1 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
3 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
4 of MATH_CODE. This fixes a bug with math-macros in RTL text.
6 * src/text.C (PrepareToPrint): Show math-macros block aligned.
8 2000-11-02 Juergen Vigna <jug@sad.it>
10 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
11 on char insertion as it has already be updated by bv->updateInset().
13 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
14 if an inset inside was updated.
16 * lib/configure.cmd: commented out fax-search code
18 2000-11-01 Yves Bastide <stid@acm.org>
20 * src/tabular.C (OldFormatRead): set tabular language to the
23 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
25 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
26 class names with non-letter characters (from Yves Bastide).
28 * lib/ui/default.ui: change Item to OptItem in import menu.
29 Comment out fax stuff.
31 * lib/configure.m4: comment out fax-related stuff.
33 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
35 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
36 useful xforms helper functions. At present contains only formatted().
37 Input a string and it returns it with line breaks so that in fits
40 * src/frontends/xforms/Makefile.am: add new files.
42 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
43 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
46 * src/frontends/xforms/FormPreferences.[Ch]:
47 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
48 but lots of little clean ups. Removed enum State. Make use of
49 formatted(). Constify lots of methods. Perhaps best of all: removed
50 requirement for that horrible reinterpret_cast from pointer to long in
53 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
55 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
56 conditionalize build on xforms < 0.89
58 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
60 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
62 * src/LyXAction.C (init): comment out fax
64 * src/lyxrc.h: comment out the fax enums
65 comment out the fax variables
67 * src/commandtags.h: comment out LFUN_FAX
69 * src/lyxrc.C: disable fax variables.
70 (read): disable parsing of fax variables
71 (output): disable writing of fax variables
72 (getFeedback): now description for fax variables
74 * src/lyxfunc.C: comment out MenuFax
75 (Dispatch): disable LFUN_FAX
77 * src/lyx_cb.C (MenuFax): comment out
79 * src/WorkArea.C: add <cctype>
80 (work_area_handler): better key handling, should be ok now.
81 for accented chars + etc
83 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
84 lyx_sendfax.h and lyx_sendfax_man.C
86 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
87 (show): don't call InitLyXLookup when using xforms 0.89
89 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
91 * src/trans.C (AddDeadkey): better fix, the other one could crash...
93 * src/support/filetools.C (GetFileContents): close to dummy change
95 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
97 * src/trans.C (AddDeadkey): workaround stupid compilers.
99 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
101 * src/frontends/xforms/FormDocument.C (class_update): fix setting
102 of two-sided document.
104 2000-10-31 Juergen Vigna <jug@sad.it>
106 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
108 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
109 xposition to the Edit call.
111 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
113 * src/trans.C (AddDeadkey): cast explicitly to char.
115 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
117 * src/tabular.C (AsciiBottomHLine): simplify?
118 (AsciiTopHLine): simplify?
119 (print_n_chars): simplify
120 (DocBook): remove most of the << endl; we should flush the stream
121 as seldom as possible.
123 (TeXBottomHLine): ditto
126 (write_attribute): try a templified version.
127 (set_row_column_number_info): lesson scope of variables
129 * src/support/lstrings.h (tostr): new specialization of tostr
131 * src/trans.C (AddDeadkey): slightly cleaner fix.
133 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
135 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
136 '%%' in Toc menu labels.
139 * src/insets/insetlatexaccent.C (draw): Correct rendering when
140 font_norm is iso10646-1.
142 * src/font.C (ascent): Fixed for 16bit fonts
143 (descent,lbearing,rbearing): ditto
145 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
147 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
148 (getFeedback): new static method.
150 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
151 Now use combox rather than choice to display languages.
152 Feedback is now output using a new timer callback mechanism, identical
153 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
155 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
157 * src/minibuffer.C: fix for older compilers
159 2000-10-30 Juergen Vigna <jug@sad.it>
161 * src/insets/insettext.C (InsertInset): fixed this as the cursor
162 has to be Left of the inset otherwise LyXText won't find it!
164 * src/BufferView2.C (open_new_inset): delete the inset if it can
167 2000-10-30 Rob Lahaye <lahaye@postech.edu>
171 2000-10-29 Marko Vendelin <markov@ioc.ee>
172 * src/frontends/gnome/FormCitation.C
173 * src/frontends/gnome/FormCitation.h
174 * src/frontends/gnome/FormCopyright.C
175 * src/frontends/gnome/FormCopyright.h
176 * src/frontends/gnome/FormError.C
177 * src/frontends/gnome/FormError.h
178 * src/frontends/gnome/FormIndex.C
179 * src/frontends/gnome/FormIndex.h
180 * src/frontends/gnome/FormPrint.C
181 * src/frontends/gnome/FormPrint.h
182 * src/frontends/gnome/FormRef.C
183 * src/frontends/gnome/FormRef.h
184 * src/frontends/gnome/FormToc.C
185 * src/frontends/gnome/FormToc.h
186 * src/frontends/gnome/FormUrl.C
187 * src/frontends/gnome/FormUrl.h
188 * src/frontends/gnome/Menubar_pimpl.C
189 * src/frontends/gnome/mainapp.C
190 * src/frontends/gnome/mainapp.h
191 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
192 changing update() to updateSlot() where appropriate
194 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
196 * src/frontends/xforms/FormPreferences.[Ch]:
197 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
200 2000-10-28 Juergen Vigna <jug@sad.it>
202 * src/insets/insettabular.C (draw): fixed drawing bug.
204 * src/insets/insettext.C (clear):
206 (SetParagraphData): clearing the TEXT buffers when deleting the
207 paragraphs used by it.
209 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
211 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
213 2000-10-27 Juergen Vigna <jug@sad.it>
215 * src/tabular.C (~LyXTabular): removed not needed anymore.
217 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
220 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
222 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
225 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
228 * src/frontends/xforms/FormPreferences.[Ch]:
229 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
230 Reorganised as modules based on tabs. Much easier to follow the
231 flow and to add new tabs. Added warning and feedback messages.
234 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
236 * src/tabular.h (DocBook): add std:: qualifier.
238 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
240 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
241 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
244 * insettabular.C (DocBook): uses the tabular methods to export
247 * src/insets/insettext.h
248 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
250 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
252 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
255 * src/lyxfunc.C (MenuNew): lessen the scope of fname
256 moved misplaced AllowInput two lines up.
258 * src/buffer.C (readFile): compare float with float, not with int
260 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
262 * src/minibuffer.C: add "using SigC::slot" statement.
264 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
266 * src/frontends/xforms/forms/README: updated section about make.
268 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
269 Tidied some forms up, made two of form_tabular's tabs more
270 self-consistent, fixed Jean-Marc's size problem in form_preferences,
271 fixed translation problem with "Column".
273 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
275 * src/minibuffer.h: use Timeout instead of the xforms timer
277 (setTimer) rewrite for the Timeout, change to unsigned arg
278 (set): change to unsigned timer arg
281 * src/minibuffer.C (TimerCB): removed func
282 (C_MiniBuffer_TimerCB): removed func
283 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
284 (peek_event): use a switch statement
285 (add): don't use fl_add_timer.
286 (Set): rewrite to use the Timeout
289 * src/Timeout.[Ch] (setType): return a Timeout &
290 (setTimeout): ditto, change to unsigned arg for timeout
292 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
294 * src/mathed/formula.C (mathed_string_width): Use string instead
295 of a constant size char array.
297 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
299 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
300 the two recently added operator<< for SMInput and State.
302 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
304 (OkCancelPolicy): ditto
305 (OkCancelReadOnlyPolicy): ditto
306 (NoRepeatedApplyReadOnlyPolicy): ditto
307 (OkApplyCancelReadOnlyPolicy): ditto
308 (OkApplyCancelPolicy): ditto
309 (NoRepeatedApplyPolicy): ditto
311 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
313 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
314 add the usual std:: qualifiers.
316 2000-10-25 Juergen Vigna <jug@sad.it>
318 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
320 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
322 * src/support/filetools.C (MakeRelPath): change some types to
325 * src/frontends/ButtonPolicies.h (operator<<): new operator for
326 ButtonPolicy::SMInput and ButtonPolicy::State.
328 * src/FontLoader.C (reset): small cleanup
329 (unload): small cleanup
331 * src/FontInfo.C (getFontname): initialize error to 10000.0
333 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
335 * src/frontends/xforms/FormPreferences.[Ch]:
336 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
337 TeX encoding and default paper size sections.
339 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
341 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
344 * src/frontends/xforms/FormError.C (disconnect): use erase() to
345 make the message_ empty.
346 (FormError): don't initialize message_ in initializer list.
348 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
350 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
352 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
354 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
356 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
358 * src/frontends/kde/*data.[Ch]: _("") is not
361 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
363 * src/buffer.C: removed redundant using directive.
365 * src/frontends/DialogBase.h: revert to original definition of
368 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
369 stuff into two classes, one for each dialog, requires a new
370 element in the dialogs vector, FormTabularCreate.
372 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
375 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
376 method. Continues Allan's idea, but means that derived classes
377 don't need to worry about "update or hide?".
379 * src/frontends/xforms/FormError.C (showInset): add connection
382 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
383 one for each dialog. FormTabular now contains main tabular dialog
386 * src/frontends/xforms/FormTabularCreate.[Ch]:
387 * src/frontends/xforms/forms/form_tabular_create.fd: the create
390 * src/frontends/xforms/FormGraphics.[Ch]:
391 * src/frontends/xforms/forms/form_graphics.fd
392 * src/frontends/xforms/FormTabular.[Ch]:
393 * src/frontends/xforms/forms/form_tabular.fd: made daughter
394 classes of FormInset.
396 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
397 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
399 * src/frontends/xforms/Makefile.am:
400 * src/frontends/xforms/forms/makefile: added new files.
402 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
403 variable. added Signal0 hide signal, in keeping with other GUI-I
406 * src/support/lstrings.h: removed redundant std:: qualifier as
407 it's already declared in Lsstream.h.
409 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
411 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
415 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
417 * src/tabular.C (Ascii): minimize scope of cell.
419 * src/BufferView2.C (nextWord): return string() instead of 0;
421 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
423 * src/converter.h: add a std:: qualifier
425 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
427 * src/importer.[Ch]: New files. Used for importing files into LyX.
429 * src/lyxfunc.C (doImport): Use the new Importer class.
431 * src/converter.h: Add shortcut member to the Format class.
432 Used for holding the menu shortcut.
434 * src/converter.C and other files: Made a distinction between
435 format name and format extension. New formats can be defined using
436 the \format lyxrc tag.
437 Added two new converter flags: latex and disable.
439 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
441 * src/support/lyxlib.h: unify namespace/struct implementation.
442 Remove extra declarations.
444 * src/support/chdir.C (chdir): remove version taking char const *
446 * src/support/rename.C: ditto.
447 * src/support/lyxsum.C: ditto.
449 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
451 * src/frontends/xforms/FormBase.[Ch]:
452 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
453 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
454 work only for the next call to fl_show_form(). The correct place to set
455 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
456 done. FormBase also stores minw_, minh_ itself. All dialogs derived
457 from FormBase have the minimum size set; no more stupid crashes with
460 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
462 * lib/ui/default.ui: fix shortcut for Insert->Include File.
464 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
466 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
468 * src/support/lyxlib.h: changed second argument of mkdir to
469 unsigned long int (unsigned int would probably have been enough,
470 but...). Removed <sys/types.h> header.
471 * src/support/mkdir.C (mkdir): ditto.
475 2000-10-19 Juergen Vigna <jug@sad.it>
477 * src/lyxfunc.C (MenuNew): small fix (form John)
479 * src/screen.C (Update): removed unneeded code.
481 * src/tabular.C (Ascii): refixed int != uint bug!
483 * src/support/lyxlib.h: added sys/types.h include for now permits
484 compiling, but I don't like this!
486 2000-10-18 Juergen Vigna <jug@sad.it>
488 * src/text2.C (ClearSelection): if we clear the selection we need
489 more refresh so set the status apropriately
491 * src/insets/insettext.C (draw): hopefully finally fixed draw
494 2000-10-12 Juergen Vigna <jug@sad.it>
496 * src/insets/insettext.C (draw): another small fix and make a block
497 so that variables are localized.
499 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
501 * src/support/lstrings.C (lowercase, uppercase):
502 use explicit casts to remove compiler warnings.
504 * src/support/LRegex.C (Impl):
505 * src/support/StrPool.C (add):
506 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
507 (AddPath, MakeDisplayPath):
508 * src/support/lstrings.C (prefixIs, subst):
509 use correct type to remove compiler warnings.
511 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
513 * src/support/lyxlib.h:
514 * src/support/mkdir.C (mkdir): change parameter to mode_t for
515 portability and to remove compiler warning with DEC cxx.
517 * src/support/FileInfo.[Ch] (flagRWX): ditto.
519 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
521 * src/minibuffer.C (peek_event): retun 1 when there has been a
522 mouseclick in the minibuffer.
526 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
528 * src/frontends/xforms/FormParagraph.C: more space above/below
531 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
533 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
534 a char only if real_current_font was changed.
536 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
538 * NEWS: update somewhat for 1.1.6
540 * lib/ui/default.ui: clean up.
542 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
544 * lib/CREDITS: clean up
546 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
548 * src/combox.[Ch] (select): changed argument back to int
549 * src/combox.C (peek_event): removed num_bytes as it is declared but
552 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
553 modified calls to Combox::select() to remove warnings about type
556 * src/insets/insetbutton.C (width): explicit cast to remove warning
557 about type conversion.
559 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
562 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
563 sel_pos_end, refering to cursor position are changed to
564 LyXParagraph::size_type.
566 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
567 consistent with LyXCursor::pos().
568 (inset_pos): changed to LyXParagraph::size_type for same reason.
570 * src/insets/insettext.C (resizeLyXText): changed some temporary
571 variables refing to cursor position to LyXParagraph::size_type.
573 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
575 * src/frontends/kde/<various>: The Great Renaming,
578 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
580 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
582 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
584 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
585 0 when there are no arguments.
587 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
589 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
590 to segfaults when pressing Ok in InsetBibtex dialog.
592 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
594 * forms/layout_forms.fd:
595 * src/layout_forms.C (create_form_form_character): small change to use
596 labelframe rather than engraved frame + text
598 * src/lyx_gui.C (create_forms): initialise choice_language with some
599 arbitrary value to prevent segfault when dialog is shown.
601 2000-10-16 Baruch Even <baruch.even@writeme.com>
603 * src/converter.C (runLaTeX, scanLog): Added a warning when there
604 is no resulting file. This pertains only to LaTeX output.
606 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
608 * src/text.C (Backspace): Make sure that the row of the cursor is
611 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
614 * src/lyx_gui.C (init): Prevent a crash when only one font from
615 menu/popup fonts is not found.
617 * lib/lyxrc.example: Add an example for binding a key for language
620 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
622 * src/converter.C (GetReachable): Changed the returned type to
624 (IsReachable): New method
626 * src/MenuBackend.C (expand): Handle formats that appear more
629 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
631 * src/frontends/support/Makefile.am
632 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
635 * lib/CREDITS: add Garst Reese.
637 * src/support/snprintf.h: add extern "C" {} around the definitions.
639 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
641 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
644 * src/frontends/xforms/FormDocument.C:
645 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
646 compile without "conversion to integral type of smaller size"
649 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
651 * src/text.C (GetColumnNearX): Fixed disabled code.
653 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
655 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
658 * src/support/snprintf.[ch]: new files
660 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
662 * src/frontends/kde/formprintdialog.C: add
663 file browser for selecting postscript output
665 * src/frontends/kde/formprintdialogdata.C:
666 * src/frontends/kde/formprintdialogdata.h: re-generate
669 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
671 * src/frontends/gnome/Makefile.am:
672 * src/frontends/kde/Makefile.am: FormCommand.C
673 disappeared from xforms
675 * src/frontends/kde/FormCitation.C:
676 * src/frontends/kde/FormIndex.C: read-only
679 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
681 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
684 * src/bufferlist.C: add using directive.
686 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
688 * src/support/lyxfunctional.h: version of class_fun for void
689 returns added, const versions of back_inseter_fun and compare_fun
692 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
694 * src/frontends/xforms/FormInset.C (showInset): fix typo.
696 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
698 * ChangeLog: cleanup.
700 * lib/CREDITS: update to add all the contributors we've forgotten.
701 I have obviously missed some, so tell me whether there were
704 2000-10-13 Marko Vendelin <markov@ioc.ee>
706 * src/frontends/gnome/FormCitation.C
707 * src/frontends/gnome/FormCitation.h
708 * src/frontends/gnome/FormError.C
709 * src/frontends/gnome/FormIndex.C
710 * src/frontends/gnome/FormRef.C
711 * src/frontends/gnome/FormRef.h
712 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
714 * src/frontends/gnome/FormCitation.C
715 * src/frontends/gnome/FormCopyright.C
716 * src/frontends/gnome/FormError.C
717 * src/frontends/gnome/FormIndex.C
718 * src/frontends/gnome/FormRef.C
719 * src/frontends/gnome/FormToc.C
720 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
723 * src/frontends/gnome/Menubar_pimpl.C
724 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
727 2000-10-11 Baruch Even <baruch.even@writeme.com>
730 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
731 to convey its real action.
733 * src/minibuffer.C (peek_event): Added action when mouse clicks to
734 clear the minibuffer and prepare to enter a command.
736 * src/mathed/formula.C (LocalDispatch): Changed to conform with
737 the rename from ExecCommand to PrepareForCommand.
738 * src/lyxfunc.C (Dispatch): ditto.
740 2000-10-11 Baruch Even <baruch.even@writeme.com>
742 * src/buffer.C (writeFile): Added test for errors on writing, this
743 catches all errors and not only file system full errors as intended.
745 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
747 * src/lyx_gui.C (create_forms): better fix for crash with
748 translated interface.
750 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
752 * src/frontends/kde/Makefile.am:
753 * src/frontends/kde/FormCopyright.C:
754 * src/frontends/kde/formcopyrightdialog.C:
755 * src/frontends/kde/formcopyrightdialog.h:
756 * src/frontends/kde/formcopyrightdialogdata.C:
757 * src/frontends/kde/formcopyrightdialogdata.h:
758 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
759 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
760 copyright to use qtarch
762 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
764 * src/encoding.C (read): Fixed bug that caused an error message at
767 * po/Makefile.in.in: Fixed rule for ext_l10n.h
769 * lib/lyxrc.example: Fixed hebrew example.
771 2000-10-13 Allan Rae <rae@lyx.org>
773 * src/frontends/xforms/FormPreferences.C (input): reworking the
775 (build, update, apply): New inputs in various tabfolders
777 * src/frontends/xforms/FormToc.C: use new button policy.
778 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
779 dialogs that either can't use any existing policy or where it just
782 * src/frontends/xforms/FormTabular.h: removed copyright notice that
785 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
786 added a bool parameter which is ignored.
788 * src/buffer.C (setReadonly):
789 * src/BufferView_pimpl.C (buffer):
790 * src/frontends/kde/FormCopyright.h (update):
791 * src/frontends/kde/FormCitation.[Ch] (update):
792 * src/frontends/kde/FormIndex.[Ch] (update):
793 * src/frontends/kde/FormPrint.[Ch] (update):
794 * src/frontends/kde/FormRef.[Ch] (update):
795 * src/frontends/kde/FormToc.[Ch] (update):
796 * src/frontends/kde/FormUrl.[Ch] (update):
797 * src/frontends/gnome/FormCopyright.h (update):
798 * src/frontends/gnome/FormCitation.[Ch] (update):
799 * src/frontends/gnome/FormError.[Ch] (update):
800 * src/frontends/gnome/FormIndex.[Ch] (update):
801 * src/frontends/gnome/FormPrint.[Ch] (update):
802 * src/frontends/gnome/FormRef.h (update):
803 * src/frontends/gnome/FormToc.[Ch] (update):
804 * src/frontends/gnome/FormUrl.[Ch] (update):
805 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
806 to updateBufferDependent and DialogBase
808 * src/frontends/xforms/FormCitation.[hC]:
809 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
810 * src/frontends/xforms/FormError.[Ch]:
811 * src/frontends/xforms/FormGraphics.[Ch]:
812 * src/frontends/xforms/FormIndex.[Ch]:
813 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
814 and fixed readOnly handling.
815 * src/frontends/xforms/FormPrint.[Ch]:
816 * src/frontends/xforms/FormRef.[Ch]:
817 * src/frontends/xforms/FormTabular.[Ch]:
818 * src/frontends/xforms/FormToc.[Ch]:
819 * src/frontends/xforms/FormUrl.[Ch]:
820 * src/frontends/xforms/FormInset.[Ch]:
821 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
822 form of updateBufferDependent.
824 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
825 if form()->visible just in case someone does stuff to the form in a
828 * src/frontends/DialogBase.h (enum): removed enum since we can now use
829 the buttoncontroller for everything the enum used to be used for.
830 (update) It would seem we need to force all dialogs to use a bool
831 parameter or have two update functions. I chose to go with one.
832 I did try removing update() from here and FormBase and defining the
833 appropriate update signatures in FormBaseB[DI] but then ran into the
834 problem of the update() call in FormBase::show(). Whatever I did
835 to get around that would require another function and that just
836 got more confusing. Hence the decision to make everyone have an
837 update(bool). An alternative might have been to override show() in
838 FormBaseB[DI] and that would allow the different and appropriate
841 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
842 true == buffer change occurred. I decided against using a default
843 template parameter since not all compilers support that at present.
845 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
847 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
848 army knife" by removing functionality.
849 (clearStore): removed. All such housekeeping on hide()ing the dialog
850 is to be carried out by overloaded disconnect() methods.
851 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
852 superceded by Baruch's neat test (FormGraphics) to update an existing
853 dialog if a new signal is recieved rather than block all new signals
855 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
856 only to Inset dialogs.
857 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
858 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
860 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
862 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
863 as a base class to all inset dialogs. Used solely to connect/disconnect
864 the Inset::hide signal and to define what action to take on receipt of
865 a UpdateBufferDependent signal.
866 (FormCommand): now derived from FormInset.
868 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
871 * src/frontends/xforms/FormCopyright.[Ch]:
872 * src/frontends/xforms/FormPreferences.[Ch]:
873 now derived from FormBaseBI.
875 * src/frontends/xforms/FormDocument.[Ch]:
876 * src/frontends/xforms/FormParagraph.[Ch]:
877 * src/frontends/xforms/FormPrint.[Ch]:
878 now derived from FormBaseBD.
880 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
882 * src/frontends/xforms/FormCitation.[Ch]:
883 * src/frontends/xforms/FormError.[Ch]:
884 * src/frontends/xforms/FormRef.[Ch]:
885 * src/frontends/xforms/FormToc.[Ch]:
886 (clearStore): reworked as disconnect().
888 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
891 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
893 * src/converter.C (runLaTeX): constify buffer argument
896 * src/frontends/support/Makefile.am (INCLUDES): fix.
898 * src/buffer.h: add std:: qualifier
899 * src/insets/figinset.C (addpidwait): ditto
900 * src/MenuBackend.C: ditto
901 * src/buffer.C: ditto
902 * src/bufferlist.C: ditto
903 * src/layout.C: ditto
904 * src/lyxfunc.C: ditto
906 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
908 * src/lyxtext.h (bidi_level): change return type to
909 LyXParagraph::size_type.
911 * src/lyxparagraph.h: change size_type to
912 TextContainer::difference_type. This should really be
913 TextContainer::size_type, but we need currently to support signed
916 2000-10-11 Marko Vendelin <markov@ioc.ee>
917 * src/frontends/gnome/FormError.h
918 * src/frontends/gnome/FormRef.C
919 * src/frontends/gnome/FormRef.h
920 * src/frontends/gnome/FormError.C
921 * src/frontends/gnome/Makefile.am
922 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
923 to Gnome frontend. Both dialogs use "action" area.
925 2000-10-12 Baruch Even <baruch.even@writeme.com>
927 * src/graphics/GraphicsCacheItem_pimpl.C:
928 * src/graphics/Renderer.C:
929 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
932 2000-10-12 Juergen Vigna <jug@sad.it>
934 * src/insets/insettext.C (draw): fixed drawing bug (specifically
935 visible when selecting).
937 * development/Code_rules/Rules: fixed some typos.
939 2000-10-09 Baruch Even <baruch.even@writeme.com>
941 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
942 compiling on egcs 1.1.2 possible.
944 * src/filedlg.C (comp_direntry::operator() ): ditto.
946 2000-08-31 Baruch Even <baruch.even@writeme.com>
948 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
951 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
952 transient it now only gets freed when the object is destructed.
954 2000-08-24 Baruch Even <baruch.even@writeme.com>
956 * src/frontends/FormGraphics.h:
957 * src/frontends/FormGraphics.C: Changed to use ButtonController and
960 2000-08-20 Baruch Even <baruch.even@writeme.com>
962 * src/insets/insetgraphics.C:
963 (draw): Added messages to the drawn rectangle to report status.
964 (updateInset): Disabled the use of the inline graphics,
967 2000-08-17 Baruch Even <baruch.even@writeme.com>
969 * src/frontends/support: Directory added for the support of GUII LyX.
971 * src/frontends/support/LyXImage.h:
972 * src/frontends/support/LyXImage.C: Base class for GUII holding of
975 * src/frontends/support/LyXImage_X.h:
976 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
977 version of LyXImage, this uses the Xlib Pixmap.
982 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
983 replacement to Pixmap.
985 * src/insets/insetgraphics.h:
986 * src/insets/insetgraphics.C:
987 * src/graphics/GraphicsCacheItem.h:
988 * src/graphics/GraphicsCacheItem.C:
989 * src/graphics/GraphicsCacheItem_pimpl.h:
990 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
993 * src/graphics/GraphicsCacheItem.h:
994 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
995 another copy of the object.
997 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
998 of cacheHandle, this fixed a bug that sent LyX crashing.
1000 * src/graphics/XPM_Renderer.h:
1001 * src/graphics/XPM_Renderer.C:
1002 * src/graphics/EPS_Renderer.h:
1003 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
1005 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1007 * src/lyxfunc.C (processKeySym): only handle the
1008 lockinginset/inset stuff if we have a buffer and text loaded...
1010 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
1012 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1014 * src/support/lyxfunctional.h: add operator= that takes a reference
1016 * src/lyxserver.C (mkfifo): make first arg const
1018 * src/layout.h: renamed name(...) to setName(...) to work around
1021 * src/buffer.C (setFileName): had to change name of function to
1022 work around bugs in egcs. (renamed from fileName)
1024 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
1026 * src/support/translator.h: move helper template classes to
1027 lyxfunctional.h, include "support/lyxfunctional.h"
1029 * src/support/lyxmanip.h: add delaration of fmt
1031 * src/support/lyxfunctional.h: new file
1032 (class_fun_t): new template class
1033 (class_fun): helper template function
1034 (back_insert_fun_iterator): new template class
1035 (back_inserter_fun): helper template function
1036 (compare_memfun_t): new template class
1037 (compare_memfun): helper template function
1038 (equal_1st_in_pair): moved here from translator
1039 (equal_2nd_in_pair): moved here from translator
1041 * src/support/fmt.C: new file
1042 (fmt): new func, can be used for a printf substitute when still
1043 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
1045 * src/support/StrPool.C: add some comments
1047 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
1050 * src/insets/figinset.C (addpidwait): use std::copy with
1051 ostream_iterator to fill the pidwaitlist
1053 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
1055 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
1058 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
1061 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
1063 * src/frontends/xforms/FormDocument.C (build): remove c_str()
1064 (class_update): ditto
1065 (BulletPanel): ditto
1066 (CheckChoiceClass): move initialization of tc and tct
1068 * src/tabular.C: remove current_view
1069 (OldFormatRead): similar to right below [istream::ignore]
1071 * src/lyxlex_pimpl.C (next): add code for faster skipping of
1072 chars, unfortunately this is buggy on gcc 2.95.2, so currently
1073 unused [istream::ignore]
1075 * src/lyxfunc.C: include "support/lyxfunctional.h"
1076 (getInsetByCode): use std::find_if and compare_memfun
1078 * src/lyxfont.C (stateText): remove c_str()
1080 * src/lyx_main.C (setDebuggingLevel): make static
1081 (commandLineHelp): make static
1083 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
1084 Screen* together with fl_get_display() and fl_screen
1086 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
1087 togheter with fl_get_display() and fl_screen
1088 (create_forms): remove c_str()
1090 * src/layout.C: include "support/lyxfunctional.h"
1091 (hasLayout): use std::find_if and compare_memfun
1092 (GetLayout): use std::find_if and comapre_memfun
1093 (delete_layout): use std::remove_if and compare_memfun
1094 (NumberOfClass): use std:.find_if and compare_memfun
1096 * src/gettext.h: change for the new functions
1098 * src/gettext.C: new file, make _(char const * str) and _(string
1099 const & str) real functions.
1101 * src/font.C (width): rewrite slightly to avoid one extra variable
1103 * src/debug.C: initialize Debug::ANY here
1105 * src/commandtags.h: update number comments
1107 * src/combox.h (get): make const func
1109 (getline): make const
1111 * src/combox.C (input_cb): handle case where fl_get_input can
1114 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
1115 "support/lyxfunctional.h", remove current_view variable.
1116 (resize): use std::for_each with std::mem_fun
1117 (getFileNames): use std::copy with back_inserter_fun
1118 (getBuffer): change arg type to unsigned int
1119 (emergencyWriteAll): call emergencyWrite with std::for_each and
1121 (emergencyWrite): new method, the for loop in emergencyWriteAll
1123 (exists): use std::find_if with compare_memfun
1124 (getBuffer): use std::find_if and compare_memfun
1126 * src/buffer.h: add typedefs for iterator_category, value_type
1127 difference_type, pointer and reference for inset_iterator
1128 add postfix ++ for inset_iterator
1129 make inset_iterator::getPos() const
1131 * src/buffer.C: added support/lyxmanip.h
1132 (readFile): use lyxerr << fmt instead of printf
1133 (makeLaTeXFile): use std::copy to write out encodings
1135 * src/Painter.C (text): rewrite slightly to avoid extra font variable
1137 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
1138 free and the char * temp.
1139 (hasMenu): use std::find_if and compare_memfun
1142 * src/Makefile.am (lyx_SOURCES): added gettext.C
1144 * src/LyXAction.C (retrieveActionArg): clear the arg, use
1145 string::insert small change to avoid temporary
1147 * src/LColor.C (getGUIName): remove c_str()
1149 * several files: change all occurrences of fl_display to
1152 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
1153 that -pedantic is not used for gcc 2.97 (cvs gcc)
1155 * boost/Makefile.am: begin slowly to prepare for a real boost lib
1157 2000-10-11 Allan Rae <rae@lyx.org>
1159 * src/frontends/xforms/FormPreferences.C (input): template path must be
1160 a readable directory. It doesn't need to be writeable.
1161 (build, delete, update, apply): New inputs in the various tabfolders
1163 * src/frontends/xforms/forms/form_preferences.fd:
1164 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
1165 several new entries to existing folders. Shuffled some existing stuff
1168 * src/frontends/xforms/forms/form_print.fd:
1169 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
1170 Should probably rework PrinterParams as well. Note that the switch to
1171 collated is effectively the same as !unsorted so changing PrinterParams
1172 will require a lot of fiddly changes to reverse the existing logic.
1174 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
1176 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1178 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
1180 2000-10-10 Allan Rae <rae@lyx.org>
1183 * src/lyxfunc.C (Dispatch):
1185 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
1188 * src/lyxrc.C (output): Only write the differences between system lyxrc
1189 and the users settings.
1192 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
1194 I'll rewrite this later, after 1.1.6 probably, to keep a single
1195 LyXRC but two instances of a LyXRCStruct.
1197 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1199 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
1201 * src/tabular.h: add a few std:: qualifiers.
1203 * src/encoding.C: add using directive.
1204 * src/language.C: ditto.
1206 * src/insets/insetquotes.C (Validate): use languages->lang()
1207 instead of only language.
1209 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
1211 * lib/languages: New file.
1213 * lib/encodings: New file.
1215 * src/language.C (Languages): New class.
1216 (read): New method. Reads the languages from the 'languages' file.
1218 * src/encoding.C (Encodings): New class.
1219 (read): New method. Reads the encodings from the 'encodings' file.
1221 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
1224 * src/bufferparams.h and a lot of files: Deleted the member language,
1225 and renamed language_info to language
1227 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
1228 * src/lyxfont.C (latexWriteStartChanges): ditto.
1229 * src/paragraph.C (validate,TeXOnePar): ditto.
1231 * src/lyxfont.C (update): Restored deleted code.
1233 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
1235 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1237 * src/BufferView_pimpl.C (buffer): cleaned up a little.
1239 * src/insets/figinset.[Ch]:
1240 * src/insets/insetinclude.[Ch]:
1241 * src/insets/insetinclude.[Ch]:
1242 * src/insets/insetparent.[Ch]:
1243 * src/insets/insetref.[Ch]:
1244 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
1246 * src/insets/*.[Ch]:
1247 * src/mathed/formula.[Ch]:
1248 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
1250 * src/buffer.C (parseSingleLyXformat2Token, readInset):
1251 * src/lyx_cb.C (FigureApplyCB):
1252 * src/lyxfunc.C (getStatus, Dispatch):
1253 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
1256 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
1258 * src/converter.[Ch] (Formats::View):
1259 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
1261 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
1262 *current_view->buffer(). This will change later, but this patch is way
1265 2000-10-09 Juergen Vigna <jug@sad.it>
1267 * src/text.C (GetRow): small fix.
1269 * src/BufferView_pimpl.C (cursorPrevious):
1270 (cursorNext): added LyXText parameter to function.
1272 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
1273 keypress depending on cursor position.
1275 2000-10-06 Juergen Vigna <jug@sad.it>
1277 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
1278 (copySelection): redone this function and also copy ascii representa-
1281 * src/tabular.C (Ascii):
1285 (print_n_chars): new functions to realize the ascii export of tabulars.
1287 2000-10-05 Juergen Vigna <jug@sad.it>
1289 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
1290 if we don't have a buffer.
1292 2000-10-10 Allan Rae <rae@lyx.org>
1294 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
1295 with closing dialog. It seems that nested tabfolders require hiding
1296 of inner tabfolders before hiding the dialog itself. Actually all I
1297 did was hide the active outer folder.
1299 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
1300 unless there really is a buffer. hideBufferDependent is called
1303 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
1304 POTFILES.in stays in $(srcdir).
1306 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
1308 * lib/lyxrc.example: Few changes.
1310 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
1312 * src/BufferView_pimpl.C (buffer): only need one the
1313 updateBufferDependent signal to be emitted once! Moved to the end of
1314 the method to allow bv_->text to be updated first.
1316 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
1317 and hSignal_ with Dialogs * and BufferDependency variables.
1318 New Buffer * parent_, initialised when the dialog is launched. Used to
1319 check whether to update() or hide() dialog in the new, private
1320 updateOrHide() method that is connected to the updateBufferDependent
1321 signal. Daughter classes dictate what to do using the
1322 ChangedBufferAction enum, passed to the c-tor.
1324 * src/frontends/xforms/FormCitation.C:
1325 * src/frontends/xforms/FormCommand.C:
1326 * src/frontends/xforms/FormCopyright.C:
1327 * src/frontends/xforms/FormDocument.C:
1328 * src/frontends/xforms/FormError.C:
1329 * src/frontends/xforms/FormIndex.C:
1330 * src/frontends/xforms/FormPreferences.C:
1331 * src/frontends/xforms/FormPrint.C:
1332 * src/frontends/xforms/FormRef.C:
1333 * src/frontends/xforms/FormToc.C:
1334 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
1337 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
1338 ChangedBufferAction enum.
1340 * src/frontends/xforms/FormParagraph.[Ch]
1341 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
1344 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1346 * lib/bind/cua.bind: fix a bit.
1347 * lib/bind/emacs.bind: ditto.
1349 * lib/bind/menus.bind: remove real menu entries from there.
1351 * src/spellchecker.C: make sure we only include strings.h when
1354 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1356 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
1357 function. It enlarges the maximum number of pup when needed.
1358 (add_toc2): Open a new menu if maximum number of items per menu has
1361 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
1363 * src/frontends/kde/FormPrint.C: fix error reporting
1365 * src/frontends/xforms/FormDocument.C: fix compiler
1368 * lib/.cvsignore: add Literate.nw
1370 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1373 * bufferview_funcs.[Ch]
1376 * text2.C: Add support for numbers in RTL text.
1378 2000-10-06 Allan Rae <rae@lyx.org>
1380 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
1381 to be gettext.m4 friendly again. ext_l10n.h is now
1382 generated into $top_srcdir instead of $top_builddir
1383 so that lyx.pot will be built correctly -- without
1384 duplicate parsing of ext_l10n.h.
1386 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1388 * src/frontends/kde/FormCitation.C: make the dialog
1389 behave more sensibly
1391 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
1393 * config/kde.m4: fix consecutive ./configure runs,
1394 look for qtarch, fix library order
1396 * src/frontends/kde/Makefile.am: tidy up,
1397 add Print dialog, add .dlg dependencies
1399 * src/frontends/kde/FormPrint.C:
1400 * src/frontends/kde/FormPrint.h:
1401 * src/frontends/kde/formprintdialog.C:
1402 * src/frontends/kde/formprintdialog.h:
1403 * src/frontends/kde/formprintdialogdata.C:
1404 * src/frontends/kde/formprintdialogdata.h:
1405 * src/frontends/kde/dlg/formprintdialog.dlg: add
1408 * src/frontends/kde/dlg/README: Added explanatory readme
1410 * src/frontends/kde/dlg/checkinitorder.pl: small perl
1411 script to double-check qtarch's output
1413 * src/frontends/kde/formindexdialog.C:
1414 * src/frontends/kde/formindexdialogdata.C:
1415 * src/frontends/kde/formindexdialogdata.h:
1416 * src/frontends/kde/dlg/formindexdialog.dlg: update
1417 for qtarch, minor fixes
1419 2000-10-05 Allan Rae <rae@lyx.org>
1421 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
1422 dialogs when switching buffers update them instead. It's up to each
1423 dialog to decide if it should still be visible or not.
1424 update() should return a bool to control visiblity within show().
1425 Or perhaps better to set a member variable and use that to control
1428 * lib/build-listerrors: create an empty "listerrors" file just to stop
1429 make trying to regenerate it all the time if you don't have noweb
1432 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
1434 * po/Makefile.in.in (ext_l10n.h): added a rule to build
1435 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
1436 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
1437 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
1438 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
1440 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
1442 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
1444 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
1445 deleting buffer. Closes all buffer-dependent dialogs.
1447 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
1449 * src/frontends/xforms/FormCitation.[Ch]:
1450 * src/frontends/xforms/FormPreferences.[Ch]:
1451 * src/frontends/xforms/FormPrint.[Ch]:
1452 * src/frontends/xforms/FormRef.[Ch]:
1453 * src/frontends/xforms/FormUrl.[Ch]: ditto
1455 * src/frontends/xforms/FormDocument.[Ch]:
1456 * src/frontends/xforms/forms/form_document.C.patch:
1457 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
1458 pass through a single input() function.
