1915 (i18nLibFileSearch): ditto
1918 (CreateTmpDir): ditto
1919 (CreateBufferTmpDir): ditto
1920 (CreateLyXTmpDir): ditto
1923 (MakeAbsPath): ditto
1925 (OnlyFilename): ditto
1927 (NormalizePath): ditto
1928 (CleanupPath): ditto
1929 (GetFileContents): ditto
1930 (ReplaceEnvironmentPath): ditto
1931 (MakeRelPath): ditto
1933 (ChangeExtension): ditto
1934 (MakeDisplayPath): ditto
1935 (do_popen): return cmdret const
1936 (findtexfile): return string const
1938 * src/support/DebugStream.h: add some /// to please doc++
1940 * src/frontends/DialogBase.h (endif): add some /// to please doc++
1942 * src/texrow.C (same_rownumber): functor to use with find_if
1943 (getIdFromRow): rewritten to use find_if and to not update the
1944 positions. return true if row is found
1945 (increasePos): new method, use to update positions
1947 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
1949 * src/lyxlex_pimpl.C (verifyTable): new method
1952 (GetString): return string const
1953 (pushTable): rewrite to use std::stack
1955 (setFile): better check
1958 * src/lyxlex.h: make LyXLex noncopyable
1960 * src/lyxlex.C (text): return char const * const
1961 (GetString): return string const
1962 (getLongString): return string const
1964 * src/lyx_gui_misc.C (askForText): return pair<...> const
1966 * src/lastfiles.[Ch] (operator): return string const
1968 * src/buffer.C (parseSingleLyXformat2Token): pass string to
1969 istringstream not char const *.
1970 move token.end() out of loop.
1971 (readFile): move initializaton of token
1973 * src/BufferView2.C (insertErrors): run texrow.increasePos if
1974 getIdFromRow is successful.
1976 * lib/bind/emacs.bind: don't include menus bind
1978 * development/Code_rules/Rules: the beginnings of making this
1979 better and covering more of the unwritten rules that we have.
1981 * development/Code_rules/Recommendations: a couple of wording
1984 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1986 * src/support/strerror.c: remove C++ comment.
1988 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
1990 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
1991 LFUN_INDEX_INSERT_LAST
1993 * src/texrow.C (getIdFromRow): changed from const_iterator to
1994 iterator, allowing code to compile with DEC cxx
1996 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
1997 stores part of the class, as suggested by Allan. Will allow
1999 (apply): test to apply uses InsetCommandParams operator!=
2001 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
2002 (apply): test to apply uses InsetCommandParams operator!=
2004 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
2005 stores part of the class.
2006 (update): removed limits on min/max size.
2008 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
2009 (apply): test to apply uses InsetCommandParams operator!=
2011 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
2012 (Read, Write, scanCommand, getCommand): moved functionality
2013 into InsetCommandParams.
2015 (getScreenLabel): made pure virtual
2016 new InsetCommandParams operators== and !=
2018 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
2019 c-tors based on InsetCommandParams. Removed others.
2020 * src/insets/insetinclude.[Ch]: ditto
2021 * src/insets/insetlabel.[Ch]: ditto
2022 * src/insets/insetparent.[Ch]: ditto
2023 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
2025 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
2026 insets derived from InsetCommand created using similar c-tors
2027 based on InsetCommandParams
2028 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
2029 * src/menus.C (ShowRefsMenu): ditto
2030 * src/paragraph.C (Clone): ditto
2031 * src/text2.C (SetCounter): ditto
2032 * src/lyxfunc.C (Dispatch) ditto
2033 Also recreated old InsetIndex behaviour exactly. Can now
2034 index-insert at the start of a paragraph and index-insert-last
2035 without launching the pop-up.
2037 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2039 * lib/lyxrc.example: mark te pdf options as non functional.
2041 * src/support/lstrings.C (strToInt): move initalization of tmpstr
2042 (isStrDbl): move tmpstr.end() out of loop.
2043 (strToDbl): move intialization of tmpstr
2044 (lowercase): return string const and move tmp.end() out of loop.
2045 (uppercase): return string const and move tmp.edn() out of loop.
2046 (prefixIs): add assertion
2051 (containsOnly): ditto
2052 (containsOnly): ditto
2053 (containsOnly): ditto
2054 (countChar): make last arg char not char const
2055 (token): return string const
2056 (subst): return string const, move tmp.end() out of loop.
2057 (subst): return string const, add assertion
2058 (strip): return string const
2059 (frontStrip): return string const, add assertion
2060 (frontStrip): return string const
2065 * src/support/lstrings.C: add inclde "LAssert.h"
2066 (isStrInt): move tmpstr.end() out of loop.
2068 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
2069 toollist.end() out of loop.
2070 (deactivate): move toollist.end() out of loop.
2071 (update): move toollist.end() out of loop.
2072 (updateLayoutList): move tc.end() out of loop.
2073 (add): move toollist.end() out of loop.
2075 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
2076 md.end() out of loop.
2078 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
2080 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
2083 * src/paragraph.C (Erase): move fontlist.end() out of loop.
2084 (Erase): move insetlist.end() out of loop.
2086 * src/lyx_sendfax_main.C: make show_logfile static and to take a
2087 ref to const string as first arg. Move initialization of some
2088 variables, whitespace changes.
2090 * src/kbmap.C (defkey): move table.end() out of loop.
2091 (kb_keymap): move table.end() out of loop.
2092 (findbinding): move table.end() out of loop.
2094 * src/MenuBackend.C (hasMenu): move end() out of loop.
2095 (getMenu): move end() out of loop.
2096 (getMenu): move menulist_.end() out of loop.
2098 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
2100 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
2103 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
2104 (getFromLyXName): move infotab.end() out of loop.
2106 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
2107 -fvtable-thunks -ffunction-sections -fdata-sections
2109 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
2111 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
2114 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
2116 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
2118 * src/frontends/xforms/FormCitation.[Ch],
2119 src/frontends/xforms/FormIndex.[Ch],
2120 src/frontends/xforms/FormToc.[Ch],
2121 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
2123 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
2125 * src/commandtags.h: renamed, created some flags for citation
2128 * src/lyx_gui_misc.C: stripped out old FD_index_form code
2130 * src/lyxfunc.C (dispatch): use signals to insert index entry
2132 * src/frontends/Dialogs.h: new signal createIndex
2134 * src/frontends/xforms/FormCommand.[Ch],
2135 src/frontends/xforms/FormCitation.[Ch],
2136 src/frontends/xforms/FormToc.[Ch],
2137 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
2139 * src/insets/insetindex.[Ch]: GUI-independent
2141 * src/frontends/xforms/FormIndex.[Ch],
2142 * src/frontends/xforms/forms/form_index.fd: xforms implementation
2145 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
2147 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
2148 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
2150 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2152 * src/insets/insetref.C (Latex): rewrite so that there is now
2153 question that a initialization is requested.
2155 * src/insets/insetcommand.h: reenable the hide signal
2157 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2159 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
2160 fix handling of shortcuts (many bugs :)
2161 (add_lastfiles): ditto.
2163 * lib/ui/default.ui: fix a few shortcuts.
2165 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
2167 * Makefile.am: Fix ``rpmdist'' target to return the exit
2168 status of the ``rpm'' command, instead of the last command in
2169 the chain (the ``rm lyx.xpm'' command, which always returns
2172 2000-08-02 Allan Rae <rae@lyx.org>
2174 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
2175 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
2176 * src/frontends/xforms/FormToc.C (FormToc): ditto
2178 * src/frontends/xforms/Makefile.am: A few forgotten files
2180 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
2181 Signals-not-copyable-problem Lars' started commenting out.
2183 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
2185 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2187 * src/insets/insetcommand.h: Signals is not copyable so anoter
2188 scheme for automatic hiding of forms must be used.
2190 * src/frontends/xforms/FormCitation.h: don't inerit from
2191 noncopyable, FormCommand already does that.
2192 * src/frontends/xforms/FormToc.h: ditto
2193 * src/frontends/xforms/FormUrl.h: ditto
2195 * src/frontends/xforms/FormCitation.C: add include <algorithm>
2197 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
2199 * src/insets/insetcommand.h (hide): new SigC::Signal0
2200 (d-tor) new virtual destructor emits hide signal
2202 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
2203 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
2205 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
2206 LOF and LOT. Inset is now GUI-independent
2208 * src/insets/insetloa.[Ch]: redundant
2209 * src/insets/insetlof.[Ch]: ditto
2210 * src/insets/insetlot.[Ch]: ditto
2212 * src/frontends/xforms/forms/form_url.fd: tweaked!
2213 * src/frontends/xforms/forms/form_citation.fd: ditto
2215 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
2216 dialogs dealing with InsetCommand insets
2218 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
2219 FormCommand base class
2220 * src/frontends/xforms/FormUrl.[Ch]: ditto
2222 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
2224 * src/frontends/xforms/FormToc.[Ch]: ditto
2226 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
2227 passed a generic InsetCommand pointer
2228 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
2230 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
2231 and modified InsetTOC class
2232 * src/buffer.C: ditto
2234 * forms/lyx.fd: strip out old FD_form_toc code
2235 * src/lyx_gui_misc.C: ditto
2236 * src/lyx_gui.C: ditto
2237 * src/lyx_cb.C: ditto
2238 * src/lyx.[Ch]: ditto
2240 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2242 * src/support/utility.hpp: tr -d '\r'
2244 2000-08-01 Juergen Vigna <jug@sad.it>
2246 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
2248 * src/commandtags.h:
2249 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
2250 LFUN_TABULAR_FEATURES.
2252 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
2253 LFUN_LAYOUT_TABULAR.
2255 * src/insets/insettabular.C (getStatus): implemented helper function.
2257 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
2259 2000-07-31 Juergen Vigna <jug@sad.it>
2261 * src/text.C (draw): fixed screen update problem for text-insets.
2263 * src/text2.C (SetParagrpah): call an update of the inset-owner when
2264 something changed probably this has to be added in various other
2267 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
2269 2000-07-31 Baruch Even <baruch.even@writeme.com>
2271 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
2272 templates to satisfy compaq cxx.
2275 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2277 * src/support/translator.h (equal_1st_in_pair::operator()): take
2278 const ref pair_type as arg.
2279 (equal_2nd_in_pair::operator()): ditto
2280 (Translator::~Translator): remove empty d-tor.
2282 * src/graphics/GraphicsCache.C: move include config.h to top, also
2283 put initialization of GraphicsCache::singleton here.
2284 (~GraphicsCache): move here
2285 (addFile): take const ref as arg
2288 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
2290 * src/BufferView2.C (insertLyXFile): change te with/without header
2293 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2295 * src/frontends/xforms/FormGraphics.C (apply): add some
2296 static_cast. Not very nice, but required by compaq cxx.
2298 * src/frontends/xforms/RadioButtonGroup.h: include header
2299 <utility> instead of <pair.h>
2301 * src/insets/insetgraphicsParams.C: add using directive.
2302 (readResize): change return type to void.
2303 (readOrigin): ditto.
2305 * src/lyxfunc.C (getStatus): add missing break for build-program
2306 function; add test for Literate for export functions.
2308 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
2309 entries in Options menu.
2311 2000-07-31 Baruch Even <baruch.even@writeme.com>
2313 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
2314 protect against auto-allocation; release icon when needed.
2316 2000-07-31 Matej Cepl <CeplM@seznam.cz>
2318 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
2319 on usual typewriter.
2321 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
2322 earlier czech.kmap), useful only for programming.
2324 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2326 * src/frontends/xforms/FormCitation.h: fix conditioning around
2329 2000-07-31 Juergen Vigna <jug@sad.it>
2331 * src/frontends/xforms/FormTabular.C (local_update): changed
2332 radio_linebreaks to radio_useparbox and added radio_useminipage.
2334 * src/tabular.C: made support for using minipages/parboxes.
2336 * src/bufferlist.C (QwriteAll): small fix for asking for save.
2338 * src/insets/insetgraphics.C (draw): just draw the inset so that the
2340 (descent): so the cursor is in the middle.
2341 (width): bit smaller box.
2343 * src/insets/insetgraphics.h: added display() function.
2345 2000-07-31 Baruch Even <baruch.even@writeme.com>
2347 * src/frontends/Dialogs.h: Added showGraphics signals.
2349 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
2350 xforms form definition of the graphics dialog.
2352 * src/frontends/xforms/FormGraphics.h:
2353 * src/frontends/xforms/FormGraphics.C: Added files, the
2354 GUIndependent code of InsetGraphics
2356 * src/insets/insetgraphics.h:
2357 * src/insets/insetgraphics.C: Major writing to make it work.
2359 * src/insets/insetgraphicsParams.h:
2360 * src/insets/insetgraphicsParams.C: Added files, parameter passing
2361 struct between InsetGraphics and GUI.
2363 * src/LaTeXFeatures.h:
2364 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
2365 support for graphicx package.
2367 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
2368 for the graphics inset.
2370 * src/support/translator.h: Added file, used in
2371 InsetGraphicsParams. this is a template to translate between two
2374 * src/frontends/xforms/RadioButtonGroup.h:
2375 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
2376 way to easily control a radio button group.
2378 2000-07-28 Juergen Vigna <jug@sad.it>
2380 * src/insets/insettabular.C (LocalDispatch):
2381 (TabularFeatures): added support for lyx-functions of tabular features.
2382 (cellstart): refixed this function after someone wrongly changed it.
2384 * src/commandtags.h:
2385 * src/LyXAction.C (init): added support for tabular-features
2387 2000-07-28 Allan Rae <rae@lyx.org>
2389 * src/frontends/xforms/FormPreferences.C (build): Setup input return
2390 checking. NOTE: It seems that pressing ESC to cancel the dialog also
2391 triggers the callback for input checking. As a result we sometimes get
2392 "LyX: This shouldn't happen..." printed to cerr.
2393 (input): Started using status variable since I only free() on
2394 destruction. Some input checking for paths and font sizes.
2396 * src/frontends/xforms/FormPreferences.h: Use status to control
2397 activation of Ok and Apply
2399 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
2400 callback. Also resized to stop segfaults with 0.88. The problem is
2401 that xforms-0.88 requires the folder to be wide enough to fit all the
2402 tabs. If it isn't it causes all sorts of problems.
2404 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
2406 * src/frontends/xforms/forms/README: Reflect reality.
2408 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
2409 * src/frontends/xforms/forms/makefile: ditto.
2411 * src/commandtags.h: Get access to new Preferences dialog
2412 * src/LyXAction.C: ditto
2413 * src/lyxfunc.C: ditto
2414 * lib/ui/default.ui: ditto
2416 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2418 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
2420 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
2423 * src/frontends/xforms/form_url.[Ch]: added.
2425 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2427 * src/insets/insetbib.h: fixed bug in previous commit
2429 * src/frontends/xforms/FormUrl.h: ditto
2431 * src/frontends/xforms/FormPrint.h: ditto
2433 * src/frontends/xforms/FormPreferences.h: ditto
2435 * src/frontends/xforms/FormCopyright.h: ditto
2437 * src/frontends/xforms/FormCitation.C: ditto
2439 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
2440 private copyconstructor and private default contructor
2442 * src/support/Makefile.am: add utility.hpp
2444 * src/support/utility.hpp: new file from boost
2446 * src/insets/insetbib.h: set owner in clone
2448 * src/frontends/xforms/FormCitation.C: added missing include
2451 * src/insets/form_url.[Ch]: removed
2453 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
2455 * development/lyx.spec.in
2456 * Makefile.am: Fix buglet for LyX RPM generation resulting from
2457 file/directory re-organization.
2459 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
2461 * src/insets/insetcommand.[Ch]: moved the string data and
2462 associated manipulation methods into a new stand-alone class
2463 InsetCommandParams. This class has two additional methods
2464 getAsString() and setFromString() allowing the contents to be
2465 moved around as a single string.
2466 (addContents) method removed.
2467 (setContents) method no longer virtual.
2469 * src/buffer.C (readInset): made use of new InsetCitation,
2470 InsetUrl constructors based on InsetCommandParams.
2472 * src/commandtags.h: add LFUN_INSERT_URL
2474 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
2475 independent InsetUrl and use InsetCommandParams to extract
2476 string info and create new Insets.
2478 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
2480 * src/frontends/xforms/FormCitation.C (apply): uses
2483 * src/frontends/xforms/form_url.C
2484 * src/frontends/xforms/form_url.h
2485 * src/frontends/xforms/FormUrl.h
2486 * src/frontends/xforms/FormUrl.C
2487 * src/frontends/xforms/forms/form_url.fd: new files
2489 * src/insets/insetcite.[Ch]: removed unused constructors.
2491 * src/insets/insetinclude.[Ch]: no longer store filename
2493 * src/insets/inseturl.[Ch]: GUI-independent.
2495 2000-07-26 Juergen Vigna <jug@sad.it>
2496 * renamed frontend from gtk to gnome as it is that what is realized
2497 and did the necessary changes in the files.
2499 2000-07-26 Marko Vendelin <markov@ioc.ee>
2501 * configure.in: cleaning up gnome configuration scripts
2503 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2505 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
2506 shortcuts syndrom by redrawing them explicitely (a better solution
2507 would be appreciated).
2509 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
2511 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
2514 * src/lyx_cb.C (MenuExport): change html export to do the right
2515 thing depending of the document type (instead of having
2516 html-linuxdoc and html-docbook).
2517 * src/lyxfunc.C (getStatus): update for html
2518 * lib/ui/default.ui: simplify due to the above change.
2519 * src/menus.C (ShowFileMenu): update too (in case we need it).
2521 * src/MenuBackend.C (read): if a menu is defined twice, add the
2522 new entries to the exiting one.
2524 2000-07-26 Juergen Vigna <jug@sad.it>
2526 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
2528 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
2529 and return a bool if it did actual save the file.
2530 (AutoSave): don't autosave a unnamed doc.
2532 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
2533 check if this is an UNNAMED new file and react to it.
2534 (newFile): set buffer to unnamed and change to not mark a new
2535 buffer dirty if I didn't do anything with it.
2537 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
2539 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2541 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
2542 friend as per Angus's patch posted to lyx-devel.
2544 * src/ext_l10n.h: updated
2546 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
2547 gettext on the style string right before inserting them into the
2550 * autogen.sh: add code to extract style strings form layout files,
2551 not good enough yet.
2553 * src/frontends/gtk/.cvsignore: add MAKEFILE
2555 * src/MenuBackend.C (read): run the label strings through gettext
2556 before storing them in the containers.
2558 * src/ext_l10n.h: new file
2560 * autogen.sh : generate the ext_l10n.h file here
2562 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2564 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
2567 * lib/ui/default.ui: fix a couple of typos.
2569 * config/gnome/gtk.m4: added (and added to the list of files in
2572 * src/insets/insetinclude.C (unique_id): fix when we are using
2573 lyxstring instead of basic_string<>.
2574 * src/insets/insettext.C (LocalDispatch): ditto.
2575 * src/support/filetools.C: ditto.
2577 * lib/configure.m4: create the ui/ directory if necessary.
2579 * src/LyXView.[Ch] (updateToolbar): new method.
2581 * src/BufferView_pimpl.C (buffer): update the toolbar when
2582 opening/closing buffer.
2584 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2586 * src/LyXAction.C (getActionName): enhance to return also the name
2587 and options of pseudo-actions.
2588 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
2590 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
2591 as an example of what is possible). Used in File->Build too (more
2592 useful) and in the import/export menus (to mimick the complicated
2593 handling of linuxdoc and friends). Try to update all the entries.
2595 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
2598 * src/MenuBackend.C (read): Parse the new OptItem tag.
2600 * src/MenuBackend.h: Add a new optional_ data member (used if the
2601 entry should be omitted when the lyxfunc is disabled).
2603 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
2604 function, used as a shortcut.
2605 (create_submenu): align correctly the shortcuts on the widest
2608 * src/MenuBackend.h: MenuItem.label() only returns the label of
2609 the menu without shortcut; new method shortcut().
2611 2000-07-14 Marko Vendelin <markov@ioc.ee>
2613 * src/frontends/gtk/Dialogs.C:
2614 * src/frontends/gtk/FormCopyright.C:
2615 * src/frontends/gtk/FormCopyright.h:
2616 * src/frontends/gtk/Makefile.am: added these source-files for the
2617 Gtk/Gnome support of the Copyright-Dialog.
2619 * src/main.C: added Gnome::Main initialization if using
2620 Gtk/Gnome frontend-GUI.
2622 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
2624 * config/gnome/aclocal-include.m4
2625 * config/gnome/compiler-flags.m4
2626 * config/gnome/curses.m4
2627 * config/gnome/gnome--.m4
2628 * config/gnome/gnome-bonobo-check.m4
2629 * config/gnome/gnome-common.m4
2630 * config/gnome/gnome-fileutils.m4
2631 * config/gnome/gnome-ghttp-check.m4
2632 * config/gnome/gnome-gnorba-check.m4
2633 * config/gnome/gnome-guile-checks.m4
2634 * config/gnome/gnome-libgtop-check.m4
2635 * config/gnome/gnome-objc-checks.m4
2636 * config/gnome/gnome-orbit-check.m4
2637 * config/gnome/gnome-print-check.m4
2638 * config/gnome/gnome-pthread-check.m4
2639 * config/gnome/gnome-support.m4
2640 * config/gnome/gnome-undelfs.m4
2641 * config/gnome/gnome-vfs.m4
2642 * config/gnome/gnome-x-checks.m4
2643 * config/gnome/gnome-xml-check.m4
2644 * config/gnome/gnome.m4
2645 * config/gnome/gperf-check.m4
2646 * config/gnome/gtk--.m4
2647 * config/gnome/linger.m4
2648 * config/gnome/need-declaration.m4: added configuration scripts
2649 for Gtk/Gnome frontend-GUI
2651 * configure.in: added support for the --with-frontend=gtk option
2653 * autogen.sh: added config/gnome/* to list of config-files
2655 * acconfig.h: added define for GTKGUI-support
2657 * config/lyxinclude.m4: added --with-frontend[=value] option value
2658 for Gtk/Gnome frontend-GUI support.
2660 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2662 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
2666 * src/paragraph.C (GetChar): remove non-const version
2668 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
2669 (search_kw): use it.
2671 * src/lyx_main.C (init): if "preferences" exist, read that instead
2673 (ReadRcFile): return bool if the file could be read ok.
2674 (ReadUIFile): add a check to see if lex file is set ok.
2676 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
2677 bastring can be used instead of lyxstring (still uses the old code
2678 if std::string is good enough or if lyxstring is used.)
2680 * src/encoding.C: make the arrays static, move ininle functions
2682 * src/encoding.h: from here.
2684 * src/buffer.C: have last_isnet_read as a file scope variable for now.
2685 (parseSingleLyXformat2Token): move inset parsing to separate method
2686 (readInset): new private method
2688 * src/Variables.h: remove virtual from get().
2690 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
2691 access to NEW_INSETS and NEW_TABULAR
2693 * src/MenuBackend.h: remove superfluous forward declaration of
2694 MenuItem. Add documentations tags "///", remove empty MenuItem
2695 destructor, remove private default contructor.
2697 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
2699 (read): more string mlabel and mname to where they are used
2700 (read): remove unused variables mlabel and mname
2701 (defaults): unconditional clear, make menusetup take advantage of
2702 add returning Menu &.
2704 * src/LyXView.h: define NEW_MENUBAR as default
2706 * src/LyXAction.C: include lyxparagraph.h temporary to get access
2707 to NEW_INSETS and NEW_TABULAR.
2708 (init): commetn out some funcs that is obsolete when NEW_INSETS is
2709 defined. Change some of the "xxxx-inset-insert" functions names to
2712 * several files: more enahncements to NEW_INSETS and the resulting
2715 * lib/lyxrc.example (\date_insert_format): move to misc section
2717 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
2718 bastring and use AC_CACHE_CHECK.
2719 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
2720 the system have the newest methods. uses AC_CACHE_CHECK
2721 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
2722 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
2723 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
2725 * configure.in: add LYX_CXX_GOOD_STD_STRING
2727 * acinclude.m4: recreated
2729 2000-07-24 Amir Karger
2731 * README: add Hebrew, Arabic kmaps
2734 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2736 * src/buffer.C (writeFileAscii): Define actcell as an int instead
2739 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2741 * Lot of files: add pragma interface/implementation.
2743 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
2745 * lib/ui/default.ui: new file (ans new directory). Contains the
2746 default menu and toolbar.
2748 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
2749 global space. Toolbars are now read (as menus) in ui files.
2751 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
2753 * src/lyxfunc.C (getStatus): do not exit immediately if a command
2754 is disabled because the document is read-only. We want to have the
2755 toggle state of the function anyway.
2756 (getStatus): add code for LFUN_VC* functions (mimicking what is
2757 done in old-style menus)
2759 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
2760 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
2762 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
2763 * src/BufferView_pimpl.C: ditto.
2764 * src/lyxfunc.C: ditto.
2766 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
2767 default). This replaces old-style menus by new ones.
2769 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
2770 MenuItem. Contain the data structure of a menu.
2772 * src/insets/insettext.C: use LyXView::setLayout instead of
2773 accessing directly the toolbar combox.
2774 * src/lyxfunc.C (Dispatch): ditto.
2776 * src/LyXView.C (setLayout): new method, which just calls
2777 Toolbar::setLayout().
2778 (updateLayoutChoice): move part of this method in Toolbar.
2780 * src/toolbar.[Ch]: removed.
2782 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
2783 implementation the toolbar.
2785 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
2786 the toolbar. It might make sense to merge it with ToolbarDefaults
2788 (setLayout): new function.
2789 (updateLayoutList): ditto.
2790 (openLayoutList): ditto.
2792 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
2793 xforms implementation of the toolbar.
2794 (get_toolbar_func): comment out, since I do not
2795 know what it is good for.
2797 * src/ToolbarDefaults.h: Add the ItemType enum.
2799 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
2800 for a list of allocated C strings. Used in Menubar xforms
2801 implementation to avoid memory leaks.
2803 * src/support/lstrings.[Ch] (uppercase): new version taking and
2807 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
2808 * lib/bind/emacs.bind: ditto.
2810 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2812 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
2813 forward decl of LyXView.
2815 * src/toolbar.C (toolbarItem): moved from toolbar.h
2816 (toolbarItem::clean): ditto
2817 (toolbarItem::~toolbarItem): ditto
2818 (toolbarItem::operator): ditto
2820 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
2822 * src/paragraph.h: control the NEW_TABULAR define from here
2824 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
2825 USE_TABULAR_INSETS to NEW_TABULAR
2827 * src/ToolbarDefaults.C: add include "lyxlex.h"
2829 * files using the old table/tabular: use NEW_TABULAR to control
2830 compilation of old tabular stuff.
