1 2000-11-03 Juergen Vigna <jug@sad.it>
3 * src/insets/insettabular.h: added fixed number to update codes so
4 that update is only in one direction.
6 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
9 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
10 before call to edit because of redraw.
12 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
14 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
16 * lib/ui/default.ui: Populate "edit_float" menu
18 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
20 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
21 "floats-operate". The name is ugly (and the func also), but this
22 is just a band-aid until we switch to new insets.
24 2000-11-03 Rob Lahaye <lahaye@postech.edu>
26 * lib/ui/default.ui: update again the menu layout (fix some
29 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
31 * src/MenuBackend.h (fulllabel): new method.
33 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
34 the menu shortcuts of a menu are unique and whether they
35 correspond to a letter of the label.
36 (expand): call checkShortcuts when debugging.
38 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
40 * src/insets/insettext.C (InsetButtonPress): shut off warning.
42 2000-11-02 Lior Silberman <lior@Princeton.EDU>
44 * lib/examples/*.lyx : '\language default' => '\language english'
46 * lib/examples/it_splash.lyx : except where it should be italian
48 * lib/templates/*.lyx : the same
50 * doc/*.lyx* : the same
52 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
54 * lib/bind/menus.bind: remove the Layout menu entries, which I
55 somehow forgot earlier.
57 2000-11-03 Rob Lahaye <lahaye@postech.edu>
59 * lib/ui/old-default.ui: keep the old one here for reference (to
62 * lib/ui/default.ui: update the menu layout
64 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
66 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
67 Can now Apply to different insets without closing the dialog.
69 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
70 Can't actually DO anything with them yet, but I'd like a little
73 * src/frontends/xforms/input_validators.[ch]
74 (fl_lowercase_filter): new.
76 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
78 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
79 of MATH_CODE. This fixes a bug with math-macros in RTL text.
81 * src/text.C (PrepareToPrint): Show math-macros block aligned.
83 2000-11-02 Juergen Vigna <jug@sad.it>
85 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
86 on char insertion as it has already be updated by bv->updateInset().
88 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
89 if an inset inside was updated.
91 * lib/configure.cmd: commented out fax-search code
93 2000-11-01 Yves Bastide <stid@acm.org>
95 * src/tabular.C (OldFormatRead): set tabular language to the
98 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
100 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
101 class names with non-letter characters (from Yves Bastide).
103 * lib/ui/default.ui: change Item to OptItem in import menu.
104 Comment out fax stuff.
106 * lib/configure.m4: comment out fax-related stuff.
108 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
110 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
111 useful xforms helper functions. At present contains only formatted().
112 Input a string and it returns it with line breaks so that in fits
115 * src/frontends/xforms/Makefile.am: add new files.
117 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
118 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
121 * src/frontends/xforms/FormPreferences.[Ch]:
122 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
123 but lots of little clean ups. Removed enum State. Make use of
124 formatted(). Constify lots of methods. Perhaps best of all: removed
125 requirement for that horrible reinterpret_cast from pointer to long in
128 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
130 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
131 conditionalize build on xforms < 0.89
133 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
135 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
137 * src/LyXAction.C (init): comment out fax
139 * src/lyxrc.h: comment out the fax enums
140 comment out the fax variables
142 * src/commandtags.h: comment out LFUN_FAX
144 * src/lyxrc.C: disable fax variables.
145 (read): disable parsing of fax variables
146 (output): disable writing of fax variables
147 (getFeedback): now description for fax variables
149 * src/lyxfunc.C: comment out MenuFax
150 (Dispatch): disable LFUN_FAX
152 * src/lyx_cb.C (MenuFax): comment out
154 * src/WorkArea.C: add <cctype>
155 (work_area_handler): better key handling, should be ok now.
156 for accented chars + etc
158 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
159 lyx_sendfax.h and lyx_sendfax_man.C
161 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
162 (show): don't call InitLyXLookup when using xforms 0.89
164 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
166 * src/trans.C (AddDeadkey): better fix, the other one could crash...
168 * src/support/filetools.C (GetFileContents): close to dummy change
170 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
172 * src/trans.C (AddDeadkey): workaround stupid compilers.
174 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
176 * src/frontends/xforms/FormDocument.C (class_update): fix setting
177 of two-sided document.
179 2000-10-31 Juergen Vigna <jug@sad.it>
181 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
183 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
184 xposition to the Edit call.
186 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
188 * src/trans.C (AddDeadkey): cast explicitly to char.
190 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
192 * src/tabular.C (AsciiBottomHLine): simplify?
193 (AsciiTopHLine): simplify?
194 (print_n_chars): simplify
195 (DocBook): remove most of the << endl; we should flush the stream
196 as seldom as possible.
198 (TeXBottomHLine): ditto
201 (write_attribute): try a templified version.
202 (set_row_column_number_info): lesson scope of variables
204 * src/support/lstrings.h (tostr): new specialization of tostr
206 * src/trans.C (AddDeadkey): slightly cleaner fix.
208 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
210 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
211 '%%' in Toc menu labels.
214 * src/insets/insetlatexaccent.C (draw): Correct rendering when
215 font_norm is iso10646-1.
217 * src/font.C (ascent): Fixed for 16bit fonts
218 (descent,lbearing,rbearing): ditto
220 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
222 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
223 (getFeedback): new static method.
225 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
226 Now use combox rather than choice to display languages.
227 Feedback is now output using a new timer callback mechanism, identical
228 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
230 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
232 * src/minibuffer.C: fix for older compilers
234 2000-10-30 Juergen Vigna <jug@sad.it>
236 * src/insets/insettext.C (InsertInset): fixed this as the cursor
237 has to be Left of the inset otherwise LyXText won't find it!
239 * src/BufferView2.C (open_new_inset): delete the inset if it can
242 2000-10-30 Rob Lahaye <lahaye@postech.edu>
246 2000-10-29 Marko Vendelin <markov@ioc.ee>
247 * src/frontends/gnome/FormCitation.C
248 * src/frontends/gnome/FormCitation.h
249 * src/frontends/gnome/FormCopyright.C
250 * src/frontends/gnome/FormCopyright.h
251 * src/frontends/gnome/FormError.C
252 * src/frontends/gnome/FormError.h
253 * src/frontends/gnome/FormIndex.C
254 * src/frontends/gnome/FormIndex.h
255 * src/frontends/gnome/FormPrint.C
256 * src/frontends/gnome/FormPrint.h
257 * src/frontends/gnome/FormRef.C
258 * src/frontends/gnome/FormRef.h
259 * src/frontends/gnome/FormToc.C
260 * src/frontends/gnome/FormToc.h
261 * src/frontends/gnome/FormUrl.C
262 * src/frontends/gnome/FormUrl.h
263 * src/frontends/gnome/Menubar_pimpl.C
264 * src/frontends/gnome/mainapp.C
265 * src/frontends/gnome/mainapp.h
266 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
267 changing update() to updateSlot() where appropriate
269 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
271 * src/frontends/xforms/FormPreferences.[Ch]:
272 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
275 2000-10-28 Juergen Vigna <jug@sad.it>
277 * src/insets/insettabular.C (draw): fixed drawing bug.
279 * src/insets/insettext.C (clear):
281 (SetParagraphData): clearing the TEXT buffers when deleting the
282 paragraphs used by it.
284 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
286 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
288 2000-10-27 Juergen Vigna <jug@sad.it>
290 * src/tabular.C (~LyXTabular): removed not needed anymore.
292 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
295 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
297 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
300 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
303 * src/frontends/xforms/FormPreferences.[Ch]:
304 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
305 Reorganised as modules based on tabs. Much easier to follow the
306 flow and to add new tabs. Added warning and feedback messages.
309 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
311 * src/tabular.h (DocBook): add std:: qualifier.
313 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
315 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
316 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
319 * insettabular.C (DocBook): uses the tabular methods to export
322 * src/insets/insettext.h
323 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
325 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
327 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
330 * src/lyxfunc.C (MenuNew): lessen the scope of fname
331 moved misplaced AllowInput two lines up.
333 * src/buffer.C (readFile): compare float with float, not with int
335 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
337 * src/minibuffer.C: add "using SigC::slot" statement.
339 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
341 * src/frontends/xforms/forms/README: updated section about make.
343 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
344 Tidied some forms up, made two of form_tabular's tabs more
345 self-consistent, fixed Jean-Marc's size problem in form_preferences,
346 fixed translation problem with "Column".
348 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
350 * src/minibuffer.h: use Timeout instead of the xforms timer
352 (setTimer) rewrite for the Timeout, change to unsigned arg
353 (set): change to unsigned timer arg
356 * src/minibuffer.C (TimerCB): removed func
357 (C_MiniBuffer_TimerCB): removed func
358 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
359 (peek_event): use a switch statement
360 (add): don't use fl_add_timer.
361 (Set): rewrite to use the Timeout
364 * src/Timeout.[Ch] (setType): return a Timeout &
365 (setTimeout): ditto, change to unsigned arg for timeout
367 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
369 * src/mathed/formula.C (mathed_string_width): Use string instead
370 of a constant size char array.
372 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
374 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
375 the two recently added operator<< for SMInput and State.
377 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
379 (OkCancelPolicy): ditto
380 (OkCancelReadOnlyPolicy): ditto
381 (NoRepeatedApplyReadOnlyPolicy): ditto
382 (OkApplyCancelReadOnlyPolicy): ditto
383 (OkApplyCancelPolicy): ditto
384 (NoRepeatedApplyPolicy): ditto
386 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
388 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
389 add the usual std:: qualifiers.
391 2000-10-25 Juergen Vigna <jug@sad.it>
393 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
395 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
397 * src/support/filetools.C (MakeRelPath): change some types to
400 * src/frontends/ButtonPolicies.h (operator<<): new operator for
401 ButtonPolicy::SMInput and ButtonPolicy::State.
403 * src/FontLoader.C (reset): small cleanup
404 (unload): small cleanup
406 * src/FontInfo.C (getFontname): initialize error to 10000.0
408 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
410 * src/frontends/xforms/FormPreferences.[Ch]:
411 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
412 TeX encoding and default paper size sections.
414 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
416 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
419 * src/frontends/xforms/FormError.C (disconnect): use erase() to
420 make the message_ empty.
421 (FormError): don't initialize message_ in initializer list.
423 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
425 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
427 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
429 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
431 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
433 * src/frontends/kde/*data.[Ch]: _("") is not
436 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
438 * src/buffer.C: removed redundant using directive.
440 * src/frontends/DialogBase.h: revert to original definition of
443 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
444 stuff into two classes, one for each dialog, requires a new
445 element in the dialogs vector, FormTabularCreate.
447 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
450 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
451 method. Continues Allan's idea, but means that derived classes
452 don't need to worry about "update or hide?".
454 * src/frontends/xforms/FormError.C (showInset): add connection
457 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
458 one for each dialog. FormTabular now contains main tabular dialog
461 * src/frontends/xforms/FormTabularCreate.[Ch]:
462 * src/frontends/xforms/forms/form_tabular_create.fd: the create
465 * src/frontends/xforms/FormGraphics.[Ch]:
466 * src/frontends/xforms/forms/form_graphics.fd
467 * src/frontends/xforms/FormTabular.[Ch]:
468 * src/frontends/xforms/forms/form_tabular.fd: made daughter
469 classes of FormInset.
471 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
472 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
474 * src/frontends/xforms/Makefile.am:
475 * src/frontends/xforms/forms/makefile: added new files.
477 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
478 variable. added Signal0 hide signal, in keeping with other GUI-I
481 * src/support/lstrings.h: removed redundant std:: qualifier as
482 it's already declared in Lsstream.h.
484 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
486 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
490 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
492 * src/tabular.C (Ascii): minimize scope of cell.
494 * src/BufferView2.C (nextWord): return string() instead of 0;
496 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
498 * src/converter.h: add a std:: qualifier
500 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
502 * src/importer.[Ch]: New files. Used for importing files into LyX.
504 * src/lyxfunc.C (doImport): Use the new Importer class.
506 * src/converter.h: Add shortcut member to the Format class.
507 Used for holding the menu shortcut.
509 * src/converter.C and other files: Made a distinction between
510 format name and format extension. New formats can be defined using
511 the \format lyxrc tag.
512 Added two new converter flags: latex and disable.
514 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
516 * src/support/lyxlib.h: unify namespace/struct implementation.
517 Remove extra declarations.
519 * src/support/chdir.C (chdir): remove version taking char const *
521 * src/support/rename.C: ditto.
522 * src/support/lyxsum.C: ditto.
524 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
526 * src/frontends/xforms/FormBase.[Ch]:
527 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
528 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
529 work only for the next call to fl_show_form(). The correct place to set
530 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
531 done. FormBase also stores minw_, minh_ itself. All dialogs derived
532 from FormBase have the minimum size set; no more stupid crashes with
535 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
537 * lib/ui/default.ui: fix shortcut for Insert->Include File.
539 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
541 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
543 * src/support/lyxlib.h: changed second argument of mkdir to
544 unsigned long int (unsigned int would probably have been enough,
545 but...). Removed <sys/types.h> header.
546 * src/support/mkdir.C (mkdir): ditto.
550 2000-10-19 Juergen Vigna <jug@sad.it>
552 * src/lyxfunc.C (MenuNew): small fix (form John)
554 * src/screen.C (Update): removed unneeded code.
556 * src/tabular.C (Ascii): refixed int != uint bug!
558 * src/support/lyxlib.h: added sys/types.h include for now permits
559 compiling, but I don't like this!
561 2000-10-18 Juergen Vigna <jug@sad.it>
563 * src/text2.C (ClearSelection): if we clear the selection we need
564 more refresh so set the status apropriately
566 * src/insets/insettext.C (draw): hopefully finally fixed draw
569 2000-10-12 Juergen Vigna <jug@sad.it>
571 * src/insets/insettext.C (draw): another small fix and make a block
572 so that variables are localized.
574 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
576 * src/support/lstrings.C (lowercase, uppercase):
577 use explicit casts to remove compiler warnings.
579 * src/support/LRegex.C (Impl):
580 * src/support/StrPool.C (add):
581 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
582 (AddPath, MakeDisplayPath):
583 * src/support/lstrings.C (prefixIs, subst):
584 use correct type to remove compiler warnings.
586 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
588 * src/support/lyxlib.h:
589 * src/support/mkdir.C (mkdir): change parameter to mode_t for
590 portability and to remove compiler warning with DEC cxx.
592 * src/support/FileInfo.[Ch] (flagRWX): ditto.
594 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
596 * src/minibuffer.C (peek_event): retun 1 when there has been a
597 mouseclick in the minibuffer.
601 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
603 * src/frontends/xforms/FormParagraph.C: more space above/below
606 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
608 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
609 a char only if real_current_font was changed.
611 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
613 * NEWS: update somewhat for 1.1.6
615 * lib/ui/default.ui: clean up.
617 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
619 * lib/CREDITS: clean up
621 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
623 * src/combox.[Ch] (select): changed argument back to int
624 * src/combox.C (peek_event): removed num_bytes as it is declared but
627 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
628 modified calls to Combox::select() to remove warnings about type
631 * src/insets/insetbutton.C (width): explicit cast to remove warning
632 about type conversion.
634 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
637 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
638 sel_pos_end, refering to cursor position are changed to
639 LyXParagraph::size_type.
641 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
642 consistent with LyXCursor::pos().
643 (inset_pos): changed to LyXParagraph::size_type for same reason.
645 * src/insets/insettext.C (resizeLyXText): changed some temporary
646 variables refing to cursor position to LyXParagraph::size_type.
648 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
650 * src/frontends/kde/<various>: The Great Renaming,
653 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
655 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
657 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
659 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
660 0 when there are no arguments.
662 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
664 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
665 to segfaults when pressing Ok in InsetBibtex dialog.
667 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
669 * forms/layout_forms.fd:
670 * src/layout_forms.C (create_form_form_character): small change to use
671 labelframe rather than engraved frame + text
673 * src/lyx_gui.C (create_forms): initialise choice_language with some
674 arbitrary value to prevent segfault when dialog is shown.
676 2000-10-16 Baruch Even <baruch.even@writeme.com>
678 * src/converter.C (runLaTeX, scanLog): Added a warning when there
679 is no resulting file. This pertains only to LaTeX output.
681 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
683 * src/text.C (Backspace): Make sure that the row of the cursor is
686 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
689 * src/lyx_gui.C (init): Prevent a crash when only one font from
690 menu/popup fonts is not found.
692 * lib/lyxrc.example: Add an example for binding a key for language
695 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
697 * src/converter.C (GetReachable): Changed the returned type to
699 (IsReachable): New method
701 * src/MenuBackend.C (expand): Handle formats that appear more
704 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
706 * src/frontends/support/Makefile.am
707 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
710 * lib/CREDITS: add Garst Reese.
712 * src/support/snprintf.h: add extern "C" {} around the definitions.
714 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
716 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
719 * src/frontends/xforms/FormDocument.C:
720 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
721 compile without "conversion to integral type of smaller size"
724 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
726 * src/text.C (GetColumnNearX): Fixed disabled code.
728 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
730 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
733 * src/support/snprintf.[ch]: new files
735 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
737 * src/frontends/kde/formprintdialog.C: add
738 file browser for selecting postscript output
740 * src/frontends/kde/formprintdialogdata.C:
741 * src/frontends/kde/formprintdialogdata.h: re-generate
744 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
746 * src/frontends/gnome/Makefile.am:
747 * src/frontends/kde/Makefile.am: FormCommand.C
748 disappeared from xforms
750 * src/frontends/kde/FormCitation.C:
751 * src/frontends/kde/FormIndex.C: read-only
754 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
756 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
759 * src/bufferlist.C: add using directive.
761 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
763 * src/support/lyxfunctional.h: version of class_fun for void
764 returns added, const versions of back_inseter_fun and compare_fun
767 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
769 * src/frontends/xforms/FormInset.C (showInset): fix typo.
771 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
773 * ChangeLog: cleanup.
775 * lib/CREDITS: update to add all the contributors we've forgotten.
776 I have obviously missed some, so tell me whether there were
779 2000-10-13 Marko Vendelin <markov@ioc.ee>
781 * src/frontends/gnome/FormCitation.C
782 * src/frontends/gnome/FormCitation.h
783 * src/frontends/gnome/FormError.C
784 * src/frontends/gnome/FormIndex.C
785 * src/frontends/gnome/FormRef.C
786 * src/frontends/gnome/FormRef.h
787 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
789 * src/frontends/gnome/FormCitation.C
790 * src/frontends/gnome/FormCopyright.C
791 * src/frontends/gnome/FormError.C
792 * src/frontends/gnome/FormIndex.C
793 * src/frontends/gnome/FormRef.C
794 * src/frontends/gnome/FormToc.C
795 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
798 * src/frontends/gnome/Menubar_pimpl.C
799 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
802 2000-10-11 Baruch Even <baruch.even@writeme.com>
805 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
806 to convey its real action.
808 * src/minibuffer.C (peek_event): Added action when mouse clicks to
809 clear the minibuffer and prepare to enter a command.
811 * src/mathed/formula.C (LocalDispatch): Changed to conform with
812 the rename from ExecCommand to PrepareForCommand.
813 * src/lyxfunc.C (Dispatch): ditto.
815 2000-10-11 Baruch Even <baruch.even@writeme.com>
817 * src/buffer.C (writeFile): Added test for errors on writing, this
818 catches all errors and not only file system full errors as intended.
820 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
822 * src/lyx_gui.C (create_forms): better fix for crash with
823 translated interface.
825 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
827 * src/frontends/kde/Makefile.am:
828 * src/frontends/kde/FormCopyright.C:
829 * src/frontends/kde/formcopyrightdialog.C:
830 * src/frontends/kde/formcopyrightdialog.h:
831 * src/frontends/kde/formcopyrightdialogdata.C:
832 * src/frontends/kde/formcopyrightdialogdata.h:
833 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
834 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
835 copyright to use qtarch
837 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
839 * src/encoding.C (read): Fixed bug that caused an error message at
842 * po/Makefile.in.in: Fixed rule for ext_l10n.h
844 * lib/lyxrc.example: Fixed hebrew example.
846 2000-10-13 Allan Rae <rae@lyx.org>
848 * src/frontends/xforms/FormPreferences.C (input): reworking the
850 (build, update, apply): New inputs in various tabfolders
852 * src/frontends/xforms/FormToc.C: use new button policy.
853 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
854 dialogs that either can't use any existing policy or where it just
857 * src/frontends/xforms/FormTabular.h: removed copyright notice that
860 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
861 added a bool parameter which is ignored.
863 * src/buffer.C (setReadonly):
864 * src/BufferView_pimpl.C (buffer):
865 * src/frontends/kde/FormCopyright.h (update):
866 * src/frontends/kde/FormCitation.[Ch] (update):
867 * src/frontends/kde/FormIndex.[Ch] (update):
868 * src/frontends/kde/FormPrint.[Ch] (update):
869 * src/frontends/kde/FormRef.[Ch] (update):
870 * src/frontends/kde/FormToc.[Ch] (update):
871 * src/frontends/kde/FormUrl.[Ch] (update):
872 * src/frontends/gnome/FormCopyright.h (update):
873 * src/frontends/gnome/FormCitation.[Ch] (update):
874 * src/frontends/gnome/FormError.[Ch] (update):
875 * src/frontends/gnome/FormIndex.[Ch] (update):
876 * src/frontends/gnome/FormPrint.[Ch] (update):
877 * src/frontends/gnome/FormRef.h (update):
878 * src/frontends/gnome/FormToc.[Ch] (update):
879 * src/frontends/gnome/FormUrl.[Ch] (update):
880 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
881 to updateBufferDependent and DialogBase
883 * src/frontends/xforms/FormCitation.[hC]:
884 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
885 * src/frontends/xforms/FormError.[Ch]:
886 * src/frontends/xforms/FormGraphics.[Ch]:
887 * src/frontends/xforms/FormIndex.[Ch]:
888 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
889 and fixed readOnly handling.
890 * src/frontends/xforms/FormPrint.[Ch]:
891 * src/frontends/xforms/FormRef.[Ch]:
892 * src/frontends/xforms/FormTabular.[Ch]:
893 * src/frontends/xforms/FormToc.[Ch]:
894 * src/frontends/xforms/FormUrl.[Ch]:
895 * src/frontends/xforms/FormInset.[Ch]:
896 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
897 form of updateBufferDependent.
899 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
900 if form()->visible just in case someone does stuff to the form in a
903 * src/frontends/DialogBase.h (enum): removed enum since we can now use
904 the buttoncontroller for everything the enum used to be used for.
905 (update) It would seem we need to force all dialogs to use a bool
906 parameter or have two update functions. I chose to go with one.
907 I did try removing update() from here and FormBase and defining the
908 appropriate update signatures in FormBaseB[DI] but then ran into the
909 problem of the update() call in FormBase::show(). Whatever I did
910 to get around that would require another function and that just
911 got more confusing. Hence the decision to make everyone have an
912 update(bool). An alternative might have been to override show() in
913 FormBaseB[DI] and that would allow the different and appropriate
916 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
917 true == buffer change occurred. I decided against using a default
918 template parameter since not all compilers support that at present.
920 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
922 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
923 army knife" by removing functionality.
924 (clearStore): removed. All such housekeeping on hide()ing the dialog
925 is to be carried out by overloaded disconnect() methods.
926 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
927 superceded by Baruch's neat test (FormGraphics) to update an existing
928 dialog if a new signal is recieved rather than block all new signals
930 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
931 only to Inset dialogs.
932 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
933 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
935 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
937 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
938 as a base class to all inset dialogs. Used solely to connect/disconnect
939 the Inset::hide signal and to define what action to take on receipt of
940 a UpdateBufferDependent signal.
941 (FormCommand): now derived from FormInset.
943 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
946 * src/frontends/xforms/FormCopyright.[Ch]:
947 * src/frontends/xforms/FormPreferences.[Ch]:
948 now derived from FormBaseBI.
950 * src/frontends/xforms/FormDocument.[Ch]:
951 * src/frontends/xforms/FormParagraph.[Ch]:
952 * src/frontends/xforms/FormPrint.[Ch]:
953 now derived from FormBaseBD.
955 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
957 * src/frontends/xforms/FormCitation.[Ch]:
958 * src/frontends/xforms/FormError.[Ch]:
959 * src/frontends/xforms/FormRef.[Ch]:
960 * src/frontends/xforms/FormToc.[Ch]:
961 (clearStore): reworked as disconnect().
963 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
966 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
968 * src/converter.C (runLaTeX): constify buffer argument
971 * src/frontends/support/Makefile.am (INCLUDES): fix.
973 * src/buffer.h: add std:: qualifier
974 * src/insets/figinset.C (addpidwait): ditto
975 * src/MenuBackend.C: ditto
976 * src/buffer.C: ditto
977 * src/bufferlist.C: ditto
978 * src/layout.C: ditto
979 * src/lyxfunc.C: ditto
981 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
983 * src/lyxtext.h (bidi_level): change return type to
984 LyXParagraph::size_type.
986 * src/lyxparagraph.h: change size_type to
987 TextContainer::difference_type. This should really be
988 TextContainer::size_type, but we need currently to support signed
991 2000-10-11 Marko Vendelin <markov@ioc.ee>
992 * src/frontends/gnome/FormError.h
993 * src/frontends/gnome/FormRef.C
994 * src/frontends/gnome/FormRef.h
995 * src/frontends/gnome/FormError.C
996 * src/frontends/gnome/Makefile.am
997 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
998 to Gnome frontend. Both dialogs use "action" area.
1000 2000-10-12 Baruch Even <baruch.even@writeme.com>
1002 * src/graphics/GraphicsCacheItem_pimpl.C:
1003 * src/graphics/Renderer.C:
1004 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
1007 2000-10-12 Juergen Vigna <jug@sad.it>
1009 * src/insets/insettext.C (draw): fixed drawing bug (specifically
1010 visible when selecting).
1012 * development/Code_rules/Rules: fixed some typos.
1014 2000-10-09 Baruch Even <baruch.even@writeme.com>
1016 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
1017 compiling on egcs 1.1.2 possible.
1019 * src/filedlg.C (comp_direntry::operator() ): ditto.
1021 2000-08-31 Baruch Even <baruch.even@writeme.com>
1023 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
1026 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
1027 transient it now only gets freed when the object is destructed.
1029 2000-08-24 Baruch Even <baruch.even@writeme.com>
1031 * src/frontends/FormGraphics.h:
1032 * src/frontends/FormGraphics.C: Changed to use ButtonController and
1035 2000-08-20 Baruch Even <baruch.even@writeme.com>
1037 * src/insets/insetgraphics.C:
1038 (draw): Added messages to the drawn rectangle to report status.
1039 (updateInset): Disabled the use of the inline graphics,
1042 2000-08-17 Baruch Even <baruch.even@writeme.com>
1044 * src/frontends/support: Directory added for the support of GUII LyX.
1046 * src/frontends/support/LyXImage.h:
1047 * src/frontends/support/LyXImage.C: Base class for GUII holding of
1050 * src/frontends/support/LyXImage_X.h:
1051 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
1052 version of LyXImage, this uses the Xlib Pixmap.
1054 * src/PainterBase.h:
1055 * src/PainterBase.C:
1057 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
1058 replacement to Pixmap.
1060 * src/insets/insetgraphics.h:
1061 * src/insets/insetgraphics.C:
1062 * src/graphics/GraphicsCacheItem.h:
1063 * src/graphics/GraphicsCacheItem.C:
1064 * src/graphics/GraphicsCacheItem_pimpl.h:
1065 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
1068 * src/graphics/GraphicsCacheItem.h:
1069 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
1070 another copy of the object.
1072 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
1073 of cacheHandle, this fixed a bug that sent LyX crashing.
1075 * src/graphics/XPM_Renderer.h:
1076 * src/graphics/XPM_Renderer.C:
1077 * src/graphics/EPS_Renderer.h:
1078 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
1080 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1082 * src/lyxfunc.C (processKeySym): only handle the
1083 lockinginset/inset stuff if we have a buffer and text loaded...
1085 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
1087 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1089 * src/support/lyxfunctional.h: add operator= that takes a reference
1091 * src/lyxserver.C (mkfifo): make first arg const
1093 * src/layout.h: renamed name(...) to setName(...) to work around
1096 * src/buffer.C (setFileName): had to change name of function to
1097 work around bugs in egcs. (renamed from fileName)
1099 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
1101 * src/support/translator.h: move helper template classes to
1102 lyxfunctional.h, include "support/lyxfunctional.h"
1104 * src/support/lyxmanip.h: add delaration of fmt
1106 * src/support/lyxfunctional.h: new file
1107 (class_fun_t): new template class
1108 (class_fun): helper template function
1109 (back_insert_fun_iterator): new template class
1110 (back_inserter_fun): helper template function
1111 (compare_memfun_t): new template class
1112 (compare_memfun): helper template function
1113 (equal_1st_in_pair): moved here from translator
1114 (equal_2nd_in_pair): moved here from translator
1116 * src/support/fmt.C: new file
1117 (fmt): new func, can be used for a printf substitute when still
1118 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
1120 * src/support/StrPool.C: add some comments
1122 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
1125 * src/insets/figinset.C (addpidwait): use std::copy with
1126 ostream_iterator to fill the pidwaitlist
1128 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
1130 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
1133 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
1136 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
1138 * src/frontends/xforms/FormDocument.C (build): remove c_str()
1139 (class_update): ditto
1140 (BulletPanel): ditto
1141 (CheckChoiceClass): move initialization of tc and tct
1143 * src/tabular.C: remove current_view
1144 (OldFormatRead): similar to right below [istream::ignore]
1146 * src/lyxlex_pimpl.C (next): add code for faster skipping of
1147 chars, unfortunately this is buggy on gcc 2.95.2, so currently
1148 unused [istream::ignore]
1150 * src/lyxfunc.C: include "support/lyxfunctional.h"
1151 (getInsetByCode): use std::find_if and compare_memfun
1153 * src/lyxfont.C (stateText): remove c_str()
1155 * src/lyx_main.C (setDebuggingLevel): make static
1156 (commandLineHelp): make static
1158 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
1159 Screen* together with fl_get_display() and fl_screen
1161 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
1162 togheter with fl_get_display() and fl_screen
1163 (create_forms): remove c_str()
1165 * src/layout.C: include "support/lyxfunctional.h"
1166 (hasLayout): use std::find_if and compare_memfun
1167 (GetLayout): use std::find_if and comapre_memfun
1168 (delete_layout): use std::remove_if and compare_memfun
1169 (NumberOfClass): use std:.find_if and compare_memfun
1171 * src/gettext.h: change for the new functions
1173 * src/gettext.C: new file, make _(char const * str) and _(string
1174 const & str) real functions.
1176 * src/font.C (width): rewrite slightly to avoid one extra variable
1178 * src/debug.C: initialize Debug::ANY here
1180 * src/commandtags.h: update number comments
1182 * src/combox.h (get): make const func
1184 (getline): make const
1186 * src/combox.C (input_cb): handle case where fl_get_input can
1189 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
1190 "support/lyxfunctional.h", remove current_view variable.
1191 (resize): use std::for_each with std::mem_fun
1192 (getFileNames): use std::copy with back_inserter_fun
1193 (getBuffer): change arg type to unsigned int
1194 (emergencyWriteAll): call emergencyWrite with std::for_each and
1196 (emergencyWrite): new method, the for loop in emergencyWriteAll
1198 (exists): use std::find_if with compare_memfun
1199 (getBuffer): use std::find_if and compare_memfun
1201 * src/buffer.h: add typedefs for iterator_category, value_type
1202 difference_type, pointer and reference for inset_iterator
1203 add postfix ++ for inset_iterator
1204 make inset_iterator::getPos() const
1206 * src/buffer.C: added support/lyxmanip.h
1207 (readFile): use lyxerr << fmt instead of printf
1208 (makeLaTeXFile): use std::copy to write out encodings
1210 * src/Painter.C (text): rewrite slightly to avoid extra font variable
1212 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
1213 free and the char * temp.
1214 (hasMenu): use std::find_if and compare_memfun
1217 * src/Makefile.am (lyx_SOURCES): added gettext.C
1219 * src/LyXAction.C (retrieveActionArg): clear the arg, use
1220 string::insert small change to avoid temporary
1222 * src/LColor.C (getGUIName): remove c_str()
1224 * several files: change all occurrences of fl_display to
1227 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
1228 that -pedantic is not used for gcc 2.97 (cvs gcc)
1230 * boost/Makefile.am: begin slowly to prepare for a real boost lib
1232 2000-10-11 Allan Rae <rae@lyx.org>
1234 * src/frontends/xforms/FormPreferences.C (input): template path must be
1235 a readable directory. It doesn't need to be writeable.
1236 (build, delete, update, apply): New inputs in the various tabfolders
1238 * src/frontends/xforms/forms/form_preferences.fd:
1239 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
1240 several new entries to existing folders. Shuffled some existing stuff
1243 * src/frontends/xforms/forms/form_print.fd:
1244 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
1245 Should probably rework PrinterParams as well. Note that the switch to
1246 collated is effectively the same as !unsorted so changing PrinterParams
1247 will require a lot of fiddly changes to reverse the existing logic.
1249 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
1251 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1253 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
1255 2000-10-10 Allan Rae <rae@lyx.org>
1258 * src/lyxfunc.C (Dispatch):
1260 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
1263 * src/lyxrc.C (output): Only write the differences between system lyxrc
1264 and the users settings.
1267 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
1269 I'll rewrite this later, after 1.1.6 probably, to keep a single
1270 LyXRC but two instances of a LyXRCStruct.
1272 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1274 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
1276 * src/tabular.h: add a few std:: qualifiers.
1278 * src/encoding.C: add using directive.
1279 * src/language.C: ditto.
1281 * src/insets/insetquotes.C (Validate): use languages->lang()
1282 instead of only language.
1284 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
1286 * lib/languages: New file.
1288 * lib/encodings: New file.
1290 * src/language.C (Languages): New class.
1291 (read): New method. Reads the languages from the 'languages' file.
1293 * src/encoding.C (Encodings): New class.
1294 (read): New method. Reads the encodings from the 'encodings' file.
1296 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
1299 * src/bufferparams.h and a lot of files: Deleted the member language,
1300 and renamed language_info to language
1302 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
1303 * src/lyxfont.C (latexWriteStartChanges): ditto.
1304 * src/paragraph.C (validate,TeXOnePar): ditto.
1306 * src/lyxfont.C (update): Restored deleted code.
1308 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
1310 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1312 * src/BufferView_pimpl.C (buffer): cleaned up a little.
1314 * src/insets/figinset.[Ch]:
1315 * src/insets/insetinclude.[Ch]:
1316 * src/insets/insetinclude.[Ch]:
1317 * src/insets/insetparent.[Ch]:
1318 * src/insets/insetref.[Ch]:
1319 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
1321 * src/insets/*.[Ch]:
1322 * src/mathed/formula.[Ch]:
1323 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
1325 * src/buffer.C (parseSingleLyXformat2Token, readInset):
1326 * src/lyx_cb.C (FigureApplyCB):
1327 * src/lyxfunc.C (getStatus, Dispatch):
1328 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
1331 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
1333 * src/converter.[Ch] (Formats::View):
1334 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
1336 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
1337 *current_view->buffer(). This will change later, but this patch is way
1340 2000-10-09 Juergen Vigna <jug@sad.it>
1342 * src/text.C (GetRow): small fix.
1344 * src/BufferView_pimpl.C (cursorPrevious):
1345 (cursorNext): added LyXText parameter to function.
1347 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
1348 keypress depending on cursor position.
1350 2000-10-06 Juergen Vigna <jug@sad.it>
1352 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
1353 (copySelection): redone this function and also copy ascii representa-
1356 * src/tabular.C (Ascii):
1360 (print_n_chars): new functions to realize the ascii export of tabulars.
1362 2000-10-05 Juergen Vigna <jug@sad.it>
1364 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
1365 if we don't have a buffer.
1367 2000-10-10 Allan Rae <rae@lyx.org>
1369 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
1370 with closing dialog. It seems that nested tabfolders require hiding
1371 of inner tabfolders before hiding the dialog itself. Actually all I
1372 did was hide the active outer folder.
1374 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
1375 unless there really is a buffer. hideBufferDependent is called
1378 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
1379 POTFILES.in stays in $(srcdir).
1381 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
1383 * lib/lyxrc.example: Few changes.
1385 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
1387 * src/BufferView_pimpl.C (buffer): only need one the
1388 updateBufferDependent signal to be emitted once! Moved to the end of
1389 the method to allow bv_->text to be updated first.
1391 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
1392 and hSignal_ with Dialogs * and BufferDependency variables.
1393 New Buffer * parent_, initialised when the dialog is launched. Used to
1394 check whether to update() or hide() dialog in the new, private
1395 updateOrHide() method that is connected to the updateBufferDependent
1396 signal. Daughter classes dictate what to do using the
1397 ChangedBufferAction enum, passed to the c-tor.
1399 * src/frontends/xforms/FormCitation.C:
1400 * src/frontends/xforms/FormCommand.C:
1401 * src/frontends/xforms/FormCopyright.C:
1402 * src/frontends/xforms/FormDocument.C:
1403 * src/frontends/xforms/FormError.C:
1404 * src/frontends/xforms/FormIndex.C:
1405 * src/frontends/xforms/FormPreferences.C:
1406 * src/frontends/xforms/FormPrint.C:
1407 * src/frontends/xforms/FormRef.C:
1408 * src/frontends/xforms/FormToc.C:
1409 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
1412 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
1413 ChangedBufferAction enum.
1415 * src/frontends/xforms/FormParagraph.[Ch]
1416 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
1419 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1421 * lib/bind/cua.bind: fix a bit.
1422 * lib/bind/emacs.bind: ditto.
1424 * lib/bind/menus.bind: remove real menu entries from there.
1426 * src/spellchecker.C: make sure we only include strings.h when
1429 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1431 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
1432 function. It enlarges the maximum number of pup when needed.
1433 (add_toc2): Open a new menu if maximum number of items per menu has
1436 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
1438 * src/frontends/kde/FormPrint.C: fix error reporting
1440 * src/frontends/xforms/FormDocument.C: fix compiler
1443 * lib/.cvsignore: add Literate.nw
1445 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1448 * bufferview_funcs.[Ch]
1451 * text2.C: Add support for numbers in RTL text.
1453 2000-10-06 Allan Rae <rae@lyx.org>
1455 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
1456 to be gettext.m4 friendly again. ext_l10n.h is now
1457 generated into $top_srcdir instead of $top_builddir
1458 so that lyx.pot will be built correctly -- without
1459 duplicate parsing of ext_l10n.h.