1460 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1462 * lib/build-listerrors: return status as OK
1464 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
1466 * lib/lyxrc.example: Updated to new export code
1468 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1470 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
1473 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
1476 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
1477 LyX-Code is defined.
1478 * lib/layouts/amsbook.layout: ditto.
1480 * boost/Makefile.am: fix typo.
1482 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
1484 (add_lastfiles): removed.
1485 (add_documents): removed.
1486 (add_formats): removed.
1488 * src/frontends/Menubar.C: remove useless "using" directive.
1490 * src/MenuBackend.h: add a new MenuItem constructor.
1492 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
1495 2000-10-04 Allan Rae <rae@lyx.org>
1497 * lib/Makefile.am (listerrors):
1498 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
1499 I haven't got notangle installed so Kayvan please test. The output
1500 should end up in $builddir. This also allows people who don't have
1501 noweb installed to complete the make process without error.
1503 * src/frontends/xforms/FormCommand.[Ch] (showInset):
1504 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
1505 by JMarc's picky compiler.
1507 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1510 * src/insets/insettabular.C (setPos): change for loop to not use
1511 sequencing operator. Please check this Jürgen.
1513 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
1515 * src/insets/insetcite.C (getScreenLabel): ditto
1516 * src/support/filetools.C (QuoteName): ditto
1517 (ChangeExtension): ditto
1519 * src/BufferView_pimpl.C (scrollCB): make heigt int
1521 * src/BufferView2.C (insertInset): comment out unused arg
1523 * boost/Makefile.am (EXTRADIST): new variable
1525 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1527 * src/exporter.C (IsExportable): Fixed
1529 * lib/configure.m4: Small fix
1531 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1533 * src/insets/insetbutton.C (width): Changed to work with no GUI.
1534 * src/insets/insetbib.C (bibitemWidest): ditto.
1535 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
1537 2000-10-03 Juergen Vigna <jug@sad.it>
1539 * src/BufferView2.C (theLockingInset): removed const because of
1540 Agnus's compile problems.
1542 * src/insets/insettext.C (LocalDispatch): set the language of the
1543 surronding paragraph on inserting the first character.
1545 * various files: changed use of BufferView::the_locking_inset.
1547 * src/BufferView2.C (theLockingInset):
1548 (theLockingInset): new functions.
1550 * src/BufferView.h: removed the_locking_inset.
1552 * src/lyxtext.h: added the_locking_inset
1554 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
1556 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
1558 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1560 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
1561 * src/mathed/math_cursor.C (IsAlpha): ditto.
1562 * src/mathed/math_inset.C (strnew): ditto.
1563 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
1564 (IMetrics): cxp set but never used; removed.
1565 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
1566 that the variable in question has been removed also!
1569 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
1570 using the Buffer * passed to Latex(), using the BufferView * passed to
1571 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
1573 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
1574 Linuxdoc() and DocBook() rather than the stored Buffer * master.
1576 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
1577 * src/buffer.C (readInset): used new InsetBibtex c-tor
1578 * (getBibkeyList): used new InsetBibtex::getKeys
1580 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1583 * lib/build-listerrors
1585 * src/exporter.C: Add literate programming support to the export code
1588 * src/lyx_cb.C: Remove old literate code.
1590 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
1593 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
1594 * src/converter.C (View, Convert): Use QuoteName.
1596 * src/insets/figinset.C (Preview): Use Formats::View.
1598 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
1600 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1602 * src/lyxfunc.C (Dispatch): move declaration of text variable at
1603 the top of the function, because compaq cxx complains that the
1604 "goto exit_with_message" when the function is disabled bypasses
1606 (MenuNew): try a better fix for the generation of new file names.
1607 This time, I used AddName() instead of AddPath(), hoping Juergen
1610 2000-10-03 Allan Rae <rae@lyx.org>
1612 * src/frontends/xforms/forms/form_preferences.fd:
1613 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
1614 nested tabfolders has begun. The old "Miscellaneous" was renamed as
1615 "Look and Feel"->"General" but will need to be split up further into
1616 general output and general input tabs. Current plan is for four outer
1617 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
1618 stuff; "Inputs" for input and import configuration; "Outputs" for
1619 output and export configuration; and one more whatever is left over
1620 called "General". The leftovers at present look like being which
1621 viewers to use, spellchecker, language support and might be better
1622 named "Support". I've put "Paths" in "Inputs" for the moment as this
1623 seems reasonable for now at least.
1624 One problem remains: X error kills LyX when you close Preferences.
1626 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1628 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
1629 qualifier from form()
1630 * src/frontends/xforms/FormCitation.[Ch]:
1631 * src/frontends/xforms/FormCopyright.[Ch]:
1632 * src/frontends/xforms/FormDocument.[Ch]:
1633 * src/frontends/xforms/FormError.[Ch]:
1634 * src/frontends/xforms/FormIndex.[Ch]:
1635 * src/frontends/xforms/FormPreferences.[Ch]:
1636 * src/frontends/xforms/FormPrint.[Ch]:
1637 * src/frontends/xforms/FormRef.[Ch]:
1638 * src/frontends/xforms/FormToc.[Ch]:
1639 * src/frontends/xforms/FormUrl.[Ch]: ditto.
1641 * src/frontends/xforms/FormCitation.[Ch]:
1642 * src/frontends/xforms/FormIndex.[Ch]:
1643 * src/frontends/xforms/FormRef.[Ch]:
1644 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
1645 with Allan's naming policy
1647 * src/frontends/xforms/FormCitation.C: some static casts to remove
1650 2000-10-02 Juergen Vigna <jug@sad.it>
1652 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
1653 now you can type or do stuff inside the table-cell also when in dummy
1654 position, fixed visible cursor.
1656 * src/insets/insettext.C (Edit): fixing cursor-view position.
1658 * src/lyxfunc.C (Dispatch): use * text variable so that it can
1659 be used for equal functions in lyxfunc and insettext.
1661 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
1663 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
1665 * src/frontends/gnome/FormCitation.h:
1666 * src/frontends/gnome/FormCopyright.h:
1667 * src/frontends/gnome/FormIndex.h:
1668 * src/frontends/gnome/FormPrint.h:
1669 * src/frontends/gnome/FormToc.h:
1670 * src/frontends/gnome/FormUrl.h:
1671 * src/frontends/kde/FormCitation.h:
1672 * src/frontends/kde/FormCopyright.h:
1673 * src/frontends/kde/FormIndex.h:
1674 * src/frontends/kde/FormRef.h:
1675 * src/frontends/kde/FormToc.h:
1676 * src/frontends/kde/FormUrl.h: fix remaining users of
1679 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1681 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
1682 from depth argument.
1683 (DocBookHandleCaption): ditto.
1684 (DocBookHandleFootnote): ditto.
1685 (SimpleDocBookOnePar): ditto.
1687 * src/frontends/xforms/FormDocument.h (form): remove extra
1688 FormDocument:: qualifier.
1690 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
1692 * sigc++/handle.h: ditto.
1694 * src/lyx_gui_misc.C: add "using" directive.
1696 * src/cheaders/cstddef: new file, needed by the boost library (for
1699 2000-10-02 Juergen Vigna <jug@sad.it>
1701 * src/insets/insettext.C (SetFont): better support.
1703 * src/insets/insettabular.C (draw): fixed drawing of single cell.
1705 * src/screen.C (DrawOneRow): some uint refixes!
1707 2000-10-02 Allan Rae <rae@lyx.org>
1709 * boost/.cvsignore: ignore Makefile as well
1711 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
1712 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
1714 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
1715 Left this one out by accident.
1717 * src/frontends/xforms/FormBase.h (restore): default to calling
1718 update() since that will restore the original/currently-applied values.
1719 Any input() triggered error messages will require the derived classes
1720 to redefine restore().
1722 * src/frontends/xforms/FormDocument.C: initialize a few variables to
1723 avoid a segfault. combo_doc_class is the main concern.
1725 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
1727 * Simplify build-listerrors in view of GUI-less export ability!
1729 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1731 * src/lyx_main.C (easyParse): Disable gui when exporting
1733 * src/insets/figinset.C:
1736 * src/lyx_gui_misc.C
1737 * src/tabular.C: Changes to allow no-gui.
1739 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1741 * src/support/utility.hpp: removed file
1742 * src/support/block.h: removed file
1744 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
1747 * src/mathed/formula.C: add support/lyxlib.h
1748 * src/mathed/formulamacro.C: ditto
1750 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
1751 * src/lyxparagraph.h: ditto
1753 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
1754 * src/frontends/Makefile.am (INCLUDES): ditto
1755 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
1756 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
1757 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
1758 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
1759 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
1760 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
1762 * src/BufferView.h: use boost/utility.hpp
1763 * src/LColor.h: ditto
1764 * src/LaTeX.h: ditto
1765 * src/LyXAction.h: ditto
1766 * src/LyXView.h: ditto
1767 * src/bufferlist.h: ditto
1768 * src/lastfiles.h: ditto
1769 * src/layout.h: ditto
1770 * src/lyx_gui.h: ditto
1771 * src/lyx_main.h: ditto
1772 * src/lyxlex.h: ditto
1773 * src/lyxrc.h: ditto
1774 * src/frontends/ButtonPolicies.h: ditto
1775 * src/frontends/Dialogs.h: ditto
1776 * src/frontends/xforms/FormBase.h: ditto
1777 * src/frontends/xforms/FormGraphics.h: ditto
1778 * src/frontends/xforms/FormParagraph.h: ditto
1779 * src/frontends/xforms/FormTabular.h: ditto
1780 * src/graphics/GraphicsCache.h: ditto
1781 * src/graphics/Renderer.h: ditto
1782 * src/insets/ExternalTemplate.h: ditto
1783 * src/insets/insetcommand.h: ditto
1784 * src/support/path.h: ditto
1786 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
1787 and introduce clause for 2.97.
1789 * boost/libs/README: new file
1791 * boost/boost/utility.hpp: new file
1793 * boost/boost/config.hpp: new file
1795 * boost/boost/array.hpp: new file
1797 * boost/Makefile.am: new file
1799 * boost/.cvsignore: new file
1801 * configure.in (AC_OUTPUT): add boost/Makefile
1803 * Makefile.am (SUBDIRS): add boost
1805 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1807 * src/support/lstrings.C (suffixIs): Fixed.
1809 2000-10-01 Allan Rae <rae@lyx.org>
1811 * src/PrinterParams.h: moved things around to avoid the "can't
1812 inline call" warning.
1814 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
1815 into doc++ documentation.
1817 * src/frontends/xforms/FormCommand.[Ch]: support button policy
1819 * src/frontends/xforms/FormRef.C: make use of button controller
1820 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
1821 cleaned up button controller usage.
1822 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
1823 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
1824 use the button controller
1826 * src/frontends/xforms/forms/*.fd: and associated generated files
1827 updated to reflect changes to FormBase. Some other FormXxxx files
1828 also got minor updates to reflect changes to FormBase.
1830 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
1831 (hide): made virtual.
1832 (input): return a bool. true == valid input
1833 (RestoreCB, restore): new
1834 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
1835 Changes to allow derived dialogs to use a ButtonController and
1836 make sense when doing so: OK button calls ok() and so on.
1838 * src/frontends/xforms/ButtonController.h (class ButtonController):
1839 Switch from template implementation to taking Policy parameter.
1840 Allows FormBase to provide a ButtonController for any dialog.
1842 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
1843 Probably should rename connect and disconnect.
1844 (apply): use the radio button groups
1845 (form): needed by FormBase
1846 (build): setup the radio button groups
1848 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
1850 * several files: type changes to reduce the number of warnings and
1851 to unify type hangling a bit. Still much to do.
1853 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1855 * lib/images/*: rename a bunch of icons to match Dekel converter
1858 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
1861 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
1863 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
1865 * sigc++/handle.h: ditto for class Handle.
1867 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
1869 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
1871 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
1873 * src/intl.C (InitKeyMapper): Correct the value of n due to the
1874 removal of the "default" language.
1876 * src/combox.h (getline): Check that sel > 0
1878 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
1880 * lib/examples/docbook_example.lyx
1881 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
1883 * lib/layouts/docbook-book.layout: new docbook book layout.
1885 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
1887 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
1889 * src/insets/figinset.C (DocBook):fixed small typo.
1891 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
1893 * src/insets/insetinclude.h: string include_label doesn't need to be
1896 2000-09-29 Allan Rae <rae@lyx.org>
1898 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
1899 Allow derived type to control connection and disconnection from signals
1900 of its choice if desired.
1902 2000-09-28 Juergen Vigna <jug@sad.it>
1904 * src/insets/insettabular.C (update): fixed cursor setting when
1905 the_locking_inset changed.
1906 (draw): made this a bit cleaner.
1907 (InsetButtonPress): fixed!
1909 * various files: added LyXText Parameter to fitCursor call.
1911 * src/BufferView.C (fitCursor): added LyXText parameter.
1913 * src/insets/insettabular.C (draw): small draw fix.
1915 * src/tabular.C: right setting of left/right celllines.
1917 * src/tabular.[Ch]: fixed various types in funcions and structures.
1918 * src/insets/insettabular.C: ditto
1919 * src/frontends/xforms/FormTabular.C: ditto
1921 2000-09-28 Allan Rae <rae@lyx.org>
1923 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
1924 that the #ifdef's had been applied to part of what should have been
1925 a complete condition. It's possible there are other tests that
1926 were specific to tables that are also wrong now that InsetTabular is
1927 being used. Now we need to fix the output of '\n' after a table in a
1928 float for the same reason as the original condition:
1929 "don't insert this if we would be adding it before or after a table
1930 in a float. This little trick is needed in order to allow use of
1931 tables in \subfigures or \subtables."
1932 Juergen can you check this?
1934 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1936 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
1937 output to the ostream.
1939 * several files: fixed types based on warnings from cxx
1941 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
1943 * src/frontends/kde/Makefile.am: fix rule for
1944 formindexdialogdata_moc.C
1946 * src/.cvsignore: add ext_l10n.h to ignore
1948 * acconfig.h: stop messing with __STRICT_ANSI__
1949 * config/gnome.m4: remove option to set -ansi
1950 * config/kde.m4: remove option to set -ansi
1951 * config/lyxinclude.m4: don't set -ansi
1953 2000-09-27 Juergen Vigna <jug@sad.it>
1955 * various files: remove "default" language check.
1957 * src/insets/insetquotes.C: removed use of current_view.
1959 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
1960 the one should have red ears by now!
1962 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
1963 in more then one paragraph. Fixed cursor-movement/selection.
1965 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
1966 paragraphs inside a text inset.
1968 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
1969 text-inset if this owner is an inset.
1971 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1973 * src/Bullet.h: changed type of font, character and size to int
1975 * src/buffer.C (asciiParagraph): remove actcell and fname1.
1977 * src/insets/inseturl.[Ch]:
1978 * src/insets/insetref.[Ch]:
1979 * src/insets/insetlabel.[Ch]: add linelen to Ascii
1981 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
1983 * src/buffer.C (readFile): block-if statement rearranged to minimise
1984 bloat. Patch does not reverse Jean-Marc's change ;-)
1986 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
1987 Class rewritten to store pointers to hide/update signals directly,
1988 rather than Dialogs *. Also defined an enum to ease use. All xforms
1989 forms can now be derived from this class.
1991 * src/frontends/xforms/FormCommand.[Ch]
1992 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
1994 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
1997 * src/frontends/xforms/forms/form_citation.fd
1998 * src/frontends/xforms/forms/form_copyright.fd
1999 * src/frontends/xforms/forms/form_error.fd
2000 * src/frontends/xforms/forms/form_index.fd
2001 * src/frontends/xforms/forms/form_ref.fd
2002 * src/frontends/xforms/forms/form_toc.fd
2003 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
2005 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
2007 * src/insets/insetfoot.C: removed redundent using directive.
2009 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2011 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
2012 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
2014 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
2015 created in the constructors in different groups. Then set() just
2016 have to show the groups as needed. This fixes the redraw problems
2017 (and is how the old menu code worked).
2019 * src/support/lyxlib.h: declare the methods as static when we do
2020 not have namespaces.
2022 2000-09-26 Juergen Vigna <jug@sad.it>
2024 * src/buffer.C (asciiParagraph): new function.
2025 (writeFileAscii): new function with parameter ostream.
2026 (writeFileAscii): use now asciiParagraph.
2028 * various inset files: added the linelen parameter to the Ascii-func.
2030 * src/tabular.C (Write): fixed error in writing file introduced by
2031 the last changes from Lars.
2033 * lib/bind/menus.bind: removed not supported functions.
2035 * src/insets/insettext.C (Ascii): implemented this function.
2037 * src/insets/lyxinset.h (Ascii): added linelen parameter.
2039 * src/tabular.C (write_attribute[int,string,bool]): new functions.
2040 (Write): use of the write_attribute functions.
2042 * src/bufferlist.C (close): fixed reasking question!
2044 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2046 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
2047 new files use the everwhere possible.
2050 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
2051 src/log_form.C src/lyx.C:
2054 * src/buffer.C (runLaTeX): remove func
2056 * src/PaperLayout.C: removed file
2057 * src/ParagraphExtra.C: likewise
2058 * src/bullet_forms.C: likewise
2059 * src/bullet_forms.h: likewise
2060 * src/bullet_forms_cb.C: likewise
2062 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
2063 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
2066 * several files: remove all traces of the old fd_form_paragraph,
2067 and functions belonging to that.
2069 * several files: remove all traces of the old fd_form_document,
2070 and functions belonging to that.
2072 * several files: constify local variables were possible.
2074 * several files: remove all code that was dead when NEW_EXPORT was
2077 * several files: removed string::c_str in as many places as
2080 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
2081 (e): be a bit more outspoken when patching
2082 (updatesrc): only move files if changed.
2084 * forms/layout_forms.h.patch: regenerated
2086 * forms/layout_forms.fd: remove form_document and form_paragraph
2087 and form_quotes and form_paper and form_table_options and
2088 form_paragraph_extra
2090 * forms/form1.fd: remove form_table
2092 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
2093 the fdui->... rewrite. Update some comments to xforms 0.88
2095 * forms/bullet_forms.C.patch: removed file
2096 * forms/bullet_forms.fd: likewise
2097 * forms/bullet_forms.h.patch: likewise
2099 * development/Code_rules/Rules: added a section on switch
2100 statements. Updated some comment to xforms 0.88.
2102 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2104 * src/buffer.C (readFile): make sure that the whole version number
2105 is read after \lyxformat (even when it contains a comma)
2107 * lib/ui/default.ui: change shortcut of math menu to M-a.
2109 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2111 * src/vspace.C (nextToken): use isStrDbl() to check for proper
2114 * src/LyXView.C (updateWindowTitle): show the full files name in
2115 window title, limited to 30 characters.
2117 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
2118 When a number of characters has been given, we should not assume
2119 that the string is 0-terminated.
2121 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
2122 calls (fixes some memory leaks)
2124 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
2125 trans member on exit.
2127 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2129 * src/converter.C (GetReachable): fix typo.
2131 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
2132 understand ',' instead of '.'.
2133 (GetInteger): rewrite to use strToInt().
2135 2000-09-26 Juergen Vigna <jug@sad.it>
2137 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
2138 better visibility and error-message on wrong VSpace input.
2140 * src/language.C (initL): added english again.
2142 2000-09-25 Juergen Vigna <jug@sad.it>
2144 * src/frontends/kde/Dialogs.C (Dialogs):
2145 * src/frontends/gnome/Dialogs.C (Dialogs):
2146 * src/frontends/kde/Makefile.am:
2147 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
2149 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
2151 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
2153 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
2155 * src/frontends/xforms/FormParagraph.C:
2156 * src/frontends/xforms/FormParagraph.h:
2157 * src/frontends/xforms/form_paragraph.C:
2158 * src/frontends/xforms/form_paragraph.h:
2159 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
2162 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
2164 * src/tabular.C (OldFormatRead): forgot to delete the temporary
2165 Paragraph-Data after use.
2167 * src/insets/insettext.C (LocalDispatch): don't set the layout on
2168 non breakable paragraphs.
2170 2000-09-25 Garst R. Reese <reese@isn.net>
2172 * src/language.C (initL): added missing language_country codes.
2174 2000-09-25 Juergen Vigna <jug@sad.it>
2176 * src/insets/insettext.C (InsetText):
2177 (deleteLyXText): remove the not released LyXText structure!
2179 2000-09-24 Marko Vendelin <markov@ioc.ee>
2181 * src/frontends/gnome/mainapp.C
2182 * src/frontends/gnome/mainapp.h: added support for keyboard
2185 * src/frontends/gnome/FormCitation.C
2186 * src/frontends/gnome/FormCitation.h
2187 * src/frontends/gnome/Makefile.am
2188 * src/frontends/gnome/pixbutton.h: completed the rewrite of
2189 FormCitation to use "action area" in mainapp window
2191 * src/frontends/gnome/Menubar_pimpl.C
2192 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
2195 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
2197 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
2198 width/descent/ascent values if name is empty.
2199 (mathed_string_height): Use std::max.
2201 2000-09-25 Allan Rae <rae@lyx.org>
2203 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
2204 segfault. This will be completely redesigned soon.
2206 * sigc++: updated libsigc++. Fixes struct timespec bug.
2208 * development/tools/makeLyXsigc.sh: .cvsignore addition
2210 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
2212 * several files: removed almost all traces of the old table
2215 * src/TableLayout.C: removed file
2217 2000-09-22 Juergen Vigna <jug@sad.it>
2219 * src/frontends/kde/Dialogs.C: added credits forms.
2221 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
2223 * src/frontends/gnome/Dialogs.C: added some forms.
2225 * src/spellchecker.C (init_spell_checker): set language in pspell code
2226 (RunSpellChecker): some modifications for setting language string.
2228 * src/language.[Ch]: added language_country code.
2230 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
2232 * src/frontends/Dialogs.h: added new signal showError.
2233 Rearranged existing signals in some sort of alphabetical order.
2235 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
2236 FormError.[Ch], form_error.[Ch]
2237 * src/frontends/xforms/forms/makefile: added new file form_error.fd
2238 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
2240 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
2241 dialogs. I think that this can be used as the base to all these
2244 * src/frontends/xforms/FormError.[Ch]
2245 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
2246 implementation of InsetError dialog.
2248 * src/insets/inseterror.[Ch]: rendered GUI-independent.
2250 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
2251 * src/frontends/kde/Makefile.am: ditto
2253 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
2255 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
2256 macrobf. This fixes a bug of invisible text.
2258 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2260 * lib/doc/LaTeXConfig.lyx.in: updated.
2262 * src/language.C (initL): remove language "francais" and change a
2263 bit the names of the two other french variations.
2265 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
2266 string that may not be 0-terminated.
2268 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2270 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
2272 2000-09-20 Marko Vendelin <markov@ioc.ee>
2274 * src/frontends/gnome/FormCitation.C
2275 * src/frontends/gnome/FormIndex.C
2276 * src/frontends/gnome/FormToc.C
2277 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
2278 the variable initialization to shut up the warnings
2280 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2282 * src/table.[Ch]: deleted files
2284 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
2287 2000-09-18 Juergen Vigna <jug@sad.it>
2289 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
2290 problems with selection. Inserted new LFUN_PASTESELECTION.
2291 (InsetButtonPress): inserted handling of middle mouse-button paste.
2293 * src/spellchecker.C: changed word to word.c_str().
2295 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
2297 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
2298 included in the ``make dist'' tarball.
2300 2000-09-15 Juergen Vigna <jug@sad.it>
2302 * src/CutAndPaste.C (cutSelection): small fix return the right
2303 end position after cut inside one paragraph only.
2305 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
2306 we are locked as otherwise we don't have a valid cursor position!
2308 * src/insets/figinset.C (draw): small bugfix but why is this needed???
2310 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
2312 * src/frontends/kde/FormRef.C: added using directive.
2313 * src/frontends/kde/FormToc.C: ditto
2315 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
2317 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
2319 2000-09-19 Marko Vendelin <markov@ioc.ee>
2321 * src/frontends/gnome/Menubar_pimpl.C
2322 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
2323 Toc, ViewFormats, UpdateFormats, and ExportFormats.
2325 * src/frontends/gnome/mainapp.C
2326 * src/frontends/gnome/mainapp.h: support for menu update used
2329 * src/frontends/gnome/mainapp.C
2330 * src/frontends/gnome/mainapp.h: support for "action" area in the
2331 main window. This area is used by small simple dialogs, such as
2334 * src/frontends/gnome/FormIndex.C
2335 * src/frontends/gnome/FormIndex.h
2336 * src/frontends/gnome/FormUrl.C
2337 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
2340 * src/frontends/gnome/FormCitation.C
2341 * src/frontends/gnome/FormCitation.h: rewrite to use main window
2342 action area. Only "Insert new citation" is implemented.
2344 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2346 * src/buffer.C (Dispatch): fix call to Dispatch
2347 * src/insets/insetref.C (Edit): likewise
2348 * src/insets/insetparent.C (Edit): likewise
2349 * src/insets/insetinclude.C (include_cb): likewise
2350 * src/frontends/xforms/FormUrl.C (apply): likewise
2351 * src/frontends/xforms/FormToc.C (apply): likewise
2352 * src/frontends/xforms/FormRef.C (apply): likewise
2353 * src/frontends/xforms/FormIndex.C (apply): likewise
2354 * src/frontends/xforms/FormCitation.C (apply): likewise
2355 * src/lyxserver.C (callback): likewise
2356 * src/lyxfunc.C (processKeySym): likewise
2357 (Dispatch): likewise
2358 (Dispatch): likewise
2359 * src/lyx_cb.C (LayoutsCB): likewise
2361 * Makefile.am (sourcedoc): small change
2363 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2365 * src/main.C (main): Don't make an empty GUIRunTime object. all
2366 methods are static. constify a bit remove unneded using + headers.
2368 * src/tabular.C: some more const to local vars move some loop vars
2370 * src/spellchecker.C: added some c_str after some word for pspell
2372 * src/frontends/GUIRunTime.h: add new static method setDefaults
2373 * src/frontends/xforms/GUIRunTime.C (setDefaults):
2374 * src/frontends/kde/GUIRunTime.C (setDefaults):
2375 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
2377 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
2378 with strnew in arg, use correct emptystring when calling SetName.
2380 * several files: remove all commented code with relation to
2381 HAVE_SSTREAM beeing false. We now only support stringstream and
2384 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2386 * src/lyxfunc.C: construct correctly the automatic new file
2389 * src/text2.C (IsStringInText): change type of variable i to shut
2392 * src/support/sstream.h: do not use namespaces if the compiler
2393 does not support them.
2395 2000-09-15 Marko Vendelin <markov@ioc.ee>
2396 * src/frontends/gnome/FormCitation.C
2397 * src/frontends/gnome/FormCitation.h
2398 * src/frontends/gnome/diainsertcitation_interface.c
2399 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
2400 regexp support to FormCitation [Gnome].
2402 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
2405 * configure.in: remove unused KDE/GTKGUI define
2407 * src/frontends/kde/FormRef.C
2408 * src/frontends/kde/FormRef.h
2409 * src/frontends/kde/formrefdialog.C
2410 * src/frontends/kde/formrefdialog.h: double click will
2411 go to reference, now it is possible to change a cross-ref
2414 * src/frontends/kde/FormToc.C
2415 * src/frontends/kde/FormToc.h
2416 * src/frontends/kde/formtocdialog.C
2417 * src/frontends/kde/formtocdialog.h: add a depth
2420 * src/frontends/kde/Makefile.am: add QtLyXView.h
2423 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
2425 * src/frontends/kde/FormCitation.h: added some using directives.
2427 * src/frontends/kde/FormToc.h: corrected definition of doTree.
2429 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
2432 * src/mathed/math_defs.h: redefine SetAlign to use string rather
2435 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2437 * src/buffer.C (pop_tag): revert for the second time a change by
2438 Lars, who seems to really hate having non-local loop variables :)
2440 * src/Lsstream.h: add "using" statements.
2442 * src/support/copy.C (copy): add a bunch of std:: qualifiers
2443 * src/buffer.C (writeFile): ditto
2445 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2447 * src/buffer.C (writeFile): try to fix the locale modified format
2448 number to always be as we want it.
2450 * src/WorkArea.C (work_area_handler): try to workaround the bugs
2451 in XForms 0.89. C-space is now working again.
2453 * src/Lsstream.h src/support/sstream.h: new files.
2455 * also commented out all cases where strstream were used.
2457 * src/Bullet.h (c_str): remove method.
2459 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
2461 * a lot of files: get rid of "char const *" and "char *" is as
2462 many places as possible. We only want to use them in interaction
2463 with system of other libraries, not inside lyx.
2465 * a lot of files: return const object is not of pod type. This
2466 helps ensure that temporary objects is not modified. And fits well
2467 with "programming by contract".
2469 * configure.in: check for the locale header too
2471 * Makefile.am (sourcedoc): new tag for generation of doc++
2474 2000-09-14 Juergen Vigna <jug@sad.it>
2476 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
2477 callback to check which combo called it and do the right action.
2479 * src/combox.C (combo_cb): added combo * to the callbacks.
2480 (Hide): moved call of callback after Ungrab of the pointer.
2482 * src/intl.h: removed LCombo2 function.
2484 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
2485 function as this can now be handled in one function.
2487 * src/combox.h: added Combox * to callback prototype.
2489 * src/frontends/xforms/Toolbar_pimpl.C:
2490 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
2492 2000-09-14 Garst Reese <reese@isn.net>
2494 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
2495 moved usepackage{xxx}'s to beginning of file. Changed left margin
2496 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
2497 underlining from title. Thanks to John Culleton for useful suggestions.
2499 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2501 * src/lyxlex_pimpl.C (setFile): change error message to debug
2504 2000-09-13 Juergen Vigna <jug@sad.it>
2506 * src/frontends/xforms/FormDocument.C: implemented choice_class
2507 as combox and give callback to combo_language so OK/Apply is activated
2510 * src/bufferlist.C (newFile): small fix so already named files
2511 (via an open call) are not requested to be named again on the
2514 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2516 * src/frontends/kde/Makefile.am
2517 * src/frontends/kde/FormRef.C
2518 * src/frontends/kde/FormRef.h
2519 * src/frontends/kde/formrefdialog.C
2520 * src/frontends/kde/formrefdialog.h: implement
2523 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2525 * src/frontends/kde/formtocdialog.C
2526 * src/frontends/kde/formtocdialog.h
2527 * src/frontends/kde/FormToc.C
2528 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
2530 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
2532 * src/frontends/kde/FormCitation.C: fix thinko
2533 where we didn't always display the reference text
2536 * src/frontends/kde/formurldialog.C
2537 * src/frontends/kde/formurldialog.h
2538 * src/frontends/kde/FormUrl.C
2539 * src/frontends/kde/FormUrl.h: minor cleanups
2541 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
2543 * src/frontends/kde/Makefile.am
2544 * src/frontends/kde/FormToc.C
2545 * src/frontends/kde/FormToc.h
2546 * src/frontends/kde/FormCitation.C
2547 * src/frontends/kde/FormCitation.h
2548 * src/frontends/kde/FormIndex.C
2549 * src/frontends/kde/FormIndex.h
2550 * src/frontends/kde/formtocdialog.C
2551 * src/frontends/kde/formtocdialog.h
2552 * src/frontends/kde/formcitationdialog.C
2553 * src/frontends/kde/formcitationdialog.h
2554 * src/frontends/kde/formindexdialog.C
2555 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
2557 2000-09-12 Juergen Vigna <jug@sad.it>
2559 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
2562 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2564 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
2567 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
2569 * src/converter.C (Add, Convert): Added support for converter flags:
2570 needaux, resultdir, resultfile.
2571 (Convert): Added new parameter view_file.
2572 (dvips_options): Fixed letter paper option.
2574 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
2575 (Export, GetExportableFormats, GetViewableFormats): Added support
2578 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
2580 (easyParse): Fixed to work with new export code.
2582 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
2585 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
2587 * lib/bind/*.bind: Replaced
2588 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
2589 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
2591 2000-09-11 Juergen Vigna <jug@sad.it>
2593 * src/lyx_gui.C (runTime): uses global guiruntime variable.
2595 * src/main.C (main): now GUII defines global guiruntime!
2597 * src/frontends/gnome/GUIRunTime.C (initApplication):
2598 * src/frontends/kde/GUIRunTime.C (initApplication):
2599 * src/frontends/xforms/GUIRunTime.C (initApplication):
2600 * src/frontends/GUIRunTime.h: added new function initApplication.
2602 * src/spellchecker.C (sc_accept_word): change to add_to_session.
2604 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
2606 2000-09-08 Juergen Vigna <jug@sad.it>
2608 * src/lyx_gui.C (create_forms): don't display the "default" entry as
2609 we have already "Reset".
2611 * src/language.C (initL): inserted "default" language and made this
2612 THE default language (and not american!)
2614 * src/paragraph.C: inserted handling of "default" language!
2616 * src/lyxfont.C: ditto
2620 * src/paragraph.C: output the \\par only if we have a following
2621 paragraph otherwise it's not needed.
2623 2000-09-05 Juergen Vigna <jug@sad.it>
2625 * config/pspell.m4: added entry to lyx-flags
2627 * src/spellchecker.C: modified version from Kevin for using pspell
2629 2000-09-01 Marko Vendelin <markov@ioc.ee>
2630 * src/frontends/gnome/Makefile.am
2631 * src/frontends/gnome/FormCitation.C
2632 * src/frontends/gnome/FormCitation.h
2633 * src/frontends/gnome/diainsertcitation_callbacks.c
2634 * src/frontends/gnome/diainsertcitation_callbacks.h
2635 * src/frontends/gnome/diainsertcitation_interface.c
2636 * src/frontends/gnome/diainsertcitation_interface.h
2637 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
2638 dialog for Gnome frontend
2640 * src/main.C: Gnome libraries require keeping application name
2641 and its version as strings
2643 * src/frontends/gnome/mainapp.C: Change the name of the main window
2644 from GnomeLyX to PACKAGE
2646 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2648 * src/frontends/Liason.C: add "using: declaration.
2650 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
2652 * src/mathed/math_macro.C (Metrics): Set the size of the template
2654 * src/mathed/formulamacro.C (Latex): Fixed the returned value
2656 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
2658 * src/converter.C (add_options): New function.
2659 (SetViewer): Change $$FName into '$$FName'.
2660 (View): Add options when running xdvi
2661 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
2662 (Convert): The 3rd parameter is now the desired filename. Converts
2663 calls to lyx::rename if necessary.
2664 Add options when running dvips.
2665 (dvi_papersize,dvips_options): New methods.
2667 * src/exporter.C (Export): Use getLatexName() instead of fileName().
2669 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
2670 using a call to Converter::dvips_options.
2671 Fixed to work with nex export code.
2673 * src/support/copy.C
2674 * src/support/rename.C: New files
2676 * src/support/syscall.h
2677 * src/support/syscall.C: Added Starttype SystemDontWait.
2679 * lib/ui/default.ui: Changed to work with new export code
2681 * lib/configure.m4: Changed to work with new export code
2683 * src/encoding.C: Changed latex name for iso8859_7 encoding.
2685 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
2687 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
2688 so that code compiles with DEC cxx.
2690 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
2691 to work correctly! Also now supports the additional elements
2694 2000-09-01 Allan Rae <rae@lyx.org>
2696 * src/frontends/ButtonPolicies.C: renamed all the references to
2697 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
2699 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
2700 since it's a const not a type.
2702 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
2704 2000-08-31 Juergen Vigna <jug@sad.it>
2706 * src/insets/figinset.C: Various changes to look if the filename has
2707 an extension and if not add it for inline previewing.
2709 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2711 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
2712 make buttonStatus and isReadOnly be const methods. (also reflect
2713 this in derived classes.)
2715 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
2716 (nextState): change to be static inline, pass the StateMachine as
2718 (PreferencesPolicy): remove casts
2719 (OkCancelPolicy): remvoe casts
2720 (OkCancelReadOnlyPolicy): remove casts
2721 (NoRepeatedApplyReadOnlyPolicy): remove casts
2722 (OkApplyCancelReadOnlyPolicy): remove casts
2723 (OkApplyCancelPolicy): remove casts
2724 (NoRepeatedApplyPolicy): remove casts
2726 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
2728 * src/converter.C: added some using directives
2730 * src/frontends/ButtonPolicies.C: changes to overcome
2731 "need lvalue" error with DEC c++
2733 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
2734 to WMHideCB for DEC c++
2736 * src/frontends/xforms/Menubar_pimpl.C: added using directive
2738 * src/frontends/xforms/forms/form_document.C.patch: use C callback
2739 to BulletBMTableCB for DEC c++
2741 2000-08-31 Allan Rae <rae@lyx.org>
2743 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
2744 character dialog separately from old document dialogs combo_language.
2747 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2749 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
2750 Removed LFUN_REF_CREATE.
2752 * src/MenuBackend.C: Added new tags: toc and references
2754 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
2755 (add_lastfiles, add_documents, add_formats): Removed the unused smn
2757 (add_toc, add_references): New methods.
2758 (create_submenu): Handle correctly the case when there is a
2759 seperator after optional menu items.
2761 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
2762 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
2763 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
2765 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
2767 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2769 * src/converter.[Ch]: New file for converting between different
2772 * src/export.[Ch]: New file for exporting a LyX file to different
2775 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
2776 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
2777 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
2778 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
2779 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
2780 RunDocBook, MenuExport.
2782 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
2783 Exporter::Preview methods if NEW_EXPORT is defined.
2785 * src/buffer.C (Dispatch): Use Exporter::Export.
2787 * src/lyxrc.C: Added new tags: \converter and \viewer.
2790 * src/LyXAction.C: Define new lyx-function: buffer-update.
2791 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
2792 when NEW_EXPORT is defined.
2794 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
2796 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
2798 * lib/ui/default.ui: Added submenus "view" and "update" to the
2801 * src/filetools.C (GetExtension): New function.
2803 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
2805 2000-08-29 Allan Rae <rae@lyx.org>
2807 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
2809 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
2810 (EnableDocumentLayout): removed
2811 (DisableDocumentLayout): removed
2812 (build): make use of ButtonController's read-only handling to
2813 de/activate various objects. Replaces both of the above functions.
2815 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
2816 (readOnly): was read_only
2817 (refresh): fixed dumb mistakes with read_only_ handling
2819 * src/frontends/xforms/forms/form_document.fd:
2820 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
2821 tabbed dialogs so the tabs look more like tabs and so its easier to
2822 work out which is the current tab.
2824 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
2825 segfault with form_table
2827 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
2829 2000-08-28 Juergen Vigna <jug@sad.it>
2831 * acconfig.h: added USE_PSPELL.
2833 * src/config.h.in: added USE_PSPELL.
2835 * autogen.sh: added pspell.m4
2837 * config/pspell.m4: new file.
