1 2000-08-31 Allan Rae <rae@lyx.org>
3 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
4 character dialog separately from old document dialogs combo_language.
7 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
9 * src/converter.[Ch]: New file for converting between different
12 * src/export.[Ch]: New file for exporting a LyX file to different
15 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
16 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
17 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
18 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
19 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
20 RunDocBook, MenuExport.
22 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
23 Exporter::Preview methods if NEW_EXPORT is defined.
25 * src/buffer.C (Dispatch): Use Exporter::Export.
27 * src/lyxrc.C: Added new tags: \converter and \viewer.
30 * src/LyXAction.C: Define new lyx-function: buffer-update.
31 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
32 when NEW_EXPORT is defined.
34 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
36 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
38 * lib/ui/default.ui: Added submenus "view" and "update" to the
41 * src/filetools.C (GetExtension): New function.
43 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
45 2000-08-29 Allan Rae <rae@lyx.org>
47 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
49 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
50 (EnableDocumentLayout): removed
51 (DisableDocumentLayout): removed
52 (build): make use of ButtonController's read-only handling to
53 de/activate various objects. Replaces both of the above functions.
55 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
56 (readOnly): was read_only
57 (refresh): fixed dumb mistakes with read_only_ handling
59 * src/frontends/xforms/forms/form_document.fd:
60 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
61 tabbed dialogs so the tabs look more like tabs and so its easier to
62 work out which is the current tab.
64 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
65 segfault with form_table
67 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
69 2000-08-28 Juergen Vigna <jug@sad.it>
71 * acconfig.h: added USE_PSPELL.
73 * src/config.h.in: added USE_PSPELL.
75 * autogen.sh: added pspell.m4
77 * config/pspell.m4: new file.
79 * src/spellchecker.C: implemented support for pspell libary.
81 2000-08-25 Juergen Vigna <jug@sad.it>
83 * src/LyXAction.C (init): renamed LFUN_TABLE to
84 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
86 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
88 * src/lyxscreen.h: add force_clear variable and fuction to force
89 a clear area when redrawing in LyXText.
91 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
93 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
95 * some whitespace and comment changes.
97 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
99 * src/buffer.C: up te LYX_FORMAT to 2.17
101 2000-08-23 Juergen Vigna <jug@sad.it>
103 * src/BufferView_pimpl.C (tripleClick): disable this when in a
106 * src/insets/insettabular.C (pasteSelection): delete the insets
107 LyXText as it is not valid anymore.
108 (copySelection): new function.
109 (pasteSelection): new function.
110 (cutSelection): new function.
111 (LocalDispatch): implemented cut/copy/paste of cell selections.
113 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
114 don't have a LyXText.
116 * src/LyXAction.C (init): a NEW_TABULAR define too much.
118 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
121 2000-08-22 Juergen Vigna <jug@sad.it>
123 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
124 ifdef form_table out if NEW_TABULAR.
126 2000-08-21 Juergen Vigna <jug@sad.it>
128 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
129 (draw): fixed draw position so that the cursor is positioned in the
131 (InsetMotionNotify): hide/show cursor so the position is updated.
132 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
133 using cellstart() function where it should be used.
135 * src/insets/insettext.C (draw): ditto.
137 * src/tabular.C: fixed initialization of some missing variables and
138 made BoxType into an enum.
140 2000-08-22 Marko Vendelin <markov@ioc.ee>
141 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
142 stock menu item using action numerical value, not its string
146 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
148 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
149 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
151 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
153 * src/frontends/xforms/GUIRunTime.C: new file
155 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
156 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
158 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
160 * src/frontends/kde/GUIRunTime.C: new file
162 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
163 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
165 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
167 * src/frontends/gnome/GUIRunTime.C: new file
169 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
172 * src/frontends/GUIRunTime.h: removed constructor and destructor,
173 small change to documetentation.
175 * src/frontends/GUIRunTime.C: removed file
177 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
179 * src/lyxparagraph.h: enable NEW_TABULAR as default
181 * src/lyxfunc.C (processKeySym): remove some commented code
183 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
184 NEW_TABULAR around the fd_form_table_options.
186 * src/lyx_gui.C (runTime): call the static member function as
187 GUIRunTime::runTime().
189 2000-08-21 Allan Rae <rae@lyx.org>
191 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
194 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
196 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
198 2000-08-21 Allan Rae <rae@lyx.org>
200 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
202 * src/frontends/xforms/FormPreferences.C (build): use setOK
203 * src/frontends/xforms/FormDocument.C (build): use setOK
204 (FormDocument): use the appropriate policy.
206 2000-08-21 Allan Rae <rae@lyx.org>
208 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
209 automatic [de]activation of arbitrary objects when in a read-only state.
211 * src/frontends/ButtonPolicies.h: More documentation
212 (isReadOnly): added to support the above.
214 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
216 2000-08-18 Juergen Vigna <jug@sad.it>
218 * src/insets/insettabular.C (getStatus): changed to return func_status.
220 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
221 display toggle menu entries if they are.
223 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
224 new document layout now.
226 * src/lyxfunc.C: ditto
228 * src/lyx_gui_misc.C: ditto
230 * src/lyx_gui.C: ditto
232 * lib/ui/default.ui: removed paper and quotes layout as they are now
233 all in the document layout tabbed folder.
235 * src/frontends/xforms/forms/form_document.fd: added Restore
236 button and callbacks for all inputs for Allan's ButtonPolicy.
238 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
239 (CheckChoiceClass): added missing params setting on class change.
240 (UpdateLayoutDocument): added for updating the layout on params.
241 (build): forgot to RETURN_ALWAYS input_doc_spacing.
242 (FormDocument): Implemented Allan's ButtonPolicy with the
245 2000-08-17 Allan Rae <rae@lyx.org>
247 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
248 so we can at least see the credits again.
250 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
251 controller calls for the appropriate callbacks. Note that since Ok
252 calls apply followed by cancel, and apply isn't a valid input for the
253 APPLIED state, the bc_ calls have to be made in the static callback not
254 within each of the real callbacks.
256 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
257 (setOk): renamed from setOkay()
259 2000-08-17 Juergen Vigna <jug@sad.it>
261 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
262 in the implementation part.
263 (composeUIInfo): don't show optional menu-items.
265 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
267 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
269 * src/bufferview_funcs.C (CurrentState): fixed to show also the
270 text-state when in a text-inset.
272 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
274 2000-08-17 Marko Vendelin <markov@ioc.ee>
275 * src/frontends/gnome/FormIndex.C
276 * src/frontends/gnome/FormIndex.h
277 * src/frontends/gnome/FormToc.C
278 * src/frontends/gnome/FormToc.h
279 * src/frontends/gnome/dialogs
280 * src/frontends/gnome/diatoc_callbacks.c
281 * src/frontends/gnome/diatoc_callbacks.h
282 * src/frontends/gnome/diainsertindex_callbacks.h
283 * src/frontends/gnome/diainsertindex_callbacks.c
284 * src/frontends/gnome/diainsertindex_interface.c
285 * src/frontends/gnome/diainsertindex_interface.h
286 * src/frontends/gnome/diatoc_interface.h
287 * src/frontends/gnome/diatoc_interface.c
288 * src/frontends/gnome/Makefile.am: Table of Contents and
289 Insert Index dialogs implementation for Gnome frontend
291 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
293 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
295 * src/frontends/gnome/diainserturl_interface.c: make the dialog
298 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
300 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
301 destructor. Don't definde if you don't need it
302 (processEvents): made static, non-blocking events processing for
304 (runTime): static method. event loop for xforms
305 * similar as above for kde and gnome.
307 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
309 (runTime): new method calss the real frontends runtime func.
311 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
313 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
315 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
317 2000-08-16 Juergen Vigna <jug@sad.it>
319 * src/lyx_gui.C (runTime): added GUII RunTime support.
321 * src/frontends/Makefile.am:
322 * src/frontends/GUIRunTime.[Ch]:
323 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
324 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
325 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
327 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
329 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
330 as this is already set in ${FRONTEND_INCLUDE} if needed.
332 * configure.in (CPPFLAGS): setting the include dir for the frontend
333 directory and don't set FRONTEND=xforms for now as this is executed
336 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
338 * src/frontends/kde/Makefile.am:
339 * src/frontends/kde/FormUrl.C:
340 * src/frontends/kde/FormUrl.h:
341 * src/frontends/kde/formurldialog.h:
342 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
344 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
346 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
348 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
350 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
353 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
355 * src/WorkArea.C (work_area_handler): more work to get te
356 FL_KEYBOARD to work with xforms 0.88 too, please test.
358 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
360 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
362 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
365 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
367 * src/Timeout.h: remove Qt::emit hack.
369 * several files: changes to allo doc++ compilation
371 * src/lyxfunc.C (processKeySym): new method
372 (processKeyEvent): comment out if FL_REVISION < 89
374 * src/WorkArea.C: change some debugging levels.
375 (WorkArea): set wantkey to FL_KEY_ALL
376 (work_area_handler): enable the FL_KEYBOARD clause, this enables
377 clearer code and the use of compose with XForms 0.89. Change to
378 use signals instead of calling methods in bufferview directly.
380 * src/Painter.C: change some debugging levels.
382 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
385 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
386 (workAreaKeyPress): new method
388 2000-08-14 Juergen Vigna <jug@sad.it>
390 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
392 * config/kde.m4: addes some features
394 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
395 include missing xforms dialogs.
397 * src/Timeout.h: a hack to be able to compile with qt/kde.
399 * sigc++/.cvsignore: added acinclude.m4
401 * lib/.cvsignore: added listerros
403 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
404 xforms tree as objects are needed for other frontends.
406 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
407 linking with not yet implemented xforms objects.
409 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
411 2000-08-14 Baruch Even <baruch.even@writeme.com>
413 * src/frontends/xforms/FormGraphics.h:
414 * src/frontends/xforms/FormGraphics.C:
415 * src/frontends/xforms/RadioButtonGroup.h:
416 * src/frontends/xforms/RadioButtonGroup.C:
417 * src/insets/insetgraphics.h:
418 * src/insets/insetgraphics.C:
419 * src/insets/insetgraphicsParams.h:
420 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
421 instead of spaces, and various other indentation issues to make the
422 sources more consistent.
424 2000-08-14 Marko Vendelin <markov@ioc.ee>
426 * src/frontends/gnome/dialogs/diaprint.glade
427 * src/frontends/gnome/FormPrint.C
428 * src/frontends/gnome/FormPrint.h
429 * src/frontends/gnome/diaprint_callbacks.c
430 * src/frontends/gnome/diaprint_callbacks.h
431 * src/frontends/gnome/diaprint_interface.c
432 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
435 * src/frontends/gnome/dialogs/diainserturl.glade
436 * src/frontends/gnome/FormUrl.C
437 * src/frontends/gnome/FormUrl.h
438 * src/frontends/gnome/diainserturl_callbacks.c
439 * src/frontends/gnome/diainserturl_callbacks.h
440 * src/frontends/gnome/diainserturl_interface.c
441 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
444 * src/frontends/gnome/Dialogs.C
445 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
446 all other dialogs. Copy all unimplemented dialogs from Xforms
449 * src/frontends/gnome/support.c
450 * src/frontends/gnome/support.h: support files generated by Glade
454 * config/gnome.m4: Gnome configuration scripts
456 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
457 configure --help message
459 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
460 only if there are no events pendling in Gnome/Gtk. This enhances
461 the performance of menus.
464 2000-08-14 Allan Rae <rae@lyx.org>
466 * lib/Makefile.am: listerrors cleaning
468 * lib/listerrors: removed -- generated file
469 * acinclude.m4: ditto
470 * sigc++/acinclude.m4: ditto
472 * src/frontends/xforms/forms/form_citation.fd:
473 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
476 * src/frontends/xforms/forms/makefile: I renamed the `install` target
477 `updatesrc` and now we have a `test` target that does what `updatesrc`
478 used to do. I didn't like having an install target that wasn't related
481 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
482 on all except FormGraphics. This may yet happen. Followed by a major
483 cleanup including using FL_TRANSIENT for most of the dialogs. More
484 changes to come when the ButtonController below is introduced.
486 * src/frontends/xforms/ButtonController.h: New file for managing up to
487 four buttons on a dialog according to an externally defined policy.
488 * src/frontends/xforms/Makefile.am: added above
490 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
491 Apply and Cancel/Close buttons and everything in between and beyond.
492 * src/frontends/Makefile.am: added above.
494 * src/frontends/xforms/forms/form_preferences.fd:
495 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
496 and removed variable 'status' as a result. Fixed the set_minsize thing.
497 Use the new screen-font-update after checking screen fonts were changed
498 Added a "Restore" button to restore the original lyxrc values while
499 editing. This restores everything not just the last input changed.
500 That's still a tricky one. As is the "LyX: this shouldn't happen..."
502 * src/LyXAction.C: screen-font-update added for updating buffers after
503 screen font settings have been changed.
504 * src/commandtags.h: ditto
505 * src/lyxfunc.C: ditto
507 * forms/lyx.fd: removed screen fonts dialog.
508 * src/lyx_gui.C: ditto
509 * src/menus.[Ch]: ditto
510 * src/lyx.[Ch]: ditto
511 * src/lyx_cb.C: ditto + code from here moved to make
512 screen-font-update. And people wonder why progress on GUII is
513 slow. Look at how scattered this stuff was! It takes forever
516 * forms/fdfix.sh: Fixup the spacing after commas.
517 * forms/makefile: Remove date from generated files. Fewer clashes now.
518 * forms/bullet_forms.C.patch: included someones handwritten changes
520 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
521 once I've discovered why LyXRC was made noncopyable.
522 * src/lyx_main.C: ditto
524 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
526 * src/frontends/xforms/forms/fdfix.sh:
527 * src/frontends/xforms/forms/fdfixh.sed:
528 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
529 * src/frontends/xforms/Form*.[hC]:
530 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
531 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
532 provide a destructor for the struct FD_form_xxxx. Another version of
533 the set_[max|min]size workaround and a few other cleanups. Actually,
534 Angus' patch from 20000809.
536 2000-08-13 Baruch Even <baruch.even@writeme.com>
538 * src/insets/insetgraphics.C (Clone): Added several fields that needed
541 2000-08-11 Juergen Vigna <jug@sad.it>
543 * src/insets/insetgraphics.C (InsetGraphics): changing init
544 order because of warnings.
546 * src/frontends/xforms/forms/makefile: adding patching .C with
549 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
550 from .C.patch to .c.patch
552 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
553 order because of warning.
555 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
557 * src/frontends/Liason.C (setMinibuffer): new helper function
559 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
561 * src/lyxfunc.C (Dispatch): calling new Document-Layout
563 * lib/ui/default.ui: commented out PaperLayout entry
565 * src/frontends/xforms/form_document.[Ch]: new added files
567 * src/frontends/xforms/FormDocument.[Ch]: ditto
569 * src/frontends/xforms/forms/form_document.fd: ditto
571 * src/frontends/xforms/forms/form_document.C.patch: ditto
573 2000-08-10 Juergen Vigna <jug@sad.it>
575 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
576 (InsetGraphics): initialized cacheHandle to 0.
577 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
579 2000-08-10 Baruch Even <baruch.even@writeme.com>
581 * src/graphics/GraphicsCache.h:
582 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
583 correctly as a cache.
585 * src/graphics/GraphicsCacheItem.h:
586 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
589 * src/graphics/GraphicsCacheItem_pimpl.h:
590 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
593 * src/insets/insetgraphics.h:
594 * src/insets/insetgraphics.C: Changed from using a signal notification
595 to polling when image is not loaded.
597 2000-08-10 Allan Rae <rae@lyx.org>
599 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
600 that there are two functions that have to been taken out of line by
601 hand and aren't taken care of in the script. (Just a reminder note)
603 * sigc++/macros/*.h.m4: Updated as above.
605 2000-08-09 Juergen Vigna <jug@sad.it>
607 * src/insets/insettext.C (draw): small fix for clearing rectangle.
609 * src/insets/insettabular.C: make drawing of single cell smarter.
611 2000-08-09 Marko Vendelin <markov@ioc.ee>
612 * src/frontends/gnome/Menubar_pimpl.C
613 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
614 implementation: new files
616 * src/frontends/gnome/mainapp.C
617 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
620 * src/main.C: create Gnome main window
622 * src/frontends/xforms/Menubar_pimpl.h
623 * src/frontends/Menubar.C
624 * src/frontends/Menubar.h: added method Menubar::update that calls
625 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
627 * src/LyXView.C: calls Menubar::update to update the state
630 * src/frontends/gnome/Makefile.am: added new files
632 * src/frontends/Makefile.am: added frontend compiler options
634 2000-08-08 Juergen Vigna <jug@sad.it>
636 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
638 * src/bufferlist.C (close):
639 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
640 documents if exiting without saving.
642 * src/buffer.C (save): use removeAutosaveFile()
644 * src/support/filetools.C (removeAutosaveFile): new function.
646 * src/lyx_cb.C (MenuWrite): returns a bool now.
647 (MenuWriteAs): check if file could really be saved and revert to the
649 (MenuWriteAs): removing old autosavefile if existant.
651 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
652 before Goto toggle declaration, because of compiler warning.
654 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
656 * src/lyxfunc.C (MenuNew): small fix.
658 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
660 * src/bufferlist.C (newFile):
661 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
663 * src/lyxrc.C: added new_ask_filename tag
665 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
667 * src/lyx.fd: removed code pertaining to form_ref
668 * src/lyx.[Ch]: ditto
669 * src/lyx_cb.C: ditto
670 * src/lyx_gui.C: ditto
671 * src/lyx_gui_misc.C: ditto
673 * src/BufferView_pimpl.C (restorePosition): update buffer only
676 * src/commandtags.h (LFUN_REFTOGGLE): removed
677 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
678 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
679 (LFUN_REFBACK): renamed LFUN_REF_BACK
681 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
683 * src/lyxfunc.C (Dispatch): ditto.
684 InsertRef dialog is now GUI-independent.
686 * src/texrow.C: added using std::endl;
688 * src/insets/insetref.[Ch]: strip out large amounts of code.
689 The inset is now a container and this functionality is now
690 managed by a new FormRef dialog
692 * src/frontends/Dialogs.h (showRef, createRef): new signals
694 * src/frontends/xforms/FormIndex.[Ch],
695 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
696 when setting dialog's min/max size
697 * src/frontends/xforms/FormIndex.[Ch]: ditto
699 * src/frontends/xforms/FormRef.[Ch],
700 src/frontends/xforms/forms/form_ref.fd: new xforms
701 implementation of an InsetRef dialog
703 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
706 * src/graphics/XPM_Renderer.C (isImageFormatOK):
707 ios::nocreate is not part of the standard. Removed.
709 2000-08-07 Baruch Even <baruch.even@writeme.com>
711 * src/graphics/Renderer.h:
712 * src/graphics/Renderer.C: Added base class for rendering of different
713 image formats into Pixmaps.
715 * src/graphics/XPM_Renderer.h:
716 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
717 in a different class.
719 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
720 easily add support for other formats.
722 * src/insets/figinset.C: plugged a leak of an X resource.
724 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
726 * src/CutAndPaste.[Ch]: make all metods static.
728 * development/Code_rules/Rules: more work, added section on
729 Exceptions, and a References section.
731 * a lot of header files: work to make doc++ able to generate the
732 source documentation, some workarounds of doc++ problems. Doc++ is
733 now able to generate the documentation.
735 2000-08-07 Juergen Vigna <jug@sad.it>
737 * src/insets/insettabular.C (recomputeTextInsets): removed function
739 * src/tabular.C (SetWidthOfMulticolCell):
741 (calculate_width_of_column_NMC): fixed return value so that it really
742 only returns true if the column-width has changed (there where
743 problems with muliticolumn-cells in this column).
745 2000-08-04 Juergen Vigna <jug@sad.it>
747 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
748 also on the scrollstatus of the inset.
749 (workAreaMotionNotify): ditto.
751 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
753 2000-08-01 Juergen Vigna <jug@sad.it>
755 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
758 * src/LyXAction.C (init):
759 * src/insets/inset.C (LocalDispatch): added support for
762 * src/insets/inset.C (scroll): new functions.
764 * src/insets/insettext.C (removeNewlines): new function.
765 (SetAutoBreakRows): removes forced newlines in the text of the
766 paragraph if autoBreakRows is set to false.
768 * src/tabular.C (Latex): generates a parbox around the cell contents
771 * src/frontends/xforms/FormTabular.C (local_update): removed
772 the radio_useparbox button.
774 * src/tabular.C (UseParbox): new function
776 2000-08-06 Baruch Even <baruch.even@writeme.com>
778 * src/graphics/GraphicsCache.h:
779 * src/graphics/GraphicsCache.C:
780 * src/graphics/GraphicsCacheItem.h:
781 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
784 * src/insets/insetgraphics.h:
785 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
786 drawing of the inline image.
788 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
789 into the wrong position.
791 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
794 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
796 * src/support/translator.h: move all typedefs to public section
798 * src/support/filetools.C (MakeLatexName): return string const
801 (FileOpenSearch): ditto
803 (LibFileSearch): ditto
804 (i18nLibFileSearch): ditto
807 (CreateTmpDir): ditto
808 (CreateBufferTmpDir): ditto
809 (CreateLyXTmpDir): ditto
814 (OnlyFilename): ditto
816 (NormalizePath): ditto
818 (GetFileContents): ditto
819 (ReplaceEnvironmentPath): ditto
822 (ChangeExtension): ditto
823 (MakeDisplayPath): ditto
824 (do_popen): return cmdret const
825 (findtexfile): return string const
827 * src/support/DebugStream.h: add some /// to please doc++
829 * src/frontends/DialogBase.h (endif): add some /// to please doc++
831 * src/texrow.C (same_rownumber): functor to use with find_if
832 (getIdFromRow): rewritten to use find_if and to not update the
833 positions. return true if row is found
834 (increasePos): new method, use to update positions
836 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
838 * src/lyxlex_pimpl.C (verifyTable): new method
841 (GetString): return string const
842 (pushTable): rewrite to use std::stack
844 (setFile): better check
847 * src/lyxlex.h: make LyXLex noncopyable
849 * src/lyxlex.C (text): return char const * const
850 (GetString): return string const
851 (getLongString): return string const
853 * src/lyx_gui_misc.C (askForText): return pair<...> const
855 * src/lastfiles.[Ch] (operator): return string const
857 * src/buffer.C (parseSingleLyXformat2Token): pass string to
858 istringstream not char const *.
859 move token.end() out of loop.
860 (readFile): move initializaton of token
862 * src/BufferView2.C (insertErrors): run texrow.increasePos if
863 getIdFromRow is successful.
865 * lib/bind/emacs.bind: don't include menus bind
867 * development/Code_rules/Rules: the beginnings of making this
868 better and covering more of the unwritten rules that we have.
870 * development/Code_rules/Recommendations: a couple of wording
873 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
875 * src/support/strerror.c: remove C++ comment.
877 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
879 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
880 LFUN_INDEX_INSERT_LAST
882 * src/texrow.C (getIdFromRow): changed from const_iterator to
883 iterator, allowing code to compile with DEC cxx
885 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
886 stores part of the class, as suggested by Allan. Will allow
888 (apply): test to apply uses InsetCommandParams operator!=
890 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
891 (apply): test to apply uses InsetCommandParams operator!=
893 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
894 stores part of the class.
895 (update): removed limits on min/max size.
897 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
898 (apply): test to apply uses InsetCommandParams operator!=
900 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
901 (Read, Write, scanCommand, getCommand): moved functionality
902 into InsetCommandParams.
904 (getScreenLabel): made pure virtual
905 new InsetCommandParams operators== and !=
907 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
908 c-tors based on InsetCommandParams. Removed others.
909 * src/insets/insetinclude.[Ch]: ditto
910 * src/insets/insetlabel.[Ch]: ditto
911 * src/insets/insetparent.[Ch]: ditto
912 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
914 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
915 insets derived from InsetCommand created using similar c-tors
916 based on InsetCommandParams
917 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
918 * src/menus.C (ShowRefsMenu): ditto
919 * src/paragraph.C (Clone): ditto
920 * src/text2.C (SetCounter): ditto
921 * src/lyxfunc.C (Dispatch) ditto
922 Also recreated old InsetIndex behaviour exactly. Can now
923 index-insert at the start of a paragraph and index-insert-last
924 without launching the pop-up.
926 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
928 * lib/lyxrc.example: mark te pdf options as non functional.
930 * src/support/lstrings.C (strToInt): move initalization of tmpstr
931 (isStrDbl): move tmpstr.end() out of loop.
932 (strToDbl): move intialization of tmpstr
933 (lowercase): return string const and move tmp.end() out of loop.
934 (uppercase): return string const and move tmp.edn() out of loop.
935 (prefixIs): add assertion
940 (containsOnly): ditto
941 (containsOnly): ditto
942 (containsOnly): ditto
943 (countChar): make last arg char not char const
944 (token): return string const
945 (subst): return string const, move tmp.end() out of loop.
946 (subst): return string const, add assertion
947 (strip): return string const
948 (frontStrip): return string const, add assertion
949 (frontStrip): return string const
954 * src/support/lstrings.C: add inclde "LAssert.h"
955 (isStrInt): move tmpstr.end() out of loop.
957 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
958 toollist.end() out of loop.
959 (deactivate): move toollist.end() out of loop.
960 (update): move toollist.end() out of loop.
961 (updateLayoutList): move tc.end() out of loop.
962 (add): move toollist.end() out of loop.
964 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
965 md.end() out of loop.
967 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
969 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
972 * src/paragraph.C (Erase): move fontlist.end() out of loop.
973 (Erase): move insetlist.end() out of loop.
975 * src/lyx_sendfax_main.C: make show_logfile static and to take a
976 ref to const string as first arg. Move initialization of some
977 variables, whitespace changes.
979 * src/kbmap.C (defkey): move table.end() out of loop.
980 (kb_keymap): move table.end() out of loop.
981 (findbinding): move table.end() out of loop.
983 * src/MenuBackend.C (hasMenu): move end() out of loop.
984 (getMenu): move end() out of loop.
985 (getMenu): move menulist_.end() out of loop.
987 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
989 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
992 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
993 (getFromLyXName): move infotab.end() out of loop.
995 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
996 -fvtable-thunks -ffunction-sections -fdata-sections
998 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
1000 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
1003 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1005 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
1007 * src/frontends/xforms/FormCitation.[Ch],
1008 src/frontends/xforms/FormIndex.[Ch],
1009 src/frontends/xforms/FormToc.[Ch],
1010 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
1012 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1014 * src/commandtags.h: renamed, created some flags for citation
1017 * src/lyx_gui_misc.C: stripped out old FD_index_form code
1019 * src/lyxfunc.C (dispatch): use signals to insert index entry
1021 * src/frontends/Dialogs.h: new signal createIndex
1023 * src/frontends/xforms/FormCommand.[Ch],
1024 src/frontends/xforms/FormCitation.[Ch],
1025 src/frontends/xforms/FormToc.[Ch],
1026 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
1028 * src/insets/insetindex.[Ch]: GUI-independent
1030 * src/frontends/xforms/FormIndex.[Ch],
1031 * src/frontends/xforms/forms/form_index.fd: xforms implementation
1034 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
1036 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
1037 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
1039 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1041 * src/insets/insetref.C (Latex): rewrite so that there is now
1042 question that a initialization is requested.
1044 * src/insets/insetcommand.h: reenable the hide signal
1046 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1048 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
1049 fix handling of shortcuts (many bugs :)
1050 (add_lastfiles): ditto.
1052 * lib/ui/default.ui: fix a few shortcuts.
1054 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
1056 * Makefile.am: Fix ``rpmdist'' target to return the exit
1057 status of the ``rpm'' command, instead of the last command in
1058 the chain (the ``rm lyx.xpm'' command, which always returns
1061 2000-08-02 Allan Rae <rae@lyx.org>
1063 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
1064 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
1065 * src/frontends/xforms/FormToc.C (FormToc): ditto
1067 * src/frontends/xforms/Makefile.am: A few forgotten files
1069 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
1070 Signals-not-copyable-problem Lars' started commenting out.
1072 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
1074 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1076 * src/insets/insetcommand.h: Signals is not copyable so anoter
1077 scheme for automatic hiding of forms must be used.
1079 * src/frontends/xforms/FormCitation.h: don't inerit from
1080 noncopyable, FormCommand already does that.
1081 * src/frontends/xforms/FormToc.h: ditto
1082 * src/frontends/xforms/FormUrl.h: ditto
1084 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1086 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
1088 * src/insets/insetcommand.h (hide): new SigC::Signal0
1089 (d-tor) new virtual destructor emits hide signal
1091 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
1092 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
1094 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
1095 LOF and LOT. Inset is now GUI-independent
1097 * src/insets/insetloa.[Ch]: redundant
1098 * src/insets/insetlof.[Ch]: ditto
1099 * src/insets/insetlot.[Ch]: ditto
1101 * src/frontends/xforms/forms/form_url.fd: tweaked!