1461 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1463 * src/frontends/kde/FormCitation.C: make the dialog
1464 behave more sensibly
1466 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
1468 * config/kde.m4: fix consecutive ./configure runs,
1469 look for qtarch, fix library order
1471 * src/frontends/kde/Makefile.am: tidy up,
1472 add Print dialog, add .dlg dependencies
1474 * src/frontends/kde/FormPrint.C:
1475 * src/frontends/kde/FormPrint.h:
1476 * src/frontends/kde/formprintdialog.C:
1477 * src/frontends/kde/formprintdialog.h:
1478 * src/frontends/kde/formprintdialogdata.C:
1479 * src/frontends/kde/formprintdialogdata.h:
1480 * src/frontends/kde/dlg/formprintdialog.dlg: add
1483 * src/frontends/kde/dlg/README: Added explanatory readme
1485 * src/frontends/kde/dlg/checkinitorder.pl: small perl
1486 script to double-check qtarch's output
1488 * src/frontends/kde/formindexdialog.C:
1489 * src/frontends/kde/formindexdialogdata.C:
1490 * src/frontends/kde/formindexdialogdata.h:
1491 * src/frontends/kde/dlg/formindexdialog.dlg: update
1492 for qtarch, minor fixes
1494 2000-10-05 Allan Rae <rae@lyx.org>
1496 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
1497 dialogs when switching buffers update them instead. It's up to each
1498 dialog to decide if it should still be visible or not.
1499 update() should return a bool to control visiblity within show().
1500 Or perhaps better to set a member variable and use that to control
1503 * lib/build-listerrors: create an empty "listerrors" file just to stop
1504 make trying to regenerate it all the time if you don't have noweb
1507 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
1509 * po/Makefile.in.in (ext_l10n.h): added a rule to build
1510 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
1511 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
1512 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
1513 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
1515 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
1517 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
1519 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
1520 deleting buffer. Closes all buffer-dependent dialogs.
1522 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
1524 * src/frontends/xforms/FormCitation.[Ch]:
1525 * src/frontends/xforms/FormPreferences.[Ch]:
1526 * src/frontends/xforms/FormPrint.[Ch]:
1527 * src/frontends/xforms/FormRef.[Ch]:
1528 * src/frontends/xforms/FormUrl.[Ch]: ditto
1530 * src/frontends/xforms/FormDocument.[Ch]:
1531 * src/frontends/xforms/forms/form_document.C.patch:
1532 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
1533 pass through a single input() function.
1535 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1537 * lib/build-listerrors: return status as OK
1539 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
1541 * lib/lyxrc.example: Updated to new export code
1543 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1545 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
1548 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
1551 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
1552 LyX-Code is defined.
1553 * lib/layouts/amsbook.layout: ditto.
1555 * boost/Makefile.am: fix typo.
1557 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
1559 (add_lastfiles): removed.
1560 (add_documents): removed.
1561 (add_formats): removed.
1563 * src/frontends/Menubar.C: remove useless "using" directive.
1565 * src/MenuBackend.h: add a new MenuItem constructor.
1567 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
1570 2000-10-04 Allan Rae <rae@lyx.org>
1572 * lib/Makefile.am (listerrors):
1573 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
1574 I haven't got notangle installed so Kayvan please test. The output
1575 should end up in $builddir. This also allows people who don't have
1576 noweb installed to complete the make process without error.
1578 * src/frontends/xforms/FormCommand.[Ch] (showInset):
1579 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
1580 by JMarc's picky compiler.
1582 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1585 * src/insets/insettabular.C (setPos): change for loop to not use
1586 sequencing operator. Please check this Jürgen.
1588 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
1590 * src/insets/insetcite.C (getScreenLabel): ditto
1591 * src/support/filetools.C (QuoteName): ditto
1592 (ChangeExtension): ditto
1594 * src/BufferView_pimpl.C (scrollCB): make heigt int
1596 * src/BufferView2.C (insertInset): comment out unused arg
1598 * boost/Makefile.am (EXTRADIST): new variable
1600 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1602 * src/exporter.C (IsExportable): Fixed
1604 * lib/configure.m4: Small fix
1606 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1608 * src/insets/insetbutton.C (width): Changed to work with no GUI.
1609 * src/insets/insetbib.C (bibitemWidest): ditto.
1610 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
1612 2000-10-03 Juergen Vigna <jug@sad.it>
1614 * src/BufferView2.C (theLockingInset): removed const because of
1615 Agnus's compile problems.
1617 * src/insets/insettext.C (LocalDispatch): set the language of the
1618 surronding paragraph on inserting the first character.
1620 * various files: changed use of BufferView::the_locking_inset.
1622 * src/BufferView2.C (theLockingInset):
1623 (theLockingInset): new functions.
1625 * src/BufferView.h: removed the_locking_inset.
1627 * src/lyxtext.h: added the_locking_inset
1629 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
1631 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
1633 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1635 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
1636 * src/mathed/math_cursor.C (IsAlpha): ditto.
1637 * src/mathed/math_inset.C (strnew): ditto.
1638 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
1639 (IMetrics): cxp set but never used; removed.
1640 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
1641 that the variable in question has been removed also!
1644 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
1645 using the Buffer * passed to Latex(), using the BufferView * passed to
1646 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
1648 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
1649 Linuxdoc() and DocBook() rather than the stored Buffer * master.
1651 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
1652 * src/buffer.C (readInset): used new InsetBibtex c-tor
1653 * (getBibkeyList): used new InsetBibtex::getKeys
1655 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1658 * lib/build-listerrors
1660 * src/exporter.C: Add literate programming support to the export code
1663 * src/lyx_cb.C: Remove old literate code.
1665 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
1668 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
1669 * src/converter.C (View, Convert): Use QuoteName.
1671 * src/insets/figinset.C (Preview): Use Formats::View.
1673 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
1675 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1677 * src/lyxfunc.C (Dispatch): move declaration of text variable at
1678 the top of the function, because compaq cxx complains that the
1679 "goto exit_with_message" when the function is disabled bypasses
1681 (MenuNew): try a better fix for the generation of new file names.
1682 This time, I used AddName() instead of AddPath(), hoping Juergen
1685 2000-10-03 Allan Rae <rae@lyx.org>
1687 * src/frontends/xforms/forms/form_preferences.fd:
1688 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
1689 nested tabfolders has begun. The old "Miscellaneous" was renamed as
1690 "Look and Feel"->"General" but will need to be split up further into
1691 general output and general input tabs. Current plan is for four outer
1692 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
1693 stuff; "Inputs" for input and import configuration; "Outputs" for
1694 output and export configuration; and one more whatever is left over
1695 called "General". The leftovers at present look like being which
1696 viewers to use, spellchecker, language support and might be better
1697 named "Support". I've put "Paths" in "Inputs" for the moment as this
1698 seems reasonable for now at least.
1699 One problem remains: X error kills LyX when you close Preferences.
1701 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1703 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
1704 qualifier from form()
1705 * src/frontends/xforms/FormCitation.[Ch]:
1706 * src/frontends/xforms/FormCopyright.[Ch]:
1707 * src/frontends/xforms/FormDocument.[Ch]:
1708 * src/frontends/xforms/FormError.[Ch]:
1709 * src/frontends/xforms/FormIndex.[Ch]:
1710 * src/frontends/xforms/FormPreferences.[Ch]:
1711 * src/frontends/xforms/FormPrint.[Ch]:
1712 * src/frontends/xforms/FormRef.[Ch]:
1713 * src/frontends/xforms/FormToc.[Ch]:
1714 * src/frontends/xforms/FormUrl.[Ch]: ditto.
1716 * src/frontends/xforms/FormCitation.[Ch]:
1717 * src/frontends/xforms/FormIndex.[Ch]:
1718 * src/frontends/xforms/FormRef.[Ch]:
1719 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
1720 with Allan's naming policy
1722 * src/frontends/xforms/FormCitation.C: some static casts to remove
1725 2000-10-02 Juergen Vigna <jug@sad.it>
1727 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
1728 now you can type or do stuff inside the table-cell also when in dummy
1729 position, fixed visible cursor.
1731 * src/insets/insettext.C (Edit): fixing cursor-view position.
1733 * src/lyxfunc.C (Dispatch): use * text variable so that it can
1734 be used for equal functions in lyxfunc and insettext.
1736 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
1738 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
1740 * src/frontends/gnome/FormCitation.h:
1741 * src/frontends/gnome/FormCopyright.h:
1742 * src/frontends/gnome/FormIndex.h:
1743 * src/frontends/gnome/FormPrint.h:
1744 * src/frontends/gnome/FormToc.h:
1745 * src/frontends/gnome/FormUrl.h:
1746 * src/frontends/kde/FormCitation.h:
1747 * src/frontends/kde/FormCopyright.h:
1748 * src/frontends/kde/FormIndex.h:
1749 * src/frontends/kde/FormRef.h:
1750 * src/frontends/kde/FormToc.h:
1751 * src/frontends/kde/FormUrl.h: fix remaining users of
1754 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1756 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
1757 from depth argument.
1758 (DocBookHandleCaption): ditto.
1759 (DocBookHandleFootnote): ditto.
1760 (SimpleDocBookOnePar): ditto.
1762 * src/frontends/xforms/FormDocument.h (form): remove extra
1763 FormDocument:: qualifier.
1765 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
1767 * sigc++/handle.h: ditto.
1769 * src/lyx_gui_misc.C: add "using" directive.
1771 * src/cheaders/cstddef: new file, needed by the boost library (for
1774 2000-10-02 Juergen Vigna <jug@sad.it>
1776 * src/insets/insettext.C (SetFont): better support.
1778 * src/insets/insettabular.C (draw): fixed drawing of single cell.
1780 * src/screen.C (DrawOneRow): some uint refixes!
1782 2000-10-02 Allan Rae <rae@lyx.org>
1784 * boost/.cvsignore: ignore Makefile as well
1786 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
1787 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
1789 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
1790 Left this one out by accident.
1792 * src/frontends/xforms/FormBase.h (restore): default to calling
1793 update() since that will restore the original/currently-applied values.
1794 Any input() triggered error messages will require the derived classes
1795 to redefine restore().
1797 * src/frontends/xforms/FormDocument.C: initialize a few variables to
1798 avoid a segfault. combo_doc_class is the main concern.
1800 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
1802 * Simplify build-listerrors in view of GUI-less export ability!
1804 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1806 * src/lyx_main.C (easyParse): Disable gui when exporting
1808 * src/insets/figinset.C:
1811 * src/lyx_gui_misc.C
1812 * src/tabular.C: Changes to allow no-gui.
1814 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1816 * src/support/utility.hpp: removed file
1817 * src/support/block.h: removed file
1819 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
1822 * src/mathed/formula.C: add support/lyxlib.h
1823 * src/mathed/formulamacro.C: ditto
1825 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
1826 * src/lyxparagraph.h: ditto
1828 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
1829 * src/frontends/Makefile.am (INCLUDES): ditto
1830 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
1831 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
1832 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
1833 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
1834 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
1835 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
1837 * src/BufferView.h: use boost/utility.hpp
1838 * src/LColor.h: ditto
1839 * src/LaTeX.h: ditto
1840 * src/LyXAction.h: ditto
1841 * src/LyXView.h: ditto
1842 * src/bufferlist.h: ditto
1843 * src/lastfiles.h: ditto
1844 * src/layout.h: ditto
1845 * src/lyx_gui.h: ditto
1846 * src/lyx_main.h: ditto
1847 * src/lyxlex.h: ditto
1848 * src/lyxrc.h: ditto
1849 * src/frontends/ButtonPolicies.h: ditto
1850 * src/frontends/Dialogs.h: ditto
1851 * src/frontends/xforms/FormBase.h: ditto
1852 * src/frontends/xforms/FormGraphics.h: ditto
1853 * src/frontends/xforms/FormParagraph.h: ditto
1854 * src/frontends/xforms/FormTabular.h: ditto
1855 * src/graphics/GraphicsCache.h: ditto
1856 * src/graphics/Renderer.h: ditto
1857 * src/insets/ExternalTemplate.h: ditto
1858 * src/insets/insetcommand.h: ditto
1859 * src/support/path.h: ditto
1861 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
1862 and introduce clause for 2.97.
1864 * boost/libs/README: new file
1866 * boost/boost/utility.hpp: new file
1868 * boost/boost/config.hpp: new file
1870 * boost/boost/array.hpp: new file
1872 * boost/Makefile.am: new file
1874 * boost/.cvsignore: new file
1876 * configure.in (AC_OUTPUT): add boost/Makefile
1878 * Makefile.am (SUBDIRS): add boost
1880 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1882 * src/support/lstrings.C (suffixIs): Fixed.
1884 2000-10-01 Allan Rae <rae@lyx.org>
1886 * src/PrinterParams.h: moved things around to avoid the "can't
1887 inline call" warning.
1889 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
1890 into doc++ documentation.
1892 * src/frontends/xforms/FormCommand.[Ch]: support button policy
1894 * src/frontends/xforms/FormRef.C: make use of button controller
1895 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
1896 cleaned up button controller usage.
1897 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
1898 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
1899 use the button controller
1901 * src/frontends/xforms/forms/*.fd: and associated generated files
1902 updated to reflect changes to FormBase. Some other FormXxxx files
1903 also got minor updates to reflect changes to FormBase.
1905 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
1906 (hide): made virtual.
1907 (input): return a bool. true == valid input
1908 (RestoreCB, restore): new
1909 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
1910 Changes to allow derived dialogs to use a ButtonController and
1911 make sense when doing so: OK button calls ok() and so on.
1913 * src/frontends/xforms/ButtonController.h (class ButtonController):
1914 Switch from template implementation to taking Policy parameter.
1915 Allows FormBase to provide a ButtonController for any dialog.
1917 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
1918 Probably should rename connect and disconnect.
1919 (apply): use the radio button groups
1920 (form): needed by FormBase
1921 (build): setup the radio button groups
1923 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
1925 * several files: type changes to reduce the number of warnings and
1926 to unify type hangling a bit. Still much to do.
1928 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1930 * lib/images/*: rename a bunch of icons to match Dekel converter
1933 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
1936 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
1938 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
1940 * sigc++/handle.h: ditto for class Handle.
1942 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
1944 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
1946 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
1948 * src/intl.C (InitKeyMapper): Correct the value of n due to the
1949 removal of the "default" language.
1951 * src/combox.h (getline): Check that sel > 0
1953 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
1955 * lib/examples/docbook_example.lyx
1956 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
1958 * lib/layouts/docbook-book.layout: new docbook book layout.
1960 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
1962 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
1964 * src/insets/figinset.C (DocBook):fixed small typo.
1966 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
1968 * src/insets/insetinclude.h: string include_label doesn't need to be
1971 2000-09-29 Allan Rae <rae@lyx.org>
1973 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
1974 Allow derived type to control connection and disconnection from signals
1975 of its choice if desired.
1977 2000-09-28 Juergen Vigna <jug@sad.it>
1979 * src/insets/insettabular.C (update): fixed cursor setting when
1980 the_locking_inset changed.
1981 (draw): made this a bit cleaner.
1982 (InsetButtonPress): fixed!
1984 * various files: added LyXText Parameter to fitCursor call.
1986 * src/BufferView.C (fitCursor): added LyXText parameter.
1988 * src/insets/insettabular.C (draw): small draw fix.
1990 * src/tabular.C: right setting of left/right celllines.
1992 * src/tabular.[Ch]: fixed various types in funcions and structures.
1993 * src/insets/insettabular.C: ditto
1994 * src/frontends/xforms/FormTabular.C: ditto
1996 2000-09-28 Allan Rae <rae@lyx.org>
1998 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
1999 that the #ifdef's had been applied to part of what should have been
2000 a complete condition. It's possible there are other tests that
2001 were specific to tables that are also wrong now that InsetTabular is
2002 being used. Now we need to fix the output of '\n' after a table in a
2003 float for the same reason as the original condition:
2004 "don't insert this if we would be adding it before or after a table
2005 in a float. This little trick is needed in order to allow use of
2006 tables in \subfigures or \subtables."
2007 Juergen can you check this?
2009 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2011 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
2012 output to the ostream.
2014 * several files: fixed types based on warnings from cxx
2016 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
2018 * src/frontends/kde/Makefile.am: fix rule for
2019 formindexdialogdata_moc.C
2021 * src/.cvsignore: add ext_l10n.h to ignore
2023 * acconfig.h: stop messing with __STRICT_ANSI__
2024 * config/gnome.m4: remove option to set -ansi
2025 * config/kde.m4: remove option to set -ansi
2026 * config/lyxinclude.m4: don't set -ansi
2028 2000-09-27 Juergen Vigna <jug@sad.it>
2030 * various files: remove "default" language check.
2032 * src/insets/insetquotes.C: removed use of current_view.
2034 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
2035 the one should have red ears by now!
2037 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
2038 in more then one paragraph. Fixed cursor-movement/selection.
2040 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
2041 paragraphs inside a text inset.
2043 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
2044 text-inset if this owner is an inset.
2046 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2048 * src/Bullet.h: changed type of font, character and size to int
2050 * src/buffer.C (asciiParagraph): remove actcell and fname1.
2052 * src/insets/inseturl.[Ch]:
2053 * src/insets/insetref.[Ch]:
2054 * src/insets/insetlabel.[Ch]: add linelen to Ascii
2056 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
2058 * src/buffer.C (readFile): block-if statement rearranged to minimise
2059 bloat. Patch does not reverse Jean-Marc's change ;-)
2061 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
2062 Class rewritten to store pointers to hide/update signals directly,
2063 rather than Dialogs *. Also defined an enum to ease use. All xforms
2064 forms can now be derived from this class.
2066 * src/frontends/xforms/FormCommand.[Ch]
2067 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
2069 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
2072 * src/frontends/xforms/forms/form_citation.fd
2073 * src/frontends/xforms/forms/form_copyright.fd
2074 * src/frontends/xforms/forms/form_error.fd
2075 * src/frontends/xforms/forms/form_index.fd
2076 * src/frontends/xforms/forms/form_ref.fd
2077 * src/frontends/xforms/forms/form_toc.fd
2078 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
2080 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
2082 * src/insets/insetfoot.C: removed redundent using directive.
2084 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2086 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
2087 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
2089 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
2090 created in the constructors in different groups. Then set() just
2091 have to show the groups as needed. This fixes the redraw problems
2092 (and is how the old menu code worked).
2094 * src/support/lyxlib.h: declare the methods as static when we do
2095 not have namespaces.
2097 2000-09-26 Juergen Vigna <jug@sad.it>
2099 * src/buffer.C (asciiParagraph): new function.
2100 (writeFileAscii): new function with parameter ostream.
2101 (writeFileAscii): use now asciiParagraph.
2103 * various inset files: added the linelen parameter to the Ascii-func.
2105 * src/tabular.C (Write): fixed error in writing file introduced by
2106 the last changes from Lars.
2108 * lib/bind/menus.bind: removed not supported functions.
2110 * src/insets/insettext.C (Ascii): implemented this function.
2112 * src/insets/lyxinset.h (Ascii): added linelen parameter.
2114 * src/tabular.C (write_attribute[int,string,bool]): new functions.
2115 (Write): use of the write_attribute functions.
2117 * src/bufferlist.C (close): fixed reasking question!
2119 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2121 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
2122 new files use the everwhere possible.
2125 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
2126 src/log_form.C src/lyx.C:
2129 * src/buffer.C (runLaTeX): remove func
2131 * src/PaperLayout.C: removed file
2132 * src/ParagraphExtra.C: likewise
2133 * src/bullet_forms.C: likewise
2134 * src/bullet_forms.h: likewise
2135 * src/bullet_forms_cb.C: likewise
2137 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
2138 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
2141 * several files: remove all traces of the old fd_form_paragraph,
2142 and functions belonging to that.
2144 * several files: remove all traces of the old fd_form_document,
2145 and functions belonging to that.
2147 * several files: constify local variables were possible.
2149 * several files: remove all code that was dead when NEW_EXPORT was
2152 * several files: removed string::c_str in as many places as
2155 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
2156 (e): be a bit more outspoken when patching
2157 (updatesrc): only move files if changed.
2159 * forms/layout_forms.h.patch: regenerated
2161 * forms/layout_forms.fd: remove form_document and form_paragraph
2162 and form_quotes and form_paper and form_table_options and
2163 form_paragraph_extra
2165 * forms/form1.fd: remove form_table
2167 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
2168 the fdui->... rewrite. Update some comments to xforms 0.88
2170 * forms/bullet_forms.C.patch: removed file
2171 * forms/bullet_forms.fd: likewise
2172 * forms/bullet_forms.h.patch: likewise
2174 * development/Code_rules/Rules: added a section on switch
2175 statements. Updated some comment to xforms 0.88.
2177 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2179 * src/buffer.C (readFile): make sure that the whole version number
2180 is read after \lyxformat (even when it contains a comma)
2182 * lib/ui/default.ui: change shortcut of math menu to M-a.
2184 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2186 * src/vspace.C (nextToken): use isStrDbl() to check for proper
2189 * src/LyXView.C (updateWindowTitle): show the full files name in
2190 window title, limited to 30 characters.
2192 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
2193 When a number of characters has been given, we should not assume
2194 that the string is 0-terminated.
2196 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
2197 calls (fixes some memory leaks)
2199 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
2200 trans member on exit.
2202 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2204 * src/converter.C (GetReachable): fix typo.
2206 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
2207 understand ',' instead of '.'.
2208 (GetInteger): rewrite to use strToInt().
2210 2000-09-26 Juergen Vigna <jug@sad.it>
2212 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
2213 better visibility and error-message on wrong VSpace input.
2215 * src/language.C (initL): added english again.
2217 2000-09-25 Juergen Vigna <jug@sad.it>
2219 * src/frontends/kde/Dialogs.C (Dialogs):
2220 * src/frontends/gnome/Dialogs.C (Dialogs):
2221 * src/frontends/kde/Makefile.am:
2222 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
2224 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
2226 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
2228 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
2230 * src/frontends/xforms/FormParagraph.C:
2231 * src/frontends/xforms/FormParagraph.h:
2232 * src/frontends/xforms/form_paragraph.C:
2233 * src/frontends/xforms/form_paragraph.h:
2234 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
2237 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
2239 * src/tabular.C (OldFormatRead): forgot to delete the temporary
2240 Paragraph-Data after use.
2242 * src/insets/insettext.C (LocalDispatch): don't set the layout on
2243 non breakable paragraphs.
2245 2000-09-25 Garst R. Reese <reese@isn.net>
2247 * src/language.C (initL): added missing language_country codes.
2249 2000-09-25 Juergen Vigna <jug@sad.it>
2251 * src/insets/insettext.C (InsetText):
2252 (deleteLyXText): remove the not released LyXText structure!
2254 2000-09-24 Marko Vendelin <markov@ioc.ee>
2256 * src/frontends/gnome/mainapp.C
2257 * src/frontends/gnome/mainapp.h: added support for keyboard
2260 * src/frontends/gnome/FormCitation.C
2261 * src/frontends/gnome/FormCitation.h
2262 * src/frontends/gnome/Makefile.am
2263 * src/frontends/gnome/pixbutton.h: completed the rewrite of
2264 FormCitation to use "action area" in mainapp window
2266 * src/frontends/gnome/Menubar_pimpl.C
2267 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
2270 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
2272 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
2273 width/descent/ascent values if name is empty.
2274 (mathed_string_height): Use std::max.
2276 2000-09-25 Allan Rae <rae@lyx.org>
2278 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
2279 segfault. This will be completely redesigned soon.
2281 * sigc++: updated libsigc++. Fixes struct timespec bug.
2283 * development/tools/makeLyXsigc.sh: .cvsignore addition
2285 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
2287 * several files: removed almost all traces of the old table
2290 * src/TableLayout.C: removed file
2292 2000-09-22 Juergen Vigna <jug@sad.it>
2294 * src/frontends/kde/Dialogs.C: added credits forms.
2296 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
2298 * src/frontends/gnome/Dialogs.C: added some forms.
2300 * src/spellchecker.C (init_spell_checker): set language in pspell code
2301 (RunSpellChecker): some modifications for setting language string.
2303 * src/language.[Ch]: added language_country code.
2305 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
2307 * src/frontends/Dialogs.h: added new signal showError.
2308 Rearranged existing signals in some sort of alphabetical order.
2310 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
2311 FormError.[Ch], form_error.[Ch]
2312 * src/frontends/xforms/forms/makefile: added new file form_error.fd
2313 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
2315 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
2316 dialogs. I think that this can be used as the base to all these
2319 * src/frontends/xforms/FormError.[Ch]
2320 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
2321 implementation of InsetError dialog.
2323 * src/insets/inseterror.[Ch]: rendered GUI-independent.
2325 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
2326 * src/frontends/kde/Makefile.am: ditto
2328 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
2330 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
2331 macrobf. This fixes a bug of invisible text.
2333 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2335 * lib/doc/LaTeXConfig.lyx.in: updated.
2337 * src/language.C (initL): remove language "francais" and change a
2338 bit the names of the two other french variations.
2340 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
2341 string that may not be 0-terminated.
2343 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2345 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
2347 2000-09-20 Marko Vendelin <markov@ioc.ee>
2349 * src/frontends/gnome/FormCitation.C
2350 * src/frontends/gnome/FormIndex.C
2351 * src/frontends/gnome/FormToc.C
2352 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
2353 the variable initialization to shut up the warnings
2355 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2357 * src/table.[Ch]: deleted files
2359 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
2362 2000-09-18 Juergen Vigna <jug@sad.it>
2364 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
2365 problems with selection. Inserted new LFUN_PASTESELECTION.
2366 (InsetButtonPress): inserted handling of middle mouse-button paste.
2368 * src/spellchecker.C: changed word to word.c_str().
2370 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
2372 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
2373 included in the ``make dist'' tarball.
2375 2000-09-15 Juergen Vigna <jug@sad.it>
2377 * src/CutAndPaste.C (cutSelection): small fix return the right
2378 end position after cut inside one paragraph only.
2380 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
2381 we are locked as otherwise we don't have a valid cursor position!
2383 * src/insets/figinset.C (draw): small bugfix but why is this needed???
2385 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
2387 * src/frontends/kde/FormRef.C: added using directive.
2388 * src/frontends/kde/FormToc.C: ditto
2390 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
2392 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
2394 2000-09-19 Marko Vendelin <markov@ioc.ee>
2396 * src/frontends/gnome/Menubar_pimpl.C
2397 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
2398 Toc, ViewFormats, UpdateFormats, and ExportFormats.
2400 * src/frontends/gnome/mainapp.C
2401 * src/frontends/gnome/mainapp.h: support for menu update used
2404 * src/frontends/gnome/mainapp.C
2405 * src/frontends/gnome/mainapp.h: support for "action" area in the
2406 main window. This area is used by small simple dialogs, such as
2409 * src/frontends/gnome/FormIndex.C
2410 * src/frontends/gnome/FormIndex.h
2411 * src/frontends/gnome/FormUrl.C
2412 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
2415 * src/frontends/gnome/FormCitation.C
2416 * src/frontends/gnome/FormCitation.h: rewrite to use main window
2417 action area. Only "Insert new citation" is implemented.
2419 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2421 * src/buffer.C (Dispatch): fix call to Dispatch
2422 * src/insets/insetref.C (Edit): likewise
2423 * src/insets/insetparent.C (Edit): likewise
2424 * src/insets/insetinclude.C (include_cb): likewise
2425 * src/frontends/xforms/FormUrl.C (apply): likewise
2426 * src/frontends/xforms/FormToc.C (apply): likewise
2427 * src/frontends/xforms/FormRef.C (apply): likewise
2428 * src/frontends/xforms/FormIndex.C (apply): likewise
2429 * src/frontends/xforms/FormCitation.C (apply): likewise
2430 * src/lyxserver.C (callback): likewise
2431 * src/lyxfunc.C (processKeySym): likewise
2432 (Dispatch): likewise
2433 (Dispatch): likewise
2434 * src/lyx_cb.C (LayoutsCB): likewise
2436 * Makefile.am (sourcedoc): small change
2438 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2440 * src/main.C (main): Don't make an empty GUIRunTime object. all
2441 methods are static. constify a bit remove unneded using + headers.
2443 * src/tabular.C: some more const to local vars move some loop vars
2445 * src/spellchecker.C: added some c_str after some word for pspell
2447 * src/frontends/GUIRunTime.h: add new static method setDefaults
2448 * src/frontends/xforms/GUIRunTime.C (setDefaults):
2449 * src/frontends/kde/GUIRunTime.C (setDefaults):
2450 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
2452 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
2453 with strnew in arg, use correct emptystring when calling SetName.
2455 * several files: remove all commented code with relation to
2456 HAVE_SSTREAM beeing false. We now only support stringstream and
2459 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2461 * src/lyxfunc.C: construct correctly the automatic new file
2464 * src/text2.C (IsStringInText): change type of variable i to shut
2467 * src/support/sstream.h: do not use namespaces if the compiler
2468 does not support them.
2470 2000-09-15 Marko Vendelin <markov@ioc.ee>
2471 * src/frontends/gnome/FormCitation.C
2472 * src/frontends/gnome/FormCitation.h
2473 * src/frontends/gnome/diainsertcitation_interface.c
2474 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
2475 regexp support to FormCitation [Gnome].
2477 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
2480 * configure.in: remove unused KDE/GTKGUI define
2482 * src/frontends/kde/FormRef.C
2483 * src/frontends/kde/FormRef.h
2484 * src/frontends/kde/formrefdialog.C
2485 * src/frontends/kde/formrefdialog.h: double click will
2486 go to reference, now it is possible to change a cross-ref
2489 * src/frontends/kde/FormToc.C
2490 * src/frontends/kde/FormToc.h
2491 * src/frontends/kde/formtocdialog.C
2492 * src/frontends/kde/formtocdialog.h: add a depth
2495 * src/frontends/kde/Makefile.am: add QtLyXView.h
2498 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
2500 * src/frontends/kde/FormCitation.h: added some using directives.
2502 * src/frontends/kde/FormToc.h: corrected definition of doTree.
2504 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
2507 * src/mathed/math_defs.h: redefine SetAlign to use string rather
2510 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2512 * src/buffer.C (pop_tag): revert for the second time a change by
2513 Lars, who seems to really hate having non-local loop variables :)
2515 * src/Lsstream.h: add "using" statements.
2517 * src/support/copy.C (copy): add a bunch of std:: qualifiers
2518 * src/buffer.C (writeFile): ditto
2520 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2522 * src/buffer.C (writeFile): try to fix the locale modified format
2523 number to always be as we want it.
2525 * src/WorkArea.C (work_area_handler): try to workaround the bugs
2526 in XForms 0.89. C-space is now working again.
2528 * src/Lsstream.h src/support/sstream.h: new files.
2530 * also commented out all cases where strstream were used.
2532 * src/Bullet.h (c_str): remove method.
2534 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
2536 * a lot of files: get rid of "char const *" and "char *" is as
2537 many places as possible. We only want to use them in interaction
2538 with system of other libraries, not inside lyx.
2540 * a lot of files: return const object is not of pod type. This
2541 helps ensure that temporary objects is not modified. And fits well
2542 with "programming by contract".
2544 * configure.in: check for the locale header too
2546 * Makefile.am (sourcedoc): new tag for generation of doc++
2549 2000-09-14 Juergen Vigna <jug@sad.it>
2551 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
2552 callback to check which combo called it and do the right action.
2554 * src/combox.C (combo_cb): added combo * to the callbacks.
2555 (Hide): moved call of callback after Ungrab of the pointer.
2557 * src/intl.h: removed LCombo2 function.
2559 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
2560 function as this can now be handled in one function.
2562 * src/combox.h: added Combox * to callback prototype.
2564 * src/frontends/xforms/Toolbar_pimpl.C:
2565 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
2567 2000-09-14 Garst Reese <reese@isn.net>
2569 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
2570 moved usepackage{xxx}'s to beginning of file. Changed left margin
2571 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
2572 underlining from title. Thanks to John Culleton for useful suggestions.
2574 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2576 * src/lyxlex_pimpl.C (setFile): change error message to debug
2579 2000-09-13 Juergen Vigna <jug@sad.it>
2581 * src/frontends/xforms/FormDocument.C: implemented choice_class
2582 as combox and give callback to combo_language so OK/Apply is activated
2585 * src/bufferlist.C (newFile): small fix so already named files
2586 (via an open call) are not requested to be named again on the
2589 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2591 * src/frontends/kde/Makefile.am
2592 * src/frontends/kde/FormRef.C
2593 * src/frontends/kde/FormRef.h
2594 * src/frontends/kde/formrefdialog.C
2595 * src/frontends/kde/formrefdialog.h: implement
2598 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2600 * src/frontends/kde/formtocdialog.C
2601 * src/frontends/kde/formtocdialog.h
2602 * src/frontends/kde/FormToc.C
2603 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
2605 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
2607 * src/frontends/kde/FormCitation.C: fix thinko
2608 where we didn't always display the reference text
2611 * src/frontends/kde/formurldialog.C
2612 * src/frontends/kde/formurldialog.h
2613 * src/frontends/kde/FormUrl.C
2614 * src/frontends/kde/FormUrl.h: minor cleanups
2616 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
2618 * src/frontends/kde/Makefile.am
2619 * src/frontends/kde/FormToc.C
2620 * src/frontends/kde/FormToc.h
2621 * src/frontends/kde/FormCitation.C
2622 * src/frontends/kde/FormCitation.h
2623 * src/frontends/kde/FormIndex.C
2624 * src/frontends/kde/FormIndex.h
2625 * src/frontends/kde/formtocdialog.C
2626 * src/frontends/kde/formtocdialog.h
2627 * src/frontends/kde/formcitationdialog.C
2628 * src/frontends/kde/formcitationdialog.h
2629 * src/frontends/kde/formindexdialog.C
2630 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
2632 2000-09-12 Juergen Vigna <jug@sad.it>
2634 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
2637 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2639 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
2642 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
2644 * src/converter.C (Add, Convert): Added support for converter flags:
2645 needaux, resultdir, resultfile.
2646 (Convert): Added new parameter view_file.
2647 (dvips_options): Fixed letter paper option.
2649 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
2650 (Export, GetExportableFormats, GetViewableFormats): Added support
2653 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
2655 (easyParse): Fixed to work with new export code.
2657 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
2660 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
2662 * lib/bind/*.bind: Replaced
2663 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
2664 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
2666 2000-09-11 Juergen Vigna <jug@sad.it>
2668 * src/lyx_gui.C (runTime): uses global guiruntime variable.
2670 * src/main.C (main): now GUII defines global guiruntime!
2672 * src/frontends/gnome/GUIRunTime.C (initApplication):
2673 * src/frontends/kde/GUIRunTime.C (initApplication):
2674 * src/frontends/xforms/GUIRunTime.C (initApplication):
2675 * src/frontends/GUIRunTime.h: added new function initApplication.
2677 * src/spellchecker.C (sc_accept_word): change to add_to_session.
2679 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
2681 2000-09-08 Juergen Vigna <jug@sad.it>
2683 * src/lyx_gui.C (create_forms): don't display the "default" entry as
2684 we have already "Reset".
2686 * src/language.C (initL): inserted "default" language and made this
2687 THE default language (and not american!)
2689 * src/paragraph.C: inserted handling of "default" language!
2691 * src/lyxfont.C: ditto
2695 * src/paragraph.C: output the \\par only if we have a following
2696 paragraph otherwise it's not needed.
2698 2000-09-05 Juergen Vigna <jug@sad.it>
2700 * config/pspell.m4: added entry to lyx-flags
2702 * src/spellchecker.C: modified version from Kevin for using pspell
2704 2000-09-01 Marko Vendelin <markov@ioc.ee>
2705 * src/frontends/gnome/Makefile.am
2706 * src/frontends/gnome/FormCitation.C
2707 * src/frontends/gnome/FormCitation.h
2708 * src/frontends/gnome/diainsertcitation_callbacks.c
2709 * src/frontends/gnome/diainsertcitation_callbacks.h
2710 * src/frontends/gnome/diainsertcitation_interface.c
2711 * src/frontends/gnome/diainsertcitation_interface.h
2712 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
2713 dialog for Gnome frontend
2715 * src/main.C: Gnome libraries require keeping application name
2716 and its version as strings
2718 * src/frontends/gnome/mainapp.C: Change the name of the main window
2719 from GnomeLyX to PACKAGE
2721 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2723 * src/frontends/Liason.C: add "using: declaration.
2725 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
2727 * src/mathed/math_macro.C (Metrics): Set the size of the template
2729 * src/mathed/formulamacro.C (Latex): Fixed the returned value
2731 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
2733 * src/converter.C (add_options): New function.
2734 (SetViewer): Change $$FName into '$$FName'.
2735 (View): Add options when running xdvi
2736 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
2737 (Convert): The 3rd parameter is now the desired filename. Converts
2738 calls to lyx::rename if necessary.
2739 Add options when running dvips.
2740 (dvi_papersize,dvips_options): New methods.
2742 * src/exporter.C (Export): Use getLatexName() instead of fileName().
2744 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
2745 using a call to Converter::dvips_options.
2746 Fixed to work with nex export code.
2748 * src/support/copy.C
2749 * src/support/rename.C: New files
2751 * src/support/syscall.h
2752 * src/support/syscall.C: Added Starttype SystemDontWait.
2754 * lib/ui/default.ui: Changed to work with new export code
2756 * lib/configure.m4: Changed to work with new export code
2758 * src/encoding.C: Changed latex name for iso8859_7 encoding.
2760 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
2762 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
2763 so that code compiles with DEC cxx.
2765 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
2766 to work correctly! Also now supports the additional elements
2769 2000-09-01 Allan Rae <rae@lyx.org>
2771 * src/frontends/ButtonPolicies.C: renamed all the references to
2772 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
2774 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
2775 since it's a const not a type.
2777 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
2779 2000-08-31 Juergen Vigna <jug@sad.it>
2781 * src/insets/figinset.C: Various changes to look if the filename has
2782 an extension and if not add it for inline previewing.
2784 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2786 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
2787 make buttonStatus and isReadOnly be const methods. (also reflect
2788 this in derived classes.)
2790 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
2791 (nextState): change to be static inline, pass the StateMachine as
2793 (PreferencesPolicy): remove casts
2794 (OkCancelPolicy): remvoe casts
2795 (OkCancelReadOnlyPolicy): remove casts
2796 (NoRepeatedApplyReadOnlyPolicy): remove casts
2797 (OkApplyCancelReadOnlyPolicy): remove casts
2798 (OkApplyCancelPolicy): remove casts
2799 (NoRepeatedApplyPolicy): remove casts
2801 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
2803 * src/converter.C: added some using directives
2805 * src/frontends/ButtonPolicies.C: changes to overcome
2806 "need lvalue" error with DEC c++
2808 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
2809 to WMHideCB for DEC c++
2811 * src/frontends/xforms/Menubar_pimpl.C: added using directive
2813 * src/frontends/xforms/forms/form_document.C.patch: use C callback
2814 to BulletBMTableCB for DEC c++
2816 2000-08-31 Allan Rae <rae@lyx.org>
2818 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
2819 character dialog separately from old document dialogs combo_language.
2822 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2824 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
2825 Removed LFUN_REF_CREATE.
2827 * src/MenuBackend.C: Added new tags: toc and references
2829 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
2830 (add_lastfiles, add_documents, add_formats): Removed the unused smn
2832 (add_toc, add_references): New methods.
2833 (create_submenu): Handle correctly the case when there is a
2834 seperator after optional menu items.
2836 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
2837 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
2838 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
2840 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
2842 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2844 * src/converter.[Ch]: New file for converting between different
2847 * src/export.[Ch]: New file for exporting a LyX file to different
2850 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
2851 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
2852 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
2853 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
2854 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
2855 RunDocBook, MenuExport.
2857 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
2858 Exporter::Preview methods if NEW_EXPORT is defined.
2860 * src/buffer.C (Dispatch): Use Exporter::Export.
