1 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
4 the two recently added operator<< for SMInput and State.
6 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
8 (OkCancelPolicy): ditto
9 (OkCancelReadOnlyPolicy): ditto
10 (NoRepeatedApplyReadOnlyPolicy): ditto
11 (OkApplyCancelReadOnlyPolicy): ditto
12 (OkApplyCancelPolicy): ditto
13 (NoRepeatedApplyPolicy): ditto
15 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
17 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
18 add the usual std:: qualifiers.
20 2000-10-25 Juergen Vigna <jug@sad.it>
22 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
24 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
26 * src/support/filetools.C (MakeRelPath): change some types to
29 * src/frontends/ButtonPolicies.h (operator<<): new operator for
30 ButtonPolicy::SMInput and ButtonPolicy::State.
32 * src/FontLoader.C (reset): small cleanup
33 (unload): small cleanup
35 * src/FontInfo.C (getFontname): initialize error to 10000.0
37 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
39 * src/frontends/xforms/FormPreferences.[Ch]:
40 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
41 TeX encoding and default paper size sections.
43 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
45 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
48 * src/frontends/xforms/FormError.C (disconnect): use erase() to
49 make the message_ empty.
50 (FormError): don't initialize message_ in initializer list.
52 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
54 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
56 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
58 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
60 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
62 * src/frontends/kde/*data.[Ch]: _("") is not
65 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
67 * src/buffer.C: removed redundant using directive.
69 * src/frontends/DialogBase.h: revert to original definition of
72 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
73 stuff into two classes, one for each dialog, requires a new
74 element in the dialogs vector, FormTabularCreate.
76 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
79 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
80 method. Continues Allan's idea, but means that derived classes
81 don't need to worry about "update or hide?".
83 * src/frontends/xforms/FormError.C (showInset): add connection
86 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
87 one for each dialog. FormTabular now contains main tabular dialog
90 * src/frontends/xforms/FormTabularCreate.[Ch]:
91 * src/frontends/xforms/forms/form_tabular_create.fd: the create
94 * src/frontends/xforms/FormGraphics.[Ch]:
95 * src/frontends/xforms/forms/form_graphics.fd
96 * src/frontends/xforms/FormTabular.[Ch]:
97 * src/frontends/xforms/forms/form_tabular.fd: made daughter
100 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
101 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
103 * src/frontends/xforms/Makefile.am:
104 * src/frontends/xforms/forms/makefile: added new files.
106 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
107 variable. added Signal0 hide signal, in keeping with other GUI-I
110 * src/support/lstrings.h: removed redundant std:: qualifier as
111 it's already declared in Lsstream.h.
113 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
115 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
119 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
121 * src/tabular.C (Ascii): minimize scope of cell.
123 * src/BufferView2.C (nextWord): return string() instead of 0;
125 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
127 * src/converter.h: add a std:: qualifier
129 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
131 * src/importer.[Ch]: New files. Used for importing files into LyX.
133 * src/lyxfunc.C (doImport): Use the new Importer class.
135 * src/converter.h: Add shortcut member to the Format class.
136 Used for holding the menu shortcut.
138 * src/converter.C and other files: Made a distinction between
139 format name and format extension. New formats can be defined using
140 the \format lyxrc tag.
141 Added two new converter flags: latex and disable.
143 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
145 * src/support/lyxlib.h: unify namespace/struct implementation.
146 Remove extra declarations.
148 * src/support/chdir.C (chdir): remove version taking char const *
150 * src/support/rename.C: ditto.
151 * src/support/lyxsum.C: ditto.
153 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
155 * src/frontends/xforms/FormBase.[Ch]:
156 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
157 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
158 work only for the next call to fl_show_form(). The correct place to set
159 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
160 done. FormBase also stores minw_, minh_ itself. All dialogs derived
161 from FormBase have the minimum size set; no more stupid crashes with
164 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
166 * lib/ui/default.ui: fix shortcut for Insert->Include File.
168 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
170 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
172 * src/support/lyxlib.h: changed second argument of mkdir to
173 unsigned long int (unsigned int would probably have been enough,
174 but...). Removed <sys/types.h> header.
175 * src/support/mkdir.C (mkdir): ditto.
179 2000-10-19 Juergen Vigna <jug@sad.it>
181 * src/lyxfunc.C (MenuNew): small fix (form John)
183 * src/screen.C (Update): removed unneeded code.
185 * src/tabular.C (Ascii): refixed int != uint bug!
187 * src/support/lyxlib.h: added sys/types.h include for now permits
188 compiling, but I don't like this!
190 2000-10-18 Juergen Vigna <jug@sad.it>
192 * src/text2.C (ClearSelection): if we clear the selection we need
193 more refresh so set the status apropriately
195 * src/insets/insettext.C (draw): hopefully finally fixed draw
198 2000-10-12 Juergen Vigna <jug@sad.it>
200 * src/insets/insettext.C (draw): another small fix and make a block
201 so that variables are localized.
203 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
205 * src/support/lstrings.C (lowercase, uppercase):
206 use explicit casts to remove compiler warnings.
208 * src/support/LRegex.C (Impl):
209 * src/support/StrPool.C (add):
210 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
211 (AddPath, MakeDisplayPath):
212 * src/support/lstrings.C (prefixIs, subst):
213 use correct type to remove compiler warnings.
215 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
217 * src/support/lyxlib.h:
218 * src/support/mkdir.C (mkdir): change parameter to mode_t for
219 portability and to remove compiler warning with DEC cxx.
221 * src/support/FileInfo.[Ch] (flagRWX): ditto.
223 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
225 * src/minibuffer.C (peek_event): retun 1 when there has been a
226 mouseclick in the minibuffer.
230 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
232 * src/frontends/xforms/FormParagraph.C: more space above/below
235 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
237 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
238 a char only if real_current_font was changed.
240 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
242 * NEWS: update somewhat for 1.1.6
244 * lib/ui/default.ui: clean up.
246 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
248 * lib/CREDITS: clean up
250 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
252 * src/combox.[Ch] (select): changed argument back to int
253 * src/combox.C (peek_event): removed num_bytes as it is declared but
256 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
257 modified calls to Combox::select() to remove warnings about type
260 * src/insets/insetbutton.C (width): explicit cast to remove warning
261 about type conversion.
263 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
266 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
267 sel_pos_end, refering to cursor position are changed to
268 LyXParagraph::size_type.
270 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
271 consistent with LyXCursor::pos().
272 (inset_pos): changed to LyXParagraph::size_type for same reason.
274 * src/insets/insettext.C (resizeLyXText): changed some temporary
275 variables refing to cursor position to LyXParagraph::size_type.
277 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
279 * src/frontends/kde/<various>: The Great Renaming,
282 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
284 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
286 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
288 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
289 0 when there are no arguments.
291 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
293 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
294 to segfaults when pressing Ok in InsetBibtex dialog.
296 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
298 * forms/layout_forms.fd:
299 * src/layout_forms.C (create_form_form_character): small change to use
300 labelframe rather than engraved frame + text
302 * src/lyx_gui.C (create_forms): initialise choice_language with some
303 arbitrary value to prevent segfault when dialog is shown.
305 2000-10-16 Baruch Even <baruch.even@writeme.com>
307 * src/converter.C (runLaTeX, scanLog): Added a warning when there
308 is no resulting file. This pertains only to LaTeX output.
310 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
312 * src/text.C (Backspace): Make sure that the row of the cursor is
315 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
318 * src/lyx_gui.C (init): Prevent a crash when only one font from
319 menu/popup fonts is not found.
321 * lib/lyxrc.example: Add an example for binding a key for language
324 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
326 * src/converter.C (GetReachable): Changed the returned type to
328 (IsReachable): New method
330 * src/MenuBackend.C (expand): Handle formats that appear more
333 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
335 * src/frontends/support/Makefile.am
336 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
339 * lib/CREDITS: add Garst Reese.
341 * src/support/snprintf.h: add extern "C" {} around the definitions.
343 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
345 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
348 * src/frontends/xforms/FormDocument.C:
349 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
350 compile without "conversion to integral type of smaller size"
353 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
355 * src/text.C (GetColumnNearX): Fixed disabled code.
357 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
359 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
362 * src/support/snprintf.[ch]: new files
364 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
366 * src/frontends/kde/formprintdialog.C: add
367 file browser for selecting postscript output
369 * src/frontends/kde/formprintdialogdata.C:
370 * src/frontends/kde/formprintdialogdata.h: re-generate
373 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
375 * src/frontends/gnome/Makefile.am:
376 * src/frontends/kde/Makefile.am: FormCommand.C
377 disappeared from xforms
379 * src/frontends/kde/FormCitation.C:
380 * src/frontends/kde/FormIndex.C: read-only
383 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
385 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
388 * src/bufferlist.C: add using directive.
390 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
392 * src/support/lyxfunctional.h: version of class_fun for void
393 returns added, const versions of back_inseter_fun and compare_fun
396 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
398 * src/frontends/xforms/FormInset.C (showInset): fix typo.
400 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
402 * ChangeLog: cleanup.
404 * lib/CREDITS: update to add all the contributors we've forgotten.
405 I have obviously missed some, so tell me whether there were
408 2000-10-13 Marko Vendelin <markov@ioc.ee>
410 * src/frontends/gnome/FormCitation.C
411 * src/frontends/gnome/FormCitation.h
412 * src/frontends/gnome/FormError.C
413 * src/frontends/gnome/FormIndex.C
414 * src/frontends/gnome/FormRef.C
415 * src/frontends/gnome/FormRef.h
416 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
418 * src/frontends/gnome/FormCitation.C
419 * src/frontends/gnome/FormCopyright.C
420 * src/frontends/gnome/FormError.C
421 * src/frontends/gnome/FormIndex.C
422 * src/frontends/gnome/FormRef.C
423 * src/frontends/gnome/FormToc.C
424 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
427 * src/frontends/gnome/Menubar_pimpl.C
428 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
431 2000-10-11 Baruch Even <baruch.even@writeme.com>
434 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
435 to convey its real action.
437 * src/minibuffer.C (peek_event): Added action when mouse clicks to
438 clear the minibuffer and prepare to enter a command.
440 * src/mathed/formula.C (LocalDispatch): Changed to conform with
441 the rename from ExecCommand to PrepareForCommand.
442 * src/lyxfunc.C (Dispatch): ditto.
444 2000-10-11 Baruch Even <baruch.even@writeme.com>
446 * src/buffer.C (writeFile): Added test for errors on writing, this
447 catches all errors and not only file system full errors as intended.
449 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
451 * src/lyx_gui.C (create_forms): better fix for crash with
452 translated interface.
454 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
456 * src/frontends/kde/Makefile.am:
457 * src/frontends/kde/FormCopyright.C:
458 * src/frontends/kde/formcopyrightdialog.C:
459 * src/frontends/kde/formcopyrightdialog.h:
460 * src/frontends/kde/formcopyrightdialogdata.C:
461 * src/frontends/kde/formcopyrightdialogdata.h:
462 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
463 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
464 copyright to use qtarch
466 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
468 * src/encoding.C (read): Fixed bug that caused an error message at
471 * po/Makefile.in.in: Fixed rule for ext_l10n.h
473 * lib/lyxrc.example: Fixed hebrew example.
475 2000-10-13 Allan Rae <rae@lyx.org>
477 * src/frontends/xforms/FormPreferences.C (input): reworking the
479 (build, update, apply): New inputs in various tabfolders
481 * src/frontends/xforms/FormToc.C: use new button policy.
482 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
483 dialogs that either can't use any existing policy or where it just
486 * src/frontends/xforms/FormTabular.h: removed copyright notice that
489 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
490 added a bool parameter which is ignored.
492 * src/buffer.C (setReadonly):
493 * src/BufferView_pimpl.C (buffer):
494 * src/frontends/kde/FormCopyright.h (update):
495 * src/frontends/kde/FormCitation.[Ch] (update):
496 * src/frontends/kde/FormIndex.[Ch] (update):
497 * src/frontends/kde/FormPrint.[Ch] (update):
498 * src/frontends/kde/FormRef.[Ch] (update):
499 * src/frontends/kde/FormToc.[Ch] (update):
500 * src/frontends/kde/FormUrl.[Ch] (update):
501 * src/frontends/gnome/FormCopyright.h (update):
502 * src/frontends/gnome/FormCitation.[Ch] (update):
503 * src/frontends/gnome/FormError.[Ch] (update):
504 * src/frontends/gnome/FormIndex.[Ch] (update):
505 * src/frontends/gnome/FormPrint.[Ch] (update):
506 * src/frontends/gnome/FormRef.h (update):
507 * src/frontends/gnome/FormToc.[Ch] (update):
508 * src/frontends/gnome/FormUrl.[Ch] (update):
509 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
510 to updateBufferDependent and DialogBase
512 * src/frontends/xforms/FormCitation.[hC]:
513 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
514 * src/frontends/xforms/FormError.[Ch]:
515 * src/frontends/xforms/FormGraphics.[Ch]:
516 * src/frontends/xforms/FormIndex.[Ch]:
517 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
518 and fixed readOnly handling.
519 * src/frontends/xforms/FormPrint.[Ch]:
520 * src/frontends/xforms/FormRef.[Ch]:
521 * src/frontends/xforms/FormTabular.[Ch]:
522 * src/frontends/xforms/FormToc.[Ch]:
523 * src/frontends/xforms/FormUrl.[Ch]:
524 * src/frontends/xforms/FormInset.[Ch]:
525 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
526 form of updateBufferDependent.
528 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
529 if form()->visible just in case someone does stuff to the form in a
532 * src/frontends/DialogBase.h (enum): removed enum since we can now use
533 the buttoncontroller for everything the enum used to be used for.
534 (update) It would seem we need to force all dialogs to use a bool
535 parameter or have two update functions. I chose to go with one.
536 I did try removing update() from here and FormBase and defining the
537 appropriate update signatures in FormBaseB[DI] but then ran into the
538 problem of the update() call in FormBase::show(). Whatever I did
539 to get around that would require another function and that just
540 got more confusing. Hence the decision to make everyone have an
541 update(bool). An alternative might have been to override show() in
542 FormBaseB[DI] and that would allow the different and appropriate
545 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
546 true == buffer change occurred. I decided against using a default
547 template parameter since not all compilers support that at present.
549 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
551 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
552 army knife" by removing functionality.
553 (clearStore): removed. All such housekeeping on hide()ing the dialog
554 is to be carried out by overloaded disconnect() methods.
555 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
556 superceded by Baruch's neat test (FormGraphics) to update an existing
557 dialog if a new signal is recieved rather than block all new signals
559 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
560 only to Inset dialogs.
561 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
562 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
564 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
566 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
567 as a base class to all inset dialogs. Used solely to connect/disconnect
568 the Inset::hide signal and to define what action to take on receipt of
569 a UpdateBufferDependent signal.
570 (FormCommand): now derived from FormInset.
572 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
575 * src/frontends/xforms/FormCopyright.[Ch]:
576 * src/frontends/xforms/FormPreferences.[Ch]:
577 now derived from FormBaseBI.
579 * src/frontends/xforms/FormDocument.[Ch]:
580 * src/frontends/xforms/FormParagraph.[Ch]:
581 * src/frontends/xforms/FormPrint.[Ch]:
582 now derived from FormBaseBD.
584 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
586 * src/frontends/xforms/FormCitation.[Ch]:
587 * src/frontends/xforms/FormError.[Ch]:
588 * src/frontends/xforms/FormRef.[Ch]:
589 * src/frontends/xforms/FormToc.[Ch]:
590 (clearStore): reworked as disconnect().
592 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
595 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
597 * src/converter.C (runLaTeX): constify buffer argument
600 * src/frontends/support/Makefile.am (INCLUDES): fix.
602 * src/buffer.h: add std:: qualifier
603 * src/insets/figinset.C (addpidwait): ditto
604 * src/MenuBackend.C: ditto
605 * src/buffer.C: ditto
606 * src/bufferlist.C: ditto
607 * src/layout.C: ditto
608 * src/lyxfunc.C: ditto
610 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
612 * src/lyxtext.h (bidi_level): change return type to
613 LyXParagraph::size_type.
615 * src/lyxparagraph.h: change size_type to
616 TextContainer::difference_type. This should really be
617 TextContainer::size_type, but we need currently to support signed
620 2000-10-11 Marko Vendelin <markov@ioc.ee>
621 * src/frontends/gnome/FormError.h
622 * src/frontends/gnome/FormRef.C
623 * src/frontends/gnome/FormRef.h
624 * src/frontends/gnome/FormError.C
625 * src/frontends/gnome/Makefile.am
626 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
627 to Gnome frontend. Both dialogs use "action" area.
629 2000-10-12 Baruch Even <baruch.even@writeme.com>
631 * src/graphics/GraphicsCacheItem_pimpl.C:
632 * src/graphics/Renderer.C:
633 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
636 2000-10-12 Juergen Vigna <jug@sad.it>
638 * src/insets/insettext.C (draw): fixed drawing bug (specifically
639 visible when selecting).
641 * development/Code_rules/Rules: fixed some typos.
643 2000-10-09 Baruch Even <baruch.even@writeme.com>
645 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
646 compiling on egcs 1.1.2 possible.
648 * src/filedlg.C (comp_direntry::operator() ): ditto.
650 2000-08-31 Baruch Even <baruch.even@writeme.com>
652 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
655 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
656 transient it now only gets freed when the object is destructed.
658 2000-08-24 Baruch Even <baruch.even@writeme.com>
660 * src/frontends/FormGraphics.h:
661 * src/frontends/FormGraphics.C: Changed to use ButtonController and
664 2000-08-20 Baruch Even <baruch.even@writeme.com>
666 * src/insets/insetgraphics.C:
667 (draw): Added messages to the drawn rectangle to report status.
668 (updateInset): Disabled the use of the inline graphics,
671 2000-08-17 Baruch Even <baruch.even@writeme.com>
673 * src/frontends/support: Directory added for the support of GUII LyX.
675 * src/frontends/support/LyXImage.h:
676 * src/frontends/support/LyXImage.C: Base class for GUII holding of
679 * src/frontends/support/LyXImage_X.h:
680 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
681 version of LyXImage, this uses the Xlib Pixmap.
686 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
687 replacement to Pixmap.
689 * src/insets/insetgraphics.h:
690 * src/insets/insetgraphics.C:
691 * src/graphics/GraphicsCacheItem.h:
692 * src/graphics/GraphicsCacheItem.C:
693 * src/graphics/GraphicsCacheItem_pimpl.h:
694 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
697 * src/graphics/GraphicsCacheItem.h:
698 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
699 another copy of the object.
701 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
702 of cacheHandle, this fixed a bug that sent LyX crashing.
704 * src/graphics/XPM_Renderer.h:
705 * src/graphics/XPM_Renderer.C:
706 * src/graphics/EPS_Renderer.h:
707 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
709 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
711 * src/lyxfunc.C (processKeySym): only handle the
712 lockinginset/inset stuff if we have a buffer and text loaded...
714 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
716 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
718 * src/support/lyxfunctional.h: add operator= that takes a reference
720 * src/lyxserver.C (mkfifo): make first arg const
722 * src/layout.h: renamed name(...) to setName(...) to work around
725 * src/buffer.C (setFileName): had to change name of function to
726 work around bugs in egcs. (renamed from fileName)
728 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
730 * src/support/translator.h: move helper template classes to
731 lyxfunctional.h, include "support/lyxfunctional.h"
733 * src/support/lyxmanip.h: add delaration of fmt
735 * src/support/lyxfunctional.h: new file
736 (class_fun_t): new template class
737 (class_fun): helper template function
738 (back_insert_fun_iterator): new template class
739 (back_inserter_fun): helper template function
740 (compare_memfun_t): new template class
741 (compare_memfun): helper template function
742 (equal_1st_in_pair): moved here from translator
743 (equal_2nd_in_pair): moved here from translator
745 * src/support/fmt.C: new file
746 (fmt): new func, can be used for a printf substitute when still
747 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
749 * src/support/StrPool.C: add some comments
751 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
754 * src/insets/figinset.C (addpidwait): use std::copy with
755 ostream_iterator to fill the pidwaitlist
757 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
759 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
762 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
765 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
767 * src/frontends/xforms/FormDocument.C (build): remove c_str()
768 (class_update): ditto
770 (CheckChoiceClass): move initialization of tc and tct
772 * src/tabular.C: remove current_view
773 (OldFormatRead): similar to right below [istream::ignore]
775 * src/lyxlex_pimpl.C (next): add code for faster skipping of
776 chars, unfortunately this is buggy on gcc 2.95.2, so currently
777 unused [istream::ignore]
779 * src/lyxfunc.C: include "support/lyxfunctional.h"
780 (getInsetByCode): use std::find_if and compare_memfun
782 * src/lyxfont.C (stateText): remove c_str()
784 * src/lyx_main.C (setDebuggingLevel): make static
785 (commandLineHelp): make static
787 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
788 Screen* together with fl_get_display() and fl_screen
790 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
791 togheter with fl_get_display() and fl_screen
792 (create_forms): remove c_str()
794 * src/layout.C: include "support/lyxfunctional.h"
795 (hasLayout): use std::find_if and compare_memfun
796 (GetLayout): use std::find_if and comapre_memfun
797 (delete_layout): use std::remove_if and compare_memfun
798 (NumberOfClass): use std:.find_if and compare_memfun
800 * src/gettext.h: change for the new functions
802 * src/gettext.C: new file, make _(char const * str) and _(string
803 const & str) real functions.
805 * src/font.C (width): rewrite slightly to avoid one extra variable
807 * src/debug.C: initialize Debug::ANY here
809 * src/commandtags.h: update number comments
811 * src/combox.h (get): make const func
813 (getline): make const
815 * src/combox.C (input_cb): handle case where fl_get_input can
818 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
819 "support/lyxfunctional.h", remove current_view variable.
820 (resize): use std::for_each with std::mem_fun
821 (getFileNames): use std::copy with back_inserter_fun
822 (getBuffer): change arg type to unsigned int
823 (emergencyWriteAll): call emergencyWrite with std::for_each and
825 (emergencyWrite): new method, the for loop in emergencyWriteAll
827 (exists): use std::find_if with compare_memfun
828 (getBuffer): use std::find_if and compare_memfun
830 * src/buffer.h: add typedefs for iterator_category, value_type
831 difference_type, pointer and reference for inset_iterator
832 add postfix ++ for inset_iterator
833 make inset_iterator::getPos() const
835 * src/buffer.C: added support/lyxmanip.h
836 (readFile): use lyxerr << fmt instead of printf
837 (makeLaTeXFile): use std::copy to write out encodings
839 * src/Painter.C (text): rewrite slightly to avoid extra font variable
841 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
842 free and the char * temp.
843 (hasMenu): use std::find_if and compare_memfun
846 * src/Makefile.am (lyx_SOURCES): added gettext.C
848 * src/LyXAction.C (retrieveActionArg): clear the arg, use
849 string::insert small change to avoid temporary
851 * src/LColor.C (getGUIName): remove c_str()
853 * several files: change all occurrences of fl_display to
856 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
857 that -pedantic is not used for gcc 2.97 (cvs gcc)
859 * boost/Makefile.am: begin slowly to prepare for a real boost lib
861 2000-10-11 Allan Rae <rae@lyx.org>
863 * src/frontends/xforms/FormPreferences.C (input): template path must be
864 a readable directory. It doesn't need to be writeable.
865 (build, delete, update, apply): New inputs in the various tabfolders
867 * src/frontends/xforms/forms/form_preferences.fd:
868 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
869 several new entries to existing folders. Shuffled some existing stuff
872 * src/frontends/xforms/forms/form_print.fd:
873 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
874 Should probably rework PrinterParams as well. Note that the switch to
875 collated is effectively the same as !unsorted so changing PrinterParams
876 will require a lot of fiddly changes to reverse the existing logic.
878 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
880 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
882 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
884 2000-10-10 Allan Rae <rae@lyx.org>
887 * src/lyxfunc.C (Dispatch):
889 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
892 * src/lyxrc.C (output): Only write the differences between system lyxrc
893 and the users settings.
896 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
898 I'll rewrite this later, after 1.1.6 probably, to keep a single
899 LyXRC but two instances of a LyXRCStruct.
901 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
903 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
905 * src/tabular.h: add a few std:: qualifiers.
907 * src/encoding.C: add using directive.
908 * src/language.C: ditto.
910 * src/insets/insetquotes.C (Validate): use languages->lang()
911 instead of only language.
913 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
915 * lib/languages: New file.
917 * lib/encodings: New file.
919 * src/language.C (Languages): New class.
920 (read): New method. Reads the languages from the 'languages' file.
922 * src/encoding.C (Encodings): New class.
923 (read): New method. Reads the encodings from the 'encodings' file.
925 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
928 * src/bufferparams.h and a lot of files: Deleted the member language,
929 and renamed language_info to language
931 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
932 * src/lyxfont.C (latexWriteStartChanges): ditto.
933 * src/paragraph.C (validate,TeXOnePar): ditto.
935 * src/lyxfont.C (update): Restored deleted code.
937 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
939 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
941 * src/BufferView_pimpl.C (buffer): cleaned up a little.
943 * src/insets/figinset.[Ch]:
944 * src/insets/insetinclude.[Ch]:
945 * src/insets/insetinclude.[Ch]:
946 * src/insets/insetparent.[Ch]:
947 * src/insets/insetref.[Ch]:
948 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
951 * src/mathed/formula.[Ch]:
952 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
954 * src/buffer.C (parseSingleLyXformat2Token, readInset):
955 * src/lyx_cb.C (FigureApplyCB):
956 * src/lyxfunc.C (getStatus, Dispatch):
957 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
960 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
962 * src/converter.[Ch] (Formats::View):
963 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
965 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
966 *current_view->buffer(). This will change later, but this patch is way
969 2000-10-09 Juergen Vigna <jug@sad.it>
971 * src/text.C (GetRow): small fix.
973 * src/BufferView_pimpl.C (cursorPrevious):
974 (cursorNext): added LyXText parameter to function.
976 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
977 keypress depending on cursor position.
979 2000-10-06 Juergen Vigna <jug@sad.it>
981 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
982 (copySelection): redone this function and also copy ascii representa-
985 * src/tabular.C (Ascii):
989 (print_n_chars): new functions to realize the ascii export of tabulars.
991 2000-10-05 Juergen Vigna <jug@sad.it>
993 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
994 if we don't have a buffer.
996 2000-10-10 Allan Rae <rae@lyx.org>
998 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
999 with closing dialog. It seems that nested tabfolders require hiding
1000 of inner tabfolders before hiding the dialog itself. Actually all I
1001 did was hide the active outer folder.
1003 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
1004 unless there really is a buffer. hideBufferDependent is called
1007 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
1008 POTFILES.in stays in $(srcdir).
1010 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
1012 * lib/lyxrc.example: Few changes.
1014 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
1016 * src/BufferView_pimpl.C (buffer): only need one the
1017 updateBufferDependent signal to be emitted once! Moved to the end of
1018 the method to allow bv_->text to be updated first.
1020 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
1021 and hSignal_ with Dialogs * and BufferDependency variables.
1022 New Buffer * parent_, initialised when the dialog is launched. Used to
1023 check whether to update() or hide() dialog in the new, private
1024 updateOrHide() method that is connected to the updateBufferDependent
1025 signal. Daughter classes dictate what to do using the
1026 ChangedBufferAction enum, passed to the c-tor.
1028 * src/frontends/xforms/FormCitation.C:
1029 * src/frontends/xforms/FormCommand.C:
1030 * src/frontends/xforms/FormCopyright.C:
1031 * src/frontends/xforms/FormDocument.C:
1032 * src/frontends/xforms/FormError.C:
1033 * src/frontends/xforms/FormIndex.C:
1034 * src/frontends/xforms/FormPreferences.C:
1035 * src/frontends/xforms/FormPrint.C:
1036 * src/frontends/xforms/FormRef.C:
1037 * src/frontends/xforms/FormToc.C:
1038 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
1041 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
1042 ChangedBufferAction enum.
1044 * src/frontends/xforms/FormParagraph.[Ch]
1045 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
1048 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1050 * lib/bind/cua.bind: fix a bit.
1051 * lib/bind/emacs.bind: ditto.
1053 * lib/bind/menus.bind: remove real menu entries from there.
1055 * src/spellchecker.C: make sure we only include strings.h when
1058 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1060 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
1061 function. It enlarges the maximum number of pup when needed.
1062 (add_toc2): Open a new menu if maximum number of items per menu has
1065 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
1067 * src/frontends/kde/FormPrint.C: fix error reporting
1069 * src/frontends/xforms/FormDocument.C: fix compiler
1072 * lib/.cvsignore: add Literate.nw
1074 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1077 * bufferview_funcs.[Ch]
1080 * text2.C: Add support for numbers in RTL text.
1082 2000-10-06 Allan Rae <rae@lyx.org>
1084 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
1085 to be gettext.m4 friendly again. ext_l10n.h is now
1086 generated into $top_srcdir instead of $top_builddir
1087 so that lyx.pot will be built correctly -- without
1088 duplicate parsing of ext_l10n.h.