2839 * src/spellchecker.C: implemented support for pspell libary.
2841 2000-08-25 Juergen Vigna <jug@sad.it>
2843 * src/LyXAction.C (init): renamed LFUN_TABLE to
2844 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
2846 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
2848 * src/lyxscreen.h: add force_clear variable and fuction to force
2849 a clear area when redrawing in LyXText.
2851 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
2853 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2855 * some whitespace and comment changes.
2857 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
2859 * src/buffer.C: up te LYX_FORMAT to 2.17
2861 2000-08-23 Juergen Vigna <jug@sad.it>
2863 * src/BufferView_pimpl.C (tripleClick): disable this when in a
2866 * src/insets/insettabular.C (pasteSelection): delete the insets
2867 LyXText as it is not valid anymore.
2868 (copySelection): new function.
2869 (pasteSelection): new function.
2870 (cutSelection): new function.
2871 (LocalDispatch): implemented cut/copy/paste of cell selections.
2873 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
2874 don't have a LyXText.
2876 * src/LyXAction.C (init): a NEW_TABULAR define too much.
2878 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
2881 2000-08-22 Juergen Vigna <jug@sad.it>
2883 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
2884 ifdef form_table out if NEW_TABULAR.
2886 2000-08-21 Juergen Vigna <jug@sad.it>
2888 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
2889 (draw): fixed draw position so that the cursor is positioned in the
2891 (InsetMotionNotify): hide/show cursor so the position is updated.
2892 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
2893 using cellstart() function where it should be used.
2895 * src/insets/insettext.C (draw): ditto.
2897 * src/tabular.C: fixed initialization of some missing variables and
2898 made BoxType into an enum.
2900 2000-08-22 Marko Vendelin <markov@ioc.ee>
2901 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
2902 stock menu item using action numerical value, not its string
2906 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
2908 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
2909 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
2911 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
2913 * src/frontends/xforms/GUIRunTime.C: new file
2915 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
2916 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2918 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
2920 * src/frontends/kde/GUIRunTime.C: new file
2922 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
2923 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2925 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
2927 * src/frontends/gnome/GUIRunTime.C: new file
2929 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
2932 * src/frontends/GUIRunTime.h: removed constructor and destructor,
2933 small change to documetentation.
2935 * src/frontends/GUIRunTime.C: removed file
2937 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
2939 * src/lyxparagraph.h: enable NEW_TABULAR as default
2941 * src/lyxfunc.C (processKeySym): remove some commented code
2943 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
2944 NEW_TABULAR around the fd_form_table_options.
2946 * src/lyx_gui.C (runTime): call the static member function as
2947 GUIRunTime::runTime().
2949 2000-08-21 Allan Rae <rae@lyx.org>
2951 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
2954 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
2956 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
2958 2000-08-21 Allan Rae <rae@lyx.org>
2960 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
2961 keep Garst happy ;-)
2962 * src/frontends/xforms/FormPreferences.C (build): use setOK
2963 * src/frontends/xforms/FormDocument.C (build): use setOK
2964 (FormDocument): use the appropriate policy.
2966 2000-08-21 Allan Rae <rae@lyx.org>
2968 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
2969 automatic [de]activation of arbitrary objects when in a read-only state.
2971 * src/frontends/ButtonPolicies.h: More documentation
2972 (isReadOnly): added to support the above.
2974 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
2976 2000-08-18 Juergen Vigna <jug@sad.it>
2978 * src/insets/insettabular.C (getStatus): changed to return func_status.
2980 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
2981 display toggle menu entries if they are.
2983 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
2984 new document layout now.
2986 * src/lyxfunc.C: ditto
2988 * src/lyx_gui_misc.C: ditto
2990 * src/lyx_gui.C: ditto
2992 * lib/ui/default.ui: removed paper and quotes layout as they are now
2993 all in the document layout tabbed folder.
2995 * src/frontends/xforms/forms/form_document.fd: added Restore
2996 button and callbacks for all inputs for Allan's ButtonPolicy.
2998 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
2999 (CheckChoiceClass): added missing params setting on class change.
3000 (UpdateLayoutDocument): added for updating the layout on params.
3001 (build): forgot to RETURN_ALWAYS input_doc_spacing.
3002 (FormDocument): Implemented Allan's ButtonPolicy with the
3005 2000-08-17 Allan Rae <rae@lyx.org>
3007 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
3008 so we can at least see the credits again.
3010 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
3011 controller calls for the appropriate callbacks. Note that since Ok
3012 calls apply followed by cancel, and apply isn't a valid input for the
3013 APPLIED state, the bc_ calls have to be made in the static callback not
3014 within each of the real callbacks.
3016 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
3017 (setOk): renamed from setOkay()
3019 2000-08-17 Juergen Vigna <jug@sad.it>
3021 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
3022 in the implementation part.
3023 (composeUIInfo): don't show optional menu-items.
3025 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
3027 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
3029 * src/bufferview_funcs.C (CurrentState): fixed to show also the
3030 text-state when in a text-inset.
3032 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
3034 2000-08-17 Marko Vendelin <markov@ioc.ee>
3035 * src/frontends/gnome/FormIndex.C
3036 * src/frontends/gnome/FormIndex.h
3037 * src/frontends/gnome/FormToc.C
3038 * src/frontends/gnome/FormToc.h
3039 * src/frontends/gnome/dialogs
3040 * src/frontends/gnome/diatoc_callbacks.c
3041 * src/frontends/gnome/diatoc_callbacks.h
3042 * src/frontends/gnome/diainsertindex_callbacks.h
3043 * src/frontends/gnome/diainsertindex_callbacks.c
3044 * src/frontends/gnome/diainsertindex_interface.c
3045 * src/frontends/gnome/diainsertindex_interface.h
3046 * src/frontends/gnome/diatoc_interface.h
3047 * src/frontends/gnome/diatoc_interface.c
3048 * src/frontends/gnome/Makefile.am: Table of Contents and
3049 Insert Index dialogs implementation for Gnome frontend
3051 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
3053 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
3055 * src/frontends/gnome/diainserturl_interface.c: make the dialog
3058 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3060 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
3061 destructor. Don't definde if you don't need it
3062 (processEvents): made static, non-blocking events processing for
3064 (runTime): static method. event loop for xforms
3065 * similar as above for kde and gnome.
3067 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
3068 new Pimpl is correct
3069 (runTime): new method calss the real frontends runtime func.
3071 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
3073 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3075 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
3077 2000-08-16 Juergen Vigna <jug@sad.it>
3079 * src/lyx_gui.C (runTime): added GUII RunTime support.
3081 * src/frontends/Makefile.am:
3082 * src/frontends/GUIRunTime.[Ch]:
3083 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
3084 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
3085 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
3087 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
3089 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
3090 as this is already set in ${FRONTEND_INCLUDE} if needed.
3092 * configure.in (CPPFLAGS): setting the include dir for the frontend
3093 directory and don't set FRONTEND=xforms for now as this is executed
3096 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
3098 * src/frontends/kde/Makefile.am:
3099 * src/frontends/kde/FormUrl.C:
3100 * src/frontends/kde/FormUrl.h:
3101 * src/frontends/kde/formurldialog.h:
3102 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
3104 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
3106 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
3108 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3110 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
3113 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
3115 * src/WorkArea.C (work_area_handler): more work to get te
3116 FL_KEYBOARD to work with xforms 0.88 too, please test.
3118 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
3120 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
3122 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
3125 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3127 * src/Timeout.h: remove Qt::emit hack.
3129 * several files: changes to allo doc++ compilation
3131 * src/lyxfunc.C (processKeySym): new method
3132 (processKeyEvent): comment out if FL_REVISION < 89
3134 * src/WorkArea.C: change some debugging levels.
3135 (WorkArea): set wantkey to FL_KEY_ALL
3136 (work_area_handler): enable the FL_KEYBOARD clause, this enables
3137 clearer code and the use of compose with XForms 0.89. Change to
3138 use signals instead of calling methods in bufferview directly.
3140 * src/Painter.C: change some debugging levels.
3142 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
3145 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
3146 (workAreaKeyPress): new method
3148 2000-08-14 Juergen Vigna <jug@sad.it>
3150 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
3152 * config/kde.m4: addes some features
3154 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
3155 include missing xforms dialogs.
3157 * src/Timeout.h: a hack to be able to compile with qt/kde.
3159 * sigc++/.cvsignore: added acinclude.m4
3161 * lib/.cvsignore: added listerros
3163 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
3164 xforms tree as objects are needed for other frontends.
3166 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
3167 linking with not yet implemented xforms objects.
3169 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
3171 2000-08-14 Baruch Even <baruch.even@writeme.com>
3173 * src/frontends/xforms/FormGraphics.h:
3174 * src/frontends/xforms/FormGraphics.C:
3175 * src/frontends/xforms/RadioButtonGroup.h:
3176 * src/frontends/xforms/RadioButtonGroup.C:
3177 * src/insets/insetgraphics.h:
3178 * src/insets/insetgraphics.C:
3179 * src/insets/insetgraphicsParams.h:
3180 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
3181 instead of spaces, and various other indentation issues to make the
3182 sources more consistent.
3184 2000-08-14 Marko Vendelin <markov@ioc.ee>
3186 * src/frontends/gnome/dialogs/diaprint.glade
3187 * src/frontends/gnome/FormPrint.C
3188 * src/frontends/gnome/FormPrint.h
3189 * src/frontends/gnome/diaprint_callbacks.c
3190 * src/frontends/gnome/diaprint_callbacks.h
3191 * src/frontends/gnome/diaprint_interface.c
3192 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
3195 * src/frontends/gnome/dialogs/diainserturl.glade
3196 * src/frontends/gnome/FormUrl.C
3197 * src/frontends/gnome/FormUrl.h
3198 * src/frontends/gnome/diainserturl_callbacks.c
3199 * src/frontends/gnome/diainserturl_callbacks.h
3200 * src/frontends/gnome/diainserturl_interface.c
3201 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
3202 Gnome implementation
3204 * src/frontends/gnome/Dialogs.C
3205 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
3206 all other dialogs. Copy all unimplemented dialogs from Xforms
3209 * src/frontends/gnome/support.c
3210 * src/frontends/gnome/support.h: support files generated by Glade
3214 * config/gnome.m4: Gnome configuration scripts
3216 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
3217 configure --help message
3219 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
3220 only if there are no events pendling in Gnome/Gtk. This enhances
3221 the performance of menus.
3224 2000-08-14 Allan Rae <rae@lyx.org>
3226 * lib/Makefile.am: listerrors cleaning
3228 * lib/listerrors: removed -- generated file
3229 * acinclude.m4: ditto
3230 * sigc++/acinclude.m4: ditto
3232 * src/frontends/xforms/forms/form_citation.fd:
3233 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
3236 * src/frontends/xforms/forms/makefile: I renamed the `install` target
3237 `updatesrc` and now we have a `test` target that does what `updatesrc`
3238 used to do. I didn't like having an install target that wasn't related
3241 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
3242 on all except FormGraphics. This may yet happen. Followed by a major
3243 cleanup including using FL_TRANSIENT for most of the dialogs. More
3244 changes to come when the ButtonController below is introduced.
3246 * src/frontends/xforms/ButtonController.h: New file for managing up to
3247 four buttons on a dialog according to an externally defined policy.
3248 * src/frontends/xforms/Makefile.am: added above
3250 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
3251 Apply and Cancel/Close buttons and everything in between and beyond.
3252 * src/frontends/Makefile.am: added above.
3254 * src/frontends/xforms/forms/form_preferences.fd:
3255 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
3256 and removed variable 'status' as a result. Fixed the set_minsize thing.
3257 Use the new screen-font-update after checking screen fonts were changed
3258 Added a "Restore" button to restore the original lyxrc values while
3259 editing. This restores everything not just the last input changed.
3260 That's still a tricky one. As is the "LyX: this shouldn't happen..."
3262 * src/LyXAction.C: screen-font-update added for updating buffers after
3263 screen font settings have been changed.
3264 * src/commandtags.h: ditto
3265 * src/lyxfunc.C: ditto
3267 * forms/lyx.fd: removed screen fonts dialog.
3268 * src/lyx_gui.C: ditto
3269 * src/menus.[Ch]: ditto
3270 * src/lyx.[Ch]: ditto
3271 * src/lyx_cb.C: ditto + code from here moved to make
3272 screen-font-update. And people wonder why progress on GUII is
3273 slow. Look at how scattered this stuff was! It takes forever
3276 * forms/fdfix.sh: Fixup the spacing after commas.
3277 * forms/makefile: Remove date from generated files. Fewer clashes now.
3278 * forms/bullet_forms.C.patch: included someones handwritten changes
3280 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
3281 once I've discovered why LyXRC was made noncopyable.
3282 * src/lyx_main.C: ditto
3284 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
3286 * src/frontends/xforms/forms/fdfix.sh:
3287 * src/frontends/xforms/forms/fdfixh.sed:
3288 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
3289 * src/frontends/xforms/Form*.[hC]:
3290 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
3291 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
3292 provide a destructor for the struct FD_form_xxxx. Another version of
3293 the set_[max|min]size workaround and a few other cleanups. Actually,
3294 Angus' patch from 20000809.
3296 2000-08-13 Baruch Even <baruch.even@writeme.com>
3298 * src/insets/insetgraphics.C (Clone): Added several fields that needed
3301 2000-08-11 Juergen Vigna <jug@sad.it>
3303 * src/insets/insetgraphics.C (InsetGraphics): changing init
3304 order because of warnings.
3306 * src/frontends/xforms/forms/makefile: adding patching .C with
3309 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
3310 from .C.patch to .c.patch
3312 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
3313 order because of warning.
3315 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
3317 * src/frontends/Liason.C (setMinibuffer): new helper function
3319 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
3321 * src/lyxfunc.C (Dispatch): calling new Document-Layout
3323 * lib/ui/default.ui: commented out PaperLayout entry
3325 * src/frontends/xforms/form_document.[Ch]: new added files
3327 * src/frontends/xforms/FormDocument.[Ch]: ditto
3329 * src/frontends/xforms/forms/form_document.fd: ditto
3331 * src/frontends/xforms/forms/form_document.C.patch: ditto
3333 2000-08-10 Juergen Vigna <jug@sad.it>
3335 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
3336 (InsetGraphics): initialized cacheHandle to 0.
3337 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
3339 2000-08-10 Baruch Even <baruch.even@writeme.com>
3341 * src/graphics/GraphicsCache.h:
3342 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
3343 correctly as a cache.
3345 * src/graphics/GraphicsCacheItem.h:
3346 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
3349 * src/graphics/GraphicsCacheItem_pimpl.h:
3350 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
3353 * src/insets/insetgraphics.h:
3354 * src/insets/insetgraphics.C: Changed from using a signal notification
3355 to polling when image is not loaded.
3357 2000-08-10 Allan Rae <rae@lyx.org>
3359 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
3360 that there are two functions that have to been taken out of line by
3361 hand and aren't taken care of in the script. (Just a reminder note)
3363 * sigc++/macros/*.h.m4: Updated as above.
3365 2000-08-09 Juergen Vigna <jug@sad.it>
3367 * src/insets/insettext.C (draw): small fix for clearing rectangle.
3369 * src/insets/insettabular.C: make drawing of single cell smarter.
3371 2000-08-09 Marko Vendelin <markov@ioc.ee>
3372 * src/frontends/gnome/Menubar_pimpl.C
3373 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
3374 implementation: new files
3376 * src/frontends/gnome/mainapp.C
3377 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
3380 * src/main.C: create Gnome main window
3382 * src/frontends/xforms/Menubar_pimpl.h
3383 * src/frontends/Menubar.C
3384 * src/frontends/Menubar.h: added method Menubar::update that calls
3385 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
3387 * src/LyXView.C: calls Menubar::update to update the state
3390 * src/frontends/gnome/Makefile.am: added new files
3392 * src/frontends/Makefile.am: added frontend compiler options
3394 2000-08-08 Juergen Vigna <jug@sad.it>
3396 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
3398 * src/bufferlist.C (close):
3399 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
3400 documents if exiting without saving.
3402 * src/buffer.C (save): use removeAutosaveFile()
3404 * src/support/filetools.C (removeAutosaveFile): new function.
3406 * src/lyx_cb.C (MenuWrite): returns a bool now.
3407 (MenuWriteAs): check if file could really be saved and revert to the
3409 (MenuWriteAs): removing old autosavefile if existant.
3411 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
3412 before Goto toggle declaration, because of compiler warning.
3414 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
3416 * src/lyxfunc.C (MenuNew): small fix.
3418 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
3420 * src/bufferlist.C (newFile):
3421 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
3423 * src/lyxrc.C: added new_ask_filename tag
3425 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
3427 * src/lyx.fd: removed code pertaining to form_ref
3428 * src/lyx.[Ch]: ditto
3429 * src/lyx_cb.C: ditto
3430 * src/lyx_gui.C: ditto
3431 * src/lyx_gui_misc.C: ditto
3433 * src/BufferView_pimpl.C (restorePosition): update buffer only
3436 * src/commandtags.h (LFUN_REFTOGGLE): removed
3437 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
3438 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
3439 (LFUN_REFBACK): renamed LFUN_REF_BACK
3441 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
3442 * src/menus.C: ditto
3443 * src/lyxfunc.C (Dispatch): ditto.
3444 InsertRef dialog is now GUI-independent.
3446 * src/texrow.C: added using std::endl;
3448 * src/insets/insetref.[Ch]: strip out large amounts of code.
3449 The inset is now a container and this functionality is now
3450 managed by a new FormRef dialog
3452 * src/frontends/Dialogs.h (showRef, createRef): new signals
3454 * src/frontends/xforms/FormIndex.[Ch],
3455 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
3456 when setting dialog's min/max size
3457 * src/frontends/xforms/FormIndex.[Ch]: ditto
3459 * src/frontends/xforms/FormRef.[Ch],
3460 src/frontends/xforms/forms/form_ref.fd: new xforms
3461 implementation of an InsetRef dialog
3463 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
3466 * src/graphics/XPM_Renderer.C (isImageFormatOK):
3467 ios::nocreate is not part of the standard. Removed.
3469 2000-08-07 Baruch Even <baruch.even@writeme.com>
3471 * src/graphics/Renderer.h:
3472 * src/graphics/Renderer.C: Added base class for rendering of different
3473 image formats into Pixmaps.
3475 * src/graphics/XPM_Renderer.h:
3476 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
3477 in a different class.
3479 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
3480 easily add support for other formats.
3482 * src/insets/figinset.C: plugged a leak of an X resource.
3484 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
3486 * src/CutAndPaste.[Ch]: make all metods static.
3488 * development/Code_rules/Rules: more work, added section on
3489 Exceptions, and a References section.
3491 * a lot of header files: work to make doc++ able to generate the
3492 source documentation, some workarounds of doc++ problems. Doc++ is
3493 now able to generate the documentation.
3495 2000-08-07 Juergen Vigna <jug@sad.it>
3497 * src/insets/insettabular.C (recomputeTextInsets): removed function
3499 * src/tabular.C (SetWidthOfMulticolCell):
3501 (calculate_width_of_column_NMC): fixed return value so that it really
3502 only returns true if the column-width has changed (there where
3503 problems with muliticolumn-cells in this column).
3505 2000-08-04 Juergen Vigna <jug@sad.it>
3507 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
3508 also on the scrollstatus of the inset.
3509 (workAreaMotionNotify): ditto.
3511 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
3513 2000-08-01 Juergen Vigna <jug@sad.it>
3515 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
3517 * src/commandtags.h:
3518 * src/LyXAction.C (init):
3519 * src/insets/inset.C (LocalDispatch): added support for
3522 * src/insets/inset.C (scroll): new functions.
3524 * src/insets/insettext.C (removeNewlines): new function.
3525 (SetAutoBreakRows): removes forced newlines in the text of the
3526 paragraph if autoBreakRows is set to false.
3528 * src/tabular.C (Latex): generates a parbox around the cell contents
3531 * src/frontends/xforms/FormTabular.C (local_update): removed
3532 the radio_useparbox button.
3534 * src/tabular.C (UseParbox): new function
3536 2000-08-06 Baruch Even <baruch.even@writeme.com>
3538 * src/graphics/GraphicsCache.h:
3539 * src/graphics/GraphicsCache.C:
3540 * src/graphics/GraphicsCacheItem.h:
3541 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
3544 * src/insets/insetgraphics.h:
3545 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
3546 and the drawing of the inline image.
3548 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
3549 loaded into the wrong position.
3551 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
3554 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3556 * src/support/translator.h: move all typedefs to public section
3558 * src/support/filetools.C (MakeLatexName): return string const
3560 (TmpFileName): ditto
3561 (FileOpenSearch): ditto
3563 (LibFileSearch): ditto
3564 (i18nLibFileSearch): ditto
3567 (CreateTmpDir): ditto
3568 (CreateBufferTmpDir): ditto
3569 (CreateLyXTmpDir): ditto
3572 (MakeAbsPath): ditto
3574 (OnlyFilename): ditto
3576 (NormalizePath): ditto
3577 (CleanupPath): ditto
3578 (GetFileContents): ditto
3579 (ReplaceEnvironmentPath): ditto
3580 (MakeRelPath): ditto
3582 (ChangeExtension): ditto
3583 (MakeDisplayPath): ditto
3584 (do_popen): return cmdret const
3585 (findtexfile): return string const
3587 * src/support/DebugStream.h: add some /// to please doc++
3589 * src/frontends/DialogBase.h (endif): add some /// to please doc++
3591 * src/texrow.C (same_rownumber): functor to use with find_if
3592 (getIdFromRow): rewritten to use find_if and to not update the
3593 positions. return true if row is found
3594 (increasePos): new method, use to update positions
3596 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
3598 * src/lyxlex_pimpl.C (verifyTable): new method
3601 (GetString): return string const
3602 (pushTable): rewrite to use std::stack
3604 (setFile): better check
3607 * src/lyxlex.h: make LyXLex noncopyable
3609 * src/lyxlex.C (text): return char const * const
3610 (GetString): return string const
3611 (getLongString): return string const
3613 * src/lyx_gui_misc.C (askForText): return pair<...> const
3615 * src/lastfiles.[Ch] (operator): return string const
3617 * src/buffer.C (parseSingleLyXformat2Token): pass string to
3618 istringstream not char const *.
3619 move token.end() out of loop.
3620 (readFile): move initializaton of token
3622 * src/BufferView2.C (insertErrors): run texrow.increasePos if
3623 getIdFromRow is successful.
3625 * lib/bind/emacs.bind: don't include menus bind
3627 * development/Code_rules/Rules: the beginnings of making this
3628 better and covering more of the unwritten rules that we have.
3630 * development/Code_rules/Recommendations: a couple of wording
3633 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3635 * src/support/strerror.c: remove C++ comment.
3637 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
3639 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
3640 LFUN_INDEX_INSERT_LAST
3642 * src/texrow.C (getIdFromRow): changed from const_iterator to
3643 iterator, allowing code to compile with DEC cxx
3645 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
3646 stores part of the class, as suggested by Allan. Will allow
3648 (apply): test to apply uses InsetCommandParams operator!=
3650 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
3651 (apply): test to apply uses InsetCommandParams operator!=
3653 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
3654 stores part of the class.
3655 (update): removed limits on min/max size.
3657 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
3658 (apply): test to apply uses InsetCommandParams operator!=
3660 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
3661 (Read, Write, scanCommand, getCommand): moved functionality
3662 into InsetCommandParams.
3664 (getScreenLabel): made pure virtual
3665 new InsetCommandParams operators== and !=
3667 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
3668 c-tors based on InsetCommandParams. Removed others.
3669 * src/insets/insetinclude.[Ch]: ditto
3670 * src/insets/insetlabel.[Ch]: ditto
3671 * src/insets/insetparent.[Ch]: ditto
3672 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
3674 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
3675 insets derived from InsetCommand created using similar c-tors
3676 based on InsetCommandParams
3677 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
3678 * src/menus.C (ShowRefsMenu): ditto
3679 * src/paragraph.C (Clone): ditto
3680 * src/text2.C (SetCounter): ditto
3681 * src/lyxfunc.C (Dispatch) ditto
3682 Also recreated old InsetIndex behaviour exactly. Can now
3683 index-insert at the start of a paragraph and index-insert-last
3684 without launching the pop-up.
3686 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3688 * lib/lyxrc.example: mark te pdf options as non functional.
3690 * src/support/lstrings.C (strToInt): move initalization of tmpstr
3691 (isStrDbl): move tmpstr.end() out of loop.
3692 (strToDbl): move intialization of tmpstr
3693 (lowercase): return string const and move tmp.end() out of loop.
3694 (uppercase): return string const and move tmp.edn() out of loop.
3695 (prefixIs): add assertion
3700 (containsOnly): ditto
3701 (containsOnly): ditto
3702 (containsOnly): ditto
3703 (countChar): make last arg char not char const
3704 (token): return string const
3705 (subst): return string const, move tmp.end() out of loop.
3706 (subst): return string const, add assertion
3707 (strip): return string const
3708 (frontStrip): return string const, add assertion
3709 (frontStrip): return string const
3714 * src/support/lstrings.C: add inclde "LAssert.h"
3715 (isStrInt): move tmpstr.end() out of loop.
3717 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
3718 toollist.end() out of loop.
3719 (deactivate): move toollist.end() out of loop.
3720 (update): move toollist.end() out of loop.
3721 (updateLayoutList): move tc.end() out of loop.
3722 (add): move toollist.end() out of loop.
3724 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
3725 md.end() out of loop.
3727 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
3729 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
3732 * src/paragraph.C (Erase): move fontlist.end() out of loop.
3733 (Erase): move insetlist.end() out of loop.
3735 * src/lyx_sendfax_main.C: make show_logfile static and to take a
3736 ref to const string as first arg. Move initialization of some
3737 variables, whitespace changes.
3739 * src/kbmap.C (defkey): move table.end() out of loop.
3740 (kb_keymap): move table.end() out of loop.
3741 (findbinding): move table.end() out of loop.
3743 * src/MenuBackend.C (hasMenu): move end() out of loop.
3744 (getMenu): move end() out of loop.
3745 (getMenu): move menulist_.end() out of loop.
3747 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
3749 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
3752 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
3753 (getFromLyXName): move infotab.end() out of loop.
3755 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
3756 -fvtable-thunks -ffunction-sections -fdata-sections
3758 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
3760 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
3763 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3765 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
3767 * src/frontends/xforms/FormCitation.[Ch],
3768 src/frontends/xforms/FormIndex.[Ch],
3769 src/frontends/xforms/FormToc.[Ch],
3770 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
3772 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3774 * src/commandtags.h: renamed, created some flags for citation
3777 * src/lyx_gui_misc.C: stripped out old FD_index_form code
3779 * src/lyxfunc.C (dispatch): use signals to insert index entry
3781 * src/frontends/Dialogs.h: new signal createIndex
3783 * src/frontends/xforms/FormCommand.[Ch],
3784 src/frontends/xforms/FormCitation.[Ch],
3785 src/frontends/xforms/FormToc.[Ch],
3786 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
3788 * src/insets/insetindex.[Ch]: GUI-independent
3790 * src/frontends/xforms/FormIndex.[Ch],
3791 * src/frontends/xforms/forms/form_index.fd: xforms implementation
3794 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
3796 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
3797 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
3799 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3801 * src/insets/insetref.C (Latex): rewrite so that there is now
3802 question that a initialization is requested.
3804 * src/insets/insetcommand.h: reenable the hide signal
3806 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3808 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
3809 fix handling of shortcuts (many bugs :)
3810 (add_lastfiles): ditto.
3812 * lib/ui/default.ui: fix a few shortcuts.
3814 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
3816 * Makefile.am: Fix ``rpmdist'' target to return the exit
3817 status of the ``rpm'' command, instead of the last command in
3818 the chain (the ``rm lyx.xpm'' command, which always returns
3821 2000-08-02 Allan Rae <rae@lyx.org>
3823 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
3824 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
3825 * src/frontends/xforms/FormToc.C (FormToc): ditto
3827 * src/frontends/xforms/Makefile.am: A few forgotten files
3829 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
3830 Signals-not-copyable-problem Lars' started commenting out.
3832 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
3834 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3836 * src/insets/insetcommand.h: Signals is not copyable so anoter
3837 scheme for automatic hiding of forms must be used.
3839 * src/frontends/xforms/FormCitation.h: don't inerit from
3840 noncopyable, FormCommand already does that.
3841 * src/frontends/xforms/FormToc.h: ditto
3842 * src/frontends/xforms/FormUrl.h: ditto
3844 * src/frontends/xforms/FormCitation.C: add include <algorithm>
3846 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
3848 * src/insets/insetcommand.h (hide): new SigC::Signal0
3849 (d-tor) new virtual destructor emits hide signal
3851 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
3852 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
3854 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
3855 LOF and LOT. Inset is now GUI-independent
3857 * src/insets/insetloa.[Ch]: redundant
3858 * src/insets/insetlof.[Ch]: ditto
3859 * src/insets/insetlot.[Ch]: ditto
3861 * src/frontends/xforms/forms/form_url.fd: tweaked!
3862 * src/frontends/xforms/forms/form_citation.fd: ditto
3864 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
3865 dialogs dealing with InsetCommand insets
3867 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
3868 FormCommand base class
3869 * src/frontends/xforms/FormUrl.[Ch]: ditto
3871 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
3873 * src/frontends/xforms/FormToc.[Ch]: ditto
3875 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
3876 passed a generic InsetCommand pointer
3877 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
3879 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
3880 and modified InsetTOC class
3881 * src/buffer.C: ditto
3883 * forms/lyx.fd: strip out old FD_form_toc code
3884 * src/lyx_gui_misc.C: ditto
3885 * src/lyx_gui.C: ditto
3886 * src/lyx_cb.C: ditto
3887 * src/lyx.[Ch]: ditto
3889 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3891 * src/support/utility.hpp: tr -d '\r'
3893 2000-08-01 Juergen Vigna <jug@sad.it>
3895 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
3897 * src/commandtags.h:
3898 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
3899 LFUN_TABULAR_FEATURES.
3901 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
3902 LFUN_LAYOUT_TABULAR.
3904 * src/insets/insettabular.C (getStatus): implemented helper function.
3906 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
3908 2000-07-31 Juergen Vigna <jug@sad.it>
3910 * src/text.C (draw): fixed screen update problem for text-insets.
3912 * src/text2.C (SetParagrpah): call an update of the inset-owner when
3913 something changed probably this has to be added in various other
3916 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
3918 2000-07-31 Baruch Even <baruch.even@writeme.com>
3920 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
3921 templates to satisfy compaq cxx.
3924 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3926 * src/support/translator.h (equal_1st_in_pair::operator()): take
3927 const ref pair_type as arg.
3928 (equal_2nd_in_pair::operator()): ditto
3929 (Translator::~Translator): remove empty d-tor.
3931 * src/graphics/GraphicsCache.C: move include config.h to top, also
3932 put initialization of GraphicsCache::singleton here.
3933 (~GraphicsCache): move here
3934 (addFile): take const ref as arg
3937 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
3939 * src/BufferView2.C (insertLyXFile): change te with/without header
3942 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3944 * src/frontends/xforms/FormGraphics.C (apply): add some
3945 static_cast. Not very nice, but required by compaq cxx.
3947 * src/frontends/xforms/RadioButtonGroup.h: include header
3948 <utility> instead of <pair.h>
3950 * src/insets/insetgraphicsParams.C: add using directive.
3951 (readResize): change return type to void.
3952 (readOrigin): ditto.
3954 * src/lyxfunc.C (getStatus): add missing break for build-program
3955 function; add test for Literate for export functions.
3957 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
3958 entries in Options menu.
3960 2000-07-31 Baruch Even <baruch.even@writeme.com>
3962 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
3963 protect against auto-allocation; release icon when needed.
3965 2000-07-31 Matej Cepl <CeplM@seznam.cz>
3967 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
3968 on usual typewriter.
3970 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
3971 earlier czech.kmap), useful only for programming.
3973 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3975 * src/frontends/xforms/FormCitation.h: fix conditioning around
3978 2000-07-31 Juergen Vigna <jug@sad.it>
3980 * src/frontends/xforms/FormTabular.C (local_update): changed
3981 radio_linebreaks to radio_useparbox and added radio_useminipage.
3983 * src/tabular.C: made support for using minipages/parboxes.
3985 * src/bufferlist.C (QwriteAll): small fix for asking for save.
3987 * src/insets/insetgraphics.C (draw): just draw the inset so that the
3989 (descent): so the cursor is in the middle.
3990 (width): bit smaller box.
3992 * src/insets/insetgraphics.h: added display() function.
3994 2000-07-31 Baruch Even <baruch.even@writeme.com>
3996 * src/frontends/Dialogs.h: Added showGraphics signals.
3998 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
3999 xforms form definition of the graphics dialog.
4001 * src/frontends/xforms/FormGraphics.h:
4002 * src/frontends/xforms/FormGraphics.C: Added files, the
4003 GUIndependent code of InsetGraphics
4005 * src/insets/insetgraphics.h:
4006 * src/insets/insetgraphics.C: Major writing to make it work.
4008 * src/insets/insetgraphicsParams.h:
4009 * src/insets/insetgraphicsParams.C: Added files, parameter passing
4010 struct between InsetGraphics and GUI.
4012 * src/LaTeXFeatures.h:
4013 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
4014 support for graphicx package.
4016 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
4017 for the graphics inset.
4019 * src/support/translator.h: Added file, used in
4020 InsetGraphicsParams. this is a template to translate between two
4023 * src/frontends/xforms/RadioButtonGroup.h:
4024 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
4025 way to easily control a radio button group.
4027 2000-07-28 Juergen Vigna <jug@sad.it>
4029 * src/insets/insettabular.C (LocalDispatch):
4030 (TabularFeatures): added support for lyx-functions of tabular features.
4031 (cellstart): refixed this function after someone wrongly changed it.
4033 * src/commandtags.h:
4034 * src/LyXAction.C (init): added support for tabular-features
4036 2000-07-28 Allan Rae <rae@lyx.org>
4038 * src/frontends/xforms/FormPreferences.C (build): Setup input return
4039 checking. NOTE: It seems that pressing ESC to cancel the dialog also
4040 triggers the callback for input checking. As a result we sometimes get
4041 "LyX: This shouldn't happen..." printed to cerr.
4042 (input): Started using status variable since I only free() on
4043 destruction. Some input checking for paths and font sizes.
4045 * src/frontends/xforms/FormPreferences.h: Use status to control
4046 activation of Ok and Apply
4048 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
4049 callback. Also resized to stop segfaults with 0.88. The problem is
4050 that xforms-0.88 requires the folder to be wide enough to fit all the
4051 tabs. If it isn't it causes all sorts of problems.
4053 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
4055 * src/frontends/xforms/forms/README: Reflect reality.
4057 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
4058 * src/frontends/xforms/forms/makefile: ditto.
4060 * src/commandtags.h: Get access to new Preferences dialog
4061 * src/LyXAction.C: ditto
4062 * src/lyxfunc.C: ditto
4063 * lib/ui/default.ui: ditto
4065 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4067 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
4069 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
4072 * src/frontends/xforms/form_url.[Ch]: added.
4074 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4076 * src/insets/insetbib.h: fixed bug in previous commit
4078 * src/frontends/xforms/FormUrl.h: ditto
4080 * src/frontends/xforms/FormPrint.h: ditto
4082 * src/frontends/xforms/FormPreferences.h: ditto
4084 * src/frontends/xforms/FormCopyright.h: ditto
4086 * src/frontends/xforms/FormCitation.C: ditto
4088 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
4089 private copyconstructor and private default contructor
4091 * src/support/Makefile.am: add utility.hpp
4093 * src/support/utility.hpp: new file from boost
4095 * src/insets/insetbib.h: set owner in clone
4097 * src/frontends/xforms/FormCitation.C: added missing include
4100 * src/insets/form_url.[Ch]: removed
4102 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
4104 * development/lyx.spec.in
4105 * Makefile.am: Fix buglet for LyX RPM generation resulting from
4106 file/directory re-organization.
4108 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
4110 * src/insets/insetcommand.[Ch]: moved the string data and
4111 associated manipulation methods into a new stand-alone class
4112 InsetCommandParams. This class has two additional methods
4113 getAsString() and setFromString() allowing the contents to be
4114 moved around as a single string.
4115 (addContents) method removed.
4116 (setContents) method no longer virtual.
4118 * src/buffer.C (readInset): made use of new InsetCitation,
4119 InsetUrl constructors based on InsetCommandParams.
4121 * src/commandtags.h: add LFUN_INSERT_URL
4123 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
4124 independent InsetUrl and use InsetCommandParams to extract
4125 string info and create new Insets.
4127 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
4129 * src/frontends/xforms/FormCitation.C (apply): uses
4132 * src/frontends/xforms/form_url.C
4133 * src/frontends/xforms/form_url.h
4134 * src/frontends/xforms/FormUrl.h
4135 * src/frontends/xforms/FormUrl.C
4136 * src/frontends/xforms/forms/form_url.fd: new files
4138 * src/insets/insetcite.[Ch]: removed unused constructors.
4140 * src/insets/insetinclude.[Ch]: no longer store filename
4142 * src/insets/inseturl.[Ch]: GUI-independent.
4144 2000-07-26 Juergen Vigna <jug@sad.it>
4145 * renamed frontend from gtk to gnome as it is that what is realized
4146 and did the necessary changes in the files.
4148 2000-07-26 Marko Vendelin <markov@ioc.ee>
4150 * configure.in: cleaning up gnome configuration scripts
4152 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4154 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
4155 shortcuts syndrom by redrawing them explicitely (a better solution
4156 would be appreciated).
4158 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
4160 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
4163 * src/lyx_cb.C (MenuExport): change html export to do the right
4164 thing depending of the document type (instead of having
4165 html-linuxdoc and html-docbook).
4166 * src/lyxfunc.C (getStatus): update for html
4167 * lib/ui/default.ui: simplify due to the above change.
4168 * src/menus.C (ShowFileMenu): update too (in case we need it).
4170 * src/MenuBackend.C (read): if a menu is defined twice, add the
4171 new entries to the exiting one.
4173 2000-07-26 Juergen Vigna <jug@sad.it>
4175 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
4177 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
4178 and return a bool if it did actual save the file.
4179 (AutoSave): don't autosave a unnamed doc.
4181 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
4182 check if this is an UNNAMED new file and react to it.
4183 (newFile): set buffer to unnamed and change to not mark a new
4184 buffer dirty if I didn't do anything with it.
4186 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
4188 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4190 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
4191 friend as per Angus's patch posted to lyx-devel.
4193 * src/ext_l10n.h: updated
4195 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
4196 gettext on the style string right before inserting them into the
4199 * autogen.sh: add code to extract style strings form layout files,
4200 not good enough yet.
4202 * src/frontends/gtk/.cvsignore: add MAKEFILE
4204 * src/MenuBackend.C (read): run the label strings through gettext
4205 before storing them in the containers.