2862 * src/lyxrc.C: Added new tags: \converter and \viewer.
2865 * src/LyXAction.C: Define new lyx-function: buffer-update.
2866 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
2867 when NEW_EXPORT is defined.
2869 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
2871 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
2873 * lib/ui/default.ui: Added submenus "view" and "update" to the
2876 * src/filetools.C (GetExtension): New function.
2878 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
2880 2000-08-29 Allan Rae <rae@lyx.org>
2882 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
2884 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
2885 (EnableDocumentLayout): removed
2886 (DisableDocumentLayout): removed
2887 (build): make use of ButtonController's read-only handling to
2888 de/activate various objects. Replaces both of the above functions.
2890 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
2891 (readOnly): was read_only
2892 (refresh): fixed dumb mistakes with read_only_ handling
2894 * src/frontends/xforms/forms/form_document.fd:
2895 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
2896 tabbed dialogs so the tabs look more like tabs and so its easier to
2897 work out which is the current tab.
2899 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
2900 segfault with form_table
2902 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
2904 2000-08-28 Juergen Vigna <jug@sad.it>
2906 * acconfig.h: added USE_PSPELL.
2908 * src/config.h.in: added USE_PSPELL.
2910 * autogen.sh: added pspell.m4
2912 * config/pspell.m4: new file.
2914 * src/spellchecker.C: implemented support for pspell libary.
2916 2000-08-25 Juergen Vigna <jug@sad.it>
2918 * src/LyXAction.C (init): renamed LFUN_TABLE to
2919 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
2921 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
2923 * src/lyxscreen.h: add force_clear variable and fuction to force
2924 a clear area when redrawing in LyXText.
2926 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
2928 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2930 * some whitespace and comment changes.
2932 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
2934 * src/buffer.C: up te LYX_FORMAT to 2.17
2936 2000-08-23 Juergen Vigna <jug@sad.it>
2938 * src/BufferView_pimpl.C (tripleClick): disable this when in a
2941 * src/insets/insettabular.C (pasteSelection): delete the insets
2942 LyXText as it is not valid anymore.
2943 (copySelection): new function.
2944 (pasteSelection): new function.
2945 (cutSelection): new function.
2946 (LocalDispatch): implemented cut/copy/paste of cell selections.
2948 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
2949 don't have a LyXText.
2951 * src/LyXAction.C (init): a NEW_TABULAR define too much.
2953 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
2956 2000-08-22 Juergen Vigna <jug@sad.it>
2958 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
2959 ifdef form_table out if NEW_TABULAR.
2961 2000-08-21 Juergen Vigna <jug@sad.it>
2963 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
2964 (draw): fixed draw position so that the cursor is positioned in the
2966 (InsetMotionNotify): hide/show cursor so the position is updated.
2967 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
2968 using cellstart() function where it should be used.
2970 * src/insets/insettext.C (draw): ditto.
2972 * src/tabular.C: fixed initialization of some missing variables and
2973 made BoxType into an enum.
2975 2000-08-22 Marko Vendelin <markov@ioc.ee>
2976 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
2977 stock menu item using action numerical value, not its string
2981 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
2983 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
2984 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
2986 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
2988 * src/frontends/xforms/GUIRunTime.C: new file
2990 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
2991 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2993 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
2995 * src/frontends/kde/GUIRunTime.C: new file
2997 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
2998 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3000 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
3002 * src/frontends/gnome/GUIRunTime.C: new file
3004 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
3007 * src/frontends/GUIRunTime.h: removed constructor and destructor,
3008 small change to documetentation.
3010 * src/frontends/GUIRunTime.C: removed file
3012 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
3014 * src/lyxparagraph.h: enable NEW_TABULAR as default
3016 * src/lyxfunc.C (processKeySym): remove some commented code
3018 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
3019 NEW_TABULAR around the fd_form_table_options.
3021 * src/lyx_gui.C (runTime): call the static member function as
3022 GUIRunTime::runTime().
3024 2000-08-21 Allan Rae <rae@lyx.org>
3026 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
3029 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
3031 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
3033 2000-08-21 Allan Rae <rae@lyx.org>
3035 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
3036 keep Garst happy ;-)
3037 * src/frontends/xforms/FormPreferences.C (build): use setOK
3038 * src/frontends/xforms/FormDocument.C (build): use setOK
3039 (FormDocument): use the appropriate policy.
3041 2000-08-21 Allan Rae <rae@lyx.org>
3043 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
3044 automatic [de]activation of arbitrary objects when in a read-only state.
3046 * src/frontends/ButtonPolicies.h: More documentation
3047 (isReadOnly): added to support the above.
3049 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
3051 2000-08-18 Juergen Vigna <jug@sad.it>
3053 * src/insets/insettabular.C (getStatus): changed to return func_status.
3055 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
3056 display toggle menu entries if they are.
3058 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
3059 new document layout now.
3061 * src/lyxfunc.C: ditto
3063 * src/lyx_gui_misc.C: ditto
3065 * src/lyx_gui.C: ditto
3067 * lib/ui/default.ui: removed paper and quotes layout as they are now
3068 all in the document layout tabbed folder.
3070 * src/frontends/xforms/forms/form_document.fd: added Restore
3071 button and callbacks for all inputs for Allan's ButtonPolicy.
3073 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
3074 (CheckChoiceClass): added missing params setting on class change.
3075 (UpdateLayoutDocument): added for updating the layout on params.
3076 (build): forgot to RETURN_ALWAYS input_doc_spacing.
3077 (FormDocument): Implemented Allan's ButtonPolicy with the
3080 2000-08-17 Allan Rae <rae@lyx.org>
3082 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
3083 so we can at least see the credits again.
3085 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
3086 controller calls for the appropriate callbacks. Note that since Ok
3087 calls apply followed by cancel, and apply isn't a valid input for the
3088 APPLIED state, the bc_ calls have to be made in the static callback not
3089 within each of the real callbacks.
3091 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
3092 (setOk): renamed from setOkay()
3094 2000-08-17 Juergen Vigna <jug@sad.it>
3096 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
3097 in the implementation part.
3098 (composeUIInfo): don't show optional menu-items.
3100 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
3102 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
3104 * src/bufferview_funcs.C (CurrentState): fixed to show also the
3105 text-state when in a text-inset.
3107 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
3109 2000-08-17 Marko Vendelin <markov@ioc.ee>
3110 * src/frontends/gnome/FormIndex.C
3111 * src/frontends/gnome/FormIndex.h
3112 * src/frontends/gnome/FormToc.C
3113 * src/frontends/gnome/FormToc.h
3114 * src/frontends/gnome/dialogs
3115 * src/frontends/gnome/diatoc_callbacks.c
3116 * src/frontends/gnome/diatoc_callbacks.h
3117 * src/frontends/gnome/diainsertindex_callbacks.h
3118 * src/frontends/gnome/diainsertindex_callbacks.c
3119 * src/frontends/gnome/diainsertindex_interface.c
3120 * src/frontends/gnome/diainsertindex_interface.h
3121 * src/frontends/gnome/diatoc_interface.h
3122 * src/frontends/gnome/diatoc_interface.c
3123 * src/frontends/gnome/Makefile.am: Table of Contents and
3124 Insert Index dialogs implementation for Gnome frontend
3126 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
3128 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
3130 * src/frontends/gnome/diainserturl_interface.c: make the dialog
3133 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3135 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
3136 destructor. Don't definde if you don't need it
3137 (processEvents): made static, non-blocking events processing for
3139 (runTime): static method. event loop for xforms
3140 * similar as above for kde and gnome.
3142 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
3143 new Pimpl is correct
3144 (runTime): new method calss the real frontends runtime func.
3146 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
3148 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3150 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
3152 2000-08-16 Juergen Vigna <jug@sad.it>
3154 * src/lyx_gui.C (runTime): added GUII RunTime support.
3156 * src/frontends/Makefile.am:
3157 * src/frontends/GUIRunTime.[Ch]:
3158 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
3159 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
3160 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
3162 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
3164 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
3165 as this is already set in ${FRONTEND_INCLUDE} if needed.
3167 * configure.in (CPPFLAGS): setting the include dir for the frontend
3168 directory and don't set FRONTEND=xforms for now as this is executed
3171 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
3173 * src/frontends/kde/Makefile.am:
3174 * src/frontends/kde/FormUrl.C:
3175 * src/frontends/kde/FormUrl.h:
3176 * src/frontends/kde/formurldialog.h:
3177 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
3179 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
3181 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
3183 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3185 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
3188 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
3190 * src/WorkArea.C (work_area_handler): more work to get te
3191 FL_KEYBOARD to work with xforms 0.88 too, please test.
3193 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
3195 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
3197 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
3200 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3202 * src/Timeout.h: remove Qt::emit hack.
3204 * several files: changes to allo doc++ compilation
3206 * src/lyxfunc.C (processKeySym): new method
3207 (processKeyEvent): comment out if FL_REVISION < 89
3209 * src/WorkArea.C: change some debugging levels.
3210 (WorkArea): set wantkey to FL_KEY_ALL
3211 (work_area_handler): enable the FL_KEYBOARD clause, this enables
3212 clearer code and the use of compose with XForms 0.89. Change to
3213 use signals instead of calling methods in bufferview directly.
3215 * src/Painter.C: change some debugging levels.
3217 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
3220 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
3221 (workAreaKeyPress): new method
3223 2000-08-14 Juergen Vigna <jug@sad.it>
3225 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
3227 * config/kde.m4: addes some features
3229 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
3230 include missing xforms dialogs.
3232 * src/Timeout.h: a hack to be able to compile with qt/kde.
3234 * sigc++/.cvsignore: added acinclude.m4
3236 * lib/.cvsignore: added listerros
3238 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
3239 xforms tree as objects are needed for other frontends.
3241 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
3242 linking with not yet implemented xforms objects.
3244 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
3246 2000-08-14 Baruch Even <baruch.even@writeme.com>
3248 * src/frontends/xforms/FormGraphics.h:
3249 * src/frontends/xforms/FormGraphics.C:
3250 * src/frontends/xforms/RadioButtonGroup.h:
3251 * src/frontends/xforms/RadioButtonGroup.C:
3252 * src/insets/insetgraphics.h:
3253 * src/insets/insetgraphics.C:
3254 * src/insets/insetgraphicsParams.h:
3255 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
3256 instead of spaces, and various other indentation issues to make the
3257 sources more consistent.
3259 2000-08-14 Marko Vendelin <markov@ioc.ee>
3261 * src/frontends/gnome/dialogs/diaprint.glade
3262 * src/frontends/gnome/FormPrint.C
3263 * src/frontends/gnome/FormPrint.h
3264 * src/frontends/gnome/diaprint_callbacks.c
3265 * src/frontends/gnome/diaprint_callbacks.h
3266 * src/frontends/gnome/diaprint_interface.c
3267 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
3270 * src/frontends/gnome/dialogs/diainserturl.glade
3271 * src/frontends/gnome/FormUrl.C
3272 * src/frontends/gnome/FormUrl.h
3273 * src/frontends/gnome/diainserturl_callbacks.c
3274 * src/frontends/gnome/diainserturl_callbacks.h
3275 * src/frontends/gnome/diainserturl_interface.c
3276 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
3277 Gnome implementation
3279 * src/frontends/gnome/Dialogs.C
3280 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
3281 all other dialogs. Copy all unimplemented dialogs from Xforms
3284 * src/frontends/gnome/support.c
3285 * src/frontends/gnome/support.h: support files generated by Glade
3289 * config/gnome.m4: Gnome configuration scripts
3291 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
3292 configure --help message
3294 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
3295 only if there are no events pendling in Gnome/Gtk. This enhances
3296 the performance of menus.
3299 2000-08-14 Allan Rae <rae@lyx.org>
3301 * lib/Makefile.am: listerrors cleaning
3303 * lib/listerrors: removed -- generated file
3304 * acinclude.m4: ditto
3305 * sigc++/acinclude.m4: ditto
3307 * src/frontends/xforms/forms/form_citation.fd:
3308 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
3311 * src/frontends/xforms/forms/makefile: I renamed the `install` target
3312 `updatesrc` and now we have a `test` target that does what `updatesrc`
3313 used to do. I didn't like having an install target that wasn't related
3316 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
3317 on all except FormGraphics. This may yet happen. Followed by a major
3318 cleanup including using FL_TRANSIENT for most of the dialogs. More
3319 changes to come when the ButtonController below is introduced.
3321 * src/frontends/xforms/ButtonController.h: New file for managing up to
3322 four buttons on a dialog according to an externally defined policy.
3323 * src/frontends/xforms/Makefile.am: added above
3325 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
3326 Apply and Cancel/Close buttons and everything in between and beyond.
3327 * src/frontends/Makefile.am: added above.
3329 * src/frontends/xforms/forms/form_preferences.fd:
3330 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
3331 and removed variable 'status' as a result. Fixed the set_minsize thing.
3332 Use the new screen-font-update after checking screen fonts were changed
3333 Added a "Restore" button to restore the original lyxrc values while
3334 editing. This restores everything not just the last input changed.
3335 That's still a tricky one. As is the "LyX: this shouldn't happen..."
3337 * src/LyXAction.C: screen-font-update added for updating buffers after
3338 screen font settings have been changed.
3339 * src/commandtags.h: ditto
3340 * src/lyxfunc.C: ditto
3342 * forms/lyx.fd: removed screen fonts dialog.
3343 * src/lyx_gui.C: ditto
3344 * src/menus.[Ch]: ditto
3345 * src/lyx.[Ch]: ditto
3346 * src/lyx_cb.C: ditto + code from here moved to make
3347 screen-font-update. And people wonder why progress on GUII is
3348 slow. Look at how scattered this stuff was! It takes forever
3351 * forms/fdfix.sh: Fixup the spacing after commas.
3352 * forms/makefile: Remove date from generated files. Fewer clashes now.
3353 * forms/bullet_forms.C.patch: included someones handwritten changes
3355 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
3356 once I've discovered why LyXRC was made noncopyable.
3357 * src/lyx_main.C: ditto
3359 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
3361 * src/frontends/xforms/forms/fdfix.sh:
3362 * src/frontends/xforms/forms/fdfixh.sed:
3363 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
3364 * src/frontends/xforms/Form*.[hC]:
3365 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
3366 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
3367 provide a destructor for the struct FD_form_xxxx. Another version of
3368 the set_[max|min]size workaround and a few other cleanups. Actually,
3369 Angus' patch from 20000809.
3371 2000-08-13 Baruch Even <baruch.even@writeme.com>
3373 * src/insets/insetgraphics.C (Clone): Added several fields that needed
3376 2000-08-11 Juergen Vigna <jug@sad.it>
3378 * src/insets/insetgraphics.C (InsetGraphics): changing init
3379 order because of warnings.
3381 * src/frontends/xforms/forms/makefile: adding patching .C with
3384 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
3385 from .C.patch to .c.patch
3387 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
3388 order because of warning.
3390 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
3392 * src/frontends/Liason.C (setMinibuffer): new helper function
3394 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
3396 * src/lyxfunc.C (Dispatch): calling new Document-Layout
3398 * lib/ui/default.ui: commented out PaperLayout entry
3400 * src/frontends/xforms/form_document.[Ch]: new added files
3402 * src/frontends/xforms/FormDocument.[Ch]: ditto
3404 * src/frontends/xforms/forms/form_document.fd: ditto
3406 * src/frontends/xforms/forms/form_document.C.patch: ditto
3408 2000-08-10 Juergen Vigna <jug@sad.it>
3410 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
3411 (InsetGraphics): initialized cacheHandle to 0.
3412 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
3414 2000-08-10 Baruch Even <baruch.even@writeme.com>
3416 * src/graphics/GraphicsCache.h:
3417 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
3418 correctly as a cache.
3420 * src/graphics/GraphicsCacheItem.h:
3421 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
3424 * src/graphics/GraphicsCacheItem_pimpl.h:
3425 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
3428 * src/insets/insetgraphics.h:
3429 * src/insets/insetgraphics.C: Changed from using a signal notification
3430 to polling when image is not loaded.
3432 2000-08-10 Allan Rae <rae@lyx.org>
3434 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
3435 that there are two functions that have to been taken out of line by
3436 hand and aren't taken care of in the script. (Just a reminder note)
3438 * sigc++/macros/*.h.m4: Updated as above.
3440 2000-08-09 Juergen Vigna <jug@sad.it>
3442 * src/insets/insettext.C (draw): small fix for clearing rectangle.
3444 * src/insets/insettabular.C: make drawing of single cell smarter.
3446 2000-08-09 Marko Vendelin <markov@ioc.ee>
3447 * src/frontends/gnome/Menubar_pimpl.C
3448 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
3449 implementation: new files
3451 * src/frontends/gnome/mainapp.C
3452 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
3455 * src/main.C: create Gnome main window
3457 * src/frontends/xforms/Menubar_pimpl.h
3458 * src/frontends/Menubar.C
3459 * src/frontends/Menubar.h: added method Menubar::update that calls
3460 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
3462 * src/LyXView.C: calls Menubar::update to update the state
3465 * src/frontends/gnome/Makefile.am: added new files
3467 * src/frontends/Makefile.am: added frontend compiler options
3469 2000-08-08 Juergen Vigna <jug@sad.it>
3471 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
3473 * src/bufferlist.C (close):
3474 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
3475 documents if exiting without saving.
3477 * src/buffer.C (save): use removeAutosaveFile()
3479 * src/support/filetools.C (removeAutosaveFile): new function.
3481 * src/lyx_cb.C (MenuWrite): returns a bool now.
3482 (MenuWriteAs): check if file could really be saved and revert to the
3484 (MenuWriteAs): removing old autosavefile if existant.
3486 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
3487 before Goto toggle declaration, because of compiler warning.
3489 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
3491 * src/lyxfunc.C (MenuNew): small fix.
3493 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
3495 * src/bufferlist.C (newFile):
3496 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
3498 * src/lyxrc.C: added new_ask_filename tag
3500 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
3502 * src/lyx.fd: removed code pertaining to form_ref
3503 * src/lyx.[Ch]: ditto
3504 * src/lyx_cb.C: ditto
3505 * src/lyx_gui.C: ditto
3506 * src/lyx_gui_misc.C: ditto
3508 * src/BufferView_pimpl.C (restorePosition): update buffer only
3511 * src/commandtags.h (LFUN_REFTOGGLE): removed
3512 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
3513 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
3514 (LFUN_REFBACK): renamed LFUN_REF_BACK
3516 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
3517 * src/menus.C: ditto
3518 * src/lyxfunc.C (Dispatch): ditto.
3519 InsertRef dialog is now GUI-independent.
3521 * src/texrow.C: added using std::endl;
3523 * src/insets/insetref.[Ch]: strip out large amounts of code.
3524 The inset is now a container and this functionality is now
3525 managed by a new FormRef dialog
3527 * src/frontends/Dialogs.h (showRef, createRef): new signals
3529 * src/frontends/xforms/FormIndex.[Ch],
3530 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
3531 when setting dialog's min/max size
3532 * src/frontends/xforms/FormIndex.[Ch]: ditto
3534 * src/frontends/xforms/FormRef.[Ch],
3535 src/frontends/xforms/forms/form_ref.fd: new xforms
3536 implementation of an InsetRef dialog
3538 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
3541 * src/graphics/XPM_Renderer.C (isImageFormatOK):
3542 ios::nocreate is not part of the standard. Removed.
3544 2000-08-07 Baruch Even <baruch.even@writeme.com>
3546 * src/graphics/Renderer.h:
3547 * src/graphics/Renderer.C: Added base class for rendering of different
3548 image formats into Pixmaps.
3550 * src/graphics/XPM_Renderer.h:
3551 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
3552 in a different class.
3554 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
3555 easily add support for other formats.
3557 * src/insets/figinset.C: plugged a leak of an X resource.
3559 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
3561 * src/CutAndPaste.[Ch]: make all metods static.
3563 * development/Code_rules/Rules: more work, added section on
3564 Exceptions, and a References section.
3566 * a lot of header files: work to make doc++ able to generate the
3567 source documentation, some workarounds of doc++ problems. Doc++ is
3568 now able to generate the documentation.
3570 2000-08-07 Juergen Vigna <jug@sad.it>
3572 * src/insets/insettabular.C (recomputeTextInsets): removed function
3574 * src/tabular.C (SetWidthOfMulticolCell):
3576 (calculate_width_of_column_NMC): fixed return value so that it really
3577 only returns true if the column-width has changed (there where
3578 problems with muliticolumn-cells in this column).
3580 2000-08-04 Juergen Vigna <jug@sad.it>
3582 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
3583 also on the scrollstatus of the inset.
3584 (workAreaMotionNotify): ditto.
3586 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
3588 2000-08-01 Juergen Vigna <jug@sad.it>
3590 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
3592 * src/commandtags.h:
3593 * src/LyXAction.C (init):
3594 * src/insets/inset.C (LocalDispatch): added support for
3597 * src/insets/inset.C (scroll): new functions.
3599 * src/insets/insettext.C (removeNewlines): new function.
3600 (SetAutoBreakRows): removes forced newlines in the text of the
3601 paragraph if autoBreakRows is set to false.
3603 * src/tabular.C (Latex): generates a parbox around the cell contents
3606 * src/frontends/xforms/FormTabular.C (local_update): removed
3607 the radio_useparbox button.
3609 * src/tabular.C (UseParbox): new function
3611 2000-08-06 Baruch Even <baruch.even@writeme.com>
3613 * src/graphics/GraphicsCache.h:
3614 * src/graphics/GraphicsCache.C:
3615 * src/graphics/GraphicsCacheItem.h:
3616 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
3619 * src/insets/insetgraphics.h:
3620 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
3621 and the drawing of the inline image.
3623 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
3624 loaded into the wrong position.
3626 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
3629 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3631 * src/support/translator.h: move all typedefs to public section
3633 * src/support/filetools.C (MakeLatexName): return string const
3635 (TmpFileName): ditto
3636 (FileOpenSearch): ditto
3638 (LibFileSearch): ditto
3639 (i18nLibFileSearch): ditto
3642 (CreateTmpDir): ditto
3643 (CreateBufferTmpDir): ditto
3644 (CreateLyXTmpDir): ditto
3647 (MakeAbsPath): ditto
3649 (OnlyFilename): ditto
3651 (NormalizePath): ditto
3652 (CleanupPath): ditto
3653 (GetFileContents): ditto
3654 (ReplaceEnvironmentPath): ditto
3655 (MakeRelPath): ditto
3657 (ChangeExtension): ditto
3658 (MakeDisplayPath): ditto
3659 (do_popen): return cmdret const
3660 (findtexfile): return string const
3662 * src/support/DebugStream.h: add some /// to please doc++
3664 * src/frontends/DialogBase.h (endif): add some /// to please doc++
3666 * src/texrow.C (same_rownumber): functor to use with find_if
3667 (getIdFromRow): rewritten to use find_if and to not update the
3668 positions. return true if row is found
3669 (increasePos): new method, use to update positions
3671 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
3673 * src/lyxlex_pimpl.C (verifyTable): new method
3676 (GetString): return string const
3677 (pushTable): rewrite to use std::stack
3679 (setFile): better check
3682 * src/lyxlex.h: make LyXLex noncopyable
3684 * src/lyxlex.C (text): return char const * const
3685 (GetString): return string const
3686 (getLongString): return string const
3688 * src/lyx_gui_misc.C (askForText): return pair<...> const
3690 * src/lastfiles.[Ch] (operator): return string const
3692 * src/buffer.C (parseSingleLyXformat2Token): pass string to
3693 istringstream not char const *.
3694 move token.end() out of loop.
3695 (readFile): move initializaton of token
3697 * src/BufferView2.C (insertErrors): run texrow.increasePos if
3698 getIdFromRow is successful.
3700 * lib/bind/emacs.bind: don't include menus bind
3702 * development/Code_rules/Rules: the beginnings of making this
3703 better and covering more of the unwritten rules that we have.
3705 * development/Code_rules/Recommendations: a couple of wording
3708 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3710 * src/support/strerror.c: remove C++ comment.
3712 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
3714 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
3715 LFUN_INDEX_INSERT_LAST
3717 * src/texrow.C (getIdFromRow): changed from const_iterator to
3718 iterator, allowing code to compile with DEC cxx
3720 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
3721 stores part of the class, as suggested by Allan. Will allow
3723 (apply): test to apply uses InsetCommandParams operator!=
3725 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
3726 (apply): test to apply uses InsetCommandParams operator!=
3728 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
3729 stores part of the class.
3730 (update): removed limits on min/max size.
3732 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
3733 (apply): test to apply uses InsetCommandParams operator!=
3735 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
3736 (Read, Write, scanCommand, getCommand): moved functionality
3737 into InsetCommandParams.
3739 (getScreenLabel): made pure virtual
3740 new InsetCommandParams operators== and !=
3742 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
3743 c-tors based on InsetCommandParams. Removed others.
3744 * src/insets/insetinclude.[Ch]: ditto
3745 * src/insets/insetlabel.[Ch]: ditto
3746 * src/insets/insetparent.[Ch]: ditto
3747 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
3749 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
3750 insets derived from InsetCommand created using similar c-tors
3751 based on InsetCommandParams
3752 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
3753 * src/menus.C (ShowRefsMenu): ditto
3754 * src/paragraph.C (Clone): ditto
3755 * src/text2.C (SetCounter): ditto
3756 * src/lyxfunc.C (Dispatch) ditto
3757 Also recreated old InsetIndex behaviour exactly. Can now
3758 index-insert at the start of a paragraph and index-insert-last
3759 without launching the pop-up.
3761 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3763 * lib/lyxrc.example: mark te pdf options as non functional.
3765 * src/support/lstrings.C (strToInt): move initalization of tmpstr
3766 (isStrDbl): move tmpstr.end() out of loop.
3767 (strToDbl): move intialization of tmpstr
3768 (lowercase): return string const and move tmp.end() out of loop.
3769 (uppercase): return string const and move tmp.edn() out of loop.
3770 (prefixIs): add assertion
3775 (containsOnly): ditto
3776 (containsOnly): ditto
3777 (containsOnly): ditto
3778 (countChar): make last arg char not char const
3779 (token): return string const
3780 (subst): return string const, move tmp.end() out of loop.
3781 (subst): return string const, add assertion
3782 (strip): return string const
3783 (frontStrip): return string const, add assertion
3784 (frontStrip): return string const
3789 * src/support/lstrings.C: add inclde "LAssert.h"
3790 (isStrInt): move tmpstr.end() out of loop.
3792 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
3793 toollist.end() out of loop.
3794 (deactivate): move toollist.end() out of loop.
3795 (update): move toollist.end() out of loop.
3796 (updateLayoutList): move tc.end() out of loop.
3797 (add): move toollist.end() out of loop.
3799 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
3800 md.end() out of loop.
3802 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
3804 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
3807 * src/paragraph.C (Erase): move fontlist.end() out of loop.
3808 (Erase): move insetlist.end() out of loop.
3810 * src/lyx_sendfax_main.C: make show_logfile static and to take a
3811 ref to const string as first arg. Move initialization of some
3812 variables, whitespace changes.
3814 * src/kbmap.C (defkey): move table.end() out of loop.
3815 (kb_keymap): move table.end() out of loop.
3816 (findbinding): move table.end() out of loop.
3818 * src/MenuBackend.C (hasMenu): move end() out of loop.
3819 (getMenu): move end() out of loop.
3820 (getMenu): move menulist_.end() out of loop.
3822 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
3824 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
3827 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
3828 (getFromLyXName): move infotab.end() out of loop.
3830 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
3831 -fvtable-thunks -ffunction-sections -fdata-sections
3833 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
3835 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
3838 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3840 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
3842 * src/frontends/xforms/FormCitation.[Ch],
3843 src/frontends/xforms/FormIndex.[Ch],
3844 src/frontends/xforms/FormToc.[Ch],
3845 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
3847 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3849 * src/commandtags.h: renamed, created some flags for citation
3852 * src/lyx_gui_misc.C: stripped out old FD_index_form code
3854 * src/lyxfunc.C (dispatch): use signals to insert index entry
3856 * src/frontends/Dialogs.h: new signal createIndex
3858 * src/frontends/xforms/FormCommand.[Ch],
3859 src/frontends/xforms/FormCitation.[Ch],
3860 src/frontends/xforms/FormToc.[Ch],
3861 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
3863 * src/insets/insetindex.[Ch]: GUI-independent
3865 * src/frontends/xforms/FormIndex.[Ch],
3866 * src/frontends/xforms/forms/form_index.fd: xforms implementation
3869 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
3871 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
3872 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
3874 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3876 * src/insets/insetref.C (Latex): rewrite so that there is now
3877 question that a initialization is requested.
3879 * src/insets/insetcommand.h: reenable the hide signal
3881 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3883 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
3884 fix handling of shortcuts (many bugs :)
3885 (add_lastfiles): ditto.
3887 * lib/ui/default.ui: fix a few shortcuts.
3889 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
3891 * Makefile.am: Fix ``rpmdist'' target to return the exit
3892 status of the ``rpm'' command, instead of the last command in
3893 the chain (the ``rm lyx.xpm'' command, which always returns
3896 2000-08-02 Allan Rae <rae@lyx.org>
3898 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
3899 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
3900 * src/frontends/xforms/FormToc.C (FormToc): ditto
3902 * src/frontends/xforms/Makefile.am: A few forgotten files
3904 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
3905 Signals-not-copyable-problem Lars' started commenting out.
3907 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
3909 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3911 * src/insets/insetcommand.h: Signals is not copyable so anoter
3912 scheme for automatic hiding of forms must be used.
3914 * src/frontends/xforms/FormCitation.h: don't inerit from
3915 noncopyable, FormCommand already does that.
3916 * src/frontends/xforms/FormToc.h: ditto
3917 * src/frontends/xforms/FormUrl.h: ditto
3919 * src/frontends/xforms/FormCitation.C: add include <algorithm>
3921 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
3923 * src/insets/insetcommand.h (hide): new SigC::Signal0
3924 (d-tor) new virtual destructor emits hide signal
3926 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
3927 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
3929 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
3930 LOF and LOT. Inset is now GUI-independent
3932 * src/insets/insetloa.[Ch]: redundant
3933 * src/insets/insetlof.[Ch]: ditto
3934 * src/insets/insetlot.[Ch]: ditto
3936 * src/frontends/xforms/forms/form_url.fd: tweaked!
3937 * src/frontends/xforms/forms/form_citation.fd: ditto
3939 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
3940 dialogs dealing with InsetCommand insets
3942 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
3943 FormCommand base class
3944 * src/frontends/xforms/FormUrl.[Ch]: ditto
3946 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
3948 * src/frontends/xforms/FormToc.[Ch]: ditto
3950 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
3951 passed a generic InsetCommand pointer
3952 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
3954 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
3955 and modified InsetTOC class
3956 * src/buffer.C: ditto
3958 * forms/lyx.fd: strip out old FD_form_toc code
3959 * src/lyx_gui_misc.C: ditto
3960 * src/lyx_gui.C: ditto
3961 * src/lyx_cb.C: ditto
3962 * src/lyx.[Ch]: ditto
3964 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3966 * src/support/utility.hpp: tr -d '\r'
3968 2000-08-01 Juergen Vigna <jug@sad.it>
3970 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
3972 * src/commandtags.h:
3973 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
3974 LFUN_TABULAR_FEATURES.
3976 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
3977 LFUN_LAYOUT_TABULAR.
3979 * src/insets/insettabular.C (getStatus): implemented helper function.
3981 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
3983 2000-07-31 Juergen Vigna <jug@sad.it>
3985 * src/text.C (draw): fixed screen update problem for text-insets.
3987 * src/text2.C (SetParagrpah): call an update of the inset-owner when
3988 something changed probably this has to be added in various other
3991 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
3993 2000-07-31 Baruch Even <baruch.even@writeme.com>
3995 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
3996 templates to satisfy compaq cxx.
3999 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4001 * src/support/translator.h (equal_1st_in_pair::operator()): take
4002 const ref pair_type as arg.
4003 (equal_2nd_in_pair::operator()): ditto
4004 (Translator::~Translator): remove empty d-tor.
4006 * src/graphics/GraphicsCache.C: move include config.h to top, also
4007 put initialization of GraphicsCache::singleton here.
4008 (~GraphicsCache): move here
4009 (addFile): take const ref as arg
4012 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
4014 * src/BufferView2.C (insertLyXFile): change te with/without header
4017 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4019 * src/frontends/xforms/FormGraphics.C (apply): add some
4020 static_cast. Not very nice, but required by compaq cxx.
4022 * src/frontends/xforms/RadioButtonGroup.h: include header
4023 <utility> instead of <pair.h>
4025 * src/insets/insetgraphicsParams.C: add using directive.
4026 (readResize): change return type to void.
4027 (readOrigin): ditto.
4029 * src/lyxfunc.C (getStatus): add missing break for build-program
4030 function; add test for Literate for export functions.
4032 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
4033 entries in Options menu.
4035 2000-07-31 Baruch Even <baruch.even@writeme.com>
4037 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
4038 protect against auto-allocation; release icon when needed.
4040 2000-07-31 Matej Cepl <CeplM@seznam.cz>
4042 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
4043 on usual typewriter.
4045 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
4046 earlier czech.kmap), useful only for programming.
4048 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4050 * src/frontends/xforms/FormCitation.h: fix conditioning around
4053 2000-07-31 Juergen Vigna <jug@sad.it>
4055 * src/frontends/xforms/FormTabular.C (local_update): changed
4056 radio_linebreaks to radio_useparbox and added radio_useminipage.
4058 * src/tabular.C: made support for using minipages/parboxes.
4060 * src/bufferlist.C (QwriteAll): small fix for asking for save.
4062 * src/insets/insetgraphics.C (draw): just draw the inset so that the
4064 (descent): so the cursor is in the middle.
4065 (width): bit smaller box.
4067 * src/insets/insetgraphics.h: added display() function.
4069 2000-07-31 Baruch Even <baruch.even@writeme.com>
4071 * src/frontends/Dialogs.h: Added showGraphics signals.
4073 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
4074 xforms form definition of the graphics dialog.
4076 * src/frontends/xforms/FormGraphics.h:
4077 * src/frontends/xforms/FormGraphics.C: Added files, the
4078 GUIndependent code of InsetGraphics
4080 * src/insets/insetgraphics.h:
4081 * src/insets/insetgraphics.C: Major writing to make it work.
4083 * src/insets/insetgraphicsParams.h:
4084 * src/insets/insetgraphicsParams.C: Added files, parameter passing
4085 struct between InsetGraphics and GUI.
4087 * src/LaTeXFeatures.h:
4088 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
4089 support for graphicx package.
4091 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
4092 for the graphics inset.
4094 * src/support/translator.h: Added file, used in
4095 InsetGraphicsParams. this is a template to translate between two
4098 * src/frontends/xforms/RadioButtonGroup.h:
4099 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
4100 way to easily control a radio button group.
4102 2000-07-28 Juergen Vigna <jug@sad.it>
4104 * src/insets/insettabular.C (LocalDispatch):
4105 (TabularFeatures): added support for lyx-functions of tabular features.
4106 (cellstart): refixed this function after someone wrongly changed it.
4108 * src/commandtags.h:
4109 * src/LyXAction.C (init): added support for tabular-features
4111 2000-07-28 Allan Rae <rae@lyx.org>
4113 * src/frontends/xforms/FormPreferences.C (build): Setup input return
4114 checking. NOTE: It seems that pressing ESC to cancel the dialog also
4115 triggers the callback for input checking. As a result we sometimes get
4116 "LyX: This shouldn't happen..." printed to cerr.
4117 (input): Started using status variable since I only free() on
4118 destruction. Some input checking for paths and font sizes.
4120 * src/frontends/xforms/FormPreferences.h: Use status to control
4121 activation of Ok and Apply
4123 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
4124 callback. Also resized to stop segfaults with 0.88. The problem is
4125 that xforms-0.88 requires the folder to be wide enough to fit all the
4126 tabs. If it isn't it causes all sorts of problems.
4128 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
4130 * src/frontends/xforms/forms/README: Reflect reality.
4132 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
4133 * src/frontends/xforms/forms/makefile: ditto.
4135 * src/commandtags.h: Get access to new Preferences dialog
4136 * src/LyXAction.C: ditto
4137 * src/lyxfunc.C: ditto
4138 * lib/ui/default.ui: ditto
4140 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4142 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
4144 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
4147 * src/frontends/xforms/form_url.[Ch]: added.
4149 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4151 * src/insets/insetbib.h: fixed bug in previous commit
4153 * src/frontends/xforms/FormUrl.h: ditto
4155 * src/frontends/xforms/FormPrint.h: ditto
4157 * src/frontends/xforms/FormPreferences.h: ditto
4159 * src/frontends/xforms/FormCopyright.h: ditto
4161 * src/frontends/xforms/FormCitation.C: ditto
4163 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
4164 private copyconstructor and private default contructor
4166 * src/support/Makefile.am: add utility.hpp
4168 * src/support/utility.hpp: new file from boost
4170 * src/insets/insetbib.h: set owner in clone
4172 * src/frontends/xforms/FormCitation.C: added missing include
4175 * src/insets/form_url.[Ch]: removed
4177 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
4179 * development/lyx.spec.in
4180 * Makefile.am: Fix buglet for LyX RPM generation resulting from
4181 file/directory re-organization.
4183 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
4185 * src/insets/insetcommand.[Ch]: moved the string data and
4186 associated manipulation methods into a new stand-alone class
4187 InsetCommandParams. This class has two additional methods
4188 getAsString() and setFromString() allowing the contents to be
4189 moved around as a single string.
4190 (addContents) method removed.
4191 (setContents) method no longer virtual.
4193 * src/buffer.C (readInset): made use of new InsetCitation,
4194 InsetUrl constructors based on InsetCommandParams.
4196 * src/commandtags.h: add LFUN_INSERT_URL
4198 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
4199 independent InsetUrl and use InsetCommandParams to extract
4200 string info and create new Insets.
4202 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
4204 * src/frontends/xforms/FormCitation.C (apply): uses
4207 * src/frontends/xforms/form_url.C
4208 * src/frontends/xforms/form_url.h
4209 * src/frontends/xforms/FormUrl.h
4210 * src/frontends/xforms/FormUrl.C
4211 * src/frontends/xforms/forms/form_url.fd: new files
4213 * src/insets/insetcite.[Ch]: removed unused constructors.
4215 * src/insets/insetinclude.[Ch]: no longer store filename
4217 * src/insets/inseturl.[Ch]: GUI-independent.
4219 2000-07-26 Juergen Vigna <jug@sad.it>
4220 * renamed frontend from gtk to gnome as it is that what is realized
4221 and did the necessary changes in the files.
4223 2000-07-26 Marko Vendelin <markov@ioc.ee>
4225 * configure.in: cleaning up gnome configuration scripts
4227 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4229 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
4230 shortcuts syndrom by redrawing them explicitely (a better solution
4231 would be appreciated).
4233 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
4235 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
4238 * src/lyx_cb.C (MenuExport): change html export to do the right
4239 thing depending of the document type (instead of having
4240 html-linuxdoc and html-docbook).