1090 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1092 * src/frontends/kde/FormCitation.C: make the dialog
1093 behave more sensibly
1095 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
1097 * config/kde.m4: fix consecutive ./configure runs,
1098 look for qtarch, fix library order
1100 * src/frontends/kde/Makefile.am: tidy up,
1101 add Print dialog, add .dlg dependencies
1103 * src/frontends/kde/FormPrint.C:
1104 * src/frontends/kde/FormPrint.h:
1105 * src/frontends/kde/formprintdialog.C:
1106 * src/frontends/kde/formprintdialog.h:
1107 * src/frontends/kde/formprintdialogdata.C:
1108 * src/frontends/kde/formprintdialogdata.h:
1109 * src/frontends/kde/dlg/formprintdialog.dlg: add
1112 * src/frontends/kde/dlg/README: Added explanatory readme
1114 * src/frontends/kde/dlg/checkinitorder.pl: small perl
1115 script to double-check qtarch's output
1117 * src/frontends/kde/formindexdialog.C:
1118 * src/frontends/kde/formindexdialogdata.C:
1119 * src/frontends/kde/formindexdialogdata.h:
1120 * src/frontends/kde/dlg/formindexdialog.dlg: update
1121 for qtarch, minor fixes
1123 2000-10-05 Allan Rae <rae@lyx.org>
1125 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
1126 dialogs when switching buffers update them instead. It's up to each
1127 dialog to decide if it should still be visible or not.
1128 update() should return a bool to control visiblity within show().
1129 Or perhaps better to set a member variable and use that to control
1132 * lib/build-listerrors: create an empty "listerrors" file just to stop
1133 make trying to regenerate it all the time if you don't have noweb
1136 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
1138 * po/Makefile.in.in (ext_l10n.h): added a rule to build
1139 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
1140 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
1141 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
1142 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
1144 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
1146 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
1148 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
1149 deleting buffer. Closes all buffer-dependent dialogs.
1151 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
1153 * src/frontends/xforms/FormCitation.[Ch]:
1154 * src/frontends/xforms/FormPreferences.[Ch]:
1155 * src/frontends/xforms/FormPrint.[Ch]:
1156 * src/frontends/xforms/FormRef.[Ch]:
1157 * src/frontends/xforms/FormUrl.[Ch]: ditto
1159 * src/frontends/xforms/FormDocument.[Ch]:
1160 * src/frontends/xforms/forms/form_document.C.patch:
1161 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
1162 pass through a single input() function.
1164 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1166 * lib/build-listerrors: return status as OK
1168 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
1170 * lib/lyxrc.example: Updated to new export code
1172 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1174 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
1177 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
1180 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
1181 LyX-Code is defined.
1182 * lib/layouts/amsbook.layout: ditto.
1184 * boost/Makefile.am: fix typo.
1186 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
1188 (add_lastfiles): removed.
1189 (add_documents): removed.
1190 (add_formats): removed.
1192 * src/frontends/Menubar.C: remove useless "using" directive.
1194 * src/MenuBackend.h: add a new MenuItem constructor.
1196 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
1199 2000-10-04 Allan Rae <rae@lyx.org>
1201 * lib/Makefile.am (listerrors):
1202 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
1203 I haven't got notangle installed so Kayvan please test. The output
1204 should end up in $builddir. This also allows people who don't have
1205 noweb installed to complete the make process without error.
1207 * src/frontends/xforms/FormCommand.[Ch] (showInset):
1208 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
1209 by JMarc's picky compiler.
1211 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1214 * src/insets/insettabular.C (setPos): change for loop to not use
1215 sequencing operator. Please check this Jürgen.
1217 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
1219 * src/insets/insetcite.C (getScreenLabel): ditto
1220 * src/support/filetools.C (QuoteName): ditto
1221 (ChangeExtension): ditto
1223 * src/BufferView_pimpl.C (scrollCB): make heigt int
1225 * src/BufferView2.C (insertInset): comment out unused arg
1227 * boost/Makefile.am (EXTRADIST): new variable
1229 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1231 * src/exporter.C (IsExportable): Fixed
1233 * lib/configure.m4: Small fix
1235 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1237 * src/insets/insetbutton.C (width): Changed to work with no GUI.
1238 * src/insets/insetbib.C (bibitemWidest): ditto.
1239 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
1241 2000-10-03 Juergen Vigna <jug@sad.it>
1243 * src/BufferView2.C (theLockingInset): removed const because of
1244 Agnus's compile problems.
1246 * src/insets/insettext.C (LocalDispatch): set the language of the
1247 surronding paragraph on inserting the first character.
1249 * various files: changed use of BufferView::the_locking_inset.
1251 * src/BufferView2.C (theLockingInset):
1252 (theLockingInset): new functions.
1254 * src/BufferView.h: removed the_locking_inset.
1256 * src/lyxtext.h: added the_locking_inset
1258 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
1260 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
1262 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1264 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
1265 * src/mathed/math_cursor.C (IsAlpha): ditto.
1266 * src/mathed/math_inset.C (strnew): ditto.
1267 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
1268 (IMetrics): cxp set but never used; removed.
1269 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
1270 that the variable in question has been removed also!
1273 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
1274 using the Buffer * passed to Latex(), using the BufferView * passed to
1275 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
1277 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
1278 Linuxdoc() and DocBook() rather than the stored Buffer * master.
1280 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
1281 * src/buffer.C (readInset): used new InsetBibtex c-tor
1282 * (getBibkeyList): used new InsetBibtex::getKeys
1284 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1287 * lib/build-listerrors
1289 * src/exporter.C: Add literate programming support to the export code
1292 * src/lyx_cb.C: Remove old literate code.
1294 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
1297 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
1298 * src/converter.C (View, Convert): Use QuoteName.
1300 * src/insets/figinset.C (Preview): Use Formats::View.
1302 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
1304 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1306 * src/lyxfunc.C (Dispatch): move declaration of text variable at
1307 the top of the function, because compaq cxx complains that the
1308 "goto exit_with_message" when the function is disabled bypasses
1310 (MenuNew): try a better fix for the generation of new file names.
1311 This time, I used AddName() instead of AddPath(), hoping Juergen
1314 2000-10-03 Allan Rae <rae@lyx.org>
1316 * src/frontends/xforms/forms/form_preferences.fd:
1317 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
1318 nested tabfolders has begun. The old "Miscellaneous" was renamed as
1319 "Look and Feel"->"General" but will need to be split up further into
1320 general output and general input tabs. Current plan is for four outer
1321 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
1322 stuff; "Inputs" for input and import configuration; "Outputs" for
1323 output and export configuration; and one more whatever is left over
1324 called "General". The leftovers at present look like being which
1325 viewers to use, spellchecker, language support and might be better
1326 named "Support". I've put "Paths" in "Inputs" for the moment as this
1327 seems reasonable for now at least.
1328 One problem remains: X error kills LyX when you close Preferences.
1330 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1332 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
1333 qualifier from form()
1334 * src/frontends/xforms/FormCitation.[Ch]:
1335 * src/frontends/xforms/FormCopyright.[Ch]:
1336 * src/frontends/xforms/FormDocument.[Ch]:
1337 * src/frontends/xforms/FormError.[Ch]:
1338 * src/frontends/xforms/FormIndex.[Ch]:
1339 * src/frontends/xforms/FormPreferences.[Ch]:
1340 * src/frontends/xforms/FormPrint.[Ch]:
1341 * src/frontends/xforms/FormRef.[Ch]:
1342 * src/frontends/xforms/FormToc.[Ch]:
1343 * src/frontends/xforms/FormUrl.[Ch]: ditto.
1345 * src/frontends/xforms/FormCitation.[Ch]:
1346 * src/frontends/xforms/FormIndex.[Ch]:
1347 * src/frontends/xforms/FormRef.[Ch]:
1348 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
1349 with Allan's naming policy
1351 * src/frontends/xforms/FormCitation.C: some static casts to remove
1354 2000-10-02 Juergen Vigna <jug@sad.it>
1356 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
1357 now you can type or do stuff inside the table-cell also when in dummy
1358 position, fixed visible cursor.
1360 * src/insets/insettext.C (Edit): fixing cursor-view position.
1362 * src/lyxfunc.C (Dispatch): use * text variable so that it can
1363 be used for equal functions in lyxfunc and insettext.
1365 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
1367 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
1369 * src/frontends/gnome/FormCitation.h:
1370 * src/frontends/gnome/FormCopyright.h:
1371 * src/frontends/gnome/FormIndex.h:
1372 * src/frontends/gnome/FormPrint.h:
1373 * src/frontends/gnome/FormToc.h:
1374 * src/frontends/gnome/FormUrl.h:
1375 * src/frontends/kde/FormCitation.h:
1376 * src/frontends/kde/FormCopyright.h:
1377 * src/frontends/kde/FormIndex.h:
1378 * src/frontends/kde/FormRef.h:
1379 * src/frontends/kde/FormToc.h:
1380 * src/frontends/kde/FormUrl.h: fix remaining users of
1383 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1385 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
1386 from depth argument.
1387 (DocBookHandleCaption): ditto.
1388 (DocBookHandleFootnote): ditto.
1389 (SimpleDocBookOnePar): ditto.
1391 * src/frontends/xforms/FormDocument.h (form): remove extra
1392 FormDocument:: qualifier.
1394 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
1396 * sigc++/handle.h: ditto.
1398 * src/lyx_gui_misc.C: add "using" directive.
1400 * src/cheaders/cstddef: new file, needed by the boost library (for
1403 2000-10-02 Juergen Vigna <jug@sad.it>
1405 * src/insets/insettext.C (SetFont): better support.
1407 * src/insets/insettabular.C (draw): fixed drawing of single cell.
1409 * src/screen.C (DrawOneRow): some uint refixes!
1411 2000-10-02 Allan Rae <rae@lyx.org>
1413 * boost/.cvsignore: ignore Makefile as well
1415 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
1416 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
1418 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
1419 Left this one out by accident.
1421 * src/frontends/xforms/FormBase.h (restore): default to calling
1422 update() since that will restore the original/currently-applied values.
1423 Any input() triggered error messages will require the derived classes
1424 to redefine restore().
1426 * src/frontends/xforms/FormDocument.C: initialize a few variables to
1427 avoid a segfault. combo_doc_class is the main concern.
1429 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
1431 * Simplify build-listerrors in view of GUI-less export ability!
1433 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1435 * src/lyx_main.C (easyParse): Disable gui when exporting
1437 * src/insets/figinset.C:
1440 * src/lyx_gui_misc.C
1441 * src/tabular.C: Changes to allow no-gui.
1443 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1445 * src/support/utility.hpp: removed file
1446 * src/support/block.h: removed file
1448 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
1451 * src/mathed/formula.C: add support/lyxlib.h
1452 * src/mathed/formulamacro.C: ditto
1454 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
1455 * src/lyxparagraph.h: ditto
1457 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
1458 * src/frontends/Makefile.am (INCLUDES): ditto
1459 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
1460 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
1461 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
1462 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
1463 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
1464 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
1466 * src/BufferView.h: use boost/utility.hpp
1467 * src/LColor.h: ditto
1468 * src/LaTeX.h: ditto
1469 * src/LyXAction.h: ditto
1470 * src/LyXView.h: ditto
1471 * src/bufferlist.h: ditto
1472 * src/lastfiles.h: ditto
1473 * src/layout.h: ditto
1474 * src/lyx_gui.h: ditto
1475 * src/lyx_main.h: ditto
1476 * src/lyxlex.h: ditto
1477 * src/lyxrc.h: ditto
1478 * src/frontends/ButtonPolicies.h: ditto
1479 * src/frontends/Dialogs.h: ditto
1480 * src/frontends/xforms/FormBase.h: ditto
1481 * src/frontends/xforms/FormGraphics.h: ditto
1482 * src/frontends/xforms/FormParagraph.h: ditto
1483 * src/frontends/xforms/FormTabular.h: ditto
1484 * src/graphics/GraphicsCache.h: ditto
1485 * src/graphics/Renderer.h: ditto
1486 * src/insets/ExternalTemplate.h: ditto
1487 * src/insets/insetcommand.h: ditto
1488 * src/support/path.h: ditto
1490 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
1491 and introduce clause for 2.97.
1493 * boost/libs/README: new file
1495 * boost/boost/utility.hpp: new file
1497 * boost/boost/config.hpp: new file
1499 * boost/boost/array.hpp: new file
1501 * boost/Makefile.am: new file
1503 * boost/.cvsignore: new file
1505 * configure.in (AC_OUTPUT): add boost/Makefile
1507 * Makefile.am (SUBDIRS): add boost
1509 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1511 * src/support/lstrings.C (suffixIs): Fixed.
1513 2000-10-01 Allan Rae <rae@lyx.org>
1515 * src/PrinterParams.h: moved things around to avoid the "can't
1516 inline call" warning.
1518 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
1519 into doc++ documentation.
1521 * src/frontends/xforms/FormCommand.[Ch]: support button policy
1523 * src/frontends/xforms/FormRef.C: make use of button controller
1524 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
1525 cleaned up button controller usage.
1526 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
1527 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
1528 use the button controller
1530 * src/frontends/xforms/forms/*.fd: and associated generated files
1531 updated to reflect changes to FormBase. Some other FormXxxx files
1532 also got minor updates to reflect changes to FormBase.
1534 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
1535 (hide): made virtual.
1536 (input): return a bool. true == valid input
1537 (RestoreCB, restore): new
1538 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
1539 Changes to allow derived dialogs to use a ButtonController and
1540 make sense when doing so: OK button calls ok() and so on.
1542 * src/frontends/xforms/ButtonController.h (class ButtonController):
1543 Switch from template implementation to taking Policy parameter.
1544 Allows FormBase to provide a ButtonController for any dialog.
1546 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
1547 Probably should rename connect and disconnect.
1548 (apply): use the radio button groups
1549 (form): needed by FormBase
1550 (build): setup the radio button groups
1552 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
1554 * several files: type changes to reduce the number of warnings and
1555 to unify type hangling a bit. Still much to do.
1557 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1559 * lib/images/*: rename a bunch of icons to match Dekel converter
1562 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
1565 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
1567 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
1569 * sigc++/handle.h: ditto for class Handle.
1571 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
1573 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
1575 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
1577 * src/intl.C (InitKeyMapper): Correct the value of n due to the
1578 removal of the "default" language.
1580 * src/combox.h (getline): Check that sel > 0
1582 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
1584 * lib/examples/docbook_example.lyx
1585 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
1587 * lib/layouts/docbook-book.layout: new docbook book layout.
1589 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
1591 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
1593 * src/insets/figinset.C (DocBook):fixed small typo.
1595 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
1597 * src/insets/insetinclude.h: string include_label doesn't need to be
1600 2000-09-29 Allan Rae <rae@lyx.org>
1602 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
1603 Allow derived type to control connection and disconnection from signals
1604 of its choice if desired.
1606 2000-09-28 Juergen Vigna <jug@sad.it>
1608 * src/insets/insettabular.C (update): fixed cursor setting when
1609 the_locking_inset changed.
1610 (draw): made this a bit cleaner.
1611 (InsetButtonPress): fixed!
1613 * various files: added LyXText Parameter to fitCursor call.
1615 * src/BufferView.C (fitCursor): added LyXText parameter.
1617 * src/insets/insettabular.C (draw): small draw fix.
1619 * src/tabular.C: right setting of left/right celllines.
1621 * src/tabular.[Ch]: fixed various types in funcions and structures.
1622 * src/insets/insettabular.C: ditto
1623 * src/frontends/xforms/FormTabular.C: ditto
1625 2000-09-28 Allan Rae <rae@lyx.org>
1627 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
1628 that the #ifdef's had been applied to part of what should have been
1629 a complete condition. It's possible there are other tests that
1630 were specific to tables that are also wrong now that InsetTabular is
1631 being used. Now we need to fix the output of '\n' after a table in a
1632 float for the same reason as the original condition:
1633 "don't insert this if we would be adding it before or after a table
1634 in a float. This little trick is needed in order to allow use of
1635 tables in \subfigures or \subtables."
1636 Juergen can you check this?
1638 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1640 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
1641 output to the ostream.
1643 * several files: fixed types based on warnings from cxx
1645 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
1647 * src/frontends/kde/Makefile.am: fix rule for
1648 formindexdialogdata_moc.C
1650 * src/.cvsignore: add ext_l10n.h to ignore
1652 * acconfig.h: stop messing with __STRICT_ANSI__
1653 * config/gnome.m4: remove option to set -ansi
1654 * config/kde.m4: remove option to set -ansi
1655 * config/lyxinclude.m4: don't set -ansi
1657 2000-09-27 Juergen Vigna <jug@sad.it>
1659 * various files: remove "default" language check.
1661 * src/insets/insetquotes.C: removed use of current_view.
1663 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
1664 the one should have red ears by now!
1666 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
1667 in more then one paragraph. Fixed cursor-movement/selection.
1669 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
1670 paragraphs inside a text inset.
1672 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
1673 text-inset if this owner is an inset.
1675 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1677 * src/Bullet.h: changed type of font, character and size to int
1679 * src/buffer.C (asciiParagraph): remove actcell and fname1.
1681 * src/insets/inseturl.[Ch]:
1682 * src/insets/insetref.[Ch]:
1683 * src/insets/insetlabel.[Ch]: add linelen to Ascii
1685 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
1687 * src/buffer.C (readFile): block-if statement rearranged to minimise
1688 bloat. Patch does not reverse Jean-Marc's change ;-)
1690 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
1691 Class rewritten to store pointers to hide/update signals directly,
1692 rather than Dialogs *. Also defined an enum to ease use. All xforms
1693 forms can now be derived from this class.
1695 * src/frontends/xforms/FormCommand.[Ch]
1696 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
1698 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
1701 * src/frontends/xforms/forms/form_citation.fd
1702 * src/frontends/xforms/forms/form_copyright.fd
1703 * src/frontends/xforms/forms/form_error.fd
1704 * src/frontends/xforms/forms/form_index.fd
1705 * src/frontends/xforms/forms/form_ref.fd
1706 * src/frontends/xforms/forms/form_toc.fd
1707 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
1709 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
1711 * src/insets/insetfoot.C: removed redundent using directive.
1713 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1715 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
1716 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
1718 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
1719 created in the constructors in different groups. Then set() just
1720 have to show the groups as needed. This fixes the redraw problems
1721 (and is how the old menu code worked).
1723 * src/support/lyxlib.h: declare the methods as static when we do
1724 not have namespaces.
1726 2000-09-26 Juergen Vigna <jug@sad.it>
1728 * src/buffer.C (asciiParagraph): new function.
1729 (writeFileAscii): new function with parameter ostream.
1730 (writeFileAscii): use now asciiParagraph.
1732 * various inset files: added the linelen parameter to the Ascii-func.
1734 * src/tabular.C (Write): fixed error in writing file introduced by
1735 the last changes from Lars.
1737 * lib/bind/menus.bind: removed not supported functions.
1739 * src/insets/insettext.C (Ascii): implemented this function.
1741 * src/insets/lyxinset.h (Ascii): added linelen parameter.
1743 * src/tabular.C (write_attribute[int,string,bool]): new functions.
1744 (Write): use of the write_attribute functions.
1746 * src/bufferlist.C (close): fixed reasking question!
1748 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1750 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
1751 new files use the everwhere possible.
1754 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
1755 src/log_form.C src/lyx.C:
1758 * src/buffer.C (runLaTeX): remove func
1760 * src/PaperLayout.C: removed file
1761 * src/ParagraphExtra.C: likewise
1762 * src/bullet_forms.C: likewise
1763 * src/bullet_forms.h: likewise
1764 * src/bullet_forms_cb.C: likewise
1766 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
1767 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
1770 * several files: remove all traces of the old fd_form_paragraph,
1771 and functions belonging to that.
1773 * several files: remove all traces of the old fd_form_document,
1774 and functions belonging to that.
1776 * several files: constify local variables were possible.
1778 * several files: remove all code that was dead when NEW_EXPORT was
1781 * several files: removed string::c_str in as many places as
1784 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
1785 (e): be a bit more outspoken when patching
1786 (updatesrc): only move files if changed.
1788 * forms/layout_forms.h.patch: regenerated
1790 * forms/layout_forms.fd: remove form_document and form_paragraph
1791 and form_quotes and form_paper and form_table_options and
1792 form_paragraph_extra
1794 * forms/form1.fd: remove form_table
1796 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
1797 the fdui->... rewrite. Update some comments to xforms 0.88
1799 * forms/bullet_forms.C.patch: removed file
1800 * forms/bullet_forms.fd: likewise
1801 * forms/bullet_forms.h.patch: likewise
1803 * development/Code_rules/Rules: added a section on switch
1804 statements. Updated some comment to xforms 0.88.
1806 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1808 * src/buffer.C (readFile): make sure that the whole version number
1809 is read after \lyxformat (even when it contains a comma)
1811 * lib/ui/default.ui: change shortcut of math menu to M-a.
1813 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1815 * src/vspace.C (nextToken): use isStrDbl() to check for proper
1818 * src/LyXView.C (updateWindowTitle): show the full files name in
1819 window title, limited to 30 characters.
1821 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
1822 When a number of characters has been given, we should not assume
1823 that the string is 0-terminated.
1825 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
1826 calls (fixes some memory leaks)
1828 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
1829 trans member on exit.
1831 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1833 * src/converter.C (GetReachable): fix typo.
1835 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
1836 understand ',' instead of '.'.
1837 (GetInteger): rewrite to use strToInt().
1839 2000-09-26 Juergen Vigna <jug@sad.it>
1841 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
1842 better visibility and error-message on wrong VSpace input.
1844 * src/language.C (initL): added english again.
1846 2000-09-25 Juergen Vigna <jug@sad.it>
1848 * src/frontends/kde/Dialogs.C (Dialogs):
1849 * src/frontends/gnome/Dialogs.C (Dialogs):
1850 * src/frontends/kde/Makefile.am:
1851 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
1853 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
1855 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
1857 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
1859 * src/frontends/xforms/FormParagraph.C:
1860 * src/frontends/xforms/FormParagraph.h:
1861 * src/frontends/xforms/form_paragraph.C:
1862 * src/frontends/xforms/form_paragraph.h:
1863 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
1866 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
1868 * src/tabular.C (OldFormatRead): forgot to delete the temporary
1869 Paragraph-Data after use.
1871 * src/insets/insettext.C (LocalDispatch): don't set the layout on
1872 non breakable paragraphs.
1874 2000-09-25 Garst R. Reese <reese@isn.net>
1876 * src/language.C (initL): added missing language_country codes.
1878 2000-09-25 Juergen Vigna <jug@sad.it>
1880 * src/insets/insettext.C (InsetText):
1881 (deleteLyXText): remove the not released LyXText structure!
1883 2000-09-24 Marko Vendelin <markov@ioc.ee>
1885 * src/frontends/gnome/mainapp.C
1886 * src/frontends/gnome/mainapp.h: added support for keyboard
1889 * src/frontends/gnome/FormCitation.C
1890 * src/frontends/gnome/FormCitation.h
1891 * src/frontends/gnome/Makefile.am
1892 * src/frontends/gnome/pixbutton.h: completed the rewrite of
1893 FormCitation to use "action area" in mainapp window
1895 * src/frontends/gnome/Menubar_pimpl.C
1896 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
1899 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
1901 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
1902 width/descent/ascent values if name is empty.
1903 (mathed_string_height): Use std::max.
1905 2000-09-25 Allan Rae <rae@lyx.org>
1907 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
1908 segfault. This will be completely redesigned soon.
1910 * sigc++: updated libsigc++. Fixes struct timespec bug.
1912 * development/tools/makeLyXsigc.sh: .cvsignore addition
1914 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
1916 * several files: removed almost all traces of the old table
1919 * src/TableLayout.C: removed file
1921 2000-09-22 Juergen Vigna <jug@sad.it>
1923 * src/frontends/kde/Dialogs.C: added credits forms.
1925 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
1927 * src/frontends/gnome/Dialogs.C: added some forms.
1929 * src/spellchecker.C (init_spell_checker): set language in pspell code
1930 (RunSpellChecker): some modifications for setting language string.
1932 * src/language.[Ch]: added language_country code.
1934 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
1936 * src/frontends/Dialogs.h: added new signal showError.
1937 Rearranged existing signals in some sort of alphabetical order.
1939 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
1940 FormError.[Ch], form_error.[Ch]
1941 * src/frontends/xforms/forms/makefile: added new file form_error.fd
1942 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
1944 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
1945 dialogs. I think that this can be used as the base to all these
1948 * src/frontends/xforms/FormError.[Ch]
1949 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
1950 implementation of InsetError dialog.
1952 * src/insets/inseterror.[Ch]: rendered GUI-independent.
1954 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
1955 * src/frontends/kde/Makefile.am: ditto
1957 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
1959 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
1960 macrobf. This fixes a bug of invisible text.
1962 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1964 * lib/doc/LaTeXConfig.lyx.in: updated.
1966 * src/language.C (initL): remove language "francais" and change a
1967 bit the names of the two other french variations.
1969 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
1970 string that may not be 0-terminated.
1972 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1974 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
1976 2000-09-20 Marko Vendelin <markov@ioc.ee>
1978 * src/frontends/gnome/FormCitation.C
1979 * src/frontends/gnome/FormIndex.C
1980 * src/frontends/gnome/FormToc.C
1981 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
1982 the variable initialization to shut up the warnings
1984 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1986 * src/table.[Ch]: deleted files
1988 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
1991 2000-09-18 Juergen Vigna <jug@sad.it>
1993 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
1994 problems with selection. Inserted new LFUN_PASTESELECTION.
1995 (InsetButtonPress): inserted handling of middle mouse-button paste.
1997 * src/spellchecker.C: changed word to word.c_str().
1999 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
2001 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
2002 included in the ``make dist'' tarball.
2004 2000-09-15 Juergen Vigna <jug@sad.it>
2006 * src/CutAndPaste.C (cutSelection): small fix return the right
2007 end position after cut inside one paragraph only.
2009 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
2010 we are locked as otherwise we don't have a valid cursor position!
2012 * src/insets/figinset.C (draw): small bugfix but why is this needed???
2014 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
2016 * src/frontends/kde/FormRef.C: added using directive.
2017 * src/frontends/kde/FormToc.C: ditto
2019 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
2021 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
2023 2000-09-19 Marko Vendelin <markov@ioc.ee>
2025 * src/frontends/gnome/Menubar_pimpl.C
2026 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
2027 Toc, ViewFormats, UpdateFormats, and ExportFormats.
2029 * src/frontends/gnome/mainapp.C
2030 * src/frontends/gnome/mainapp.h: support for menu update used
2033 * src/frontends/gnome/mainapp.C
2034 * src/frontends/gnome/mainapp.h: support for "action" area in the
2035 main window. This area is used by small simple dialogs, such as
2038 * src/frontends/gnome/FormIndex.C
2039 * src/frontends/gnome/FormIndex.h
2040 * src/frontends/gnome/FormUrl.C
2041 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
2044 * src/frontends/gnome/FormCitation.C
2045 * src/frontends/gnome/FormCitation.h: rewrite to use main window
2046 action area. Only "Insert new citation" is implemented.
2048 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2050 * src/buffer.C (Dispatch): fix call to Dispatch
2051 * src/insets/insetref.C (Edit): likewise
2052 * src/insets/insetparent.C (Edit): likewise
2053 * src/insets/insetinclude.C (include_cb): likewise
2054 * src/frontends/xforms/FormUrl.C (apply): likewise
2055 * src/frontends/xforms/FormToc.C (apply): likewise
2056 * src/frontends/xforms/FormRef.C (apply): likewise
2057 * src/frontends/xforms/FormIndex.C (apply): likewise
2058 * src/frontends/xforms/FormCitation.C (apply): likewise
2059 * src/lyxserver.C (callback): likewise
2060 * src/lyxfunc.C (processKeySym): likewise
2061 (Dispatch): likewise
2062 (Dispatch): likewise
2063 * src/lyx_cb.C (LayoutsCB): likewise
2065 * Makefile.am (sourcedoc): small change
2067 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2069 * src/main.C (main): Don't make an empty GUIRunTime object. all
2070 methods are static. constify a bit remove unneded using + headers.
2072 * src/tabular.C: some more const to local vars move some loop vars
2074 * src/spellchecker.C: added some c_str after some word for pspell
2076 * src/frontends/GUIRunTime.h: add new static method setDefaults
2077 * src/frontends/xforms/GUIRunTime.C (setDefaults):
2078 * src/frontends/kde/GUIRunTime.C (setDefaults):
2079 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
2081 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
2082 with strnew in arg, use correct emptystring when calling SetName.
2084 * several files: remove all commented code with relation to
2085 HAVE_SSTREAM beeing false. We now only support stringstream and
2088 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2090 * src/lyxfunc.C: construct correctly the automatic new file
2093 * src/text2.C (IsStringInText): change type of variable i to shut
2096 * src/support/sstream.h: do not use namespaces if the compiler
2097 does not support them.
2099 2000-09-15 Marko Vendelin <markov@ioc.ee>
2100 * src/frontends/gnome/FormCitation.C
2101 * src/frontends/gnome/FormCitation.h
2102 * src/frontends/gnome/diainsertcitation_interface.c
2103 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
2104 regexp support to FormCitation [Gnome].
2106 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
2109 * configure.in: remove unused KDE/GTKGUI define
2111 * src/frontends/kde/FormRef.C
2112 * src/frontends/kde/FormRef.h
2113 * src/frontends/kde/formrefdialog.C
2114 * src/frontends/kde/formrefdialog.h: double click will
2115 go to reference, now it is possible to change a cross-ref
2118 * src/frontends/kde/FormToc.C
2119 * src/frontends/kde/FormToc.h
2120 * src/frontends/kde/formtocdialog.C
2121 * src/frontends/kde/formtocdialog.h: add a depth
2124 * src/frontends/kde/Makefile.am: add QtLyXView.h
2127 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
2129 * src/frontends/kde/FormCitation.h: added some using directives.