2832 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
2835 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
2836 planemet in reading of old style floats, fix the \end_deeper
2837 problem when reading old style floats.
2839 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2841 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
2843 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
2845 * lib/bind/sciword.bind: updated.
2847 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2849 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
2850 layout write problem
2852 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2854 * src/Makefile.am (INCLUDES): remove image directory from include
2857 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
2858 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
2860 * src/LyXView.C (create_form_form_main): read the application icon
2863 * lib/images/*.xpm: change the icons to use transparent color for
2866 * src/toolbar.C (update): change the color of the button when it
2869 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2871 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
2872 setting explicitely the minibuffer.
2873 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
2875 * src/LyXView.C (showState): new function. Shows font information
2876 in minibuffer and update toolbar state.
2877 (LyXView): call Toolbar::update after creating the
2880 * src/toolbar.C: change toollist to be a vector instead of a
2882 (BubbleTimerCB): get help string directly from the callback
2883 argument of the corresponding icon (which is the action)
2884 (set): remove unnecessary ugliness.
2885 (update): new function. update the icons (depressed, disabled)
2886 depending of the status of the corresponding action.
2888 * src/toolbar.h: remove help in toolbarItem
2890 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
2892 * src/Painter.C (text): Added code for using symbol glyphs from
2893 iso10646 fonts. Currently diabled.
2895 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
2898 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
2899 magyar,turkish and usorbian.
2901 * src/paragraph.C (isMultiLingual): Made more efficient.
2903 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
2906 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
2907 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
2908 Also changed the prototype to "bool math_insert_greek(char)".
2910 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2912 * lots of files: apply the NEW_INSETS on all code that will not be
2913 needed when we move to use the new insets. Enable the define in
2914 lyxparagrah.h to try it.
2916 * src/insets/insettabular.C (cellstart): change to be a static
2918 (InsetTabular): initialize buffer in the initializer list.
2920 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
2922 * src/frontends/xforms/FormPrint.[Ch] : moved #include
2923 form_print.h out of the header file. Replaced with forward
2924 declarations of the relevant struct.
2926 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
2929 * src/commandtags.h: do not include "debug.h" which does not
2930 belong there. #include it in some other places because of this
2933 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2935 * src/insets/insetcaption.C: add a couple "using" directives.
2937 * src/toolbar.C (add): get the help text directly from lyxaction.
2939 (setPixmap): new function. Loads from disk and sets a pixmap on a
2940 botton; the name of the pixmap file is derived from the command
2943 * src/toolbar.h: remove members isBitmap and pixmap from
2946 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
2947 * lib/images/: move many files from images/banner.xpm.
2949 * src/lyx_gui.C (create_forms): read banner pixmap from file.
2951 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
2952 * src/toolbar.C: ditto.
2953 * configure.in: ditto.
2954 * INSTALL: document.
2956 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
2957 the spellchecker popup is closed from the WM.
2959 2000-07-19 Juergen Vigna <jug@sad.it>
2961 * src/insets/insetfloat.C (Write): small fix because we use the
2962 insetname for the type now!
2964 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
2966 * src/frontends/xforms/forms/form_citation.fd: object sizes are
2969 * src/frontends/Dialogs.h: removed hideCitation signal
2971 * src/insets/insetcite.h: added hide signal
2973 * src/insets/insetcite.C (~InsetCitation): emits new signal
2974 (getScreenLabel): "intelligent" label should now fit on the screen!
2976 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
2978 * src/frontends/xforms/FormCitation.C (showInset): connects
2979 hide() to the inset's hide signal
2980 (show): modified to use fl_set_object_position rather than
2981 fl_set_object_geometry wherever possible
2983 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2985 * src/insets/lyxinset.h: add caption code
2987 * src/insets/insetfloat.C (type): new method
2989 * src/insets/insetcaption.C (Write): new method
2991 (LyxCode): new method
2993 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
2994 to get it right together with using the FloatList.
2996 * src/commandtags.h: add LFUN_INSET_CAPTION
2997 * src/lyxfunc.C (Dispatch): handle it
2999 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
3002 * src/Variables.[Ch]: make expand take a const reference, remove
3003 the destructor, some whitespace changes.
3005 * src/LyXAction.C (init): add caption-inset-insert
3007 * src/FloatList.C (FloatList): update the default floats a bit.
3009 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3011 * src/Variables.[Ch]: new files. Intended to be used for language
3012 specific strings (like \chaptername) and filename substitution in
3015 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
3017 * lib/kbd/american.kmap: update
3019 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
3021 * src/bufferparams.[Ch]: remove member allowAccents.
3023 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
3025 * src/LaTeXLog.C: use the log_form.h header.
3026 * src/lyx_gui.C: ditto.
3027 * src/lyx_gui_misc.C: ditto.
3028 * src/lyxvc.h: ditto.
3030 * forms/log_form.fd: new file, created from latexoptions.fd. I
3031 kept the log popup and nuked the options form.
3033 * src/{la,}texoptions.[Ch]: removed.
3034 * src/lyx_cb.C (LaTeXOptions): ditto
3036 * src/lyx_gui.C (create_forms): do not handle the
3037 fd_latex_options form.
3039 2000-07-18 Juergen Vigna <jug@sad.it>
3041 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
3042 name of the inset so that it can be requested outside (text2.C).
3044 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
3047 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3049 * src/mathed/formula.h (ConvertFont): constify
3051 * src/mathed/formula.C (Read): add warning if \end_inset is not
3052 found on expected place.
3054 * src/insets/lyxinset.h (ConvertFont): consify
3056 * src/insets/insetquotes.C (ConvertFont): constify
3057 * src/insets/insetquotes.h: ditto
3059 * src/insets/insetinfo.h: add labelfont
3061 * src/insets/insetinfo.C (InsetInfo): set the labelfont
3062 (ascent): use labelfont
3066 (Write): make .lyx file a bit nicer
3068 * src/insets/insetfloat.C (Write): simplify somewhat...
3069 (Read): add warning if arg is not found
3071 * src/insets/insetcollapsable.C: add using std::max
3072 (Read): move string token and add warning in arg is not found
3073 (draw): use std::max to get the right ty
3074 (getMaxWidth): simplify by using std::max
3076 * src/insets/insetsection.h: new file
3077 * src/insets/insetsection.C: new file
3078 * src/insets/insetcaption.h: new file
3079 * src/insets/insetcaption.C: new file
3081 * src/insets/inset.C (ConvertFont): constify signature
3083 * src/insets/Makefile.am (libinsets_la_SOURCES): add
3084 insetcaption.[Ch] and insetsection.[Ch]
3086 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
3087 uses to use LABEL_COUNTER_CHAPTER instead.
3088 * src/text2.C (SetCounter): here
3090 * src/counters.h: new file
3091 * src/counters.C: new file
3092 * src/Sectioning.h: new file
3093 * src/Sectioning.C: new file
3095 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
3097 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3099 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
3102 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
3105 2000-07-17 Juergen Vigna <jug@sad.it>
3107 * src/tabular.C (Validate): check if array-package is needed.
3108 (SetVAlignment): added support for vertical alignment.
3109 (SetLTFoot): better support for longtable header/footers
3110 (Latex): modified to support added features.
3112 * src/LaTeXFeatures.[Ch]: added array-package.
3114 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
3116 * src/lyx_gui.C (LyXGUI): make sure that the height is large
3119 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
3121 * configure.in: do not forget to put a space after -isystem.
3123 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
3125 * lib/kbd/arabic.kmap: a few fixes.
3127 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3129 * some whitespace chagnes to a number of files.
3131 * src/support/DebugStream.h: change to make it easier for
3132 doc++ to parse correctly.
3133 * src/support/lyxstring.h: ditto
3135 * src/mathed/math_utils.C (compara): change to have only one
3137 (MathedLookupBOP): change because of the above.
3139 * src/mathed/math_delim.C (math_deco_compare): change to have only
3141 (search_deco): change becasue of the above.
3143 * src/insets/insettabular.C (DrawCellSelection): use std::swap
3144 instead of manually coded one.
3146 * src/insets/insetquotes.C (Read): read the \end_inset too
3148 * src/insets/insetlatex.h: remove file
3149 * src/insets/insetlatex.C: remove file
3151 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
3153 (InsetPrintIndex): remove destructor
3155 * src/insets/insetinclude.h: remove default constructor
3157 * src/insets/insetfloat.C: work to make it work better
3159 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
3161 * src/insets/insetcite.h (InsetCitation): remove default constructor
3163 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
3165 * src/text.C (GetColumnNearX): comment out some currently unused code.
3167 * src/paragraph.C (writeFile): move some initializations closer to
3169 (CutIntoMinibuffer): small change to use new matchIT operator
3173 (InsertInset): ditto
3176 (InsetIterator): ditto
3177 (Erase): small change to use new matchFT operator
3179 (GetFontSettings): ditto
3180 (HighestFontInRange): ditto
3183 * src/lyxparagraph.h: some chars changed to value_type
3184 (matchIT): because of some stronger checking (perhaps too strong)
3185 in SGI STL, the two operator() unified to one.
3188 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
3190 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
3191 the last inset read added
3192 (parseSingleLyXformat2Token): some more (future) compability code added
3193 (parseSingleLyXformat2Token): warning about solitary \end_inset added
3194 (parseSingleLyXformat2Token): set last_inset_read
3195 (parseSingleLyXformat2Token): more code to read new "Float" correctly
3196 (parseSingleLyXformat2Token): don't double intializw string next_token
3198 * src/TextCache.C (text_fits::operator()): add const's to the signature
3199 (has_buffer::operator()): ditto
3201 * src/Floating.h: add some comments on the class
3203 * src/FloatList.[Ch] (typeExist): new method
3206 * src/BackStack.h: added default constructor, wanted by Gcc.
3208 2000-07-14 Juergen Vigna <jug@sad.it>
3210 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
3212 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
3214 * src/insets/insettabular.C (resizeLyXText): need this to be able to
3215 do a redraw when the window is resized!
3216 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
3218 * src/insets/insettext.C (resizeLyXText): added function to correctly
3219 being able to resize the LyXWindow.
3221 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
3223 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
3225 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
3226 crashes when closing dialog to a deleted inset.
3228 * src/insets/insetcite.[Ch] (Edit) : the return of this former
3229 method! Now similar to other insets.
3231 2000-07-13 Juergen Vigna <jug@sad.it>
3233 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
3235 * lib/examples/Literate.lyx: small patch!
3237 * src/insets/insetbib.C (Read): added this function because of wrong
3238 Write (without [begin|end]_inset).
3240 2000-07-11 Juergen Vigna <jug@sad.it>
3242 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
3243 as the insertInset could not be good!
3245 * src/screen.C (ToggleSelection): fixed toggle selection bug as
3246 the bool param should not be last.
3248 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3250 * sigc++/configure.in: fix bug in threading-related code (Yes, I
3251 did submit that to Karl).
3253 * configure.in: use -isystem instead of -I for X headers. This
3254 fixes a problem on solaris with a recent gcc;
3255 put the front-end code after the X detection code;
3256 configure in sigc++ before lib/
3258 * src/lyx_main.C (commandLineHelp): remove -display from command
3261 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
3263 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
3264 Also put in Makefile rules for building the ``listerrors''
3265 program for parsing errors from literate programs written in LyX.
3267 * lib/build-listerrors: Added small shell script as part of compile
3268 process. This builds a working ``listerrors'' binary if noweb is
3269 installed and either 1) the VNC X server is installed on the machine,
3270 or 2) the user is compiling from within a GUI. The existence of a GUI
3271 is necessary to use the ``lyx --export'' feature for now. This
3272 hack can be removed once ``lyx --export'' no longer requires a GUI to
3275 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
3277 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
3278 now passed back correctly from gcc and placed "under" error
3279 buttons in a Literate LyX source.
3281 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3283 * src/text.C (GetColumnNearX): Better behavior when a RTL
3284 paragraph is ended by LTR text.
3286 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
3289 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3291 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
3292 true when clipboard is empty.
3294 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3296 * text.C (Backspace): Prevent rebreaking of a row if it is the last
3297 row of the paragraph.
3298 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
3299 to prevent calculation of bidi tables
3301 2000-07-07 Juergen Vigna <jug@sad.it>
3303 * src/screen.C (ToggleSelection): added y_offset and x_offset
3306 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
3309 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
3311 * src/insets/insettext.C: fixed Layout-Display!
3313 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3315 * configure.in: add check for strings.h header.
3317 * src/spellchecker.C: include <strings.h> in order to have a
3318 definition for bzero().
3320 2000-07-07 Juergen Vigna <jug@sad.it>
3322 * src/insets/insettext.C (draw): set the status of the bv->text to
3323 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
3325 * src/screen.C (DrawOneRow):
3326 (DrawFromTo): redraw the actual row if something has changed in it
3329 * src/text.C (draw): call an update of the toplevel-inset if something
3330 has changed inside while drawing.
3332 * src/lyxtext.h: added CHANGED_IN_DRAW status.
3334 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
3336 * src/insets/insetbib.[Ch] (callback) new method, moving callback
3337 processing inside class.
3339 * src/insets/insetindex.[Ch] (callback) new method, moving callback
3340 processing inside class.
3342 * src/insets/insetindex.h new struct Holder, consistent with other
3345 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
3346 citation dialog from main code and placed it in src/frontends/xforms.
3347 Dialog launched through signals instead of callbacks
3349 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
3351 * lyx.man: update the options description.
3353 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
3355 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
3356 handle neg values, set min width to 590, add doc about -display
3358 2000-07-05 Juergen Vigna <jug@sad.it>
3360 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
3361 calls to BufferView *.
3363 * src/insets/insettext.C (checkAndActivateInset): small fix non
3364 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
3366 * src/insets/insetcommand.C (Read): Fixed as insets should read till
3367 their \end_inset token!
3369 2000-07-04 edscott <edscott@imp.mx>
3371 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
3372 lib/lyxrc.example: added option \wheel_jump
3374 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
3376 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
3377 remove support for -width,-height,-xpos and -ypos.
3379 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
3381 * src/encoding.[Ch]: New files.
3383 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
3384 (text): Call to the underline() method only when needed.
3386 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
3388 * src/buffer.C (makeLaTeXFile): Compute automatically the input
3389 encoding(s) for the document.
3391 * src/bufferparams.C (BufferParams): Changed default value of
3394 * src/language.C (newLang): Removed.
3395 (items[]): Added encoding information for all defined languages.
3397 * src/lyx_gui.C (create_forms): Added "auto" option to the input
3398 encoding choice button.
3400 * src/lyxrc.h (font_norm_type): New member variable.
3401 (set_font_norm_type): New method.
3403 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
3404 paragraphs with different encodings.
3406 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
3407 (TransformChar): Changed to work correctly with Arabic points.
3408 (draw): Added support for drawing Arabic points.
3409 (draw): Removed code for drawing underbars (this is done by
3412 * src/support/textutils.h (IsPrintableNonspace): New function.
3414 * src/BufferView_pimpl.h: Added "using SigC::Object".
3415 * src/LyXView.h: ditto.
3417 * src/insets/insetinclude.h (include_label): Changed to mutable.
3419 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3421 * src/mathed/math_iter.h: remove empty destructor
3423 * src/mathed/math_cursor.h: remove empty destructor
3425 * src/insets/lyxinset.h: add THEOREM_CODE
3427 * src/insets/insettheorem.[Ch]: new files
3429 * src/insets/insetminipage.C: (InsertInset): remove
3431 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
3433 (InsertInset): remove
3435 * src/insets/insetlist.C: (InsertList): remove
3437 * src/insets/insetfootlike.[Ch]: new files
3439 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
3442 (InsertInset): ditto
3444 * src/insets/insetert.C: remove include Painter.h, reindent
3445 (InsertInset): move to header
3447 * src/insets/insetcollapsable.h: remove explicit from default
3448 contructor, remove empty destructor, add InsertInset
3450 * src/insets/insetcollapsable.C (InsertInset): new func
3452 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3454 * src/vspace.h: add explicit to constructor
3456 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
3457 \textcompwordmark, please test this.
3459 * src/lyxrc.C: set ascii_linelen to 65 by default
3461 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
3463 * src/commandtags.h: add LFUN_INSET_THEOREM
3465 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
3466 (makeLinuxDocFile): remove _some_ of the nice logic
3467 (makeDocBookFile): ditto
3469 * src/Painter.[Ch]: (~Painter): removed
3471 * src/LyXAction.C (init): entry for insettheorem added
3473 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
3475 (deplog): code to detect files generated by LaTeX, needs testing
3478 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3480 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
3482 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3484 * src/LaTeX.C (deplog): Add a check for files that are going to be
3485 created by the first latex run, part of the project to remove the
3488 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
3489 contents to the extension list.
3491 2000-07-04 Juergen Vigna <jug@sad.it>
3493 * src/text.C (NextBreakPoint): added support for needFullRow()
3495 * src/insets/lyxinset.h: added needFullRow()
3497 * src/insets/insetcollapsable.C: redone now this uses a text-inset
3500 * src/insets/insettext.C: lots of changes for update!
3502 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
3504 * src/LaTeXFeatures.h: add a missing std:: qualifier.
3506 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
3508 * src/insets/insetinclude.C (InsetInclude): fixed
3509 initialization of include_label.
3510 (unique_id): now returns a string.
3512 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
3514 * src/LaTeXFeatures.h: new member IncludedFiles, for
3515 a map of key, included file name.
3517 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
3518 with the included files for inclusion in SGML preamble,
3519 i. e., linuxdoc and docbook.
3522 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
3523 nice (is the generated linuxdoc code to be exported?), that
3524 allows to remove column, and only_body that will be true for
3525 slave documents. Insets are allowed inside SGML font type.
3526 New handling of the SGML preamble for included files.
3527 (makeDocBookFile): the same for docbook.
3529 * src/insets/insetinclude.h:
3530 * src/insets/insetinclude.C (Validate): keeps a list of included files.
3532 (DocBook): new export methods.
3534 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
3535 and makeDocBookFile.
3537 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
3538 formats to export with command line argument -x.
3540 2000-06-29 Juergen Vigna <jug@sad.it>
3542 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
3543 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
3545 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
3546 region could already been cleared by an inset!
3548 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3550 * src/BufferView_pimpl.h: remove member variables lyx_focus and
3553 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
3555 (cursorToggle): remove special handling of lyx focus.
3557 2000-06-28 Juergen Vigna <jug@sad.it>
3559 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
3562 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3564 * src/insets/insetindex.C (Edit): add a callback when popup is
3567 * src/insets/insettext.C (LocalDispatch):
3568 * src/insets/insetmarginal.h:
3569 * src/insets/insetlist.h:
3570 * src/insets/insetfoot.h:
3571 * src/insets/insetfloat.h:
3572 * src/insets/insetert.h: add a missing std:: qualifier.
3574 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3576 * src/support/lyxsum.C (sum): '\0' teminate file read when using
3579 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
3581 * src/insets/insettext.C (Read): remove tmptok unused variable
3582 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
3583 (InsertInset): change for new InsetInset code
3585 * src/insets/insettext.h: add TEXT inline method
3587 * src/insets/insettext.C: remove TEXT macro
3589 * src/insets/insetmarginal.C (Write): new method
3590 (Latex): change output slightly
3592 * src/insets/insetfoot.C (Write): new method
3593 (Latex): change output slightly (don't use endl when no need)
3595 * src/insets/insetert.C (Write): new method
3597 * src/insets/insetcollapsable.h: make button_length, button_top_y
3598 and button_bottm_y protected.
3600 * src/insets/insetcollapsable.C (Write): simplify code by using
3601 tostr. Also do not output the float name, the children class
3602 should to that to get control over own arguments
3604 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
3605 src/insets/insetminipage.[Ch]:
3608 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3610 * src/lyxfunc.C (Dispatch): cases for new insets/commands
3612 * src/Makefile.am (lyx_SOURCES): add the new files
3614 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
3615 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
3616 * src/commandtags.h: ditto
3618 * src/LaTeXFeatures.h: add a std::set of used floattypes
3620 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
3622 * src/FloatList.[Ch] src/Floating.h: new files
3624 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
3626 * src/lyx_cb.C (TableApplyCB): ditto
3628 * src/text2.C: ditto
3629 * src/buffer.C (SimpleLinuxDocOnePar): ditto
3630 (parseSingleLyXformat2Token): ditto + add code for
3631 backwards compability for old float styles + add code for new insets
3633 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
3635 (InsertInset(size_type, Inset *, LyXFont)): new method
3636 (InsetChar(size_type, char)): changed to use the other InsetChar
3637 with a LyXFont(ALL_INHERIT).
3638 (InsetInset(size_type, Inset*)): changed to use InsetChar to
3639 insert the META_INSET.
3641 * sigc++/thread.cc (Privete<int>::operator int&): move definition
3643 * sigc++/thread.h (Threads): from here
3645 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
3646 definition out of line
3647 * sigc++/scope.h: from here
3649 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3651 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
3652 is specified (adapted from a patch from edscott <edscott@imp.mx>).
3654 * Makefile.am (bindist): new target.
3656 * INSTALL: add instructions for doing a binary distribution.
3658 * development/tools/README.bin.example: update a bit.
3660 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
3663 * lib/lyxrc.example: new lyxrc tag \set_color.
3665 * src/lyxfunc.C (Dispatch):
3666 * src/commandtags.h:
3667 * src/LyXAction.C: new lyxfunc "set-color".
3669 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
3670 and an x11name given as strings.
3672 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
3673 cache when a color is changed.
3675 2000-06-26 Juergen Vigna <jug@sad.it>
3677 * src/lyxrow.C (width): added this functions and variable.
3679 * src/insets/insetcite.C (create_form_citation_form): some Gravity
3682 * src/text.C (SetHeightOfRow): fixed calcualting of width.
3684 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3686 * images/undo_bw.xpm: new icon.
3687 * images/redo_bw.xpm: ditto.
3689 * configure.in (INSTALL_SCRIPT): change value to
3690 ${INSTALL} to avoid failures of install-script target.
3691 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
3693 * src/BufferView.h: add a magic "friend" declaration to please
3696 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
3698 * forms/cite.fd: modified to allow resizing without messing
3701 * src/insetcite.C: Uses code from cite.fd almost without
3703 User can now resize dialog in the x-direction.
3704 Resizing the dialog in the y-direction is prevented, as the
3705 code does this intelligently already.
3707 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3709 * INSTALL: remove obsolete entry in "problems" section.
3711 * lib/examples/sl_*.lyx: update of the slovenian examples.
3713 * src/support/FileInfo.[Ch] (getBlockSize): remove.
3715 2000-06-23 Juergen Vigna <jug@sad.it>
3717 * src/lyxtext.h: added a 'cleared' flag to draw() function.
3719 * src/buffer.C (resize): delete the LyXText of textinsets.
3721 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
3723 * src/insets/lyxinset.h: added another parameter 'cleared' to
3724 the draw() function.
3726 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
3727 unlocking inset in inset.
3729 2000-06-22 Juergen Vigna <jug@sad.it>
3731 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
3732 of insets and moved first to LyXText.
3734 * src/mathed/formulamacro.[Ch]:
3735 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
3737 2000-06-21 Juergen Vigna <jug@sad.it>
3739 * src/text.C (GetVisibleRow): look if I should clear the area or not
3740 using Inset::doClearArea() function.
3742 * src/insets/lyxinset.h: added doClearArea() function and
3743 modified draw(Painter &, ...) to draw(BufferView *, ...)
3745 * src/text2.C (UpdateInset): return bool insted of int
3747 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
3749 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
3750 combox in the character popup
3752 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
3753 BufferParams const & params
3755 2000-06-20 Juergen Vigna <jug@sad.it>
3757 * src/insets/insettext.C (SetParagraphData): set insetowner on
3760 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3762 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
3763 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
3765 (form_main_): remove
3767 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
3768 (create_form_form_main): remove FD_form_main stuff, connect to
3769 autosave_timeout signal
3771 * src/LyXView.[Ch] (getMainForm): remove
3772 (UpdateTimerCB): remove
3773 * src/BufferView_pimpl.h: inherit from SigC::Object
3775 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
3776 signal instead of callback
3778 * src/BufferView.[Ch] (cursorToggleCB): remove
3780 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3782 * src/BufferView_pimpl.C: changes because of the one below
3784 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
3785 instead of storing a pointer to a LyXText.
3787 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
3789 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
3791 * src/lyxparagraph.h
3793 * src/paragraph.C: Changed fontlist to a sorted vector.
3795 2000-06-19 Juergen Vigna <jug@sad.it>
3797 * src/BufferView.h: added screen() function.
3799 * src/insets/insettext.C (LocalDispatch): some selection code
3802 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
3804 * src/insets/insettext.C (SetParagraphData):
3806 (InsetText): fixes for multiple paragraphs.
3808 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
3810 * development/lyx.spec.in: Call configure with ``--without-warnings''
3811 to work around a bug with the Makefiles when doing ``make lyxrpm''.
3812 This should be fine, however, since we generally don't want to be
3813 verbose when making an RPM.
3815 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
3817 * lib/scripts/fig2pstex.py: New file
3819 2000-06-16 Juergen Vigna <jug@sad.it>
3821 * src/insets/insettabular.C (UpdateLocal):
3822 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
3823 (LocalDispatch): Changed all functions to use LyXText.
3825 2000-06-15 Juergen Vigna <jug@sad.it>
3827 * src/text.C (SetHeightOfRow): call inset::update before requesting
3830 * src/insets/insettext.C (update):
3831 * src/insets/insettabular.C (update): added implementation
3833 * src/insets/lyxinset.h: added update function
3835 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3837 * src/text.C (SelectNextWord): protect against null pointers with
3838 old-style string streams. (fix from Paul Theo Gonciari
3841 * src/cite.[Ch]: remove erroneous files.
3843 * lib/configure.m4: update the list of created directories.
3845 * src/lyxrow.C: include <config.h>
3846 * src/lyxcursor.C: ditto.
3848 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3850 * lib/examples/decimal.lyx: new example file from Mike.
3852 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
3853 to find template definitions (from Dekel)
3855 * src/frontends/.cvsignore: add a few things.
3857 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
3859 * src/Timeout.C (TimeOut): remove default argument.
3861 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
3864 * src/insets/ExternalTemplate.C: add a "using" directive.
3866 * src/lyx_main.h: remove the act_ struct, which seems unused
3869 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
3871 * LyX Developers Meeting: All files changed, due to random C++ (by
3872 coincidence) code generator script.
3874 - external inset (cool!)
3875 - initial online editing of preferences
3876 - insettabular breaks insettext(s contents)
3878 - some DocBook fixes
3879 - example files update
3880 - other cool stuff, create a diff and look for yourself.