4241 * src/lyxfunc.C (getStatus): update for html
4242 * lib/ui/default.ui: simplify due to the above change.
4243 * src/menus.C (ShowFileMenu): update too (in case we need it).
4245 * src/MenuBackend.C (read): if a menu is defined twice, add the
4246 new entries to the exiting one.
4248 2000-07-26 Juergen Vigna <jug@sad.it>
4250 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
4252 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
4253 and return a bool if it did actual save the file.
4254 (AutoSave): don't autosave a unnamed doc.
4256 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
4257 check if this is an UNNAMED new file and react to it.
4258 (newFile): set buffer to unnamed and change to not mark a new
4259 buffer dirty if I didn't do anything with it.
4261 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
4263 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4265 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
4266 friend as per Angus's patch posted to lyx-devel.
4268 * src/ext_l10n.h: updated
4270 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
4271 gettext on the style string right before inserting them into the
4274 * autogen.sh: add code to extract style strings form layout files,
4275 not good enough yet.
4277 * src/frontends/gtk/.cvsignore: add MAKEFILE
4279 * src/MenuBackend.C (read): run the label strings through gettext
4280 before storing them in the containers.
4282 * src/ext_l10n.h: new file
4284 * autogen.sh : generate the ext_l10n.h file here
4286 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4288 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
4291 * lib/ui/default.ui: fix a couple of typos.
4293 * config/gnome/gtk.m4: added (and added to the list of files in
4296 * src/insets/insetinclude.C (unique_id): fix when we are using
4297 lyxstring instead of basic_string<>.
4298 * src/insets/insettext.C (LocalDispatch): ditto.
4299 * src/support/filetools.C: ditto.
4301 * lib/configure.m4: create the ui/ directory if necessary.
4303 * src/LyXView.[Ch] (updateToolbar): new method.
4305 * src/BufferView_pimpl.C (buffer): update the toolbar when
4306 opening/closing buffer.
4308 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4310 * src/LyXAction.C (getActionName): enhance to return also the name
4311 and options of pseudo-actions.
4312 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
4314 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
4315 as an example of what is possible). Used in File->Build too (more
4316 useful) and in the import/export menus (to mimick the complicated
4317 handling of linuxdoc and friends). Try to update all the entries.
4319 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
4322 * src/MenuBackend.C (read): Parse the new OptItem tag.
4324 * src/MenuBackend.h: Add a new optional_ data member (used if the
4325 entry should be omitted when the lyxfunc is disabled).
4327 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
4328 function, used as a shortcut.
4329 (create_submenu): align correctly the shortcuts on the widest
4332 * src/MenuBackend.h: MenuItem.label() only returns the label of
4333 the menu without shortcut; new method shortcut().
4335 2000-07-14 Marko Vendelin <markov@ioc.ee>
4337 * src/frontends/gtk/Dialogs.C:
4338 * src/frontends/gtk/FormCopyright.C:
4339 * src/frontends/gtk/FormCopyright.h:
4340 * src/frontends/gtk/Makefile.am: added these source-files for the
4341 Gtk/Gnome support of the Copyright-Dialog.
4343 * src/main.C: added Gnome::Main initialization if using
4344 Gtk/Gnome frontend-GUI.
4346 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
4348 * config/gnome/aclocal-include.m4
4349 * config/gnome/compiler-flags.m4
4350 * config/gnome/curses.m4
4351 * config/gnome/gnome--.m4
4352 * config/gnome/gnome-bonobo-check.m4
4353 * config/gnome/gnome-common.m4
4354 * config/gnome/gnome-fileutils.m4
4355 * config/gnome/gnome-ghttp-check.m4
4356 * config/gnome/gnome-gnorba-check.m4
4357 * config/gnome/gnome-guile-checks.m4
4358 * config/gnome/gnome-libgtop-check.m4
4359 * config/gnome/gnome-objc-checks.m4
4360 * config/gnome/gnome-orbit-check.m4
4361 * config/gnome/gnome-print-check.m4
4362 * config/gnome/gnome-pthread-check.m4
4363 * config/gnome/gnome-support.m4
4364 * config/gnome/gnome-undelfs.m4
4365 * config/gnome/gnome-vfs.m4
4366 * config/gnome/gnome-x-checks.m4
4367 * config/gnome/gnome-xml-check.m4
4368 * config/gnome/gnome.m4
4369 * config/gnome/gperf-check.m4
4370 * config/gnome/gtk--.m4
4371 * config/gnome/linger.m4
4372 * config/gnome/need-declaration.m4: added configuration scripts
4373 for Gtk/Gnome frontend-GUI
4375 * configure.in: added support for the --with-frontend=gtk option
4377 * autogen.sh: added config/gnome/* to list of config-files
4379 * acconfig.h: added define for GTKGUI-support
4381 * config/lyxinclude.m4: added --with-frontend[=value] option value
4382 for Gtk/Gnome frontend-GUI support.
4384 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4386 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
4390 * src/paragraph.C (GetChar): remove non-const version
4392 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
4393 (search_kw): use it.
4395 * src/lyx_main.C (init): if "preferences" exist, read that instead
4397 (ReadRcFile): return bool if the file could be read ok.
4398 (ReadUIFile): add a check to see if lex file is set ok.
4400 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
4401 bastring can be used instead of lyxstring (still uses the old code
4402 if std::string is good enough or if lyxstring is used.)
4404 * src/encoding.C: make the arrays static, move ininle functions
4406 * src/encoding.h: from here.
4408 * src/buffer.C: have last_isnet_read as a file scope variable for now.
4409 (parseSingleLyXformat2Token): move inset parsing to separate method
4410 (readInset): new private method
4412 * src/Variables.h: remove virtual from get().
4414 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
4415 access to NEW_INSETS and NEW_TABULAR
4417 * src/MenuBackend.h: remove superfluous forward declaration of
4418 MenuItem. Add documentations tags "///", remove empty MenuItem
4419 destructor, remove private default contructor.
4421 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
4423 (read): more string mlabel and mname to where they are used
4424 (read): remove unused variables mlabel and mname
4425 (defaults): unconditional clear, make menusetup take advantage of
4426 add returning Menu &.
4428 * src/LyXView.h: define NEW_MENUBAR as default
4430 * src/LyXAction.C: include lyxparagraph.h temporary to get access
4431 to NEW_INSETS and NEW_TABULAR.
4432 (init): commetn out some funcs that is obsolete when NEW_INSETS is
4433 defined. Change some of the "xxxx-inset-insert" functions names to
4436 * several files: more enahncements to NEW_INSETS and the resulting
4439 * lib/lyxrc.example (\date_insert_format): move to misc section
4441 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
4442 bastring and use AC_CACHE_CHECK.
4443 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
4444 the system have the newest methods. uses AC_CACHE_CHECK
4445 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
4446 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
4447 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
4449 * configure.in: add LYX_CXX_GOOD_STD_STRING
4451 * acinclude.m4: recreated
4453 2000-07-24 Amir Karger <karger@lyx.org>
4455 * README: add Hebrew, Arabic kmaps
4458 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4460 * src/buffer.C (writeFileAscii): Define actcell as an int instead
4463 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4465 * Lot of files: add pragma interface/implementation.
4467 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
4469 * lib/ui/default.ui: new file (ans new directory). Contains the
4470 default menu and toolbar.
4472 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
4473 global space. Toolbars are now read (as menus) in ui files.
4475 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
4477 * src/lyxfunc.C (getStatus): do not exit immediately if a command
4478 is disabled because the document is read-only. We want to have the
4479 toggle state of the function anyway.
4480 (getStatus): add code for LFUN_VC* functions (mimicking what is
4481 done in old-style menus)
4483 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
4484 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
4486 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
4487 * src/BufferView_pimpl.C: ditto.
4488 * src/lyxfunc.C: ditto.
4490 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
4491 default). This replaces old-style menus by new ones.
4493 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
4494 MenuItem. Contain the data structure of a menu.
4496 * src/insets/insettext.C: use LyXView::setLayout instead of
4497 accessing directly the toolbar combox.
4498 * src/lyxfunc.C (Dispatch): ditto.
4500 * src/LyXView.C (setLayout): new method, which just calls
4501 Toolbar::setLayout().
4502 (updateLayoutChoice): move part of this method in Toolbar.
4504 * src/toolbar.[Ch]: removed.
4506 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
4507 implementation the toolbar.
4509 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
4510 the toolbar. It might make sense to merge it with ToolbarDefaults
4512 (setLayout): new function.
4513 (updateLayoutList): ditto.
4514 (openLayoutList): ditto.
4516 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
4517 xforms implementation of the toolbar.
4518 (get_toolbar_func): comment out, since I do not
4519 know what it is good for.
4521 * src/ToolbarDefaults.h: Add the ItemType enum.
4523 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
4524 for a list of allocated C strings. Used in Menubar xforms
4525 implementation to avoid memory leaks.
4527 * src/support/lstrings.[Ch] (uppercase): new version taking and
4531 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
4532 * lib/bind/emacs.bind: ditto.
4534 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4536 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
4537 forward decl of LyXView.
4539 * src/toolbar.C (toolbarItem): moved from toolbar.h
4540 (toolbarItem::clean): ditto
4541 (toolbarItem::~toolbarItem): ditto
4542 (toolbarItem::operator): ditto
4544 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
4546 * src/paragraph.h: control the NEW_TABULAR define from here
4548 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
4549 USE_TABULAR_INSETS to NEW_TABULAR
4551 * src/ToolbarDefaults.C: add include "lyxlex.h"
4553 * files using the old table/tabular: use NEW_TABULAR to control
4554 compilation of old tabular stuff.
4556 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
4559 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
4560 planemet in reading of old style floats, fix the \end_deeper
4561 problem when reading old style floats.
4563 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4565 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
4567 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
4569 * lib/bind/sciword.bind: updated.
4571 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4573 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
4574 layout write problem
4576 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4578 * src/Makefile.am (INCLUDES): remove image directory from include
4581 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
4582 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
4584 * src/LyXView.C (create_form_form_main): read the application icon
4587 * lib/images/*.xpm: change the icons to use transparent color for
4590 * src/toolbar.C (update): change the color of the button when it
4593 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4595 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
4596 setting explicitely the minibuffer.
4597 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
4599 * src/LyXView.C (showState): new function. Shows font information
4600 in minibuffer and update toolbar state.
4601 (LyXView): call Toolbar::update after creating the
4604 * src/toolbar.C: change toollist to be a vector instead of a
4606 (BubbleTimerCB): get help string directly from the callback
4607 argument of the corresponding icon (which is the action)
4608 (set): remove unnecessary ugliness.
4609 (update): new function. update the icons (depressed, disabled)
4610 depending of the status of the corresponding action.
4612 * src/toolbar.h: remove help in toolbarItem
4614 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
4616 * src/Painter.C (text): Added code for using symbol glyphs from
4617 iso10646 fonts. Currently diabled.
4619 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
4622 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
4623 magyar,turkish and usorbian.
4625 * src/paragraph.C (isMultiLingual): Made more efficient.
4627 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
4630 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
4631 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
4632 Also changed the prototype to "bool math_insert_greek(char)".
4634 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4636 * lots of files: apply the NEW_INSETS on all code that will not be
4637 needed when we move to use the new insets. Enable the define in
4638 lyxparagrah.h to try it.
4640 * src/insets/insettabular.C (cellstart): change to be a static
4642 (InsetTabular): initialize buffer in the initializer list.
4644 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
4646 * src/frontends/xforms/FormPrint.[Ch] : moved #include
4647 form_print.h out of the header file. Replaced with forward
4648 declarations of the relevant struct.
4650 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
4653 * src/commandtags.h: do not include "debug.h" which does not
4654 belong there. #include it in some other places because of this
4657 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4659 * src/insets/insetcaption.C: add a couple "using" directives.
4661 * src/toolbar.C (add): get the help text directly from lyxaction.
4663 (setPixmap): new function. Loads from disk and sets a pixmap on a
4664 botton; the name of the pixmap file is derived from the command
4667 * src/toolbar.h: remove members isBitmap and pixmap from
4670 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
4671 * lib/images/: move many files from images/banner.xpm.
4673 * src/lyx_gui.C (create_forms): read banner pixmap from file.
4675 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
4676 * src/toolbar.C: ditto.
4677 * configure.in: ditto.
4678 * INSTALL: document.
4680 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
4681 the spellchecker popup is closed from the WM.
4683 2000-07-19 Juergen Vigna <jug@sad.it>
4685 * src/insets/insetfloat.C (Write): small fix because we use the
4686 insetname for the type now!
4688 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
4690 * src/frontends/xforms/forms/form_citation.fd: object sizes are
4693 * src/frontends/Dialogs.h: removed hideCitation signal
4695 * src/insets/insetcite.h: added hide signal
4697 * src/insets/insetcite.C (~InsetCitation): emits new signal
4698 (getScreenLabel): "intelligent" label should now fit on the screen!
4700 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
4702 * src/frontends/xforms/FormCitation.C (showInset): connects
4703 hide() to the inset's hide signal
4704 (show): modified to use fl_set_object_position rather than
4705 fl_set_object_geometry wherever possible
4707 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4709 * src/insets/lyxinset.h: add caption code
4711 * src/insets/insetfloat.C (type): new method
4713 * src/insets/insetcaption.C (Write): new method
4715 (LyxCode): new method
4717 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
4718 to get it right together with using the FloatList.
4720 * src/commandtags.h: add LFUN_INSET_CAPTION
4721 * src/lyxfunc.C (Dispatch): handle it
4723 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
4726 * src/Variables.[Ch]: make expand take a const reference, remove
4727 the destructor, some whitespace changes.
4729 * src/LyXAction.C (init): add caption-inset-insert
4731 * src/FloatList.C (FloatList): update the default floats a bit.
4733 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4735 * src/Variables.[Ch]: new files. Intended to be used for language
4736 specific strings (like \chaptername) and filename substitution in
4739 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
4741 * lib/kbd/american.kmap: update
4743 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
4745 * src/bufferparams.[Ch]: remove member allowAccents.
4747 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
4749 * src/LaTeXLog.C: use the log_form.h header.
4750 * src/lyx_gui.C: ditto.
4751 * src/lyx_gui_misc.C: ditto.
4752 * src/lyxvc.h: ditto.
4754 * forms/log_form.fd: new file, created from latexoptions.fd. I
4755 kept the log popup and nuked the options form.
4757 * src/{la,}texoptions.[Ch]: removed.
4758 * src/lyx_cb.C (LaTeXOptions): ditto
4760 * src/lyx_gui.C (create_forms): do not handle the
4761 fd_latex_options form.
4763 2000-07-18 Juergen Vigna <jug@sad.it>
4765 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
4766 name of the inset so that it can be requested outside (text2.C).
4768 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
4771 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4773 * src/mathed/formula.h (ConvertFont): constify
4775 * src/mathed/formula.C (Read): add warning if \end_inset is not
4776 found on expected place.
4778 * src/insets/lyxinset.h (ConvertFont): consify
4780 * src/insets/insetquotes.C (ConvertFont): constify
4781 * src/insets/insetquotes.h: ditto
4783 * src/insets/insetinfo.h: add labelfont
4785 * src/insets/insetinfo.C (InsetInfo): set the labelfont
4786 (ascent): use labelfont
4790 (Write): make .lyx file a bit nicer
4792 * src/insets/insetfloat.C (Write): simplify somewhat...
4793 (Read): add warning if arg is not found
4795 * src/insets/insetcollapsable.C: add using std::max
4796 (Read): move string token and add warning in arg is not found
4797 (draw): use std::max to get the right ty
4798 (getMaxWidth): simplify by using std::max
4800 * src/insets/insetsection.h: new file
4801 * src/insets/insetsection.C: new file
4802 * src/insets/insetcaption.h: new file
4803 * src/insets/insetcaption.C: new file
4805 * src/insets/inset.C (ConvertFont): constify signature
4807 * src/insets/Makefile.am (libinsets_la_SOURCES): add
4808 insetcaption.[Ch] and insetsection.[Ch]
4810 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
4811 uses to use LABEL_COUNTER_CHAPTER instead.
4812 * src/text2.C (SetCounter): here
4814 * src/counters.h: new file
4815 * src/counters.C: new file
4816 * src/Sectioning.h: new file
4817 * src/Sectioning.C: new file
4819 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
4821 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4823 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
4826 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
4829 2000-07-17 Juergen Vigna <jug@sad.it>
4831 * src/tabular.C (Validate): check if array-package is needed.
4832 (SetVAlignment): added support for vertical alignment.
4833 (SetLTFoot): better support for longtable header/footers
4834 (Latex): modified to support added features.
4836 * src/LaTeXFeatures.[Ch]: added array-package.
4838 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
4840 * src/lyx_gui.C (LyXGUI): make sure that the height is large
4843 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
4845 * configure.in: do not forget to put a space after -isystem.
4847 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
4849 * lib/kbd/arabic.kmap: a few fixes.
4851 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4853 * some whitespace chagnes to a number of files.
4855 * src/support/DebugStream.h: change to make it easier for
4856 doc++ to parse correctly.
4857 * src/support/lyxstring.h: ditto
4859 * src/mathed/math_utils.C (compara): change to have only one
4861 (MathedLookupBOP): change because of the above.
4863 * src/mathed/math_delim.C (math_deco_compare): change to have only
4865 (search_deco): change becasue of the above.
4867 * src/insets/insettabular.C (DrawCellSelection): use std::swap
4868 instead of manually coded one.
4870 * src/insets/insetquotes.C (Read): read the \end_inset too
4872 * src/insets/insetlatex.h: remove file
4873 * src/insets/insetlatex.C: remove file
4875 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
4877 (InsetPrintIndex): remove destructor
4879 * src/insets/insetinclude.h: remove default constructor
4881 * src/insets/insetfloat.C: work to make it work better
4883 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
4885 * src/insets/insetcite.h (InsetCitation): remove default constructor
4887 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
4889 * src/text.C (GetColumnNearX): comment out some currently unused code.
4891 * src/paragraph.C (writeFile): move some initializations closer to
4893 (CutIntoMinibuffer): small change to use new matchIT operator
4897 (InsertInset): ditto
4900 (InsetIterator): ditto
4901 (Erase): small change to use new matchFT operator
4903 (GetFontSettings): ditto
4904 (HighestFontInRange): ditto
4907 * src/lyxparagraph.h: some chars changed to value_type
4908 (matchIT): because of some stronger checking (perhaps too strong)
4909 in SGI STL, the two operator() unified to one.
4912 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
4914 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
4915 the last inset read added
4916 (parseSingleLyXformat2Token): some more (future) compability code added
4917 (parseSingleLyXformat2Token): warning about solitary \end_inset added
4918 (parseSingleLyXformat2Token): set last_inset_read
4919 (parseSingleLyXformat2Token): more code to read new "Float" correctly
4920 (parseSingleLyXformat2Token): don't double intializw string next_token
4922 * src/TextCache.C (text_fits::operator()): add const's to the signature
4923 (has_buffer::operator()): ditto
4925 * src/Floating.h: add some comments on the class
4927 * src/FloatList.[Ch] (typeExist): new method
4930 * src/BackStack.h: added default constructor, wanted by Gcc.
4932 2000-07-14 Juergen Vigna <jug@sad.it>
4934 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
4936 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
4938 * src/insets/insettabular.C (resizeLyXText): need this to be able to
4939 do a redraw when the window is resized!
4940 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
4942 * src/insets/insettext.C (resizeLyXText): added function to correctly
4943 being able to resize the LyXWindow.
4945 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
4947 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
4949 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
4950 crashes when closing dialog to a deleted inset.
4952 * src/insets/insetcite.[Ch] (Edit) : the return of this former
4953 method! Now similar to other insets.
4955 2000-07-13 Juergen Vigna <jug@sad.it>
4957 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
4959 * lib/examples/Literate.lyx: small patch!
4961 * src/insets/insetbib.C (Read): added this function because of wrong
4962 Write (without [begin|end]_inset).
4964 2000-07-11 Juergen Vigna <jug@sad.it>
4966 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
4967 as the insertInset could not be good!
4969 * src/screen.C (ToggleSelection): fixed toggle selection bug as
4970 the bool param should not be last.
4972 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4974 * sigc++/configure.in: fix bug in threading-related code (Yes, I
4975 did submit that to Karl).
4977 * configure.in: use -isystem instead of -I for X headers. This
4978 fixes a problem on solaris with a recent gcc;
4979 put the front-end code after the X detection code;
4980 configure in sigc++ before lib/
4982 * src/lyx_main.C (commandLineHelp): remove -display from command
4985 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
4987 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
4988 Also put in Makefile rules for building the ``listerrors''
4989 program for parsing errors from literate programs written in LyX.
4991 * lib/build-listerrors: Added small shell script as part of compile
4992 process. This builds a working ``listerrors'' binary if noweb is
4993 installed and either 1) the VNC X server is installed on the machine,
4994 or 2) the user is compiling from within a GUI. The existence of a GUI
4995 is necessary to use the ``lyx --export'' feature for now. This
4996 hack can be removed once ``lyx --export'' no longer requires a GUI to
4999 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
5001 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
5002 now passed back correctly from gcc and placed "under" error
5003 buttons in a Literate LyX source.
5005 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5007 * src/text.C (GetColumnNearX): Better behavior when a RTL
5008 paragraph is ended by LTR text.
5010 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
5013 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5015 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
5016 true when clipboard is empty.
5018 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5020 * text.C (Backspace): Prevent rebreaking of a row if it is the last
5021 row of the paragraph.
5022 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
5023 to prevent calculation of bidi tables
5025 2000-07-07 Juergen Vigna <jug@sad.it>
5027 * src/screen.C (ToggleSelection): added y_offset and x_offset
5030 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
5033 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
5035 * src/insets/insettext.C: fixed Layout-Display!
5037 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5039 * configure.in: add check for strings.h header.
5041 * src/spellchecker.C: include <strings.h> in order to have a
5042 definition for bzero().
5044 2000-07-07 Juergen Vigna <jug@sad.it>
5046 * src/insets/insettext.C (draw): set the status of the bv->text to
5047 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
5049 * src/screen.C (DrawOneRow):
5050 (DrawFromTo): redraw the actual row if something has changed in it
5053 * src/text.C (draw): call an update of the toplevel-inset if something
5054 has changed inside while drawing.
5056 * src/lyxtext.h: added CHANGED_IN_DRAW status.
5058 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
5060 * src/insets/insetbib.[Ch] (callback) new method, moving callback
5061 processing inside class.
5063 * src/insets/insetindex.[Ch] (callback) new method, moving callback
5064 processing inside class.
5066 * src/insets/insetindex.h new struct Holder, consistent with other
5069 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
5070 citation dialog from main code and placed it in src/frontends/xforms.
5071 Dialog launched through signals instead of callbacks
5073 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
5075 * lyx.man: update the options description.
5077 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
5079 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
5080 handle neg values, set min width to 590, add doc about -display
5082 2000-07-05 Juergen Vigna <jug@sad.it>
5084 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
5085 calls to BufferView *.
5087 * src/insets/insettext.C (checkAndActivateInset): small fix non
5088 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
5090 * src/insets/insetcommand.C (Read): Fixed as insets should read till
5091 their \end_inset token!
5093 2000-07-04 edscott <edscott@imp.mx>
5095 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
5096 lib/lyxrc.example: added option \wheel_jump
5098 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
5100 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
5101 remove support for -width,-height,-xpos and -ypos.
5103 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
5105 * src/encoding.[Ch]: New files.
5107 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
5108 (text): Call to the underline() method only when needed.
5110 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
5112 * src/buffer.C (makeLaTeXFile): Compute automatically the input
5113 encoding(s) for the document.
5115 * src/bufferparams.C (BufferParams): Changed default value of
5118 * src/language.C (newLang): Removed.
5119 (items[]): Added encoding information for all defined languages.
5121 * src/lyx_gui.C (create_forms): Added "auto" option to the input
5122 encoding choice button.
5124 * src/lyxrc.h (font_norm_type): New member variable.
5125 (set_font_norm_type): New method.
5127 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
5128 paragraphs with different encodings.
5130 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
5131 (TransformChar): Changed to work correctly with Arabic points.
5132 (draw): Added support for drawing Arabic points.
5133 (draw): Removed code for drawing underbars (this is done by
5136 * src/support/textutils.h (IsPrintableNonspace): New function.
5138 * src/BufferView_pimpl.h: Added "using SigC::Object".
5139 * src/LyXView.h: ditto.
5141 * src/insets/insetinclude.h (include_label): Changed to mutable.
5143 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5145 * src/mathed/math_iter.h: remove empty destructor
5147 * src/mathed/math_cursor.h: remove empty destructor
5149 * src/insets/lyxinset.h: add THEOREM_CODE
5151 * src/insets/insettheorem.[Ch]: new files
5153 * src/insets/insetminipage.C: (InsertInset): remove
5155 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
5157 (InsertInset): remove
5159 * src/insets/insetlist.C: (InsertList): remove
5161 * src/insets/insetfootlike.[Ch]: new files
5163 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
5166 (InsertInset): ditto
5168 * src/insets/insetert.C: remove include Painter.h, reindent
5169 (InsertInset): move to header
5171 * src/insets/insetcollapsable.h: remove explicit from default
5172 contructor, remove empty destructor, add InsertInset
5174 * src/insets/insetcollapsable.C (InsertInset): new func
5176 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5178 * src/vspace.h: add explicit to constructor
5180 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
5181 \textcompwordmark, please test this.
5183 * src/lyxrc.C: set ascii_linelen to 65 by default
5185 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
5187 * src/commandtags.h: add LFUN_INSET_THEOREM
5189 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
5190 (makeLinuxDocFile): remove _some_ of the nice logic
5191 (makeDocBookFile): ditto
5193 * src/Painter.[Ch]: (~Painter): removed
5195 * src/LyXAction.C (init): entry for insettheorem added
5197 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
5199 (deplog): code to detect files generated by LaTeX, needs testing
5202 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5204 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
5206 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5208 * src/LaTeX.C (deplog): Add a check for files that are going to be
5209 created by the first latex run, part of the project to remove the
5212 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
5213 contents to the extension list.
5215 2000-07-04 Juergen Vigna <jug@sad.it>
5217 * src/text.C (NextBreakPoint): added support for needFullRow()
5219 * src/insets/lyxinset.h: added needFullRow()
5221 * src/insets/insetcollapsable.C: redone now this uses a text-inset
5224 * src/insets/insettext.C: lots of changes for update!
5226 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
5228 * src/LaTeXFeatures.h: add a missing std:: qualifier.
5230 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
5232 * src/insets/insetinclude.C (InsetInclude): fixed
5233 initialization of include_label.
5234 (unique_id): now returns a string.
5236 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
5238 * src/LaTeXFeatures.h: new member IncludedFiles, for
5239 a map of key, included file name.
5241 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
5242 with the included files for inclusion in SGML preamble,
5243 i. e., linuxdoc and docbook.
5246 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
5247 nice (is the generated linuxdoc code to be exported?), that
5248 allows to remove column, and only_body that will be true for
5249 slave documents. Insets are allowed inside SGML font type.
5250 New handling of the SGML preamble for included files.
5251 (makeDocBookFile): the same for docbook.
5253 * src/insets/insetinclude.h:
5254 * src/insets/insetinclude.C (Validate): keeps a list of included files.
5256 (DocBook): new export methods.
5258 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
5259 and makeDocBookFile.
5261 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
5262 formats to export with command line argument -x.
5264 2000-06-29 Juergen Vigna <jug@sad.it>
5266 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
5267 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
5269 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
5270 region could already been cleared by an inset!
5272 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5274 * src/BufferView_pimpl.h: remove member variables lyx_focus and
5277 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
5279 (cursorToggle): remove special handling of lyx focus.
5281 2000-06-28 Juergen Vigna <jug@sad.it>
5283 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
5286 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5288 * src/insets/insetindex.C (Edit): add a callback when popup is
5291 * src/insets/insettext.C (LocalDispatch):
5292 * src/insets/insetmarginal.h:
5293 * src/insets/insetlist.h:
5294 * src/insets/insetfoot.h:
5295 * src/insets/insetfloat.h:
5296 * src/insets/insetert.h: add a missing std:: qualifier.
5298 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5300 * src/support/lyxsum.C (sum): '\0' teminate file read when using
5303 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
5305 * src/insets/insettext.C (Read): remove tmptok unused variable
5306 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
5307 (InsertInset): change for new InsetInset code
5309 * src/insets/insettext.h: add TEXT inline method
5311 * src/insets/insettext.C: remove TEXT macro
5313 * src/insets/insetmarginal.C (Write): new method
5314 (Latex): change output slightly
5316 * src/insets/insetfoot.C (Write): new method
5317 (Latex): change output slightly (don't use endl when no need)
5319 * src/insets/insetert.C (Write): new method
5321 * src/insets/insetcollapsable.h: make button_length, button_top_y
5322 and button_bottm_y protected.
5324 * src/insets/insetcollapsable.C (Write): simplify code by using
5325 tostr. Also do not output the float name, the children class
5326 should to that to get control over own arguments
5328 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
5329 src/insets/insetminipage.[Ch]:
5332 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5334 * src/lyxfunc.C (Dispatch): cases for new insets/commands
5336 * src/Makefile.am (lyx_SOURCES): add the new files
5338 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
5339 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
5340 * src/commandtags.h: ditto
5342 * src/LaTeXFeatures.h: add a std::set of used floattypes
5344 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
5346 * src/FloatList.[Ch] src/Floating.h: new files
5348 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
5350 * src/lyx_cb.C (TableApplyCB): ditto
5352 * src/text2.C: ditto
5353 * src/buffer.C (SimpleLinuxDocOnePar): ditto
5354 (parseSingleLyXformat2Token): ditto + add code for
5355 backwards compability for old float styles + add code for new insets
5357 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
5359 (InsertInset(size_type, Inset *, LyXFont)): new method
5360 (InsetChar(size_type, char)): changed to use the other InsetChar
5361 with a LyXFont(ALL_INHERIT).
5362 (InsetInset(size_type, Inset*)): changed to use InsetChar to
5363 insert the META_INSET.
5365 * sigc++/thread.cc (Privete<int>::operator int&): move definition
5367 * sigc++/thread.h (Threads): from here
5369 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
5370 definition out of line
5371 * sigc++/scope.h: from here
5373 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5375 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
5376 is specified (adapted from a patch from edscott <edscott@imp.mx>).
5378 * Makefile.am (bindist): new target.
5380 * INSTALL: add instructions for doing a binary distribution.
5382 * development/tools/README.bin.example: update a bit.
5384 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
5387 * lib/lyxrc.example: new lyxrc tag \set_color.
5389 * src/lyxfunc.C (Dispatch):
5390 * src/commandtags.h:
5391 * src/LyXAction.C: new lyxfunc "set-color".
5393 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
5394 and an x11name given as strings.
5396 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
5397 cache when a color is changed.
5399 2000-06-26 Juergen Vigna <jug@sad.it>
5401 * src/lyxrow.C (width): added this functions and variable.
5403 * src/insets/insetcite.C (create_form_citation_form): some Gravity
5406 * src/text.C (SetHeightOfRow): fixed calcualting of width.
5408 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5410 * images/undo_bw.xpm: new icon.
5411 * images/redo_bw.xpm: ditto.
5413 * configure.in (INSTALL_SCRIPT): change value to
5414 ${INSTALL} to avoid failures of install-script target.
5415 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
5417 * src/BufferView.h: add a magic "friend" declaration to please
5420 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
5422 * forms/cite.fd: modified to allow resizing without messing
5425 * src/insetcite.C: Uses code from cite.fd almost without
5427 User can now resize dialog in the x-direction.
5428 Resizing the dialog in the y-direction is prevented, as the
5429 code does this intelligently already.
5431 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5433 * INSTALL: remove obsolete entry in "problems" section.
5435 * lib/examples/sl_*.lyx: update of the slovenian examples.
5437 * src/support/FileInfo.[Ch] (getBlockSize): remove.
5439 2000-06-23 Juergen Vigna <jug@sad.it>
5441 * src/lyxtext.h: added a 'cleared' flag to draw() function.
5443 * src/buffer.C (resize): delete the LyXText of textinsets.
5445 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
5447 * src/insets/lyxinset.h: added another parameter 'cleared' to
5448 the draw() function.
5450 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
5451 unlocking inset in inset.
5453 2000-06-22 Juergen Vigna <jug@sad.it>
5455 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
5456 of insets and moved first to LyXText.
5458 * src/mathed/formulamacro.[Ch]:
5459 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
5461 2000-06-21 Juergen Vigna <jug@sad.it>
5463 * src/text.C (GetVisibleRow): look if I should clear the area or not
5464 using Inset::doClearArea() function.
5466 * src/insets/lyxinset.h: added doClearArea() function and
5467 modified draw(Painter &, ...) to draw(BufferView *, ...)
5469 * src/text2.C (UpdateInset): return bool insted of int
5471 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
5473 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
5474 combox in the character popup
5476 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
5477 BufferParams const & params
5479 2000-06-20 Juergen Vigna <jug@sad.it>
5481 * src/insets/insettext.C (SetParagraphData): set insetowner on
5484 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5486 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
5487 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
5489 (form_main_): remove
5491 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
5492 (create_form_form_main): remove FD_form_main stuff, connect to
5493 autosave_timeout signal
5495 * src/LyXView.[Ch] (getMainForm): remove
5496 (UpdateTimerCB): remove
5497 * src/BufferView_pimpl.h: inherit from SigC::Object
5499 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
5500 signal instead of callback
5502 * src/BufferView.[Ch] (cursorToggleCB): remove
5504 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5506 * src/BufferView_pimpl.C: changes because of the one below
5508 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
5509 instead of storing a pointer to a LyXText.
5511 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
5513 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
5515 * src/lyxparagraph.h
5517 * src/paragraph.C: Changed fontlist to a sorted vector.
5519 2000-06-19 Juergen Vigna <jug@sad.it>
5521 * src/BufferView.h: added screen() function.
5523 * src/insets/insettext.C (LocalDispatch): some selection code
5526 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
5528 * src/insets/insettext.C (SetParagraphData):
5530 (InsetText): fixes for multiple paragraphs.
5532 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
5534 * development/lyx.spec.in: Call configure with ``--without-warnings''
5535 to work around a bug with the Makefiles when doing ``make lyxrpm''.
5536 This should be fine, however, since we generally don't want to be
5537 verbose when making an RPM.
5539 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
5541 * lib/scripts/fig2pstex.py: New file
5543 2000-06-16 Juergen Vigna <jug@sad.it>
5545 * src/insets/insettabular.C (UpdateLocal):
5546 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
5547 (LocalDispatch): Changed all functions to use LyXText.
5549 2000-06-15 Juergen Vigna <jug@sad.it>
5551 * src/text.C (SetHeightOfRow): call inset::update before requesting
5554 * src/insets/insettext.C (update):
5555 * src/insets/insettabular.C (update): added implementation
5557 * src/insets/lyxinset.h: added update function
5559 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5561 * src/text.C (SelectNextWord): protect against null pointers with
5562 old-style string streams. (fix from Paul Theo Gonciari
5565 * src/cite.[Ch]: remove erroneous files.
5567 * lib/configure.m4: update the list of created directories.
5569 * src/lyxrow.C: include <config.h>
5570 * src/lyxcursor.C: ditto.
5572 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5574 * lib/examples/decimal.lyx: new example file from Mike.
5576 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
5577 to find template definitions (from Dekel)
5579 * src/frontends/.cvsignore: add a few things.
5581 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
5583 * src/Timeout.C (TimeOut): remove default argument.
5585 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
5588 * src/insets/ExternalTemplate.C: add a "using" directive.
5590 * src/lyx_main.h: remove the act_ struct, which seems unused
5593 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5595 * LyX Developers Meeting: All files changed, due to random C++ (by
5596 coincidence) code generator script.
5598 - external inset (cool!)
5599 - initial online editing of preferences
5600 - insettabular breaks insettext(s contents)
5602 - some DocBook fixes
5603 - example files update
5604 - other cool stuff, create a diff and look for yourself.
5606 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
5608 * src/insets/insettext.C (computeTextRows): if the maxWidth is
5609 -1 this is a non-line-breaking textinset.
5611 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
5612 if there is no width set.
5614 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5616 * Lots of files: Merged the dialogbase branch.
5618 2000-06-09 Allan Rae <rae@lyx.org>
5620 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
5621 and the Dispatch methods that used it.
5623 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
5624 access to functions formerly kept in Dispatch.
5626 2000-05-19 Allan Rae <rae@lyx.org>
5628 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
5629 made to_page and count_copies integers again. from_page remains a
5630 string however because I want to allow entry of a print range like
5631 "1,4,22-25" using this field.
5633 * src/LyXAction.C: added action info and commands for buffer-print-xtl
5634 and printer-params-get. These aren't useful from the minibuffer but
5635 could be used by a script/LyXServer app provided it passes a suitable
5636 auto_mem_buffer. I guess I should take a look at how the LyXServer
5637 works and make it support xtl buffers.
5639 * sigc++/: updated to libsigc++-1.0.1
5641 * src/xtl/: updated to xtl-1.3.pl.11
5643 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
5644 those changes done to the files in src/ are actually recreated when
5645 they get regenerated. Please don't ever accept a patch that changes a
5646 dialog unless that patch includes the changes to the corresponding *.fd
5649 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
5650 stringOnlyContains, renamed it and generalised it.
5652 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
5653 branch. Removed the remaining old form_print code.
5655 2000-04-26 Allan Rae <rae@lyx.org>
5657 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
5658 trap I was trying to fix with the ID: fields in src/xtl/ :-)
5660 2000-04-25 Allan Rae <rae@lyx.org>
5662 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
5663 against a base of xtl-1.3.pl.4
5665 * development/tools/lxtl.sh: fixed a couple of silly typos and now
5666 filter the Id: entries so they still show the xtl version number
5669 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
5670 into the src/xtl code. Patch still pending with José (XTL)
5672 2000-04-24 Allan Rae <rae@lyx.org>
5674 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
5675 both more generic and much safer. Use the new template functions.
5676 * src/buffer.[Ch] (Dispatch): ditto.
5678 * src/frontends/xforms/FormPrint.C (update): Use new template functions
5679 and mem buffer more intelligently. Also a little general cleanup.
5682 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
5683 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
5684 * src/xtl/Makefile.am: ditto.
5685 * src/xtl/.cvsignore: ditto.
5686 * src/Makefile.am: ditto.
5688 * src/PrinterParams.h: Removed the macros member functions. Added a
5689 testInvariant member function. A bit of tidying up and commenting.
5690 Included Angus's idea for fixing operation with egcs-1.1.2.
5692 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
5693 cool expansion of XTL's mem_buffer to support automatic memory
5694 management within the buffer itself. Removed the various macros and
5695 replaced them with template functions that use either auto_mem_buffer
5696 or mem_buffer depending on a #define. The mem_buffer support will
5697 disappear as soon as the auto_mem_buffer is confirmed to be good on
5698 other platforms/compilers. That is, it's there so you've got something
5701 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
5702 effectively forked XTL. However I expect José will include my code
5703 into the next major release. Also fixed a memory leak.
5704 * src/xtl/text.h: ditto.