2131 * src/frontends/kde/FormToc.h: corrected definition of doTree.
2133 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
2136 * src/mathed/math_defs.h: redefine SetAlign to use string rather
2139 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2141 * src/buffer.C (pop_tag): revert for the second time a change by
2142 Lars, who seems to really hate having non-local loop variables :)
2144 * src/Lsstream.h: add "using" statements.
2146 * src/support/copy.C (copy): add a bunch of std:: qualifiers
2147 * src/buffer.C (writeFile): ditto
2149 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2151 * src/buffer.C (writeFile): try to fix the locale modified format
2152 number to always be as we want it.
2154 * src/WorkArea.C (work_area_handler): try to workaround the bugs
2155 in XForms 0.89. C-space is now working again.
2157 * src/Lsstream.h src/support/sstream.h: new files.
2159 * also commented out all cases where strstream were used.
2161 * src/Bullet.h (c_str): remove method.
2163 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
2165 * a lot of files: get rid of "char const *" and "char *" is as
2166 many places as possible. We only want to use them in interaction
2167 with system of other libraries, not inside lyx.
2169 * a lot of files: return const object is not of pod type. This
2170 helps ensure that temporary objects is not modified. And fits well
2171 with "programming by contract".
2173 * configure.in: check for the locale header too
2175 * Makefile.am (sourcedoc): new tag for generation of doc++
2178 2000-09-14 Juergen Vigna <jug@sad.it>
2180 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
2181 callback to check which combo called it and do the right action.
2183 * src/combox.C (combo_cb): added combo * to the callbacks.
2184 (Hide): moved call of callback after Ungrab of the pointer.
2186 * src/intl.h: removed LCombo2 function.
2188 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
2189 function as this can now be handled in one function.
2191 * src/combox.h: added Combox * to callback prototype.
2193 * src/frontends/xforms/Toolbar_pimpl.C:
2194 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
2196 2000-09-14 Garst Reese <reese@isn.net>
2198 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
2199 moved usepackage{xxx}'s to beginning of file. Changed left margin
2200 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
2201 underlining from title. Thanks to John Culleton for useful suggestions.
2203 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2205 * src/lyxlex_pimpl.C (setFile): change error message to debug
2208 2000-09-13 Juergen Vigna <jug@sad.it>
2210 * src/frontends/xforms/FormDocument.C: implemented choice_class
2211 as combox and give callback to combo_language so OK/Apply is activated
2214 * src/bufferlist.C (newFile): small fix so already named files
2215 (via an open call) are not requested to be named again on the
2218 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2220 * src/frontends/kde/Makefile.am
2221 * src/frontends/kde/FormRef.C
2222 * src/frontends/kde/FormRef.h
2223 * src/frontends/kde/formrefdialog.C
2224 * src/frontends/kde/formrefdialog.h: implement
2227 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2229 * src/frontends/kde/formtocdialog.C
2230 * src/frontends/kde/formtocdialog.h
2231 * src/frontends/kde/FormToc.C
2232 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
2234 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
2236 * src/frontends/kde/FormCitation.C: fix thinko
2237 where we didn't always display the reference text
2240 * src/frontends/kde/formurldialog.C
2241 * src/frontends/kde/formurldialog.h
2242 * src/frontends/kde/FormUrl.C
2243 * src/frontends/kde/FormUrl.h: minor cleanups
2245 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
2247 * src/frontends/kde/Makefile.am
2248 * src/frontends/kde/FormToc.C
2249 * src/frontends/kde/FormToc.h
2250 * src/frontends/kde/FormCitation.C
2251 * src/frontends/kde/FormCitation.h
2252 * src/frontends/kde/FormIndex.C
2253 * src/frontends/kde/FormIndex.h
2254 * src/frontends/kde/formtocdialog.C
2255 * src/frontends/kde/formtocdialog.h
2256 * src/frontends/kde/formcitationdialog.C
2257 * src/frontends/kde/formcitationdialog.h
2258 * src/frontends/kde/formindexdialog.C
2259 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
2261 2000-09-12 Juergen Vigna <jug@sad.it>
2263 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
2266 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2268 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
2271 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
2273 * src/converter.C (Add, Convert): Added support for converter flags:
2274 needaux, resultdir, resultfile.
2275 (Convert): Added new parameter view_file.
2276 (dvips_options): Fixed letter paper option.
2278 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
2279 (Export, GetExportableFormats, GetViewableFormats): Added support
2282 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
2284 (easyParse): Fixed to work with new export code.
2286 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
2289 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
2291 * lib/bind/*.bind: Replaced
2292 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
2293 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
2295 2000-09-11 Juergen Vigna <jug@sad.it>
2297 * src/lyx_gui.C (runTime): uses global guiruntime variable.
2299 * src/main.C (main): now GUII defines global guiruntime!
2301 * src/frontends/gnome/GUIRunTime.C (initApplication):
2302 * src/frontends/kde/GUIRunTime.C (initApplication):
2303 * src/frontends/xforms/GUIRunTime.C (initApplication):
2304 * src/frontends/GUIRunTime.h: added new function initApplication.
2306 * src/spellchecker.C (sc_accept_word): change to add_to_session.
2308 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
2310 2000-09-08 Juergen Vigna <jug@sad.it>
2312 * src/lyx_gui.C (create_forms): don't display the "default" entry as
2313 we have already "Reset".
2315 * src/language.C (initL): inserted "default" language and made this
2316 THE default language (and not american!)
2318 * src/paragraph.C: inserted handling of "default" language!
2320 * src/lyxfont.C: ditto
2324 * src/paragraph.C: output the \\par only if we have a following
2325 paragraph otherwise it's not needed.
2327 2000-09-05 Juergen Vigna <jug@sad.it>
2329 * config/pspell.m4: added entry to lyx-flags
2331 * src/spellchecker.C: modified version from Kevin for using pspell
2333 2000-09-01 Marko Vendelin <markov@ioc.ee>
2334 * src/frontends/gnome/Makefile.am
2335 * src/frontends/gnome/FormCitation.C
2336 * src/frontends/gnome/FormCitation.h
2337 * src/frontends/gnome/diainsertcitation_callbacks.c
2338 * src/frontends/gnome/diainsertcitation_callbacks.h
2339 * src/frontends/gnome/diainsertcitation_interface.c
2340 * src/frontends/gnome/diainsertcitation_interface.h
2341 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
2342 dialog for Gnome frontend
2344 * src/main.C: Gnome libraries require keeping application name
2345 and its version as strings
2347 * src/frontends/gnome/mainapp.C: Change the name of the main window
2348 from GnomeLyX to PACKAGE
2350 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2352 * src/frontends/Liason.C: add "using: declaration.
2354 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
2356 * src/mathed/math_macro.C (Metrics): Set the size of the template
2358 * src/mathed/formulamacro.C (Latex): Fixed the returned value
2360 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
2362 * src/converter.C (add_options): New function.
2363 (SetViewer): Change $$FName into '$$FName'.
2364 (View): Add options when running xdvi
2365 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
2366 (Convert): The 3rd parameter is now the desired filename. Converts
2367 calls to lyx::rename if necessary.
2368 Add options when running dvips.
2369 (dvi_papersize,dvips_options): New methods.
2371 * src/exporter.C (Export): Use getLatexName() instead of fileName().
2373 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
2374 using a call to Converter::dvips_options.
2375 Fixed to work with nex export code.
2377 * src/support/copy.C
2378 * src/support/rename.C: New files
2380 * src/support/syscall.h
2381 * src/support/syscall.C: Added Starttype SystemDontWait.
2383 * lib/ui/default.ui: Changed to work with new export code
2385 * lib/configure.m4: Changed to work with new export code
2387 * src/encoding.C: Changed latex name for iso8859_7 encoding.
2389 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
2391 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
2392 so that code compiles with DEC cxx.
2394 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
2395 to work correctly! Also now supports the additional elements
2398 2000-09-01 Allan Rae <rae@lyx.org>
2400 * src/frontends/ButtonPolicies.C: renamed all the references to
2401 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
2403 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
2404 since it's a const not a type.
2406 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
2408 2000-08-31 Juergen Vigna <jug@sad.it>
2410 * src/insets/figinset.C: Various changes to look if the filename has
2411 an extension and if not add it for inline previewing.
2413 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2415 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
2416 make buttonStatus and isReadOnly be const methods. (also reflect
2417 this in derived classes.)
2419 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
2420 (nextState): change to be static inline, pass the StateMachine as
2422 (PreferencesPolicy): remove casts
2423 (OkCancelPolicy): remvoe casts
2424 (OkCancelReadOnlyPolicy): remove casts
2425 (NoRepeatedApplyReadOnlyPolicy): remove casts
2426 (OkApplyCancelReadOnlyPolicy): remove casts
2427 (OkApplyCancelPolicy): remove casts
2428 (NoRepeatedApplyPolicy): remove casts
2430 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
2432 * src/converter.C: added some using directives
2434 * src/frontends/ButtonPolicies.C: changes to overcome
2435 "need lvalue" error with DEC c++
2437 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
2438 to WMHideCB for DEC c++
2440 * src/frontends/xforms/Menubar_pimpl.C: added using directive
2442 * src/frontends/xforms/forms/form_document.C.patch: use C callback
2443 to BulletBMTableCB for DEC c++
2445 2000-08-31 Allan Rae <rae@lyx.org>
2447 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
2448 character dialog separately from old document dialogs combo_language.
2451 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2453 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
2454 Removed LFUN_REF_CREATE.
2456 * src/MenuBackend.C: Added new tags: toc and references
2458 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
2459 (add_lastfiles, add_documents, add_formats): Removed the unused smn
2461 (add_toc, add_references): New methods.
2462 (create_submenu): Handle correctly the case when there is a
2463 seperator after optional menu items.
2465 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
2466 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
2467 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
2469 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
2471 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2473 * src/converter.[Ch]: New file for converting between different
2476 * src/export.[Ch]: New file for exporting a LyX file to different
2479 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
2480 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
2481 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
2482 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
2483 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
2484 RunDocBook, MenuExport.
2486 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
2487 Exporter::Preview methods if NEW_EXPORT is defined.
2489 * src/buffer.C (Dispatch): Use Exporter::Export.
2491 * src/lyxrc.C: Added new tags: \converter and \viewer.
2494 * src/LyXAction.C: Define new lyx-function: buffer-update.
2495 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
2496 when NEW_EXPORT is defined.
2498 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
2500 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
2502 * lib/ui/default.ui: Added submenus "view" and "update" to the
2505 * src/filetools.C (GetExtension): New function.
2507 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
2509 2000-08-29 Allan Rae <rae@lyx.org>
2511 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
2513 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
2514 (EnableDocumentLayout): removed
2515 (DisableDocumentLayout): removed
2516 (build): make use of ButtonController's read-only handling to
2517 de/activate various objects. Replaces both of the above functions.
2519 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
2520 (readOnly): was read_only
2521 (refresh): fixed dumb mistakes with read_only_ handling
2523 * src/frontends/xforms/forms/form_document.fd:
2524 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
2525 tabbed dialogs so the tabs look more like tabs and so its easier to
2526 work out which is the current tab.
2528 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
2529 segfault with form_table
2531 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
2533 2000-08-28 Juergen Vigna <jug@sad.it>
2535 * acconfig.h: added USE_PSPELL.
2537 * src/config.h.in: added USE_PSPELL.
2539 * autogen.sh: added pspell.m4
2541 * config/pspell.m4: new file.
2543 * src/spellchecker.C: implemented support for pspell libary.
2545 2000-08-25 Juergen Vigna <jug@sad.it>
2547 * src/LyXAction.C (init): renamed LFUN_TABLE to
2548 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
2550 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
2552 * src/lyxscreen.h: add force_clear variable and fuction to force
2553 a clear area when redrawing in LyXText.
2555 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
2557 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2559 * some whitespace and comment changes.
2561 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
2563 * src/buffer.C: up te LYX_FORMAT to 2.17
2565 2000-08-23 Juergen Vigna <jug@sad.it>
2567 * src/BufferView_pimpl.C (tripleClick): disable this when in a
2570 * src/insets/insettabular.C (pasteSelection): delete the insets
2571 LyXText as it is not valid anymore.
2572 (copySelection): new function.
2573 (pasteSelection): new function.
2574 (cutSelection): new function.
2575 (LocalDispatch): implemented cut/copy/paste of cell selections.
2577 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
2578 don't have a LyXText.
2580 * src/LyXAction.C (init): a NEW_TABULAR define too much.
2582 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
2585 2000-08-22 Juergen Vigna <jug@sad.it>
2587 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
2588 ifdef form_table out if NEW_TABULAR.
2590 2000-08-21 Juergen Vigna <jug@sad.it>
2592 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
2593 (draw): fixed draw position so that the cursor is positioned in the
2595 (InsetMotionNotify): hide/show cursor so the position is updated.
2596 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
2597 using cellstart() function where it should be used.
2599 * src/insets/insettext.C (draw): ditto.
2601 * src/tabular.C: fixed initialization of some missing variables and
2602 made BoxType into an enum.
2604 2000-08-22 Marko Vendelin <markov@ioc.ee>
2605 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
2606 stock menu item using action numerical value, not its string
2610 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
2612 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
2613 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
2615 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
2617 * src/frontends/xforms/GUIRunTime.C: new file
2619 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
2620 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2622 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
2624 * src/frontends/kde/GUIRunTime.C: new file
2626 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
2627 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2629 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
2631 * src/frontends/gnome/GUIRunTime.C: new file
2633 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
2636 * src/frontends/GUIRunTime.h: removed constructor and destructor,
2637 small change to documetentation.
2639 * src/frontends/GUIRunTime.C: removed file
2641 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
2643 * src/lyxparagraph.h: enable NEW_TABULAR as default
2645 * src/lyxfunc.C (processKeySym): remove some commented code
2647 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
2648 NEW_TABULAR around the fd_form_table_options.
2650 * src/lyx_gui.C (runTime): call the static member function as
2651 GUIRunTime::runTime().
2653 2000-08-21 Allan Rae <rae@lyx.org>
2655 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
2658 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
2660 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
2662 2000-08-21 Allan Rae <rae@lyx.org>
2664 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
2665 keep Garst happy ;-)
2666 * src/frontends/xforms/FormPreferences.C (build): use setOK
2667 * src/frontends/xforms/FormDocument.C (build): use setOK
2668 (FormDocument): use the appropriate policy.
2670 2000-08-21 Allan Rae <rae@lyx.org>
2672 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
2673 automatic [de]activation of arbitrary objects when in a read-only state.
2675 * src/frontends/ButtonPolicies.h: More documentation
2676 (isReadOnly): added to support the above.
2678 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
2680 2000-08-18 Juergen Vigna <jug@sad.it>
2682 * src/insets/insettabular.C (getStatus): changed to return func_status.
2684 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
2685 display toggle menu entries if they are.
2687 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
2688 new document layout now.
2690 * src/lyxfunc.C: ditto
2692 * src/lyx_gui_misc.C: ditto
2694 * src/lyx_gui.C: ditto
2696 * lib/ui/default.ui: removed paper and quotes layout as they are now
2697 all in the document layout tabbed folder.
2699 * src/frontends/xforms/forms/form_document.fd: added Restore
2700 button and callbacks for all inputs for Allan's ButtonPolicy.
2702 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
2703 (CheckChoiceClass): added missing params setting on class change.
2704 (UpdateLayoutDocument): added for updating the layout on params.
2705 (build): forgot to RETURN_ALWAYS input_doc_spacing.
2706 (FormDocument): Implemented Allan's ButtonPolicy with the
2709 2000-08-17 Allan Rae <rae@lyx.org>
2711 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
2712 so we can at least see the credits again.
2714 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
2715 controller calls for the appropriate callbacks. Note that since Ok
2716 calls apply followed by cancel, and apply isn't a valid input for the
2717 APPLIED state, the bc_ calls have to be made in the static callback not
2718 within each of the real callbacks.
2720 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
2721 (setOk): renamed from setOkay()
2723 2000-08-17 Juergen Vigna <jug@sad.it>
2725 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
2726 in the implementation part.
2727 (composeUIInfo): don't show optional menu-items.
2729 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
2731 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
2733 * src/bufferview_funcs.C (CurrentState): fixed to show also the
2734 text-state when in a text-inset.
2736 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
2738 2000-08-17 Marko Vendelin <markov@ioc.ee>
2739 * src/frontends/gnome/FormIndex.C
2740 * src/frontends/gnome/FormIndex.h
2741 * src/frontends/gnome/FormToc.C
2742 * src/frontends/gnome/FormToc.h
2743 * src/frontends/gnome/dialogs
2744 * src/frontends/gnome/diatoc_callbacks.c
2745 * src/frontends/gnome/diatoc_callbacks.h
2746 * src/frontends/gnome/diainsertindex_callbacks.h
2747 * src/frontends/gnome/diainsertindex_callbacks.c
2748 * src/frontends/gnome/diainsertindex_interface.c
2749 * src/frontends/gnome/diainsertindex_interface.h
2750 * src/frontends/gnome/diatoc_interface.h
2751 * src/frontends/gnome/diatoc_interface.c
2752 * src/frontends/gnome/Makefile.am: Table of Contents and
2753 Insert Index dialogs implementation for Gnome frontend
2755 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
2757 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
2759 * src/frontends/gnome/diainserturl_interface.c: make the dialog
2762 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2764 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
2765 destructor. Don't definde if you don't need it
2766 (processEvents): made static, non-blocking events processing for
2768 (runTime): static method. event loop for xforms
2769 * similar as above for kde and gnome.
2771 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
2772 new Pimpl is correct
2773 (runTime): new method calss the real frontends runtime func.
2775 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
2777 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2779 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
2781 2000-08-16 Juergen Vigna <jug@sad.it>
2783 * src/lyx_gui.C (runTime): added GUII RunTime support.
2785 * src/frontends/Makefile.am:
2786 * src/frontends/GUIRunTime.[Ch]:
2787 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
2788 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
2789 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
2791 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
2793 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
2794 as this is already set in ${FRONTEND_INCLUDE} if needed.
2796 * configure.in (CPPFLAGS): setting the include dir for the frontend
2797 directory and don't set FRONTEND=xforms for now as this is executed
2800 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
2802 * src/frontends/kde/Makefile.am:
2803 * src/frontends/kde/FormUrl.C:
2804 * src/frontends/kde/FormUrl.h:
2805 * src/frontends/kde/formurldialog.h:
2806 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
2808 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
2810 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
2812 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2814 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
2817 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
2819 * src/WorkArea.C (work_area_handler): more work to get te
2820 FL_KEYBOARD to work with xforms 0.88 too, please test.
2822 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
2824 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
2826 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
2829 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2831 * src/Timeout.h: remove Qt::emit hack.
2833 * several files: changes to allo doc++ compilation
2835 * src/lyxfunc.C (processKeySym): new method
2836 (processKeyEvent): comment out if FL_REVISION < 89
2838 * src/WorkArea.C: change some debugging levels.
2839 (WorkArea): set wantkey to FL_KEY_ALL
2840 (work_area_handler): enable the FL_KEYBOARD clause, this enables
2841 clearer code and the use of compose with XForms 0.89. Change to
2842 use signals instead of calling methods in bufferview directly.
2844 * src/Painter.C: change some debugging levels.
2846 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
2849 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
2850 (workAreaKeyPress): new method
2852 2000-08-14 Juergen Vigna <jug@sad.it>
2854 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
2856 * config/kde.m4: addes some features
2858 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
2859 include missing xforms dialogs.
2861 * src/Timeout.h: a hack to be able to compile with qt/kde.
2863 * sigc++/.cvsignore: added acinclude.m4
2865 * lib/.cvsignore: added listerros
2867 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
2868 xforms tree as objects are needed for other frontends.
2870 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
2871 linking with not yet implemented xforms objects.
2873 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
2875 2000-08-14 Baruch Even <baruch.even@writeme.com>
2877 * src/frontends/xforms/FormGraphics.h:
2878 * src/frontends/xforms/FormGraphics.C:
2879 * src/frontends/xforms/RadioButtonGroup.h:
2880 * src/frontends/xforms/RadioButtonGroup.C:
2881 * src/insets/insetgraphics.h:
2882 * src/insets/insetgraphics.C:
2883 * src/insets/insetgraphicsParams.h:
2884 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
2885 instead of spaces, and various other indentation issues to make the
2886 sources more consistent.
2888 2000-08-14 Marko Vendelin <markov@ioc.ee>
2890 * src/frontends/gnome/dialogs/diaprint.glade
2891 * src/frontends/gnome/FormPrint.C
2892 * src/frontends/gnome/FormPrint.h
2893 * src/frontends/gnome/diaprint_callbacks.c
2894 * src/frontends/gnome/diaprint_callbacks.h
2895 * src/frontends/gnome/diaprint_interface.c
2896 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
2899 * src/frontends/gnome/dialogs/diainserturl.glade
2900 * src/frontends/gnome/FormUrl.C
2901 * src/frontends/gnome/FormUrl.h
2902 * src/frontends/gnome/diainserturl_callbacks.c
2903 * src/frontends/gnome/diainserturl_callbacks.h
2904 * src/frontends/gnome/diainserturl_interface.c
2905 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
2906 Gnome implementation
2908 * src/frontends/gnome/Dialogs.C
2909 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
2910 all other dialogs. Copy all unimplemented dialogs from Xforms
2913 * src/frontends/gnome/support.c
2914 * src/frontends/gnome/support.h: support files generated by Glade
2918 * config/gnome.m4: Gnome configuration scripts
2920 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
2921 configure --help message
2923 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
2924 only if there are no events pendling in Gnome/Gtk. This enhances
2925 the performance of menus.
2928 2000-08-14 Allan Rae <rae@lyx.org>
2930 * lib/Makefile.am: listerrors cleaning
2932 * lib/listerrors: removed -- generated file
2933 * acinclude.m4: ditto
2934 * sigc++/acinclude.m4: ditto
2936 * src/frontends/xforms/forms/form_citation.fd:
2937 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
2940 * src/frontends/xforms/forms/makefile: I renamed the `install` target
2941 `updatesrc` and now we have a `test` target that does what `updatesrc`
2942 used to do. I didn't like having an install target that wasn't related
2945 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
2946 on all except FormGraphics. This may yet happen. Followed by a major
2947 cleanup including using FL_TRANSIENT for most of the dialogs. More
2948 changes to come when the ButtonController below is introduced.
2950 * src/frontends/xforms/ButtonController.h: New file for managing up to
2951 four buttons on a dialog according to an externally defined policy.
2952 * src/frontends/xforms/Makefile.am: added above
2954 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
2955 Apply and Cancel/Close buttons and everything in between and beyond.
2956 * src/frontends/Makefile.am: added above.
2958 * src/frontends/xforms/forms/form_preferences.fd:
2959 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
2960 and removed variable 'status' as a result. Fixed the set_minsize thing.
2961 Use the new screen-font-update after checking screen fonts were changed
2962 Added a "Restore" button to restore the original lyxrc values while
2963 editing. This restores everything not just the last input changed.
2964 That's still a tricky one. As is the "LyX: this shouldn't happen..."
2966 * src/LyXAction.C: screen-font-update added for updating buffers after
2967 screen font settings have been changed.
2968 * src/commandtags.h: ditto
2969 * src/lyxfunc.C: ditto
2971 * forms/lyx.fd: removed screen fonts dialog.
2972 * src/lyx_gui.C: ditto
2973 * src/menus.[Ch]: ditto
2974 * src/lyx.[Ch]: ditto
2975 * src/lyx_cb.C: ditto + code from here moved to make
2976 screen-font-update. And people wonder why progress on GUII is
2977 slow. Look at how scattered this stuff was! It takes forever
2980 * forms/fdfix.sh: Fixup the spacing after commas.
2981 * forms/makefile: Remove date from generated files. Fewer clashes now.
2982 * forms/bullet_forms.C.patch: included someones handwritten changes
2984 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
2985 once I've discovered why LyXRC was made noncopyable.
2986 * src/lyx_main.C: ditto
2988 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
2990 * src/frontends/xforms/forms/fdfix.sh:
2991 * src/frontends/xforms/forms/fdfixh.sed:
2992 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
2993 * src/frontends/xforms/Form*.[hC]:
2994 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
2995 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
2996 provide a destructor for the struct FD_form_xxxx. Another version of
2997 the set_[max|min]size workaround and a few other cleanups. Actually,
2998 Angus' patch from 20000809.
3000 2000-08-13 Baruch Even <baruch.even@writeme.com>
3002 * src/insets/insetgraphics.C (Clone): Added several fields that needed
3005 2000-08-11 Juergen Vigna <jug@sad.it>
3007 * src/insets/insetgraphics.C (InsetGraphics): changing init
3008 order because of warnings.
3010 * src/frontends/xforms/forms/makefile: adding patching .C with
3013 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
3014 from .C.patch to .c.patch
3016 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
3017 order because of warning.
3019 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
3021 * src/frontends/Liason.C (setMinibuffer): new helper function
3023 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
3025 * src/lyxfunc.C (Dispatch): calling new Document-Layout
3027 * lib/ui/default.ui: commented out PaperLayout entry
3029 * src/frontends/xforms/form_document.[Ch]: new added files
3031 * src/frontends/xforms/FormDocument.[Ch]: ditto
3033 * src/frontends/xforms/forms/form_document.fd: ditto
3035 * src/frontends/xforms/forms/form_document.C.patch: ditto
3037 2000-08-10 Juergen Vigna <jug@sad.it>
3039 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
3040 (InsetGraphics): initialized cacheHandle to 0.
3041 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
3043 2000-08-10 Baruch Even <baruch.even@writeme.com>
3045 * src/graphics/GraphicsCache.h:
3046 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
3047 correctly as a cache.
3049 * src/graphics/GraphicsCacheItem.h:
3050 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
3053 * src/graphics/GraphicsCacheItem_pimpl.h:
3054 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
3057 * src/insets/insetgraphics.h:
3058 * src/insets/insetgraphics.C: Changed from using a signal notification
3059 to polling when image is not loaded.
3061 2000-08-10 Allan Rae <rae@lyx.org>
3063 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
3064 that there are two functions that have to been taken out of line by
3065 hand and aren't taken care of in the script. (Just a reminder note)
3067 * sigc++/macros/*.h.m4: Updated as above.
3069 2000-08-09 Juergen Vigna <jug@sad.it>
3071 * src/insets/insettext.C (draw): small fix for clearing rectangle.
3073 * src/insets/insettabular.C: make drawing of single cell smarter.
3075 2000-08-09 Marko Vendelin <markov@ioc.ee>
3076 * src/frontends/gnome/Menubar_pimpl.C
3077 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
3078 implementation: new files
3080 * src/frontends/gnome/mainapp.C
3081 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
3084 * src/main.C: create Gnome main window
3086 * src/frontends/xforms/Menubar_pimpl.h
3087 * src/frontends/Menubar.C
3088 * src/frontends/Menubar.h: added method Menubar::update that calls
3089 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
3091 * src/LyXView.C: calls Menubar::update to update the state
3094 * src/frontends/gnome/Makefile.am: added new files
3096 * src/frontends/Makefile.am: added frontend compiler options
3098 2000-08-08 Juergen Vigna <jug@sad.it>
3100 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
3102 * src/bufferlist.C (close):
3103 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
3104 documents if exiting without saving.
3106 * src/buffer.C (save): use removeAutosaveFile()
3108 * src/support/filetools.C (removeAutosaveFile): new function.
3110 * src/lyx_cb.C (MenuWrite): returns a bool now.
3111 (MenuWriteAs): check if file could really be saved and revert to the
3113 (MenuWriteAs): removing old autosavefile if existant.
3115 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
3116 before Goto toggle declaration, because of compiler warning.
3118 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
3120 * src/lyxfunc.C (MenuNew): small fix.
3122 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
3124 * src/bufferlist.C (newFile):
3125 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
3127 * src/lyxrc.C: added new_ask_filename tag
3129 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
3131 * src/lyx.fd: removed code pertaining to form_ref
3132 * src/lyx.[Ch]: ditto
3133 * src/lyx_cb.C: ditto
3134 * src/lyx_gui.C: ditto
3135 * src/lyx_gui_misc.C: ditto
3137 * src/BufferView_pimpl.C (restorePosition): update buffer only
3140 * src/commandtags.h (LFUN_REFTOGGLE): removed
3141 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
3142 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
3143 (LFUN_REFBACK): renamed LFUN_REF_BACK
3145 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
3146 * src/menus.C: ditto
3147 * src/lyxfunc.C (Dispatch): ditto.
3148 InsertRef dialog is now GUI-independent.
3150 * src/texrow.C: added using std::endl;
3152 * src/insets/insetref.[Ch]: strip out large amounts of code.
3153 The inset is now a container and this functionality is now
3154 managed by a new FormRef dialog
3156 * src/frontends/Dialogs.h (showRef, createRef): new signals
3158 * src/frontends/xforms/FormIndex.[Ch],
3159 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
3160 when setting dialog's min/max size
3161 * src/frontends/xforms/FormIndex.[Ch]: ditto
3163 * src/frontends/xforms/FormRef.[Ch],
3164 src/frontends/xforms/forms/form_ref.fd: new xforms
3165 implementation of an InsetRef dialog
3167 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
3170 * src/graphics/XPM_Renderer.C (isImageFormatOK):
3171 ios::nocreate is not part of the standard. Removed.
3173 2000-08-07 Baruch Even <baruch.even@writeme.com>
3175 * src/graphics/Renderer.h:
3176 * src/graphics/Renderer.C: Added base class for rendering of different
3177 image formats into Pixmaps.