4207 * src/ext_l10n.h: new file
4209 * autogen.sh : generate the ext_l10n.h file here
4211 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4213 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
4216 * lib/ui/default.ui: fix a couple of typos.
4218 * config/gnome/gtk.m4: added (and added to the list of files in
4221 * src/insets/insetinclude.C (unique_id): fix when we are using
4222 lyxstring instead of basic_string<>.
4223 * src/insets/insettext.C (LocalDispatch): ditto.
4224 * src/support/filetools.C: ditto.
4226 * lib/configure.m4: create the ui/ directory if necessary.
4228 * src/LyXView.[Ch] (updateToolbar): new method.
4230 * src/BufferView_pimpl.C (buffer): update the toolbar when
4231 opening/closing buffer.
4233 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4235 * src/LyXAction.C (getActionName): enhance to return also the name
4236 and options of pseudo-actions.
4237 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
4239 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
4240 as an example of what is possible). Used in File->Build too (more
4241 useful) and in the import/export menus (to mimick the complicated
4242 handling of linuxdoc and friends). Try to update all the entries.
4244 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
4247 * src/MenuBackend.C (read): Parse the new OptItem tag.
4249 * src/MenuBackend.h: Add a new optional_ data member (used if the
4250 entry should be omitted when the lyxfunc is disabled).
4252 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
4253 function, used as a shortcut.
4254 (create_submenu): align correctly the shortcuts on the widest
4257 * src/MenuBackend.h: MenuItem.label() only returns the label of
4258 the menu without shortcut; new method shortcut().
4260 2000-07-14 Marko Vendelin <markov@ioc.ee>
4262 * src/frontends/gtk/Dialogs.C:
4263 * src/frontends/gtk/FormCopyright.C:
4264 * src/frontends/gtk/FormCopyright.h:
4265 * src/frontends/gtk/Makefile.am: added these source-files for the
4266 Gtk/Gnome support of the Copyright-Dialog.
4268 * src/main.C: added Gnome::Main initialization if using
4269 Gtk/Gnome frontend-GUI.
4271 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
4273 * config/gnome/aclocal-include.m4
4274 * config/gnome/compiler-flags.m4
4275 * config/gnome/curses.m4
4276 * config/gnome/gnome--.m4
4277 * config/gnome/gnome-bonobo-check.m4
4278 * config/gnome/gnome-common.m4
4279 * config/gnome/gnome-fileutils.m4
4280 * config/gnome/gnome-ghttp-check.m4
4281 * config/gnome/gnome-gnorba-check.m4
4282 * config/gnome/gnome-guile-checks.m4
4283 * config/gnome/gnome-libgtop-check.m4
4284 * config/gnome/gnome-objc-checks.m4
4285 * config/gnome/gnome-orbit-check.m4
4286 * config/gnome/gnome-print-check.m4
4287 * config/gnome/gnome-pthread-check.m4
4288 * config/gnome/gnome-support.m4
4289 * config/gnome/gnome-undelfs.m4
4290 * config/gnome/gnome-vfs.m4
4291 * config/gnome/gnome-x-checks.m4
4292 * config/gnome/gnome-xml-check.m4
4293 * config/gnome/gnome.m4
4294 * config/gnome/gperf-check.m4
4295 * config/gnome/gtk--.m4
4296 * config/gnome/linger.m4
4297 * config/gnome/need-declaration.m4: added configuration scripts
4298 for Gtk/Gnome frontend-GUI
4300 * configure.in: added support for the --with-frontend=gtk option
4302 * autogen.sh: added config/gnome/* to list of config-files
4304 * acconfig.h: added define for GTKGUI-support
4306 * config/lyxinclude.m4: added --with-frontend[=value] option value
4307 for Gtk/Gnome frontend-GUI support.
4309 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4311 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
4315 * src/paragraph.C (GetChar): remove non-const version
4317 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
4318 (search_kw): use it.
4320 * src/lyx_main.C (init): if "preferences" exist, read that instead
4322 (ReadRcFile): return bool if the file could be read ok.
4323 (ReadUIFile): add a check to see if lex file is set ok.
4325 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
4326 bastring can be used instead of lyxstring (still uses the old code
4327 if std::string is good enough or if lyxstring is used.)
4329 * src/encoding.C: make the arrays static, move ininle functions
4331 * src/encoding.h: from here.
4333 * src/buffer.C: have last_isnet_read as a file scope variable for now.
4334 (parseSingleLyXformat2Token): move inset parsing to separate method
4335 (readInset): new private method
4337 * src/Variables.h: remove virtual from get().
4339 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
4340 access to NEW_INSETS and NEW_TABULAR
4342 * src/MenuBackend.h: remove superfluous forward declaration of
4343 MenuItem. Add documentations tags "///", remove empty MenuItem
4344 destructor, remove private default contructor.
4346 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
4348 (read): more string mlabel and mname to where they are used
4349 (read): remove unused variables mlabel and mname
4350 (defaults): unconditional clear, make menusetup take advantage of
4351 add returning Menu &.
4353 * src/LyXView.h: define NEW_MENUBAR as default
4355 * src/LyXAction.C: include lyxparagraph.h temporary to get access
4356 to NEW_INSETS and NEW_TABULAR.
4357 (init): commetn out some funcs that is obsolete when NEW_INSETS is
4358 defined. Change some of the "xxxx-inset-insert" functions names to
4361 * several files: more enahncements to NEW_INSETS and the resulting
4364 * lib/lyxrc.example (\date_insert_format): move to misc section
4366 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
4367 bastring and use AC_CACHE_CHECK.
4368 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
4369 the system have the newest methods. uses AC_CACHE_CHECK
4370 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
4371 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
4372 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
4374 * configure.in: add LYX_CXX_GOOD_STD_STRING
4376 * acinclude.m4: recreated
4378 2000-07-24 Amir Karger <karger@lyx.org>
4380 * README: add Hebrew, Arabic kmaps
4383 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4385 * src/buffer.C (writeFileAscii): Define actcell as an int instead
4388 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4390 * Lot of files: add pragma interface/implementation.
4392 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
4394 * lib/ui/default.ui: new file (ans new directory). Contains the
4395 default menu and toolbar.
4397 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
4398 global space. Toolbars are now read (as menus) in ui files.
4400 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
4402 * src/lyxfunc.C (getStatus): do not exit immediately if a command
4403 is disabled because the document is read-only. We want to have the
4404 toggle state of the function anyway.
4405 (getStatus): add code for LFUN_VC* functions (mimicking what is
4406 done in old-style menus)
4408 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
4409 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
4411 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
4412 * src/BufferView_pimpl.C: ditto.
4413 * src/lyxfunc.C: ditto.
4415 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
4416 default). This replaces old-style menus by new ones.
4418 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
4419 MenuItem. Contain the data structure of a menu.
4421 * src/insets/insettext.C: use LyXView::setLayout instead of
4422 accessing directly the toolbar combox.
4423 * src/lyxfunc.C (Dispatch): ditto.
4425 * src/LyXView.C (setLayout): new method, which just calls
4426 Toolbar::setLayout().
4427 (updateLayoutChoice): move part of this method in Toolbar.
4429 * src/toolbar.[Ch]: removed.
4431 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
4432 implementation the toolbar.
4434 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
4435 the toolbar. It might make sense to merge it with ToolbarDefaults
4437 (setLayout): new function.
4438 (updateLayoutList): ditto.
4439 (openLayoutList): ditto.
4441 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
4442 xforms implementation of the toolbar.
4443 (get_toolbar_func): comment out, since I do not
4444 know what it is good for.
4446 * src/ToolbarDefaults.h: Add the ItemType enum.
4448 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
4449 for a list of allocated C strings. Used in Menubar xforms
4450 implementation to avoid memory leaks.
4452 * src/support/lstrings.[Ch] (uppercase): new version taking and
4456 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
4457 * lib/bind/emacs.bind: ditto.
4459 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4461 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
4462 forward decl of LyXView.
4464 * src/toolbar.C (toolbarItem): moved from toolbar.h
4465 (toolbarItem::clean): ditto
4466 (toolbarItem::~toolbarItem): ditto
4467 (toolbarItem::operator): ditto
4469 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
4471 * src/paragraph.h: control the NEW_TABULAR define from here
4473 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
4474 USE_TABULAR_INSETS to NEW_TABULAR
4476 * src/ToolbarDefaults.C: add include "lyxlex.h"
4478 * files using the old table/tabular: use NEW_TABULAR to control
4479 compilation of old tabular stuff.
4481 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
4484 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
4485 planemet in reading of old style floats, fix the \end_deeper
4486 problem when reading old style floats.
4488 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4490 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
4492 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
4494 * lib/bind/sciword.bind: updated.
4496 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4498 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
4499 layout write problem
4501 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4503 * src/Makefile.am (INCLUDES): remove image directory from include
4506 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
4507 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
4509 * src/LyXView.C (create_form_form_main): read the application icon
4512 * lib/images/*.xpm: change the icons to use transparent color for
4515 * src/toolbar.C (update): change the color of the button when it
4518 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4520 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
4521 setting explicitely the minibuffer.
4522 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
4524 * src/LyXView.C (showState): new function. Shows font information
4525 in minibuffer and update toolbar state.
4526 (LyXView): call Toolbar::update after creating the
4529 * src/toolbar.C: change toollist to be a vector instead of a
4531 (BubbleTimerCB): get help string directly from the callback
4532 argument of the corresponding icon (which is the action)
4533 (set): remove unnecessary ugliness.
4534 (update): new function. update the icons (depressed, disabled)
4535 depending of the status of the corresponding action.
4537 * src/toolbar.h: remove help in toolbarItem
4539 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
4541 * src/Painter.C (text): Added code for using symbol glyphs from
4542 iso10646 fonts. Currently diabled.
4544 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
4547 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
4548 magyar,turkish and usorbian.
4550 * src/paragraph.C (isMultiLingual): Made more efficient.
4552 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
4555 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
4556 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
4557 Also changed the prototype to "bool math_insert_greek(char)".
4559 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4561 * lots of files: apply the NEW_INSETS on all code that will not be
4562 needed when we move to use the new insets. Enable the define in
4563 lyxparagrah.h to try it.
4565 * src/insets/insettabular.C (cellstart): change to be a static
4567 (InsetTabular): initialize buffer in the initializer list.
4569 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
4571 * src/frontends/xforms/FormPrint.[Ch] : moved #include
4572 form_print.h out of the header file. Replaced with forward
4573 declarations of the relevant struct.
4575 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
4578 * src/commandtags.h: do not include "debug.h" which does not
4579 belong there. #include it in some other places because of this
4582 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4584 * src/insets/insetcaption.C: add a couple "using" directives.
4586 * src/toolbar.C (add): get the help text directly from lyxaction.
4588 (setPixmap): new function. Loads from disk and sets a pixmap on a
4589 botton; the name of the pixmap file is derived from the command
4592 * src/toolbar.h: remove members isBitmap and pixmap from
4595 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
4596 * lib/images/: move many files from images/banner.xpm.
4598 * src/lyx_gui.C (create_forms): read banner pixmap from file.
4600 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
4601 * src/toolbar.C: ditto.
4602 * configure.in: ditto.
4603 * INSTALL: document.
4605 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
4606 the spellchecker popup is closed from the WM.
4608 2000-07-19 Juergen Vigna <jug@sad.it>
4610 * src/insets/insetfloat.C (Write): small fix because we use the
4611 insetname for the type now!
4613 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
4615 * src/frontends/xforms/forms/form_citation.fd: object sizes are
4618 * src/frontends/Dialogs.h: removed hideCitation signal
4620 * src/insets/insetcite.h: added hide signal
4622 * src/insets/insetcite.C (~InsetCitation): emits new signal
4623 (getScreenLabel): "intelligent" label should now fit on the screen!
4625 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
4627 * src/frontends/xforms/FormCitation.C (showInset): connects
4628 hide() to the inset's hide signal
4629 (show): modified to use fl_set_object_position rather than
4630 fl_set_object_geometry wherever possible
4632 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4634 * src/insets/lyxinset.h: add caption code
4636 * src/insets/insetfloat.C (type): new method
4638 * src/insets/insetcaption.C (Write): new method
4640 (LyxCode): new method
4642 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
4643 to get it right together with using the FloatList.
4645 * src/commandtags.h: add LFUN_INSET_CAPTION
4646 * src/lyxfunc.C (Dispatch): handle it
4648 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
4651 * src/Variables.[Ch]: make expand take a const reference, remove
4652 the destructor, some whitespace changes.
4654 * src/LyXAction.C (init): add caption-inset-insert
4656 * src/FloatList.C (FloatList): update the default floats a bit.
4658 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4660 * src/Variables.[Ch]: new files. Intended to be used for language
4661 specific strings (like \chaptername) and filename substitution in
4664 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
4666 * lib/kbd/american.kmap: update
4668 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
4670 * src/bufferparams.[Ch]: remove member allowAccents.
4672 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
4674 * src/LaTeXLog.C: use the log_form.h header.
4675 * src/lyx_gui.C: ditto.
4676 * src/lyx_gui_misc.C: ditto.
4677 * src/lyxvc.h: ditto.
4679 * forms/log_form.fd: new file, created from latexoptions.fd. I
4680 kept the log popup and nuked the options form.
4682 * src/{la,}texoptions.[Ch]: removed.
4683 * src/lyx_cb.C (LaTeXOptions): ditto
4685 * src/lyx_gui.C (create_forms): do not handle the
4686 fd_latex_options form.
4688 2000-07-18 Juergen Vigna <jug@sad.it>
4690 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
4691 name of the inset so that it can be requested outside (text2.C).
4693 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
4696 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4698 * src/mathed/formula.h (ConvertFont): constify
4700 * src/mathed/formula.C (Read): add warning if \end_inset is not
4701 found on expected place.
4703 * src/insets/lyxinset.h (ConvertFont): consify
4705 * src/insets/insetquotes.C (ConvertFont): constify
4706 * src/insets/insetquotes.h: ditto
4708 * src/insets/insetinfo.h: add labelfont
4710 * src/insets/insetinfo.C (InsetInfo): set the labelfont
4711 (ascent): use labelfont
4715 (Write): make .lyx file a bit nicer
4717 * src/insets/insetfloat.C (Write): simplify somewhat...
4718 (Read): add warning if arg is not found
4720 * src/insets/insetcollapsable.C: add using std::max
4721 (Read): move string token and add warning in arg is not found
4722 (draw): use std::max to get the right ty
4723 (getMaxWidth): simplify by using std::max
4725 * src/insets/insetsection.h: new file
4726 * src/insets/insetsection.C: new file
4727 * src/insets/insetcaption.h: new file
4728 * src/insets/insetcaption.C: new file
4730 * src/insets/inset.C (ConvertFont): constify signature
4732 * src/insets/Makefile.am (libinsets_la_SOURCES): add
4733 insetcaption.[Ch] and insetsection.[Ch]
4735 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
4736 uses to use LABEL_COUNTER_CHAPTER instead.
4737 * src/text2.C (SetCounter): here
4739 * src/counters.h: new file
4740 * src/counters.C: new file
4741 * src/Sectioning.h: new file
4742 * src/Sectioning.C: new file
4744 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
4746 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4748 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
4751 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
4754 2000-07-17 Juergen Vigna <jug@sad.it>
4756 * src/tabular.C (Validate): check if array-package is needed.
4757 (SetVAlignment): added support for vertical alignment.
4758 (SetLTFoot): better support for longtable header/footers
4759 (Latex): modified to support added features.
4761 * src/LaTeXFeatures.[Ch]: added array-package.
4763 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
4765 * src/lyx_gui.C (LyXGUI): make sure that the height is large
4768 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
4770 * configure.in: do not forget to put a space after -isystem.
4772 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
4774 * lib/kbd/arabic.kmap: a few fixes.
4776 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4778 * some whitespace chagnes to a number of files.
4780 * src/support/DebugStream.h: change to make it easier for
4781 doc++ to parse correctly.
4782 * src/support/lyxstring.h: ditto
4784 * src/mathed/math_utils.C (compara): change to have only one
4786 (MathedLookupBOP): change because of the above.
4788 * src/mathed/math_delim.C (math_deco_compare): change to have only
4790 (search_deco): change becasue of the above.
4792 * src/insets/insettabular.C (DrawCellSelection): use std::swap
4793 instead of manually coded one.
4795 * src/insets/insetquotes.C (Read): read the \end_inset too
4797 * src/insets/insetlatex.h: remove file
4798 * src/insets/insetlatex.C: remove file
4800 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
4802 (InsetPrintIndex): remove destructor
4804 * src/insets/insetinclude.h: remove default constructor
4806 * src/insets/insetfloat.C: work to make it work better
4808 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
4810 * src/insets/insetcite.h (InsetCitation): remove default constructor
4812 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
4814 * src/text.C (GetColumnNearX): comment out some currently unused code.
4816 * src/paragraph.C (writeFile): move some initializations closer to
4818 (CutIntoMinibuffer): small change to use new matchIT operator
4822 (InsertInset): ditto
4825 (InsetIterator): ditto
4826 (Erase): small change to use new matchFT operator
4828 (GetFontSettings): ditto
4829 (HighestFontInRange): ditto
4832 * src/lyxparagraph.h: some chars changed to value_type
4833 (matchIT): because of some stronger checking (perhaps too strong)
4834 in SGI STL, the two operator() unified to one.
4837 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
4839 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
4840 the last inset read added
4841 (parseSingleLyXformat2Token): some more (future) compability code added
4842 (parseSingleLyXformat2Token): warning about solitary \end_inset added
4843 (parseSingleLyXformat2Token): set last_inset_read
4844 (parseSingleLyXformat2Token): more code to read new "Float" correctly
4845 (parseSingleLyXformat2Token): don't double intializw string next_token
4847 * src/TextCache.C (text_fits::operator()): add const's to the signature
4848 (has_buffer::operator()): ditto
4850 * src/Floating.h: add some comments on the class
4852 * src/FloatList.[Ch] (typeExist): new method
4855 * src/BackStack.h: added default constructor, wanted by Gcc.
4857 2000-07-14 Juergen Vigna <jug@sad.it>
4859 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
4861 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
4863 * src/insets/insettabular.C (resizeLyXText): need this to be able to
4864 do a redraw when the window is resized!
4865 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
4867 * src/insets/insettext.C (resizeLyXText): added function to correctly
4868 being able to resize the LyXWindow.
4870 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
4872 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
4874 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
4875 crashes when closing dialog to a deleted inset.
4877 * src/insets/insetcite.[Ch] (Edit) : the return of this former
4878 method! Now similar to other insets.
4880 2000-07-13 Juergen Vigna <jug@sad.it>
4882 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
4884 * lib/examples/Literate.lyx: small patch!
4886 * src/insets/insetbib.C (Read): added this function because of wrong
4887 Write (without [begin|end]_inset).
4889 2000-07-11 Juergen Vigna <jug@sad.it>
4891 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
4892 as the insertInset could not be good!
4894 * src/screen.C (ToggleSelection): fixed toggle selection bug as
4895 the bool param should not be last.
4897 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4899 * sigc++/configure.in: fix bug in threading-related code (Yes, I
4900 did submit that to Karl).
4902 * configure.in: use -isystem instead of -I for X headers. This
4903 fixes a problem on solaris with a recent gcc;
4904 put the front-end code after the X detection code;
4905 configure in sigc++ before lib/
4907 * src/lyx_main.C (commandLineHelp): remove -display from command
4910 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
4912 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
4913 Also put in Makefile rules for building the ``listerrors''
4914 program for parsing errors from literate programs written in LyX.
4916 * lib/build-listerrors: Added small shell script as part of compile
4917 process. This builds a working ``listerrors'' binary if noweb is
4918 installed and either 1) the VNC X server is installed on the machine,
4919 or 2) the user is compiling from within a GUI. The existence of a GUI
4920 is necessary to use the ``lyx --export'' feature for now. This
4921 hack can be removed once ``lyx --export'' no longer requires a GUI to
4924 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
4926 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
4927 now passed back correctly from gcc and placed "under" error
4928 buttons in a Literate LyX source.
4930 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4932 * src/text.C (GetColumnNearX): Better behavior when a RTL
4933 paragraph is ended by LTR text.
4935 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
4938 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4940 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
4941 true when clipboard is empty.
4943 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4945 * text.C (Backspace): Prevent rebreaking of a row if it is the last
4946 row of the paragraph.
4947 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
4948 to prevent calculation of bidi tables
4950 2000-07-07 Juergen Vigna <jug@sad.it>
4952 * src/screen.C (ToggleSelection): added y_offset and x_offset
4955 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
4958 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
4960 * src/insets/insettext.C: fixed Layout-Display!
4962 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4964 * configure.in: add check for strings.h header.
4966 * src/spellchecker.C: include <strings.h> in order to have a
4967 definition for bzero().
4969 2000-07-07 Juergen Vigna <jug@sad.it>
4971 * src/insets/insettext.C (draw): set the status of the bv->text to
4972 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
4974 * src/screen.C (DrawOneRow):
4975 (DrawFromTo): redraw the actual row if something has changed in it
4978 * src/text.C (draw): call an update of the toplevel-inset if something
4979 has changed inside while drawing.
4981 * src/lyxtext.h: added CHANGED_IN_DRAW status.
4983 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
4985 * src/insets/insetbib.[Ch] (callback) new method, moving callback
4986 processing inside class.
4988 * src/insets/insetindex.[Ch] (callback) new method, moving callback
4989 processing inside class.
4991 * src/insets/insetindex.h new struct Holder, consistent with other
4994 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
4995 citation dialog from main code and placed it in src/frontends/xforms.
4996 Dialog launched through signals instead of callbacks
4998 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
5000 * lyx.man: update the options description.
5002 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
5004 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
5005 handle neg values, set min width to 590, add doc about -display
5007 2000-07-05 Juergen Vigna <jug@sad.it>
5009 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
5010 calls to BufferView *.
5012 * src/insets/insettext.C (checkAndActivateInset): small fix non
5013 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
5015 * src/insets/insetcommand.C (Read): Fixed as insets should read till
5016 their \end_inset token!
5018 2000-07-04 edscott <edscott@imp.mx>
5020 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
5021 lib/lyxrc.example: added option \wheel_jump
5023 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
5025 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
5026 remove support for -width,-height,-xpos and -ypos.
5028 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
5030 * src/encoding.[Ch]: New files.
5032 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
5033 (text): Call to the underline() method only when needed.
5035 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
5037 * src/buffer.C (makeLaTeXFile): Compute automatically the input
5038 encoding(s) for the document.
5040 * src/bufferparams.C (BufferParams): Changed default value of
5043 * src/language.C (newLang): Removed.
5044 (items[]): Added encoding information for all defined languages.
5046 * src/lyx_gui.C (create_forms): Added "auto" option to the input
5047 encoding choice button.
5049 * src/lyxrc.h (font_norm_type): New member variable.
5050 (set_font_norm_type): New method.
5052 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
5053 paragraphs with different encodings.
5055 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
5056 (TransformChar): Changed to work correctly with Arabic points.
5057 (draw): Added support for drawing Arabic points.
5058 (draw): Removed code for drawing underbars (this is done by
5061 * src/support/textutils.h (IsPrintableNonspace): New function.
5063 * src/BufferView_pimpl.h: Added "using SigC::Object".
5064 * src/LyXView.h: ditto.
5066 * src/insets/insetinclude.h (include_label): Changed to mutable.
5068 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5070 * src/mathed/math_iter.h: remove empty destructor
5072 * src/mathed/math_cursor.h: remove empty destructor
5074 * src/insets/lyxinset.h: add THEOREM_CODE
5076 * src/insets/insettheorem.[Ch]: new files
5078 * src/insets/insetminipage.C: (InsertInset): remove
5080 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
5082 (InsertInset): remove
5084 * src/insets/insetlist.C: (InsertList): remove
5086 * src/insets/insetfootlike.[Ch]: new files
5088 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
5091 (InsertInset): ditto
5093 * src/insets/insetert.C: remove include Painter.h, reindent
5094 (InsertInset): move to header
5096 * src/insets/insetcollapsable.h: remove explicit from default
5097 contructor, remove empty destructor, add InsertInset
5099 * src/insets/insetcollapsable.C (InsertInset): new func
5101 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5103 * src/vspace.h: add explicit to constructor
5105 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
5106 \textcompwordmark, please test this.
5108 * src/lyxrc.C: set ascii_linelen to 65 by default
5110 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
5112 * src/commandtags.h: add LFUN_INSET_THEOREM
5114 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
5115 (makeLinuxDocFile): remove _some_ of the nice logic
5116 (makeDocBookFile): ditto
5118 * src/Painter.[Ch]: (~Painter): removed
5120 * src/LyXAction.C (init): entry for insettheorem added
5122 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
5124 (deplog): code to detect files generated by LaTeX, needs testing
5127 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5129 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
5131 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5133 * src/LaTeX.C (deplog): Add a check for files that are going to be
5134 created by the first latex run, part of the project to remove the
5137 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
5138 contents to the extension list.
5140 2000-07-04 Juergen Vigna <jug@sad.it>
5142 * src/text.C (NextBreakPoint): added support for needFullRow()
5144 * src/insets/lyxinset.h: added needFullRow()
5146 * src/insets/insetcollapsable.C: redone now this uses a text-inset
5149 * src/insets/insettext.C: lots of changes for update!
5151 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
5153 * src/LaTeXFeatures.h: add a missing std:: qualifier.
5155 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
5157 * src/insets/insetinclude.C (InsetInclude): fixed
5158 initialization of include_label.
5159 (unique_id): now returns a string.
5161 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
5163 * src/LaTeXFeatures.h: new member IncludedFiles, for
5164 a map of key, included file name.
5166 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
5167 with the included files for inclusion in SGML preamble,
5168 i. e., linuxdoc and docbook.
5171 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
5172 nice (is the generated linuxdoc code to be exported?), that
5173 allows to remove column, and only_body that will be true for
5174 slave documents. Insets are allowed inside SGML font type.
5175 New handling of the SGML preamble for included files.
5176 (makeDocBookFile): the same for docbook.
5178 * src/insets/insetinclude.h:
5179 * src/insets/insetinclude.C (Validate): keeps a list of included files.
5181 (DocBook): new export methods.
5183 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
5184 and makeDocBookFile.
5186 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
5187 formats to export with command line argument -x.
5189 2000-06-29 Juergen Vigna <jug@sad.it>
5191 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
5192 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
5194 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
5195 region could already been cleared by an inset!
5197 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5199 * src/BufferView_pimpl.h: remove member variables lyx_focus and
5202 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
5204 (cursorToggle): remove special handling of lyx focus.
5206 2000-06-28 Juergen Vigna <jug@sad.it>
5208 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
5211 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5213 * src/insets/insetindex.C (Edit): add a callback when popup is
5216 * src/insets/insettext.C (LocalDispatch):
5217 * src/insets/insetmarginal.h:
5218 * src/insets/insetlist.h:
5219 * src/insets/insetfoot.h:
5220 * src/insets/insetfloat.h:
5221 * src/insets/insetert.h: add a missing std:: qualifier.
5223 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5225 * src/support/lyxsum.C (sum): '\0' teminate file read when using
5228 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
5230 * src/insets/insettext.C (Read): remove tmptok unused variable
5231 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
5232 (InsertInset): change for new InsetInset code
5234 * src/insets/insettext.h: add TEXT inline method
5236 * src/insets/insettext.C: remove TEXT macro
5238 * src/insets/insetmarginal.C (Write): new method
5239 (Latex): change output slightly
5241 * src/insets/insetfoot.C (Write): new method
5242 (Latex): change output slightly (don't use endl when no need)
5244 * src/insets/insetert.C (Write): new method
5246 * src/insets/insetcollapsable.h: make button_length, button_top_y
5247 and button_bottm_y protected.
5249 * src/insets/insetcollapsable.C (Write): simplify code by using
5250 tostr. Also do not output the float name, the children class
5251 should to that to get control over own arguments
5253 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
5254 src/insets/insetminipage.[Ch]:
5257 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5259 * src/lyxfunc.C (Dispatch): cases for new insets/commands
5261 * src/Makefile.am (lyx_SOURCES): add the new files
5263 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
5264 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
5265 * src/commandtags.h: ditto
5267 * src/LaTeXFeatures.h: add a std::set of used floattypes
5269 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
5271 * src/FloatList.[Ch] src/Floating.h: new files
5273 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
5275 * src/lyx_cb.C (TableApplyCB): ditto
5277 * src/text2.C: ditto
5278 * src/buffer.C (SimpleLinuxDocOnePar): ditto
5279 (parseSingleLyXformat2Token): ditto + add code for
5280 backwards compability for old float styles + add code for new insets
5282 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
5284 (InsertInset(size_type, Inset *, LyXFont)): new method
5285 (InsetChar(size_type, char)): changed to use the other InsetChar
5286 with a LyXFont(ALL_INHERIT).
5287 (InsetInset(size_type, Inset*)): changed to use InsetChar to
5288 insert the META_INSET.
5290 * sigc++/thread.cc (Privete<int>::operator int&): move definition
5292 * sigc++/thread.h (Threads): from here
5294 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
5295 definition out of line
5296 * sigc++/scope.h: from here
5298 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5300 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
5301 is specified (adapted from a patch from edscott <edscott@imp.mx>).
5303 * Makefile.am (bindist): new target.
5305 * INSTALL: add instructions for doing a binary distribution.
5307 * development/tools/README.bin.example: update a bit.
5309 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
5312 * lib/lyxrc.example: new lyxrc tag \set_color.
5314 * src/lyxfunc.C (Dispatch):
5315 * src/commandtags.h:
5316 * src/LyXAction.C: new lyxfunc "set-color".
5318 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
5319 and an x11name given as strings.
5321 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
5322 cache when a color is changed.
5324 2000-06-26 Juergen Vigna <jug@sad.it>
5326 * src/lyxrow.C (width): added this functions and variable.
5328 * src/insets/insetcite.C (create_form_citation_form): some Gravity
5331 * src/text.C (SetHeightOfRow): fixed calcualting of width.
5333 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5335 * images/undo_bw.xpm: new icon.
5336 * images/redo_bw.xpm: ditto.
5338 * configure.in (INSTALL_SCRIPT): change value to
5339 ${INSTALL} to avoid failures of install-script target.
5340 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
5342 * src/BufferView.h: add a magic "friend" declaration to please
5345 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
5347 * forms/cite.fd: modified to allow resizing without messing
5350 * src/insetcite.C: Uses code from cite.fd almost without
5352 User can now resize dialog in the x-direction.
5353 Resizing the dialog in the y-direction is prevented, as the
5354 code does this intelligently already.
5356 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5358 * INSTALL: remove obsolete entry in "problems" section.
5360 * lib/examples/sl_*.lyx: update of the slovenian examples.
5362 * src/support/FileInfo.[Ch] (getBlockSize): remove.
5364 2000-06-23 Juergen Vigna <jug@sad.it>
5366 * src/lyxtext.h: added a 'cleared' flag to draw() function.
5368 * src/buffer.C (resize): delete the LyXText of textinsets.
5370 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
5372 * src/insets/lyxinset.h: added another parameter 'cleared' to
5373 the draw() function.
5375 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
5376 unlocking inset in inset.
5378 2000-06-22 Juergen Vigna <jug@sad.it>
5380 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
5381 of insets and moved first to LyXText.
5383 * src/mathed/formulamacro.[Ch]:
5384 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
5386 2000-06-21 Juergen Vigna <jug@sad.it>
5388 * src/text.C (GetVisibleRow): look if I should clear the area or not
5389 using Inset::doClearArea() function.
5391 * src/insets/lyxinset.h: added doClearArea() function and
5392 modified draw(Painter &, ...) to draw(BufferView *, ...)
5394 * src/text2.C (UpdateInset): return bool insted of int
5396 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
5398 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
5399 combox in the character popup
5401 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
5402 BufferParams const & params
5404 2000-06-20 Juergen Vigna <jug@sad.it>
5406 * src/insets/insettext.C (SetParagraphData): set insetowner on
5409 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5411 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
5412 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
5414 (form_main_): remove
5416 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
5417 (create_form_form_main): remove FD_form_main stuff, connect to
5418 autosave_timeout signal
5420 * src/LyXView.[Ch] (getMainForm): remove
5421 (UpdateTimerCB): remove
5422 * src/BufferView_pimpl.h: inherit from SigC::Object
5424 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
5425 signal instead of callback
5427 * src/BufferView.[Ch] (cursorToggleCB): remove
5429 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5431 * src/BufferView_pimpl.C: changes because of the one below
5433 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
5434 instead of storing a pointer to a LyXText.
5436 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
5438 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
5440 * src/lyxparagraph.h
5442 * src/paragraph.C: Changed fontlist to a sorted vector.
5444 2000-06-19 Juergen Vigna <jug@sad.it>
5446 * src/BufferView.h: added screen() function.
5448 * src/insets/insettext.C (LocalDispatch): some selection code
5451 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
5453 * src/insets/insettext.C (SetParagraphData):
5455 (InsetText): fixes for multiple paragraphs.
5457 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
5459 * development/lyx.spec.in: Call configure with ``--without-warnings''
5460 to work around a bug with the Makefiles when doing ``make lyxrpm''.
5461 This should be fine, however, since we generally don't want to be
5462 verbose when making an RPM.
5464 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
5466 * lib/scripts/fig2pstex.py: New file
5468 2000-06-16 Juergen Vigna <jug@sad.it>
5470 * src/insets/insettabular.C (UpdateLocal):
5471 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
5472 (LocalDispatch): Changed all functions to use LyXText.
5474 2000-06-15 Juergen Vigna <jug@sad.it>
5476 * src/text.C (SetHeightOfRow): call inset::update before requesting
5479 * src/insets/insettext.C (update):
5480 * src/insets/insettabular.C (update): added implementation
5482 * src/insets/lyxinset.h: added update function
5484 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5486 * src/text.C (SelectNextWord): protect against null pointers with
5487 old-style string streams. (fix from Paul Theo Gonciari
5490 * src/cite.[Ch]: remove erroneous files.
5492 * lib/configure.m4: update the list of created directories.
5494 * src/lyxrow.C: include <config.h>
5495 * src/lyxcursor.C: ditto.
5497 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5499 * lib/examples/decimal.lyx: new example file from Mike.
5501 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
5502 to find template definitions (from Dekel)
5504 * src/frontends/.cvsignore: add a few things.
5506 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
5508 * src/Timeout.C (TimeOut): remove default argument.
5510 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
5513 * src/insets/ExternalTemplate.C: add a "using" directive.
5515 * src/lyx_main.h: remove the act_ struct, which seems unused
5518 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5520 * LyX Developers Meeting: All files changed, due to random C++ (by
5521 coincidence) code generator script.
5523 - external inset (cool!)
5524 - initial online editing of preferences
5525 - insettabular breaks insettext(s contents)
5527 - some DocBook fixes
5528 - example files update
5529 - other cool stuff, create a diff and look for yourself.
5531 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
5533 * src/insets/insettext.C (computeTextRows): if the maxWidth is
5534 -1 this is a non-line-breaking textinset.
5536 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
5537 if there is no width set.
5539 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5541 * Lots of files: Merged the dialogbase branch.
5543 2000-06-09 Allan Rae <rae@lyx.org>
5545 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
5546 and the Dispatch methods that used it.
5548 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
5549 access to functions formerly kept in Dispatch.
5551 2000-05-19 Allan Rae <rae@lyx.org>
5553 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
5554 made to_page and count_copies integers again. from_page remains a
5555 string however because I want to allow entry of a print range like
5556 "1,4,22-25" using this field.
5558 * src/LyXAction.C: added action info and commands for buffer-print-xtl
5559 and printer-params-get. These aren't useful from the minibuffer but
5560 could be used by a script/LyXServer app provided it passes a suitable
5561 auto_mem_buffer. I guess I should take a look at how the LyXServer
5562 works and make it support xtl buffers.
5564 * sigc++/: updated to libsigc++-1.0.1
5566 * src/xtl/: updated to xtl-1.3.pl.11
5568 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
5569 those changes done to the files in src/ are actually recreated when
5570 they get regenerated. Please don't ever accept a patch that changes a
5571 dialog unless that patch includes the changes to the corresponding *.fd
5574 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
5575 stringOnlyContains, renamed it and generalised it.
5577 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
5578 branch. Removed the remaining old form_print code.
5580 2000-04-26 Allan Rae <rae@lyx.org>
5582 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
5583 trap I was trying to fix with the ID: fields in src/xtl/ :-)
5585 2000-04-25 Allan Rae <rae@lyx.org>
5587 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
5588 against a base of xtl-1.3.pl.4
5590 * development/tools/lxtl.sh: fixed a couple of silly typos and now
5591 filter the Id: entries so they still show the xtl version number
5594 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
5595 into the src/xtl code. Patch still pending with José (XTL)
5597 2000-04-24 Allan Rae <rae@lyx.org>
5599 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
5600 both more generic and much safer. Use the new template functions.
5601 * src/buffer.[Ch] (Dispatch): ditto.
5603 * src/frontends/xforms/FormPrint.C (update): Use new template functions
5604 and mem buffer more intelligently. Also a little general cleanup.
5607 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
5608 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
5609 * src/xtl/Makefile.am: ditto.
5610 * src/xtl/.cvsignore: ditto.
5611 * src/Makefile.am: ditto.
5613 * src/PrinterParams.h: Removed the macros member functions. Added a
5614 testInvariant member function. A bit of tidying up and commenting.
5615 Included Angus's idea for fixing operation with egcs-1.1.2.
5617 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
5618 cool expansion of XTL's mem_buffer to support automatic memory
5619 management within the buffer itself. Removed the various macros and
5620 replaced them with template functions that use either auto_mem_buffer
5621 or mem_buffer depending on a #define. The mem_buffer support will
5622 disappear as soon as the auto_mem_buffer is confirmed to be good on
5623 other platforms/compilers. That is, it's there so you've got something
5626 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
5627 effectively forked XTL. However I expect José will include my code
5628 into the next major release. Also fixed a memory leak.
5629 * src/xtl/text.h: ditto.
5630 * src/xtl/xdr.h: ditto.
5631 * src/xtl/giop.h: ditto.
5633 2000-04-16 Allan Rae <rae@lyx.org>
5635 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
5636 by autogen.sh and removed by maintainer-clean anyway.
5637 * .cvsignore, sigc++/.cvsignore: Support the above.
5639 * sigc++/.cvsignore: Forgot that retbind.h was generated.
5641 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
5643 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
5644 macros, renamed static callback-target member functions to suit new
5645 scheme and made them public.
5646 * src/frontends/xforms/forms/form_print.fd: ditto.
5647 * src/frontends/xforms/forms/form_copyright.fd: ditto.
5649 * src/support/lxtl.h: small cleanup to use typedef instead of #define
5652 * src/xtl/: New directory containing a minimal distribution of XTL.
5653 This is XTL-1.3.pl.4.
5655 * development/tools/lxtl.sh: A script to generate the above mini-dist.