3882 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
3884 * src/insets/insettext.C (computeTextRows): if the maxWidth is
3885 -1 this is a non-line-breaking textinset.
3887 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
3888 if there is no width set.
3890 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
3892 * Lots of files: Merged the dialogbase branch.
3894 2000-06-09 Allan Rae <rae@lyx.org>
3896 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
3897 and the Dispatch methods that used it.
3899 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
3900 access to functions formerly kept in Dispatch.
3902 2000-05-19 Allan Rae <rae@lyx.org>
3904 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
3905 made to_page and count_copies integers again. from_page remains a
3906 string however because I want to allow entry of a print range like
3907 "1,4,22-25" using this field.
3909 * src/LyXAction.C: added action info and commands for buffer-print-xtl
3910 and printer-params-get. These aren't useful from the minibuffer but
3911 could be used by a script/LyXServer app provided it passes a suitable
3912 auto_mem_buffer. I guess I should take a look at how the LyXServer
3913 works and make it support xtl buffers.
3915 * sigc++/: updated to libsigc++-1.0.1
3917 * src/xtl/: updated to xtl-1.3.pl.11
3919 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
3920 those changes done to the files in src/ are actually recreated when
3921 they get regenerated. Please don't ever accept a patch that changes a
3922 dialog unless that patch includes the changes to the corresponding *.fd
3925 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
3926 stringOnlyContains, renamed it and generalised it.
3928 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
3929 branch. Removed the remaining old form_print code.
3931 2000-04-26 Allan Rae <rae@lyx.org>
3933 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
3934 trap I was trying to fix with the ID: fields in src/xtl/ :-)
3936 2000-04-25 Allan Rae <rae@lyx.org>
3938 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
3939 against a base of xtl-1.3.pl.4
3941 * development/tools/lxtl.sh: fixed a couple of silly typos and now
3942 filter the Id: entries so they still show the xtl version number
3945 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
3946 into the src/xtl code. Patch still pending with José (XTL)
3948 2000-04-24 Allan Rae <rae@lyx.org>
3950 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
3951 both more generic and much safer. Use the new template functions.
3952 * src/buffer.[Ch] (Dispatch): ditto.
3954 * src/frontends/xforms/FormPrint.C (update): Use new template functions
3955 and mem buffer more intelligently. Also a little general cleanup.
3958 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
3959 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
3960 * src/xtl/Makefile.am: ditto.
3961 * src/xtl/.cvsignore: ditto.
3962 * src/Makefile.am: ditto.
3964 * src/PrinterParams.h: Removed the macros member functions. Added a
3965 testInvariant member function. A bit of tidying up and commenting.
3966 Included Angus's idea for fixing operation with egcs-1.1.2.
3968 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
3969 cool expansion of XTL's mem_buffer to support automatic memory
3970 management within the buffer itself. Removed the various macros and
3971 replaced them with template functions that use either auto_mem_buffer
3972 or mem_buffer depending on a #define. The mem_buffer support will
3973 disappear as soon as the auto_mem_buffer is confirmed to be good on
3974 other platforms/compilers. That is, it's there so you've got something
3977 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
3978 effectively forked XTL. However I expect José will include my code
3979 into the next major release. Also fixed a memory leak.
3980 * src/xtl/text.h: ditto.
3981 * src/xtl/xdr.h: ditto.
3982 * src/xtl/giop.h: ditto.
3984 2000-04-16 Allan Rae <rae@lyx.org>
3986 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
3987 by autogen.sh and removed by maintainer-clean anyway.
3988 * .cvsignore, sigc++/.cvsignore: Support the above.
3990 * sigc++/.cvsignore: Forgot that retbind.h was generated.
3992 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
3994 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
3995 macros, renamed static callback-target member functions to suit new
3996 scheme and made them public.
3997 * src/frontends/xforms/forms/form_print.fd: ditto.
3998 * src/frontends/xforms/forms/form_copyright.fd: ditto.
4000 * src/support/lxtl.h: small cleanup to use typedef instead of #define
4003 * src/xtl/: New directory containing a minimal distribution of XTL.
4004 This is XTL-1.3.pl.4.
4006 * development/tools/lxtl.sh: A script to generate the above mini-dist.
4008 2000-04-15 Allan Rae <rae@lyx.org>
4010 * development/tools/makeLyXsigc.sh: Remove the library version numbers
4012 * sigc++/: Updated to libsigc++-1.0.0
4014 2000-04-14 Allan Rae <rae@lyx.org>
4016 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
4017 use the generic ones in future. I'll modify my conversion script.
4019 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
4021 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
4022 (CloseAllBufferRelatedDialogs): Renamed.
4023 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
4025 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
4026 of the generic ones. These are the same ones my conversion script
4029 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
4030 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
4031 * src/buffer.C (Dispatch): ditto
4033 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
4034 functions for updating and hiding buffer dependent dialogs.
4035 * src/BufferView.C (buffer): ditto
4036 * src/buffer.C (setReadonly): ditto
4037 * src/lyxfunc.C (CloseBuffer): ditto
4039 * src/buffer.h: Take setReadonly() out of line so I don't have to include
4040 Dialogs.h, and hence all the SigC stuff, into every file that includes
4041 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
4043 * src/BufferView2.C: reduce the number of headers included by buffer.h
4045 2000-04-11 Allan Rae <rae@lyx.org>
4047 * src/frontends/xforms/xform_macros.h: A small collection of macros
4048 for building C callbacks.
4050 * src/frontends/xforms/Makefile.am: Added above file.
4052 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
4053 scheme again. This time it should work for JMarc. If this is
4054 successful I'll revise my conversion script to automate some of this.
4055 The static member functions in the class also have to be public for
4056 this scheme will work. If the scheme works (it's almost identical to
4057 the way BufferView::cursorToggleCB is handled so it should work) then
4058 FormCopyright and FormPrint will be ready for inclusion into the main
4059 trunk immediately after 1.1.5 is released -- provided we're prepared
4060 for complaints about lame compilers not handling XTL.
4062 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
4064 2000-04-07 Allan Rae <rae@lyx.org>
4066 * config/lyxinclude.m4: A bit more tidying up (Angus)
4068 * src/LString.h: JMarc's <string> header fix
4070 * src/PrinterParams.h: Used string for most data to remove some
4071 ugly code in the Print dialog and avoid even uglier code when
4072 appending the ints to a string for output.
4074 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
4075 and moved "default:" back to the end of switch statement. Cleaned
4076 up the printing so it uses the right function calls and so the
4077 "print to file" option actually puts the file in the right directory.
4079 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
4081 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
4082 and Ok+Apply button control into a separate method: input (Angus).
4083 (input) Cleaned it up and improved it to be very thorough now.
4084 (All CB) static_cast used instead of C style cast (Angus). This will
4085 probably change again once we've worked out how to keep gcc-2.8.1 happy
4086 with real C callbacks.
4087 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
4088 ignore some of the bool settings and has random numbers instead. Needs
4089 some more investigation. Added other input length checks and checking
4090 of file and printer names.
4092 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
4093 would link (Angus). Seems the old code doesn't compile with the pragma
4094 statement either. Separated callback entries from internal methods.
4096 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
4098 2000-03-17 Allan Rae <rae@lyx.org>
4100 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
4101 need it? Maybe it could go in Dialogs instead? I could make it a
4102 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
4103 values to get the bool return value.
4104 (Dispatch): New overloaded method for xtl support.
4106 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
4107 extern "C" callback instead of static member functions. Hopefully,
4108 JMarc will be able to compile this. I haven't changed
4109 forms/form_copyright.fd yet. Breaking one of my own rules already.
4111 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
4112 because they aren't useful from the minibuffer. Maybe a LyXServer
4113 might want a help message though?
4115 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
4117 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
4118 xtl which needs both rtti and exceptions.
4120 * src/support/Makefile.am:
4121 * src/support/lxtl.h: New file. Some helper macros for using XTL.
4123 * src/frontends/xforms/input_validators.[ch]: input filters and
4124 validators. These conrol what keys are valid in input boxes.
4125 Use them and write some more. Much better idea than waiting till
4126 after the user has pressed Ok to say that the input fields don't make
4129 * src/frontends/xforms/Makefile.am:
4130 * src/frontends/xforms/forms/form_print.fd:
4131 * src/frontends/xforms/forms/makefile:
4132 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
4133 new scheme. Still have to make sure I haven't missed anything from
4134 the current implementation.
4136 * src/Makefile.am, src/PrinterParams.h: New data store.
4138 * other files: Added a couple of copyright notices.
4140 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4142 * src/insets/insetbib.h: move Holder struct in public space.
4144 * src/frontends/include/DialogBase.h: use SigC:: only when
4145 SIGC_CXX_NAMESPACES is defined.
4146 * src/frontends/include/Dialogs.h: ditto.
4148 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
4150 * src/frontends/xforms/FormCopyright.[Ch]: do not
4151 mention SigC:: explicitely.
4153 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4155 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
4156 deals with testing KDE in main configure.in
4157 * configure.in: ditto.
4159 2000-02-22 Allan Rae <rae@lyx.org>
4161 * Lots of files: Merged from HEAD
4163 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
4164 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
4166 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
4168 * sigc++/: new minidist.
4170 2000-02-14 Allan Rae <rae@lyx.org>
4172 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
4174 2000-02-08 Juergen Vigna <jug@sad.it>
4176 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
4177 file for the buildin GUI builder of KDevelop of the copyright-dialog.
4179 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
4180 for this port and so it is much easier for other people to port
4181 dialogs in a common development environment.
4183 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
4184 the QT/KDE implementation.
4186 * src/frontends/kde/Dialogs.C:
4187 * src/frontends/kde/FormCopyright.C:
4188 * src/frontends/kde/FormCopyright.h:
4189 * src/frontends/kde/Makefile.am:
4190 * src/frontends/kde/formcopyrightdialog.C:
4191 * src/frontends/kde/formcopyrightdialog.h:
4192 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
4193 for the kde support of the Copyright-Dialog.
4195 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
4196 subdir-substitution instead of hardcoded 'xforms' as we now have also
4199 * src/frontends/include/DialogBase.h (Object): just commented the
4200 label after #endif (nasty warning and I don't like warnings ;)
4202 * src/main.C (main): added KApplication initialization if using
4205 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
4206 For now only the KDE event-loop is added if frontend==kde.
4208 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
4210 * configure.in: added support for the --with-frontend[=value] option
4212 * autogen.sh: added kde.m4 file to list of config-files
4214 * acconfig.h: added define for KDEGUI-support
4216 * config/kde.m4: added configuration functions for KDE-port
4218 * config/lyxinclude.m4: added --with-frontend[=value] option with
4219 support for xforms and KDE.
4221 2000-02-08 Allan Rae <rae@lyx.org>
4223 * all Makefile.am: Fixed up so the make targets dist, distclean,
4224 install and uninstall all work even if builddir != srcdir. Still
4225 have a new sigc++ minidist update to come.
4227 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
4229 2000-02-01 Allan Rae <rae@lyx.org>
4231 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
4232 Many mods to get builddir != srcdir working.
4234 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
4235 for building on NT and so we can do the builddir != srcdir stuff.
4237 2000-01-30 Allan Rae <rae@lyx.org>
4239 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
4240 This will stay in "rae" branch. We probably don't really need it in
4241 the main trunk as anyone who wants to help programming it should get
4242 a full library installed also. So they can check both included and
4243 system supplied library compilation.
4245 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
4246 Added a 'mini' distribution of libsigc++. If you feel the urge to
4247 change something in these directories - Resist it. If you can't
4248 resist the urge then you should modify the following script and rebuild
4249 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
4250 all happen. Still uses a hacked version of libsigc++'s configure.in.
4251 I'm quite happy with the results. I'm not sure the extra work to turn
4252 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
4253 worth the trouble and would probably lead to extra maintenance
4255 I haven't tested the following important make targets: install, dist.
4256 Not ready for prime time but very close. Maybe 1.1.5.
4258 * development/tools/makeLyXsigc.sh: A shell script to automatically
4259 generate our mini-dist of libsigc++. It can only be used with a CVS
4260 checkout of libsigc++ not a tarball distribution. It's well commented.
4261 This will end up as part of the libsigc++ distribution so other apps
4262 can easily have an included mini-dist. If someone makes mods to the
4263 sigc++ subpackage without modifying this script to generate those
4264 changes I'll be very upset!
4266 * src/frontends/: Started the gui/system indep structure.
4268 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
4269 to access the gui-indep dialogs are in this class. Much improved
4270 design compared to previous revision. Lars, please refrain from
4271 moving this header into src/ like you did with Popups.h last time.
4273 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
4275 * src/frontends/xforms/: Started the gui-indep system with a single
4276 dialog: FormCopyright. Initial testing of use of libsigc++ was very
4279 * src/frontends/xforms/forms: Repository for the xforms .fd files.
4280 Here you'll find a very useful makefile and automated fdfix.sh that
4281 makes updating dailogs a no-brainer -- provided you follow the rules
4282 set out in the README. I'm thinking about adding another script to
4283 automatically generate skeleton code for a new dialog given just the
4286 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
4287 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
4288 Made FormCopyright gui-indep and added a lyxfunc to get to it.
4290 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4292 * src/support/LSubstring.C (operator): simplify
4294 * src/lyxtext.h: removed bparams, use buffer_->params instead
4296 * src/lyxrow.h: make Row a real class, move all variables to
4297 private and use accessors.
4299 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
4301 (isRightToLeftPar): ditto
4302 (ChangeLanguage): ditto
4303 (isMultiLingual): ditto
4306 (SimpleTeXOnePar): ditto
4307 (TeXEnvironment): ditto
4308 (GetEndLabel): ditto
4310 (SetOnlyLayout): ditto
4311 (BreakParagraph): ditto
4312 (BreakParagraphConservative): ditto
4313 (GetFontSettings): ditto
4315 (CopyIntoMinibuffer): ditto
4316 (CutIntoMinibuffer): ditto
4317 (PasteParagraph): ditto
4318 (SetPExtraType): ditto
4319 (UnsetPExtraType): ditto
4320 (DocBookContTableRows): ditto
4321 (SimpleDocBookOneTablePar): ditto
4323 (TeXFootnote): ditto
4324 (SimpleTeXOneTablePar): ditto
4325 (TeXContTableRows): ditto
4326 (SimpleTeXSpecialChars): ditto
4329 * src/lyxcursor.h: make LyXCursor a real class, move all variables
4330 to private and use accessors.
4332 * src/lyx_cb.C: remove char updatetimer, and all code that uses
4333 this, we did not use it anymore and has not been for ages. Just a
4334 waste of cpu cycles.
4336 * src/language.h: make Language a real class, move all variables
4337 to private and use accessors.
4339 * src/BufferView_pimpl.C (Pimpl): use new timer code.
4340 (create_view): remove
4341 (update): some changes for new timer
4342 (cursorToggle): use new timer
4343 (beforeChange): change for new timer
4345 * src/BufferView.h (cursorToggleCB): removed last paramter because
4348 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
4349 (cursorToggleCB): change because of new timer code
4351 * lib/CREDITS: updated own mailaddress
4353 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4355 * src/support/filetools.C (PutEnv): fix the code in case neither
4356 putenv() nor setenv() have been found.
4358 * INSTALL: mention the install-strip Makefile target.
4360 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
4361 read-only documents.
4363 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4365 * lib/reLyX/configure.in (VERSION): avoid using a previously
4366 generated reLyX wrapper to find out $prefix.
4368 * lib/examples/eu_adibide_lyx-atua.lyx:
4369 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
4370 translation of the Tutorial (Dooteo)
4372 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
4374 * forms/cite.fd: new citation dialog
4376 * src/insetcite.[Ch]: the new citation dialog is moved into
4379 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
4382 * src/insets/insetcommand.h: data members made private.
4384 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4386 * LyX 1.1.5 released
4388 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4390 * src/version.h (LYX_RELEASE): to 1.1.5
4392 * src/spellchecker.C (RunSpellChecker): return false if the
4393 spellchecker dies upon creation.
4395 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4397 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
4398 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
4402 * lib/CREDITS: update entry for Martin Vermeer.
4404 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
4406 * src/text.C (draw): Draw foreign language bars at the bottom of
4407 the row instead of at the baseline.
4409 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
4411 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4413 * lib/bind/de_menus.bind: updated
4415 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4417 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
4419 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4421 * src/menus.C (Limit_string_length): New function
4422 (ShowTocMenu): Limit the number of items/length of items in the
4425 * src/paragraph.C (String): Correct result for a paragraph inside
4428 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4430 * src/bufferlist.C (close): test of buf->getuser() == NULL
4432 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
4434 * src/BufferView2.C (removeAutoInsets): Fix a bug:
4435 Do not call to SetCursor when the paragraph is a closed footnote!
4437 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
4439 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
4442 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
4444 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4447 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
4448 reference popup, that activates the reference-back action
4450 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
4452 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
4453 the menus. Also fixed a bug.
4455 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
4456 the math panels when switching buffers (unless new buffer is readonly).
4458 * src/BufferView.C (NoSavedPositions)
4459 * src/BufferView_pimpl.C (NoSavedPositions): New methods
4461 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4463 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
4464 less of dvi dirty or not.
4466 * src/trans_mgr.[Ch] (insert): change first parameter to string
4469 * src/chset.[Ch] (encodeString): add const to first parameter
4471 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4473 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
4477 * src/LaTeX.C (deplog): better searching for dependency files in
4478 the latex log. Uses now regexps.
4480 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
4481 instead of the box hack or \hfill.
4483 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4485 * src/lyxfunc.C (doImportHelper): do not create the file before
4486 doing the actual import.
4487 (doImportASCIIasLines): create a new file before doing the insert.
4488 (doImportASCIIasParagraphs): ditto.
4490 * lib/lyxrc.example: remove mention of non-existing commands
4492 * lyx.man: remove mention of color-related switches.
4494 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
4496 * src/lyx_gui.C: remove all the color-related ressources, which
4497 are not used anymore.
4499 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
4502 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4504 * src/lyxrc.C (read): Add a missing break in the switch
4506 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
4508 * src/text2.C (InsertStringA): Fix a bug with insertion into table
4510 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
4513 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4515 * src/text.C (draw): draw bars under foreign language words.
4517 * src/LColor.[Ch]: add LColor::language
4519 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4521 * src/lyxcursor.h (boundary): New member variable
4523 * src/text.C (IsBoundary): New methods
4525 * src/text.C: Use the above for currect cursor movement when there
4526 is both RTL & LTR text.
4528 * src/text2.C: ditto
4530 * src/bufferview_funcs.C (ToggleAndShow): ditto
4532 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4534 * src/text.C (DeleteLineForward): set selection to true to avoid
4535 that DeleteEmptyParagraphMechanism does some magic. This is how it
4536 is done in all other functions, and seems reasonable.
4537 (DeleteWordForward): do not jump over non-word stuff, since
4538 CursorRightOneWord() already does it.
4540 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
4541 DeleteWordBackward, since they seem safe to me (since selection is
4542 set to "true") DeleteEmptyParagraphMechanism does nothing.
4544 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4546 * src/lyx_main.C (easyParse): simplify the code by factoring the
4547 part that removes parameters from the command line.
4548 (LyX): check wether wrong command line options have been given.
4550 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
4552 * src/lyx_main.C : add support for specifying user LyX
4553 directory via command line option -userdir.
4555 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
4557 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
4558 the number of items per popup.
4559 (Add_to_refs_menu): Ditto.
4561 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4563 * src/lyxparagraph.h: renamed ClearParagraph() to
4564 StripLeadingSpaces() and moved it to paragraph.C. We pass the
4565 textclass as parameter, and do nothing if free_spacing is
4566 true. This fixes part of the line-delete-forward problems.
4568 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
4569 (pasteSelection): ditto.
4570 (SwitchLayoutsBetweenClasses): more translatable strings.
4572 * src/text2.C (CutSelection): use StripLeadingSpaces.
4573 (PasteSelection): ditto.
4574 (DeleteEmptyParagraphMechanism): ditto.
4576 2000-05-26 Juergen Vigna <jug@sad.it>
4578 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
4579 is not needed in tabular insets.
4581 * src/insets/insettabular.C (TabularFeatures): added missing features.
4583 * src/tabular.C (DeleteColumn):
4585 (AppendRow): implemented this functions
4586 (cellsturct::operator=): clone the inset too;
4588 2000-05-23 Juergen Vigna <jug@sad.it>
4590 * src/insets/insettabular.C (LocalDispatch): better selection support
4591 when having multicolumn-cells.
4593 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4595 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
4597 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4599 * src/ColorHandler.C (getGCForeground): put more test into _()
4601 * lib/examples/eu_splash.lyx: new file (Basque translation) from
4604 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
4607 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
4609 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
4610 there are no labels, or when buffer is readonly.
4612 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
4613 there are no labels, buffer is SGML, or when buffer is readonly.
4615 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4617 * src/LColor.C (LColor): change a couple of grey40 to grey60
4618 (LColor): rewore initalization to make compiles go some magnitude
4620 (getGUIName): don't use gettext until we need the string.
4622 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
4624 * src/Bullet.[Ch]: Fixed a small bug.
4626 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
4628 * src/paragraph.C (String): Several fixes/improvements
4630 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
4632 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4634 * src/paragraph.C (String): give more correct output.
4636 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
4638 * src/lyxfont.C (stateText) Do not output the language if it is
4639 eqaul to the language of the document.
4641 * src/paragraph.C (TeXOnePar): Do not put language switch commands
4642 between two paragraphs with the same language.
4644 * src/paragraph.C (getParLanguage) Return a correct answer for an
4645 empty dummy paragraph.
4647 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
4650 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
4653 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
4654 the menus/popup, if requested fonts are unavailable.
4656 2000-05-22 Juergen Vigna <jug@sad.it>
4658 * src/insets/insettabular.C (LocalDispatch): added some more cursor
4659 movement support (Up/Down/Tab/Shift-Tab).
4660 (LocalDispatch): added also preliminari cursor-selection.
4662 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
4664 * src/paragraph.C (PasteParagraph): Hopefully now right!
4666 2000-05-22 Garst R. Reese <reese@isn.net>
4668 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
4669 of list, change all references to Environment to Command
4670 * tex/hollywood.cls : rewrite environments as commands, add
4671 \uppercase to interiorshot and exteriorshot to force uppecase.
4672 * tex/broadway.cls : rewrite environments as commands. Tweak
4675 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4677 * src/menus.C (Add_to_toc_menu): fix the code which limits the
4678 size of items: use a constant intead of the hardcoded 40, and more
4679 importantly do not remove the %m and %x tags added at the end.
4680 (Add_to_refs_menu): use vector::size_type instead of
4681 unsigned int as basic types for the variables. _Please_ do not
4682 assume that size_t is equal to unsigned int. On an alpha, this is
4683 unsigned long, which is _not_ the same.
4685 * src/language.C (initL): remove language "hungarian", since it
4686 seems that "magyar" is better.
4688 2000-05-22 Juergen Vigna <jug@sad.it>
4690 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
4692 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
4695 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
4696 next was deleted but not set to 0.
4698 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4700 * src/language.C (initL): change the initialization of languages
4701 so that compiles goes _fast_.
4703 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
4706 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
4708 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4712 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4714 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
4716 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
4720 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
4723 * src/insets/insetlo*.[Ch]: Made editable
4725 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4727 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
4728 the current selection.
4730 * src/BufferView_pimpl.C (stuffClipboard): new method
4732 * src/BufferView.C (stuffClipboard): new method
4734 * src/paragraph.C (String): new method
4736 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
4737 LColor::ignore when lyxname is not found.
4739 * src/BufferView.C (pasteSelection): new method
4741 * src/BufferView_pimpl.C (pasteSelection): new method
4743 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
4745 * src/WorkArea.C (request_clipboard_cb): new static function
4746 (getClipboard): new method
4747 (putClipboard): new method
4749 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4751 * LyX 1.1.5pre2 released
4753 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4755 * src/vspace.C (operator=): removed
4756 (operator=): removed
4758 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
4760 * src/layout.C (NumberOfClass): manually set the type in make_pair
4761 (NumberOfLayout): ditto
4763 * src/language.C: use the Language constructor for ignore_lang
4765 * src/language.h: add constructors to struct Language
4767 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
4769 * src/text2.C (SetCursorIntern): comment out #warning
4771 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
4773 * src/mathed/math_iter.h: initialize sx and sw to 0
4775 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4777 * forms/lyx.fd: Redesign of form_ref
4779 * src/LaTeXFeatures.[Ch]
4783 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
4786 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
4787 and Buffer::inset_iterator.
4789 * src/menus.C: Added new menus: TOC and Refs.
4791 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
4793 * src/buffer.C (getTocList): New method.
4795 * src/BufferView2.C (ChangeRefs): New method.
4797 * src/buffer.C (getLabelList): New method. It replaces the old
4798 getReferenceList. The return type is vector<string> instead of
4801 * src/insets/insetinclude.C (getLabelList): New method. Replaces
4802 the old getLabel() and GetNumberOfLabels() methods.
4803 * src/insets/insetlabel.C (getLabelList): ditto
4804 * src/mathed/formula.C (getLabelList): ditto
4806 * src/paragraph.C (String): New method.
4808 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
4809 Uses the new getTocList() method.
4810 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
4811 which automatically updates the contents of the browser.
4812 (RefUpdateCB): Use the new getLabelList method.
4814 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
4816 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
4818 * src/spellchecker.C: Added using std::reverse;
4820 2000-05-19 Juergen Vigna <jug@sad.it>
4822 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
4824 * src/insets/insettext.C (computeTextRows): small fix for display of
4825 1 character after a newline.
4827 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
4830 2000-05-18 Juergen Vigna <jug@sad.it>
4832 * src/insets/insettabular.C (TabularFeatures): fixed update of display
4833 when changing width of column.
4835 * src/tabular.C (set_row_column_number_info): setting of
4836 autobreak rows if necessary.
4838 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4840 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
4842 * src/vc-backend.*: renamed stat() to status() and vcstat to
4843 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
4844 compilation broke. The new name seems more relevant, anyway.
4846 2000-05-17 Juergen Vigna <jug@sad.it>
4848 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
4849 which was wrong if the removing caused removing of rows!
4851 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
4852 (pushToken): new function.
4854 * src/text2.C (CutSelection): fix problem discovered with purify
4856 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4858 * src/debug.C (showTags): enlarge the first column, now that we
4859 have 6-digits debug codes.
4861 * lib/layouts/hollywood.layout:
4862 * lib/tex/hollywood.cls:
4863 * lib/tex/brodway.cls:
4864 * lib/layouts/brodway.layout: more commands and fewer
4865 environments. Preambles moved in the .cls files. Broadway now has
4866 more options on scene numbering and less whitespace (from Garst)
4868 * src/insets/insetbib.C (getKeys): make sure that we are in the
4869 document directory, in case the bib file is there.