3179 * src/graphics/XPM_Renderer.h:
3180 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
3181 in a different class.
3183 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
3184 easily add support for other formats.
3186 * src/insets/figinset.C: plugged a leak of an X resource.
3188 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
3190 * src/CutAndPaste.[Ch]: make all metods static.
3192 * development/Code_rules/Rules: more work, added section on
3193 Exceptions, and a References section.
3195 * a lot of header files: work to make doc++ able to generate the
3196 source documentation, some workarounds of doc++ problems. Doc++ is
3197 now able to generate the documentation.
3199 2000-08-07 Juergen Vigna <jug@sad.it>
3201 * src/insets/insettabular.C (recomputeTextInsets): removed function
3203 * src/tabular.C (SetWidthOfMulticolCell):
3205 (calculate_width_of_column_NMC): fixed return value so that it really
3206 only returns true if the column-width has changed (there where
3207 problems with muliticolumn-cells in this column).
3209 2000-08-04 Juergen Vigna <jug@sad.it>
3211 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
3212 also on the scrollstatus of the inset.
3213 (workAreaMotionNotify): ditto.
3215 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
3217 2000-08-01 Juergen Vigna <jug@sad.it>
3219 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
3221 * src/commandtags.h:
3222 * src/LyXAction.C (init):
3223 * src/insets/inset.C (LocalDispatch): added support for
3226 * src/insets/inset.C (scroll): new functions.
3228 * src/insets/insettext.C (removeNewlines): new function.
3229 (SetAutoBreakRows): removes forced newlines in the text of the
3230 paragraph if autoBreakRows is set to false.
3232 * src/tabular.C (Latex): generates a parbox around the cell contents
3235 * src/frontends/xforms/FormTabular.C (local_update): removed
3236 the radio_useparbox button.
3238 * src/tabular.C (UseParbox): new function
3240 2000-08-06 Baruch Even <baruch.even@writeme.com>
3242 * src/graphics/GraphicsCache.h:
3243 * src/graphics/GraphicsCache.C:
3244 * src/graphics/GraphicsCacheItem.h:
3245 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
3248 * src/insets/insetgraphics.h:
3249 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
3250 and the drawing of the inline image.
3252 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
3253 loaded into the wrong position.
3255 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
3258 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3260 * src/support/translator.h: move all typedefs to public section
3262 * src/support/filetools.C (MakeLatexName): return string const
3264 (TmpFileName): ditto
3265 (FileOpenSearch): ditto
3267 (LibFileSearch): ditto
3268 (i18nLibFileSearch): ditto
3271 (CreateTmpDir): ditto
3272 (CreateBufferTmpDir): ditto
3273 (CreateLyXTmpDir): ditto
3276 (MakeAbsPath): ditto
3278 (OnlyFilename): ditto
3280 (NormalizePath): ditto
3281 (CleanupPath): ditto
3282 (GetFileContents): ditto
3283 (ReplaceEnvironmentPath): ditto
3284 (MakeRelPath): ditto
3286 (ChangeExtension): ditto
3287 (MakeDisplayPath): ditto
3288 (do_popen): return cmdret const
3289 (findtexfile): return string const
3291 * src/support/DebugStream.h: add some /// to please doc++
3293 * src/frontends/DialogBase.h (endif): add some /// to please doc++
3295 * src/texrow.C (same_rownumber): functor to use with find_if
3296 (getIdFromRow): rewritten to use find_if and to not update the
3297 positions. return true if row is found
3298 (increasePos): new method, use to update positions
3300 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
3302 * src/lyxlex_pimpl.C (verifyTable): new method
3305 (GetString): return string const
3306 (pushTable): rewrite to use std::stack
3308 (setFile): better check
3311 * src/lyxlex.h: make LyXLex noncopyable
3313 * src/lyxlex.C (text): return char const * const
3314 (GetString): return string const
3315 (getLongString): return string const
3317 * src/lyx_gui_misc.C (askForText): return pair<...> const
3319 * src/lastfiles.[Ch] (operator): return string const
3321 * src/buffer.C (parseSingleLyXformat2Token): pass string to
3322 istringstream not char const *.
3323 move token.end() out of loop.
3324 (readFile): move initializaton of token
3326 * src/BufferView2.C (insertErrors): run texrow.increasePos if
3327 getIdFromRow is successful.
3329 * lib/bind/emacs.bind: don't include menus bind
3331 * development/Code_rules/Rules: the beginnings of making this
3332 better and covering more of the unwritten rules that we have.
3334 * development/Code_rules/Recommendations: a couple of wording
3337 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3339 * src/support/strerror.c: remove C++ comment.
3341 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
3343 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
3344 LFUN_INDEX_INSERT_LAST
3346 * src/texrow.C (getIdFromRow): changed from const_iterator to
3347 iterator, allowing code to compile with DEC cxx
3349 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
3350 stores part of the class, as suggested by Allan. Will allow
3352 (apply): test to apply uses InsetCommandParams operator!=
3354 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
3355 (apply): test to apply uses InsetCommandParams operator!=
3357 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
3358 stores part of the class.
3359 (update): removed limits on min/max size.
3361 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
3362 (apply): test to apply uses InsetCommandParams operator!=
3364 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
3365 (Read, Write, scanCommand, getCommand): moved functionality
3366 into InsetCommandParams.
3368 (getScreenLabel): made pure virtual
3369 new InsetCommandParams operators== and !=
3371 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
3372 c-tors based on InsetCommandParams. Removed others.
3373 * src/insets/insetinclude.[Ch]: ditto
3374 * src/insets/insetlabel.[Ch]: ditto
3375 * src/insets/insetparent.[Ch]: ditto
3376 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
3378 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
3379 insets derived from InsetCommand created using similar c-tors
3380 based on InsetCommandParams
3381 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
3382 * src/menus.C (ShowRefsMenu): ditto
3383 * src/paragraph.C (Clone): ditto
3384 * src/text2.C (SetCounter): ditto
3385 * src/lyxfunc.C (Dispatch) ditto
3386 Also recreated old InsetIndex behaviour exactly. Can now
3387 index-insert at the start of a paragraph and index-insert-last
3388 without launching the pop-up.
3390 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3392 * lib/lyxrc.example: mark te pdf options as non functional.
3394 * src/support/lstrings.C (strToInt): move initalization of tmpstr
3395 (isStrDbl): move tmpstr.end() out of loop.
3396 (strToDbl): move intialization of tmpstr
3397 (lowercase): return string const and move tmp.end() out of loop.
3398 (uppercase): return string const and move tmp.edn() out of loop.
3399 (prefixIs): add assertion
3404 (containsOnly): ditto
3405 (containsOnly): ditto
3406 (containsOnly): ditto
3407 (countChar): make last arg char not char const
3408 (token): return string const
3409 (subst): return string const, move tmp.end() out of loop.
3410 (subst): return string const, add assertion
3411 (strip): return string const
3412 (frontStrip): return string const, add assertion
3413 (frontStrip): return string const
3418 * src/support/lstrings.C: add inclde "LAssert.h"
3419 (isStrInt): move tmpstr.end() out of loop.
3421 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
3422 toollist.end() out of loop.
3423 (deactivate): move toollist.end() out of loop.
3424 (update): move toollist.end() out of loop.
3425 (updateLayoutList): move tc.end() out of loop.
3426 (add): move toollist.end() out of loop.
3428 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
3429 md.end() out of loop.
3431 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
3433 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
3436 * src/paragraph.C (Erase): move fontlist.end() out of loop.
3437 (Erase): move insetlist.end() out of loop.
3439 * src/lyx_sendfax_main.C: make show_logfile static and to take a
3440 ref to const string as first arg. Move initialization of some
3441 variables, whitespace changes.
3443 * src/kbmap.C (defkey): move table.end() out of loop.
3444 (kb_keymap): move table.end() out of loop.
3445 (findbinding): move table.end() out of loop.
3447 * src/MenuBackend.C (hasMenu): move end() out of loop.
3448 (getMenu): move end() out of loop.
3449 (getMenu): move menulist_.end() out of loop.
3451 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
3453 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
3456 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
3457 (getFromLyXName): move infotab.end() out of loop.
3459 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
3460 -fvtable-thunks -ffunction-sections -fdata-sections
3462 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
3464 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
3467 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3469 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
3471 * src/frontends/xforms/FormCitation.[Ch],
3472 src/frontends/xforms/FormIndex.[Ch],
3473 src/frontends/xforms/FormToc.[Ch],
3474 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
3476 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3478 * src/commandtags.h: renamed, created some flags for citation
3481 * src/lyx_gui_misc.C: stripped out old FD_index_form code
3483 * src/lyxfunc.C (dispatch): use signals to insert index entry
3485 * src/frontends/Dialogs.h: new signal createIndex
3487 * src/frontends/xforms/FormCommand.[Ch],
3488 src/frontends/xforms/FormCitation.[Ch],
3489 src/frontends/xforms/FormToc.[Ch],
3490 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
3492 * src/insets/insetindex.[Ch]: GUI-independent
3494 * src/frontends/xforms/FormIndex.[Ch],
3495 * src/frontends/xforms/forms/form_index.fd: xforms implementation
3498 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
3500 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
3501 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
3503 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3505 * src/insets/insetref.C (Latex): rewrite so that there is now
3506 question that a initialization is requested.
3508 * src/insets/insetcommand.h: reenable the hide signal
3510 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3512 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
3513 fix handling of shortcuts (many bugs :)
3514 (add_lastfiles): ditto.
3516 * lib/ui/default.ui: fix a few shortcuts.
3518 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
3520 * Makefile.am: Fix ``rpmdist'' target to return the exit
3521 status of the ``rpm'' command, instead of the last command in
3522 the chain (the ``rm lyx.xpm'' command, which always returns
3525 2000-08-02 Allan Rae <rae@lyx.org>
3527 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
3528 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
3529 * src/frontends/xforms/FormToc.C (FormToc): ditto
3531 * src/frontends/xforms/Makefile.am: A few forgotten files
3533 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
3534 Signals-not-copyable-problem Lars' started commenting out.
3536 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
3538 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3540 * src/insets/insetcommand.h: Signals is not copyable so anoter
3541 scheme for automatic hiding of forms must be used.
3543 * src/frontends/xforms/FormCitation.h: don't inerit from
3544 noncopyable, FormCommand already does that.
3545 * src/frontends/xforms/FormToc.h: ditto
3546 * src/frontends/xforms/FormUrl.h: ditto
3548 * src/frontends/xforms/FormCitation.C: add include <algorithm>
3550 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
3552 * src/insets/insetcommand.h (hide): new SigC::Signal0
3553 (d-tor) new virtual destructor emits hide signal
3555 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
3556 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
3558 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
3559 LOF and LOT. Inset is now GUI-independent
3561 * src/insets/insetloa.[Ch]: redundant
3562 * src/insets/insetlof.[Ch]: ditto
3563 * src/insets/insetlot.[Ch]: ditto
3565 * src/frontends/xforms/forms/form_url.fd: tweaked!
3566 * src/frontends/xforms/forms/form_citation.fd: ditto
3568 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
3569 dialogs dealing with InsetCommand insets
3571 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
3572 FormCommand base class
3573 * src/frontends/xforms/FormUrl.[Ch]: ditto
3575 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
3577 * src/frontends/xforms/FormToc.[Ch]: ditto
3579 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
3580 passed a generic InsetCommand pointer
3581 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
3583 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
3584 and modified InsetTOC class
3585 * src/buffer.C: ditto
3587 * forms/lyx.fd: strip out old FD_form_toc code
3588 * src/lyx_gui_misc.C: ditto
3589 * src/lyx_gui.C: ditto
3590 * src/lyx_cb.C: ditto
3591 * src/lyx.[Ch]: ditto
3593 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3595 * src/support/utility.hpp: tr -d '\r'
3597 2000-08-01 Juergen Vigna <jug@sad.it>
3599 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
3601 * src/commandtags.h:
3602 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
3603 LFUN_TABULAR_FEATURES.
3605 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
3606 LFUN_LAYOUT_TABULAR.
3608 * src/insets/insettabular.C (getStatus): implemented helper function.
3610 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
3612 2000-07-31 Juergen Vigna <jug@sad.it>
3614 * src/text.C (draw): fixed screen update problem for text-insets.
3616 * src/text2.C (SetParagrpah): call an update of the inset-owner when
3617 something changed probably this has to be added in various other
3620 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
3622 2000-07-31 Baruch Even <baruch.even@writeme.com>
3624 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
3625 templates to satisfy compaq cxx.
3628 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3630 * src/support/translator.h (equal_1st_in_pair::operator()): take
3631 const ref pair_type as arg.
3632 (equal_2nd_in_pair::operator()): ditto
3633 (Translator::~Translator): remove empty d-tor.
3635 * src/graphics/GraphicsCache.C: move include config.h to top, also
3636 put initialization of GraphicsCache::singleton here.
3637 (~GraphicsCache): move here
3638 (addFile): take const ref as arg
3641 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
3643 * src/BufferView2.C (insertLyXFile): change te with/without header
3646 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3648 * src/frontends/xforms/FormGraphics.C (apply): add some
3649 static_cast. Not very nice, but required by compaq cxx.
3651 * src/frontends/xforms/RadioButtonGroup.h: include header
3652 <utility> instead of <pair.h>
3654 * src/insets/insetgraphicsParams.C: add using directive.
3655 (readResize): change return type to void.
3656 (readOrigin): ditto.
3658 * src/lyxfunc.C (getStatus): add missing break for build-program
3659 function; add test for Literate for export functions.
3661 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
3662 entries in Options menu.
3664 2000-07-31 Baruch Even <baruch.even@writeme.com>
3666 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
3667 protect against auto-allocation; release icon when needed.
3669 2000-07-31 Matej Cepl <CeplM@seznam.cz>
3671 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
3672 on usual typewriter.
3674 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
3675 earlier czech.kmap), useful only for programming.
3677 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3679 * src/frontends/xforms/FormCitation.h: fix conditioning around
3682 2000-07-31 Juergen Vigna <jug@sad.it>
3684 * src/frontends/xforms/FormTabular.C (local_update): changed
3685 radio_linebreaks to radio_useparbox and added radio_useminipage.
3687 * src/tabular.C: made support for using minipages/parboxes.
3689 * src/bufferlist.C (QwriteAll): small fix for asking for save.
3691 * src/insets/insetgraphics.C (draw): just draw the inset so that the
3693 (descent): so the cursor is in the middle.
3694 (width): bit smaller box.
3696 * src/insets/insetgraphics.h: added display() function.
3698 2000-07-31 Baruch Even <baruch.even@writeme.com>
3700 * src/frontends/Dialogs.h: Added showGraphics signals.
3702 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
3703 xforms form definition of the graphics dialog.
3705 * src/frontends/xforms/FormGraphics.h:
3706 * src/frontends/xforms/FormGraphics.C: Added files, the
3707 GUIndependent code of InsetGraphics
3709 * src/insets/insetgraphics.h:
3710 * src/insets/insetgraphics.C: Major writing to make it work.
3712 * src/insets/insetgraphicsParams.h:
3713 * src/insets/insetgraphicsParams.C: Added files, parameter passing
3714 struct between InsetGraphics and GUI.
3716 * src/LaTeXFeatures.h:
3717 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
3718 support for graphicx package.
3720 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
3721 for the graphics inset.
3723 * src/support/translator.h: Added file, used in
3724 InsetGraphicsParams. this is a template to translate between two
3727 * src/frontends/xforms/RadioButtonGroup.h:
3728 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
3729 way to easily control a radio button group.
3731 2000-07-28 Juergen Vigna <jug@sad.it>
3733 * src/insets/insettabular.C (LocalDispatch):
3734 (TabularFeatures): added support for lyx-functions of tabular features.
3735 (cellstart): refixed this function after someone wrongly changed it.
3737 * src/commandtags.h:
3738 * src/LyXAction.C (init): added support for tabular-features
3740 2000-07-28 Allan Rae <rae@lyx.org>
3742 * src/frontends/xforms/FormPreferences.C (build): Setup input return
3743 checking. NOTE: It seems that pressing ESC to cancel the dialog also
3744 triggers the callback for input checking. As a result we sometimes get
3745 "LyX: This shouldn't happen..." printed to cerr.
3746 (input): Started using status variable since I only free() on
3747 destruction. Some input checking for paths and font sizes.
3749 * src/frontends/xforms/FormPreferences.h: Use status to control
3750 activation of Ok and Apply
3752 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
3753 callback. Also resized to stop segfaults with 0.88. The problem is
3754 that xforms-0.88 requires the folder to be wide enough to fit all the
3755 tabs. If it isn't it causes all sorts of problems.
3757 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
3759 * src/frontends/xforms/forms/README: Reflect reality.
3761 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
3762 * src/frontends/xforms/forms/makefile: ditto.
3764 * src/commandtags.h: Get access to new Preferences dialog
3765 * src/LyXAction.C: ditto
3766 * src/lyxfunc.C: ditto
3767 * lib/ui/default.ui: ditto
3769 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3771 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
3773 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
3776 * src/frontends/xforms/form_url.[Ch]: added.
3778 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3780 * src/insets/insetbib.h: fixed bug in previous commit
3782 * src/frontends/xforms/FormUrl.h: ditto
3784 * src/frontends/xforms/FormPrint.h: ditto
3786 * src/frontends/xforms/FormPreferences.h: ditto
3788 * src/frontends/xforms/FormCopyright.h: ditto
3790 * src/frontends/xforms/FormCitation.C: ditto
3792 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
3793 private copyconstructor and private default contructor
3795 * src/support/Makefile.am: add utility.hpp
3797 * src/support/utility.hpp: new file from boost
3799 * src/insets/insetbib.h: set owner in clone
3801 * src/frontends/xforms/FormCitation.C: added missing include
3804 * src/insets/form_url.[Ch]: removed
3806 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
3808 * development/lyx.spec.in
3809 * Makefile.am: Fix buglet for LyX RPM generation resulting from
3810 file/directory re-organization.
3812 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
3814 * src/insets/insetcommand.[Ch]: moved the string data and
3815 associated manipulation methods into a new stand-alone class
3816 InsetCommandParams. This class has two additional methods
3817 getAsString() and setFromString() allowing the contents to be
3818 moved around as a single string.
3819 (addContents) method removed.
3820 (setContents) method no longer virtual.
3822 * src/buffer.C (readInset): made use of new InsetCitation,
3823 InsetUrl constructors based on InsetCommandParams.
3825 * src/commandtags.h: add LFUN_INSERT_URL
3827 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
3828 independent InsetUrl and use InsetCommandParams to extract
3829 string info and create new Insets.
3831 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
3833 * src/frontends/xforms/FormCitation.C (apply): uses
3836 * src/frontends/xforms/form_url.C
3837 * src/frontends/xforms/form_url.h
3838 * src/frontends/xforms/FormUrl.h
3839 * src/frontends/xforms/FormUrl.C
3840 * src/frontends/xforms/forms/form_url.fd: new files
3842 * src/insets/insetcite.[Ch]: removed unused constructors.
3844 * src/insets/insetinclude.[Ch]: no longer store filename
3846 * src/insets/inseturl.[Ch]: GUI-independent.
3848 2000-07-26 Juergen Vigna <jug@sad.it>
3849 * renamed frontend from gtk to gnome as it is that what is realized
3850 and did the necessary changes in the files.
3852 2000-07-26 Marko Vendelin <markov@ioc.ee>
3854 * configure.in: cleaning up gnome configuration scripts
3856 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3858 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
3859 shortcuts syndrom by redrawing them explicitely (a better solution
3860 would be appreciated).
3862 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
3864 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
3867 * src/lyx_cb.C (MenuExport): change html export to do the right
3868 thing depending of the document type (instead of having
3869 html-linuxdoc and html-docbook).
3870 * src/lyxfunc.C (getStatus): update for html
3871 * lib/ui/default.ui: simplify due to the above change.
3872 * src/menus.C (ShowFileMenu): update too (in case we need it).
3874 * src/MenuBackend.C (read): if a menu is defined twice, add the
3875 new entries to the exiting one.
3877 2000-07-26 Juergen Vigna <jug@sad.it>
3879 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
3881 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
3882 and return a bool if it did actual save the file.
3883 (AutoSave): don't autosave a unnamed doc.
3885 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
3886 check if this is an UNNAMED new file and react to it.
3887 (newFile): set buffer to unnamed and change to not mark a new
3888 buffer dirty if I didn't do anything with it.
3890 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
3892 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3894 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
3895 friend as per Angus's patch posted to lyx-devel.
3897 * src/ext_l10n.h: updated
3899 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
3900 gettext on the style string right before inserting them into the
3903 * autogen.sh: add code to extract style strings form layout files,
3904 not good enough yet.
3906 * src/frontends/gtk/.cvsignore: add MAKEFILE
3908 * src/MenuBackend.C (read): run the label strings through gettext
3909 before storing them in the containers.
3911 * src/ext_l10n.h: new file
3913 * autogen.sh : generate the ext_l10n.h file here
3915 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3917 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
3920 * lib/ui/default.ui: fix a couple of typos.
3922 * config/gnome/gtk.m4: added (and added to the list of files in
3925 * src/insets/insetinclude.C (unique_id): fix when we are using
3926 lyxstring instead of basic_string<>.
3927 * src/insets/insettext.C (LocalDispatch): ditto.
3928 * src/support/filetools.C: ditto.
3930 * lib/configure.m4: create the ui/ directory if necessary.
3932 * src/LyXView.[Ch] (updateToolbar): new method.
3934 * src/BufferView_pimpl.C (buffer): update the toolbar when
3935 opening/closing buffer.
3937 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3939 * src/LyXAction.C (getActionName): enhance to return also the name
3940 and options of pseudo-actions.
3941 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
3943 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
3944 as an example of what is possible). Used in File->Build too (more
3945 useful) and in the import/export menus (to mimick the complicated
3946 handling of linuxdoc and friends). Try to update all the entries.
3948 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
3951 * src/MenuBackend.C (read): Parse the new OptItem tag.
3953 * src/MenuBackend.h: Add a new optional_ data member (used if the
3954 entry should be omitted when the lyxfunc is disabled).
3956 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
3957 function, used as a shortcut.
3958 (create_submenu): align correctly the shortcuts on the widest
3961 * src/MenuBackend.h: MenuItem.label() only returns the label of
3962 the menu without shortcut; new method shortcut().
3964 2000-07-14 Marko Vendelin <markov@ioc.ee>
3966 * src/frontends/gtk/Dialogs.C:
3967 * src/frontends/gtk/FormCopyright.C:
3968 * src/frontends/gtk/FormCopyright.h:
3969 * src/frontends/gtk/Makefile.am: added these source-files for the
3970 Gtk/Gnome support of the Copyright-Dialog.
3972 * src/main.C: added Gnome::Main initialization if using
3973 Gtk/Gnome frontend-GUI.
3975 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
3977 * config/gnome/aclocal-include.m4
3978 * config/gnome/compiler-flags.m4
3979 * config/gnome/curses.m4
3980 * config/gnome/gnome--.m4
3981 * config/gnome/gnome-bonobo-check.m4
3982 * config/gnome/gnome-common.m4
3983 * config/gnome/gnome-fileutils.m4
3984 * config/gnome/gnome-ghttp-check.m4
3985 * config/gnome/gnome-gnorba-check.m4
3986 * config/gnome/gnome-guile-checks.m4
3987 * config/gnome/gnome-libgtop-check.m4
3988 * config/gnome/gnome-objc-checks.m4
3989 * config/gnome/gnome-orbit-check.m4
3990 * config/gnome/gnome-print-check.m4
3991 * config/gnome/gnome-pthread-check.m4
3992 * config/gnome/gnome-support.m4
3993 * config/gnome/gnome-undelfs.m4
3994 * config/gnome/gnome-vfs.m4
3995 * config/gnome/gnome-x-checks.m4
3996 * config/gnome/gnome-xml-check.m4
3997 * config/gnome/gnome.m4
3998 * config/gnome/gperf-check.m4
3999 * config/gnome/gtk--.m4
4000 * config/gnome/linger.m4
4001 * config/gnome/need-declaration.m4: added configuration scripts
4002 for Gtk/Gnome frontend-GUI
4004 * configure.in: added support for the --with-frontend=gtk option
4006 * autogen.sh: added config/gnome/* to list of config-files
4008 * acconfig.h: added define for GTKGUI-support
4010 * config/lyxinclude.m4: added --with-frontend[=value] option value
4011 for Gtk/Gnome frontend-GUI support.
4013 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4015 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
4019 * src/paragraph.C (GetChar): remove non-const version
4021 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
4022 (search_kw): use it.
4024 * src/lyx_main.C (init): if "preferences" exist, read that instead
4026 (ReadRcFile): return bool if the file could be read ok.
4027 (ReadUIFile): add a check to see if lex file is set ok.
4029 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
4030 bastring can be used instead of lyxstring (still uses the old code
4031 if std::string is good enough or if lyxstring is used.)
4033 * src/encoding.C: make the arrays static, move ininle functions
4035 * src/encoding.h: from here.
4037 * src/buffer.C: have last_isnet_read as a file scope variable for now.
4038 (parseSingleLyXformat2Token): move inset parsing to separate method
4039 (readInset): new private method
4041 * src/Variables.h: remove virtual from get().
4043 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
4044 access to NEW_INSETS and NEW_TABULAR
4046 * src/MenuBackend.h: remove superfluous forward declaration of
4047 MenuItem. Add documentations tags "///", remove empty MenuItem
4048 destructor, remove private default contructor.
4050 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
4052 (read): more string mlabel and mname to where they are used
4053 (read): remove unused variables mlabel and mname
4054 (defaults): unconditional clear, make menusetup take advantage of
4055 add returning Menu &.
4057 * src/LyXView.h: define NEW_MENUBAR as default
4059 * src/LyXAction.C: include lyxparagraph.h temporary to get access
4060 to NEW_INSETS and NEW_TABULAR.
4061 (init): commetn out some funcs that is obsolete when NEW_INSETS is
4062 defined. Change some of the "xxxx-inset-insert" functions names to
4065 * several files: more enahncements to NEW_INSETS and the resulting
4068 * lib/lyxrc.example (\date_insert_format): move to misc section
4070 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
4071 bastring and use AC_CACHE_CHECK.
4072 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
4073 the system have the newest methods. uses AC_CACHE_CHECK
4074 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
4075 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
4076 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
4078 * configure.in: add LYX_CXX_GOOD_STD_STRING
4080 * acinclude.m4: recreated
4082 2000-07-24 Amir Karger <karger@lyx.org>
4084 * README: add Hebrew, Arabic kmaps
4087 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4089 * src/buffer.C (writeFileAscii): Define actcell as an int instead
4092 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4094 * Lot of files: add pragma interface/implementation.
4096 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
4098 * lib/ui/default.ui: new file (ans new directory). Contains the
4099 default menu and toolbar.
4101 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
4102 global space. Toolbars are now read (as menus) in ui files.
4104 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
4106 * src/lyxfunc.C (getStatus): do not exit immediately if a command
4107 is disabled because the document is read-only. We want to have the
4108 toggle state of the function anyway.
4109 (getStatus): add code for LFUN_VC* functions (mimicking what is
4110 done in old-style menus)
4112 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
4113 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
4115 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
4116 * src/BufferView_pimpl.C: ditto.
4117 * src/lyxfunc.C: ditto.
4119 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
4120 default). This replaces old-style menus by new ones.
4122 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
4123 MenuItem. Contain the data structure of a menu.
4125 * src/insets/insettext.C: use LyXView::setLayout instead of
4126 accessing directly the toolbar combox.
4127 * src/lyxfunc.C (Dispatch): ditto.
4129 * src/LyXView.C (setLayout): new method, which just calls
4130 Toolbar::setLayout().
4131 (updateLayoutChoice): move part of this method in Toolbar.
4133 * src/toolbar.[Ch]: removed.
4135 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
4136 implementation the toolbar.
4138 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
4139 the toolbar. It might make sense to merge it with ToolbarDefaults
4141 (setLayout): new function.
4142 (updateLayoutList): ditto.
4143 (openLayoutList): ditto.
4145 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
4146 xforms implementation of the toolbar.
4147 (get_toolbar_func): comment out, since I do not
4148 know what it is good for.
4150 * src/ToolbarDefaults.h: Add the ItemType enum.
4152 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
4153 for a list of allocated C strings. Used in Menubar xforms
4154 implementation to avoid memory leaks.
4156 * src/support/lstrings.[Ch] (uppercase): new version taking and
4160 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
4161 * lib/bind/emacs.bind: ditto.
4163 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4165 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
4166 forward decl of LyXView.
4168 * src/toolbar.C (toolbarItem): moved from toolbar.h
4169 (toolbarItem::clean): ditto
4170 (toolbarItem::~toolbarItem): ditto
4171 (toolbarItem::operator): ditto
4173 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
4175 * src/paragraph.h: control the NEW_TABULAR define from here
4177 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
4178 USE_TABULAR_INSETS to NEW_TABULAR
4180 * src/ToolbarDefaults.C: add include "lyxlex.h"
4182 * files using the old table/tabular: use NEW_TABULAR to control
4183 compilation of old tabular stuff.
4185 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
4188 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
4189 planemet in reading of old style floats, fix the \end_deeper
4190 problem when reading old style floats.
4192 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4194 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
4196 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
4198 * lib/bind/sciword.bind: updated.
