1 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
4 destructor. Don't definde if you don't need it
5 (processEvents): made static, non-blocking events processing for
7 (runTime): static method. event loop for xforms
8 * similar as above for kde and gnome.
10 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
12 (runTime): new method calss the real frontends runtime func.
14 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
16 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
18 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
20 2000-08-16 Juergen Vigna <jug@sad.it>
22 * src/lyx_gui.C (runTime): added GUII RunTime support.
24 * src/frontends/Makefile.am:
25 * src/frontends/GUIRunTime.[Ch]:
26 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
27 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
28 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
30 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
32 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
33 as this is already set in ${FRONTEND_INCLUDE} if needed.
35 * configure.in (CPPFLAGS): setting the include dir for the frontend
36 directory and don't set FRONTEND=xforms for now as this is executed
39 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
41 * src/frontends/kde/Makefile.am:
42 * src/frontends/kde/FormUrl.C:
43 * src/frontends/kde/FormUrl.h:
44 * src/frontends/kde/formurldialog.h:
45 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
47 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
49 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
51 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
53 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
56 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
58 * src/WorkArea.C (work_area_handler): more work to get te
59 FL_KEYBOARD to work with xforms 0.88 too, please test.
61 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
63 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
65 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
68 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
70 * src/Timeout.h: remove Qt::emit hack.
72 * several files: changes to allo doc++ compilation
74 * src/lyxfunc.C (processKeySym): new method
75 (processKeyEvent): comment out if FL_REVISION < 89
77 * src/WorkArea.C: change some debugging levels.
78 (WorkArea): set wantkey to FL_KEY_ALL
79 (work_area_handler): enable the FL_KEYBOARD clause, this enables
80 clearer code and the use of compose with XForms 0.89. Change to
81 use signals instead of calling methods in bufferview directly.
83 * src/Painter.C: change some debugging levels.
85 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
88 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
89 (workAreaKeyPress): new method
91 2000-08-14 Juergen Vigna <jug@sad.it>
93 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
95 * config/kde.m4: addes some features
97 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
98 include missing xforms dialogs.
100 * src/Timeout.h: a hack to be able to compile with qt/kde.
102 * sigc++/.cvsignore: added acinclude.m4
104 * lib/.cvsignore: added listerros
106 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
107 xforms tree as objects are needed for other frontends.
109 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
110 linking with not yet implemented xforms objects.
112 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
114 2000-08-14 Baruch Even <baruch.even@writeme.com>
116 * src/frontends/xforms/FormGraphics.h:
117 * src/frontends/xforms/FormGraphics.C:
118 * src/frontends/xforms/RadioButtonGroup.h:
119 * src/frontends/xforms/RadioButtonGroup.C:
120 * src/insets/insetgraphics.h:
121 * src/insets/insetgraphics.C:
122 * src/insets/insetgraphicsParams.h:
123 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
124 instead of spaces, and various other indentation issues to make the
125 sources more consistent.
127 2000-08-14 Marko Vendelin <markov@ioc.ee>
129 * src/frontends/gnome/dialogs/diaprint.glade
130 * src/frontends/gnome/FormPrint.C
131 * src/frontends/gnome/FormPrint.h
132 * src/frontends/gnome/diaprint_callbacks.c
133 * src/frontends/gnome/diaprint_callbacks.h
134 * src/frontends/gnome/diaprint_interface.c
135 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
138 * src/frontends/gnome/dialogs/diainserturl.glade
139 * src/frontends/gnome/FormUrl.C
140 * src/frontends/gnome/FormUrl.h
141 * src/frontends/gnome/diainserturl_callbacks.c
142 * src/frontends/gnome/diainserturl_callbacks.h
143 * src/frontends/gnome/diainserturl_interface.c
144 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
147 * src/frontends/gnome/Dialogs.C
148 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
149 all other dialogs. Copy all unimplemented dialogs from Xforms
152 * src/frontends/gnome/support.c
153 * src/frontends/gnome/support.h: support files generated by Glade
157 * config/gnome.m4: Gnome configuration scripts
159 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
160 configure --help message
162 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
163 only if there are no events pendling in Gnome/Gtk. This enhances
164 the performance of menus.
167 2000-08-14 Allan Rae <rae@lyx.org>
169 * lib/Makefile.am: listerrors cleaning
171 * lib/listerrors: removed -- generated file
172 * acinclude.m4: ditto
173 * sigc++/acinclude.m4: ditto
175 * src/frontends/xforms/forms/form_citation.fd:
176 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
179 * src/frontends/xforms/forms/makefile: I renamed the `install` target
180 `updatesrc` and now we have a `test` target that does what `updatesrc`
181 used to do. I didn't like having an install target that wasn't related
184 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
185 on all except FormGraphics. This may yet happen. Followed by a major
186 cleanup including using FL_TRANSIENT for most of the dialogs. More
187 changes to come when the ButtonController below is introduced.
189 * src/frontends/xforms/ButtonController.h: New file for managing up to
190 four buttons on a dialog according to an externally defined policy.
191 * src/frontends/xforms/Makefile.am: added above
193 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
194 Apply and Cancel/Close buttons and everything in between and beyond.
195 * src/frontends/Makefile.am: added above.
197 * src/frontends/xforms/forms/form_preferences.fd:
198 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
199 and removed variable 'status' as a result. Fixed the set_minsize thing.
200 Use the new screen-font-update after checking screen fonts were changed
201 Added a "Restore" button to restore the original lyxrc values while
202 editing. This restores everything not just the last input changed.
203 That's still a tricky one. As is the "LyX: this shouldn't happen..."
205 * src/LyXAction.C: screen-font-update added for updating buffers after
206 screen font settings have been changed.
207 * src/commandtags.h: ditto
208 * src/lyxfunc.C: ditto
210 * forms/lyx.fd: removed screen fonts dialog.
211 * src/lyx_gui.C: ditto
212 * src/menus.[Ch]: ditto
213 * src/lyx.[Ch]: ditto
214 * src/lyx_cb.C: ditto + code from here moved to make
215 screen-font-update. And people wonder why progress on GUII is
216 slow. Look at how scattered this stuff was! It takes forever
219 * forms/fdfix.sh: Fixup the spacing after commas.
220 * forms/makefile: Remove date from generated files. Fewer clashes now.
221 * forms/bullet_forms.C.patch: included someones handwritten changes
223 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
224 once I've discovered why LyXRC was made noncopyable.
225 * src/lyx_main.C: ditto
227 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
229 * src/frontends/xforms/forms/fdfix.sh:
230 * src/frontends/xforms/forms/fdfixh.sed:
231 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
232 * src/frontends/xforms/Form*.[hC]:
233 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
234 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
235 provide a destructor for the struct FD_form_xxxx. Another version of
236 the set_[max|min]size workaround and a few other cleanups. Actually,
237 Angus' patch from 20000809.
239 2000-08-13 Baruch Even <baruch.even@writeme.com>
241 * src/insets/insetgraphics.C (Clone): Added several fields that needed
244 2000-08-11 Juergen Vigna <jug@sad.it>
246 * src/insets/insetgraphics.C (InsetGraphics): changing init
247 order because of warnings.
249 * src/frontends/xforms/forms/makefile: adding patching .C with
252 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
253 from .C.patch to .c.patch
255 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
256 order because of warning.
258 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
260 * src/frontends/Liason.C (setMinibuffer): new helper function
262 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
264 * src/lyxfunc.C (Dispatch): calling new Document-Layout
266 * lib/ui/default.ui: commented out PaperLayout entry
268 * src/frontends/xforms/form_document.[Ch]: new added files
270 * src/frontends/xforms/FormDocument.[Ch]: ditto
272 * src/frontends/xforms/forms/form_document.fd: ditto
274 * src/frontends/xforms/forms/form_document.C.patch: ditto
276 2000-08-10 Juergen Vigna <jug@sad.it>
278 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
279 (InsetGraphics): initialized cacheHandle to 0.
280 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
282 2000-08-10 Baruch Even <baruch.even@writeme.com>
284 * src/graphics/GraphicsCache.h:
285 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
286 correctly as a cache.
288 * src/graphics/GraphicsCacheItem.h:
289 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
292 * src/graphics/GraphicsCacheItem_pimpl.h:
293 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
296 * src/insets/insetgraphics.h:
297 * src/insets/insetgraphics.C: Changed from using a signal notification
298 to polling when image is not loaded.
300 2000-08-10 Allan Rae <rae@lyx.org>
302 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
303 that there are two functions that have to been taken out of line by
304 hand and aren't taken care of in the script. (Just a reminder note)
306 * sigc++/macros/*.h.m4: Updated as above.
308 2000-08-09 Juergen Vigna <jug@sad.it>
310 * src/insets/insettext.C (draw): small fix for clearing rectangle.
312 * src/insets/insettabular.C: make drawing of single cell smarter.
314 2000-08-09 Marko Vendelin <markov@ioc.ee>
315 * src/frontends/gnome/Menubar_pimpl.C
316 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
317 implementation: new files
319 * src/frontends/gnome/mainapp.C
320 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
323 * src/main.C: create Gnome main window
325 * src/frontends/xforms/Menubar_pimpl.h
326 * src/frontends/Menubar.C
327 * src/frontends/Menubar.h: added method Menubar::update that calls
328 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
330 * src/LyXView.C: calls Menubar::update to update the state
333 * src/frontends/gnome/Makefile.am: added new files
335 * src/frontends/Makefile.am: added frontend compiler options
337 2000-08-08 Juergen Vigna <jug@sad.it>
339 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
341 * src/bufferlist.C (close):
342 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
343 documents if exiting without saving.
345 * src/buffer.C (save): use removeAutosaveFile()
347 * src/support/filetools.C (removeAutosaveFile): new function.
349 * src/lyx_cb.C (MenuWrite): returns a bool now.
350 (MenuWriteAs): check if file could really be saved and revert to the
352 (MenuWriteAs): removing old autosavefile if existant.
354 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
355 before Goto toggle declaration, because of compiler warning.
357 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
359 * src/lyxfunc.C (MenuNew): small fix.
361 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
363 * src/bufferlist.C (newFile):
364 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
366 * src/lyxrc.C: added new_ask_filename tag
368 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
370 * src/lyx.fd: removed code pertaining to form_ref
371 * src/lyx.[Ch]: ditto
372 * src/lyx_cb.C: ditto
373 * src/lyx_gui.C: ditto
374 * src/lyx_gui_misc.C: ditto
376 * src/BufferView_pimpl.C (restorePosition): update buffer only
379 * src/commandtags.h (LFUN_REFTOGGLE): removed
380 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
381 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
382 (LFUN_REFBACK): renamed LFUN_REF_BACK
384 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
386 * src/lyxfunc.C (Dispatch): ditto.
387 InsertRef dialog is now GUI-independent.
389 * src/texrow.C: added using std::endl;
391 * src/insets/insetref.[Ch]: strip out large amounts of code.
392 The inset is now a container and this functionality is now
393 managed by a new FormRef dialog
395 * src/frontends/Dialogs.h (showRef, createRef): new signals
397 * src/frontends/xforms/FormIndex.[Ch],
398 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
399 when setting dialog's min/max size
400 * src/frontends/xforms/FormIndex.[Ch]: ditto
402 * src/frontends/xforms/FormRef.[Ch],
403 src/frontends/xforms/forms/form_ref.fd: new xforms
404 implementation of an InsetRef dialog
406 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
409 * src/graphics/XPM_Renderer.C (isImageFormatOK):
410 ios::nocreate is not part of the standard. Removed.
412 2000-08-07 Baruch Even <baruch.even@writeme.com>
414 * src/graphics/Renderer.h:
415 * src/graphics/Renderer.C: Added base class for rendering of different
416 image formats into Pixmaps.
418 * src/graphics/XPM_Renderer.h:
419 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
420 in a different class.
422 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
423 easily add support for other formats.
425 * src/insets/figinset.C: plugged a leak of an X resource.
427 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
429 * src/CutAndPaste.[Ch]: make all metods static.
431 * development/Code_rules/Rules: more work, added section on
432 Exceptions, and a References section.
434 * a lot of header files: work to make doc++ able to generate the
435 source documentation, some workarounds of doc++ problems. Doc++ is
436 now able to generate the documentation.
438 2000-08-07 Juergen Vigna <jug@sad.it>
440 * src/insets/insettabular.C (recomputeTextInsets): removed function
442 * src/tabular.C (SetWidthOfMulticolCell):
444 (calculate_width_of_column_NMC): fixed return value so that it really
445 only returns true if the column-width has changed (there where
446 problems with muliticolumn-cells in this column).
448 2000-08-04 Juergen Vigna <jug@sad.it>
450 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
451 also on the scrollstatus of the inset.
452 (workAreaMotionNotify): ditto.
454 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
456 2000-08-01 Juergen Vigna <jug@sad.it>
458 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
461 * src/LyXAction.C (init):
462 * src/insets/inset.C (LocalDispatch): added support for
465 * src/insets/inset.C (scroll): new functions.
467 * src/insets/insettext.C (removeNewlines): new function.
468 (SetAutoBreakRows): removes forced newlines in the text of the
469 paragraph if autoBreakRows is set to false.
471 * src/tabular.C (Latex): generates a parbox around the cell contents
474 * src/frontends/xforms/FormTabular.C (local_update): removed
475 the radio_useparbox button.
477 * src/tabular.C (UseParbox): new function
479 2000-08-06 Baruch Even <baruch.even@writeme.com>
481 * src/graphics/GraphicsCache.h:
482 * src/graphics/GraphicsCache.C:
483 * src/graphics/GraphicsCacheItem.h:
484 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
487 * src/insets/insetgraphics.h:
488 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
489 drawing of the inline image.
491 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
492 into the wrong position.
494 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
497 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
499 * src/support/translator.h: move all typedefs to public section
501 * src/support/filetools.C (MakeLatexName): return string const
504 (FileOpenSearch): ditto
506 (LibFileSearch): ditto
507 (i18nLibFileSearch): ditto
510 (CreateTmpDir): ditto
511 (CreateBufferTmpDir): ditto
512 (CreateLyXTmpDir): ditto
517 (OnlyFilename): ditto
519 (NormalizePath): ditto
521 (GetFileContents): ditto
522 (ReplaceEnvironmentPath): ditto
525 (ChangeExtension): ditto
526 (MakeDisplayPath): ditto
527 (do_popen): return cmdret const
528 (findtexfile): return string const
530 * src/support/DebugStream.h: add some /// to please doc++
532 * src/frontends/DialogBase.h (endif): add some /// to please doc++
534 * src/texrow.C (same_rownumber): functor to use with find_if
535 (getIdFromRow): rewritten to use find_if and to not update the
536 positions. return true if row is found
537 (increasePos): new method, use to update positions
539 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
541 * src/lyxlex_pimpl.C (verifyTable): new method
544 (GetString): return string const
545 (pushTable): rewrite to use std::stack
547 (setFile): better check
550 * src/lyxlex.h: make LyXLex noncopyable
552 * src/lyxlex.C (text): return char const * const
553 (GetString): return string const
554 (getLongString): return string const
556 * src/lyx_gui_misc.C (askForText): return pair<...> const
558 * src/lastfiles.[Ch] (operator): return string const
560 * src/buffer.C (parseSingleLyXformat2Token): pass string to
561 istringstream not char const *.
562 move token.end() out of loop.
563 (readFile): move initializaton of token
565 * src/BufferView2.C (insertErrors): run texrow.increasePos if
566 getIdFromRow is successful.
568 * lib/bind/emacs.bind: don't include menus bind
570 * development/Code_rules/Rules: the beginnings of making this
571 better and covering more of the unwritten rules that we have.
573 * development/Code_rules/Recommendations: a couple of wording
576 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
578 * src/support/strerror.c: remove C++ comment.
580 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
582 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
583 LFUN_INDEX_INSERT_LAST
585 * src/texrow.C (getIdFromRow): changed from const_iterator to
586 iterator, allowing code to compile with DEC cxx
588 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
589 stores part of the class, as suggested by Allan. Will allow
591 (apply): test to apply uses InsetCommandParams operator!=
593 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
594 (apply): test to apply uses InsetCommandParams operator!=
596 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
597 stores part of the class.
598 (update): removed limits on min/max size.
600 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
601 (apply): test to apply uses InsetCommandParams operator!=
603 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
604 (Read, Write, scanCommand, getCommand): moved functionality
605 into InsetCommandParams.
607 (getScreenLabel): made pure virtual
608 new InsetCommandParams operators== and !=
610 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
611 c-tors based on InsetCommandParams. Removed others.
612 * src/insets/insetinclude.[Ch]: ditto
613 * src/insets/insetlabel.[Ch]: ditto
614 * src/insets/insetparent.[Ch]: ditto
615 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
617 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
618 insets derived from InsetCommand created using similar c-tors
619 based on InsetCommandParams
620 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
621 * src/menus.C (ShowRefsMenu): ditto
622 * src/paragraph.C (Clone): ditto
623 * src/text2.C (SetCounter): ditto
624 * src/lyxfunc.C (Dispatch) ditto
625 Also recreated old InsetIndex behaviour exactly. Can now
626 index-insert at the start of a paragraph and index-insert-last
627 without launching the pop-up.
629 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
631 * lib/lyxrc.example: mark te pdf options as non functional.
633 * src/support/lstrings.C (strToInt): move initalization of tmpstr
634 (isStrDbl): move tmpstr.end() out of loop.
635 (strToDbl): move intialization of tmpstr
636 (lowercase): return string const and move tmp.end() out of loop.
637 (uppercase): return string const and move tmp.edn() out of loop.
638 (prefixIs): add assertion
643 (containsOnly): ditto
644 (containsOnly): ditto
645 (containsOnly): ditto
646 (countChar): make last arg char not char const
647 (token): return string const
648 (subst): return string const, move tmp.end() out of loop.
649 (subst): return string const, add assertion
650 (strip): return string const
651 (frontStrip): return string const, add assertion
652 (frontStrip): return string const
657 * src/support/lstrings.C: add inclde "LAssert.h"
658 (isStrInt): move tmpstr.end() out of loop.
660 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
661 toollist.end() out of loop.
662 (deactivate): move toollist.end() out of loop.
663 (update): move toollist.end() out of loop.
664 (updateLayoutList): move tc.end() out of loop.
665 (add): move toollist.end() out of loop.
667 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
668 md.end() out of loop.
670 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
672 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
675 * src/paragraph.C (Erase): move fontlist.end() out of loop.
676 (Erase): move insetlist.end() out of loop.
678 * src/lyx_sendfax_main.C: make show_logfile static and to take a
679 ref to const string as first arg. Move initialization of some
680 variables, whitespace changes.
682 * src/kbmap.C (defkey): move table.end() out of loop.
683 (kb_keymap): move table.end() out of loop.
684 (findbinding): move table.end() out of loop.
686 * src/MenuBackend.C (hasMenu): move end() out of loop.
687 (getMenu): move end() out of loop.
688 (getMenu): move menulist_.end() out of loop.
690 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
692 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
695 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
696 (getFromLyXName): move infotab.end() out of loop.
698 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
699 -fvtable-thunks -ffunction-sections -fdata-sections
701 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
703 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
706 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
708 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
710 * src/frontends/xforms/FormCitation.[Ch],
711 src/frontends/xforms/FormIndex.[Ch],
712 src/frontends/xforms/FormToc.[Ch],
713 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
715 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
717 * src/commandtags.h: renamed, created some flags for citation
720 * src/lyx_gui_misc.C: stripped out old FD_index_form code
722 * src/lyxfunc.C (dispatch): use signals to insert index entry
724 * src/frontends/Dialogs.h: new signal createIndex
726 * src/frontends/xforms/FormCommand.[Ch],
727 src/frontends/xforms/FormCitation.[Ch],
728 src/frontends/xforms/FormToc.[Ch],
729 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
731 * src/insets/insetindex.[Ch]: GUI-independent
733 * src/frontends/xforms/FormIndex.[Ch],
734 * src/frontends/xforms/forms/form_index.fd: xforms implementation
737 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
739 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
740 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
742 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
744 * src/insets/insetref.C (Latex): rewrite so that there is now
745 question that a initialization is requested.
747 * src/insets/insetcommand.h: reenable the hide signal
749 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
751 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
752 fix handling of shortcuts (many bugs :)
753 (add_lastfiles): ditto.
755 * lib/ui/default.ui: fix a few shortcuts.
757 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
759 * Makefile.am: Fix ``rpmdist'' target to return the exit
760 status of the ``rpm'' command, instead of the last command in
761 the chain (the ``rm lyx.xpm'' command, which always returns
764 2000-08-02 Allan Rae <rae@lyx.org>
766 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
767 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
768 * src/frontends/xforms/FormToc.C (FormToc): ditto
770 * src/frontends/xforms/Makefile.am: A few forgotten files
772 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
773 Signals-not-copyable-problem Lars' started commenting out.
775 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
777 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
779 * src/insets/insetcommand.h: Signals is not copyable so anoter
780 scheme for automatic hiding of forms must be used.
782 * src/frontends/xforms/FormCitation.h: don't inerit from
783 noncopyable, FormCommand already does that.
784 * src/frontends/xforms/FormToc.h: ditto
785 * src/frontends/xforms/FormUrl.h: ditto
787 * src/frontends/xforms/FormCitation.C: add include <algorithm>
789 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
791 * src/insets/insetcommand.h (hide): new SigC::Signal0
792 (d-tor) new virtual destructor emits hide signal
794 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
795 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
797 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
798 LOF and LOT. Inset is now GUI-independent
800 * src/insets/insetloa.[Ch]: redundant
801 * src/insets/insetlof.[Ch]: ditto
802 * src/insets/insetlot.[Ch]: ditto
804 * src/frontends/xforms/forms/form_url.fd: tweaked!
805 * src/frontends/xforms/forms/form_citation.fd: ditto
807 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
808 dialogs dealing with InsetCommand insets
810 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
811 FormCommand base class
812 * src/frontends/xforms/FormUrl.[Ch]: ditto
814 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
816 * src/frontends/xforms/FormToc.[Ch]: ditto
818 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
819 passed a generic InsetCommand pointer
820 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
822 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
823 and modified InsetTOC class
824 * src/buffer.C: ditto
826 * forms/lyx.fd: strip out old FD_form_toc code
827 * src/lyx_gui_misc.C: ditto
828 * src/lyx_gui.C: ditto
829 * src/lyx_cb.C: ditto
830 * src/lyx.[Ch]: ditto
832 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
834 * src/support/utility.hpp: tr -d '\r'
836 2000-08-01 Juergen Vigna <jug@sad.it>
838 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
841 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
842 LFUN_TABULAR_FEATURES.
844 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
847 * src/insets/insettabular.C (getStatus): implemented helper function.
849 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
851 2000-07-31 Juergen Vigna <jug@sad.it>
853 * src/text.C (draw): fixed screen update problem for text-insets.
855 * src/text2.C (SetParagrpah): call an update of the inset-owner when
856 something changed probably this has to be added in various other
859 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
861 2000-07-31 Baruch Even <baruch.even@writeme.com>
863 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
864 templates to satisfy compaq cxx.
867 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
869 * src/support/translator.h (equal_1st_in_pair::operator()): take
870 const ref pair_type as arg.
871 (equal_2nd_in_pair::operator()): ditto
872 (Translator::~Translator): remove empty d-tor.
874 * src/graphics/GraphicsCache.C: move include config.h to top, also
875 put initialization of GraphicsCache::singleton here.
876 (~GraphicsCache): move here
877 (addFile): take const ref as arg
880 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
882 * src/BufferView2.C (insertLyXFile): change te with/without header
885 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
887 * src/frontends/xforms/FormGraphics.C (apply): add some
888 static_cast. Not very nice, but required by compaq cxx.
890 * src/frontends/xforms/RadioButtonGroup.h: include header
891 <utility> instead of <pair.h>
893 * src/insets/insetgraphicsParams.C: add using directive.
894 (readResize): change return type to void.
897 * src/lyxfunc.C (getStatus): add missing break for build-program
898 function; add test for Literate for export functions.
900 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
901 entries in Options menu.
903 2000-07-31 Baruch Even <baruch.even@writeme.com>
905 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
906 protect against auto-allocation; release icon when needed.
908 2000-07-31 Matej Cepl <CeplM@seznam.cz>
910 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
913 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
914 earlier czech.kmap), useful only for programming.
916 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
918 * src/frontends/xforms/FormCitation.h: fix conditioning around
921 2000-07-31 Juergen Vigna <jug@sad.it>
923 * src/frontends/xforms/FormTabular.C (local_update): changed
924 radio_linebreaks to radio_useparbox and added radio_useminipage.
926 * src/tabular.C: made support for using minipages/parboxes.
928 * src/bufferlist.C (QwriteAll): small fix for asking for save.
930 * src/insets/insetgraphics.C (draw): just draw the inset so that the
932 (descent): so the cursor is in the middle.
933 (width): bit smaller box.
935 * src/insets/insetgraphics.h: added display() function.
937 2000-07-31 Baruch Even <baruch.even@writeme.com>
939 * src/frontends/Dialogs.h: Added showGraphics signals.
941 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
942 xforms form definition of the graphics dialog.
944 * src/frontends/xforms/FormGraphics.h:
945 * src/frontends/xforms/FormGraphics.C: Added files, the
946 GUIndependent code of InsetGraphics
948 * src/insets/insetgraphics.h:
949 * src/insets/insetgraphics.C: Major writing to make it work.
951 * src/insets/insetgraphicsParams.h:
952 * src/insets/insetgraphicsParams.C: Added files, parameter passing
953 struct between InsetGraphics and GUI.
955 * src/LaTeXFeatures.h:
956 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
957 support for graphicx package.
959 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
960 for the graphics inset.
962 * src/support/translator.h: Added file, used in
963 InsetGraphicsParams. this is a template to translate between two
966 * src/frontends/xforms/RadioButtonGroup.h:
967 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
968 way to easily control a radio button group.
970 2000-07-28 Juergen Vigna <jug@sad.it>
972 * src/insets/insettabular.C (LocalDispatch):
973 (TabularFeatures): added support for lyx-functions of tabular features.
974 (cellstart): refixed this function after someone wrongly changed it.
977 * src/LyXAction.C (init): added support for tabular-features
979 2000-07-28 Allan Rae <rae@lyx.org>
981 * src/frontends/xforms/FormPreferences.C (build): Setup input return
982 checking. NOTE: It seems that pressing ESC to cancel the dialog also
983 triggers the callback for input checking. As a result we sometimes get
984 "LyX: This shouldn't happen..." printed to cerr.
985 (input): Started using status variable since I only free() on
986 destruction. Some input checking for paths and font sizes.
988 * src/frontends/xforms/FormPreferences.h: Use status to control
989 activation of Ok and Apply
991 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
992 callback. Also resized to stop segfaults with 0.88. The problem is
993 that xforms-0.88 requires the folder to be wide enough to fit all the
994 tabs. If it isn't it causes all sorts of problems.
996 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
998 * src/frontends/xforms/forms/README: Reflect reality.
1000 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
1001 * src/frontends/xforms/forms/makefile: ditto.
1003 * src/commandtags.h: Get access to new Preferences dialog
1004 * src/LyXAction.C: ditto
1005 * src/lyxfunc.C: ditto
1006 * lib/ui/default.ui: ditto
1008 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1010 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
1012 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
1015 * src/frontends/xforms/form_url.[Ch]: added.
1017 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1019 * src/insets/insetbib.h: fixed bug in previous commit
1021 * src/frontends/xforms/FormUrl.h: ditto
1023 * src/frontends/xforms/FormPrint.h: ditto
1025 * src/frontends/xforms/FormPreferences.h: ditto
1027 * src/frontends/xforms/FormCopyright.h: ditto
1029 * src/frontends/xforms/FormCitation.C: ditto
1031 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
1032 private copyconstructor and private default contructor
1034 * src/support/Makefile.am: add utility.hpp
1036 * src/support/utility.hpp: new file from boost
1038 * src/insets/insetbib.h: set owner in clone
1040 * src/frontends/xforms/FormCitation.C: added missing include
1043 * src/insets/form_url.[Ch]: removed
1045 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
1047 * development/lyx.spec.in
1048 * Makefile.am: Fix buglet for LyX RPM generation resulting from
1049 file/directory re-organization.