4871 * src/insets/insetbib.C (Latex): revert bogus change.
4873 2000-05-16 Juergen Vigna <jug@sad.it>
4875 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
4876 the TabularLayout on cursor move.
4878 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
4880 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
4883 (draw): fixed cursor position and drawing so that the cursor is
4884 visible when before the tabular-inset.
4886 * src/insets/insettext.C (init): drawLockedFrame was not initialized
4887 when creating from old insettext.
4889 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
4891 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4893 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
4894 * lib/tex/brodway.cls: ditto
4896 * lib/layouts/brodway.layout: change alignment of parenthical
4899 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4901 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
4902 versions 0.88 and 0.89 are supported.
4904 2000-05-15 Juergen Vigna <jug@sad.it>
4906 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
4909 * src/insets/insettext.C (computeTextRows): redone completely this
4910 function in a much cleaner way, because of problems when having a
4912 (draw): added a frame border when the inset is locked.
4913 (SetDrawLockedFrame): this sets if we draw the border or not.
4914 (SetFrameColor): this sets the frame color (default=insetframe).
4916 * src/insets/lyxinset.h: added x() and y() functions which return
4917 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
4918 function which is needed to see if we have a locking inset of some
4919 type in this inset (needed for now in insettabular).
4921 * src/vspace.C (inPixels): the same function also without a BufferView
4922 parameter as so it is easier to use it in some ocasions.
4924 * src/lyxfunc.C: changed all places where insertInset was used so
4925 that now if it couldn't be inserted it is deleted!
4927 * src/TabularLayout.C:
4928 * src/TableLayout.C: added support for new tabular-inset!
4930 * src/BufferView2.C (insertInset): this now returns a bool if the
4931 inset was really inserted!!!
4933 * src/tabular.C (GetLastCellInRow):
4934 (GetFirstCellInRow): new helper functions.
4935 (Latex): implemented for new tabular class.
4939 (TeXTopHLine): new Latex() helper functions.
4941 2000-05-12 Juergen Vigna <jug@sad.it>
4943 * src/mathed/formulamacro.C (Read):
4944 * src/mathed/formula.C (Read): read also the \end_inset here!
4946 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4948 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
4949 crush when saving formulae with unbalanced parenthesis.
4951 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
4953 * src/layout.C: Add new keyword "endlabelstring" to layout file
4955 * src/text.C (GetVisibleRow): Draw endlabel string.
4957 * lib/layouts/broadway.layout
4958 * lib/layouts/hollywood.layout: Added endlabel for the
4959 Parenthetical layout.
4961 * lib/layouts/heb-article.layout: Do not use slanted font shape
4962 for Theorem like environments.
4964 * src/buffer.C (makeLaTeXFile): Always add "american" to
4965 the UsedLanguages list if document language is RTL.
4967 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4969 * add addendum to README.OS2 and small patch (from SMiyata)
4971 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4973 * many files: correct the calls to ChangeExtension().
4975 * src/support/filetools.C (ChangeExtension): remove the no_path
4976 argument, which does not belong there. Use OnlyFileName() instead.
4978 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
4979 files when LaTeXing a non-nice latex file.
4981 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
4982 a chain of "if". Return false when deadkeys are not handled.
4984 * src/lyx_main.C (LyX): adapted the code for default bindings.
4986 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
4987 bindings for basic functionality (except deadkeys).
4988 (deadKeyBindings): new method. Performs the bindings of deadkeys.
4990 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
4991 several methods: handle override_x_deadkeys.
4993 * src/lyxrc.h: remove the "bindings" map, which did not make much
4994 sense anyway. New variable override_x_deadkeys, defaulting to "true".
4996 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4998 * src/lyxfont.C (stateText): use a saner method to determine
4999 whether the font is "default". Seems to fix the crash with DEC
5002 * src/Bullet.[Ch] (Bullet): remove const on parameters.
5004 2000-05-08 Juergen Vigna <jug@sad.it>
5006 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
5007 TabularLayoutMenu with mouse-button-3
5008 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
5010 * src/TabularLayout.C: added this file for having a Layout for
5013 2000-05-05 Juergen Vigna <jug@sad.it>
5015 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
5016 recalculating inset-widths.
5017 (TabularFeatures): activated this function so that I can change
5018 tabular-features via menu.
5020 * src/menus.C (ShowEditMenu): inserted support for insettabular so
5021 that I can test some functions with the Table menu.
5023 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5025 * src/lyxfont.C (stateText): guard against stupid c++libs.
5027 * src/tabular.C: add using std::vector
5028 some whitespace changes, + removed som autogenerated code.
5030 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
5032 2000-05-05 Juergen Vigna <jug@sad.it>
5034 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
5035 row, columns and cellstructures.
5037 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5039 * lib/lyxrc.example: remove obsolete entries.
5041 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
5042 reading of protected_separator for free_spacing.
5044 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5046 * src/text.C (draw): do not display an exclamation mark in the
5047 margin for margin notes. This is confusing, ugly and
5050 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
5051 AMS math' is checked.
5053 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
5054 name to see whether including the amsmath package is needed.
5056 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
5058 * src/paragraph.C (validate): Compute UsedLanguages correctly
5059 (don't insert the american language if it doesn't appear in the
5062 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
5063 The argument of \thanks{} command is considered moving argument
5065 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
5068 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
5070 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
5071 for appendix/minipage/depth. The lines can be now both in the footnote
5072 frame, and outside the frame.
5074 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
5077 2000-05-05 Juergen Vigna <jug@sad.it>
5079 * src/table.[Ch]: removed the inset and buffer stuff as this is now
5080 neede only in tabular.[Ch].
5082 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5084 * src/insets/insetspecialchar.C (Read): allow command == '~' for
5086 (Write): write '~' for PROTECTED_SEPARATOR
5088 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5090 * src/lyxparagraph.h: add a friend struct matchIT after the struct
5093 * src/mathed/formula.C (drawStr): rename size to siz.
5095 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
5096 possibly fix a bug by not changing the pflags = flags to piflags =
5099 2000-05-05 Juergen Vigna <jug@sad.it>
5101 * src/insets/insetbib.C: moved using directive
5103 * src/ImportNoweb.C: small fix for being able to compile (missing
5106 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5108 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
5109 to use clear, since we don't depend on this in the code. Add test
5112 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5114 * (various *.C files): add using std::foo directives to please dec
5117 * replace calls to string::clear() to string::erase() (Angus)
5119 * src/cheaders/cmath: modified to provide std::abs.
5121 2000-05-04 Juergen Vigna <jug@sad.it>
5123 * src/insets/insettext.C: Prepared all for inserting of multiple
5124 paragraphs. Still display stuff to do (alignment and other things),
5125 but I would like to use LyXText to do this when we cleaned out the
5126 table-support stuff.
5128 * src/insets/insettabular.C: Changed lot of stuff and added lots
5129 of functionality still a lot to do.
5131 * src/tabular.C: Various functions changed name and moved to be
5132 const functions. Added new Read and Write functions and changed
5133 lots of things so it works good with tabular-insets (also removed
5134 some stuff which is not needed anymore * hacks *).
5136 * src/lyxcursor.h: added operators == and != which just look if
5137 par and pos are (not) equal.
5139 * src/buffer.C (latexParagraphs): inserted this function to latex
5140 all paragraphs form par to endpar as then I can use this too for
5143 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
5144 so that I can call this to from text insets with their own cursor.
5146 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
5147 output off all paragraphs (because of the fix below)!
5149 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
5150 the very last paragraph (this could be also the last paragraph of an
5153 * src/texrow.h: added rows() call which returns the count-variable.
5155 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
5157 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
5159 * lib/configure.m4: better autodetection of DocBook tools.
5161 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5163 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
5165 * src/lyx_cb.C: add using std::reverse;
5167 * src/LaTeX.C (run): on error always run deleteFilesOnError before
5170 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
5171 selected files. Should fix repeated errors from generated files.
5173 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
5175 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
5177 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
5178 the spellchecker popup.
5180 * lib/lyxrc.example: Removed the \number_inset section
5182 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5184 * src/insets/figinset.C (various): Use IsFileReadable() to make
5185 sure that the file actually exist. Relying on ghostscripts errors
5186 is a bad idea since they can lead to X server crashes.
5188 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
5190 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
5193 * lib/lyxrc.example: smallish typo in description of
5194 \view_dvi_paper_option
5196 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5199 * src/lyxfunc.C: doImportHelper to factor out common code of the
5200 various import methods. New functions doImportASCIIasLines,
5201 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
5202 doImportLinuxDoc for the format specific parts.
5205 * buffer.C: Dispatch returns now a bool to indicate success
5208 * lyx_gui.C: Add getLyXView() for member access
5210 * lyx_main.C: Change logic for batch commands: First try
5211 Buffer::Dispatch (possibly without GUI), if that fails, use
5214 * lyx_main.C: Add support for --import command line switch.
5215 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
5216 Available Formats: Everything accepted by 'buffer-import <format>'
5218 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5220 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
5223 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
5224 documents will be reformatted upon reentry.
5226 2000-04-27 Juergen Vigna <jug@sad.it>
5228 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
5229 correctly only last pos this was a bug.
5231 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5233 * release of lyx-1.1.5pre1
5235 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5237 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
5239 * src/menus.C: revert the change of naming (Figure->Graphic...)
5240 from 2000-04-11. It was incomplete and bad.
5242 * src/LColor.[Ch]: add LColor::depthbar.
5243 * src/text.C (GetVisibleRow): use it.
5245 * README: update the languages list.
5247 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5249 * src/text.C (GetVisibleRow): show the depth of paragraphs using
5252 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5254 * README: remove sections that were just wrong.
5256 * src/text2.C (GetRowNearY): remove currentrow code
5258 * src/text.C (GetRow): remove currentrow code
5260 * src/screen.C (Update): rewritten a bit.
5261 (SmallUpdate): removed func
5263 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
5265 (FullRebreak): return bool
5266 (currentrow): remove var
5267 (currentrow_y): ditto
5269 * src/lyxscreen.h (Draw): change arg to unsigned long
5270 (FitCursor): return bool
5271 (FitManualCursor): ditto
5272 (Smallpdate): remove func
5273 (first): change to unsigned long
5274 (DrawOneRow): change second arg to long (from long &)
5275 (screen_refresh_y): remove var
5276 (scree_refresh_row): ditto
5278 * src/lyxrow.h: change baseline to usigned int from unsigned
5279 short, this brings some implicit/unsigned issues out in the open.
5281 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
5283 (Dispatch): don't call updateScrollbar after fitCursor. Use update
5284 instead of smallUpdate.
5286 * src/lyxcursor.h: change y to unsigned long
5288 * src/buffer.h: don't call updateScrollbar after fitcursor
5290 * src/buffer.C (parseSingleLyXformat2Token): move variables to
5291 where they are used. Removed "\\direction", this was not present
5292 in 1.1.4 and is already obsolete. Commented out some code that I
5293 believe to never be called.
5294 (runLiterate): don't call updateScrollbar after fitCursor
5296 (buildProgram): ditto
5299 * src/WorkArea.h (workWidth): change return val to unsigned
5302 (redraw): remove the button redraws
5303 (setScrollbarValue): change for scrollbar
5304 (getScrollbarValue): change for scrollbar
5305 (getScrollbarBounds): change for scrollbar
5307 * src/WorkArea.C (C_WorkArea_up_cb): removed func
5308 (C_WorkArea_down_cb): removed func
5309 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
5310 (resize): change for scrollbar
5311 (setScrollbar): ditto
5312 (setScrollbarBounds): ditto
5313 (setScrollbarIncrements): ditto
5314 (up_cb): removed func
5315 (down_cb): removed func
5316 (scroll_cb): change for scrollbar
5317 (work_area_handler): ditto
5319 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
5320 when FitCursor did something.
5321 (updateScrollbar): some unsigned changes
5322 (downCB): removed func
5323 (scrollUpOnePage): removed func
5324 (scrollDownOnePage): remvoed func
5325 (workAreaMotionNotify): don't call screen->FitCursor but use
5326 fitCursor instead. and bool return val
5327 (workAreaButtonPress): ditto
5328 (workAreaButtonRelease): some unsigned changes
5329 (checkInsetHit): ditto
5330 (workAreaExpose): ditto
5331 (update): parts rewritten, comments about the signed char arg added
5332 (smallUpdate): removed func
5333 (cursorPrevious): call needed updateScrollbar
5336 * src/BufferView2.C (allFloats): don't call updateScrollbar after
5339 * src/BufferView.[Ch] (upCB): removed func
5340 (downCB): removed func
5341 (smallUpdate): removed func
5343 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5345 * src/lyxtext.h src/text.C src/text2.C: removed support for the
5346 currentrow, currentrow_y optimization. This did not help a lot and
5347 if we want to do this kind of optimization we should rather use
5348 cursor.row instead of the currentrow.
5350 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
5351 buffer spacing and klyx spacing support.
5353 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5355 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
5358 2000-04-26 Juergen Vigna <jug@sad.it>
5360 * src/insets/figinset.C: fixes to Lars sstream changes!
5362 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
5364 * A lot of files: Added Ascii(ostream &) methods to all inset
5365 classes. Used when exporting to ASCII.
5367 * src/buffer.C (writeFileAscii,RoffAsciiTable)
5368 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
5371 * src/text2.C (ToggleFree): Disabled implicit word selection when
5372 there is a change in the language
5374 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
5375 no output was generated for end-of-sentence inset.
5377 * src/insets/lyxinset.h
5380 * src/paragraph.C: Removed the insetnumber code
5382 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
5384 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5386 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
5387 no_babel and no_epsfig completely from the file.
5388 (parseSingleLyXformat2Token): add handling for per-paragraph
5389 spacing as written by klyx.
5391 * src/insets/figinset.C: applied patch by Andre. Made it work with
5394 2000-04-20 Juergen Vigna <jug@sad.it>
5396 * src/insets/insettext.C (cutSelection):
5397 (copySelection): Fixed with selection from right to left.
5398 (draw): now the rows are not recalculated at every draw.
5399 (computeTextRows): for now reset the inset-owner here (this is
5400 important for an undo or copy where the inset-owner is not set
5403 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
5404 motion to the_locking_inset screen->first was forgotten, this was
5405 not important till we got multiline insets.
5407 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5409 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
5410 code seems to be alright (it is code changed by Dekel, and the
5411 intent is indeed that all macros should be defined \protect'ed)
5413 * NEWS: a bit of reorganisation of the new user-visible features.
5415 2000-04-19 Juergen Vigna <jug@sad.it>
5417 * src/insets/insettext.C (init): using a LyXCursor now for cursor
5418 position. Set the inset_owner of the used paragraph so that it knows
5419 that it is inside an inset. Fixed cursor handling with mouse and
5420 cursor keys. Fixed wrong timed inset redraws and lots of other changes
5421 and cleanups to make TextInsets work better.
5423 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
5424 Changed parameters of various functions and added LockInsetInInset().
5426 * src/insets/insettext.C:
5428 * src/insets/insetcollapsable.h:
5429 * src/insets/insetcollapsable.C:
5430 * src/insets/insetfoot.h:
5431 * src/insets/insetfoot.C:
5432 * src/insets/insetert.h:
5433 * src/insets/insetert.C: cleaned up the code so that it works now
5434 correctly with insettext.
5436 * src/insets/inset.C:
5437 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
5438 that insets in insets are supported right.
5441 * src/table.C: lots of changes for use with inset tabular (and cleanup)
5443 * src/paragraph.C: some small fixes
5445 * src/debug.h: inserted INSETS debug info
5447 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
5448 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
5450 * src/commandtags.h:
5451 * src/LyXAction.C: insert code for InsetTabular.
5453 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
5454 not Button1MotionMask.
5455 (workAreaButtonRelease): send always a InsetButtonRelease event to
5457 (checkInsetHit): some setCursor fixes (always with insets).
5459 * src/BufferView2.C (lockInset): returns a bool now and extended for
5460 locking insets inside insets.
5461 (showLockedInsetCursor): it is important to have the cursor always
5462 before the locked inset.
5463 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
5465 * src/BufferView.h: made lockInset return a bool.
5467 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
5469 * src/text2.C (SetCursor): This now has a version with a LyXCursor
5470 that is used also internally but can be called as public to have back
5471 a cursor pos which is not set internally.
5472 (SetCursorIntern): Changed to use above function.
5474 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
5476 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5481 * NEWS: updated for prerelease of 1.1.5. Please comment and send
5482 patches for things that should be in or should be changed.
5484 * src/* [insetfiles]: change "usigned char fragile" to bool
5485 fragile. There was only one point that could that be questioned
5486 and that is commented in formulamacro.C. Grep for "CHECK".
5488 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
5489 (DeleteBuffer): take it out of CutAndPaste and make it static.
5491 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5493 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
5494 output the spacing envir commands. Also the new commands used in
5495 the LaTeX output makes the result better.
5497 * src/Spacing.C (writeEnvirBegin): new method
5498 (writeEnvirEnd): new method
5500 2000-04-18 Juergen Vigna <jug@sad.it>
5502 * src/CutAndPaste.C: made textclass a static member of the class
5503 as otherwise it is not accesed right!!!
5505 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
5507 * forms/layout_forms.fd
5508 * src/layout_forms.h
5509 * src/layout_forms.C (create_form_form_character)
5510 * src/lyx_cb.C (UserFreeFont)
5511 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
5512 documents (in the layout->character popup).
5514 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5516 * src/spellchecker.C (create_ispell_pipe): fix a bug where
5517 \spell_command was in fact not honored (from Kevin Atkinson).
5519 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
5522 * src/lyx_gui.h: make lyxViews private (Angus)
5524 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
5526 * src/mathed/math_write.C
5527 (MathMatrixInset::Write) Put \protect before \begin{array} and
5528 \end{array} if fragile
5529 (MathParInset::Write): Put \protect before \\ if fragile
5531 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5533 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
5534 initialization if the LyXColorHandler must be done after the
5535 connections to the XServer has been established.
5537 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
5538 get the background pixel from the lyxColorhandler so that the
5539 figures are rendered with the correct background color.
5540 (NextToken): removed functions.
5541 (GetPSSizes): use ifs >> string instead of NextToken.
5543 * src/Painter.[Ch]: the color cache moved out of this file.
5545 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
5548 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5550 * src/WorkArea.C (work_area_handler): call BufferView::enterView
5551 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
5553 * src/BufferView.C (enterView): new func
5554 (leaveView): new func
5556 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
5558 (leaveView): new func, undefines xterm cursor when approp.
5560 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
5561 (AllowInput): delete the Workarea cursor handling from this func.
5563 * src/Painter.C (underline): draw a slimer underline in most cases.
5565 * src/lyx_main.C (error_handler): use extern "C"
5567 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5569 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
5570 sent directly to me.
5572 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
5573 to the list by Dekel.
5575 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
5578 * src/bufferview_funcs.[Ch]: two new files, moved several of the
5579 methods from lyx_cb.here.
5581 * src/lyx_cb.C: in addition to the above; removed input_prohibited
5584 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5586 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
5587 instead of using current_view directly.
5589 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
5591 * src/LyXAction.C (init): add the paragraph-spacing command.
5593 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
5595 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
5597 * src/lyx_cb.C (CurrentState): output a string when the spacing is
5598 different from the documents.
5600 * src/text.C (SetHeightOfRow): take paragraph spacing into
5601 account, paragraph spacing takes precedence over buffer spacing
5602 (GetVisibleRow): ditto
5604 * src/paragraph.C (writeFile): output the spacing parameter too.
5605 (validate): set the correct features if spacing is used in the
5607 (Clear): set spacing to default
5608 (MakeSameLayout): spacing too
5609 (HasSameLayout): spacing too
5610 (SetLayout): spacing too
5611 (TeXOnePar): output the spacing commands
5613 * src/lyxparagraph.h: added a spacing variable for use with
5614 per-paragraph spacing.
5616 * src/Spacing.h: add a Default spacing and a method to check if
5617 the current spacing is default. also added an operator==
5619 * src/text2.C (DeleteEmptyParagraphMechanism): added a
5622 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5624 * src/lyxserver.C (callback): fix dispatch of functions
5626 * src/insets/insetlatexaccent.C (checkContents): turn bogus
5627 printf() into lyxerr call.
5629 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
5632 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
5633 "Table" to "Table Box", "Float" to "Floating Material"; deletes
5634 the "Float" from each of the subitems.
5635 (ShowHelpMenu): add entry for "FAQ" and "TOC".
5637 * src/support/DebugStream.h: add an #ifdef to work around a gcc
5638 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
5639 documented the change so that the workaround can be nuked later.
5641 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
5644 * src/lyxlex_pimpl.C (next): do not re-declare the default value
5646 * src/buffer.C (getLatexName): ditto
5647 (setReadonly): ditto
5649 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5651 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
5652 avoid some uses of current_view. Added also a bufferParams()
5653 method to get at this.
5655 * src/lyxtext.h: changed params->buffer and paramters->bparams.
5657 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5659 * src/lyxparagraph.[Ch]: removed
5660 operator<(LyXParagraph::InsetTable..., added a struct matchIT
5661 with operators used by lower_bound and
5662 upper_bound in InsetTable's
5663 Make struct InsetTable private again. Used matchpos.
5665 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
5667 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
5668 document, the language of existing text is changed (unless the
5669 document is multi-lingual)
5671 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
5673 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
5675 * A lot of files: A rewrite of the Right-to-Left support.
5677 2000-04-10 Juergen Vigna <jug@sad.it>
5679 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
5680 misplaced cursor when inset in inset is locked.
5682 * src/insets/insettext.C (LocalDispatch): small fix so that a
5683 BREAKLINE is not inserted if we don't permit it with autBreakRows.
5685 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
5686 footnote font should be decreased in size twice when displaying.
5688 * src/insets/insettext.C (GetDrawFont): inserted this function as
5689 the drawing-font may differ from the real paragraph font.
5691 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
5692 insets (inset in inset!).
5694 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
5695 function here because we don't want footnotes inside footnotes.
5697 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
5699 (init): now set the inset_owner in paragraph.C
5700 (LocalDispatch): added some resetPos() in the right position
5703 (pasteSelection): changed to use the new CutAndPaste-Class.
5705 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
5706 which tells if it is allowed to insert another inset inside this one.
5708 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
5709 SwitchLayoutsBetweenClasses.
5711 * src/text2.C (InsertInset): checking of the new paragraph-function
5713 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
5714 is not needed anymore here!
5717 (PasteSelection): redone (also with #ifdef) so that now this uses
5718 the CutAndPaste-Class.
5719 (SwitchLayoutsBetweenClasses): removed here and implemented in the
5722 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
5723 from/to text/insets.
5725 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
5726 so that the paragraph knows if it is inside an (text)-inset.
5727 (InsertFromMinibuffer): changed return-value to bool as now it
5728 may happen that an inset is not inserted in the paragraph.
5729 (InsertInsetAllowed): this checks if it is allowed to insert an
5730 inset in this paragraph.
5732 (BreakParagraphConservative):
5733 (BreakParagraph) : small change for the above change of the return
5734 value of InsertFromMinibuffer.
5736 * src/lyxparagraph.h: added inset_owner and the functions to handle
5737 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
5739 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5741 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
5742 functions from BufferView to BufferView::Pimpl to ease maintence.
5744 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
5745 correctly. Also use SetCursorIntern instead of SetCursor.
5747 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
5750 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5752 * src/WorkArea.C (belowMouse): manually implement below mouse.
5754 * src/*: Add "explicit" on several constructors, I added probably
5755 some unneeded ones. A couple of changes to code because of this.
5757 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
5758 implementation and private parts from the users of BufferView. Not
5761 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
5762 implementation and private parts from the users of LyXLex. Not
5765 * src/BufferView_pimpl.[Ch]: new files
5767 * src/lyxlex_pimpl.[Ch]: new files
5769 * src/LyXView.[Ch]: some inline functions move out-of-line
5771 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5773 * src/lyxparagraph.h: make struct InsetTable public.
5775 * src/support/lyxstring.h: change lyxstring::difference_type to be
5776 ptrdiff_t. Add std:: modifiers to streams.
5778 * src/font.C: include the <cctype> header, for islower() and
5781 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5783 * src/font.[Ch]: new files. Contains the metric functions for
5784 fonts, takes a LyXFont as parameter. Better separation of concepts.
5786 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
5787 changes because of this.
5789 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
5791 * src/*: compile with -Winline and move functions that don't
5794 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
5797 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5799 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
5800 (various files changed because of this)
5802 * src/Painter.C (text): fixed the drawing of smallcaps.
5804 * src/lyxfont.[Ch] (drawText): removed unused member func.
5807 * src/*.C: added needed "using" statements and "std::" qualifiers.
5809 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5811 * src/*.h: removed all use of "using" from header files use
5812 qualifier std:: instead.
5814 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5816 * src/text.C (Backspace): some additional cleanups (we already
5817 know whether cursor.pos is 0 or not).
5819 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
5820 automake does not provide one).
5822 * src/bmtable.h: replace C++ comments with C comments.
5824 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
5826 * src/screen.C (ShowCursor): Change the shape of the cursor if
5827 the current language is not equal to the language of the document.
5828 (If the cursor change its shape unexpectedly, then you've found a bug)
5830 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
5833 * src/insets/insetnumber.[Ch]: New files.
5835 * src/LyXAction.C (init)
5836 * src/lyxfunc.C (dispatch): Add command number-inset-insert
5839 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
5841 * src/lyxparagraph.h
5842 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
5843 (the vector is kept sorted).
5845 * src/text.C (GetVisibleRow): Draw selection correctly when there
5846 is both LTR and RTL text.
5848 * src/paragraph.C (Clone): Use the assignment operator for cloning,
5849 which is much faster.
5851 * src/text.C (GetVisibleRow and other): Do not draw the last space
5852 in a row if the direction of the last letter is not equal to the
5853 direction of the paragraph.
5855 * src/lyxfont.C (latexWriteStartChanges):
5856 Check that font language is not equal to basefont language.
5857 (latexWriteEndChanges): ditto
5859 * src/lyx_cb.C (StyleReset): Don't change the language while using
5860 the font-default command.
5862 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
5863 empty paragraph before a footnote.
5865 * src/insets/insetcommand.C (draw): Increase x correctly.
5867 * src/screen.C (ShowCursor): Change cursor shape if
5868 current language != document language.
5870 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
5872 2000-03-31 Juergen Vigna <jug@sad.it>
5874 * src/paragraph.C (GetInset): commented out text[pos] = ' '
5875 (Clone): changed mode how the paragraph-data is copied to the
5876 new clone-paragraph.