1102 * src/frontends/xforms/forms/form_citation.fd: ditto
1104 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
1105 dialogs dealing with InsetCommand insets
1107 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
1108 FormCommand base class
1109 * src/frontends/xforms/FormUrl.[Ch]: ditto
1111 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
1113 * src/frontends/xforms/FormToc.[Ch]: ditto
1115 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
1116 passed a generic InsetCommand pointer
1117 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
1119 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
1120 and modified InsetTOC class
1121 * src/buffer.C: ditto
1123 * forms/lyx.fd: strip out old FD_form_toc code
1124 * src/lyx_gui_misc.C: ditto
1125 * src/lyx_gui.C: ditto
1126 * src/lyx_cb.C: ditto
1127 * src/lyx.[Ch]: ditto
1129 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1131 * src/support/utility.hpp: tr -d '\r'
1133 2000-08-01 Juergen Vigna <jug@sad.it>
1135 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
1137 * src/commandtags.h:
1138 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
1139 LFUN_TABULAR_FEATURES.
1141 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
1142 LFUN_LAYOUT_TABULAR.
1144 * src/insets/insettabular.C (getStatus): implemented helper function.
1146 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
1148 2000-07-31 Juergen Vigna <jug@sad.it>
1150 * src/text.C (draw): fixed screen update problem for text-insets.
1152 * src/text2.C (SetParagrpah): call an update of the inset-owner when
1153 something changed probably this has to be added in various other
1156 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
1158 2000-07-31 Baruch Even <baruch.even@writeme.com>
1160 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
1161 templates to satisfy compaq cxx.
1164 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1166 * src/support/translator.h (equal_1st_in_pair::operator()): take
1167 const ref pair_type as arg.
1168 (equal_2nd_in_pair::operator()): ditto
1169 (Translator::~Translator): remove empty d-tor.
1171 * src/graphics/GraphicsCache.C: move include config.h to top, also
1172 put initialization of GraphicsCache::singleton here.
1173 (~GraphicsCache): move here
1174 (addFile): take const ref as arg
1177 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
1179 * src/BufferView2.C (insertLyXFile): change te with/without header
1182 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1184 * src/frontends/xforms/FormGraphics.C (apply): add some
1185 static_cast. Not very nice, but required by compaq cxx.
1187 * src/frontends/xforms/RadioButtonGroup.h: include header
1188 <utility> instead of <pair.h>
1190 * src/insets/insetgraphicsParams.C: add using directive.
1191 (readResize): change return type to void.
1192 (readOrigin): ditto.
1194 * src/lyxfunc.C (getStatus): add missing break for build-program
1195 function; add test for Literate for export functions.
1197 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
1198 entries in Options menu.
1200 2000-07-31 Baruch Even <baruch.even@writeme.com>
1202 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
1203 protect against auto-allocation; release icon when needed.
1205 2000-07-31 Matej Cepl <CeplM@seznam.cz>
1207 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
1208 on usual typewriter.
1210 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
1211 earlier czech.kmap), useful only for programming.
1213 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1215 * src/frontends/xforms/FormCitation.h: fix conditioning around
1218 2000-07-31 Juergen Vigna <jug@sad.it>
1220 * src/frontends/xforms/FormTabular.C (local_update): changed
1221 radio_linebreaks to radio_useparbox and added radio_useminipage.
1223 * src/tabular.C: made support for using minipages/parboxes.
1225 * src/bufferlist.C (QwriteAll): small fix for asking for save.
1227 * src/insets/insetgraphics.C (draw): just draw the inset so that the
1229 (descent): so the cursor is in the middle.
1230 (width): bit smaller box.
1232 * src/insets/insetgraphics.h: added display() function.
1234 2000-07-31 Baruch Even <baruch.even@writeme.com>
1236 * src/frontends/Dialogs.h: Added showGraphics signals.
1238 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
1239 xforms form definition of the graphics dialog.
1241 * src/frontends/xforms/FormGraphics.h:
1242 * src/frontends/xforms/FormGraphics.C: Added files, the
1243 GUIndependent code of InsetGraphics
1245 * src/insets/insetgraphics.h:
1246 * src/insets/insetgraphics.C: Major writing to make it work.
1248 * src/insets/insetgraphicsParams.h:
1249 * src/insets/insetgraphicsParams.C: Added files, parameter passing
1250 struct between InsetGraphics and GUI.
1252 * src/LaTeXFeatures.h:
1253 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
1254 support for graphicx package.
1256 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
1257 for the graphics inset.
1259 * src/support/translator.h: Added file, used in
1260 InsetGraphicsParams. this is a template to translate between two
1263 * src/frontends/xforms/RadioButtonGroup.h:
1264 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
1265 way to easily control a radio button group.
1267 2000-07-28 Juergen Vigna <jug@sad.it>
1269 * src/insets/insettabular.C (LocalDispatch):
1270 (TabularFeatures): added support for lyx-functions of tabular features.
1271 (cellstart): refixed this function after someone wrongly changed it.
1273 * src/commandtags.h:
1274 * src/LyXAction.C (init): added support for tabular-features
1276 2000-07-28 Allan Rae <rae@lyx.org>
1278 * src/frontends/xforms/FormPreferences.C (build): Setup input return
1279 checking. NOTE: It seems that pressing ESC to cancel the dialog also
1280 triggers the callback for input checking. As a result we sometimes get
1281 "LyX: This shouldn't happen..." printed to cerr.
1282 (input): Started using status variable since I only free() on
1283 destruction. Some input checking for paths and font sizes.
1285 * src/frontends/xforms/FormPreferences.h: Use status to control
1286 activation of Ok and Apply
1288 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
1289 callback. Also resized to stop segfaults with 0.88. The problem is
1290 that xforms-0.88 requires the folder to be wide enough to fit all the
1291 tabs. If it isn't it causes all sorts of problems.
1293 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
1295 * src/frontends/xforms/forms/README: Reflect reality.
1297 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
1298 * src/frontends/xforms/forms/makefile: ditto.
1300 * src/commandtags.h: Get access to new Preferences dialog
1301 * src/LyXAction.C: ditto
1302 * src/lyxfunc.C: ditto
1303 * lib/ui/default.ui: ditto
1305 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1307 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
1309 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
1312 * src/frontends/xforms/form_url.[Ch]: added.
1314 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1316 * src/insets/insetbib.h: fixed bug in previous commit
1318 * src/frontends/xforms/FormUrl.h: ditto
1320 * src/frontends/xforms/FormPrint.h: ditto
1322 * src/frontends/xforms/FormPreferences.h: ditto
1324 * src/frontends/xforms/FormCopyright.h: ditto
1326 * src/frontends/xforms/FormCitation.C: ditto
1328 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
1329 private copyconstructor and private default contructor
1331 * src/support/Makefile.am: add utility.hpp
1333 * src/support/utility.hpp: new file from boost
1335 * src/insets/insetbib.h: set owner in clone
1337 * src/frontends/xforms/FormCitation.C: added missing include
1340 * src/insets/form_url.[Ch]: removed
1342 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
1344 * development/lyx.spec.in
1345 * Makefile.am: Fix buglet for LyX RPM generation resulting from
1346 file/directory re-organization.
1348 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
1350 * src/insets/insetcommand.[Ch]: moved the string data and
1351 associated manipulation methods into a new stand-alone class
1352 InsetCommandParams. This class has two additional methods
1353 getAsString() and setFromString() allowing the contents to be
1354 moved around as a single string.
1355 (addContents) method removed.
1356 (setContents) method no longer virtual.
1358 * src/buffer.C (readInset): made use of new InsetCitation,
1359 InsetUrl constructors based on InsetCommandParams.
1361 * src/commandtags.h: add LFUN_INSERT_URL
1363 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
1364 independent InsetUrl and use InsetCommandParams to extract
1365 string info and create new Insets.
1367 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
1369 * src/frontends/xforms/FormCitation.C (apply): uses
1372 * src/frontends/xforms/form_url.C
1373 * src/frontends/xforms/form_url.h
1374 * src/frontends/xforms/FormUrl.h
1375 * src/frontends/xforms/FormUrl.C
1376 * src/frontends/xforms/forms/form_url.fd: new files
1378 * src/insets/insetcite.[Ch]: removed unused constructors.
1380 * src/insets/insetinclude.[Ch]: no longer store filename
1382 * src/insets/inseturl.[Ch]: GUI-independent.
1384 2000-07-26 Juergen Vigna <jug@sad.it>
1385 * renamed frontend from gtk to gnome as it is that what is realized
1386 and did the necessary changes in the files.
1388 2000-07-26 Marko Vendelin <markov@ioc.ee>
1390 * configure.in: cleaning up gnome configuration scripts
1392 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1394 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
1395 shortcuts syndrom by redrawing them explicitely (a better solution
1396 would be appreciated).
1398 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
1400 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
1403 * src/lyx_cb.C (MenuExport): change html export to do the right
1404 thing depending of the document type (instead of having
1405 html-linuxdoc and html-docbook).
1406 * src/lyxfunc.C (getStatus): update for html
1407 * lib/ui/default.ui: simplify due to the above change.
1408 * src/menus.C (ShowFileMenu): update too (in case we need it).
1410 * src/MenuBackend.C (read): if a menu is defined twice, add the
1411 new entries to the exiting one.
1413 2000-07-26 Juergen Vigna <jug@sad.it>
1415 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
1417 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
1418 and return a bool if it did actual save the file.
1419 (AutoSave): don't autosave a unnamed doc.
1421 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
1422 check if this is an UNNAMED new file and react to it.
1423 (newFile): set buffer to unnamed and change to not mark a new
1424 buffer dirty if I didn't do anything with it.
1426 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
1428 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1430 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
1431 friend as per Angus's patch posted to lyx-devel.
1433 * src/ext_l10n.h: updated
1435 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
1436 gettext on the style string right before inserting them into the
1439 * autogen.sh: add code to extract style strings form layout files,
1440 not good enough yet.
1442 * src/frontends/gtk/.cvsignore: add MAKEFILE
1444 * src/MenuBackend.C (read): run the label strings through gettext
1445 before storing them in the containers.
1447 * src/ext_l10n.h: new file
1449 * autogen.sh : generate the ext_l10n.h file here
1451 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1453 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
1456 * lib/ui/default.ui: fix a couple of typos.
1458 * config/gnome/gtk.m4: added (and added to the list of files in
1461 * src/insets/insetinclude.C (unique_id): fix when we are using
1462 lyxstring instead of basic_string<>.
1463 * src/insets/insettext.C (LocalDispatch): ditto.
1464 * src/support/filetools.C: ditto.
1466 * lib/configure.m4: create the ui/ directory if necessary.
1468 * src/LyXView.[Ch] (updateToolbar): new method.
1470 * src/BufferView_pimpl.C (buffer): update the toolbar when
1471 opening/closing buffer.
1473 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1475 * src/LyXAction.C (getActionName): enhance to return also the name
1476 and options of pseudo-actions.
1477 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
1479 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
1480 as an example of what is possible). Used in File->Build too (more
1481 useful) and in the import/export menus (to mimick the complicated
1482 handling of linuxdoc and friends). Try to update all the entries.
1484 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
1487 * src/MenuBackend.C (read): Parse the new OptItem tag.
1489 * src/MenuBackend.h: Add a new optional_ data member (used if the
1490 entry should be omitted when the lyxfunc is disabled).
1492 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
1493 function, used as a shortcut.
1494 (create_submenu): align correctly the shortcuts on the widest
1497 * src/MenuBackend.h: MenuItem.label() only returns the label of
1498 the menu without shortcut; new method shortcut().
1500 2000-07-14 Marko Vendelin <markov@ioc.ee>
1502 * src/frontends/gtk/Dialogs.C:
1503 * src/frontends/gtk/FormCopyright.C:
1504 * src/frontends/gtk/FormCopyright.h:
1505 * src/frontends/gtk/Makefile.am: added these source-files for the
1506 Gtk/Gnome support of the Copyright-Dialog.
1508 * src/main.C: added Gnome::Main initialization if using
1509 Gtk/Gnome frontend-GUI.
1511 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
1513 * config/gnome/aclocal-include.m4
1514 * config/gnome/compiler-flags.m4
1515 * config/gnome/curses.m4
1516 * config/gnome/gnome--.m4
1517 * config/gnome/gnome-bonobo-check.m4
1518 * config/gnome/gnome-common.m4
1519 * config/gnome/gnome-fileutils.m4
1520 * config/gnome/gnome-ghttp-check.m4
1521 * config/gnome/gnome-gnorba-check.m4
1522 * config/gnome/gnome-guile-checks.m4
1523 * config/gnome/gnome-libgtop-check.m4
1524 * config/gnome/gnome-objc-checks.m4
1525 * config/gnome/gnome-orbit-check.m4
1526 * config/gnome/gnome-print-check.m4
1527 * config/gnome/gnome-pthread-check.m4
1528 * config/gnome/gnome-support.m4
1529 * config/gnome/gnome-undelfs.m4
1530 * config/gnome/gnome-vfs.m4
1531 * config/gnome/gnome-x-checks.m4
1532 * config/gnome/gnome-xml-check.m4
1533 * config/gnome/gnome.m4
1534 * config/gnome/gperf-check.m4
1535 * config/gnome/gtk--.m4
1536 * config/gnome/linger.m4
1537 * config/gnome/need-declaration.m4: added configuration scripts
1538 for Gtk/Gnome frontend-GUI
1540 * configure.in: added support for the --with-frontend=gtk option
1542 * autogen.sh: added config/gnome/* to list of config-files
1544 * acconfig.h: added define for GTKGUI-support
1546 * config/lyxinclude.m4: added --with-frontend[=value] option value
1547 for Gtk/Gnome frontend-GUI support.
1549 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1551 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
1555 * src/paragraph.C (GetChar): remove non-const version
1557 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
1558 (search_kw): use it.
1560 * src/lyx_main.C (init): if "preferences" exist, read that instead
1562 (ReadRcFile): return bool if the file could be read ok.
1563 (ReadUIFile): add a check to see if lex file is set ok.
1565 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
1566 bastring can be used instead of lyxstring (still uses the old code
1567 if std::string is good enough or if lyxstring is used.)
1569 * src/encoding.C: make the arrays static, move ininle functions
1571 * src/encoding.h: from here.
1573 * src/buffer.C: have last_isnet_read as a file scope variable for now.
1574 (parseSingleLyXformat2Token): move inset parsing to separate method
1575 (readInset): new private method
1577 * src/Variables.h: remove virtual from get().
1579 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
1580 access to NEW_INSETS and NEW_TABULAR
1582 * src/MenuBackend.h: remove superfluous forward declaration of
1583 MenuItem. Add documentations tags "///", remove empty MenuItem
1584 destructor, remove private default contructor.
1586 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
1588 (read): more string mlabel and mname to where they are used
1589 (read): remove unused variables mlabel and mname
1590 (defaults): unconditional clear, make menusetup take advantage of
1591 add returning Menu &.
1593 * src/LyXView.h: define NEW_MENUBAR as default
1595 * src/LyXAction.C: include lyxparagraph.h temporary to get access
1596 to NEW_INSETS and NEW_TABULAR.
1597 (init): commetn out some funcs that is obsolete when NEW_INSETS is
1598 defined. Change some of the "xxxx-inset-insert" functions names to
1601 * several files: more enahncements to NEW_INSETS and the resulting
1604 * lib/lyxrc.example (\date_insert_format): move to misc section
1606 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
1607 bastring and use AC_CACHE_CHECK.
1608 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
1609 the system have the newest methods. uses AC_CACHE_CHECK
1610 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
1611 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
1612 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
1614 * configure.in: add LYX_CXX_GOOD_STD_STRING
1616 * acinclude.m4: recreated
1618 2000-07-24 Amir Karger
1620 * README: add Hebrew, Arabic kmaps
1623 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1625 * src/buffer.C (writeFileAscii): Define actcell as an int instead
1628 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1630 * Lot of files: add pragma interface/implementation.
1632 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
1634 * lib/ui/default.ui: new file (ans new directory). Contains the
1635 default menu and toolbar.
1637 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
1638 global space. Toolbars are now read (as menus) in ui files.
1640 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
1642 * src/lyxfunc.C (getStatus): do not exit immediately if a command
1643 is disabled because the document is read-only. We want to have the
1644 toggle state of the function anyway.
1645 (getStatus): add code for LFUN_VC* functions (mimicking what is
1646 done in old-style menus)
1648 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
1649 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
1651 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
1652 * src/BufferView_pimpl.C: ditto.
1653 * src/lyxfunc.C: ditto.
1655 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
1656 default). This replaces old-style menus by new ones.
1658 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
1659 MenuItem. Contain the data structure of a menu.
1661 * src/insets/insettext.C: use LyXView::setLayout instead of
1662 accessing directly the toolbar combox.
1663 * src/lyxfunc.C (Dispatch): ditto.
1665 * src/LyXView.C (setLayout): new method, which just calls
1666 Toolbar::setLayout().
1667 (updateLayoutChoice): move part of this method in Toolbar.
1669 * src/toolbar.[Ch]: removed.
1671 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
1672 implementation the toolbar.
1674 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
1675 the toolbar. It might make sense to merge it with ToolbarDefaults
1677 (setLayout): new function.
1678 (updateLayoutList): ditto.
1679 (openLayoutList): ditto.
1681 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
1682 xforms implementation of the toolbar.
1683 (get_toolbar_func): comment out, since I do not
1684 know what it is good for.
1686 * src/ToolbarDefaults.h: Add the ItemType enum.
1688 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
1689 for a list of allocated C strings. Used in Menubar xforms
1690 implementation to avoid memory leaks.
1692 * src/support/lstrings.[Ch] (uppercase): new version taking and
1696 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
1697 * lib/bind/emacs.bind: ditto.
1699 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
1701 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
1702 forward decl of LyXView.
1704 * src/toolbar.C (toolbarItem): moved from toolbar.h
1705 (toolbarItem::clean): ditto
1706 (toolbarItem::~toolbarItem): ditto
1707 (toolbarItem::operator): ditto
1709 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
1711 * src/paragraph.h: control the NEW_TABULAR define from here
1713 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
1714 USE_TABULAR_INSETS to NEW_TABULAR
1716 * src/ToolbarDefaults.C: add include "lyxlex.h"
1718 * files using the old table/tabular: use NEW_TABULAR to control
1719 compilation of old tabular stuff.
1721 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
1724 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
1725 planemet in reading of old style floats, fix the \end_deeper
1726 problem when reading old style floats.
1728 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1730 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
1732 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
1734 * lib/bind/sciword.bind: updated.
1736 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1738 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
1739 layout write problem
1741 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1743 * src/Makefile.am (INCLUDES): remove image directory from include
1746 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
1747 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
1749 * src/LyXView.C (create_form_form_main): read the application icon
1752 * lib/images/*.xpm: change the icons to use transparent color for
1755 * src/toolbar.C (update): change the color of the button when it
1758 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1760 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
1761 setting explicitely the minibuffer.
1762 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
1764 * src/LyXView.C (showState): new function. Shows font information
1765 in minibuffer and update toolbar state.
1766 (LyXView): call Toolbar::update after creating the
1769 * src/toolbar.C: change toollist to be a vector instead of a
1771 (BubbleTimerCB): get help string directly from the callback
1772 argument of the corresponding icon (which is the action)
1773 (set): remove unnecessary ugliness.
1774 (update): new function. update the icons (depressed, disabled)
1775 depending of the status of the corresponding action.
1777 * src/toolbar.h: remove help in toolbarItem
1779 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
1781 * src/Painter.C (text): Added code for using symbol glyphs from
1782 iso10646 fonts. Currently diabled.
1784 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
1787 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
1788 magyar,turkish and usorbian.
1790 * src/paragraph.C (isMultiLingual): Made more efficient.
1792 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
1795 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
1796 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
1797 Also changed the prototype to "bool math_insert_greek(char)".
1799 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1801 * lots of files: apply the NEW_INSETS on all code that will not be
1802 needed when we move to use the new insets. Enable the define in
1803 lyxparagrah.h to try it.
1805 * src/insets/insettabular.C (cellstart): change to be a static
1807 (InsetTabular): initialize buffer in the initializer list.
1809 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
1811 * src/frontends/xforms/FormPrint.[Ch] : moved #include
1812 form_print.h out of the header file. Replaced with forward
1813 declarations of the relevant struct.
1815 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
1818 * src/commandtags.h: do not include "debug.h" which does not
1819 belong there. #include it in some other places because of this
1822 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1824 * src/insets/insetcaption.C: add a couple "using" directives.
1826 * src/toolbar.C (add): get the help text directly from lyxaction.
1828 (setPixmap): new function. Loads from disk and sets a pixmap on a
1829 botton; the name of the pixmap file is derived from the command
1832 * src/toolbar.h: remove members isBitmap and pixmap from
1835 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
1836 * lib/images/: move many files from images/banner.xpm.
1838 * src/lyx_gui.C (create_forms): read banner pixmap from file.
1840 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
1841 * src/toolbar.C: ditto.
1842 * configure.in: ditto.
1843 * INSTALL: document.
1845 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
1846 the spellchecker popup is closed from the WM.
1848 2000-07-19 Juergen Vigna <jug@sad.it>
1850 * src/insets/insetfloat.C (Write): small fix because we use the
1851 insetname for the type now!
1853 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
1855 * src/frontends/xforms/forms/form_citation.fd: object sizes are
1858 * src/frontends/Dialogs.h: removed hideCitation signal
1860 * src/insets/insetcite.h: added hide signal
1862 * src/insets/insetcite.C (~InsetCitation): emits new signal
1863 (getScreenLabel): "intelligent" label should now fit on the screen!
1865 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
1867 * src/frontends/xforms/FormCitation.C (showInset): connects
1868 hide() to the inset's hide signal
1869 (show): modified to use fl_set_object_position rather than
1870 fl_set_object_geometry wherever possible
1872 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1874 * src/insets/lyxinset.h: add caption code
1876 * src/insets/insetfloat.C (type): new method
1878 * src/insets/insetcaption.C (Write): new method
1880 (LyxCode): new method
1882 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
1883 to get it right together with using the FloatList.
1885 * src/commandtags.h: add LFUN_INSET_CAPTION
1886 * src/lyxfunc.C (Dispatch): handle it
1888 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
1891 * src/Variables.[Ch]: make expand take a const reference, remove
1892 the destructor, some whitespace changes.
1894 * src/LyXAction.C (init): add caption-inset-insert
1896 * src/FloatList.C (FloatList): update the default floats a bit.
1898 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1900 * src/Variables.[Ch]: new files. Intended to be used for language
1901 specific strings (like \chaptername) and filename substitution in
1904 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
1906 * lib/kbd/american.kmap: update
1908 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
1910 * src/bufferparams.[Ch]: remove member allowAccents.
1912 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
1914 * src/LaTeXLog.C: use the log_form.h header.
1915 * src/lyx_gui.C: ditto.
1916 * src/lyx_gui_misc.C: ditto.
1917 * src/lyxvc.h: ditto.
1919 * forms/log_form.fd: new file, created from latexoptions.fd. I
1920 kept the log popup and nuked the options form.
1922 * src/{la,}texoptions.[Ch]: removed.
1923 * src/lyx_cb.C (LaTeXOptions): ditto
1925 * src/lyx_gui.C (create_forms): do not handle the
1926 fd_latex_options form.
1928 2000-07-18 Juergen Vigna <jug@sad.it>
1930 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
1931 name of the inset so that it can be requested outside (text2.C).
1933 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
1936 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1938 * src/mathed/formula.h (ConvertFont): constify
1940 * src/mathed/formula.C (Read): add warning if \end_inset is not
1941 found on expected place.
1943 * src/insets/lyxinset.h (ConvertFont): consify
1945 * src/insets/insetquotes.C (ConvertFont): constify
1946 * src/insets/insetquotes.h: ditto
1948 * src/insets/insetinfo.h: add labelfont
1950 * src/insets/insetinfo.C (InsetInfo): set the labelfont
1951 (ascent): use labelfont
1955 (Write): make .lyx file a bit nicer
1957 * src/insets/insetfloat.C (Write): simplify somewhat...
1958 (Read): add warning if arg is not found
1960 * src/insets/insetcollapsable.C: add using std::max
1961 (Read): move string token and add warning in arg is not found
1962 (draw): use std::max to get the right ty
1963 (getMaxWidth): simplify by using std::max
1965 * src/insets/insetsection.h: new file
1966 * src/insets/insetsection.C: new file
1967 * src/insets/insetcaption.h: new file
1968 * src/insets/insetcaption.C: new file
1970 * src/insets/inset.C (ConvertFont): constify signature
1972 * src/insets/Makefile.am (libinsets_la_SOURCES): add
1973 insetcaption.[Ch] and insetsection.[Ch]
1975 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
1976 uses to use LABEL_COUNTER_CHAPTER instead.
1977 * src/text2.C (SetCounter): here
1979 * src/counters.h: new file
1980 * src/counters.C: new file
1981 * src/Sectioning.h: new file
1982 * src/Sectioning.C: new file
1984 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
1986 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1988 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
1991 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
1994 2000-07-17 Juergen Vigna <jug@sad.it>
1996 * src/tabular.C (Validate): check if array-package is needed.
1997 (SetVAlignment): added support for vertical alignment.
1998 (SetLTFoot): better support for longtable header/footers
1999 (Latex): modified to support added features.
2001 * src/LaTeXFeatures.[Ch]: added array-package.
2003 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
2005 * src/lyx_gui.C (LyXGUI): make sure that the height is large
2008 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
2010 * configure.in: do not forget to put a space after -isystem.
2012 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
2014 * lib/kbd/arabic.kmap: a few fixes.
2016 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2018 * some whitespace chagnes to a number of files.
2020 * src/support/DebugStream.h: change to make it easier for
2021 doc++ to parse correctly.
2022 * src/support/lyxstring.h: ditto
2024 * src/mathed/math_utils.C (compara): change to have only one
2026 (MathedLookupBOP): change because of the above.
2028 * src/mathed/math_delim.C (math_deco_compare): change to have only
2030 (search_deco): change becasue of the above.
2032 * src/insets/insettabular.C (DrawCellSelection): use std::swap
2033 instead of manually coded one.
2035 * src/insets/insetquotes.C (Read): read the \end_inset too
2037 * src/insets/insetlatex.h: remove file
2038 * src/insets/insetlatex.C: remove file
2040 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
2042 (InsetPrintIndex): remove destructor
2044 * src/insets/insetinclude.h: remove default constructor
2046 * src/insets/insetfloat.C: work to make it work better
2048 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
2050 * src/insets/insetcite.h (InsetCitation): remove default constructor
2052 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
2054 * src/text.C (GetColumnNearX): comment out some currently unused code.
2056 * src/paragraph.C (writeFile): move some initializations closer to
2058 (CutIntoMinibuffer): small change to use new matchIT operator
2062 (InsertInset): ditto
2065 (InsetIterator): ditto
2066 (Erase): small change to use new matchFT operator
2068 (GetFontSettings): ditto
2069 (HighestFontInRange): ditto
2072 * src/lyxparagraph.h: some chars changed to value_type
2073 (matchIT): because of some stronger checking (perhaps too strong)
2074 in SGI STL, the two operator() unified to one.
2077 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
2079 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
2080 the last inset read added
2081 (parseSingleLyXformat2Token): some more (future) compability code added
2082 (parseSingleLyXformat2Token): warning about solitary \end_inset added
2083 (parseSingleLyXformat2Token): set last_inset_read
2084 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2085 (parseSingleLyXformat2Token): don't double intializw string next_token
2087 * src/TextCache.C (text_fits::operator()): add const's to the signature
2088 (has_buffer::operator()): ditto
2090 * src/Floating.h: add some comments on the class
2092 * src/FloatList.[Ch] (typeExist): new method
2095 * src/BackStack.h: added default constructor, wanted by Gcc.
2097 2000-07-14 Juergen Vigna <jug@sad.it>
2099 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
2101 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
2103 * src/insets/insettabular.C (resizeLyXText): need this to be able to
2104 do a redraw when the window is resized!
2105 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
2107 * src/insets/insettext.C (resizeLyXText): added function to correctly
2108 being able to resize the LyXWindow.
2110 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
2112 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
2114 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
2115 crashes when closing dialog to a deleted inset.
2117 * src/insets/insetcite.[Ch] (Edit) : the return of this former
2118 method! Now similar to other insets.
2120 2000-07-13 Juergen Vigna <jug@sad.it>
2122 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
2124 * lib/examples/Literate.lyx: small patch!
2126 * src/insets/insetbib.C (Read): added this function because of wrong
2127 Write (without [begin|end]_inset).
2129 2000-07-11 Juergen Vigna <jug@sad.it>
2131 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
2132 as the insertInset could not be good!
2134 * src/screen.C (ToggleSelection): fixed toggle selection bug as
2135 the bool param should not be last.
2137 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2139 * sigc++/configure.in: fix bug in threading-related code (Yes, I
2140 did submit that to Karl).
2142 * configure.in: use -isystem instead of -I for X headers. This
2143 fixes a problem on solaris with a recent gcc;
2144 put the front-end code after the X detection code;
2145 configure in sigc++ before lib/
2147 * src/lyx_main.C (commandLineHelp): remove -display from command
2150 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
2152 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
2153 Also put in Makefile rules for building the ``listerrors''
2154 program for parsing errors from literate programs written in LyX.