1051 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
1053 * src/insets/insetcommand.[Ch]: moved the string data and
1054 associated manipulation methods into a new stand-alone class
1055 InsetCommandParams. This class has two additional methods
1056 getAsString() and setFromString() allowing the contents to be
1057 moved around as a single string.
1058 (addContents) method removed.
1059 (setContents) method no longer virtual.
1061 * src/buffer.C (readInset): made use of new InsetCitation,
1062 InsetUrl constructors based on InsetCommandParams.
1064 * src/commandtags.h: add LFUN_INSERT_URL
1066 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
1067 independent InsetUrl and use InsetCommandParams to extract
1068 string info and create new Insets.
1070 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
1072 * src/frontends/xforms/FormCitation.C (apply): uses
1075 * src/frontends/xforms/form_url.C
1076 * src/frontends/xforms/form_url.h
1077 * src/frontends/xforms/FormUrl.h
1078 * src/frontends/xforms/FormUrl.C
1079 * src/frontends/xforms/forms/form_url.fd: new files
1081 * src/insets/insetcite.[Ch]: removed unused constructors.
1083 * src/insets/insetinclude.[Ch]: no longer store filename
1085 * src/insets/inseturl.[Ch]: GUI-independent.
1087 2000-07-26 Juergen Vigna <jug@sad.it>
1088 * renamed frontend from gtk to gnome as it is that what is realized
1089 and did the necessary changes in the files.
1091 2000-07-26 Marko Vendelin <markov@ioc.ee>
1093 * configure.in: cleaning up gnome configuration scripts
1095 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1097 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
1098 shortcuts syndrom by redrawing them explicitely (a better solution
1099 would be appreciated).
1101 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
1103 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
1106 * src/lyx_cb.C (MenuExport): change html export to do the right
1107 thing depending of the document type (instead of having
1108 html-linuxdoc and html-docbook).
1109 * src/lyxfunc.C (getStatus): update for html
1110 * lib/ui/default.ui: simplify due to the above change.
1111 * src/menus.C (ShowFileMenu): update too (in case we need it).
1113 * src/MenuBackend.C (read): if a menu is defined twice, add the
1114 new entries to the exiting one.
1116 2000-07-26 Juergen Vigna <jug@sad.it>
1118 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
1120 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
1121 and return a bool if it did actual save the file.
1122 (AutoSave): don't autosave a unnamed doc.
1124 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
1125 check if this is an UNNAMED new file and react to it.
1126 (newFile): set buffer to unnamed and change to not mark a new
1127 buffer dirty if I didn't do anything with it.
1129 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
1131 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1133 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
1134 friend as per Angus's patch posted to lyx-devel.
1136 * src/ext_l10n.h: updated
1138 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
1139 gettext on the style string right before inserting them into the
1142 * autogen.sh: add code to extract style strings form layout files,
1143 not good enough yet.
1145 * src/frontends/gtk/.cvsignore: add MAKEFILE
1147 * src/MenuBackend.C (read): run the label strings through gettext
1148 before storing them in the containers.
1150 * src/ext_l10n.h: new file
1152 * autogen.sh : generate the ext_l10n.h file here
1154 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1156 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
1159 * lib/ui/default.ui: fix a couple of typos.
1161 * config/gnome/gtk.m4: added (and added to the list of files in
1164 * src/insets/insetinclude.C (unique_id): fix when we are using
1165 lyxstring instead of basic_string<>.
1166 * src/insets/insettext.C (LocalDispatch): ditto.
1167 * src/support/filetools.C: ditto.
1169 * lib/configure.m4: create the ui/ directory if necessary.
1171 * src/LyXView.[Ch] (updateToolbar): new method.
1173 * src/BufferView_pimpl.C (buffer): update the toolbar when
1174 opening/closing buffer.
1176 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1178 * src/LyXAction.C (getActionName): enhance to return also the name
1179 and options of pseudo-actions.
1180 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
1182 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
1183 as an example of what is possible). Used in File->Build too (more
1184 useful) and in the import/export menus (to mimick the complicated
1185 handling of linuxdoc and friends). Try to update all the entries.
1187 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
1190 * src/MenuBackend.C (read): Parse the new OptItem tag.
1192 * src/MenuBackend.h: Add a new optional_ data member (used if the
1193 entry should be omitted when the lyxfunc is disabled).
1195 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
1196 function, used as a shortcut.
1197 (create_submenu): align correctly the shortcuts on the widest
1200 * src/MenuBackend.h: MenuItem.label() only returns the label of
1201 the menu without shortcut; new method shortcut().
1203 2000-07-14 Marko Vendelin <markov@ioc.ee>
1205 * src/frontends/gtk/Dialogs.C:
1206 * src/frontends/gtk/FormCopyright.C:
1207 * src/frontends/gtk/FormCopyright.h:
1208 * src/frontends/gtk/Makefile.am: added these source-files for the
1209 Gtk/Gnome support of the Copyright-Dialog.
1211 * src/main.C: added Gnome::Main initialization if using
1212 Gtk/Gnome frontend-GUI.
1214 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
1216 * config/gnome/aclocal-include.m4
1217 * config/gnome/compiler-flags.m4
1218 * config/gnome/curses.m4
1219 * config/gnome/gnome--.m4
1220 * config/gnome/gnome-bonobo-check.m4
1221 * config/gnome/gnome-common.m4
1222 * config/gnome/gnome-fileutils.m4
1223 * config/gnome/gnome-ghttp-check.m4
1224 * config/gnome/gnome-gnorba-check.m4
1225 * config/gnome/gnome-guile-checks.m4
1226 * config/gnome/gnome-libgtop-check.m4
1227 * config/gnome/gnome-objc-checks.m4
1228 * config/gnome/gnome-orbit-check.m4
1229 * config/gnome/gnome-print-check.m4
1230 * config/gnome/gnome-pthread-check.m4
1231 * config/gnome/gnome-support.m4
1232 * config/gnome/gnome-undelfs.m4
1233 * config/gnome/gnome-vfs.m4
1234 * config/gnome/gnome-x-checks.m4
1235 * config/gnome/gnome-xml-check.m4
1236 * config/gnome/gnome.m4
1237 * config/gnome/gperf-check.m4
1238 * config/gnome/gtk--.m4
1239 * config/gnome/linger.m4
1240 * config/gnome/need-declaration.m4: added configuration scripts
1241 for Gtk/Gnome frontend-GUI
1243 * configure.in: added support for the --with-frontend=gtk option
1245 * autogen.sh: added config/gnome/* to list of config-files
1247 * acconfig.h: added define for GTKGUI-support
1249 * config/lyxinclude.m4: added --with-frontend[=value] option value
1250 for Gtk/Gnome frontend-GUI support.
1252 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1254 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
1258 * src/paragraph.C (GetChar): remove non-const version
1260 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
1261 (search_kw): use it.
1263 * src/lyx_main.C (init): if "preferences" exist, read that instead
1265 (ReadRcFile): return bool if the file could be read ok.
1266 (ReadUIFile): add a check to see if lex file is set ok.
1268 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
1269 bastring can be used instead of lyxstring (still uses the old code
1270 if std::string is good enough or if lyxstring is used.)
1272 * src/encoding.C: make the arrays static, move ininle functions
1274 * src/encoding.h: from here.
1276 * src/buffer.C: have last_isnet_read as a file scope variable for now.
1277 (parseSingleLyXformat2Token): move inset parsing to separate method
1278 (readInset): new private method
1280 * src/Variables.h: remove virtual from get().
1282 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
1283 access to NEW_INSETS and NEW_TABULAR
1285 * src/MenuBackend.h: remove superfluous forward declaration of
1286 MenuItem. Add documentations tags "///", remove empty MenuItem
1287 destructor, remove private default contructor.
1289 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
1291 (read): more string mlabel and mname to where they are used
1292 (read): remove unused variables mlabel and mname
1293 (defaults): unconditional clear, make menusetup take advantage of
1294 add returning Menu &.
1296 * src/LyXView.h: define NEW_MENUBAR as default
1298 * src/LyXAction.C: include lyxparagraph.h temporary to get access
1299 to NEW_INSETS and NEW_TABULAR.
1300 (init): commetn out some funcs that is obsolete when NEW_INSETS is
1301 defined. Change some of the "xxxx-inset-insert" functions names to
1304 * several files: more enahncements to NEW_INSETS and the resulting
1307 * lib/lyxrc.example (\date_insert_format): move to misc section
1309 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
1310 bastring and use AC_CACHE_CHECK.
1311 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
1312 the system have the newest methods. uses AC_CACHE_CHECK
1313 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
1314 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
1315 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
1317 * configure.in: add LYX_CXX_GOOD_STD_STRING
1319 * acinclude.m4: recreated
1321 2000-07-24 Amir Karger
1323 * README: add Hebrew, Arabic kmaps
1326 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1328 * src/buffer.C (writeFileAscii): Define actcell as an int instead
1331 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1333 * Lot of files: add pragma interface/implementation.
1335 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
1337 * lib/ui/default.ui: new file (ans new directory). Contains the
1338 default menu and toolbar.
1340 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
1341 global space. Toolbars are now read (as menus) in ui files.
1343 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
1345 * src/lyxfunc.C (getStatus): do not exit immediately if a command
1346 is disabled because the document is read-only. We want to have the
1347 toggle state of the function anyway.
1348 (getStatus): add code for LFUN_VC* functions (mimicking what is
1349 done in old-style menus)
1351 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
1352 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
1354 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
1355 * src/BufferView_pimpl.C: ditto.
1356 * src/lyxfunc.C: ditto.
1358 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
1359 default). This replaces old-style menus by new ones.
1361 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
1362 MenuItem. Contain the data structure of a menu.
1364 * src/insets/insettext.C: use LyXView::setLayout instead of
1365 accessing directly the toolbar combox.
1366 * src/lyxfunc.C (Dispatch): ditto.
1368 * src/LyXView.C (setLayout): new method, which just calls
1369 Toolbar::setLayout().
1370 (updateLayoutChoice): move part of this method in Toolbar.
1372 * src/toolbar.[Ch]: removed.
1374 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
1375 implementation the toolbar.
1377 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
1378 the toolbar. It might make sense to merge it with ToolbarDefaults
1380 (setLayout): new function.
1381 (updateLayoutList): ditto.
1382 (openLayoutList): ditto.
1384 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
1385 xforms implementation of the toolbar.
1386 (get_toolbar_func): comment out, since I do not
1387 know what it is good for.
1389 * src/ToolbarDefaults.h: Add the ItemType enum.
1391 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
1392 for a list of allocated C strings. Used in Menubar xforms
1393 implementation to avoid memory leaks.
1395 * src/support/lstrings.[Ch] (uppercase): new version taking and
1399 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
1400 * lib/bind/emacs.bind: ditto.
1402 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
1404 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
1405 forward decl of LyXView.
1407 * src/toolbar.C (toolbarItem): moved from toolbar.h
1408 (toolbarItem::clean): ditto
1409 (toolbarItem::~toolbarItem): ditto
1410 (toolbarItem::operator): ditto
1412 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
1414 * src/paragraph.h: control the NEW_TABULAR define from here
1416 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
1417 USE_TABULAR_INSETS to NEW_TABULAR
1419 * src/ToolbarDefaults.C: add include "lyxlex.h"
1421 * files using the old table/tabular: use NEW_TABULAR to control
1422 compilation of old tabular stuff.
1424 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
1427 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
1428 planemet in reading of old style floats, fix the \end_deeper
1429 problem when reading old style floats.
1431 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1433 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
1435 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
1437 * lib/bind/sciword.bind: updated.
1439 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1441 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
1442 layout write problem
1444 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1446 * src/Makefile.am (INCLUDES): remove image directory from include
1449 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
1450 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
1452 * src/LyXView.C (create_form_form_main): read the application icon
1455 * lib/images/*.xpm: change the icons to use transparent color for
1458 * src/toolbar.C (update): change the color of the button when it
1461 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1463 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
1464 setting explicitely the minibuffer.
1465 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
1467 * src/LyXView.C (showState): new function. Shows font information
1468 in minibuffer and update toolbar state.
1469 (LyXView): call Toolbar::update after creating the
1472 * src/toolbar.C: change toollist to be a vector instead of a
1474 (BubbleTimerCB): get help string directly from the callback
1475 argument of the corresponding icon (which is the action)
1476 (set): remove unnecessary ugliness.
1477 (update): new function. update the icons (depressed, disabled)
1478 depending of the status of the corresponding action.
1480 * src/toolbar.h: remove help in toolbarItem
1482 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
1484 * src/Painter.C (text): Added code for using symbol glyphs from
1485 iso10646 fonts. Currently diabled.
1487 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
1490 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
1491 magyar,turkish and usorbian.
1493 * src/paragraph.C (isMultiLingual): Made more efficient.
1495 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
1498 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
1499 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
1500 Also changed the prototype to "bool math_insert_greek(char)".
1502 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1504 * lots of files: apply the NEW_INSETS on all code that will not be
1505 needed when we move to use the new insets. Enable the define in
1506 lyxparagrah.h to try it.
1508 * src/insets/insettabular.C (cellstart): change to be a static
1510 (InsetTabular): initialize buffer in the initializer list.
1512 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
1514 * src/frontends/xforms/FormPrint.[Ch] : moved #include
1515 form_print.h out of the header file. Replaced with forward
1516 declarations of the relevant struct.
1518 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
1521 * src/commandtags.h: do not include "debug.h" which does not
1522 belong there. #include it in some other places because of this
1525 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1527 * src/insets/insetcaption.C: add a couple "using" directives.
1529 * src/toolbar.C (add): get the help text directly from lyxaction.
1531 (setPixmap): new function. Loads from disk and sets a pixmap on a
1532 botton; the name of the pixmap file is derived from the command
1535 * src/toolbar.h: remove members isBitmap and pixmap from
1538 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
1539 * lib/images/: move many files from images/banner.xpm.
1541 * src/lyx_gui.C (create_forms): read banner pixmap from file.
1543 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
1544 * src/toolbar.C: ditto.
1545 * configure.in: ditto.
1546 * INSTALL: document.
1548 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
1549 the spellchecker popup is closed from the WM.
1551 2000-07-19 Juergen Vigna <jug@sad.it>
1553 * src/insets/insetfloat.C (Write): small fix because we use the
1554 insetname for the type now!
1556 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
1558 * src/frontends/xforms/forms/form_citation.fd: object sizes are
1561 * src/frontends/Dialogs.h: removed hideCitation signal
1563 * src/insets/insetcite.h: added hide signal
1565 * src/insets/insetcite.C (~InsetCitation): emits new signal
1566 (getScreenLabel): "intelligent" label should now fit on the screen!
1568 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
1570 * src/frontends/xforms/FormCitation.C (showInset): connects
1571 hide() to the inset's hide signal
1572 (show): modified to use fl_set_object_position rather than
1573 fl_set_object_geometry wherever possible
1575 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1577 * src/insets/lyxinset.h: add caption code
1579 * src/insets/insetfloat.C (type): new method
1581 * src/insets/insetcaption.C (Write): new method
1583 (LyxCode): new method
1585 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
1586 to get it right together with using the FloatList.
1588 * src/commandtags.h: add LFUN_INSET_CAPTION
1589 * src/lyxfunc.C (Dispatch): handle it
1591 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
1594 * src/Variables.[Ch]: make expand take a const reference, remove
1595 the destructor, some whitespace changes.
1597 * src/LyXAction.C (init): add caption-inset-insert
1599 * src/FloatList.C (FloatList): update the default floats a bit.
1601 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1603 * src/Variables.[Ch]: new files. Intended to be used for language
1604 specific strings (like \chaptername) and filename substitution in
1607 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
1609 * lib/kbd/american.kmap: update
1611 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
1613 * src/bufferparams.[Ch]: remove member allowAccents.
1615 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
1617 * src/LaTeXLog.C: use the log_form.h header.
1618 * src/lyx_gui.C: ditto.
1619 * src/lyx_gui_misc.C: ditto.
1620 * src/lyxvc.h: ditto.
1622 * forms/log_form.fd: new file, created from latexoptions.fd. I
1623 kept the log popup and nuked the options form.
1625 * src/{la,}texoptions.[Ch]: removed.
1626 * src/lyx_cb.C (LaTeXOptions): ditto
1628 * src/lyx_gui.C (create_forms): do not handle the
1629 fd_latex_options form.
1631 2000-07-18 Juergen Vigna <jug@sad.it>
1633 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
1634 name of the inset so that it can be requested outside (text2.C).
1636 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
1639 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1641 * src/mathed/formula.h (ConvertFont): constify
1643 * src/mathed/formula.C (Read): add warning if \end_inset is not
1644 found on expected place.
1646 * src/insets/lyxinset.h (ConvertFont): consify
1648 * src/insets/insetquotes.C (ConvertFont): constify
1649 * src/insets/insetquotes.h: ditto
1651 * src/insets/insetinfo.h: add labelfont
1653 * src/insets/insetinfo.C (InsetInfo): set the labelfont
1654 (ascent): use labelfont
1658 (Write): make .lyx file a bit nicer
1660 * src/insets/insetfloat.C (Write): simplify somewhat...
1661 (Read): add warning if arg is not found
1663 * src/insets/insetcollapsable.C: add using std::max
1664 (Read): move string token and add warning in arg is not found
1665 (draw): use std::max to get the right ty
1666 (getMaxWidth): simplify by using std::max
1668 * src/insets/insetsection.h: new file
1669 * src/insets/insetsection.C: new file
1670 * src/insets/insetcaption.h: new file
1671 * src/insets/insetcaption.C: new file
1673 * src/insets/inset.C (ConvertFont): constify signature
1675 * src/insets/Makefile.am (libinsets_la_SOURCES): add
1676 insetcaption.[Ch] and insetsection.[Ch]
1678 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
1679 uses to use LABEL_COUNTER_CHAPTER instead.
1680 * src/text2.C (SetCounter): here
1682 * src/counters.h: new file
1683 * src/counters.C: new file
1684 * src/Sectioning.h: new file
1685 * src/Sectioning.C: new file
1687 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
1689 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1691 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
1694 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
1697 2000-07-17 Juergen Vigna <jug@sad.it>
1699 * src/tabular.C (Validate): check if array-package is needed.
1700 (SetVAlignment): added support for vertical alignment.
1701 (SetLTFoot): better support for longtable header/footers
1702 (Latex): modified to support added features.
1704 * src/LaTeXFeatures.[Ch]: added array-package.
1706 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
1708 * src/lyx_gui.C (LyXGUI): make sure that the height is large
1711 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
1713 * configure.in: do not forget to put a space after -isystem.
1715 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
1717 * lib/kbd/arabic.kmap: a few fixes.
1719 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1721 * some whitespace chagnes to a number of files.
1723 * src/support/DebugStream.h: change to make it easier for
1724 doc++ to parse correctly.
1725 * src/support/lyxstring.h: ditto
1727 * src/mathed/math_utils.C (compara): change to have only one
1729 (MathedLookupBOP): change because of the above.
1731 * src/mathed/math_delim.C (math_deco_compare): change to have only
1733 (search_deco): change becasue of the above.
1735 * src/insets/insettabular.C (DrawCellSelection): use std::swap
1736 instead of manually coded one.
1738 * src/insets/insetquotes.C (Read): read the \end_inset too
1740 * src/insets/insetlatex.h: remove file
1741 * src/insets/insetlatex.C: remove file
1743 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
1745 (InsetPrintIndex): remove destructor
1747 * src/insets/insetinclude.h: remove default constructor
1749 * src/insets/insetfloat.C: work to make it work better
1751 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
1753 * src/insets/insetcite.h (InsetCitation): remove default constructor
1755 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
1757 * src/text.C (GetColumnNearX): comment out some currently unused code.
1759 * src/paragraph.C (writeFile): move some initializations closer to
1761 (CutIntoMinibuffer): small change to use new matchIT operator
1765 (InsertInset): ditto
1768 (InsetIterator): ditto
1769 (Erase): small change to use new matchFT operator
1771 (GetFontSettings): ditto
1772 (HighestFontInRange): ditto
1775 * src/lyxparagraph.h: some chars changed to value_type
1776 (matchIT): because of some stronger checking (perhaps too strong)
1777 in SGI STL, the two operator() unified to one.
1780 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
1782 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
1783 the last inset read added
1784 (parseSingleLyXformat2Token): some more (future) compability code added
1785 (parseSingleLyXformat2Token): warning about solitary \end_inset added
1786 (parseSingleLyXformat2Token): set last_inset_read
1787 (parseSingleLyXformat2Token): more code to read new "Float" correctly
1788 (parseSingleLyXformat2Token): don't double intializw string next_token
1790 * src/TextCache.C (text_fits::operator()): add const's to the signature
1791 (has_buffer::operator()): ditto
1793 * src/Floating.h: add some comments on the class
1795 * src/FloatList.[Ch] (typeExist): new method
1798 * src/BackStack.h: added default constructor, wanted by Gcc.
1800 2000-07-14 Juergen Vigna <jug@sad.it>
1802 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
1804 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
1806 * src/insets/insettabular.C (resizeLyXText): need this to be able to
1807 do a redraw when the window is resized!
1808 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
1810 * src/insets/insettext.C (resizeLyXText): added function to correctly
1811 being able to resize the LyXWindow.
1813 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
1815 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
1817 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
1818 crashes when closing dialog to a deleted inset.
1820 * src/insets/insetcite.[Ch] (Edit) : the return of this former
1821 method! Now similar to other insets.
1823 2000-07-13 Juergen Vigna <jug@sad.it>
1825 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
1827 * lib/examples/Literate.lyx: small patch!
1829 * src/insets/insetbib.C (Read): added this function because of wrong
1830 Write (without [begin|end]_inset).
1832 2000-07-11 Juergen Vigna <jug@sad.it>
1834 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
1835 as the insertInset could not be good!
1837 * src/screen.C (ToggleSelection): fixed toggle selection bug as
1838 the bool param should not be last.
1840 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1842 * sigc++/configure.in: fix bug in threading-related code (Yes, I
1843 did submit that to Karl).
1845 * configure.in: use -isystem instead of -I for X headers. This
1846 fixes a problem on solaris with a recent gcc;
1847 put the front-end code after the X detection code;
1848 configure in sigc++ before lib/
1850 * src/lyx_main.C (commandLineHelp): remove -display from command
1853 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
1855 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
1856 Also put in Makefile rules for building the ``listerrors''
1857 program for parsing errors from literate programs written in LyX.
1859 * lib/build-listerrors: Added small shell script as part of compile
1860 process. This builds a working ``listerrors'' binary if noweb is
1861 installed and either 1) the VNC X server is installed on the machine,
1862 or 2) the user is compiling from within a GUI. The existence of a GUI
1863 is necessary to use the ``lyx --export'' feature for now. This
1864 hack can be removed once ``lyx --export'' no longer requires a GUI to
1867 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
1869 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
1870 now passed back correctly from gcc and placed "under" error
1871 buttons in a Literate LyX source.
1873 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
1875 * src/text.C (GetColumnNearX): Better behavior when a RTL
1876 paragraph is ended by LTR text.
1878 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
1881 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
1883 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
1884 true when clipboard is empty.
1886 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
1888 * text.C (Backspace): Prevent rebreaking of a row if it is the last
1889 row of the paragraph.
1890 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
1891 to prevent calculation of bidi tables
1893 2000-07-07 Juergen Vigna <jug@sad.it>
1895 * src/screen.C (ToggleSelection): added y_offset and x_offset
1898 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
1901 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
1903 * src/insets/insettext.C: fixed Layout-Display!
1905 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1907 * configure.in: add check for strings.h header.
1909 * src/spellchecker.C: include <strings.h> in order to have a
1910 definition for bzero().
1912 2000-07-07 Juergen Vigna <jug@sad.it>
1914 * src/insets/insettext.C (draw): set the status of the bv->text to
1915 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
1917 * src/screen.C (DrawOneRow):
1918 (DrawFromTo): redraw the actual row if something has changed in it
1921 * src/text.C (draw): call an update of the toplevel-inset if something
1922 has changed inside while drawing.
1924 * src/lyxtext.h: added CHANGED_IN_DRAW status.
1926 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
1928 * src/insets/insetbib.[Ch] (callback) new method, moving callback
1929 processing inside class.
1931 * src/insets/insetindex.[Ch] (callback) new method, moving callback
1932 processing inside class.
1934 * src/insets/insetindex.h new struct Holder, consistent with other
1937 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
1938 citation dialog from main code and placed it in src/frontends/xforms.
1939 Dialog launched through signals instead of callbacks
1941 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
1943 * lyx.man: update the options description.
1945 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
1947 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
1948 handle neg values, set min width to 590, add doc about -display
1950 2000-07-05 Juergen Vigna <jug@sad.it>
1952 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
1953 calls to BufferView *.
1955 * src/insets/insettext.C (checkAndActivateInset): small fix non
1956 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
1958 * src/insets/insetcommand.C (Read): Fixed as insets should read till
1959 their \end_inset token!
1961 2000-07-04 edscott <edscott@imp.mx>
1963 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
1964 lib/lyxrc.example: added option \wheel_jump
1966 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
1968 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
1969 remove support for -width,-height,-xpos and -ypos.
1971 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
1973 * src/encoding.[Ch]: New files.
1975 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
1976 (text): Call to the underline() method only when needed.
1978 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
1980 * src/buffer.C (makeLaTeXFile): Compute automatically the input
1981 encoding(s) for the document.
1983 * src/bufferparams.C (BufferParams): Changed default value of
1986 * src/language.C (newLang): Removed.
1987 (items[]): Added encoding information for all defined languages.
1989 * src/lyx_gui.C (create_forms): Added "auto" option to the input
1990 encoding choice button.
1992 * src/lyxrc.h (font_norm_type): New member variable.
1993 (set_font_norm_type): New method.
1995 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
1996 paragraphs with different encodings.
1998 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
1999 (TransformChar): Changed to work correctly with Arabic points.
2000 (draw): Added support for drawing Arabic points.
2001 (draw): Removed code for drawing underbars (this is done by
2004 * src/support/textutils.h (IsPrintableNonspace): New function.
2006 * src/BufferView_pimpl.h: Added "using SigC::Object".
2007 * src/LyXView.h: ditto.
2009 * src/insets/insetinclude.h (include_label): Changed to mutable.
2011 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
2013 * src/mathed/math_iter.h: remove empty destructor
2015 * src/mathed/math_cursor.h: remove empty destructor
2017 * src/insets/lyxinset.h: add THEOREM_CODE
2019 * src/insets/insettheorem.[Ch]: new files
2021 * src/insets/insetminipage.C: (InsertInset): remove
2023 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
2025 (InsertInset): remove
2027 * src/insets/insetlist.C: (InsertList): remove
2029 * src/insets/insetfootlike.[Ch]: new files
2031 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
2034 (InsertInset): ditto
2036 * src/insets/insetert.C: remove include Painter.h, reindent
2037 (InsertInset): move to header
2039 * src/insets/insetcollapsable.h: remove explicit from default
2040 contructor, remove empty destructor, add InsertInset
2042 * src/insets/insetcollapsable.C (InsertInset): new func
2044 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2046 * src/vspace.h: add explicit to constructor
2048 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
2049 \textcompwordmark, please test this.
2051 * src/lyxrc.C: set ascii_linelen to 65 by default
2053 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
2055 * src/commandtags.h: add LFUN_INSET_THEOREM
2057 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
2058 (makeLinuxDocFile): remove _some_ of the nice logic
2059 (makeDocBookFile): ditto
2061 * src/Painter.[Ch]: (~Painter): removed
2063 * src/LyXAction.C (init): entry for insettheorem added
2065 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
2067 (deplog): code to detect files generated by LaTeX, needs testing
2070 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2072 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
2074 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2076 * src/LaTeX.C (deplog): Add a check for files that are going to be
2077 created by the first latex run, part of the project to remove the
2080 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
2081 contents to the extension list.
2083 2000-07-04 Juergen Vigna <jug@sad.it>
2085 * src/text.C (NextBreakPoint): added support for needFullRow()
2087 * src/insets/lyxinset.h: added needFullRow()
2089 * src/insets/insetcollapsable.C: redone now this uses a text-inset
2092 * src/insets/insettext.C: lots of changes for update!
2094 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
2096 * src/LaTeXFeatures.h: add a missing std:: qualifier.