5705 * src/xtl/xdr.h: ditto.
5706 * src/xtl/giop.h: ditto.
5708 2000-04-16 Allan Rae <rae@lyx.org>
5710 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
5711 by autogen.sh and removed by maintainer-clean anyway.
5712 * .cvsignore, sigc++/.cvsignore: Support the above.
5714 * sigc++/.cvsignore: Forgot that retbind.h was generated.
5716 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
5718 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
5719 macros, renamed static callback-target member functions to suit new
5720 scheme and made them public.
5721 * src/frontends/xforms/forms/form_print.fd: ditto.
5722 * src/frontends/xforms/forms/form_copyright.fd: ditto.
5724 * src/support/lxtl.h: small cleanup to use typedef instead of #define
5727 * src/xtl/: New directory containing a minimal distribution of XTL.
5728 This is XTL-1.3.pl.4.
5730 * development/tools/lxtl.sh: A script to generate the above mini-dist.
5732 2000-04-15 Allan Rae <rae@lyx.org>
5734 * development/tools/makeLyXsigc.sh: Remove the library version numbers
5736 * sigc++/: Updated to libsigc++-1.0.0
5738 2000-04-14 Allan Rae <rae@lyx.org>
5740 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
5741 use the generic ones in future. I'll modify my conversion script.
5743 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
5745 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
5746 (CloseAllBufferRelatedDialogs): Renamed.
5747 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
5749 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
5750 of the generic ones. These are the same ones my conversion script
5753 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
5754 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
5755 * src/buffer.C (Dispatch): ditto
5757 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
5758 functions for updating and hiding buffer dependent dialogs.
5759 * src/BufferView.C (buffer): ditto
5760 * src/buffer.C (setReadonly): ditto
5761 * src/lyxfunc.C (CloseBuffer): ditto
5763 * src/buffer.h: Take setReadonly() out of line so I don't have to include
5764 Dialogs.h, and hence all the SigC stuff, into every file that includes
5765 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
5767 * src/BufferView2.C: reduce the number of headers included by buffer.h
5769 2000-04-11 Allan Rae <rae@lyx.org>
5771 * src/frontends/xforms/xform_macros.h: A small collection of macros
5772 for building C callbacks.
5774 * src/frontends/xforms/Makefile.am: Added above file.
5776 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
5777 scheme again. This time it should work for JMarc. If this is
5778 successful I'll revise my conversion script to automate some of this.
5779 The static member functions in the class also have to be public for
5780 this scheme will work. If the scheme works (it's almost identical to
5781 the way BufferView::cursorToggleCB is handled so it should work) then
5782 FormCopyright and FormPrint will be ready for inclusion into the main
5783 trunk immediately after 1.1.5 is released -- provided we're prepared
5784 for complaints about lame compilers not handling XTL.
5786 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
5788 2000-04-07 Allan Rae <rae@lyx.org>
5790 * config/lyxinclude.m4: A bit more tidying up (Angus)
5792 * src/LString.h: JMarc's <string> header fix
5794 * src/PrinterParams.h: Used string for most data to remove some
5795 ugly code in the Print dialog and avoid even uglier code when
5796 appending the ints to a string for output.
5798 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
5799 and moved "default:" back to the end of switch statement. Cleaned
5800 up the printing so it uses the right function calls and so the
5801 "print to file" option actually puts the file in the right directory.
5803 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
5805 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
5806 and Ok+Apply button control into a separate method: input (Angus).
5807 (input) Cleaned it up and improved it to be very thorough now.
5808 (All CB) static_cast used instead of C style cast (Angus). This will
5809 probably change again once we've worked out how to keep gcc-2.8.1 happy
5810 with real C callbacks.
5811 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
5812 ignore some of the bool settings and has random numbers instead. Needs
5813 some more investigation. Added other input length checks and checking
5814 of file and printer names.
5816 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
5817 would link (Angus). Seems the old code doesn't compile with the pragma
5818 statement either. Separated callback entries from internal methods.
5820 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
5822 2000-03-17 Allan Rae <rae@lyx.org>
5824 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
5825 need it? Maybe it could go in Dialogs instead? I could make it a
5826 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
5827 values to get the bool return value.
5828 (Dispatch): New overloaded method for xtl support.
5830 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
5831 extern "C" callback instead of static member functions. Hopefully,
5832 JMarc will be able to compile this. I haven't changed
5833 forms/form_copyright.fd yet. Breaking one of my own rules already.
5835 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
5836 because they aren't useful from the minibuffer. Maybe a LyXServer
5837 might want a help message though?
5839 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
5841 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
5842 xtl which needs both rtti and exceptions.
5844 * src/support/Makefile.am:
5845 * src/support/lxtl.h: New file. Some helper macros for using XTL.
5847 * src/frontends/xforms/input_validators.[ch]: input filters and
5848 validators. These conrol what keys are valid in input boxes.
5849 Use them and write some more. Much better idea than waiting till
5850 after the user has pressed Ok to say that the input fields don't make
5853 * src/frontends/xforms/Makefile.am:
5854 * src/frontends/xforms/forms/form_print.fd:
5855 * src/frontends/xforms/forms/makefile:
5856 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
5857 new scheme. Still have to make sure I haven't missed anything from
5858 the current implementation.
5860 * src/Makefile.am, src/PrinterParams.h: New data store.
5862 * other files: Added a couple of copyright notices.
5864 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5866 * src/insets/insetbib.h: move Holder struct in public space.
5868 * src/frontends/include/DialogBase.h: use SigC:: only when
5869 SIGC_CXX_NAMESPACES is defined.
5870 * src/frontends/include/Dialogs.h: ditto.
5872 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
5874 * src/frontends/xforms/FormCopyright.[Ch]: do not
5875 mention SigC:: explicitely.
5877 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5879 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
5880 deals with testing KDE in main configure.in
5881 * configure.in: ditto.
5883 2000-02-22 Allan Rae <rae@lyx.org>
5885 * Lots of files: Merged from HEAD
5887 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
5888 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
5890 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
5892 * sigc++/: new minidist.
5894 2000-02-14 Allan Rae <rae@lyx.org>
5896 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
5898 2000-02-08 Juergen Vigna <jug@sad.it>
5900 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
5901 file for the buildin GUI builder of KDevelop of the copyright-dialog.
5903 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
5904 for this port and so it is much easier for other people to port
5905 dialogs in a common development environment.
5907 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
5908 the QT/KDE implementation.
5910 * src/frontends/kde/Dialogs.C:
5911 * src/frontends/kde/FormCopyright.C:
5912 * src/frontends/kde/FormCopyright.h:
5913 * src/frontends/kde/Makefile.am:
5914 * src/frontends/kde/formcopyrightdialog.C:
5915 * src/frontends/kde/formcopyrightdialog.h:
5916 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
5917 for the kde support of the Copyright-Dialog.
5919 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
5920 subdir-substitution instead of hardcoded 'xforms' as we now have also
5923 * src/frontends/include/DialogBase.h (Object): just commented the
5924 label after #endif (nasty warning and I don't like warnings ;)
5926 * src/main.C (main): added KApplication initialization if using
5929 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
5930 For now only the KDE event-loop is added if frontend==kde.
5932 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
5934 * configure.in: added support for the --with-frontend[=value] option
5936 * autogen.sh: added kde.m4 file to list of config-files
5938 * acconfig.h: added define for KDEGUI-support
5940 * config/kde.m4: added configuration functions for KDE-port
5942 * config/lyxinclude.m4: added --with-frontend[=value] option with
5943 support for xforms and KDE.
5945 2000-02-08 Allan Rae <rae@lyx.org>
5947 * all Makefile.am: Fixed up so the make targets dist, distclean,
5948 install and uninstall all work even if builddir != srcdir. Still
5949 have a new sigc++ minidist update to come.
5951 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
5953 2000-02-01 Allan Rae <rae@lyx.org>
5955 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
5956 Many mods to get builddir != srcdir working.
5958 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
5959 for building on NT and so we can do the builddir != srcdir stuff.
5961 2000-01-30 Allan Rae <rae@lyx.org>
5963 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
5964 This will stay in "rae" branch. We probably don't really need it in
5965 the main trunk as anyone who wants to help programming it should get
5966 a full library installed also. So they can check both included and
5967 system supplied library compilation.
5969 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
5970 Added a 'mini' distribution of libsigc++. If you feel the urge to
5971 change something in these directories - Resist it. If you can't
5972 resist the urge then you should modify the following script and rebuild
5973 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
5974 all happen. Still uses a hacked version of libsigc++'s configure.in.
5975 I'm quite happy with the results. I'm not sure the extra work to turn
5976 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
5977 worth the trouble and would probably lead to extra maintenance
5979 I haven't tested the following important make targets: install, dist.
5980 Not ready for prime time but very close. Maybe 1.1.5.
5982 * development/tools/makeLyXsigc.sh: A shell script to automatically
5983 generate our mini-dist of libsigc++. It can only be used with a CVS
5984 checkout of libsigc++ not a tarball distribution. It's well commented.
5985 This will end up as part of the libsigc++ distribution so other apps
5986 can easily have an included mini-dist. If someone makes mods to the
5987 sigc++ subpackage without modifying this script to generate those
5988 changes I'll be very upset!
5990 * src/frontends/: Started the gui/system indep structure.
5992 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
5993 to access the gui-indep dialogs are in this class. Much improved
5994 design compared to previous revision. Lars, please refrain from
5995 moving this header into src/ like you did with Popups.h last time.
5997 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
5999 * src/frontends/xforms/: Started the gui-indep system with a single
6000 dialog: FormCopyright. Initial testing of use of libsigc++ was very
6003 * src/frontends/xforms/forms: Repository for the xforms .fd files.
6004 Here you'll find a very useful makefile and automated fdfix.sh that
6005 makes updating dailogs a no-brainer -- provided you follow the rules
6006 set out in the README. I'm thinking about adding another script to
6007 automatically generate skeleton code for a new dialog given just the
6010 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
6011 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
6012 Made FormCopyright gui-indep and added a lyxfunc to get to it.
6014 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6016 * src/support/LSubstring.C (operator): simplify
6018 * src/lyxtext.h: removed bparams, use buffer_->params instead
6020 * src/lyxrow.h: make Row a real class, move all variables to
6021 private and use accessors.
6023 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
6025 (isRightToLeftPar): ditto
6026 (ChangeLanguage): ditto
6027 (isMultiLingual): ditto
6030 (SimpleTeXOnePar): ditto
6031 (TeXEnvironment): ditto
6032 (GetEndLabel): ditto
6034 (SetOnlyLayout): ditto
6035 (BreakParagraph): ditto
6036 (BreakParagraphConservative): ditto
6037 (GetFontSettings): ditto
6039 (CopyIntoMinibuffer): ditto
6040 (CutIntoMinibuffer): ditto
6041 (PasteParagraph): ditto
6042 (SetPExtraType): ditto
6043 (UnsetPExtraType): ditto
6044 (DocBookContTableRows): ditto
6045 (SimpleDocBookOneTablePar): ditto
6047 (TeXFootnote): ditto
6048 (SimpleTeXOneTablePar): ditto
6049 (TeXContTableRows): ditto
6050 (SimpleTeXSpecialChars): ditto
6053 * src/lyxcursor.h: make LyXCursor a real class, move all variables
6054 to private and use accessors.
6056 * src/lyx_cb.C: remove char updatetimer, and all code that uses
6057 this, we did not use it anymore and has not been for ages. Just a
6058 waste of cpu cycles.
6060 * src/language.h: make Language a real class, move all variables
6061 to private and use accessors.
6063 * src/BufferView_pimpl.C (Pimpl): use new timer code.
6064 (create_view): remove
6065 (update): some changes for new timer
6066 (cursorToggle): use new timer
6067 (beforeChange): change for new timer
6069 * src/BufferView.h (cursorToggleCB): removed last paramter because
6072 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
6073 (cursorToggleCB): change because of new timer code
6075 * lib/CREDITS: updated own mailaddress
6077 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6079 * src/support/filetools.C (PutEnv): fix the code in case neither
6080 putenv() nor setenv() have been found.
6082 * INSTALL: mention the install-strip Makefile target.
6084 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
6085 read-only documents.
6087 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6089 * lib/reLyX/configure.in (VERSION): avoid using a previously
6090 generated reLyX wrapper to find out $prefix.
6092 * lib/examples/eu_adibide_lyx-atua.lyx:
6093 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
6094 translation of the Tutorial (Dooteo)
6096 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
6098 * forms/cite.fd: new citation dialog
6100 * src/insetcite.[Ch]: the new citation dialog is moved into
6103 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
6106 * src/insets/insetcommand.h: data members made private.
6108 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6110 * LyX 1.1.5 released
6112 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6114 * src/version.h (LYX_RELEASE): to 1.1.5
6116 * src/spellchecker.C (RunSpellChecker): return false if the
6117 spellchecker dies upon creation.
6119 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6121 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
6122 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
6126 * lib/CREDITS: update entry for Martin Vermeer.
6128 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
6130 * src/text.C (draw): Draw foreign language bars at the bottom of
6131 the row instead of at the baseline.
6133 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
6135 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6137 * lib/bind/de_menus.bind: updated
6139 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6141 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
6143 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6145 * src/menus.C (Limit_string_length): New function
6146 (ShowTocMenu): Limit the number of items/length of items in the
6149 * src/paragraph.C (String): Correct result for a paragraph inside
6152 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6154 * src/bufferlist.C (close): test of buf->getuser() == NULL
6156 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
6158 * src/BufferView2.C (removeAutoInsets): Fix a bug:
6159 Do not call to SetCursor when the paragraph is a closed footnote!
6161 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
6163 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
6166 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
6168 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6171 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
6172 reference popup, that activates the reference-back action
6174 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
6176 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
6177 the menus. Also fixed a bug.
6179 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
6180 the math panels when switching buffers (unless new buffer is readonly).
6182 * src/BufferView.C (NoSavedPositions)
6183 * src/BufferView_pimpl.C (NoSavedPositions): New methods
6185 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6187 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
6188 less of dvi dirty or not.
6190 * src/trans_mgr.[Ch] (insert): change first parameter to string
6193 * src/chset.[Ch] (encodeString): add const to first parameter
6195 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6197 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
6201 * src/LaTeX.C (deplog): better searching for dependency files in
6202 the latex log. Uses now regexps.
6204 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
6205 instead of the box hack or \hfill.
6207 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6209 * src/lyxfunc.C (doImportHelper): do not create the file before
6210 doing the actual import.
6211 (doImportASCIIasLines): create a new file before doing the insert.
6212 (doImportASCIIasParagraphs): ditto.
6214 * lib/lyxrc.example: remove mention of non-existing commands
6216 * lyx.man: remove mention of color-related switches.
6218 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
6220 * src/lyx_gui.C: remove all the color-related ressources, which
6221 are not used anymore.
6223 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
6226 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6228 * src/lyxrc.C (read): Add a missing break in the switch
6230 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
6232 * src/text2.C (InsertStringA): Fix a bug with insertion into table
6234 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
6237 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6239 * src/text.C (draw): draw bars under foreign language words.
6241 * src/LColor.[Ch]: add LColor::language
6243 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6245 * src/lyxcursor.h (boundary): New member variable
6247 * src/text.C (IsBoundary): New methods
6249 * src/text.C: Use the above for currect cursor movement when there
6250 is both RTL & LTR text.
6252 * src/text2.C: ditto
6254 * src/bufferview_funcs.C (ToggleAndShow): ditto
6256 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6258 * src/text.C (DeleteLineForward): set selection to true to avoid
6259 that DeleteEmptyParagraphMechanism does some magic. This is how it
6260 is done in all other functions, and seems reasonable.
6261 (DeleteWordForward): do not jump over non-word stuff, since
6262 CursorRightOneWord() already does it.
6264 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
6265 DeleteWordBackward, since they seem safe to me (since selection is
6266 set to "true") DeleteEmptyParagraphMechanism does nothing.
6268 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6270 * src/lyx_main.C (easyParse): simplify the code by factoring the
6271 part that removes parameters from the command line.
6272 (LyX): check wether wrong command line options have been given.
6274 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
6276 * src/lyx_main.C : add support for specifying user LyX
6277 directory via command line option -userdir.
6279 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
6281 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
6282 the number of items per popup.
6283 (Add_to_refs_menu): Ditto.
6285 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6287 * src/lyxparagraph.h: renamed ClearParagraph() to
6288 StripLeadingSpaces() and moved it to paragraph.C. We pass the
6289 textclass as parameter, and do nothing if free_spacing is
6290 true. This fixes part of the line-delete-forward problems.
6292 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
6293 (pasteSelection): ditto.
6294 (SwitchLayoutsBetweenClasses): more translatable strings.
6296 * src/text2.C (CutSelection): use StripLeadingSpaces.
6297 (PasteSelection): ditto.
6298 (DeleteEmptyParagraphMechanism): ditto.
6300 2000-05-26 Juergen Vigna <jug@sad.it>
6302 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
6303 is not needed in tabular insets.
6305 * src/insets/insettabular.C (TabularFeatures): added missing features.
6307 * src/tabular.C (DeleteColumn):
6309 (AppendRow): implemented this functions
6310 (cellsturct::operator=): clone the inset too;
6312 2000-05-23 Juergen Vigna <jug@sad.it>
6314 * src/insets/insettabular.C (LocalDispatch): better selection support
6315 when having multicolumn-cells.
6317 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6319 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
6321 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6323 * src/ColorHandler.C (getGCForeground): put more test into _()
6325 * lib/examples/eu_splash.lyx: new file (Basque translation) from
6328 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
6331 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
6333 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
6334 there are no labels, or when buffer is readonly.
6336 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
6337 there are no labels, buffer is SGML, or when buffer is readonly.
6339 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6341 * src/LColor.C (LColor): change a couple of grey40 to grey60
6342 (LColor): rewore initalization to make compiles go some magnitude
6344 (getGUIName): don't use gettext until we need the string.
6346 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
6348 * src/Bullet.[Ch]: Fixed a small bug.
6350 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
6352 * src/paragraph.C (String): Several fixes/improvements
6354 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
6356 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6358 * src/paragraph.C (String): give more correct output.
6360 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
6362 * src/lyxfont.C (stateText) Do not output the language if it is
6363 eqaul to the language of the document.
6365 * src/paragraph.C (TeXOnePar): Do not put language switch commands
6366 between two paragraphs with the same language.
6368 * src/paragraph.C (getParLanguage) Return a correct answer for an
6369 empty dummy paragraph.
6371 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
6374 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
6377 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
6378 the menus/popup, if requested fonts are unavailable.
6380 2000-05-22 Juergen Vigna <jug@sad.it>
6382 * src/insets/insettabular.C (LocalDispatch): added some more cursor
6383 movement support (Up/Down/Tab/Shift-Tab).
6384 (LocalDispatch): added also preliminari cursor-selection.
6386 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
6388 * src/paragraph.C (PasteParagraph): Hopefully now right!
6390 2000-05-22 Garst R. Reese <reese@isn.net>
6392 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
6393 of list, change all references to Environment to Command
6394 * tex/hollywood.cls : rewrite environments as commands, add
6395 \uppercase to interiorshot and exteriorshot to force uppecase.
6396 * tex/broadway.cls : rewrite environments as commands. Tweak
6399 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6401 * src/menus.C (Add_to_toc_menu): fix the code which limits the
6402 size of items: use a constant intead of the hardcoded 40, and more
6403 importantly do not remove the %m and %x tags added at the end.
6404 (Add_to_refs_menu): use vector::size_type instead of
6405 unsigned int as basic types for the variables. _Please_ do not
6406 assume that size_t is equal to unsigned int. On an alpha, this is
6407 unsigned long, which is _not_ the same.
6409 * src/language.C (initL): remove language "hungarian", since it
6410 seems that "magyar" is better.
6412 2000-05-22 Juergen Vigna <jug@sad.it>
6414 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
6416 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
6419 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
6420 next was deleted but not set to 0.
6422 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6424 * src/language.C (initL): change the initialization of languages
6425 so that compiles goes _fast_.
6427 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
6430 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
6432 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6436 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6438 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
6440 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
6444 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
6447 * src/insets/insetlo*.[Ch]: Made editable
6449 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6451 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
6452 the current selection.
6454 * src/BufferView_pimpl.C (stuffClipboard): new method
6456 * src/BufferView.C (stuffClipboard): new method
6458 * src/paragraph.C (String): new method
6460 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
6461 LColor::ignore when lyxname is not found.
6463 * src/BufferView.C (pasteSelection): new method
6465 * src/BufferView_pimpl.C (pasteSelection): new method
6467 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
6469 * src/WorkArea.C (request_clipboard_cb): new static function
6470 (getClipboard): new method
6471 (putClipboard): new method
6473 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6475 * LyX 1.1.5pre2 released
6477 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6479 * src/vspace.C (operator=): removed
6480 (operator=): removed
6482 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
6484 * src/layout.C (NumberOfClass): manually set the type in make_pair
6485 (NumberOfLayout): ditto
6487 * src/language.C: use the Language constructor for ignore_lang
6489 * src/language.h: add constructors to struct Language
6491 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
6493 * src/text2.C (SetCursorIntern): comment out #warning
6495 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
6497 * src/mathed/math_iter.h: initialize sx and sw to 0
6499 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6501 * forms/lyx.fd: Redesign of form_ref
6503 * src/LaTeXFeatures.[Ch]
6507 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
6510 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
6511 and Buffer::inset_iterator.
6513 * src/menus.C: Added new menus: TOC and Refs.
6515 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
6517 * src/buffer.C (getTocList): New method.
6519 * src/BufferView2.C (ChangeRefs): New method.
6521 * src/buffer.C (getLabelList): New method. It replaces the old
6522 getReferenceList. The return type is vector<string> instead of
6525 * src/insets/insetinclude.C (getLabelList): New method. Replaces
6526 the old getLabel() and GetNumberOfLabels() methods.
6527 * src/insets/insetlabel.C (getLabelList): ditto
6528 * src/mathed/formula.C (getLabelList): ditto
6530 * src/paragraph.C (String): New method.
6532 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
6533 Uses the new getTocList() method.
6534 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
6535 which automatically updates the contents of the browser.
6536 (RefUpdateCB): Use the new getLabelList method.
6538 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
6540 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
6542 * src/spellchecker.C: Added using std::reverse;
6544 2000-05-19 Juergen Vigna <jug@sad.it>
6546 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
6548 * src/insets/insettext.C (computeTextRows): small fix for display of
6549 1 character after a newline.
6551 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
6554 2000-05-18 Juergen Vigna <jug@sad.it>
6556 * src/insets/insettabular.C (TabularFeatures): fixed update of display
6557 when changing width of column.
6559 * src/tabular.C (set_row_column_number_info): setting of
6560 autobreak rows if necessary.
6562 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6564 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
6566 * src/vc-backend.*: renamed stat() to status() and vcstat to
6567 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
6568 compilation broke. The new name seems more relevant, anyway.
6570 2000-05-17 Juergen Vigna <jug@sad.it>
6572 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
6573 which was wrong if the removing caused removing of rows!
6575 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
6576 (pushToken): new function.
6578 * src/text2.C (CutSelection): fix problem discovered with purify
6580 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6582 * src/debug.C (showTags): enlarge the first column, now that we
6583 have 6-digits debug codes.
6585 * lib/layouts/hollywood.layout:
6586 * lib/tex/hollywood.cls:
6587 * lib/tex/brodway.cls:
6588 * lib/layouts/brodway.layout: more commands and fewer
6589 environments. Preambles moved in the .cls files. Broadway now has
6590 more options on scene numbering and less whitespace (from Garst)
6592 * src/insets/insetbib.C (getKeys): make sure that we are in the
6593 document directory, in case the bib file is there.
6595 * src/insets/insetbib.C (Latex): revert bogus change.
6597 2000-05-16 Juergen Vigna <jug@sad.it>
6599 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
6600 the TabularLayout on cursor move.
6602 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
6604 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
6607 (draw): fixed cursor position and drawing so that the cursor is
6608 visible when before the tabular-inset.
6610 * src/insets/insettext.C (init): drawLockedFrame was not initialized
6611 when creating from old insettext.
6613 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
6615 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6617 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
6618 * lib/tex/brodway.cls: ditto
6620 * lib/layouts/brodway.layout: change alignment of parenthical
6623 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6625 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
6626 versions 0.88 and 0.89 are supported.
6628 2000-05-15 Juergen Vigna <jug@sad.it>
6630 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
6633 * src/insets/insettext.C (computeTextRows): redone completely this
6634 function in a much cleaner way, because of problems when having a
6636 (draw): added a frame border when the inset is locked.
6637 (SetDrawLockedFrame): this sets if we draw the border or not.
6638 (SetFrameColor): this sets the frame color (default=insetframe).
6640 * src/insets/lyxinset.h: added x() and y() functions which return
6641 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
6642 function which is needed to see if we have a locking inset of some
6643 type in this inset (needed for now in insettabular).
6645 * src/vspace.C (inPixels): the same function also without a BufferView
6646 parameter as so it is easier to use it in some ocasions.
6648 * src/lyxfunc.C: changed all places where insertInset was used so
6649 that now if it couldn't be inserted it is deleted!
6651 * src/TabularLayout.C:
6652 * src/TableLayout.C: added support for new tabular-inset!
6654 * src/BufferView2.C (insertInset): this now returns a bool if the
6655 inset was really inserted!!!
6657 * src/tabular.C (GetLastCellInRow):
6658 (GetFirstCellInRow): new helper functions.
6659 (Latex): implemented for new tabular class.
6663 (TeXTopHLine): new Latex() helper functions.
6665 2000-05-12 Juergen Vigna <jug@sad.it>
6667 * src/mathed/formulamacro.C (Read):
6668 * src/mathed/formula.C (Read): read also the \end_inset here!
6670 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6672 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
6673 crush when saving formulae with unbalanced parenthesis.
6675 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
6677 * src/layout.C: Add new keyword "endlabelstring" to layout file
6679 * src/text.C (GetVisibleRow): Draw endlabel string.
6681 * lib/layouts/broadway.layout
6682 * lib/layouts/hollywood.layout: Added endlabel for the
6683 Parenthetical layout.
6685 * lib/layouts/heb-article.layout: Do not use slanted font shape
6686 for Theorem like environments.
6688 * src/buffer.C (makeLaTeXFile): Always add "american" to
6689 the UsedLanguages list if document language is RTL.
6691 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6693 * add addendum to README.OS2 and small patch (from SMiyata)
6695 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6697 * many files: correct the calls to ChangeExtension().
6699 * src/support/filetools.C (ChangeExtension): remove the no_path
6700 argument, which does not belong there. Use OnlyFileName() instead.
6702 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
6703 files when LaTeXing a non-nice latex file.
6705 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
6706 a chain of "if". Return false when deadkeys are not handled.
6708 * src/lyx_main.C (LyX): adapted the code for default bindings.
6710 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
6711 bindings for basic functionality (except deadkeys).
6712 (deadKeyBindings): new method. Performs the bindings of deadkeys.
6714 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
6715 several methods: handle override_x_deadkeys.
6717 * src/lyxrc.h: remove the "bindings" map, which did not make much
6718 sense anyway. New variable override_x_deadkeys, defaulting to "true".
6720 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6722 * src/lyxfont.C (stateText): use a saner method to determine
6723 whether the font is "default". Seems to fix the crash with DEC
6726 * src/Bullet.[Ch] (Bullet): remove const on parameters.
6728 2000-05-08 Juergen Vigna <jug@sad.it>
6730 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
6731 TabularLayoutMenu with mouse-button-3
6732 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
6734 * src/TabularLayout.C: added this file for having a Layout for
6737 2000-05-05 Juergen Vigna <jug@sad.it>
6739 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
6740 recalculating inset-widths.
6741 (TabularFeatures): activated this function so that I can change
6742 tabular-features via menu.
6744 * src/menus.C (ShowEditMenu): inserted support for insettabular so
6745 that I can test some functions with the Table menu.
6747 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6749 * src/lyxfont.C (stateText): guard against stupid c++libs.
6751 * src/tabular.C: add using std::vector
6752 some whitespace changes, + removed som autogenerated code.
6754 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
6756 2000-05-05 Juergen Vigna <jug@sad.it>
6758 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
6759 row, columns and cellstructures.
6761 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6763 * lib/lyxrc.example: remove obsolete entries.
6765 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
6766 reading of protected_separator for free_spacing.
6768 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6770 * src/text.C (draw): do not display an exclamation mark in the
6771 margin for margin notes. This is confusing, ugly and
6774 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
6775 AMS math' is checked.
6777 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
6778 name to see whether including the amsmath package is needed.
6780 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
6782 * src/paragraph.C (validate): Compute UsedLanguages correctly
6783 (don't insert the american language if it doesn't appear in the
6786 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
6787 The argument of \thanks{} command is considered moving argument
6789 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
6792 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
6794 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
6795 for appendix/minipage/depth. The lines can be now both in the footnote
6796 frame, and outside the frame.
6798 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
6801 2000-05-05 Juergen Vigna <jug@sad.it>
6803 * src/table.[Ch]: removed the inset and buffer stuff as this is now
6804 neede only in tabular.[Ch].
6806 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6808 * src/insets/insetspecialchar.C (Read): allow command == '~' for
6810 (Write): write '~' for PROTECTED_SEPARATOR
6812 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6814 * src/lyxparagraph.h: add a friend struct matchIT after the struct
6817 * src/mathed/formula.C (drawStr): rename size to siz.
6819 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
6820 possibly fix a bug by not changing the pflags = flags to piflags =
6823 2000-05-05 Juergen Vigna <jug@sad.it>
6825 * src/insets/insetbib.C: moved using directive
6827 * src/ImportNoweb.C: small fix for being able to compile (missing
6830 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6832 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
6833 to use clear, since we don't depend on this in the code. Add test
6836 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6838 * (various *.C files): add using std::foo directives to please dec
6841 * replace calls to string::clear() to string::erase() (Angus)
6843 * src/cheaders/cmath: modified to provide std::abs.
6845 2000-05-04 Juergen Vigna <jug@sad.it>
6847 * src/insets/insettext.C: Prepared all for inserting of multiple
6848 paragraphs. Still display stuff to do (alignment and other things),
6849 but I would like to use LyXText to do this when we cleaned out the
6850 table-support stuff.
6852 * src/insets/insettabular.C: Changed lot of stuff and added lots
6853 of functionality still a lot to do.
6855 * src/tabular.C: Various functions changed name and moved to be
6856 const functions. Added new Read and Write functions and changed
6857 lots of things so it works good with tabular-insets (also removed
6858 some stuff which is not needed anymore * hacks *).
6860 * src/lyxcursor.h: added operators == and != which just look if
6861 par and pos are (not) equal.
6863 * src/buffer.C (latexParagraphs): inserted this function to latex
6864 all paragraphs form par to endpar as then I can use this too for
6867 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
6868 so that I can call this to from text insets with their own cursor.
6870 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
6871 output off all paragraphs (because of the fix below)!
6873 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
6874 the very last paragraph (this could be also the last paragraph of an
6877 * src/texrow.h: added rows() call which returns the count-variable.
6879 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6881 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
6883 * lib/configure.m4: better autodetection of DocBook tools.
6885 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6887 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
6889 * src/lyx_cb.C: add using std::reverse;
6891 * src/LaTeX.C (run): on error always run deleteFilesOnError before
6894 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
6895 selected files. Should fix repeated errors from generated files.
6897 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
6899 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
6901 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
6902 the spellchecker popup.
6904 * lib/lyxrc.example: Removed the \number_inset section
6906 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6908 * src/insets/figinset.C (various): Use IsFileReadable() to make
6909 sure that the file actually exist. Relying on ghostscripts errors
6910 is a bad idea since they can lead to X server crashes.
6912 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
6914 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
6917 * lib/lyxrc.example: smallish typo in description of
6918 \view_dvi_paper_option
6920 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6923 * src/lyxfunc.C: doImportHelper to factor out common code of the
6924 various import methods. New functions doImportASCIIasLines,
6925 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
6926 doImportLinuxDoc for the format specific parts.
6929 * buffer.C: Dispatch returns now a bool to indicate success
6932 * lyx_gui.C: Add getLyXView() for member access
6934 * lyx_main.C: Change logic for batch commands: First try
6935 Buffer::Dispatch (possibly without GUI), if that fails, use
6938 * lyx_main.C: Add support for --import command line switch.
6939 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
6940 Available Formats: Everything accepted by 'buffer-import <format>'
6942 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6944 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
6947 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
6948 documents will be reformatted upon reentry.
6950 2000-04-27 Juergen Vigna <jug@sad.it>
6952 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
6953 correctly only last pos this was a bug.
6955 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6957 * release of lyx-1.1.5pre1
6959 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6961 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
6963 * src/menus.C: revert the change of naming (Figure->Graphic...)
6964 from 2000-04-11. It was incomplete and bad.
6966 * src/LColor.[Ch]: add LColor::depthbar.
6967 * src/text.C (GetVisibleRow): use it.
6969 * README: update the languages list.
6971 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6973 * src/text.C (GetVisibleRow): show the depth of paragraphs using
6976 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6978 * README: remove sections that were just wrong.
6980 * src/text2.C (GetRowNearY): remove currentrow code
6982 * src/text.C (GetRow): remove currentrow code
6984 * src/screen.C (Update): rewritten a bit.
6985 (SmallUpdate): removed func
6987 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
6989 (FullRebreak): return bool
6990 (currentrow): remove var
6991 (currentrow_y): ditto
6993 * src/lyxscreen.h (Draw): change arg to unsigned long
6994 (FitCursor): return bool
6995 (FitManualCursor): ditto
6996 (Smallpdate): remove func
6997 (first): change to unsigned long
6998 (DrawOneRow): change second arg to long (from long &)
6999 (screen_refresh_y): remove var
7000 (scree_refresh_row): ditto
7002 * src/lyxrow.h: change baseline to usigned int from unsigned
7003 short, this brings some implicit/unsigned issues out in the open.
7005 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
7007 (Dispatch): don't call updateScrollbar after fitCursor. Use update
7008 instead of smallUpdate.
7010 * src/lyxcursor.h: change y to unsigned long
7012 * src/buffer.h: don't call updateScrollbar after fitcursor
7014 * src/buffer.C (parseSingleLyXformat2Token): move variables to
7015 where they are used. Removed "\\direction", this was not present
7016 in 1.1.4 and is already obsolete. Commented out some code that I
7017 believe to never be called.
7018 (runLiterate): don't call updateScrollbar after fitCursor
7020 (buildProgram): ditto
7023 * src/WorkArea.h (workWidth): change return val to unsigned
7026 (redraw): remove the button redraws
7027 (setScrollbarValue): change for scrollbar
7028 (getScrollbarValue): change for scrollbar
7029 (getScrollbarBounds): change for scrollbar
7031 * src/WorkArea.C (C_WorkArea_up_cb): removed func
7032 (C_WorkArea_down_cb): removed func
7033 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
7034 (resize): change for scrollbar
7035 (setScrollbar): ditto
7036 (setScrollbarBounds): ditto
7037 (setScrollbarIncrements): ditto
7038 (up_cb): removed func
7039 (down_cb): removed func
7040 (scroll_cb): change for scrollbar
7041 (work_area_handler): ditto
7043 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
7044 when FitCursor did something.
7045 (updateScrollbar): some unsigned changes
7046 (downCB): removed func
7047 (scrollUpOnePage): removed func
7048 (scrollDownOnePage): remvoed func
7049 (workAreaMotionNotify): don't call screen->FitCursor but use
7050 fitCursor instead. and bool return val
7051 (workAreaButtonPress): ditto
7052 (workAreaButtonRelease): some unsigned changes
7053 (checkInsetHit): ditto
7054 (workAreaExpose): ditto
7055 (update): parts rewritten, comments about the signed char arg added
7056 (smallUpdate): removed func
7057 (cursorPrevious): call needed updateScrollbar
7060 * src/BufferView2.C (allFloats): don't call updateScrollbar after
7063 * src/BufferView.[Ch] (upCB): removed func
7064 (downCB): removed func
7065 (smallUpdate): removed func
7067 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7069 * src/lyxtext.h src/text.C src/text2.C: removed support for the
7070 currentrow, currentrow_y optimization. This did not help a lot and
7071 if we want to do this kind of optimization we should rather use
7072 cursor.row instead of the currentrow.
7074 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
7075 buffer spacing and klyx spacing support.
7077 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7079 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
7082 2000-04-26 Juergen Vigna <jug@sad.it>
7084 * src/insets/figinset.C: fixes to Lars sstream changes!
7086 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
7088 * A lot of files: Added Ascii(ostream &) methods to all inset
7089 classes. Used when exporting to ASCII.
7091 * src/buffer.C (writeFileAscii,RoffAsciiTable)
7092 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
7095 * src/text2.C (ToggleFree): Disabled implicit word selection when
7096 there is a change in the language
7098 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
7099 no output was generated for end-of-sentence inset.
7101 * src/insets/lyxinset.h
7104 * src/paragraph.C: Removed the insetnumber code
7106 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
7108 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7110 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
7111 no_babel and no_epsfig completely from the file.
7112 (parseSingleLyXformat2Token): add handling for per-paragraph
7113 spacing as written by klyx.
7115 * src/insets/figinset.C: applied patch by Andre. Made it work with
7118 2000-04-20 Juergen Vigna <jug@sad.it>
7120 * src/insets/insettext.C (cutSelection):
7121 (copySelection): Fixed with selection from right to left.
7122 (draw): now the rows are not recalculated at every draw.
7123 (computeTextRows): for now reset the inset-owner here (this is
7124 important for an undo or copy where the inset-owner is not set
7127 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
7128 motion to the_locking_inset screen->first was forgotten, this was
7129 not important till we got multiline insets.
7131 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7133 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
7134 code seems to be alright (it is code changed by Dekel, and the
7135 intent is indeed that all macros should be defined \protect'ed)
7137 * NEWS: a bit of reorganisation of the new user-visible features.
7139 2000-04-19 Juergen Vigna <jug@sad.it>
7141 * src/insets/insettext.C (init): using a LyXCursor now for cursor
7142 position. Set the inset_owner of the used paragraph so that it knows
7143 that it is inside an inset. Fixed cursor handling with mouse and
7144 cursor keys. Fixed wrong timed inset redraws and lots of other changes
7145 and cleanups to make TextInsets work better.
7147 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
7148 Changed parameters of various functions and added LockInsetInInset().
7150 * src/insets/insettext.C:
7152 * src/insets/insetcollapsable.h:
7153 * src/insets/insetcollapsable.C:
7154 * src/insets/insetfoot.h:
7155 * src/insets/insetfoot.C:
7156 * src/insets/insetert.h:
7157 * src/insets/insetert.C: cleaned up the code so that it works now
7158 correctly with insettext.
7160 * src/insets/inset.C:
7161 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
7162 that insets in insets are supported right.
7165 * src/table.C: lots of changes for use with inset tabular (and cleanup)
7167 * src/paragraph.C: some small fixes
7169 * src/debug.h: inserted INSETS debug info
7171 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
7172 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
7174 * src/commandtags.h:
7175 * src/LyXAction.C: insert code for InsetTabular.
7177 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
7178 not Button1MotionMask.