2156 * lib/build-listerrors: Added small shell script as part of compile
2157 process. This builds a working ``listerrors'' binary if noweb is
2158 installed and either 1) the VNC X server is installed on the machine,
2159 or 2) the user is compiling from within a GUI. The existence of a GUI
2160 is necessary to use the ``lyx --export'' feature for now. This
2161 hack can be removed once ``lyx --export'' no longer requires a GUI to
2164 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
2166 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
2167 now passed back correctly from gcc and placed "under" error
2168 buttons in a Literate LyX source.
2170 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2172 * src/text.C (GetColumnNearX): Better behavior when a RTL
2173 paragraph is ended by LTR text.
2175 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
2178 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2180 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
2181 true when clipboard is empty.
2183 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2185 * text.C (Backspace): Prevent rebreaking of a row if it is the last
2186 row of the paragraph.
2187 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
2188 to prevent calculation of bidi tables
2190 2000-07-07 Juergen Vigna <jug@sad.it>
2192 * src/screen.C (ToggleSelection): added y_offset and x_offset
2195 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
2198 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
2200 * src/insets/insettext.C: fixed Layout-Display!
2202 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2204 * configure.in: add check for strings.h header.
2206 * src/spellchecker.C: include <strings.h> in order to have a
2207 definition for bzero().
2209 2000-07-07 Juergen Vigna <jug@sad.it>
2211 * src/insets/insettext.C (draw): set the status of the bv->text to
2212 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
2214 * src/screen.C (DrawOneRow):
2215 (DrawFromTo): redraw the actual row if something has changed in it
2218 * src/text.C (draw): call an update of the toplevel-inset if something
2219 has changed inside while drawing.
2221 * src/lyxtext.h: added CHANGED_IN_DRAW status.
2223 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
2225 * src/insets/insetbib.[Ch] (callback) new method, moving callback
2226 processing inside class.
2228 * src/insets/insetindex.[Ch] (callback) new method, moving callback
2229 processing inside class.
2231 * src/insets/insetindex.h new struct Holder, consistent with other
2234 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
2235 citation dialog from main code and placed it in src/frontends/xforms.
2236 Dialog launched through signals instead of callbacks
2238 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
2240 * lyx.man: update the options description.
2242 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
2244 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
2245 handle neg values, set min width to 590, add doc about -display
2247 2000-07-05 Juergen Vigna <jug@sad.it>
2249 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
2250 calls to BufferView *.
2252 * src/insets/insettext.C (checkAndActivateInset): small fix non
2253 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
2255 * src/insets/insetcommand.C (Read): Fixed as insets should read till
2256 their \end_inset token!
2258 2000-07-04 edscott <edscott@imp.mx>
2260 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
2261 lib/lyxrc.example: added option \wheel_jump
2263 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
2265 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
2266 remove support for -width,-height,-xpos and -ypos.
2268 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
2270 * src/encoding.[Ch]: New files.
2272 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
2273 (text): Call to the underline() method only when needed.
2275 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
2277 * src/buffer.C (makeLaTeXFile): Compute automatically the input
2278 encoding(s) for the document.
2280 * src/bufferparams.C (BufferParams): Changed default value of
2283 * src/language.C (newLang): Removed.
2284 (items[]): Added encoding information for all defined languages.
2286 * src/lyx_gui.C (create_forms): Added "auto" option to the input
2287 encoding choice button.
2289 * src/lyxrc.h (font_norm_type): New member variable.
2290 (set_font_norm_type): New method.
2292 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
2293 paragraphs with different encodings.
2295 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
2296 (TransformChar): Changed to work correctly with Arabic points.
2297 (draw): Added support for drawing Arabic points.
2298 (draw): Removed code for drawing underbars (this is done by
2301 * src/support/textutils.h (IsPrintableNonspace): New function.
2303 * src/BufferView_pimpl.h: Added "using SigC::Object".
2304 * src/LyXView.h: ditto.
2306 * src/insets/insetinclude.h (include_label): Changed to mutable.
2308 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
2310 * src/mathed/math_iter.h: remove empty destructor
2312 * src/mathed/math_cursor.h: remove empty destructor
2314 * src/insets/lyxinset.h: add THEOREM_CODE
2316 * src/insets/insettheorem.[Ch]: new files
2318 * src/insets/insetminipage.C: (InsertInset): remove
2320 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
2322 (InsertInset): remove
2324 * src/insets/insetlist.C: (InsertList): remove
2326 * src/insets/insetfootlike.[Ch]: new files
2328 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
2331 (InsertInset): ditto
2333 * src/insets/insetert.C: remove include Painter.h, reindent
2334 (InsertInset): move to header
2336 * src/insets/insetcollapsable.h: remove explicit from default
2337 contructor, remove empty destructor, add InsertInset
2339 * src/insets/insetcollapsable.C (InsertInset): new func
2341 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2343 * src/vspace.h: add explicit to constructor
2345 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
2346 \textcompwordmark, please test this.
2348 * src/lyxrc.C: set ascii_linelen to 65 by default
2350 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
2352 * src/commandtags.h: add LFUN_INSET_THEOREM
2354 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
2355 (makeLinuxDocFile): remove _some_ of the nice logic
2356 (makeDocBookFile): ditto
2358 * src/Painter.[Ch]: (~Painter): removed
2360 * src/LyXAction.C (init): entry for insettheorem added
2362 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
2364 (deplog): code to detect files generated by LaTeX, needs testing
2367 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2369 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
2371 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2373 * src/LaTeX.C (deplog): Add a check for files that are going to be
2374 created by the first latex run, part of the project to remove the
2377 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
2378 contents to the extension list.
2380 2000-07-04 Juergen Vigna <jug@sad.it>
2382 * src/text.C (NextBreakPoint): added support for needFullRow()
2384 * src/insets/lyxinset.h: added needFullRow()
2386 * src/insets/insetcollapsable.C: redone now this uses a text-inset
2389 * src/insets/insettext.C: lots of changes for update!
2391 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
2393 * src/LaTeXFeatures.h: add a missing std:: qualifier.
2395 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
2397 * src/insets/insetinclude.C (InsetInclude): fixed
2398 initialization of include_label.
2399 (unique_id): now returns a string.
2401 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
2403 * src/LaTeXFeatures.h: new member IncludedFiles, for
2404 a map of key, included file name.
2406 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
2407 with the included files for inclusion in SGML preamble,
2408 i. e., linuxdoc and docbook.
2411 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
2412 nice (is the generated linuxdoc code to be exported?), that
2413 allows to remove column, and only_body that will be true for
2414 slave documents. Insets are allowed inside SGML font type.
2415 New handling of the SGML preamble for included files.
2416 (makeDocBookFile): the same for docbook.
2418 * src/insets/insetinclude.h:
2419 * src/insets/insetinclude.C (Validate): keeps a list of included files.
2421 (DocBook): new export methods.
2423 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
2424 and makeDocBookFile.
2426 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
2427 formats to export with command line argument -x.
2429 2000-06-29 Juergen Vigna <jug@sad.it>
2431 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
2432 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
2434 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
2435 region could already been cleared by an inset!
2437 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2439 * src/BufferView_pimpl.h: remove member variables lyx_focus and
2442 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
2444 (cursorToggle): remove special handling of lyx focus.
2446 2000-06-28 Juergen Vigna <jug@sad.it>
2448 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
2451 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2453 * src/insets/insetindex.C (Edit): add a callback when popup is
2456 * src/insets/insettext.C (LocalDispatch):
2457 * src/insets/insetmarginal.h:
2458 * src/insets/insetlist.h:
2459 * src/insets/insetfoot.h:
2460 * src/insets/insetfloat.h:
2461 * src/insets/insetert.h: add a missing std:: qualifier.
2463 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2465 * src/support/lyxsum.C (sum): '\0' teminate file read when using
2468 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
2470 * src/insets/insettext.C (Read): remove tmptok unused variable
2471 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
2472 (InsertInset): change for new InsetInset code
2474 * src/insets/insettext.h: add TEXT inline method
2476 * src/insets/insettext.C: remove TEXT macro
2478 * src/insets/insetmarginal.C (Write): new method
2479 (Latex): change output slightly
2481 * src/insets/insetfoot.C (Write): new method
2482 (Latex): change output slightly (don't use endl when no need)
2484 * src/insets/insetert.C (Write): new method
2486 * src/insets/insetcollapsable.h: make button_length, button_top_y
2487 and button_bottm_y protected.
2489 * src/insets/insetcollapsable.C (Write): simplify code by using
2490 tostr. Also do not output the float name, the children class
2491 should to that to get control over own arguments
2493 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
2494 src/insets/insetminipage.[Ch]:
2497 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2499 * src/lyxfunc.C (Dispatch): cases for new insets/commands
2501 * src/Makefile.am (lyx_SOURCES): add the new files
2503 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
2504 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
2505 * src/commandtags.h: ditto
2507 * src/LaTeXFeatures.h: add a std::set of used floattypes
2509 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
2511 * src/FloatList.[Ch] src/Floating.h: new files
2513 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
2515 * src/lyx_cb.C (TableApplyCB): ditto
2517 * src/text2.C: ditto
2518 * src/buffer.C (SimpleLinuxDocOnePar): ditto
2519 (parseSingleLyXformat2Token): ditto + add code for
2520 backwards compability for old float styles + add code for new insets
2522 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
2524 (InsertInset(size_type, Inset *, LyXFont)): new method
2525 (InsetChar(size_type, char)): changed to use the other InsetChar
2526 with a LyXFont(ALL_INHERIT).
2527 (InsetInset(size_type, Inset*)): changed to use InsetChar to
2528 insert the META_INSET.
2530 * sigc++/thread.cc (Privete<int>::operator int&): move definition
2532 * sigc++/thread.h (Threads): from here
2534 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
2535 definition out of line
2536 * sigc++/scope.h: from here
2538 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2540 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
2541 is specified (adapted from a patch from edscott <edscott@imp.mx>).
2543 * Makefile.am (bindist): new target.
2545 * INSTALL: add instructions for doing a binary distribution.
2547 * development/tools/README.bin.example: update a bit.
2549 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
2552 * lib/lyxrc.example: new lyxrc tag \set_color.
2554 * src/lyxfunc.C (Dispatch):
2555 * src/commandtags.h:
2556 * src/LyXAction.C: new lyxfunc "set-color".
2558 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
2559 and an x11name given as strings.
2561 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
2562 cache when a color is changed.
2564 2000-06-26 Juergen Vigna <jug@sad.it>
2566 * src/lyxrow.C (width): added this functions and variable.
2568 * src/insets/insetcite.C (create_form_citation_form): some Gravity
2571 * src/text.C (SetHeightOfRow): fixed calcualting of width.
2573 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2575 * images/undo_bw.xpm: new icon.
2576 * images/redo_bw.xpm: ditto.
2578 * configure.in (INSTALL_SCRIPT): change value to
2579 ${INSTALL} to avoid failures of install-script target.
2580 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
2582 * src/BufferView.h: add a magic "friend" declaration to please
2585 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
2587 * forms/cite.fd: modified to allow resizing without messing
2590 * src/insetcite.C: Uses code from cite.fd almost without
2592 User can now resize dialog in the x-direction.
2593 Resizing the dialog in the y-direction is prevented, as the
2594 code does this intelligently already.
2596 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2598 * INSTALL: remove obsolete entry in "problems" section.
2600 * lib/examples/sl_*.lyx: update of the slovenian examples.
2602 * src/support/FileInfo.[Ch] (getBlockSize): remove.
2604 2000-06-23 Juergen Vigna <jug@sad.it>
2606 * src/lyxtext.h: added a 'cleared' flag to draw() function.
2608 * src/buffer.C (resize): delete the LyXText of textinsets.
2610 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
2612 * src/insets/lyxinset.h: added another parameter 'cleared' to
2613 the draw() function.
2615 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
2616 unlocking inset in inset.
2618 2000-06-22 Juergen Vigna <jug@sad.it>
2620 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
2621 of insets and moved first to LyXText.
2623 * src/mathed/formulamacro.[Ch]:
2624 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
2626 2000-06-21 Juergen Vigna <jug@sad.it>
2628 * src/text.C (GetVisibleRow): look if I should clear the area or not
2629 using Inset::doClearArea() function.
2631 * src/insets/lyxinset.h: added doClearArea() function and
2632 modified draw(Painter &, ...) to draw(BufferView *, ...)
2634 * src/text2.C (UpdateInset): return bool insted of int
2636 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
2638 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
2639 combox in the character popup
2641 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
2642 BufferParams const & params
2644 2000-06-20 Juergen Vigna <jug@sad.it>
2646 * src/insets/insettext.C (SetParagraphData): set insetowner on
2649 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2651 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
2652 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
2654 (form_main_): remove
2656 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
2657 (create_form_form_main): remove FD_form_main stuff, connect to
2658 autosave_timeout signal
2660 * src/LyXView.[Ch] (getMainForm): remove
2661 (UpdateTimerCB): remove
2662 * src/BufferView_pimpl.h: inherit from SigC::Object
2664 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
2665 signal instead of callback
2667 * src/BufferView.[Ch] (cursorToggleCB): remove
2669 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2671 * src/BufferView_pimpl.C: changes because of the one below
2673 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
2674 instead of storing a pointer to a LyXText.
2676 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
2678 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
2680 * src/lyxparagraph.h
2682 * src/paragraph.C: Changed fontlist to a sorted vector.
2684 2000-06-19 Juergen Vigna <jug@sad.it>
2686 * src/BufferView.h: added screen() function.
2688 * src/insets/insettext.C (LocalDispatch): some selection code
2691 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
2693 * src/insets/insettext.C (SetParagraphData):
2695 (InsetText): fixes for multiple paragraphs.
2697 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
2699 * development/lyx.spec.in: Call configure with ``--without-warnings''
2700 to work around a bug with the Makefiles when doing ``make lyxrpm''.
2701 This should be fine, however, since we generally don't want to be
2702 verbose when making an RPM.
2704 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
2706 * lib/scripts/fig2pstex.py: New file
2708 2000-06-16 Juergen Vigna <jug@sad.it>
2710 * src/insets/insettabular.C (UpdateLocal):
2711 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
2712 (LocalDispatch): Changed all functions to use LyXText.
2714 2000-06-15 Juergen Vigna <jug@sad.it>
2716 * src/text.C (SetHeightOfRow): call inset::update before requesting
2719 * src/insets/insettext.C (update):
2720 * src/insets/insettabular.C (update): added implementation
2722 * src/insets/lyxinset.h: added update function
2724 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2726 * src/text.C (SelectNextWord): protect against null pointers with
2727 old-style string streams. (fix from Paul Theo Gonciari
2730 * src/cite.[Ch]: remove erroneous files.
2732 * lib/configure.m4: update the list of created directories.
2734 * src/lyxrow.C: include <config.h>
2735 * src/lyxcursor.C: ditto.
2737 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2739 * lib/examples/decimal.lyx: new example file from Mike.
2741 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
2742 to find template definitions (from Dekel)
2744 * src/frontends/.cvsignore: add a few things.
2746 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
2748 * src/Timeout.C (TimeOut): remove default argument.
2750 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
2753 * src/insets/ExternalTemplate.C: add a "using" directive.
2755 * src/lyx_main.h: remove the act_ struct, which seems unused
2758 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2760 * LyX Developers Meeting: All files changed, due to random C++ (by
2761 coincidence) code generator script.
2763 - external inset (cool!)
2764 - initial online editing of preferences
2765 - insettabular breaks insettext(s contents)
2767 - some DocBook fixes
2768 - example files update
2769 - other cool stuff, create a diff and look for yourself.
2771 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
2773 * src/insets/insettext.C (computeTextRows): if the maxWidth is
2774 -1 this is a non-line-breaking textinset.
2776 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
2777 if there is no width set.
2779 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
2781 * Lots of files: Merged the dialogbase branch.
2783 2000-06-09 Allan Rae <rae@lyx.org>
2785 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
2786 and the Dispatch methods that used it.
2788 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
2789 access to functions formerly kept in Dispatch.
2791 2000-05-19 Allan Rae <rae@lyx.org>
2793 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
2794 made to_page and count_copies integers again. from_page remains a
2795 string however because I want to allow entry of a print range like
2796 "1,4,22-25" using this field.
2798 * src/LyXAction.C: added action info and commands for buffer-print-xtl
2799 and printer-params-get. These aren't useful from the minibuffer but
2800 could be used by a script/LyXServer app provided it passes a suitable
2801 auto_mem_buffer. I guess I should take a look at how the LyXServer
2802 works and make it support xtl buffers.
2804 * sigc++/: updated to libsigc++-1.0.1
2806 * src/xtl/: updated to xtl-1.3.pl.11
2808 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
2809 those changes done to the files in src/ are actually recreated when
2810 they get regenerated. Please don't ever accept a patch that changes a
2811 dialog unless that patch includes the changes to the corresponding *.fd
2814 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
2815 stringOnlyContains, renamed it and generalised it.
2817 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
2818 branch. Removed the remaining old form_print code.
2820 2000-04-26 Allan Rae <rae@lyx.org>
2822 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
2823 trap I was trying to fix with the ID: fields in src/xtl/ :-)
2825 2000-04-25 Allan Rae <rae@lyx.org>
2827 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
2828 against a base of xtl-1.3.pl.4
2830 * development/tools/lxtl.sh: fixed a couple of silly typos and now
2831 filter the Id: entries so they still show the xtl version number
2834 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
2835 into the src/xtl code. Patch still pending with José (XTL)
2837 2000-04-24 Allan Rae <rae@lyx.org>
2839 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
2840 both more generic and much safer. Use the new template functions.
2841 * src/buffer.[Ch] (Dispatch): ditto.
2843 * src/frontends/xforms/FormPrint.C (update): Use new template functions
2844 and mem buffer more intelligently. Also a little general cleanup.
2847 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
2848 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
2849 * src/xtl/Makefile.am: ditto.
2850 * src/xtl/.cvsignore: ditto.
2851 * src/Makefile.am: ditto.
2853 * src/PrinterParams.h: Removed the macros member functions. Added a
2854 testInvariant member function. A bit of tidying up and commenting.
2855 Included Angus's idea for fixing operation with egcs-1.1.2.
2857 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
2858 cool expansion of XTL's mem_buffer to support automatic memory
2859 management within the buffer itself. Removed the various macros and
2860 replaced them with template functions that use either auto_mem_buffer
2861 or mem_buffer depending on a #define. The mem_buffer support will
2862 disappear as soon as the auto_mem_buffer is confirmed to be good on
2863 other platforms/compilers. That is, it's there so you've got something
2866 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
2867 effectively forked XTL. However I expect José will include my code
2868 into the next major release. Also fixed a memory leak.
2869 * src/xtl/text.h: ditto.
2870 * src/xtl/xdr.h: ditto.
2871 * src/xtl/giop.h: ditto.
2873 2000-04-16 Allan Rae <rae@lyx.org>
2875 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
2876 by autogen.sh and removed by maintainer-clean anyway.
2877 * .cvsignore, sigc++/.cvsignore: Support the above.
2879 * sigc++/.cvsignore: Forgot that retbind.h was generated.
2881 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
2883 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
2884 macros, renamed static callback-target member functions to suit new
2885 scheme and made them public.
2886 * src/frontends/xforms/forms/form_print.fd: ditto.
2887 * src/frontends/xforms/forms/form_copyright.fd: ditto.
2889 * src/support/lxtl.h: small cleanup to use typedef instead of #define
2892 * src/xtl/: New directory containing a minimal distribution of XTL.
2893 This is XTL-1.3.pl.4.
2895 * development/tools/lxtl.sh: A script to generate the above mini-dist.
2897 2000-04-15 Allan Rae <rae@lyx.org>
2899 * development/tools/makeLyXsigc.sh: Remove the library version numbers
2901 * sigc++/: Updated to libsigc++-1.0.0
2903 2000-04-14 Allan Rae <rae@lyx.org>
2905 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
2906 use the generic ones in future. I'll modify my conversion script.
2908 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
2910 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
2911 (CloseAllBufferRelatedDialogs): Renamed.
2912 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
2914 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
2915 of the generic ones. These are the same ones my conversion script
2918 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
2919 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
2920 * src/buffer.C (Dispatch): ditto
2922 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
2923 functions for updating and hiding buffer dependent dialogs.
2924 * src/BufferView.C (buffer): ditto
2925 * src/buffer.C (setReadonly): ditto
2926 * src/lyxfunc.C (CloseBuffer): ditto
2928 * src/buffer.h: Take setReadonly() out of line so I don't have to include
2929 Dialogs.h, and hence all the SigC stuff, into every file that includes
2930 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
2932 * src/BufferView2.C: reduce the number of headers included by buffer.h
2934 2000-04-11 Allan Rae <rae@lyx.org>
2936 * src/frontends/xforms/xform_macros.h: A small collection of macros
2937 for building C callbacks.
2939 * src/frontends/xforms/Makefile.am: Added above file.
2941 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
2942 scheme again. This time it should work for JMarc. If this is
2943 successful I'll revise my conversion script to automate some of this.
2944 The static member functions in the class also have to be public for
2945 this scheme will work. If the scheme works (it's almost identical to
2946 the way BufferView::cursorToggleCB is handled so it should work) then
2947 FormCopyright and FormPrint will be ready for inclusion into the main
2948 trunk immediately after 1.1.5 is released -- provided we're prepared
2949 for complaints about lame compilers not handling XTL.
2951 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
2953 2000-04-07 Allan Rae <rae@lyx.org>
2955 * config/lyxinclude.m4: A bit more tidying up (Angus)
2957 * src/LString.h: JMarc's <string> header fix
2959 * src/PrinterParams.h: Used string for most data to remove some
2960 ugly code in the Print dialog and avoid even uglier code when
2961 appending the ints to a string for output.
2963 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
2964 and moved "default:" back to the end of switch statement. Cleaned
2965 up the printing so it uses the right function calls and so the
2966 "print to file" option actually puts the file in the right directory.
2968 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
2970 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
2971 and Ok+Apply button control into a separate method: input (Angus).
2972 (input) Cleaned it up and improved it to be very thorough now.
2973 (All CB) static_cast used instead of C style cast (Angus). This will
2974 probably change again once we've worked out how to keep gcc-2.8.1 happy
2975 with real C callbacks.
2976 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
2977 ignore some of the bool settings and has random numbers instead. Needs
2978 some more investigation. Added other input length checks and checking
2979 of file and printer names.
2981 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
2982 would link (Angus). Seems the old code doesn't compile with the pragma
2983 statement either. Separated callback entries from internal methods.
2985 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
2987 2000-03-17 Allan Rae <rae@lyx.org>
2989 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
2990 need it? Maybe it could go in Dialogs instead? I could make it a
2991 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
2992 values to get the bool return value.
2993 (Dispatch): New overloaded method for xtl support.
2995 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
2996 extern "C" callback instead of static member functions. Hopefully,
2997 JMarc will be able to compile this. I haven't changed
2998 forms/form_copyright.fd yet. Breaking one of my own rules already.
3000 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
3001 because they aren't useful from the minibuffer. Maybe a LyXServer
3002 might want a help message though?
3004 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
3006 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
3007 xtl which needs both rtti and exceptions.
3009 * src/support/Makefile.am:
3010 * src/support/lxtl.h: New file. Some helper macros for using XTL.
3012 * src/frontends/xforms/input_validators.[ch]: input filters and
3013 validators. These conrol what keys are valid in input boxes.
3014 Use them and write some more. Much better idea than waiting till
3015 after the user has pressed Ok to say that the input fields don't make
3018 * src/frontends/xforms/Makefile.am:
3019 * src/frontends/xforms/forms/form_print.fd:
3020 * src/frontends/xforms/forms/makefile:
3021 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
3022 new scheme. Still have to make sure I haven't missed anything from
3023 the current implementation.
3025 * src/Makefile.am, src/PrinterParams.h: New data store.
3027 * other files: Added a couple of copyright notices.
3029 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3031 * src/insets/insetbib.h: move Holder struct in public space.
3033 * src/frontends/include/DialogBase.h: use SigC:: only when
3034 SIGC_CXX_NAMESPACES is defined.
3035 * src/frontends/include/Dialogs.h: ditto.
3037 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
3039 * src/frontends/xforms/FormCopyright.[Ch]: do not
3040 mention SigC:: explicitely.
3042 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3044 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
3045 deals with testing KDE in main configure.in
3046 * configure.in: ditto.
3048 2000-02-22 Allan Rae <rae@lyx.org>
3050 * Lots of files: Merged from HEAD
3052 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
3053 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
3055 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
3057 * sigc++/: new minidist.
3059 2000-02-14 Allan Rae <rae@lyx.org>
3061 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
3063 2000-02-08 Juergen Vigna <jug@sad.it>
3065 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
3066 file for the buildin GUI builder of KDevelop of the copyright-dialog.
3068 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
3069 for this port and so it is much easier for other people to port
3070 dialogs in a common development environment.
3072 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
3073 the QT/KDE implementation.
3075 * src/frontends/kde/Dialogs.C:
3076 * src/frontends/kde/FormCopyright.C:
3077 * src/frontends/kde/FormCopyright.h:
3078 * src/frontends/kde/Makefile.am:
3079 * src/frontends/kde/formcopyrightdialog.C:
3080 * src/frontends/kde/formcopyrightdialog.h:
3081 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
3082 for the kde support of the Copyright-Dialog.
3084 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3085 subdir-substitution instead of hardcoded 'xforms' as we now have also
3088 * src/frontends/include/DialogBase.h (Object): just commented the
3089 label after #endif (nasty warning and I don't like warnings ;)
3091 * src/main.C (main): added KApplication initialization if using
3094 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
3095 For now only the KDE event-loop is added if frontend==kde.
3097 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
3099 * configure.in: added support for the --with-frontend[=value] option
3101 * autogen.sh: added kde.m4 file to list of config-files
3103 * acconfig.h: added define for KDEGUI-support
3105 * config/kde.m4: added configuration functions for KDE-port
3107 * config/lyxinclude.m4: added --with-frontend[=value] option with
3108 support for xforms and KDE.
3110 2000-02-08 Allan Rae <rae@lyx.org>
3112 * all Makefile.am: Fixed up so the make targets dist, distclean,
3113 install and uninstall all work even if builddir != srcdir. Still
3114 have a new sigc++ minidist update to come.
3116 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
3118 2000-02-01 Allan Rae <rae@lyx.org>
3120 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
3121 Many mods to get builddir != srcdir working.
3123 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
3124 for building on NT and so we can do the builddir != srcdir stuff.
3126 2000-01-30 Allan Rae <rae@lyx.org>
3128 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
3129 This will stay in "rae" branch. We probably don't really need it in
3130 the main trunk as anyone who wants to help programming it should get
3131 a full library installed also. So they can check both included and
3132 system supplied library compilation.
3134 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
3135 Added a 'mini' distribution of libsigc++. If you feel the urge to
3136 change something in these directories - Resist it. If you can't
3137 resist the urge then you should modify the following script and rebuild
3138 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
3139 all happen. Still uses a hacked version of libsigc++'s configure.in.
3140 I'm quite happy with the results. I'm not sure the extra work to turn
3141 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
3142 worth the trouble and would probably lead to extra maintenance
3144 I haven't tested the following important make targets: install, dist.
3145 Not ready for prime time but very close. Maybe 1.1.5.
3147 * development/tools/makeLyXsigc.sh: A shell script to automatically
3148 generate our mini-dist of libsigc++. It can only be used with a CVS
3149 checkout of libsigc++ not a tarball distribution. It's well commented.
3150 This will end up as part of the libsigc++ distribution so other apps
3151 can easily have an included mini-dist. If someone makes mods to the
3152 sigc++ subpackage without modifying this script to generate those
3153 changes I'll be very upset!
3155 * src/frontends/: Started the gui/system indep structure.
3157 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
3158 to access the gui-indep dialogs are in this class. Much improved
3159 design compared to previous revision. Lars, please refrain from
3160 moving this header into src/ like you did with Popups.h last time.
3162 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
3164 * src/frontends/xforms/: Started the gui-indep system with a single
3165 dialog: FormCopyright. Initial testing of use of libsigc++ was very
3168 * src/frontends/xforms/forms: Repository for the xforms .fd files.
3169 Here you'll find a very useful makefile and automated fdfix.sh that
3170 makes updating dailogs a no-brainer -- provided you follow the rules
3171 set out in the README. I'm thinking about adding another script to
3172 automatically generate skeleton code for a new dialog given just the
3175 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
3176 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
3177 Made FormCopyright gui-indep and added a lyxfunc to get to it.
3179 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
3181 * src/support/LSubstring.C (operator): simplify
3183 * src/lyxtext.h: removed bparams, use buffer_->params instead
3185 * src/lyxrow.h: make Row a real class, move all variables to
3186 private and use accessors.
3188 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
3190 (isRightToLeftPar): ditto
3191 (ChangeLanguage): ditto
3192 (isMultiLingual): ditto
3195 (SimpleTeXOnePar): ditto
3196 (TeXEnvironment): ditto
3197 (GetEndLabel): ditto
3199 (SetOnlyLayout): ditto
3200 (BreakParagraph): ditto
3201 (BreakParagraphConservative): ditto
3202 (GetFontSettings): ditto
3204 (CopyIntoMinibuffer): ditto
3205 (CutIntoMinibuffer): ditto
3206 (PasteParagraph): ditto
3207 (SetPExtraType): ditto
3208 (UnsetPExtraType): ditto
3209 (DocBookContTableRows): ditto
3210 (SimpleDocBookOneTablePar): ditto
3212 (TeXFootnote): ditto
3213 (SimpleTeXOneTablePar): ditto
3214 (TeXContTableRows): ditto
3215 (SimpleTeXSpecialChars): ditto
3218 * src/lyxcursor.h: make LyXCursor a real class, move all variables
3219 to private and use accessors.