5878 * src/lyxfunc.C (Dispatch): fixed small problem when calling
5879 GetInset(pos) with no inset anymore there (in inset UNDO)
5881 * src/insets/insetcommand.C (draw): small fix as here x is
5882 incremented not as much as width() returns (2 before, 2 behind = 4)
5884 2000-03-30 Juergen Vigna <jug@sad.it>
5886 * src/insets/insettext.C (InsetText): small fix in initialize
5887 widthOffset (should not be done in the init() function)
5889 2000-03-29 Amir Karger <karger@lyx.org>
5891 * lib/examples/it_ItemizeBullets.lyx: translation by
5894 * Implemented \textasciitilde and fixed a tiny bug in reLyX
5896 2000-03-29 Juergen Vigna <jug@sad.it>
5898 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
5900 * src/insets/insetfoot.C (Clone): small change as for the below
5901 new init function in the text-inset
5903 * src/insets/insettext.C (init): new function as I've seen that
5904 clone did not copy the Paragraph-Data!
5905 (LocalDispatch): Added code so that now we have some sort of Undo
5906 functionality (well actually we HAVE Undo ;)
5908 * src/text.C (Backspace): Small fix for the a | a Backspace problem
5910 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
5912 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
5915 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5917 * src/main.C: added a runtime check that verifies that the xforms
5918 header used when building LyX and the library used when running
5919 LyX match. Exit with a message if they don't match. This is a
5920 version number check only.
5922 * src/buffer.C (save): Don't allocate memory on the heap for
5923 struct utimbuf times.
5925 * *: some using changes, use iosfwd instead of the real headers.
5927 * src/lyxfont.C use char const * instead of string for the static
5928 strings. Rewrite some functions to use sstream.
5930 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5932 * src/text.C (Backspace): hopefully fix the dreaded backaspace
5935 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5937 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
5938 of Geodesy (from Martin Vermeer)
5940 * lib/layouts/svjour.inc: include file for the Springer svjour
5941 class. It can be used to support journals other than JoG.
5943 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
5944 Miskiewicz <misiek@pld.org.pl>)
5945 * lib/reLyX/Makefile.am: ditto.
5947 2000-03-27 Juergen Vigna <jug@sad.it>
5949 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
5950 also some modifications with operations on selected text.
5952 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
5953 problems with clicking on insets (last famous words ;)
5955 * src/insets/insetcommand.C (draw):
5956 (width): Changed to have a bit of space before and after the inset so
5957 that the blinking cursor can be seen (otherwise it was hidden)
5959 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5961 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
5962 would not be added to the link list when an installed gettext (not
5963 part of libc) is found.
5965 2000-03-24 Juergen Vigna <jug@sad.it>
5967 * src/insets/insetcollapsable.C (Edit):
5968 * src/mathed/formula.C (InsetButtonRelease):
5969 (InsetButtonPress): fixed for new handling of ButtonPress/Release
5972 * src/BufferView.C (workAreaButtonPress):
5973 (workAreaButtonRelease):
5974 (checkInsetHit): Finally fixed the clicking on insets be handled
5977 * src/insets/insetert.C (Edit): inserted this call so that ERT
5978 insets work always with LaTeX-font
5980 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5982 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
5983 caused lyx to startup with no GUI in place, causing in a crash
5984 upon startup when called with arguments.
5986 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5988 * src/FontLoader.C: better initialization of dummyXFontStruct.
5990 2000-03-20 José Abílio Matos <jamatos@lyx.org>
5992 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
5993 for linuxdoc and docbook import and export format options.
5995 * lib/lyxrc.example Example of default values for the previous flags.
5997 * src/lyx_cb.C Use those flags instead of the hardwired values for
5998 linuxdoc and docbook export.
6000 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
6003 * src/menus.C Added menus entries for the new import/exports formats.
6005 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6007 * src/lyxrc.*: Added support for running without Gui
6010 * src/FontLoader.C: sensible defaults if no fonts are needed
6012 * src/lyx_cb.C: New function ShowMessage (writes either to the
6013 minibuffer or cout in case of no gui
6014 New function AskOverwrite for common stuff
6015 Consequently various changes to call these functions
6017 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
6018 wild guess at sensible screen resolution when having no gui
6020 * src/lyxfont.C: no gui, no fonts... set some defaults
6022 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6024 * src/LColor.C: made the command inset background a bit lighter.
6026 2000-03-20 Hartmut Goebel <goebel@noris.net>
6028 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
6029 stdstruct.inc. Koma-Script added some title elements which
6030 otherwise have been listed below "bibliography". This split allows
6031 adding title elements to where they belong.
6033 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
6034 define the additional tilte elements and then include
6037 * many other layout files: changed to include stdtitle.inc just
6038 before stdstruct.inc.
6040 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
6042 * src/buffer.C: (save) Added the option to store all backup files
6043 in a single directory
6045 * src/lyxrc.[Ch]: Added variable \backupdir_path
6047 * lib/lyxrc.example: Added descriptions of recently added variables
6049 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
6050 bibtex inset, not closing the bibtex popup when deleting the inset)
6052 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6054 * src/lyx_cb.C: add a couple using directives.
6056 2000-03-17 José Abílio Matos <jamatos@lyx.org>
6057 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
6058 import based on the filename.
6060 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
6061 file would be imported at start, if the filename where of a sgml file.
6063 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
6065 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
6067 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
6068 * src/lyxfont.h Replaced the member variable bits.direction by the
6069 member variable lang. Made many changes in other files.
6070 This allows having a multi-lingual document
6072 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
6073 that change the current language to <l>.
6074 Removed the command "font-rtl"
6076 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
6077 format for Hebrew documents)
6079 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
6080 When auto_mathmode is "true", pressing a digit key in normal mode
6081 will cause entering into mathmode.
6082 If auto_mathmode is "rtl" then this behavior will be active only
6083 when writing right-to-left text.
6085 * src/text2.C (InsertStringA) The string is inserted using the
6088 * src/paragraph.C (GetEndLabel) Gives a correct result for
6089 footnote paragraphs.
6091 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
6093 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6095 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
6096 front of PasteParagraph. Never insert a ' '. This should at least
6097 fix some cause for the segfaults that we have been experiencing,
6098 it also fixes backspace behaviour slightly. (Phu!)
6100 * src/support/lstrings.C (compare_no_case): some change to make it
6101 compile with gcc 2.95.2 and stdlibc++-v3
6103 * src/text2.C (MeltFootnoteEnvironment): change type o
6104 first_footnote_par_is_not_empty to bool.
6106 * src/lyxparagraph.h: make text private. Changes in other files
6108 (fitToSize): new function
6109 (setContentsFromPar): new function
6110 (clearContents): new function
6111 (SetChar): new function
6113 * src/paragraph.C (readSimpleWholeFile): deleted.
6115 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
6116 the file, just use a simple string instead. Also read the file in
6117 a more maintainable manner.
6119 * src/text2.C (InsertStringA): deleted.
6120 (InsertStringB): deleted.
6122 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6124 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
6125 RedoParagraphs from the doublespace handling part, just set status
6126 to NEED_MORE_REFRESH. Also don't update cursor position (should be
6127 done, but perhaps not like this.)
6129 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6131 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
6132 character when inserting an inset.
6134 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6136 * src/bufferparams.C (readLanguage): now takes "default" into
6139 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
6140 also initialize the toplevel_keymap with the default bindings from
6143 * src/buffer.C (Buffer): remove lyxrc from the parameters.
6145 * all files using lyxrc: have lyxrc as a real variable and not a
6146 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
6149 * src/lyxrc.C: remove double call to defaultKeyBindings
6151 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
6152 toolbar defauls using lyxlex. Remove enums, structs, functions
6155 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
6156 toolbar defaults. Also store default keybindings in a map.
6158 * src/ToolbarDefaults.[Ch]: New file. This class is used for
6159 storing the toolbar defaults without any xforms dependencies.
6161 * src/insets/figinset.C: patch posted to list by Andre Poenitz
6162 applied. Changed to use iterators.
6164 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
6166 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
6167 systems that don't have LINGUAS set to begin with.
6169 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6171 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
6172 the list by Dekel Tsur.
6174 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6176 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
6177 * src/insets/form_graphics.C: ditto.
6179 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
6181 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6183 * src/bufferparams.C (readLanguage): use the new language map
6185 * src/intl.C (InitKeyMapper): use the new language map
6187 * src/lyx_gui.C (create_forms): use the new language map
6189 * src/language.[Ch]: New files. Used for holding the information
6190 about each language. Now! Use this new language map enhance it and
6191 make it really usable for our needs.
6193 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
6195 * screen.C (ShowCursor): Removed duplicate code.
6196 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
6197 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
6199 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
6202 * src/text.C Added TransformChar method. Used for rendering Arabic
6203 text correctly (change the glyphs of the letter according to the
6204 position in the word)
6209 * src/lyxrc.C Added lyxrc command {language_command_begin,
6210 language_command_end,language_command_ltr,language_command_rtl,
6211 language_package} which allows the use of either arabtex or Omega
6214 * src/lyx_gui.C (init)
6216 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
6217 to use encoding for menu fonts which is different than the encoding
6220 * src/buffer.C (makeLaTeXFile): If params.language = "default",
6221 do not load the babel package.
6222 To write an English document with Hebrew/Arabic, change the document
6223 language to "english".
6225 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
6226 (alphaCounter): changed to return char
6227 (loweralphaCounter, hebrewCounter, romanCounter): New functions
6229 * lib/lyxrc.example Added examples for Hebrew/Arabic
6232 * src/layout.C Added layout command endlabeltype
6234 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
6236 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
6238 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6240 * src/mathed/math_delim.C (search_deco): return a
6241 math_deco_struct* instead of index.
6243 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6245 * All files with a USE_OSTREAM_ONLY within: removed all code that
6246 was unused when USE_OSTREAM_ONLY is defined.
6248 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
6249 of any less. Removed header and using.
6251 * src/text.C (GetVisibleRow): draw the string "Page Break
6252 (top/bottom)" on screen when drawing a pagebreak line.
6254 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6256 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
6258 * src/mathed/math_macro.C (draw): do some cast magic.
6261 * src/mathed/math_defs.h: change byte* argument to byte const*.
6263 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
6265 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
6266 know it is right to return InsetFoot* too, but cxx does not like
6269 * src/insets/insetcollapsable.[Ch] (Clone): make const.
6271 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
6273 * src/mathed/math_delim.C: change == to proper assignment.
6275 2000-03-09 Juergen Vigna <jug@sad.it>
6277 * src/insets/insettext.C (setPos): fixed various cursor positioning
6278 problems (via mouse and cursor-keys)
6279 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
6280 inset (still a small display problem but it works ;)
6282 * src/insets/insetcollapsable.C (draw): added button_top_y and
6283 button_bottom_y to have correct values for clicking on the inset.
6285 * src/support/lyxalgo.h: commented out 'using std::less'
6287 2000-03-08 Juergen Vigna <jug@sad.it>
6289 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
6290 Button-Release event closes as it is alos the Release-Event
6293 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
6295 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6297 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
6298 can add multiple spaces in Scrap (literate programming) styles...
6299 which, by the way, is how I got hooked on LyX to begin with.
6301 * src/mathed/formula.C (Write): Added dummy variable to an
6302 inset::Latex() call.
6303 (Latex): Add free_spacing boolean to inset::Latex()
6305 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
6307 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
6308 virtual function to include the free_spacing boolean from
6309 the containing paragraph's style.
6311 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
6312 Added free_spacing boolean arg to match inset.h
6314 * src/insets/insettext.C, src/insets/insettext.h (Latex):
6315 Added free_spacing boolean arg to match inset.h
6317 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
6318 Added free_spacing boolean and made sure that if in a free_spacing
6319 paragraph, that we output normal space if there is a protected space.
6321 * src/insets/insetref.C, src/insets/insetref.h (Latex):
6322 Added free_spacing boolean arg to match inset.h
6324 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
6325 Added free_spacing boolean arg to match inset.h
6327 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
6328 Added free_spacing boolean arg to match inset.h
6330 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
6331 Added free_spacing boolean arg to match inset.h
6333 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
6334 Added free_spacing boolean arg to match inset.h
6336 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
6337 free_spacing boolean arg to match inset.h
6339 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
6340 Added free_spacing boolean arg to match inset.h
6342 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
6343 Added free_spacing boolean arg to match inset.h
6345 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
6346 Added free_spacing boolean arg to match inset.h
6348 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
6349 Added free_spacing boolean arg to match inset.h
6351 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
6352 Added free_spacing boolean arg to match inset.h
6354 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
6355 free_spacing boolean arg to match inset.h
6357 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
6358 free_spacing boolean arg to match inset.h
6360 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
6361 ignore free_spacing paragraphs. The user's spaces are left
6364 * src/text.C (InsertChar): Fixed the free_spacing layout
6365 attribute behavior. Now, if free_spacing is set, you can
6366 add multiple spaces in a paragraph with impunity (and they
6367 get output verbatim).
6368 (SelectSelectedWord): Added dummy argument to inset::Latex()
6371 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
6374 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
6375 paragraph layouts now only input a simple space instead.
6376 Special character insets don't make any sense in free-spacing
6379 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
6380 hard-spaces in the *input* file to simple spaces if the layout
6381 is free-spacing. This converts old files which had to have
6382 hard-spaces in free-spacing layouts where a simple space was
6384 (writeFileAscii): Added free_spacing check to pass to the newly
6385 reworked inset::Latex(...) methods. The inset::Latex() code
6386 ensures that hard-spaces in free-spacing paragraphs get output
6387 as spaces (rather than "~").
6389 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6391 * src/mathed/math_delim.C (draw): draw the empty placeholder
6392 delims with a onoffdash line.
6393 (struct math_deco_compare): struct that holds the "functors" used
6394 for the sort and the binary search in math_deco_table.
6395 (class init_deco_table): class used for initial sort of the
6397 (search_deco): use lower_bound to do a binary search in the
6400 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6402 * src/lyxrc.C: a small secret thingie...
6404 * src/lyxlex.C (printTable): changed to take a ostream as paramter
6405 and to not flush the stream as often as it used to.
6407 * src/support/lyxalgo.h: new file
6408 (sorted): template function used for checking if a sequence is
6409 sorted or not. Two versions with and without user supplied
6410 compare. Uses same compare as std::sort.
6412 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
6413 it and give warning on lyxerr.
6415 (struct compare_tags): struct with function operators used for
6416 checking if sorted, sorting and lower_bound.
6417 (search_kw): use lower_bound instead of manually implemented
6420 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6422 * src/insets/insetcollapsable.h: fix Clone() declaration.
6423 * src/insets/insetfoot.h: ditto.
6425 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
6427 2000-03-08 Juergen Vigna <jug@sad.it>
6429 * src/insets/lyxinset.h: added owner call which tells us if
6430 this inset is inside another inset. Changed also the return-type
6431 of Editable to an enum so it tells clearer what the return-value is.
6433 * src/insets/insettext.C (computeTextRows): fixed computing of
6434 textinsets which split automatically on more rows.
6436 * src/insets/insetert.[Ch]: changed this to be of BaseType
6439 * src/insets/insetfoot.[Ch]: added footnote inset
6441 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
6442 collapsable insets (like footnote, ert, ...)
6444 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6446 * src/lyxdraw.h: remvoe file
6448 * src/lyxdraw.C: remove file
6450 * src/insets/insettext.C: added <algorithm>.
6452 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6454 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
6455 (matrix_cb): case MM_OK use string stream
6457 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
6460 * src/mathed/math_macro.C (draw): use string stream
6461 (Metrics): use string stream
6463 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
6464 directly to the ostream.
6466 * src/vspace.C (asString): use string stream.
6467 (asString): use string stream
6468 (asLatexString): use string stream
6470 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
6471 setting Spacing::Other.
6473 * src/LaTeXFeatures.C (getPackages): use string stream instead of
6474 sprintf when creating the stretch vale.
6476 * src/text2.C (alphaCounter): changed to return a string and to
6477 not use a static variable internally. Also fixed a one-off bug.
6478 (SetCounter): changed the drawing of the labels to use string
6479 streams instead of sprintf.
6481 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
6482 manipulator to use a scheme that does not require library support.
6483 This is also the way it is done in the new GNU libstdc++. Should
6484 work with DEC cxx now.
6486 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6488 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
6489 end. This fixes a bug.
6491 * src/mathed (all files concerned with file writing): apply the
6492 USE_OSTREAM_ONLY changes to mathed too.
6494 * src/support/DebugStream.h: make the constructor explicit.
6496 * src/lyxfont.C (latexWriteStartChanges): small bug related to
6497 count and ostream squashed.
6499 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6501 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
6503 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
6504 ostringstream uses STL strings, and we might not.
6506 * src/insets/insetspecialchar.C: add using directive.
6507 * src/insets/insettext.C: ditto.
6509 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6511 * lib/layouts/seminar.layout: feeble attempt at a layout for
6512 seminar.cls, far from completet and could really use some looking
6513 at from people used to write layout files.
6515 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
6516 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
6517 a lot nicer and works nicely with ostreams.
6519 * src/mathed/formula.C (draw): a slightly different solution that
6520 the one posted to the list, but I think this one works too. (font
6521 size wrong in headers.)
6523 * src/insets/insettext.C (computeTextRows): some fiddling on
6524 Jürgens turf, added some comments that he should read.
6526 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
6527 used and it gave compiler warnings.
6528 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
6531 * src/lyx_gui.C (create_forms): do the right thing when
6532 show_banner is true/false.
6534 * src/lyx_cb.C (TimerCB): no need to close or do anything if
6535 show_banner is false.
6537 * most file writing files: Now use iostreams to do almost all of
6538 the writing. Also instead of passing string &, we now use
6539 stringstreams. mathed output is still not adapted to iostreams.
6540 This change can be turned off by commenting out all the occurences
6541 of the "#define USE_OSTREAM_ONLY 1" lines.
6543 * src/WorkArea.C (createPixmap): don't output debug messages.
6544 (WorkArea): don't output debug messages.
6546 * lib/lyxrc.example: added a comment about the new variable
6549 * development/Code_rules/Rules: Added some more commente about how
6550 to build class interfaces and on how better encapsulation can be
6553 2000-03-03 Juergen Vigna <jug@sad.it>
6555 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
6556 automatically with the width of the LyX-Window
6558 * src/insets/insettext.C (computeTextRows): fixed update bug in
6559 displaying text-insets (scrollvalues where not initialized!)
6561 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6563 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
6564 id in the check of the result from lower_bound is not enough since
6565 lower_bound can return last too, and then res->id will not be a
6568 * all insets and some code that use them: I have conditionalized
6569 removed the Latex(string & out, ...) this means that only the
6570 Latex(ostream &, ...) will be used. This is a work in progress to
6571 move towards using streams for all output of files.
6573 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
6576 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6578 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
6579 routine (this fixes bug where greek letters were surrounded by too
6582 * src/support/filetools.C (findtexfile): change a bit the search
6583 algorithm, to fix bug introduced in 1.1.4. Note that --format is
6584 no longer passed to kpsewhich, we may have to change that later.
6586 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
6587 warning options to avoid problems with X header files (from Angus
6589 * acinclude.m4: regenerated.
6591 2000-03-02 Juergen Vigna <jug@sad.it>
6593 * src/insets/insettext.C (WriteParagraphData): Using the
6594 par->writeFile() function for writing paragraph-data.
6595 (Read): Using buffer->parseSingleLyXformat2Token()-function
6596 for parsing paragraph data!
6598 * src/buffer.C (readLyXformat2): removed all parse data and using
6599 the new parseSingleLyXformat2Token()-function.
6600 (parseSingleLyXformat2Token): added this function to parse (read)
6601 lyx-file-format (this is called also from text-insets now!)
6603 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6605 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
6608 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
6609 directly instead of going through a func. One very bad thing: a
6610 static LyXFindReplace, but I don't know where to place it.
6612 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
6613 string instead of char[]. Also changed to static.
6614 (GetSelectionOrWordAtCursor): changed to static inline
6615 (SetSelectionOverLenChars): ditto.
6617 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
6618 current_view and global variables. both classes has changed names
6619 and LyXFindReplace is not inherited from SearchForm.
6621 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
6622 fl_form_search form.
6624 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
6626 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6628 * lib/bind/*.bind: make sure 'buffer-previous' function is not
6629 bound (from Kayvan).
6631 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
6633 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
6635 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6637 * some things that I should comment but the local pub says head to
6640 * comment out all code that belongs to the Roff code for Ascii
6641 export of tables. (this is unused)
6643 * src/LyXView.C: use correct type for global variable
6644 current_layout. (LyXTextClass::size_type)
6646 * some code to get the new insetgraphics closer to working I'd be
6647 grateful for any help.
6649 * src/BufferView2.C (insertInset): use the return type of
6650 NumberOfLayout properly. (also changes in other files)
6652 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
6653 this as a test. I want to know what breaks because of this.
6655 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
6657 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6659 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
6660 to use a \makebox in the label, this allows proper justification
6661 with out using protected spaces or multiple hfills. Now it is
6662 "label" for left justified, "\hfill label\hfill" for center, and
6663 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
6664 should be changed accordingly.
6666 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6668 * src/lyxtext.h: change SetLayout() to take a
6669 LyXTextClass::size_type instead of a char (when there is more than
6670 127 layouts in a class); also change type of copylayouttype.
6671 * src/text2.C (SetLayout): ditto.
6672 * src/LyXView.C (updateLayoutChoice): ditto.
6674 * src/LaTeX.C (scanLogFile): errors where the line number was not
6675 given just after the '!'-line were ignored (from Dekel Tsur).
6677 * lib/lyxrc.example: fix description of \date_insert_format
6679 * lib/layouts/llncs.layout: new layout, contributed by Martin
6682 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6684 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
6685 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
6686 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
6687 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
6688 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
6689 paragraph.C, text.C, text2.C)
6691 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6693 * src/insets/insettext.C (LocalDispatch): remove extra break
6696 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
6697 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
6699 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
6700 * src/insets/insettext.[Ch] (GetCursorPos): ditto
6702 * src/insets/insetbib.h: move InsetBibkey::Holder and
6703 InsetCitation::Holder in public space.
6705 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6707 * src/insets/insettext.h: small change to get the new files from
6708 Juergen to compile (use "string", not "class string").
6710 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
6711 const & as parameter to LocalDispatch, use LyXFont const & as
6712 paramter to some other func. This also had impacto on lyxinsets.h
6713 and the two mathed insets.
6715 2000-02-24 Juergen Vigna <jug@sad.it>
6718 * src/commandtags.h:
6720 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
6724 * src/BufferView2.C: added/updated code for various inset-functions
6726 * src/insets/insetert.[Ch]: added implementation of InsetERT
6728 * src/insets/insettext.[Ch]: added implementation of InsetText
6730 * src/insets/inset.C (Edit): added "unsigned int button" parameter
6731 (draw): added preliminary code for inset scrolling not finshed yet
6733 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
6734 as it is in lyxfunc.C now
6736 * src/insets/lyxinset.h: Added functions for text-insets
6738 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6740 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
6741 BufferView and reimplement the list as a queue put inside its own
6744 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
6746 * several files: use the new interface to the "updateinsetlist"
6748 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
6750 (work_area_handler): call BufferView::trippleClick on trippleclick.
6752 * src/BufferView.C (doubleClick): new function, selects word on
6754 (trippleClick): new function, selects line on trippleclick.
6756 2000-02-22 Allan Rae <rae@lyx.org>
6758 * lib/bind/xemacs.bind: buffer-previous not supported
6760 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6762 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
6765 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6767 * src/bufferlist.C: get rid of current_view from this file
6769 * src/spellchecker.C: get rid of current_view from this file
6771 * src/vspace.C: get rid of current_view from this file
6772 (inPixels): added BufferView parameter for this func
6773 (asLatexCommand): added a BufferParams for this func
6775 * src/text.C src/text2.C: get rid of current_view from these
6778 * src/lyxfont.C (getFontDirection): move this function here from
6781 * src/bufferparams.C (getDocumentDirection): move this function
6784 * src/paragraph.C (getParDirection): move this function here from
6786 (getLetterDirection): ditto
6788 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6790 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
6791 resize due to wrong pixmap beeing used. Also took the opurtunity
6792 to make the LyXScreen stateless on regard to WorkArea and some
6793 general cleanup in the same files.
6795 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6797 * src/Makefile.am: add missing direction.h
6799 * src/PainterBase.h: made the width functions const.
6801 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
6804 * src/insets/insetcommand.C (draw): draw Editable as buttons.
6806 * src/insets/insetlatexaccent.C (draw): make the accents draw
6807 better, at present this will only work well with iso8859-1.
6809 * several files: remove the old drawing code, now we use the new
6812 * several files: remove support for mono_video, reverse_video and
6815 2000-02-17 Juergen Vigna <jug@sad.it>
6817 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
6818 int ** as we have to return the pointer, otherwise we have only
6819 NULL pointers in the returning function.
6821 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6823 * src/LaTeX.C (operator()): quote file name when running latex.
6825 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6827 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
6828 (bubble tip), this removes our special handling of this.
6830 * Remove all code that is unused now that we have the new
6831 workarea. (Code that are not active when NEW_WA is defined.)
6833 * Make the uses of XSync not conditionalized on define USE_XSYNC.
6835 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6837 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
6838 nonexisting layout; correctly redirect obsoleted layouts.
6840 * lib/lyxrc.example: document \view_dvi_paper_option
6842 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
6845 * src/lyx_cb.C (RunScript): handle $$FName for command names.
6846 (PreviewDVI): handle the view_dvi_paper_option variable.
6847 [Both from Roland Krause]
6849 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6851 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
6852 char const *, int, LyXFont)
6853 (text(int, int, string, LyXFont)): ditto
6855 * src/text.C (InsertCharInTable): attempt to fix the double-space
6856 feature in tables too.
6857 (BackspaceInTable): ditto.
6858 (GetVisibleRow): make bottom pagebreak line be a onoff line.
6860 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6862 * src/text2.C (owner): only complain if owner_ is set and bv != 0
6864 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
6865 newly found text in textcache to this.
6866 (buffer): set the owner of the text put into the textcache to 0
6868 * src/insets/figinset.C (draw): fixed the drawing of figures with
6871 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
6872 drawing of mathframe, hfills, protected space, table lines. I have
6873 now no outstanding drawing problems with the new Painter code.
6875 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6877 * src/PainterBase.C (ellipse, circle): do not specify the default
6880 * src/LColor.h: add using directive.