5657 2000-04-15 Allan Rae <rae@lyx.org>
5659 * development/tools/makeLyXsigc.sh: Remove the library version numbers
5661 * sigc++/: Updated to libsigc++-1.0.0
5663 2000-04-14 Allan Rae <rae@lyx.org>
5665 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
5666 use the generic ones in future. I'll modify my conversion script.
5668 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
5670 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
5671 (CloseAllBufferRelatedDialogs): Renamed.
5672 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
5674 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
5675 of the generic ones. These are the same ones my conversion script
5678 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
5679 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
5680 * src/buffer.C (Dispatch): ditto
5682 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
5683 functions for updating and hiding buffer dependent dialogs.
5684 * src/BufferView.C (buffer): ditto
5685 * src/buffer.C (setReadonly): ditto
5686 * src/lyxfunc.C (CloseBuffer): ditto
5688 * src/buffer.h: Take setReadonly() out of line so I don't have to include
5689 Dialogs.h, and hence all the SigC stuff, into every file that includes
5690 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
5692 * src/BufferView2.C: reduce the number of headers included by buffer.h
5694 2000-04-11 Allan Rae <rae@lyx.org>
5696 * src/frontends/xforms/xform_macros.h: A small collection of macros
5697 for building C callbacks.
5699 * src/frontends/xforms/Makefile.am: Added above file.
5701 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
5702 scheme again. This time it should work for JMarc. If this is
5703 successful I'll revise my conversion script to automate some of this.
5704 The static member functions in the class also have to be public for
5705 this scheme will work. If the scheme works (it's almost identical to
5706 the way BufferView::cursorToggleCB is handled so it should work) then
5707 FormCopyright and FormPrint will be ready for inclusion into the main
5708 trunk immediately after 1.1.5 is released -- provided we're prepared
5709 for complaints about lame compilers not handling XTL.
5711 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
5713 2000-04-07 Allan Rae <rae@lyx.org>
5715 * config/lyxinclude.m4: A bit more tidying up (Angus)
5717 * src/LString.h: JMarc's <string> header fix
5719 * src/PrinterParams.h: Used string for most data to remove some
5720 ugly code in the Print dialog and avoid even uglier code when
5721 appending the ints to a string for output.
5723 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
5724 and moved "default:" back to the end of switch statement. Cleaned
5725 up the printing so it uses the right function calls and so the
5726 "print to file" option actually puts the file in the right directory.
5728 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
5730 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
5731 and Ok+Apply button control into a separate method: input (Angus).
5732 (input) Cleaned it up and improved it to be very thorough now.
5733 (All CB) static_cast used instead of C style cast (Angus). This will
5734 probably change again once we've worked out how to keep gcc-2.8.1 happy
5735 with real C callbacks.
5736 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
5737 ignore some of the bool settings and has random numbers instead. Needs
5738 some more investigation. Added other input length checks and checking
5739 of file and printer names.
5741 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
5742 would link (Angus). Seems the old code doesn't compile with the pragma
5743 statement either. Separated callback entries from internal methods.
5745 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
5747 2000-03-17 Allan Rae <rae@lyx.org>
5749 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
5750 need it? Maybe it could go in Dialogs instead? I could make it a
5751 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
5752 values to get the bool return value.
5753 (Dispatch): New overloaded method for xtl support.
5755 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
5756 extern "C" callback instead of static member functions. Hopefully,
5757 JMarc will be able to compile this. I haven't changed
5758 forms/form_copyright.fd yet. Breaking one of my own rules already.
5760 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
5761 because they aren't useful from the minibuffer. Maybe a LyXServer
5762 might want a help message though?
5764 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
5766 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
5767 xtl which needs both rtti and exceptions.
5769 * src/support/Makefile.am:
5770 * src/support/lxtl.h: New file. Some helper macros for using XTL.
5772 * src/frontends/xforms/input_validators.[ch]: input filters and
5773 validators. These conrol what keys are valid in input boxes.
5774 Use them and write some more. Much better idea than waiting till
5775 after the user has pressed Ok to say that the input fields don't make
5778 * src/frontends/xforms/Makefile.am:
5779 * src/frontends/xforms/forms/form_print.fd:
5780 * src/frontends/xforms/forms/makefile:
5781 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
5782 new scheme. Still have to make sure I haven't missed anything from
5783 the current implementation.
5785 * src/Makefile.am, src/PrinterParams.h: New data store.
5787 * other files: Added a couple of copyright notices.
5789 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5791 * src/insets/insetbib.h: move Holder struct in public space.
5793 * src/frontends/include/DialogBase.h: use SigC:: only when
5794 SIGC_CXX_NAMESPACES is defined.
5795 * src/frontends/include/Dialogs.h: ditto.
5797 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
5799 * src/frontends/xforms/FormCopyright.[Ch]: do not
5800 mention SigC:: explicitely.
5802 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5804 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
5805 deals with testing KDE in main configure.in
5806 * configure.in: ditto.
5808 2000-02-22 Allan Rae <rae@lyx.org>
5810 * Lots of files: Merged from HEAD
5812 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
5813 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
5815 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
5817 * sigc++/: new minidist.
5819 2000-02-14 Allan Rae <rae@lyx.org>
5821 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
5823 2000-02-08 Juergen Vigna <jug@sad.it>
5825 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
5826 file for the buildin GUI builder of KDevelop of the copyright-dialog.
5828 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
5829 for this port and so it is much easier for other people to port
5830 dialogs in a common development environment.
5832 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
5833 the QT/KDE implementation.
5835 * src/frontends/kde/Dialogs.C:
5836 * src/frontends/kde/FormCopyright.C:
5837 * src/frontends/kde/FormCopyright.h:
5838 * src/frontends/kde/Makefile.am:
5839 * src/frontends/kde/formcopyrightdialog.C:
5840 * src/frontends/kde/formcopyrightdialog.h:
5841 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
5842 for the kde support of the Copyright-Dialog.
5844 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
5845 subdir-substitution instead of hardcoded 'xforms' as we now have also
5848 * src/frontends/include/DialogBase.h (Object): just commented the
5849 label after #endif (nasty warning and I don't like warnings ;)
5851 * src/main.C (main): added KApplication initialization if using
5854 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
5855 For now only the KDE event-loop is added if frontend==kde.
5857 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
5859 * configure.in: added support for the --with-frontend[=value] option
5861 * autogen.sh: added kde.m4 file to list of config-files
5863 * acconfig.h: added define for KDEGUI-support
5865 * config/kde.m4: added configuration functions for KDE-port
5867 * config/lyxinclude.m4: added --with-frontend[=value] option with
5868 support for xforms and KDE.
5870 2000-02-08 Allan Rae <rae@lyx.org>
5872 * all Makefile.am: Fixed up so the make targets dist, distclean,
5873 install and uninstall all work even if builddir != srcdir. Still
5874 have a new sigc++ minidist update to come.
5876 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
5878 2000-02-01 Allan Rae <rae@lyx.org>
5880 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
5881 Many mods to get builddir != srcdir working.
5883 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
5884 for building on NT and so we can do the builddir != srcdir stuff.
5886 2000-01-30 Allan Rae <rae@lyx.org>
5888 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
5889 This will stay in "rae" branch. We probably don't really need it in
5890 the main trunk as anyone who wants to help programming it should get
5891 a full library installed also. So they can check both included and
5892 system supplied library compilation.
5894 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
5895 Added a 'mini' distribution of libsigc++. If you feel the urge to
5896 change something in these directories - Resist it. If you can't
5897 resist the urge then you should modify the following script and rebuild
5898 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
5899 all happen. Still uses a hacked version of libsigc++'s configure.in.
5900 I'm quite happy with the results. I'm not sure the extra work to turn
5901 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
5902 worth the trouble and would probably lead to extra maintenance
5904 I haven't tested the following important make targets: install, dist.
5905 Not ready for prime time but very close. Maybe 1.1.5.
5907 * development/tools/makeLyXsigc.sh: A shell script to automatically
5908 generate our mini-dist of libsigc++. It can only be used with a CVS
5909 checkout of libsigc++ not a tarball distribution. It's well commented.
5910 This will end up as part of the libsigc++ distribution so other apps
5911 can easily have an included mini-dist. If someone makes mods to the
5912 sigc++ subpackage without modifying this script to generate those
5913 changes I'll be very upset!
5915 * src/frontends/: Started the gui/system indep structure.
5917 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
5918 to access the gui-indep dialogs are in this class. Much improved
5919 design compared to previous revision. Lars, please refrain from
5920 moving this header into src/ like you did with Popups.h last time.
5922 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
5924 * src/frontends/xforms/: Started the gui-indep system with a single
5925 dialog: FormCopyright. Initial testing of use of libsigc++ was very
5928 * src/frontends/xforms/forms: Repository for the xforms .fd files.
5929 Here you'll find a very useful makefile and automated fdfix.sh that
5930 makes updating dailogs a no-brainer -- provided you follow the rules
5931 set out in the README. I'm thinking about adding another script to
5932 automatically generate skeleton code for a new dialog given just the
5935 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
5936 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
5937 Made FormCopyright gui-indep and added a lyxfunc to get to it.
5939 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5941 * src/support/LSubstring.C (operator): simplify
5943 * src/lyxtext.h: removed bparams, use buffer_->params instead
5945 * src/lyxrow.h: make Row a real class, move all variables to
5946 private and use accessors.
5948 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
5950 (isRightToLeftPar): ditto
5951 (ChangeLanguage): ditto
5952 (isMultiLingual): ditto
5955 (SimpleTeXOnePar): ditto
5956 (TeXEnvironment): ditto
5957 (GetEndLabel): ditto
5959 (SetOnlyLayout): ditto
5960 (BreakParagraph): ditto
5961 (BreakParagraphConservative): ditto
5962 (GetFontSettings): ditto
5964 (CopyIntoMinibuffer): ditto
5965 (CutIntoMinibuffer): ditto
5966 (PasteParagraph): ditto
5967 (SetPExtraType): ditto
5968 (UnsetPExtraType): ditto
5969 (DocBookContTableRows): ditto
5970 (SimpleDocBookOneTablePar): ditto
5972 (TeXFootnote): ditto
5973 (SimpleTeXOneTablePar): ditto
5974 (TeXContTableRows): ditto
5975 (SimpleTeXSpecialChars): ditto
5978 * src/lyxcursor.h: make LyXCursor a real class, move all variables
5979 to private and use accessors.
5981 * src/lyx_cb.C: remove char updatetimer, and all code that uses
5982 this, we did not use it anymore and has not been for ages. Just a
5983 waste of cpu cycles.
5985 * src/language.h: make Language a real class, move all variables
5986 to private and use accessors.
5988 * src/BufferView_pimpl.C (Pimpl): use new timer code.
5989 (create_view): remove
5990 (update): some changes for new timer
5991 (cursorToggle): use new timer
5992 (beforeChange): change for new timer
5994 * src/BufferView.h (cursorToggleCB): removed last paramter because
5997 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
5998 (cursorToggleCB): change because of new timer code
6000 * lib/CREDITS: updated own mailaddress
6002 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6004 * src/support/filetools.C (PutEnv): fix the code in case neither
6005 putenv() nor setenv() have been found.
6007 * INSTALL: mention the install-strip Makefile target.
6009 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
6010 read-only documents.
6012 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6014 * lib/reLyX/configure.in (VERSION): avoid using a previously
6015 generated reLyX wrapper to find out $prefix.
6017 * lib/examples/eu_adibide_lyx-atua.lyx:
6018 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
6019 translation of the Tutorial (Dooteo)
6021 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
6023 * forms/cite.fd: new citation dialog
6025 * src/insetcite.[Ch]: the new citation dialog is moved into
6028 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
6031 * src/insets/insetcommand.h: data members made private.
6033 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6035 * LyX 1.1.5 released
6037 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6039 * src/version.h (LYX_RELEASE): to 1.1.5
6041 * src/spellchecker.C (RunSpellChecker): return false if the
6042 spellchecker dies upon creation.
6044 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6046 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
6047 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
6051 * lib/CREDITS: update entry for Martin Vermeer.
6053 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
6055 * src/text.C (draw): Draw foreign language bars at the bottom of
6056 the row instead of at the baseline.
6058 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
6060 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6062 * lib/bind/de_menus.bind: updated
6064 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6066 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
6068 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6070 * src/menus.C (Limit_string_length): New function
6071 (ShowTocMenu): Limit the number of items/length of items in the
6074 * src/paragraph.C (String): Correct result for a paragraph inside
6077 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6079 * src/bufferlist.C (close): test of buf->getuser() == NULL
6081 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
6083 * src/BufferView2.C (removeAutoInsets): Fix a bug:
6084 Do not call to SetCursor when the paragraph is a closed footnote!
6086 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
6088 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
6091 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
6093 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6096 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
6097 reference popup, that activates the reference-back action
6099 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
6101 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
6102 the menus. Also fixed a bug.
6104 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
6105 the math panels when switching buffers (unless new buffer is readonly).
6107 * src/BufferView.C (NoSavedPositions)
6108 * src/BufferView_pimpl.C (NoSavedPositions): New methods
6110 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6112 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
6113 less of dvi dirty or not.
6115 * src/trans_mgr.[Ch] (insert): change first parameter to string
6118 * src/chset.[Ch] (encodeString): add const to first parameter
6120 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6122 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
6126 * src/LaTeX.C (deplog): better searching for dependency files in
6127 the latex log. Uses now regexps.
6129 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
6130 instead of the box hack or \hfill.
6132 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6134 * src/lyxfunc.C (doImportHelper): do not create the file before
6135 doing the actual import.
6136 (doImportASCIIasLines): create a new file before doing the insert.
6137 (doImportASCIIasParagraphs): ditto.
6139 * lib/lyxrc.example: remove mention of non-existing commands
6141 * lyx.man: remove mention of color-related switches.
6143 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
6145 * src/lyx_gui.C: remove all the color-related ressources, which
6146 are not used anymore.
6148 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
6151 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6153 * src/lyxrc.C (read): Add a missing break in the switch
6155 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
6157 * src/text2.C (InsertStringA): Fix a bug with insertion into table
6159 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
6162 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6164 * src/text.C (draw): draw bars under foreign language words.
6166 * src/LColor.[Ch]: add LColor::language
6168 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6170 * src/lyxcursor.h (boundary): New member variable
6172 * src/text.C (IsBoundary): New methods
6174 * src/text.C: Use the above for currect cursor movement when there
6175 is both RTL & LTR text.
6177 * src/text2.C: ditto
6179 * src/bufferview_funcs.C (ToggleAndShow): ditto
6181 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6183 * src/text.C (DeleteLineForward): set selection to true to avoid
6184 that DeleteEmptyParagraphMechanism does some magic. This is how it
6185 is done in all other functions, and seems reasonable.
6186 (DeleteWordForward): do not jump over non-word stuff, since
6187 CursorRightOneWord() already does it.
6189 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
6190 DeleteWordBackward, since they seem safe to me (since selection is
6191 set to "true") DeleteEmptyParagraphMechanism does nothing.
6193 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6195 * src/lyx_main.C (easyParse): simplify the code by factoring the
6196 part that removes parameters from the command line.
6197 (LyX): check wether wrong command line options have been given.
6199 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
6201 * src/lyx_main.C : add support for specifying user LyX
6202 directory via command line option -userdir.
6204 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
6206 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
6207 the number of items per popup.
6208 (Add_to_refs_menu): Ditto.
6210 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6212 * src/lyxparagraph.h: renamed ClearParagraph() to
6213 StripLeadingSpaces() and moved it to paragraph.C. We pass the
6214 textclass as parameter, and do nothing if free_spacing is
6215 true. This fixes part of the line-delete-forward problems.
6217 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
6218 (pasteSelection): ditto.
6219 (SwitchLayoutsBetweenClasses): more translatable strings.
6221 * src/text2.C (CutSelection): use StripLeadingSpaces.
6222 (PasteSelection): ditto.
6223 (DeleteEmptyParagraphMechanism): ditto.
6225 2000-05-26 Juergen Vigna <jug@sad.it>
6227 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
6228 is not needed in tabular insets.
6230 * src/insets/insettabular.C (TabularFeatures): added missing features.
6232 * src/tabular.C (DeleteColumn):
6234 (AppendRow): implemented this functions
6235 (cellsturct::operator=): clone the inset too;
6237 2000-05-23 Juergen Vigna <jug@sad.it>
6239 * src/insets/insettabular.C (LocalDispatch): better selection support
6240 when having multicolumn-cells.
6242 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6244 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
6246 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6248 * src/ColorHandler.C (getGCForeground): put more test into _()
6250 * lib/examples/eu_splash.lyx: new file (Basque translation) from
6253 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
6256 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
6258 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
6259 there are no labels, or when buffer is readonly.
6261 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
6262 there are no labels, buffer is SGML, or when buffer is readonly.
6264 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6266 * src/LColor.C (LColor): change a couple of grey40 to grey60
6267 (LColor): rewore initalization to make compiles go some magnitude
6269 (getGUIName): don't use gettext until we need the string.
6271 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
6273 * src/Bullet.[Ch]: Fixed a small bug.
6275 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
6277 * src/paragraph.C (String): Several fixes/improvements
6279 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
6281 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6283 * src/paragraph.C (String): give more correct output.
6285 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
6287 * src/lyxfont.C (stateText) Do not output the language if it is
6288 eqaul to the language of the document.
6290 * src/paragraph.C (TeXOnePar): Do not put language switch commands
6291 between two paragraphs with the same language.
6293 * src/paragraph.C (getParLanguage) Return a correct answer for an
6294 empty dummy paragraph.
6296 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
6299 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
6302 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
6303 the menus/popup, if requested fonts are unavailable.
6305 2000-05-22 Juergen Vigna <jug@sad.it>
6307 * src/insets/insettabular.C (LocalDispatch): added some more cursor
6308 movement support (Up/Down/Tab/Shift-Tab).
6309 (LocalDispatch): added also preliminari cursor-selection.
6311 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
6313 * src/paragraph.C (PasteParagraph): Hopefully now right!
6315 2000-05-22 Garst R. Reese <reese@isn.net>
6317 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
6318 of list, change all references to Environment to Command
6319 * tex/hollywood.cls : rewrite environments as commands, add
6320 \uppercase to interiorshot and exteriorshot to force uppecase.
6321 * tex/broadway.cls : rewrite environments as commands. Tweak
6324 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6326 * src/menus.C (Add_to_toc_menu): fix the code which limits the
6327 size of items: use a constant intead of the hardcoded 40, and more
6328 importantly do not remove the %m and %x tags added at the end.
6329 (Add_to_refs_menu): use vector::size_type instead of
6330 unsigned int as basic types for the variables. _Please_ do not
6331 assume that size_t is equal to unsigned int. On an alpha, this is
6332 unsigned long, which is _not_ the same.
6334 * src/language.C (initL): remove language "hungarian", since it
6335 seems that "magyar" is better.
6337 2000-05-22 Juergen Vigna <jug@sad.it>
6339 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
6341 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
6344 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
6345 next was deleted but not set to 0.
6347 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6349 * src/language.C (initL): change the initialization of languages
6350 so that compiles goes _fast_.
6352 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
6355 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
6357 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6361 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6363 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
6365 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
6369 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
6372 * src/insets/insetlo*.[Ch]: Made editable
6374 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6376 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
6377 the current selection.
6379 * src/BufferView_pimpl.C (stuffClipboard): new method
6381 * src/BufferView.C (stuffClipboard): new method
6383 * src/paragraph.C (String): new method
6385 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
6386 LColor::ignore when lyxname is not found.
6388 * src/BufferView.C (pasteSelection): new method
6390 * src/BufferView_pimpl.C (pasteSelection): new method
6392 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
6394 * src/WorkArea.C (request_clipboard_cb): new static function
6395 (getClipboard): new method
6396 (putClipboard): new method
6398 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6400 * LyX 1.1.5pre2 released
6402 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6404 * src/vspace.C (operator=): removed
6405 (operator=): removed
6407 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
6409 * src/layout.C (NumberOfClass): manually set the type in make_pair
6410 (NumberOfLayout): ditto
6412 * src/language.C: use the Language constructor for ignore_lang
6414 * src/language.h: add constructors to struct Language
6416 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
6418 * src/text2.C (SetCursorIntern): comment out #warning
6420 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
6422 * src/mathed/math_iter.h: initialize sx and sw to 0
6424 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6426 * forms/lyx.fd: Redesign of form_ref
6428 * src/LaTeXFeatures.[Ch]
6432 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
6435 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
6436 and Buffer::inset_iterator.
6438 * src/menus.C: Added new menus: TOC and Refs.
6440 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
6442 * src/buffer.C (getTocList): New method.
6444 * src/BufferView2.C (ChangeRefs): New method.
6446 * src/buffer.C (getLabelList): New method. It replaces the old
6447 getReferenceList. The return type is vector<string> instead of
6450 * src/insets/insetinclude.C (getLabelList): New method. Replaces
6451 the old getLabel() and GetNumberOfLabels() methods.
6452 * src/insets/insetlabel.C (getLabelList): ditto
6453 * src/mathed/formula.C (getLabelList): ditto
6455 * src/paragraph.C (String): New method.
6457 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
6458 Uses the new getTocList() method.
6459 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
6460 which automatically updates the contents of the browser.
6461 (RefUpdateCB): Use the new getLabelList method.
6463 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
6465 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
6467 * src/spellchecker.C: Added using std::reverse;
6469 2000-05-19 Juergen Vigna <jug@sad.it>
6471 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
6473 * src/insets/insettext.C (computeTextRows): small fix for display of
6474 1 character after a newline.
6476 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
6479 2000-05-18 Juergen Vigna <jug@sad.it>
6481 * src/insets/insettabular.C (TabularFeatures): fixed update of display
6482 when changing width of column.
6484 * src/tabular.C (set_row_column_number_info): setting of
6485 autobreak rows if necessary.
6487 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6489 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
6491 * src/vc-backend.*: renamed stat() to status() and vcstat to
6492 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
6493 compilation broke. The new name seems more relevant, anyway.
6495 2000-05-17 Juergen Vigna <jug@sad.it>
6497 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
6498 which was wrong if the removing caused removing of rows!
6500 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
6501 (pushToken): new function.
6503 * src/text2.C (CutSelection): fix problem discovered with purify
6505 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6507 * src/debug.C (showTags): enlarge the first column, now that we
6508 have 6-digits debug codes.
6510 * lib/layouts/hollywood.layout:
6511 * lib/tex/hollywood.cls:
6512 * lib/tex/brodway.cls:
6513 * lib/layouts/brodway.layout: more commands and fewer
6514 environments. Preambles moved in the .cls files. Broadway now has
6515 more options on scene numbering and less whitespace (from Garst)
6517 * src/insets/insetbib.C (getKeys): make sure that we are in the
6518 document directory, in case the bib file is there.
6520 * src/insets/insetbib.C (Latex): revert bogus change.
6522 2000-05-16 Juergen Vigna <jug@sad.it>
6524 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
6525 the TabularLayout on cursor move.
6527 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
6529 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
6532 (draw): fixed cursor position and drawing so that the cursor is
6533 visible when before the tabular-inset.
6535 * src/insets/insettext.C (init): drawLockedFrame was not initialized
6536 when creating from old insettext.
6538 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
6540 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6542 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
6543 * lib/tex/brodway.cls: ditto
6545 * lib/layouts/brodway.layout: change alignment of parenthical
6548 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6550 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
6551 versions 0.88 and 0.89 are supported.
6553 2000-05-15 Juergen Vigna <jug@sad.it>
6555 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
6558 * src/insets/insettext.C (computeTextRows): redone completely this
6559 function in a much cleaner way, because of problems when having a
6561 (draw): added a frame border when the inset is locked.
6562 (SetDrawLockedFrame): this sets if we draw the border or not.
6563 (SetFrameColor): this sets the frame color (default=insetframe).
6565 * src/insets/lyxinset.h: added x() and y() functions which return
6566 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
6567 function which is needed to see if we have a locking inset of some
6568 type in this inset (needed for now in insettabular).
6570 * src/vspace.C (inPixels): the same function also without a BufferView
6571 parameter as so it is easier to use it in some ocasions.
6573 * src/lyxfunc.C: changed all places where insertInset was used so
6574 that now if it couldn't be inserted it is deleted!
6576 * src/TabularLayout.C:
6577 * src/TableLayout.C: added support for new tabular-inset!
6579 * src/BufferView2.C (insertInset): this now returns a bool if the
6580 inset was really inserted!!!
6582 * src/tabular.C (GetLastCellInRow):
6583 (GetFirstCellInRow): new helper functions.
6584 (Latex): implemented for new tabular class.
6588 (TeXTopHLine): new Latex() helper functions.
6590 2000-05-12 Juergen Vigna <jug@sad.it>
6592 * src/mathed/formulamacro.C (Read):
6593 * src/mathed/formula.C (Read): read also the \end_inset here!
6595 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6597 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
6598 crush when saving formulae with unbalanced parenthesis.
6600 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
6602 * src/layout.C: Add new keyword "endlabelstring" to layout file
6604 * src/text.C (GetVisibleRow): Draw endlabel string.
6606 * lib/layouts/broadway.layout
6607 * lib/layouts/hollywood.layout: Added endlabel for the
6608 Parenthetical layout.
6610 * lib/layouts/heb-article.layout: Do not use slanted font shape
6611 for Theorem like environments.
6613 * src/buffer.C (makeLaTeXFile): Always add "american" to
6614 the UsedLanguages list if document language is RTL.
6616 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6618 * add addendum to README.OS2 and small patch (from SMiyata)
6620 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6622 * many files: correct the calls to ChangeExtension().
6624 * src/support/filetools.C (ChangeExtension): remove the no_path
6625 argument, which does not belong there. Use OnlyFileName() instead.
6627 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
6628 files when LaTeXing a non-nice latex file.
6630 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
6631 a chain of "if". Return false when deadkeys are not handled.
6633 * src/lyx_main.C (LyX): adapted the code for default bindings.
6635 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
6636 bindings for basic functionality (except deadkeys).
6637 (deadKeyBindings): new method. Performs the bindings of deadkeys.
6639 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
6640 several methods: handle override_x_deadkeys.
6642 * src/lyxrc.h: remove the "bindings" map, which did not make much
6643 sense anyway. New variable override_x_deadkeys, defaulting to "true".
6645 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6647 * src/lyxfont.C (stateText): use a saner method to determine
6648 whether the font is "default". Seems to fix the crash with DEC
6651 * src/Bullet.[Ch] (Bullet): remove const on parameters.
6653 2000-05-08 Juergen Vigna <jug@sad.it>
6655 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
6656 TabularLayoutMenu with mouse-button-3
6657 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
6659 * src/TabularLayout.C: added this file for having a Layout for
6662 2000-05-05 Juergen Vigna <jug@sad.it>
6664 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
6665 recalculating inset-widths.
6666 (TabularFeatures): activated this function so that I can change
6667 tabular-features via menu.
6669 * src/menus.C (ShowEditMenu): inserted support for insettabular so
6670 that I can test some functions with the Table menu.
6672 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6674 * src/lyxfont.C (stateText): guard against stupid c++libs.
6676 * src/tabular.C: add using std::vector
6677 some whitespace changes, + removed som autogenerated code.
6679 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
6681 2000-05-05 Juergen Vigna <jug@sad.it>
6683 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
6684 row, columns and cellstructures.
6686 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6688 * lib/lyxrc.example: remove obsolete entries.
6690 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
6691 reading of protected_separator for free_spacing.
6693 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6695 * src/text.C (draw): do not display an exclamation mark in the
6696 margin for margin notes. This is confusing, ugly and
6699 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
6700 AMS math' is checked.
6702 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
6703 name to see whether including the amsmath package is needed.
6705 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
6707 * src/paragraph.C (validate): Compute UsedLanguages correctly
6708 (don't insert the american language if it doesn't appear in the
6711 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
6712 The argument of \thanks{} command is considered moving argument
6714 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
6717 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
6719 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
6720 for appendix/minipage/depth. The lines can be now both in the footnote
6721 frame, and outside the frame.
6723 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
6726 2000-05-05 Juergen Vigna <jug@sad.it>
6728 * src/table.[Ch]: removed the inset and buffer stuff as this is now
6729 neede only in tabular.[Ch].
6731 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6733 * src/insets/insetspecialchar.C (Read): allow command == '~' for
6735 (Write): write '~' for PROTECTED_SEPARATOR
6737 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6739 * src/lyxparagraph.h: add a friend struct matchIT after the struct
6742 * src/mathed/formula.C (drawStr): rename size to siz.
6744 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
6745 possibly fix a bug by not changing the pflags = flags to piflags =
6748 2000-05-05 Juergen Vigna <jug@sad.it>
6750 * src/insets/insetbib.C: moved using directive
6752 * src/ImportNoweb.C: small fix for being able to compile (missing
6755 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6757 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
6758 to use clear, since we don't depend on this in the code. Add test
6761 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6763 * (various *.C files): add using std::foo directives to please dec
6766 * replace calls to string::clear() to string::erase() (Angus)
6768 * src/cheaders/cmath: modified to provide std::abs.
6770 2000-05-04 Juergen Vigna <jug@sad.it>
6772 * src/insets/insettext.C: Prepared all for inserting of multiple
6773 paragraphs. Still display stuff to do (alignment and other things),
6774 but I would like to use LyXText to do this when we cleaned out the
6775 table-support stuff.
6777 * src/insets/insettabular.C: Changed lot of stuff and added lots
6778 of functionality still a lot to do.
6780 * src/tabular.C: Various functions changed name and moved to be
6781 const functions. Added new Read and Write functions and changed
6782 lots of things so it works good with tabular-insets (also removed
6783 some stuff which is not needed anymore * hacks *).
6785 * src/lyxcursor.h: added operators == and != which just look if
6786 par and pos are (not) equal.
6788 * src/buffer.C (latexParagraphs): inserted this function to latex
6789 all paragraphs form par to endpar as then I can use this too for
6792 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
6793 so that I can call this to from text insets with their own cursor.
6795 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
6796 output off all paragraphs (because of the fix below)!
6798 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
6799 the very last paragraph (this could be also the last paragraph of an
6802 * src/texrow.h: added rows() call which returns the count-variable.
6804 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6806 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
6808 * lib/configure.m4: better autodetection of DocBook tools.
6810 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6812 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
6814 * src/lyx_cb.C: add using std::reverse;
6816 * src/LaTeX.C (run): on error always run deleteFilesOnError before
6819 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
6820 selected files. Should fix repeated errors from generated files.
6822 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
6824 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
6826 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
6827 the spellchecker popup.
6829 * lib/lyxrc.example: Removed the \number_inset section
6831 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6833 * src/insets/figinset.C (various): Use IsFileReadable() to make
6834 sure that the file actually exist. Relying on ghostscripts errors
6835 is a bad idea since they can lead to X server crashes.
6837 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
6839 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
6842 * lib/lyxrc.example: smallish typo in description of
6843 \view_dvi_paper_option
6845 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6848 * src/lyxfunc.C: doImportHelper to factor out common code of the
6849 various import methods. New functions doImportASCIIasLines,
6850 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
6851 doImportLinuxDoc for the format specific parts.
6854 * buffer.C: Dispatch returns now a bool to indicate success
6857 * lyx_gui.C: Add getLyXView() for member access
6859 * lyx_main.C: Change logic for batch commands: First try
6860 Buffer::Dispatch (possibly without GUI), if that fails, use
6863 * lyx_main.C: Add support for --import command line switch.
6864 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
6865 Available Formats: Everything accepted by 'buffer-import <format>'
6867 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6869 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
6872 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
6873 documents will be reformatted upon reentry.
6875 2000-04-27 Juergen Vigna <jug@sad.it>
6877 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
6878 correctly only last pos this was a bug.
6880 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6882 * release of lyx-1.1.5pre1
6884 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6886 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
6888 * src/menus.C: revert the change of naming (Figure->Graphic...)
6889 from 2000-04-11. It was incomplete and bad.
6891 * src/LColor.[Ch]: add LColor::depthbar.
6892 * src/text.C (GetVisibleRow): use it.
6894 * README: update the languages list.
6896 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6898 * src/text.C (GetVisibleRow): show the depth of paragraphs using
6901 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6903 * README: remove sections that were just wrong.
6905 * src/text2.C (GetRowNearY): remove currentrow code
6907 * src/text.C (GetRow): remove currentrow code
6909 * src/screen.C (Update): rewritten a bit.
6910 (SmallUpdate): removed func
6912 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
6914 (FullRebreak): return bool
6915 (currentrow): remove var
6916 (currentrow_y): ditto
6918 * src/lyxscreen.h (Draw): change arg to unsigned long
6919 (FitCursor): return bool
6920 (FitManualCursor): ditto
6921 (Smallpdate): remove func
6922 (first): change to unsigned long
6923 (DrawOneRow): change second arg to long (from long &)
6924 (screen_refresh_y): remove var
6925 (scree_refresh_row): ditto
6927 * src/lyxrow.h: change baseline to usigned int from unsigned
6928 short, this brings some implicit/unsigned issues out in the open.
6930 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
6932 (Dispatch): don't call updateScrollbar after fitCursor. Use update
6933 instead of smallUpdate.
6935 * src/lyxcursor.h: change y to unsigned long
6937 * src/buffer.h: don't call updateScrollbar after fitcursor
6939 * src/buffer.C (parseSingleLyXformat2Token): move variables to
6940 where they are used. Removed "\\direction", this was not present
6941 in 1.1.4 and is already obsolete. Commented out some code that I
6942 believe to never be called.
6943 (runLiterate): don't call updateScrollbar after fitCursor
6945 (buildProgram): ditto
6948 * src/WorkArea.h (workWidth): change return val to unsigned
6951 (redraw): remove the button redraws
6952 (setScrollbarValue): change for scrollbar
6953 (getScrollbarValue): change for scrollbar
6954 (getScrollbarBounds): change for scrollbar
6956 * src/WorkArea.C (C_WorkArea_up_cb): removed func
6957 (C_WorkArea_down_cb): removed func
6958 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
6959 (resize): change for scrollbar
6960 (setScrollbar): ditto
6961 (setScrollbarBounds): ditto
6962 (setScrollbarIncrements): ditto
6963 (up_cb): removed func
6964 (down_cb): removed func
6965 (scroll_cb): change for scrollbar
6966 (work_area_handler): ditto
6968 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
6969 when FitCursor did something.
6970 (updateScrollbar): some unsigned changes
6971 (downCB): removed func
6972 (scrollUpOnePage): removed func
6973 (scrollDownOnePage): remvoed func
6974 (workAreaMotionNotify): don't call screen->FitCursor but use
6975 fitCursor instead. and bool return val
6976 (workAreaButtonPress): ditto
6977 (workAreaButtonRelease): some unsigned changes
6978 (checkInsetHit): ditto
6979 (workAreaExpose): ditto
6980 (update): parts rewritten, comments about the signed char arg added
6981 (smallUpdate): removed func
6982 (cursorPrevious): call needed updateScrollbar
6985 * src/BufferView2.C (allFloats): don't call updateScrollbar after
6988 * src/BufferView.[Ch] (upCB): removed func
6989 (downCB): removed func
6990 (smallUpdate): removed func
6992 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6994 * src/lyxtext.h src/text.C src/text2.C: removed support for the
6995 currentrow, currentrow_y optimization. This did not help a lot and
6996 if we want to do this kind of optimization we should rather use
6997 cursor.row instead of the currentrow.
6999 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
7000 buffer spacing and klyx spacing support.
7002 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7004 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
7007 2000-04-26 Juergen Vigna <jug@sad.it>
7009 * src/insets/figinset.C: fixes to Lars sstream changes!
7011 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
7013 * A lot of files: Added Ascii(ostream &) methods to all inset
7014 classes. Used when exporting to ASCII.
7016 * src/buffer.C (writeFileAscii,RoffAsciiTable)
7017 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
7020 * src/text2.C (ToggleFree): Disabled implicit word selection when
7021 there is a change in the language
7023 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
7024 no output was generated for end-of-sentence inset.
7026 * src/insets/lyxinset.h
7029 * src/paragraph.C: Removed the insetnumber code
7031 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
7033 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7035 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
7036 no_babel and no_epsfig completely from the file.
7037 (parseSingleLyXformat2Token): add handling for per-paragraph
7038 spacing as written by klyx.
7040 * src/insets/figinset.C: applied patch by Andre. Made it work with
7043 2000-04-20 Juergen Vigna <jug@sad.it>
7045 * src/insets/insettext.C (cutSelection):
7046 (copySelection): Fixed with selection from right to left.
7047 (draw): now the rows are not recalculated at every draw.
7048 (computeTextRows): for now reset the inset-owner here (this is
7049 important for an undo or copy where the inset-owner is not set
7052 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
7053 motion to the_locking_inset screen->first was forgotten, this was
7054 not important till we got multiline insets.
7056 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7058 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
7059 code seems to be alright (it is code changed by Dekel, and the
7060 intent is indeed that all macros should be defined \protect'ed)
7062 * NEWS: a bit of reorganisation of the new user-visible features.
7064 2000-04-19 Juergen Vigna <jug@sad.it>
7066 * src/insets/insettext.C (init): using a LyXCursor now for cursor
7067 position. Set the inset_owner of the used paragraph so that it knows
7068 that it is inside an inset. Fixed cursor handling with mouse and
7069 cursor keys. Fixed wrong timed inset redraws and lots of other changes
7070 and cleanups to make TextInsets work better.
7072 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
7073 Changed parameters of various functions and added LockInsetInInset().
7075 * src/insets/insettext.C:
7077 * src/insets/insetcollapsable.h:
7078 * src/insets/insetcollapsable.C:
7079 * src/insets/insetfoot.h:
7080 * src/insets/insetfoot.C:
7081 * src/insets/insetert.h:
7082 * src/insets/insetert.C: cleaned up the code so that it works now
7083 correctly with insettext.
7085 * src/insets/inset.C:
7086 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
7087 that insets in insets are supported right.
7090 * src/table.C: lots of changes for use with inset tabular (and cleanup)
7092 * src/paragraph.C: some small fixes
7094 * src/debug.h: inserted INSETS debug info
7096 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
7097 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
7099 * src/commandtags.h:
7100 * src/LyXAction.C: insert code for InsetTabular.
7102 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
7103 not Button1MotionMask.
7104 (workAreaButtonRelease): send always a InsetButtonRelease event to
7106 (checkInsetHit): some setCursor fixes (always with insets).
7108 * src/BufferView2.C (lockInset): returns a bool now and extended for
7109 locking insets inside insets.
7110 (showLockedInsetCursor): it is important to have the cursor always
7111 before the locked inset.
7112 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
7114 * src/BufferView.h: made lockInset return a bool.
7116 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
7118 * src/text2.C (SetCursor): This now has a version with a LyXCursor
7119 that is used also internally but can be called as public to have back
7120 a cursor pos which is not set internally.
7121 (SetCursorIntern): Changed to use above function.
7123 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
7125 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7130 * NEWS: updated for prerelease of 1.1.5. Please comment and send
7131 patches for things that should be in or should be changed.