3221 * src/lyx_cb.C: remove char updatetimer, and all code that uses
3222 this, we did not use it anymore and has not been for ages. Just a
3223 waste of cpu cycles.
3225 * src/language.h: make Language a real class, move all variables
3226 to private and use accessors.
3228 * src/BufferView_pimpl.C (Pimpl): use new timer code.
3229 (create_view): remove
3230 (update): some changes for new timer
3231 (cursorToggle): use new timer
3232 (beforeChange): change for new timer
3234 * src/BufferView.h (cursorToggleCB): removed last paramter because
3237 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
3238 (cursorToggleCB): change because of new timer code
3240 * lib/CREDITS: updated own mailaddress
3242 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3244 * src/support/filetools.C (PutEnv): fix the code in case neither
3245 putenv() nor setenv() have been found.
3247 * INSTALL: mention the install-strip Makefile target.
3249 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
3250 read-only documents.
3252 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3254 * lib/reLyX/configure.in (VERSION): avoid using a previously
3255 generated reLyX wrapper to find out $prefix.
3257 * lib/examples/eu_adibide_lyx-atua.lyx:
3258 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
3259 translation of the Tutorial (Dooteo)
3261 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
3263 * forms/cite.fd: new citation dialog
3265 * src/insetcite.[Ch]: the new citation dialog is moved into
3268 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
3271 * src/insets/insetcommand.h: data members made private.
3273 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3275 * LyX 1.1.5 released
3277 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3279 * src/version.h (LYX_RELEASE): to 1.1.5
3281 * src/spellchecker.C (RunSpellChecker): return false if the
3282 spellchecker dies upon creation.
3284 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3286 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
3287 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
3291 * lib/CREDITS: update entry for Martin Vermeer.
3293 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
3295 * src/text.C (draw): Draw foreign language bars at the bottom of
3296 the row instead of at the baseline.
3298 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
3300 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3302 * lib/bind/de_menus.bind: updated
3304 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3306 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
3308 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3310 * src/menus.C (Limit_string_length): New function
3311 (ShowTocMenu): Limit the number of items/length of items in the
3314 * src/paragraph.C (String): Correct result for a paragraph inside
3317 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3319 * src/bufferlist.C (close): test of buf->getuser() == NULL
3321 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
3323 * src/BufferView2.C (removeAutoInsets): Fix a bug:
3324 Do not call to SetCursor when the paragraph is a closed footnote!
3326 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
3328 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
3331 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
3333 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3336 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
3337 reference popup, that activates the reference-back action
3339 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
3341 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
3342 the menus. Also fixed a bug.
3344 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
3345 the math panels when switching buffers (unless new buffer is readonly).
3347 * src/BufferView.C (NoSavedPositions)
3348 * src/BufferView_pimpl.C (NoSavedPositions): New methods
3350 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3352 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
3353 less of dvi dirty or not.
3355 * src/trans_mgr.[Ch] (insert): change first parameter to string
3358 * src/chset.[Ch] (encodeString): add const to first parameter
3360 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3362 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
3366 * src/LaTeX.C (deplog): better searching for dependency files in
3367 the latex log. Uses now regexps.
3369 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
3370 instead of the box hack or \hfill.
3372 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3374 * src/lyxfunc.C (doImportHelper): do not create the file before
3375 doing the actual import.
3376 (doImportASCIIasLines): create a new file before doing the insert.
3377 (doImportASCIIasParagraphs): ditto.
3379 * lib/lyxrc.example: remove mention of non-existing commands
3381 * lyx.man: remove mention of color-related switches.
3383 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
3385 * src/lyx_gui.C: remove all the color-related ressources, which
3386 are not used anymore.
3388 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
3391 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3393 * src/lyxrc.C (read): Add a missing break in the switch
3395 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
3397 * src/text2.C (InsertStringA): Fix a bug with insertion into table
3399 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
3402 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3404 * src/text.C (draw): draw bars under foreign language words.
3406 * src/LColor.[Ch]: add LColor::language
3408 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3410 * src/lyxcursor.h (boundary): New member variable
3412 * src/text.C (IsBoundary): New methods
3414 * src/text.C: Use the above for currect cursor movement when there
3415 is both RTL & LTR text.
3417 * src/text2.C: ditto
3419 * src/bufferview_funcs.C (ToggleAndShow): ditto
3421 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3423 * src/text.C (DeleteLineForward): set selection to true to avoid
3424 that DeleteEmptyParagraphMechanism does some magic. This is how it
3425 is done in all other functions, and seems reasonable.
3426 (DeleteWordForward): do not jump over non-word stuff, since
3427 CursorRightOneWord() already does it.
3429 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
3430 DeleteWordBackward, since they seem safe to me (since selection is
3431 set to "true") DeleteEmptyParagraphMechanism does nothing.
3433 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3435 * src/lyx_main.C (easyParse): simplify the code by factoring the
3436 part that removes parameters from the command line.
3437 (LyX): check wether wrong command line options have been given.
3439 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
3441 * src/lyx_main.C : add support for specifying user LyX
3442 directory via command line option -userdir.
3444 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
3446 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
3447 the number of items per popup.
3448 (Add_to_refs_menu): Ditto.
3450 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3452 * src/lyxparagraph.h: renamed ClearParagraph() to
3453 StripLeadingSpaces() and moved it to paragraph.C. We pass the
3454 textclass as parameter, and do nothing if free_spacing is
3455 true. This fixes part of the line-delete-forward problems.
3457 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
3458 (pasteSelection): ditto.
3459 (SwitchLayoutsBetweenClasses): more translatable strings.
3461 * src/text2.C (CutSelection): use StripLeadingSpaces.
3462 (PasteSelection): ditto.
3463 (DeleteEmptyParagraphMechanism): ditto.
3465 2000-05-26 Juergen Vigna <jug@sad.it>
3467 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
3468 is not needed in tabular insets.
3470 * src/insets/insettabular.C (TabularFeatures): added missing features.
3472 * src/tabular.C (DeleteColumn):
3474 (AppendRow): implemented this functions
3475 (cellsturct::operator=): clone the inset too;
3477 2000-05-23 Juergen Vigna <jug@sad.it>
3479 * src/insets/insettabular.C (LocalDispatch): better selection support
3480 when having multicolumn-cells.
3482 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3484 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
3486 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3488 * src/ColorHandler.C (getGCForeground): put more test into _()
3490 * lib/examples/eu_splash.lyx: new file (Basque translation) from
3493 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
3496 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
3498 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
3499 there are no labels, or when buffer is readonly.
3501 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
3502 there are no labels, buffer is SGML, or when buffer is readonly.
3504 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3506 * src/LColor.C (LColor): change a couple of grey40 to grey60
3507 (LColor): rewore initalization to make compiles go some magnitude
3509 (getGUIName): don't use gettext until we need the string.
3511 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
3513 * src/Bullet.[Ch]: Fixed a small bug.
3515 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
3517 * src/paragraph.C (String): Several fixes/improvements
3519 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
3521 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3523 * src/paragraph.C (String): give more correct output.
3525 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
3527 * src/lyxfont.C (stateText) Do not output the language if it is
3528 eqaul to the language of the document.
3530 * src/paragraph.C (TeXOnePar): Do not put language switch commands
3531 between two paragraphs with the same language.
3533 * src/paragraph.C (getParLanguage) Return a correct answer for an
3534 empty dummy paragraph.
3536 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
3539 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
3542 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
3543 the menus/popup, if requested fonts are unavailable.
3545 2000-05-22 Juergen Vigna <jug@sad.it>
3547 * src/insets/insettabular.C (LocalDispatch): added some more cursor
3548 movement support (Up/Down/Tab/Shift-Tab).
3549 (LocalDispatch): added also preliminari cursor-selection.
3551 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
3553 * src/paragraph.C (PasteParagraph): Hopefully now right!
3555 2000-05-22 Garst R. Reese <reese@isn.net>
3557 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
3558 of list, change all references to Environment to Command
3559 * tex/hollywood.cls : rewrite environments as commands, add
3560 \uppercase to interiorshot and exteriorshot to force uppecase.
3561 * tex/broadway.cls : rewrite environments as commands. Tweak
3564 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3566 * src/menus.C (Add_to_toc_menu): fix the code which limits the
3567 size of items: use a constant intead of the hardcoded 40, and more
3568 importantly do not remove the %m and %x tags added at the end.
3569 (Add_to_refs_menu): use vector::size_type instead of
3570 unsigned int as basic types for the variables. _Please_ do not
3571 assume that size_t is equal to unsigned int. On an alpha, this is
3572 unsigned long, which is _not_ the same.
3574 * src/language.C (initL): remove language "hungarian", since it
3575 seems that "magyar" is better.
3577 2000-05-22 Juergen Vigna <jug@sad.it>
3579 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
3581 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
3584 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
3585 next was deleted but not set to 0.
3587 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3589 * src/language.C (initL): change the initialization of languages
3590 so that compiles goes _fast_.
3592 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
3595 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
3597 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3601 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3603 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
3605 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
3609 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
3612 * src/insets/insetlo*.[Ch]: Made editable
3614 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3616 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
3617 the current selection.
3619 * src/BufferView_pimpl.C (stuffClipboard): new method
3621 * src/BufferView.C (stuffClipboard): new method
3623 * src/paragraph.C (String): new method
3625 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
3626 LColor::ignore when lyxname is not found.
3628 * src/BufferView.C (pasteSelection): new method
3630 * src/BufferView_pimpl.C (pasteSelection): new method
3632 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
3634 * src/WorkArea.C (request_clipboard_cb): new static function
3635 (getClipboard): new method
3636 (putClipboard): new method
3638 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3640 * LyX 1.1.5pre2 released
3642 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3644 * src/vspace.C (operator=): removed
3645 (operator=): removed
3647 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
3649 * src/layout.C (NumberOfClass): manually set the type in make_pair
3650 (NumberOfLayout): ditto
3652 * src/language.C: use the Language constructor for ignore_lang
3654 * src/language.h: add constructors to struct Language
3656 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
3658 * src/text2.C (SetCursorIntern): comment out #warning
3660 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
3662 * src/mathed/math_iter.h: initialize sx and sw to 0
3664 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3666 * forms/lyx.fd: Redesign of form_ref
3668 * src/LaTeXFeatures.[Ch]
3672 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
3675 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
3676 and Buffer::inset_iterator.
3678 * src/menus.C: Added new menus: TOC and Refs.
3680 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
3682 * src/buffer.C (getTocList): New method.
3684 * src/BufferView2.C (ChangeRefs): New method.
3686 * src/buffer.C (getLabelList): New method. It replaces the old
3687 getReferenceList. The return type is vector<string> instead of
3690 * src/insets/insetinclude.C (getLabelList): New method. Replaces
3691 the old getLabel() and GetNumberOfLabels() methods.
3692 * src/insets/insetlabel.C (getLabelList): ditto
3693 * src/mathed/formula.C (getLabelList): ditto
3695 * src/paragraph.C (String): New method.
3697 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
3698 Uses the new getTocList() method.
3699 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
3700 which automatically updates the contents of the browser.
3701 (RefUpdateCB): Use the new getLabelList method.
3703 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
3705 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
3707 * src/spellchecker.C: Added using std::reverse;
3709 2000-05-19 Juergen Vigna <jug@sad.it>
3711 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
3713 * src/insets/insettext.C (computeTextRows): small fix for display of
3714 1 character after a newline.
3716 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
3719 2000-05-18 Juergen Vigna <jug@sad.it>
3721 * src/insets/insettabular.C (TabularFeatures): fixed update of display
3722 when changing width of column.
3724 * src/tabular.C (set_row_column_number_info): setting of
3725 autobreak rows if necessary.
3727 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3729 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
3731 * src/vc-backend.*: renamed stat() to status() and vcstat to
3732 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
3733 compilation broke. The new name seems more relevant, anyway.
3735 2000-05-17 Juergen Vigna <jug@sad.it>
3737 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
3738 which was wrong if the removing caused removing of rows!
3740 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
3741 (pushToken): new function.
3743 * src/text2.C (CutSelection): fix problem discovered with purify
3745 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3747 * src/debug.C (showTags): enlarge the first column, now that we
3748 have 6-digits debug codes.
3750 * lib/layouts/hollywood.layout:
3751 * lib/tex/hollywood.cls:
3752 * lib/tex/brodway.cls:
3753 * lib/layouts/brodway.layout: more commands and fewer
3754 environments. Preambles moved in the .cls files. Broadway now has
3755 more options on scene numbering and less whitespace (from Garst)
3757 * src/insets/insetbib.C (getKeys): make sure that we are in the
3758 document directory, in case the bib file is there.
3760 * src/insets/insetbib.C (Latex): revert bogus change.
3762 2000-05-16 Juergen Vigna <jug@sad.it>
3764 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
3765 the TabularLayout on cursor move.
3767 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
3769 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
3772 (draw): fixed cursor position and drawing so that the cursor is
3773 visible when before the tabular-inset.
3775 * src/insets/insettext.C (init): drawLockedFrame was not initialized
3776 when creating from old insettext.
3778 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
3780 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3782 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
3783 * lib/tex/brodway.cls: ditto
3785 * lib/layouts/brodway.layout: change alignment of parenthical
3788 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3790 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
3791 versions 0.88 and 0.89 are supported.
3793 2000-05-15 Juergen Vigna <jug@sad.it>
3795 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
3798 * src/insets/insettext.C (computeTextRows): redone completely this
3799 function in a much cleaner way, because of problems when having a
3801 (draw): added a frame border when the inset is locked.
3802 (SetDrawLockedFrame): this sets if we draw the border or not.
3803 (SetFrameColor): this sets the frame color (default=insetframe).
3805 * src/insets/lyxinset.h: added x() and y() functions which return
3806 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
3807 function which is needed to see if we have a locking inset of some
3808 type in this inset (needed for now in insettabular).
3810 * src/vspace.C (inPixels): the same function also without a BufferView
3811 parameter as so it is easier to use it in some ocasions.
3813 * src/lyxfunc.C: changed all places where insertInset was used so
3814 that now if it couldn't be inserted it is deleted!
3816 * src/TabularLayout.C:
3817 * src/TableLayout.C: added support for new tabular-inset!
3819 * src/BufferView2.C (insertInset): this now returns a bool if the
3820 inset was really inserted!!!
3822 * src/tabular.C (GetLastCellInRow):
3823 (GetFirstCellInRow): new helper functions.
3824 (Latex): implemented for new tabular class.
3828 (TeXTopHLine): new Latex() helper functions.
3830 2000-05-12 Juergen Vigna <jug@sad.it>
3832 * src/mathed/formulamacro.C (Read):
3833 * src/mathed/formula.C (Read): read also the \end_inset here!
3835 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3837 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
3838 crush when saving formulae with unbalanced parenthesis.
3840 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
3842 * src/layout.C: Add new keyword "endlabelstring" to layout file
3844 * src/text.C (GetVisibleRow): Draw endlabel string.
3846 * lib/layouts/broadway.layout
3847 * lib/layouts/hollywood.layout: Added endlabel for the
3848 Parenthetical layout.
3850 * lib/layouts/heb-article.layout: Do not use slanted font shape
3851 for Theorem like environments.
3853 * src/buffer.C (makeLaTeXFile): Always add "american" to
3854 the UsedLanguages list if document language is RTL.
3856 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3858 * add addendum to README.OS2 and small patch (from SMiyata)
3860 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3862 * many files: correct the calls to ChangeExtension().
3864 * src/support/filetools.C (ChangeExtension): remove the no_path
3865 argument, which does not belong there. Use OnlyFileName() instead.
3867 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
3868 files when LaTeXing a non-nice latex file.
3870 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
3871 a chain of "if". Return false when deadkeys are not handled.
3873 * src/lyx_main.C (LyX): adapted the code for default bindings.
3875 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
3876 bindings for basic functionality (except deadkeys).
3877 (deadKeyBindings): new method. Performs the bindings of deadkeys.
3879 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
3880 several methods: handle override_x_deadkeys.
3882 * src/lyxrc.h: remove the "bindings" map, which did not make much
3883 sense anyway. New variable override_x_deadkeys, defaulting to "true".
3885 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3887 * src/lyxfont.C (stateText): use a saner method to determine
3888 whether the font is "default". Seems to fix the crash with DEC
3891 * src/Bullet.[Ch] (Bullet): remove const on parameters.
3893 2000-05-08 Juergen Vigna <jug@sad.it>
3895 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
3896 TabularLayoutMenu with mouse-button-3
3897 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
3899 * src/TabularLayout.C: added this file for having a Layout for
3902 2000-05-05 Juergen Vigna <jug@sad.it>
3904 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
3905 recalculating inset-widths.
3906 (TabularFeatures): activated this function so that I can change
3907 tabular-features via menu.
3909 * src/menus.C (ShowEditMenu): inserted support for insettabular so
3910 that I can test some functions with the Table menu.
3912 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3914 * src/lyxfont.C (stateText): guard against stupid c++libs.
3916 * src/tabular.C: add using std::vector
3917 some whitespace changes, + removed som autogenerated code.
3919 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
3921 2000-05-05 Juergen Vigna <jug@sad.it>
3923 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
3924 row, columns and cellstructures.
3926 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3928 * lib/lyxrc.example: remove obsolete entries.
3930 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
3931 reading of protected_separator for free_spacing.
3933 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3935 * src/text.C (draw): do not display an exclamation mark in the
3936 margin for margin notes. This is confusing, ugly and
3939 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
3940 AMS math' is checked.
3942 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
3943 name to see whether including the amsmath package is needed.
3945 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
3947 * src/paragraph.C (validate): Compute UsedLanguages correctly
3948 (don't insert the american language if it doesn't appear in the
3951 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
3952 The argument of \thanks{} command is considered moving argument
3954 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
3957 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
3959 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
3960 for appendix/minipage/depth. The lines can be now both in the footnote
3961 frame, and outside the frame.
3963 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
3966 2000-05-05 Juergen Vigna <jug@sad.it>
3968 * src/table.[Ch]: removed the inset and buffer stuff as this is now
3969 neede only in tabular.[Ch].
3971 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3973 * src/insets/insetspecialchar.C (Read): allow command == '~' for
3975 (Write): write '~' for PROTECTED_SEPARATOR
3977 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3979 * src/lyxparagraph.h: add a friend struct matchIT after the struct
3982 * src/mathed/formula.C (drawStr): rename size to siz.
3984 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
3985 possibly fix a bug by not changing the pflags = flags to piflags =
3988 2000-05-05 Juergen Vigna <jug@sad.it>
3990 * src/insets/insetbib.C: moved using directive
3992 * src/ImportNoweb.C: small fix for being able to compile (missing
3995 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3997 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
3998 to use clear, since we don't depend on this in the code. Add test
4001 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4003 * (various *.C files): add using std::foo directives to please dec
4006 * replace calls to string::clear() to string::erase() (Angus)
4008 * src/cheaders/cmath: modified to provide std::abs.
4010 2000-05-04 Juergen Vigna <jug@sad.it>
4012 * src/insets/insettext.C: Prepared all for inserting of multiple
4013 paragraphs. Still display stuff to do (alignment and other things),
4014 but I would like to use LyXText to do this when we cleaned out the
4015 table-support stuff.
4017 * src/insets/insettabular.C: Changed lot of stuff and added lots
4018 of functionality still a lot to do.
4020 * src/tabular.C: Various functions changed name and moved to be
4021 const functions. Added new Read and Write functions and changed
4022 lots of things so it works good with tabular-insets (also removed
4023 some stuff which is not needed anymore * hacks *).
4025 * src/lyxcursor.h: added operators == and != which just look if
4026 par and pos are (not) equal.
4028 * src/buffer.C (latexParagraphs): inserted this function to latex
4029 all paragraphs form par to endpar as then I can use this too for
4032 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
4033 so that I can call this to from text insets with their own cursor.
4035 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
4036 output off all paragraphs (because of the fix below)!
4038 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
4039 the very last paragraph (this could be also the last paragraph of an
4042 * src/texrow.h: added rows() call which returns the count-variable.
4044 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4046 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
4048 * lib/configure.m4: better autodetection of DocBook tools.
4050 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4052 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
4054 * src/lyx_cb.C: add using std::reverse;
4056 * src/LaTeX.C (run): on error always run deleteFilesOnError before
4059 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
4060 selected files. Should fix repeated errors from generated files.
4062 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
4064 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
4066 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
4067 the spellchecker popup.
4069 * lib/lyxrc.example: Removed the \number_inset section
4071 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4073 * src/insets/figinset.C (various): Use IsFileReadable() to make
4074 sure that the file actually exist. Relying on ghostscripts errors
4075 is a bad idea since they can lead to X server crashes.
4077 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
4079 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
4082 * lib/lyxrc.example: smallish typo in description of
4083 \view_dvi_paper_option
4085 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4088 * src/lyxfunc.C: doImportHelper to factor out common code of the
4089 various import methods. New functions doImportASCIIasLines,
4090 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
4091 doImportLinuxDoc for the format specific parts.
4094 * buffer.C: Dispatch returns now a bool to indicate success
4097 * lyx_gui.C: Add getLyXView() for member access
4099 * lyx_main.C: Change logic for batch commands: First try
4100 Buffer::Dispatch (possibly without GUI), if that fails, use
4103 * lyx_main.C: Add support for --import command line switch.
4104 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
4105 Available Formats: Everything accepted by 'buffer-import <format>'
4107 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4109 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
4112 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
4113 documents will be reformatted upon reentry.
4115 2000-04-27 Juergen Vigna <jug@sad.it>
4117 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
4118 correctly only last pos this was a bug.
4120 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4122 * release of lyx-1.1.5pre1
4124 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4126 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
4128 * src/menus.C: revert the change of naming (Figure->Graphic...)
4129 from 2000-04-11. It was incomplete and bad.
4131 * src/LColor.[Ch]: add LColor::depthbar.
4132 * src/text.C (GetVisibleRow): use it.
4134 * README: update the languages list.
4136 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4138 * src/text.C (GetVisibleRow): show the depth of paragraphs using
4141 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4143 * README: remove sections that were just wrong.
4145 * src/text2.C (GetRowNearY): remove currentrow code
4147 * src/text.C (GetRow): remove currentrow code
4149 * src/screen.C (Update): rewritten a bit.
4150 (SmallUpdate): removed func
4152 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
4154 (FullRebreak): return bool
4155 (currentrow): remove var
4156 (currentrow_y): ditto
4158 * src/lyxscreen.h (Draw): change arg to unsigned long
4159 (FitCursor): return bool
4160 (FitManualCursor): ditto
4161 (Smallpdate): remove func
4162 (first): change to unsigned long
4163 (DrawOneRow): change second arg to long (from long &)
4164 (screen_refresh_y): remove var
4165 (scree_refresh_row): ditto
4167 * src/lyxrow.h: change baseline to usigned int from unsigned
4168 short, this brings some implicit/unsigned issues out in the open.
4170 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
4172 (Dispatch): don't call updateScrollbar after fitCursor. Use update
4173 instead of smallUpdate.
4175 * src/lyxcursor.h: change y to unsigned long
4177 * src/buffer.h: don't call updateScrollbar after fitcursor
4179 * src/buffer.C (parseSingleLyXformat2Token): move variables to
4180 where they are used. Removed "\\direction", this was not present
4181 in 1.1.4 and is already obsolete. Commented out some code that I
4182 believe to never be called.
4183 (runLiterate): don't call updateScrollbar after fitCursor
4185 (buildProgram): ditto
4188 * src/WorkArea.h (workWidth): change return val to unsigned
4191 (redraw): remove the button redraws
4192 (setScrollbarValue): change for scrollbar
4193 (getScrollbarValue): change for scrollbar
4194 (getScrollbarBounds): change for scrollbar
4196 * src/WorkArea.C (C_WorkArea_up_cb): removed func
4197 (C_WorkArea_down_cb): removed func
4198 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
4199 (resize): change for scrollbar
4200 (setScrollbar): ditto
4201 (setScrollbarBounds): ditto
4202 (setScrollbarIncrements): ditto
4203 (up_cb): removed func
4204 (down_cb): removed func
4205 (scroll_cb): change for scrollbar
4206 (work_area_handler): ditto
4208 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
4209 when FitCursor did something.
4210 (updateScrollbar): some unsigned changes
4211 (downCB): removed func
4212 (scrollUpOnePage): removed func
4213 (scrollDownOnePage): remvoed func
4214 (workAreaMotionNotify): don't call screen->FitCursor but use
4215 fitCursor instead. and bool return val
4216 (workAreaButtonPress): ditto
4217 (workAreaButtonRelease): some unsigned changes
4218 (checkInsetHit): ditto
4219 (workAreaExpose): ditto
4220 (update): parts rewritten, comments about the signed char arg added
4221 (smallUpdate): removed func
4222 (cursorPrevious): call needed updateScrollbar
4225 * src/BufferView2.C (allFloats): don't call updateScrollbar after
4228 * src/BufferView.[Ch] (upCB): removed func
4229 (downCB): removed func
4230 (smallUpdate): removed func
4232 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4234 * src/lyxtext.h src/text.C src/text2.C: removed support for the
4235 currentrow, currentrow_y optimization. This did not help a lot and
4236 if we want to do this kind of optimization we should rather use
4237 cursor.row instead of the currentrow.
4239 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
4240 buffer spacing and klyx spacing support.
4242 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4244 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
4247 2000-04-26 Juergen Vigna <jug@sad.it>
4249 * src/insets/figinset.C: fixes to Lars sstream changes!
4251 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
4253 * A lot of files: Added Ascii(ostream &) methods to all inset
4254 classes. Used when exporting to ASCII.
4256 * src/buffer.C (writeFileAscii,RoffAsciiTable)
4257 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
4260 * src/text2.C (ToggleFree): Disabled implicit word selection when
4261 there is a change in the language
4263 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
4264 no output was generated for end-of-sentence inset.
4266 * src/insets/lyxinset.h
4269 * src/paragraph.C: Removed the insetnumber code
4271 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
4273 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4275 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
4276 no_babel and no_epsfig completely from the file.
4277 (parseSingleLyXformat2Token): add handling for per-paragraph
4278 spacing as written by klyx.
4280 * src/insets/figinset.C: applied patch by Andre. Made it work with
4283 2000-04-20 Juergen Vigna <jug@sad.it>
4285 * src/insets/insettext.C (cutSelection):
4286 (copySelection): Fixed with selection from right to left.
4287 (draw): now the rows are not recalculated at every draw.
4288 (computeTextRows): for now reset the inset-owner here (this is
4289 important for an undo or copy where the inset-owner is not set
4292 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
4293 motion to the_locking_inset screen->first was forgotten, this was
4294 not important till we got multiline insets.
4296 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4298 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
4299 code seems to be alright (it is code changed by Dekel, and the
4300 intent is indeed that all macros should be defined \protect'ed)
4302 * NEWS: a bit of reorganisation of the new user-visible features.
4304 2000-04-19 Juergen Vigna <jug@sad.it>
4306 * src/insets/insettext.C (init): using a LyXCursor now for cursor
4307 position. Set the inset_owner of the used paragraph so that it knows
4308 that it is inside an inset. Fixed cursor handling with mouse and
4309 cursor keys. Fixed wrong timed inset redraws and lots of other changes
4310 and cleanups to make TextInsets work better.
4312 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
4313 Changed parameters of various functions and added LockInsetInInset().
4315 * src/insets/insettext.C:
4317 * src/insets/insetcollapsable.h:
4318 * src/insets/insetcollapsable.C:
4319 * src/insets/insetfoot.h:
4320 * src/insets/insetfoot.C:
4321 * src/insets/insetert.h:
4322 * src/insets/insetert.C: cleaned up the code so that it works now
4323 correctly with insettext.
4325 * src/insets/inset.C:
4326 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
4327 that insets in insets are supported right.
4330 * src/table.C: lots of changes for use with inset tabular (and cleanup)
4332 * src/paragraph.C: some small fixes
4334 * src/debug.h: inserted INSETS debug info
4336 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
4337 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
4339 * src/commandtags.h:
4340 * src/LyXAction.C: insert code for InsetTabular.
4342 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
4343 not Button1MotionMask.
4344 (workAreaButtonRelease): send always a InsetButtonRelease event to
4346 (checkInsetHit): some setCursor fixes (always with insets).
4348 * src/BufferView2.C (lockInset): returns a bool now and extended for
4349 locking insets inside insets.
4350 (showLockedInsetCursor): it is important to have the cursor always
4351 before the locked inset.
4352 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
4354 * src/BufferView.h: made lockInset return a bool.
4356 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
4358 * src/text2.C (SetCursor): This now has a version with a LyXCursor
4359 that is used also internally but can be called as public to have back
4360 a cursor pos which is not set internally.
4361 (SetCursorIntern): Changed to use above function.