2098 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
2100 * src/insets/insetinclude.C (InsetInclude): fixed
2101 initialization of include_label.
2102 (unique_id): now returns a string.
2104 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
2106 * src/LaTeXFeatures.h: new member IncludedFiles, for
2107 a map of key, included file name.
2109 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
2110 with the included files for inclusion in SGML preamble,
2111 i. e., linuxdoc and docbook.
2114 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
2115 nice (is the generated linuxdoc code to be exported?), that
2116 allows to remove column, and only_body that will be true for
2117 slave documents. Insets are allowed inside SGML font type.
2118 New handling of the SGML preamble for included files.
2119 (makeDocBookFile): the same for docbook.
2121 * src/insets/insetinclude.h:
2122 * src/insets/insetinclude.C (Validate): keeps a list of included files.
2124 (DocBook): new export methods.
2126 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
2127 and makeDocBookFile.
2129 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
2130 formats to export with command line argument -x.
2132 2000-06-29 Juergen Vigna <jug@sad.it>
2134 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
2135 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
2137 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
2138 region could already been cleared by an inset!
2140 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2142 * src/BufferView_pimpl.h: remove member variables lyx_focus and
2145 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
2147 (cursorToggle): remove special handling of lyx focus.
2149 2000-06-28 Juergen Vigna <jug@sad.it>
2151 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
2154 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2156 * src/insets/insetindex.C (Edit): add a callback when popup is
2159 * src/insets/insettext.C (LocalDispatch):
2160 * src/insets/insetmarginal.h:
2161 * src/insets/insetlist.h:
2162 * src/insets/insetfoot.h:
2163 * src/insets/insetfloat.h:
2164 * src/insets/insetert.h: add a missing std:: qualifier.
2166 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2168 * src/support/lyxsum.C (sum): '\0' teminate file read when using
2171 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
2173 * src/insets/insettext.C (Read): remove tmptok unused variable
2174 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
2175 (InsertInset): change for new InsetInset code
2177 * src/insets/insettext.h: add TEXT inline method
2179 * src/insets/insettext.C: remove TEXT macro
2181 * src/insets/insetmarginal.C (Write): new method
2182 (Latex): change output slightly
2184 * src/insets/insetfoot.C (Write): new method
2185 (Latex): change output slightly (don't use endl when no need)
2187 * src/insets/insetert.C (Write): new method
2189 * src/insets/insetcollapsable.h: make button_length, button_top_y
2190 and button_bottm_y protected.
2192 * src/insets/insetcollapsable.C (Write): simplify code by using
2193 tostr. Also do not output the float name, the children class
2194 should to that to get control over own arguments
2196 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
2197 src/insets/insetminipage.[Ch]:
2200 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2202 * src/lyxfunc.C (Dispatch): cases for new insets/commands
2204 * src/Makefile.am (lyx_SOURCES): add the new files
2206 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
2207 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
2208 * src/commandtags.h: ditto
2210 * src/LaTeXFeatures.h: add a std::set of used floattypes
2212 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
2214 * src/FloatList.[Ch] src/Floating.h: new files
2216 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
2218 * src/lyx_cb.C (TableApplyCB): ditto
2220 * src/text2.C: ditto
2221 * src/buffer.C (SimpleLinuxDocOnePar): ditto
2222 (parseSingleLyXformat2Token): ditto + add code for
2223 backwards compability for old float styles + add code for new insets
2225 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
2227 (InsertInset(size_type, Inset *, LyXFont)): new method
2228 (InsetChar(size_type, char)): changed to use the other InsetChar
2229 with a LyXFont(ALL_INHERIT).
2230 (InsetInset(size_type, Inset*)): changed to use InsetChar to
2231 insert the META_INSET.
2233 * sigc++/thread.cc (Privete<int>::operator int&): move definition
2235 * sigc++/thread.h (Threads): from here
2237 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
2238 definition out of line
2239 * sigc++/scope.h: from here
2241 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2243 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
2244 is specified (adapted from a patch from edscott <edscott@imp.mx>).
2246 * Makefile.am (bindist): new target.
2248 * INSTALL: add instructions for doing a binary distribution.
2250 * development/tools/README.bin.example: update a bit.
2252 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
2255 * lib/lyxrc.example: new lyxrc tag \set_color.
2257 * src/lyxfunc.C (Dispatch):
2258 * src/commandtags.h:
2259 * src/LyXAction.C: new lyxfunc "set-color".
2261 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
2262 and an x11name given as strings.
2264 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
2265 cache when a color is changed.
2267 2000-06-26 Juergen Vigna <jug@sad.it>
2269 * src/lyxrow.C (width): added this functions and variable.
2271 * src/insets/insetcite.C (create_form_citation_form): some Gravity
2274 * src/text.C (SetHeightOfRow): fixed calcualting of width.
2276 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2278 * images/undo_bw.xpm: new icon.
2279 * images/redo_bw.xpm: ditto.
2281 * configure.in (INSTALL_SCRIPT): change value to
2282 ${INSTALL} to avoid failures of install-script target.
2283 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
2285 * src/BufferView.h: add a magic "friend" declaration to please
2288 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
2290 * forms/cite.fd: modified to allow resizing without messing
2293 * src/insetcite.C: Uses code from cite.fd almost without
2295 User can now resize dialog in the x-direction.
2296 Resizing the dialog in the y-direction is prevented, as the
2297 code does this intelligently already.
2299 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2301 * INSTALL: remove obsolete entry in "problems" section.
2303 * lib/examples/sl_*.lyx: update of the slovenian examples.
2305 * src/support/FileInfo.[Ch] (getBlockSize): remove.
2307 2000-06-23 Juergen Vigna <jug@sad.it>
2309 * src/lyxtext.h: added a 'cleared' flag to draw() function.
2311 * src/buffer.C (resize): delete the LyXText of textinsets.
2313 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
2315 * src/insets/lyxinset.h: added another parameter 'cleared' to
2316 the draw() function.
2318 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
2319 unlocking inset in inset.
2321 2000-06-22 Juergen Vigna <jug@sad.it>
2323 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
2324 of insets and moved first to LyXText.
2326 * src/mathed/formulamacro.[Ch]:
2327 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
2329 2000-06-21 Juergen Vigna <jug@sad.it>
2331 * src/text.C (GetVisibleRow): look if I should clear the area or not
2332 using Inset::doClearArea() function.
2334 * src/insets/lyxinset.h: added doClearArea() function and
2335 modified draw(Painter &, ...) to draw(BufferView *, ...)
2337 * src/text2.C (UpdateInset): return bool insted of int
2339 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
2341 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
2342 combox in the character popup
2344 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
2345 BufferParams const & params
2347 2000-06-20 Juergen Vigna <jug@sad.it>
2349 * src/insets/insettext.C (SetParagraphData): set insetowner on
2352 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2354 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
2355 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
2357 (form_main_): remove
2359 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
2360 (create_form_form_main): remove FD_form_main stuff, connect to
2361 autosave_timeout signal
2363 * src/LyXView.[Ch] (getMainForm): remove
2364 (UpdateTimerCB): remove
2365 * src/BufferView_pimpl.h: inherit from SigC::Object
2367 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
2368 signal instead of callback
2370 * src/BufferView.[Ch] (cursorToggleCB): remove
2372 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2374 * src/BufferView_pimpl.C: changes because of the one below
2376 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
2377 instead of storing a pointer to a LyXText.
2379 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
2381 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
2383 * src/lyxparagraph.h
2385 * src/paragraph.C: Changed fontlist to a sorted vector.
2387 2000-06-19 Juergen Vigna <jug@sad.it>
2389 * src/BufferView.h: added screen() function.
2391 * src/insets/insettext.C (LocalDispatch): some selection code
2394 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
2396 * src/insets/insettext.C (SetParagraphData):
2398 (InsetText): fixes for multiple paragraphs.
2400 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
2402 * development/lyx.spec.in: Call configure with ``--without-warnings''
2403 to work around a bug with the Makefiles when doing ``make lyxrpm''.
2404 This should be fine, however, since we generally don't want to be
2405 verbose when making an RPM.
2407 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
2409 * lib/scripts/fig2pstex.py: New file
2411 2000-06-16 Juergen Vigna <jug@sad.it>
2413 * src/insets/insettabular.C (UpdateLocal):
2414 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
2415 (LocalDispatch): Changed all functions to use LyXText.
2417 2000-06-15 Juergen Vigna <jug@sad.it>
2419 * src/text.C (SetHeightOfRow): call inset::update before requesting
2422 * src/insets/insettext.C (update):
2423 * src/insets/insettabular.C (update): added implementation
2425 * src/insets/lyxinset.h: added update function
2427 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2429 * src/text.C (SelectNextWord): protect against null pointers with
2430 old-style string streams. (fix from Paul Theo Gonciari
2433 * src/cite.[Ch]: remove erroneous files.
2435 * lib/configure.m4: update the list of created directories.
2437 * src/lyxrow.C: include <config.h>
2438 * src/lyxcursor.C: ditto.
2440 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2442 * lib/examples/decimal.lyx: new example file from Mike.
2444 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
2445 to find template definitions (from Dekel)
2447 * src/frontends/.cvsignore: add a few things.
2449 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
2451 * src/Timeout.C (TimeOut): remove default argument.
2453 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
2456 * src/insets/ExternalTemplate.C: add a "using" directive.
2458 * src/lyx_main.h: remove the act_ struct, which seems unused
2461 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2463 * LyX Developers Meeting: All files changed, due to random C++ (by
2464 coincidence) code generator script.
2466 - external inset (cool!)
2467 - initial online editing of preferences
2468 - insettabular breaks insettext(s contents)
2470 - some DocBook fixes
2471 - example files update
2472 - other cool stuff, create a diff and look for yourself.
2474 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
2476 * src/insets/insettext.C (computeTextRows): if the maxWidth is
2477 -1 this is a non-line-breaking textinset.
2479 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
2480 if there is no width set.
2482 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
2484 * Lots of files: Merged the dialogbase branch.
2486 2000-06-09 Allan Rae <rae@lyx.org>
2488 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
2489 and the Dispatch methods that used it.
2491 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
2492 access to functions formerly kept in Dispatch.
2494 2000-05-19 Allan Rae <rae@lyx.org>
2496 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
2497 made to_page and count_copies integers again. from_page remains a
2498 string however because I want to allow entry of a print range like
2499 "1,4,22-25" using this field.
2501 * src/LyXAction.C: added action info and commands for buffer-print-xtl
2502 and printer-params-get. These aren't useful from the minibuffer but
2503 could be used by a script/LyXServer app provided it passes a suitable
2504 auto_mem_buffer. I guess I should take a look at how the LyXServer
2505 works and make it support xtl buffers.
2507 * sigc++/: updated to libsigc++-1.0.1
2509 * src/xtl/: updated to xtl-1.3.pl.11
2511 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
2512 those changes done to the files in src/ are actually recreated when
2513 they get regenerated. Please don't ever accept a patch that changes a
2514 dialog unless that patch includes the changes to the corresponding *.fd
2517 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
2518 stringOnlyContains, renamed it and generalised it.
2520 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
2521 branch. Removed the remaining old form_print code.
2523 2000-04-26 Allan Rae <rae@lyx.org>
2525 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
2526 trap I was trying to fix with the ID: fields in src/xtl/ :-)
2528 2000-04-25 Allan Rae <rae@lyx.org>
2530 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
2531 against a base of xtl-1.3.pl.4
2533 * development/tools/lxtl.sh: fixed a couple of silly typos and now
2534 filter the Id: entries so they still show the xtl version number
2537 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
2538 into the src/xtl code. Patch still pending with José (XTL)
2540 2000-04-24 Allan Rae <rae@lyx.org>
2542 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
2543 both more generic and much safer. Use the new template functions.
2544 * src/buffer.[Ch] (Dispatch): ditto.
2546 * src/frontends/xforms/FormPrint.C (update): Use new template functions
2547 and mem buffer more intelligently. Also a little general cleanup.
2550 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
2551 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
2552 * src/xtl/Makefile.am: ditto.
2553 * src/xtl/.cvsignore: ditto.
2554 * src/Makefile.am: ditto.
2556 * src/PrinterParams.h: Removed the macros member functions. Added a
2557 testInvariant member function. A bit of tidying up and commenting.
2558 Included Angus's idea for fixing operation with egcs-1.1.2.
2560 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
2561 cool expansion of XTL's mem_buffer to support automatic memory
2562 management within the buffer itself. Removed the various macros and
2563 replaced them with template functions that use either auto_mem_buffer
2564 or mem_buffer depending on a #define. The mem_buffer support will
2565 disappear as soon as the auto_mem_buffer is confirmed to be good on
2566 other platforms/compilers. That is, it's there so you've got something
2569 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
2570 effectively forked XTL. However I expect José will include my code
2571 into the next major release. Also fixed a memory leak.
2572 * src/xtl/text.h: ditto.
2573 * src/xtl/xdr.h: ditto.
2574 * src/xtl/giop.h: ditto.
2576 2000-04-16 Allan Rae <rae@lyx.org>
2578 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
2579 by autogen.sh and removed by maintainer-clean anyway.
2580 * .cvsignore, sigc++/.cvsignore: Support the above.
2582 * sigc++/.cvsignore: Forgot that retbind.h was generated.
2584 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
2586 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
2587 macros, renamed static callback-target member functions to suit new
2588 scheme and made them public.
2589 * src/frontends/xforms/forms/form_print.fd: ditto.
2590 * src/frontends/xforms/forms/form_copyright.fd: ditto.
2592 * src/support/lxtl.h: small cleanup to use typedef instead of #define
2595 * src/xtl/: New directory containing a minimal distribution of XTL.
2596 This is XTL-1.3.pl.4.
2598 * development/tools/lxtl.sh: A script to generate the above mini-dist.
2600 2000-04-15 Allan Rae <rae@lyx.org>
2602 * development/tools/makeLyXsigc.sh: Remove the library version numbers
2604 * sigc++/: Updated to libsigc++-1.0.0
2606 2000-04-14 Allan Rae <rae@lyx.org>
2608 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
2609 use the generic ones in future. I'll modify my conversion script.
2611 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
2613 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
2614 (CloseAllBufferRelatedDialogs): Renamed.
2615 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
2617 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
2618 of the generic ones. These are the same ones my conversion script
2621 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
2622 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
2623 * src/buffer.C (Dispatch): ditto
2625 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
2626 functions for updating and hiding buffer dependent dialogs.
2627 * src/BufferView.C (buffer): ditto
2628 * src/buffer.C (setReadonly): ditto
2629 * src/lyxfunc.C (CloseBuffer): ditto
2631 * src/buffer.h: Take setReadonly() out of line so I don't have to include
2632 Dialogs.h, and hence all the SigC stuff, into every file that includes
2633 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
2635 * src/BufferView2.C: reduce the number of headers included by buffer.h
2637 2000-04-11 Allan Rae <rae@lyx.org>
2639 * src/frontends/xforms/xform_macros.h: A small collection of macros
2640 for building C callbacks.
2642 * src/frontends/xforms/Makefile.am: Added above file.
2644 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
2645 scheme again. This time it should work for JMarc. If this is
2646 successful I'll revise my conversion script to automate some of this.
2647 The static member functions in the class also have to be public for
2648 this scheme will work. If the scheme works (it's almost identical to
2649 the way BufferView::cursorToggleCB is handled so it should work) then
2650 FormCopyright and FormPrint will be ready for inclusion into the main
2651 trunk immediately after 1.1.5 is released -- provided we're prepared
2652 for complaints about lame compilers not handling XTL.
2654 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
2656 2000-04-07 Allan Rae <rae@lyx.org>
2658 * config/lyxinclude.m4: A bit more tidying up (Angus)
2660 * src/LString.h: JMarc's <string> header fix
2662 * src/PrinterParams.h: Used string for most data to remove some
2663 ugly code in the Print dialog and avoid even uglier code when
2664 appending the ints to a string for output.
2666 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
2667 and moved "default:" back to the end of switch statement. Cleaned
2668 up the printing so it uses the right function calls and so the
2669 "print to file" option actually puts the file in the right directory.
2671 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
2673 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
2674 and Ok+Apply button control into a separate method: input (Angus).
2675 (input) Cleaned it up and improved it to be very thorough now.
2676 (All CB) static_cast used instead of C style cast (Angus). This will
2677 probably change again once we've worked out how to keep gcc-2.8.1 happy
2678 with real C callbacks.
2679 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
2680 ignore some of the bool settings and has random numbers instead. Needs
2681 some more investigation. Added other input length checks and checking
2682 of file and printer names.
2684 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
2685 would link (Angus). Seems the old code doesn't compile with the pragma
2686 statement either. Separated callback entries from internal methods.
2688 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
2690 2000-03-17 Allan Rae <rae@lyx.org>
2692 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
2693 need it? Maybe it could go in Dialogs instead? I could make it a
2694 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
2695 values to get the bool return value.
2696 (Dispatch): New overloaded method for xtl support.
2698 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
2699 extern "C" callback instead of static member functions. Hopefully,
2700 JMarc will be able to compile this. I haven't changed
2701 forms/form_copyright.fd yet. Breaking one of my own rules already.
2703 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
2704 because they aren't useful from the minibuffer. Maybe a LyXServer
2705 might want a help message though?
2707 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
2709 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
2710 xtl which needs both rtti and exceptions.
2712 * src/support/Makefile.am:
2713 * src/support/lxtl.h: New file. Some helper macros for using XTL.
2715 * src/frontends/xforms/input_validators.[ch]: input filters and
2716 validators. These conrol what keys are valid in input boxes.
2717 Use them and write some more. Much better idea than waiting till
2718 after the user has pressed Ok to say that the input fields don't make
2721 * src/frontends/xforms/Makefile.am:
2722 * src/frontends/xforms/forms/form_print.fd:
2723 * src/frontends/xforms/forms/makefile:
2724 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
2725 new scheme. Still have to make sure I haven't missed anything from
2726 the current implementation.
2728 * src/Makefile.am, src/PrinterParams.h: New data store.
2730 * other files: Added a couple of copyright notices.
2732 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2734 * src/insets/insetbib.h: move Holder struct in public space.
2736 * src/frontends/include/DialogBase.h: use SigC:: only when
2737 SIGC_CXX_NAMESPACES is defined.
2738 * src/frontends/include/Dialogs.h: ditto.
2740 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
2742 * src/frontends/xforms/FormCopyright.[Ch]: do not
2743 mention SigC:: explicitely.
2745 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2747 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
2748 deals with testing KDE in main configure.in
2749 * configure.in: ditto.
2751 2000-02-22 Allan Rae <rae@lyx.org>
2753 * Lots of files: Merged from HEAD
2755 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
2756 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
2758 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
2760 * sigc++/: new minidist.
2762 2000-02-14 Allan Rae <rae@lyx.org>
2764 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
2766 2000-02-08 Juergen Vigna <jug@sad.it>
2768 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
2769 file for the buildin GUI builder of KDevelop of the copyright-dialog.
2771 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
2772 for this port and so it is much easier for other people to port
2773 dialogs in a common development environment.
2775 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
2776 the QT/KDE implementation.
2778 * src/frontends/kde/Dialogs.C:
2779 * src/frontends/kde/FormCopyright.C:
2780 * src/frontends/kde/FormCopyright.h:
2781 * src/frontends/kde/Makefile.am:
2782 * src/frontends/kde/formcopyrightdialog.C:
2783 * src/frontends/kde/formcopyrightdialog.h:
2784 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
2785 for the kde support of the Copyright-Dialog.
2787 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
2788 subdir-substitution instead of hardcoded 'xforms' as we now have also
2791 * src/frontends/include/DialogBase.h (Object): just commented the
2792 label after #endif (nasty warning and I don't like warnings ;)
2794 * src/main.C (main): added KApplication initialization if using
2797 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
2798 For now only the KDE event-loop is added if frontend==kde.
2800 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
2802 * configure.in: added support for the --with-frontend[=value] option
2804 * autogen.sh: added kde.m4 file to list of config-files
2806 * acconfig.h: added define for KDEGUI-support
2808 * config/kde.m4: added configuration functions for KDE-port
2810 * config/lyxinclude.m4: added --with-frontend[=value] option with
2811 support for xforms and KDE.
2813 2000-02-08 Allan Rae <rae@lyx.org>
2815 * all Makefile.am: Fixed up so the make targets dist, distclean,
2816 install and uninstall all work even if builddir != srcdir. Still
2817 have a new sigc++ minidist update to come.
2819 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
2821 2000-02-01 Allan Rae <rae@lyx.org>
2823 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
2824 Many mods to get builddir != srcdir working.
2826 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
2827 for building on NT and so we can do the builddir != srcdir stuff.
2829 2000-01-30 Allan Rae <rae@lyx.org>
2831 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
2832 This will stay in "rae" branch. We probably don't really need it in
2833 the main trunk as anyone who wants to help programming it should get
2834 a full library installed also. So they can check both included and
2835 system supplied library compilation.
2837 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
2838 Added a 'mini' distribution of libsigc++. If you feel the urge to
2839 change something in these directories - Resist it. If you can't
2840 resist the urge then you should modify the following script and rebuild
2841 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
2842 all happen. Still uses a hacked version of libsigc++'s configure.in.
2843 I'm quite happy with the results. I'm not sure the extra work to turn
2844 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
2845 worth the trouble and would probably lead to extra maintenance
2847 I haven't tested the following important make targets: install, dist.
2848 Not ready for prime time but very close. Maybe 1.1.5.
2850 * development/tools/makeLyXsigc.sh: A shell script to automatically
2851 generate our mini-dist of libsigc++. It can only be used with a CVS
2852 checkout of libsigc++ not a tarball distribution. It's well commented.
2853 This will end up as part of the libsigc++ distribution so other apps
2854 can easily have an included mini-dist. If someone makes mods to the
2855 sigc++ subpackage without modifying this script to generate those
2856 changes I'll be very upset!
2858 * src/frontends/: Started the gui/system indep structure.
2860 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
2861 to access the gui-indep dialogs are in this class. Much improved
2862 design compared to previous revision. Lars, please refrain from
2863 moving this header into src/ like you did with Popups.h last time.
2865 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
2867 * src/frontends/xforms/: Started the gui-indep system with a single
2868 dialog: FormCopyright. Initial testing of use of libsigc++ was very
2871 * src/frontends/xforms/forms: Repository for the xforms .fd files.
2872 Here you'll find a very useful makefile and automated fdfix.sh that
2873 makes updating dailogs a no-brainer -- provided you follow the rules
2874 set out in the README. I'm thinking about adding another script to
2875 automatically generate skeleton code for a new dialog given just the
2878 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
2879 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
2880 Made FormCopyright gui-indep and added a lyxfunc to get to it.
2882 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
2884 * src/support/LSubstring.C (operator): simplify
2886 * src/lyxtext.h: removed bparams, use buffer_->params instead
2888 * src/lyxrow.h: make Row a real class, move all variables to
2889 private and use accessors.
2891 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
2893 (isRightToLeftPar): ditto
2894 (ChangeLanguage): ditto
2895 (isMultiLingual): ditto
2898 (SimpleTeXOnePar): ditto
2899 (TeXEnvironment): ditto
2900 (GetEndLabel): ditto
2902 (SetOnlyLayout): ditto
2903 (BreakParagraph): ditto
2904 (BreakParagraphConservative): ditto
2905 (GetFontSettings): ditto
2907 (CopyIntoMinibuffer): ditto
2908 (CutIntoMinibuffer): ditto
2909 (PasteParagraph): ditto
2910 (SetPExtraType): ditto
2911 (UnsetPExtraType): ditto
2912 (DocBookContTableRows): ditto
2913 (SimpleDocBookOneTablePar): ditto
2915 (TeXFootnote): ditto
2916 (SimpleTeXOneTablePar): ditto
2917 (TeXContTableRows): ditto
2918 (SimpleTeXSpecialChars): ditto
2921 * src/lyxcursor.h: make LyXCursor a real class, move all variables
2922 to private and use accessors.
2924 * src/lyx_cb.C: remove char updatetimer, and all code that uses
2925 this, we did not use it anymore and has not been for ages. Just a
2926 waste of cpu cycles.
2928 * src/language.h: make Language a real class, move all variables
2929 to private and use accessors.
2931 * src/BufferView_pimpl.C (Pimpl): use new timer code.
2932 (create_view): remove
2933 (update): some changes for new timer
2934 (cursorToggle): use new timer
2935 (beforeChange): change for new timer
2937 * src/BufferView.h (cursorToggleCB): removed last paramter because
2940 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
2941 (cursorToggleCB): change because of new timer code
2943 * lib/CREDITS: updated own mailaddress
2945 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2947 * src/support/filetools.C (PutEnv): fix the code in case neither
2948 putenv() nor setenv() have been found.
2950 * INSTALL: mention the install-strip Makefile target.
2952 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
2953 read-only documents.
2955 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2957 * lib/reLyX/configure.in (VERSION): avoid using a previously
2958 generated reLyX wrapper to find out $prefix.
2960 * lib/examples/eu_adibide_lyx-atua.lyx:
2961 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
2962 translation of the Tutorial (Dooteo)
2964 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
2966 * forms/cite.fd: new citation dialog
2968 * src/insetcite.[Ch]: the new citation dialog is moved into
2971 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
2974 * src/insets/insetcommand.h: data members made private.
2976 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
2978 * LyX 1.1.5 released
2980 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
2982 * src/version.h (LYX_RELEASE): to 1.1.5
2984 * src/spellchecker.C (RunSpellChecker): return false if the
2985 spellchecker dies upon creation.
2987 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2989 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
2990 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
2994 * lib/CREDITS: update entry for Martin Vermeer.
2996 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
2998 * src/text.C (draw): Draw foreign language bars at the bottom of
2999 the row instead of at the baseline.
3001 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
3003 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3005 * lib/bind/de_menus.bind: updated
3007 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3009 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
3011 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3013 * src/menus.C (Limit_string_length): New function
3014 (ShowTocMenu): Limit the number of items/length of items in the
3017 * src/paragraph.C (String): Correct result for a paragraph inside
3020 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3022 * src/bufferlist.C (close): test of buf->getuser() == NULL
3024 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
3026 * src/BufferView2.C (removeAutoInsets): Fix a bug:
3027 Do not call to SetCursor when the paragraph is a closed footnote!
3029 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
3031 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
3034 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
3036 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3039 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
3040 reference popup, that activates the reference-back action
3042 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
3044 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
3045 the menus. Also fixed a bug.
3047 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
3048 the math panels when switching buffers (unless new buffer is readonly).
3050 * src/BufferView.C (NoSavedPositions)
3051 * src/BufferView_pimpl.C (NoSavedPositions): New methods
3053 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3055 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
3056 less of dvi dirty or not.
3058 * src/trans_mgr.[Ch] (insert): change first parameter to string
3061 * src/chset.[Ch] (encodeString): add const to first parameter
3063 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3065 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
3069 * src/LaTeX.C (deplog): better searching for dependency files in
3070 the latex log. Uses now regexps.
3072 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
3073 instead of the box hack or \hfill.
3075 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3077 * src/lyxfunc.C (doImportHelper): do not create the file before
3078 doing the actual import.
3079 (doImportASCIIasLines): create a new file before doing the insert.
3080 (doImportASCIIasParagraphs): ditto.
3082 * lib/lyxrc.example: remove mention of non-existing commands
3084 * lyx.man: remove mention of color-related switches.
3086 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
3088 * src/lyx_gui.C: remove all the color-related ressources, which
3089 are not used anymore.
3091 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
3094 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3096 * src/lyxrc.C (read): Add a missing break in the switch
3098 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
3100 * src/text2.C (InsertStringA): Fix a bug with insertion into table
3102 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
3105 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3107 * src/text.C (draw): draw bars under foreign language words.
3109 * src/LColor.[Ch]: add LColor::language
3111 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3113 * src/lyxcursor.h (boundary): New member variable
3115 * src/text.C (IsBoundary): New methods
3117 * src/text.C: Use the above for currect cursor movement when there
3118 is both RTL & LTR text.
3120 * src/text2.C: ditto
3122 * src/bufferview_funcs.C (ToggleAndShow): ditto
3124 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3126 * src/text.C (DeleteLineForward): set selection to true to avoid
3127 that DeleteEmptyParagraphMechanism does some magic. This is how it
3128 is done in all other functions, and seems reasonable.