7133 * src/* [insetfiles]: change "usigned char fragile" to bool
7134 fragile. There was only one point that could that be questioned
7135 and that is commented in formulamacro.C. Grep for "CHECK".
7137 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
7138 (DeleteBuffer): take it out of CutAndPaste and make it static.
7140 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7142 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
7143 output the spacing envir commands. Also the new commands used in
7144 the LaTeX output makes the result better.
7146 * src/Spacing.C (writeEnvirBegin): new method
7147 (writeEnvirEnd): new method
7149 2000-04-18 Juergen Vigna <jug@sad.it>
7151 * src/CutAndPaste.C: made textclass a static member of the class
7152 as otherwise it is not accesed right!!!
7154 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
7156 * forms/layout_forms.fd
7157 * src/layout_forms.h
7158 * src/layout_forms.C (create_form_form_character)
7159 * src/lyx_cb.C (UserFreeFont)
7160 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
7161 documents (in the layout->character popup).
7163 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7165 * src/spellchecker.C (create_ispell_pipe): fix a bug where
7166 \spell_command was in fact not honored (from Kevin Atkinson).
7168 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
7171 * src/lyx_gui.h: make lyxViews private (Angus)
7173 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
7175 * src/mathed/math_write.C
7176 (MathMatrixInset::Write) Put \protect before \begin{array} and
7177 \end{array} if fragile
7178 (MathParInset::Write): Put \protect before \\ if fragile
7180 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7182 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
7183 initialization if the LyXColorHandler must be done after the
7184 connections to the XServer has been established.
7186 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
7187 get the background pixel from the lyxColorhandler so that the
7188 figures are rendered with the correct background color.
7189 (NextToken): removed functions.
7190 (GetPSSizes): use ifs >> string instead of NextToken.
7192 * src/Painter.[Ch]: the color cache moved out of this file.
7194 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
7197 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7199 * src/WorkArea.C (work_area_handler): call BufferView::enterView
7200 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
7202 * src/BufferView.C (enterView): new func
7203 (leaveView): new func
7205 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
7207 (leaveView): new func, undefines xterm cursor when approp.
7209 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
7210 (AllowInput): delete the Workarea cursor handling from this func.
7212 * src/Painter.C (underline): draw a slimer underline in most cases.
7214 * src/lyx_main.C (error_handler): use extern "C"
7216 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7218 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
7219 sent directly to me.
7221 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
7222 to the list by Dekel.
7224 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
7227 * src/bufferview_funcs.[Ch]: two new files, moved several of the
7228 methods from lyx_cb.here.
7230 * src/lyx_cb.C: in addition to the above; removed input_prohibited
7233 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7235 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
7236 instead of using current_view directly.
7238 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
7240 * src/LyXAction.C (init): add the paragraph-spacing command.
7242 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
7244 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
7246 * src/lyx_cb.C (CurrentState): output a string when the spacing is
7247 different from the documents.
7249 * src/text.C (SetHeightOfRow): take paragraph spacing into
7250 account, paragraph spacing takes precedence over buffer spacing
7251 (GetVisibleRow): ditto
7253 * src/paragraph.C (writeFile): output the spacing parameter too.
7254 (validate): set the correct features if spacing is used in the
7256 (Clear): set spacing to default
7257 (MakeSameLayout): spacing too
7258 (HasSameLayout): spacing too
7259 (SetLayout): spacing too
7260 (TeXOnePar): output the spacing commands
7262 * src/lyxparagraph.h: added a spacing variable for use with
7263 per-paragraph spacing.
7265 * src/Spacing.h: add a Default spacing and a method to check if
7266 the current spacing is default. also added an operator==
7268 * src/text2.C (DeleteEmptyParagraphMechanism): added a
7271 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7273 * src/lyxserver.C (callback): fix dispatch of functions
7275 * src/insets/insetlatexaccent.C (checkContents): turn bogus
7276 printf() into lyxerr call.
7278 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
7281 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
7282 "Table" to "Table Box", "Float" to "Floating Material"; deletes
7283 the "Float" from each of the subitems.
7284 (ShowHelpMenu): add entry for "FAQ" and "TOC".
7286 * src/support/DebugStream.h: add an #ifdef to work around a gcc
7287 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
7288 documented the change so that the workaround can be nuked later.
7290 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
7293 * src/lyxlex_pimpl.C (next): do not re-declare the default value
7295 * src/buffer.C (getLatexName): ditto
7296 (setReadonly): ditto
7298 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7300 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
7301 avoid some uses of current_view. Added also a bufferParams()
7302 method to get at this.
7304 * src/lyxtext.h: changed params->buffer and paramters->bparams.
7306 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7308 * src/lyxparagraph.[Ch]: removed
7309 operator<(LyXParagraph::InsetTable..., added a struct matchIT
7310 with operators used by lower_bound and
7311 upper_bound in InsetTable's
7312 Make struct InsetTable private again. Used matchpos.
7314 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
7316 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
7317 document, the language of existing text is changed (unless the
7318 document is multi-lingual)
7320 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
7322 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
7324 * A lot of files: A rewrite of the Right-to-Left support.
7326 2000-04-10 Juergen Vigna <jug@sad.it>
7328 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
7329 misplaced cursor when inset in inset is locked.
7331 * src/insets/insettext.C (LocalDispatch): small fix so that a
7332 BREAKLINE is not inserted if we don't permit it with autBreakRows.
7334 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
7335 footnote font should be decreased in size twice when displaying.
7337 * src/insets/insettext.C (GetDrawFont): inserted this function as
7338 the drawing-font may differ from the real paragraph font.
7340 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
7341 insets (inset in inset!).
7343 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
7344 function here because we don't want footnotes inside footnotes.
7346 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
7348 (init): now set the inset_owner in paragraph.C
7349 (LocalDispatch): added some resetPos() in the right position
7352 (pasteSelection): changed to use the new CutAndPaste-Class.
7354 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
7355 which tells if it is allowed to insert another inset inside this one.
7357 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
7358 SwitchLayoutsBetweenClasses.
7360 * src/text2.C (InsertInset): checking of the new paragraph-function
7362 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
7363 is not needed anymore here!
7366 (PasteSelection): redone (also with #ifdef) so that now this uses
7367 the CutAndPaste-Class.
7368 (SwitchLayoutsBetweenClasses): removed here and implemented in the
7371 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
7372 from/to text/insets.
7374 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
7375 so that the paragraph knows if it is inside an (text)-inset.
7376 (InsertFromMinibuffer): changed return-value to bool as now it
7377 may happen that an inset is not inserted in the paragraph.
7378 (InsertInsetAllowed): this checks if it is allowed to insert an
7379 inset in this paragraph.
7381 (BreakParagraphConservative):
7382 (BreakParagraph) : small change for the above change of the return
7383 value of InsertFromMinibuffer.
7385 * src/lyxparagraph.h: added inset_owner and the functions to handle
7386 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
7388 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7390 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
7391 functions from BufferView to BufferView::Pimpl to ease maintence.
7393 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
7394 correctly. Also use SetCursorIntern instead of SetCursor.
7396 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
7399 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7401 * src/WorkArea.C (belowMouse): manually implement below mouse.
7403 * src/*: Add "explicit" on several constructors, I added probably
7404 some unneeded ones. A couple of changes to code because of this.
7406 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
7407 implementation and private parts from the users of BufferView. Not
7410 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
7411 implementation and private parts from the users of LyXLex. Not
7414 * src/BufferView_pimpl.[Ch]: new files
7416 * src/lyxlex_pimpl.[Ch]: new files
7418 * src/LyXView.[Ch]: some inline functions move out-of-line
7420 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7422 * src/lyxparagraph.h: make struct InsetTable public.
7424 * src/support/lyxstring.h: change lyxstring::difference_type to be
7425 ptrdiff_t. Add std:: modifiers to streams.
7427 * src/font.C: include the <cctype> header, for islower() and
7430 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7432 * src/font.[Ch]: new files. Contains the metric functions for
7433 fonts, takes a LyXFont as parameter. Better separation of concepts.
7435 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
7436 changes because of this.
7438 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
7440 * src/*: compile with -Winline and move functions that don't
7443 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
7446 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7448 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
7449 (various files changed because of this)
7451 * src/Painter.C (text): fixed the drawing of smallcaps.
7453 * src/lyxfont.[Ch] (drawText): removed unused member func.
7456 * src/*.C: added needed "using" statements and "std::" qualifiers.
7458 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7460 * src/*.h: removed all use of "using" from header files use
7461 qualifier std:: instead.
7463 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7465 * src/text.C (Backspace): some additional cleanups (we already
7466 know whether cursor.pos is 0 or not).
7468 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
7469 automake does not provide one).
7471 * src/bmtable.h: replace C++ comments with C comments.
7473 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
7475 * src/screen.C (ShowCursor): Change the shape of the cursor if
7476 the current language is not equal to the language of the document.
7477 (If the cursor change its shape unexpectedly, then you've found a bug)
7479 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
7482 * src/insets/insetnumber.[Ch]: New files.
7484 * src/LyXAction.C (init)
7485 * src/lyxfunc.C (dispatch): Add command number-inset-insert
7488 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
7490 * src/lyxparagraph.h
7491 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
7492 (the vector is kept sorted).
7494 * src/text.C (GetVisibleRow): Draw selection correctly when there
7495 is both LTR and RTL text.
7497 * src/paragraph.C (Clone): Use the assignment operator for cloning,
7498 which is much faster.
7500 * src/text.C (GetVisibleRow and other): Do not draw the last space
7501 in a row if the direction of the last letter is not equal to the
7502 direction of the paragraph.
7504 * src/lyxfont.C (latexWriteStartChanges):
7505 Check that font language is not equal to basefont language.
7506 (latexWriteEndChanges): ditto
7508 * src/lyx_cb.C (StyleReset): Don't change the language while using
7509 the font-default command.
7511 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
7512 empty paragraph before a footnote.
7514 * src/insets/insetcommand.C (draw): Increase x correctly.
7516 * src/screen.C (ShowCursor): Change cursor shape if
7517 current language != document language.
7519 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
7521 2000-03-31 Juergen Vigna <jug@sad.it>
7523 * src/paragraph.C (GetInset): commented out text[pos] = ' '
7524 (Clone): changed mode how the paragraph-data is copied to the
7525 new clone-paragraph.
7527 * src/lyxfunc.C (Dispatch): fixed small problem when calling
7528 GetInset(pos) with no inset anymore there (in inset UNDO)
7530 * src/insets/insetcommand.C (draw): small fix as here x is
7531 incremented not as much as width() returns (2 before, 2 behind = 4)
7533 2000-03-30 Juergen Vigna <jug@sad.it>
7535 * src/insets/insettext.C (InsetText): small fix in initialize
7536 widthOffset (should not be done in the init() function)
7538 2000-03-29 Amir Karger <karger@lyx.org>
7540 * lib/examples/it_ItemizeBullets.lyx: translation by
7543 * Implemented \textasciitilde and fixed a tiny bug in reLyX
7545 2000-03-29 Juergen Vigna <jug@sad.it>
7547 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
7549 * src/insets/insetfoot.C (Clone): small change as for the below
7550 new init function in the text-inset
7552 * src/insets/insettext.C (init): new function as I've seen that
7553 clone did not copy the Paragraph-Data!
7554 (LocalDispatch): Added code so that now we have some sort of Undo
7555 functionality (well actually we HAVE Undo ;)
7557 * src/text.C (Backspace): Small fix for the a | a Backspace problem
7559 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
7561 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
7564 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7566 * src/main.C: added a runtime check that verifies that the xforms
7567 header used when building LyX and the library used when running
7568 LyX match. Exit with a message if they don't match. This is a
7569 version number check only.
7571 * src/buffer.C (save): Don't allocate memory on the heap for
7572 struct utimbuf times.
7574 * *: some using changes, use iosfwd instead of the real headers.
7576 * src/lyxfont.C use char const * instead of string for the static
7577 strings. Rewrite some functions to use sstream.
7579 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7581 * src/text.C (Backspace): hopefully fix the dreaded backaspace
7584 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7586 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
7587 of Geodesy (from Martin Vermeer)
7589 * lib/layouts/svjour.inc: include file for the Springer svjour
7590 class. It can be used to support journals other than JoG.
7592 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
7593 Miskiewicz <misiek@pld.org.pl>)
7594 * lib/reLyX/Makefile.am: ditto.
7596 2000-03-27 Juergen Vigna <jug@sad.it>
7598 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
7599 also some modifications with operations on selected text.
7601 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
7602 problems with clicking on insets (last famous words ;)
7604 * src/insets/insetcommand.C (draw):
7605 (width): Changed to have a bit of space before and after the inset so
7606 that the blinking cursor can be seen (otherwise it was hidden)
7608 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7610 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
7611 would not be added to the link list when an installed gettext (not
7612 part of libc) is found.
7614 2000-03-24 Juergen Vigna <jug@sad.it>
7616 * src/insets/insetcollapsable.C (Edit):
7617 * src/mathed/formula.C (InsetButtonRelease):
7618 (InsetButtonPress): fixed for new handling of ButtonPress/Release
7621 * src/BufferView.C (workAreaButtonPress):
7622 (workAreaButtonRelease):
7623 (checkInsetHit): Finally fixed the clicking on insets be handled
7626 * src/insets/insetert.C (Edit): inserted this call so that ERT
7627 insets work always with LaTeX-font
7629 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7631 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
7632 caused lyx to startup with no GUI in place, causing in a crash
7633 upon startup when called with arguments.
7635 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7637 * src/FontLoader.C: better initialization of dummyXFontStruct.
7639 2000-03-20 José Abílio Matos <jamatos@lyx.org>
7641 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
7642 for linuxdoc and docbook import and export format options.
7644 * lib/lyxrc.example Example of default values for the previous flags.
7646 * src/lyx_cb.C Use those flags instead of the hardwired values for
7647 linuxdoc and docbook export.
7649 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
7652 * src/menus.C Added menus entries for the new import/exports formats.
7654 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7656 * src/lyxrc.*: Added support for running without Gui
7659 * src/FontLoader.C: sensible defaults if no fonts are needed
7661 * src/lyx_cb.C: New function ShowMessage (writes either to the
7662 minibuffer or cout in case of no gui
7663 New function AskOverwrite for common stuff
7664 Consequently various changes to call these functions
7666 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
7667 wild guess at sensible screen resolution when having no gui
7669 * src/lyxfont.C: no gui, no fonts... set some defaults
7671 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7673 * src/LColor.C: made the command inset background a bit lighter.
7675 2000-03-20 Hartmut Goebel <goebel@noris.net>
7677 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
7678 stdstruct.inc. Koma-Script added some title elements which
7679 otherwise have been listed below "bibliography". This split allows
7680 adding title elements to where they belong.
7682 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
7683 define the additional title elements and then include
7686 * many other layout files: changed to include stdtitle.inc just
7687 before stdstruct.inc.
7689 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
7691 * src/buffer.C: (save) Added the option to store all backup files
7692 in a single directory
7694 * src/lyxrc.[Ch]: Added variable \backupdir_path
7696 * lib/lyxrc.example: Added descriptions of recently added variables
7698 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
7699 bibtex inset, not closing the bibtex popup when deleting the inset)
7701 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7703 * src/lyx_cb.C: add a couple using directives.
7705 2000-03-17 José Abílio Matos <jamatos@lyx.org>
7706 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
7707 import based on the filename.
7709 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
7710 file would be imported at start, if the filename where of a sgml file.
7712 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
7714 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
7716 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
7717 * src/lyxfont.h Replaced the member variable bits.direction by the
7718 member variable lang. Made many changes in other files.
7719 This allows having a multi-lingual document
7721 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
7722 that change the current language to <l>.
7723 Removed the command "font-rtl"
7725 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
7726 format for Hebrew documents)
7728 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
7729 When auto_mathmode is "true", pressing a digit key in normal mode
7730 will cause entering into mathmode.
7731 If auto_mathmode is "rtl" then this behavior will be active only
7732 when writing right-to-left text.
7734 * src/text2.C (InsertStringA) The string is inserted using the
7737 * src/paragraph.C (GetEndLabel) Gives a correct result for
7738 footnote paragraphs.
7740 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
7742 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7744 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
7745 front of PasteParagraph. Never insert a ' '. This should at least
7746 fix some cause for the segfaults that we have been experiencing,
7747 it also fixes backspace behaviour slightly. (Phu!)
7749 * src/support/lstrings.C (compare_no_case): some change to make it
7750 compile with gcc 2.95.2 and stdlibc++-v3
7752 * src/text2.C (MeltFootnoteEnvironment): change type o
7753 first_footnote_par_is_not_empty to bool.
7755 * src/lyxparagraph.h: make text private. Changes in other files
7757 (fitToSize): new function
7758 (setContentsFromPar): new function
7759 (clearContents): new function
7760 (SetChar): new function
7762 * src/paragraph.C (readSimpleWholeFile): deleted.
7764 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
7765 the file, just use a simple string instead. Also read the file in
7766 a more maintainable manner.
7768 * src/text2.C (InsertStringA): deleted.
7769 (InsertStringB): deleted.
7771 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7773 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
7774 RedoParagraphs from the doublespace handling part, just set status
7775 to NEED_MORE_REFRESH. Also don't update cursor position (should be
7776 done, but perhaps not like this.)
7778 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7780 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
7781 character when inserting an inset.
7783 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7785 * src/bufferparams.C (readLanguage): now takes "default" into
7788 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
7789 also initialize the toplevel_keymap with the default bindings from
7792 * src/buffer.C (Buffer): remove lyxrc from the parameters.
7794 * all files using lyxrc: have lyxrc as a real variable and not a
7795 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
7798 * src/lyxrc.C: remove double call to defaultKeyBindings
7800 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
7801 toolbar defauls using lyxlex. Remove enums, structs, functions
7804 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
7805 toolbar defaults. Also store default keybindings in a map.
7807 * src/ToolbarDefaults.[Ch]: New file. This class is used for
7808 storing the toolbar defaults without any xforms dependencies.
7810 * src/insets/figinset.C: patch posted to list by Andre Poenitz
7811 applied. Changed to use iterators.
7813 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7815 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
7816 systems that don't have LINGUAS set to begin with.
7818 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7820 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
7821 the list by Dekel Tsur.
7823 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7825 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
7826 * src/insets/form_graphics.C: ditto.
7828 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
7830 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7832 * src/bufferparams.C (readLanguage): use the new language map
7834 * src/intl.C (InitKeyMapper): use the new language map
7836 * src/lyx_gui.C (create_forms): use the new language map
7838 * src/language.[Ch]: New files. Used for holding the information
7839 about each language. Now! Use this new language map enhance it and
7840 make it really usable for our needs.
7842 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
7844 * screen.C (ShowCursor): Removed duplicate code.
7845 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
7846 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
7848 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
7851 * src/text.C Added TransformChar method. Used for rendering Arabic
7852 text correctly (change the glyphs of the letter according to the
7853 position in the word)
7858 * src/lyxrc.C Added lyxrc command {language_command_begin,
7859 language_command_end,language_command_ltr,language_command_rtl,
7860 language_package} which allows the use of either arabtex or Omega
7863 * src/lyx_gui.C (init)
7865 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
7866 to use encoding for menu fonts which is different than the encoding
7869 * src/buffer.C (makeLaTeXFile): If params.language = "default",
7870 do not load the babel package.
7871 To write an English document with Hebrew/Arabic, change the document
7872 language to "english".
7874 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
7875 (alphaCounter): changed to return char
7876 (loweralphaCounter, hebrewCounter, romanCounter): New functions
7878 * lib/lyxrc.example Added examples for Hebrew/Arabic
7881 * src/layout.C Added layout command endlabeltype
7883 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
7885 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
7887 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7889 * src/mathed/math_delim.C (search_deco): return a
7890 math_deco_struct* instead of index.
7892 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7894 * All files with a USE_OSTREAM_ONLY within: removed all code that
7895 was unused when USE_OSTREAM_ONLY is defined.
7897 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
7898 of any less. Removed header and using.
7900 * src/text.C (GetVisibleRow): draw the string "Page Break
7901 (top/bottom)" on screen when drawing a pagebreak line.
7903 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7905 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
7907 * src/mathed/math_macro.C (draw): do some cast magic.
7910 * src/mathed/math_defs.h: change byte* argument to byte const*.
7912 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
7914 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
7915 know it is right to return InsetFoot* too, but cxx does not like
7918 * src/insets/insetcollapsable.[Ch] (Clone): make const.
7920 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
7922 * src/mathed/math_delim.C: change == to proper assignment.
7924 2000-03-09 Juergen Vigna <jug@sad.it>
7926 * src/insets/insettext.C (setPos): fixed various cursor positioning
7927 problems (via mouse and cursor-keys)
7928 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
7929 inset (still a small display problem but it works ;)
7931 * src/insets/insetcollapsable.C (draw): added button_top_y and
7932 button_bottom_y to have correct values for clicking on the inset.
7934 * src/support/lyxalgo.h: commented out 'using std::less'
7936 2000-03-08 Juergen Vigna <jug@sad.it>
7938 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
7939 Button-Release event closes as it is alos the Release-Event
7942 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
7944 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7946 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
7947 can add multiple spaces in Scrap (literate programming) styles...
7948 which, by the way, is how I got hooked on LyX to begin with.
7950 * src/mathed/formula.C (Write): Added dummy variable to an
7951 inset::Latex() call.
7952 (Latex): Add free_spacing boolean to inset::Latex()
7954 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
7956 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
7957 virtual function to include the free_spacing boolean from
7958 the containing paragraph's style.
7960 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
7961 Added free_spacing boolean arg to match inset.h
7963 * src/insets/insettext.C, src/insets/insettext.h (Latex):
7964 Added free_spacing boolean arg to match inset.h
7966 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
7967 Added free_spacing boolean and made sure that if in a free_spacing
7968 paragraph, that we output normal space if there is a protected space.
7970 * src/insets/insetref.C, src/insets/insetref.h (Latex):
7971 Added free_spacing boolean arg to match inset.h
7973 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
7974 Added free_spacing boolean arg to match inset.h
7976 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
7977 Added free_spacing boolean arg to match inset.h
7979 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
7980 Added free_spacing boolean arg to match inset.h
7982 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
7983 Added free_spacing boolean arg to match inset.h
7985 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
7986 free_spacing boolean arg to match inset.h
7988 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
7989 Added free_spacing boolean arg to match inset.h
7991 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
7992 Added free_spacing boolean arg to match inset.h
7994 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
7995 Added free_spacing boolean arg to match inset.h
7997 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
7998 Added free_spacing boolean arg to match inset.h
8000 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
8001 Added free_spacing boolean arg to match inset.h
8003 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
8004 free_spacing boolean arg to match inset.h
8006 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
8007 free_spacing boolean arg to match inset.h
8009 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
8010 ignore free_spacing paragraphs. The user's spaces are left
8013 * src/text.C (InsertChar): Fixed the free_spacing layout
8014 attribute behavior. Now, if free_spacing is set, you can
8015 add multiple spaces in a paragraph with impunity (and they
8016 get output verbatim).
8017 (SelectSelectedWord): Added dummy argument to inset::Latex()
8020 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
8023 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
8024 paragraph layouts now only input a simple space instead.
8025 Special character insets don't make any sense in free-spacing
8028 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
8029 hard-spaces in the *input* file to simple spaces if the layout
8030 is free-spacing. This converts old files which had to have
8031 hard-spaces in free-spacing layouts where a simple space was
8033 (writeFileAscii): Added free_spacing check to pass to the newly
8034 reworked inset::Latex(...) methods. The inset::Latex() code
8035 ensures that hard-spaces in free-spacing paragraphs get output
8036 as spaces (rather than "~").
8038 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8040 * src/mathed/math_delim.C (draw): draw the empty placeholder
8041 delims with a onoffdash line.
8042 (struct math_deco_compare): struct that holds the "functors" used
8043 for the sort and the binary search in math_deco_table.
8044 (class init_deco_table): class used for initial sort of the
8046 (search_deco): use lower_bound to do a binary search in the
8049 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8051 * src/lyxrc.C: a small secret thingie...
8053 * src/lyxlex.C (printTable): changed to take a ostream as paramter
8054 and to not flush the stream as often as it used to.
8056 * src/support/lyxalgo.h: new file
8057 (sorted): template function used for checking if a sequence is
8058 sorted or not. Two versions with and without user supplied
8059 compare. Uses same compare as std::sort.
8061 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
8062 it and give warning on lyxerr.
8064 (struct compare_tags): struct with function operators used for
8065 checking if sorted, sorting and lower_bound.
8066 (search_kw): use lower_bound instead of manually implemented
8069 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8071 * src/insets/insetcollapsable.h: fix Clone() declaration.
8072 * src/insets/insetfoot.h: ditto.
8074 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
8076 2000-03-08 Juergen Vigna <jug@sad.it>
8078 * src/insets/lyxinset.h: added owner call which tells us if
8079 this inset is inside another inset. Changed also the return-type
8080 of Editable to an enum so it tells clearer what the return-value is.
8082 * src/insets/insettext.C (computeTextRows): fixed computing of
8083 textinsets which split automatically on more rows.
8085 * src/insets/insetert.[Ch]: changed this to be of BaseType
8088 * src/insets/insetfoot.[Ch]: added footnote inset
8090 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
8091 collapsable insets (like footnote, ert, ...)
8093 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8095 * src/lyxdraw.h: remvoe file
8097 * src/lyxdraw.C: remove file
8099 * src/insets/insettext.C: added <algorithm>.
8101 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8103 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
8104 (matrix_cb): case MM_OK use string stream
8106 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
8109 * src/mathed/math_macro.C (draw): use string stream
8110 (Metrics): use string stream
8112 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
8113 directly to the ostream.
8115 * src/vspace.C (asString): use string stream.
8116 (asString): use string stream
8117 (asLatexString): use string stream
8119 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
8120 setting Spacing::Other.
8122 * src/LaTeXFeatures.C (getPackages): use string stream instead of
8123 sprintf when creating the stretch vale.
8125 * src/text2.C (alphaCounter): changed to return a string and to
8126 not use a static variable internally. Also fixed a one-off bug.
8127 (SetCounter): changed the drawing of the labels to use string
8128 streams instead of sprintf.
8130 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
8131 manipulator to use a scheme that does not require library support.
8132 This is also the way it is done in the new GNU libstdc++. Should
8133 work with DEC cxx now.
8135 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8137 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
8138 end. This fixes a bug.
8140 * src/mathed (all files concerned with file writing): apply the
8141 USE_OSTREAM_ONLY changes to mathed too.
8143 * src/support/DebugStream.h: make the constructor explicit.
8145 * src/lyxfont.C (latexWriteStartChanges): small bug related to
8146 count and ostream squashed.
8148 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8150 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
8152 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
8153 ostringstream uses STL strings, and we might not.
8155 * src/insets/insetspecialchar.C: add using directive.
8156 * src/insets/insettext.C: ditto.
8158 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8160 * lib/layouts/seminar.layout: feeble attempt at a layout for
8161 seminar.cls, far from completet and could really use some looking
8162 at from people used to write layout files.
8164 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
8165 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
8166 a lot nicer and works nicely with ostreams.
8168 * src/mathed/formula.C (draw): a slightly different solution that
8169 the one posted to the list, but I think this one works too. (font
8170 size wrong in headers.)
8172 * src/insets/insettext.C (computeTextRows): some fiddling on
8173 Jürgens turf, added some comments that he should read.
8175 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
8176 used and it gave compiler warnings.
8177 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
8180 * src/lyx_gui.C (create_forms): do the right thing when
8181 show_banner is true/false.
8183 * src/lyx_cb.C (TimerCB): no need to close or do anything if
8184 show_banner is false.
8186 * most file writing files: Now use iostreams to do almost all of
8187 the writing. Also instead of passing string &, we now use
8188 stringstreams. mathed output is still not adapted to iostreams.
8189 This change can be turned off by commenting out all the occurences
8190 of the "#define USE_OSTREAM_ONLY 1" lines.
8192 * src/WorkArea.C (createPixmap): don't output debug messages.
8193 (WorkArea): don't output debug messages.
8195 * lib/lyxrc.example: added a comment about the new variable
8198 * development/Code_rules/Rules: Added some more commente about how
8199 to build class interfaces and on how better encapsulation can be
8202 2000-03-03 Juergen Vigna <jug@sad.it>
8204 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
8205 automatically with the width of the LyX-Window
8207 * src/insets/insettext.C (computeTextRows): fixed update bug in
8208 displaying text-insets (scrollvalues where not initialized!)
8210 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8212 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
8213 id in the check of the result from lower_bound is not enough since
8214 lower_bound can return last too, and then res->id will not be a
8217 * all insets and some code that use them: I have conditionalized
8218 removed the Latex(string & out, ...) this means that only the
8219 Latex(ostream &, ...) will be used. This is a work in progress to
8220 move towards using streams for all output of files.
8222 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
8225 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8227 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
8228 routine (this fixes bug where greek letters were surrounded by too
8231 * src/support/filetools.C (findtexfile): change a bit the search
8232 algorithm, to fix bug introduced in 1.1.4. Note that --format is
8233 no longer passed to kpsewhich, we may have to change that later.
8235 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
8236 warning options to avoid problems with X header files (from Angus
8238 * acinclude.m4: regenerated.
8240 2000-03-02 Juergen Vigna <jug@sad.it>
8242 * src/insets/insettext.C (WriteParagraphData): Using the
8243 par->writeFile() function for writing paragraph-data.
8244 (Read): Using buffer->parseSingleLyXformat2Token()-function
8245 for parsing paragraph data!
8247 * src/buffer.C (readLyXformat2): removed all parse data and using
8248 the new parseSingleLyXformat2Token()-function.
8249 (parseSingleLyXformat2Token): added this function to parse (read)
8250 lyx-file-format (this is called also from text-insets now!)
8252 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8254 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
8257 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
8258 directly instead of going through a func. One very bad thing: a
8259 static LyXFindReplace, but I don't know where to place it.
8261 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
8262 string instead of char[]. Also changed to static.
8263 (GetSelectionOrWordAtCursor): changed to static inline
8264 (SetSelectionOverLenChars): ditto.
8266 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
8267 current_view and global variables. both classes has changed names
8268 and LyXFindReplace is not inherited from SearchForm.
8270 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
8271 fl_form_search form.
8273 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
8275 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8277 * lib/bind/*.bind: make sure 'buffer-previous' function is not
8278 bound (from Kayvan).
8280 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
8282 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
8284 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8286 * some things that I should comment but the local pub says head to
8289 * comment out all code that belongs to the Roff code for Ascii
8290 export of tables. (this is unused)
8292 * src/LyXView.C: use correct type for global variable
8293 current_layout. (LyXTextClass::size_type)
8295 * some code to get the new insetgraphics closer to working I'd be
8296 grateful for any help.
8298 * src/BufferView2.C (insertInset): use the return type of
8299 NumberOfLayout properly. (also changes in other files)
8301 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
8302 this as a test. I want to know what breaks because of this.
8304 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
8306 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8308 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
8309 to use a \makebox in the label, this allows proper justification
8310 with out using protected spaces or multiple hfills. Now it is
8311 "label" for left justified, "\hfill label\hfill" for center, and
8312 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
8313 should be changed accordingly.
8315 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8317 * src/lyxtext.h: change SetLayout() to take a
8318 LyXTextClass::size_type instead of a char (when there is more than
8319 127 layouts in a class); also change type of copylayouttype.
8320 * src/text2.C (SetLayout): ditto.
8321 * src/LyXView.C (updateLayoutChoice): ditto.
8323 * src/LaTeX.C (scanLogFile): errors where the line number was not
8324 given just after the '!'-line were ignored (from Dekel Tsur).
8326 * lib/lyxrc.example: fix description of \date_insert_format
8328 * lib/layouts/llncs.layout: new layout, contributed by Martin
8331 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8333 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
8334 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
8335 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
8336 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
8337 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
8338 paragraph.C, text.C, text2.C)
8340 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8342 * src/insets/insettext.C (LocalDispatch): remove extra break
8345 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
8346 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
8348 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
8349 * src/insets/insettext.[Ch] (GetCursorPos): ditto
8351 * src/insets/insetbib.h: move InsetBibkey::Holder and
8352 InsetCitation::Holder in public space.
8354 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8356 * src/insets/insettext.h: small change to get the new files from
8357 Juergen to compile (use "string", not "class string").
8359 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
8360 const & as parameter to LocalDispatch, use LyXFont const & as
8361 paramter to some other func. This also had impacto on lyxinsets.h
8362 and the two mathed insets.
8364 2000-02-24 Juergen Vigna <jug@sad.it>
8367 * src/commandtags.h:
8369 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
8373 * src/BufferView2.C: added/updated code for various inset-functions
8375 * src/insets/insetert.[Ch]: added implementation of InsetERT
8377 * src/insets/insettext.[Ch]: added implementation of InsetText
8379 * src/insets/inset.C (Edit): added "unsigned int button" parameter
8380 (draw): added preliminary code for inset scrolling not finshed yet
8382 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
8383 as it is in lyxfunc.C now
8385 * src/insets/lyxinset.h: Added functions for text-insets
8387 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8389 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
8390 BufferView and reimplement the list as a queue put inside its own
8393 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
8395 * several files: use the new interface to the "updateinsetlist"
8397 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
8399 (work_area_handler): call BufferView::trippleClick on trippleclick.
8401 * src/BufferView.C (doubleClick): new function, selects word on
8403 (trippleClick): new function, selects line on trippleclick.
8405 2000-02-22 Allan Rae <rae@lyx.org>
8407 * lib/bind/xemacs.bind: buffer-previous not supported
8409 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8411 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
8414 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8416 * src/bufferlist.C: get rid of current_view from this file
8418 * src/spellchecker.C: get rid of current_view from this file
8420 * src/vspace.C: get rid of current_view from this file
8421 (inPixels): added BufferView parameter for this func
8422 (asLatexCommand): added a BufferParams for this func
8424 * src/text.C src/text2.C: get rid of current_view from these
8427 * src/lyxfont.C (getFontDirection): move this function here from
8430 * src/bufferparams.C (getDocumentDirection): move this function
8433 * src/paragraph.C (getParDirection): move this function here from
8435 (getLetterDirection): ditto
8437 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
8439 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
8440 resize due to wrong pixmap beeing used. Also took the opurtunity
8441 to make the LyXScreen stateless on regard to WorkArea and some
8442 general cleanup in the same files.
8444 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8446 * src/Makefile.am: add missing direction.h
8448 * src/PainterBase.h: made the width functions const.
8450 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
8453 * src/insets/insetcommand.C (draw): draw Editable as buttons.
8455 * src/insets/insetlatexaccent.C (draw): make the accents draw
8456 better, at present this will only work well with iso8859-1.
8458 * several files: remove the old drawing code, now we use the new
8461 * several files: remove support for mono_video, reverse_video and
8464 2000-02-17 Juergen Vigna <jug@sad.it>
8466 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
8467 int ** as we have to return the pointer, otherwise we have only
8468 NULL pointers in the returning function.
8470 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8472 * src/LaTeX.C (operator()): quote file name when running latex.
8474 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8476 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
8477 (bubble tip), this removes our special handling of this.
8479 * Remove all code that is unused now that we have the new
8480 workarea. (Code that are not active when NEW_WA is defined.)
8482 * Make the uses of XSync not conditionalized on define USE_XSYNC.
8484 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8486 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
8487 nonexisting layout; correctly redirect obsoleted layouts.
8489 * lib/lyxrc.example: document \view_dvi_paper_option
8491 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
8494 * src/lyx_cb.C (RunScript): handle $$FName for command names.
8495 (PreviewDVI): handle the view_dvi_paper_option variable.
8496 [Both from Roland Krause]
8498 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8500 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
8501 char const *, int, LyXFont)
8502 (text(int, int, string, LyXFont)): ditto
8504 * src/text.C (InsertCharInTable): attempt to fix the double-space
8505 feature in tables too.
8506 (BackspaceInTable): ditto.
8507 (GetVisibleRow): make bottom pagebreak line be a onoff line.
8509 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8511 * src/text2.C (owner): only complain if owner_ is set and bv != 0
8513 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
8514 newly found text in textcache to this.
8515 (buffer): set the owner of the text put into the textcache to 0
8517 * src/insets/figinset.C (draw): fixed the drawing of figures with
8520 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
8521 drawing of mathframe, hfills, protected space, table lines. I have
8522 now no outstanding drawing problems with the new Painter code.
8524 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8526 * src/PainterBase.C (ellipse, circle): do not specify the default
8529 * src/LColor.h: add using directive.
8531 * src/Painter.[Ch]: change return type of methods from Painter& to
8532 PainterBase&. Add a using directive.
8534 * src/WorkArea.C: wrap xforms callbacks in C functions
8537 * lib/layouts/foils.layout: font fix and simplifications from Carl
8540 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8542 * a lot of files: The Painter, LColor and WorkArea from the old
8543 devel branch has been ported to lyx-devel. Some new files and a
8544 lot of #ifdeffed code. The new workarea is enabled by default, but
8545 if you want to test the new Painter and LColor you have to compile
8546 with USE_PAINTER defined (do this in config.h f.ex.) There are
8547 still some rought edges, and I'd like some help to clear those
8548 out. It looks stable (loads and displays the Userguide very well).
8551 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8553 * src/buffer.C (pop_tag): revert to the previous implementation
8554 (use a global variable for both loops).
8556 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
8558 * src/lyxrc.C (LyXRC): change slightly default date format.
8560 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
8561 there is an English text with a footnote that starts with a Hebrew
8562 paragraph, or vice versa.
8563 (TeXFootnote): ditto.
8565 * src/text.C (LeftMargin): allow for negative values for
8566 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
8569 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
8570 for input encoding (cyrillic)
8572 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8574 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
8577 * src/toolbar.C (set): ditto
8578 * src/insets/insetbib.C (create_form_citation_form): ditto
8580 * lib/CREDITS: added Dekel Tsur.
8582 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
8583 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
8584 hebrew supports files from Dekel Tsur.
8586 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
8587 <tzafrir@technion.ac.il>
8589 * src/lyxrc.C: put \date_insert_format at the right place.
8591 * src/buffer.C (makeLaTeXFile): fix the handling of
8592 BufferParams::sides when writing out latex files.
8594 * src/BufferView2.C: add a "using" directive.
8596 * src/support/lyxsum.C (sum): when we use lyxstring,
8597 ostringstream::str needs an additional .c_str().
8599 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8601 * src/support/filetools.C (ChangeExtension): patch from Etienne
8604 * src/TextCache.C (show): remove const_cast and make second
8605 parameter non-const LyXText *.
8607 * src/TextCache.h: use non const LyXText in show.
8609 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
8612 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8614 * src/support/lyxsum.C: rework to be more flexible.
8616 * several places: don't check if a pointer is 0 if you are going
8619 * src/text.C: remove some dead code.