4200 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4202 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
4203 layout write problem
4205 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4207 * src/Makefile.am (INCLUDES): remove image directory from include
4210 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
4211 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
4213 * src/LyXView.C (create_form_form_main): read the application icon
4216 * lib/images/*.xpm: change the icons to use transparent color for
4219 * src/toolbar.C (update): change the color of the button when it
4222 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4224 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
4225 setting explicitely the minibuffer.
4226 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
4228 * src/LyXView.C (showState): new function. Shows font information
4229 in minibuffer and update toolbar state.
4230 (LyXView): call Toolbar::update after creating the
4233 * src/toolbar.C: change toollist to be a vector instead of a
4235 (BubbleTimerCB): get help string directly from the callback
4236 argument of the corresponding icon (which is the action)
4237 (set): remove unnecessary ugliness.
4238 (update): new function. update the icons (depressed, disabled)
4239 depending of the status of the corresponding action.
4241 * src/toolbar.h: remove help in toolbarItem
4243 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
4245 * src/Painter.C (text): Added code for using symbol glyphs from
4246 iso10646 fonts. Currently diabled.
4248 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
4251 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
4252 magyar,turkish and usorbian.
4254 * src/paragraph.C (isMultiLingual): Made more efficient.
4256 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
4259 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
4260 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
4261 Also changed the prototype to "bool math_insert_greek(char)".
4263 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4265 * lots of files: apply the NEW_INSETS on all code that will not be
4266 needed when we move to use the new insets. Enable the define in
4267 lyxparagrah.h to try it.
4269 * src/insets/insettabular.C (cellstart): change to be a static
4271 (InsetTabular): initialize buffer in the initializer list.
4273 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
4275 * src/frontends/xforms/FormPrint.[Ch] : moved #include
4276 form_print.h out of the header file. Replaced with forward
4277 declarations of the relevant struct.
4279 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
4282 * src/commandtags.h: do not include "debug.h" which does not
4283 belong there. #include it in some other places because of this
4286 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4288 * src/insets/insetcaption.C: add a couple "using" directives.
4290 * src/toolbar.C (add): get the help text directly from lyxaction.
4292 (setPixmap): new function. Loads from disk and sets a pixmap on a
4293 botton; the name of the pixmap file is derived from the command
4296 * src/toolbar.h: remove members isBitmap and pixmap from
4299 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
4300 * lib/images/: move many files from images/banner.xpm.
4302 * src/lyx_gui.C (create_forms): read banner pixmap from file.
4304 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
4305 * src/toolbar.C: ditto.
4306 * configure.in: ditto.
4307 * INSTALL: document.
4309 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
4310 the spellchecker popup is closed from the WM.
4312 2000-07-19 Juergen Vigna <jug@sad.it>
4314 * src/insets/insetfloat.C (Write): small fix because we use the
4315 insetname for the type now!
4317 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
4319 * src/frontends/xforms/forms/form_citation.fd: object sizes are
4322 * src/frontends/Dialogs.h: removed hideCitation signal
4324 * src/insets/insetcite.h: added hide signal
4326 * src/insets/insetcite.C (~InsetCitation): emits new signal
4327 (getScreenLabel): "intelligent" label should now fit on the screen!
4329 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
4331 * src/frontends/xforms/FormCitation.C (showInset): connects
4332 hide() to the inset's hide signal
4333 (show): modified to use fl_set_object_position rather than
4334 fl_set_object_geometry wherever possible
4336 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4338 * src/insets/lyxinset.h: add caption code
4340 * src/insets/insetfloat.C (type): new method
4342 * src/insets/insetcaption.C (Write): new method
4344 (LyxCode): new method
4346 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
4347 to get it right together with using the FloatList.
4349 * src/commandtags.h: add LFUN_INSET_CAPTION
4350 * src/lyxfunc.C (Dispatch): handle it
4352 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
4355 * src/Variables.[Ch]: make expand take a const reference, remove
4356 the destructor, some whitespace changes.
4358 * src/LyXAction.C (init): add caption-inset-insert
4360 * src/FloatList.C (FloatList): update the default floats a bit.
4362 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4364 * src/Variables.[Ch]: new files. Intended to be used for language
4365 specific strings (like \chaptername) and filename substitution in
4368 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
4370 * lib/kbd/american.kmap: update
4372 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
4374 * src/bufferparams.[Ch]: remove member allowAccents.
4376 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
4378 * src/LaTeXLog.C: use the log_form.h header.
4379 * src/lyx_gui.C: ditto.
4380 * src/lyx_gui_misc.C: ditto.
4381 * src/lyxvc.h: ditto.
4383 * forms/log_form.fd: new file, created from latexoptions.fd. I
4384 kept the log popup and nuked the options form.
4386 * src/{la,}texoptions.[Ch]: removed.
4387 * src/lyx_cb.C (LaTeXOptions): ditto
4389 * src/lyx_gui.C (create_forms): do not handle the
4390 fd_latex_options form.
4392 2000-07-18 Juergen Vigna <jug@sad.it>
4394 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
4395 name of the inset so that it can be requested outside (text2.C).
4397 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
4400 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4402 * src/mathed/formula.h (ConvertFont): constify
4404 * src/mathed/formula.C (Read): add warning if \end_inset is not
4405 found on expected place.
4407 * src/insets/lyxinset.h (ConvertFont): consify
4409 * src/insets/insetquotes.C (ConvertFont): constify
4410 * src/insets/insetquotes.h: ditto
4412 * src/insets/insetinfo.h: add labelfont
4414 * src/insets/insetinfo.C (InsetInfo): set the labelfont
4415 (ascent): use labelfont
4419 (Write): make .lyx file a bit nicer
4421 * src/insets/insetfloat.C (Write): simplify somewhat...
4422 (Read): add warning if arg is not found
4424 * src/insets/insetcollapsable.C: add using std::max
4425 (Read): move string token and add warning in arg is not found
4426 (draw): use std::max to get the right ty
4427 (getMaxWidth): simplify by using std::max
4429 * src/insets/insetsection.h: new file
4430 * src/insets/insetsection.C: new file
4431 * src/insets/insetcaption.h: new file
4432 * src/insets/insetcaption.C: new file
4434 * src/insets/inset.C (ConvertFont): constify signature
4436 * src/insets/Makefile.am (libinsets_la_SOURCES): add
4437 insetcaption.[Ch] and insetsection.[Ch]
4439 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
4440 uses to use LABEL_COUNTER_CHAPTER instead.
4441 * src/text2.C (SetCounter): here
4443 * src/counters.h: new file
4444 * src/counters.C: new file
4445 * src/Sectioning.h: new file
4446 * src/Sectioning.C: new file
4448 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
4450 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4452 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
4455 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
4458 2000-07-17 Juergen Vigna <jug@sad.it>
4460 * src/tabular.C (Validate): check if array-package is needed.
4461 (SetVAlignment): added support for vertical alignment.
4462 (SetLTFoot): better support for longtable header/footers
4463 (Latex): modified to support added features.
4465 * src/LaTeXFeatures.[Ch]: added array-package.
4467 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
4469 * src/lyx_gui.C (LyXGUI): make sure that the height is large
4472 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
4474 * configure.in: do not forget to put a space after -isystem.
4476 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
4478 * lib/kbd/arabic.kmap: a few fixes.
4480 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4482 * some whitespace chagnes to a number of files.
4484 * src/support/DebugStream.h: change to make it easier for
4485 doc++ to parse correctly.
4486 * src/support/lyxstring.h: ditto
4488 * src/mathed/math_utils.C (compara): change to have only one
4490 (MathedLookupBOP): change because of the above.
4492 * src/mathed/math_delim.C (math_deco_compare): change to have only
4494 (search_deco): change becasue of the above.
4496 * src/insets/insettabular.C (DrawCellSelection): use std::swap
4497 instead of manually coded one.
4499 * src/insets/insetquotes.C (Read): read the \end_inset too
4501 * src/insets/insetlatex.h: remove file
4502 * src/insets/insetlatex.C: remove file
4504 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
4506 (InsetPrintIndex): remove destructor
4508 * src/insets/insetinclude.h: remove default constructor
4510 * src/insets/insetfloat.C: work to make it work better
4512 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
4514 * src/insets/insetcite.h (InsetCitation): remove default constructor
4516 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
4518 * src/text.C (GetColumnNearX): comment out some currently unused code.
4520 * src/paragraph.C (writeFile): move some initializations closer to
4522 (CutIntoMinibuffer): small change to use new matchIT operator
4526 (InsertInset): ditto
4529 (InsetIterator): ditto
4530 (Erase): small change to use new matchFT operator
4532 (GetFontSettings): ditto
4533 (HighestFontInRange): ditto
4536 * src/lyxparagraph.h: some chars changed to value_type
4537 (matchIT): because of some stronger checking (perhaps too strong)
4538 in SGI STL, the two operator() unified to one.
4541 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
4543 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
4544 the last inset read added
4545 (parseSingleLyXformat2Token): some more (future) compability code added
4546 (parseSingleLyXformat2Token): warning about solitary \end_inset added
4547 (parseSingleLyXformat2Token): set last_inset_read
4548 (parseSingleLyXformat2Token): more code to read new "Float" correctly
4549 (parseSingleLyXformat2Token): don't double intializw string next_token
4551 * src/TextCache.C (text_fits::operator()): add const's to the signature
4552 (has_buffer::operator()): ditto
4554 * src/Floating.h: add some comments on the class
4556 * src/FloatList.[Ch] (typeExist): new method
4559 * src/BackStack.h: added default constructor, wanted by Gcc.
4561 2000-07-14 Juergen Vigna <jug@sad.it>
4563 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
4565 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
4567 * src/insets/insettabular.C (resizeLyXText): need this to be able to
4568 do a redraw when the window is resized!
4569 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
4571 * src/insets/insettext.C (resizeLyXText): added function to correctly
4572 being able to resize the LyXWindow.
4574 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
4576 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
4578 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
4579 crashes when closing dialog to a deleted inset.
4581 * src/insets/insetcite.[Ch] (Edit) : the return of this former
4582 method! Now similar to other insets.
4584 2000-07-13 Juergen Vigna <jug@sad.it>
4586 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
4588 * lib/examples/Literate.lyx: small patch!
4590 * src/insets/insetbib.C (Read): added this function because of wrong
4591 Write (without [begin|end]_inset).
4593 2000-07-11 Juergen Vigna <jug@sad.it>
4595 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
4596 as the insertInset could not be good!
4598 * src/screen.C (ToggleSelection): fixed toggle selection bug as
4599 the bool param should not be last.
4601 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4603 * sigc++/configure.in: fix bug in threading-related code (Yes, I
4604 did submit that to Karl).
4606 * configure.in: use -isystem instead of -I for X headers. This
4607 fixes a problem on solaris with a recent gcc;
4608 put the front-end code after the X detection code;
4609 configure in sigc++ before lib/
4611 * src/lyx_main.C (commandLineHelp): remove -display from command
4614 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
4616 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
4617 Also put in Makefile rules for building the ``listerrors''
4618 program for parsing errors from literate programs written in LyX.
4620 * lib/build-listerrors: Added small shell script as part of compile
4621 process. This builds a working ``listerrors'' binary if noweb is
4622 installed and either 1) the VNC X server is installed on the machine,
4623 or 2) the user is compiling from within a GUI. The existence of a GUI
4624 is necessary to use the ``lyx --export'' feature for now. This
4625 hack can be removed once ``lyx --export'' no longer requires a GUI to
4628 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
4630 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
4631 now passed back correctly from gcc and placed "under" error
4632 buttons in a Literate LyX source.
4634 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4636 * src/text.C (GetColumnNearX): Better behavior when a RTL
4637 paragraph is ended by LTR text.
4639 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
4642 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4644 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
4645 true when clipboard is empty.
4647 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4649 * text.C (Backspace): Prevent rebreaking of a row if it is the last
4650 row of the paragraph.
4651 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
4652 to prevent calculation of bidi tables
4654 2000-07-07 Juergen Vigna <jug@sad.it>
4656 * src/screen.C (ToggleSelection): added y_offset and x_offset
4659 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
4662 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
4664 * src/insets/insettext.C: fixed Layout-Display!
4666 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4668 * configure.in: add check for strings.h header.
4670 * src/spellchecker.C: include <strings.h> in order to have a
4671 definition for bzero().
4673 2000-07-07 Juergen Vigna <jug@sad.it>
4675 * src/insets/insettext.C (draw): set the status of the bv->text to
4676 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
4678 * src/screen.C (DrawOneRow):
4679 (DrawFromTo): redraw the actual row if something has changed in it
4682 * src/text.C (draw): call an update of the toplevel-inset if something
4683 has changed inside while drawing.
4685 * src/lyxtext.h: added CHANGED_IN_DRAW status.
4687 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
4689 * src/insets/insetbib.[Ch] (callback) new method, moving callback
4690 processing inside class.
4692 * src/insets/insetindex.[Ch] (callback) new method, moving callback
4693 processing inside class.
4695 * src/insets/insetindex.h new struct Holder, consistent with other
4698 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
4699 citation dialog from main code and placed it in src/frontends/xforms.
4700 Dialog launched through signals instead of callbacks
4702 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
4704 * lyx.man: update the options description.
4706 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
4708 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
4709 handle neg values, set min width to 590, add doc about -display
4711 2000-07-05 Juergen Vigna <jug@sad.it>
4713 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
4714 calls to BufferView *.
4716 * src/insets/insettext.C (checkAndActivateInset): small fix non
4717 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
4719 * src/insets/insetcommand.C (Read): Fixed as insets should read till
4720 their \end_inset token!
4722 2000-07-04 edscott <edscott@imp.mx>
4724 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
4725 lib/lyxrc.example: added option \wheel_jump
4727 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
4729 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
4730 remove support for -width,-height,-xpos and -ypos.
4732 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
4734 * src/encoding.[Ch]: New files.
4736 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
4737 (text): Call to the underline() method only when needed.
4739 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
4741 * src/buffer.C (makeLaTeXFile): Compute automatically the input
4742 encoding(s) for the document.
4744 * src/bufferparams.C (BufferParams): Changed default value of
4747 * src/language.C (newLang): Removed.
4748 (items[]): Added encoding information for all defined languages.
4750 * src/lyx_gui.C (create_forms): Added "auto" option to the input
4751 encoding choice button.
4753 * src/lyxrc.h (font_norm_type): New member variable.
4754 (set_font_norm_type): New method.
4756 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
4757 paragraphs with different encodings.
4759 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
4760 (TransformChar): Changed to work correctly with Arabic points.
4761 (draw): Added support for drawing Arabic points.
4762 (draw): Removed code for drawing underbars (this is done by
4765 * src/support/textutils.h (IsPrintableNonspace): New function.
4767 * src/BufferView_pimpl.h: Added "using SigC::Object".
4768 * src/LyXView.h: ditto.
4770 * src/insets/insetinclude.h (include_label): Changed to mutable.
4772 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4774 * src/mathed/math_iter.h: remove empty destructor
4776 * src/mathed/math_cursor.h: remove empty destructor
4778 * src/insets/lyxinset.h: add THEOREM_CODE
4780 * src/insets/insettheorem.[Ch]: new files
4782 * src/insets/insetminipage.C: (InsertInset): remove
4784 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
4786 (InsertInset): remove
4788 * src/insets/insetlist.C: (InsertList): remove
4790 * src/insets/insetfootlike.[Ch]: new files
4792 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
4795 (InsertInset): ditto
4797 * src/insets/insetert.C: remove include Painter.h, reindent
4798 (InsertInset): move to header
4800 * src/insets/insetcollapsable.h: remove explicit from default
4801 contructor, remove empty destructor, add InsertInset
4803 * src/insets/insetcollapsable.C (InsertInset): new func
4805 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
4807 * src/vspace.h: add explicit to constructor
4809 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
4810 \textcompwordmark, please test this.
4812 * src/lyxrc.C: set ascii_linelen to 65 by default
4814 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
4816 * src/commandtags.h: add LFUN_INSET_THEOREM
4818 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
4819 (makeLinuxDocFile): remove _some_ of the nice logic
4820 (makeDocBookFile): ditto
4822 * src/Painter.[Ch]: (~Painter): removed
4824 * src/LyXAction.C (init): entry for insettheorem added
4826 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
4828 (deplog): code to detect files generated by LaTeX, needs testing
4831 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4833 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
4835 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4837 * src/LaTeX.C (deplog): Add a check for files that are going to be
4838 created by the first latex run, part of the project to remove the
4841 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
4842 contents to the extension list.
4844 2000-07-04 Juergen Vigna <jug@sad.it>
4846 * src/text.C (NextBreakPoint): added support for needFullRow()
4848 * src/insets/lyxinset.h: added needFullRow()
4850 * src/insets/insetcollapsable.C: redone now this uses a text-inset
4853 * src/insets/insettext.C: lots of changes for update!
4855 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
4857 * src/LaTeXFeatures.h: add a missing std:: qualifier.
4859 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
4861 * src/insets/insetinclude.C (InsetInclude): fixed
4862 initialization of include_label.
4863 (unique_id): now returns a string.
4865 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
4867 * src/LaTeXFeatures.h: new member IncludedFiles, for
4868 a map of key, included file name.
4870 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
4871 with the included files for inclusion in SGML preamble,
4872 i. e., linuxdoc and docbook.
4875 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
4876 nice (is the generated linuxdoc code to be exported?), that
4877 allows to remove column, and only_body that will be true for
4878 slave documents. Insets are allowed inside SGML font type.
4879 New handling of the SGML preamble for included files.
4880 (makeDocBookFile): the same for docbook.
4882 * src/insets/insetinclude.h:
4883 * src/insets/insetinclude.C (Validate): keeps a list of included files.
4885 (DocBook): new export methods.
4887 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
4888 and makeDocBookFile.
4890 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
4891 formats to export with command line argument -x.
4893 2000-06-29 Juergen Vigna <jug@sad.it>
4895 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
4896 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
4898 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
4899 region could already been cleared by an inset!
4901 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4903 * src/BufferView_pimpl.h: remove member variables lyx_focus and
4906 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
4908 (cursorToggle): remove special handling of lyx focus.
4910 2000-06-28 Juergen Vigna <jug@sad.it>
4912 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
4915 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4917 * src/insets/insetindex.C (Edit): add a callback when popup is
4920 * src/insets/insettext.C (LocalDispatch):
4921 * src/insets/insetmarginal.h:
4922 * src/insets/insetlist.h:
4923 * src/insets/insetfoot.h:
4924 * src/insets/insetfloat.h:
4925 * src/insets/insetert.h: add a missing std:: qualifier.
4927 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4929 * src/support/lyxsum.C (sum): '\0' teminate file read when using
4932 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
4934 * src/insets/insettext.C (Read): remove tmptok unused variable
4935 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
4936 (InsertInset): change for new InsetInset code
4938 * src/insets/insettext.h: add TEXT inline method
4940 * src/insets/insettext.C: remove TEXT macro
4942 * src/insets/insetmarginal.C (Write): new method
4943 (Latex): change output slightly
4945 * src/insets/insetfoot.C (Write): new method
4946 (Latex): change output slightly (don't use endl when no need)
4948 * src/insets/insetert.C (Write): new method
4950 * src/insets/insetcollapsable.h: make button_length, button_top_y
4951 and button_bottm_y protected.
4953 * src/insets/insetcollapsable.C (Write): simplify code by using
4954 tostr. Also do not output the float name, the children class
4955 should to that to get control over own arguments
4957 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
4958 src/insets/insetminipage.[Ch]:
4961 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
4963 * src/lyxfunc.C (Dispatch): cases for new insets/commands
4965 * src/Makefile.am (lyx_SOURCES): add the new files
4967 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
4968 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
4969 * src/commandtags.h: ditto
4971 * src/LaTeXFeatures.h: add a std::set of used floattypes
4973 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
4975 * src/FloatList.[Ch] src/Floating.h: new files
4977 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
4979 * src/lyx_cb.C (TableApplyCB): ditto
4981 * src/text2.C: ditto
4982 * src/buffer.C (SimpleLinuxDocOnePar): ditto
4983 (parseSingleLyXformat2Token): ditto + add code for
4984 backwards compability for old float styles + add code for new insets
4986 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
4988 (InsertInset(size_type, Inset *, LyXFont)): new method
4989 (InsetChar(size_type, char)): changed to use the other InsetChar
4990 with a LyXFont(ALL_INHERIT).
4991 (InsetInset(size_type, Inset*)): changed to use InsetChar to
4992 insert the META_INSET.
4994 * sigc++/thread.cc (Privete<int>::operator int&): move definition
4996 * sigc++/thread.h (Threads): from here
4998 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
4999 definition out of line
5000 * sigc++/scope.h: from here
5002 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5004 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
5005 is specified (adapted from a patch from edscott <edscott@imp.mx>).
5007 * Makefile.am (bindist): new target.
5009 * INSTALL: add instructions for doing a binary distribution.
5011 * development/tools/README.bin.example: update a bit.
5013 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
5016 * lib/lyxrc.example: new lyxrc tag \set_color.
5018 * src/lyxfunc.C (Dispatch):
5019 * src/commandtags.h:
5020 * src/LyXAction.C: new lyxfunc "set-color".
5022 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
5023 and an x11name given as strings.
5025 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
5026 cache when a color is changed.
5028 2000-06-26 Juergen Vigna <jug@sad.it>
5030 * src/lyxrow.C (width): added this functions and variable.
5032 * src/insets/insetcite.C (create_form_citation_form): some Gravity
5035 * src/text.C (SetHeightOfRow): fixed calcualting of width.
5037 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5039 * images/undo_bw.xpm: new icon.
5040 * images/redo_bw.xpm: ditto.
5042 * configure.in (INSTALL_SCRIPT): change value to
5043 ${INSTALL} to avoid failures of install-script target.
5044 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
5046 * src/BufferView.h: add a magic "friend" declaration to please
5049 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
5051 * forms/cite.fd: modified to allow resizing without messing
5054 * src/insetcite.C: Uses code from cite.fd almost without
5056 User can now resize dialog in the x-direction.
5057 Resizing the dialog in the y-direction is prevented, as the
5058 code does this intelligently already.
5060 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5062 * INSTALL: remove obsolete entry in "problems" section.
5064 * lib/examples/sl_*.lyx: update of the slovenian examples.
5066 * src/support/FileInfo.[Ch] (getBlockSize): remove.
5068 2000-06-23 Juergen Vigna <jug@sad.it>
5070 * src/lyxtext.h: added a 'cleared' flag to draw() function.
5072 * src/buffer.C (resize): delete the LyXText of textinsets.
5074 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
5076 * src/insets/lyxinset.h: added another parameter 'cleared' to
5077 the draw() function.
5079 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
5080 unlocking inset in inset.
5082 2000-06-22 Juergen Vigna <jug@sad.it>
5084 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
5085 of insets and moved first to LyXText.
5087 * src/mathed/formulamacro.[Ch]:
5088 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
5090 2000-06-21 Juergen Vigna <jug@sad.it>
5092 * src/text.C (GetVisibleRow): look if I should clear the area or not
5093 using Inset::doClearArea() function.
5095 * src/insets/lyxinset.h: added doClearArea() function and
5096 modified draw(Painter &, ...) to draw(BufferView *, ...)
5098 * src/text2.C (UpdateInset): return bool insted of int
5100 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
5102 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
5103 combox in the character popup
5105 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
5106 BufferParams const & params
5108 2000-06-20 Juergen Vigna <jug@sad.it>
5110 * src/insets/insettext.C (SetParagraphData): set insetowner on
5113 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5115 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
5116 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
5118 (form_main_): remove
5120 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
5121 (create_form_form_main): remove FD_form_main stuff, connect to
5122 autosave_timeout signal
5124 * src/LyXView.[Ch] (getMainForm): remove
5125 (UpdateTimerCB): remove
5126 * src/BufferView_pimpl.h: inherit from SigC::Object
5128 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
5129 signal instead of callback
5131 * src/BufferView.[Ch] (cursorToggleCB): remove
5133 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5135 * src/BufferView_pimpl.C: changes because of the one below
5137 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
5138 instead of storing a pointer to a LyXText.
5140 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
5142 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
5144 * src/lyxparagraph.h
5146 * src/paragraph.C: Changed fontlist to a sorted vector.
5148 2000-06-19 Juergen Vigna <jug@sad.it>
5150 * src/BufferView.h: added screen() function.
5152 * src/insets/insettext.C (LocalDispatch): some selection code
5155 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
5157 * src/insets/insettext.C (SetParagraphData):
5159 (InsetText): fixes for multiple paragraphs.
5161 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
5163 * development/lyx.spec.in: Call configure with ``--without-warnings''
5164 to work around a bug with the Makefiles when doing ``make lyxrpm''.
5165 This should be fine, however, since we generally don't want to be
5166 verbose when making an RPM.
5168 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
5170 * lib/scripts/fig2pstex.py: New file
5172 2000-06-16 Juergen Vigna <jug@sad.it>
5174 * src/insets/insettabular.C (UpdateLocal):
5175 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
5176 (LocalDispatch): Changed all functions to use LyXText.
5178 2000-06-15 Juergen Vigna <jug@sad.it>
5180 * src/text.C (SetHeightOfRow): call inset::update before requesting
5183 * src/insets/insettext.C (update):
5184 * src/insets/insettabular.C (update): added implementation
5186 * src/insets/lyxinset.h: added update function
5188 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5190 * src/text.C (SelectNextWord): protect against null pointers with
5191 old-style string streams. (fix from Paul Theo Gonciari
5194 * src/cite.[Ch]: remove erroneous files.
5196 * lib/configure.m4: update the list of created directories.
5198 * src/lyxrow.C: include <config.h>
5199 * src/lyxcursor.C: ditto.
5201 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5203 * lib/examples/decimal.lyx: new example file from Mike.
5205 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
5206 to find template definitions (from Dekel)
5208 * src/frontends/.cvsignore: add a few things.
5210 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
5212 * src/Timeout.C (TimeOut): remove default argument.
5214 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
5217 * src/insets/ExternalTemplate.C: add a "using" directive.
5219 * src/lyx_main.h: remove the act_ struct, which seems unused
5222 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5224 * LyX Developers Meeting: All files changed, due to random C++ (by
5225 coincidence) code generator script.
5227 - external inset (cool!)
5228 - initial online editing of preferences
5229 - insettabular breaks insettext(s contents)
5231 - some DocBook fixes
5232 - example files update
5233 - other cool stuff, create a diff and look for yourself.
5235 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
5237 * src/insets/insettext.C (computeTextRows): if the maxWidth is
5238 -1 this is a non-line-breaking textinset.
5240 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
5241 if there is no width set.
5243 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5245 * Lots of files: Merged the dialogbase branch.
5247 2000-06-09 Allan Rae <rae@lyx.org>
5249 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
5250 and the Dispatch methods that used it.
5252 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
5253 access to functions formerly kept in Dispatch.
5255 2000-05-19 Allan Rae <rae@lyx.org>
5257 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
5258 made to_page and count_copies integers again. from_page remains a
5259 string however because I want to allow entry of a print range like
5260 "1,4,22-25" using this field.
5262 * src/LyXAction.C: added action info and commands for buffer-print-xtl
5263 and printer-params-get. These aren't useful from the minibuffer but
5264 could be used by a script/LyXServer app provided it passes a suitable
5265 auto_mem_buffer. I guess I should take a look at how the LyXServer
5266 works and make it support xtl buffers.
5268 * sigc++/: updated to libsigc++-1.0.1
5270 * src/xtl/: updated to xtl-1.3.pl.11
5272 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
5273 those changes done to the files in src/ are actually recreated when
5274 they get regenerated. Please don't ever accept a patch that changes a
5275 dialog unless that patch includes the changes to the corresponding *.fd
5278 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
5279 stringOnlyContains, renamed it and generalised it.
5281 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
5282 branch. Removed the remaining old form_print code.
5284 2000-04-26 Allan Rae <rae@lyx.org>
5286 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
5287 trap I was trying to fix with the ID: fields in src/xtl/ :-)
5289 2000-04-25 Allan Rae <rae@lyx.org>
5291 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
5292 against a base of xtl-1.3.pl.4
5294 * development/tools/lxtl.sh: fixed a couple of silly typos and now
5295 filter the Id: entries so they still show the xtl version number
5298 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
5299 into the src/xtl code. Patch still pending with José (XTL)
5301 2000-04-24 Allan Rae <rae@lyx.org>
5303 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
5304 both more generic and much safer. Use the new template functions.
5305 * src/buffer.[Ch] (Dispatch): ditto.
5307 * src/frontends/xforms/FormPrint.C (update): Use new template functions
5308 and mem buffer more intelligently. Also a little general cleanup.
5311 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
5312 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
5313 * src/xtl/Makefile.am: ditto.
5314 * src/xtl/.cvsignore: ditto.
5315 * src/Makefile.am: ditto.
5317 * src/PrinterParams.h: Removed the macros member functions. Added a
5318 testInvariant member function. A bit of tidying up and commenting.
5319 Included Angus's idea for fixing operation with egcs-1.1.2.
5321 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
5322 cool expansion of XTL's mem_buffer to support automatic memory
5323 management within the buffer itself. Removed the various macros and
5324 replaced them with template functions that use either auto_mem_buffer
5325 or mem_buffer depending on a #define. The mem_buffer support will
5326 disappear as soon as the auto_mem_buffer is confirmed to be good on
5327 other platforms/compilers. That is, it's there so you've got something
5330 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
5331 effectively forked XTL. However I expect José will include my code
5332 into the next major release. Also fixed a memory leak.
5333 * src/xtl/text.h: ditto.