7179 (workAreaButtonRelease): send always a InsetButtonRelease event to
7181 (checkInsetHit): some setCursor fixes (always with insets).
7183 * src/BufferView2.C (lockInset): returns a bool now and extended for
7184 locking insets inside insets.
7185 (showLockedInsetCursor): it is important to have the cursor always
7186 before the locked inset.
7187 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
7189 * src/BufferView.h: made lockInset return a bool.
7191 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
7193 * src/text2.C (SetCursor): This now has a version with a LyXCursor
7194 that is used also internally but can be called as public to have back
7195 a cursor pos which is not set internally.
7196 (SetCursorIntern): Changed to use above function.
7198 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
7200 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7205 * NEWS: updated for prerelease of 1.1.5. Please comment and send
7206 patches for things that should be in or should be changed.
7208 * src/* [insetfiles]: change "usigned char fragile" to bool
7209 fragile. There was only one point that could that be questioned
7210 and that is commented in formulamacro.C. Grep for "CHECK".
7212 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
7213 (DeleteBuffer): take it out of CutAndPaste and make it static.
7215 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7217 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
7218 output the spacing envir commands. Also the new commands used in
7219 the LaTeX output makes the result better.
7221 * src/Spacing.C (writeEnvirBegin): new method
7222 (writeEnvirEnd): new method
7224 2000-04-18 Juergen Vigna <jug@sad.it>
7226 * src/CutAndPaste.C: made textclass a static member of the class
7227 as otherwise it is not accesed right!!!
7229 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
7231 * forms/layout_forms.fd
7232 * src/layout_forms.h
7233 * src/layout_forms.C (create_form_form_character)
7234 * src/lyx_cb.C (UserFreeFont)
7235 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
7236 documents (in the layout->character popup).
7238 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7240 * src/spellchecker.C (create_ispell_pipe): fix a bug where
7241 \spell_command was in fact not honored (from Kevin Atkinson).
7243 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
7246 * src/lyx_gui.h: make lyxViews private (Angus)
7248 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
7250 * src/mathed/math_write.C
7251 (MathMatrixInset::Write) Put \protect before \begin{array} and
7252 \end{array} if fragile
7253 (MathParInset::Write): Put \protect before \\ if fragile
7255 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7257 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
7258 initialization if the LyXColorHandler must be done after the
7259 connections to the XServer has been established.
7261 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
7262 get the background pixel from the lyxColorhandler so that the
7263 figures are rendered with the correct background color.
7264 (NextToken): removed functions.
7265 (GetPSSizes): use ifs >> string instead of NextToken.
7267 * src/Painter.[Ch]: the color cache moved out of this file.
7269 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
7272 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7274 * src/WorkArea.C (work_area_handler): call BufferView::enterView
7275 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
7277 * src/BufferView.C (enterView): new func
7278 (leaveView): new func
7280 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
7282 (leaveView): new func, undefines xterm cursor when approp.
7284 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
7285 (AllowInput): delete the Workarea cursor handling from this func.
7287 * src/Painter.C (underline): draw a slimer underline in most cases.
7289 * src/lyx_main.C (error_handler): use extern "C"
7291 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7293 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
7294 sent directly to me.
7296 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
7297 to the list by Dekel.
7299 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
7302 * src/bufferview_funcs.[Ch]: two new files, moved several of the
7303 methods from lyx_cb.here.
7305 * src/lyx_cb.C: in addition to the above; removed input_prohibited
7308 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7310 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
7311 instead of using current_view directly.
7313 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
7315 * src/LyXAction.C (init): add the paragraph-spacing command.
7317 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
7319 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
7321 * src/lyx_cb.C (CurrentState): output a string when the spacing is
7322 different from the documents.
7324 * src/text.C (SetHeightOfRow): take paragraph spacing into
7325 account, paragraph spacing takes precedence over buffer spacing
7326 (GetVisibleRow): ditto
7328 * src/paragraph.C (writeFile): output the spacing parameter too.
7329 (validate): set the correct features if spacing is used in the
7331 (Clear): set spacing to default
7332 (MakeSameLayout): spacing too
7333 (HasSameLayout): spacing too
7334 (SetLayout): spacing too
7335 (TeXOnePar): output the spacing commands
7337 * src/lyxparagraph.h: added a spacing variable for use with
7338 per-paragraph spacing.
7340 * src/Spacing.h: add a Default spacing and a method to check if
7341 the current spacing is default. also added an operator==
7343 * src/text2.C (DeleteEmptyParagraphMechanism): added a
7346 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7348 * src/lyxserver.C (callback): fix dispatch of functions
7350 * src/insets/insetlatexaccent.C (checkContents): turn bogus
7351 printf() into lyxerr call.
7353 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
7356 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
7357 "Table" to "Table Box", "Float" to "Floating Material"; deletes
7358 the "Float" from each of the subitems.
7359 (ShowHelpMenu): add entry for "FAQ" and "TOC".
7361 * src/support/DebugStream.h: add an #ifdef to work around a gcc
7362 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
7363 documented the change so that the workaround can be nuked later.
7365 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
7368 * src/lyxlex_pimpl.C (next): do not re-declare the default value
7370 * src/buffer.C (getLatexName): ditto
7371 (setReadonly): ditto
7373 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7375 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
7376 avoid some uses of current_view. Added also a bufferParams()
7377 method to get at this.
7379 * src/lyxtext.h: changed params->buffer and paramters->bparams.
7381 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7383 * src/lyxparagraph.[Ch]: removed
7384 operator<(LyXParagraph::InsetTable..., added a struct matchIT
7385 with operators used by lower_bound and
7386 upper_bound in InsetTable's
7387 Make struct InsetTable private again. Used matchpos.
7389 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
7391 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
7392 document, the language of existing text is changed (unless the
7393 document is multi-lingual)
7395 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
7397 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
7399 * A lot of files: A rewrite of the Right-to-Left support.
7401 2000-04-10 Juergen Vigna <jug@sad.it>
7403 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
7404 misplaced cursor when inset in inset is locked.
7406 * src/insets/insettext.C (LocalDispatch): small fix so that a
7407 BREAKLINE is not inserted if we don't permit it with autBreakRows.
7409 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
7410 footnote font should be decreased in size twice when displaying.
7412 * src/insets/insettext.C (GetDrawFont): inserted this function as
7413 the drawing-font may differ from the real paragraph font.
7415 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
7416 insets (inset in inset!).
7418 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
7419 function here because we don't want footnotes inside footnotes.
7421 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
7423 (init): now set the inset_owner in paragraph.C
7424 (LocalDispatch): added some resetPos() in the right position
7427 (pasteSelection): changed to use the new CutAndPaste-Class.
7429 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
7430 which tells if it is allowed to insert another inset inside this one.
7432 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
7433 SwitchLayoutsBetweenClasses.
7435 * src/text2.C (InsertInset): checking of the new paragraph-function
7437 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
7438 is not needed anymore here!
7441 (PasteSelection): redone (also with #ifdef) so that now this uses
7442 the CutAndPaste-Class.
7443 (SwitchLayoutsBetweenClasses): removed here and implemented in the
7446 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
7447 from/to text/insets.
7449 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
7450 so that the paragraph knows if it is inside an (text)-inset.
7451 (InsertFromMinibuffer): changed return-value to bool as now it
7452 may happen that an inset is not inserted in the paragraph.
7453 (InsertInsetAllowed): this checks if it is allowed to insert an
7454 inset in this paragraph.
7456 (BreakParagraphConservative):
7457 (BreakParagraph) : small change for the above change of the return
7458 value of InsertFromMinibuffer.
7460 * src/lyxparagraph.h: added inset_owner and the functions to handle
7461 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
7463 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7465 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
7466 functions from BufferView to BufferView::Pimpl to ease maintence.
7468 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
7469 correctly. Also use SetCursorIntern instead of SetCursor.
7471 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
7474 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7476 * src/WorkArea.C (belowMouse): manually implement below mouse.
7478 * src/*: Add "explicit" on several constructors, I added probably
7479 some unneeded ones. A couple of changes to code because of this.
7481 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
7482 implementation and private parts from the users of BufferView. Not
7485 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
7486 implementation and private parts from the users of LyXLex. Not
7489 * src/BufferView_pimpl.[Ch]: new files
7491 * src/lyxlex_pimpl.[Ch]: new files
7493 * src/LyXView.[Ch]: some inline functions move out-of-line
7495 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7497 * src/lyxparagraph.h: make struct InsetTable public.
7499 * src/support/lyxstring.h: change lyxstring::difference_type to be
7500 ptrdiff_t. Add std:: modifiers to streams.
7502 * src/font.C: include the <cctype> header, for islower() and
7505 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7507 * src/font.[Ch]: new files. Contains the metric functions for
7508 fonts, takes a LyXFont as parameter. Better separation of concepts.
7510 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
7511 changes because of this.
7513 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
7515 * src/*: compile with -Winline and move functions that don't
7518 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
7521 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7523 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
7524 (various files changed because of this)
7526 * src/Painter.C (text): fixed the drawing of smallcaps.
7528 * src/lyxfont.[Ch] (drawText): removed unused member func.
7531 * src/*.C: added needed "using" statements and "std::" qualifiers.
7533 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7535 * src/*.h: removed all use of "using" from header files use
7536 qualifier std:: instead.
7538 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7540 * src/text.C (Backspace): some additional cleanups (we already
7541 know whether cursor.pos is 0 or not).
7543 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
7544 automake does not provide one).
7546 * src/bmtable.h: replace C++ comments with C comments.
7548 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
7550 * src/screen.C (ShowCursor): Change the shape of the cursor if
7551 the current language is not equal to the language of the document.
7552 (If the cursor change its shape unexpectedly, then you've found a bug)
7554 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
7557 * src/insets/insetnumber.[Ch]: New files.
7559 * src/LyXAction.C (init)
7560 * src/lyxfunc.C (dispatch): Add command number-inset-insert
7563 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
7565 * src/lyxparagraph.h
7566 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
7567 (the vector is kept sorted).
7569 * src/text.C (GetVisibleRow): Draw selection correctly when there
7570 is both LTR and RTL text.
7572 * src/paragraph.C (Clone): Use the assignment operator for cloning,
7573 which is much faster.
7575 * src/text.C (GetVisibleRow and other): Do not draw the last space
7576 in a row if the direction of the last letter is not equal to the
7577 direction of the paragraph.
7579 * src/lyxfont.C (latexWriteStartChanges):
7580 Check that font language is not equal to basefont language.
7581 (latexWriteEndChanges): ditto
7583 * src/lyx_cb.C (StyleReset): Don't change the language while using
7584 the font-default command.
7586 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
7587 empty paragraph before a footnote.
7589 * src/insets/insetcommand.C (draw): Increase x correctly.
7591 * src/screen.C (ShowCursor): Change cursor shape if
7592 current language != document language.
7594 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
7596 2000-03-31 Juergen Vigna <jug@sad.it>
7598 * src/paragraph.C (GetInset): commented out text[pos] = ' '
7599 (Clone): changed mode how the paragraph-data is copied to the
7600 new clone-paragraph.
7602 * src/lyxfunc.C (Dispatch): fixed small problem when calling
7603 GetInset(pos) with no inset anymore there (in inset UNDO)
7605 * src/insets/insetcommand.C (draw): small fix as here x is
7606 incremented not as much as width() returns (2 before, 2 behind = 4)
7608 2000-03-30 Juergen Vigna <jug@sad.it>
7610 * src/insets/insettext.C (InsetText): small fix in initialize
7611 widthOffset (should not be done in the init() function)
7613 2000-03-29 Amir Karger <karger@lyx.org>
7615 * lib/examples/it_ItemizeBullets.lyx: translation by
7618 * Implemented \textasciitilde and fixed a tiny bug in reLyX
7620 2000-03-29 Juergen Vigna <jug@sad.it>
7622 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
7624 * src/insets/insetfoot.C (Clone): small change as for the below
7625 new init function in the text-inset
7627 * src/insets/insettext.C (init): new function as I've seen that
7628 clone did not copy the Paragraph-Data!
7629 (LocalDispatch): Added code so that now we have some sort of Undo
7630 functionality (well actually we HAVE Undo ;)
7632 * src/text.C (Backspace): Small fix for the a | a Backspace problem
7634 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
7636 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
7639 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7641 * src/main.C: added a runtime check that verifies that the xforms
7642 header used when building LyX and the library used when running
7643 LyX match. Exit with a message if they don't match. This is a
7644 version number check only.
7646 * src/buffer.C (save): Don't allocate memory on the heap for
7647 struct utimbuf times.
7649 * *: some using changes, use iosfwd instead of the real headers.
7651 * src/lyxfont.C use char const * instead of string for the static
7652 strings. Rewrite some functions to use sstream.
7654 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7656 * src/text.C (Backspace): hopefully fix the dreaded backaspace
7659 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7661 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
7662 of Geodesy (from Martin Vermeer)
7664 * lib/layouts/svjour.inc: include file for the Springer svjour
7665 class. It can be used to support journals other than JoG.
7667 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
7668 Miskiewicz <misiek@pld.org.pl>)
7669 * lib/reLyX/Makefile.am: ditto.
7671 2000-03-27 Juergen Vigna <jug@sad.it>
7673 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
7674 also some modifications with operations on selected text.
7676 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
7677 problems with clicking on insets (last famous words ;)
7679 * src/insets/insetcommand.C (draw):
7680 (width): Changed to have a bit of space before and after the inset so
7681 that the blinking cursor can be seen (otherwise it was hidden)
7683 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7685 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
7686 would not be added to the link list when an installed gettext (not
7687 part of libc) is found.
7689 2000-03-24 Juergen Vigna <jug@sad.it>
7691 * src/insets/insetcollapsable.C (Edit):
7692 * src/mathed/formula.C (InsetButtonRelease):
7693 (InsetButtonPress): fixed for new handling of ButtonPress/Release
7696 * src/BufferView.C (workAreaButtonPress):
7697 (workAreaButtonRelease):
7698 (checkInsetHit): Finally fixed the clicking on insets be handled
7701 * src/insets/insetert.C (Edit): inserted this call so that ERT
7702 insets work always with LaTeX-font
7704 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7706 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
7707 caused lyx to startup with no GUI in place, causing in a crash
7708 upon startup when called with arguments.
7710 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7712 * src/FontLoader.C: better initialization of dummyXFontStruct.
7714 2000-03-20 José Abílio Matos <jamatos@lyx.org>
7716 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
7717 for linuxdoc and docbook import and export format options.
7719 * lib/lyxrc.example Example of default values for the previous flags.
7721 * src/lyx_cb.C Use those flags instead of the hardwired values for
7722 linuxdoc and docbook export.
7724 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
7727 * src/menus.C Added menus entries for the new import/exports formats.
7729 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7731 * src/lyxrc.*: Added support for running without Gui
7734 * src/FontLoader.C: sensible defaults if no fonts are needed
7736 * src/lyx_cb.C: New function ShowMessage (writes either to the
7737 minibuffer or cout in case of no gui
7738 New function AskOverwrite for common stuff
7739 Consequently various changes to call these functions
7741 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
7742 wild guess at sensible screen resolution when having no gui
7744 * src/lyxfont.C: no gui, no fonts... set some defaults
7746 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7748 * src/LColor.C: made the command inset background a bit lighter.
7750 2000-03-20 Hartmut Goebel <goebel@noris.net>
7752 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
7753 stdstruct.inc. Koma-Script added some title elements which
7754 otherwise have been listed below "bibliography". This split allows
7755 adding title elements to where they belong.
7757 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
7758 define the additional title elements and then include
7761 * many other layout files: changed to include stdtitle.inc just
7762 before stdstruct.inc.
7764 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
7766 * src/buffer.C: (save) Added the option to store all backup files
7767 in a single directory
7769 * src/lyxrc.[Ch]: Added variable \backupdir_path
7771 * lib/lyxrc.example: Added descriptions of recently added variables
7773 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
7774 bibtex inset, not closing the bibtex popup when deleting the inset)
7776 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7778 * src/lyx_cb.C: add a couple using directives.
7780 2000-03-17 José Abílio Matos <jamatos@lyx.org>
7781 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
7782 import based on the filename.
7784 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
7785 file would be imported at start, if the filename where of a sgml file.
7787 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
7789 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
7791 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
7792 * src/lyxfont.h Replaced the member variable bits.direction by the
7793 member variable lang. Made many changes in other files.
7794 This allows having a multi-lingual document
7796 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
7797 that change the current language to <l>.
7798 Removed the command "font-rtl"
7800 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
7801 format for Hebrew documents)
7803 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
7804 When auto_mathmode is "true", pressing a digit key in normal mode
7805 will cause entering into mathmode.
7806 If auto_mathmode is "rtl" then this behavior will be active only
7807 when writing right-to-left text.
7809 * src/text2.C (InsertStringA) The string is inserted using the
7812 * src/paragraph.C (GetEndLabel) Gives a correct result for
7813 footnote paragraphs.
7815 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
7817 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7819 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
7820 front of PasteParagraph. Never insert a ' '. This should at least
7821 fix some cause for the segfaults that we have been experiencing,
7822 it also fixes backspace behaviour slightly. (Phu!)
7824 * src/support/lstrings.C (compare_no_case): some change to make it
7825 compile with gcc 2.95.2 and stdlibc++-v3
7827 * src/text2.C (MeltFootnoteEnvironment): change type o
7828 first_footnote_par_is_not_empty to bool.
7830 * src/lyxparagraph.h: make text private. Changes in other files
7832 (fitToSize): new function
7833 (setContentsFromPar): new function
7834 (clearContents): new function
7835 (SetChar): new function
7837 * src/paragraph.C (readSimpleWholeFile): deleted.
7839 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
7840 the file, just use a simple string instead. Also read the file in
7841 a more maintainable manner.
7843 * src/text2.C (InsertStringA): deleted.
7844 (InsertStringB): deleted.
7846 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7848 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
7849 RedoParagraphs from the doublespace handling part, just set status
7850 to NEED_MORE_REFRESH. Also don't update cursor position (should be
7851 done, but perhaps not like this.)
7853 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7855 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
7856 character when inserting an inset.
7858 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7860 * src/bufferparams.C (readLanguage): now takes "default" into
7863 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
7864 also initialize the toplevel_keymap with the default bindings from
7867 * src/buffer.C (Buffer): remove lyxrc from the parameters.
7869 * all files using lyxrc: have lyxrc as a real variable and not a
7870 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
7873 * src/lyxrc.C: remove double call to defaultKeyBindings
7875 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
7876 toolbar defauls using lyxlex. Remove enums, structs, functions
7879 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
7880 toolbar defaults. Also store default keybindings in a map.
7882 * src/ToolbarDefaults.[Ch]: New file. This class is used for
7883 storing the toolbar defaults without any xforms dependencies.
7885 * src/insets/figinset.C: patch posted to list by Andre Poenitz
7886 applied. Changed to use iterators.
7888 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7890 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
7891 systems that don't have LINGUAS set to begin with.
7893 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7895 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
7896 the list by Dekel Tsur.
7898 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7900 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
7901 * src/insets/form_graphics.C: ditto.
7903 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
7905 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7907 * src/bufferparams.C (readLanguage): use the new language map
7909 * src/intl.C (InitKeyMapper): use the new language map
7911 * src/lyx_gui.C (create_forms): use the new language map
7913 * src/language.[Ch]: New files. Used for holding the information
7914 about each language. Now! Use this new language map enhance it and
7915 make it really usable for our needs.
7917 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
7919 * screen.C (ShowCursor): Removed duplicate code.
7920 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
7921 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
7923 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
7926 * src/text.C Added TransformChar method. Used for rendering Arabic
7927 text correctly (change the glyphs of the letter according to the
7928 position in the word)
7933 * src/lyxrc.C Added lyxrc command {language_command_begin,
7934 language_command_end,language_command_ltr,language_command_rtl,
7935 language_package} which allows the use of either arabtex or Omega
7938 * src/lyx_gui.C (init)
7940 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
7941 to use encoding for menu fonts which is different than the encoding
7944 * src/buffer.C (makeLaTeXFile): If params.language = "default",
7945 do not load the babel package.
7946 To write an English document with Hebrew/Arabic, change the document
7947 language to "english".
7949 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
7950 (alphaCounter): changed to return char
7951 (loweralphaCounter, hebrewCounter, romanCounter): New functions
7953 * lib/lyxrc.example Added examples for Hebrew/Arabic
7956 * src/layout.C Added layout command endlabeltype
7958 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
7960 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
7962 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7964 * src/mathed/math_delim.C (search_deco): return a
7965 math_deco_struct* instead of index.
7967 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7969 * All files with a USE_OSTREAM_ONLY within: removed all code that
7970 was unused when USE_OSTREAM_ONLY is defined.
7972 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
7973 of any less. Removed header and using.
7975 * src/text.C (GetVisibleRow): draw the string "Page Break
7976 (top/bottom)" on screen when drawing a pagebreak line.
7978 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7980 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
7982 * src/mathed/math_macro.C (draw): do some cast magic.
7985 * src/mathed/math_defs.h: change byte* argument to byte const*.
7987 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
7989 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
7990 know it is right to return InsetFoot* too, but cxx does not like
7993 * src/insets/insetcollapsable.[Ch] (Clone): make const.
7995 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
7997 * src/mathed/math_delim.C: change == to proper assignment.
7999 2000-03-09 Juergen Vigna <jug@sad.it>
8001 * src/insets/insettext.C (setPos): fixed various cursor positioning
8002 problems (via mouse and cursor-keys)
8003 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
8004 inset (still a small display problem but it works ;)
8006 * src/insets/insetcollapsable.C (draw): added button_top_y and
8007 button_bottom_y to have correct values for clicking on the inset.
8009 * src/support/lyxalgo.h: commented out 'using std::less'
8011 2000-03-08 Juergen Vigna <jug@sad.it>
8013 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
8014 Button-Release event closes as it is alos the Release-Event
8017 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
8019 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8021 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
8022 can add multiple spaces in Scrap (literate programming) styles...
8023 which, by the way, is how I got hooked on LyX to begin with.
8025 * src/mathed/formula.C (Write): Added dummy variable to an
8026 inset::Latex() call.
8027 (Latex): Add free_spacing boolean to inset::Latex()
8029 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
8031 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
8032 virtual function to include the free_spacing boolean from
8033 the containing paragraph's style.
8035 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
8036 Added free_spacing boolean arg to match inset.h
8038 * src/insets/insettext.C, src/insets/insettext.h (Latex):
8039 Added free_spacing boolean arg to match inset.h
8041 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
8042 Added free_spacing boolean and made sure that if in a free_spacing
8043 paragraph, that we output normal space if there is a protected space.
8045 * src/insets/insetref.C, src/insets/insetref.h (Latex):
8046 Added free_spacing boolean arg to match inset.h
8048 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
8049 Added free_spacing boolean arg to match inset.h
8051 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
8052 Added free_spacing boolean arg to match inset.h
8054 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
8055 Added free_spacing boolean arg to match inset.h
8057 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
8058 Added free_spacing boolean arg to match inset.h
8060 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
8061 free_spacing boolean arg to match inset.h
8063 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
8064 Added free_spacing boolean arg to match inset.h
8066 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
8067 Added free_spacing boolean arg to match inset.h
8069 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
8070 Added free_spacing boolean arg to match inset.h
8072 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
8073 Added free_spacing boolean arg to match inset.h
8075 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
8076 Added free_spacing boolean arg to match inset.h
8078 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
8079 free_spacing boolean arg to match inset.h
8081 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
8082 free_spacing boolean arg to match inset.h
8084 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
8085 ignore free_spacing paragraphs. The user's spaces are left
8088 * src/text.C (InsertChar): Fixed the free_spacing layout
8089 attribute behavior. Now, if free_spacing is set, you can
8090 add multiple spaces in a paragraph with impunity (and they
8091 get output verbatim).
8092 (SelectSelectedWord): Added dummy argument to inset::Latex()
8095 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
8098 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
8099 paragraph layouts now only input a simple space instead.
8100 Special character insets don't make any sense in free-spacing
8103 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
8104 hard-spaces in the *input* file to simple spaces if the layout
8105 is free-spacing. This converts old files which had to have
8106 hard-spaces in free-spacing layouts where a simple space was
8108 (writeFileAscii): Added free_spacing check to pass to the newly
8109 reworked inset::Latex(...) methods. The inset::Latex() code
8110 ensures that hard-spaces in free-spacing paragraphs get output
8111 as spaces (rather than "~").
8113 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8115 * src/mathed/math_delim.C (draw): draw the empty placeholder
8116 delims with a onoffdash line.
8117 (struct math_deco_compare): struct that holds the "functors" used
8118 for the sort and the binary search in math_deco_table.
8119 (class init_deco_table): class used for initial sort of the
8121 (search_deco): use lower_bound to do a binary search in the
8124 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8126 * src/lyxrc.C: a small secret thingie...
8128 * src/lyxlex.C (printTable): changed to take a ostream as paramter
8129 and to not flush the stream as often as it used to.
8131 * src/support/lyxalgo.h: new file
8132 (sorted): template function used for checking if a sequence is
8133 sorted or not. Two versions with and without user supplied
8134 compare. Uses same compare as std::sort.
8136 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
8137 it and give warning on lyxerr.
8139 (struct compare_tags): struct with function operators used for
8140 checking if sorted, sorting and lower_bound.
8141 (search_kw): use lower_bound instead of manually implemented
8144 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8146 * src/insets/insetcollapsable.h: fix Clone() declaration.
8147 * src/insets/insetfoot.h: ditto.
8149 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
8151 2000-03-08 Juergen Vigna <jug@sad.it>
8153 * src/insets/lyxinset.h: added owner call which tells us if
8154 this inset is inside another inset. Changed also the return-type
8155 of Editable to an enum so it tells clearer what the return-value is.
8157 * src/insets/insettext.C (computeTextRows): fixed computing of
8158 textinsets which split automatically on more rows.
8160 * src/insets/insetert.[Ch]: changed this to be of BaseType
8163 * src/insets/insetfoot.[Ch]: added footnote inset
8165 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
8166 collapsable insets (like footnote, ert, ...)
8168 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8170 * src/lyxdraw.h: remvoe file
8172 * src/lyxdraw.C: remove file
8174 * src/insets/insettext.C: added <algorithm>.
8176 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8178 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
8179 (matrix_cb): case MM_OK use string stream
8181 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
8184 * src/mathed/math_macro.C (draw): use string stream
8185 (Metrics): use string stream
8187 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
8188 directly to the ostream.
8190 * src/vspace.C (asString): use string stream.
8191 (asString): use string stream
8192 (asLatexString): use string stream
8194 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
8195 setting Spacing::Other.
8197 * src/LaTeXFeatures.C (getPackages): use string stream instead of
8198 sprintf when creating the stretch vale.
8200 * src/text2.C (alphaCounter): changed to return a string and to
8201 not use a static variable internally. Also fixed a one-off bug.
8202 (SetCounter): changed the drawing of the labels to use string
8203 streams instead of sprintf.
8205 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
8206 manipulator to use a scheme that does not require library support.
8207 This is also the way it is done in the new GNU libstdc++. Should
8208 work with DEC cxx now.
8210 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8212 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
8213 end. This fixes a bug.
8215 * src/mathed (all files concerned with file writing): apply the
8216 USE_OSTREAM_ONLY changes to mathed too.
8218 * src/support/DebugStream.h: make the constructor explicit.
8220 * src/lyxfont.C (latexWriteStartChanges): small bug related to
8221 count and ostream squashed.
8223 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8225 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
8227 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
8228 ostringstream uses STL strings, and we might not.
8230 * src/insets/insetspecialchar.C: add using directive.
8231 * src/insets/insettext.C: ditto.
8233 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8235 * lib/layouts/seminar.layout: feeble attempt at a layout for
8236 seminar.cls, far from completet and could really use some looking
8237 at from people used to write layout files.
8239 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
8240 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
8241 a lot nicer and works nicely with ostreams.
8243 * src/mathed/formula.C (draw): a slightly different solution that
8244 the one posted to the list, but I think this one works too. (font
8245 size wrong in headers.)
8247 * src/insets/insettext.C (computeTextRows): some fiddling on
8248 Jürgens turf, added some comments that he should read.
8250 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
8251 used and it gave compiler warnings.
8252 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
8255 * src/lyx_gui.C (create_forms): do the right thing when
8256 show_banner is true/false.
8258 * src/lyx_cb.C (TimerCB): no need to close or do anything if
8259 show_banner is false.
8261 * most file writing files: Now use iostreams to do almost all of
8262 the writing. Also instead of passing string &, we now use
8263 stringstreams. mathed output is still not adapted to iostreams.
8264 This change can be turned off by commenting out all the occurences
8265 of the "#define USE_OSTREAM_ONLY 1" lines.
8267 * src/WorkArea.C (createPixmap): don't output debug messages.
8268 (WorkArea): don't output debug messages.
8270 * lib/lyxrc.example: added a comment about the new variable
8273 * development/Code_rules/Rules: Added some more commente about how
8274 to build class interfaces and on how better encapsulation can be
8277 2000-03-03 Juergen Vigna <jug@sad.it>
8279 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
8280 automatically with the width of the LyX-Window
8282 * src/insets/insettext.C (computeTextRows): fixed update bug in
8283 displaying text-insets (scrollvalues where not initialized!)
8285 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8287 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
8288 id in the check of the result from lower_bound is not enough since
8289 lower_bound can return last too, and then res->id will not be a
8292 * all insets and some code that use them: I have conditionalized
8293 removed the Latex(string & out, ...) this means that only the
8294 Latex(ostream &, ...) will be used. This is a work in progress to
8295 move towards using streams for all output of files.
8297 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
8300 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8302 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
8303 routine (this fixes bug where greek letters were surrounded by too
8306 * src/support/filetools.C (findtexfile): change a bit the search
8307 algorithm, to fix bug introduced in 1.1.4. Note that --format is
8308 no longer passed to kpsewhich, we may have to change that later.
8310 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
8311 warning options to avoid problems with X header files (from Angus
8313 * acinclude.m4: regenerated.
8315 2000-03-02 Juergen Vigna <jug@sad.it>
8317 * src/insets/insettext.C (WriteParagraphData): Using the
8318 par->writeFile() function for writing paragraph-data.
8319 (Read): Using buffer->parseSingleLyXformat2Token()-function
8320 for parsing paragraph data!
8322 * src/buffer.C (readLyXformat2): removed all parse data and using
8323 the new parseSingleLyXformat2Token()-function.
8324 (parseSingleLyXformat2Token): added this function to parse (read)
8325 lyx-file-format (this is called also from text-insets now!)
8327 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8329 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
8332 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
8333 directly instead of going through a func. One very bad thing: a
8334 static LyXFindReplace, but I don't know where to place it.
8336 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
8337 string instead of char[]. Also changed to static.
8338 (GetSelectionOrWordAtCursor): changed to static inline
8339 (SetSelectionOverLenChars): ditto.
8341 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
8342 current_view and global variables. both classes has changed names
8343 and LyXFindReplace is not inherited from SearchForm.
8345 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
8346 fl_form_search form.
8348 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
8350 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8352 * lib/bind/*.bind: make sure 'buffer-previous' function is not
8353 bound (from Kayvan).
8355 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
8357 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
8359 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8361 * some things that I should comment but the local pub says head to
8364 * comment out all code that belongs to the Roff code for Ascii
8365 export of tables. (this is unused)
8367 * src/LyXView.C: use correct type for global variable
8368 current_layout. (LyXTextClass::size_type)
8370 * some code to get the new insetgraphics closer to working I'd be
8371 grateful for any help.
8373 * src/BufferView2.C (insertInset): use the return type of
8374 NumberOfLayout properly. (also changes in other files)
8376 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
8377 this as a test. I want to know what breaks because of this.
8379 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
8381 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8383 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
8384 to use a \makebox in the label, this allows proper justification
8385 with out using protected spaces or multiple hfills. Now it is
8386 "label" for left justified, "\hfill label\hfill" for center, and
8387 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
8388 should be changed accordingly.
8390 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8392 * src/lyxtext.h: change SetLayout() to take a
8393 LyXTextClass::size_type instead of a char (when there is more than
8394 127 layouts in a class); also change type of copylayouttype.
8395 * src/text2.C (SetLayout): ditto.
8396 * src/LyXView.C (updateLayoutChoice): ditto.
8398 * src/LaTeX.C (scanLogFile): errors where the line number was not
8399 given just after the '!'-line were ignored (from Dekel Tsur).
8401 * lib/lyxrc.example: fix description of \date_insert_format
8403 * lib/layouts/llncs.layout: new layout, contributed by Martin
8406 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8408 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
8409 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
8410 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
8411 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
8412 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
8413 paragraph.C, text.C, text2.C)
8415 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8417 * src/insets/insettext.C (LocalDispatch): remove extra break
8420 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
8421 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
8423 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
8424 * src/insets/insettext.[Ch] (GetCursorPos): ditto
8426 * src/insets/insetbib.h: move InsetBibkey::Holder and
8427 InsetCitation::Holder in public space.
8429 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8431 * src/insets/insettext.h: small change to get the new files from
8432 Juergen to compile (use "string", not "class string").
8434 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
8435 const & as parameter to LocalDispatch, use LyXFont const & as
8436 paramter to some other func. This also had impacto on lyxinsets.h
8437 and the two mathed insets.
8439 2000-02-24 Juergen Vigna <jug@sad.it>
8442 * src/commandtags.h:
8444 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
8448 * src/BufferView2.C: added/updated code for various inset-functions
8450 * src/insets/insetert.[Ch]: added implementation of InsetERT
8452 * src/insets/insettext.[Ch]: added implementation of InsetText
8454 * src/insets/inset.C (Edit): added "unsigned int button" parameter
8455 (draw): added preliminary code for inset scrolling not finshed yet
8457 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
8458 as it is in lyxfunc.C now
8460 * src/insets/lyxinset.h: Added functions for text-insets
8462 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8464 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
8465 BufferView and reimplement the list as a queue put inside its own
8468 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
8470 * several files: use the new interface to the "updateinsetlist"
8472 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
8474 (work_area_handler): call BufferView::trippleClick on trippleclick.
8476 * src/BufferView.C (doubleClick): new function, selects word on
8478 (trippleClick): new function, selects line on trippleclick.
8480 2000-02-22 Allan Rae <rae@lyx.org>
8482 * lib/bind/xemacs.bind: buffer-previous not supported
8484 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8486 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
8489 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8491 * src/bufferlist.C: get rid of current_view from this file
8493 * src/spellchecker.C: get rid of current_view from this file
8495 * src/vspace.C: get rid of current_view from this file
8496 (inPixels): added BufferView parameter for this func
8497 (asLatexCommand): added a BufferParams for this func
8499 * src/text.C src/text2.C: get rid of current_view from these
8502 * src/lyxfont.C (getFontDirection): move this function here from
8505 * src/bufferparams.C (getDocumentDirection): move this function
8508 * src/paragraph.C (getParDirection): move this function here from
8510 (getLetterDirection): ditto
8512 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
8514 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
8515 resize due to wrong pixmap beeing used. Also took the opurtunity
8516 to make the LyXScreen stateless on regard to WorkArea and some
8517 general cleanup in the same files.
8519 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8521 * src/Makefile.am: add missing direction.h
8523 * src/PainterBase.h: made the width functions const.
8525 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
8528 * src/insets/insetcommand.C (draw): draw Editable as buttons.
8530 * src/insets/insetlatexaccent.C (draw): make the accents draw
8531 better, at present this will only work well with iso8859-1.
8533 * several files: remove the old drawing code, now we use the new
8536 * several files: remove support for mono_video, reverse_video and
8539 2000-02-17 Juergen Vigna <jug@sad.it>
8541 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
8542 int ** as we have to return the pointer, otherwise we have only
8543 NULL pointers in the returning function.
8545 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8547 * src/LaTeX.C (operator()): quote file name when running latex.
8549 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8551 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
8552 (bubble tip), this removes our special handling of this.
8554 * Remove all code that is unused now that we have the new
8555 workarea. (Code that are not active when NEW_WA is defined.)
8557 * Make the uses of XSync not conditionalized on define USE_XSYNC.
8559 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8561 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
8562 nonexisting layout; correctly redirect obsoleted layouts.
8564 * lib/lyxrc.example: document \view_dvi_paper_option
8566 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
8569 * src/lyx_cb.C (RunScript): handle $$FName for command names.
8570 (PreviewDVI): handle the view_dvi_paper_option variable.
8571 [Both from Roland Krause]
8573 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8575 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
8576 char const *, int, LyXFont)
8577 (text(int, int, string, LyXFont)): ditto
8579 * src/text.C (InsertCharInTable): attempt to fix the double-space
8580 feature in tables too.
8581 (BackspaceInTable): ditto.
8582 (GetVisibleRow): make bottom pagebreak line be a onoff line.
8584 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8586 * src/text2.C (owner): only complain if owner_ is set and bv != 0
8588 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
8589 newly found text in textcache to this.
8590 (buffer): set the owner of the text put into the textcache to 0
8592 * src/insets/figinset.C (draw): fixed the drawing of figures with
8595 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
8596 drawing of mathframe, hfills, protected space, table lines. I have
8597 now no outstanding drawing problems with the new Painter code.
8599 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8601 * src/PainterBase.C (ellipse, circle): do not specify the default
8604 * src/LColor.h: add using directive.
8606 * src/Painter.[Ch]: change return type of methods from Painter& to
8607 PainterBase&. Add a using directive.
8609 * src/WorkArea.C: wrap xforms callbacks in C functions
8612 * lib/layouts/foils.layout: font fix and simplifications from Carl
8615 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8617 * a lot of files: The Painter, LColor and WorkArea from the old
8618 devel branch has been ported to lyx-devel. Some new files and a
8619 lot of #ifdeffed code. The new workarea is enabled by default, but
8620 if you want to test the new Painter and LColor you have to compile
8621 with USE_PAINTER defined (do this in config.h f.ex.) There are
8622 still some rought edges, and I'd like some help to clear those
8623 out. It looks stable (loads and displays the Userguide very well).
8626 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8628 * src/buffer.C (pop_tag): revert to the previous implementation
8629 (use a global variable for both loops).
8631 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
8633 * src/lyxrc.C (LyXRC): change slightly default date format.
8635 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
8636 there is an English text with a footnote that starts with a Hebrew
8637 paragraph, or vice versa.
8638 (TeXFootnote): ditto.
8640 * src/text.C (LeftMargin): allow for negative values for
8641 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
8644 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
8645 for input encoding (cyrillic)
8647 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8649 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
8652 * src/toolbar.C (set): ditto
8653 * src/insets/insetbib.C (create_form_citation_form): ditto
8655 * lib/CREDITS: added Dekel Tsur.
8657 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
8658 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
8659 hebrew supports files from Dekel Tsur.
8661 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
8662 <tzafrir@technion.ac.il>
8664 * src/lyxrc.C: put \date_insert_format at the right place.
8666 * src/buffer.C (makeLaTeXFile): fix the handling of
8667 BufferParams::sides when writing out latex files.
8669 * src/BufferView2.C: add a "using" directive.
8671 * src/support/lyxsum.C (sum): when we use lyxstring,
8672 ostringstream::str needs an additional .c_str().