8621 * src/insets/figinset.C: remove some dead code
8623 * src/buffer.C: move the BufferView funcs to BufferView2.C
8624 remove all support for insetlatexdel
8625 remove support for oldpapersize stuff
8626 made some member funcs const
8628 * src/kbmap.C: use a std::list to store the bindings in.
8630 * src/BufferView2.C: new file
8632 * src/kbsequence.[Ch]: new files
8634 * src/LyXAction.C + others: remove all trace of buffer-previous
8636 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
8637 only have one copy in the binary of this table.
8639 * hebrew patch: moved some functions from LyXText to more
8640 appropriate places. (LyXParagraph, BufferParams, LyXFont)
8642 * several files: remove support for XForms older than 0.88
8644 remove some #if 0 #endif code
8646 * src/TextCache.[Ch]: new file. Holds the textcache.
8648 * src/BufferView.C: changes to use the new TextCache interface.
8649 (waitForX): remove the now unused code.
8651 * src/BackStack.h: remove some commented code
8653 * lib/bind/emacs.bind: remove binding for buffer-previous
8655 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8657 * applied the hebrew patch.
8659 * src/lyxrow.h: make sure that all Row variables are initialized.
8661 * src/text2.C (TextHandleUndo): comment out a delete, this might
8662 introduce a memory leak, but should also help us to not try to
8663 read freed memory. We need to look at this one.
8665 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
8666 (LyXParagraph): initalize footnotekind.
8668 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
8669 forgot this when applying the patch. Please heed the warnings.
8671 * src/BufferView.C (buffer): a fix for the buffer-reload problem
8672 (aka. reformat problem)
8674 * src/bufferlist.C (exists): made const, and use const_iterator
8675 (isLoaded): new func.
8676 (release): use std::find to find the correct buffer.
8678 * src/bufferlist.h: made getState a const func.
8679 made empty a const func.
8680 made exists a const func.
8683 2000-02-01 Juergen Vigna <jug@sad.it>
8685 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
8687 * po/it.po: updated a bit the italian po file and also changed the
8688 'file nuovo' for newfile to 'filenuovo' without a space, this did
8691 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
8692 for the new insert_date command.
8694 * src/lyxfunc.C (Dispatch): added support for a insert_date function
8695 from jdblair, to insert a date into the current text conforming to
8696 a strftime format (for now only considering the locale-set and not
8697 the document-language).
8699 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8701 * src/lyxfont.C (textWidth): hopefully better fix for the Array
8702 Bounds Read error seen by purify. The problem was that islower is
8703 a macros which takes an unsigned char and uses it as an index for
8704 in array of characters properties (and is thus subject to the
8708 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
8709 correctly the paper sides radio buttons.
8710 (UpdateDocumentButtons): ditto.
8712 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8714 * src/kbmap.C (getsym + others): change to return unsigned int,
8715 returning a long can give problems on 64 bit systems. (I assume
8716 that int is 32bit on 64bit systems)
8718 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8720 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
8721 LyXLookupString to be zero-terminated. Really fixes problems seen
8724 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8726 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
8727 write a (char*)0 to the lyxerr stream.
8729 * src/lastfiles.C: move algorithm before the using statemets.
8731 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8733 * src/lastfiles.C: move using directives in global scope (egcs 1.x
8734 complains otherwise).
8735 * src/table.C: ditto
8737 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
8740 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
8741 that I removed earlier... It is really needed.
8743 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
8745 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8747 * INSTALL: update xforms home page URL.
8749 * lib/configure.m4: fix a bug with unreadable layout files.
8751 * src/table.C (calculate_width_of_column): add "using std::max"
8754 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8756 * several files: marked several lines with "DEL LINE", this is
8757 lines that can be deleted without changing anything.
8758 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
8759 checks this anyway */
8762 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
8764 * src/DepTable.C (update): add a "+" at the end when the checksum
8765 is different. (debugging string only)
8767 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
8768 the next inset to not be displayed. This should also fix the list
8769 of labels in the "Insert Crossreference" dialog.
8771 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8773 * src/support/LSubstring.C (LSubstring): set pos to string::npos
8774 when regex was not found.
8776 * src/support/lstrings.C (lowercase): use handcoded transform always.
8779 * src/text.C (Delete): fixed the crash. cursor.par->prev and
8780 old_cursor.par->prev could be 0.
8782 * several files: changed post inc/dec to pre inc/dec
8784 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
8785 write the lastfiles to file.
8787 * src/BufferView.C (buffer): only show TextCache info when debugging
8789 (resizeCurrentBuffer): ditto
8790 (workAreaExpose): ditto
8792 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
8794 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
8796 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
8797 a bit better by removing the special case for \i and \j.
8799 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8801 * src/lyx_main.C (easyParse): remove test for bad comand line
8802 options, since this broke all xforms-related parsing.
8804 * src/kbmap.C (getsym): set return type to unsigned long, as
8805 declared in header. On an alpha, long is _not_ the same as int.
8807 * src/support/LOstream.h: add a "using std::flush;"
8809 * src/insets/figinset.C: ditto.
8811 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8813 * src/bufferlist.C (write): use blinding fast file copy instead of
8814 "a char at a time", now we are doing it the C++ way.
8816 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
8817 std::list<int> instead.
8818 (addpidwait): reflect move to std::list<int>
8819 (sigchldchecker): ditto
8821 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
8824 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
8825 that obviously was wrong...
8827 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
8828 c, this avoids warnings with purify and islower.
8830 * src/insets/figinset.C: rename struct queue to struct
8831 queue_element and rewrite to use a std::queue. gsqueue is now a
8832 std::queue<queue_element>
8833 (runqueue): reflect move to std::queue
8836 * src/support/lstrings.h (tostr): specialize for bool, otherwise
8837 we would get "1" "0" instead of "true" "false. Also make the tostr
8840 2000-01-21 Juergen Vigna <jug@sad.it>
8842 * src/buffer.C (writeFileAscii): Disabled code for special groff
8843 handling of tabulars till I fix this in table.C
8845 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8847 * src/support/mkdir.C (mkdir): change second argument of mkdir to
8849 * src/support/lyxlib.h: ditto.
8851 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8853 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
8854 and 'j' look better. This might fix the "macron" bug that has been
8857 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
8858 functions as one template function. Delete the old versions.
8860 * src/support/lyxsum.C: move using std::ifstream inside
8863 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
8866 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
8868 * src/mathed/formula.C: delete #include "bufferlist.h" never used
8870 * src/insets/figinset.C (InitFigures): use new instead of malloc
8871 to allocate memory for figures and bitmaps.
8872 (DoneFigures): use delete[] instead of free to deallocate memory
8873 for figures and bitmaps.
8874 (runqueue): use new to allocate
8875 (getfigdata): use new/delete[] instead of malloc/free
8876 (RegisterFigure): ditto
8878 * some files: moved some declarations closer to first use, small
8879 whitespace changes use preincrement instead of postincrement where
8880 it does not make a difference.
8882 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
8883 step on the way to use stl::containers for key maps.
8885 * src/bufferlist.h: add a typedef for const_iterator and const
8886 versions of begin and end.
8888 * src/bufferlist.[Ch]: change name of member variable _state to
8889 state_. (avoid reserved names)
8891 (getFileNames): returns the filenames of the buffers in a vector.
8893 * configure.in (ALL_LINGUAS): added ro
8895 * src/support/putenv.C: new file
8897 * src/support/mkdir.C: new file
8899 2000-01-20 Allan Rae <rae@lyx.org>
8901 * lib/layouts/IEEEtran.layout: Added several theorem environments
8903 * lib/templates/IEEEtran.lyx: Example theorem environments and a
8904 couple of minor additions.
8906 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
8907 (except for those in footnotes of course)
8909 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8911 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
8913 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
8914 std::sort and std::lower_bound instead of qsort and handwritten
8916 (struct compara): struct that holds the functors used by std::sort
8917 and std::lower_bound in MathedLookupBOP.
8919 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8921 * src/support/LAssert.h: do not do partial specialization. We do
8924 * src/support/lyxlib.h: note that lyx::getUserName() and
8925 lyx::date() are not in use right now. Should these be suppressed?
8927 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
8928 (makeLinuxDocFile): do not put date and user name in linuxdoc
8931 * src/support/lyxlib.h (kill): change first argument to long int,
8932 since that's what solaris uses.
8934 * src/support/kill.C (kill): fix declaration to match prototype.
8936 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
8937 actually check whether namespaces are supported. This is not what
8940 * src/support/lyxsum.C: add a using directive.
8942 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8944 * src/support/kill.C: if we have namespace support we don't have
8945 to include lyxlib.h.
8947 * src/support/lyxlib.h: use namespace lyx if supported.
8949 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8951 * src/support/date.C: new file
8953 * src/support/chdir.C: new file
8955 * src/support/getUserName.C: new file
8957 * src/support/getcwd.C: new file
8959 * src/support/abort.C: new file
8961 * src/support/kill.C: new file
8963 * src/support/lyxlib.h: moved all the functions in this file
8964 insede struct lyx. Added also kill and abort to this struct. This
8965 is a way to avoid the "kill is not defined in <csignal>", we make
8966 C++ wrappers for functions that are not ANSI C or ANSI C++.
8968 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
8969 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
8970 lyx it has been renamed to sum.
8972 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8974 * src/text.C: add using directives for std::min and std::max.
8976 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8978 * src/texrow.C (getIdFromRow): actually return something useful in
8979 id and pos. Hopefully fixes the bug with positionning of errorbox
8982 * src/lyx_main.C (easyParse): output an error and exit if an
8983 incorrect command line option has been given.
8985 * src/spellchecker.C (ispell_check_word): document a memory leak.
8987 * src/bufferlist.C (write): fix mismatched allocation/deletion,
8988 where a "struct utimbuf" is allocated with "new" and deleted with
8991 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8993 * src/text2.C (CutSelection): don't delete double spaces.
8994 (PasteSelection): ditto
8995 (CopySelection): ditto
8997 * src/text.C (Backspace): don't delete double spaces.
8999 * src/lyxlex.C (next): fix a bug that were only present with
9000 conformant std::istream::get to read comment lines, use
9001 std::istream::getline instead. This seems to fix the problem.
9003 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9005 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
9006 allowed to insert space before space" editing problem. Please read
9007 commends at the beginning of the function. Comments about usage
9010 * src/text.C (InsertChar): fix for the "not allowed to insert
9011 space before space" editing problem.
9013 * src/text2.C (DeleteEmptyParagraphMechanism): when
9014 IsEmptyTableRow can only return false this last "else if" will
9015 always be a no-op. Commented out.
9017 * src/text.C (RedoParagraph): As far as I can understand tmp
9018 cursor is not really needed.
9020 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
9021 present it could only return false anyway.
9022 (several functions): Did something not so smart...added a const
9023 specifier on a lot of methods.
9025 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
9026 and add a tmp->text.resize. The LyXParagraph constructor does the
9028 (BreakParagraphConservative): ditto
9030 * src/support/path.h (Path): add a define so that the wrong usage
9031 "Path("/tmp") will be flagged as a compilation error:
9032 "`unnamed_Path' undeclared (first use this function)"
9034 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9036 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
9037 which was bogus for several reasons.
9039 * src/LaTeX.C (scanAux): fix the regular expression used to scan
9043 * autogen.sh: do not use "type -path" (what's that anyway?).
9045 * src/support/filetools.C (findtexfile): remove extraneous space
9046 which caused a kpsewhich warning (at least with kpathsea version
9049 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9051 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
9053 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
9055 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
9057 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9059 * src/paragraph.C (BreakParagraph): do not reserve space on text
9060 if we don't need to (otherwise, if pos_end < pos, we end up
9061 reserving huge amounts of memory due to bad unsigned karma).
9062 (BreakParagraphConservative): ditto, although I have not seen
9063 evidence the bug can happen here.
9065 * src/lyxparagraph.h: add a using std::list.
9067 2000-01-11 Juergen Vigna <jug@sad.it>
9069 * src/menus.C (MenuDocu): output an Alert if the documentation-file
9072 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9074 * src/vc-backend.C (doVCCommand): change to be static and take one
9075 more parameter: the path to chdir too be fore executing the command.
9076 (retrive): new function equiv to "co -r"
9078 * src/bufferlist.C (loadLyXFile): implement the missing parts if
9079 file_not_found_hook is true.
9081 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
9083 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
9084 if a file is readwrite,readonly...anything else.
9086 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9088 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
9089 (CreatePostscript): name change from MenuRunDVIPS (or something)
9090 (PreviewPostscript): name change from MenuPreviewPS
9091 (PreviewDVI): name change from MenuPreviewDVI
9093 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
9094 \view_pdf_command., \pdf_to_ps_command
9096 * lib/configure.m4: added search for PDF viewer, and search for
9097 PDF to PS converter.
9098 (lyxrc.defaults output): add \pdflatex_command,
9099 \view_pdf_command and \pdf_to_ps_command.
9101 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
9103 * src/bufferlist.C (write): we don't use blocksize for anything so
9106 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9108 * src/support/block.h: disable operator T* (), since it causes
9109 problems with both compilers I tried. See comments in the file.
9111 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
9114 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
9115 variable LYX_DIR_10x to LYX_DIR_11x.
9117 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
9119 * INSTALL: document --with-lyxname.
9122 * configure.in: new configure flag --with-lyxname which allows to
9123 choose the name under which lyx is installed. Default is "lyx", of
9124 course. It used to be possible to do this with --program-suffix,
9125 but the later has in fact a different meaning for autoconf.
9127 * src/support/lstrings.h (lstrchr): reformat a bit.
9129 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
9130 * src/mathed/math_defs.h: ditto.
9132 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9134 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
9135 true, decides if we create a backup file or not when saving. New
9136 tag and variable \pdf_mode, defaults to false. New tag and
9137 variable \pdflatex_command, defaults to pdflatex. New tag and
9138 variable \view_pdf_command, defaults to xpdf. New tag and variable
9139 \pdf_to_ps_command, defaults to pdf2ps.
9141 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9143 * src/bufferlist.C (close): don't call insetUnlock if the buffer
9144 does not have a BufferView.
9145 (unlockInset): ditto + don't access the_locking_inset if the
9146 buffer does not have a BufferView.
9148 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
9149 certain circumstances so that we don't continue a keyboard
9150 operation long after the key was released. Try f.ex. to load a
9151 large document, press PageDown for some seconds and then release
9152 it. Before this change the document would contine to scroll for
9153 some time, with this change it stops imidiatly.
9155 * src/support/block.h: don't allocate more space than needed. As
9156 long as we don't try to write to the arr[x] in a array_type arr[x]
9157 it is perfectly ok. (if you write to it you might segfault).
9158 added operator value_type*() so that is possible to pass the array
9159 to functions expecting a C-pointer.
9161 * lib/Makefile.am (dist-hook): don't fail completely if unable to
9164 * intl/*: updated to gettext 0.10.35, tried to add our own
9165 required modifications. Please verify.
9167 * po/*: updated to gettext 0.10.35, tried to add our own required
9168 modifications. Please verify.
9170 * src/support/lstrings.C (tostr): go at fixing the problem with
9171 cxx and stringstream. When stringstream is used return
9172 oss.str().c_str() so that problems with lyxstring and basic_string
9173 are avoided. Note that the best solution would be for cxx to use
9174 basic_string all the way, but it is not conformant yet. (it seems)
9176 * src/lyx_cb.C + other files: moved several global functions to
9177 class BufferView, some have been moved to BufferView.[Ch] others
9178 are still located in lyx_cb.C. Code changes because of this. (part
9179 of "get rid of current_view project".)
9181 * src/buffer.C + other files: moved several Buffer functions to
9182 class BufferView, the functions are still present in buffer.C.
9183 Code changes because of this.
9185 * config/lcmessage.m4: updated to most recent. used when creating
9188 * config/progtest.m4: updated to most recent. used when creating
9191 * config/gettext.m4: updated to most recent. applied patch for
9194 * config/gettext.m4.patch: new file that shows what changes we
9195 have done to the local copy of gettext.m4.
9197 * config/libtool.m4: new file, used in creation of acinclude.m4
9199 * config/lyxinclude.m4: new file, this is the lyx created m4
9200 macros, used in making acinclude.m4.
9202 * autogen.sh: GNU m4 discovered as a separate task not as part of
9203 the lib/configure creation.
9204 Generate acinlucde from files in config. Actually cat
9205 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
9206 easier to upgrade .m4 files that really are external.
9208 * src/Spacing.h: moved using std::istringstream to right after
9209 <sstream>. This should fix the problem seen with some compilers.
9211 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9213 * src/lyx_cb.C: began some work to remove the dependency a lot of
9214 functions have on BufferView::text, even if not really needed.
9215 (GetCurrentTextClass): removed this func, it only hid the
9218 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
9219 forgot this in last commit.
9221 * src/Bullet.C (bulletEntry): use static char const *[] for the
9222 tables, becuase of this the return arg had to change to string.
9224 (~Bullet): removed unneeded destructor
9226 * src/BufferView.C (beforeChange): moved from lyx_cb.C
9227 (insetSleep): moved from Buffer
9228 (insetWakeup): moved from Buffer
9229 (insetUnlock): moved from Buffer
9231 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
9232 from Buffer to BufferView.
9234 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
9236 * config/ltmain.sh: updated to version 1.3.4 of libtool
9238 * config/ltconfig: updated to version 1.3.4 of libtool
9240 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9243 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
9244 Did I get that right?
9246 * src/lyxlex.h: add a "using" directive or two.
9247 * src/Spacing.h: ditto.
9248 * src/insets/figinset.C: ditto.
9249 * src/support/filetools.C: ditto.
9250 * src/support/lstrings.C: ditto.
9251 * src/BufferView.C: ditto.
9252 * src/bufferlist.C: ditto.
9253 * src/lyx_cb.C: ditto.
9254 * src/lyxlex.C: ditto.
9256 * NEWS: add some changes for 1.1.4.
9258 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9260 * src/BufferView.C: first go at a TextCache to speed up switching
9263 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9265 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
9266 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
9267 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
9268 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
9271 * src/mathed/math_defs.h (MathedRowSt): make sure that all
9272 members of the struct are correctly initialized to 0 (detected by
9274 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
9275 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
9277 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
9278 pidwait, since it was allocated with "new". This was potentially
9279 very bad. Thanks to Michael Schmitt for running purify for us.
9282 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9284 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
9286 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
9288 1999-12-30 Allan Rae <rae@lyx.org>
9290 * lib/templates/IEEEtran.lyx: minor change
9292 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
9293 src/mathed/formula.C (LocalDispatch): askForText changes
9295 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
9296 know when a user has cancelled input. Fixes annoying problems with
9297 inserting labels and version control.
9299 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9301 * src/support/lstrings.C (tostr): rewritten to use strstream and
9304 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9306 * src/support/filetools.C (IsFileWriteable): use fstream to check
9307 (IsDirWriteable): use fileinfo to check
9309 * src/support/filetools.h (FilePtr): whole class deleted
9311 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
9313 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
9315 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
9317 * src/bufferlist.C (write): use ifstream and ofstream instead of
9320 * src/Spacing.h: use istrstream instead of sscanf
9322 * src/mathed/math_defs.h: change first arg to istream from FILE*
9324 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
9326 * src/mathed/math_parser.C: have yyis to be an istream
9327 (LexGetArg): use istream (yyis)
9329 (mathed_parse): ditto
9330 (mathed_parser_file): first arg istream instead of FILE*, set yyis
9332 * src/mathed/formula.C (Read): rewritten to use istream
9334 * src/mathed/formulamacro.C (Read): rewritten to use istream
9336 * src/lyxlex.h (~LyXLex): deleted desturctor
9337 (getStream): new function, returns an istream
9338 (getFile): deleted funtion
9339 (IsOK): return is.good();
9341 * src/lyxlex.C (LyXLex): delete file and owns_file
9342 (setFile): open an filebuf and assign that to a istream instead of
9344 (setStream): new function, takes an istream as arg.
9345 (setFile): deleted function
9346 (EatLine): rewritten us use istream instead of FILE*
9350 * src/table.C (LyXTable): use istream instead of FILE*
9351 (Read): rewritten to take an istream instead of FILE*
9353 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9355 * src/buffer.C (Dispatch): remove an extraneous break statement.
9357 * src/support/filetools.C (QuoteName): change to do simple
9358 'quoting'. More work is necessary. Also changed to do nothing
9359 under emx (needs fix too).
9360 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
9362 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
9363 config.h.in to the AC_DEFINE_UNQUOTED() call.
9364 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
9365 needs char * as argument (because Solaris 7 declares it like
9368 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
9369 remove definition of BZERO.
9371 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9373 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
9374 defined, "lyxregex.h" if not.
9376 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
9378 (REGEX): new variable that is set to regex.c lyxregex.h when
9379 AM_CONDITIONAL USE_REGEX is set.
9380 (libsupport_la_SOURCES): add $(REGEX)
9382 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
9385 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
9388 * configure.in: add call to LYX_REGEX
9390 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
9391 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
9393 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9395 * lib/bind/fi_menus.bind: new file, from
9396 pauli.virtanen@saunalahti.fi.
9398 * src/buffer.C (getBibkeyList): pass the parameter delim to
9399 InsetInclude::getKeys and InsetBibtex::getKeys.
9401 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
9402 is passed to Buffer::getBibkeyList
9404 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
9405 instead of the hardcoded comma.
9407 * src/insets/insetbib.C (getKeys): make sure that there are not
9408 leading blanks in bibtex keys. Normal latex does not care, but
9409 harvard.sty seems to dislike blanks at the beginning of citation
9410 keys. In particular, the retturn value of the function is
9412 * INSTALL: make it clear that libstdc++ is needed and that gcc
9413 2.7.x probably does not work.
9415 * src/support/filetools.C (findtexfile): make debug message go to
9417 * src/insets/insetbib.C (getKeys): ditto
9419 * src/debug.C (showTags): make sure that the output is correctly
9422 * configure.in: add a comment for TWO_COLOR_ICON define.
9424 * acconfig.h: remove all the entries that already defined in
9425 configure.in or acinclude.m4.
9427 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
9428 to avoid user name, date and copyright.
9430 1999-12-21 Juergen Vigna <jug@sad.it>
9432 * src/table.C (Read): Now read bogus row format informations
9433 if the format is < 5 so that afterwards the table can
9434 be read by lyx but without any format-info. Fixed the
9435 crash we experienced when not doing this.
9437 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9439 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
9440 (RedoDrawingOfParagraph): ditto
9441 (RedoParagraphs): ditto
9442 (RemoveTableRow): ditto
9444 * src/text.C (Fill): rename arg paperwidth -> paper_width
9446 * src/buffer.C (insertLyXFile): rename var filename -> fname
9447 (writeFile): rename arg filename -> fname
9448 (writeFileAscii): ditto
9449 (makeLaTeXFile): ditto
9450 (makeLinuxDocFile): ditto
9451 (makeDocBookFile): ditto
9453 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
9456 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
9458 * src/bmtable.h: add extern "C" on this file when __cplusplus is
9461 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
9462 compiled by a C compiler not C++.
9464 * src/layout.h (LyXTextClass): added typedef for const_iterator
9465 (LyXTextClassList): added typedef for const_iterator + member
9466 functions begin and end.
9468 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
9469 iterators to fill the choice_class.
9470 (updateLayoutChoice): rewritten to use iterators to fill the
9471 layoutlist in the toolbar.
9473 * src/BufferView.h (BufferView::work_area_width): removed unused
9476 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
9478 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
9479 (sgmlCloseTag): ditto
9481 * src/support/lstrings.h: return type of countChar changed to
9484 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
9485 what version of this func to use. Also made to return unsigned int.
9487 * configure.in: call LYX_STD_COUNT
9489 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
9490 conforming std::count.
9492 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9494 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
9495 and a subscript would give bad display (patch from Dekel Tsur
9496 <dekel@math.tau.ac.il>).
9498 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
9500 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
9503 * src/chset.h: add a few 'using' directives
9505 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
9506 triggered when no buffer is active
9508 * src/layout.C: removed `break' after `return' in switch(), since
9511 * src/lyx_main.C (init): make sure LyX can be ran in place even
9512 when libtool has done its magic with shared libraries. Fix the
9513 test for the case when the system directory has not been found.
9515 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
9516 name for the latex file.
9517 (MenuMakeHTML): ditto
9519 * src/buffer.h: add an optional boolean argument, which is passed
9522 1999-12-20 Allan Rae <rae@lyx.org>
9524 * lib/templates/IEEEtran.lyx: small correction and update.
9526 * configure.in: Attempted to use LYX_PATH_HEADER
9528 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
9530 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
9531 input from JMarc. Now use preprocessor to find the header.
9532 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
9533 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
9534 LYX_STL_STRING_FWD. See comments in file.
9536 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
9538 * The global MiniBuffer * minibuffer variable is dead.
9540 * The global FD_form_main * fd_form_main variable is dead.
9542 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9544 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
9546 * src/table.h: add the LOstream.h header
9547 * src/debug.h: ditto
9549 * src/LyXAction.h: change the explaination of the ReadOnly
9550 attribute: is indicates that the function _can_ be used.
9552 * src/LyXAction.C (init): find-replace _can_ be used in read-only
9555 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9557 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
9563 * src/paragraph.C (GetWord): assert on pos>=0
9566 * src/support/lyxstring.C: condition the use of an invariant on
9568 * src/support/lyxstring.h: ditto
9570 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
9571 Use LAssert.h instead of plain assert().
9573 * src/support/lstrings.h: add LAssert.h, in case it is needed.
9575 * src/lyxfunc.C: do not include LAssert.h, it is not used.
9576 * src/support/filetools.C: ditto
9578 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
9581 * INSTALL: document the new configure flags
9583 * configure.in: suppress --with-debug; add --enable-assertions
9585 * acinclude.m4: various changes in alignment of help strings.
9587 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9589 * src/kbmap.C: commented out the use of the hash map in kb_map,
9590 beginning of movement to a stl::container.
9592 * several files: removed code that was not in effect when
9593 MOVE_TEXT was defined.
9595 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
9596 for escaping should not be used. We can discuss if the string
9597 should be enclosed in f.ex. [] instead of "".
9599 * src/trans_mgr.C (insert): use the new returned value from
9600 encodeString to get deadkeys and keymaps done correctly.
9602 * src/chset.C (encodeString): changed to return a pair, to tell
9603 what to use if we know the string.
9605 * src/lyxscreen.h (fillArc): new function.
9607 * src/FontInfo.C (resize): rewritten to use more std::string like
9608 structore, especially string::replace.
9610 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
9613 * configure.in (chmod +x some scripts): remove config/gcc-hack
9615 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9617 * src/buffer.C (writeFile): change once again the top comment in a
9618 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
9619 instead of an hardcoded version number.
9620 (makeDocBookFile): ditto
9622 * src/version.h: add new define LYX_DOCVERSION
9624 * po/de.po: update from Pit Sütterlin
9625 * lib/bind/de_menus.bind: ditto.
9627 * src/lyxfunc.C (Dispatch): call MenuExport()
9628 * src/buffer.C (Dispatch): ditto
9630 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
9631 LyXFunc::Dispatch().
9632 (MenuExport): new function, moved from
9633 LyXFunc::Dispatch().
9635 * src/trans_mgr.C (insert): small cleanup
9636 * src/chset.C (loadFile): ditto
9638 * lib/kbd/iso8859-1.cdef: add missing backslashes
9640 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9642 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
9643 help with placing the manually drawn accents better.
9645 (Draw): x2 and hg changed to float to minimize rounding errors and
9646 help place the accents better.
9648 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
9649 unsigned short to char is just wrong...cast the char to unsigned
9650 char instead so that the two values can compare sanely. This
9651 should also make the display of insetlatexaccents better and
9652 perhaps also some other insets.
9654 (lbearing): new function
9657 1999-12-15 Allan Rae <rae@lyx.org>
9659 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
9660 header that provides a wrapper around the very annoying SGI STL header
9663 * src/support/lyxstring.C, src/LString.h:
9664 removed old SGI-STL-compatability attempts.
9666 * configure.in: Use LYX_STL_STRING_FWD.
9668 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
9669 stl_string_fwd.h is around and try to determine it's location.
9670 Major improvement over previous SGI STL 3.2 compatability.
9671 Three small problems remain with this function due to my zero
9672 knowledge of autoconf. JMarc and lgb see the comments in the code.
9674 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9676 * src/broken_const.h, config/hack-gcc, config/README: removed
9678 * configure.in: remove --with-gcc-hack option; do not call
9681 * INSTALL: remove documentation of --with-broken-const and
9684 * acconfig.h: remove all trace of BROKEN_CONST define
9686 * src/buffer.C (makeDocBookFile): update version number in output
9688 (SimpleDocBookOnePar): fix an assert when trying to a character
9689 access beyond string length
9692 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9694 * po/de.po: fix the Export menu
9696 * lyx.man: update the description of -dbg
9698 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
9699 (commandLineHelp): updated
9700 (easyParse): show list of available debug levels if -dbg is passed
9703 * src/Makefile.am: add debug.C
9705 * src/debug.h: moved some code to debug.C
9707 * src/debug.C: new file. Contains code to set and show debug
9710 * src/layout.C: remove 'break' after 'continue' in switch
9711 statements, since these cannot be reached.
9713 1999-12-13 Allan Rae <rae@lyx.org>
9715 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
9716 (in_word_set): hash() -> math_hash()
9718 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
9720 * acconfig.h: Added a test for whether we are using exceptions in the
9721 current compilation run. If so USING_EXCEPTIONS is defined.
9723 * config.in: Check for existance of stl_string_fwd.h
9724 * src/LString.h: If compiling --with-included-string and SGI's
9725 STL version 3.2 is present (see above test) we need to block their
9726 forward declaration of string and supply a __get_c_string().
9727 However, it turns out this is only necessary if compiling with
9728 exceptions enabled so I've a bit more to add yet.
9730 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
9731 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
9732 src/support/LRegex.h, src/undo.h:
9733 Shuffle the order of the included files a little to ensure that
9734 LString.h gets included before anything that includes stl_string_fwd.h
9736 * src/support/lyxstring.C: We need to #include LString.h instead of
9737 lyxstring.h to get the necessary definition of __get_c_string.
9738 (__get_c_string): New function. This is defined static just like SGI's
9739 although why they need to do this I'm not sure. Perhaps it should be
9740 in lstrings.C instead.
9742 * lib/templates/IEEEtran.lyx: New template file.
9744 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9746 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
9747 * intl/Makefile.in (MKINSTALLDIRS): ditto
9749 * src/LyXAction.C (init): changed to hold the LFUN data in a
9750 automatic array in stead of in callso to newFunc, this speeds up
9751 compilation a lot. Also all the memory used by the array is
9752 returned when the init is completed.
9754 * a lot of files: compiled with -Wold-style-cast, changed most of
9755 the reported offenders to C++ style casts. Did not change the
9756 offenders in C files.
9758 * src/trans.h (Match): change argument type to unsigned int.
9760 * src/support/DebugStream.C: fix some types on the streambufs so
9761 that it works on a conforming implementation.
9763 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9765 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
9767 * src/support/lyxstring.C: remove the inline added earlier since
9768 they cause a bunch of unsatisfied symbols when linking with dec
9769 cxx. Cxx likes to have the body of inlines at the place where they
9772 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
9773 accessing negative bounds in array. This fixes the crash when
9774 inserting accented characters.
9775 * src/trans.h (Match): ditto
9777 * src/buffer.C (Dispatch): since this is a void, it should not try
9778 to return anything...
9780 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9782 * src/buffer.h: removed the two friends from Buffer. Some changes
9783 because of this. Buffer::getFileName and Buffer::setFileName
9784 renamed to Buffer::fileName() and Buffer::fileName(...).
9786 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9788 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
9789 and Buffer::update(short) to BufferView. This move is currently
9790 controlled by a define MOVE_TEXT, this will be removed when all
9791 shows to be ok. This move paves the way for better separation
9792 between buffer contents and buffer view. One side effect is that
9793 the BufferView needs a rebreak when swiching buffers, if we want
9794 to avoid this we can add a cache that holds pointers to LyXText's
9795 that is not currently in use.
9797 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
9800 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9802 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
9804 * lyx_main.C: new command line option -x (or --execute) and
9805 -e (or --export). Now direct conversion from .lyx to .tex
9806 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
9807 Unfortunately, X is still needed and the GUI pops up during the
9810 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9812 * src/Spacing.C: add a using directive to bring stream stuff into
9814 * src/paragraph.C: ditto
9815 * src/buffer.C: ditto
9817 * NEWS: updated a bit the new features of 1.1.3 (took a few things
9818 from Lars' announcement).
9820 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
9821 example files from Tino Meinen.
9823 1999-12-06 Allan Rae <rae@lyx.org>
9825 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
9827 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9829 * src/support/lyxstring.C: added a lot of inline for no good
9832 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
9833 latexWriteEndChanges, they were not used.
9835 * src/layout.h (operator<<): output operator for PageSides
9837 * src/mathed/math_iter.C (my_memcpy): slightly changed.
9839 * some example files: loaded in LyX 1.0.4 and saved again to update
9840 certain constructs (table format)
9842 * a lot of files: did the change to use fstream/iostream for all
9843 writing of files. Done with a close look at Andre Poenitz's patch.
9845 * some files: whitespace changes.
9847 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9849 * src/mathed/math_iter.C (my_memcpy): new function. Since the
9850 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
9851 architecture, we provide our own. It is used unconditionnally, but
9852 I do not think this is a performance problem. Thanks to Angus
9853 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
9854 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
9856 (GetInset): use my_memcpy.
9860 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
9861 it is easier to understand, but it uses less TeX-only constructs now.
9863 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
9864 elements contain spaces
9866 * lib/configure: regenerated
9868 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
9869 elements contain spaces; display the list of programs that are
9872 * autogen.sh: make sure lib/configure is executable
9874 * lib/examples/*: rename the tutorial examples to begin with the
9875 two-letters language code.
9877 * src/lyxfunc.C (getStatus): do not query current font if no
9880 * src/lyx_cb.C (RunScript): use QuoteName
9881 (MenuRunDvips): ditto
9882 (PrintApplyCB): ditto
9884 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
9885 around argument, so that it works well with the current shell.
9886 Does not work properly with OS/2 shells currently.
9888 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
9889 * src/LyXSendto.C (SendtoApplyCB): ditto
9890 * src/lyxfunc.C (Dispatch): ditto
9891 * src/buffer.C (runLaTeX): ditto
9892 (runLiterate): ditto
9893 (buildProgram): ditto
9895 * src/lyx_cb.C (RunScript): ditto
9896 (MenuMakeLaTeX): ditto
9898 * src/buffer.h (getLatexName): new method
9900 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
9902 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9904 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
9905 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
9906 (create_math_panel): ditto
9908 * src/lyxfunc.C (getStatus): re-activate the code which gets
9909 current font and cursor; add test for export to html.
9911 * src/lyxrc.C (read): remove unreachable break statements; add a
9914 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
9916 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9918 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
9919 introduced by faulty regex.
9920 * src/buffer.C: ditto
9921 * src/lastfiles.C: ditto
9922 * src/paragraph.C: ditto
9923 * src/table.C: ditto
9924 * src/vspace.C: ditto
9925 * src/insets/figinset.C: ditto
9926 Note: most of these is absolutely harmless, except the one in
9927 src/mathed formula.C.
9929 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9931 * src/ImportNoweb.C (documentclass): fixed bounds for substr
9932 operation, yielding correct results for the reLyX command.
9934 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9936 * src/support/filetools.C (ExpandPath): removed an over eager
9938 (ReplaceEnvironmentPath): ditto
9940 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
9941 shows that we are doing something fishy in our code...
9945 * src/lyxrc.C (read): use a double switch trick to get more help
9946 from the compiler. (the same trick is used in layout.C)
9947 (write): new function. opens a ofstream and pass that to output
9948 (output): new function, takes a ostream and writes the lyxrc
9949 elemts to it. uses a dummy switch to make sure no elements are
9952 * src/lyxlex.h: added a struct pushpophelper for use in functions
9953 with more than one exit point.
9955 * src/lyxlex.[Ch] (GetInteger): made it const
9959 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
9961 * src/layout.[hC] : LayoutTags splitted into several enums, new
9962 methods created, better error handling cleaner use of lyxlex. Read
9965 * src/bmtable.[Ch]: change some member prototypes because of the
9966 image const changes.
9968 * commandtags.h, src/LyXAction.C (init): new function:
9969 "preferences-save", saves the lyxrc entries into .lyx/preferences.
9970 This file is not read automatically but you can add \input
9971 preferences to your lyxrc if you want to. We need to discuss how
9974 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
9975 in .aux, also remove .bib and .bst files from dependencies when
9978 * src/BufferView.C, src/LyXView.C: add const_cast several places
9979 because of changes to images.
9981 * lib/images/*: same change as for images/*
9983 * lib/lyxrc.example: Default for accept_compound is false not no.
9985 * images/*: changed to be const, however I have som misgivings
9986 about this change so it might be changed back.
9988 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9990 * lib/configure, po/POTFILES.in: regenerated
9992 * autogen.sh: autogenerate lib/configure from lib/configure.m4
9994 * config/lib_configure.m4: removed
9996 * lib/configure.m4: new file (was config/lib_configure.m4)
9998 * configure.in: do not test for rtti, since we do not use it.
10000 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10002 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
10003 doubling of allocated space scheme. This makes it faster for large
10004 strings end to use less memory for small strings. xtra rememoved.
10006 * src/insets/figinset.C (waitalarm): commented out.
10007 (GhostscriptMsg): use static_cast
10008 (GhostscriptMsg): use new instead of malloc to allocate memory for
10009 cmap. also delete the memory after use.
10011 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
10013 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
10014 for changes in bibtex database or style.
10015 (runBibTeX): remove all .bib and .bst files from dep before we
10017 (run): use scanAuc in when dep file already exist.
10019 * src/DepTable.C (remove_files_with_extension): new method
10020 (exist): new method
10022 * src/DepTable.[Ch]: made many of the methods const.
10024 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10026 * src/bufferparams.C: make sure that the default textclass is
10027 "article". It used to be the first one by description order, but
10028 now the first one is "docbook".
10030 * src/lyx_main.C (setDebuggingLevel): change type of argument to
10031 string; call Debug::value.
10032 (easyParse): pass complete argument to setDebuggingLevel().
10034 * src/debug.h (value): fix the code that parses debug levels.
10036 * src/debug.h: add new debug type ACTION, reserved for LyXAction
10039 * src/LyXAction.C: use Debug::ACTION as debug channel.
10041 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
10043 * NEWS: updated for the future 1.1.3 release.
10045 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
10046 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
10047 it should. This is of course a controversial change (since many
10048 people will find that their lyx workscreen is suddenly full of
10049 red), but done for the sake of correctness.
10051 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
10052 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
10054 * src/insets/inseterror.h, src/insets/inseturl.h,
10055 src/insets/insetinfo.h, src/insets/figinset.h,
10056 src/mathed/formulamacro.h, src/mathed/math_macro.h
10057 (EditMessage): add a missing const and add _() to make sure that
10058 translation happens
10060 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
10061 src/insets/insetbib.C, src/support/filetools.C: add `using'
10062 directives for cxx.