6882 * src/Painter.[Ch]: change return type of methods from Painter& to
6883 PainterBase&. Add a using directive.
6885 * src/WorkArea.C: wrap xforms callbacks in C functions
6888 * lib/layouts/foils.layout: font fix and simplifications from Carl
6891 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6893 * a lot of files: The Painter, LColor and WorkArea from the old
6894 devel branch has been ported to lyx-devel. Some new files and a
6895 lot of #ifdeffed code. The new workarea is enabled by default, but
6896 if you want to test the new Painter and LColor you have to compile
6897 with USE_PAINTER defined (do this in config.h f.ex.) There are
6898 still some rought edges, and I'd like some help to clear those
6899 out. It looks stable (loads and displays the Userguide very well).
6902 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6904 * src/buffer.C (pop_tag): revert to the previous implementation
6905 (use a global variable for both loops).
6907 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
6909 * src/lyxrc.C (LyXRC): change slightly default date format.
6911 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
6912 there is an English text with a footnote that starts with a Hebrew
6913 paragraph, or vice versa.
6914 (TeXFootnote): ditto.
6916 * src/text.C (LeftMargin): allow for negative values for
6917 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
6920 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
6921 for input encoding (cyrillic)
6923 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6925 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
6928 * src/toolbar.C (set): ditto
6929 * src/insets/insetbib.C (create_form_citation_form): ditto
6931 * lib/CREDITS: added Dekel Tsur.
6933 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
6934 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
6935 hebrew supports files from Dekel Tsur.
6937 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
6938 <tzafrir@technion.ac.il>
6940 * src/lyxrc.C: put \date_insert_format at the right place.
6942 * src/buffer.C (makeLaTeXFile): fix the handling of
6943 BufferParams::sides when writing out latex files.
6945 * src/BufferView2.C: add a "using" directive.
6947 * src/support/lyxsum.C (sum): when we use lyxstring,
6948 ostringstream::str needs an additional .c_str().
6950 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6952 * src/support/filetools.C (ChangeExtension): patch from Etienne
6955 * src/TextCache.C (show): remove const_cast and make second
6956 parameter non-const LyXText *.
6958 * src/TextCache.h: use non const LyXText in show.
6960 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
6963 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6965 * src/support/lyxsum.C: rework to be more flexible.
6967 * several places: don't check if a pointer is 0 if you are going
6970 * src/text.C: remove some dead code.
6972 * src/insets/figinset.C: remove some dead code
6974 * src/buffer.C: move the BufferView funcs to BufferView2.C
6975 remove all support for insetlatexdel
6976 remove support for oldpapersize stuff
6977 made some member funcs const
6979 * src/kbmap.C: use a std::list to store the bindings in.
6981 * src/BufferView2.C: new file
6983 * src/kbsequence.[Ch]: new files
6985 * src/LyXAction.C + others: remove all trace of buffer-previous
6987 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
6988 only have one copy in the binary of this table.
6990 * hebrew patch: moved some functions from LyXText to more
6991 appropriate places. (LyXParagraph, BufferParams, LyXFont)
6993 * several files: remove support for XForms older than 0.88
6995 remove some #if 0 #endif code
6997 * src/TextCache.[Ch]: new file. Holds the textcache.
6999 * src/BufferView.C: changes to use the new TextCache interface.
7000 (waitForX): remove the now unused code.
7002 * src/BackStack.h: remove some commented code
7004 * lib/bind/emacs.bind: remove binding for buffer-previous
7006 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7008 * applied the hebrew patch.
7010 * src/lyxrow.h: make sure that all Row variables are initialized.
7012 * src/text2.C (TextHandleUndo): comment out a delete, this might
7013 introduce a memory leak, but should also help us to not try to
7014 read freed memory. We need to look at this one.
7016 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
7017 (LyXParagraph): initalize footnotekind.
7019 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
7020 forgot this when applying the patch. Please heed the warnings.
7022 * src/BufferView.C (buffer): a fix for the buffer-reload problem
7023 (aka. reformat problem)
7025 * src/bufferlist.C (exists): made const, and use const_iterator
7026 (isLoaded): new func.
7027 (release): use std::find to find the correct buffer.
7029 * src/bufferlist.h: made getState a const func.
7030 made empty a const func.
7031 made exists a const func.
7034 2000-02-01 Juergen Vigna <jug@sad.it>
7036 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
7038 * po/it.po: updated a bit the italian po file and also changed the
7039 'file nuovo' for newfile to 'filenuovo' without a space, this did
7042 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
7043 for the new insert_date command.
7045 * src/lyxfunc.C (Dispatch): added support for a insert_date function
7046 from jdblair, to insert a date into the current text conforming to
7047 a strftime format (for now only considering the locale-set and not
7048 the document-language).
7050 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7052 * src/lyxfont.C (textWidth): hopefully better fix for the Array
7053 Bounds Read error seen by purify. The problem was that islower is
7054 a macros which takes an unsigned char and uses it as an index for
7055 in array of characters properties (and is thus subject to the
7059 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
7060 correctly the paper sides radio buttons.
7061 (UpdateDocumentButtons): ditto.
7063 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7065 * src/kbmap.C (getsym + others): change to return unsigned int,
7066 returning a long can give problems on 64 bit systems. (I assume
7067 that int is 32bit on 64bit systems)
7069 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7071 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
7072 LyXLookupString to be zero-terminated. Really fixes problems seen
7075 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7077 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
7078 write a (char*)0 to the lyxerr stream.
7080 * src/lastfiles.C: move algorithm before the using statemets.
7082 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7084 * src/lastfiles.C: move using directives in global scope (egcs 1.x
7085 complains otherwise).
7086 * src/table.C: ditto
7088 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
7091 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
7092 that I removed earlier... It is really needed.
7094 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
7096 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7098 * INSTALL: update xforms home page URL.
7100 * lib/configure.m4: fix a bug with unreadable layout files.
7102 * src/table.C (calculate_width_of_column): add "using std::max"
7105 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7107 * several files: marked several lines with "DEL LINE", this is
7108 lines that can be deleted without changing anything.
7109 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
7110 checks this anyway */
7113 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
7115 * src/DepTable.C (update): add a "+" at the end when the checksum
7116 is different. (debugging string only)
7118 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
7119 the next inset to not be displayed. This should also fix the list
7120 of labels in the "Insert Crossreference" dialog.
7122 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7124 * src/support/LSubstring.C (LSubstring): set pos to string::npos
7125 when regex was not found.
7127 * src/support/lstrings.C (lowercase): use handcoded transform always.
7130 * src/text.C (Delete): fixed the crash. cursor.par->prev and
7131 old_cursor.par->prev could be 0.
7133 * several files: changed post inc/dec to pre inc/dec
7135 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
7136 write the lastfiles to file.
7138 * src/BufferView.C (buffer): only show TextCache info when debugging
7140 (resizeCurrentBuffer): ditto
7141 (workAreaExpose): ditto
7143 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
7145 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
7147 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
7148 a bit better by removing the special case for \i and \j.
7150 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7152 * src/lyx_main.C (easyParse): remove test for bad comand line
7153 options, since this broke all xforms-related parsing.
7155 * src/kbmap.C (getsym): set return type to unsigned long, as
7156 declared in header. On an alpha, long is _not_ the same as int.
7158 * src/support/LOstream.h: add a "using std::flush;"
7160 * src/insets/figinset.C: ditto.
7162 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7164 * src/bufferlist.C (write): use blinding fast file copy instead of
7165 "a char at a time", now we are doing it the C++ way.
7167 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
7168 std::list<int> instead.
7169 (addpidwait): reflect move to std::list<int>
7170 (sigchldchecker): ditto
7172 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
7175 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
7176 that obviously was wrong...
7178 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
7179 c, this avoids warnings with purify and islower.
7181 * src/insets/figinset.C: rename struct queue to struct
7182 queue_element and rewrite to use a std::queue. gsqueue is now a
7183 std::queue<queue_element>
7184 (runqueue): reflect move to std::queue
7187 * src/support/lstrings.h (tostr): specialize for bool, otherwise
7188 we would get "1" "0" instead of "true" "false. Also make the tostr
7191 2000-01-21 Juergen Vigna <jug@sad.it>
7193 * src/buffer.C (writeFileAscii): Disabled code for special groff
7194 handling of tabulars till I fix this in table.C
7196 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7198 * src/support/mkdir.C (mkdir): change second argument of mkdir to
7200 * src/support/lyxlib.h: ditto.
7202 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7204 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
7205 and 'j' look better. This might fix the "macron" bug that has been
7208 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
7209 functions as one template function. Delete the old versions.
7211 * src/support/lyxsum.C: move using std::ifstream inside
7214 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
7217 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
7219 * src/mathed/formula.C: delete #include "bufferlist.h" never used
7221 * src/insets/figinset.C (InitFigures): use new instead of malloc
7222 to allocate memory for figures and bitmaps.
7223 (DoneFigures): use delete[] instead of free to deallocate memory
7224 for figures and bitmaps.
7225 (runqueue): use new to allocate
7226 (getfigdata): use new/delete[] instead of malloc/free
7227 (RegisterFigure): ditto
7229 * some files: moved some declarations closer to first use, small
7230 whitespace changes use preincrement instead of postincrement where
7231 it does not make a difference.
7233 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
7234 step on the way to use stl::containers for key maps.
7236 * src/bufferlist.h: add a typedef for const_iterator and const
7237 versions of begin and end.
7239 * src/bufferlist.[Ch]: change name of member variable _state to
7240 state_. (avoid reserved names)
7242 (getFileNames): returns the filenames of the buffers in a vector.
7244 * configure.in (ALL_LINGUAS): added ro
7246 * src/support/putenv.C: new file
7248 * src/support/mkdir.C: new file
7250 2000-01-20 Allan Rae <rae@lyx.org>
7252 * lib/layouts/IEEEtran.layout: Added several theorem environments
7254 * lib/templates/IEEEtran.lyx: Example theorem environments and a
7255 couple of minor additions.
7257 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
7258 (except for those in footnotes of course)
7260 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7262 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
7264 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
7265 std::sort and std::lower_bound instead of qsort and handwritten
7267 (struct compara): struct that holds the functors used by std::sort
7268 and std::lower_bound in MathedLookupBOP.
7270 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7272 * src/support/LAssert.h: do not do partial specialization. We do
7275 * src/support/lyxlib.h: note that lyx::getUserName() and
7276 lyx::date() are not in use right now. Should these be suppressed?
7278 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
7279 (makeLinuxDocFile): do not put date and user name in linuxdoc
7282 * src/support/lyxlib.h (kill): change first argument to long int,
7283 since that's what solaris uses.
7285 * src/support/kill.C (kill): fix declaration to match prototype.
7287 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
7288 actually check whether namespaces are supported. This is not what
7291 * src/support/lyxsum.C: add a using directive.
7293 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7295 * src/support/kill.C: if we have namespace support we don't have
7296 to include lyxlib.h.
7298 * src/support/lyxlib.h: use namespace lyx if supported.
7300 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7302 * src/support/date.C: new file
7304 * src/support/chdir.C: new file
7306 * src/support/getUserName.C: new file
7308 * src/support/getcwd.C: new file
7310 * src/support/abort.C: new file
7312 * src/support/kill.C: new file
7314 * src/support/lyxlib.h: moved all the functions in this file
7315 insede struct lyx. Added also kill and abort to this struct. This
7316 is a way to avoid the "kill is not defined in <csignal>", we make
7317 C++ wrappers for functions that are not ANSI C or ANSI C++.
7319 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
7320 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
7321 lyx it has been renamed to sum.
7323 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7325 * src/text.C: add using directives for std::min and std::max.
7327 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7329 * src/texrow.C (getIdFromRow): actually return something useful in
7330 id and pos. Hopefully fixes the bug with positionning of errorbox
7333 * src/lyx_main.C (easyParse): output an error and exit if an
7334 incorrect command line option has been given.
7336 * src/spellchecker.C (ispell_check_word): document a memory leak.
7338 * src/bufferlist.C (write): fix mismatched allocation/deletion,
7339 where a "struct utimbuf" is allocated with "new" and deleted with
7342 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
7344 * src/text2.C (CutSelection): don't delete double spaces.
7345 (PasteSelection): ditto
7346 (CopySelection): ditto
7348 * src/text.C (Backspace): don't delete double spaces.
7350 * src/lyxlex.C (next): fix a bug that were only present with
7351 conformant std::istream::get to read comment lines, use
7352 std::istream::getline instead. This seems to fix the problem.
7354 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7356 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
7357 allowed to insert space before space" editing problem. Please read
7358 commends at the beginning of the function. Comments about usage
7361 * src/text.C (InsertChar): fix for the "not allowed to insert
7362 space before space" editing problem.
7364 * src/text2.C (DeleteEmptyParagraphMechanism): when
7365 IsEmptyTableRow can only return false this last "else if" will
7366 always be a no-op. Commented out.
7368 * src/text.C (RedoParagraph): As far as I can understand tmp
7369 cursor is not really needed.
7371 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
7372 present it could only return false anyway.
7373 (several functions): Did something not so smart...added a const
7374 specifier on a lot of methods.
7376 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
7377 and add a tmp->text.resize. The LyXParagraph constructor does the
7379 (BreakParagraphConservative): ditto
7381 * src/support/path.h (Path): add a define so that the wrong usage
7382 "Path("/tmp") will be flagged as a compilation error:
7383 "`unnamed_Path' undeclared (first use this function)"
7385 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7387 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
7388 which was bogus for several reasons.
7390 * src/LaTeX.C (scanAux): fix the regular expression used to scan
7394 * autogen.sh: do not use "type -path" (what's that anyway?).
7396 * src/support/filetools.C (findtexfile): remove extraneous space
7397 which caused a kpsewhich warning (at least with kpathsea version
7400 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7402 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
7404 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
7406 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
7408 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7410 * src/paragraph.C (BreakParagraph): do not reserve space on text
7411 if we don't need to (otherwise, if pos_end < pos, we end up
7412 reserving huge amounts of memory due to bad unsigned karma).
7413 (BreakParagraphConservative): ditto, although I have not seen
7414 evidence the bug can happen here.
7416 * src/lyxparagraph.h: add a using std::list.
7418 2000-01-11 Juergen Vigna <jug@sad.it>
7420 * src/menus.C (MenuDocu): output an Alert if the documentation-file
7423 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7425 * src/vc-backend.C (doVCCommand): change to be static and take one
7426 more parameter: the path to chdir too be fore executing the command.
7427 (retrive): new function equiv to "co -r"
7429 * src/bufferlist.C (loadLyXFile): implement the missing parts if
7430 file_not_found_hook is true.
7432 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
7434 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
7435 if a file is readwrite,readonly...anything else.
7437 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7439 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
7440 (CreatePostscript): name change from MenuRunDVIPS (or something)
7441 (PreviewPostscript): name change from MenuPreviewPS
7442 (PreviewDVI): name change from MenuPreviewDVI
7444 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
7445 \view_pdf_command., \pdf_to_ps_command
7447 * lib/configure.m4: added search for PDF viewer, and search for
7448 PDF to PS converter.
7449 (lyxrc.defaults output): add \pdflatex_command,
7450 \view_pdf_command and \pdf_to_ps_command.
7452 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
7454 * src/bufferlist.C (write): we don't use blocksize for anything so
7457 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7459 * src/support/block.h: disable operator T* (), since it causes
7460 problems with both compilers I tried. See comments in the file.
7462 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
7465 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
7466 variable LYX_DIR_10x to LYX_DIR_11x.
7468 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
7470 * INSTALL: document --with-lyxname.
7473 * configure.in: new configure flag --with-lyxname which allows to
7474 choose the name under which lyx is installed. Default is "lyx", of
7475 course. It used to be possible to do this with --program-suffix,
7476 but the later has in fact a different meaning for autoconf.
7478 * src/support/lstrings.h (lstrchr): reformat a bit.
7480 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
7481 * src/mathed/math_defs.h: ditto.
7483 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7485 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
7486 true, decides if we create a backup file or not when saving. New
7487 tag and variable \pdf_mode, defaults to false. New tag and
7488 variable \pdflatex_command, defaults to pdflatex. New tag and
7489 variable \view_pdf_command, defaults to xpdf. New tag and variable
7490 \pdf_to_ps_command, defaults to pdf2ps.
7492 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7494 * src/bufferlist.C (close): don't call insetUnlock if the buffer
7495 does not have a BufferView.
7496 (unlockInset): ditto + don't access the_locking_inset if the
7497 buffer does not have a BufferView.
7499 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
7500 certain circumstances so that we don't continue a keyboard
7501 operation long after the key was released. Try f.ex. to load a
7502 large document, press PageDown for some seconds and then release
7503 it. Before this change the document would contine to scroll for
7504 some time, with this change it stops imidiatly.
7506 * src/support/block.h: don't allocate more space than needed. As
7507 long as we don't try to write to the arr[x] in a array_type arr[x]
7508 it is perfectly ok. (if you write to it you might segfault).
7509 added operator value_type*() so that is possible to pass the array
7510 to functions expecting a C-pointer.
7512 * lib/Makefile.am (dist-hook): don't fail completely if unable to
7515 * intl/*: updated to gettext 0.10.35, tried to add our own
7516 required modifications. Please verify.
7518 * po/*: updated to gettext 0.10.35, tried to add our own required
7519 modifications. Please verify.
7521 * src/support/lstrings.C (tostr): go at fixing the problem with
7522 cxx and stringstream. When stringstream is used return
7523 oss.str().c_str() so that problems with lyxstring and basic_string
7524 are avoided. Note that the best solution would be for cxx to use
7525 basic_string all the way, but it is not conformant yet. (it seems)
7527 * src/lyx_cb.C + other files: moved several global functions to
7528 class BufferView, some have been moved to BufferView.[Ch] others
7529 are still located in lyx_cb.C. Code changes because of this. (part
7530 of "get rid of current_view project".)
7532 * src/buffer.C + other files: moved several Buffer functions to
7533 class BufferView, the functions are still present in buffer.C.
7534 Code changes because of this.
7536 * config/lcmessage.m4: updated to most recent. used when creating
7539 * config/progtest.m4: updated to most recent. used when creating
7542 * config/gettext.m4: updated to most recent. applied patch for
7545 * config/gettext.m4.patch: new file that shows what changes we
7546 have done to the local copy of gettext.m4.
7548 * config/libtool.m4: new file, used in creation of acinclude.m4
7550 * config/lyxinclude.m4: new file, this is the lyx created m4
7551 macros, used in making acinclude.m4.
7553 * autogen.sh: GNU m4 discovered as a separate task not as part of
7554 the lib/configure creation.
7555 Generate acinlucde from files in config. Actually cat
7556 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
7557 easier to upgrade .m4 files that really are external.
7559 * src/Spacing.h: moved using std::istringstream to right after
7560 <sstream>. This should fix the problem seen with some compilers.
7562 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7564 * src/lyx_cb.C: began some work to remove the dependency a lot of
7565 functions have on BufferView::text, even if not really needed.
7566 (GetCurrentTextClass): removed this func, it only hid the
7569 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
7570 forgot this in last commit.
7572 * src/Bullet.C (bulletEntry): use static char const *[] for the
7573 tables, becuase of this the return arg had to change to string.
7575 (~Bullet): removed unneeded destructor
7577 * src/BufferView.C (beforeChange): moved from lyx_cb.C
7578 (insetSleep): moved from Buffer
7579 (insetWakeup): moved from Buffer
7580 (insetUnlock): moved from Buffer
7582 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
7583 from Buffer to BufferView.
7585 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
7587 * config/ltmain.sh: updated to version 1.3.4 of libtool
7589 * config/ltconfig: updated to version 1.3.4 of libtool
7591 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7594 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
7595 Did I get that right?
7597 * src/lyxlex.h: add a "using" directive or two.
7598 * src/Spacing.h: ditto.
7599 * src/insets/figinset.C: ditto.
7600 * src/support/filetools.C: ditto.
7601 * src/support/lstrings.C: ditto.
7602 * src/BufferView.C: ditto.
7603 * src/bufferlist.C: ditto.
7604 * src/lyx_cb.C: ditto.
7605 * src/lyxlex.C: ditto.
7607 * NEWS: add some changes for 1.1.4.
7609 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7611 * src/BufferView.C: first go at a TextCache to speed up switching
7614 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7616 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
7617 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
7618 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
7619 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
7622 * src/mathed/math_defs.h (MathedRowSt): make sure that all
7623 members of the struct are correctly initialized to 0 (detected by
7625 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
7626 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
7628 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
7629 pidwait, since it was allocated with "new". This was potentially
7630 very bad. Thanks to Michael Schmitt for running purify for us.
7633 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7635 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
7637 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
7639 1999-12-30 Allan Rae <rae@lyx.org>
7641 * lib/templates/IEEEtran.lyx: minor change
7643 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
7644 src/mathed/formula.C (LocalDispatch): askForText changes
7646 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
7647 know when a user has cancelled input. Fixes annoying problems with
7648 inserting labels and version control.
7650 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7652 * src/support/lstrings.C (tostr): rewritten to use strstream and
7655 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7657 * src/support/filetools.C (IsFileWriteable): use fstream to check
7658 (IsDirWriteable): use fileinfo to check
7660 * src/support/filetools.h (FilePtr): whole class deleted
7662 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
7664 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
7666 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
7668 * src/bufferlist.C (write): use ifstream and ofstream instead of
7671 * src/Spacing.h: use istrstream instead of sscanf
7673 * src/mathed/math_defs.h: change first arg to istream from FILE*
7675 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
7677 * src/mathed/math_parser.C: have yyis to be an istream
7678 (LexGetArg): use istream (yyis)
7680 (mathed_parse): ditto
7681 (mathed_parser_file): first arg istream instead of FILE*, set yyis
7683 * src/mathed/formula.C (Read): rewritten to use istream
7685 * src/mathed/formulamacro.C (Read): rewritten to use istream
7687 * src/lyxlex.h (~LyXLex): deleted desturctor
7688 (getStream): new function, returns an istream
7689 (getFile): deleted funtion
7690 (IsOK): return is.good();
7692 * src/lyxlex.C (LyXLex): delete file and owns_file
7693 (setFile): open an filebuf and assign that to a istream instead of
7695 (setStream): new function, takes an istream as arg.
7696 (setFile): deleted function
7697 (EatLine): rewritten us use istream instead of FILE*
7701 * src/table.C (LyXTable): use istream instead of FILE*
7702 (Read): rewritten to take an istream instead of FILE*
7704 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7706 * src/buffer.C (Dispatch): remove an extraneous break statement.
7708 * src/support/filetools.C (QuoteName): change to do simple
7709 'quoting'. More work is necessary. Also changed to do nothing
7710 under emx (needs fix too).
7711 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
7713 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
7714 config.h.in to the AC_DEFINE_UNQUOTED() call.
7715 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
7716 needs char * as argument (because Solaris 7 declares it like
7719 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
7720 remove definition of BZERO.
7722 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7724 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
7725 defined, "lyxregex.h" if not.
7727 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
7729 (REGEX): new variable that is set to regex.c lyxregex.h when
7730 AM_CONDITIONAL USE_REGEX is set.
7731 (libsupport_la_SOURCES): add $(REGEX)
7733 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
7736 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
7739 * configure.in: add call to LYX_REGEX
7741 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
7742 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
7744 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7746 * lib/bind/fi_menus.bind: new file, from
7747 pauli.virtanen@saunalahti.fi.
7749 * src/buffer.C (getBibkeyList): pass the parameter delim to
7750 InsetInclude::getKeys and InsetBibtex::getKeys.
7752 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
7753 is passed to Buffer::getBibkeyList
7755 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
7756 instead of the hardcoded comma.
7758 * src/insets/insetbib.C (getKeys): make sure that there are not
7759 leading blanks in bibtex keys. Normal latex does not care, but
7760 harvard.sty seems to dislike blanks at the beginning of citation
7761 keys. In particular, the retturn value of the function is
7763 * INSTALL: make it clear that libstdc++ is needed and that gcc
7764 2.7.x probably does not work.
7766 * src/support/filetools.C (findtexfile): make debug message go to
7768 * src/insets/insetbib.C (getKeys): ditto
7770 * src/debug.C (showTags): make sure that the output is correctly
7773 * configure.in: add a comment for TWO_COLOR_ICON define.
7775 * acconfig.h: remove all the entries that already defined in
7776 configure.in or acinclude.m4.
7778 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
7779 to avoid user name, date and copyright.
7781 1999-12-21 Juergen Vigna <jug@sad.it>
7783 * src/table.C (Read): Now read bogus row format informations
7784 if the format is < 5 so that afterwards the table can
7785 be read by lyx but without any format-info. Fixed the
7786 crash we experienced when not doing this.
7788 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7790 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
7791 (RedoDrawingOfParagraph): ditto
7792 (RedoParagraphs): ditto
7793 (RemoveTableRow): ditto
7795 * src/text.C (Fill): rename arg paperwidth -> paper_width
7797 * src/buffer.C (insertLyXFile): rename var filename -> fname
7798 (writeFile): rename arg filename -> fname
7799 (writeFileAscii): ditto
7800 (makeLaTeXFile): ditto
7801 (makeLinuxDocFile): ditto
7802 (makeDocBookFile): ditto
7804 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
7807 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
7809 * src/bmtable.h: add extern "C" on this file when __cplusplus is
7812 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
7813 compiled by a C compiler not C++.
7815 * src/layout.h (LyXTextClass): added typedef for const_iterator
7816 (LyXTextClassList): added typedef for const_iterator + member
7817 functions begin and end.
7819 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
7820 iterators to fill the choice_class.
7821 (updateLayoutChoice): rewritten to use iterators to fill the
7822 layoutlist in the toolbar.
7824 * src/BufferView.h (BufferView::work_area_width): removed unused
7827 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
7829 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
7830 (sgmlCloseTag): ditto
7832 * src/support/lstrings.h: return type of countChar changed to
7835 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
7836 what version of this func to use. Also made to return unsigned int.
7838 * configure.in: call LYX_STD_COUNT
7840 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
7841 conforming std::count.
7843 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7845 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
7846 and a subscript would give bad display (patch from Dekel Tsur
7847 <dekel@math.tau.ac.il>).
7849 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
7851 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
7854 * src/chset.h: add a few 'using' directives
7856 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
7857 triggered when no buffer is active
7859 * src/layout.C: removed `break' after `return' in switch(), since
7862 * src/lyx_main.C (init): make sure LyX can be ran in place even
7863 when libtool has done its magic with shared libraries. Fix the
7864 test for the case when the system directory has not been found.
7866 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
7867 name for the latex file.
7868 (MenuMakeHTML): ditto
7870 * src/buffer.h: add an optional boolean argument, which is passed
7873 1999-12-20 Allan Rae <rae@lyx.org>
7875 * lib/templates/IEEEtran.lyx: small correction and update.