5334 * src/xtl/xdr.h: ditto.
5335 * src/xtl/giop.h: ditto.
5337 2000-04-16 Allan Rae <rae@lyx.org>
5339 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
5340 by autogen.sh and removed by maintainer-clean anyway.
5341 * .cvsignore, sigc++/.cvsignore: Support the above.
5343 * sigc++/.cvsignore: Forgot that retbind.h was generated.
5345 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
5347 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
5348 macros, renamed static callback-target member functions to suit new
5349 scheme and made them public.
5350 * src/frontends/xforms/forms/form_print.fd: ditto.
5351 * src/frontends/xforms/forms/form_copyright.fd: ditto.
5353 * src/support/lxtl.h: small cleanup to use typedef instead of #define
5356 * src/xtl/: New directory containing a minimal distribution of XTL.
5357 This is XTL-1.3.pl.4.
5359 * development/tools/lxtl.sh: A script to generate the above mini-dist.
5361 2000-04-15 Allan Rae <rae@lyx.org>
5363 * development/tools/makeLyXsigc.sh: Remove the library version numbers
5365 * sigc++/: Updated to libsigc++-1.0.0
5367 2000-04-14 Allan Rae <rae@lyx.org>
5369 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
5370 use the generic ones in future. I'll modify my conversion script.
5372 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
5374 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
5375 (CloseAllBufferRelatedDialogs): Renamed.
5376 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
5378 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
5379 of the generic ones. These are the same ones my conversion script
5382 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
5383 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
5384 * src/buffer.C (Dispatch): ditto
5386 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
5387 functions for updating and hiding buffer dependent dialogs.
5388 * src/BufferView.C (buffer): ditto
5389 * src/buffer.C (setReadonly): ditto
5390 * src/lyxfunc.C (CloseBuffer): ditto
5392 * src/buffer.h: Take setReadonly() out of line so I don't have to include
5393 Dialogs.h, and hence all the SigC stuff, into every file that includes
5394 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
5396 * src/BufferView2.C: reduce the number of headers included by buffer.h
5398 2000-04-11 Allan Rae <rae@lyx.org>
5400 * src/frontends/xforms/xform_macros.h: A small collection of macros
5401 for building C callbacks.
5403 * src/frontends/xforms/Makefile.am: Added above file.
5405 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
5406 scheme again. This time it should work for JMarc. If this is
5407 successful I'll revise my conversion script to automate some of this.
5408 The static member functions in the class also have to be public for
5409 this scheme will work. If the scheme works (it's almost identical to
5410 the way BufferView::cursorToggleCB is handled so it should work) then
5411 FormCopyright and FormPrint will be ready for inclusion into the main
5412 trunk immediately after 1.1.5 is released -- provided we're prepared
5413 for complaints about lame compilers not handling XTL.
5415 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
5417 2000-04-07 Allan Rae <rae@lyx.org>
5419 * config/lyxinclude.m4: A bit more tidying up (Angus)
5421 * src/LString.h: JMarc's <string> header fix
5423 * src/PrinterParams.h: Used string for most data to remove some
5424 ugly code in the Print dialog and avoid even uglier code when
5425 appending the ints to a string for output.
5427 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
5428 and moved "default:" back to the end of switch statement. Cleaned
5429 up the printing so it uses the right function calls and so the
5430 "print to file" option actually puts the file in the right directory.
5432 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
5434 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
5435 and Ok+Apply button control into a separate method: input (Angus).
5436 (input) Cleaned it up and improved it to be very thorough now.
5437 (All CB) static_cast used instead of C style cast (Angus). This will
5438 probably change again once we've worked out how to keep gcc-2.8.1 happy
5439 with real C callbacks.
5440 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
5441 ignore some of the bool settings and has random numbers instead. Needs
5442 some more investigation. Added other input length checks and checking
5443 of file and printer names.
5445 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
5446 would link (Angus). Seems the old code doesn't compile with the pragma
5447 statement either. Separated callback entries from internal methods.
5449 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
5451 2000-03-17 Allan Rae <rae@lyx.org>
5453 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
5454 need it? Maybe it could go in Dialogs instead? I could make it a
5455 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
5456 values to get the bool return value.
5457 (Dispatch): New overloaded method for xtl support.
5459 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
5460 extern "C" callback instead of static member functions. Hopefully,
5461 JMarc will be able to compile this. I haven't changed
5462 forms/form_copyright.fd yet. Breaking one of my own rules already.
5464 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
5465 because they aren't useful from the minibuffer. Maybe a LyXServer
5466 might want a help message though?
5468 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
5470 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
5471 xtl which needs both rtti and exceptions.
5473 * src/support/Makefile.am:
5474 * src/support/lxtl.h: New file. Some helper macros for using XTL.
5476 * src/frontends/xforms/input_validators.[ch]: input filters and
5477 validators. These conrol what keys are valid in input boxes.
5478 Use them and write some more. Much better idea than waiting till
5479 after the user has pressed Ok to say that the input fields don't make
5482 * src/frontends/xforms/Makefile.am:
5483 * src/frontends/xforms/forms/form_print.fd:
5484 * src/frontends/xforms/forms/makefile:
5485 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
5486 new scheme. Still have to make sure I haven't missed anything from
5487 the current implementation.
5489 * src/Makefile.am, src/PrinterParams.h: New data store.
5491 * other files: Added a couple of copyright notices.
5493 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5495 * src/insets/insetbib.h: move Holder struct in public space.
5497 * src/frontends/include/DialogBase.h: use SigC:: only when
5498 SIGC_CXX_NAMESPACES is defined.
5499 * src/frontends/include/Dialogs.h: ditto.
5501 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
5503 * src/frontends/xforms/FormCopyright.[Ch]: do not
5504 mention SigC:: explicitely.
5506 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5508 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
5509 deals with testing KDE in main configure.in
5510 * configure.in: ditto.
5512 2000-02-22 Allan Rae <rae@lyx.org>
5514 * Lots of files: Merged from HEAD
5516 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
5517 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
5519 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
5521 * sigc++/: new minidist.
5523 2000-02-14 Allan Rae <rae@lyx.org>
5525 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
5527 2000-02-08 Juergen Vigna <jug@sad.it>
5529 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
5530 file for the buildin GUI builder of KDevelop of the copyright-dialog.
5532 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
5533 for this port and so it is much easier for other people to port
5534 dialogs in a common development environment.
5536 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
5537 the QT/KDE implementation.
5539 * src/frontends/kde/Dialogs.C:
5540 * src/frontends/kde/FormCopyright.C:
5541 * src/frontends/kde/FormCopyright.h:
5542 * src/frontends/kde/Makefile.am:
5543 * src/frontends/kde/formcopyrightdialog.C:
5544 * src/frontends/kde/formcopyrightdialog.h:
5545 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
5546 for the kde support of the Copyright-Dialog.
5548 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
5549 subdir-substitution instead of hardcoded 'xforms' as we now have also
5552 * src/frontends/include/DialogBase.h (Object): just commented the
5553 label after #endif (nasty warning and I don't like warnings ;)
5555 * src/main.C (main): added KApplication initialization if using
5558 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
5559 For now only the KDE event-loop is added if frontend==kde.
5561 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
5563 * configure.in: added support for the --with-frontend[=value] option
5565 * autogen.sh: added kde.m4 file to list of config-files
5567 * acconfig.h: added define for KDEGUI-support
5569 * config/kde.m4: added configuration functions for KDE-port
5571 * config/lyxinclude.m4: added --with-frontend[=value] option with
5572 support for xforms and KDE.
5574 2000-02-08 Allan Rae <rae@lyx.org>
5576 * all Makefile.am: Fixed up so the make targets dist, distclean,
5577 install and uninstall all work even if builddir != srcdir. Still
5578 have a new sigc++ minidist update to come.
5580 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
5582 2000-02-01 Allan Rae <rae@lyx.org>
5584 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
5585 Many mods to get builddir != srcdir working.
5587 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
5588 for building on NT and so we can do the builddir != srcdir stuff.
5590 2000-01-30 Allan Rae <rae@lyx.org>
5592 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
5593 This will stay in "rae" branch. We probably don't really need it in
5594 the main trunk as anyone who wants to help programming it should get
5595 a full library installed also. So they can check both included and
5596 system supplied library compilation.
5598 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
5599 Added a 'mini' distribution of libsigc++. If you feel the urge to
5600 change something in these directories - Resist it. If you can't
5601 resist the urge then you should modify the following script and rebuild
5602 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
5603 all happen. Still uses a hacked version of libsigc++'s configure.in.
5604 I'm quite happy with the results. I'm not sure the extra work to turn
5605 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
5606 worth the trouble and would probably lead to extra maintenance
5608 I haven't tested the following important make targets: install, dist.
5609 Not ready for prime time but very close. Maybe 1.1.5.
5611 * development/tools/makeLyXsigc.sh: A shell script to automatically
5612 generate our mini-dist of libsigc++. It can only be used with a CVS
5613 checkout of libsigc++ not a tarball distribution. It's well commented.
5614 This will end up as part of the libsigc++ distribution so other apps
5615 can easily have an included mini-dist. If someone makes mods to the
5616 sigc++ subpackage without modifying this script to generate those
5617 changes I'll be very upset!
5619 * src/frontends/: Started the gui/system indep structure.
5621 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
5622 to access the gui-indep dialogs are in this class. Much improved
5623 design compared to previous revision. Lars, please refrain from
5624 moving this header into src/ like you did with Popups.h last time.
5626 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
5628 * src/frontends/xforms/: Started the gui-indep system with a single
5629 dialog: FormCopyright. Initial testing of use of libsigc++ was very
5632 * src/frontends/xforms/forms: Repository for the xforms .fd files.
5633 Here you'll find a very useful makefile and automated fdfix.sh that
5634 makes updating dailogs a no-brainer -- provided you follow the rules
5635 set out in the README. I'm thinking about adding another script to
5636 automatically generate skeleton code for a new dialog given just the
5639 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
5640 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
5641 Made FormCopyright gui-indep and added a lyxfunc to get to it.
5643 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5645 * src/support/LSubstring.C (operator): simplify
5647 * src/lyxtext.h: removed bparams, use buffer_->params instead
5649 * src/lyxrow.h: make Row a real class, move all variables to
5650 private and use accessors.
5652 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
5654 (isRightToLeftPar): ditto
5655 (ChangeLanguage): ditto
5656 (isMultiLingual): ditto
5659 (SimpleTeXOnePar): ditto
5660 (TeXEnvironment): ditto
5661 (GetEndLabel): ditto
5663 (SetOnlyLayout): ditto
5664 (BreakParagraph): ditto
5665 (BreakParagraphConservative): ditto
5666 (GetFontSettings): ditto
5668 (CopyIntoMinibuffer): ditto
5669 (CutIntoMinibuffer): ditto
5670 (PasteParagraph): ditto
5671 (SetPExtraType): ditto
5672 (UnsetPExtraType): ditto
5673 (DocBookContTableRows): ditto
5674 (SimpleDocBookOneTablePar): ditto
5676 (TeXFootnote): ditto
5677 (SimpleTeXOneTablePar): ditto
5678 (TeXContTableRows): ditto
5679 (SimpleTeXSpecialChars): ditto
5682 * src/lyxcursor.h: make LyXCursor a real class, move all variables
5683 to private and use accessors.
5685 * src/lyx_cb.C: remove char updatetimer, and all code that uses
5686 this, we did not use it anymore and has not been for ages. Just a
5687 waste of cpu cycles.
5689 * src/language.h: make Language a real class, move all variables
5690 to private and use accessors.
5692 * src/BufferView_pimpl.C (Pimpl): use new timer code.
5693 (create_view): remove
5694 (update): some changes for new timer
5695 (cursorToggle): use new timer
5696 (beforeChange): change for new timer
5698 * src/BufferView.h (cursorToggleCB): removed last paramter because
5701 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
5702 (cursorToggleCB): change because of new timer code
5704 * lib/CREDITS: updated own mailaddress
5706 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5708 * src/support/filetools.C (PutEnv): fix the code in case neither
5709 putenv() nor setenv() have been found.
5711 * INSTALL: mention the install-strip Makefile target.
5713 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
5714 read-only documents.
5716 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5718 * lib/reLyX/configure.in (VERSION): avoid using a previously
5719 generated reLyX wrapper to find out $prefix.
5721 * lib/examples/eu_adibide_lyx-atua.lyx:
5722 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
5723 translation of the Tutorial (Dooteo)
5725 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
5727 * forms/cite.fd: new citation dialog
5729 * src/insetcite.[Ch]: the new citation dialog is moved into
5732 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
5735 * src/insets/insetcommand.h: data members made private.
5737 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5739 * LyX 1.1.5 released
5741 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5743 * src/version.h (LYX_RELEASE): to 1.1.5
5745 * src/spellchecker.C (RunSpellChecker): return false if the
5746 spellchecker dies upon creation.
5748 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5750 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
5751 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
5755 * lib/CREDITS: update entry for Martin Vermeer.
5757 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
5759 * src/text.C (draw): Draw foreign language bars at the bottom of
5760 the row instead of at the baseline.
5762 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
5764 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5766 * lib/bind/de_menus.bind: updated
5768 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5770 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
5772 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5774 * src/menus.C (Limit_string_length): New function
5775 (ShowTocMenu): Limit the number of items/length of items in the
5778 * src/paragraph.C (String): Correct result for a paragraph inside
5781 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5783 * src/bufferlist.C (close): test of buf->getuser() == NULL
5785 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
5787 * src/BufferView2.C (removeAutoInsets): Fix a bug:
5788 Do not call to SetCursor when the paragraph is a closed footnote!
5790 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
5792 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
5795 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
5797 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5800 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
5801 reference popup, that activates the reference-back action
5803 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
5805 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
5806 the menus. Also fixed a bug.
5808 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
5809 the math panels when switching buffers (unless new buffer is readonly).
5811 * src/BufferView.C (NoSavedPositions)
5812 * src/BufferView_pimpl.C (NoSavedPositions): New methods
5814 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5816 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
5817 less of dvi dirty or not.
5819 * src/trans_mgr.[Ch] (insert): change first parameter to string
5822 * src/chset.[Ch] (encodeString): add const to first parameter
5824 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5826 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
5830 * src/LaTeX.C (deplog): better searching for dependency files in
5831 the latex log. Uses now regexps.
5833 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
5834 instead of the box hack or \hfill.
5836 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5838 * src/lyxfunc.C (doImportHelper): do not create the file before
5839 doing the actual import.
5840 (doImportASCIIasLines): create a new file before doing the insert.
5841 (doImportASCIIasParagraphs): ditto.
5843 * lib/lyxrc.example: remove mention of non-existing commands
5845 * lyx.man: remove mention of color-related switches.
5847 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
5849 * src/lyx_gui.C: remove all the color-related ressources, which
5850 are not used anymore.
5852 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
5855 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5857 * src/lyxrc.C (read): Add a missing break in the switch
5859 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
5861 * src/text2.C (InsertStringA): Fix a bug with insertion into table
5863 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
5866 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
5868 * src/text.C (draw): draw bars under foreign language words.
5870 * src/LColor.[Ch]: add LColor::language
5872 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
5874 * src/lyxcursor.h (boundary): New member variable
5876 * src/text.C (IsBoundary): New methods
5878 * src/text.C: Use the above for currect cursor movement when there
5879 is both RTL & LTR text.
5881 * src/text2.C: ditto
5883 * src/bufferview_funcs.C (ToggleAndShow): ditto
5885 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5887 * src/text.C (DeleteLineForward): set selection to true to avoid
5888 that DeleteEmptyParagraphMechanism does some magic. This is how it
5889 is done in all other functions, and seems reasonable.
5890 (DeleteWordForward): do not jump over non-word stuff, since
5891 CursorRightOneWord() already does it.
5893 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
5894 DeleteWordBackward, since they seem safe to me (since selection is
5895 set to "true") DeleteEmptyParagraphMechanism does nothing.
5897 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5899 * src/lyx_main.C (easyParse): simplify the code by factoring the
5900 part that removes parameters from the command line.
5901 (LyX): check wether wrong command line options have been given.
5903 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
5905 * src/lyx_main.C : add support for specifying user LyX
5906 directory via command line option -userdir.
5908 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
5910 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
5911 the number of items per popup.
5912 (Add_to_refs_menu): Ditto.
5914 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5916 * src/lyxparagraph.h: renamed ClearParagraph() to
5917 StripLeadingSpaces() and moved it to paragraph.C. We pass the
5918 textclass as parameter, and do nothing if free_spacing is
5919 true. This fixes part of the line-delete-forward problems.
5921 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
5922 (pasteSelection): ditto.
5923 (SwitchLayoutsBetweenClasses): more translatable strings.
5925 * src/text2.C (CutSelection): use StripLeadingSpaces.
5926 (PasteSelection): ditto.
5927 (DeleteEmptyParagraphMechanism): ditto.
5929 2000-05-26 Juergen Vigna <jug@sad.it>
5931 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
5932 is not needed in tabular insets.
5934 * src/insets/insettabular.C (TabularFeatures): added missing features.
5936 * src/tabular.C (DeleteColumn):
5938 (AppendRow): implemented this functions
5939 (cellsturct::operator=): clone the inset too;
5941 2000-05-23 Juergen Vigna <jug@sad.it>
5943 * src/insets/insettabular.C (LocalDispatch): better selection support
5944 when having multicolumn-cells.
5946 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
5948 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
5950 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5952 * src/ColorHandler.C (getGCForeground): put more test into _()
5954 * lib/examples/eu_splash.lyx: new file (Basque translation) from
5957 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
5960 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
5962 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
5963 there are no labels, or when buffer is readonly.
5965 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
5966 there are no labels, buffer is SGML, or when buffer is readonly.
5968 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5970 * src/LColor.C (LColor): change a couple of grey40 to grey60
5971 (LColor): rewore initalization to make compiles go some magnitude
5973 (getGUIName): don't use gettext until we need the string.
5975 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
5977 * src/Bullet.[Ch]: Fixed a small bug.
5979 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
5981 * src/paragraph.C (String): Several fixes/improvements
5983 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
5985 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5987 * src/paragraph.C (String): give more correct output.
5989 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
5991 * src/lyxfont.C (stateText) Do not output the language if it is
5992 eqaul to the language of the document.
5994 * src/paragraph.C (TeXOnePar): Do not put language switch commands
5995 between two paragraphs with the same language.
5997 * src/paragraph.C (getParLanguage) Return a correct answer for an
5998 empty dummy paragraph.
6000 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
6003 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
6006 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
6007 the menus/popup, if requested fonts are unavailable.
6009 2000-05-22 Juergen Vigna <jug@sad.it>
6011 * src/insets/insettabular.C (LocalDispatch): added some more cursor
6012 movement support (Up/Down/Tab/Shift-Tab).
6013 (LocalDispatch): added also preliminari cursor-selection.
6015 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
6017 * src/paragraph.C (PasteParagraph): Hopefully now right!
6019 2000-05-22 Garst R. Reese <reese@isn.net>
6021 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
6022 of list, change all references to Environment to Command
6023 * tex/hollywood.cls : rewrite environments as commands, add
6024 \uppercase to interiorshot and exteriorshot to force uppecase.
6025 * tex/broadway.cls : rewrite environments as commands. Tweak
6028 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6030 * src/menus.C (Add_to_toc_menu): fix the code which limits the
6031 size of items: use a constant intead of the hardcoded 40, and more
6032 importantly do not remove the %m and %x tags added at the end.
6033 (Add_to_refs_menu): use vector::size_type instead of
6034 unsigned int as basic types for the variables. _Please_ do not
6035 assume that size_t is equal to unsigned int. On an alpha, this is
6036 unsigned long, which is _not_ the same.
6038 * src/language.C (initL): remove language "hungarian", since it
6039 seems that "magyar" is better.
6041 2000-05-22 Juergen Vigna <jug@sad.it>
6043 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
6045 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
6048 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
6049 next was deleted but not set to 0.
6051 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6053 * src/language.C (initL): change the initialization of languages
6054 so that compiles goes _fast_.
6056 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
6059 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
6061 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6065 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6067 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
6069 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
6073 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
6076 * src/insets/insetlo*.[Ch]: Made editable
6078 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6080 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
6081 the current selection.
6083 * src/BufferView_pimpl.C (stuffClipboard): new method
6085 * src/BufferView.C (stuffClipboard): new method
6087 * src/paragraph.C (String): new method
6089 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
6090 LColor::ignore when lyxname is not found.
6092 * src/BufferView.C (pasteSelection): new method
6094 * src/BufferView_pimpl.C (pasteSelection): new method
6096 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
6098 * src/WorkArea.C (request_clipboard_cb): new static function
6099 (getClipboard): new method
6100 (putClipboard): new method
6102 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6104 * LyX 1.1.5pre2 released
6106 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6108 * src/vspace.C (operator=): removed
6109 (operator=): removed
6111 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
6113 * src/layout.C (NumberOfClass): manually set the type in make_pair
6114 (NumberOfLayout): ditto
6116 * src/language.C: use the Language constructor for ignore_lang
6118 * src/language.h: add constructors to struct Language
6120 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
6122 * src/text2.C (SetCursorIntern): comment out #warning
6124 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
6126 * src/mathed/math_iter.h: initialize sx and sw to 0
6128 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6130 * forms/lyx.fd: Redesign of form_ref
6132 * src/LaTeXFeatures.[Ch]
6136 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
6139 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
6140 and Buffer::inset_iterator.
6142 * src/menus.C: Added new menus: TOC and Refs.
6144 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
6146 * src/buffer.C (getTocList): New method.
6148 * src/BufferView2.C (ChangeRefs): New method.
6150 * src/buffer.C (getLabelList): New method. It replaces the old
6151 getReferenceList. The return type is vector<string> instead of
6154 * src/insets/insetinclude.C (getLabelList): New method. Replaces
6155 the old getLabel() and GetNumberOfLabels() methods.
6156 * src/insets/insetlabel.C (getLabelList): ditto
6157 * src/mathed/formula.C (getLabelList): ditto
6159 * src/paragraph.C (String): New method.
6161 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
6162 Uses the new getTocList() method.
6163 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
6164 which automatically updates the contents of the browser.
6165 (RefUpdateCB): Use the new getLabelList method.
6167 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
6169 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
6171 * src/spellchecker.C: Added using std::reverse;
6173 2000-05-19 Juergen Vigna <jug@sad.it>
6175 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
6177 * src/insets/insettext.C (computeTextRows): small fix for display of
6178 1 character after a newline.
6180 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
6183 2000-05-18 Juergen Vigna <jug@sad.it>
6185 * src/insets/insettabular.C (TabularFeatures): fixed update of display
6186 when changing width of column.
6188 * src/tabular.C (set_row_column_number_info): setting of
6189 autobreak rows if necessary.
6191 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6193 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
6195 * src/vc-backend.*: renamed stat() to status() and vcstat to
6196 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
6197 compilation broke. The new name seems more relevant, anyway.
6199 2000-05-17 Juergen Vigna <jug@sad.it>
6201 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
6202 which was wrong if the removing caused removing of rows!
6204 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
6205 (pushToken): new function.
6207 * src/text2.C (CutSelection): fix problem discovered with purify
6209 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6211 * src/debug.C (showTags): enlarge the first column, now that we
6212 have 6-digits debug codes.
6214 * lib/layouts/hollywood.layout:
6215 * lib/tex/hollywood.cls:
6216 * lib/tex/brodway.cls:
6217 * lib/layouts/brodway.layout: more commands and fewer
6218 environments. Preambles moved in the .cls files. Broadway now has
6219 more options on scene numbering and less whitespace (from Garst)
6221 * src/insets/insetbib.C (getKeys): make sure that we are in the
6222 document directory, in case the bib file is there.
6224 * src/insets/insetbib.C (Latex): revert bogus change.
6226 2000-05-16 Juergen Vigna <jug@sad.it>
6228 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
6229 the TabularLayout on cursor move.
6231 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
6233 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
6236 (draw): fixed cursor position and drawing so that the cursor is
6237 visible when before the tabular-inset.
6239 * src/insets/insettext.C (init): drawLockedFrame was not initialized
6240 when creating from old insettext.
6242 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
6244 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6246 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
6247 * lib/tex/brodway.cls: ditto
6249 * lib/layouts/brodway.layout: change alignment of parenthical
6252 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6254 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
6255 versions 0.88 and 0.89 are supported.
6257 2000-05-15 Juergen Vigna <jug@sad.it>
6259 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
6262 * src/insets/insettext.C (computeTextRows): redone completely this
6263 function in a much cleaner way, because of problems when having a
6265 (draw): added a frame border when the inset is locked.
6266 (SetDrawLockedFrame): this sets if we draw the border or not.
6267 (SetFrameColor): this sets the frame color (default=insetframe).
6269 * src/insets/lyxinset.h: added x() and y() functions which return
6270 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
6271 function which is needed to see if we have a locking inset of some
6272 type in this inset (needed for now in insettabular).
6274 * src/vspace.C (inPixels): the same function also without a BufferView
6275 parameter as so it is easier to use it in some ocasions.
6277 * src/lyxfunc.C: changed all places where insertInset was used so
6278 that now if it couldn't be inserted it is deleted!
6280 * src/TabularLayout.C:
6281 * src/TableLayout.C: added support for new tabular-inset!
6283 * src/BufferView2.C (insertInset): this now returns a bool if the
6284 inset was really inserted!!!
6286 * src/tabular.C (GetLastCellInRow):
6287 (GetFirstCellInRow): new helper functions.
6288 (Latex): implemented for new tabular class.
6292 (TeXTopHLine): new Latex() helper functions.
6294 2000-05-12 Juergen Vigna <jug@sad.it>
6296 * src/mathed/formulamacro.C (Read):
6297 * src/mathed/formula.C (Read): read also the \end_inset here!
6299 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6301 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
6302 crush when saving formulae with unbalanced parenthesis.
6304 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
6306 * src/layout.C: Add new keyword "endlabelstring" to layout file
6308 * src/text.C (GetVisibleRow): Draw endlabel string.
6310 * lib/layouts/broadway.layout
6311 * lib/layouts/hollywood.layout: Added endlabel for the
6312 Parenthetical layout.
6314 * lib/layouts/heb-article.layout: Do not use slanted font shape
6315 for Theorem like environments.
6317 * src/buffer.C (makeLaTeXFile): Always add "american" to
6318 the UsedLanguages list if document language is RTL.
6320 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6322 * add addendum to README.OS2 and small patch (from SMiyata)
6324 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6326 * many files: correct the calls to ChangeExtension().
6328 * src/support/filetools.C (ChangeExtension): remove the no_path
6329 argument, which does not belong there. Use OnlyFileName() instead.
6331 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
6332 files when LaTeXing a non-nice latex file.
6334 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
6335 a chain of "if". Return false when deadkeys are not handled.
6337 * src/lyx_main.C (LyX): adapted the code for default bindings.
6339 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
6340 bindings for basic functionality (except deadkeys).
6341 (deadKeyBindings): new method. Performs the bindings of deadkeys.
6343 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
6344 several methods: handle override_x_deadkeys.
6346 * src/lyxrc.h: remove the "bindings" map, which did not make much
6347 sense anyway. New variable override_x_deadkeys, defaulting to "true".
6349 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6351 * src/lyxfont.C (stateText): use a saner method to determine
6352 whether the font is "default". Seems to fix the crash with DEC
6355 * src/Bullet.[Ch] (Bullet): remove const on parameters.
6357 2000-05-08 Juergen Vigna <jug@sad.it>
6359 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
6360 TabularLayoutMenu with mouse-button-3
6361 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
6363 * src/TabularLayout.C: added this file for having a Layout for
6366 2000-05-05 Juergen Vigna <jug@sad.it>
6368 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
6369 recalculating inset-widths.
6370 (TabularFeatures): activated this function so that I can change
6371 tabular-features via menu.
6373 * src/menus.C (ShowEditMenu): inserted support for insettabular so
6374 that I can test some functions with the Table menu.
6376 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6378 * src/lyxfont.C (stateText): guard against stupid c++libs.
6380 * src/tabular.C: add using std::vector
6381 some whitespace changes, + removed som autogenerated code.
6383 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
6385 2000-05-05 Juergen Vigna <jug@sad.it>
6387 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
6388 row, columns and cellstructures.
6390 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6392 * lib/lyxrc.example: remove obsolete entries.
6394 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
6395 reading of protected_separator for free_spacing.
6397 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6399 * src/text.C (draw): do not display an exclamation mark in the
6400 margin for margin notes. This is confusing, ugly and
6403 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
6404 AMS math' is checked.
6406 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
6407 name to see whether including the amsmath package is needed.
6409 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
6411 * src/paragraph.C (validate): Compute UsedLanguages correctly
6412 (don't insert the american language if it doesn't appear in the
6415 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
6416 The argument of \thanks{} command is considered moving argument
6418 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
6421 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
6423 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
6424 for appendix/minipage/depth. The lines can be now both in the footnote
6425 frame, and outside the frame.
6427 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
6430 2000-05-05 Juergen Vigna <jug@sad.it>
6432 * src/table.[Ch]: removed the inset and buffer stuff as this is now
6433 neede only in tabular.[Ch].
6435 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6437 * src/insets/insetspecialchar.C (Read): allow command == '~' for
6439 (Write): write '~' for PROTECTED_SEPARATOR
6441 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6443 * src/lyxparagraph.h: add a friend struct matchIT after the struct
6446 * src/mathed/formula.C (drawStr): rename size to siz.