10064 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
10065 doing 'Insert index of last word' at the beginning of a paragraph.
10067 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10069 * several files: white-space changes.
10071 * src/mathed/formula.C: removed IsAlpha and IsDigit
10073 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
10074 .bib file. use a ifstream instead of FilePtr when parsing the .bib
10077 * src/insets/figinset.C (GetPSSizes): don't break when
10078 "EndComments" is seen. But break when a boundingbox is read.
10080 * all classes inherited from Inset: return value of Clone
10081 changed back to Inset *.
10083 * all classes inherited form MathInset: return value of Clone
10084 changed back to MathedInset *.
10086 * src/insets/figinset.C (runqueue): use a ofstream to output the
10087 gs/ps file. Might need some setpresicion or setw. However I can
10088 see no problem with the current code.
10089 (runqueue): use sleep instead of the alarm/signal code. I just
10090 can't see the difference.
10092 * src/paragraph.C (LyXParagraph): reserve space in the new
10093 paragraph and resize the inserted paragraph to just fit.
10095 * src/lyxfunc.h (operator|=): added operator for func_status.
10097 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
10098 check for readable file.
10100 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
10101 check for readable file.
10102 (MenuMakeLinuxDoc): ditto
10103 (MenuMakeDocBook): ditto
10104 (MenuMakeAscii): ditto
10105 (InsertAsciiFile): split the test for openable and readable
10107 * src/bmtable.C (draw_bitmaptable): use
10108 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
10110 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
10111 findtexfile from LaTeX to filetools.
10113 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
10114 instead of FilePtr. Needs to be verified by a literate user.
10116 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10118 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
10119 (EditMessage): likewise.
10121 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
10122 respectively as \textasciitilde and \textasciicircum.
10124 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10126 * src/support/lyxstring.h: made the methods that take iterators
10127 use const_iterator.
10129 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
10130 (regexMatch): made is use the real regex class.
10132 * src/support/Makefile.am: changed to use libtool
10134 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
10136 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
10138 (MathIsInset ++): changed several macros to be inline functions
10141 * src/mathed/Makefile.am: changed to use libtool
10143 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
10145 * src/insets/inset* : Clone changed to const and return type is
10146 the true insettype not just Inset*.
10148 * src/insets/Makefile.am: changed to use libtool
10150 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
10152 * src/undo.[Ch] : added empty() and changed some of the method
10155 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
10157 * src/lyxparagraph.h: use id() and id(...) instead of getID and
10158 setID use block<> for the bullets array, added const several places.
10160 * src/lyxfunc.C (getStatus): new function
10162 * src/lyxfunc.[Ch] : small changes to take advantage of the new
10163 LyXAction, added const to several funtions.
10165 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
10166 a std::map, and to store the dir items in a vector.
10168 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
10171 * src/LyXView.[Ch] + other files : changed currentView to view.
10173 * src/LyXAction.[Ch] : ported from the old devel branch.
10175 * src/.cvsignore: added .libs and a.out
10177 * configure.in : changes to use libtool.
10179 * acinclude.m4 : inserted libtool.m4
10181 * .cvsignore: added libtool
10183 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10185 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
10186 file name in insets and mathed directories (otherwise the
10187 dependency is not taken in account under cygwin).
10189 * src/text2.C (InsertString[AB]): make sure that we do not try to
10190 read characters past the string length.
10192 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10194 * lib/doc/LaTeXConfig.lyx.in,
10195 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
10197 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
10198 file saying who created them and when this heppened; this is
10199 useless and annoys tools like cvs.
10201 * lib/layouts/g-brief-{en,de}.layout,
10202 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
10203 from Thomas Hartkens <thomas@hartkens.de>.
10205 * src/{insets,mathed}/Makefile.am: do not declare an empty
10206 LDFLAGS, so that it can be set at configure time (useful on Irix
10209 * lib/reLyX/configure.in: make sure that the prefix is set
10210 correctly in LYX_DIR.
10212 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10214 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
10215 be used by 'command-sequence' this allows to bind a key to a
10216 sequence of LyX-commands
10217 (Example: 'command-sequence math-insert alpha; math-insert beta;")
10219 * src/LyXAction.C: add "command-sequence"
10221 * src/LyXFunction.C: handling of "command-sequence"
10223 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
10224 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
10226 * src/lyxserver.C, src/minibuffer.C: Use this new interface
10228 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10230 * src/buffer.C (writeFile): Do not output a comment giving user
10231 and date at the beginning of a .lyx file. This is useless and
10232 annoys cvs anyway; update version number to 1.1.
10234 * src/Makefile.am (LYX_DIR): add this definition, so that a
10235 default path is hardcoded in LyX.
10237 * configure.in: Use LYX_GNU_GETTEXT.
10239 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
10240 AM_GNU_GETTEXT with a bug fixed.
10242 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
10244 * src/chset.C: add "using std::ifstream;" to please dec cxx.
10246 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
10247 which is used to point to LyX data is now LYX_DIR_11x.
10249 * lyx.man: convert to a unix text file; small updates.
10251 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10253 * src/support/LSubstring.[Ch]: made the second arg of most of the
10254 constructors be a const reference.
10256 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
10259 * src/support/lyxstring.[Ch] (swap): added missing member function
10260 and specialization of swap(str, str);
10262 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
10264 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
10265 trace of the old one.
10267 * src/undo.[Ch]: made the undostack use std::list to store undo's in
10268 put the member definitions in undo.C.
10270 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
10271 NEW_TEXT and have now only code that was included when this was
10274 * src/intl.C (LCombo): use static_cast
10276 (DispatchCallback): ditto
10278 * src/definitions.h: removed whole file
10280 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
10282 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
10283 parsing and stores in a std:map. a regex defines the file format.
10284 removed unneeded members.
10286 * src/bufferparams.h: added several enums from definitions.h here.
10287 Removed unsused destructor. Changed some types to use proper enum
10288 types. use block to have the temp_bullets and user_defined_bullets
10289 and to make the whole class assignable.
10291 * src/bufferparams.C (Copy): removed this functions, use a default
10292 assignment instead.
10294 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
10297 * src/buffer.C (readLyXformat2): commend out all that have with
10298 oldpapersize to do. also comment out all that hve to do with
10299 insetlatex and insetlatexdel.
10300 (setOldPaperStuff): commented out
10302 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
10304 * src/LyXAction.C: remove use of inset-latex-insert
10306 * src/mathed/math_panel.C (button_cb): use static_cast
10308 * src/insets/Makefile.am (insets_o_SOURCES): removed
10311 * src/support/lyxstring.C (helper): use the unsigned long
10312 specifier, UL, instead of a static_cast.
10314 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
10316 * src/support/block.h: new file. to be used as a c-style array in
10317 classes, so that the class can be assignable.
10319 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10321 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
10322 NULL, make sure to return an empty string (it is not possible to
10323 set a string to NULL).
10325 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10327 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
10329 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
10331 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
10332 link line, so that Irix users (for example) can set it explicitely to
10335 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
10336 it can be overidden at make time (static or dynamic link, for
10339 * src/vc-backend.C, src/LaTeXFeatures.h,
10340 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
10341 statements to bring templates to global namespace.
10343 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10345 * src/support/lyxstring.C (operator[] const): make it standard
10348 * src/minibuffer.C (Init): changed to reflect that more
10349 information is given from the lyxvc and need not be provided here.
10351 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
10353 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
10355 * src/LyXView.C (UpdateTimerCB): use static_cast
10356 (KeyPressMask_raw_callback): ditto
10358 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
10359 buffer_, a lot of changes because of this. currentBuffer() ->
10360 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
10361 also changes to other files because of this.
10363 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10365 * src/vc-backend.[Ch]: new files. The backends for vc handling,
10366 have no support for RCS and partial support for CVS, will be
10369 * src/insets/ several files: changes because of function name
10370 changes in Bufferview and LyXView.
10372 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
10374 * src/support/LSubstring.[Ch]: new files. These implement a
10375 Substring that can be very convenient to use. i.e. is this
10377 string a = "Mary had a little sheep";
10378 Substring(a, "sheep") = "lamb";
10379 a is now "Mary has a little lamb".
10381 * src/support/LRegex.[Ch]: a regex class that can be used to pick
10382 out patterns and subpatterns of strings. It is used by LSubstring
10383 and also by vc-backend.C
10385 * src/support/lyxstring.C: went over all the assertions used and
10386 tried to correct the wrong ones and flag which of them is required
10387 by the standard. some bugs found because of this. Also removed a
10388 couple of assertions.
10390 * src/support/Makefile.am (libsupport_a_SOURCES): added
10391 LSubstring.[Ch] and LRegex.[Ch]
10393 * src/support/FileInfo.h: have struct stat buf as an object and
10394 not a pointer to one, some changes because of this.
10396 * src/LaTeXFeatures.C (getTClassPreamble): also use the
10397 information in layout when adding the layouts preamble to the
10398 textclass preamble.
10400 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
10403 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
10404 because of bug in OS/2.
10406 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10408 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
10409 \verbatim@font instead of \ttfamily, so that it can be redefined.
10411 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
10412 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
10413 src/layout.h, src/text2.C: add 'using' directive to bring the
10414 STL templates we need from the std:: namespace to the global one.
10415 Needed by DEC cxx in strict ansi mode.
10417 * src/support/LIstream.h,src/support/LOstream.h,
10418 src/support/lyxstring.h,src/table.h,
10419 src/lyxlookup.h: do not include <config.h> in header
10420 files. This should be done in the .C files only.
10422 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
10426 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10428 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
10429 from Kayvan to fix the tth invokation.
10431 * development/lyx.spec.in: updates from Kayvan to reflect the
10432 changes of file names.
10434 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10436 * src/text2.C (InsertStringB): use std::copy
10437 (InsertStringA): use std::copy
10439 * src/bufferlist.C: use a vector to store the buffers in. This is
10440 an internal change and should not affect any other thing.
10442 * src/BufferView.C (waitForX): use XSync instead of the lengthy
10445 * src/text.C (Fill): fix potential bug, one off bug.
10447 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10449 * src/Makefile.am (lyx_main.o): add more files it depends on.
10451 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
10453 * src/support/lyxstring.C: use size_t for the reference count,
10454 size, reserved memory and xtra.
10455 (internal_compare): new private member function. Now the compare
10456 functions should work for std::strings that have embedded '\0'
10458 (compare): all compare functions rewritten to use
10461 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10463 * src/support/lyxstring.C (compare): pass c_str()
10464 (compare): pass c_str
10465 (compare): pass c_str
10467 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10469 * src/support/DebugStream.C: <config.h> was not included correctly.
10471 * lib/configure: forgot to re-generate it :( I'll make this file
10472 auto generated soon.
10474 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10476 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
10479 * src/support/lyxstring.C: some changes from length() to rep->sz.
10480 avoids a function call.
10482 * src/support/filetools.C (SpaceLess): yet another version of the
10483 algorithm...now per Jean-Marc's suggestions.
10485 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10487 * src/layout.C (less_textclass_desc): functor for use in sorting
10489 (LyXTextClass::Read): sort the textclasses after reading.
10491 * src/support/filetools.C (SpaceLess): new version of the
10492 SpaceLess functions. What problems does this one give? Please
10495 * images/banner_bw.xbm: made the arrays unsigned char *
10497 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10499 * src/support/lyxstring.C (find): remove bogus assertion in the
10500 two versions of find where this has not been done yet.
10502 * src/support/lyxlib.h: add missing int return type to
10505 * src/menus.C (ShowFileMenu): disable exporting to html if no
10506 html export command is present.
10508 * config/lib_configure.m4: add a test for an HTML converter. The
10509 programs checked for are, in this order: tth, latex2html and
10512 * lib/configure: generated from config/lib_configure.m4.
10514 * src/lyxfunc.C (Dispatch): update and improve the execution of an
10515 html converter. The parameters are now passed through $$FName and
10516 $$OutName, instead of standard input/output.
10518 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
10520 * lib/lyxrc.example: update description of \html_command.
10521 add "quotes" around \screen_font_xxx font setting examples to help
10522 people who use fonts with spaces in their names.
10524 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10526 * Distribution files: updates for v1.1.2
10528 * src/support/lyxstring.C (find): remove bogus assert and return
10529 npos for the same condition.
10531 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10533 * added patch for OS/2 from SMiyata.
10535 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10537 * src/text2.C (CutSelection): make space_wrapped a bool
10538 (CutSelection): dont declare int i until we have to.
10539 (alphaCounter): return a char const *.
10541 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10543 * src/support/syscall.C (Systemcalls::kill):
10544 src/support/filetools.C (PutEnv, PutEnvPath):
10545 src/lyx_cb.C (addNewlineAndDepth):
10546 src/FontInfo.C (FontInfo::resize): condition some #warning
10547 directives with WITH_WARNINGS.
10550 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10552 * src/layout.[Ch] + several files: access to class variables
10553 limited and made accessor functions instead a lot of code changed
10554 becuase of this. Also instead of returning pointers often a const
10555 reference is returned instead.
10557 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
10559 * src/Makefile.am (dist-hook): added used to remove the CVS from
10560 cheaders upon creating a dist
10561 (EXTRA_DIST): added cheaders
10563 * src/support/lstrings.C (tostr(char)): fix it to handle param as
10564 a character not as a small integer.
10566 * src/support/lyxstring.C (find): removed Assert and added i >=
10567 rep->sz to the first if.
10569 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10571 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
10572 src/LyXView.C src/buffer.C src/bufferparams.C
10573 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
10574 src/text2.C src/insets/insetinclude.C:
10575 lyxlayout renamed to textclasslist.
10577 * src/layout.C: some lyxerr changes.
10579 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
10580 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
10581 (LyXLayoutList): removed all traces of this class.
10582 (LyXTextClass::Read): rewrote LT_STYLE
10583 (LyXTextClass::hasLayout): new function
10584 (LyXTextClass::GetLayout): rewritten to return an iterator + has
10585 both const and nonconst version.
10586 (LyXTextClass::delete_layout): new function.
10587 (LyXTextClassList::Style): bug fix. do the right thing if layout
10589 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
10590 (LyXTextClassList::NameOfLayout): ditto
10591 (LyXTextClassList::Load): ditto
10593 * src/buffer.C (makeLaTeXFile): new access to layoutlist
10595 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
10597 * src/LyXAction.C (LookupFunc): added a workaround for sun
10598 compiler, on the other hand...we don't know if the current code
10599 compiles on sun at all...
10601 * src/support/filetools.C (CleanupPath): subst fix
10603 * src/insets/insetbib.C (delDatabase): subst fix, this looks
10606 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
10607 complained about this one?
10609 * src/insets/insetinclude.C (Latex): subst fix
10611 * src/insets/insetbib.C (getKeys): subst fix
10613 * src/LyXSendto.C (SendtoApplyCB): subst fix
10615 * src/lyx_main.C (init): subst fix
10617 * src/layout.C (Read): subst fix
10619 * src/lyx_sendfax_main.C (button_send): subst fix
10621 * src/buffer.C (RoffAsciiTable): subst fix
10623 * src/lyx_cb.C (MenuFax): subst fix
10624 (PrintApplyCB): subst fix
10626 1999-10-26 Juergen Vigna <jug@sad.it>
10628 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
10630 (Read): Cleaned up this code so now we read only format vestion >= 5
10632 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10634 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
10635 come nobody has complained about this one?
10637 * src/insets/insetinclude.C (Latex): subst fix
10639 * src/insets/insetbib.C (getKeys): subst fix
10641 * src/lyx_main.C (init): subst fix
10643 * src/layout.C (Read): subst fix
10645 * src/buffer.C (RoffAsciiTable): subst fix
10647 * src/lyx_cb.C (MenuFax): subst fix.
10649 * src/layout.[hC] + some other files: rewrote to use
10650 std::container to store textclasses and layouts in.
10651 Simplified, removed a lot of code. Make all classes
10652 assignable. Further simplifications and review of type
10653 use still to be one.
10655 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
10656 lastfiles to create the lastfiles partr of the menu.
10658 * src/lastfiles.[Ch]: rewritten to use deque to store the
10659 lastfiles in. Uses fstream for reading and writing. Simplifies
10662 * src/support/syscall.C: remove explicit cast.
10664 * src/BufferView.C (CursorToggleCB): removed code snippets that
10665 were commented out.
10666 use explicat C++ style casts instead of C style casts. also use
10667 u_vdata instea of passing pointers in longs.
10669 * src/PaperLayout.C: removed code snippets that were commented out.
10671 * src/lyx_gui_misc.C: removed code snippets that were commented out.
10673 * src/lyx_main.C: removed code snippets that wer commented out.
10675 * src/paragraph.C: removed code snippets that were commented out.
10677 * src/lyxvc.C (logClose): use static_cast
10679 (viewLog): remove explicit cast to void*
10680 (showLog): removed old commented code
10682 * src/menus.C: use static_cast instead of C style casts. use
10683 u_vdata instead of u_ldata. remove explicit cast to (long) for
10684 pointers. Removed old code that was commented out.
10686 * src/insets/inset.C: removed old commented func
10688 * src/insets/insetref.C (InsetRef): removed old code that had been
10689 commented out for a long time.
10691 (escape): removed C style cast
10693 * src/insets/insetlatexaccent.C (Draw): removed old commented code
10695 * src/insets/insetlatex.C (Draw): removed old commented code
10696 (Read): rewritten to use string
10698 * src/insets/insetlabel.C (escape): removed C style cast
10700 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
10702 * src/insets/insetindex.C: use static_cast and u_vdata, removed
10703 old commented code.
10705 * src/insets/insetinclude.h: removed a couple of stupid bools
10707 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
10708 (Clone): remove C style cast
10709 (getKeys): changed list to lst because of std::list
10711 * src/insets/inseterror.C (Draw): removed som old commented code.
10713 * src/insets/insetcommand.C (Draw): removed some old commented code.
10715 * src/insets/insetbib.C (bibitem_cb): removed code that has been
10716 commented out forever.
10717 (bibitem_cb): use static_cast instead of C style cast
10718 use of vdata changed to u_vdata.
10720 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
10722 (CloseUrlCB): use static_cast instead of C style cast.
10723 (CloseUrlCB): added a fl_free form...it seemed to be missing.
10725 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
10726 (C_InsetInfo_CloseInfoCB): forward the ob parameter
10727 (CloseInfoCB): static_cast from ob->u_vdata instead.
10728 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
10731 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
10732 (C_InsetError_CloseErrorCB): forward the ob parameter
10733 (CloseErrorCB): static_cast from ob->u_vdata instead.
10735 * src/vspace.h: include LString.h since we use string in this class.
10737 * src/vspace.C (lyx_advance): changed name from advance because of
10738 nameclash with stl. And since we cannot use namespaces yet...I
10739 used a lyx_ prefix instead. Expect this to change when we begin
10742 * src/BufferView.[Ch] (BufferView::~BufferView): removed
10744 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
10745 and removed now defunct constructor and deconstructor.
10747 * src/BufferView.h: have backstack as a object not as a pointer.
10748 removed initialization from constructor. added include for BackStack
10750 * development/lyx.spec.in (%build): add CFLAGS also.
10752 * src/screen.C (drawFrame): removed another warning.
10754 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10756 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
10757 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
10758 README and ANNOUNCE a bit for the next release. More work is
10761 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
10762 unbreakable if we are in freespacing mode (LyX-Code), but not in
10765 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10767 * src/BackStack.h: fixed initialization order in constructor
10769 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
10771 * acinclude.m4 (VERSION): new rules for when a version is
10772 development, added also a variable for prerelease.
10773 (warnings): we set with_warnings=yes for prereleases
10774 (lyx_opt): prereleases compile with same optimization as development
10775 (CXXFLAGS): only use pedantic if we are a development version
10777 * src/BufferView.C (restorePosition): don't do anything if the
10778 backstack is empty.
10780 * src/BackStack.h: added member empty, use this to test if there
10781 is anything to pop...
10783 1999-10-25 Juergen Vigna <jug@sad.it>
10786 * forms/layout_forms.fd +
10787 * forms/latexoptions.fd +
10788 * lyx.fd: changed for various form resize issues
10790 * src/mathed/math_panel.C +
10791 * src/insets/inseterror.C +
10792 * src/insets/insetinfo.C +
10793 * src/insets/inseturl.C +
10794 * src/insets/inseturl.h +
10796 * src/LyXSendto.C +
10797 * src/PaperLayout.C +
10798 * src/ParagraphExtra.C +
10799 * src/TableLayout.C +
10801 * src/layout_forms.C +
10808 * src/menus.C: fixed various resize issues. So now forms can be
10809 resized savely or not be resized at all.
10811 * forms/form_url.fd +
10812 * src/insets/form_url.[Ch]: added because it's cleaner and easier
10815 * src/insets/Makefile.am: added files form_url.[Ch]
10817 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10819 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
10820 (and presumably 6.2).
10822 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
10823 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
10824 remaining static member callbacks.
10826 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
10829 * src/support/lyxstring.h: declare struct Srep as friend of
10830 lyxstring, since DEC cxx complains otherwise.
10832 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10834 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10836 * src/LaTeX.C (run): made run_bibtex also depend on files with
10838 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
10839 are put into the dependency file.
10841 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
10842 the code has shown itself to work
10843 (create_ispell_pipe): removed another warning, added a comment
10846 * src/minibuffer.C (ExecutingCB): removed code that has been
10847 commented out a long time
10849 * src/lyxfunc.C (processKeyEvent): removed some very old commented
10850 out code + a warning.
10852 * src/support/lyxstring.h: comment out the three private
10853 operators, when compiling with string ansi conforming compilers
10854 they make problems.
10856 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
10858 (pixmapFromBitmapData): change type of bdata to be unsigned char *
10859 (pixmapFromBitmapData): add a reinterpret_cast in the call to
10862 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
10865 * src/mathed/math_panel.C (create_math_panel): remove explicit
10868 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
10871 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
10872 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
10873 to XCreatePixmapFromBitmapData
10874 (fl_set_bmtable_data): change the last argument to be unsigned
10876 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
10877 and bh to be unsigned int, remove explicit casts in call to
10878 XReadBitmapFileData.
10880 * images/arrows.xbm: made the arrays unsigned char *
10881 * images/varsz.xbm: ditto
10882 * images/misc.xbm: ditto
10883 * images/greek.xbm: ditto
10884 * images/dots.xbm: ditto
10885 * images/brel.xbm: ditto
10886 * images/bop.xbm: ditto
10888 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
10890 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
10891 (LYX_PROG_CXX): added -pedantic to g++ compile options when
10892 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
10894 (LYX_CXX_CHEADERS): added <clocale> to the test.
10896 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
10898 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
10900 * src/support/lyxstring.C (append): fixed something that must be a
10901 bug, rep->assign was used instead of rep->append.
10903 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
10906 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
10907 lyx insert double chars. Fix spotted by Kayvan.
10909 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10911 * Fixed the tth support. I messed up with the Emacs patch apply feature
10912 and omitted the changes in lyxrc.C.
10914 1999-10-22 Juergen Vigna <jug@sad.it>
10916 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
10918 * src/lyx_cb.C (MenuInsertRef) +
10919 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
10920 the form cannot be resized under it limits (fixes a segfault)
10922 * src/lyx.C (create_form_form_ref) +
10923 * forms/lyx.fd: Changed Gravity on name input field so that it is
10926 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10928 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
10929 <ostream> and <istream>.
10931 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
10932 whether <fstream> provides the latest standard features, or if we
10933 have an oldstyle library (like in egcs).
10934 (LYX_CXX_STL_STRING): fix the test.
10936 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
10937 code on MODERN_STL_STREAM.
10939 * src/support/lyxstring.h: use L{I,O}stream.h.
10941 * src/support/L{I,O}stream.h: new files, designed to setup
10942 correctly streams for our use
10943 - includes the right header depending on STL capabilities
10944 - puts std::ostream and std::endl (for LOStream.h) or
10945 std::istream (LIStream.h) in toplevel namespace.
10947 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10949 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
10950 was a bib file that had been changed we ensure that bibtex is run.
10951 (runBibTeX): enhanced to extract the names of the bib files and
10952 getting their absolute path and enter them into the dep file.
10953 (findtexfile): static func that is used to look for tex-files,
10954 checks for absolute patchs and tries also with kpsewhich.
10955 Alternative ways of finding the correct files are wanted. Will
10957 (do_popen): function that runs a command using popen and returns
10958 the whole output of that command in a string. Should be moved to
10961 * src/DepTable.[Ch] (extchanged): new function that returns true if a
10962 file with extension ext has changed.
10964 * src/insets/figinset.C: added ifdef guards around the fl_free
10965 code that jug commented out. Now it is commented out when
10966 compiling with XForms == 0.89.
10968 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
10969 to lyxstring.C, and only keep a forward declaration in
10970 lyxstring.h. Simplifies the header file a bit and should help a
10971 bit on compile time too. Also changes to Srep will not mandate a
10972 recompile of code just using string.
10973 (~lyxstring): definition moved here since it uses srep.
10974 (size): definition moved here since it uses srep.
10976 * src/support/lyxstring.h: removed a couple of "inline" that should
10979 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10981 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
10984 1999-10-21 Juergen Vigna <jug@sad.it>
10986 * src/table.C (SetPWidth): Just a small fix so the alignment is not
10987 set to left if I just remove the width entry (or it is empty).
10989 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
10990 paragraph when having dummy paragraphs.
10992 1999-10-20 Juergen Vigna <jug@sad.it>
10994 * src/insets/figinset.C: just commented some fl_free_form calls
10995 and added warnings so that this calls should be activated later
10996 again. This avoids for now a segfault, but we have a memory leak!
10998 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
10999 'const char * argument' to 'string argument', this should
11000 fix some Asserts() in lyxstring.C.
11002 * src/lyxfunc.h: Removed the function argAsString(const char *)
11003 as it is not used anymore.
11005 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
11007 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
11010 * src/Literate.h: some funcs moved from public to private to make
11011 interface clearer. Unneeded args removed.
11013 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
11015 (scanBuildLogFile): ditto
11017 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
11018 normal TeX Error. Still room for improvement.
11020 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
11022 * src/buffer.C (insertErrors): changes to make the error
11023 desctription show properly.
11025 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
11028 * src/support/lyxstring.C (helper): changed to use
11029 sizeof(object->rep->ref).
11030 (operator>>): changed to use a pointer instead.
11032 * src/support/lyxstring.h: changed const reference & to value_type
11033 const & lets see if that helps.
11035 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
11037 * Makefile.am (rpmdist): fixed to have non static package and
11040 * src/support/lyxstring.C: removed the compilation guards
11042 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
11045 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
11046 conditional compile of lyxstring.Ch
11048 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
11049 stupid check, but it is a lot better than the bastring hack.
11050 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
11052 * several files: changed string::erase into string::clear. Not
11055 * src/chset.C (encodeString): use a char temporary instead
11057 * src/table.C (TexEndOfCell): added tostr around
11058 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
11059 (TexEndOfCell): ditto
11060 (TexEndOfCell): ditto
11061 (TexEndOfCell): ditto
11062 (DocBookEndOfCell): ditto
11063 (DocBookEndOfCell): ditto
11064 (DocBookEndOfCell): ditto
11065 (DocBookEndOfCell): ditto
11067 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
11069 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
11071 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
11072 (MenuBuildProg): added tostr around ret
11073 (MenuRunChktex): added tostr around ret
11074 (DocumentApplyCB): added tostr around ret
11076 * src/chset.C (encodeString): added tostr around t->ic
11078 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
11079 (makeLaTeXFile): added tostr around tocdepth
11080 (makeLaTeXFile): added tostr around ftcound - 1
11082 * src/insets/insetbib.C (setCounter): added tostr around counter.
11084 * src/support/lyxstring.h: added an operator+=(int) to catch more
11087 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
11088 (lyxstring): We DON'T allow NULL pointers.
11090 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11092 * src/mathed/math_macro.C (MathMacroArgument::Write,
11093 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
11094 when writing them out.
11096 * src/LString.C: remove, since it is not used anymore.
11098 * src/support/lyxstring.C: condition the content to
11099 USE_INCLUDED_STRING macro.
11101 * src/mathed/math_symbols.C, src/support/lstrings.C,
11102 src/support/lyxstring.C: add `using' directive to specify what
11103 we need in <algorithm>. I do not think that we need to
11104 conditionalize this, but any thought is appreciated.
11106 * many files: change all callback functions to "C" linkage
11107 functions to please strict C++ compilers like DEC cxx 6.1 in mode
11108 strict_ansi. Those who were static are now global.
11109 The case of callbacks which are static class members is
11110 trickier, since we have to make C wrappers around them (see
11111 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
11112 did not finish this yet, since it defeats the purpose of
11113 encapsulation, and I am not sure what the best route is.
11115 1999-10-19 Juergen Vigna <jug@sad.it>
11117 * src/support/lyxstring.C (lyxstring): we permit to have a null
11118 pointer as assignment value and just don't assign it.
11120 * src/vspace.C (nextToken): corrected this function substituting
11121 find_first(_not)_of with find_last_of.
11123 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
11124 (TableOptCloseCB) (TableSpeCloseCB):
11125 inserted fl_set_focus call for problem with fl_hide_form() in
11128 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11130 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
11133 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11135 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
11136 LyXLex::next() and not eatline() to get its argument.
11138 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
11140 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
11141 instead, use fstreams for io of the depfile, removed unneeded
11142 functions and variables.
11144 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
11145 vector instead, removed all functions and variables that is not in
11148 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11150 * src/buffer.C (insertErrors): use new interface to TeXError
11152 * Makefile.am (rpmdist): added a rpmdist target
11154 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
11155 per Kayvan's instructions.
11157 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11159 * src/Makefile.am: add a definition for localedir, so that locales
11160 are found after installation (Kayvan)
11162 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11164 * development/.cvsignore: new file.
11166 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11168 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
11169 C++ compiler provides wrappers for C headers and use our alternate
11172 * configure.in: use LYX_CXX_CHEADERS.
11174 * src/cheader/: new directory, populated with cname headers from
11175 libstdc++-2.8.1. They are a bit old, but probably good enough for
11176 what we want (support compilers who lack them).
11178 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
11179 from includes. It turns out is was stupid.
11181 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11183 * lib/Makefile.am (install-data-local): forgot a ';'
11184 (install-data-local): forgot a '\'
11185 (libinstalldirs): needed after all. reintroduced.
11187 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
11189 * configure.in (AC_OUTPUT): added lyx.spec
11191 * development/lyx.spec: removed file
11193 * development/lyx.spec.in: new file
11195 * po/*.po: merged with lyx.pot becuase of make distcheck
11197 * lib/Makefile.am (dist-hook): added dist-hook so that
11198 documentation files will be included when doing a make
11199 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
11200 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
11202 more: tried to make install do the right thing, exclude CVS dirs
11205 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
11206 Path would fit in more nicely.
11208 * all files that used to use pathstack: uses now Path instead.
11209 This change was a lot easier than expected.
11211 * src/support/path.h: new file
11213 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
11215 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
11217 * src/support/lyxstring.C (getline): Default arg was given for
11220 * Configure.cmd: removed file
11222 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11224 * src/support/DebugStream.[Ch]: remove the explicit std:: before
11225 streams classes and types, add the proper 'using' statements when
11226 MODERN_STL is defined.
11228 * src/debug.h: move the << operator definition after the inclusion
11231 * src/support/filetools.C: include "LAssert.h", which is needed
11234 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
11237 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
11238 include "debug.h" to define a proper ostream.
11240 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11242 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
11243 method to the SystemCall class which can kill a process, but it's
11244 not fully implemented yet.
11246 * src/*.C: Changed Systemcalls::Startscript() to startscript()
11248 * src/support/FileInfo.h: Better documentation
11250 * src/lyxfunc.C: Added support for buffer-export html
11252 * src/menus.C: Added Export->As HTML...
11254 * lib/bind/*.bind: Added short-cut for buffer-export html
11256 * src/lyxrc.*: Added support for new \tth_command
11258 * lib/lyxrc.example: Added stuff for new \tth_command
11260 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11262 * lib/Makefile.am (IMAGES): removed images/README
11263 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
11264 installes in correct place. Check permisions is installed
11267 * src/LaTeX.C: some no-op changes moved declaration of some
11270 * src/LaTeX.h (LATEX_H): changed include guard name
11272 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11274 * lib/reLyX/Makefile.am: install noweb2lyx.
11276 * lib/Makefile.am: install configure.
11278 * lib/reLyX/configure.in: declare a config aux dir; set package
11279 name to lyx (not sure what the best solution is); generate noweb2lyx.
11281 * lib/layouts/egs.layout: fix the bibliography layout.
11283 1999-10-08 Jürgen Vigna <jug@sad.it>
11285 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
11286 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
11287 it returned without continuing to search the path.
11289 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11291 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
11292 also fixes a bug. It is not allowed to do tricks with std::strings
11293 like: string a("hei"); &a[e]; this will not give what you
11294 think... Any reason for the complexity in this func?
11296 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
11298 * Updated README and INSTALL a bit, mostly to check that my
11299 CVS rights are correctly set up.
11301 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
11303 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
11304 does not allow '\0' chars but lyxstring and std::string does.
11306 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11308 * autogen.sh (AUTOCONF): let the autogen script create the
11309 POTFILES.in file too. POTFILES.in should perhaps now not be
11310 included in the cvs module.
11312 * some more files changed to use C++ includes instead of C ones.
11314 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
11316 (Reread): added tostr to nlink. buggy output otherwise.
11317 (Reread): added a string() around szMode when assigning to Buffer,
11318 without this I got a log of garbled info strings.
11320 * acconfig.h: commented out the PTR_AS_INT macros. They should not
11323 * I have added several ostream & operator<<(ostream &, some_type)
11324 functions. This has been done to avoid casting and warnings when
11325 outputting enums to lyxerr. This as thus eliminated a lot of
11326 explicit casts and has made the code clearer. Among the enums
11327 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
11328 mathed enums, some font enum the Debug::type enum.
11330 * src/support/lyxstring.h (clear): missing method. equivalent of
11333 * all files that contained "stderr": rewrote constructs that used
11334 stderr to use lyxerr instead. (except bmtable)
11336 * src/support/DebugStream.h (level): and the passed t with
11337 Debug::ANY to avoid spurious bits set.
11339 * src/debug.h (Debug::type value): made it accept strings of the
11340 type INFO,INIT,KEY.
11342 * configure.in (Check for programs): Added a check for kpsewhich,
11343 the latex generation will use this later to better the dicovery of
11346 * src/BufferView.C (create_view): we don't need to cast this to
11347 (void*) that is done automatically.
11348 (WorkAreaButtonPress): removed some dead code.
11350 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11352 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
11353 is not overwritten when translated (David Sua'rez de Lis).
11355 * lib/CREDITS: Added David Sua'rez de Lis
11357 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
11359 * src/bufferparams.C (BufferParams): default input encoding is now
11362 * acinclude.m4 (cross_compiling): comment out macro
11363 LYX_GXX_STRENGTH_REDUCE.
11365 * acconfig.h: make sure that const is not defined (to empty) when
11366 we are compiling C++. Remove commented out code using SIZEOF_xx
11369 * configure.in : move the test for const and inline as late as
11370 possible so that these C tests do not interefere with C++ ones.
11371 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
11372 has not been proven.
11374 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11376 * src/table.C (getDocBookAlign): remove bad default value for
11377 isColumn parameter.
11379 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
11381 (ShowFileMenu2): ditto.
11383 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
11384 of files to ignore.
11386 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11388 * Most files: finished the change from the old error code to use
11389 DebugStream for all lyxerr debugging. Only minor changes remain
11390 (e.g. the setting of debug levels using strings instead of number)
11392 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11394 * src/layout.C (Add): Changed to use compare_no_case instead of
11397 * src/FontInfo.C: changed loop variable type too string::size_type.
11399 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11401 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
11402 set ETAGS_ARGS to --c++
11404 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
11406 * src/table.C (DocBookEndOfCell): commented out two unused variables
11408 * src/paragraph.C: commented out four unused variables.
11410 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
11411 insed a if clause with type string::size_type.
11413 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
11416 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
11418 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
11419 variable, also changed loop to go from 0 to lenght + 1, instead of
11420 -1 to length. This should be correct.
11422 * src/LaTeX.C (scanError): use string::size_type as loop variable
11425 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
11426 (l.896) since y_tmp and row was not used anyway.
11428 * src/insets/insetref.C (escape): use string::size_type as loop
11431 * src/insets/insetquotes.C (Width): use string::size_type as loop
11433 (Draw): use string::size_type as loop variable type.
11435 * src/insets/insetlatexaccent.C (checkContents): use
11436 string::size_type as loop variable type.
11438 * src/insets/insetlabel.C (escape): use string::size_type as loop
11441 * src/insets/insetinfo.C: added an extern for current_view.
11443 * src/insets/insetcommand.C (scanCommand): use string::size_type
11444 as loop variable type.
11446 * most files: removed the RCS tags. With them we had to recompile
11447 a lot of files after a simple cvs commit. Also we have never used
11448 them for anything meaningful.
11450 * most files: tags-query-replace NULL 0. As adviced several plases
11451 we now use "0" instead of "NULL" in our code.
11453 * src/support/filetools.C (SpaceLess): use string::size_type as
11454 loop variable type.
11456 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11458 * src/paragraph.C: fixed up some more string stuff.
11460 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11462 * src/support/filetools.h: make modestr a std::string.
11464 * src/filetools.C (GetEnv): made ch really const.
11466 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
11467 made code that used these use max/min from <algorithm> instead.
11469 * changed several c library include files to their equivalent c++
11470 library include files. All is not changed yet.
11472 * created a support subdir in src, put lyxstring and lstrings
11473 there + the extra files atexit, fileblock, strerror. Created
11474 Makefile.am. edited configure.in and src/Makefile.am to use this
11475 new subdir. More files moved to support.
11477 * imported som of the functions from repository lyx, filetools
11479 * ran tags-query-replace on LString -> string, corrected the bogus
11480 cases. Tried to make use of lstrings.[hC], debugged a lot. There
11481 is still some errors in there. This is errors where too much or
11482 too litle get deleted from strings (string::erase, string::substr,
11483 string::replace), there can also be some off by one errors, or
11484 just plain wrong use of functions from lstrings. Viewing of quotes
11487 * LyX is now running fairly well with string, but there are
11488 certainly some bugs yet (see above) also string is quite different
11489 from LString among others in that it does not allow null pointers
11490 passed in and will abort if it gets any.
11492 * Added the revtex4 files I forgot when setting up the repository.
11494 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11496 * All over: Tried to clean everything up so that only the files
11497 that we really need are included in the cvs repository.
11498 * Switched to use automake.
11499 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
11500 * Install has not been checked.
11502 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11504 * po/pt.po: Three errors:
11505 l.533 and l.538 format specification error
11506 l. 402 duplicate entry, I just deleted it.