3129 (DeleteWordForward): do not jump over non-word stuff, since
3130 CursorRightOneWord() already does it.
3132 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
3133 DeleteWordBackward, since they seem safe to me (since selection is
3134 set to "true") DeleteEmptyParagraphMechanism does nothing.
3136 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3138 * src/lyx_main.C (easyParse): simplify the code by factoring the
3139 part that removes parameters from the command line.
3140 (LyX): check wether wrong command line options have been given.
3142 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
3144 * src/lyx_main.C : add support for specifying user LyX
3145 directory via command line option -userdir.
3147 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
3149 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
3150 the number of items per popup.
3151 (Add_to_refs_menu): Ditto.
3153 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3155 * src/lyxparagraph.h: renamed ClearParagraph() to
3156 StripLeadingSpaces() and moved it to paragraph.C. We pass the
3157 textclass as parameter, and do nothing if free_spacing is
3158 true. This fixes part of the line-delete-forward problems.
3160 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
3161 (pasteSelection): ditto.
3162 (SwitchLayoutsBetweenClasses): more translatable strings.
3164 * src/text2.C (CutSelection): use StripLeadingSpaces.
3165 (PasteSelection): ditto.
3166 (DeleteEmptyParagraphMechanism): ditto.
3168 2000-05-26 Juergen Vigna <jug@sad.it>
3170 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
3171 is not needed in tabular insets.
3173 * src/insets/insettabular.C (TabularFeatures): added missing features.
3175 * src/tabular.C (DeleteColumn):
3177 (AppendRow): implemented this functions
3178 (cellsturct::operator=): clone the inset too;
3180 2000-05-23 Juergen Vigna <jug@sad.it>
3182 * src/insets/insettabular.C (LocalDispatch): better selection support
3183 when having multicolumn-cells.
3185 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3187 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
3189 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3191 * src/ColorHandler.C (getGCForeground): put more test into _()
3193 * lib/examples/eu_splash.lyx: new file (Basque translation) from
3196 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
3199 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
3201 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
3202 there are no labels, or when buffer is readonly.
3204 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
3205 there are no labels, buffer is SGML, or when buffer is readonly.
3207 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3209 * src/LColor.C (LColor): change a couple of grey40 to grey60
3210 (LColor): rewore initalization to make compiles go some magnitude
3212 (getGUIName): don't use gettext until we need the string.
3214 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
3216 * src/Bullet.[Ch]: Fixed a small bug.
3218 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
3220 * src/paragraph.C (String): Several fixes/improvements
3222 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
3224 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3226 * src/paragraph.C (String): give more correct output.
3228 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
3230 * src/lyxfont.C (stateText) Do not output the language if it is
3231 eqaul to the language of the document.
3233 * src/paragraph.C (TeXOnePar): Do not put language switch commands
3234 between two paragraphs with the same language.
3236 * src/paragraph.C (getParLanguage) Return a correct answer for an
3237 empty dummy paragraph.
3239 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
3242 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
3245 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
3246 the menus/popup, if requested fonts are unavailable.
3248 2000-05-22 Juergen Vigna <jug@sad.it>
3250 * src/insets/insettabular.C (LocalDispatch): added some more cursor
3251 movement support (Up/Down/Tab/Shift-Tab).
3252 (LocalDispatch): added also preliminari cursor-selection.
3254 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
3256 * src/paragraph.C (PasteParagraph): Hopefully now right!
3258 2000-05-22 Garst R. Reese <reese@isn.net>
3260 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
3261 of list, change all references to Environment to Command
3262 * tex/hollywood.cls : rewrite environments as commands, add
3263 \uppercase to interiorshot and exteriorshot to force uppecase.
3264 * tex/broadway.cls : rewrite environments as commands. Tweak
3267 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3269 * src/menus.C (Add_to_toc_menu): fix the code which limits the
3270 size of items: use a constant intead of the hardcoded 40, and more
3271 importantly do not remove the %m and %x tags added at the end.
3272 (Add_to_refs_menu): use vector::size_type instead of
3273 unsigned int as basic types for the variables. _Please_ do not
3274 assume that size_t is equal to unsigned int. On an alpha, this is
3275 unsigned long, which is _not_ the same.
3277 * src/language.C (initL): remove language "hungarian", since it
3278 seems that "magyar" is better.
3280 2000-05-22 Juergen Vigna <jug@sad.it>
3282 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
3284 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
3287 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
3288 next was deleted but not set to 0.
3290 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3292 * src/language.C (initL): change the initialization of languages
3293 so that compiles goes _fast_.
3295 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
3298 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
3300 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3304 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3306 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
3308 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
3312 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
3315 * src/insets/insetlo*.[Ch]: Made editable
3317 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3319 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
3320 the current selection.
3322 * src/BufferView_pimpl.C (stuffClipboard): new method
3324 * src/BufferView.C (stuffClipboard): new method
3326 * src/paragraph.C (String): new method
3328 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
3329 LColor::ignore when lyxname is not found.
3331 * src/BufferView.C (pasteSelection): new method
3333 * src/BufferView_pimpl.C (pasteSelection): new method
3335 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
3337 * src/WorkArea.C (request_clipboard_cb): new static function
3338 (getClipboard): new method
3339 (putClipboard): new method
3341 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3343 * LyX 1.1.5pre2 released
3345 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3347 * src/vspace.C (operator=): removed
3348 (operator=): removed
3350 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
3352 * src/layout.C (NumberOfClass): manually set the type in make_pair
3353 (NumberOfLayout): ditto
3355 * src/language.C: use the Language constructor for ignore_lang
3357 * src/language.h: add constructors to struct Language
3359 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
3361 * src/text2.C (SetCursorIntern): comment out #warning
3363 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
3365 * src/mathed/math_iter.h: initialize sx and sw to 0
3367 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3369 * forms/lyx.fd: Redesign of form_ref
3371 * src/LaTeXFeatures.[Ch]
3375 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
3378 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
3379 and Buffer::inset_iterator.
3381 * src/menus.C: Added new menus: TOC and Refs.
3383 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
3385 * src/buffer.C (getTocList): New method.
3387 * src/BufferView2.C (ChangeRefs): New method.
3389 * src/buffer.C (getLabelList): New method. It replaces the old
3390 getReferenceList. The return type is vector<string> instead of
3393 * src/insets/insetinclude.C (getLabelList): New method. Replaces
3394 the old getLabel() and GetNumberOfLabels() methods.
3395 * src/insets/insetlabel.C (getLabelList): ditto
3396 * src/mathed/formula.C (getLabelList): ditto
3398 * src/paragraph.C (String): New method.
3400 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
3401 Uses the new getTocList() method.
3402 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
3403 which automatically updates the contents of the browser.
3404 (RefUpdateCB): Use the new getLabelList method.
3406 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
3408 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
3410 * src/spellchecker.C: Added using std::reverse;
3412 2000-05-19 Juergen Vigna <jug@sad.it>
3414 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
3416 * src/insets/insettext.C (computeTextRows): small fix for display of
3417 1 character after a newline.
3419 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
3422 2000-05-18 Juergen Vigna <jug@sad.it>
3424 * src/insets/insettabular.C (TabularFeatures): fixed update of display
3425 when changing width of column.
3427 * src/tabular.C (set_row_column_number_info): setting of
3428 autobreak rows if necessary.
3430 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3432 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
3434 * src/vc-backend.*: renamed stat() to status() and vcstat to
3435 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
3436 compilation broke. The new name seems more relevant, anyway.
3438 2000-05-17 Juergen Vigna <jug@sad.it>
3440 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
3441 which was wrong if the removing caused removing of rows!
3443 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
3444 (pushToken): new function.
3446 * src/text2.C (CutSelection): fix problem discovered with purify
3448 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3450 * src/debug.C (showTags): enlarge the first column, now that we
3451 have 6-digits debug codes.
3453 * lib/layouts/hollywood.layout:
3454 * lib/tex/hollywood.cls:
3455 * lib/tex/brodway.cls:
3456 * lib/layouts/brodway.layout: more commands and fewer
3457 environments. Preambles moved in the .cls files. Broadway now has
3458 more options on scene numbering and less whitespace (from Garst)
3460 * src/insets/insetbib.C (getKeys): make sure that we are in the
3461 document directory, in case the bib file is there.
3463 * src/insets/insetbib.C (Latex): revert bogus change.
3465 2000-05-16 Juergen Vigna <jug@sad.it>
3467 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
3468 the TabularLayout on cursor move.
3470 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
3472 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
3475 (draw): fixed cursor position and drawing so that the cursor is
3476 visible when before the tabular-inset.
3478 * src/insets/insettext.C (init): drawLockedFrame was not initialized
3479 when creating from old insettext.
3481 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
3483 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3485 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
3486 * lib/tex/brodway.cls: ditto
3488 * lib/layouts/brodway.layout: change alignment of parenthical
3491 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3493 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
3494 versions 0.88 and 0.89 are supported.
3496 2000-05-15 Juergen Vigna <jug@sad.it>
3498 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
3501 * src/insets/insettext.C (computeTextRows): redone completely this
3502 function in a much cleaner way, because of problems when having a
3504 (draw): added a frame border when the inset is locked.
3505 (SetDrawLockedFrame): this sets if we draw the border or not.
3506 (SetFrameColor): this sets the frame color (default=insetframe).
3508 * src/insets/lyxinset.h: added x() and y() functions which return
3509 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
3510 function which is needed to see if we have a locking inset of some
3511 type in this inset (needed for now in insettabular).
3513 * src/vspace.C (inPixels): the same function also without a BufferView
3514 parameter as so it is easier to use it in some ocasions.
3516 * src/lyxfunc.C: changed all places where insertInset was used so
3517 that now if it couldn't be inserted it is deleted!
3519 * src/TabularLayout.C:
3520 * src/TableLayout.C: added support for new tabular-inset!
3522 * src/BufferView2.C (insertInset): this now returns a bool if the
3523 inset was really inserted!!!
3525 * src/tabular.C (GetLastCellInRow):
3526 (GetFirstCellInRow): new helper functions.
3527 (Latex): implemented for new tabular class.
3531 (TeXTopHLine): new Latex() helper functions.
3533 2000-05-12 Juergen Vigna <jug@sad.it>
3535 * src/mathed/formulamacro.C (Read):
3536 * src/mathed/formula.C (Read): read also the \end_inset here!
3538 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3540 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
3541 crush when saving formulae with unbalanced parenthesis.
3543 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
3545 * src/layout.C: Add new keyword "endlabelstring" to layout file
3547 * src/text.C (GetVisibleRow): Draw endlabel string.
3549 * lib/layouts/broadway.layout
3550 * lib/layouts/hollywood.layout: Added endlabel for the
3551 Parenthetical layout.
3553 * lib/layouts/heb-article.layout: Do not use slanted font shape
3554 for Theorem like environments.
3556 * src/buffer.C (makeLaTeXFile): Always add "american" to
3557 the UsedLanguages list if document language is RTL.
3559 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3561 * add addendum to README.OS2 and small patch (from SMiyata)
3563 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3565 * many files: correct the calls to ChangeExtension().
3567 * src/support/filetools.C (ChangeExtension): remove the no_path
3568 argument, which does not belong there. Use OnlyFileName() instead.
3570 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
3571 files when LaTeXing a non-nice latex file.
3573 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
3574 a chain of "if". Return false when deadkeys are not handled.
3576 * src/lyx_main.C (LyX): adapted the code for default bindings.
3578 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
3579 bindings for basic functionality (except deadkeys).
3580 (deadKeyBindings): new method. Performs the bindings of deadkeys.
3582 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
3583 several methods: handle override_x_deadkeys.
3585 * src/lyxrc.h: remove the "bindings" map, which did not make much
3586 sense anyway. New variable override_x_deadkeys, defaulting to "true".
3588 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3590 * src/lyxfont.C (stateText): use a saner method to determine
3591 whether the font is "default". Seems to fix the crash with DEC
3594 * src/Bullet.[Ch] (Bullet): remove const on parameters.
3596 2000-05-08 Juergen Vigna <jug@sad.it>
3598 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
3599 TabularLayoutMenu with mouse-button-3
3600 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
3602 * src/TabularLayout.C: added this file for having a Layout for
3605 2000-05-05 Juergen Vigna <jug@sad.it>
3607 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
3608 recalculating inset-widths.
3609 (TabularFeatures): activated this function so that I can change
3610 tabular-features via menu.
3612 * src/menus.C (ShowEditMenu): inserted support for insettabular so
3613 that I can test some functions with the Table menu.
3615 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3617 * src/lyxfont.C (stateText): guard against stupid c++libs.
3619 * src/tabular.C: add using std::vector
3620 some whitespace changes, + removed som autogenerated code.
3622 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
3624 2000-05-05 Juergen Vigna <jug@sad.it>
3626 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
3627 row, columns and cellstructures.
3629 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3631 * lib/lyxrc.example: remove obsolete entries.
3633 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
3634 reading of protected_separator for free_spacing.
3636 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3638 * src/text.C (draw): do not display an exclamation mark in the
3639 margin for margin notes. This is confusing, ugly and
3642 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
3643 AMS math' is checked.
3645 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
3646 name to see whether including the amsmath package is needed.
3648 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
3650 * src/paragraph.C (validate): Compute UsedLanguages correctly
3651 (don't insert the american language if it doesn't appear in the
3654 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
3655 The argument of \thanks{} command is considered moving argument
3657 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
3660 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
3662 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
3663 for appendix/minipage/depth. The lines can be now both in the footnote
3664 frame, and outside the frame.
3666 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
3669 2000-05-05 Juergen Vigna <jug@sad.it>
3671 * src/table.[Ch]: removed the inset and buffer stuff as this is now
3672 neede only in tabular.[Ch].
3674 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3676 * src/insets/insetspecialchar.C (Read): allow command == '~' for
3678 (Write): write '~' for PROTECTED_SEPARATOR
3680 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3682 * src/lyxparagraph.h: add a friend struct matchIT after the struct
3685 * src/mathed/formula.C (drawStr): rename size to siz.
3687 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
3688 possibly fix a bug by not changing the pflags = flags to piflags =
3691 2000-05-05 Juergen Vigna <jug@sad.it>
3693 * src/insets/insetbib.C: moved using directive
3695 * src/ImportNoweb.C: small fix for being able to compile (missing
3698 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3700 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
3701 to use clear, since we don't depend on this in the code. Add test
3704 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3706 * (various *.C files): add using std::foo directives to please dec
3709 * replace calls to string::clear() to string::erase() (Angus)
3711 * src/cheaders/cmath: modified to provide std::abs.
3713 2000-05-04 Juergen Vigna <jug@sad.it>
3715 * src/insets/insettext.C: Prepared all for inserting of multiple
3716 paragraphs. Still display stuff to do (alignment and other things),
3717 but I would like to use LyXText to do this when we cleaned out the
3718 table-support stuff.
3720 * src/insets/insettabular.C: Changed lot of stuff and added lots
3721 of functionality still a lot to do.
3723 * src/tabular.C: Various functions changed name and moved to be
3724 const functions. Added new Read and Write functions and changed
3725 lots of things so it works good with tabular-insets (also removed
3726 some stuff which is not needed anymore * hacks *).
3728 * src/lyxcursor.h: added operators == and != which just look if
3729 par and pos are (not) equal.
3731 * src/buffer.C (latexParagraphs): inserted this function to latex
3732 all paragraphs form par to endpar as then I can use this too for
3735 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
3736 so that I can call this to from text insets with their own cursor.
3738 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
3739 output off all paragraphs (because of the fix below)!
3741 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
3742 the very last paragraph (this could be also the last paragraph of an
3745 * src/texrow.h: added rows() call which returns the count-variable.
3747 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3749 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
3751 * lib/configure.m4: better autodetection of DocBook tools.
3753 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3755 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
3757 * src/lyx_cb.C: add using std::reverse;
3759 * src/LaTeX.C (run): on error always run deleteFilesOnError before
3762 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
3763 selected files. Should fix repeated errors from generated files.
3765 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
3767 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
3769 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
3770 the spellchecker popup.
3772 * lib/lyxrc.example: Removed the \number_inset section
3774 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3776 * src/insets/figinset.C (various): Use IsFileReadable() to make
3777 sure that the file actually exist. Relying on ghostscripts errors
3778 is a bad idea since they can lead to X server crashes.
3780 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
3782 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
3785 * lib/lyxrc.example: smallish typo in description of
3786 \view_dvi_paper_option
3788 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
3791 * src/lyxfunc.C: doImportHelper to factor out common code of the
3792 various import methods. New functions doImportASCIIasLines,
3793 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
3794 doImportLinuxDoc for the format specific parts.
3797 * buffer.C: Dispatch returns now a bool to indicate success
3800 * lyx_gui.C: Add getLyXView() for member access
3802 * lyx_main.C: Change logic for batch commands: First try
3803 Buffer::Dispatch (possibly without GUI), if that fails, use
3806 * lyx_main.C: Add support for --import command line switch.
3807 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
3808 Available Formats: Everything accepted by 'buffer-import <format>'
3810 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3812 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
3815 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
3816 documents will be reformatted upon reentry.
3818 2000-04-27 Juergen Vigna <jug@sad.it>
3820 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
3821 correctly only last pos this was a bug.
3823 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3825 * release of lyx-1.1.5pre1
3827 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3829 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
3831 * src/menus.C: revert the change of naming (Figure->Graphic...)
3832 from 2000-04-11. It was incomplete and bad.
3834 * src/LColor.[Ch]: add LColor::depthbar.
3835 * src/text.C (GetVisibleRow): use it.
3837 * README: update the languages list.
3839 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
3841 * src/text.C (GetVisibleRow): show the depth of paragraphs using
3844 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3846 * README: remove sections that were just wrong.
3848 * src/text2.C (GetRowNearY): remove currentrow code
3850 * src/text.C (GetRow): remove currentrow code
3852 * src/screen.C (Update): rewritten a bit.
3853 (SmallUpdate): removed func
3855 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
3857 (FullRebreak): return bool
3858 (currentrow): remove var
3859 (currentrow_y): ditto
3861 * src/lyxscreen.h (Draw): change arg to unsigned long
3862 (FitCursor): return bool
3863 (FitManualCursor): ditto
3864 (Smallpdate): remove func
3865 (first): change to unsigned long
3866 (DrawOneRow): change second arg to long (from long &)
3867 (screen_refresh_y): remove var
3868 (scree_refresh_row): ditto
3870 * src/lyxrow.h: change baseline to usigned int from unsigned
3871 short, this brings some implicit/unsigned issues out in the open.
3873 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
3875 (Dispatch): don't call updateScrollbar after fitCursor. Use update
3876 instead of smallUpdate.
3878 * src/lyxcursor.h: change y to unsigned long
3880 * src/buffer.h: don't call updateScrollbar after fitcursor
3882 * src/buffer.C (parseSingleLyXformat2Token): move variables to
3883 where they are used. Removed "\\direction", this was not present
3884 in 1.1.4 and is already obsolete. Commented out some code that I
3885 believe to never be called.
3886 (runLiterate): don't call updateScrollbar after fitCursor
3888 (buildProgram): ditto
3891 * src/WorkArea.h (workWidth): change return val to unsigned
3894 (redraw): remove the button redraws
3895 (setScrollbarValue): change for scrollbar
3896 (getScrollbarValue): change for scrollbar
3897 (getScrollbarBounds): change for scrollbar
3899 * src/WorkArea.C (C_WorkArea_up_cb): removed func
3900 (C_WorkArea_down_cb): removed func
3901 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
3902 (resize): change for scrollbar
3903 (setScrollbar): ditto
3904 (setScrollbarBounds): ditto
3905 (setScrollbarIncrements): ditto
3906 (up_cb): removed func
3907 (down_cb): removed func
3908 (scroll_cb): change for scrollbar
3909 (work_area_handler): ditto
3911 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
3912 when FitCursor did something.
3913 (updateScrollbar): some unsigned changes
3914 (downCB): removed func
3915 (scrollUpOnePage): removed func
3916 (scrollDownOnePage): remvoed func
3917 (workAreaMotionNotify): don't call screen->FitCursor but use
3918 fitCursor instead. and bool return val
3919 (workAreaButtonPress): ditto
3920 (workAreaButtonRelease): some unsigned changes
3921 (checkInsetHit): ditto
3922 (workAreaExpose): ditto
3923 (update): parts rewritten, comments about the signed char arg added
3924 (smallUpdate): removed func
3925 (cursorPrevious): call needed updateScrollbar
3928 * src/BufferView2.C (allFloats): don't call updateScrollbar after
3931 * src/BufferView.[Ch] (upCB): removed func
3932 (downCB): removed func
3933 (smallUpdate): removed func
3935 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3937 * src/lyxtext.h src/text.C src/text2.C: removed support for the
3938 currentrow, currentrow_y optimization. This did not help a lot and
3939 if we want to do this kind of optimization we should rather use
3940 cursor.row instead of the currentrow.
3942 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
3943 buffer spacing and klyx spacing support.
3945 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
3947 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
3950 2000-04-26 Juergen Vigna <jug@sad.it>
3952 * src/insets/figinset.C: fixes to Lars sstream changes!
3954 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
3956 * A lot of files: Added Ascii(ostream &) methods to all inset
3957 classes. Used when exporting to ASCII.
3959 * src/buffer.C (writeFileAscii,RoffAsciiTable)
3960 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
3963 * src/text2.C (ToggleFree): Disabled implicit word selection when
3964 there is a change in the language
3966 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
3967 no output was generated for end-of-sentence inset.
3969 * src/insets/lyxinset.h
3972 * src/paragraph.C: Removed the insetnumber code
3974 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
3976 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3978 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
3979 no_babel and no_epsfig completely from the file.
3980 (parseSingleLyXformat2Token): add handling for per-paragraph
3981 spacing as written by klyx.
3983 * src/insets/figinset.C: applied patch by Andre. Made it work with
3986 2000-04-20 Juergen Vigna <jug@sad.it>
3988 * src/insets/insettext.C (cutSelection):
3989 (copySelection): Fixed with selection from right to left.
3990 (draw): now the rows are not recalculated at every draw.
3991 (computeTextRows): for now reset the inset-owner here (this is
3992 important for an undo or copy where the inset-owner is not set
3995 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
3996 motion to the_locking_inset screen->first was forgotten, this was
3997 not important till we got multiline insets.
3999 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4001 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
4002 code seems to be alright (it is code changed by Dekel, and the
4003 intent is indeed that all macros should be defined \protect'ed)
4005 * NEWS: a bit of reorganisation of the new user-visible features.
4007 2000-04-19 Juergen Vigna <jug@sad.it>
4009 * src/insets/insettext.C (init): using a LyXCursor now for cursor
4010 position. Set the inset_owner of the used paragraph so that it knows
4011 that it is inside an inset. Fixed cursor handling with mouse and
4012 cursor keys. Fixed wrong timed inset redraws and lots of other changes
4013 and cleanups to make TextInsets work better.
4015 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
4016 Changed parameters of various functions and added LockInsetInInset().
4018 * src/insets/insettext.C:
4020 * src/insets/insetcollapsable.h:
4021 * src/insets/insetcollapsable.C:
4022 * src/insets/insetfoot.h:
4023 * src/insets/insetfoot.C:
4024 * src/insets/insetert.h:
4025 * src/insets/insetert.C: cleaned up the code so that it works now
4026 correctly with insettext.
4028 * src/insets/inset.C:
4029 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
4030 that insets in insets are supported right.
4033 * src/table.C: lots of changes for use with inset tabular (and cleanup)
4035 * src/paragraph.C: some small fixes
4037 * src/debug.h: inserted INSETS debug info
4039 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
4040 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
4042 * src/commandtags.h:
4043 * src/LyXAction.C: insert code for InsetTabular.
4045 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
4046 not Button1MotionMask.
4047 (workAreaButtonRelease): send always a InsetButtonRelease event to
4049 (checkInsetHit): some setCursor fixes (always with insets).
4051 * src/BufferView2.C (lockInset): returns a bool now and extended for
4052 locking insets inside insets.
4053 (showLockedInsetCursor): it is important to have the cursor always
4054 before the locked inset.
4055 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
4057 * src/BufferView.h: made lockInset return a bool.
4059 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
4061 * src/text2.C (SetCursor): This now has a version with a LyXCursor
4062 that is used also internally but can be called as public to have back
4063 a cursor pos which is not set internally.
4064 (SetCursorIntern): Changed to use above function.
4066 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
4068 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4073 * NEWS: updated for prerelease of 1.1.5. Please comment and send
4074 patches for things that should be in or should be changed.
4076 * src/* [insetfiles]: change "usigned char fragile" to bool
4077 fragile. There was only one point that could that be questioned
4078 and that is commented in formulamacro.C. Grep for "CHECK".
4080 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
4081 (DeleteBuffer): take it out of CutAndPaste and make it static.
4083 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4085 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
4086 output the spacing envir commands. Also the new commands used in
4087 the LaTeX output makes the result better.
4089 * src/Spacing.C (writeEnvirBegin): new method
4090 (writeEnvirEnd): new method
4092 2000-04-18 Juergen Vigna <jug@sad.it>
4094 * src/CutAndPaste.C: made textclass a static member of the class
4095 as otherwise it is not accesed right!!!
4097 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
4099 * forms/layout_forms.fd
4100 * src/layout_forms.h
4101 * src/layout_forms.C (create_form_form_character)
4102 * src/lyx_cb.C (UserFreeFont)
4103 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
4104 documents (in the layout->character popup).
4106 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4108 * src/spellchecker.C (create_ispell_pipe): fix a bug where
4109 \spell_command was in fact not honored (from Kevin Atkinson).
4111 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
4114 * src/lyx_gui.h: make lyxViews private (Angus)
4116 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
4118 * src/mathed/math_write.C
4119 (MathMatrixInset::Write) Put \protect before \begin{array} and
4120 \end{array} if fragile
4121 (MathParInset::Write): Put \protect before \\ if fragile
4123 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4125 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
4126 initialization if the LyXColorHandler must be done after the
4127 connections to the XServer has been established.
4129 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
4130 get the background pixel from the lyxColorhandler so that the
4131 figures are rendered with the correct background color.
4132 (NextToken): removed functions.
4133 (GetPSSizes): use ifs >> string instead of NextToken.
4135 * src/Painter.[Ch]: the color cache moved out of this file.
4137 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
4140 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4142 * src/WorkArea.C (work_area_handler): call BufferView::enterView
4143 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
4145 * src/BufferView.C (enterView): new func
4146 (leaveView): new func
4148 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
4150 (leaveView): new func, undefines xterm cursor when approp.
4152 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
4153 (AllowInput): delete the Workarea cursor handling from this func.
4155 * src/Painter.C (underline): draw a slimer underline in most cases.
4157 * src/lyx_main.C (error_handler): use extern "C"
4159 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4161 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
4162 sent directly to me.
4164 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
4165 to the list by Dekel.
4167 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
4170 * src/bufferview_funcs.[Ch]: two new files, moved several of the
4171 methods from lyx_cb.here.
4173 * src/lyx_cb.C: in addition to the above; removed input_prohibited
4176 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4178 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
4179 instead of using current_view directly.
4181 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
4183 * src/LyXAction.C (init): add the paragraph-spacing command.
4185 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
4187 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
4189 * src/lyx_cb.C (CurrentState): output a string when the spacing is
4190 different from the documents.
4192 * src/text.C (SetHeightOfRow): take paragraph spacing into
4193 account, paragraph spacing takes precedence over buffer spacing
4194 (GetVisibleRow): ditto
4196 * src/paragraph.C (writeFile): output the spacing parameter too.
4197 (validate): set the correct features if spacing is used in the
4199 (Clear): set spacing to default
4200 (MakeSameLayout): spacing too
4201 (HasSameLayout): spacing too
4202 (SetLayout): spacing too
4203 (TeXOnePar): output the spacing commands
4205 * src/lyxparagraph.h: added a spacing variable for use with
4206 per-paragraph spacing.
4208 * src/Spacing.h: add a Default spacing and a method to check if
4209 the current spacing is default. also added an operator==
4211 * src/text2.C (DeleteEmptyParagraphMechanism): added a
4214 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4216 * src/lyxserver.C (callback): fix dispatch of functions
4218 * src/insets/insetlatexaccent.C (checkContents): turn bogus
4219 printf() into lyxerr call.