4363 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
4365 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4370 * NEWS: updated for prerelease of 1.1.5. Please comment and send
4371 patches for things that should be in or should be changed.
4373 * src/* [insetfiles]: change "usigned char fragile" to bool
4374 fragile. There was only one point that could that be questioned
4375 and that is commented in formulamacro.C. Grep for "CHECK".
4377 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
4378 (DeleteBuffer): take it out of CutAndPaste and make it static.
4380 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4382 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
4383 output the spacing envir commands. Also the new commands used in
4384 the LaTeX output makes the result better.
4386 * src/Spacing.C (writeEnvirBegin): new method
4387 (writeEnvirEnd): new method
4389 2000-04-18 Juergen Vigna <jug@sad.it>
4391 * src/CutAndPaste.C: made textclass a static member of the class
4392 as otherwise it is not accesed right!!!
4394 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
4396 * forms/layout_forms.fd
4397 * src/layout_forms.h
4398 * src/layout_forms.C (create_form_form_character)
4399 * src/lyx_cb.C (UserFreeFont)
4400 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
4401 documents (in the layout->character popup).
4403 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4405 * src/spellchecker.C (create_ispell_pipe): fix a bug where
4406 \spell_command was in fact not honored (from Kevin Atkinson).
4408 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
4411 * src/lyx_gui.h: make lyxViews private (Angus)
4413 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
4415 * src/mathed/math_write.C
4416 (MathMatrixInset::Write) Put \protect before \begin{array} and
4417 \end{array} if fragile
4418 (MathParInset::Write): Put \protect before \\ if fragile
4420 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4422 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
4423 initialization if the LyXColorHandler must be done after the
4424 connections to the XServer has been established.
4426 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
4427 get the background pixel from the lyxColorhandler so that the
4428 figures are rendered with the correct background color.
4429 (NextToken): removed functions.
4430 (GetPSSizes): use ifs >> string instead of NextToken.
4432 * src/Painter.[Ch]: the color cache moved out of this file.
4434 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
4437 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4439 * src/WorkArea.C (work_area_handler): call BufferView::enterView
4440 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
4442 * src/BufferView.C (enterView): new func
4443 (leaveView): new func
4445 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
4447 (leaveView): new func, undefines xterm cursor when approp.
4449 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
4450 (AllowInput): delete the Workarea cursor handling from this func.
4452 * src/Painter.C (underline): draw a slimer underline in most cases.
4454 * src/lyx_main.C (error_handler): use extern "C"
4456 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4458 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
4459 sent directly to me.
4461 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
4462 to the list by Dekel.
4464 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
4467 * src/bufferview_funcs.[Ch]: two new files, moved several of the
4468 methods from lyx_cb.here.
4470 * src/lyx_cb.C: in addition to the above; removed input_prohibited
4473 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4475 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
4476 instead of using current_view directly.
4478 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
4480 * src/LyXAction.C (init): add the paragraph-spacing command.
4482 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
4484 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
4486 * src/lyx_cb.C (CurrentState): output a string when the spacing is
4487 different from the documents.
4489 * src/text.C (SetHeightOfRow): take paragraph spacing into
4490 account, paragraph spacing takes precedence over buffer spacing
4491 (GetVisibleRow): ditto
4493 * src/paragraph.C (writeFile): output the spacing parameter too.
4494 (validate): set the correct features if spacing is used in the
4496 (Clear): set spacing to default
4497 (MakeSameLayout): spacing too
4498 (HasSameLayout): spacing too
4499 (SetLayout): spacing too
4500 (TeXOnePar): output the spacing commands
4502 * src/lyxparagraph.h: added a spacing variable for use with
4503 per-paragraph spacing.
4505 * src/Spacing.h: add a Default spacing and a method to check if
4506 the current spacing is default. also added an operator==
4508 * src/text2.C (DeleteEmptyParagraphMechanism): added a
4511 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4513 * src/lyxserver.C (callback): fix dispatch of functions
4515 * src/insets/insetlatexaccent.C (checkContents): turn bogus
4516 printf() into lyxerr call.
4518 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
4521 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
4522 "Table" to "Table Box", "Float" to "Floating Material"; deletes
4523 the "Float" from each of the subitems.
4524 (ShowHelpMenu): add entry for "FAQ" and "TOC".
4526 * src/support/DebugStream.h: add an #ifdef to work around a gcc
4527 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
4528 documented the change so that the workaround can be nuked later.
4530 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
4533 * src/lyxlex_pimpl.C (next): do not re-declare the default value
4535 * src/buffer.C (getLatexName): ditto
4536 (setReadonly): ditto
4538 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4540 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
4541 avoid some uses of current_view. Added also a bufferParams()
4542 method to get at this.
4544 * src/lyxtext.h: changed params->buffer and paramters->bparams.
4546 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4548 * src/lyxparagraph.[Ch]: removed
4549 operator<(LyXParagraph::InsetTable..., added a struct matchIT
4550 with operators used by lower_bound and
4551 upper_bound in InsetTable's
4552 Make struct InsetTable private again. Used matchpos.
4554 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
4556 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
4557 document, the language of existing text is changed (unless the
4558 document is multi-lingual)
4560 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
4562 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
4564 * A lot of files: A rewrite of the Right-to-Left support.
4566 2000-04-10 Juergen Vigna <jug@sad.it>
4568 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
4569 misplaced cursor when inset in inset is locked.
4571 * src/insets/insettext.C (LocalDispatch): small fix so that a
4572 BREAKLINE is not inserted if we don't permit it with autBreakRows.
4574 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
4575 footnote font should be decreased in size twice when displaying.
4577 * src/insets/insettext.C (GetDrawFont): inserted this function as
4578 the drawing-font may differ from the real paragraph font.
4580 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
4581 insets (inset in inset!).
4583 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
4584 function here because we don't want footnotes inside footnotes.
4586 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
4588 (init): now set the inset_owner in paragraph.C
4589 (LocalDispatch): added some resetPos() in the right position
4592 (pasteSelection): changed to use the new CutAndPaste-Class.
4594 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
4595 which tells if it is allowed to insert another inset inside this one.
4597 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
4598 SwitchLayoutsBetweenClasses.
4600 * src/text2.C (InsertInset): checking of the new paragraph-function
4602 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
4603 is not needed anymore here!
4606 (PasteSelection): redone (also with #ifdef) so that now this uses
4607 the CutAndPaste-Class.
4608 (SwitchLayoutsBetweenClasses): removed here and implemented in the
4611 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
4612 from/to text/insets.
4614 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
4615 so that the paragraph knows if it is inside an (text)-inset.
4616 (InsertFromMinibuffer): changed return-value to bool as now it
4617 may happen that an inset is not inserted in the paragraph.
4618 (InsertInsetAllowed): this checks if it is allowed to insert an
4619 inset in this paragraph.
4621 (BreakParagraphConservative):
4622 (BreakParagraph) : small change for the above change of the return
4623 value of InsertFromMinibuffer.
4625 * src/lyxparagraph.h: added inset_owner and the functions to handle
4626 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
4628 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4630 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
4631 functions from BufferView to BufferView::Pimpl to ease maintence.
4633 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
4634 correctly. Also use SetCursorIntern instead of SetCursor.
4636 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
4639 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4641 * src/WorkArea.C (belowMouse): manually implement below mouse.
4643 * src/*: Add "explicit" on several constructors, I added probably
4644 some unneeded ones. A couple of changes to code because of this.
4646 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
4647 implementation and private parts from the users of BufferView. Not
4650 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
4651 implementation and private parts from the users of LyXLex. Not
4654 * src/BufferView_pimpl.[Ch]: new files
4656 * src/lyxlex_pimpl.[Ch]: new files
4658 * src/LyXView.[Ch]: some inline functions move out-of-line
4660 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4662 * src/lyxparagraph.h: make struct InsetTable public.
4664 * src/support/lyxstring.h: change lyxstring::difference_type to be
4665 ptrdiff_t. Add std:: modifiers to streams.
4667 * src/font.C: include the <cctype> header, for islower() and
4670 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4672 * src/font.[Ch]: new files. Contains the metric functions for
4673 fonts, takes a LyXFont as parameter. Better separation of concepts.
4675 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
4676 changes because of this.
4678 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
4680 * src/*: compile with -Winline and move functions that don't
4683 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
4686 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4688 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
4689 (various files changed because of this)
4691 * src/Painter.C (text): fixed the drawing of smallcaps.
4693 * src/lyxfont.[Ch] (drawText): removed unused member func.
4696 * src/*.C: added needed "using" statements and "std::" qualifiers.
4698 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4700 * src/*.h: removed all use of "using" from header files use
4701 qualifier std:: instead.
4703 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4705 * src/text.C (Backspace): some additional cleanups (we already
4706 know whether cursor.pos is 0 or not).
4708 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
4709 automake does not provide one).
4711 * src/bmtable.h: replace C++ comments with C comments.
4713 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
4715 * src/screen.C (ShowCursor): Change the shape of the cursor if
4716 the current language is not equal to the language of the document.
4717 (If the cursor change its shape unexpectedly, then you've found a bug)
4719 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
4722 * src/insets/insetnumber.[Ch]: New files.
4724 * src/LyXAction.C (init)
4725 * src/lyxfunc.C (dispatch): Add command number-inset-insert
4728 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
4730 * src/lyxparagraph.h
4731 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
4732 (the vector is kept sorted).
4734 * src/text.C (GetVisibleRow): Draw selection correctly when there
4735 is both LTR and RTL text.
4737 * src/paragraph.C (Clone): Use the assignment operator for cloning,
4738 which is much faster.
4740 * src/text.C (GetVisibleRow and other): Do not draw the last space
4741 in a row if the direction of the last letter is not equal to the
4742 direction of the paragraph.
4744 * src/lyxfont.C (latexWriteStartChanges):
4745 Check that font language is not equal to basefont language.
4746 (latexWriteEndChanges): ditto
4748 * src/lyx_cb.C (StyleReset): Don't change the language while using
4749 the font-default command.
4751 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
4752 empty paragraph before a footnote.
4754 * src/insets/insetcommand.C (draw): Increase x correctly.
4756 * src/screen.C (ShowCursor): Change cursor shape if
4757 current language != document language.
4759 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
4761 2000-03-31 Juergen Vigna <jug@sad.it>
4763 * src/paragraph.C (GetInset): commented out text[pos] = ' '
4764 (Clone): changed mode how the paragraph-data is copied to the
4765 new clone-paragraph.
4767 * src/lyxfunc.C (Dispatch): fixed small problem when calling
4768 GetInset(pos) with no inset anymore there (in inset UNDO)
4770 * src/insets/insetcommand.C (draw): small fix as here x is
4771 incremented not as much as width() returns (2 before, 2 behind = 4)
4773 2000-03-30 Juergen Vigna <jug@sad.it>
4775 * src/insets/insettext.C (InsetText): small fix in initialize
4776 widthOffset (should not be done in the init() function)
4778 2000-03-29 Amir Karger <karger@lyx.org>
4780 * lib/examples/it_ItemizeBullets.lyx: translation by
4783 * Implemented \textasciitilde and fixed a tiny bug in reLyX
4785 2000-03-29 Juergen Vigna <jug@sad.it>
4787 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
4789 * src/insets/insetfoot.C (Clone): small change as for the below
4790 new init function in the text-inset
4792 * src/insets/insettext.C (init): new function as I've seen that
4793 clone did not copy the Paragraph-Data!
4794 (LocalDispatch): Added code so that now we have some sort of Undo
4795 functionality (well actually we HAVE Undo ;)
4797 * src/text.C (Backspace): Small fix for the a | a Backspace problem
4799 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
4801 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
4804 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4806 * src/main.C: added a runtime check that verifies that the xforms
4807 header used when building LyX and the library used when running
4808 LyX match. Exit with a message if they don't match. This is a
4809 version number check only.
4811 * src/buffer.C (save): Don't allocate memory on the heap for
4812 struct utimbuf times.
4814 * *: some using changes, use iosfwd instead of the real headers.
4816 * src/lyxfont.C use char const * instead of string for the static
4817 strings. Rewrite some functions to use sstream.
4819 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4821 * src/text.C (Backspace): hopefully fix the dreaded backaspace
4824 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4826 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
4827 of Geodesy (from Martin Vermeer)
4829 * lib/layouts/svjour.inc: include file for the Springer svjour
4830 class. It can be used to support journals other than JoG.
4832 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
4833 Miskiewicz <misiek@pld.org.pl>)
4834 * lib/reLyX/Makefile.am: ditto.
4836 2000-03-27 Juergen Vigna <jug@sad.it>
4838 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
4839 also some modifications with operations on selected text.
4841 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
4842 problems with clicking on insets (last famous words ;)
4844 * src/insets/insetcommand.C (draw):
4845 (width): Changed to have a bit of space before and after the inset so
4846 that the blinking cursor can be seen (otherwise it was hidden)
4848 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4850 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
4851 would not be added to the link list when an installed gettext (not
4852 part of libc) is found.
4854 2000-03-24 Juergen Vigna <jug@sad.it>
4856 * src/insets/insetcollapsable.C (Edit):
4857 * src/mathed/formula.C (InsetButtonRelease):
4858 (InsetButtonPress): fixed for new handling of ButtonPress/Release
4861 * src/BufferView.C (workAreaButtonPress):
4862 (workAreaButtonRelease):
4863 (checkInsetHit): Finally fixed the clicking on insets be handled
4866 * src/insets/insetert.C (Edit): inserted this call so that ERT
4867 insets work always with LaTeX-font
4869 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
4871 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
4872 caused lyx to startup with no GUI in place, causing in a crash
4873 upon startup when called with arguments.
4875 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4877 * src/FontLoader.C: better initialization of dummyXFontStruct.
4879 2000-03-20 José Abílio Matos <jamatos@lyx.org>
4881 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
4882 for linuxdoc and docbook import and export format options.
4884 * lib/lyxrc.example Example of default values for the previous flags.
4886 * src/lyx_cb.C Use those flags instead of the hardwired values for
4887 linuxdoc and docbook export.
4889 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
4892 * src/menus.C Added menus entries for the new import/exports formats.
4894 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4896 * src/lyxrc.*: Added support for running without Gui
4899 * src/FontLoader.C: sensible defaults if no fonts are needed
4901 * src/lyx_cb.C: New function ShowMessage (writes either to the
4902 minibuffer or cout in case of no gui
4903 New function AskOverwrite for common stuff
4904 Consequently various changes to call these functions
4906 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
4907 wild guess at sensible screen resolution when having no gui
4909 * src/lyxfont.C: no gui, no fonts... set some defaults
4911 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4913 * src/LColor.C: made the command inset background a bit lighter.
4915 2000-03-20 Hartmut Goebel <goebel@noris.net>
4917 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
4918 stdstruct.inc. Koma-Script added some title elements which
4919 otherwise have been listed below "bibliography". This split allows
4920 adding title elements to where they belong.
4922 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
4923 define the additional tilte elements and then include
4926 * many other layout files: changed to include stdtitle.inc just
4927 before stdstruct.inc.
4929 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
4931 * src/buffer.C: (save) Added the option to store all backup files
4932 in a single directory
4934 * src/lyxrc.[Ch]: Added variable \backupdir_path
4936 * lib/lyxrc.example: Added descriptions of recently added variables
4938 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
4939 bibtex inset, not closing the bibtex popup when deleting the inset)
4941 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4943 * src/lyx_cb.C: add a couple using directives.
4945 2000-03-17 José Abílio Matos <jamatos@lyx.org>
4946 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
4947 import based on the filename.
4949 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
4950 file would be imported at start, if the filename where of a sgml file.
4952 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
4954 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
4956 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
4957 * src/lyxfont.h Replaced the member variable bits.direction by the
4958 member variable lang. Made many changes in other files.
4959 This allows having a multi-lingual document
4961 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
4962 that change the current language to <l>.
4963 Removed the command "font-rtl"
4965 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
4966 format for Hebrew documents)
4968 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
4969 When auto_mathmode is "true", pressing a digit key in normal mode
4970 will cause entering into mathmode.
4971 If auto_mathmode is "rtl" then this behavior will be active only
4972 when writing right-to-left text.
4974 * src/text2.C (InsertStringA) The string is inserted using the
4977 * src/paragraph.C (GetEndLabel) Gives a correct result for
4978 footnote paragraphs.
4980 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
4982 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4984 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
4985 front of PasteParagraph. Never insert a ' '. This should at least
4986 fix some cause for the segfaults that we have been experiencing,
4987 it also fixes backspace behaviour slightly. (Phu!)
4989 * src/support/lstrings.C (compare_no_case): some change to make it
4990 compile with gcc 2.95.2 and stdlibc++-v3
4992 * src/text2.C (MeltFootnoteEnvironment): change type o
4993 first_footnote_par_is_not_empty to bool.
4995 * src/lyxparagraph.h: make text private. Changes in other files
4997 (fitToSize): new function
4998 (setContentsFromPar): new function
4999 (clearContents): new function
5000 (SetChar): new function
5002 * src/paragraph.C (readSimpleWholeFile): deleted.
5004 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
5005 the file, just use a simple string instead. Also read the file in
5006 a more maintainable manner.
5008 * src/text2.C (InsertStringA): deleted.
5009 (InsertStringB): deleted.
5011 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5013 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
5014 RedoParagraphs from the doublespace handling part, just set status
5015 to NEED_MORE_REFRESH. Also don't update cursor position (should be
5016 done, but perhaps not like this.)
5018 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5020 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
5021 character when inserting an inset.
5023 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5025 * src/bufferparams.C (readLanguage): now takes "default" into
5028 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
5029 also initialize the toplevel_keymap with the default bindings from
5032 * src/buffer.C (Buffer): remove lyxrc from the parameters.
5034 * all files using lyxrc: have lyxrc as a real variable and not a
5035 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
5038 * src/lyxrc.C: remove double call to defaultKeyBindings
5040 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
5041 toolbar defauls using lyxlex. Remove enums, structs, functions
5044 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
5045 toolbar defaults. Also store default keybindings in a map.
5047 * src/ToolbarDefaults.[Ch]: New file. This class is used for
5048 storing the toolbar defaults without any xforms dependencies.
5050 * src/insets/figinset.C: patch posted to list by Andre Poenitz
5051 applied. Changed to use iterators.
5053 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
5055 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
5056 systems that don't have LINGUAS set to begin with.
5058 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5060 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
5061 the list by Dekel Tsur.
5063 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5065 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
5066 * src/insets/form_graphics.C: ditto.
5068 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
5070 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5072 * src/bufferparams.C (readLanguage): use the new language map
5074 * src/intl.C (InitKeyMapper): use the new language map
5076 * src/lyx_gui.C (create_forms): use the new language map
5078 * src/language.[Ch]: New files. Used for holding the information
5079 about each language. Now! Use this new language map enhance it and
5080 make it really usable for our needs.
5082 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
5084 * screen.C (ShowCursor): Removed duplicate code.
5085 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5086 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
5088 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
5091 * src/text.C Added TransformChar method. Used for rendering Arabic
5092 text correctly (change the glyphs of the letter according to the
5093 position in the word)
5098 * src/lyxrc.C Added lyxrc command {language_command_begin,
5099 language_command_end,language_command_ltr,language_command_rtl,
5100 language_package} which allows the use of either arabtex or Omega
5103 * src/lyx_gui.C (init)
5105 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
5106 to use encoding for menu fonts which is different than the encoding
5109 * src/buffer.C (makeLaTeXFile): If params.language = "default",
5110 do not load the babel package.
5111 To write an English document with Hebrew/Arabic, change the document
5112 language to "english".
5114 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
5115 (alphaCounter): changed to return char
5116 (loweralphaCounter, hebrewCounter, romanCounter): New functions
5118 * lib/lyxrc.example Added examples for Hebrew/Arabic
5121 * src/layout.C Added layout command endlabeltype
5123 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
5125 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
5127 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5129 * src/mathed/math_delim.C (search_deco): return a
5130 math_deco_struct* instead of index.
5132 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5134 * All files with a USE_OSTREAM_ONLY within: removed all code that
5135 was unused when USE_OSTREAM_ONLY is defined.
5137 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
5138 of any less. Removed header and using.
5140 * src/text.C (GetVisibleRow): draw the string "Page Break
5141 (top/bottom)" on screen when drawing a pagebreak line.
5143 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5145 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
5147 * src/mathed/math_macro.C (draw): do some cast magic.
5150 * src/mathed/math_defs.h: change byte* argument to byte const*.
5152 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
5154 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
5155 know it is right to return InsetFoot* too, but cxx does not like
5158 * src/insets/insetcollapsable.[Ch] (Clone): make const.
5160 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
5162 * src/mathed/math_delim.C: change == to proper assignment.
5164 2000-03-09 Juergen Vigna <jug@sad.it>
5166 * src/insets/insettext.C (setPos): fixed various cursor positioning
5167 problems (via mouse and cursor-keys)
5168 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
5169 inset (still a small display problem but it works ;)
5171 * src/insets/insetcollapsable.C (draw): added button_top_y and
5172 button_bottom_y to have correct values for clicking on the inset.
5174 * src/support/lyxalgo.h: commented out 'using std::less'
5176 2000-03-08 Juergen Vigna <jug@sad.it>
5178 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
5179 Button-Release event closes as it is alos the Release-Event
5182 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
5184 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5186 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
5187 can add multiple spaces in Scrap (literate programming) styles...
5188 which, by the way, is how I got hooked on LyX to begin with.
5190 * src/mathed/formula.C (Write): Added dummy variable to an
5191 inset::Latex() call.
5192 (Latex): Add free_spacing boolean to inset::Latex()
5194 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
5196 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
5197 virtual function to include the free_spacing boolean from
5198 the containing paragraph's style.
5200 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
5201 Added free_spacing boolean arg to match inset.h
5203 * src/insets/insettext.C, src/insets/insettext.h (Latex):
5204 Added free_spacing boolean arg to match inset.h
5206 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
5207 Added free_spacing boolean and made sure that if in a free_spacing
5208 paragraph, that we output normal space if there is a protected space.
5210 * src/insets/insetref.C, src/insets/insetref.h (Latex):
5211 Added free_spacing boolean arg to match inset.h
5213 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
5214 Added free_spacing boolean arg to match inset.h
5216 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
5217 Added free_spacing boolean arg to match inset.h
5219 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
5220 Added free_spacing boolean arg to match inset.h
5222 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
5223 Added free_spacing boolean arg to match inset.h
5225 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
5226 free_spacing boolean arg to match inset.h
5228 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
5229 Added free_spacing boolean arg to match inset.h
5231 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
5232 Added free_spacing boolean arg to match inset.h
5234 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
5235 Added free_spacing boolean arg to match inset.h
5237 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
5238 Added free_spacing boolean arg to match inset.h
5240 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
5241 Added free_spacing boolean arg to match inset.h
5243 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
5244 free_spacing boolean arg to match inset.h
5246 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
5247 free_spacing boolean arg to match inset.h
5249 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
5250 ignore free_spacing paragraphs. The user's spaces are left
5253 * src/text.C (InsertChar): Fixed the free_spacing layout
5254 attribute behavior. Now, if free_spacing is set, you can
5255 add multiple spaces in a paragraph with impunity (and they
5256 get output verbatim).
5257 (SelectSelectedWord): Added dummy argument to inset::Latex()
5260 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
5263 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
5264 paragraph layouts now only input a simple space instead.
5265 Special character insets don't make any sense in free-spacing
5268 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
5269 hard-spaces in the *input* file to simple spaces if the layout
5270 is free-spacing. This converts old files which had to have
5271 hard-spaces in free-spacing layouts where a simple space was
5273 (writeFileAscii): Added free_spacing check to pass to the newly
5274 reworked inset::Latex(...) methods. The inset::Latex() code
5275 ensures that hard-spaces in free-spacing paragraphs get output
5276 as spaces (rather than "~").
5278 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5280 * src/mathed/math_delim.C (draw): draw the empty placeholder
5281 delims with a onoffdash line.
5282 (struct math_deco_compare): struct that holds the "functors" used
5283 for the sort and the binary search in math_deco_table.
5284 (class init_deco_table): class used for initial sort of the
5286 (search_deco): use lower_bound to do a binary search in the
5289 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5291 * src/lyxrc.C: a small secret thingie...
5293 * src/lyxlex.C (printTable): changed to take a ostream as paramter
5294 and to not flush the stream as often as it used to.
5296 * src/support/lyxalgo.h: new file
5297 (sorted): template function used for checking if a sequence is
5298 sorted or not. Two versions with and without user supplied
5299 compare. Uses same compare as std::sort.
5301 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
5302 it and give warning on lyxerr.
5304 (struct compare_tags): struct with function operators used for
5305 checking if sorted, sorting and lower_bound.
5306 (search_kw): use lower_bound instead of manually implemented
5309 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5311 * src/insets/insetcollapsable.h: fix Clone() declaration.
5312 * src/insets/insetfoot.h: ditto.
5314 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
5316 2000-03-08 Juergen Vigna <jug@sad.it>
5318 * src/insets/lyxinset.h: added owner call which tells us if
5319 this inset is inside another inset. Changed also the return-type
5320 of Editable to an enum so it tells clearer what the return-value is.
5322 * src/insets/insettext.C (computeTextRows): fixed computing of
5323 textinsets which split automatically on more rows.
5325 * src/insets/insetert.[Ch]: changed this to be of BaseType
5328 * src/insets/insetfoot.[Ch]: added footnote inset
5330 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
5331 collapsable insets (like footnote, ert, ...)
5333 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5335 * src/lyxdraw.h: remvoe file
5337 * src/lyxdraw.C: remove file
5339 * src/insets/insettext.C: added <algorithm>.
5341 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5343 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
5344 (matrix_cb): case MM_OK use string stream
5346 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
5349 * src/mathed/math_macro.C (draw): use string stream
5350 (Metrics): use string stream
5352 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
5353 directly to the ostream.
5355 * src/vspace.C (asString): use string stream.
5356 (asString): use string stream
5357 (asLatexString): use string stream
5359 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
5360 setting Spacing::Other.
5362 * src/LaTeXFeatures.C (getPackages): use string stream instead of
5363 sprintf when creating the stretch vale.
5365 * src/text2.C (alphaCounter): changed to return a string and to
5366 not use a static variable internally. Also fixed a one-off bug.
5367 (SetCounter): changed the drawing of the labels to use string
5368 streams instead of sprintf.
5370 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
5371 manipulator to use a scheme that does not require library support.
5372 This is also the way it is done in the new GNU libstdc++. Should
5373 work with DEC cxx now.
5375 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5377 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
5378 end. This fixes a bug.
5380 * src/mathed (all files concerned with file writing): apply the
5381 USE_OSTREAM_ONLY changes to mathed too.
5383 * src/support/DebugStream.h: make the constructor explicit.
5385 * src/lyxfont.C (latexWriteStartChanges): small bug related to
5386 count and ostream squashed.
5388 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5390 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
5392 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
5393 ostringstream uses STL strings, and we might not.
5395 * src/insets/insetspecialchar.C: add using directive.
5396 * src/insets/insettext.C: ditto.
5398 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5400 * lib/layouts/seminar.layout: feeble attempt at a layout for
5401 seminar.cls, far from completet and could really use some looking
5402 at from people used to write layout files.
5404 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
5405 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
5406 a lot nicer and works nicely with ostreams.
5408 * src/mathed/formula.C (draw): a slightly different solution that
5409 the one posted to the list, but I think this one works too. (font
5410 size wrong in headers.)
5412 * src/insets/insettext.C (computeTextRows): some fiddling on
5413 Jürgens turf, added some comments that he should read.
5415 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
5416 used and it gave compiler warnings.
5417 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
5420 * src/lyx_gui.C (create_forms): do the right thing when
5421 show_banner is true/false.
5423 * src/lyx_cb.C (TimerCB): no need to close or do anything if
5424 show_banner is false.
5426 * most file writing files: Now use iostreams to do almost all of
5427 the writing. Also instead of passing string &, we now use
5428 stringstreams. mathed output is still not adapted to iostreams.
5429 This change can be turned off by commenting out all the occurences
5430 of the "#define USE_OSTREAM_ONLY 1" lines.
5432 * src/WorkArea.C (createPixmap): don't output debug messages.
5433 (WorkArea): don't output debug messages.
5435 * lib/lyxrc.example: added a comment about the new variable
5438 * development/Code_rules/Rules: Added some more commente about how
5439 to build class interfaces and on how better encapsulation can be
5442 2000-03-03 Juergen Vigna <jug@sad.it>
5444 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
5445 automatically with the width of the LyX-Window
5447 * src/insets/insettext.C (computeTextRows): fixed update bug in
5448 displaying text-insets (scrollvalues where not initialized!)
5450 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5452 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
5453 id in the check of the result from lower_bound is not enough since
5454 lower_bound can return last too, and then res->id will not be a
5457 * all insets and some code that use them: I have conditionalized
5458 removed the Latex(string & out, ...) this means that only the
5459 Latex(ostream &, ...) will be used. This is a work in progress to
5460 move towards using streams for all output of files.
5462 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
5465 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5467 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
5468 routine (this fixes bug where greek letters were surrounded by too
5471 * src/support/filetools.C (findtexfile): change a bit the search
5472 algorithm, to fix bug introduced in 1.1.4. Note that --format is
5473 no longer passed to kpsewhich, we may have to change that later.