8674 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8676 * src/support/filetools.C (ChangeExtension): patch from Etienne
8679 * src/TextCache.C (show): remove const_cast and make second
8680 parameter non-const LyXText *.
8682 * src/TextCache.h: use non const LyXText in show.
8684 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
8687 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8689 * src/support/lyxsum.C: rework to be more flexible.
8691 * several places: don't check if a pointer is 0 if you are going
8694 * src/text.C: remove some dead code.
8696 * src/insets/figinset.C: remove some dead code
8698 * src/buffer.C: move the BufferView funcs to BufferView2.C
8699 remove all support for insetlatexdel
8700 remove support for oldpapersize stuff
8701 made some member funcs const
8703 * src/kbmap.C: use a std::list to store the bindings in.
8705 * src/BufferView2.C: new file
8707 * src/kbsequence.[Ch]: new files
8709 * src/LyXAction.C + others: remove all trace of buffer-previous
8711 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
8712 only have one copy in the binary of this table.
8714 * hebrew patch: moved some functions from LyXText to more
8715 appropriate places. (LyXParagraph, BufferParams, LyXFont)
8717 * several files: remove support for XForms older than 0.88
8719 remove some #if 0 #endif code
8721 * src/TextCache.[Ch]: new file. Holds the textcache.
8723 * src/BufferView.C: changes to use the new TextCache interface.
8724 (waitForX): remove the now unused code.
8726 * src/BackStack.h: remove some commented code
8728 * lib/bind/emacs.bind: remove binding for buffer-previous
8730 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8732 * applied the hebrew patch.
8734 * src/lyxrow.h: make sure that all Row variables are initialized.
8736 * src/text2.C (TextHandleUndo): comment out a delete, this might
8737 introduce a memory leak, but should also help us to not try to
8738 read freed memory. We need to look at this one.
8740 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
8741 (LyXParagraph): initalize footnotekind.
8743 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
8744 forgot this when applying the patch. Please heed the warnings.
8746 * src/BufferView.C (buffer): a fix for the buffer-reload problem
8747 (aka. reformat problem)
8749 * src/bufferlist.C (exists): made const, and use const_iterator
8750 (isLoaded): new func.
8751 (release): use std::find to find the correct buffer.
8753 * src/bufferlist.h: made getState a const func.
8754 made empty a const func.
8755 made exists a const func.
8758 2000-02-01 Juergen Vigna <jug@sad.it>
8760 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
8762 * po/it.po: updated a bit the italian po file and also changed the
8763 'file nuovo' for newfile to 'filenuovo' without a space, this did
8766 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
8767 for the new insert_date command.
8769 * src/lyxfunc.C (Dispatch): added support for a insert_date function
8770 from jdblair, to insert a date into the current text conforming to
8771 a strftime format (for now only considering the locale-set and not
8772 the document-language).
8774 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8776 * src/lyxfont.C (textWidth): hopefully better fix for the Array
8777 Bounds Read error seen by purify. The problem was that islower is
8778 a macros which takes an unsigned char and uses it as an index for
8779 in array of characters properties (and is thus subject to the
8783 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
8784 correctly the paper sides radio buttons.
8785 (UpdateDocumentButtons): ditto.
8787 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8789 * src/kbmap.C (getsym + others): change to return unsigned int,
8790 returning a long can give problems on 64 bit systems. (I assume
8791 that int is 32bit on 64bit systems)
8793 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8795 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
8796 LyXLookupString to be zero-terminated. Really fixes problems seen
8799 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8801 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
8802 write a (char*)0 to the lyxerr stream.
8804 * src/lastfiles.C: move algorithm before the using statemets.
8806 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8808 * src/lastfiles.C: move using directives in global scope (egcs 1.x
8809 complains otherwise).
8810 * src/table.C: ditto
8812 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
8815 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
8816 that I removed earlier... It is really needed.
8818 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
8820 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8822 * INSTALL: update xforms home page URL.
8824 * lib/configure.m4: fix a bug with unreadable layout files.
8826 * src/table.C (calculate_width_of_column): add "using std::max"
8829 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8831 * several files: marked several lines with "DEL LINE", this is
8832 lines that can be deleted without changing anything.
8833 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
8834 checks this anyway */
8837 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
8839 * src/DepTable.C (update): add a "+" at the end when the checksum
8840 is different. (debugging string only)
8842 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
8843 the next inset to not be displayed. This should also fix the list
8844 of labels in the "Insert Crossreference" dialog.
8846 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8848 * src/support/LSubstring.C (LSubstring): set pos to string::npos
8849 when regex was not found.
8851 * src/support/lstrings.C (lowercase): use handcoded transform always.
8854 * src/text.C (Delete): fixed the crash. cursor.par->prev and
8855 old_cursor.par->prev could be 0.
8857 * several files: changed post inc/dec to pre inc/dec
8859 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
8860 write the lastfiles to file.
8862 * src/BufferView.C (buffer): only show TextCache info when debugging
8864 (resizeCurrentBuffer): ditto
8865 (workAreaExpose): ditto
8867 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
8869 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
8871 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
8872 a bit better by removing the special case for \i and \j.
8874 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8876 * src/lyx_main.C (easyParse): remove test for bad comand line
8877 options, since this broke all xforms-related parsing.
8879 * src/kbmap.C (getsym): set return type to unsigned long, as
8880 declared in header. On an alpha, long is _not_ the same as int.
8882 * src/support/LOstream.h: add a "using std::flush;"
8884 * src/insets/figinset.C: ditto.
8886 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8888 * src/bufferlist.C (write): use blinding fast file copy instead of
8889 "a char at a time", now we are doing it the C++ way.
8891 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
8892 std::list<int> instead.
8893 (addpidwait): reflect move to std::list<int>
8894 (sigchldchecker): ditto
8896 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
8899 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
8900 that obviously was wrong...
8902 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
8903 c, this avoids warnings with purify and islower.
8905 * src/insets/figinset.C: rename struct queue to struct
8906 queue_element and rewrite to use a std::queue. gsqueue is now a
8907 std::queue<queue_element>
8908 (runqueue): reflect move to std::queue
8911 * src/support/lstrings.h (tostr): specialize for bool, otherwise
8912 we would get "1" "0" instead of "true" "false. Also make the tostr
8915 2000-01-21 Juergen Vigna <jug@sad.it>
8917 * src/buffer.C (writeFileAscii): Disabled code for special groff
8918 handling of tabulars till I fix this in table.C
8920 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8922 * src/support/mkdir.C (mkdir): change second argument of mkdir to
8924 * src/support/lyxlib.h: ditto.
8926 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8928 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
8929 and 'j' look better. This might fix the "macron" bug that has been
8932 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
8933 functions as one template function. Delete the old versions.
8935 * src/support/lyxsum.C: move using std::ifstream inside
8938 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
8941 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
8943 * src/mathed/formula.C: delete #include "bufferlist.h" never used
8945 * src/insets/figinset.C (InitFigures): use new instead of malloc
8946 to allocate memory for figures and bitmaps.
8947 (DoneFigures): use delete[] instead of free to deallocate memory
8948 for figures and bitmaps.
8949 (runqueue): use new to allocate
8950 (getfigdata): use new/delete[] instead of malloc/free
8951 (RegisterFigure): ditto
8953 * some files: moved some declarations closer to first use, small
8954 whitespace changes use preincrement instead of postincrement where
8955 it does not make a difference.
8957 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
8958 step on the way to use stl::containers for key maps.
8960 * src/bufferlist.h: add a typedef for const_iterator and const
8961 versions of begin and end.
8963 * src/bufferlist.[Ch]: change name of member variable _state to
8964 state_. (avoid reserved names)
8966 (getFileNames): returns the filenames of the buffers in a vector.
8968 * configure.in (ALL_LINGUAS): added ro
8970 * src/support/putenv.C: new file
8972 * src/support/mkdir.C: new file
8974 2000-01-20 Allan Rae <rae@lyx.org>
8976 * lib/layouts/IEEEtran.layout: Added several theorem environments
8978 * lib/templates/IEEEtran.lyx: Example theorem environments and a
8979 couple of minor additions.
8981 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
8982 (except for those in footnotes of course)
8984 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8986 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
8988 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
8989 std::sort and std::lower_bound instead of qsort and handwritten
8991 (struct compara): struct that holds the functors used by std::sort
8992 and std::lower_bound in MathedLookupBOP.
8994 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8996 * src/support/LAssert.h: do not do partial specialization. We do
8999 * src/support/lyxlib.h: note that lyx::getUserName() and
9000 lyx::date() are not in use right now. Should these be suppressed?
9002 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
9003 (makeLinuxDocFile): do not put date and user name in linuxdoc
9006 * src/support/lyxlib.h (kill): change first argument to long int,
9007 since that's what solaris uses.
9009 * src/support/kill.C (kill): fix declaration to match prototype.
9011 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
9012 actually check whether namespaces are supported. This is not what
9015 * src/support/lyxsum.C: add a using directive.
9017 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9019 * src/support/kill.C: if we have namespace support we don't have
9020 to include lyxlib.h.
9022 * src/support/lyxlib.h: use namespace lyx if supported.
9024 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9026 * src/support/date.C: new file
9028 * src/support/chdir.C: new file
9030 * src/support/getUserName.C: new file
9032 * src/support/getcwd.C: new file
9034 * src/support/abort.C: new file
9036 * src/support/kill.C: new file
9038 * src/support/lyxlib.h: moved all the functions in this file
9039 insede struct lyx. Added also kill and abort to this struct. This
9040 is a way to avoid the "kill is not defined in <csignal>", we make
9041 C++ wrappers for functions that are not ANSI C or ANSI C++.
9043 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
9044 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
9045 lyx it has been renamed to sum.
9047 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9049 * src/text.C: add using directives for std::min and std::max.
9051 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9053 * src/texrow.C (getIdFromRow): actually return something useful in
9054 id and pos. Hopefully fixes the bug with positionning of errorbox
9057 * src/lyx_main.C (easyParse): output an error and exit if an
9058 incorrect command line option has been given.
9060 * src/spellchecker.C (ispell_check_word): document a memory leak.
9062 * src/bufferlist.C (write): fix mismatched allocation/deletion,
9063 where a "struct utimbuf" is allocated with "new" and deleted with
9066 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9068 * src/text2.C (CutSelection): don't delete double spaces.
9069 (PasteSelection): ditto
9070 (CopySelection): ditto
9072 * src/text.C (Backspace): don't delete double spaces.
9074 * src/lyxlex.C (next): fix a bug that were only present with
9075 conformant std::istream::get to read comment lines, use
9076 std::istream::getline instead. This seems to fix the problem.
9078 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9080 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
9081 allowed to insert space before space" editing problem. Please read
9082 commends at the beginning of the function. Comments about usage
9085 * src/text.C (InsertChar): fix for the "not allowed to insert
9086 space before space" editing problem.
9088 * src/text2.C (DeleteEmptyParagraphMechanism): when
9089 IsEmptyTableRow can only return false this last "else if" will
9090 always be a no-op. Commented out.
9092 * src/text.C (RedoParagraph): As far as I can understand tmp
9093 cursor is not really needed.
9095 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
9096 present it could only return false anyway.
9097 (several functions): Did something not so smart...added a const
9098 specifier on a lot of methods.
9100 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
9101 and add a tmp->text.resize. The LyXParagraph constructor does the
9103 (BreakParagraphConservative): ditto
9105 * src/support/path.h (Path): add a define so that the wrong usage
9106 "Path("/tmp") will be flagged as a compilation error:
9107 "`unnamed_Path' undeclared (first use this function)"
9109 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9111 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
9112 which was bogus for several reasons.
9114 * src/LaTeX.C (scanAux): fix the regular expression used to scan
9118 * autogen.sh: do not use "type -path" (what's that anyway?).
9120 * src/support/filetools.C (findtexfile): remove extraneous space
9121 which caused a kpsewhich warning (at least with kpathsea version
9124 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9126 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
9128 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
9130 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
9132 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9134 * src/paragraph.C (BreakParagraph): do not reserve space on text
9135 if we don't need to (otherwise, if pos_end < pos, we end up
9136 reserving huge amounts of memory due to bad unsigned karma).
9137 (BreakParagraphConservative): ditto, although I have not seen
9138 evidence the bug can happen here.
9140 * src/lyxparagraph.h: add a using std::list.
9142 2000-01-11 Juergen Vigna <jug@sad.it>
9144 * src/menus.C (MenuDocu): output an Alert if the documentation-file
9147 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9149 * src/vc-backend.C (doVCCommand): change to be static and take one
9150 more parameter: the path to chdir too be fore executing the command.
9151 (retrive): new function equiv to "co -r"
9153 * src/bufferlist.C (loadLyXFile): implement the missing parts if
9154 file_not_found_hook is true.
9156 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
9158 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
9159 if a file is readwrite,readonly...anything else.
9161 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9163 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
9164 (CreatePostscript): name change from MenuRunDVIPS (or something)
9165 (PreviewPostscript): name change from MenuPreviewPS
9166 (PreviewDVI): name change from MenuPreviewDVI
9168 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
9169 \view_pdf_command., \pdf_to_ps_command
9171 * lib/configure.m4: added search for PDF viewer, and search for
9172 PDF to PS converter.
9173 (lyxrc.defaults output): add \pdflatex_command,
9174 \view_pdf_command and \pdf_to_ps_command.
9176 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
9178 * src/bufferlist.C (write): we don't use blocksize for anything so
9181 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9183 * src/support/block.h: disable operator T* (), since it causes
9184 problems with both compilers I tried. See comments in the file.
9186 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
9189 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
9190 variable LYX_DIR_10x to LYX_DIR_11x.
9192 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
9194 * INSTALL: document --with-lyxname.
9197 * configure.in: new configure flag --with-lyxname which allows to
9198 choose the name under which lyx is installed. Default is "lyx", of
9199 course. It used to be possible to do this with --program-suffix,
9200 but the later has in fact a different meaning for autoconf.
9202 * src/support/lstrings.h (lstrchr): reformat a bit.
9204 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
9205 * src/mathed/math_defs.h: ditto.
9207 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9209 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
9210 true, decides if we create a backup file or not when saving. New
9211 tag and variable \pdf_mode, defaults to false. New tag and
9212 variable \pdflatex_command, defaults to pdflatex. New tag and
9213 variable \view_pdf_command, defaults to xpdf. New tag and variable
9214 \pdf_to_ps_command, defaults to pdf2ps.
9216 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9218 * src/bufferlist.C (close): don't call insetUnlock if the buffer
9219 does not have a BufferView.
9220 (unlockInset): ditto + don't access the_locking_inset if the
9221 buffer does not have a BufferView.
9223 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
9224 certain circumstances so that we don't continue a keyboard
9225 operation long after the key was released. Try f.ex. to load a
9226 large document, press PageDown for some seconds and then release
9227 it. Before this change the document would contine to scroll for
9228 some time, with this change it stops imidiatly.
9230 * src/support/block.h: don't allocate more space than needed. As
9231 long as we don't try to write to the arr[x] in a array_type arr[x]
9232 it is perfectly ok. (if you write to it you might segfault).
9233 added operator value_type*() so that is possible to pass the array
9234 to functions expecting a C-pointer.
9236 * lib/Makefile.am (dist-hook): don't fail completely if unable to
9239 * intl/*: updated to gettext 0.10.35, tried to add our own
9240 required modifications. Please verify.
9242 * po/*: updated to gettext 0.10.35, tried to add our own required
9243 modifications. Please verify.
9245 * src/support/lstrings.C (tostr): go at fixing the problem with
9246 cxx and stringstream. When stringstream is used return
9247 oss.str().c_str() so that problems with lyxstring and basic_string
9248 are avoided. Note that the best solution would be for cxx to use
9249 basic_string all the way, but it is not conformant yet. (it seems)
9251 * src/lyx_cb.C + other files: moved several global functions to
9252 class BufferView, some have been moved to BufferView.[Ch] others
9253 are still located in lyx_cb.C. Code changes because of this. (part
9254 of "get rid of current_view project".)
9256 * src/buffer.C + other files: moved several Buffer functions to
9257 class BufferView, the functions are still present in buffer.C.
9258 Code changes because of this.
9260 * config/lcmessage.m4: updated to most recent. used when creating
9263 * config/progtest.m4: updated to most recent. used when creating
9266 * config/gettext.m4: updated to most recent. applied patch for
9269 * config/gettext.m4.patch: new file that shows what changes we
9270 have done to the local copy of gettext.m4.
9272 * config/libtool.m4: new file, used in creation of acinclude.m4
9274 * config/lyxinclude.m4: new file, this is the lyx created m4
9275 macros, used in making acinclude.m4.
9277 * autogen.sh: GNU m4 discovered as a separate task not as part of
9278 the lib/configure creation.
9279 Generate acinlucde from files in config. Actually cat
9280 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
9281 easier to upgrade .m4 files that really are external.
9283 * src/Spacing.h: moved using std::istringstream to right after
9284 <sstream>. This should fix the problem seen with some compilers.
9286 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9288 * src/lyx_cb.C: began some work to remove the dependency a lot of
9289 functions have on BufferView::text, even if not really needed.
9290 (GetCurrentTextClass): removed this func, it only hid the
9293 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
9294 forgot this in last commit.
9296 * src/Bullet.C (bulletEntry): use static char const *[] for the
9297 tables, becuase of this the return arg had to change to string.
9299 (~Bullet): removed unneeded destructor
9301 * src/BufferView.C (beforeChange): moved from lyx_cb.C
9302 (insetSleep): moved from Buffer
9303 (insetWakeup): moved from Buffer
9304 (insetUnlock): moved from Buffer
9306 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
9307 from Buffer to BufferView.
9309 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
9311 * config/ltmain.sh: updated to version 1.3.4 of libtool
9313 * config/ltconfig: updated to version 1.3.4 of libtool
9315 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9318 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
9319 Did I get that right?
9321 * src/lyxlex.h: add a "using" directive or two.
9322 * src/Spacing.h: ditto.
9323 * src/insets/figinset.C: ditto.
9324 * src/support/filetools.C: ditto.
9325 * src/support/lstrings.C: ditto.
9326 * src/BufferView.C: ditto.
9327 * src/bufferlist.C: ditto.
9328 * src/lyx_cb.C: ditto.
9329 * src/lyxlex.C: ditto.
9331 * NEWS: add some changes for 1.1.4.
9333 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9335 * src/BufferView.C: first go at a TextCache to speed up switching
9338 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9340 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
9341 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
9342 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
9343 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
9346 * src/mathed/math_defs.h (MathedRowSt): make sure that all
9347 members of the struct are correctly initialized to 0 (detected by
9349 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
9350 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
9352 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
9353 pidwait, since it was allocated with "new". This was potentially
9354 very bad. Thanks to Michael Schmitt for running purify for us.
9357 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9359 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
9361 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
9363 1999-12-30 Allan Rae <rae@lyx.org>
9365 * lib/templates/IEEEtran.lyx: minor change
9367 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
9368 src/mathed/formula.C (LocalDispatch): askForText changes
9370 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
9371 know when a user has cancelled input. Fixes annoying problems with
9372 inserting labels and version control.
9374 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9376 * src/support/lstrings.C (tostr): rewritten to use strstream and
9379 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9381 * src/support/filetools.C (IsFileWriteable): use fstream to check
9382 (IsDirWriteable): use fileinfo to check
9384 * src/support/filetools.h (FilePtr): whole class deleted
9386 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
9388 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
9390 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
9392 * src/bufferlist.C (write): use ifstream and ofstream instead of
9395 * src/Spacing.h: use istrstream instead of sscanf
9397 * src/mathed/math_defs.h: change first arg to istream from FILE*
9399 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
9401 * src/mathed/math_parser.C: have yyis to be an istream
9402 (LexGetArg): use istream (yyis)
9404 (mathed_parse): ditto
9405 (mathed_parser_file): first arg istream instead of FILE*, set yyis
9407 * src/mathed/formula.C (Read): rewritten to use istream
9409 * src/mathed/formulamacro.C (Read): rewritten to use istream
9411 * src/lyxlex.h (~LyXLex): deleted desturctor
9412 (getStream): new function, returns an istream
9413 (getFile): deleted funtion
9414 (IsOK): return is.good();
9416 * src/lyxlex.C (LyXLex): delete file and owns_file
9417 (setFile): open an filebuf and assign that to a istream instead of
9419 (setStream): new function, takes an istream as arg.
9420 (setFile): deleted function
9421 (EatLine): rewritten us use istream instead of FILE*
9425 * src/table.C (LyXTable): use istream instead of FILE*
9426 (Read): rewritten to take an istream instead of FILE*
9428 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9430 * src/buffer.C (Dispatch): remove an extraneous break statement.
9432 * src/support/filetools.C (QuoteName): change to do simple
9433 'quoting'. More work is necessary. Also changed to do nothing
9434 under emx (needs fix too).
9435 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
9437 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
9438 config.h.in to the AC_DEFINE_UNQUOTED() call.
9439 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
9440 needs char * as argument (because Solaris 7 declares it like
9443 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
9444 remove definition of BZERO.
9446 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9448 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
9449 defined, "lyxregex.h" if not.
9451 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
9453 (REGEX): new variable that is set to regex.c lyxregex.h when
9454 AM_CONDITIONAL USE_REGEX is set.
9455 (libsupport_la_SOURCES): add $(REGEX)
9457 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
9460 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
9463 * configure.in: add call to LYX_REGEX
9465 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
9466 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
9468 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9470 * lib/bind/fi_menus.bind: new file, from
9471 pauli.virtanen@saunalahti.fi.
9473 * src/buffer.C (getBibkeyList): pass the parameter delim to
9474 InsetInclude::getKeys and InsetBibtex::getKeys.
9476 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
9477 is passed to Buffer::getBibkeyList
9479 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
9480 instead of the hardcoded comma.
9482 * src/insets/insetbib.C (getKeys): make sure that there are not
9483 leading blanks in bibtex keys. Normal latex does not care, but
9484 harvard.sty seems to dislike blanks at the beginning of citation
9485 keys. In particular, the retturn value of the function is
9487 * INSTALL: make it clear that libstdc++ is needed and that gcc
9488 2.7.x probably does not work.
9490 * src/support/filetools.C (findtexfile): make debug message go to
9492 * src/insets/insetbib.C (getKeys): ditto
9494 * src/debug.C (showTags): make sure that the output is correctly
9497 * configure.in: add a comment for TWO_COLOR_ICON define.
9499 * acconfig.h: remove all the entries that already defined in
9500 configure.in or acinclude.m4.
9502 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
9503 to avoid user name, date and copyright.
9505 1999-12-21 Juergen Vigna <jug@sad.it>
9507 * src/table.C (Read): Now read bogus row format informations
9508 if the format is < 5 so that afterwards the table can
9509 be read by lyx but without any format-info. Fixed the
9510 crash we experienced when not doing this.
9512 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9514 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
9515 (RedoDrawingOfParagraph): ditto
9516 (RedoParagraphs): ditto
9517 (RemoveTableRow): ditto
9519 * src/text.C (Fill): rename arg paperwidth -> paper_width
9521 * src/buffer.C (insertLyXFile): rename var filename -> fname
9522 (writeFile): rename arg filename -> fname
9523 (writeFileAscii): ditto
9524 (makeLaTeXFile): ditto
9525 (makeLinuxDocFile): ditto
9526 (makeDocBookFile): ditto
9528 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
9531 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
9533 * src/bmtable.h: add extern "C" on this file when __cplusplus is
9536 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
9537 compiled by a C compiler not C++.
9539 * src/layout.h (LyXTextClass): added typedef for const_iterator
9540 (LyXTextClassList): added typedef for const_iterator + member
9541 functions begin and end.
9543 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
9544 iterators to fill the choice_class.
9545 (updateLayoutChoice): rewritten to use iterators to fill the
9546 layoutlist in the toolbar.
9548 * src/BufferView.h (BufferView::work_area_width): removed unused
9551 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
9553 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
9554 (sgmlCloseTag): ditto
9556 * src/support/lstrings.h: return type of countChar changed to
9559 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
9560 what version of this func to use. Also made to return unsigned int.
9562 * configure.in: call LYX_STD_COUNT
9564 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
9565 conforming std::count.
9567 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9569 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
9570 and a subscript would give bad display (patch from Dekel Tsur
9571 <dekel@math.tau.ac.il>).
9573 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
9575 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
9578 * src/chset.h: add a few 'using' directives
9580 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
9581 triggered when no buffer is active
9583 * src/layout.C: removed `break' after `return' in switch(), since
9586 * src/lyx_main.C (init): make sure LyX can be ran in place even
9587 when libtool has done its magic with shared libraries. Fix the
9588 test for the case when the system directory has not been found.
9590 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
9591 name for the latex file.
9592 (MenuMakeHTML): ditto
9594 * src/buffer.h: add an optional boolean argument, which is passed
9597 1999-12-20 Allan Rae <rae@lyx.org>
9599 * lib/templates/IEEEtran.lyx: small correction and update.
9601 * configure.in: Attempted to use LYX_PATH_HEADER
9603 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
9605 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
9606 input from JMarc. Now use preprocessor to find the header.
9607 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
9608 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
9609 LYX_STL_STRING_FWD. See comments in file.
9611 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
9613 * The global MiniBuffer * minibuffer variable is dead.
9615 * The global FD_form_main * fd_form_main variable is dead.
9617 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9619 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
9621 * src/table.h: add the LOstream.h header
9622 * src/debug.h: ditto
9624 * src/LyXAction.h: change the explaination of the ReadOnly
9625 attribute: is indicates that the function _can_ be used.
9627 * src/LyXAction.C (init): find-replace _can_ be used in read-only
9630 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9632 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
9638 * src/paragraph.C (GetWord): assert on pos>=0
9641 * src/support/lyxstring.C: condition the use of an invariant on
9643 * src/support/lyxstring.h: ditto
9645 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
9646 Use LAssert.h instead of plain assert().
9648 * src/support/lstrings.h: add LAssert.h, in case it is needed.
9650 * src/lyxfunc.C: do not include LAssert.h, it is not used.
9651 * src/support/filetools.C: ditto
9653 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
9656 * INSTALL: document the new configure flags
9658 * configure.in: suppress --with-debug; add --enable-assertions
9660 * acinclude.m4: various changes in alignment of help strings.
9662 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9664 * src/kbmap.C: commented out the use of the hash map in kb_map,
9665 beginning of movement to a stl::container.
9667 * several files: removed code that was not in effect when
9668 MOVE_TEXT was defined.
9670 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
9671 for escaping should not be used. We can discuss if the string
9672 should be enclosed in f.ex. [] instead of "".
9674 * src/trans_mgr.C (insert): use the new returned value from
9675 encodeString to get deadkeys and keymaps done correctly.
9677 * src/chset.C (encodeString): changed to return a pair, to tell
9678 what to use if we know the string.
9680 * src/lyxscreen.h (fillArc): new function.
9682 * src/FontInfo.C (resize): rewritten to use more std::string like
9683 structore, especially string::replace.
9685 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
9688 * configure.in (chmod +x some scripts): remove config/gcc-hack
9690 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9692 * src/buffer.C (writeFile): change once again the top comment in a
9693 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
9694 instead of an hardcoded version number.
9695 (makeDocBookFile): ditto
9697 * src/version.h: add new define LYX_DOCVERSION
9699 * po/de.po: update from Pit Sütterlin
9700 * lib/bind/de_menus.bind: ditto.
9702 * src/lyxfunc.C (Dispatch): call MenuExport()
9703 * src/buffer.C (Dispatch): ditto
9705 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
9706 LyXFunc::Dispatch().
9707 (MenuExport): new function, moved from
9708 LyXFunc::Dispatch().
9710 * src/trans_mgr.C (insert): small cleanup
9711 * src/chset.C (loadFile): ditto
9713 * lib/kbd/iso8859-1.cdef: add missing backslashes
9715 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9717 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
9718 help with placing the manually drawn accents better.
9720 (Draw): x2 and hg changed to float to minimize rounding errors and
9721 help place the accents better.
9723 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
9724 unsigned short to char is just wrong...cast the char to unsigned
9725 char instead so that the two values can compare sanely. This
9726 should also make the display of insetlatexaccents better and
9727 perhaps also some other insets.
9729 (lbearing): new function
9732 1999-12-15 Allan Rae <rae@lyx.org>
9734 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
9735 header that provides a wrapper around the very annoying SGI STL header
9738 * src/support/lyxstring.C, src/LString.h:
9739 removed old SGI-STL-compatability attempts.
9741 * configure.in: Use LYX_STL_STRING_FWD.
9743 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
9744 stl_string_fwd.h is around and try to determine it's location.
9745 Major improvement over previous SGI STL 3.2 compatability.
9746 Three small problems remain with this function due to my zero
9747 knowledge of autoconf. JMarc and lgb see the comments in the code.
9749 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9751 * src/broken_const.h, config/hack-gcc, config/README: removed
9753 * configure.in: remove --with-gcc-hack option; do not call
9756 * INSTALL: remove documentation of --with-broken-const and
9759 * acconfig.h: remove all trace of BROKEN_CONST define
9761 * src/buffer.C (makeDocBookFile): update version number in output
9763 (SimpleDocBookOnePar): fix an assert when trying to a character
9764 access beyond string length
9767 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9769 * po/de.po: fix the Export menu
9771 * lyx.man: update the description of -dbg
9773 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
9774 (commandLineHelp): updated
9775 (easyParse): show list of available debug levels if -dbg is passed
9778 * src/Makefile.am: add debug.C
9780 * src/debug.h: moved some code to debug.C
9782 * src/debug.C: new file. Contains code to set and show debug
9785 * src/layout.C: remove 'break' after 'continue' in switch
9786 statements, since these cannot be reached.
9788 1999-12-13 Allan Rae <rae@lyx.org>
9790 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
9791 (in_word_set): hash() -> math_hash()
9793 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
9795 * acconfig.h: Added a test for whether we are using exceptions in the
9796 current compilation run. If so USING_EXCEPTIONS is defined.
9798 * config.in: Check for existance of stl_string_fwd.h
9799 * src/LString.h: If compiling --with-included-string and SGI's
9800 STL version 3.2 is present (see above test) we need to block their
9801 forward declaration of string and supply a __get_c_string().
9802 However, it turns out this is only necessary if compiling with
9803 exceptions enabled so I've a bit more to add yet.
9805 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
9806 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
9807 src/support/LRegex.h, src/undo.h:
9808 Shuffle the order of the included files a little to ensure that
9809 LString.h gets included before anything that includes stl_string_fwd.h
9811 * src/support/lyxstring.C: We need to #include LString.h instead of
9812 lyxstring.h to get the necessary definition of __get_c_string.
9813 (__get_c_string): New function. This is defined static just like SGI's
9814 although why they need to do this I'm not sure. Perhaps it should be
9815 in lstrings.C instead.
9817 * lib/templates/IEEEtran.lyx: New template file.
9819 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9821 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
9822 * intl/Makefile.in (MKINSTALLDIRS): ditto
9824 * src/LyXAction.C (init): changed to hold the LFUN data in a
9825 automatic array in stead of in callso to newFunc, this speeds up
9826 compilation a lot. Also all the memory used by the array is
9827 returned when the init is completed.
9829 * a lot of files: compiled with -Wold-style-cast, changed most of
9830 the reported offenders to C++ style casts. Did not change the
9831 offenders in C files.
9833 * src/trans.h (Match): change argument type to unsigned int.
9835 * src/support/DebugStream.C: fix some types on the streambufs so
9836 that it works on a conforming implementation.
9838 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9840 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
9842 * src/support/lyxstring.C: remove the inline added earlier since
9843 they cause a bunch of unsatisfied symbols when linking with dec
9844 cxx. Cxx likes to have the body of inlines at the place where they
9847 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
9848 accessing negative bounds in array. This fixes the crash when
9849 inserting accented characters.
9850 * src/trans.h (Match): ditto
9852 * src/buffer.C (Dispatch): since this is a void, it should not try
9853 to return anything...
9855 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9857 * src/buffer.h: removed the two friends from Buffer. Some changes
9858 because of this. Buffer::getFileName and Buffer::setFileName
9859 renamed to Buffer::fileName() and Buffer::fileName(...).
9861 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9863 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
9864 and Buffer::update(short) to BufferView. This move is currently
9865 controlled by a define MOVE_TEXT, this will be removed when all
9866 shows to be ok. This move paves the way for better separation
9867 between buffer contents and buffer view. One side effect is that
9868 the BufferView needs a rebreak when swiching buffers, if we want
9869 to avoid this we can add a cache that holds pointers to LyXText's
9870 that is not currently in use.
9872 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
9875 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9877 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
9879 * lyx_main.C: new command line option -x (or --execute) and
9880 -e (or --export). Now direct conversion from .lyx to .tex
9881 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
9882 Unfortunately, X is still needed and the GUI pops up during the
9885 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9887 * src/Spacing.C: add a using directive to bring stream stuff into
9889 * src/paragraph.C: ditto
9890 * src/buffer.C: ditto
9892 * NEWS: updated a bit the new features of 1.1.3 (took a few things
9893 from Lars' announcement).
9895 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
9896 example files from Tino Meinen.
9898 1999-12-06 Allan Rae <rae@lyx.org>
9900 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
9902 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9904 * src/support/lyxstring.C: added a lot of inline for no good
9907 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
9908 latexWriteEndChanges, they were not used.
9910 * src/layout.h (operator<<): output operator for PageSides
9912 * src/mathed/math_iter.C (my_memcpy): slightly changed.
9914 * some example files: loaded in LyX 1.0.4 and saved again to update
9915 certain constructs (table format)
9917 * a lot of files: did the change to use fstream/iostream for all
9918 writing of files. Done with a close look at Andre Poenitz's patch.
9920 * some files: whitespace changes.
9922 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9924 * src/mathed/math_iter.C (my_memcpy): new function. Since the
9925 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
9926 architecture, we provide our own. It is used unconditionnally, but
9927 I do not think this is a performance problem. Thanks to Angus
9928 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
9929 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
9931 (GetInset): use my_memcpy.
9935 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
9936 it is easier to understand, but it uses less TeX-only constructs now.
9938 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
9939 elements contain spaces
9941 * lib/configure: regenerated
9943 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
9944 elements contain spaces; display the list of programs that are
9947 * autogen.sh: make sure lib/configure is executable
9949 * lib/examples/*: rename the tutorial examples to begin with the
9950 two-letters language code.
9952 * src/lyxfunc.C (getStatus): do not query current font if no
9955 * src/lyx_cb.C (RunScript): use QuoteName
9956 (MenuRunDvips): ditto
9957 (PrintApplyCB): ditto
9959 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
9960 around argument, so that it works well with the current shell.
9961 Does not work properly with OS/2 shells currently.
9963 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
9964 * src/LyXSendto.C (SendtoApplyCB): ditto
9965 * src/lyxfunc.C (Dispatch): ditto
9966 * src/buffer.C (runLaTeX): ditto
9967 (runLiterate): ditto
9968 (buildProgram): ditto
9970 * src/lyx_cb.C (RunScript): ditto
9971 (MenuMakeLaTeX): ditto
9973 * src/buffer.h (getLatexName): new method
9975 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
9977 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9979 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
9980 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
9981 (create_math_panel): ditto
9983 * src/lyxfunc.C (getStatus): re-activate the code which gets
9984 current font and cursor; add test for export to html.
9986 * src/lyxrc.C (read): remove unreachable break statements; add a
9989 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
9991 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9993 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
9994 introduced by faulty regex.
9995 * src/buffer.C: ditto
9996 * src/lastfiles.C: ditto
9997 * src/paragraph.C: ditto
9998 * src/table.C: ditto
9999 * src/vspace.C: ditto
10000 * src/insets/figinset.C: ditto
10001 Note: most of these is absolutely harmless, except the one in
10002 src/mathed formula.C.
10004 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
10006 * src/ImportNoweb.C (documentclass): fixed bounds for substr
10007 operation, yielding correct results for the reLyX command.
10009 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10011 * src/support/filetools.C (ExpandPath): removed an over eager
10013 (ReplaceEnvironmentPath): ditto
10015 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
10016 shows that we are doing something fishy in our code...
10017 (BubblePost): ditto
10020 * src/lyxrc.C (read): use a double switch trick to get more help
10021 from the compiler. (the same trick is used in layout.C)
10022 (write): new function. opens a ofstream and pass that to output
10023 (output): new function, takes a ostream and writes the lyxrc
10024 elemts to it. uses a dummy switch to make sure no elements are
10027 * src/lyxlex.h: added a struct pushpophelper for use in functions
10028 with more than one exit point.
10030 * src/lyxlex.[Ch] (GetInteger): made it const
10034 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
10036 * src/layout.[hC] : LayoutTags splitted into several enums, new
10037 methods created, better error handling cleaner use of lyxlex. Read
10040 * src/bmtable.[Ch]: change some member prototypes because of the
10041 image const changes.
10043 * commandtags.h, src/LyXAction.C (init): new function:
10044 "preferences-save", saves the lyxrc entries into .lyx/preferences.
10045 This file is not read automatically but you can add \input
10046 preferences to your lyxrc if you want to. We need to discuss how
10049 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
10050 in .aux, also remove .bib and .bst files from dependencies when
10053 * src/BufferView.C, src/LyXView.C: add const_cast several places
10054 because of changes to images.
10056 * lib/images/*: same change as for images/*
10058 * lib/lyxrc.example: Default for accept_compound is false not no.
10060 * images/*: changed to be const, however I have som misgivings
10061 about this change so it might be changed back.
10063 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10065 * lib/configure, po/POTFILES.in: regenerated
10067 * autogen.sh: autogenerate lib/configure from lib/configure.m4
10069 * config/lib_configure.m4: removed
10071 * lib/configure.m4: new file (was config/lib_configure.m4)
10073 * configure.in: do not test for rtti, since we do not use it.
10075 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10077 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
10078 doubling of allocated space scheme. This makes it faster for large
10079 strings end to use less memory for small strings. xtra rememoved.
10081 * src/insets/figinset.C (waitalarm): commented out.
10082 (GhostscriptMsg): use static_cast
10083 (GhostscriptMsg): use new instead of malloc to allocate memory for
10084 cmap. also delete the memory after use.
10086 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
10088 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
10089 for changes in bibtex database or style.
10090 (runBibTeX): remove all .bib and .bst files from dep before we
10092 (run): use scanAuc in when dep file already exist.
10094 * src/DepTable.C (remove_files_with_extension): new method
10095 (exist): new method
10097 * src/DepTable.[Ch]: made many of the methods const.
10099 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10101 * src/bufferparams.C: make sure that the default textclass is
10102 "article". It used to be the first one by description order, but
10103 now the first one is "docbook".
10105 * src/lyx_main.C (setDebuggingLevel): change type of argument to
10106 string; call Debug::value.
10107 (easyParse): pass complete argument to setDebuggingLevel().
10109 * src/debug.h (value): fix the code that parses debug levels.
10111 * src/debug.h: add new debug type ACTION, reserved for LyXAction
10114 * src/LyXAction.C: use Debug::ACTION as debug channel.
10116 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
10118 * NEWS: updated for the future 1.1.3 release.
10120 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
10121 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
10122 it should. This is of course a controversial change (since many
10123 people will find that their lyx workscreen is suddenly full of
10124 red), but done for the sake of correctness.