6448 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
6449 possibly fix a bug by not changing the pflags = flags to piflags =
6452 2000-05-05 Juergen Vigna <jug@sad.it>
6454 * src/insets/insetbib.C: moved using directive
6456 * src/ImportNoweb.C: small fix for being able to compile (missing
6459 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6461 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
6462 to use clear, since we don't depend on this in the code. Add test
6465 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6467 * (various *.C files): add using std::foo directives to please dec
6470 * replace calls to string::clear() to string::erase() (Angus)
6472 * src/cheaders/cmath: modified to provide std::abs.
6474 2000-05-04 Juergen Vigna <jug@sad.it>
6476 * src/insets/insettext.C: Prepared all for inserting of multiple
6477 paragraphs. Still display stuff to do (alignment and other things),
6478 but I would like to use LyXText to do this when we cleaned out the
6479 table-support stuff.
6481 * src/insets/insettabular.C: Changed lot of stuff and added lots
6482 of functionality still a lot to do.
6484 * src/tabular.C: Various functions changed name and moved to be
6485 const functions. Added new Read and Write functions and changed
6486 lots of things so it works good with tabular-insets (also removed
6487 some stuff which is not needed anymore * hacks *).
6489 * src/lyxcursor.h: added operators == and != which just look if
6490 par and pos are (not) equal.
6492 * src/buffer.C (latexParagraphs): inserted this function to latex
6493 all paragraphs form par to endpar as then I can use this too for
6496 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
6497 so that I can call this to from text insets with their own cursor.
6499 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
6500 output off all paragraphs (because of the fix below)!
6502 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
6503 the very last paragraph (this could be also the last paragraph of an
6506 * src/texrow.h: added rows() call which returns the count-variable.
6508 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6510 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
6512 * lib/configure.m4: better autodetection of DocBook tools.
6514 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6516 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
6518 * src/lyx_cb.C: add using std::reverse;
6520 * src/LaTeX.C (run): on error always run deleteFilesOnError before
6523 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
6524 selected files. Should fix repeated errors from generated files.
6526 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
6528 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
6530 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
6531 the spellchecker popup.
6533 * lib/lyxrc.example: Removed the \number_inset section
6535 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6537 * src/insets/figinset.C (various): Use IsFileReadable() to make
6538 sure that the file actually exist. Relying on ghostscripts errors
6539 is a bad idea since they can lead to X server crashes.
6541 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
6543 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
6546 * lib/lyxrc.example: smallish typo in description of
6547 \view_dvi_paper_option
6549 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6552 * src/lyxfunc.C: doImportHelper to factor out common code of the
6553 various import methods. New functions doImportASCIIasLines,
6554 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
6555 doImportLinuxDoc for the format specific parts.
6558 * buffer.C: Dispatch returns now a bool to indicate success
6561 * lyx_gui.C: Add getLyXView() for member access
6563 * lyx_main.C: Change logic for batch commands: First try
6564 Buffer::Dispatch (possibly without GUI), if that fails, use
6567 * lyx_main.C: Add support for --import command line switch.
6568 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
6569 Available Formats: Everything accepted by 'buffer-import <format>'
6571 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6573 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
6576 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
6577 documents will be reformatted upon reentry.
6579 2000-04-27 Juergen Vigna <jug@sad.it>
6581 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
6582 correctly only last pos this was a bug.
6584 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6586 * release of lyx-1.1.5pre1
6588 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6590 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
6592 * src/menus.C: revert the change of naming (Figure->Graphic...)
6593 from 2000-04-11. It was incomplete and bad.
6595 * src/LColor.[Ch]: add LColor::depthbar.
6596 * src/text.C (GetVisibleRow): use it.
6598 * README: update the languages list.
6600 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6602 * src/text.C (GetVisibleRow): show the depth of paragraphs using
6605 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6607 * README: remove sections that were just wrong.
6609 * src/text2.C (GetRowNearY): remove currentrow code
6611 * src/text.C (GetRow): remove currentrow code
6613 * src/screen.C (Update): rewritten a bit.
6614 (SmallUpdate): removed func
6616 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
6618 (FullRebreak): return bool
6619 (currentrow): remove var
6620 (currentrow_y): ditto
6622 * src/lyxscreen.h (Draw): change arg to unsigned long
6623 (FitCursor): return bool
6624 (FitManualCursor): ditto
6625 (Smallpdate): remove func
6626 (first): change to unsigned long
6627 (DrawOneRow): change second arg to long (from long &)
6628 (screen_refresh_y): remove var
6629 (scree_refresh_row): ditto
6631 * src/lyxrow.h: change baseline to usigned int from unsigned
6632 short, this brings some implicit/unsigned issues out in the open.
6634 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
6636 (Dispatch): don't call updateScrollbar after fitCursor. Use update
6637 instead of smallUpdate.
6639 * src/lyxcursor.h: change y to unsigned long
6641 * src/buffer.h: don't call updateScrollbar after fitcursor
6643 * src/buffer.C (parseSingleLyXformat2Token): move variables to
6644 where they are used. Removed "\\direction", this was not present
6645 in 1.1.4 and is already obsolete. Commented out some code that I
6646 believe to never be called.
6647 (runLiterate): don't call updateScrollbar after fitCursor
6649 (buildProgram): ditto
6652 * src/WorkArea.h (workWidth): change return val to unsigned
6655 (redraw): remove the button redraws
6656 (setScrollbarValue): change for scrollbar
6657 (getScrollbarValue): change for scrollbar
6658 (getScrollbarBounds): change for scrollbar
6660 * src/WorkArea.C (C_WorkArea_up_cb): removed func
6661 (C_WorkArea_down_cb): removed func
6662 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
6663 (resize): change for scrollbar
6664 (setScrollbar): ditto
6665 (setScrollbarBounds): ditto
6666 (setScrollbarIncrements): ditto
6667 (up_cb): removed func
6668 (down_cb): removed func
6669 (scroll_cb): change for scrollbar
6670 (work_area_handler): ditto
6672 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
6673 when FitCursor did something.
6674 (updateScrollbar): some unsigned changes
6675 (downCB): removed func
6676 (scrollUpOnePage): removed func
6677 (scrollDownOnePage): remvoed func
6678 (workAreaMotionNotify): don't call screen->FitCursor but use
6679 fitCursor instead. and bool return val
6680 (workAreaButtonPress): ditto
6681 (workAreaButtonRelease): some unsigned changes
6682 (checkInsetHit): ditto
6683 (workAreaExpose): ditto
6684 (update): parts rewritten, comments about the signed char arg added
6685 (smallUpdate): removed func
6686 (cursorPrevious): call needed updateScrollbar
6689 * src/BufferView2.C (allFloats): don't call updateScrollbar after
6692 * src/BufferView.[Ch] (upCB): removed func
6693 (downCB): removed func
6694 (smallUpdate): removed func
6696 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6698 * src/lyxtext.h src/text.C src/text2.C: removed support for the
6699 currentrow, currentrow_y optimization. This did not help a lot and
6700 if we want to do this kind of optimization we should rather use
6701 cursor.row instead of the currentrow.
6703 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
6704 buffer spacing and klyx spacing support.
6706 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6708 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
6711 2000-04-26 Juergen Vigna <jug@sad.it>
6713 * src/insets/figinset.C: fixes to Lars sstream changes!
6715 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
6717 * A lot of files: Added Ascii(ostream &) methods to all inset
6718 classes. Used when exporting to ASCII.
6720 * src/buffer.C (writeFileAscii,RoffAsciiTable)
6721 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
6724 * src/text2.C (ToggleFree): Disabled implicit word selection when
6725 there is a change in the language
6727 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
6728 no output was generated for end-of-sentence inset.
6730 * src/insets/lyxinset.h
6733 * src/paragraph.C: Removed the insetnumber code
6735 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
6737 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6739 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
6740 no_babel and no_epsfig completely from the file.
6741 (parseSingleLyXformat2Token): add handling for per-paragraph
6742 spacing as written by klyx.
6744 * src/insets/figinset.C: applied patch by Andre. Made it work with
6747 2000-04-20 Juergen Vigna <jug@sad.it>
6749 * src/insets/insettext.C (cutSelection):
6750 (copySelection): Fixed with selection from right to left.
6751 (draw): now the rows are not recalculated at every draw.
6752 (computeTextRows): for now reset the inset-owner here (this is
6753 important for an undo or copy where the inset-owner is not set
6756 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
6757 motion to the_locking_inset screen->first was forgotten, this was
6758 not important till we got multiline insets.
6760 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6762 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
6763 code seems to be alright (it is code changed by Dekel, and the
6764 intent is indeed that all macros should be defined \protect'ed)
6766 * NEWS: a bit of reorganisation of the new user-visible features.
6768 2000-04-19 Juergen Vigna <jug@sad.it>
6770 * src/insets/insettext.C (init): using a LyXCursor now for cursor
6771 position. Set the inset_owner of the used paragraph so that it knows
6772 that it is inside an inset. Fixed cursor handling with mouse and
6773 cursor keys. Fixed wrong timed inset redraws and lots of other changes
6774 and cleanups to make TextInsets work better.
6776 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
6777 Changed parameters of various functions and added LockInsetInInset().
6779 * src/insets/insettext.C:
6781 * src/insets/insetcollapsable.h:
6782 * src/insets/insetcollapsable.C:
6783 * src/insets/insetfoot.h:
6784 * src/insets/insetfoot.C:
6785 * src/insets/insetert.h:
6786 * src/insets/insetert.C: cleaned up the code so that it works now
6787 correctly with insettext.
6789 * src/insets/inset.C:
6790 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
6791 that insets in insets are supported right.
6794 * src/table.C: lots of changes for use with inset tabular (and cleanup)
6796 * src/paragraph.C: some small fixes
6798 * src/debug.h: inserted INSETS debug info
6800 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
6801 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
6803 * src/commandtags.h:
6804 * src/LyXAction.C: insert code for InsetTabular.
6806 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
6807 not Button1MotionMask.
6808 (workAreaButtonRelease): send always a InsetButtonRelease event to
6810 (checkInsetHit): some setCursor fixes (always with insets).
6812 * src/BufferView2.C (lockInset): returns a bool now and extended for
6813 locking insets inside insets.
6814 (showLockedInsetCursor): it is important to have the cursor always
6815 before the locked inset.
6816 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
6818 * src/BufferView.h: made lockInset return a bool.
6820 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
6822 * src/text2.C (SetCursor): This now has a version with a LyXCursor
6823 that is used also internally but can be called as public to have back
6824 a cursor pos which is not set internally.
6825 (SetCursorIntern): Changed to use above function.
6827 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
6829 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6834 * NEWS: updated for prerelease of 1.1.5. Please comment and send
6835 patches for things that should be in or should be changed.
6837 * src/* [insetfiles]: change "usigned char fragile" to bool
6838 fragile. There was only one point that could that be questioned
6839 and that is commented in formulamacro.C. Grep for "CHECK".
6841 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
6842 (DeleteBuffer): take it out of CutAndPaste and make it static.
6844 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6846 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
6847 output the spacing envir commands. Also the new commands used in
6848 the LaTeX output makes the result better.
6850 * src/Spacing.C (writeEnvirBegin): new method
6851 (writeEnvirEnd): new method
6853 2000-04-18 Juergen Vigna <jug@sad.it>
6855 * src/CutAndPaste.C: made textclass a static member of the class
6856 as otherwise it is not accesed right!!!
6858 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
6860 * forms/layout_forms.fd
6861 * src/layout_forms.h
6862 * src/layout_forms.C (create_form_form_character)
6863 * src/lyx_cb.C (UserFreeFont)
6864 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
6865 documents (in the layout->character popup).
6867 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6869 * src/spellchecker.C (create_ispell_pipe): fix a bug where
6870 \spell_command was in fact not honored (from Kevin Atkinson).
6872 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
6875 * src/lyx_gui.h: make lyxViews private (Angus)
6877 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
6879 * src/mathed/math_write.C
6880 (MathMatrixInset::Write) Put \protect before \begin{array} and
6881 \end{array} if fragile
6882 (MathParInset::Write): Put \protect before \\ if fragile
6884 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6886 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
6887 initialization if the LyXColorHandler must be done after the
6888 connections to the XServer has been established.
6890 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
6891 get the background pixel from the lyxColorhandler so that the
6892 figures are rendered with the correct background color.
6893 (NextToken): removed functions.
6894 (GetPSSizes): use ifs >> string instead of NextToken.
6896 * src/Painter.[Ch]: the color cache moved out of this file.
6898 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
6901 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6903 * src/WorkArea.C (work_area_handler): call BufferView::enterView
6904 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
6906 * src/BufferView.C (enterView): new func
6907 (leaveView): new func
6909 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
6911 (leaveView): new func, undefines xterm cursor when approp.
6913 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
6914 (AllowInput): delete the Workarea cursor handling from this func.
6916 * src/Painter.C (underline): draw a slimer underline in most cases.
6918 * src/lyx_main.C (error_handler): use extern "C"
6920 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6922 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
6923 sent directly to me.
6925 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
6926 to the list by Dekel.
6928 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
6931 * src/bufferview_funcs.[Ch]: two new files, moved several of the
6932 methods from lyx_cb.here.
6934 * src/lyx_cb.C: in addition to the above; removed input_prohibited
6937 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6939 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
6940 instead of using current_view directly.
6942 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
6944 * src/LyXAction.C (init): add the paragraph-spacing command.
6946 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
6948 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
6950 * src/lyx_cb.C (CurrentState): output a string when the spacing is
6951 different from the documents.
6953 * src/text.C (SetHeightOfRow): take paragraph spacing into
6954 account, paragraph spacing takes precedence over buffer spacing
6955 (GetVisibleRow): ditto
6957 * src/paragraph.C (writeFile): output the spacing parameter too.
6958 (validate): set the correct features if spacing is used in the
6960 (Clear): set spacing to default
6961 (MakeSameLayout): spacing too
6962 (HasSameLayout): spacing too
6963 (SetLayout): spacing too
6964 (TeXOnePar): output the spacing commands
6966 * src/lyxparagraph.h: added a spacing variable for use with
6967 per-paragraph spacing.
6969 * src/Spacing.h: add a Default spacing and a method to check if
6970 the current spacing is default. also added an operator==
6972 * src/text2.C (DeleteEmptyParagraphMechanism): added a
6975 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6977 * src/lyxserver.C (callback): fix dispatch of functions
6979 * src/insets/insetlatexaccent.C (checkContents): turn bogus
6980 printf() into lyxerr call.
6982 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
6985 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
6986 "Table" to "Table Box", "Float" to "Floating Material"; deletes
6987 the "Float" from each of the subitems.
6988 (ShowHelpMenu): add entry for "FAQ" and "TOC".
6990 * src/support/DebugStream.h: add an #ifdef to work around a gcc
6991 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
6992 documented the change so that the workaround can be nuked later.
6994 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
6997 * src/lyxlex_pimpl.C (next): do not re-declare the default value
6999 * src/buffer.C (getLatexName): ditto
7000 (setReadonly): ditto
7002 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7004 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
7005 avoid some uses of current_view. Added also a bufferParams()
7006 method to get at this.
7008 * src/lyxtext.h: changed params->buffer and paramters->bparams.
7010 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7012 * src/lyxparagraph.[Ch]: removed
7013 operator<(LyXParagraph::InsetTable..., added a struct matchIT
7014 with operators used by lower_bound and
7015 upper_bound in InsetTable's
7016 Make struct InsetTable private again. Used matchpos.
7018 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
7020 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
7021 document, the language of existing text is changed (unless the
7022 document is multi-lingual)
7024 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
7026 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
7028 * A lot of files: A rewrite of the Right-to-Left support.
7030 2000-04-10 Juergen Vigna <jug@sad.it>
7032 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
7033 misplaced cursor when inset in inset is locked.
7035 * src/insets/insettext.C (LocalDispatch): small fix so that a
7036 BREAKLINE is not inserted if we don't permit it with autBreakRows.
7038 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
7039 footnote font should be decreased in size twice when displaying.
7041 * src/insets/insettext.C (GetDrawFont): inserted this function as
7042 the drawing-font may differ from the real paragraph font.
7044 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
7045 insets (inset in inset!).
7047 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
7048 function here because we don't want footnotes inside footnotes.
7050 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
7052 (init): now set the inset_owner in paragraph.C
7053 (LocalDispatch): added some resetPos() in the right position
7056 (pasteSelection): changed to use the new CutAndPaste-Class.
7058 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
7059 which tells if it is allowed to insert another inset inside this one.
7061 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
7062 SwitchLayoutsBetweenClasses.
7064 * src/text2.C (InsertInset): checking of the new paragraph-function
7066 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
7067 is not needed anymore here!
7070 (PasteSelection): redone (also with #ifdef) so that now this uses
7071 the CutAndPaste-Class.
7072 (SwitchLayoutsBetweenClasses): removed here and implemented in the
7075 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
7076 from/to text/insets.
7078 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
7079 so that the paragraph knows if it is inside an (text)-inset.
7080 (InsertFromMinibuffer): changed return-value to bool as now it
7081 may happen that an inset is not inserted in the paragraph.
7082 (InsertInsetAllowed): this checks if it is allowed to insert an
7083 inset in this paragraph.
7085 (BreakParagraphConservative):
7086 (BreakParagraph) : small change for the above change of the return
7087 value of InsertFromMinibuffer.
7089 * src/lyxparagraph.h: added inset_owner and the functions to handle
7090 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
7092 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7094 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
7095 functions from BufferView to BufferView::Pimpl to ease maintence.
7097 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
7098 correctly. Also use SetCursorIntern instead of SetCursor.
7100 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
7103 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7105 * src/WorkArea.C (belowMouse): manually implement below mouse.
7107 * src/*: Add "explicit" on several constructors, I added probably
7108 some unneeded ones. A couple of changes to code because of this.
7110 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
7111 implementation and private parts from the users of BufferView. Not
7114 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
7115 implementation and private parts from the users of LyXLex. Not
7118 * src/BufferView_pimpl.[Ch]: new files
7120 * src/lyxlex_pimpl.[Ch]: new files
7122 * src/LyXView.[Ch]: some inline functions move out-of-line
7124 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7126 * src/lyxparagraph.h: make struct InsetTable public.
7128 * src/support/lyxstring.h: change lyxstring::difference_type to be
7129 ptrdiff_t. Add std:: modifiers to streams.
7131 * src/font.C: include the <cctype> header, for islower() and
7134 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7136 * src/font.[Ch]: new files. Contains the metric functions for
7137 fonts, takes a LyXFont as parameter. Better separation of concepts.
7139 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
7140 changes because of this.
7142 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
7144 * src/*: compile with -Winline and move functions that don't
7147 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
7150 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7152 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
7153 (various files changed because of this)
7155 * src/Painter.C (text): fixed the drawing of smallcaps.
7157 * src/lyxfont.[Ch] (drawText): removed unused member func.
7160 * src/*.C: added needed "using" statements and "std::" qualifiers.
7162 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7164 * src/*.h: removed all use of "using" from header files use
7165 qualifier std:: instead.
7167 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7169 * src/text.C (Backspace): some additional cleanups (we already
7170 know whether cursor.pos is 0 or not).
7172 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
7173 automake does not provide one).
7175 * src/bmtable.h: replace C++ comments with C comments.
7177 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
7179 * src/screen.C (ShowCursor): Change the shape of the cursor if
7180 the current language is not equal to the language of the document.
7181 (If the cursor change its shape unexpectedly, then you've found a bug)
7183 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
7186 * src/insets/insetnumber.[Ch]: New files.
7188 * src/LyXAction.C (init)
7189 * src/lyxfunc.C (dispatch): Add command number-inset-insert
7192 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
7194 * src/lyxparagraph.h
7195 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
7196 (the vector is kept sorted).
7198 * src/text.C (GetVisibleRow): Draw selection correctly when there
7199 is both LTR and RTL text.
7201 * src/paragraph.C (Clone): Use the assignment operator for cloning,
7202 which is much faster.
7204 * src/text.C (GetVisibleRow and other): Do not draw the last space
7205 in a row if the direction of the last letter is not equal to the
7206 direction of the paragraph.
7208 * src/lyxfont.C (latexWriteStartChanges):
7209 Check that font language is not equal to basefont language.
7210 (latexWriteEndChanges): ditto
7212 * src/lyx_cb.C (StyleReset): Don't change the language while using
7213 the font-default command.
7215 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
7216 empty paragraph before a footnote.
7218 * src/insets/insetcommand.C (draw): Increase x correctly.
7220 * src/screen.C (ShowCursor): Change cursor shape if
7221 current language != document language.
7223 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
7225 2000-03-31 Juergen Vigna <jug@sad.it>
7227 * src/paragraph.C (GetInset): commented out text[pos] = ' '
7228 (Clone): changed mode how the paragraph-data is copied to the
7229 new clone-paragraph.
7231 * src/lyxfunc.C (Dispatch): fixed small problem when calling
7232 GetInset(pos) with no inset anymore there (in inset UNDO)
7234 * src/insets/insetcommand.C (draw): small fix as here x is
7235 incremented not as much as width() returns (2 before, 2 behind = 4)
7237 2000-03-30 Juergen Vigna <jug@sad.it>
7239 * src/insets/insettext.C (InsetText): small fix in initialize
7240 widthOffset (should not be done in the init() function)
7242 2000-03-29 Amir Karger <karger@lyx.org>
7244 * lib/examples/it_ItemizeBullets.lyx: translation by
7247 * Implemented \textasciitilde and fixed a tiny bug in reLyX
7249 2000-03-29 Juergen Vigna <jug@sad.it>
7251 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
7253 * src/insets/insetfoot.C (Clone): small change as for the below
7254 new init function in the text-inset
7256 * src/insets/insettext.C (init): new function as I've seen that
7257 clone did not copy the Paragraph-Data!
7258 (LocalDispatch): Added code so that now we have some sort of Undo
7259 functionality (well actually we HAVE Undo ;)
7261 * src/text.C (Backspace): Small fix for the a | a Backspace problem
7263 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
7265 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
7268 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7270 * src/main.C: added a runtime check that verifies that the xforms
7271 header used when building LyX and the library used when running
7272 LyX match. Exit with a message if they don't match. This is a
7273 version number check only.
7275 * src/buffer.C (save): Don't allocate memory on the heap for
7276 struct utimbuf times.
7278 * *: some using changes, use iosfwd instead of the real headers.
7280 * src/lyxfont.C use char const * instead of string for the static
7281 strings. Rewrite some functions to use sstream.
7283 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7285 * src/text.C (Backspace): hopefully fix the dreaded backaspace
7288 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7290 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
7291 of Geodesy (from Martin Vermeer)
7293 * lib/layouts/svjour.inc: include file for the Springer svjour
7294 class. It can be used to support journals other than JoG.
7296 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
7297 Miskiewicz <misiek@pld.org.pl>)
7298 * lib/reLyX/Makefile.am: ditto.
7300 2000-03-27 Juergen Vigna <jug@sad.it>
7302 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
7303 also some modifications with operations on selected text.
7305 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
7306 problems with clicking on insets (last famous words ;)
7308 * src/insets/insetcommand.C (draw):
7309 (width): Changed to have a bit of space before and after the inset so
7310 that the blinking cursor can be seen (otherwise it was hidden)
7312 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7314 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
7315 would not be added to the link list when an installed gettext (not
7316 part of libc) is found.
7318 2000-03-24 Juergen Vigna <jug@sad.it>
7320 * src/insets/insetcollapsable.C (Edit):
7321 * src/mathed/formula.C (InsetButtonRelease):
7322 (InsetButtonPress): fixed for new handling of ButtonPress/Release
7325 * src/BufferView.C (workAreaButtonPress):
7326 (workAreaButtonRelease):
7327 (checkInsetHit): Finally fixed the clicking on insets be handled
7330 * src/insets/insetert.C (Edit): inserted this call so that ERT
7331 insets work always with LaTeX-font
7333 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7335 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
7336 caused lyx to startup with no GUI in place, causing in a crash
7337 upon startup when called with arguments.
7339 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7341 * src/FontLoader.C: better initialization of dummyXFontStruct.
7343 2000-03-20 José Abílio Matos <jamatos@lyx.org>
7345 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
7346 for linuxdoc and docbook import and export format options.
7348 * lib/lyxrc.example Example of default values for the previous flags.
7350 * src/lyx_cb.C Use those flags instead of the hardwired values for
7351 linuxdoc and docbook export.
7353 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
7356 * src/menus.C Added menus entries for the new import/exports formats.
7358 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7360 * src/lyxrc.*: Added support for running without Gui
7363 * src/FontLoader.C: sensible defaults if no fonts are needed
7365 * src/lyx_cb.C: New function ShowMessage (writes either to the
7366 minibuffer or cout in case of no gui
7367 New function AskOverwrite for common stuff
7368 Consequently various changes to call these functions
7370 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
7371 wild guess at sensible screen resolution when having no gui
7373 * src/lyxfont.C: no gui, no fonts... set some defaults
7375 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7377 * src/LColor.C: made the command inset background a bit lighter.
7379 2000-03-20 Hartmut Goebel <goebel@noris.net>
7381 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
7382 stdstruct.inc. Koma-Script added some title elements which
7383 otherwise have been listed below "bibliography". This split allows
7384 adding title elements to where they belong.
7386 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
7387 define the additional title elements and then include
7390 * many other layout files: changed to include stdtitle.inc just
7391 before stdstruct.inc.
7393 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
7395 * src/buffer.C: (save) Added the option to store all backup files
7396 in a single directory
7398 * src/lyxrc.[Ch]: Added variable \backupdir_path
7400 * lib/lyxrc.example: Added descriptions of recently added variables
7402 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
7403 bibtex inset, not closing the bibtex popup when deleting the inset)
7405 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7407 * src/lyx_cb.C: add a couple using directives.
7409 2000-03-17 José Abílio Matos <jamatos@lyx.org>
7410 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
7411 import based on the filename.
7413 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
7414 file would be imported at start, if the filename where of a sgml file.
7416 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
7418 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
7420 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
7421 * src/lyxfont.h Replaced the member variable bits.direction by the
7422 member variable lang. Made many changes in other files.
7423 This allows having a multi-lingual document
7425 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
7426 that change the current language to <l>.
7427 Removed the command "font-rtl"
7429 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
7430 format for Hebrew documents)
7432 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
7433 When auto_mathmode is "true", pressing a digit key in normal mode
7434 will cause entering into mathmode.
7435 If auto_mathmode is "rtl" then this behavior will be active only
7436 when writing right-to-left text.
7438 * src/text2.C (InsertStringA) The string is inserted using the
7441 * src/paragraph.C (GetEndLabel) Gives a correct result for
7442 footnote paragraphs.
7444 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
7446 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7448 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
7449 front of PasteParagraph. Never insert a ' '. This should at least
7450 fix some cause for the segfaults that we have been experiencing,
7451 it also fixes backspace behaviour slightly. (Phu!)
7453 * src/support/lstrings.C (compare_no_case): some change to make it
7454 compile with gcc 2.95.2 and stdlibc++-v3
7456 * src/text2.C (MeltFootnoteEnvironment): change type o
7457 first_footnote_par_is_not_empty to bool.
7459 * src/lyxparagraph.h: make text private. Changes in other files
7461 (fitToSize): new function
7462 (setContentsFromPar): new function
7463 (clearContents): new function
7464 (SetChar): new function
7466 * src/paragraph.C (readSimpleWholeFile): deleted.
7468 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
7469 the file, just use a simple string instead. Also read the file in
7470 a more maintainable manner.
7472 * src/text2.C (InsertStringA): deleted.
7473 (InsertStringB): deleted.
7475 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7477 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
7478 RedoParagraphs from the doublespace handling part, just set status
7479 to NEED_MORE_REFRESH. Also don't update cursor position (should be
7480 done, but perhaps not like this.)
7482 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7484 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
7485 character when inserting an inset.
7487 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7489 * src/bufferparams.C (readLanguage): now takes "default" into
7492 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
7493 also initialize the toplevel_keymap with the default bindings from
7496 * src/buffer.C (Buffer): remove lyxrc from the parameters.
7498 * all files using lyxrc: have lyxrc as a real variable and not a
7499 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
7502 * src/lyxrc.C: remove double call to defaultKeyBindings
7504 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
7505 toolbar defauls using lyxlex. Remove enums, structs, functions
7508 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
7509 toolbar defaults. Also store default keybindings in a map.
7511 * src/ToolbarDefaults.[Ch]: New file. This class is used for
7512 storing the toolbar defaults without any xforms dependencies.
7514 * src/insets/figinset.C: patch posted to list by Andre Poenitz
7515 applied. Changed to use iterators.
7517 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7519 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
7520 systems that don't have LINGUAS set to begin with.
7522 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7524 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
7525 the list by Dekel Tsur.
7527 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7529 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
7530 * src/insets/form_graphics.C: ditto.
7532 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
7534 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7536 * src/bufferparams.C (readLanguage): use the new language map
7538 * src/intl.C (InitKeyMapper): use the new language map
7540 * src/lyx_gui.C (create_forms): use the new language map
7542 * src/language.[Ch]: New files. Used for holding the information
7543 about each language. Now! Use this new language map enhance it and
7544 make it really usable for our needs.
7546 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
7548 * screen.C (ShowCursor): Removed duplicate code.
7549 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
7550 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
7552 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
7555 * src/text.C Added TransformChar method. Used for rendering Arabic
7556 text correctly (change the glyphs of the letter according to the
7557 position in the word)
7562 * src/lyxrc.C Added lyxrc command {language_command_begin,
7563 language_command_end,language_command_ltr,language_command_rtl,
7564 language_package} which allows the use of either arabtex or Omega
7567 * src/lyx_gui.C (init)
7569 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
7570 to use encoding for menu fonts which is different than the encoding
7573 * src/buffer.C (makeLaTeXFile): If params.language = "default",
7574 do not load the babel package.