7877 * configure.in: Attempted to use LYX_PATH_HEADER
7879 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
7881 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
7882 input from JMarc. Now use preprocessor to find the header.
7883 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
7884 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
7885 LYX_STL_STRING_FWD. See comments in file.
7887 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
7889 * The global MiniBuffer * minibuffer variable is dead.
7891 * The global FD_form_main * fd_form_main variable is dead.
7893 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7895 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
7897 * src/table.h: add the LOstream.h header
7898 * src/debug.h: ditto
7900 * src/LyXAction.h: change the explaination of the ReadOnly
7901 attribute: is indicates that the function _can_ be used.
7903 * src/LyXAction.C (init): find-replace _can_ be used in read-only
7906 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7908 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
7914 * src/paragraph.C (GetWord): assert on pos>=0
7917 * src/support/lyxstring.C: condition the use of an invariant on
7919 * src/support/lyxstring.h: ditto
7921 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
7922 Use LAssert.h instead of plain assert().
7924 * src/support/lstrings.h: add LAssert.h, in case it is needed.
7926 * src/lyxfunc.C: do not include LAssert.h, it is not used.
7927 * src/support/filetools.C: ditto
7929 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
7932 * INSTALL: document the new configure flags
7934 * configure.in: suppress --with-debug; add --enable-assertions
7936 * acinclude.m4: various changes in alignment of help strings.
7938 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7940 * src/kbmap.C: commented out the use of the hash map in kb_map,
7941 beginning of movement to a stl::container.
7943 * several files: removed code that was not in effect when
7944 MOVE_TEXT was defined.
7946 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
7947 for escaping should not be used. We can discuss if the string
7948 should be enclosed in f.ex. [] instead of "".
7950 * src/trans_mgr.C (insert): use the new returned value from
7951 encodeString to get deadkeys and keymaps done correctly.
7953 * src/chset.C (encodeString): changed to return a pair, to tell
7954 what to use if we know the string.
7956 * src/lyxscreen.h (fillArc): new function.
7958 * src/FontInfo.C (resize): rewritten to use more std::string like
7959 structore, especially string::replace.
7961 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
7964 * configure.in (chmod +x some scripts): remove config/gcc-hack
7966 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7968 * src/buffer.C (writeFile): change once again the top comment in a
7969 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
7970 instead of an hardcoded version number.
7971 (makeDocBookFile): ditto
7973 * src/version.h: add new define LYX_DOCVERSION
7975 * po/de.po: update from Pit Sütterlin
7976 * lib/bind/de_menus.bind: ditto.
7978 * src/lyxfunc.C (Dispatch): call MenuExport()
7979 * src/buffer.C (Dispatch): ditto
7981 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
7982 LyXFunc::Dispatch().
7983 (MenuExport): new function, moved from
7984 LyXFunc::Dispatch().
7986 * src/trans_mgr.C (insert): small cleanup
7987 * src/chset.C (loadFile): ditto
7989 * lib/kbd/iso8859-1.cdef: add missing backslashes
7991 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7993 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
7994 help with placing the manually drawn accents better.
7996 (Draw): x2 and hg changed to float to minimize rounding errors and
7997 help place the accents better.
7999 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
8000 unsigned short to char is just wrong...cast the char to unsigned
8001 char instead so that the two values can compare sanely. This
8002 should also make the display of insetlatexaccents better and
8003 perhaps also some other insets.
8005 (lbearing): new function
8008 1999-12-15 Allan Rae <rae@lyx.org>
8010 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
8011 header that provides a wrapper around the very annoying SGI STL header
8014 * src/support/lyxstring.C, src/LString.h:
8015 removed old SGI-STL-compatability attempts.
8017 * configure.in: Use LYX_STL_STRING_FWD.
8019 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
8020 stl_string_fwd.h is around and try to determine it's location.
8021 Major improvement over previous SGI STL 3.2 compatability.
8022 Three small problems remain with this function due to my zero
8023 knowledge of autoconf. JMarc and lgb see the comments in the code.
8025 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8027 * src/broken_const.h, config/hack-gcc, config/README: removed
8029 * configure.in: remove --with-gcc-hack option; do not call
8032 * INSTALL: remove documentation of --with-broken-const and
8035 * acconfig.h: remove all trace of BROKEN_CONST define
8037 * src/buffer.C (makeDocBookFile): update version number in output
8039 (SimpleDocBookOnePar): fix an assert when trying to a character
8040 access beyond string length
8043 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8045 * po/de.po: fix the Export menu
8047 * lyx.man: update the description of -dbg
8049 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
8050 (commandLineHelp): updated
8051 (easyParse): show list of available debug levels if -dbg is passed
8054 * src/Makefile.am: add debug.C
8056 * src/debug.h: moved some code to debug.C
8058 * src/debug.C: new file. Contains code to set and show debug
8061 * src/layout.C: remove 'break' after 'continue' in switch
8062 statements, since these cannot be reached.
8064 1999-12-13 Allan Rae <rae@lyx.org>
8066 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
8067 (in_word_set): hash() -> math_hash()
8069 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
8071 * acconfig.h: Added a test for whether we are using exceptions in the
8072 current compilation run. If so USING_EXCEPTIONS is defined.
8074 * config.in: Check for existance of stl_string_fwd.h
8075 * src/LString.h: If compiling --with-included-string and SGI's
8076 STL version 3.2 is present (see above test) we need to block their
8077 forward declaration of string and supply a __get_c_string().
8078 However, it turns out this is only necessary if compiling with
8079 exceptions enabled so I've a bit more to add yet.
8081 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
8082 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
8083 src/support/LRegex.h, src/undo.h:
8084 Shuffle the order of the included files a little to ensure that
8085 LString.h gets included before anything that includes stl_string_fwd.h
8087 * src/support/lyxstring.C: We need to #include LString.h instead of
8088 lyxstring.h to get the necessary definition of __get_c_string.
8089 (__get_c_string): New function. This is defined static just like SGI's
8090 although why they need to do this I'm not sure. Perhaps it should be
8091 in lstrings.C instead.
8093 * lib/templates/IEEEtran.lyx: New template file.
8095 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8097 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
8098 * intl/Makefile.in (MKINSTALLDIRS): ditto
8100 * src/LyXAction.C (init): changed to hold the LFUN data in a
8101 automatic array in stead of in callso to newFunc, this speeds up
8102 compilation a lot. Also all the memory used by the array is
8103 returned when the init is completed.
8105 * a lot of files: compiled with -Wold-style-cast, changed most of
8106 the reported offenders to C++ style casts. Did not change the
8107 offenders in C files.
8109 * src/trans.h (Match): change argument type to unsigned int.
8111 * src/support/DebugStream.C: fix some types on the streambufs so
8112 that it works on a conforming implementation.
8114 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8116 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
8118 * src/support/lyxstring.C: remove the inline added earlier since
8119 they cause a bunch of unsatisfied symbols when linking with dec
8120 cxx. Cxx likes to have the body of inlines at the place where they
8123 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
8124 accessing negative bounds in array. This fixes the crash when
8125 inserting accented characters.
8126 * src/trans.h (Match): ditto
8128 * src/buffer.C (Dispatch): since this is a void, it should not try
8129 to return anything...
8131 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8133 * src/buffer.h: removed the two friends from Buffer. Some changes
8134 because of this. Buffer::getFileName and Buffer::setFileName
8135 renamed to Buffer::fileName() and Buffer::fileName(...).
8137 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8139 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
8140 and Buffer::update(short) to BufferView. This move is currently
8141 controlled by a define MOVE_TEXT, this will be removed when all
8142 shows to be ok. This move paves the way for better separation
8143 between buffer contents and buffer view. One side effect is that
8144 the BufferView needs a rebreak when swiching buffers, if we want
8145 to avoid this we can add a cache that holds pointers to LyXText's
8146 that is not currently in use.
8148 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
8151 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8153 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
8155 * lyx_main.C: new command line option -x (or --execute) and
8156 -e (or --export). Now direct conversion from .lyx to .tex
8157 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
8158 Unfortunately, X is still needed and the GUI pops up during the
8161 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8163 * src/Spacing.C: add a using directive to bring stream stuff into
8165 * src/paragraph.C: ditto
8166 * src/buffer.C: ditto
8168 * NEWS: updated a bit the new features of 1.1.3 (took a few things
8169 from Lars' announcement).
8171 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
8172 example files from Tino Meinen.
8174 1999-12-06 Allan Rae <rae@lyx.org>
8176 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
8178 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8180 * src/support/lyxstring.C: added a lot of inline for no good
8183 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
8184 latexWriteEndChanges, they were not used.
8186 * src/layout.h (operator<<): output operator for PageSides
8188 * src/mathed/math_iter.C (my_memcpy): slightly changed.
8190 * some example files: loaded in LyX 1.0.4 and saved again to update
8191 certain constructs (table format)
8193 * a lot of files: did the change to use fstream/iostream for all
8194 writing of files. Done with a close look at Andre Poenitz's patch.
8196 * some files: whitespace changes.
8198 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8200 * src/mathed/math_iter.C (my_memcpy): new function. Since the
8201 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
8202 architecture, we provide our own. It is used unconditionnally, but
8203 I do not think this is a performance problem. Thanks to Angus
8204 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
8205 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
8207 (GetInset): use my_memcpy.
8211 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
8212 it is easier to understand, but it uses less TeX-only constructs now.
8214 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
8215 elements contain spaces
8217 * lib/configure: regenerated
8219 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
8220 elements contain spaces; display the list of programs that are
8223 * autogen.sh: make sure lib/configure is executable
8225 * lib/examples/*: rename the tutorial examples to begin with the
8226 two-letters language code.
8228 * src/lyxfunc.C (getStatus): do not query current font if no
8231 * src/lyx_cb.C (RunScript): use QuoteName
8232 (MenuRunDvips): ditto
8233 (PrintApplyCB): ditto
8235 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
8236 around argument, so that it works well with the current shell.
8237 Does not work properly with OS/2 shells currently.
8239 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
8240 * src/LyXSendto.C (SendtoApplyCB): ditto
8241 * src/lyxfunc.C (Dispatch): ditto
8242 * src/buffer.C (runLaTeX): ditto
8243 (runLiterate): ditto
8244 (buildProgram): ditto
8246 * src/lyx_cb.C (RunScript): ditto
8247 (MenuMakeLaTeX): ditto
8249 * src/buffer.h (getLatexName): new method
8251 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
8253 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8255 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
8256 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
8257 (create_math_panel): ditto
8259 * src/lyxfunc.C (getStatus): re-activate the code which gets
8260 current font and cursor; add test for export to html.
8262 * src/lyxrc.C (read): remove unreachable break statements; add a
8265 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
8267 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8269 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
8270 introduced by faulty regex.
8271 * src/buffer.C: ditto
8272 * src/lastfiles.C: ditto
8273 * src/paragraph.C: ditto
8274 * src/table.C: ditto
8275 * src/vspace.C: ditto
8276 * src/insets/figinset.C: ditto
8277 Note: most of these is absolutely harmless, except the one in
8278 src/mathed formula.C.
8280 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8282 * src/ImportNoweb.C (documentclass): fixed bounds for substr
8283 operation, yielding correct results for the reLyX command.
8285 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8287 * src/support/filetools.C (ExpandPath): removed an over eager
8289 (ReplaceEnvironmentPath): ditto
8291 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
8292 shows that we are doing something fishy in our code...
8296 * src/lyxrc.C (read): use a double switch trick to get more help
8297 from the compiler. (the same trick is used in layout.C)
8298 (write): new function. opens a ofstream and pass that to output
8299 (output): new function, takes a ostream and writes the lyxrc
8300 elemts to it. uses a dummy switch to make sure no elements are
8303 * src/lyxlex.h: added a struct pushpophelper for use in functions
8304 with more than one exit point.
8306 * src/lyxlex.[Ch] (GetInteger): made it const
8310 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
8312 * src/layout.[hC] : LayoutTags splitted into several enums, new
8313 methods created, better error handling cleaner use of lyxlex. Read
8316 * src/bmtable.[Ch]: change some member prototypes because of the
8317 image const changes.
8319 * commandtags.h, src/LyXAction.C (init): new function:
8320 "preferences-save", saves the lyxrc entries into .lyx/preferences.
8321 This file is not read automatically but you can add \input
8322 preferences to your lyxrc if you want to. We need to discuss how
8325 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
8326 in .aux, also remove .bib and .bst files from dependencies when
8329 * src/BufferView.C, src/LyXView.C: add const_cast several places
8330 because of changes to images.
8332 * lib/images/*: same change as for images/*
8334 * lib/lyxrc.example: Default for accept_compound is false not no.
8336 * images/*: changed to be const, however I have som misgivings
8337 about this change so it might be changed back.
8339 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8341 * lib/configure, po/POTFILES.in: regenerated
8343 * autogen.sh: autogenerate lib/configure from lib/configure.m4
8345 * config/lib_configure.m4: removed
8347 * lib/configure.m4: new file (was config/lib_configure.m4)
8349 * configure.in: do not test for rtti, since we do not use it.
8351 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8353 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
8354 doubling of allocated space scheme. This makes it faster for large
8355 strings end to use less memory for small strings. xtra rememoved.
8357 * src/insets/figinset.C (waitalarm): commented out.
8358 (GhostscriptMsg): use static_cast
8359 (GhostscriptMsg): use new instead of malloc to allocate memory for
8360 cmap. also delete the memory after use.
8362 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
8364 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
8365 for changes in bibtex database or style.
8366 (runBibTeX): remove all .bib and .bst files from dep before we
8368 (run): use scanAuc in when dep file already exist.
8370 * src/DepTable.C (remove_files_with_extension): new method
8373 * src/DepTable.[Ch]: made many of the methods const.
8375 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8377 * src/bufferparams.C: make sure that the default textclass is
8378 "article". It used to be the first one by description order, but
8379 now the first one is "docbook".
8381 * src/lyx_main.C (setDebuggingLevel): change type of argument to
8382 string; call Debug::value.
8383 (easyParse): pass complete argument to setDebuggingLevel().
8385 * src/debug.h (value): fix the code that parses debug levels.
8387 * src/debug.h: add new debug type ACTION, reserved for LyXAction
8390 * src/LyXAction.C: use Debug::ACTION as debug channel.
8392 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
8394 * NEWS: updated for the future 1.1.3 release.
8396 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
8397 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
8398 it should. This is of course a controversial change (since many
8399 people will find that their lyx workscreen is suddenly full of
8400 red), but done for the sake of correctness.
8402 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
8403 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
8405 * src/insets/inseterror.h, src/insets/inseturl.h,
8406 src/insets/insetinfo.h, src/insets/figinset.h,
8407 src/mathed/formulamacro.h, src/mathed/math_macro.h
8408 (EditMessage): add a missing const and add _() to make sure that
8411 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
8412 src/insets/insetbib.C, src/support/filetools.C: add `using'
8415 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
8416 doing 'Insert index of last word' at the beginning of a paragraph.
8418 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8420 * several files: white-space changes.
8422 * src/mathed/formula.C: removed IsAlpha and IsDigit
8424 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
8425 .bib file. use a ifstream instead of FilePtr when parsing the .bib
8428 * src/insets/figinset.C (GetPSSizes): don't break when
8429 "EndComments" is seen. But break when a boundingbox is read.
8431 * all classes inherited from Inset: return value of Clone
8432 changed back to Inset *.
8434 * all classes inherited form MathInset: return value of Clone
8435 changed back to MathedInset *.
8437 * src/insets/figinset.C (runqueue): use a ofstream to output the
8438 gs/ps file. Might need some setpresicion or setw. However I can
8439 see no problem with the current code.
8440 (runqueue): use sleep instead of the alarm/signal code. I just
8441 can't see the difference.
8443 * src/paragraph.C (LyXParagraph): reserve space in the new
8444 paragraph and resize the inserted paragraph to just fit.
8446 * src/lyxfunc.h (operator|=): added operator for func_status.
8448 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
8449 check for readable file.
8451 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
8452 check for readable file.
8453 (MenuMakeLinuxDoc): ditto
8454 (MenuMakeDocBook): ditto
8455 (MenuMakeAscii): ditto
8456 (InsertAsciiFile): split the test for openable and readable
8458 * src/bmtable.C (draw_bitmaptable): use
8459 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
8461 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
8462 findtexfile from LaTeX to filetools.
8464 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
8465 instead of FilePtr. Needs to be verified by a literate user.
8467 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8469 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
8470 (EditMessage): likewise.
8472 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
8473 respectively as \textasciitilde and \textasciicircum.
8475 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8477 * src/support/lyxstring.h: made the methods that take iterators
8480 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
8481 (regexMatch): made is use the real regex class.
8483 * src/support/Makefile.am: changed to use libtool
8485 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
8487 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
8489 (MathIsInset ++): changed several macros to be inline functions
8492 * src/mathed/Makefile.am: changed to use libtool
8494 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
8496 * src/insets/inset* : Clone changed to const and return type is
8497 the true insettype not just Inset*.
8499 * src/insets/Makefile.am: changed to use libtool
8501 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
8503 * src/undo.[Ch] : added empty() and changed some of the method
8506 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
8508 * src/lyxparagraph.h: use id() and id(...) instead of getID and
8509 setID use block<> for the bullets array, added const several places.
8511 * src/lyxfunc.C (getStatus): new function
8513 * src/lyxfunc.[Ch] : small changes to take advantage of the new
8514 LyXAction, added const to several funtions.
8516 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
8517 a std::map, and to store the dir items in a vector.
8519 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
8522 * src/LyXView.[Ch] + other files : changed currentView to view.
8524 * src/LyXAction.[Ch] : ported from the old devel branch.
8526 * src/.cvsignore: added .libs and a.out
8528 * configure.in : changes to use libtool.
8530 * acinclude.m4 : inserted libtool.m4
8532 * .cvsignore: added libtool
8534 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8536 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
8537 file name in insets and mathed directories (otherwise the
8538 dependency is not taken in account under cygwin).
8540 * src/text2.C (InsertString[AB]): make sure that we do not try to
8541 read characters past the string length.
8543 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8545 * lib/doc/LaTeXConfig.lyx.in,
8546 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
8548 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
8549 file saying who created them and when this heppened; this is
8550 useless and annoys tools like cvs.
8552 * lib/layouts/g-brief-{en,de}.layout,
8553 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
8554 from Thomas Hartkens <thomas@hartkens.de>.
8556 * src/{insets,mathed}/Makefile.am: do not declare an empty
8557 LDFLAGS, so that it can be set at configure time (useful on Irix
8560 * lib/reLyX/configure.in: make sure that the prefix is set
8561 correctly in LYX_DIR.
8563 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8565 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
8566 be used by 'command-sequence' this allows to bind a key to a
8567 sequence of LyX-commands
8568 (Example: 'command-sequence math-insert alpha; math-insert beta;")
8570 * src/LyXAction.C: add "command-sequence"
8572 * src/LyXFunction.C: handling of "command-sequence"
8574 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
8575 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
8577 * src/lyxserver.C, src/minibuffer.C: Use this new interface
8579 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8581 * src/buffer.C (writeFile): Do not output a comment giving user
8582 and date at the beginning of a .lyx file. This is useless and
8583 annoys cvs anyway; update version number to 1.1.
8585 * src/Makefile.am (LYX_DIR): add this definition, so that a
8586 default path is hardcoded in LyX.
8588 * configure.in: Use LYX_GNU_GETTEXT.
8590 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
8591 AM_GNU_GETTEXT with a bug fixed.
8593 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
8595 * src/chset.C: add "using std::ifstream;" to please dec cxx.
8597 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
8598 which is used to point to LyX data is now LYX_DIR_11x.
8600 * lyx.man: convert to a unix text file; small updates.
8602 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8604 * src/support/LSubstring.[Ch]: made the second arg of most of the
8605 constructors be a const reference.
8607 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
8610 * src/support/lyxstring.[Ch] (swap): added missing member function
8611 and specialization of swap(str, str);
8613 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
8615 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
8616 trace of the old one.
8618 * src/undo.[Ch]: made the undostack use std::list to store undo's in
8619 put the member definitions in undo.C.
8621 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
8622 NEW_TEXT and have now only code that was included when this was
8625 * src/intl.C (LCombo): use static_cast
8627 (DispatchCallback): ditto
8629 * src/definitions.h: removed whole file
8631 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
8633 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
8634 parsing and stores in a std:map. a regex defines the file format.
8635 removed unneeded members.
8637 * src/bufferparams.h: added several enums from definitions.h here.
8638 Removed unsused destructor. Changed some types to use proper enum
8639 types. use block to have the temp_bullets and user_defined_bullets
8640 and to make the whole class assignable.
8642 * src/bufferparams.C (Copy): removed this functions, use a default
8645 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
8648 * src/buffer.C (readLyXformat2): commend out all that have with
8649 oldpapersize to do. also comment out all that hve to do with
8650 insetlatex and insetlatexdel.
8651 (setOldPaperStuff): commented out
8653 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
8655 * src/LyXAction.C: remove use of inset-latex-insert
8657 * src/mathed/math_panel.C (button_cb): use static_cast
8659 * src/insets/Makefile.am (insets_o_SOURCES): removed
8662 * src/support/lyxstring.C (helper): use the unsigned long
8663 specifier, UL, instead of a static_cast.
8665 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
8667 * src/support/block.h: new file. to be used as a c-style array in
8668 classes, so that the class can be assignable.
8670 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8672 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
8673 NULL, make sure to return an empty string (it is not possible to
8674 set a string to NULL).
8676 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8678 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
8680 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
8682 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
8683 link line, so that Irix users (for example) can set it explicitely to
8686 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
8687 it can be overidden at make time (static or dynamic link, for
8690 * src/vc-backend.C, src/LaTeXFeatures.h,
8691 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
8692 statements to bring templates to global namespace.
8694 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8696 * src/support/lyxstring.C (operator[] const): make it standard
8699 * src/minibuffer.C (Init): changed to reflect that more
8700 information is given from the lyxvc and need not be provided here.
8702 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
8704 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
8706 * src/LyXView.C (UpdateTimerCB): use static_cast
8707 (KeyPressMask_raw_callback): ditto
8709 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
8710 buffer_, a lot of changes because of this. currentBuffer() ->
8711 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
8712 also changes to other files because of this.
8714 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8716 * src/vc-backend.[Ch]: new files. The backends for vc handling,
8717 have no support for RCS and partial support for CVS, will be
8720 * src/insets/ several files: changes because of function name
8721 changes in Bufferview and LyXView.
8723 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
8725 * src/support/LSubstring.[Ch]: new files. These implement a
8726 Substring that can be very convenient to use. i.e. is this
8728 string a = "Mary had a little sheep";
8729 Substring(a, "sheep") = "lamb";
8730 a is now "Mary has a little lamb".
8732 * src/support/LRegex.[Ch]: a regex class that can be used to pick
8733 out patterns and subpatterns of strings. It is used by LSubstring
8734 and also by vc-backend.C
8736 * src/support/lyxstring.C: went over all the assertions used and
8737 tried to correct the wrong ones and flag which of them is required
8738 by the standard. some bugs found because of this. Also removed a
8739 couple of assertions.
8741 * src/support/Makefile.am (libsupport_a_SOURCES): added
8742 LSubstring.[Ch] and LRegex.[Ch]
8744 * src/support/FileInfo.h: have struct stat buf as an object and
8745 not a pointer to one, some changes because of this.
8747 * src/LaTeXFeatures.C (getTClassPreamble): also use the
8748 information in layout when adding the layouts preamble to the
8751 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
8754 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
8755 because of bug in OS/2.
8757 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8759 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
8760 \verbatim@font instead of \ttfamily, so that it can be redefined.
8762 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
8763 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
8764 src/layout.h, src/text2.C: add 'using' directive to bring the
8765 STL templates we need from the std:: namespace to the global one.
8766 Needed by DEC cxx in strict ansi mode.
8768 * src/support/LIstream.h,src/support/LOstream.h,
8769 src/support/lyxstring.h,src/table.h,
8770 src/lyxlookup.h: do not include <config.h> in header
8771 files. This should be done in the .C files only.
8773 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
8777 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8779 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
8780 from Kayvan to fix the tth invokation.
8782 * development/lyx.spec.in: updates from Kayvan to reflect the
8783 changes of file names.
8785 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8787 * src/text2.C (InsertStringB): use std::copy
8788 (InsertStringA): use std::copy
8790 * src/bufferlist.C: use a vector to store the buffers in. This is
8791 an internal change and should not affect any other thing.
8793 * src/BufferView.C (waitForX): use XSync instead of the lengthy
8796 * src/text.C (Fill): fix potential bug, one off bug.
8798 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8800 * src/Makefile.am (lyx_main.o): add more files it depends on.
8802 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
8804 * src/support/lyxstring.C: use size_t for the reference count,
8805 size, reserved memory and xtra.
8806 (internal_compare): new private member function. Now the compare
8807 functions should work for std::strings that have embedded '\0'
8809 (compare): all compare functions rewritten to use
8812 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8814 * src/support/lyxstring.C (compare): pass c_str()
8815 (compare): pass c_str
8816 (compare): pass c_str
8818 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8820 * src/support/DebugStream.C: <config.h> was not included correctly.
8822 * lib/configure: forgot to re-generate it :( I'll make this file
8823 auto generated soon.
8825 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8827 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
8830 * src/support/lyxstring.C: some changes from length() to rep->sz.
8831 avoids a function call.
8833 * src/support/filetools.C (SpaceLess): yet another version of the
8834 algorithm...now per Jean-Marc's suggestions.
8836 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8838 * src/layout.C (less_textclass_desc): functor for use in sorting
8840 (LyXTextClass::Read): sort the textclasses after reading.
8842 * src/support/filetools.C (SpaceLess): new version of the
8843 SpaceLess functions. What problems does this one give? Please
8846 * images/banner_bw.xbm: made the arrays unsigned char *
8848 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8850 * src/support/lyxstring.C (find): remove bogus assertion in the
8851 two versions of find where this has not been done yet.
8853 * src/support/lyxlib.h: add missing int return type to
8856 * src/menus.C (ShowFileMenu): disable exporting to html if no
8857 html export command is present.
8859 * config/lib_configure.m4: add a test for an HTML converter. The
8860 programs checked for are, in this order: tth, latex2html and
8863 * lib/configure: generated from config/lib_configure.m4.
8865 * src/lyxfunc.C (Dispatch): update and improve the execution of an
8866 html converter. The parameters are now passed through $$FName and
8867 $$OutName, instead of standard input/output.
8869 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
8871 * lib/lyxrc.example: update description of \html_command.
8872 add "quotes" around \screen_font_xxx font setting examples to help
8873 people who use fonts with spaces in their names.