5475 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
5476 warning options to avoid problems with X header files (from Angus
5478 * acinclude.m4: regenerated.
5480 2000-03-02 Juergen Vigna <jug@sad.it>
5482 * src/insets/insettext.C (WriteParagraphData): Using the
5483 par->writeFile() function for writing paragraph-data.
5484 (Read): Using buffer->parseSingleLyXformat2Token()-function
5485 for parsing paragraph data!
5487 * src/buffer.C (readLyXformat2): removed all parse data and using
5488 the new parseSingleLyXformat2Token()-function.
5489 (parseSingleLyXformat2Token): added this function to parse (read)
5490 lyx-file-format (this is called also from text-insets now!)
5492 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5494 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
5497 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
5498 directly instead of going through a func. One very bad thing: a
5499 static LyXFindReplace, but I don't know where to place it.
5501 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
5502 string instead of char[]. Also changed to static.
5503 (GetSelectionOrWordAtCursor): changed to static inline
5504 (SetSelectionOverLenChars): ditto.
5506 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
5507 current_view and global variables. both classes has changed names
5508 and LyXFindReplace is not inherited from SearchForm.
5510 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
5511 fl_form_search form.
5513 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
5515 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5517 * lib/bind/*.bind: make sure 'buffer-previous' function is not
5518 bound (from Kayvan).
5520 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
5522 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
5524 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5526 * some things that I should comment but the local pub says head to
5529 * comment out all code that belongs to the Roff code for Ascii
5530 export of tables. (this is unused)
5532 * src/LyXView.C: use correct type for global variable
5533 current_layout. (LyXTextClass::size_type)
5535 * some code to get the new insetgraphics closer to working I'd be
5536 grateful for any help.
5538 * src/BufferView2.C (insertInset): use the return type of
5539 NumberOfLayout properly. (also changes in other files)
5541 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
5542 this as a test. I want to know what breaks because of this.
5544 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
5546 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
5548 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
5549 to use a \makebox in the label, this allows proper justification
5550 with out using protected spaces or multiple hfills. Now it is
5551 "label" for left justified, "\hfill label\hfill" for center, and
5552 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
5553 should be changed accordingly.
5555 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5557 * src/lyxtext.h: change SetLayout() to take a
5558 LyXTextClass::size_type instead of a char (when there is more than
5559 127 layouts in a class); also change type of copylayouttype.
5560 * src/text2.C (SetLayout): ditto.
5561 * src/LyXView.C (updateLayoutChoice): ditto.
5563 * src/LaTeX.C (scanLogFile): errors where the line number was not
5564 given just after the '!'-line were ignored (from Dekel Tsur).
5566 * lib/lyxrc.example: fix description of \date_insert_format
5568 * lib/layouts/llncs.layout: new layout, contributed by Martin
5571 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5573 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
5574 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
5575 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
5576 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
5577 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
5578 paragraph.C, text.C, text2.C)
5580 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5582 * src/insets/insettext.C (LocalDispatch): remove extra break
5585 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
5586 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
5588 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
5589 * src/insets/insettext.[Ch] (GetCursorPos): ditto
5591 * src/insets/insetbib.h: move InsetBibkey::Holder and
5592 InsetCitation::Holder in public space.
5594 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5596 * src/insets/insettext.h: small change to get the new files from
5597 Juergen to compile (use "string", not "class string").
5599 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
5600 const & as parameter to LocalDispatch, use LyXFont const & as
5601 paramter to some other func. This also had impacto on lyxinsets.h
5602 and the two mathed insets.
5604 2000-02-24 Juergen Vigna <jug@sad.it>
5607 * src/commandtags.h:
5609 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
5613 * src/BufferView2.C: added/updated code for various inset-functions
5615 * src/insets/insetert.[Ch]: added implementation of InsetERT
5617 * src/insets/insettext.[Ch]: added implementation of InsetText
5619 * src/insets/inset.C (Edit): added "unsigned int button" parameter
5620 (draw): added preliminary code for inset scrolling not finshed yet
5622 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
5623 as it is in lyxfunc.C now
5625 * src/insets/lyxinset.h: Added functions for text-insets
5627 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5629 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
5630 BufferView and reimplement the list as a queue put inside its own
5633 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
5635 * several files: use the new interface to the "updateinsetlist"
5637 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
5639 (work_area_handler): call BufferView::trippleClick on trippleclick.
5641 * src/BufferView.C (doubleClick): new function, selects word on
5643 (trippleClick): new function, selects line on trippleclick.
5645 2000-02-22 Allan Rae <rae@lyx.org>
5647 * lib/bind/xemacs.bind: buffer-previous not supported
5649 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5651 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
5654 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5656 * src/bufferlist.C: get rid of current_view from this file
5658 * src/spellchecker.C: get rid of current_view from this file
5660 * src/vspace.C: get rid of current_view from this file
5661 (inPixels): added BufferView parameter for this func
5662 (asLatexCommand): added a BufferParams for this func
5664 * src/text.C src/text2.C: get rid of current_view from these
5667 * src/lyxfont.C (getFontDirection): move this function here from
5670 * src/bufferparams.C (getDocumentDirection): move this function
5673 * src/paragraph.C (getParDirection): move this function here from
5675 (getLetterDirection): ditto
5677 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5679 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
5680 resize due to wrong pixmap beeing used. Also took the opurtunity
5681 to make the LyXScreen stateless on regard to WorkArea and some
5682 general cleanup in the same files.
5684 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5686 * src/Makefile.am: add missing direction.h
5688 * src/PainterBase.h: made the width functions const.
5690 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
5693 * src/insets/insetcommand.C (draw): draw Editable as buttons.
5695 * src/insets/insetlatexaccent.C (draw): make the accents draw
5696 better, at present this will only work well with iso8859-1.
5698 * several files: remove the old drawing code, now we use the new
5701 * several files: remove support for mono_video, reverse_video and
5704 2000-02-17 Juergen Vigna <jug@sad.it>
5706 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
5707 int ** as we have to return the pointer, otherwise we have only
5708 NULL pointers in the returning function.
5710 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5712 * src/LaTeX.C (operator()): quote file name when running latex.
5714 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5716 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
5717 (bubble tip), this removes our special handling of this.
5719 * Remove all code that is unused now that we have the new
5720 workarea. (Code that are not active when NEW_WA is defined.)
5722 * Make the uses of XSync not conditionalized on define USE_XSYNC.
5724 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5726 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
5727 nonexisting layout; correctly redirect obsoleted layouts.
5729 * lib/lyxrc.example: document \view_dvi_paper_option
5731 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
5734 * src/lyx_cb.C (RunScript): handle $$FName for command names.
5735 (PreviewDVI): handle the view_dvi_paper_option variable.
5736 [Both from Roland Krause]
5738 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5740 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
5741 char const *, int, LyXFont)
5742 (text(int, int, string, LyXFont)): ditto
5744 * src/text.C (InsertCharInTable): attempt to fix the double-space
5745 feature in tables too.
5746 (BackspaceInTable): ditto.
5747 (GetVisibleRow): make bottom pagebreak line be a onoff line.
5749 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5751 * src/text2.C (owner): only complain if owner_ is set and bv != 0
5753 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
5754 newly found text in textcache to this.
5755 (buffer): set the owner of the text put into the textcache to 0
5757 * src/insets/figinset.C (draw): fixed the drawing of figures with
5760 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
5761 drawing of mathframe, hfills, protected space, table lines. I have
5762 now no outstanding drawing problems with the new Painter code.
5764 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5766 * src/PainterBase.C (ellipse, circle): do not specify the default
5769 * src/LColor.h: add using directive.
5771 * src/Painter.[Ch]: change return type of methods from Painter& to
5772 PainterBase&. Add a using directive.
5774 * src/WorkArea.C: wrap xforms callbacks in C functions
5777 * lib/layouts/foils.layout: font fix and simplifications from Carl
5780 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5782 * a lot of files: The Painter, LColor and WorkArea from the old
5783 devel branch has been ported to lyx-devel. Some new files and a
5784 lot of #ifdeffed code. The new workarea is enabled by default, but
5785 if you want to test the new Painter and LColor you have to compile
5786 with USE_PAINTER defined (do this in config.h f.ex.) There are
5787 still some rought edges, and I'd like some help to clear those
5788 out. It looks stable (loads and displays the Userguide very well).
5791 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5793 * src/buffer.C (pop_tag): revert to the previous implementation
5794 (use a global variable for both loops).
5796 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
5798 * src/lyxrc.C (LyXRC): change slightly default date format.
5800 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
5801 there is an English text with a footnote that starts with a Hebrew
5802 paragraph, or vice versa.
5803 (TeXFootnote): ditto.
5805 * src/text.C (LeftMargin): allow for negative values for
5806 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
5809 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
5810 for input encoding (cyrillic)
5812 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5814 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
5817 * src/toolbar.C (set): ditto
5818 * src/insets/insetbib.C (create_form_citation_form): ditto
5820 * lib/CREDITS: added Dekel Tsur.
5822 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
5823 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
5824 hebrew supports files from Dekel Tsur.
5826 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
5827 <tzafrir@technion.ac.il>
5829 * src/lyxrc.C: put \date_insert_format at the right place.
5831 * src/buffer.C (makeLaTeXFile): fix the handling of
5832 BufferParams::sides when writing out latex files.
5834 * src/BufferView2.C: add a "using" directive.
5836 * src/support/lyxsum.C (sum): when we use lyxstring,
5837 ostringstream::str needs an additional .c_str().
5839 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5841 * src/support/filetools.C (ChangeExtension): patch from Etienne
5844 * src/TextCache.C (show): remove const_cast and make second
5845 parameter non-const LyXText *.
5847 * src/TextCache.h: use non const LyXText in show.
5849 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
5852 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5854 * src/support/lyxsum.C: rework to be more flexible.
5856 * several places: don't check if a pointer is 0 if you are going
5859 * src/text.C: remove some dead code.
5861 * src/insets/figinset.C: remove some dead code
5863 * src/buffer.C: move the BufferView funcs to BufferView2.C
5864 remove all support for insetlatexdel
5865 remove support for oldpapersize stuff
5866 made some member funcs const
5868 * src/kbmap.C: use a std::list to store the bindings in.
5870 * src/BufferView2.C: new file
5872 * src/kbsequence.[Ch]: new files
5874 * src/LyXAction.C + others: remove all trace of buffer-previous
5876 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
5877 only have one copy in the binary of this table.
5879 * hebrew patch: moved some functions from LyXText to more
5880 appropriate places. (LyXParagraph, BufferParams, LyXFont)
5882 * several files: remove support for XForms older than 0.88
5884 remove some #if 0 #endif code
5886 * src/TextCache.[Ch]: new file. Holds the textcache.
5888 * src/BufferView.C: changes to use the new TextCache interface.
5889 (waitForX): remove the now unused code.
5891 * src/BackStack.h: remove some commented code
5893 * lib/bind/emacs.bind: remove binding for buffer-previous
5895 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5897 * applied the hebrew patch.
5899 * src/lyxrow.h: make sure that all Row variables are initialized.
5901 * src/text2.C (TextHandleUndo): comment out a delete, this might
5902 introduce a memory leak, but should also help us to not try to
5903 read freed memory. We need to look at this one.
5905 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
5906 (LyXParagraph): initalize footnotekind.
5908 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
5909 forgot this when applying the patch. Please heed the warnings.
5911 * src/BufferView.C (buffer): a fix for the buffer-reload problem
5912 (aka. reformat problem)
5914 * src/bufferlist.C (exists): made const, and use const_iterator
5915 (isLoaded): new func.
5916 (release): use std::find to find the correct buffer.
5918 * src/bufferlist.h: made getState a const func.
5919 made empty a const func.
5920 made exists a const func.
5923 2000-02-01 Juergen Vigna <jug@sad.it>
5925 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
5927 * po/it.po: updated a bit the italian po file and also changed the
5928 'file nuovo' for newfile to 'filenuovo' without a space, this did
5931 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
5932 for the new insert_date command.
5934 * src/lyxfunc.C (Dispatch): added support for a insert_date function
5935 from jdblair, to insert a date into the current text conforming to
5936 a strftime format (for now only considering the locale-set and not
5937 the document-language).
5939 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5941 * src/lyxfont.C (textWidth): hopefully better fix for the Array
5942 Bounds Read error seen by purify. The problem was that islower is
5943 a macros which takes an unsigned char and uses it as an index for
5944 in array of characters properties (and is thus subject to the
5948 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
5949 correctly the paper sides radio buttons.
5950 (UpdateDocumentButtons): ditto.
5952 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5954 * src/kbmap.C (getsym + others): change to return unsigned int,
5955 returning a long can give problems on 64 bit systems. (I assume
5956 that int is 32bit on 64bit systems)
5958 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5960 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
5961 LyXLookupString to be zero-terminated. Really fixes problems seen
5964 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5966 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
5967 write a (char*)0 to the lyxerr stream.
5969 * src/lastfiles.C: move algorithm before the using statemets.
5971 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5973 * src/lastfiles.C: move using directives in global scope (egcs 1.x
5974 complains otherwise).
5975 * src/table.C: ditto
5977 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
5980 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
5981 that I removed earlier... It is really needed.
5983 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
5985 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5987 * INSTALL: update xforms home page URL.
5989 * lib/configure.m4: fix a bug with unreadable layout files.
5991 * src/table.C (calculate_width_of_column): add "using std::max"
5994 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5996 * several files: marked several lines with "DEL LINE", this is
5997 lines that can be deleted without changing anything.
5998 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
5999 checks this anyway */
6002 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
6004 * src/DepTable.C (update): add a "+" at the end when the checksum
6005 is different. (debugging string only)
6007 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
6008 the next inset to not be displayed. This should also fix the list
6009 of labels in the "Insert Crossreference" dialog.
6011 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6013 * src/support/LSubstring.C (LSubstring): set pos to string::npos
6014 when regex was not found.
6016 * src/support/lstrings.C (lowercase): use handcoded transform always.
6019 * src/text.C (Delete): fixed the crash. cursor.par->prev and
6020 old_cursor.par->prev could be 0.
6022 * several files: changed post inc/dec to pre inc/dec
6024 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
6025 write the lastfiles to file.
6027 * src/BufferView.C (buffer): only show TextCache info when debugging
6029 (resizeCurrentBuffer): ditto
6030 (workAreaExpose): ditto
6032 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
6034 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
6036 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
6037 a bit better by removing the special case for \i and \j.
6039 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6041 * src/lyx_main.C (easyParse): remove test for bad comand line
6042 options, since this broke all xforms-related parsing.
6044 * src/kbmap.C (getsym): set return type to unsigned long, as
6045 declared in header. On an alpha, long is _not_ the same as int.
6047 * src/support/LOstream.h: add a "using std::flush;"
6049 * src/insets/figinset.C: ditto.
6051 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6053 * src/bufferlist.C (write): use blinding fast file copy instead of
6054 "a char at a time", now we are doing it the C++ way.
6056 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
6057 std::list<int> instead.
6058 (addpidwait): reflect move to std::list<int>
6059 (sigchldchecker): ditto
6061 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
6064 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
6065 that obviously was wrong...
6067 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
6068 c, this avoids warnings with purify and islower.
6070 * src/insets/figinset.C: rename struct queue to struct
6071 queue_element and rewrite to use a std::queue. gsqueue is now a
6072 std::queue<queue_element>
6073 (runqueue): reflect move to std::queue
6076 * src/support/lstrings.h (tostr): specialize for bool, otherwise
6077 we would get "1" "0" instead of "true" "false. Also make the tostr
6080 2000-01-21 Juergen Vigna <jug@sad.it>
6082 * src/buffer.C (writeFileAscii): Disabled code for special groff
6083 handling of tabulars till I fix this in table.C
6085 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6087 * src/support/mkdir.C (mkdir): change second argument of mkdir to
6089 * src/support/lyxlib.h: ditto.
6091 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6093 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
6094 and 'j' look better. This might fix the "macron" bug that has been
6097 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
6098 functions as one template function. Delete the old versions.
6100 * src/support/lyxsum.C: move using std::ifstream inside
6103 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
6106 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
6108 * src/mathed/formula.C: delete #include "bufferlist.h" never used
6110 * src/insets/figinset.C (InitFigures): use new instead of malloc
6111 to allocate memory for figures and bitmaps.
6112 (DoneFigures): use delete[] instead of free to deallocate memory
6113 for figures and bitmaps.
6114 (runqueue): use new to allocate
6115 (getfigdata): use new/delete[] instead of malloc/free
6116 (RegisterFigure): ditto
6118 * some files: moved some declarations closer to first use, small
6119 whitespace changes use preincrement instead of postincrement where
6120 it does not make a difference.
6122 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
6123 step on the way to use stl::containers for key maps.
6125 * src/bufferlist.h: add a typedef for const_iterator and const
6126 versions of begin and end.
6128 * src/bufferlist.[Ch]: change name of member variable _state to
6129 state_. (avoid reserved names)
6131 (getFileNames): returns the filenames of the buffers in a vector.
6133 * configure.in (ALL_LINGUAS): added ro
6135 * src/support/putenv.C: new file
6137 * src/support/mkdir.C: new file
6139 2000-01-20 Allan Rae <rae@lyx.org>
6141 * lib/layouts/IEEEtran.layout: Added several theorem environments
6143 * lib/templates/IEEEtran.lyx: Example theorem environments and a
6144 couple of minor additions.
6146 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
6147 (except for those in footnotes of course)
6149 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6151 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
6153 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
6154 std::sort and std::lower_bound instead of qsort and handwritten
6156 (struct compara): struct that holds the functors used by std::sort
6157 and std::lower_bound in MathedLookupBOP.
6159 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6161 * src/support/LAssert.h: do not do partial specialization. We do
6164 * src/support/lyxlib.h: note that lyx::getUserName() and
6165 lyx::date() are not in use right now. Should these be suppressed?
6167 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
6168 (makeLinuxDocFile): do not put date and user name in linuxdoc
6171 * src/support/lyxlib.h (kill): change first argument to long int,
6172 since that's what solaris uses.
6174 * src/support/kill.C (kill): fix declaration to match prototype.
6176 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
6177 actually check whether namespaces are supported. This is not what
6180 * src/support/lyxsum.C: add a using directive.
6182 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6184 * src/support/kill.C: if we have namespace support we don't have
6185 to include lyxlib.h.
6187 * src/support/lyxlib.h: use namespace lyx if supported.
6189 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6191 * src/support/date.C: new file
6193 * src/support/chdir.C: new file
6195 * src/support/getUserName.C: new file
6197 * src/support/getcwd.C: new file
6199 * src/support/abort.C: new file
6201 * src/support/kill.C: new file
6203 * src/support/lyxlib.h: moved all the functions in this file
6204 insede struct lyx. Added also kill and abort to this struct. This
6205 is a way to avoid the "kill is not defined in <csignal>", we make
6206 C++ wrappers for functions that are not ANSI C or ANSI C++.
6208 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
6209 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
6210 lyx it has been renamed to sum.
6212 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6214 * src/text.C: add using directives for std::min and std::max.
6216 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6218 * src/texrow.C (getIdFromRow): actually return something useful in
6219 id and pos. Hopefully fixes the bug with positionning of errorbox
6222 * src/lyx_main.C (easyParse): output an error and exit if an
6223 incorrect command line option has been given.
6225 * src/spellchecker.C (ispell_check_word): document a memory leak.
6227 * src/bufferlist.C (write): fix mismatched allocation/deletion,
6228 where a "struct utimbuf" is allocated with "new" and deleted with
6231 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
6233 * src/text2.C (CutSelection): don't delete double spaces.
6234 (PasteSelection): ditto
6235 (CopySelection): ditto
6237 * src/text.C (Backspace): don't delete double spaces.
6239 * src/lyxlex.C (next): fix a bug that were only present with
6240 conformant std::istream::get to read comment lines, use
6241 std::istream::getline instead. This seems to fix the problem.
6243 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6245 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
6246 allowed to insert space before space" editing problem. Please read
6247 commends at the beginning of the function. Comments about usage
6250 * src/text.C (InsertChar): fix for the "not allowed to insert
6251 space before space" editing problem.
6253 * src/text2.C (DeleteEmptyParagraphMechanism): when
6254 IsEmptyTableRow can only return false this last "else if" will
6255 always be a no-op. Commented out.
6257 * src/text.C (RedoParagraph): As far as I can understand tmp
6258 cursor is not really needed.
6260 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
6261 present it could only return false anyway.
6262 (several functions): Did something not so smart...added a const
6263 specifier on a lot of methods.
6265 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
6266 and add a tmp->text.resize. The LyXParagraph constructor does the
6268 (BreakParagraphConservative): ditto
6270 * src/support/path.h (Path): add a define so that the wrong usage
6271 "Path("/tmp") will be flagged as a compilation error:
6272 "`unnamed_Path' undeclared (first use this function)"
6274 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6276 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
6277 which was bogus for several reasons.
6279 * src/LaTeX.C (scanAux): fix the regular expression used to scan
6283 * autogen.sh: do not use "type -path" (what's that anyway?).
6285 * src/support/filetools.C (findtexfile): remove extraneous space
6286 which caused a kpsewhich warning (at least with kpathsea version
6289 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6291 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
6293 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
6295 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
6297 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6299 * src/paragraph.C (BreakParagraph): do not reserve space on text
6300 if we don't need to (otherwise, if pos_end < pos, we end up
6301 reserving huge amounts of memory due to bad unsigned karma).
6302 (BreakParagraphConservative): ditto, although I have not seen
6303 evidence the bug can happen here.
6305 * src/lyxparagraph.h: add a using std::list.
6307 2000-01-11 Juergen Vigna <jug@sad.it>
6309 * src/menus.C (MenuDocu): output an Alert if the documentation-file
6312 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6314 * src/vc-backend.C (doVCCommand): change to be static and take one
6315 more parameter: the path to chdir too be fore executing the command.
6316 (retrive): new function equiv to "co -r"
6318 * src/bufferlist.C (loadLyXFile): implement the missing parts if
6319 file_not_found_hook is true.
6321 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
6323 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
6324 if a file is readwrite,readonly...anything else.
6326 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6328 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
6329 (CreatePostscript): name change from MenuRunDVIPS (or something)
6330 (PreviewPostscript): name change from MenuPreviewPS
6331 (PreviewDVI): name change from MenuPreviewDVI
6333 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
6334 \view_pdf_command., \pdf_to_ps_command
6336 * lib/configure.m4: added search for PDF viewer, and search for
6337 PDF to PS converter.
6338 (lyxrc.defaults output): add \pdflatex_command,
6339 \view_pdf_command and \pdf_to_ps_command.
6341 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
6343 * src/bufferlist.C (write): we don't use blocksize for anything so
6346 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6348 * src/support/block.h: disable operator T* (), since it causes
6349 problems with both compilers I tried. See comments in the file.
6351 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
6354 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
6355 variable LYX_DIR_10x to LYX_DIR_11x.
6357 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
6359 * INSTALL: document --with-lyxname.
6362 * configure.in: new configure flag --with-lyxname which allows to
6363 choose the name under which lyx is installed. Default is "lyx", of
6364 course. It used to be possible to do this with --program-suffix,
6365 but the later has in fact a different meaning for autoconf.
6367 * src/support/lstrings.h (lstrchr): reformat a bit.
6369 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
6370 * src/mathed/math_defs.h: ditto.
6372 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6374 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
6375 true, decides if we create a backup file or not when saving. New
6376 tag and variable \pdf_mode, defaults to false. New tag and
6377 variable \pdflatex_command, defaults to pdflatex. New tag and
6378 variable \view_pdf_command, defaults to xpdf. New tag and variable
6379 \pdf_to_ps_command, defaults to pdf2ps.
6381 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6383 * src/bufferlist.C (close): don't call insetUnlock if the buffer
6384 does not have a BufferView.
6385 (unlockInset): ditto + don't access the_locking_inset if the
6386 buffer does not have a BufferView.
6388 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
6389 certain circumstances so that we don't continue a keyboard
6390 operation long after the key was released. Try f.ex. to load a
6391 large document, press PageDown for some seconds and then release
6392 it. Before this change the document would contine to scroll for
6393 some time, with this change it stops imidiatly.
6395 * src/support/block.h: don't allocate more space than needed. As
6396 long as we don't try to write to the arr[x] in a array_type arr[x]
6397 it is perfectly ok. (if you write to it you might segfault).
6398 added operator value_type*() so that is possible to pass the array
6399 to functions expecting a C-pointer.
6401 * lib/Makefile.am (dist-hook): don't fail completely if unable to
6404 * intl/*: updated to gettext 0.10.35, tried to add our own
6405 required modifications. Please verify.
6407 * po/*: updated to gettext 0.10.35, tried to add our own required
6408 modifications. Please verify.
6410 * src/support/lstrings.C (tostr): go at fixing the problem with
6411 cxx and stringstream. When stringstream is used return
6412 oss.str().c_str() so that problems with lyxstring and basic_string
6413 are avoided. Note that the best solution would be for cxx to use
6414 basic_string all the way, but it is not conformant yet. (it seems)
6416 * src/lyx_cb.C + other files: moved several global functions to
6417 class BufferView, some have been moved to BufferView.[Ch] others
6418 are still located in lyx_cb.C. Code changes because of this. (part
6419 of "get rid of current_view project".)
6421 * src/buffer.C + other files: moved several Buffer functions to
6422 class BufferView, the functions are still present in buffer.C.
6423 Code changes because of this.
6425 * config/lcmessage.m4: updated to most recent. used when creating
6428 * config/progtest.m4: updated to most recent. used when creating
6431 * config/gettext.m4: updated to most recent. applied patch for
6434 * config/gettext.m4.patch: new file that shows what changes we
6435 have done to the local copy of gettext.m4.
6437 * config/libtool.m4: new file, used in creation of acinclude.m4
6439 * config/lyxinclude.m4: new file, this is the lyx created m4
6440 macros, used in making acinclude.m4.
6442 * autogen.sh: GNU m4 discovered as a separate task not as part of
6443 the lib/configure creation.
6444 Generate acinlucde from files in config. Actually cat
6445 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
6446 easier to upgrade .m4 files that really are external.
6448 * src/Spacing.h: moved using std::istringstream to right after
6449 <sstream>. This should fix the problem seen with some compilers.
6451 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6453 * src/lyx_cb.C: began some work to remove the dependency a lot of
6454 functions have on BufferView::text, even if not really needed.
6455 (GetCurrentTextClass): removed this func, it only hid the
6458 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
6459 forgot this in last commit.
6461 * src/Bullet.C (bulletEntry): use static char const *[] for the
6462 tables, becuase of this the return arg had to change to string.
6464 (~Bullet): removed unneeded destructor
6466 * src/BufferView.C (beforeChange): moved from lyx_cb.C
6467 (insetSleep): moved from Buffer
6468 (insetWakeup): moved from Buffer
6469 (insetUnlock): moved from Buffer
6471 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
6472 from Buffer to BufferView.
6474 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
6476 * config/ltmain.sh: updated to version 1.3.4 of libtool
6478 * config/ltconfig: updated to version 1.3.4 of libtool
6480 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6483 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
6484 Did I get that right?
6486 * src/lyxlex.h: add a "using" directive or two.
6487 * src/Spacing.h: ditto.
6488 * src/insets/figinset.C: ditto.
6489 * src/support/filetools.C: ditto.
6490 * src/support/lstrings.C: ditto.
6491 * src/BufferView.C: ditto.
6492 * src/bufferlist.C: ditto.
6493 * src/lyx_cb.C: ditto.
6494 * src/lyxlex.C: ditto.
6496 * NEWS: add some changes for 1.1.4.
6498 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6500 * src/BufferView.C: first go at a TextCache to speed up switching
6503 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6505 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
6506 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
6507 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
6508 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
6511 * src/mathed/math_defs.h (MathedRowSt): make sure that all
6512 members of the struct are correctly initialized to 0 (detected by
6514 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
6515 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
6517 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
6518 pidwait, since it was allocated with "new". This was potentially
6519 very bad. Thanks to Michael Schmitt for running purify for us.
6522 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6524 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
6526 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
6528 1999-12-30 Allan Rae <rae@lyx.org>
6530 * lib/templates/IEEEtran.lyx: minor change
6532 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
6533 src/mathed/formula.C (LocalDispatch): askForText changes
6535 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
6536 know when a user has cancelled input. Fixes annoying problems with
6537 inserting labels and version control.
6539 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6541 * src/support/lstrings.C (tostr): rewritten to use strstream and
6544 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6546 * src/support/filetools.C (IsFileWriteable): use fstream to check
6547 (IsDirWriteable): use fileinfo to check
6549 * src/support/filetools.h (FilePtr): whole class deleted
6551 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
6553 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
6555 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
6557 * src/bufferlist.C (write): use ifstream and ofstream instead of
6560 * src/Spacing.h: use istrstream instead of sscanf
6562 * src/mathed/math_defs.h: change first arg to istream from FILE*
6564 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
6566 * src/mathed/math_parser.C: have yyis to be an istream
6567 (LexGetArg): use istream (yyis)
6569 (mathed_parse): ditto
6570 (mathed_parser_file): first arg istream instead of FILE*, set yyis
6572 * src/mathed/formula.C (Read): rewritten to use istream
6574 * src/mathed/formulamacro.C (Read): rewritten to use istream
6576 * src/lyxlex.h (~LyXLex): deleted desturctor
6577 (getStream): new function, returns an istream
6578 (getFile): deleted funtion
6579 (IsOK): return is.good();
6581 * src/lyxlex.C (LyXLex): delete file and owns_file
6582 (setFile): open an filebuf and assign that to a istream instead of
6584 (setStream): new function, takes an istream as arg.