4221 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
4224 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
4225 "Table" to "Table Box", "Float" to "Floating Material"; deletes
4226 the "Float" from each of the subitems.
4227 (ShowHelpMenu): add entry for "FAQ" and "TOC".
4229 * src/support/DebugStream.h: add an #ifdef to work around a gcc
4230 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
4231 documented the change so that the workaround can be nuked later.
4233 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
4236 * src/lyxlex_pimpl.C (next): do not re-declare the default value
4238 * src/buffer.C (getLatexName): ditto
4239 (setReadonly): ditto
4241 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4243 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
4244 avoid some uses of current_view. Added also a bufferParams()
4245 method to get at this.
4247 * src/lyxtext.h: changed params->buffer and paramters->bparams.
4249 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4251 * src/lyxparagraph.[Ch]: removed
4252 operator<(LyXParagraph::InsetTable..., added a struct matchIT
4253 with operators used by lower_bound and
4254 upper_bound in InsetTable's
4255 Make struct InsetTable private again. Used matchpos.
4257 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
4259 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
4260 document, the language of existing text is changed (unless the
4261 document is multi-lingual)
4263 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
4265 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
4267 * A lot of files: A rewrite of the Right-to-Left support.
4269 2000-04-10 Juergen Vigna <jug@sad.it>
4271 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
4272 misplaced cursor when inset in inset is locked.
4274 * src/insets/insettext.C (LocalDispatch): small fix so that a
4275 BREAKLINE is not inserted if we don't permit it with autBreakRows.
4277 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
4278 footnote font should be decreased in size twice when displaying.
4280 * src/insets/insettext.C (GetDrawFont): inserted this function as
4281 the drawing-font may differ from the real paragraph font.
4283 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
4284 insets (inset in inset!).
4286 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
4287 function here because we don't want footnotes inside footnotes.
4289 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
4291 (init): now set the inset_owner in paragraph.C
4292 (LocalDispatch): added some resetPos() in the right position
4295 (pasteSelection): changed to use the new CutAndPaste-Class.
4297 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
4298 which tells if it is allowed to insert another inset inside this one.
4300 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
4301 SwitchLayoutsBetweenClasses.
4303 * src/text2.C (InsertInset): checking of the new paragraph-function
4305 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
4306 is not needed anymore here!
4309 (PasteSelection): redone (also with #ifdef) so that now this uses
4310 the CutAndPaste-Class.
4311 (SwitchLayoutsBetweenClasses): removed here and implemented in the
4314 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
4315 from/to text/insets.
4317 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
4318 so that the paragraph knows if it is inside an (text)-inset.
4319 (InsertFromMinibuffer): changed return-value to bool as now it
4320 may happen that an inset is not inserted in the paragraph.
4321 (InsertInsetAllowed): this checks if it is allowed to insert an
4322 inset in this paragraph.
4324 (BreakParagraphConservative):
4325 (BreakParagraph) : small change for the above change of the return
4326 value of InsertFromMinibuffer.
4328 * src/lyxparagraph.h: added inset_owner and the functions to handle
4329 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
4331 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4333 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
4334 functions from BufferView to BufferView::Pimpl to ease maintence.
4336 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
4337 correctly. Also use SetCursorIntern instead of SetCursor.
4339 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
4342 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4344 * src/WorkArea.C (belowMouse): manually implement below mouse.
4346 * src/*: Add "explicit" on several constructors, I added probably
4347 some unneeded ones. A couple of changes to code because of this.
4349 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
4350 implementation and private parts from the users of BufferView. Not
4353 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
4354 implementation and private parts from the users of LyXLex. Not
4357 * src/BufferView_pimpl.[Ch]: new files
4359 * src/lyxlex_pimpl.[Ch]: new files
4361 * src/LyXView.[Ch]: some inline functions move out-of-line
4363 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4365 * src/lyxparagraph.h: make struct InsetTable public.
4367 * src/support/lyxstring.h: change lyxstring::difference_type to be
4368 ptrdiff_t. Add std:: modifiers to streams.
4370 * src/font.C: include the <cctype> header, for islower() and
4373 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4375 * src/font.[Ch]: new files. Contains the metric functions for
4376 fonts, takes a LyXFont as parameter. Better separation of concepts.
4378 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
4379 changes because of this.
4381 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
4383 * src/*: compile with -Winline and move functions that don't
4386 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
4389 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4391 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
4392 (various files changed because of this)
4394 * src/Painter.C (text): fixed the drawing of smallcaps.
4396 * src/lyxfont.[Ch] (drawText): removed unused member func.
4399 * src/*.C: added needed "using" statements and "std::" qualifiers.
4401 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4403 * src/*.h: removed all use of "using" from header files use
4404 qualifier std:: instead.
4406 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4408 * src/text.C (Backspace): some additional cleanups (we already
4409 know whether cursor.pos is 0 or not).
4411 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
4412 automake does not provide one).
4414 * src/bmtable.h: replace C++ comments with C comments.
4416 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
4418 * src/screen.C (ShowCursor): Change the shape of the cursor if
4419 the current language is not equal to the language of the document.
4420 (If the cursor change its shape unexpectedly, then you've found a bug)
4422 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
4425 * src/insets/insetnumber.[Ch]: New files.
4427 * src/LyXAction.C (init)
4428 * src/lyxfunc.C (dispatch): Add command number-inset-insert
4431 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
4433 * src/lyxparagraph.h
4434 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
4435 (the vector is kept sorted).
4437 * src/text.C (GetVisibleRow): Draw selection correctly when there
4438 is both LTR and RTL text.
4440 * src/paragraph.C (Clone): Use the assignment operator for cloning,
4441 which is much faster.
4443 * src/text.C (GetVisibleRow and other): Do not draw the last space
4444 in a row if the direction of the last letter is not equal to the
4445 direction of the paragraph.
4447 * src/lyxfont.C (latexWriteStartChanges):
4448 Check that font language is not equal to basefont language.
4449 (latexWriteEndChanges): ditto
4451 * src/lyx_cb.C (StyleReset): Don't change the language while using
4452 the font-default command.
4454 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
4455 empty paragraph before a footnote.
4457 * src/insets/insetcommand.C (draw): Increase x correctly.
4459 * src/screen.C (ShowCursor): Change cursor shape if
4460 current language != document language.
4462 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
4464 2000-03-31 Juergen Vigna <jug@sad.it>
4466 * src/paragraph.C (GetInset): commented out text[pos] = ' '
4467 (Clone): changed mode how the paragraph-data is copied to the
4468 new clone-paragraph.
4470 * src/lyxfunc.C (Dispatch): fixed small problem when calling
4471 GetInset(pos) with no inset anymore there (in inset UNDO)
4473 * src/insets/insetcommand.C (draw): small fix as here x is
4474 incremented not as much as width() returns (2 before, 2 behind = 4)
4476 2000-03-30 Juergen Vigna <jug@sad.it>
4478 * src/insets/insettext.C (InsetText): small fix in initialize
4479 widthOffset (should not be done in the init() function)
4481 2000-03-29 Amir Karger <karger@lyx.org>
4483 * lib/examples/it_ItemizeBullets.lyx: translation by
4486 * Implemented \textasciitilde and fixed a tiny bug in reLyX
4488 2000-03-29 Juergen Vigna <jug@sad.it>
4490 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
4492 * src/insets/insetfoot.C (Clone): small change as for the below
4493 new init function in the text-inset
4495 * src/insets/insettext.C (init): new function as I've seen that
4496 clone did not copy the Paragraph-Data!
4497 (LocalDispatch): Added code so that now we have some sort of Undo
4498 functionality (well actually we HAVE Undo ;)
4500 * src/text.C (Backspace): Small fix for the a | a Backspace problem
4502 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
4504 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
4507 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4509 * src/main.C: added a runtime check that verifies that the xforms
4510 header used when building LyX and the library used when running
4511 LyX match. Exit with a message if they don't match. This is a
4512 version number check only.
4514 * src/buffer.C (save): Don't allocate memory on the heap for
4515 struct utimbuf times.
4517 * *: some using changes, use iosfwd instead of the real headers.
4519 * src/lyxfont.C use char const * instead of string for the static
4520 strings. Rewrite some functions to use sstream.
4522 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4524 * src/text.C (Backspace): hopefully fix the dreaded backaspace
4527 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4529 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
4530 of Geodesy (from Martin Vermeer)
4532 * lib/layouts/svjour.inc: include file for the Springer svjour
4533 class. It can be used to support journals other than JoG.
4535 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
4536 Miskiewicz <misiek@pld.org.pl>)
4537 * lib/reLyX/Makefile.am: ditto.
4539 2000-03-27 Juergen Vigna <jug@sad.it>
4541 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
4542 also some modifications with operations on selected text.
4544 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
4545 problems with clicking on insets (last famous words ;)
4547 * src/insets/insetcommand.C (draw):
4548 (width): Changed to have a bit of space before and after the inset so
4549 that the blinking cursor can be seen (otherwise it was hidden)
4551 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4553 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
4554 would not be added to the link list when an installed gettext (not
4555 part of libc) is found.
4557 2000-03-24 Juergen Vigna <jug@sad.it>
4559 * src/insets/insetcollapsable.C (Edit):
4560 * src/mathed/formula.C (InsetButtonRelease):
4561 (InsetButtonPress): fixed for new handling of ButtonPress/Release
4564 * src/BufferView.C (workAreaButtonPress):
4565 (workAreaButtonRelease):
4566 (checkInsetHit): Finally fixed the clicking on insets be handled
4569 * src/insets/insetert.C (Edit): inserted this call so that ERT
4570 insets work always with LaTeX-font
4572 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
4574 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
4575 caused lyx to startup with no GUI in place, causing in a crash
4576 upon startup when called with arguments.
4578 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4580 * src/FontLoader.C: better initialization of dummyXFontStruct.
4582 2000-03-20 José Abílio Matos <jamatos@lyx.org>
4584 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
4585 for linuxdoc and docbook import and export format options.
4587 * lib/lyxrc.example Example of default values for the previous flags.
4589 * src/lyx_cb.C Use those flags instead of the hardwired values for
4590 linuxdoc and docbook export.
4592 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
4595 * src/menus.C Added menus entries for the new import/exports formats.
4597 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4599 * src/lyxrc.*: Added support for running without Gui
4602 * src/FontLoader.C: sensible defaults if no fonts are needed
4604 * src/lyx_cb.C: New function ShowMessage (writes either to the
4605 minibuffer or cout in case of no gui
4606 New function AskOverwrite for common stuff
4607 Consequently various changes to call these functions
4609 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
4610 wild guess at sensible screen resolution when having no gui
4612 * src/lyxfont.C: no gui, no fonts... set some defaults
4614 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4616 * src/LColor.C: made the command inset background a bit lighter.
4618 2000-03-20 Hartmut Goebel <goebel@noris.net>
4620 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
4621 stdstruct.inc. Koma-Script added some title elements which
4622 otherwise have been listed below "bibliography". This split allows
4623 adding title elements to where they belong.
4625 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
4626 define the additional tilte elements and then include
4629 * many other layout files: changed to include stdtitle.inc just
4630 before stdstruct.inc.
4632 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
4634 * src/buffer.C: (save) Added the option to store all backup files
4635 in a single directory
4637 * src/lyxrc.[Ch]: Added variable \backupdir_path
4639 * lib/lyxrc.example: Added descriptions of recently added variables
4641 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
4642 bibtex inset, not closing the bibtex popup when deleting the inset)
4644 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4646 * src/lyx_cb.C: add a couple using directives.
4648 2000-03-17 José Abílio Matos <jamatos@lyx.org>
4649 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
4650 import based on the filename.
4652 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
4653 file would be imported at start, if the filename where of a sgml file.
4655 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
4657 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
4659 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
4660 * src/lyxfont.h Replaced the member variable bits.direction by the
4661 member variable lang. Made many changes in other files.
4662 This allows having a multi-lingual document
4664 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
4665 that change the current language to <l>.
4666 Removed the command "font-rtl"
4668 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
4669 format for Hebrew documents)
4671 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
4672 When auto_mathmode is "true", pressing a digit key in normal mode
4673 will cause entering into mathmode.
4674 If auto_mathmode is "rtl" then this behavior will be active only
4675 when writing right-to-left text.
4677 * src/text2.C (InsertStringA) The string is inserted using the
4680 * src/paragraph.C (GetEndLabel) Gives a correct result for
4681 footnote paragraphs.
4683 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
4685 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4687 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
4688 front of PasteParagraph. Never insert a ' '. This should at least
4689 fix some cause for the segfaults that we have been experiencing,
4690 it also fixes backspace behaviour slightly. (Phu!)
4692 * src/support/lstrings.C (compare_no_case): some change to make it
4693 compile with gcc 2.95.2 and stdlibc++-v3
4695 * src/text2.C (MeltFootnoteEnvironment): change type o
4696 first_footnote_par_is_not_empty to bool.
4698 * src/lyxparagraph.h: make text private. Changes in other files
4700 (fitToSize): new function
4701 (setContentsFromPar): new function
4702 (clearContents): new function
4703 (SetChar): new function
4705 * src/paragraph.C (readSimpleWholeFile): deleted.
4707 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
4708 the file, just use a simple string instead. Also read the file in
4709 a more maintainable manner.
4711 * src/text2.C (InsertStringA): deleted.
4712 (InsertStringB): deleted.
4714 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4716 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
4717 RedoParagraphs from the doublespace handling part, just set status
4718 to NEED_MORE_REFRESH. Also don't update cursor position (should be
4719 done, but perhaps not like this.)
4721 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4723 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
4724 character when inserting an inset.
4726 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4728 * src/bufferparams.C (readLanguage): now takes "default" into
4731 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
4732 also initialize the toplevel_keymap with the default bindings from
4735 * src/buffer.C (Buffer): remove lyxrc from the parameters.
4737 * all files using lyxrc: have lyxrc as a real variable and not a
4738 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
4741 * src/lyxrc.C: remove double call to defaultKeyBindings
4743 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
4744 toolbar defauls using lyxlex. Remove enums, structs, functions
4747 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
4748 toolbar defaults. Also store default keybindings in a map.
4750 * src/ToolbarDefaults.[Ch]: New file. This class is used for
4751 storing the toolbar defaults without any xforms dependencies.
4753 * src/insets/figinset.C: patch posted to list by Andre Poenitz
4754 applied. Changed to use iterators.
4756 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
4758 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
4759 systems that don't have LINGUAS set to begin with.
4761 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4763 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
4764 the list by Dekel Tsur.
4766 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4768 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
4769 * src/insets/form_graphics.C: ditto.
4771 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
4773 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4775 * src/bufferparams.C (readLanguage): use the new language map
4777 * src/intl.C (InitKeyMapper): use the new language map
4779 * src/lyx_gui.C (create_forms): use the new language map
4781 * src/language.[Ch]: New files. Used for holding the information
4782 about each language. Now! Use this new language map enhance it and
4783 make it really usable for our needs.
4785 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
4787 * screen.C (ShowCursor): Removed duplicate code.
4788 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
4789 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
4791 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
4794 * src/text.C Added TransformChar method. Used for rendering Arabic
4795 text correctly (change the glyphs of the letter according to the
4796 position in the word)
4801 * src/lyxrc.C Added lyxrc command {language_command_begin,
4802 language_command_end,language_command_ltr,language_command_rtl,
4803 language_package} which allows the use of either arabtex or Omega
4806 * src/lyx_gui.C (init)
4808 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
4809 to use encoding for menu fonts which is different than the encoding
4812 * src/buffer.C (makeLaTeXFile): If params.language = "default",
4813 do not load the babel package.
4814 To write an English document with Hebrew/Arabic, change the document
4815 language to "english".
4817 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
4818 (alphaCounter): changed to return char
4819 (loweralphaCounter, hebrewCounter, romanCounter): New functions
4821 * lib/lyxrc.example Added examples for Hebrew/Arabic
4824 * src/layout.C Added layout command endlabeltype
4826 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
4828 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
4830 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4832 * src/mathed/math_delim.C (search_deco): return a
4833 math_deco_struct* instead of index.
4835 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4837 * All files with a USE_OSTREAM_ONLY within: removed all code that
4838 was unused when USE_OSTREAM_ONLY is defined.
4840 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
4841 of any less. Removed header and using.
4843 * src/text.C (GetVisibleRow): draw the string "Page Break
4844 (top/bottom)" on screen when drawing a pagebreak line.
4846 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4848 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
4850 * src/mathed/math_macro.C (draw): do some cast magic.
4853 * src/mathed/math_defs.h: change byte* argument to byte const*.
4855 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
4857 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
4858 know it is right to return InsetFoot* too, but cxx does not like
4861 * src/insets/insetcollapsable.[Ch] (Clone): make const.
4863 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
4865 * src/mathed/math_delim.C: change == to proper assignment.
4867 2000-03-09 Juergen Vigna <jug@sad.it>
4869 * src/insets/insettext.C (setPos): fixed various cursor positioning
4870 problems (via mouse and cursor-keys)
4871 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
4872 inset (still a small display problem but it works ;)
4874 * src/insets/insetcollapsable.C (draw): added button_top_y and
4875 button_bottom_y to have correct values for clicking on the inset.
4877 * src/support/lyxalgo.h: commented out 'using std::less'
4879 2000-03-08 Juergen Vigna <jug@sad.it>
4881 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
4882 Button-Release event closes as it is alos the Release-Event
4885 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
4887 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
4889 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
4890 can add multiple spaces in Scrap (literate programming) styles...
4891 which, by the way, is how I got hooked on LyX to begin with.
4893 * src/mathed/formula.C (Write): Added dummy variable to an
4894 inset::Latex() call.
4895 (Latex): Add free_spacing boolean to inset::Latex()
4897 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
4899 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
4900 virtual function to include the free_spacing boolean from
4901 the containing paragraph's style.
4903 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
4904 Added free_spacing boolean arg to match inset.h
4906 * src/insets/insettext.C, src/insets/insettext.h (Latex):
4907 Added free_spacing boolean arg to match inset.h
4909 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
4910 Added free_spacing boolean and made sure that if in a free_spacing
4911 paragraph, that we output normal space if there is a protected space.
4913 * src/insets/insetref.C, src/insets/insetref.h (Latex):
4914 Added free_spacing boolean arg to match inset.h
4916 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
4917 Added free_spacing boolean arg to match inset.h
4919 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
4920 Added free_spacing boolean arg to match inset.h
4922 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
4923 Added free_spacing boolean arg to match inset.h
4925 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
4926 Added free_spacing boolean arg to match inset.h
4928 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
4929 free_spacing boolean arg to match inset.h
4931 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
4932 Added free_spacing boolean arg to match inset.h
4934 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
4935 Added free_spacing boolean arg to match inset.h
4937 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
4938 Added free_spacing boolean arg to match inset.h
4940 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
4941 Added free_spacing boolean arg to match inset.h
4943 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
4944 Added free_spacing boolean arg to match inset.h
4946 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
4947 free_spacing boolean arg to match inset.h
4949 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
4950 free_spacing boolean arg to match inset.h
4952 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
4953 ignore free_spacing paragraphs. The user's spaces are left
4956 * src/text.C (InsertChar): Fixed the free_spacing layout
4957 attribute behavior. Now, if free_spacing is set, you can
4958 add multiple spaces in a paragraph with impunity (and they
4959 get output verbatim).
4960 (SelectSelectedWord): Added dummy argument to inset::Latex()
4963 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
4966 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
4967 paragraph layouts now only input a simple space instead.
4968 Special character insets don't make any sense in free-spacing
4971 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
4972 hard-spaces in the *input* file to simple spaces if the layout
4973 is free-spacing. This converts old files which had to have
4974 hard-spaces in free-spacing layouts where a simple space was
4976 (writeFileAscii): Added free_spacing check to pass to the newly
4977 reworked inset::Latex(...) methods. The inset::Latex() code
4978 ensures that hard-spaces in free-spacing paragraphs get output
4979 as spaces (rather than "~").
4981 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4983 * src/mathed/math_delim.C (draw): draw the empty placeholder
4984 delims with a onoffdash line.
4985 (struct math_deco_compare): struct that holds the "functors" used
4986 for the sort and the binary search in math_deco_table.
4987 (class init_deco_table): class used for initial sort of the
4989 (search_deco): use lower_bound to do a binary search in the
4992 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4994 * src/lyxrc.C: a small secret thingie...
4996 * src/lyxlex.C (printTable): changed to take a ostream as paramter
4997 and to not flush the stream as often as it used to.
4999 * src/support/lyxalgo.h: new file
5000 (sorted): template function used for checking if a sequence is
5001 sorted or not. Two versions with and without user supplied
5002 compare. Uses same compare as std::sort.
5004 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
5005 it and give warning on lyxerr.
5007 (struct compare_tags): struct with function operators used for
5008 checking if sorted, sorting and lower_bound.
5009 (search_kw): use lower_bound instead of manually implemented
5012 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5014 * src/insets/insetcollapsable.h: fix Clone() declaration.
5015 * src/insets/insetfoot.h: ditto.
5017 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
5019 2000-03-08 Juergen Vigna <jug@sad.it>
5021 * src/insets/lyxinset.h: added owner call which tells us if
5022 this inset is inside another inset. Changed also the return-type
5023 of Editable to an enum so it tells clearer what the return-value is.
5025 * src/insets/insettext.C (computeTextRows): fixed computing of
5026 textinsets which split automatically on more rows.
5028 * src/insets/insetert.[Ch]: changed this to be of BaseType
5031 * src/insets/insetfoot.[Ch]: added footnote inset
5033 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
5034 collapsable insets (like footnote, ert, ...)
5036 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5038 * src/lyxdraw.h: remvoe file
5040 * src/lyxdraw.C: remove file
5042 * src/insets/insettext.C: added <algorithm>.
5044 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5046 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
5047 (matrix_cb): case MM_OK use string stream
5049 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
5052 * src/mathed/math_macro.C (draw): use string stream
5053 (Metrics): use string stream
5055 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
5056 directly to the ostream.
5058 * src/vspace.C (asString): use string stream.
5059 (asString): use string stream
5060 (asLatexString): use string stream
5062 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
5063 setting Spacing::Other.
5065 * src/LaTeXFeatures.C (getPackages): use string stream instead of
5066 sprintf when creating the stretch vale.
5068 * src/text2.C (alphaCounter): changed to return a string and to
5069 not use a static variable internally. Also fixed a one-off bug.
5070 (SetCounter): changed the drawing of the labels to use string
5071 streams instead of sprintf.
5073 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
5074 manipulator to use a scheme that does not require library support.
5075 This is also the way it is done in the new GNU libstdc++. Should
5076 work with DEC cxx now.
5078 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5080 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
5081 end. This fixes a bug.
5083 * src/mathed (all files concerned with file writing): apply the
5084 USE_OSTREAM_ONLY changes to mathed too.
5086 * src/support/DebugStream.h: make the constructor explicit.
5088 * src/lyxfont.C (latexWriteStartChanges): small bug related to
5089 count and ostream squashed.
5091 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5093 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
5095 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
5096 ostringstream uses STL strings, and we might not.
5098 * src/insets/insetspecialchar.C: add using directive.
5099 * src/insets/insettext.C: ditto.
5101 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5103 * lib/layouts/seminar.layout: feeble attempt at a layout for
5104 seminar.cls, far from completet and could really use some looking
5105 at from people used to write layout files.
5107 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
5108 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
5109 a lot nicer and works nicely with ostreams.
5111 * src/mathed/formula.C (draw): a slightly different solution that
5112 the one posted to the list, but I think this one works too. (font
5113 size wrong in headers.)
5115 * src/insets/insettext.C (computeTextRows): some fiddling on
5116 Jürgens turf, added some comments that he should read.
5118 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
5119 used and it gave compiler warnings.
5120 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
5123 * src/lyx_gui.C (create_forms): do the right thing when
5124 show_banner is true/false.
5126 * src/lyx_cb.C (TimerCB): no need to close or do anything if
5127 show_banner is false.
5129 * most file writing files: Now use iostreams to do almost all of
5130 the writing. Also instead of passing string &, we now use
5131 stringstreams. mathed output is still not adapted to iostreams.
5132 This change can be turned off by commenting out all the occurences
5133 of the "#define USE_OSTREAM_ONLY 1" lines.
5135 * src/WorkArea.C (createPixmap): don't output debug messages.
5136 (WorkArea): don't output debug messages.
5138 * lib/lyxrc.example: added a comment about the new variable
5141 * development/Code_rules/Rules: Added some more commente about how
5142 to build class interfaces and on how better encapsulation can be
5145 2000-03-03 Juergen Vigna <jug@sad.it>
5147 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
5148 automatically with the width of the LyX-Window
5150 * src/insets/insettext.C (computeTextRows): fixed update bug in
5151 displaying text-insets (scrollvalues where not initialized!)
5153 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5155 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
5156 id in the check of the result from lower_bound is not enough since
5157 lower_bound can return last too, and then res->id will not be a
5160 * all insets and some code that use them: I have conditionalized
5161 removed the Latex(string & out, ...) this means that only the
5162 Latex(ostream &, ...) will be used. This is a work in progress to
5163 move towards using streams for all output of files.
5165 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
5168 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5170 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
5171 routine (this fixes bug where greek letters were surrounded by too
5174 * src/support/filetools.C (findtexfile): change a bit the search
5175 algorithm, to fix bug introduced in 1.1.4. Note that --format is
5176 no longer passed to kpsewhich, we may have to change that later.
5178 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
5179 warning options to avoid problems with X header files (from Angus
5181 * acinclude.m4: regenerated.
5183 2000-03-02 Juergen Vigna <jug@sad.it>
5185 * src/insets/insettext.C (WriteParagraphData): Using the
5186 par->writeFile() function for writing paragraph-data.
5187 (Read): Using buffer->parseSingleLyXformat2Token()-function
5188 for parsing paragraph data!
5190 * src/buffer.C (readLyXformat2): removed all parse data and using
5191 the new parseSingleLyXformat2Token()-function.
5192 (parseSingleLyXformat2Token): added this function to parse (read)
5193 lyx-file-format (this is called also from text-insets now!)
5195 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5197 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
5200 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
5201 directly instead of going through a func. One very bad thing: a
5202 static LyXFindReplace, but I don't know where to place it.
5204 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
5205 string instead of char[]. Also changed to static.
5206 (GetSelectionOrWordAtCursor): changed to static inline
5207 (SetSelectionOverLenChars): ditto.
5209 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
5210 current_view and global variables. both classes has changed names
5211 and LyXFindReplace is not inherited from SearchForm.
5213 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
5214 fl_form_search form.
5216 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
5218 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5220 * lib/bind/*.bind: make sure 'buffer-previous' function is not
5221 bound (from Kayvan).
5223 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
5225 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
5227 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5229 * some things that I should comment but the local pub says head to
5232 * comment out all code that belongs to the Roff code for Ascii
5233 export of tables. (this is unused)
5235 * src/LyXView.C: use correct type for global variable
5236 current_layout. (LyXTextClass::size_type)
5238 * some code to get the new insetgraphics closer to working I'd be
5239 grateful for any help.
5241 * src/BufferView2.C (insertInset): use the return type of
5242 NumberOfLayout properly. (also changes in other files)
5244 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
5245 this as a test. I want to know what breaks because of this.
5247 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
5249 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
5251 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
5252 to use a \makebox in the label, this allows proper justification
5253 with out using protected spaces or multiple hfills. Now it is
5254 "label" for left justified, "\hfill label\hfill" for center, and
5255 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
5256 should be changed accordingly.
5258 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5260 * src/lyxtext.h: change SetLayout() to take a
5261 LyXTextClass::size_type instead of a char (when there is more than
5262 127 layouts in a class); also change type of copylayouttype.
5263 * src/text2.C (SetLayout): ditto.
5264 * src/LyXView.C (updateLayoutChoice): ditto.
5266 * src/LaTeX.C (scanLogFile): errors where the line number was not
5267 given just after the '!'-line were ignored (from Dekel Tsur).