8875 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8877 * Distribution files: updates for v1.1.2
8879 * src/support/lyxstring.C (find): remove bogus assert and return
8880 npos for the same condition.
8882 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8884 * added patch for OS/2 from SMiyata.
8886 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8888 * src/text2.C (CutSelection): make space_wrapped a bool
8889 (CutSelection): dont declare int i until we have to.
8890 (alphaCounter): return a char const *.
8892 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8894 * src/support/syscall.C (Systemcalls::kill):
8895 src/support/filetools.C (PutEnv, PutEnvPath):
8896 src/lyx_cb.C (addNewlineAndDepth):
8897 src/FontInfo.C (FontInfo::resize): condition some #warning
8898 directives with WITH_WARNINGS.
8901 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8903 * src/layout.[Ch] + several files: access to class variables
8904 limited and made accessor functions instead a lot of code changed
8905 becuase of this. Also instead of returning pointers often a const
8906 reference is returned instead.
8908 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
8910 * src/Makefile.am (dist-hook): added used to remove the CVS from
8911 cheaders upon creating a dist
8912 (EXTRA_DIST): added cheaders
8914 * src/support/lstrings.C (tostr(char)): fix it to handle param as
8915 a character not as a small integer.
8917 * src/support/lyxstring.C (find): removed Assert and added i >=
8918 rep->sz to the first if.
8920 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8922 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
8923 src/LyXView.C src/buffer.C src/bufferparams.C
8924 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
8925 src/text2.C src/insets/insetinclude.C:
8926 lyxlayout renamed to textclasslist.
8928 * src/layout.C: some lyxerr changes.
8930 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
8931 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
8932 (LyXLayoutList): removed all traces of this class.
8933 (LyXTextClass::Read): rewrote LT_STYLE
8934 (LyXTextClass::hasLayout): new function
8935 (LyXTextClass::GetLayout): rewritten to return an iterator + has
8936 both const and nonconst version.
8937 (LyXTextClass::delete_layout): new function.
8938 (LyXTextClassList::Style): bug fix. do the right thing if layout
8940 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
8941 (LyXTextClassList::NameOfLayout): ditto
8942 (LyXTextClassList::Load): ditto
8944 * src/buffer.C (makeLaTeXFile): new access to layoutlist
8946 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
8948 * src/LyXAction.C (LookupFunc): added a workaround for sun
8949 compiler, on the other hand...we don't know if the current code
8950 compiles on sun at all...
8952 * src/support/filetools.C (CleanupPath): subst fix
8954 * src/insets/insetbib.C (delDatabase): subst fix, this looks
8957 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
8958 complained about this one?
8960 * src/insets/insetinclude.C (Latex): subst fix
8962 * src/insets/insetbib.C (getKeys): subst fix
8964 * src/LyXSendto.C (SendtoApplyCB): subst fix
8966 * src/lyx_main.C (init): subst fix
8968 * src/layout.C (Read): subst fix
8970 * src/lyx_sendfax_main.C (button_send): subst fix
8972 * src/buffer.C (RoffAsciiTable): subst fix
8974 * src/lyx_cb.C (MenuFax): subst fix
8975 (PrintApplyCB): subst fix
8977 1999-10-26 Juergen Vigna <jug@sad.it>
8979 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
8981 (Read): Cleaned up this code so now we read only format vestion >= 5
8983 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8985 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
8986 come nobody has complained about this one?
8988 * src/insets/insetinclude.C (Latex): subst fix
8990 * src/insets/insetbib.C (getKeys): subst fix
8992 * src/lyx_main.C (init): subst fix
8994 * src/layout.C (Read): subst fix
8996 * src/buffer.C (RoffAsciiTable): subst fix
8998 * src/lyx_cb.C (MenuFax): subst fix.
9000 * src/layout.[hC] + some other files: rewrote to use
9001 std::container to store textclasses and layouts in.
9002 Simplified, removed a lot of code. Make all classes
9003 assignable. Further simplifications and review of type
9004 use still to be one.
9006 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
9007 lastfiles to create the lastfiles partr of the menu.
9009 * src/lastfiles.[Ch]: rewritten to use deque to store the
9010 lastfiles in. Uses fstream for reading and writing. Simplifies
9013 * src/support/syscall.C: remove explicit cast.
9015 * src/BufferView.C (CursorToggleCB): removed code snippets that
9017 use explicat C++ style casts instead of C style casts. also use
9018 u_vdata instea of passing pointers in longs.
9020 * src/PaperLayout.C: removed code snippets that were commented out.
9022 * src/lyx_gui_misc.C: removed code snippets that were commented out.
9024 * src/lyx_main.C: removed code snippets that wer commented out.
9026 * src/paragraph.C: removed code snippets that were commented out.
9028 * src/lyxvc.C (logClose): use static_cast
9030 (viewLog): remove explicit cast to void*
9031 (showLog): removed old commented code
9033 * src/menus.C: use static_cast instead of C style casts. use
9034 u_vdata instead of u_ldata. remove explicit cast to (long) for
9035 pointers. Removed old code that was commented out.
9037 * src/insets/inset.C: removed old commented func
9039 * src/insets/insetref.C (InsetRef): removed old code that had been
9040 commented out for a long time.
9042 (escape): removed C style cast
9044 * src/insets/insetlatexaccent.C (Draw): removed old commented code
9046 * src/insets/insetlatex.C (Draw): removed old commented code
9047 (Read): rewritten to use string
9049 * src/insets/insetlabel.C (escape): removed C style cast
9051 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
9053 * src/insets/insetindex.C: use static_cast and u_vdata, removed
9056 * src/insets/insetinclude.h: removed a couple of stupid bools
9058 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
9059 (Clone): remove C style cast
9060 (getKeys): changed list to lst because of std::list
9062 * src/insets/inseterror.C (Draw): removed som old commented code.
9064 * src/insets/insetcommand.C (Draw): removed some old commented code.
9066 * src/insets/insetbib.C (bibitem_cb): removed code that has been
9067 commented out forever.
9068 (bibitem_cb): use static_cast instead of C style cast
9069 use of vdata changed to u_vdata.
9071 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
9073 (CloseUrlCB): use static_cast instead of C style cast.
9074 (CloseUrlCB): added a fl_free form...it seemed to be missing.
9076 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
9077 (C_InsetInfo_CloseInfoCB): forward the ob parameter
9078 (CloseInfoCB): static_cast from ob->u_vdata instead.
9079 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
9082 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
9083 (C_InsetError_CloseErrorCB): forward the ob parameter
9084 (CloseErrorCB): static_cast from ob->u_vdata instead.
9086 * src/vspace.h: include LString.h since we use string in this class.
9088 * src/vspace.C (lyx_advance): changed name from advance because of
9089 nameclash with stl. And since we cannot use namespaces yet...I
9090 used a lyx_ prefix instead. Expect this to change when we begin
9093 * src/BufferView.[Ch] (BufferView::~BufferView): removed
9095 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
9096 and removed now defunct constructor and deconstructor.
9098 * src/BufferView.h: have backstack as a object not as a pointer.
9099 removed initialization from constructor. added include for BackStack
9101 * development/lyx.spec.in (%build): add CFLAGS also.
9103 * src/screen.C (drawFrame): removed another warning.
9105 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9107 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
9108 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
9109 README and ANNOUNCE a bit for the next release. More work is
9112 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
9113 unbreakable if we are in freespacing mode (LyX-Code), but not in
9116 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9118 * src/BackStack.h: fixed initialization order in constructor
9120 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
9122 * acinclude.m4 (VERSION): new rules for when a version is
9123 development, added also a variable for prerelease.
9124 (warnings): we set with_warnings=yes for prereleases
9125 (lyx_opt): prereleases compile with same optimization as development
9126 (CXXFLAGS): only use pedantic if we are a development version
9128 * src/BufferView.C (restorePosition): don't do anything if the
9131 * src/BackStack.h: added member empty, use this to test if there
9132 is anything to pop...
9134 1999-10-25 Juergen Vigna <jug@sad.it>
9137 * forms/layout_forms.fd +
9138 * forms/latexoptions.fd +
9139 * lyx.fd: changed for various form resize issues
9141 * src/mathed/math_panel.C +
9142 * src/insets/inseterror.C +
9143 * src/insets/insetinfo.C +
9144 * src/insets/inseturl.C +
9145 * src/insets/inseturl.h +
9148 * src/PaperLayout.C +
9149 * src/ParagraphExtra.C +
9150 * src/TableLayout.C +
9152 * src/layout_forms.C +
9159 * src/menus.C: fixed various resize issues. So now forms can be
9160 resized savely or not be resized at all.
9162 * forms/form_url.fd +
9163 * src/insets/form_url.[Ch]: added because it's cleaner and easier
9166 * src/insets/Makefile.am: added files form_url.[Ch]
9168 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9170 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
9171 (and presumably 6.2).
9173 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
9174 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
9175 remaining static member callbacks.
9177 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
9180 * src/support/lyxstring.h: declare struct Srep as friend of
9181 lyxstring, since DEC cxx complains otherwise.
9183 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9185 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9187 * src/LaTeX.C (run): made run_bibtex also depend on files with
9189 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
9190 are put into the dependency file.
9192 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
9193 the code has shown itself to work
9194 (create_ispell_pipe): removed another warning, added a comment
9197 * src/minibuffer.C (ExecutingCB): removed code that has been
9198 commented out a long time
9200 * src/lyxfunc.C (processKeyEvent): removed some very old commented
9201 out code + a warning.
9203 * src/support/lyxstring.h: comment out the three private
9204 operators, when compiling with string ansi conforming compilers
9207 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
9209 (pixmapFromBitmapData): change type of bdata to be unsigned char *
9210 (pixmapFromBitmapData): add a reinterpret_cast in the call to
9213 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
9216 * src/mathed/math_panel.C (create_math_panel): remove explicit
9219 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
9222 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
9223 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
9224 to XCreatePixmapFromBitmapData
9225 (fl_set_bmtable_data): change the last argument to be unsigned
9227 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
9228 and bh to be unsigned int, remove explicit casts in call to
9229 XReadBitmapFileData.
9231 * images/arrows.xbm: made the arrays unsigned char *
9232 * images/varsz.xbm: ditto
9233 * images/misc.xbm: ditto
9234 * images/greek.xbm: ditto
9235 * images/dots.xbm: ditto
9236 * images/brel.xbm: ditto
9237 * images/bop.xbm: ditto
9239 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
9241 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
9242 (LYX_PROG_CXX): added -pedantic to g++ compile options when
9243 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
9245 (LYX_CXX_CHEADERS): added <clocale> to the test.
9247 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
9249 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
9251 * src/support/lyxstring.C (append): fixed something that must be a
9252 bug, rep->assign was used instead of rep->append.
9254 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
9257 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
9258 lyx insert double chars. Fix spotted by Kayvan.
9260 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9262 * Fixed the tth support. I messed up with the Emacs patch apply feature
9263 and omitted the changes in lyxrc.C.
9265 1999-10-22 Juergen Vigna <jug@sad.it>
9267 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
9269 * src/lyx_cb.C (MenuInsertRef) +
9270 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
9271 the form cannot be resized under it limits (fixes a segfault)
9273 * src/lyx.C (create_form_form_ref) +
9274 * forms/lyx.fd: Changed Gravity on name input field so that it is
9277 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9279 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
9280 <ostream> and <istream>.
9282 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
9283 whether <fstream> provides the latest standard features, or if we
9284 have an oldstyle library (like in egcs).
9285 (LYX_CXX_STL_STRING): fix the test.
9287 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
9288 code on MODERN_STL_STREAM.
9290 * src/support/lyxstring.h: use L{I,O}stream.h.
9292 * src/support/L{I,O}stream.h: new files, designed to setup
9293 correctly streams for our use
9294 - includes the right header depending on STL capabilities
9295 - puts std::ostream and std::endl (for LOStream.h) or
9296 std::istream (LIStream.h) in toplevel namespace.
9298 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9300 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
9301 was a bib file that had been changed we ensure that bibtex is run.
9302 (runBibTeX): enhanced to extract the names of the bib files and
9303 getting their absolute path and enter them into the dep file.
9304 (findtexfile): static func that is used to look for tex-files,
9305 checks for absolute patchs and tries also with kpsewhich.
9306 Alternative ways of finding the correct files are wanted. Will
9308 (do_popen): function that runs a command using popen and returns
9309 the whole output of that command in a string. Should be moved to
9312 * src/DepTable.[Ch] (extchanged): new function that returns true if a
9313 file with extension ext has changed.
9315 * src/insets/figinset.C: added ifdef guards around the fl_free
9316 code that jug commented out. Now it is commented out when
9317 compiling with XForms == 0.89.
9319 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
9320 to lyxstring.C, and only keep a forward declaration in
9321 lyxstring.h. Simplifies the header file a bit and should help a
9322 bit on compile time too. Also changes to Srep will not mandate a
9323 recompile of code just using string.
9324 (~lyxstring): definition moved here since it uses srep.
9325 (size): definition moved here since it uses srep.
9327 * src/support/lyxstring.h: removed a couple of "inline" that should
9330 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9332 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
9335 1999-10-21 Juergen Vigna <jug@sad.it>
9337 * src/table.C (SetPWidth): Just a small fix so the alignment is not
9338 set to left if I just remove the width entry (or it is empty).
9340 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
9341 paragraph when having dummy paragraphs.
9343 1999-10-20 Juergen Vigna <jug@sad.it>
9345 * src/insets/figinset.C: just commented some fl_free_form calls
9346 and added warnings so that this calls should be activated later
9347 again. This avoids for now a segfault, but we have a memory leak!
9349 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
9350 'const char * argument' to 'string argument', this should
9351 fix some Asserts() in lyxstring.C.
9353 * src/lyxfunc.h: Removed the function argAsString(const char *)
9354 as it is not used anymore.
9356 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9358 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
9361 * src/Literate.h: some funcs moved from public to private to make
9362 interface clearer. Unneeded args removed.
9364 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
9366 (scanBuildLogFile): ditto
9368 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
9369 normal TeX Error. Still room for improvement.
9371 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
9373 * src/buffer.C (insertErrors): changes to make the error
9374 desctription show properly.
9376 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
9379 * src/support/lyxstring.C (helper): changed to use
9380 sizeof(object->rep->ref).
9381 (operator>>): changed to use a pointer instead.
9383 * src/support/lyxstring.h: changed const reference & to value_type
9384 const & lets see if that helps.
9386 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9388 * Makefile.am (rpmdist): fixed to have non static package and
9391 * src/support/lyxstring.C: removed the compilation guards
9393 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
9396 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
9397 conditional compile of lyxstring.Ch
9399 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
9400 stupid check, but it is a lot better than the bastring hack.
9401 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
9403 * several files: changed string::erase into string::clear. Not
9406 * src/chset.C (encodeString): use a char temporary instead
9408 * src/table.C (TexEndOfCell): added tostr around
9409 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
9410 (TexEndOfCell): ditto
9411 (TexEndOfCell): ditto
9412 (TexEndOfCell): ditto
9413 (DocBookEndOfCell): ditto
9414 (DocBookEndOfCell): ditto
9415 (DocBookEndOfCell): ditto
9416 (DocBookEndOfCell): ditto
9418 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
9420 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
9422 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
9423 (MenuBuildProg): added tostr around ret
9424 (MenuRunChktex): added tostr around ret
9425 (DocumentApplyCB): added tostr around ret
9427 * src/chset.C (encodeString): added tostr around t->ic
9429 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
9430 (makeLaTeXFile): added tostr around tocdepth
9431 (makeLaTeXFile): added tostr around ftcound - 1
9433 * src/insets/insetbib.C (setCounter): added tostr around counter.
9435 * src/support/lyxstring.h: added an operator+=(int) to catch more
9438 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
9439 (lyxstring): We DON'T allow NULL pointers.
9441 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9443 * src/mathed/math_macro.C (MathMacroArgument::Write,
9444 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
9445 when writing them out.
9447 * src/LString.C: remove, since it is not used anymore.
9449 * src/support/lyxstring.C: condition the content to
9450 USE_INCLUDED_STRING macro.
9452 * src/mathed/math_symbols.C, src/support/lstrings.C,
9453 src/support/lyxstring.C: add `using' directive to specify what
9454 we need in <algorithm>. I do not think that we need to
9455 conditionalize this, but any thought is appreciated.
9457 * many files: change all callback functions to "C" linkage
9458 functions to please strict C++ compilers like DEC cxx 6.1 in mode
9459 strict_ansi. Those who were static are now global.
9460 The case of callbacks which are static class members is
9461 trickier, since we have to make C wrappers around them (see
9462 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
9463 did not finish this yet, since it defeats the purpose of
9464 encapsulation, and I am not sure what the best route is.
9466 1999-10-19 Juergen Vigna <jug@sad.it>
9468 * src/support/lyxstring.C (lyxstring): we permit to have a null
9469 pointer as assignment value and just don't assign it.
9471 * src/vspace.C (nextToken): corrected this function substituting
9472 find_first(_not)_of with find_last_of.
9474 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
9475 (TableOptCloseCB) (TableSpeCloseCB):
9476 inserted fl_set_focus call for problem with fl_hide_form() in
9479 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9481 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
9484 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9486 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
9487 LyXLex::next() and not eatline() to get its argument.
9489 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9491 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
9492 instead, use fstreams for io of the depfile, removed unneeded
9493 functions and variables.
9495 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
9496 vector instead, removed all functions and variables that is not in
9499 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9501 * src/buffer.C (insertErrors): use new interface to TeXError
9503 * Makefile.am (rpmdist): added a rpmdist target
9505 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
9506 per Kayvan's instructions.
9508 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9510 * src/Makefile.am: add a definition for localedir, so that locales
9511 are found after installation (Kayvan)
9513 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9515 * development/.cvsignore: new file.
9517 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9519 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
9520 C++ compiler provides wrappers for C headers and use our alternate
9523 * configure.in: use LYX_CXX_CHEADERS.
9525 * src/cheader/: new directory, populated with cname headers from
9526 libstdc++-2.8.1. They are a bit old, but probably good enough for
9527 what we want (support compilers who lack them).
9529 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
9530 from includes. It turns out is was stupid.
9532 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9534 * lib/Makefile.am (install-data-local): forgot a ';'
9535 (install-data-local): forgot a '\'
9536 (libinstalldirs): needed after all. reintroduced.
9538 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9540 * configure.in (AC_OUTPUT): added lyx.spec
9542 * development/lyx.spec: removed file
9544 * development/lyx.spec.in: new file
9546 * po/*.po: merged with lyx.pot becuase of make distcheck
9548 * lib/Makefile.am (dist-hook): added dist-hook so that
9549 documentation files will be included when doing a make
9550 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
9551 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
9553 more: tried to make install do the right thing, exclude CVS dirs
9556 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
9557 Path would fit in more nicely.
9559 * all files that used to use pathstack: uses now Path instead.
9560 This change was a lot easier than expected.
9562 * src/support/path.h: new file
9564 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
9566 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
9568 * src/support/lyxstring.C (getline): Default arg was given for
9571 * Configure.cmd: removed file
9573 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9575 * src/support/DebugStream.[Ch]: remove the explicit std:: before
9576 streams classes and types, add the proper 'using' statements when
9577 MODERN_STL is defined.
9579 * src/debug.h: move the << operator definition after the inclusion
9582 * src/support/filetools.C: include "LAssert.h", which is needed
9585 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
9588 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
9589 include "debug.h" to define a proper ostream.
9591 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9593 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
9594 method to the SystemCall class which can kill a process, but it's
9595 not fully implemented yet.
9597 * src/*.C: Changed Systemcalls::Startscript() to startscript()
9599 * src/support/FileInfo.h: Better documentation
9601 * src/lyxfunc.C: Added support for buffer-export html
9603 * src/menus.C: Added Export->As HTML...
9605 * lib/bind/*.bind: Added short-cut for buffer-export html
9607 * src/lyxrc.*: Added support for new \tth_command
9609 * lib/lyxrc.example: Added stuff for new \tth_command
9611 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9613 * lib/Makefile.am (IMAGES): removed images/README
9614 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
9615 installes in correct place. Check permisions is installed
9618 * src/LaTeX.C: some no-op changes moved declaration of some
9621 * src/LaTeX.h (LATEX_H): changed include guard name
9623 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9625 * lib/reLyX/Makefile.am: install noweb2lyx.
9627 * lib/Makefile.am: install configure.
9629 * lib/reLyX/configure.in: declare a config aux dir; set package
9630 name to lyx (not sure what the best solution is); generate noweb2lyx.
9632 * lib/layouts/egs.layout: fix the bibliography layout.
9634 1999-10-08 Jürgen Vigna <jug@sad.it>
9636 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
9637 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
9638 it returned without continuing to search the path.
9640 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9642 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
9643 also fixes a bug. It is not allowed to do tricks with std::strings
9644 like: string a("hei"); &a[e]; this will not give what you
9645 think... Any reason for the complexity in this func?
9647 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
9649 * Updated README and INSTALL a bit, mostly to check that my
9650 CVS rights are correctly set up.
9652 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9654 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
9655 does not allow '\0' chars but lyxstring and std::string does.
9657 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9659 * autogen.sh (AUTOCONF): let the autogen script create the
9660 POTFILES.in file too. POTFILES.in should perhaps now not be
9661 included in the cvs module.
9663 * some more files changed to use C++ includes instead of C ones.
9665 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
9667 (Reread): added tostr to nlink. buggy output otherwise.
9668 (Reread): added a string() around szMode when assigning to Buffer,
9669 without this I got a log of garbled info strings.
9671 * acconfig.h: commented out the PTR_AS_INT macros. They should not
9674 * I have added several ostream & operator<<(ostream &, some_type)
9675 functions. This has been done to avoid casting and warnings when
9676 outputting enums to lyxerr. This as thus eliminated a lot of
9677 explicit casts and has made the code clearer. Among the enums
9678 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
9679 mathed enums, some font enum the Debug::type enum.
9681 * src/support/lyxstring.h (clear): missing method. equivalent of
9684 * all files that contained "stderr": rewrote constructs that used
9685 stderr to use lyxerr instead. (except bmtable)
9687 * src/support/DebugStream.h (level): and the passed t with
9688 Debug::ANY to avoid spurious bits set.
9690 * src/debug.h (Debug::type value): made it accept strings of the
9693 * configure.in (Check for programs): Added a check for kpsewhich,
9694 the latex generation will use this later to better the dicovery of
9697 * src/BufferView.C (create_view): we don't need to cast this to
9698 (void*) that is done automatically.
9699 (WorkAreaButtonPress): removed some dead code.
9701 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9703 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
9704 is not overwritten when translated (David Sua'rez de Lis).
9706 * lib/CREDITS: Added David Sua'rez de Lis
9708 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
9710 * src/bufferparams.C (BufferParams): default input encoding is now
9713 * acinclude.m4 (cross_compiling): comment out macro
9714 LYX_GXX_STRENGTH_REDUCE.
9716 * acconfig.h: make sure that const is not defined (to empty) when
9717 we are compiling C++. Remove commented out code using SIZEOF_xx
9720 * configure.in : move the test for const and inline as late as
9721 possible so that these C tests do not interefere with C++ ones.
9722 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
9723 has not been proven.
9725 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9727 * src/table.C (getDocBookAlign): remove bad default value for
9730 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
9732 (ShowFileMenu2): ditto.
9734 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
9737 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9739 * Most files: finished the change from the old error code to use
9740 DebugStream for all lyxerr debugging. Only minor changes remain
9741 (e.g. the setting of debug levels using strings instead of number)
9743 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9745 * src/layout.C (Add): Changed to use compare_no_case instead of
9748 * src/FontInfo.C: changed loop variable type too string::size_type.
9750 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9752 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
9753 set ETAGS_ARGS to --c++
9755 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
9757 * src/table.C (DocBookEndOfCell): commented out two unused variables
9759 * src/paragraph.C: commented out four unused variables.
9761 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
9762 insed a if clause with type string::size_type.
9764 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
9767 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
9769 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
9770 variable, also changed loop to go from 0 to lenght + 1, instead of
9771 -1 to length. This should be correct.
9773 * src/LaTeX.C (scanError): use string::size_type as loop variable
9776 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
9777 (l.896) since y_tmp and row was not used anyway.
9779 * src/insets/insetref.C (escape): use string::size_type as loop
9782 * src/insets/insetquotes.C (Width): use string::size_type as loop
9784 (Draw): use string::size_type as loop variable type.
9786 * src/insets/insetlatexaccent.C (checkContents): use
9787 string::size_type as loop variable type.
9789 * src/insets/insetlabel.C (escape): use string::size_type as loop
9792 * src/insets/insetinfo.C: added an extern for current_view.
9794 * src/insets/insetcommand.C (scanCommand): use string::size_type
9795 as loop variable type.
9797 * most files: removed the RCS tags. With them we had to recompile
9798 a lot of files after a simple cvs commit. Also we have never used
9799 them for anything meaningful.
9801 * most files: tags-query-replace NULL 0. As adviced several plases
9802 we now use "0" instead of "NULL" in our code.
9804 * src/support/filetools.C (SpaceLess): use string::size_type as
9807 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9809 * src/paragraph.C: fixed up some more string stuff.
9811 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9813 * src/support/filetools.h: make modestr a std::string.
9815 * src/filetools.C (GetEnv): made ch really const.
9817 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
9818 made code that used these use max/min from <algorithm> instead.
9820 * changed several c library include files to their equivalent c++
9821 library include files. All is not changed yet.
9823 * created a support subdir in src, put lyxstring and lstrings
9824 there + the extra files atexit, fileblock, strerror. Created
9825 Makefile.am. edited configure.in and src/Makefile.am to use this
9826 new subdir. More files moved to support.
9828 * imported som of the functions from repository lyx, filetools
9830 * ran tags-query-replace on LString -> string, corrected the bogus
9831 cases. Tried to make use of lstrings.[hC], debugged a lot. There
9832 is still some errors in there. This is errors where too much or
9833 too litle get deleted from strings (string::erase, string::substr,
9834 string::replace), there can also be some off by one errors, or
9835 just plain wrong use of functions from lstrings. Viewing of quotes
9838 * LyX is now running fairly well with string, but there are
9839 certainly some bugs yet (see above) also string is quite different
9840 from LString among others in that it does not allow null pointers
9841 passed in and will abort if it gets any.
9843 * Added the revtex4 files I forgot when setting up the repository.
9845 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9847 * All over: Tried to clean everything up so that only the files
9848 that we really need are included in the cvs repository.
9849 * Switched to use automake.
9850 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
9851 * Install has not been checked.
9853 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9855 * po/pt.po: Three errors:
9856 l.533 and l.538 format specification error
9857 l. 402 duplicate entry, I just deleted it.