6585 (setFile): deleted function
6586 (EatLine): rewritten us use istream instead of FILE*
6590 * src/table.C (LyXTable): use istream instead of FILE*
6591 (Read): rewritten to take an istream instead of FILE*
6593 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6595 * src/buffer.C (Dispatch): remove an extraneous break statement.
6597 * src/support/filetools.C (QuoteName): change to do simple
6598 'quoting'. More work is necessary. Also changed to do nothing
6599 under emx (needs fix too).
6600 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
6602 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
6603 config.h.in to the AC_DEFINE_UNQUOTED() call.
6604 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
6605 needs char * as argument (because Solaris 7 declares it like
6608 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
6609 remove definition of BZERO.
6611 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6613 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
6614 defined, "lyxregex.h" if not.
6616 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
6618 (REGEX): new variable that is set to regex.c lyxregex.h when
6619 AM_CONDITIONAL USE_REGEX is set.
6620 (libsupport_la_SOURCES): add $(REGEX)
6622 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
6625 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
6628 * configure.in: add call to LYX_REGEX
6630 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
6631 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
6633 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6635 * lib/bind/fi_menus.bind: new file, from
6636 pauli.virtanen@saunalahti.fi.
6638 * src/buffer.C (getBibkeyList): pass the parameter delim to
6639 InsetInclude::getKeys and InsetBibtex::getKeys.
6641 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
6642 is passed to Buffer::getBibkeyList
6644 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
6645 instead of the hardcoded comma.
6647 * src/insets/insetbib.C (getKeys): make sure that there are not
6648 leading blanks in bibtex keys. Normal latex does not care, but
6649 harvard.sty seems to dislike blanks at the beginning of citation
6650 keys. In particular, the retturn value of the function is
6652 * INSTALL: make it clear that libstdc++ is needed and that gcc
6653 2.7.x probably does not work.
6655 * src/support/filetools.C (findtexfile): make debug message go to
6657 * src/insets/insetbib.C (getKeys): ditto
6659 * src/debug.C (showTags): make sure that the output is correctly
6662 * configure.in: add a comment for TWO_COLOR_ICON define.
6664 * acconfig.h: remove all the entries that already defined in
6665 configure.in or acinclude.m4.
6667 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
6668 to avoid user name, date and copyright.
6670 1999-12-21 Juergen Vigna <jug@sad.it>
6672 * src/table.C (Read): Now read bogus row format informations
6673 if the format is < 5 so that afterwards the table can
6674 be read by lyx but without any format-info. Fixed the
6675 crash we experienced when not doing this.
6677 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6679 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
6680 (RedoDrawingOfParagraph): ditto
6681 (RedoParagraphs): ditto
6682 (RemoveTableRow): ditto
6684 * src/text.C (Fill): rename arg paperwidth -> paper_width
6686 * src/buffer.C (insertLyXFile): rename var filename -> fname
6687 (writeFile): rename arg filename -> fname
6688 (writeFileAscii): ditto
6689 (makeLaTeXFile): ditto
6690 (makeLinuxDocFile): ditto
6691 (makeDocBookFile): ditto
6693 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
6696 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
6698 * src/bmtable.h: add extern "C" on this file when __cplusplus is
6701 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
6702 compiled by a C compiler not C++.
6704 * src/layout.h (LyXTextClass): added typedef for const_iterator
6705 (LyXTextClassList): added typedef for const_iterator + member
6706 functions begin and end.
6708 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
6709 iterators to fill the choice_class.
6710 (updateLayoutChoice): rewritten to use iterators to fill the
6711 layoutlist in the toolbar.
6713 * src/BufferView.h (BufferView::work_area_width): removed unused
6716 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
6718 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
6719 (sgmlCloseTag): ditto
6721 * src/support/lstrings.h: return type of countChar changed to
6724 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
6725 what version of this func to use. Also made to return unsigned int.
6727 * configure.in: call LYX_STD_COUNT
6729 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
6730 conforming std::count.
6732 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6734 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
6735 and a subscript would give bad display (patch from Dekel Tsur
6736 <dekel@math.tau.ac.il>).
6738 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
6740 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
6743 * src/chset.h: add a few 'using' directives
6745 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
6746 triggered when no buffer is active
6748 * src/layout.C: removed `break' after `return' in switch(), since
6751 * src/lyx_main.C (init): make sure LyX can be ran in place even
6752 when libtool has done its magic with shared libraries. Fix the
6753 test for the case when the system directory has not been found.
6755 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
6756 name for the latex file.
6757 (MenuMakeHTML): ditto
6759 * src/buffer.h: add an optional boolean argument, which is passed
6762 1999-12-20 Allan Rae <rae@lyx.org>
6764 * lib/templates/IEEEtran.lyx: small correction and update.
6766 * configure.in: Attempted to use LYX_PATH_HEADER
6768 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
6770 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
6771 input from JMarc. Now use preprocessor to find the header.
6772 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
6773 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
6774 LYX_STL_STRING_FWD. See comments in file.
6776 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
6778 * The global MiniBuffer * minibuffer variable is dead.
6780 * The global FD_form_main * fd_form_main variable is dead.
6782 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6784 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
6786 * src/table.h: add the LOstream.h header
6787 * src/debug.h: ditto
6789 * src/LyXAction.h: change the explaination of the ReadOnly
6790 attribute: is indicates that the function _can_ be used.
6792 * src/LyXAction.C (init): find-replace _can_ be used in read-only
6795 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6797 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
6803 * src/paragraph.C (GetWord): assert on pos>=0
6806 * src/support/lyxstring.C: condition the use of an invariant on
6808 * src/support/lyxstring.h: ditto
6810 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
6811 Use LAssert.h instead of plain assert().
6813 * src/support/lstrings.h: add LAssert.h, in case it is needed.
6815 * src/lyxfunc.C: do not include LAssert.h, it is not used.
6816 * src/support/filetools.C: ditto
6818 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
6821 * INSTALL: document the new configure flags
6823 * configure.in: suppress --with-debug; add --enable-assertions
6825 * acinclude.m4: various changes in alignment of help strings.
6827 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6829 * src/kbmap.C: commented out the use of the hash map in kb_map,
6830 beginning of movement to a stl::container.
6832 * several files: removed code that was not in effect when
6833 MOVE_TEXT was defined.
6835 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
6836 for escaping should not be used. We can discuss if the string
6837 should be enclosed in f.ex. [] instead of "".
6839 * src/trans_mgr.C (insert): use the new returned value from
6840 encodeString to get deadkeys and keymaps done correctly.
6842 * src/chset.C (encodeString): changed to return a pair, to tell
6843 what to use if we know the string.
6845 * src/lyxscreen.h (fillArc): new function.
6847 * src/FontInfo.C (resize): rewritten to use more std::string like
6848 structore, especially string::replace.
6850 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
6853 * configure.in (chmod +x some scripts): remove config/gcc-hack
6855 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6857 * src/buffer.C (writeFile): change once again the top comment in a
6858 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
6859 instead of an hardcoded version number.
6860 (makeDocBookFile): ditto
6862 * src/version.h: add new define LYX_DOCVERSION
6864 * po/de.po: update from Pit Sütterlin
6865 * lib/bind/de_menus.bind: ditto.
6867 * src/lyxfunc.C (Dispatch): call MenuExport()
6868 * src/buffer.C (Dispatch): ditto
6870 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
6871 LyXFunc::Dispatch().
6872 (MenuExport): new function, moved from
6873 LyXFunc::Dispatch().
6875 * src/trans_mgr.C (insert): small cleanup
6876 * src/chset.C (loadFile): ditto
6878 * lib/kbd/iso8859-1.cdef: add missing backslashes
6880 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6882 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
6883 help with placing the manually drawn accents better.
6885 (Draw): x2 and hg changed to float to minimize rounding errors and
6886 help place the accents better.
6888 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
6889 unsigned short to char is just wrong...cast the char to unsigned
6890 char instead so that the two values can compare sanely. This
6891 should also make the display of insetlatexaccents better and
6892 perhaps also some other insets.
6894 (lbearing): new function
6897 1999-12-15 Allan Rae <rae@lyx.org>
6899 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
6900 header that provides a wrapper around the very annoying SGI STL header
6903 * src/support/lyxstring.C, src/LString.h:
6904 removed old SGI-STL-compatability attempts.
6906 * configure.in: Use LYX_STL_STRING_FWD.
6908 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
6909 stl_string_fwd.h is around and try to determine it's location.
6910 Major improvement over previous SGI STL 3.2 compatability.
6911 Three small problems remain with this function due to my zero
6912 knowledge of autoconf. JMarc and lgb see the comments in the code.
6914 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6916 * src/broken_const.h, config/hack-gcc, config/README: removed
6918 * configure.in: remove --with-gcc-hack option; do not call
6921 * INSTALL: remove documentation of --with-broken-const and
6924 * acconfig.h: remove all trace of BROKEN_CONST define
6926 * src/buffer.C (makeDocBookFile): update version number in output
6928 (SimpleDocBookOnePar): fix an assert when trying to a character
6929 access beyond string length
6932 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6934 * po/de.po: fix the Export menu
6936 * lyx.man: update the description of -dbg
6938 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
6939 (commandLineHelp): updated
6940 (easyParse): show list of available debug levels if -dbg is passed
6943 * src/Makefile.am: add debug.C
6945 * src/debug.h: moved some code to debug.C
6947 * src/debug.C: new file. Contains code to set and show debug
6950 * src/layout.C: remove 'break' after 'continue' in switch
6951 statements, since these cannot be reached.
6953 1999-12-13 Allan Rae <rae@lyx.org>
6955 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
6956 (in_word_set): hash() -> math_hash()
6958 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
6960 * acconfig.h: Added a test for whether we are using exceptions in the
6961 current compilation run. If so USING_EXCEPTIONS is defined.
6963 * config.in: Check for existance of stl_string_fwd.h
6964 * src/LString.h: If compiling --with-included-string and SGI's
6965 STL version 3.2 is present (see above test) we need to block their
6966 forward declaration of string and supply a __get_c_string().
6967 However, it turns out this is only necessary if compiling with
6968 exceptions enabled so I've a bit more to add yet.
6970 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
6971 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
6972 src/support/LRegex.h, src/undo.h:
6973 Shuffle the order of the included files a little to ensure that
6974 LString.h gets included before anything that includes stl_string_fwd.h
6976 * src/support/lyxstring.C: We need to #include LString.h instead of
6977 lyxstring.h to get the necessary definition of __get_c_string.
6978 (__get_c_string): New function. This is defined static just like SGI's
6979 although why they need to do this I'm not sure. Perhaps it should be
6980 in lstrings.C instead.
6982 * lib/templates/IEEEtran.lyx: New template file.
6984 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6986 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
6987 * intl/Makefile.in (MKINSTALLDIRS): ditto
6989 * src/LyXAction.C (init): changed to hold the LFUN data in a
6990 automatic array in stead of in callso to newFunc, this speeds up
6991 compilation a lot. Also all the memory used by the array is
6992 returned when the init is completed.
6994 * a lot of files: compiled with -Wold-style-cast, changed most of
6995 the reported offenders to C++ style casts. Did not change the
6996 offenders in C files.
6998 * src/trans.h (Match): change argument type to unsigned int.
7000 * src/support/DebugStream.C: fix some types on the streambufs so
7001 that it works on a conforming implementation.
7003 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7005 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
7007 * src/support/lyxstring.C: remove the inline added earlier since
7008 they cause a bunch of unsatisfied symbols when linking with dec
7009 cxx. Cxx likes to have the body of inlines at the place where they
7012 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
7013 accessing negative bounds in array. This fixes the crash when
7014 inserting accented characters.
7015 * src/trans.h (Match): ditto
7017 * src/buffer.C (Dispatch): since this is a void, it should not try
7018 to return anything...
7020 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7022 * src/buffer.h: removed the two friends from Buffer. Some changes
7023 because of this. Buffer::getFileName and Buffer::setFileName
7024 renamed to Buffer::fileName() and Buffer::fileName(...).
7026 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7028 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
7029 and Buffer::update(short) to BufferView. This move is currently
7030 controlled by a define MOVE_TEXT, this will be removed when all
7031 shows to be ok. This move paves the way for better separation
7032 between buffer contents and buffer view. One side effect is that
7033 the BufferView needs a rebreak when swiching buffers, if we want
7034 to avoid this we can add a cache that holds pointers to LyXText's
7035 that is not currently in use.
7037 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
7040 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7042 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
7044 * lyx_main.C: new command line option -x (or --execute) and
7045 -e (or --export). Now direct conversion from .lyx to .tex
7046 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
7047 Unfortunately, X is still needed and the GUI pops up during the
7050 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7052 * src/Spacing.C: add a using directive to bring stream stuff into
7054 * src/paragraph.C: ditto
7055 * src/buffer.C: ditto
7057 * NEWS: updated a bit the new features of 1.1.3 (took a few things
7058 from Lars' announcement).
7060 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
7061 example files from Tino Meinen.
7063 1999-12-06 Allan Rae <rae@lyx.org>
7065 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
7067 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7069 * src/support/lyxstring.C: added a lot of inline for no good
7072 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
7073 latexWriteEndChanges, they were not used.
7075 * src/layout.h (operator<<): output operator for PageSides
7077 * src/mathed/math_iter.C (my_memcpy): slightly changed.
7079 * some example files: loaded in LyX 1.0.4 and saved again to update
7080 certain constructs (table format)
7082 * a lot of files: did the change to use fstream/iostream for all
7083 writing of files. Done with a close look at Andre Poenitz's patch.
7085 * some files: whitespace changes.
7087 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7089 * src/mathed/math_iter.C (my_memcpy): new function. Since the
7090 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
7091 architecture, we provide our own. It is used unconditionnally, but
7092 I do not think this is a performance problem. Thanks to Angus
7093 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
7094 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
7096 (GetInset): use my_memcpy.
7100 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
7101 it is easier to understand, but it uses less TeX-only constructs now.
7103 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
7104 elements contain spaces
7106 * lib/configure: regenerated
7108 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
7109 elements contain spaces; display the list of programs that are
7112 * autogen.sh: make sure lib/configure is executable
7114 * lib/examples/*: rename the tutorial examples to begin with the
7115 two-letters language code.
7117 * src/lyxfunc.C (getStatus): do not query current font if no
7120 * src/lyx_cb.C (RunScript): use QuoteName
7121 (MenuRunDvips): ditto
7122 (PrintApplyCB): ditto
7124 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
7125 around argument, so that it works well with the current shell.
7126 Does not work properly with OS/2 shells currently.
7128 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
7129 * src/LyXSendto.C (SendtoApplyCB): ditto
7130 * src/lyxfunc.C (Dispatch): ditto
7131 * src/buffer.C (runLaTeX): ditto
7132 (runLiterate): ditto
7133 (buildProgram): ditto
7135 * src/lyx_cb.C (RunScript): ditto
7136 (MenuMakeLaTeX): ditto
7138 * src/buffer.h (getLatexName): new method
7140 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
7142 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7144 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
7145 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
7146 (create_math_panel): ditto
7148 * src/lyxfunc.C (getStatus): re-activate the code which gets
7149 current font and cursor; add test for export to html.
7151 * src/lyxrc.C (read): remove unreachable break statements; add a
7154 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
7156 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7158 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
7159 introduced by faulty regex.
7160 * src/buffer.C: ditto
7161 * src/lastfiles.C: ditto
7162 * src/paragraph.C: ditto
7163 * src/table.C: ditto
7164 * src/vspace.C: ditto
7165 * src/insets/figinset.C: ditto
7166 Note: most of these is absolutely harmless, except the one in
7167 src/mathed formula.C.
7169 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7171 * src/ImportNoweb.C (documentclass): fixed bounds for substr
7172 operation, yielding correct results for the reLyX command.
7174 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7176 * src/support/filetools.C (ExpandPath): removed an over eager
7178 (ReplaceEnvironmentPath): ditto
7180 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
7181 shows that we are doing something fishy in our code...
7185 * src/lyxrc.C (read): use a double switch trick to get more help
7186 from the compiler. (the same trick is used in layout.C)
7187 (write): new function. opens a ofstream and pass that to output
7188 (output): new function, takes a ostream and writes the lyxrc
7189 elemts to it. uses a dummy switch to make sure no elements are
7192 * src/lyxlex.h: added a struct pushpophelper for use in functions
7193 with more than one exit point.
7195 * src/lyxlex.[Ch] (GetInteger): made it const
7199 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
7201 * src/layout.[hC] : LayoutTags splitted into several enums, new
7202 methods created, better error handling cleaner use of lyxlex. Read
7205 * src/bmtable.[Ch]: change some member prototypes because of the
7206 image const changes.
7208 * commandtags.h, src/LyXAction.C (init): new function:
7209 "preferences-save", saves the lyxrc entries into .lyx/preferences.
7210 This file is not read automatically but you can add \input
7211 preferences to your lyxrc if you want to. We need to discuss how
7214 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
7215 in .aux, also remove .bib and .bst files from dependencies when
7218 * src/BufferView.C, src/LyXView.C: add const_cast several places
7219 because of changes to images.
7221 * lib/images/*: same change as for images/*
7223 * lib/lyxrc.example: Default for accept_compound is false not no.
7225 * images/*: changed to be const, however I have som misgivings
7226 about this change so it might be changed back.
7228 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7230 * lib/configure, po/POTFILES.in: regenerated
7232 * autogen.sh: autogenerate lib/configure from lib/configure.m4
7234 * config/lib_configure.m4: removed
7236 * lib/configure.m4: new file (was config/lib_configure.m4)
7238 * configure.in: do not test for rtti, since we do not use it.
7240 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7242 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
7243 doubling of allocated space scheme. This makes it faster for large
7244 strings end to use less memory for small strings. xtra rememoved.
7246 * src/insets/figinset.C (waitalarm): commented out.
7247 (GhostscriptMsg): use static_cast
7248 (GhostscriptMsg): use new instead of malloc to allocate memory for
7249 cmap. also delete the memory after use.
7251 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
7253 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
7254 for changes in bibtex database or style.
7255 (runBibTeX): remove all .bib and .bst files from dep before we
7257 (run): use scanAuc in when dep file already exist.
7259 * src/DepTable.C (remove_files_with_extension): new method
7262 * src/DepTable.[Ch]: made many of the methods const.
7264 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7266 * src/bufferparams.C: make sure that the default textclass is
7267 "article". It used to be the first one by description order, but
7268 now the first one is "docbook".
7270 * src/lyx_main.C (setDebuggingLevel): change type of argument to
7271 string; call Debug::value.
7272 (easyParse): pass complete argument to setDebuggingLevel().
7274 * src/debug.h (value): fix the code that parses debug levels.
7276 * src/debug.h: add new debug type ACTION, reserved for LyXAction
7279 * src/LyXAction.C: use Debug::ACTION as debug channel.
7281 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
7283 * NEWS: updated for the future 1.1.3 release.
7285 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
7286 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
7287 it should. This is of course a controversial change (since many
7288 people will find that their lyx workscreen is suddenly full of
7289 red), but done for the sake of correctness.
7291 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
7292 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
7294 * src/insets/inseterror.h, src/insets/inseturl.h,
7295 src/insets/insetinfo.h, src/insets/figinset.h,
7296 src/mathed/formulamacro.h, src/mathed/math_macro.h
7297 (EditMessage): add a missing const and add _() to make sure that
7300 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
7301 src/insets/insetbib.C, src/support/filetools.C: add `using'
7304 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
7305 doing 'Insert index of last word' at the beginning of a paragraph.
7307 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7309 * several files: white-space changes.
7311 * src/mathed/formula.C: removed IsAlpha and IsDigit
7313 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
7314 .bib file. use a ifstream instead of FilePtr when parsing the .bib
7317 * src/insets/figinset.C (GetPSSizes): don't break when
7318 "EndComments" is seen. But break when a boundingbox is read.
7320 * all classes inherited from Inset: return value of Clone
7321 changed back to Inset *.
7323 * all classes inherited form MathInset: return value of Clone
7324 changed back to MathedInset *.
7326 * src/insets/figinset.C (runqueue): use a ofstream to output the
7327 gs/ps file. Might need some setpresicion or setw. However I can
7328 see no problem with the current code.
7329 (runqueue): use sleep instead of the alarm/signal code. I just
7330 can't see the difference.
7332 * src/paragraph.C (LyXParagraph): reserve space in the new
7333 paragraph and resize the inserted paragraph to just fit.
7335 * src/lyxfunc.h (operator|=): added operator for func_status.
7337 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
7338 check for readable file.
7340 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
7341 check for readable file.
7342 (MenuMakeLinuxDoc): ditto
7343 (MenuMakeDocBook): ditto
7344 (MenuMakeAscii): ditto
7345 (InsertAsciiFile): split the test for openable and readable
7347 * src/bmtable.C (draw_bitmaptable): use
7348 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
7350 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
7351 findtexfile from LaTeX to filetools.
7353 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
7354 instead of FilePtr. Needs to be verified by a literate user.
7356 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7358 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
7359 (EditMessage): likewise.
7361 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
7362 respectively as \textasciitilde and \textasciicircum.
7364 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7366 * src/support/lyxstring.h: made the methods that take iterators
7369 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
7370 (regexMatch): made is use the real regex class.
7372 * src/support/Makefile.am: changed to use libtool
7374 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
7376 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
7378 (MathIsInset ++): changed several macros to be inline functions
7381 * src/mathed/Makefile.am: changed to use libtool
7383 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
7385 * src/insets/inset* : Clone changed to const and return type is
7386 the true insettype not just Inset*.
7388 * src/insets/Makefile.am: changed to use libtool
7390 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
7392 * src/undo.[Ch] : added empty() and changed some of the method
7395 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
7397 * src/lyxparagraph.h: use id() and id(...) instead of getID and
7398 setID use block<> for the bullets array, added const several places.
7400 * src/lyxfunc.C (getStatus): new function
7402 * src/lyxfunc.[Ch] : small changes to take advantage of the new
7403 LyXAction, added const to several funtions.
7405 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
7406 a std::map, and to store the dir items in a vector.
7408 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
7411 * src/LyXView.[Ch] + other files : changed currentView to view.
7413 * src/LyXAction.[Ch] : ported from the old devel branch.
7415 * src/.cvsignore: added .libs and a.out
7417 * configure.in : changes to use libtool.
7419 * acinclude.m4 : inserted libtool.m4
7421 * .cvsignore: added libtool
7423 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7425 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
7426 file name in insets and mathed directories (otherwise the
7427 dependency is not taken in account under cygwin).
7429 * src/text2.C (InsertString[AB]): make sure that we do not try to
7430 read characters past the string length.
7432 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7434 * lib/doc/LaTeXConfig.lyx.in,
7435 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
7437 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
7438 file saying who created them and when this heppened; this is
7439 useless and annoys tools like cvs.
7441 * lib/layouts/g-brief-{en,de}.layout,
7442 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
7443 from Thomas Hartkens <thomas@hartkens.de>.
7445 * src/{insets,mathed}/Makefile.am: do not declare an empty
7446 LDFLAGS, so that it can be set at configure time (useful on Irix
7449 * lib/reLyX/configure.in: make sure that the prefix is set
7450 correctly in LYX_DIR.
7452 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7454 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
7455 be used by 'command-sequence' this allows to bind a key to a
7456 sequence of LyX-commands
7457 (Example: 'command-sequence math-insert alpha; math-insert beta;")
7459 * src/LyXAction.C: add "command-sequence"
7461 * src/LyXFunction.C: handling of "command-sequence"
7463 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
7464 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
7466 * src/lyxserver.C, src/minibuffer.C: Use this new interface
7468 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7470 * src/buffer.C (writeFile): Do not output a comment giving user
7471 and date at the beginning of a .lyx file. This is useless and
7472 annoys cvs anyway; update version number to 1.1.
7474 * src/Makefile.am (LYX_DIR): add this definition, so that a
7475 default path is hardcoded in LyX.
7477 * configure.in: Use LYX_GNU_GETTEXT.
7479 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
7480 AM_GNU_GETTEXT with a bug fixed.
7482 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
7484 * src/chset.C: add "using std::ifstream;" to please dec cxx.
7486 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
7487 which is used to point to LyX data is now LYX_DIR_11x.
7489 * lyx.man: convert to a unix text file; small updates.
7491 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7493 * src/support/LSubstring.[Ch]: made the second arg of most of the
7494 constructors be a const reference.
7496 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
7499 * src/support/lyxstring.[Ch] (swap): added missing member function
7500 and specialization of swap(str, str);
7502 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
7504 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
7505 trace of the old one.
7507 * src/undo.[Ch]: made the undostack use std::list to store undo's in
7508 put the member definitions in undo.C.
7510 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
7511 NEW_TEXT and have now only code that was included when this was
7514 * src/intl.C (LCombo): use static_cast
7516 (DispatchCallback): ditto
7518 * src/definitions.h: removed whole file
7520 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
7522 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
7523 parsing and stores in a std:map. a regex defines the file format.
7524 removed unneeded members.
7526 * src/bufferparams.h: added several enums from definitions.h here.
7527 Removed unsused destructor. Changed some types to use proper enum
7528 types. use block to have the temp_bullets and user_defined_bullets
7529 and to make the whole class assignable.
7531 * src/bufferparams.C (Copy): removed this functions, use a default
7534 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
7537 * src/buffer.C (readLyXformat2): commend out all that have with
7538 oldpapersize to do. also comment out all that hve to do with
7539 insetlatex and insetlatexdel.
7540 (setOldPaperStuff): commented out
7542 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
7544 * src/LyXAction.C: remove use of inset-latex-insert
7546 * src/mathed/math_panel.C (button_cb): use static_cast
7548 * src/insets/Makefile.am (insets_o_SOURCES): removed
7551 * src/support/lyxstring.C (helper): use the unsigned long
7552 specifier, UL, instead of a static_cast.
7554 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
7556 * src/support/block.h: new file. to be used as a c-style array in
7557 classes, so that the class can be assignable.
7559 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7561 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
7562 NULL, make sure to return an empty string (it is not possible to
7563 set a string to NULL).
7565 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7567 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
7569 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
7571 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
7572 link line, so that Irix users (for example) can set it explicitely to
7575 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
7576 it can be overidden at make time (static or dynamic link, for
7579 * src/vc-backend.C, src/LaTeXFeatures.h,
7580 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
7581 statements to bring templates to global namespace.
7583 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7585 * src/support/lyxstring.C (operator[] const): make it standard
7588 * src/minibuffer.C (Init): changed to reflect that more
7589 information is given from the lyxvc and need not be provided here.
7591 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
7593 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
7595 * src/LyXView.C (UpdateTimerCB): use static_cast
7596 (KeyPressMask_raw_callback): ditto
7598 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
7599 buffer_, a lot of changes because of this. currentBuffer() ->
7600 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
7601 also changes to other files because of this.
7603 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7605 * src/vc-backend.[Ch]: new files. The backends for vc handling,
7606 have no support for RCS and partial support for CVS, will be
7609 * src/insets/ several files: changes because of function name
7610 changes in Bufferview and LyXView.
7612 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
7614 * src/support/LSubstring.[Ch]: new files. These implement a
7615 Substring that can be very convenient to use. i.e. is this
7617 string a = "Mary had a little sheep";
7618 Substring(a, "sheep") = "lamb";
7619 a is now "Mary has a little lamb".
7621 * src/support/LRegex.[Ch]: a regex class that can be used to pick
7622 out patterns and subpatterns of strings. It is used by LSubstring
7623 and also by vc-backend.C
7625 * src/support/lyxstring.C: went over all the assertions used and
7626 tried to correct the wrong ones and flag which of them is required
7627 by the standard. some bugs found because of this. Also removed a
7628 couple of assertions.
7630 * src/support/Makefile.am (libsupport_a_SOURCES): added
7631 LSubstring.[Ch] and LRegex.[Ch]
7633 * src/support/FileInfo.h: have struct stat buf as an object and
7634 not a pointer to one, some changes because of this.
7636 * src/LaTeXFeatures.C (getTClassPreamble): also use the
7637 information in layout when adding the layouts preamble to the
7640 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
7643 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
7644 because of bug in OS/2.
7646 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7648 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
7649 \verbatim@font instead of \ttfamily, so that it can be redefined.
7651 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
7652 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
7653 src/layout.h, src/text2.C: add 'using' directive to bring the
7654 STL templates we need from the std:: namespace to the global one.
7655 Needed by DEC cxx in strict ansi mode.
7657 * src/support/LIstream.h,src/support/LOstream.h,
7658 src/support/lyxstring.h,src/table.h,
7659 src/lyxlookup.h: do not include <config.h> in header
7660 files. This should be done in the .C files only.
7662 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
7666 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7668 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
7669 from Kayvan to fix the tth invokation.