5269 * lib/lyxrc.example: fix description of \date_insert_format
5271 * lib/layouts/llncs.layout: new layout, contributed by Martin
5274 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5276 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
5277 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
5278 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
5279 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
5280 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
5281 paragraph.C, text.C, text2.C)
5283 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5285 * src/insets/insettext.C (LocalDispatch): remove extra break
5288 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
5289 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
5291 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
5292 * src/insets/insettext.[Ch] (GetCursorPos): ditto
5294 * src/insets/insetbib.h: move InsetBibkey::Holder and
5295 InsetCitation::Holder in public space.
5297 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5299 * src/insets/insettext.h: small change to get the new files from
5300 Juergen to compile (use "string", not "class string").
5302 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
5303 const & as parameter to LocalDispatch, use LyXFont const & as
5304 paramter to some other func. This also had impacto on lyxinsets.h
5305 and the two mathed insets.
5307 2000-02-24 Juergen Vigna <jug@sad.it>
5310 * src/commandtags.h:
5312 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
5316 * src/BufferView2.C: added/updated code for various inset-functions
5318 * src/insets/insetert.[Ch]: added implementation of InsetERT
5320 * src/insets/insettext.[Ch]: added implementation of InsetText
5322 * src/insets/inset.C (Edit): added "unsigned int button" parameter
5323 (draw): added preliminary code for inset scrolling not finshed yet
5325 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
5326 as it is in lyxfunc.C now
5328 * src/insets/lyxinset.h: Added functions for text-insets
5330 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5332 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
5333 BufferView and reimplement the list as a queue put inside its own
5336 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
5338 * several files: use the new interface to the "updateinsetlist"
5340 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
5342 (work_area_handler): call BufferView::trippleClick on trippleclick.
5344 * src/BufferView.C (doubleClick): new function, selects word on
5346 (trippleClick): new function, selects line on trippleclick.
5348 2000-02-22 Allan Rae <rae@lyx.org>
5350 * lib/bind/xemacs.bind: buffer-previous not supported
5352 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5354 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
5357 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5359 * src/bufferlist.C: get rid of current_view from this file
5361 * src/spellchecker.C: get rid of current_view from this file
5363 * src/vspace.C: get rid of current_view from this file
5364 (inPixels): added BufferView parameter for this func
5365 (asLatexCommand): added a BufferParams for this func
5367 * src/text.C src/text2.C: get rid of current_view from these
5370 * src/lyxfont.C (getFontDirection): move this function here from
5373 * src/bufferparams.C (getDocumentDirection): move this function
5376 * src/paragraph.C (getParDirection): move this function here from
5378 (getLetterDirection): ditto
5380 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5382 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
5383 resize due to wrong pixmap beeing used. Also took the opurtunity
5384 to make the LyXScreen stateless on regard to WorkArea and some
5385 general cleanup in the same files.
5387 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5389 * src/Makefile.am: add missing direction.h
5391 * src/PainterBase.h: made the width functions const.
5393 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
5396 * src/insets/insetcommand.C (draw): draw Editable as buttons.
5398 * src/insets/insetlatexaccent.C (draw): make the accents draw
5399 better, at present this will only work well with iso8859-1.
5401 * several files: remove the old drawing code, now we use the new
5404 * several files: remove support for mono_video, reverse_video and
5407 2000-02-17 Juergen Vigna <jug@sad.it>
5409 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
5410 int ** as we have to return the pointer, otherwise we have only
5411 NULL pointers in the returning function.
5413 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5415 * src/LaTeX.C (operator()): quote file name when running latex.
5417 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5419 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
5420 (bubble tip), this removes our special handling of this.
5422 * Remove all code that is unused now that we have the new
5423 workarea. (Code that are not active when NEW_WA is defined.)
5425 * Make the uses of XSync not conditionalized on define USE_XSYNC.
5427 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5429 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
5430 nonexisting layout; correctly redirect obsoleted layouts.
5432 * lib/lyxrc.example: document \view_dvi_paper_option
5434 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
5437 * src/lyx_cb.C (RunScript): handle $$FName for command names.
5438 (PreviewDVI): handle the view_dvi_paper_option variable.
5439 [Both from Roland Krause]
5441 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5443 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
5444 char const *, int, LyXFont)
5445 (text(int, int, string, LyXFont)): ditto
5447 * src/text.C (InsertCharInTable): attempt to fix the double-space
5448 feature in tables too.
5449 (BackspaceInTable): ditto.
5450 (GetVisibleRow): make bottom pagebreak line be a onoff line.
5452 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5454 * src/text2.C (owner): only complain if owner_ is set and bv != 0
5456 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
5457 newly found text in textcache to this.
5458 (buffer): set the owner of the text put into the textcache to 0
5460 * src/insets/figinset.C (draw): fixed the drawing of figures with
5463 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
5464 drawing of mathframe, hfills, protected space, table lines. I have
5465 now no outstanding drawing problems with the new Painter code.
5467 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5469 * src/PainterBase.C (ellipse, circle): do not specify the default
5472 * src/LColor.h: add using directive.
5474 * src/Painter.[Ch]: change return type of methods from Painter& to
5475 PainterBase&. Add a using directive.
5477 * src/WorkArea.C: wrap xforms callbacks in C functions
5480 * lib/layouts/foils.layout: font fix and simplifications from Carl
5483 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5485 * a lot of files: The Painter, LColor and WorkArea from the old
5486 devel branch has been ported to lyx-devel. Some new files and a
5487 lot of #ifdeffed code. The new workarea is enabled by default, but
5488 if you want to test the new Painter and LColor you have to compile
5489 with USE_PAINTER defined (do this in config.h f.ex.) There are
5490 still some rought edges, and I'd like some help to clear those
5491 out. It looks stable (loads and displays the Userguide very well).
5494 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5496 * src/buffer.C (pop_tag): revert to the previous implementation
5497 (use a global variable for both loops).
5499 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
5501 * src/lyxrc.C (LyXRC): change slightly default date format.
5503 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
5504 there is an English text with a footnote that starts with a Hebrew
5505 paragraph, or vice versa.
5506 (TeXFootnote): ditto.
5508 * src/text.C (LeftMargin): allow for negative values for
5509 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
5512 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
5513 for input encoding (cyrillic)
5515 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5517 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
5520 * src/toolbar.C (set): ditto
5521 * src/insets/insetbib.C (create_form_citation_form): ditto
5523 * lib/CREDITS: added Dekel Tsur.
5525 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
5526 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
5527 hebrew supports files from Dekel Tsur.
5529 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
5530 <tzafrir@technion.ac.il>
5532 * src/lyxrc.C: put \date_insert_format at the right place.
5534 * src/buffer.C (makeLaTeXFile): fix the handling of
5535 BufferParams::sides when writing out latex files.
5537 * src/BufferView2.C: add a "using" directive.
5539 * src/support/lyxsum.C (sum): when we use lyxstring,
5540 ostringstream::str needs an additional .c_str().
5542 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5544 * src/support/filetools.C (ChangeExtension): patch from Etienne
5547 * src/TextCache.C (show): remove const_cast and make second
5548 parameter non-const LyXText *.
5550 * src/TextCache.h: use non const LyXText in show.
5552 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
5555 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5557 * src/support/lyxsum.C: rework to be more flexible.
5559 * several places: don't check if a pointer is 0 if you are going
5562 * src/text.C: remove some dead code.
5564 * src/insets/figinset.C: remove some dead code
5566 * src/buffer.C: move the BufferView funcs to BufferView2.C
5567 remove all support for insetlatexdel
5568 remove support for oldpapersize stuff
5569 made some member funcs const
5571 * src/kbmap.C: use a std::list to store the bindings in.
5573 * src/BufferView2.C: new file
5575 * src/kbsequence.[Ch]: new files
5577 * src/LyXAction.C + others: remove all trace of buffer-previous
5579 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
5580 only have one copy in the binary of this table.
5582 * hebrew patch: moved some functions from LyXText to more
5583 appropriate places. (LyXParagraph, BufferParams, LyXFont)
5585 * several files: remove support for XForms older than 0.88
5587 remove some #if 0 #endif code
5589 * src/TextCache.[Ch]: new file. Holds the textcache.
5591 * src/BufferView.C: changes to use the new TextCache interface.
5592 (waitForX): remove the now unused code.
5594 * src/BackStack.h: remove some commented code
5596 * lib/bind/emacs.bind: remove binding for buffer-previous
5598 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5600 * applied the hebrew patch.
5602 * src/lyxrow.h: make sure that all Row variables are initialized.
5604 * src/text2.C (TextHandleUndo): comment out a delete, this might
5605 introduce a memory leak, but should also help us to not try to
5606 read freed memory. We need to look at this one.
5608 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
5609 (LyXParagraph): initalize footnotekind.
5611 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
5612 forgot this when applying the patch. Please heed the warnings.
5614 * src/BufferView.C (buffer): a fix for the buffer-reload problem
5615 (aka. reformat problem)
5617 * src/bufferlist.C (exists): made const, and use const_iterator
5618 (isLoaded): new func.
5619 (release): use std::find to find the correct buffer.
5621 * src/bufferlist.h: made getState a const func.
5622 made empty a const func.
5623 made exists a const func.
5626 2000-02-01 Juergen Vigna <jug@sad.it>
5628 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
5630 * po/it.po: updated a bit the italian po file and also changed the
5631 'file nuovo' for newfile to 'filenuovo' without a space, this did
5634 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
5635 for the new insert_date command.
5637 * src/lyxfunc.C (Dispatch): added support for a insert_date function
5638 from jdblair, to insert a date into the current text conforming to
5639 a strftime format (for now only considering the locale-set and not
5640 the document-language).
5642 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5644 * src/lyxfont.C (textWidth): hopefully better fix for the Array
5645 Bounds Read error seen by purify. The problem was that islower is
5646 a macros which takes an unsigned char and uses it as an index for
5647 in array of characters properties (and is thus subject to the
5651 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
5652 correctly the paper sides radio buttons.
5653 (UpdateDocumentButtons): ditto.
5655 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5657 * src/kbmap.C (getsym + others): change to return unsigned int,
5658 returning a long can give problems on 64 bit systems. (I assume
5659 that int is 32bit on 64bit systems)
5661 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5663 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
5664 LyXLookupString to be zero-terminated. Really fixes problems seen
5667 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5669 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
5670 write a (char*)0 to the lyxerr stream.
5672 * src/lastfiles.C: move algorithm before the using statemets.
5674 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5676 * src/lastfiles.C: move using directives in global scope (egcs 1.x
5677 complains otherwise).
5678 * src/table.C: ditto
5680 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
5683 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
5684 that I removed earlier... It is really needed.
5686 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
5688 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5690 * INSTALL: update xforms home page URL.
5692 * lib/configure.m4: fix a bug with unreadable layout files.
5694 * src/table.C (calculate_width_of_column): add "using std::max"
5697 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5699 * several files: marked several lines with "DEL LINE", this is
5700 lines that can be deleted without changing anything.
5701 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
5702 checks this anyway */
5705 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
5707 * src/DepTable.C (update): add a "+" at the end when the checksum
5708 is different. (debugging string only)
5710 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
5711 the next inset to not be displayed. This should also fix the list
5712 of labels in the "Insert Crossreference" dialog.
5714 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
5716 * src/support/LSubstring.C (LSubstring): set pos to string::npos
5717 when regex was not found.
5719 * src/support/lstrings.C (lowercase): use handcoded transform always.
5722 * src/text.C (Delete): fixed the crash. cursor.par->prev and
5723 old_cursor.par->prev could be 0.
5725 * several files: changed post inc/dec to pre inc/dec
5727 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
5728 write the lastfiles to file.
5730 * src/BufferView.C (buffer): only show TextCache info when debugging
5732 (resizeCurrentBuffer): ditto
5733 (workAreaExpose): ditto
5735 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
5737 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
5739 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
5740 a bit better by removing the special case for \i and \j.
5742 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5744 * src/lyx_main.C (easyParse): remove test for bad comand line
5745 options, since this broke all xforms-related parsing.
5747 * src/kbmap.C (getsym): set return type to unsigned long, as
5748 declared in header. On an alpha, long is _not_ the same as int.
5750 * src/support/LOstream.h: add a "using std::flush;"
5752 * src/insets/figinset.C: ditto.
5754 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5756 * src/bufferlist.C (write): use blinding fast file copy instead of
5757 "a char at a time", now we are doing it the C++ way.
5759 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
5760 std::list<int> instead.
5761 (addpidwait): reflect move to std::list<int>
5762 (sigchldchecker): ditto
5764 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
5767 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
5768 that obviously was wrong...
5770 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
5771 c, this avoids warnings with purify and islower.
5773 * src/insets/figinset.C: rename struct queue to struct
5774 queue_element and rewrite to use a std::queue. gsqueue is now a
5775 std::queue<queue_element>
5776 (runqueue): reflect move to std::queue
5779 * src/support/lstrings.h (tostr): specialize for bool, otherwise
5780 we would get "1" "0" instead of "true" "false. Also make the tostr
5783 2000-01-21 Juergen Vigna <jug@sad.it>
5785 * src/buffer.C (writeFileAscii): Disabled code for special groff
5786 handling of tabulars till I fix this in table.C
5788 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5790 * src/support/mkdir.C (mkdir): change second argument of mkdir to
5792 * src/support/lyxlib.h: ditto.
5794 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5796 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
5797 and 'j' look better. This might fix the "macron" bug that has been
5800 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
5801 functions as one template function. Delete the old versions.
5803 * src/support/lyxsum.C: move using std::ifstream inside
5806 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
5809 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
5811 * src/mathed/formula.C: delete #include "bufferlist.h" never used
5813 * src/insets/figinset.C (InitFigures): use new instead of malloc
5814 to allocate memory for figures and bitmaps.
5815 (DoneFigures): use delete[] instead of free to deallocate memory
5816 for figures and bitmaps.
5817 (runqueue): use new to allocate
5818 (getfigdata): use new/delete[] instead of malloc/free
5819 (RegisterFigure): ditto
5821 * some files: moved some declarations closer to first use, small
5822 whitespace changes use preincrement instead of postincrement where
5823 it does not make a difference.
5825 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
5826 step on the way to use stl::containers for key maps.
5828 * src/bufferlist.h: add a typedef for const_iterator and const
5829 versions of begin and end.
5831 * src/bufferlist.[Ch]: change name of member variable _state to
5832 state_. (avoid reserved names)
5834 (getFileNames): returns the filenames of the buffers in a vector.
5836 * configure.in (ALL_LINGUAS): added ro
5838 * src/support/putenv.C: new file
5840 * src/support/mkdir.C: new file
5842 2000-01-20 Allan Rae <rae@lyx.org>
5844 * lib/layouts/IEEEtran.layout: Added several theorem environments
5846 * lib/templates/IEEEtran.lyx: Example theorem environments and a
5847 couple of minor additions.
5849 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
5850 (except for those in footnotes of course)
5852 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5854 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
5856 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
5857 std::sort and std::lower_bound instead of qsort and handwritten
5859 (struct compara): struct that holds the functors used by std::sort
5860 and std::lower_bound in MathedLookupBOP.
5862 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5864 * src/support/LAssert.h: do not do partial specialization. We do
5867 * src/support/lyxlib.h: note that lyx::getUserName() and
5868 lyx::date() are not in use right now. Should these be suppressed?
5870 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
5871 (makeLinuxDocFile): do not put date and user name in linuxdoc
5874 * src/support/lyxlib.h (kill): change first argument to long int,
5875 since that's what solaris uses.
5877 * src/support/kill.C (kill): fix declaration to match prototype.
5879 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
5880 actually check whether namespaces are supported. This is not what
5883 * src/support/lyxsum.C: add a using directive.
5885 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5887 * src/support/kill.C: if we have namespace support we don't have
5888 to include lyxlib.h.
5890 * src/support/lyxlib.h: use namespace lyx if supported.
5892 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5894 * src/support/date.C: new file
5896 * src/support/chdir.C: new file
5898 * src/support/getUserName.C: new file
5900 * src/support/getcwd.C: new file
5902 * src/support/abort.C: new file
5904 * src/support/kill.C: new file
5906 * src/support/lyxlib.h: moved all the functions in this file
5907 insede struct lyx. Added also kill and abort to this struct. This
5908 is a way to avoid the "kill is not defined in <csignal>", we make
5909 C++ wrappers for functions that are not ANSI C or ANSI C++.
5911 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
5912 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
5913 lyx it has been renamed to sum.
5915 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5917 * src/text.C: add using directives for std::min and std::max.
5919 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5921 * src/texrow.C (getIdFromRow): actually return something useful in
5922 id and pos. Hopefully fixes the bug with positionning of errorbox
5925 * src/lyx_main.C (easyParse): output an error and exit if an
5926 incorrect command line option has been given.
5928 * src/spellchecker.C (ispell_check_word): document a memory leak.
5930 * src/bufferlist.C (write): fix mismatched allocation/deletion,
5931 where a "struct utimbuf" is allocated with "new" and deleted with
5934 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
5936 * src/text2.C (CutSelection): don't delete double spaces.
5937 (PasteSelection): ditto
5938 (CopySelection): ditto
5940 * src/text.C (Backspace): don't delete double spaces.
5942 * src/lyxlex.C (next): fix a bug that were only present with
5943 conformant std::istream::get to read comment lines, use
5944 std::istream::getline instead. This seems to fix the problem.
5946 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5948 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
5949 allowed to insert space before space" editing problem. Please read
5950 commends at the beginning of the function. Comments about usage
5953 * src/text.C (InsertChar): fix for the "not allowed to insert
5954 space before space" editing problem.
5956 * src/text2.C (DeleteEmptyParagraphMechanism): when
5957 IsEmptyTableRow can only return false this last "else if" will
5958 always be a no-op. Commented out.
5960 * src/text.C (RedoParagraph): As far as I can understand tmp
5961 cursor is not really needed.
5963 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
5964 present it could only return false anyway.
5965 (several functions): Did something not so smart...added a const
5966 specifier on a lot of methods.
5968 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
5969 and add a tmp->text.resize. The LyXParagraph constructor does the
5971 (BreakParagraphConservative): ditto
5973 * src/support/path.h (Path): add a define so that the wrong usage
5974 "Path("/tmp") will be flagged as a compilation error:
5975 "`unnamed_Path' undeclared (first use this function)"
5977 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5979 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
5980 which was bogus for several reasons.
5982 * src/LaTeX.C (scanAux): fix the regular expression used to scan
5986 * autogen.sh: do not use "type -path" (what's that anyway?).
5988 * src/support/filetools.C (findtexfile): remove extraneous space
5989 which caused a kpsewhich warning (at least with kpathsea version
5992 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5994 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
5996 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
5998 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
6000 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6002 * src/paragraph.C (BreakParagraph): do not reserve space on text
6003 if we don't need to (otherwise, if pos_end < pos, we end up
6004 reserving huge amounts of memory due to bad unsigned karma).
6005 (BreakParagraphConservative): ditto, although I have not seen
6006 evidence the bug can happen here.
6008 * src/lyxparagraph.h: add a using std::list.
6010 2000-01-11 Juergen Vigna <jug@sad.it>
6012 * src/menus.C (MenuDocu): output an Alert if the documentation-file
6015 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6017 * src/vc-backend.C (doVCCommand): change to be static and take one
6018 more parameter: the path to chdir too be fore executing the command.
6019 (retrive): new function equiv to "co -r"
6021 * src/bufferlist.C (loadLyXFile): implement the missing parts if
6022 file_not_found_hook is true.
6024 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
6026 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
6027 if a file is readwrite,readonly...anything else.
6029 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6031 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
6032 (CreatePostscript): name change from MenuRunDVIPS (or something)
6033 (PreviewPostscript): name change from MenuPreviewPS
6034 (PreviewDVI): name change from MenuPreviewDVI
6036 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
6037 \view_pdf_command., \pdf_to_ps_command
6039 * lib/configure.m4: added search for PDF viewer, and search for
6040 PDF to PS converter.
6041 (lyxrc.defaults output): add \pdflatex_command,
6042 \view_pdf_command and \pdf_to_ps_command.
6044 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
6046 * src/bufferlist.C (write): we don't use blocksize for anything so
6049 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6051 * src/support/block.h: disable operator T* (), since it causes
6052 problems with both compilers I tried. See comments in the file.
6054 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
6057 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
6058 variable LYX_DIR_10x to LYX_DIR_11x.
6060 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
6062 * INSTALL: document --with-lyxname.
6065 * configure.in: new configure flag --with-lyxname which allows to
6066 choose the name under which lyx is installed. Default is "lyx", of
6067 course. It used to be possible to do this with --program-suffix,
6068 but the later has in fact a different meaning for autoconf.
6070 * src/support/lstrings.h (lstrchr): reformat a bit.
6072 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
6073 * src/mathed/math_defs.h: ditto.
6075 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6077 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
6078 true, decides if we create a backup file or not when saving. New
6079 tag and variable \pdf_mode, defaults to false. New tag and
6080 variable \pdflatex_command, defaults to pdflatex. New tag and
6081 variable \view_pdf_command, defaults to xpdf. New tag and variable
6082 \pdf_to_ps_command, defaults to pdf2ps.
6084 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6086 * src/bufferlist.C (close): don't call insetUnlock if the buffer
6087 does not have a BufferView.
6088 (unlockInset): ditto + don't access the_locking_inset if the
6089 buffer does not have a BufferView.
6091 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
6092 certain circumstances so that we don't continue a keyboard
6093 operation long after the key was released. Try f.ex. to load a
6094 large document, press PageDown for some seconds and then release
6095 it. Before this change the document would contine to scroll for
6096 some time, with this change it stops imidiatly.
6098 * src/support/block.h: don't allocate more space than needed. As
6099 long as we don't try to write to the arr[x] in a array_type arr[x]
6100 it is perfectly ok. (if you write to it you might segfault).
6101 added operator value_type*() so that is possible to pass the array
6102 to functions expecting a C-pointer.
6104 * lib/Makefile.am (dist-hook): don't fail completely if unable to
6107 * intl/*: updated to gettext 0.10.35, tried to add our own
6108 required modifications. Please verify.
6110 * po/*: updated to gettext 0.10.35, tried to add our own required
6111 modifications. Please verify.
6113 * src/support/lstrings.C (tostr): go at fixing the problem with
6114 cxx and stringstream. When stringstream is used return
6115 oss.str().c_str() so that problems with lyxstring and basic_string
6116 are avoided. Note that the best solution would be for cxx to use
6117 basic_string all the way, but it is not conformant yet. (it seems)
6119 * src/lyx_cb.C + other files: moved several global functions to
6120 class BufferView, some have been moved to BufferView.[Ch] others
6121 are still located in lyx_cb.C. Code changes because of this. (part
6122 of "get rid of current_view project".)
6124 * src/buffer.C + other files: moved several Buffer functions to
6125 class BufferView, the functions are still present in buffer.C.
6126 Code changes because of this.
6128 * config/lcmessage.m4: updated to most recent. used when creating
6131 * config/progtest.m4: updated to most recent. used when creating
6134 * config/gettext.m4: updated to most recent. applied patch for
6137 * config/gettext.m4.patch: new file that shows what changes we
6138 have done to the local copy of gettext.m4.
6140 * config/libtool.m4: new file, used in creation of acinclude.m4
6142 * config/lyxinclude.m4: new file, this is the lyx created m4
6143 macros, used in making acinclude.m4.
6145 * autogen.sh: GNU m4 discovered as a separate task not as part of
6146 the lib/configure creation.
6147 Generate acinlucde from files in config. Actually cat
6148 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
6149 easier to upgrade .m4 files that really are external.
6151 * src/Spacing.h: moved using std::istringstream to right after
6152 <sstream>. This should fix the problem seen with some compilers.
6154 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6156 * src/lyx_cb.C: began some work to remove the dependency a lot of
6157 functions have on BufferView::text, even if not really needed.
6158 (GetCurrentTextClass): removed this func, it only hid the
6161 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
6162 forgot this in last commit.
6164 * src/Bullet.C (bulletEntry): use static char const *[] for the
6165 tables, becuase of this the return arg had to change to string.
6167 (~Bullet): removed unneeded destructor
6169 * src/BufferView.C (beforeChange): moved from lyx_cb.C
6170 (insetSleep): moved from Buffer
6171 (insetWakeup): moved from Buffer
6172 (insetUnlock): moved from Buffer
6174 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
6175 from Buffer to BufferView.
6177 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
6179 * config/ltmain.sh: updated to version 1.3.4 of libtool
6181 * config/ltconfig: updated to version 1.3.4 of libtool
6183 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6186 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
6187 Did I get that right?
6189 * src/lyxlex.h: add a "using" directive or two.
6190 * src/Spacing.h: ditto.
6191 * src/insets/figinset.C: ditto.
6192 * src/support/filetools.C: ditto.
6193 * src/support/lstrings.C: ditto.
6194 * src/BufferView.C: ditto.
6195 * src/bufferlist.C: ditto.
6196 * src/lyx_cb.C: ditto.
6197 * src/lyxlex.C: ditto.
6199 * NEWS: add some changes for 1.1.4.
6201 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6203 * src/BufferView.C: first go at a TextCache to speed up switching
6206 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6208 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
6209 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
6210 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
6211 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
6214 * src/mathed/math_defs.h (MathedRowSt): make sure that all
6215 members of the struct are correctly initialized to 0 (detected by
6217 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
6218 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
6220 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
6221 pidwait, since it was allocated with "new". This was potentially
6222 very bad. Thanks to Michael Schmitt for running purify for us.
6225 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6227 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
6229 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
6231 1999-12-30 Allan Rae <rae@lyx.org>
6233 * lib/templates/IEEEtran.lyx: minor change
6235 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
6236 src/mathed/formula.C (LocalDispatch): askForText changes
6238 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
6239 know when a user has cancelled input. Fixes annoying problems with
6240 inserting labels and version control.
6242 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6244 * src/support/lstrings.C (tostr): rewritten to use strstream and
6247 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6249 * src/support/filetools.C (IsFileWriteable): use fstream to check
6250 (IsDirWriteable): use fileinfo to check
6252 * src/support/filetools.h (FilePtr): whole class deleted
6254 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
6256 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
6258 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
6260 * src/bufferlist.C (write): use ifstream and ofstream instead of
6263 * src/Spacing.h: use istrstream instead of sscanf
6265 * src/mathed/math_defs.h: change first arg to istream from FILE*
6267 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
6269 * src/mathed/math_parser.C: have yyis to be an istream
6270 (LexGetArg): use istream (yyis)
6272 (mathed_parse): ditto
6273 (mathed_parser_file): first arg istream instead of FILE*, set yyis
6275 * src/mathed/formula.C (Read): rewritten to use istream
6277 * src/mathed/formulamacro.C (Read): rewritten to use istream
6279 * src/lyxlex.h (~LyXLex): deleted desturctor
6280 (getStream): new function, returns an istream
6281 (getFile): deleted funtion
6282 (IsOK): return is.good();
6284 * src/lyxlex.C (LyXLex): delete file and owns_file
6285 (setFile): open an filebuf and assign that to a istream instead of
6287 (setStream): new function, takes an istream as arg.
6288 (setFile): deleted function
6289 (EatLine): rewritten us use istream instead of FILE*
6293 * src/table.C (LyXTable): use istream instead of FILE*
6294 (Read): rewritten to take an istream instead of FILE*
6296 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6298 * src/buffer.C (Dispatch): remove an extraneous break statement.
6300 * src/support/filetools.C (QuoteName): change to do simple
6301 'quoting'. More work is necessary. Also changed to do nothing
6302 under emx (needs fix too).
6303 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
6305 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
6306 config.h.in to the AC_DEFINE_UNQUOTED() call.
6307 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
6308 needs char * as argument (because Solaris 7 declares it like
6311 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
6312 remove definition of BZERO.
6314 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6316 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
6317 defined, "lyxregex.h" if not.
6319 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
6321 (REGEX): new variable that is set to regex.c lyxregex.h when
6322 AM_CONDITIONAL USE_REGEX is set.
6323 (libsupport_la_SOURCES): add $(REGEX)
6325 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
6328 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
6331 * configure.in: add call to LYX_REGEX
6333 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
6334 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
6336 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6338 * lib/bind/fi_menus.bind: new file, from
6339 pauli.virtanen@saunalahti.fi.
6341 * src/buffer.C (getBibkeyList): pass the parameter delim to
6342 InsetInclude::getKeys and InsetBibtex::getKeys.
6344 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
6345 is passed to Buffer::getBibkeyList
6347 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
6348 instead of the hardcoded comma.