10126 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
10127 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
10129 * src/insets/inseterror.h, src/insets/inseturl.h,
10130 src/insets/insetinfo.h, src/insets/figinset.h,
10131 src/mathed/formulamacro.h, src/mathed/math_macro.h
10132 (EditMessage): add a missing const and add _() to make sure that
10133 translation happens
10135 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
10136 src/insets/insetbib.C, src/support/filetools.C: add `using'
10137 directives for cxx.
10139 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
10140 doing 'Insert index of last word' at the beginning of a paragraph.
10142 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10144 * several files: white-space changes.
10146 * src/mathed/formula.C: removed IsAlpha and IsDigit
10148 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
10149 .bib file. use a ifstream instead of FilePtr when parsing the .bib
10152 * src/insets/figinset.C (GetPSSizes): don't break when
10153 "EndComments" is seen. But break when a boundingbox is read.
10155 * all classes inherited from Inset: return value of Clone
10156 changed back to Inset *.
10158 * all classes inherited form MathInset: return value of Clone
10159 changed back to MathedInset *.
10161 * src/insets/figinset.C (runqueue): use a ofstream to output the
10162 gs/ps file. Might need some setpresicion or setw. However I can
10163 see no problem with the current code.
10164 (runqueue): use sleep instead of the alarm/signal code. I just
10165 can't see the difference.
10167 * src/paragraph.C (LyXParagraph): reserve space in the new
10168 paragraph and resize the inserted paragraph to just fit.
10170 * src/lyxfunc.h (operator|=): added operator for func_status.
10172 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
10173 check for readable file.
10175 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
10176 check for readable file.
10177 (MenuMakeLinuxDoc): ditto
10178 (MenuMakeDocBook): ditto
10179 (MenuMakeAscii): ditto
10180 (InsertAsciiFile): split the test for openable and readable
10182 * src/bmtable.C (draw_bitmaptable): use
10183 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
10185 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
10186 findtexfile from LaTeX to filetools.
10188 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
10189 instead of FilePtr. Needs to be verified by a literate user.
10191 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10193 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
10194 (EditMessage): likewise.
10196 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
10197 respectively as \textasciitilde and \textasciicircum.
10199 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10201 * src/support/lyxstring.h: made the methods that take iterators
10202 use const_iterator.
10204 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
10205 (regexMatch): made is use the real regex class.
10207 * src/support/Makefile.am: changed to use libtool
10209 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
10211 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
10213 (MathIsInset ++): changed several macros to be inline functions
10216 * src/mathed/Makefile.am: changed to use libtool
10218 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
10220 * src/insets/inset* : Clone changed to const and return type is
10221 the true insettype not just Inset*.
10223 * src/insets/Makefile.am: changed to use libtool
10225 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
10227 * src/undo.[Ch] : added empty() and changed some of the method
10230 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
10232 * src/lyxparagraph.h: use id() and id(...) instead of getID and
10233 setID use block<> for the bullets array, added const several places.
10235 * src/lyxfunc.C (getStatus): new function
10237 * src/lyxfunc.[Ch] : small changes to take advantage of the new
10238 LyXAction, added const to several funtions.
10240 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
10241 a std::map, and to store the dir items in a vector.
10243 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
10246 * src/LyXView.[Ch] + other files : changed currentView to view.
10248 * src/LyXAction.[Ch] : ported from the old devel branch.
10250 * src/.cvsignore: added .libs and a.out
10252 * configure.in : changes to use libtool.
10254 * acinclude.m4 : inserted libtool.m4
10256 * .cvsignore: added libtool
10258 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10260 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
10261 file name in insets and mathed directories (otherwise the
10262 dependency is not taken in account under cygwin).
10264 * src/text2.C (InsertString[AB]): make sure that we do not try to
10265 read characters past the string length.
10267 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10269 * lib/doc/LaTeXConfig.lyx.in,
10270 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
10272 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
10273 file saying who created them and when this heppened; this is
10274 useless and annoys tools like cvs.
10276 * lib/layouts/g-brief-{en,de}.layout,
10277 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
10278 from Thomas Hartkens <thomas@hartkens.de>.
10280 * src/{insets,mathed}/Makefile.am: do not declare an empty
10281 LDFLAGS, so that it can be set at configure time (useful on Irix
10284 * lib/reLyX/configure.in: make sure that the prefix is set
10285 correctly in LYX_DIR.
10287 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10289 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
10290 be used by 'command-sequence' this allows to bind a key to a
10291 sequence of LyX-commands
10292 (Example: 'command-sequence math-insert alpha; math-insert beta;")
10294 * src/LyXAction.C: add "command-sequence"
10296 * src/LyXFunction.C: handling of "command-sequence"
10298 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
10299 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
10301 * src/lyxserver.C, src/minibuffer.C: Use this new interface
10303 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10305 * src/buffer.C (writeFile): Do not output a comment giving user
10306 and date at the beginning of a .lyx file. This is useless and
10307 annoys cvs anyway; update version number to 1.1.
10309 * src/Makefile.am (LYX_DIR): add this definition, so that a
10310 default path is hardcoded in LyX.
10312 * configure.in: Use LYX_GNU_GETTEXT.
10314 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
10315 AM_GNU_GETTEXT with a bug fixed.
10317 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
10319 * src/chset.C: add "using std::ifstream;" to please dec cxx.
10321 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
10322 which is used to point to LyX data is now LYX_DIR_11x.
10324 * lyx.man: convert to a unix text file; small updates.
10326 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10328 * src/support/LSubstring.[Ch]: made the second arg of most of the
10329 constructors be a const reference.
10331 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
10334 * src/support/lyxstring.[Ch] (swap): added missing member function
10335 and specialization of swap(str, str);
10337 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
10339 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
10340 trace of the old one.
10342 * src/undo.[Ch]: made the undostack use std::list to store undo's in
10343 put the member definitions in undo.C.
10345 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
10346 NEW_TEXT and have now only code that was included when this was
10349 * src/intl.C (LCombo): use static_cast
10351 (DispatchCallback): ditto
10353 * src/definitions.h: removed whole file
10355 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
10357 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
10358 parsing and stores in a std:map. a regex defines the file format.
10359 removed unneeded members.
10361 * src/bufferparams.h: added several enums from definitions.h here.
10362 Removed unsused destructor. Changed some types to use proper enum
10363 types. use block to have the temp_bullets and user_defined_bullets
10364 and to make the whole class assignable.
10366 * src/bufferparams.C (Copy): removed this functions, use a default
10367 assignment instead.
10369 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
10372 * src/buffer.C (readLyXformat2): commend out all that have with
10373 oldpapersize to do. also comment out all that hve to do with
10374 insetlatex and insetlatexdel.
10375 (setOldPaperStuff): commented out
10377 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
10379 * src/LyXAction.C: remove use of inset-latex-insert
10381 * src/mathed/math_panel.C (button_cb): use static_cast
10383 * src/insets/Makefile.am (insets_o_SOURCES): removed
10386 * src/support/lyxstring.C (helper): use the unsigned long
10387 specifier, UL, instead of a static_cast.
10389 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
10391 * src/support/block.h: new file. to be used as a c-style array in
10392 classes, so that the class can be assignable.
10394 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10396 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
10397 NULL, make sure to return an empty string (it is not possible to
10398 set a string to NULL).
10400 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10402 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
10404 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
10406 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
10407 link line, so that Irix users (for example) can set it explicitely to
10410 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
10411 it can be overidden at make time (static or dynamic link, for
10414 * src/vc-backend.C, src/LaTeXFeatures.h,
10415 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
10416 statements to bring templates to global namespace.
10418 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10420 * src/support/lyxstring.C (operator[] const): make it standard
10423 * src/minibuffer.C (Init): changed to reflect that more
10424 information is given from the lyxvc and need not be provided here.
10426 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
10428 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
10430 * src/LyXView.C (UpdateTimerCB): use static_cast
10431 (KeyPressMask_raw_callback): ditto
10433 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
10434 buffer_, a lot of changes because of this. currentBuffer() ->
10435 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
10436 also changes to other files because of this.
10438 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10440 * src/vc-backend.[Ch]: new files. The backends for vc handling,
10441 have no support for RCS and partial support for CVS, will be
10444 * src/insets/ several files: changes because of function name
10445 changes in Bufferview and LyXView.
10447 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
10449 * src/support/LSubstring.[Ch]: new files. These implement a
10450 Substring that can be very convenient to use. i.e. is this
10452 string a = "Mary had a little sheep";
10453 Substring(a, "sheep") = "lamb";
10454 a is now "Mary has a little lamb".
10456 * src/support/LRegex.[Ch]: a regex class that can be used to pick
10457 out patterns and subpatterns of strings. It is used by LSubstring
10458 and also by vc-backend.C
10460 * src/support/lyxstring.C: went over all the assertions used and
10461 tried to correct the wrong ones and flag which of them is required
10462 by the standard. some bugs found because of this. Also removed a
10463 couple of assertions.
10465 * src/support/Makefile.am (libsupport_a_SOURCES): added
10466 LSubstring.[Ch] and LRegex.[Ch]
10468 * src/support/FileInfo.h: have struct stat buf as an object and
10469 not a pointer to one, some changes because of this.
10471 * src/LaTeXFeatures.C (getTClassPreamble): also use the
10472 information in layout when adding the layouts preamble to the
10473 textclass preamble.
10475 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
10478 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
10479 because of bug in OS/2.
10481 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10483 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
10484 \verbatim@font instead of \ttfamily, so that it can be redefined.
10486 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
10487 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
10488 src/layout.h, src/text2.C: add 'using' directive to bring the
10489 STL templates we need from the std:: namespace to the global one.
10490 Needed by DEC cxx in strict ansi mode.
10492 * src/support/LIstream.h,src/support/LOstream.h,
10493 src/support/lyxstring.h,src/table.h,
10494 src/lyxlookup.h: do not include <config.h> in header
10495 files. This should be done in the .C files only.
10497 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
10501 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10503 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
10504 from Kayvan to fix the tth invokation.
10506 * development/lyx.spec.in: updates from Kayvan to reflect the
10507 changes of file names.
10509 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10511 * src/text2.C (InsertStringB): use std::copy
10512 (InsertStringA): use std::copy
10514 * src/bufferlist.C: use a vector to store the buffers in. This is
10515 an internal change and should not affect any other thing.
10517 * src/BufferView.C (waitForX): use XSync instead of the lengthy
10520 * src/text.C (Fill): fix potential bug, one off bug.
10522 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10524 * src/Makefile.am (lyx_main.o): add more files it depends on.
10526 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
10528 * src/support/lyxstring.C: use size_t for the reference count,
10529 size, reserved memory and xtra.
10530 (internal_compare): new private member function. Now the compare
10531 functions should work for std::strings that have embedded '\0'
10533 (compare): all compare functions rewritten to use
10536 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10538 * src/support/lyxstring.C (compare): pass c_str()
10539 (compare): pass c_str
10540 (compare): pass c_str
10542 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10544 * src/support/DebugStream.C: <config.h> was not included correctly.
10546 * lib/configure: forgot to re-generate it :( I'll make this file
10547 auto generated soon.
10549 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10551 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
10554 * src/support/lyxstring.C: some changes from length() to rep->sz.
10555 avoids a function call.
10557 * src/support/filetools.C (SpaceLess): yet another version of the
10558 algorithm...now per Jean-Marc's suggestions.
10560 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10562 * src/layout.C (less_textclass_desc): functor for use in sorting
10564 (LyXTextClass::Read): sort the textclasses after reading.
10566 * src/support/filetools.C (SpaceLess): new version of the
10567 SpaceLess functions. What problems does this one give? Please
10570 * images/banner_bw.xbm: made the arrays unsigned char *
10572 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10574 * src/support/lyxstring.C (find): remove bogus assertion in the
10575 two versions of find where this has not been done yet.
10577 * src/support/lyxlib.h: add missing int return type to
10580 * src/menus.C (ShowFileMenu): disable exporting to html if no
10581 html export command is present.
10583 * config/lib_configure.m4: add a test for an HTML converter. The
10584 programs checked for are, in this order: tth, latex2html and
10587 * lib/configure: generated from config/lib_configure.m4.
10589 * src/lyxfunc.C (Dispatch): update and improve the execution of an
10590 html converter. The parameters are now passed through $$FName and
10591 $$OutName, instead of standard input/output.
10593 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
10595 * lib/lyxrc.example: update description of \html_command.
10596 add "quotes" around \screen_font_xxx font setting examples to help
10597 people who use fonts with spaces in their names.
10599 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10601 * Distribution files: updates for v1.1.2
10603 * src/support/lyxstring.C (find): remove bogus assert and return
10604 npos for the same condition.
10606 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10608 * added patch for OS/2 from SMiyata.
10610 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10612 * src/text2.C (CutSelection): make space_wrapped a bool
10613 (CutSelection): dont declare int i until we have to.
10614 (alphaCounter): return a char const *.
10616 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10618 * src/support/syscall.C (Systemcalls::kill):
10619 src/support/filetools.C (PutEnv, PutEnvPath):
10620 src/lyx_cb.C (addNewlineAndDepth):
10621 src/FontInfo.C (FontInfo::resize): condition some #warning
10622 directives with WITH_WARNINGS.
10625 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10627 * src/layout.[Ch] + several files: access to class variables
10628 limited and made accessor functions instead a lot of code changed
10629 becuase of this. Also instead of returning pointers often a const
10630 reference is returned instead.
10632 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
10634 * src/Makefile.am (dist-hook): added used to remove the CVS from
10635 cheaders upon creating a dist
10636 (EXTRA_DIST): added cheaders
10638 * src/support/lstrings.C (tostr(char)): fix it to handle param as
10639 a character not as a small integer.
10641 * src/support/lyxstring.C (find): removed Assert and added i >=
10642 rep->sz to the first if.
10644 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10646 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
10647 src/LyXView.C src/buffer.C src/bufferparams.C
10648 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
10649 src/text2.C src/insets/insetinclude.C:
10650 lyxlayout renamed to textclasslist.
10652 * src/layout.C: some lyxerr changes.
10654 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
10655 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
10656 (LyXLayoutList): removed all traces of this class.
10657 (LyXTextClass::Read): rewrote LT_STYLE
10658 (LyXTextClass::hasLayout): new function
10659 (LyXTextClass::GetLayout): rewritten to return an iterator + has
10660 both const and nonconst version.
10661 (LyXTextClass::delete_layout): new function.
10662 (LyXTextClassList::Style): bug fix. do the right thing if layout
10664 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
10665 (LyXTextClassList::NameOfLayout): ditto
10666 (LyXTextClassList::Load): ditto
10668 * src/buffer.C (makeLaTeXFile): new access to layoutlist
10670 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
10672 * src/LyXAction.C (LookupFunc): added a workaround for sun
10673 compiler, on the other hand...we don't know if the current code
10674 compiles on sun at all...
10676 * src/support/filetools.C (CleanupPath): subst fix
10678 * src/insets/insetbib.C (delDatabase): subst fix, this looks
10681 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
10682 complained about this one?
10684 * src/insets/insetinclude.C (Latex): subst fix
10686 * src/insets/insetbib.C (getKeys): subst fix
10688 * src/LyXSendto.C (SendtoApplyCB): subst fix
10690 * src/lyx_main.C (init): subst fix
10692 * src/layout.C (Read): subst fix
10694 * src/lyx_sendfax_main.C (button_send): subst fix
10696 * src/buffer.C (RoffAsciiTable): subst fix
10698 * src/lyx_cb.C (MenuFax): subst fix
10699 (PrintApplyCB): subst fix
10701 1999-10-26 Juergen Vigna <jug@sad.it>
10703 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
10705 (Read): Cleaned up this code so now we read only format vestion >= 5
10707 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10709 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
10710 come nobody has complained about this one?
10712 * src/insets/insetinclude.C (Latex): subst fix
10714 * src/insets/insetbib.C (getKeys): subst fix
10716 * src/lyx_main.C (init): subst fix
10718 * src/layout.C (Read): subst fix
10720 * src/buffer.C (RoffAsciiTable): subst fix
10722 * src/lyx_cb.C (MenuFax): subst fix.
10724 * src/layout.[hC] + some other files: rewrote to use
10725 std::container to store textclasses and layouts in.
10726 Simplified, removed a lot of code. Make all classes
10727 assignable. Further simplifications and review of type
10728 use still to be one.
10730 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
10731 lastfiles to create the lastfiles partr of the menu.
10733 * src/lastfiles.[Ch]: rewritten to use deque to store the
10734 lastfiles in. Uses fstream for reading and writing. Simplifies
10737 * src/support/syscall.C: remove explicit cast.
10739 * src/BufferView.C (CursorToggleCB): removed code snippets that
10740 were commented out.
10741 use explicat C++ style casts instead of C style casts. also use
10742 u_vdata instea of passing pointers in longs.
10744 * src/PaperLayout.C: removed code snippets that were commented out.
10746 * src/lyx_gui_misc.C: removed code snippets that were commented out.
10748 * src/lyx_main.C: removed code snippets that wer commented out.
10750 * src/paragraph.C: removed code snippets that were commented out.
10752 * src/lyxvc.C (logClose): use static_cast
10754 (viewLog): remove explicit cast to void*
10755 (showLog): removed old commented code
10757 * src/menus.C: use static_cast instead of C style casts. use
10758 u_vdata instead of u_ldata. remove explicit cast to (long) for
10759 pointers. Removed old code that was commented out.
10761 * src/insets/inset.C: removed old commented func
10763 * src/insets/insetref.C (InsetRef): removed old code that had been
10764 commented out for a long time.
10766 (escape): removed C style cast
10768 * src/insets/insetlatexaccent.C (Draw): removed old commented code
10770 * src/insets/insetlatex.C (Draw): removed old commented code
10771 (Read): rewritten to use string
10773 * src/insets/insetlabel.C (escape): removed C style cast
10775 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
10777 * src/insets/insetindex.C: use static_cast and u_vdata, removed
10778 old commented code.
10780 * src/insets/insetinclude.h: removed a couple of stupid bools
10782 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
10783 (Clone): remove C style cast
10784 (getKeys): changed list to lst because of std::list
10786 * src/insets/inseterror.C (Draw): removed som old commented code.
10788 * src/insets/insetcommand.C (Draw): removed some old commented code.
10790 * src/insets/insetbib.C (bibitem_cb): removed code that has been
10791 commented out forever.
10792 (bibitem_cb): use static_cast instead of C style cast
10793 use of vdata changed to u_vdata.
10795 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
10797 (CloseUrlCB): use static_cast instead of C style cast.
10798 (CloseUrlCB): added a fl_free form...it seemed to be missing.
10800 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
10801 (C_InsetInfo_CloseInfoCB): forward the ob parameter
10802 (CloseInfoCB): static_cast from ob->u_vdata instead.
10803 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
10806 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
10807 (C_InsetError_CloseErrorCB): forward the ob parameter
10808 (CloseErrorCB): static_cast from ob->u_vdata instead.
10810 * src/vspace.h: include LString.h since we use string in this class.
10812 * src/vspace.C (lyx_advance): changed name from advance because of
10813 nameclash with stl. And since we cannot use namespaces yet...I
10814 used a lyx_ prefix instead. Expect this to change when we begin
10817 * src/BufferView.[Ch] (BufferView::~BufferView): removed
10819 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
10820 and removed now defunct constructor and deconstructor.
10822 * src/BufferView.h: have backstack as a object not as a pointer.
10823 removed initialization from constructor. added include for BackStack
10825 * development/lyx.spec.in (%build): add CFLAGS also.
10827 * src/screen.C (drawFrame): removed another warning.
10829 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10831 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
10832 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
10833 README and ANNOUNCE a bit for the next release. More work is
10836 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
10837 unbreakable if we are in freespacing mode (LyX-Code), but not in
10840 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10842 * src/BackStack.h: fixed initialization order in constructor
10844 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
10846 * acinclude.m4 (VERSION): new rules for when a version is
10847 development, added also a variable for prerelease.
10848 (warnings): we set with_warnings=yes for prereleases
10849 (lyx_opt): prereleases compile with same optimization as development
10850 (CXXFLAGS): only use pedantic if we are a development version
10852 * src/BufferView.C (restorePosition): don't do anything if the
10853 backstack is empty.
10855 * src/BackStack.h: added member empty, use this to test if there
10856 is anything to pop...
10858 1999-10-25 Juergen Vigna <jug@sad.it>
10861 * forms/layout_forms.fd +
10862 * forms/latexoptions.fd +
10863 * lyx.fd: changed for various form resize issues
10865 * src/mathed/math_panel.C +
10866 * src/insets/inseterror.C +
10867 * src/insets/insetinfo.C +
10868 * src/insets/inseturl.C +
10869 * src/insets/inseturl.h +
10871 * src/LyXSendto.C +
10872 * src/PaperLayout.C +
10873 * src/ParagraphExtra.C +
10874 * src/TableLayout.C +
10876 * src/layout_forms.C +
10883 * src/menus.C: fixed various resize issues. So now forms can be
10884 resized savely or not be resized at all.
10886 * forms/form_url.fd +
10887 * src/insets/form_url.[Ch]: added because it's cleaner and easier
10890 * src/insets/Makefile.am: added files form_url.[Ch]
10892 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10894 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
10895 (and presumably 6.2).
10897 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
10898 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
10899 remaining static member callbacks.
10901 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
10904 * src/support/lyxstring.h: declare struct Srep as friend of
10905 lyxstring, since DEC cxx complains otherwise.
10907 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10909 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10911 * src/LaTeX.C (run): made run_bibtex also depend on files with
10913 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
10914 are put into the dependency file.
10916 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
10917 the code has shown itself to work
10918 (create_ispell_pipe): removed another warning, added a comment
10921 * src/minibuffer.C (ExecutingCB): removed code that has been
10922 commented out a long time
10924 * src/lyxfunc.C (processKeyEvent): removed some very old commented
10925 out code + a warning.
10927 * src/support/lyxstring.h: comment out the three private
10928 operators, when compiling with string ansi conforming compilers
10929 they make problems.
10931 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
10933 (pixmapFromBitmapData): change type of bdata to be unsigned char *
10934 (pixmapFromBitmapData): add a reinterpret_cast in the call to
10937 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
10940 * src/mathed/math_panel.C (create_math_panel): remove explicit
10943 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
10946 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
10947 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
10948 to XCreatePixmapFromBitmapData
10949 (fl_set_bmtable_data): change the last argument to be unsigned
10951 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
10952 and bh to be unsigned int, remove explicit casts in call to
10953 XReadBitmapFileData.
10955 * images/arrows.xbm: made the arrays unsigned char *
10956 * images/varsz.xbm: ditto
10957 * images/misc.xbm: ditto
10958 * images/greek.xbm: ditto
10959 * images/dots.xbm: ditto
10960 * images/brel.xbm: ditto
10961 * images/bop.xbm: ditto
10963 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
10965 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
10966 (LYX_PROG_CXX): added -pedantic to g++ compile options when
10967 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
10969 (LYX_CXX_CHEADERS): added <clocale> to the test.
10971 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
10973 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
10975 * src/support/lyxstring.C (append): fixed something that must be a
10976 bug, rep->assign was used instead of rep->append.
10978 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
10981 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
10982 lyx insert double chars. Fix spotted by Kayvan.
10984 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10986 * Fixed the tth support. I messed up with the Emacs patch apply feature
10987 and omitted the changes in lyxrc.C.
10989 1999-10-22 Juergen Vigna <jug@sad.it>
10991 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
10993 * src/lyx_cb.C (MenuInsertRef) +
10994 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
10995 the form cannot be resized under it limits (fixes a segfault)
10997 * src/lyx.C (create_form_form_ref) +
10998 * forms/lyx.fd: Changed Gravity on name input field so that it is
11001 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11003 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
11004 <ostream> and <istream>.
11006 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
11007 whether <fstream> provides the latest standard features, or if we
11008 have an oldstyle library (like in egcs).
11009 (LYX_CXX_STL_STRING): fix the test.
11011 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
11012 code on MODERN_STL_STREAM.
11014 * src/support/lyxstring.h: use L{I,O}stream.h.
11016 * src/support/L{I,O}stream.h: new files, designed to setup
11017 correctly streams for our use
11018 - includes the right header depending on STL capabilities
11019 - puts std::ostream and std::endl (for LOStream.h) or
11020 std::istream (LIStream.h) in toplevel namespace.
11022 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11024 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
11025 was a bib file that had been changed we ensure that bibtex is run.
11026 (runBibTeX): enhanced to extract the names of the bib files and
11027 getting their absolute path and enter them into the dep file.
11028 (findtexfile): static func that is used to look for tex-files,
11029 checks for absolute patchs and tries also with kpsewhich.
11030 Alternative ways of finding the correct files are wanted. Will
11032 (do_popen): function that runs a command using popen and returns
11033 the whole output of that command in a string. Should be moved to
11036 * src/DepTable.[Ch] (extchanged): new function that returns true if a
11037 file with extension ext has changed.
11039 * src/insets/figinset.C: added ifdef guards around the fl_free
11040 code that jug commented out. Now it is commented out when
11041 compiling with XForms == 0.89.
11043 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
11044 to lyxstring.C, and only keep a forward declaration in
11045 lyxstring.h. Simplifies the header file a bit and should help a
11046 bit on compile time too. Also changes to Srep will not mandate a
11047 recompile of code just using string.
11048 (~lyxstring): definition moved here since it uses srep.
11049 (size): definition moved here since it uses srep.
11051 * src/support/lyxstring.h: removed a couple of "inline" that should
11054 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11056 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
11059 1999-10-21 Juergen Vigna <jug@sad.it>
11061 * src/table.C (SetPWidth): Just a small fix so the alignment is not
11062 set to left if I just remove the width entry (or it is empty).
11064 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
11065 paragraph when having dummy paragraphs.
11067 1999-10-20 Juergen Vigna <jug@sad.it>
11069 * src/insets/figinset.C: just commented some fl_free_form calls
11070 and added warnings so that this calls should be activated later
11071 again. This avoids for now a segfault, but we have a memory leak!
11073 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
11074 'const char * argument' to 'string argument', this should
11075 fix some Asserts() in lyxstring.C.
11077 * src/lyxfunc.h: Removed the function argAsString(const char *)
11078 as it is not used anymore.
11080 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
11082 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
11085 * src/Literate.h: some funcs moved from public to private to make
11086 interface clearer. Unneeded args removed.
11088 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
11090 (scanBuildLogFile): ditto
11092 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
11093 normal TeX Error. Still room for improvement.
11095 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
11097 * src/buffer.C (insertErrors): changes to make the error
11098 desctription show properly.
11100 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
11103 * src/support/lyxstring.C (helper): changed to use
11104 sizeof(object->rep->ref).
11105 (operator>>): changed to use a pointer instead.
11107 * src/support/lyxstring.h: changed const reference & to value_type
11108 const & lets see if that helps.
11110 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
11112 * Makefile.am (rpmdist): fixed to have non static package and
11115 * src/support/lyxstring.C: removed the compilation guards
11117 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
11120 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
11121 conditional compile of lyxstring.Ch
11123 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
11124 stupid check, but it is a lot better than the bastring hack.
11125 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
11127 * several files: changed string::erase into string::clear. Not
11130 * src/chset.C (encodeString): use a char temporary instead
11132 * src/table.C (TexEndOfCell): added tostr around
11133 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
11134 (TexEndOfCell): ditto
11135 (TexEndOfCell): ditto
11136 (TexEndOfCell): ditto
11137 (DocBookEndOfCell): ditto
11138 (DocBookEndOfCell): ditto
11139 (DocBookEndOfCell): ditto
11140 (DocBookEndOfCell): ditto
11142 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
11144 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
11146 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
11147 (MenuBuildProg): added tostr around ret
11148 (MenuRunChktex): added tostr around ret
11149 (DocumentApplyCB): added tostr around ret
11151 * src/chset.C (encodeString): added tostr around t->ic
11153 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
11154 (makeLaTeXFile): added tostr around tocdepth
11155 (makeLaTeXFile): added tostr around ftcound - 1
11157 * src/insets/insetbib.C (setCounter): added tostr around counter.
11159 * src/support/lyxstring.h: added an operator+=(int) to catch more
11162 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
11163 (lyxstring): We DON'T allow NULL pointers.
11165 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11167 * src/mathed/math_macro.C (MathMacroArgument::Write,
11168 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
11169 when writing them out.
11171 * src/LString.C: remove, since it is not used anymore.
11173 * src/support/lyxstring.C: condition the content to
11174 USE_INCLUDED_STRING macro.
11176 * src/mathed/math_symbols.C, src/support/lstrings.C,
11177 src/support/lyxstring.C: add `using' directive to specify what
11178 we need in <algorithm>. I do not think that we need to
11179 conditionalize this, but any thought is appreciated.
11181 * many files: change all callback functions to "C" linkage
11182 functions to please strict C++ compilers like DEC cxx 6.1 in mode
11183 strict_ansi. Those who were static are now global.
11184 The case of callbacks which are static class members is
11185 trickier, since we have to make C wrappers around them (see
11186 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
11187 did not finish this yet, since it defeats the purpose of
11188 encapsulation, and I am not sure what the best route is.
11190 1999-10-19 Juergen Vigna <jug@sad.it>
11192 * src/support/lyxstring.C (lyxstring): we permit to have a null
11193 pointer as assignment value and just don't assign it.
11195 * src/vspace.C (nextToken): corrected this function substituting
11196 find_first(_not)_of with find_last_of.
11198 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
11199 (TableOptCloseCB) (TableSpeCloseCB):
11200 inserted fl_set_focus call for problem with fl_hide_form() in
11203 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11205 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
11208 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11210 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
11211 LyXLex::next() and not eatline() to get its argument.
11213 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
11215 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
11216 instead, use fstreams for io of the depfile, removed unneeded
11217 functions and variables.
11219 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
11220 vector instead, removed all functions and variables that is not in
11223 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11225 * src/buffer.C (insertErrors): use new interface to TeXError
11227 * Makefile.am (rpmdist): added a rpmdist target
11229 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
11230 per Kayvan's instructions.
11232 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11234 * src/Makefile.am: add a definition for localedir, so that locales
11235 are found after installation (Kayvan)
11237 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11239 * development/.cvsignore: new file.
11241 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11243 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
11244 C++ compiler provides wrappers for C headers and use our alternate
11247 * configure.in: use LYX_CXX_CHEADERS.
11249 * src/cheader/: new directory, populated with cname headers from
11250 libstdc++-2.8.1. They are a bit old, but probably good enough for
11251 what we want (support compilers who lack them).
11253 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
11254 from includes. It turns out is was stupid.
11256 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11258 * lib/Makefile.am (install-data-local): forgot a ';'
11259 (install-data-local): forgot a '\'
11260 (libinstalldirs): needed after all. reintroduced.
11262 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
11264 * configure.in (AC_OUTPUT): added lyx.spec
11266 * development/lyx.spec: removed file
11268 * development/lyx.spec.in: new file
11270 * po/*.po: merged with lyx.pot becuase of make distcheck
11272 * lib/Makefile.am (dist-hook): added dist-hook so that
11273 documentation files will be included when doing a make
11274 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
11275 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
11277 more: tried to make install do the right thing, exclude CVS dirs
11280 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
11281 Path would fit in more nicely.
11283 * all files that used to use pathstack: uses now Path instead.
11284 This change was a lot easier than expected.
11286 * src/support/path.h: new file
11288 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
11290 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
11292 * src/support/lyxstring.C (getline): Default arg was given for
11295 * Configure.cmd: removed file
11297 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11299 * src/support/DebugStream.[Ch]: remove the explicit std:: before
11300 streams classes and types, add the proper 'using' statements when
11301 MODERN_STL is defined.
11303 * src/debug.h: move the << operator definition after the inclusion
11306 * src/support/filetools.C: include "LAssert.h", which is needed
11309 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
11312 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
11313 include "debug.h" to define a proper ostream.
11315 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11317 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
11318 method to the SystemCall class which can kill a process, but it's
11319 not fully implemented yet.
11321 * src/*.C: Changed Systemcalls::Startscript() to startscript()
11323 * src/support/FileInfo.h: Better documentation
11325 * src/lyxfunc.C: Added support for buffer-export html
11327 * src/menus.C: Added Export->As HTML...
11329 * lib/bind/*.bind: Added short-cut for buffer-export html
11331 * src/lyxrc.*: Added support for new \tth_command
11333 * lib/lyxrc.example: Added stuff for new \tth_command
11335 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11337 * lib/Makefile.am (IMAGES): removed images/README
11338 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
11339 installes in correct place. Check permisions is installed
11342 * src/LaTeX.C: some no-op changes moved declaration of some
11345 * src/LaTeX.h (LATEX_H): changed include guard name
11347 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11349 * lib/reLyX/Makefile.am: install noweb2lyx.
11351 * lib/Makefile.am: install configure.
11353 * lib/reLyX/configure.in: declare a config aux dir; set package
11354 name to lyx (not sure what the best solution is); generate noweb2lyx.
11356 * lib/layouts/egs.layout: fix the bibliography layout.
11358 1999-10-08 Jürgen Vigna <jug@sad.it>
11360 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
11361 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
11362 it returned without continuing to search the path.
11364 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11366 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
11367 also fixes a bug. It is not allowed to do tricks with std::strings
11368 like: string a("hei"); &a[e]; this will not give what you
11369 think... Any reason for the complexity in this func?
11371 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
11373 * Updated README and INSTALL a bit, mostly to check that my
11374 CVS rights are correctly set up.
11376 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
11378 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
11379 does not allow '\0' chars but lyxstring and std::string does.
11381 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11383 * autogen.sh (AUTOCONF): let the autogen script create the
11384 POTFILES.in file too. POTFILES.in should perhaps now not be
11385 included in the cvs module.
11387 * some more files changed to use C++ includes instead of C ones.
11389 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
11391 (Reread): added tostr to nlink. buggy output otherwise.
11392 (Reread): added a string() around szMode when assigning to Buffer,
11393 without this I got a log of garbled info strings.
11395 * acconfig.h: commented out the PTR_AS_INT macros. They should not
11398 * I have added several ostream & operator<<(ostream &, some_type)
11399 functions. This has been done to avoid casting and warnings when
11400 outputting enums to lyxerr. This as thus eliminated a lot of
11401 explicit casts and has made the code clearer. Among the enums
11402 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
11403 mathed enums, some font enum the Debug::type enum.
11405 * src/support/lyxstring.h (clear): missing method. equivalent of
11408 * all files that contained "stderr": rewrote constructs that used
11409 stderr to use lyxerr instead. (except bmtable)
11411 * src/support/DebugStream.h (level): and the passed t with
11412 Debug::ANY to avoid spurious bits set.
11414 * src/debug.h (Debug::type value): made it accept strings of the
11415 type INFO,INIT,KEY.
11417 * configure.in (Check for programs): Added a check for kpsewhich,
11418 the latex generation will use this later to better the dicovery of
11421 * src/BufferView.C (create_view): we don't need to cast this to
11422 (void*) that is done automatically.
11423 (WorkAreaButtonPress): removed some dead code.
11425 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11427 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
11428 is not overwritten when translated (David Sua'rez de Lis).
11430 * lib/CREDITS: Added David Sua'rez de Lis
11432 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
11434 * src/bufferparams.C (BufferParams): default input encoding is now
11437 * acinclude.m4 (cross_compiling): comment out macro
11438 LYX_GXX_STRENGTH_REDUCE.
11440 * acconfig.h: make sure that const is not defined (to empty) when
11441 we are compiling C++. Remove commented out code using SIZEOF_xx
11444 * configure.in : move the test for const and inline as late as
11445 possible so that these C tests do not interefere with C++ ones.
11446 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
11447 has not been proven.
11449 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11451 * src/table.C (getDocBookAlign): remove bad default value for
11452 isColumn parameter.
11454 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
11456 (ShowFileMenu2): ditto.
11458 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
11459 of files to ignore.
11461 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11463 * Most files: finished the change from the old error code to use
11464 DebugStream for all lyxerr debugging. Only minor changes remain
11465 (e.g. the setting of debug levels using strings instead of number)
11467 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11469 * src/layout.C (Add): Changed to use compare_no_case instead of
11472 * src/FontInfo.C: changed loop variable type too string::size_type.
11474 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11476 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
11477 set ETAGS_ARGS to --c++
11479 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
11481 * src/table.C (DocBookEndOfCell): commented out two unused variables
11483 * src/paragraph.C: commented out four unused variables.
11485 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
11486 insed a if clause with type string::size_type.
11488 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
11491 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
11493 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
11494 variable, also changed loop to go from 0 to lenght + 1, instead of
11495 -1 to length. This should be correct.
11497 * src/LaTeX.C (scanError): use string::size_type as loop variable
11500 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
11501 (l.896) since y_tmp and row was not used anyway.
11503 * src/insets/insetref.C (escape): use string::size_type as loop
11506 * src/insets/insetquotes.C (Width): use string::size_type as loop
11508 (Draw): use string::size_type as loop variable type.
11510 * src/insets/insetlatexaccent.C (checkContents): use
11511 string::size_type as loop variable type.
11513 * src/insets/insetlabel.C (escape): use string::size_type as loop
11516 * src/insets/insetinfo.C: added an extern for current_view.
11518 * src/insets/insetcommand.C (scanCommand): use string::size_type
11519 as loop variable type.
11521 * most files: removed the RCS tags. With them we had to recompile
11522 a lot of files after a simple cvs commit. Also we have never used
11523 them for anything meaningful.
11525 * most files: tags-query-replace NULL 0. As adviced several plases
11526 we now use "0" instead of "NULL" in our code.
11528 * src/support/filetools.C (SpaceLess): use string::size_type as
11529 loop variable type.
11531 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11533 * src/paragraph.C: fixed up some more string stuff.
11535 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11537 * src/support/filetools.h: make modestr a std::string.
11539 * src/filetools.C (GetEnv): made ch really const.
11541 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
11542 made code that used these use max/min from <algorithm> instead.
11544 * changed several c library include files to their equivalent c++
11545 library include files. All is not changed yet.
11547 * created a support subdir in src, put lyxstring and lstrings
11548 there + the extra files atexit, fileblock, strerror. Created
11549 Makefile.am. edited configure.in and src/Makefile.am to use this
11550 new subdir. More files moved to support.
11552 * imported som of the functions from repository lyx, filetools
11554 * ran tags-query-replace on LString -> string, corrected the bogus
11555 cases. Tried to make use of lstrings.[hC], debugged a lot. There
11556 is still some errors in there. This is errors where too much or
11557 too litle get deleted from strings (string::erase, string::substr,
11558 string::replace), there can also be some off by one errors, or
11559 just plain wrong use of functions from lstrings. Viewing of quotes
11562 * LyX is now running fairly well with string, but there are
11563 certainly some bugs yet (see above) also string is quite different
11564 from LString among others in that it does not allow null pointers
11565 passed in and will abort if it gets any.
11567 * Added the revtex4 files I forgot when setting up the repository.
11569 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11571 * All over: Tried to clean everything up so that only the files
11572 that we really need are included in the cvs repository.
11573 * Switched to use automake.
11574 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
11575 * Install has not been checked.
11577 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11579 * po/pt.po: Three errors:
11580 l.533 and l.538 format specification error
11581 l. 402 duplicate entry, I just deleted it.