7671 * development/lyx.spec.in: updates from Kayvan to reflect the
7672 changes of file names.
7674 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7676 * src/text2.C (InsertStringB): use std::copy
7677 (InsertStringA): use std::copy
7679 * src/bufferlist.C: use a vector to store the buffers in. This is
7680 an internal change and should not affect any other thing.
7682 * src/BufferView.C (waitForX): use XSync instead of the lengthy
7685 * src/text.C (Fill): fix potential bug, one off bug.
7687 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7689 * src/Makefile.am (lyx_main.o): add more files it depends on.
7691 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
7693 * src/support/lyxstring.C: use size_t for the reference count,
7694 size, reserved memory and xtra.
7695 (internal_compare): new private member function. Now the compare
7696 functions should work for std::strings that have embedded '\0'
7698 (compare): all compare functions rewritten to use
7701 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7703 * src/support/lyxstring.C (compare): pass c_str()
7704 (compare): pass c_str
7705 (compare): pass c_str
7707 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7709 * src/support/DebugStream.C: <config.h> was not included correctly.
7711 * lib/configure: forgot to re-generate it :( I'll make this file
7712 auto generated soon.
7714 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7716 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
7719 * src/support/lyxstring.C: some changes from length() to rep->sz.
7720 avoids a function call.
7722 * src/support/filetools.C (SpaceLess): yet another version of the
7723 algorithm...now per Jean-Marc's suggestions.
7725 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7727 * src/layout.C (less_textclass_desc): functor for use in sorting
7729 (LyXTextClass::Read): sort the textclasses after reading.
7731 * src/support/filetools.C (SpaceLess): new version of the
7732 SpaceLess functions. What problems does this one give? Please
7735 * images/banner_bw.xbm: made the arrays unsigned char *
7737 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7739 * src/support/lyxstring.C (find): remove bogus assertion in the
7740 two versions of find where this has not been done yet.
7742 * src/support/lyxlib.h: add missing int return type to
7745 * src/menus.C (ShowFileMenu): disable exporting to html if no
7746 html export command is present.
7748 * config/lib_configure.m4: add a test for an HTML converter. The
7749 programs checked for are, in this order: tth, latex2html and
7752 * lib/configure: generated from config/lib_configure.m4.
7754 * src/lyxfunc.C (Dispatch): update and improve the execution of an
7755 html converter. The parameters are now passed through $$FName and
7756 $$OutName, instead of standard input/output.
7758 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
7760 * lib/lyxrc.example: update description of \html_command.
7761 add "quotes" around \screen_font_xxx font setting examples to help
7762 people who use fonts with spaces in their names.
7764 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7766 * Distribution files: updates for v1.1.2
7768 * src/support/lyxstring.C (find): remove bogus assert and return
7769 npos for the same condition.
7771 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7773 * added patch for OS/2 from SMiyata.
7775 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7777 * src/text2.C (CutSelection): make space_wrapped a bool
7778 (CutSelection): dont declare int i until we have to.
7779 (alphaCounter): return a char const *.
7781 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7783 * src/support/syscall.C (Systemcalls::kill):
7784 src/support/filetools.C (PutEnv, PutEnvPath):
7785 src/lyx_cb.C (addNewlineAndDepth):
7786 src/FontInfo.C (FontInfo::resize): condition some #warning
7787 directives with WITH_WARNINGS.
7790 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7792 * src/layout.[Ch] + several files: access to class variables
7793 limited and made accessor functions instead a lot of code changed
7794 becuase of this. Also instead of returning pointers often a const
7795 reference is returned instead.
7797 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
7799 * src/Makefile.am (dist-hook): added used to remove the CVS from
7800 cheaders upon creating a dist
7801 (EXTRA_DIST): added cheaders
7803 * src/support/lstrings.C (tostr(char)): fix it to handle param as
7804 a character not as a small integer.
7806 * src/support/lyxstring.C (find): removed Assert and added i >=
7807 rep->sz to the first if.
7809 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7811 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
7812 src/LyXView.C src/buffer.C src/bufferparams.C
7813 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
7814 src/text2.C src/insets/insetinclude.C:
7815 lyxlayout renamed to textclasslist.
7817 * src/layout.C: some lyxerr changes.
7819 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
7820 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
7821 (LyXLayoutList): removed all traces of this class.
7822 (LyXTextClass::Read): rewrote LT_STYLE
7823 (LyXTextClass::hasLayout): new function
7824 (LyXTextClass::GetLayout): rewritten to return an iterator + has
7825 both const and nonconst version.
7826 (LyXTextClass::delete_layout): new function.
7827 (LyXTextClassList::Style): bug fix. do the right thing if layout
7829 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
7830 (LyXTextClassList::NameOfLayout): ditto
7831 (LyXTextClassList::Load): ditto
7833 * src/buffer.C (makeLaTeXFile): new access to layoutlist
7835 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
7837 * src/LyXAction.C (LookupFunc): added a workaround for sun
7838 compiler, on the other hand...we don't know if the current code
7839 compiles on sun at all...
7841 * src/support/filetools.C (CleanupPath): subst fix
7843 * src/insets/insetbib.C (delDatabase): subst fix, this looks
7846 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
7847 complained about this one?
7849 * src/insets/insetinclude.C (Latex): subst fix
7851 * src/insets/insetbib.C (getKeys): subst fix
7853 * src/LyXSendto.C (SendtoApplyCB): subst fix
7855 * src/lyx_main.C (init): subst fix
7857 * src/layout.C (Read): subst fix
7859 * src/lyx_sendfax_main.C (button_send): subst fix
7861 * src/buffer.C (RoffAsciiTable): subst fix
7863 * src/lyx_cb.C (MenuFax): subst fix
7864 (PrintApplyCB): subst fix
7866 1999-10-26 Juergen Vigna <jug@sad.it>
7868 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
7870 (Read): Cleaned up this code so now we read only format vestion >= 5
7872 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7874 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
7875 come nobody has complained about this one?
7877 * src/insets/insetinclude.C (Latex): subst fix
7879 * src/insets/insetbib.C (getKeys): subst fix
7881 * src/lyx_main.C (init): subst fix
7883 * src/layout.C (Read): subst fix
7885 * src/buffer.C (RoffAsciiTable): subst fix
7887 * src/lyx_cb.C (MenuFax): subst fix.
7889 * src/layout.[hC] + some other files: rewrote to use
7890 std::container to store textclasses and layouts in.
7891 Simplified, removed a lot of code. Make all classes
7892 assignable. Further simplifications and review of type
7893 use still to be one.
7895 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
7896 lastfiles to create the lastfiles partr of the menu.
7898 * src/lastfiles.[Ch]: rewritten to use deque to store the
7899 lastfiles in. Uses fstream for reading and writing. Simplifies
7902 * src/support/syscall.C: remove explicit cast.
7904 * src/BufferView.C (CursorToggleCB): removed code snippets that
7906 use explicat C++ style casts instead of C style casts. also use
7907 u_vdata instea of passing pointers in longs.
7909 * src/PaperLayout.C: removed code snippets that were commented out.
7911 * src/lyx_gui_misc.C: removed code snippets that were commented out.
7913 * src/lyx_main.C: removed code snippets that wer commented out.
7915 * src/paragraph.C: removed code snippets that were commented out.
7917 * src/lyxvc.C (logClose): use static_cast
7919 (viewLog): remove explicit cast to void*
7920 (showLog): removed old commented code
7922 * src/menus.C: use static_cast instead of C style casts. use
7923 u_vdata instead of u_ldata. remove explicit cast to (long) for
7924 pointers. Removed old code that was commented out.
7926 * src/insets/inset.C: removed old commented func
7928 * src/insets/insetref.C (InsetRef): removed old code that had been
7929 commented out for a long time.
7931 (escape): removed C style cast
7933 * src/insets/insetlatexaccent.C (Draw): removed old commented code
7935 * src/insets/insetlatex.C (Draw): removed old commented code
7936 (Read): rewritten to use string
7938 * src/insets/insetlabel.C (escape): removed C style cast
7940 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
7942 * src/insets/insetindex.C: use static_cast and u_vdata, removed
7945 * src/insets/insetinclude.h: removed a couple of stupid bools
7947 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
7948 (Clone): remove C style cast
7949 (getKeys): changed list to lst because of std::list
7951 * src/insets/inseterror.C (Draw): removed som old commented code.
7953 * src/insets/insetcommand.C (Draw): removed some old commented code.
7955 * src/insets/insetbib.C (bibitem_cb): removed code that has been
7956 commented out forever.
7957 (bibitem_cb): use static_cast instead of C style cast
7958 use of vdata changed to u_vdata.
7960 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
7962 (CloseUrlCB): use static_cast instead of C style cast.
7963 (CloseUrlCB): added a fl_free form...it seemed to be missing.
7965 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
7966 (C_InsetInfo_CloseInfoCB): forward the ob parameter
7967 (CloseInfoCB): static_cast from ob->u_vdata instead.
7968 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
7971 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
7972 (C_InsetError_CloseErrorCB): forward the ob parameter
7973 (CloseErrorCB): static_cast from ob->u_vdata instead.
7975 * src/vspace.h: include LString.h since we use string in this class.
7977 * src/vspace.C (lyx_advance): changed name from advance because of
7978 nameclash with stl. And since we cannot use namespaces yet...I
7979 used a lyx_ prefix instead. Expect this to change when we begin
7982 * src/BufferView.[Ch] (BufferView::~BufferView): removed
7984 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
7985 and removed now defunct constructor and deconstructor.
7987 * src/BufferView.h: have backstack as a object not as a pointer.
7988 removed initialization from constructor. added include for BackStack
7990 * development/lyx.spec.in (%build): add CFLAGS also.
7992 * src/screen.C (drawFrame): removed another warning.
7994 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7996 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
7997 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
7998 README and ANNOUNCE a bit for the next release. More work is
8001 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
8002 unbreakable if we are in freespacing mode (LyX-Code), but not in
8005 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8007 * src/BackStack.h: fixed initialization order in constructor
8009 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
8011 * acinclude.m4 (VERSION): new rules for when a version is
8012 development, added also a variable for prerelease.
8013 (warnings): we set with_warnings=yes for prereleases
8014 (lyx_opt): prereleases compile with same optimization as development
8015 (CXXFLAGS): only use pedantic if we are a development version
8017 * src/BufferView.C (restorePosition): don't do anything if the
8020 * src/BackStack.h: added member empty, use this to test if there
8021 is anything to pop...
8023 1999-10-25 Juergen Vigna <jug@sad.it>
8026 * forms/layout_forms.fd +
8027 * forms/latexoptions.fd +
8028 * lyx.fd: changed for various form resize issues
8030 * src/mathed/math_panel.C +
8031 * src/insets/inseterror.C +
8032 * src/insets/insetinfo.C +
8033 * src/insets/inseturl.C +
8034 * src/insets/inseturl.h +
8037 * src/PaperLayout.C +
8038 * src/ParagraphExtra.C +
8039 * src/TableLayout.C +
8041 * src/layout_forms.C +
8048 * src/menus.C: fixed various resize issues. So now forms can be
8049 resized savely or not be resized at all.
8051 * forms/form_url.fd +
8052 * src/insets/form_url.[Ch]: added because it's cleaner and easier
8055 * src/insets/Makefile.am: added files form_url.[Ch]
8057 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8059 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
8060 (and presumably 6.2).
8062 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
8063 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
8064 remaining static member callbacks.
8066 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
8069 * src/support/lyxstring.h: declare struct Srep as friend of
8070 lyxstring, since DEC cxx complains otherwise.
8072 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8074 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8076 * src/LaTeX.C (run): made run_bibtex also depend on files with
8078 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
8079 are put into the dependency file.
8081 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
8082 the code has shown itself to work
8083 (create_ispell_pipe): removed another warning, added a comment
8086 * src/minibuffer.C (ExecutingCB): removed code that has been
8087 commented out a long time
8089 * src/lyxfunc.C (processKeyEvent): removed some very old commented
8090 out code + a warning.
8092 * src/support/lyxstring.h: comment out the three private
8093 operators, when compiling with string ansi conforming compilers
8096 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
8098 (pixmapFromBitmapData): change type of bdata to be unsigned char *
8099 (pixmapFromBitmapData): add a reinterpret_cast in the call to
8102 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
8105 * src/mathed/math_panel.C (create_math_panel): remove explicit
8108 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
8111 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
8112 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
8113 to XCreatePixmapFromBitmapData
8114 (fl_set_bmtable_data): change the last argument to be unsigned
8116 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
8117 and bh to be unsigned int, remove explicit casts in call to
8118 XReadBitmapFileData.
8120 * images/arrows.xbm: made the arrays unsigned char *
8121 * images/varsz.xbm: ditto
8122 * images/misc.xbm: ditto
8123 * images/greek.xbm: ditto
8124 * images/dots.xbm: ditto
8125 * images/brel.xbm: ditto
8126 * images/bop.xbm: ditto
8128 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
8130 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
8131 (LYX_PROG_CXX): added -pedantic to g++ compile options when
8132 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
8134 (LYX_CXX_CHEADERS): added <clocale> to the test.
8136 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
8138 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
8140 * src/support/lyxstring.C (append): fixed something that must be a
8141 bug, rep->assign was used instead of rep->append.
8143 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
8146 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
8147 lyx insert double chars. Fix spotted by Kayvan.
8149 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8151 * Fixed the tth support. I messed up with the Emacs patch apply feature
8152 and omitted the changes in lyxrc.C.
8154 1999-10-22 Juergen Vigna <jug@sad.it>
8156 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
8158 * src/lyx_cb.C (MenuInsertRef) +
8159 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
8160 the form cannot be resized under it limits (fixes a segfault)
8162 * src/lyx.C (create_form_form_ref) +
8163 * forms/lyx.fd: Changed Gravity on name input field so that it is
8166 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8168 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
8169 <ostream> and <istream>.
8171 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
8172 whether <fstream> provides the latest standard features, or if we
8173 have an oldstyle library (like in egcs).
8174 (LYX_CXX_STL_STRING): fix the test.
8176 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
8177 code on MODERN_STL_STREAM.
8179 * src/support/lyxstring.h: use L{I,O}stream.h.
8181 * src/support/L{I,O}stream.h: new files, designed to setup
8182 correctly streams for our use
8183 - includes the right header depending on STL capabilities
8184 - puts std::ostream and std::endl (for LOStream.h) or
8185 std::istream (LIStream.h) in toplevel namespace.
8187 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8189 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
8190 was a bib file that had been changed we ensure that bibtex is run.
8191 (runBibTeX): enhanced to extract the names of the bib files and
8192 getting their absolute path and enter them into the dep file.
8193 (findtexfile): static func that is used to look for tex-files,
8194 checks for absolute patchs and tries also with kpsewhich.
8195 Alternative ways of finding the correct files are wanted. Will
8197 (do_popen): function that runs a command using popen and returns
8198 the whole output of that command in a string. Should be moved to
8201 * src/DepTable.[Ch] (extchanged): new function that returns true if a
8202 file with extension ext has changed.
8204 * src/insets/figinset.C: added ifdef guards around the fl_free
8205 code that jug commented out. Now it is commented out when
8206 compiling with XForms == 0.89.
8208 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
8209 to lyxstring.C, and only keep a forward declaration in
8210 lyxstring.h. Simplifies the header file a bit and should help a
8211 bit on compile time too. Also changes to Srep will not mandate a
8212 recompile of code just using string.
8213 (~lyxstring): definition moved here since it uses srep.
8214 (size): definition moved here since it uses srep.
8216 * src/support/lyxstring.h: removed a couple of "inline" that should
8219 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8221 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
8224 1999-10-21 Juergen Vigna <jug@sad.it>
8226 * src/table.C (SetPWidth): Just a small fix so the alignment is not
8227 set to left if I just remove the width entry (or it is empty).
8229 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
8230 paragraph when having dummy paragraphs.
8232 1999-10-20 Juergen Vigna <jug@sad.it>
8234 * src/insets/figinset.C: just commented some fl_free_form calls
8235 and added warnings so that this calls should be activated later
8236 again. This avoids for now a segfault, but we have a memory leak!
8238 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
8239 'const char * argument' to 'string argument', this should
8240 fix some Asserts() in lyxstring.C.
8242 * src/lyxfunc.h: Removed the function argAsString(const char *)
8243 as it is not used anymore.
8245 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8247 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
8250 * src/Literate.h: some funcs moved from public to private to make
8251 interface clearer. Unneeded args removed.
8253 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
8255 (scanBuildLogFile): ditto
8257 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
8258 normal TeX Error. Still room for improvement.
8260 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
8262 * src/buffer.C (insertErrors): changes to make the error
8263 desctription show properly.
8265 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
8268 * src/support/lyxstring.C (helper): changed to use
8269 sizeof(object->rep->ref).
8270 (operator>>): changed to use a pointer instead.
8272 * src/support/lyxstring.h: changed const reference & to value_type
8273 const & lets see if that helps.
8275 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8277 * Makefile.am (rpmdist): fixed to have non static package and
8280 * src/support/lyxstring.C: removed the compilation guards
8282 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
8285 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
8286 conditional compile of lyxstring.Ch
8288 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
8289 stupid check, but it is a lot better than the bastring hack.
8290 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
8292 * several files: changed string::erase into string::clear. Not
8295 * src/chset.C (encodeString): use a char temporary instead
8297 * src/table.C (TexEndOfCell): added tostr around
8298 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
8299 (TexEndOfCell): ditto
8300 (TexEndOfCell): ditto
8301 (TexEndOfCell): ditto
8302 (DocBookEndOfCell): ditto
8303 (DocBookEndOfCell): ditto
8304 (DocBookEndOfCell): ditto
8305 (DocBookEndOfCell): ditto
8307 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
8309 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
8311 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
8312 (MenuBuildProg): added tostr around ret
8313 (MenuRunChktex): added tostr around ret
8314 (DocumentApplyCB): added tostr around ret
8316 * src/chset.C (encodeString): added tostr around t->ic
8318 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
8319 (makeLaTeXFile): added tostr around tocdepth
8320 (makeLaTeXFile): added tostr around ftcound - 1
8322 * src/insets/insetbib.C (setCounter): added tostr around counter.
8324 * src/support/lyxstring.h: added an operator+=(int) to catch more
8327 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
8328 (lyxstring): We DON'T allow NULL pointers.
8330 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8332 * src/mathed/math_macro.C (MathMacroArgument::Write,
8333 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
8334 when writing them out.
8336 * src/LString.C: remove, since it is not used anymore.
8338 * src/support/lyxstring.C: condition the content to
8339 USE_INCLUDED_STRING macro.
8341 * src/mathed/math_symbols.C, src/support/lstrings.C,
8342 src/support/lyxstring.C: add `using' directive to specify what
8343 we need in <algorithm>. I do not think that we need to
8344 conditionalize this, but any thought is appreciated.
8346 * many files: change all callback functions to "C" linkage
8347 functions to please strict C++ compilers like DEC cxx 6.1 in mode
8348 strict_ansi. Those who were static are now global.
8349 The case of callbacks which are static class members is
8350 trickier, since we have to make C wrappers around them (see
8351 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
8352 did not finish this yet, since it defeats the purpose of
8353 encapsulation, and I am not sure what the best route is.
8355 1999-10-19 Juergen Vigna <jug@sad.it>
8357 * src/support/lyxstring.C (lyxstring): we permit to have a null
8358 pointer as assignment value and just don't assign it.
8360 * src/vspace.C (nextToken): corrected this function substituting
8361 find_first(_not)_of with find_last_of.
8363 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
8364 (TableOptCloseCB) (TableSpeCloseCB):
8365 inserted fl_set_focus call for problem with fl_hide_form() in
8368 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8370 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
8373 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8375 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
8376 LyXLex::next() and not eatline() to get its argument.
8378 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8380 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
8381 instead, use fstreams for io of the depfile, removed unneeded
8382 functions and variables.
8384 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
8385 vector instead, removed all functions and variables that is not in
8388 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8390 * src/buffer.C (insertErrors): use new interface to TeXError
8392 * Makefile.am (rpmdist): added a rpmdist target
8394 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
8395 per Kayvan's instructions.
8397 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8399 * src/Makefile.am: add a definition for localedir, so that locales
8400 are found after installation (Kayvan)
8402 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8404 * development/.cvsignore: new file.
8406 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8408 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
8409 C++ compiler provides wrappers for C headers and use our alternate
8412 * configure.in: use LYX_CXX_CHEADERS.
8414 * src/cheader/: new directory, populated with cname headers from
8415 libstdc++-2.8.1. They are a bit old, but probably good enough for
8416 what we want (support compilers who lack them).
8418 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
8419 from includes. It turns out is was stupid.
8421 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8423 * lib/Makefile.am (install-data-local): forgot a ';'
8424 (install-data-local): forgot a '\'
8425 (libinstalldirs): needed after all. reintroduced.
8427 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8429 * configure.in (AC_OUTPUT): added lyx.spec
8431 * development/lyx.spec: removed file
8433 * development/lyx.spec.in: new file
8435 * po/*.po: merged with lyx.pot becuase of make distcheck
8437 * lib/Makefile.am (dist-hook): added dist-hook so that
8438 documentation files will be included when doing a make
8439 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
8440 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
8442 more: tried to make install do the right thing, exclude CVS dirs
8445 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
8446 Path would fit in more nicely.
8448 * all files that used to use pathstack: uses now Path instead.
8449 This change was a lot easier than expected.
8451 * src/support/path.h: new file
8453 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
8455 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
8457 * src/support/lyxstring.C (getline): Default arg was given for
8460 * Configure.cmd: removed file
8462 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8464 * src/support/DebugStream.[Ch]: remove the explicit std:: before
8465 streams classes and types, add the proper 'using' statements when
8466 MODERN_STL is defined.
8468 * src/debug.h: move the << operator definition after the inclusion
8471 * src/support/filetools.C: include "LAssert.h", which is needed
8474 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
8477 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
8478 include "debug.h" to define a proper ostream.
8480 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8482 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
8483 method to the SystemCall class which can kill a process, but it's
8484 not fully implemented yet.
8486 * src/*.C: Changed Systemcalls::Startscript() to startscript()
8488 * src/support/FileInfo.h: Better documentation
8490 * src/lyxfunc.C: Added support for buffer-export html
8492 * src/menus.C: Added Export->As HTML...
8494 * lib/bind/*.bind: Added short-cut for buffer-export html
8496 * src/lyxrc.*: Added support for new \tth_command
8498 * lib/lyxrc.example: Added stuff for new \tth_command
8500 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8502 * lib/Makefile.am (IMAGES): removed images/README
8503 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
8504 installes in correct place. Check permisions is installed
8507 * src/LaTeX.C: some no-op changes moved declaration of some
8510 * src/LaTeX.h (LATEX_H): changed include guard name
8512 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8514 * lib/reLyX/Makefile.am: install noweb2lyx.
8516 * lib/Makefile.am: install configure.
8518 * lib/reLyX/configure.in: declare a config aux dir; set package
8519 name to lyx (not sure what the best solution is); generate noweb2lyx.
8521 * lib/layouts/egs.layout: fix the bibliography layout.
8523 1999-10-08 Jürgen Vigna <jug@sad.it>
8525 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
8526 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
8527 it returned without continuing to search the path.
8529 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8531 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
8532 also fixes a bug. It is not allowed to do tricks with std::strings
8533 like: string a("hei"); &a[e]; this will not give what you
8534 think... Any reason for the complexity in this func?
8536 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
8538 * Updated README and INSTALL a bit, mostly to check that my
8539 CVS rights are correctly set up.
8541 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8543 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
8544 does not allow '\0' chars but lyxstring and std::string does.
8546 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8548 * autogen.sh (AUTOCONF): let the autogen script create the
8549 POTFILES.in file too. POTFILES.in should perhaps now not be
8550 included in the cvs module.
8552 * some more files changed to use C++ includes instead of C ones.
8554 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
8556 (Reread): added tostr to nlink. buggy output otherwise.
8557 (Reread): added a string() around szMode when assigning to Buffer,
8558 without this I got a log of garbled info strings.
8560 * acconfig.h: commented out the PTR_AS_INT macros. They should not
8563 * I have added several ostream & operator<<(ostream &, some_type)
8564 functions. This has been done to avoid casting and warnings when
8565 outputting enums to lyxerr. This as thus eliminated a lot of
8566 explicit casts and has made the code clearer. Among the enums
8567 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
8568 mathed enums, some font enum the Debug::type enum.
8570 * src/support/lyxstring.h (clear): missing method. equivalent of
8573 * all files that contained "stderr": rewrote constructs that used
8574 stderr to use lyxerr instead. (except bmtable)
8576 * src/support/DebugStream.h (level): and the passed t with
8577 Debug::ANY to avoid spurious bits set.
8579 * src/debug.h (Debug::type value): made it accept strings of the
8582 * configure.in (Check for programs): Added a check for kpsewhich,
8583 the latex generation will use this later to better the dicovery of
8586 * src/BufferView.C (create_view): we don't need to cast this to
8587 (void*) that is done automatically.
8588 (WorkAreaButtonPress): removed some dead code.
8590 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8592 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
8593 is not overwritten when translated (David Sua'rez de Lis).
8595 * lib/CREDITS: Added David Sua'rez de Lis
8597 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
8599 * src/bufferparams.C (BufferParams): default input encoding is now
8602 * acinclude.m4 (cross_compiling): comment out macro
8603 LYX_GXX_STRENGTH_REDUCE.
8605 * acconfig.h: make sure that const is not defined (to empty) when
8606 we are compiling C++. Remove commented out code using SIZEOF_xx
8609 * configure.in : move the test for const and inline as late as
8610 possible so that these C tests do not interefere with C++ ones.
8611 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
8612 has not been proven.
8614 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8616 * src/table.C (getDocBookAlign): remove bad default value for
8619 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
8621 (ShowFileMenu2): ditto.
8623 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
8626 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8628 * Most files: finished the change from the old error code to use
8629 DebugStream for all lyxerr debugging. Only minor changes remain
8630 (e.g. the setting of debug levels using strings instead of number)
8632 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8634 * src/layout.C (Add): Changed to use compare_no_case instead of
8637 * src/FontInfo.C: changed loop variable type too string::size_type.
8639 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8641 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
8642 set ETAGS_ARGS to --c++
8644 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
8646 * src/table.C (DocBookEndOfCell): commented out two unused variables
8648 * src/paragraph.C: commented out four unused variables.
8650 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
8651 insed a if clause with type string::size_type.
8653 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
8656 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
8658 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
8659 variable, also changed loop to go from 0 to lenght + 1, instead of
8660 -1 to length. This should be correct.
8662 * src/LaTeX.C (scanError): use string::size_type as loop variable
8665 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
8666 (l.896) since y_tmp and row was not used anyway.
8668 * src/insets/insetref.C (escape): use string::size_type as loop
8671 * src/insets/insetquotes.C (Width): use string::size_type as loop
8673 (Draw): use string::size_type as loop variable type.
8675 * src/insets/insetlatexaccent.C (checkContents): use
8676 string::size_type as loop variable type.
8678 * src/insets/insetlabel.C (escape): use string::size_type as loop
8681 * src/insets/insetinfo.C: added an extern for current_view.
8683 * src/insets/insetcommand.C (scanCommand): use string::size_type
8684 as loop variable type.
8686 * most files: removed the RCS tags. With them we had to recompile
8687 a lot of files after a simple cvs commit. Also we have never used
8688 them for anything meaningful.
8690 * most files: tags-query-replace NULL 0. As adviced several plases
8691 we now use "0" instead of "NULL" in our code.
8693 * src/support/filetools.C (SpaceLess): use string::size_type as
8696 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8698 * src/paragraph.C: fixed up some more string stuff.
8700 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8702 * src/support/filetools.h: make modestr a std::string.
8704 * src/filetools.C (GetEnv): made ch really const.
8706 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
8707 made code that used these use max/min from <algorithm> instead.
8709 * changed several c library include files to their equivalent c++
8710 library include files. All is not changed yet.
8712 * created a support subdir in src, put lyxstring and lstrings
8713 there + the extra files atexit, fileblock, strerror. Created
8714 Makefile.am. edited configure.in and src/Makefile.am to use this
8715 new subdir. More files moved to support.
8717 * imported som of the functions from repository lyx, filetools
8719 * ran tags-query-replace on LString -> string, corrected the bogus
8720 cases. Tried to make use of lstrings.[hC], debugged a lot. There
8721 is still some errors in there. This is errors where too much or
8722 too litle get deleted from strings (string::erase, string::substr,
8723 string::replace), there can also be some off by one errors, or
8724 just plain wrong use of functions from lstrings. Viewing of quotes
8727 * LyX is now running fairly well with string, but there are
8728 certainly some bugs yet (see above) also string is quite different
8729 from LString among others in that it does not allow null pointers
8730 passed in and will abort if it gets any.
8732 * Added the revtex4 files I forgot when setting up the repository.
8734 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8736 * All over: Tried to clean everything up so that only the files
8737 that we really need are included in the cvs repository.
8738 * Switched to use automake.
8739 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
8740 * Install has not been checked.
8742 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8744 * po/pt.po: Three errors:
8745 l.533 and l.538 format specification error
8746 l. 402 duplicate entry, I just deleted it.