6350 * src/insets/insetbib.C (getKeys): make sure that there are not
6351 leading blanks in bibtex keys. Normal latex does not care, but
6352 harvard.sty seems to dislike blanks at the beginning of citation
6353 keys. In particular, the retturn value of the function is
6355 * INSTALL: make it clear that libstdc++ is needed and that gcc
6356 2.7.x probably does not work.
6358 * src/support/filetools.C (findtexfile): make debug message go to
6360 * src/insets/insetbib.C (getKeys): ditto
6362 * src/debug.C (showTags): make sure that the output is correctly
6365 * configure.in: add a comment for TWO_COLOR_ICON define.
6367 * acconfig.h: remove all the entries that already defined in
6368 configure.in or acinclude.m4.
6370 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
6371 to avoid user name, date and copyright.
6373 1999-12-21 Juergen Vigna <jug@sad.it>
6375 * src/table.C (Read): Now read bogus row format informations
6376 if the format is < 5 so that afterwards the table can
6377 be read by lyx but without any format-info. Fixed the
6378 crash we experienced when not doing this.
6380 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6382 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
6383 (RedoDrawingOfParagraph): ditto
6384 (RedoParagraphs): ditto
6385 (RemoveTableRow): ditto
6387 * src/text.C (Fill): rename arg paperwidth -> paper_width
6389 * src/buffer.C (insertLyXFile): rename var filename -> fname
6390 (writeFile): rename arg filename -> fname
6391 (writeFileAscii): ditto
6392 (makeLaTeXFile): ditto
6393 (makeLinuxDocFile): ditto
6394 (makeDocBookFile): ditto
6396 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
6399 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
6401 * src/bmtable.h: add extern "C" on this file when __cplusplus is
6404 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
6405 compiled by a C compiler not C++.
6407 * src/layout.h (LyXTextClass): added typedef for const_iterator
6408 (LyXTextClassList): added typedef for const_iterator + member
6409 functions begin and end.
6411 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
6412 iterators to fill the choice_class.
6413 (updateLayoutChoice): rewritten to use iterators to fill the
6414 layoutlist in the toolbar.
6416 * src/BufferView.h (BufferView::work_area_width): removed unused
6419 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
6421 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
6422 (sgmlCloseTag): ditto
6424 * src/support/lstrings.h: return type of countChar changed to
6427 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
6428 what version of this func to use. Also made to return unsigned int.
6430 * configure.in: call LYX_STD_COUNT
6432 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
6433 conforming std::count.
6435 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6437 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
6438 and a subscript would give bad display (patch from Dekel Tsur
6439 <dekel@math.tau.ac.il>).
6441 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
6443 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
6446 * src/chset.h: add a few 'using' directives
6448 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
6449 triggered when no buffer is active
6451 * src/layout.C: removed `break' after `return' in switch(), since
6454 * src/lyx_main.C (init): make sure LyX can be ran in place even
6455 when libtool has done its magic with shared libraries. Fix the
6456 test for the case when the system directory has not been found.
6458 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
6459 name for the latex file.
6460 (MenuMakeHTML): ditto
6462 * src/buffer.h: add an optional boolean argument, which is passed
6465 1999-12-20 Allan Rae <rae@lyx.org>
6467 * lib/templates/IEEEtran.lyx: small correction and update.
6469 * configure.in: Attempted to use LYX_PATH_HEADER
6471 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
6473 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
6474 input from JMarc. Now use preprocessor to find the header.
6475 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
6476 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
6477 LYX_STL_STRING_FWD. See comments in file.
6479 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
6481 * The global MiniBuffer * minibuffer variable is dead.
6483 * The global FD_form_main * fd_form_main variable is dead.
6485 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6487 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
6489 * src/table.h: add the LOstream.h header
6490 * src/debug.h: ditto
6492 * src/LyXAction.h: change the explaination of the ReadOnly
6493 attribute: is indicates that the function _can_ be used.
6495 * src/LyXAction.C (init): find-replace _can_ be used in read-only
6498 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6500 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
6506 * src/paragraph.C (GetWord): assert on pos>=0
6509 * src/support/lyxstring.C: condition the use of an invariant on
6511 * src/support/lyxstring.h: ditto
6513 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
6514 Use LAssert.h instead of plain assert().
6516 * src/support/lstrings.h: add LAssert.h, in case it is needed.
6518 * src/lyxfunc.C: do not include LAssert.h, it is not used.
6519 * src/support/filetools.C: ditto
6521 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
6524 * INSTALL: document the new configure flags
6526 * configure.in: suppress --with-debug; add --enable-assertions
6528 * acinclude.m4: various changes in alignment of help strings.
6530 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6532 * src/kbmap.C: commented out the use of the hash map in kb_map,
6533 beginning of movement to a stl::container.
6535 * several files: removed code that was not in effect when
6536 MOVE_TEXT was defined.
6538 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
6539 for escaping should not be used. We can discuss if the string
6540 should be enclosed in f.ex. [] instead of "".
6542 * src/trans_mgr.C (insert): use the new returned value from
6543 encodeString to get deadkeys and keymaps done correctly.
6545 * src/chset.C (encodeString): changed to return a pair, to tell
6546 what to use if we know the string.
6548 * src/lyxscreen.h (fillArc): new function.
6550 * src/FontInfo.C (resize): rewritten to use more std::string like
6551 structore, especially string::replace.
6553 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
6556 * configure.in (chmod +x some scripts): remove config/gcc-hack
6558 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6560 * src/buffer.C (writeFile): change once again the top comment in a
6561 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
6562 instead of an hardcoded version number.
6563 (makeDocBookFile): ditto
6565 * src/version.h: add new define LYX_DOCVERSION
6567 * po/de.po: update from Pit Sütterlin
6568 * lib/bind/de_menus.bind: ditto.
6570 * src/lyxfunc.C (Dispatch): call MenuExport()
6571 * src/buffer.C (Dispatch): ditto
6573 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
6574 LyXFunc::Dispatch().
6575 (MenuExport): new function, moved from
6576 LyXFunc::Dispatch().
6578 * src/trans_mgr.C (insert): small cleanup
6579 * src/chset.C (loadFile): ditto
6581 * lib/kbd/iso8859-1.cdef: add missing backslashes
6583 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6585 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
6586 help with placing the manually drawn accents better.
6588 (Draw): x2 and hg changed to float to minimize rounding errors and
6589 help place the accents better.
6591 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
6592 unsigned short to char is just wrong...cast the char to unsigned
6593 char instead so that the two values can compare sanely. This
6594 should also make the display of insetlatexaccents better and
6595 perhaps also some other insets.
6597 (lbearing): new function
6600 1999-12-15 Allan Rae <rae@lyx.org>
6602 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
6603 header that provides a wrapper around the very annoying SGI STL header
6606 * src/support/lyxstring.C, src/LString.h:
6607 removed old SGI-STL-compatability attempts.
6609 * configure.in: Use LYX_STL_STRING_FWD.
6611 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
6612 stl_string_fwd.h is around and try to determine it's location.
6613 Major improvement over previous SGI STL 3.2 compatability.
6614 Three small problems remain with this function due to my zero
6615 knowledge of autoconf. JMarc and lgb see the comments in the code.
6617 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6619 * src/broken_const.h, config/hack-gcc, config/README: removed
6621 * configure.in: remove --with-gcc-hack option; do not call
6624 * INSTALL: remove documentation of --with-broken-const and
6627 * acconfig.h: remove all trace of BROKEN_CONST define
6629 * src/buffer.C (makeDocBookFile): update version number in output
6631 (SimpleDocBookOnePar): fix an assert when trying to a character
6632 access beyond string length
6635 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6637 * po/de.po: fix the Export menu
6639 * lyx.man: update the description of -dbg
6641 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
6642 (commandLineHelp): updated
6643 (easyParse): show list of available debug levels if -dbg is passed
6646 * src/Makefile.am: add debug.C
6648 * src/debug.h: moved some code to debug.C
6650 * src/debug.C: new file. Contains code to set and show debug
6653 * src/layout.C: remove 'break' after 'continue' in switch
6654 statements, since these cannot be reached.
6656 1999-12-13 Allan Rae <rae@lyx.org>
6658 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
6659 (in_word_set): hash() -> math_hash()
6661 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
6663 * acconfig.h: Added a test for whether we are using exceptions in the
6664 current compilation run. If so USING_EXCEPTIONS is defined.
6666 * config.in: Check for existance of stl_string_fwd.h
6667 * src/LString.h: If compiling --with-included-string and SGI's
6668 STL version 3.2 is present (see above test) we need to block their
6669 forward declaration of string and supply a __get_c_string().
6670 However, it turns out this is only necessary if compiling with
6671 exceptions enabled so I've a bit more to add yet.
6673 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
6674 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
6675 src/support/LRegex.h, src/undo.h:
6676 Shuffle the order of the included files a little to ensure that
6677 LString.h gets included before anything that includes stl_string_fwd.h
6679 * src/support/lyxstring.C: We need to #include LString.h instead of
6680 lyxstring.h to get the necessary definition of __get_c_string.
6681 (__get_c_string): New function. This is defined static just like SGI's
6682 although why they need to do this I'm not sure. Perhaps it should be
6683 in lstrings.C instead.
6685 * lib/templates/IEEEtran.lyx: New template file.
6687 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6689 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
6690 * intl/Makefile.in (MKINSTALLDIRS): ditto
6692 * src/LyXAction.C (init): changed to hold the LFUN data in a
6693 automatic array in stead of in callso to newFunc, this speeds up
6694 compilation a lot. Also all the memory used by the array is
6695 returned when the init is completed.
6697 * a lot of files: compiled with -Wold-style-cast, changed most of
6698 the reported offenders to C++ style casts. Did not change the
6699 offenders in C files.
6701 * src/trans.h (Match): change argument type to unsigned int.
6703 * src/support/DebugStream.C: fix some types on the streambufs so
6704 that it works on a conforming implementation.
6706 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6708 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
6710 * src/support/lyxstring.C: remove the inline added earlier since
6711 they cause a bunch of unsatisfied symbols when linking with dec
6712 cxx. Cxx likes to have the body of inlines at the place where they
6715 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
6716 accessing negative bounds in array. This fixes the crash when
6717 inserting accented characters.
6718 * src/trans.h (Match): ditto
6720 * src/buffer.C (Dispatch): since this is a void, it should not try
6721 to return anything...
6723 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6725 * src/buffer.h: removed the two friends from Buffer. Some changes
6726 because of this. Buffer::getFileName and Buffer::setFileName
6727 renamed to Buffer::fileName() and Buffer::fileName(...).
6729 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6731 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
6732 and Buffer::update(short) to BufferView. This move is currently
6733 controlled by a define MOVE_TEXT, this will be removed when all
6734 shows to be ok. This move paves the way for better separation
6735 between buffer contents and buffer view. One side effect is that
6736 the BufferView needs a rebreak when swiching buffers, if we want
6737 to avoid this we can add a cache that holds pointers to LyXText's
6738 that is not currently in use.
6740 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
6743 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6745 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
6747 * lyx_main.C: new command line option -x (or --execute) and
6748 -e (or --export). Now direct conversion from .lyx to .tex
6749 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
6750 Unfortunately, X is still needed and the GUI pops up during the
6753 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6755 * src/Spacing.C: add a using directive to bring stream stuff into
6757 * src/paragraph.C: ditto
6758 * src/buffer.C: ditto
6760 * NEWS: updated a bit the new features of 1.1.3 (took a few things
6761 from Lars' announcement).
6763 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
6764 example files from Tino Meinen.
6766 1999-12-06 Allan Rae <rae@lyx.org>
6768 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
6770 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6772 * src/support/lyxstring.C: added a lot of inline for no good
6775 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
6776 latexWriteEndChanges, they were not used.
6778 * src/layout.h (operator<<): output operator for PageSides
6780 * src/mathed/math_iter.C (my_memcpy): slightly changed.
6782 * some example files: loaded in LyX 1.0.4 and saved again to update
6783 certain constructs (table format)
6785 * a lot of files: did the change to use fstream/iostream for all
6786 writing of files. Done with a close look at Andre Poenitz's patch.
6788 * some files: whitespace changes.
6790 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6792 * src/mathed/math_iter.C (my_memcpy): new function. Since the
6793 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
6794 architecture, we provide our own. It is used unconditionnally, but
6795 I do not think this is a performance problem. Thanks to Angus
6796 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
6797 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
6799 (GetInset): use my_memcpy.
6803 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
6804 it is easier to understand, but it uses less TeX-only constructs now.
6806 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
6807 elements contain spaces
6809 * lib/configure: regenerated
6811 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
6812 elements contain spaces; display the list of programs that are
6815 * autogen.sh: make sure lib/configure is executable
6817 * lib/examples/*: rename the tutorial examples to begin with the
6818 two-letters language code.
6820 * src/lyxfunc.C (getStatus): do not query current font if no
6823 * src/lyx_cb.C (RunScript): use QuoteName
6824 (MenuRunDvips): ditto
6825 (PrintApplyCB): ditto
6827 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
6828 around argument, so that it works well with the current shell.
6829 Does not work properly with OS/2 shells currently.
6831 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
6832 * src/LyXSendto.C (SendtoApplyCB): ditto
6833 * src/lyxfunc.C (Dispatch): ditto
6834 * src/buffer.C (runLaTeX): ditto
6835 (runLiterate): ditto
6836 (buildProgram): ditto
6838 * src/lyx_cb.C (RunScript): ditto
6839 (MenuMakeLaTeX): ditto
6841 * src/buffer.h (getLatexName): new method
6843 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
6845 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6847 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
6848 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
6849 (create_math_panel): ditto
6851 * src/lyxfunc.C (getStatus): re-activate the code which gets
6852 current font and cursor; add test for export to html.
6854 * src/lyxrc.C (read): remove unreachable break statements; add a
6857 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
6859 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6861 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
6862 introduced by faulty regex.
6863 * src/buffer.C: ditto
6864 * src/lastfiles.C: ditto
6865 * src/paragraph.C: ditto
6866 * src/table.C: ditto
6867 * src/vspace.C: ditto
6868 * src/insets/figinset.C: ditto
6869 Note: most of these is absolutely harmless, except the one in
6870 src/mathed formula.C.
6872 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
6874 * src/ImportNoweb.C (documentclass): fixed bounds for substr
6875 operation, yielding correct results for the reLyX command.
6877 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6879 * src/support/filetools.C (ExpandPath): removed an over eager
6881 (ReplaceEnvironmentPath): ditto
6883 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
6884 shows that we are doing something fishy in our code...
6888 * src/lyxrc.C (read): use a double switch trick to get more help
6889 from the compiler. (the same trick is used in layout.C)
6890 (write): new function. opens a ofstream and pass that to output
6891 (output): new function, takes a ostream and writes the lyxrc
6892 elemts to it. uses a dummy switch to make sure no elements are
6895 * src/lyxlex.h: added a struct pushpophelper for use in functions
6896 with more than one exit point.
6898 * src/lyxlex.[Ch] (GetInteger): made it const
6902 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
6904 * src/layout.[hC] : LayoutTags splitted into several enums, new
6905 methods created, better error handling cleaner use of lyxlex. Read
6908 * src/bmtable.[Ch]: change some member prototypes because of the
6909 image const changes.
6911 * commandtags.h, src/LyXAction.C (init): new function:
6912 "preferences-save", saves the lyxrc entries into .lyx/preferences.
6913 This file is not read automatically but you can add \input
6914 preferences to your lyxrc if you want to. We need to discuss how
6917 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
6918 in .aux, also remove .bib and .bst files from dependencies when
6921 * src/BufferView.C, src/LyXView.C: add const_cast several places
6922 because of changes to images.
6924 * lib/images/*: same change as for images/*
6926 * lib/lyxrc.example: Default for accept_compound is false not no.
6928 * images/*: changed to be const, however I have som misgivings
6929 about this change so it might be changed back.
6931 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6933 * lib/configure, po/POTFILES.in: regenerated
6935 * autogen.sh: autogenerate lib/configure from lib/configure.m4
6937 * config/lib_configure.m4: removed
6939 * lib/configure.m4: new file (was config/lib_configure.m4)
6941 * configure.in: do not test for rtti, since we do not use it.
6943 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6945 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
6946 doubling of allocated space scheme. This makes it faster for large
6947 strings end to use less memory for small strings. xtra rememoved.
6949 * src/insets/figinset.C (waitalarm): commented out.
6950 (GhostscriptMsg): use static_cast
6951 (GhostscriptMsg): use new instead of malloc to allocate memory for
6952 cmap. also delete the memory after use.
6954 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
6956 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
6957 for changes in bibtex database or style.
6958 (runBibTeX): remove all .bib and .bst files from dep before we
6960 (run): use scanAuc in when dep file already exist.
6962 * src/DepTable.C (remove_files_with_extension): new method
6965 * src/DepTable.[Ch]: made many of the methods const.
6967 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6969 * src/bufferparams.C: make sure that the default textclass is
6970 "article". It used to be the first one by description order, but
6971 now the first one is "docbook".
6973 * src/lyx_main.C (setDebuggingLevel): change type of argument to
6974 string; call Debug::value.
6975 (easyParse): pass complete argument to setDebuggingLevel().
6977 * src/debug.h (value): fix the code that parses debug levels.
6979 * src/debug.h: add new debug type ACTION, reserved for LyXAction
6982 * src/LyXAction.C: use Debug::ACTION as debug channel.
6984 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
6986 * NEWS: updated for the future 1.1.3 release.
6988 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
6989 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
6990 it should. This is of course a controversial change (since many
6991 people will find that their lyx workscreen is suddenly full of
6992 red), but done for the sake of correctness.
6994 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
6995 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
6997 * src/insets/inseterror.h, src/insets/inseturl.h,
6998 src/insets/insetinfo.h, src/insets/figinset.h,
6999 src/mathed/formulamacro.h, src/mathed/math_macro.h
7000 (EditMessage): add a missing const and add _() to make sure that
7003 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
7004 src/insets/insetbib.C, src/support/filetools.C: add `using'
7007 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
7008 doing 'Insert index of last word' at the beginning of a paragraph.
7010 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7012 * several files: white-space changes.
7014 * src/mathed/formula.C: removed IsAlpha and IsDigit
7016 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
7017 .bib file. use a ifstream instead of FilePtr when parsing the .bib
7020 * src/insets/figinset.C (GetPSSizes): don't break when
7021 "EndComments" is seen. But break when a boundingbox is read.
7023 * all classes inherited from Inset: return value of Clone
7024 changed back to Inset *.
7026 * all classes inherited form MathInset: return value of Clone
7027 changed back to MathedInset *.
7029 * src/insets/figinset.C (runqueue): use a ofstream to output the
7030 gs/ps file. Might need some setpresicion or setw. However I can
7031 see no problem with the current code.
7032 (runqueue): use sleep instead of the alarm/signal code. I just
7033 can't see the difference.
7035 * src/paragraph.C (LyXParagraph): reserve space in the new
7036 paragraph and resize the inserted paragraph to just fit.
7038 * src/lyxfunc.h (operator|=): added operator for func_status.
7040 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
7041 check for readable file.
7043 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
7044 check for readable file.
7045 (MenuMakeLinuxDoc): ditto
7046 (MenuMakeDocBook): ditto
7047 (MenuMakeAscii): ditto
7048 (InsertAsciiFile): split the test for openable and readable
7050 * src/bmtable.C (draw_bitmaptable): use
7051 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
7053 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
7054 findtexfile from LaTeX to filetools.
7056 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
7057 instead of FilePtr. Needs to be verified by a literate user.
7059 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7061 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
7062 (EditMessage): likewise.
7064 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
7065 respectively as \textasciitilde and \textasciicircum.
7067 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7069 * src/support/lyxstring.h: made the methods that take iterators
7072 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
7073 (regexMatch): made is use the real regex class.
7075 * src/support/Makefile.am: changed to use libtool
7077 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
7079 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
7081 (MathIsInset ++): changed several macros to be inline functions
7084 * src/mathed/Makefile.am: changed to use libtool
7086 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
7088 * src/insets/inset* : Clone changed to const and return type is
7089 the true insettype not just Inset*.
7091 * src/insets/Makefile.am: changed to use libtool
7093 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
7095 * src/undo.[Ch] : added empty() and changed some of the method
7098 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
7100 * src/lyxparagraph.h: use id() and id(...) instead of getID and
7101 setID use block<> for the bullets array, added const several places.
7103 * src/lyxfunc.C (getStatus): new function
7105 * src/lyxfunc.[Ch] : small changes to take advantage of the new
7106 LyXAction, added const to several funtions.
7108 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
7109 a std::map, and to store the dir items in a vector.
7111 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
7114 * src/LyXView.[Ch] + other files : changed currentView to view.
7116 * src/LyXAction.[Ch] : ported from the old devel branch.
7118 * src/.cvsignore: added .libs and a.out
7120 * configure.in : changes to use libtool.
7122 * acinclude.m4 : inserted libtool.m4
7124 * .cvsignore: added libtool
7126 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7128 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
7129 file name in insets and mathed directories (otherwise the
7130 dependency is not taken in account under cygwin).
7132 * src/text2.C (InsertString[AB]): make sure that we do not try to
7133 read characters past the string length.
7135 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7137 * lib/doc/LaTeXConfig.lyx.in,
7138 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
7140 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
7141 file saying who created them and when this heppened; this is
7142 useless and annoys tools like cvs.
7144 * lib/layouts/g-brief-{en,de}.layout,
7145 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
7146 from Thomas Hartkens <thomas@hartkens.de>.
7148 * src/{insets,mathed}/Makefile.am: do not declare an empty
7149 LDFLAGS, so that it can be set at configure time (useful on Irix
7152 * lib/reLyX/configure.in: make sure that the prefix is set
7153 correctly in LYX_DIR.
7155 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7157 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
7158 be used by 'command-sequence' this allows to bind a key to a
7159 sequence of LyX-commands
7160 (Example: 'command-sequence math-insert alpha; math-insert beta;")
7162 * src/LyXAction.C: add "command-sequence"
7164 * src/LyXFunction.C: handling of "command-sequence"
7166 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
7167 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
7169 * src/lyxserver.C, src/minibuffer.C: Use this new interface
7171 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7173 * src/buffer.C (writeFile): Do not output a comment giving user
7174 and date at the beginning of a .lyx file. This is useless and
7175 annoys cvs anyway; update version number to 1.1.
7177 * src/Makefile.am (LYX_DIR): add this definition, so that a
7178 default path is hardcoded in LyX.
7180 * configure.in: Use LYX_GNU_GETTEXT.
7182 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
7183 AM_GNU_GETTEXT with a bug fixed.
7185 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
7187 * src/chset.C: add "using std::ifstream;" to please dec cxx.
7189 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
7190 which is used to point to LyX data is now LYX_DIR_11x.
7192 * lyx.man: convert to a unix text file; small updates.
7194 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7196 * src/support/LSubstring.[Ch]: made the second arg of most of the
7197 constructors be a const reference.
7199 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
7202 * src/support/lyxstring.[Ch] (swap): added missing member function
7203 and specialization of swap(str, str);
7205 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
7207 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
7208 trace of the old one.
7210 * src/undo.[Ch]: made the undostack use std::list to store undo's in
7211 put the member definitions in undo.C.
7213 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
7214 NEW_TEXT and have now only code that was included when this was
7217 * src/intl.C (LCombo): use static_cast
7219 (DispatchCallback): ditto
7221 * src/definitions.h: removed whole file
7223 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
7225 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
7226 parsing and stores in a std:map. a regex defines the file format.
7227 removed unneeded members.
7229 * src/bufferparams.h: added several enums from definitions.h here.
7230 Removed unsused destructor. Changed some types to use proper enum
7231 types. use block to have the temp_bullets and user_defined_bullets
7232 and to make the whole class assignable.
7234 * src/bufferparams.C (Copy): removed this functions, use a default
7237 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
7240 * src/buffer.C (readLyXformat2): commend out all that have with
7241 oldpapersize to do. also comment out all that hve to do with
7242 insetlatex and insetlatexdel.
7243 (setOldPaperStuff): commented out
7245 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
7247 * src/LyXAction.C: remove use of inset-latex-insert
7249 * src/mathed/math_panel.C (button_cb): use static_cast
7251 * src/insets/Makefile.am (insets_o_SOURCES): removed
7254 * src/support/lyxstring.C (helper): use the unsigned long
7255 specifier, UL, instead of a static_cast.
7257 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
7259 * src/support/block.h: new file. to be used as a c-style array in
7260 classes, so that the class can be assignable.
7262 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7264 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
7265 NULL, make sure to return an empty string (it is not possible to
7266 set a string to NULL).
7268 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7270 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
7272 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
7274 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
7275 link line, so that Irix users (for example) can set it explicitely to
7278 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
7279 it can be overidden at make time (static or dynamic link, for
7282 * src/vc-backend.C, src/LaTeXFeatures.h,
7283 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
7284 statements to bring templates to global namespace.
7286 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7288 * src/support/lyxstring.C (operator[] const): make it standard
7291 * src/minibuffer.C (Init): changed to reflect that more
7292 information is given from the lyxvc and need not be provided here.
7294 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
7296 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
7298 * src/LyXView.C (UpdateTimerCB): use static_cast
7299 (KeyPressMask_raw_callback): ditto
7301 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
7302 buffer_, a lot of changes because of this. currentBuffer() ->
7303 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
7304 also changes to other files because of this.
7306 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7308 * src/vc-backend.[Ch]: new files. The backends for vc handling,
7309 have no support for RCS and partial support for CVS, will be
7312 * src/insets/ several files: changes because of function name
7313 changes in Bufferview and LyXView.
7315 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
7317 * src/support/LSubstring.[Ch]: new files. These implement a
7318 Substring that can be very convenient to use. i.e. is this
7320 string a = "Mary had a little sheep";
7321 Substring(a, "sheep") = "lamb";
7322 a is now "Mary has a little lamb".
7324 * src/support/LRegex.[Ch]: a regex class that can be used to pick
7325 out patterns and subpatterns of strings. It is used by LSubstring
7326 and also by vc-backend.C
7328 * src/support/lyxstring.C: went over all the assertions used and
7329 tried to correct the wrong ones and flag which of them is required
7330 by the standard. some bugs found because of this. Also removed a
7331 couple of assertions.
7333 * src/support/Makefile.am (libsupport_a_SOURCES): added
7334 LSubstring.[Ch] and LRegex.[Ch]
7336 * src/support/FileInfo.h: have struct stat buf as an object and
7337 not a pointer to one, some changes because of this.
7339 * src/LaTeXFeatures.C (getTClassPreamble): also use the
7340 information in layout when adding the layouts preamble to the
7343 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
7346 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
7347 because of bug in OS/2.
7349 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7351 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
7352 \verbatim@font instead of \ttfamily, so that it can be redefined.
7354 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
7355 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
7356 src/layout.h, src/text2.C: add 'using' directive to bring the
7357 STL templates we need from the std:: namespace to the global one.
7358 Needed by DEC cxx in strict ansi mode.
7360 * src/support/LIstream.h,src/support/LOstream.h,
7361 src/support/lyxstring.h,src/table.h,
7362 src/lyxlookup.h: do not include <config.h> in header
7363 files. This should be done in the .C files only.
7365 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
7369 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7371 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
7372 from Kayvan to fix the tth invokation.
7374 * development/lyx.spec.in: updates from Kayvan to reflect the
7375 changes of file names.
7377 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7379 * src/text2.C (InsertStringB): use std::copy
7380 (InsertStringA): use std::copy
7382 * src/bufferlist.C: use a vector to store the buffers in. This is
7383 an internal change and should not affect any other thing.
7385 * src/BufferView.C (waitForX): use XSync instead of the lengthy
7388 * src/text.C (Fill): fix potential bug, one off bug.
7390 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7392 * src/Makefile.am (lyx_main.o): add more files it depends on.
7394 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
7396 * src/support/lyxstring.C: use size_t for the reference count,
7397 size, reserved memory and xtra.
7398 (internal_compare): new private member function. Now the compare
7399 functions should work for std::strings that have embedded '\0'
7401 (compare): all compare functions rewritten to use
7404 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7406 * src/support/lyxstring.C (compare): pass c_str()
7407 (compare): pass c_str
7408 (compare): pass c_str
7410 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7412 * src/support/DebugStream.C: <config.h> was not included correctly.
7414 * lib/configure: forgot to re-generate it :( I'll make this file
7415 auto generated soon.
7417 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7419 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
7422 * src/support/lyxstring.C: some changes from length() to rep->sz.
7423 avoids a function call.
7425 * src/support/filetools.C (SpaceLess): yet another version of the
7426 algorithm...now per Jean-Marc's suggestions.
7428 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7430 * src/layout.C (less_textclass_desc): functor for use in sorting
7432 (LyXTextClass::Read): sort the textclasses after reading.
7434 * src/support/filetools.C (SpaceLess): new version of the
7435 SpaceLess functions. What problems does this one give? Please
7438 * images/banner_bw.xbm: made the arrays unsigned char *
7440 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7442 * src/support/lyxstring.C (find): remove bogus assertion in the
7443 two versions of find where this has not been done yet.
7445 * src/support/lyxlib.h: add missing int return type to
7448 * src/menus.C (ShowFileMenu): disable exporting to html if no
7449 html export command is present.
7451 * config/lib_configure.m4: add a test for an HTML converter. The
7452 programs checked for are, in this order: tth, latex2html and
7455 * lib/configure: generated from config/lib_configure.m4.
7457 * src/lyxfunc.C (Dispatch): update and improve the execution of an
7458 html converter. The parameters are now passed through $$FName and
7459 $$OutName, instead of standard input/output.
7461 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
7463 * lib/lyxrc.example: update description of \html_command.
7464 add "quotes" around \screen_font_xxx font setting examples to help
7465 people who use fonts with spaces in their names.
7467 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7469 * Distribution files: updates for v1.1.2
7471 * src/support/lyxstring.C (find): remove bogus assert and return
7472 npos for the same condition.
7474 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7476 * added patch for OS/2 from SMiyata.
7478 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7480 * src/text2.C (CutSelection): make space_wrapped a bool
7481 (CutSelection): dont declare int i until we have to.
7482 (alphaCounter): return a char const *.
7484 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7486 * src/support/syscall.C (Systemcalls::kill):
7487 src/support/filetools.C (PutEnv, PutEnvPath):
7488 src/lyx_cb.C (addNewlineAndDepth):
7489 src/FontInfo.C (FontInfo::resize): condition some #warning
7490 directives with WITH_WARNINGS.
7493 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7495 * src/layout.[Ch] + several files: access to class variables
7496 limited and made accessor functions instead a lot of code changed
7497 becuase of this. Also instead of returning pointers often a const
7498 reference is returned instead.
7500 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
7502 * src/Makefile.am (dist-hook): added used to remove the CVS from
7503 cheaders upon creating a dist
7504 (EXTRA_DIST): added cheaders
7506 * src/support/lstrings.C (tostr(char)): fix it to handle param as
7507 a character not as a small integer.
7509 * src/support/lyxstring.C (find): removed Assert and added i >=
7510 rep->sz to the first if.
7512 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7514 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
7515 src/LyXView.C src/buffer.C src/bufferparams.C
7516 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
7517 src/text2.C src/insets/insetinclude.C:
7518 lyxlayout renamed to textclasslist.
7520 * src/layout.C: some lyxerr changes.
7522 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
7523 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
7524 (LyXLayoutList): removed all traces of this class.
7525 (LyXTextClass::Read): rewrote LT_STYLE
7526 (LyXTextClass::hasLayout): new function
7527 (LyXTextClass::GetLayout): rewritten to return an iterator + has
7528 both const and nonconst version.
7529 (LyXTextClass::delete_layout): new function.
7530 (LyXTextClassList::Style): bug fix. do the right thing if layout
7532 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
7533 (LyXTextClassList::NameOfLayout): ditto
7534 (LyXTextClassList::Load): ditto
7536 * src/buffer.C (makeLaTeXFile): new access to layoutlist
7538 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
7540 * src/LyXAction.C (LookupFunc): added a workaround for sun
7541 compiler, on the other hand...we don't know if the current code
7542 compiles on sun at all...
7544 * src/support/filetools.C (CleanupPath): subst fix
7546 * src/insets/insetbib.C (delDatabase): subst fix, this looks
7549 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
7550 complained about this one?
7552 * src/insets/insetinclude.C (Latex): subst fix
7554 * src/insets/insetbib.C (getKeys): subst fix
7556 * src/LyXSendto.C (SendtoApplyCB): subst fix
7558 * src/lyx_main.C (init): subst fix
7560 * src/layout.C (Read): subst fix
7562 * src/lyx_sendfax_main.C (button_send): subst fix
7564 * src/buffer.C (RoffAsciiTable): subst fix
7566 * src/lyx_cb.C (MenuFax): subst fix
7567 (PrintApplyCB): subst fix
7569 1999-10-26 Juergen Vigna <jug@sad.it>
7571 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
7573 (Read): Cleaned up this code so now we read only format vestion >= 5
7575 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7577 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
7578 come nobody has complained about this one?
7580 * src/insets/insetinclude.C (Latex): subst fix
7582 * src/insets/insetbib.C (getKeys): subst fix
7584 * src/lyx_main.C (init): subst fix
7586 * src/layout.C (Read): subst fix
7588 * src/buffer.C (RoffAsciiTable): subst fix
7590 * src/lyx_cb.C (MenuFax): subst fix.
7592 * src/layout.[hC] + some other files: rewrote to use
7593 std::container to store textclasses and layouts in.
7594 Simplified, removed a lot of code. Make all classes
7595 assignable. Further simplifications and review of type
7596 use still to be one.
7598 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
7599 lastfiles to create the lastfiles partr of the menu.
7601 * src/lastfiles.[Ch]: rewritten to use deque to store the
7602 lastfiles in. Uses fstream for reading and writing. Simplifies
7605 * src/support/syscall.C: remove explicit cast.
7607 * src/BufferView.C (CursorToggleCB): removed code snippets that
7609 use explicat C++ style casts instead of C style casts. also use
7610 u_vdata instea of passing pointers in longs.
7612 * src/PaperLayout.C: removed code snippets that were commented out.
7614 * src/lyx_gui_misc.C: removed code snippets that were commented out.
7616 * src/lyx_main.C: removed code snippets that wer commented out.
7618 * src/paragraph.C: removed code snippets that were commented out.
7620 * src/lyxvc.C (logClose): use static_cast
7622 (viewLog): remove explicit cast to void*
7623 (showLog): removed old commented code
7625 * src/menus.C: use static_cast instead of C style casts. use
7626 u_vdata instead of u_ldata. remove explicit cast to (long) for
7627 pointers. Removed old code that was commented out.
7629 * src/insets/inset.C: removed old commented func
7631 * src/insets/insetref.C (InsetRef): removed old code that had been
7632 commented out for a long time.
7634 (escape): removed C style cast
7636 * src/insets/insetlatexaccent.C (Draw): removed old commented code
7638 * src/insets/insetlatex.C (Draw): removed old commented code
7639 (Read): rewritten to use string
7641 * src/insets/insetlabel.C (escape): removed C style cast
7643 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
7645 * src/insets/insetindex.C: use static_cast and u_vdata, removed
7648 * src/insets/insetinclude.h: removed a couple of stupid bools
7650 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
7651 (Clone): remove C style cast
7652 (getKeys): changed list to lst because of std::list
7654 * src/insets/inseterror.C (Draw): removed som old commented code.
7656 * src/insets/insetcommand.C (Draw): removed some old commented code.
7658 * src/insets/insetbib.C (bibitem_cb): removed code that has been
7659 commented out forever.
7660 (bibitem_cb): use static_cast instead of C style cast
7661 use of vdata changed to u_vdata.
7663 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
7665 (CloseUrlCB): use static_cast instead of C style cast.
7666 (CloseUrlCB): added a fl_free form...it seemed to be missing.
7668 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
7669 (C_InsetInfo_CloseInfoCB): forward the ob parameter
7670 (CloseInfoCB): static_cast from ob->u_vdata instead.
7671 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
7674 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
7675 (C_InsetError_CloseErrorCB): forward the ob parameter
7676 (CloseErrorCB): static_cast from ob->u_vdata instead.
7678 * src/vspace.h: include LString.h since we use string in this class.
7680 * src/vspace.C (lyx_advance): changed name from advance because of
7681 nameclash with stl. And since we cannot use namespaces yet...I
7682 used a lyx_ prefix instead. Expect this to change when we begin
7685 * src/BufferView.[Ch] (BufferView::~BufferView): removed
7687 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
7688 and removed now defunct constructor and deconstructor.
7690 * src/BufferView.h: have backstack as a object not as a pointer.
7691 removed initialization from constructor. added include for BackStack
7693 * development/lyx.spec.in (%build): add CFLAGS also.
7695 * src/screen.C (drawFrame): removed another warning.
7697 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7699 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
7700 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
7701 README and ANNOUNCE a bit for the next release. More work is
7704 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
7705 unbreakable if we are in freespacing mode (LyX-Code), but not in
7708 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7710 * src/BackStack.h: fixed initialization order in constructor
7712 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
7714 * acinclude.m4 (VERSION): new rules for when a version is
7715 development, added also a variable for prerelease.
7716 (warnings): we set with_warnings=yes for prereleases
7717 (lyx_opt): prereleases compile with same optimization as development
7718 (CXXFLAGS): only use pedantic if we are a development version
7720 * src/BufferView.C (restorePosition): don't do anything if the
7723 * src/BackStack.h: added member empty, use this to test if there
7724 is anything to pop...
7726 1999-10-25 Juergen Vigna <jug@sad.it>
7729 * forms/layout_forms.fd +
7730 * forms/latexoptions.fd +
7731 * lyx.fd: changed for various form resize issues
7733 * src/mathed/math_panel.C +
7734 * src/insets/inseterror.C +
7735 * src/insets/insetinfo.C +
7736 * src/insets/inseturl.C +
7737 * src/insets/inseturl.h +
7740 * src/PaperLayout.C +
7741 * src/ParagraphExtra.C +
7742 * src/TableLayout.C +
7744 * src/layout_forms.C +
7751 * src/menus.C: fixed various resize issues. So now forms can be
7752 resized savely or not be resized at all.
7754 * forms/form_url.fd +
7755 * src/insets/form_url.[Ch]: added because it's cleaner and easier
7758 * src/insets/Makefile.am: added files form_url.[Ch]
7760 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7762 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
7763 (and presumably 6.2).
7765 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
7766 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
7767 remaining static member callbacks.
7769 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
7772 * src/support/lyxstring.h: declare struct Srep as friend of
7773 lyxstring, since DEC cxx complains otherwise.
7775 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7777 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7779 * src/LaTeX.C (run): made run_bibtex also depend on files with
7781 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
7782 are put into the dependency file.
7784 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
7785 the code has shown itself to work
7786 (create_ispell_pipe): removed another warning, added a comment
7789 * src/minibuffer.C (ExecutingCB): removed code that has been
7790 commented out a long time
7792 * src/lyxfunc.C (processKeyEvent): removed some very old commented
7793 out code + a warning.
7795 * src/support/lyxstring.h: comment out the three private
7796 operators, when compiling with string ansi conforming compilers
7799 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
7801 (pixmapFromBitmapData): change type of bdata to be unsigned char *
7802 (pixmapFromBitmapData): add a reinterpret_cast in the call to
7805 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
7808 * src/mathed/math_panel.C (create_math_panel): remove explicit
7811 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
7814 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
7815 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
7816 to XCreatePixmapFromBitmapData
7817 (fl_set_bmtable_data): change the last argument to be unsigned
7819 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
7820 and bh to be unsigned int, remove explicit casts in call to
7821 XReadBitmapFileData.
7823 * images/arrows.xbm: made the arrays unsigned char *
7824 * images/varsz.xbm: ditto
7825 * images/misc.xbm: ditto
7826 * images/greek.xbm: ditto
7827 * images/dots.xbm: ditto
7828 * images/brel.xbm: ditto
7829 * images/bop.xbm: ditto
7831 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
7833 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
7834 (LYX_PROG_CXX): added -pedantic to g++ compile options when
7835 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
7837 (LYX_CXX_CHEADERS): added <clocale> to the test.
7839 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
7841 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
7843 * src/support/lyxstring.C (append): fixed something that must be a
7844 bug, rep->assign was used instead of rep->append.
7846 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
7849 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
7850 lyx insert double chars. Fix spotted by Kayvan.
7852 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
7854 * Fixed the tth support. I messed up with the Emacs patch apply feature
7855 and omitted the changes in lyxrc.C.
7857 1999-10-22 Juergen Vigna <jug@sad.it>
7859 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
7861 * src/lyx_cb.C (MenuInsertRef) +
7862 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
7863 the form cannot be resized under it limits (fixes a segfault)
7865 * src/lyx.C (create_form_form_ref) +
7866 * forms/lyx.fd: Changed Gravity on name input field so that it is
7869 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7871 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
7872 <ostream> and <istream>.
7874 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
7875 whether <fstream> provides the latest standard features, or if we
7876 have an oldstyle library (like in egcs).
7877 (LYX_CXX_STL_STRING): fix the test.
7879 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
7880 code on MODERN_STL_STREAM.
7882 * src/support/lyxstring.h: use L{I,O}stream.h.
7884 * src/support/L{I,O}stream.h: new files, designed to setup
7885 correctly streams for our use
7886 - includes the right header depending on STL capabilities
7887 - puts std::ostream and std::endl (for LOStream.h) or
7888 std::istream (LIStream.h) in toplevel namespace.
7890 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7892 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
7893 was a bib file that had been changed we ensure that bibtex is run.
7894 (runBibTeX): enhanced to extract the names of the bib files and
7895 getting their absolute path and enter them into the dep file.
7896 (findtexfile): static func that is used to look for tex-files,
7897 checks for absolute patchs and tries also with kpsewhich.
7898 Alternative ways of finding the correct files are wanted. Will
7900 (do_popen): function that runs a command using popen and returns
7901 the whole output of that command in a string. Should be moved to
7904 * src/DepTable.[Ch] (extchanged): new function that returns true if a
7905 file with extension ext has changed.
7907 * src/insets/figinset.C: added ifdef guards around the fl_free
7908 code that jug commented out. Now it is commented out when
7909 compiling with XForms == 0.89.
7911 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
7912 to lyxstring.C, and only keep a forward declaration in
7913 lyxstring.h. Simplifies the header file a bit and should help a
7914 bit on compile time too. Also changes to Srep will not mandate a
7915 recompile of code just using string.
7916 (~lyxstring): definition moved here since it uses srep.
7917 (size): definition moved here since it uses srep.
7919 * src/support/lyxstring.h: removed a couple of "inline" that should
7922 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7924 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
7927 1999-10-21 Juergen Vigna <jug@sad.it>
7929 * src/table.C (SetPWidth): Just a small fix so the alignment is not
7930 set to left if I just remove the width entry (or it is empty).
7932 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
7933 paragraph when having dummy paragraphs.
7935 1999-10-20 Juergen Vigna <jug@sad.it>
7937 * src/insets/figinset.C: just commented some fl_free_form calls
7938 and added warnings so that this calls should be activated later
7939 again. This avoids for now a segfault, but we have a memory leak!
7941 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
7942 'const char * argument' to 'string argument', this should
7943 fix some Asserts() in lyxstring.C.
7945 * src/lyxfunc.h: Removed the function argAsString(const char *)
7946 as it is not used anymore.
7948 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7950 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
7953 * src/Literate.h: some funcs moved from public to private to make
7954 interface clearer. Unneeded args removed.
7956 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
7958 (scanBuildLogFile): ditto
7960 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
7961 normal TeX Error. Still room for improvement.
7963 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
7965 * src/buffer.C (insertErrors): changes to make the error
7966 desctription show properly.
7968 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
7971 * src/support/lyxstring.C (helper): changed to use
7972 sizeof(object->rep->ref).
7973 (operator>>): changed to use a pointer instead.
7975 * src/support/lyxstring.h: changed const reference & to value_type
7976 const & lets see if that helps.
7978 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7980 * Makefile.am (rpmdist): fixed to have non static package and
7983 * src/support/lyxstring.C: removed the compilation guards
7985 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
7988 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
7989 conditional compile of lyxstring.Ch
7991 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
7992 stupid check, but it is a lot better than the bastring hack.
7993 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
7995 * several files: changed string::erase into string::clear. Not
7998 * src/chset.C (encodeString): use a char temporary instead
8000 * src/table.C (TexEndOfCell): added tostr around
8001 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
8002 (TexEndOfCell): ditto
8003 (TexEndOfCell): ditto
8004 (TexEndOfCell): ditto
8005 (DocBookEndOfCell): ditto
8006 (DocBookEndOfCell): ditto
8007 (DocBookEndOfCell): ditto
8008 (DocBookEndOfCell): ditto
8010 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
8012 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
8014 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
8015 (MenuBuildProg): added tostr around ret
8016 (MenuRunChktex): added tostr around ret
8017 (DocumentApplyCB): added tostr around ret
8019 * src/chset.C (encodeString): added tostr around t->ic
8021 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
8022 (makeLaTeXFile): added tostr around tocdepth
8023 (makeLaTeXFile): added tostr around ftcound - 1
8025 * src/insets/insetbib.C (setCounter): added tostr around counter.
8027 * src/support/lyxstring.h: added an operator+=(int) to catch more
8030 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
8031 (lyxstring): We DON'T allow NULL pointers.
8033 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8035 * src/mathed/math_macro.C (MathMacroArgument::Write,
8036 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
8037 when writing them out.
8039 * src/LString.C: remove, since it is not used anymore.
8041 * src/support/lyxstring.C: condition the content to
8042 USE_INCLUDED_STRING macro.
8044 * src/mathed/math_symbols.C, src/support/lstrings.C,
8045 src/support/lyxstring.C: add `using' directive to specify what
8046 we need in <algorithm>. I do not think that we need to
8047 conditionalize this, but any thought is appreciated.
8049 * many files: change all callback functions to "C" linkage
8050 functions to please strict C++ compilers like DEC cxx 6.1 in mode
8051 strict_ansi. Those who were static are now global.
8052 The case of callbacks which are static class members is
8053 trickier, since we have to make C wrappers around them (see
8054 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
8055 did not finish this yet, since it defeats the purpose of
8056 encapsulation, and I am not sure what the best route is.
8058 1999-10-19 Juergen Vigna <jug@sad.it>
8060 * src/support/lyxstring.C (lyxstring): we permit to have a null
8061 pointer as assignment value and just don't assign it.
8063 * src/vspace.C (nextToken): corrected this function substituting
8064 find_first(_not)_of with find_last_of.
8066 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
8067 (TableOptCloseCB) (TableSpeCloseCB):
8068 inserted fl_set_focus call for problem with fl_hide_form() in
8071 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8073 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
8076 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8078 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
8079 LyXLex::next() and not eatline() to get its argument.
8081 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8083 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
8084 instead, use fstreams for io of the depfile, removed unneeded
8085 functions and variables.
8087 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
8088 vector instead, removed all functions and variables that is not in
8091 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8093 * src/buffer.C (insertErrors): use new interface to TeXError
8095 * Makefile.am (rpmdist): added a rpmdist target
8097 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
8098 per Kayvan's instructions.
8100 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8102 * src/Makefile.am: add a definition for localedir, so that locales
8103 are found after installation (Kayvan)
8105 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8107 * development/.cvsignore: new file.
8109 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8111 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
8112 C++ compiler provides wrappers for C headers and use our alternate
8115 * configure.in: use LYX_CXX_CHEADERS.
8117 * src/cheader/: new directory, populated with cname headers from
8118 libstdc++-2.8.1. They are a bit old, but probably good enough for
8119 what we want (support compilers who lack them).
8121 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
8122 from includes. It turns out is was stupid.
8124 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8126 * lib/Makefile.am (install-data-local): forgot a ';'
8127 (install-data-local): forgot a '\'
8128 (libinstalldirs): needed after all. reintroduced.
8130 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8132 * configure.in (AC_OUTPUT): added lyx.spec
8134 * development/lyx.spec: removed file
8136 * development/lyx.spec.in: new file
8138 * po/*.po: merged with lyx.pot becuase of make distcheck
8140 * lib/Makefile.am (dist-hook): added dist-hook so that
8141 documentation files will be included when doing a make
8142 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
8143 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
8145 more: tried to make install do the right thing, exclude CVS dirs
8148 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
8149 Path would fit in more nicely.
8151 * all files that used to use pathstack: uses now Path instead.
8152 This change was a lot easier than expected.
8154 * src/support/path.h: new file
8156 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
8158 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
8160 * src/support/lyxstring.C (getline): Default arg was given for
8163 * Configure.cmd: removed file
8165 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8167 * src/support/DebugStream.[Ch]: remove the explicit std:: before
8168 streams classes and types, add the proper 'using' statements when
8169 MODERN_STL is defined.
8171 * src/debug.h: move the << operator definition after the inclusion
8174 * src/support/filetools.C: include "LAssert.h", which is needed
8177 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
8180 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
8181 include "debug.h" to define a proper ostream.
8183 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8185 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
8186 method to the SystemCall class which can kill a process, but it's
8187 not fully implemented yet.
8189 * src/*.C: Changed Systemcalls::Startscript() to startscript()
8191 * src/support/FileInfo.h: Better documentation
8193 * src/lyxfunc.C: Added support for buffer-export html
8195 * src/menus.C: Added Export->As HTML...
8197 * lib/bind/*.bind: Added short-cut for buffer-export html
8199 * src/lyxrc.*: Added support for new \tth_command
8201 * lib/lyxrc.example: Added stuff for new \tth_command
8203 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8205 * lib/Makefile.am (IMAGES): removed images/README
8206 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
8207 installes in correct place. Check permisions is installed
8210 * src/LaTeX.C: some no-op changes moved declaration of some
8213 * src/LaTeX.h (LATEX_H): changed include guard name
8215 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8217 * lib/reLyX/Makefile.am: install noweb2lyx.
8219 * lib/Makefile.am: install configure.
8221 * lib/reLyX/configure.in: declare a config aux dir; set package
8222 name to lyx (not sure what the best solution is); generate noweb2lyx.
8224 * lib/layouts/egs.layout: fix the bibliography layout.
8226 1999-10-08 Jürgen Vigna <jug@sad.it>
8228 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
8229 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
8230 it returned without continuing to search the path.
8232 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8234 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
8235 also fixes a bug. It is not allowed to do tricks with std::strings
8236 like: string a("hei"); &a[e]; this will not give what you
8237 think... Any reason for the complexity in this func?
8239 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
8241 * Updated README and INSTALL a bit, mostly to check that my
8242 CVS rights are correctly set up.
8244 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8246 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
8247 does not allow '\0' chars but lyxstring and std::string does.
8249 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8251 * autogen.sh (AUTOCONF): let the autogen script create the
8252 POTFILES.in file too. POTFILES.in should perhaps now not be
8253 included in the cvs module.
8255 * some more files changed to use C++ includes instead of C ones.
8257 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
8259 (Reread): added tostr to nlink. buggy output otherwise.
8260 (Reread): added a string() around szMode when assigning to Buffer,
8261 without this I got a log of garbled info strings.
8263 * acconfig.h: commented out the PTR_AS_INT macros. They should not
8266 * I have added several ostream & operator<<(ostream &, some_type)
8267 functions. This has been done to avoid casting and warnings when
8268 outputting enums to lyxerr. This as thus eliminated a lot of
8269 explicit casts and has made the code clearer. Among the enums
8270 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
8271 mathed enums, some font enum the Debug::type enum.
8273 * src/support/lyxstring.h (clear): missing method. equivalent of
8276 * all files that contained "stderr": rewrote constructs that used
8277 stderr to use lyxerr instead. (except bmtable)
8279 * src/support/DebugStream.h (level): and the passed t with
8280 Debug::ANY to avoid spurious bits set.
8282 * src/debug.h (Debug::type value): made it accept strings of the
8285 * configure.in (Check for programs): Added a check for kpsewhich,
8286 the latex generation will use this later to better the dicovery of
8289 * src/BufferView.C (create_view): we don't need to cast this to
8290 (void*) that is done automatically.
8291 (WorkAreaButtonPress): removed some dead code.
8293 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8295 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
8296 is not overwritten when translated (David Sua'rez de Lis).
8298 * lib/CREDITS: Added David Sua'rez de Lis
8300 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
8302 * src/bufferparams.C (BufferParams): default input encoding is now
8305 * acinclude.m4 (cross_compiling): comment out macro
8306 LYX_GXX_STRENGTH_REDUCE.
8308 * acconfig.h: make sure that const is not defined (to empty) when
8309 we are compiling C++. Remove commented out code using SIZEOF_xx
8312 * configure.in : move the test for const and inline as late as
8313 possible so that these C tests do not interefere with C++ ones.
8314 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
8315 has not been proven.
8317 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8319 * src/table.C (getDocBookAlign): remove bad default value for
8322 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
8324 (ShowFileMenu2): ditto.
8326 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
8329 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8331 * Most files: finished the change from the old error code to use
8332 DebugStream for all lyxerr debugging. Only minor changes remain
8333 (e.g. the setting of debug levels using strings instead of number)
8335 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8337 * src/layout.C (Add): Changed to use compare_no_case instead of
8340 * src/FontInfo.C: changed loop variable type too string::size_type.
8342 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8344 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
8345 set ETAGS_ARGS to --c++
8347 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
8349 * src/table.C (DocBookEndOfCell): commented out two unused variables
8351 * src/paragraph.C: commented out four unused variables.
8353 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
8354 insed a if clause with type string::size_type.
8356 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
8359 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
8361 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
8362 variable, also changed loop to go from 0 to lenght + 1, instead of
8363 -1 to length. This should be correct.
8365 * src/LaTeX.C (scanError): use string::size_type as loop variable
8368 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
8369 (l.896) since y_tmp and row was not used anyway.
8371 * src/insets/insetref.C (escape): use string::size_type as loop
8374 * src/insets/insetquotes.C (Width): use string::size_type as loop
8376 (Draw): use string::size_type as loop variable type.
8378 * src/insets/insetlatexaccent.C (checkContents): use
8379 string::size_type as loop variable type.
8381 * src/insets/insetlabel.C (escape): use string::size_type as loop
8384 * src/insets/insetinfo.C: added an extern for current_view.
8386 * src/insets/insetcommand.C (scanCommand): use string::size_type
8387 as loop variable type.
8389 * most files: removed the RCS tags. With them we had to recompile
8390 a lot of files after a simple cvs commit. Also we have never used
8391 them for anything meaningful.
8393 * most files: tags-query-replace NULL 0. As adviced several plases
8394 we now use "0" instead of "NULL" in our code.
8396 * src/support/filetools.C (SpaceLess): use string::size_type as
8399 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8401 * src/paragraph.C: fixed up some more string stuff.
8403 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8405 * src/support/filetools.h: make modestr a std::string.
8407 * src/filetools.C (GetEnv): made ch really const.
8409 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
8410 made code that used these use max/min from <algorithm> instead.
8412 * changed several c library include files to their equivalent c++
8413 library include files. All is not changed yet.
8415 * created a support subdir in src, put lyxstring and lstrings
8416 there + the extra files atexit, fileblock, strerror. Created
8417 Makefile.am. edited configure.in and src/Makefile.am to use this
8418 new subdir. More files moved to support.
8420 * imported som of the functions from repository lyx, filetools
8422 * ran tags-query-replace on LString -> string, corrected the bogus
8423 cases. Tried to make use of lstrings.[hC], debugged a lot. There
8424 is still some errors in there. This is errors where too much or
8425 too litle get deleted from strings (string::erase, string::substr,
8426 string::replace), there can also be some off by one errors, or
8427 just plain wrong use of functions from lstrings. Viewing of quotes
8430 * LyX is now running fairly well with string, but there are
8431 certainly some bugs yet (see above) also string is quite different
8432 from LString among others in that it does not allow null pointers
8433 passed in and will abort if it gets any.
8435 * Added the revtex4 files I forgot when setting up the repository.
8437 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8439 * All over: Tried to clean everything up so that only the files
8440 that we really need are included in the cvs repository.
8441 * Switched to use automake.
8442 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
8443 * Install has not been checked.
8445 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8447 * po/pt.po: Three errors:
8448 l.533 and l.538 format specification error
8449 l. 402 duplicate entry, I just deleted it.