7575 To write an English document with Hebrew/Arabic, change the document
7576 language to "english".
7578 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
7579 (alphaCounter): changed to return char
7580 (loweralphaCounter, hebrewCounter, romanCounter): New functions
7582 * lib/lyxrc.example Added examples for Hebrew/Arabic
7585 * src/layout.C Added layout command endlabeltype
7587 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
7589 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
7591 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7593 * src/mathed/math_delim.C (search_deco): return a
7594 math_deco_struct* instead of index.
7596 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7598 * All files with a USE_OSTREAM_ONLY within: removed all code that
7599 was unused when USE_OSTREAM_ONLY is defined.
7601 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
7602 of any less. Removed header and using.
7604 * src/text.C (GetVisibleRow): draw the string "Page Break
7605 (top/bottom)" on screen when drawing a pagebreak line.
7607 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7609 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
7611 * src/mathed/math_macro.C (draw): do some cast magic.
7614 * src/mathed/math_defs.h: change byte* argument to byte const*.
7616 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
7618 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
7619 know it is right to return InsetFoot* too, but cxx does not like
7622 * src/insets/insetcollapsable.[Ch] (Clone): make const.
7624 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
7626 * src/mathed/math_delim.C: change == to proper assignment.
7628 2000-03-09 Juergen Vigna <jug@sad.it>
7630 * src/insets/insettext.C (setPos): fixed various cursor positioning
7631 problems (via mouse and cursor-keys)
7632 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
7633 inset (still a small display problem but it works ;)
7635 * src/insets/insetcollapsable.C (draw): added button_top_y and
7636 button_bottom_y to have correct values for clicking on the inset.
7638 * src/support/lyxalgo.h: commented out 'using std::less'
7640 2000-03-08 Juergen Vigna <jug@sad.it>
7642 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
7643 Button-Release event closes as it is alos the Release-Event
7646 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
7648 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7650 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
7651 can add multiple spaces in Scrap (literate programming) styles...
7652 which, by the way, is how I got hooked on LyX to begin with.
7654 * src/mathed/formula.C (Write): Added dummy variable to an
7655 inset::Latex() call.
7656 (Latex): Add free_spacing boolean to inset::Latex()
7658 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
7660 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
7661 virtual function to include the free_spacing boolean from
7662 the containing paragraph's style.
7664 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
7665 Added free_spacing boolean arg to match inset.h
7667 * src/insets/insettext.C, src/insets/insettext.h (Latex):
7668 Added free_spacing boolean arg to match inset.h
7670 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
7671 Added free_spacing boolean and made sure that if in a free_spacing
7672 paragraph, that we output normal space if there is a protected space.
7674 * src/insets/insetref.C, src/insets/insetref.h (Latex):
7675 Added free_spacing boolean arg to match inset.h
7677 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
7678 Added free_spacing boolean arg to match inset.h
7680 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
7681 Added free_spacing boolean arg to match inset.h
7683 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
7684 Added free_spacing boolean arg to match inset.h
7686 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
7687 Added free_spacing boolean arg to match inset.h
7689 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
7690 free_spacing boolean arg to match inset.h
7692 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
7693 Added free_spacing boolean arg to match inset.h
7695 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
7696 Added free_spacing boolean arg to match inset.h
7698 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
7699 Added free_spacing boolean arg to match inset.h
7701 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
7702 Added free_spacing boolean arg to match inset.h
7704 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
7705 Added free_spacing boolean arg to match inset.h
7707 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
7708 free_spacing boolean arg to match inset.h
7710 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
7711 free_spacing boolean arg to match inset.h
7713 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
7714 ignore free_spacing paragraphs. The user's spaces are left
7717 * src/text.C (InsertChar): Fixed the free_spacing layout
7718 attribute behavior. Now, if free_spacing is set, you can
7719 add multiple spaces in a paragraph with impunity (and they
7720 get output verbatim).
7721 (SelectSelectedWord): Added dummy argument to inset::Latex()
7724 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
7727 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
7728 paragraph layouts now only input a simple space instead.
7729 Special character insets don't make any sense in free-spacing
7732 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
7733 hard-spaces in the *input* file to simple spaces if the layout
7734 is free-spacing. This converts old files which had to have
7735 hard-spaces in free-spacing layouts where a simple space was
7737 (writeFileAscii): Added free_spacing check to pass to the newly
7738 reworked inset::Latex(...) methods. The inset::Latex() code
7739 ensures that hard-spaces in free-spacing paragraphs get output
7740 as spaces (rather than "~").
7742 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7744 * src/mathed/math_delim.C (draw): draw the empty placeholder
7745 delims with a onoffdash line.
7746 (struct math_deco_compare): struct that holds the "functors" used
7747 for the sort and the binary search in math_deco_table.
7748 (class init_deco_table): class used for initial sort of the
7750 (search_deco): use lower_bound to do a binary search in the
7753 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7755 * src/lyxrc.C: a small secret thingie...
7757 * src/lyxlex.C (printTable): changed to take a ostream as paramter
7758 and to not flush the stream as often as it used to.
7760 * src/support/lyxalgo.h: new file
7761 (sorted): template function used for checking if a sequence is
7762 sorted or not. Two versions with and without user supplied
7763 compare. Uses same compare as std::sort.
7765 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
7766 it and give warning on lyxerr.
7768 (struct compare_tags): struct with function operators used for
7769 checking if sorted, sorting and lower_bound.
7770 (search_kw): use lower_bound instead of manually implemented
7773 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7775 * src/insets/insetcollapsable.h: fix Clone() declaration.
7776 * src/insets/insetfoot.h: ditto.
7778 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
7780 2000-03-08 Juergen Vigna <jug@sad.it>
7782 * src/insets/lyxinset.h: added owner call which tells us if
7783 this inset is inside another inset. Changed also the return-type
7784 of Editable to an enum so it tells clearer what the return-value is.
7786 * src/insets/insettext.C (computeTextRows): fixed computing of
7787 textinsets which split automatically on more rows.
7789 * src/insets/insetert.[Ch]: changed this to be of BaseType
7792 * src/insets/insetfoot.[Ch]: added footnote inset
7794 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
7795 collapsable insets (like footnote, ert, ...)
7797 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7799 * src/lyxdraw.h: remvoe file
7801 * src/lyxdraw.C: remove file
7803 * src/insets/insettext.C: added <algorithm>.
7805 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7807 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
7808 (matrix_cb): case MM_OK use string stream
7810 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
7813 * src/mathed/math_macro.C (draw): use string stream
7814 (Metrics): use string stream
7816 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
7817 directly to the ostream.
7819 * src/vspace.C (asString): use string stream.
7820 (asString): use string stream
7821 (asLatexString): use string stream
7823 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
7824 setting Spacing::Other.
7826 * src/LaTeXFeatures.C (getPackages): use string stream instead of
7827 sprintf when creating the stretch vale.
7829 * src/text2.C (alphaCounter): changed to return a string and to
7830 not use a static variable internally. Also fixed a one-off bug.
7831 (SetCounter): changed the drawing of the labels to use string
7832 streams instead of sprintf.
7834 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
7835 manipulator to use a scheme that does not require library support.
7836 This is also the way it is done in the new GNU libstdc++. Should
7837 work with DEC cxx now.
7839 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7841 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
7842 end. This fixes a bug.
7844 * src/mathed (all files concerned with file writing): apply the
7845 USE_OSTREAM_ONLY changes to mathed too.
7847 * src/support/DebugStream.h: make the constructor explicit.
7849 * src/lyxfont.C (latexWriteStartChanges): small bug related to
7850 count and ostream squashed.
7852 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7854 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
7856 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
7857 ostringstream uses STL strings, and we might not.
7859 * src/insets/insetspecialchar.C: add using directive.
7860 * src/insets/insettext.C: ditto.
7862 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7864 * lib/layouts/seminar.layout: feeble attempt at a layout for
7865 seminar.cls, far from completet and could really use some looking
7866 at from people used to write layout files.
7868 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
7869 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
7870 a lot nicer and works nicely with ostreams.
7872 * src/mathed/formula.C (draw): a slightly different solution that
7873 the one posted to the list, but I think this one works too. (font
7874 size wrong in headers.)
7876 * src/insets/insettext.C (computeTextRows): some fiddling on
7877 Jürgens turf, added some comments that he should read.
7879 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
7880 used and it gave compiler warnings.
7881 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
7884 * src/lyx_gui.C (create_forms): do the right thing when
7885 show_banner is true/false.
7887 * src/lyx_cb.C (TimerCB): no need to close or do anything if
7888 show_banner is false.
7890 * most file writing files: Now use iostreams to do almost all of
7891 the writing. Also instead of passing string &, we now use
7892 stringstreams. mathed output is still not adapted to iostreams.
7893 This change can be turned off by commenting out all the occurences
7894 of the "#define USE_OSTREAM_ONLY 1" lines.
7896 * src/WorkArea.C (createPixmap): don't output debug messages.
7897 (WorkArea): don't output debug messages.
7899 * lib/lyxrc.example: added a comment about the new variable
7902 * development/Code_rules/Rules: Added some more commente about how
7903 to build class interfaces and on how better encapsulation can be
7906 2000-03-03 Juergen Vigna <jug@sad.it>
7908 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
7909 automatically with the width of the LyX-Window
7911 * src/insets/insettext.C (computeTextRows): fixed update bug in
7912 displaying text-insets (scrollvalues where not initialized!)
7914 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7916 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
7917 id in the check of the result from lower_bound is not enough since
7918 lower_bound can return last too, and then res->id will not be a
7921 * all insets and some code that use them: I have conditionalized
7922 removed the Latex(string & out, ...) this means that only the
7923 Latex(ostream &, ...) will be used. This is a work in progress to
7924 move towards using streams for all output of files.
7926 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
7929 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7931 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
7932 routine (this fixes bug where greek letters were surrounded by too
7935 * src/support/filetools.C (findtexfile): change a bit the search
7936 algorithm, to fix bug introduced in 1.1.4. Note that --format is
7937 no longer passed to kpsewhich, we may have to change that later.
7939 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
7940 warning options to avoid problems with X header files (from Angus
7942 * acinclude.m4: regenerated.
7944 2000-03-02 Juergen Vigna <jug@sad.it>
7946 * src/insets/insettext.C (WriteParagraphData): Using the
7947 par->writeFile() function for writing paragraph-data.
7948 (Read): Using buffer->parseSingleLyXformat2Token()-function
7949 for parsing paragraph data!
7951 * src/buffer.C (readLyXformat2): removed all parse data and using
7952 the new parseSingleLyXformat2Token()-function.
7953 (parseSingleLyXformat2Token): added this function to parse (read)
7954 lyx-file-format (this is called also from text-insets now!)
7956 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7958 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
7961 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
7962 directly instead of going through a func. One very bad thing: a
7963 static LyXFindReplace, but I don't know where to place it.
7965 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
7966 string instead of char[]. Also changed to static.
7967 (GetSelectionOrWordAtCursor): changed to static inline
7968 (SetSelectionOverLenChars): ditto.
7970 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
7971 current_view and global variables. both classes has changed names
7972 and LyXFindReplace is not inherited from SearchForm.
7974 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
7975 fl_form_search form.
7977 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
7979 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7981 * lib/bind/*.bind: make sure 'buffer-previous' function is not
7982 bound (from Kayvan).
7984 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
7986 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
7988 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7990 * some things that I should comment but the local pub says head to
7993 * comment out all code that belongs to the Roff code for Ascii
7994 export of tables. (this is unused)
7996 * src/LyXView.C: use correct type for global variable
7997 current_layout. (LyXTextClass::size_type)
7999 * some code to get the new insetgraphics closer to working I'd be
8000 grateful for any help.
8002 * src/BufferView2.C (insertInset): use the return type of
8003 NumberOfLayout properly. (also changes in other files)
8005 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
8006 this as a test. I want to know what breaks because of this.
8008 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
8010 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8012 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
8013 to use a \makebox in the label, this allows proper justification
8014 with out using protected spaces or multiple hfills. Now it is
8015 "label" for left justified, "\hfill label\hfill" for center, and
8016 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
8017 should be changed accordingly.
8019 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8021 * src/lyxtext.h: change SetLayout() to take a
8022 LyXTextClass::size_type instead of a char (when there is more than
8023 127 layouts in a class); also change type of copylayouttype.
8024 * src/text2.C (SetLayout): ditto.
8025 * src/LyXView.C (updateLayoutChoice): ditto.
8027 * src/LaTeX.C (scanLogFile): errors where the line number was not
8028 given just after the '!'-line were ignored (from Dekel Tsur).
8030 * lib/lyxrc.example: fix description of \date_insert_format
8032 * lib/layouts/llncs.layout: new layout, contributed by Martin
8035 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8037 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
8038 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
8039 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
8040 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
8041 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
8042 paragraph.C, text.C, text2.C)
8044 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8046 * src/insets/insettext.C (LocalDispatch): remove extra break
8049 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
8050 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
8052 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
8053 * src/insets/insettext.[Ch] (GetCursorPos): ditto
8055 * src/insets/insetbib.h: move InsetBibkey::Holder and
8056 InsetCitation::Holder in public space.
8058 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8060 * src/insets/insettext.h: small change to get the new files from
8061 Juergen to compile (use "string", not "class string").
8063 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
8064 const & as parameter to LocalDispatch, use LyXFont const & as
8065 paramter to some other func. This also had impacto on lyxinsets.h
8066 and the two mathed insets.
8068 2000-02-24 Juergen Vigna <jug@sad.it>
8071 * src/commandtags.h:
8073 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
8077 * src/BufferView2.C: added/updated code for various inset-functions
8079 * src/insets/insetert.[Ch]: added implementation of InsetERT
8081 * src/insets/insettext.[Ch]: added implementation of InsetText
8083 * src/insets/inset.C (Edit): added "unsigned int button" parameter
8084 (draw): added preliminary code for inset scrolling not finshed yet
8086 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
8087 as it is in lyxfunc.C now
8089 * src/insets/lyxinset.h: Added functions for text-insets
8091 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8093 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
8094 BufferView and reimplement the list as a queue put inside its own
8097 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
8099 * several files: use the new interface to the "updateinsetlist"
8101 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
8103 (work_area_handler): call BufferView::trippleClick on trippleclick.
8105 * src/BufferView.C (doubleClick): new function, selects word on
8107 (trippleClick): new function, selects line on trippleclick.
8109 2000-02-22 Allan Rae <rae@lyx.org>
8111 * lib/bind/xemacs.bind: buffer-previous not supported
8113 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8115 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
8118 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8120 * src/bufferlist.C: get rid of current_view from this file
8122 * src/spellchecker.C: get rid of current_view from this file
8124 * src/vspace.C: get rid of current_view from this file
8125 (inPixels): added BufferView parameter for this func
8126 (asLatexCommand): added a BufferParams for this func
8128 * src/text.C src/text2.C: get rid of current_view from these
8131 * src/lyxfont.C (getFontDirection): move this function here from
8134 * src/bufferparams.C (getDocumentDirection): move this function
8137 * src/paragraph.C (getParDirection): move this function here from
8139 (getLetterDirection): ditto
8141 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
8143 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
8144 resize due to wrong pixmap beeing used. Also took the opurtunity
8145 to make the LyXScreen stateless on regard to WorkArea and some
8146 general cleanup in the same files.
8148 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8150 * src/Makefile.am: add missing direction.h
8152 * src/PainterBase.h: made the width functions const.
8154 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
8157 * src/insets/insetcommand.C (draw): draw Editable as buttons.
8159 * src/insets/insetlatexaccent.C (draw): make the accents draw
8160 better, at present this will only work well with iso8859-1.
8162 * several files: remove the old drawing code, now we use the new
8165 * several files: remove support for mono_video, reverse_video and
8168 2000-02-17 Juergen Vigna <jug@sad.it>
8170 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
8171 int ** as we have to return the pointer, otherwise we have only
8172 NULL pointers in the returning function.
8174 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8176 * src/LaTeX.C (operator()): quote file name when running latex.
8178 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8180 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
8181 (bubble tip), this removes our special handling of this.
8183 * Remove all code that is unused now that we have the new
8184 workarea. (Code that are not active when NEW_WA is defined.)
8186 * Make the uses of XSync not conditionalized on define USE_XSYNC.
8188 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8190 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
8191 nonexisting layout; correctly redirect obsoleted layouts.
8193 * lib/lyxrc.example: document \view_dvi_paper_option
8195 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
8198 * src/lyx_cb.C (RunScript): handle $$FName for command names.
8199 (PreviewDVI): handle the view_dvi_paper_option variable.
8200 [Both from Roland Krause]
8202 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8204 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
8205 char const *, int, LyXFont)
8206 (text(int, int, string, LyXFont)): ditto
8208 * src/text.C (InsertCharInTable): attempt to fix the double-space
8209 feature in tables too.
8210 (BackspaceInTable): ditto.
8211 (GetVisibleRow): make bottom pagebreak line be a onoff line.
8213 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8215 * src/text2.C (owner): only complain if owner_ is set and bv != 0
8217 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
8218 newly found text in textcache to this.
8219 (buffer): set the owner of the text put into the textcache to 0
8221 * src/insets/figinset.C (draw): fixed the drawing of figures with
8224 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
8225 drawing of mathframe, hfills, protected space, table lines. I have
8226 now no outstanding drawing problems with the new Painter code.
8228 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8230 * src/PainterBase.C (ellipse, circle): do not specify the default
8233 * src/LColor.h: add using directive.
8235 * src/Painter.[Ch]: change return type of methods from Painter& to
8236 PainterBase&. Add a using directive.
8238 * src/WorkArea.C: wrap xforms callbacks in C functions
8241 * lib/layouts/foils.layout: font fix and simplifications from Carl
8244 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8246 * a lot of files: The Painter, LColor and WorkArea from the old
8247 devel branch has been ported to lyx-devel. Some new files and a
8248 lot of #ifdeffed code. The new workarea is enabled by default, but
8249 if you want to test the new Painter and LColor you have to compile
8250 with USE_PAINTER defined (do this in config.h f.ex.) There are
8251 still some rought edges, and I'd like some help to clear those
8252 out. It looks stable (loads and displays the Userguide very well).
8255 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8257 * src/buffer.C (pop_tag): revert to the previous implementation
8258 (use a global variable for both loops).
8260 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
8262 * src/lyxrc.C (LyXRC): change slightly default date format.
8264 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
8265 there is an English text with a footnote that starts with a Hebrew
8266 paragraph, or vice versa.
8267 (TeXFootnote): ditto.
8269 * src/text.C (LeftMargin): allow for negative values for
8270 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
8273 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
8274 for input encoding (cyrillic)
8276 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8278 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
8281 * src/toolbar.C (set): ditto
8282 * src/insets/insetbib.C (create_form_citation_form): ditto
8284 * lib/CREDITS: added Dekel Tsur.
8286 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
8287 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
8288 hebrew supports files from Dekel Tsur.
8290 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
8291 <tzafrir@technion.ac.il>
8293 * src/lyxrc.C: put \date_insert_format at the right place.
8295 * src/buffer.C (makeLaTeXFile): fix the handling of
8296 BufferParams::sides when writing out latex files.
8298 * src/BufferView2.C: add a "using" directive.
8300 * src/support/lyxsum.C (sum): when we use lyxstring,
8301 ostringstream::str needs an additional .c_str().
8303 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8305 * src/support/filetools.C (ChangeExtension): patch from Etienne
8308 * src/TextCache.C (show): remove const_cast and make second
8309 parameter non-const LyXText *.
8311 * src/TextCache.h: use non const LyXText in show.
8313 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
8316 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8318 * src/support/lyxsum.C: rework to be more flexible.
8320 * several places: don't check if a pointer is 0 if you are going
8323 * src/text.C: remove some dead code.
8325 * src/insets/figinset.C: remove some dead code
8327 * src/buffer.C: move the BufferView funcs to BufferView2.C
8328 remove all support for insetlatexdel
8329 remove support for oldpapersize stuff
8330 made some member funcs const
8332 * src/kbmap.C: use a std::list to store the bindings in.
8334 * src/BufferView2.C: new file
8336 * src/kbsequence.[Ch]: new files
8338 * src/LyXAction.C + others: remove all trace of buffer-previous
8340 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
8341 only have one copy in the binary of this table.
8343 * hebrew patch: moved some functions from LyXText to more
8344 appropriate places. (LyXParagraph, BufferParams, LyXFont)
8346 * several files: remove support for XForms older than 0.88
8348 remove some #if 0 #endif code
8350 * src/TextCache.[Ch]: new file. Holds the textcache.
8352 * src/BufferView.C: changes to use the new TextCache interface.
8353 (waitForX): remove the now unused code.
8355 * src/BackStack.h: remove some commented code
8357 * lib/bind/emacs.bind: remove binding for buffer-previous
8359 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8361 * applied the hebrew patch.
8363 * src/lyxrow.h: make sure that all Row variables are initialized.
8365 * src/text2.C (TextHandleUndo): comment out a delete, this might
8366 introduce a memory leak, but should also help us to not try to
8367 read freed memory. We need to look at this one.
8369 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
8370 (LyXParagraph): initalize footnotekind.
8372 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
8373 forgot this when applying the patch. Please heed the warnings.
8375 * src/BufferView.C (buffer): a fix for the buffer-reload problem
8376 (aka. reformat problem)
8378 * src/bufferlist.C (exists): made const, and use const_iterator
8379 (isLoaded): new func.
8380 (release): use std::find to find the correct buffer.
8382 * src/bufferlist.h: made getState a const func.
8383 made empty a const func.
8384 made exists a const func.
8387 2000-02-01 Juergen Vigna <jug@sad.it>
8389 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
8391 * po/it.po: updated a bit the italian po file and also changed the
8392 'file nuovo' for newfile to 'filenuovo' without a space, this did
8395 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
8396 for the new insert_date command.
8398 * src/lyxfunc.C (Dispatch): added support for a insert_date function
8399 from jdblair, to insert a date into the current text conforming to
8400 a strftime format (for now only considering the locale-set and not
8401 the document-language).
8403 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8405 * src/lyxfont.C (textWidth): hopefully better fix for the Array
8406 Bounds Read error seen by purify. The problem was that islower is
8407 a macros which takes an unsigned char and uses it as an index for
8408 in array of characters properties (and is thus subject to the
8412 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
8413 correctly the paper sides radio buttons.
8414 (UpdateDocumentButtons): ditto.
8416 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8418 * src/kbmap.C (getsym + others): change to return unsigned int,
8419 returning a long can give problems on 64 bit systems. (I assume
8420 that int is 32bit on 64bit systems)
8422 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8424 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
8425 LyXLookupString to be zero-terminated. Really fixes problems seen
8428 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8430 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
8431 write a (char*)0 to the lyxerr stream.
8433 * src/lastfiles.C: move algorithm before the using statemets.
8435 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8437 * src/lastfiles.C: move using directives in global scope (egcs 1.x
8438 complains otherwise).
8439 * src/table.C: ditto
8441 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
8444 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
8445 that I removed earlier... It is really needed.
8447 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
8449 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8451 * INSTALL: update xforms home page URL.
8453 * lib/configure.m4: fix a bug with unreadable layout files.
8455 * src/table.C (calculate_width_of_column): add "using std::max"
8458 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8460 * several files: marked several lines with "DEL LINE", this is
8461 lines that can be deleted without changing anything.
8462 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
8463 checks this anyway */
8466 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
8468 * src/DepTable.C (update): add a "+" at the end when the checksum
8469 is different. (debugging string only)
8471 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
8472 the next inset to not be displayed. This should also fix the list
8473 of labels in the "Insert Crossreference" dialog.
8475 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8477 * src/support/LSubstring.C (LSubstring): set pos to string::npos
8478 when regex was not found.
8480 * src/support/lstrings.C (lowercase): use handcoded transform always.
8483 * src/text.C (Delete): fixed the crash. cursor.par->prev and
8484 old_cursor.par->prev could be 0.
8486 * several files: changed post inc/dec to pre inc/dec
8488 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
8489 write the lastfiles to file.
8491 * src/BufferView.C (buffer): only show TextCache info when debugging
8493 (resizeCurrentBuffer): ditto
8494 (workAreaExpose): ditto
8496 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
8498 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
8500 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
8501 a bit better by removing the special case for \i and \j.
8503 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8505 * src/lyx_main.C (easyParse): remove test for bad comand line
8506 options, since this broke all xforms-related parsing.
8508 * src/kbmap.C (getsym): set return type to unsigned long, as
8509 declared in header. On an alpha, long is _not_ the same as int.
8511 * src/support/LOstream.h: add a "using std::flush;"
8513 * src/insets/figinset.C: ditto.
8515 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8517 * src/bufferlist.C (write): use blinding fast file copy instead of
8518 "a char at a time", now we are doing it the C++ way.
8520 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
8521 std::list<int> instead.
8522 (addpidwait): reflect move to std::list<int>
8523 (sigchldchecker): ditto
8525 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
8528 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
8529 that obviously was wrong...
8531 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
8532 c, this avoids warnings with purify and islower.
8534 * src/insets/figinset.C: rename struct queue to struct
8535 queue_element and rewrite to use a std::queue. gsqueue is now a
8536 std::queue<queue_element>
8537 (runqueue): reflect move to std::queue
8540 * src/support/lstrings.h (tostr): specialize for bool, otherwise
8541 we would get "1" "0" instead of "true" "false. Also make the tostr
8544 2000-01-21 Juergen Vigna <jug@sad.it>
8546 * src/buffer.C (writeFileAscii): Disabled code for special groff
8547 handling of tabulars till I fix this in table.C
8549 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8551 * src/support/mkdir.C (mkdir): change second argument of mkdir to
8553 * src/support/lyxlib.h: ditto.
8555 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8557 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
8558 and 'j' look better. This might fix the "macron" bug that has been
8561 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
8562 functions as one template function. Delete the old versions.
8564 * src/support/lyxsum.C: move using std::ifstream inside
8567 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
8570 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
8572 * src/mathed/formula.C: delete #include "bufferlist.h" never used
8574 * src/insets/figinset.C (InitFigures): use new instead of malloc
8575 to allocate memory for figures and bitmaps.
8576 (DoneFigures): use delete[] instead of free to deallocate memory
8577 for figures and bitmaps.
8578 (runqueue): use new to allocate
8579 (getfigdata): use new/delete[] instead of malloc/free
8580 (RegisterFigure): ditto
8582 * some files: moved some declarations closer to first use, small
8583 whitespace changes use preincrement instead of postincrement where
8584 it does not make a difference.
8586 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
8587 step on the way to use stl::containers for key maps.
8589 * src/bufferlist.h: add a typedef for const_iterator and const
8590 versions of begin and end.
8592 * src/bufferlist.[Ch]: change name of member variable _state to
8593 state_. (avoid reserved names)
8595 (getFileNames): returns the filenames of the buffers in a vector.
8597 * configure.in (ALL_LINGUAS): added ro
8599 * src/support/putenv.C: new file
8601 * src/support/mkdir.C: new file
8603 2000-01-20 Allan Rae <rae@lyx.org>
8605 * lib/layouts/IEEEtran.layout: Added several theorem environments
8607 * lib/templates/IEEEtran.lyx: Example theorem environments and a
8608 couple of minor additions.
8610 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
8611 (except for those in footnotes of course)
8613 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8615 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
8617 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
8618 std::sort and std::lower_bound instead of qsort and handwritten
8620 (struct compara): struct that holds the functors used by std::sort
8621 and std::lower_bound in MathedLookupBOP.
8623 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8625 * src/support/LAssert.h: do not do partial specialization. We do
8628 * src/support/lyxlib.h: note that lyx::getUserName() and
8629 lyx::date() are not in use right now. Should these be suppressed?
8631 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
8632 (makeLinuxDocFile): do not put date and user name in linuxdoc
8635 * src/support/lyxlib.h (kill): change first argument to long int,
8636 since that's what solaris uses.
8638 * src/support/kill.C (kill): fix declaration to match prototype.
8640 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
8641 actually check whether namespaces are supported. This is not what
8644 * src/support/lyxsum.C: add a using directive.
8646 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8648 * src/support/kill.C: if we have namespace support we don't have
8649 to include lyxlib.h.
8651 * src/support/lyxlib.h: use namespace lyx if supported.
8653 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8655 * src/support/date.C: new file
8657 * src/support/chdir.C: new file
8659 * src/support/getUserName.C: new file
8661 * src/support/getcwd.C: new file
8663 * src/support/abort.C: new file
8665 * src/support/kill.C: new file
8667 * src/support/lyxlib.h: moved all the functions in this file
8668 insede struct lyx. Added also kill and abort to this struct. This
8669 is a way to avoid the "kill is not defined in <csignal>", we make
8670 C++ wrappers for functions that are not ANSI C or ANSI C++.
8672 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
8673 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
8674 lyx it has been renamed to sum.
8676 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8678 * src/text.C: add using directives for std::min and std::max.
8680 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8682 * src/texrow.C (getIdFromRow): actually return something useful in
8683 id and pos. Hopefully fixes the bug with positionning of errorbox
8686 * src/lyx_main.C (easyParse): output an error and exit if an
8687 incorrect command line option has been given.
8689 * src/spellchecker.C (ispell_check_word): document a memory leak.
8691 * src/bufferlist.C (write): fix mismatched allocation/deletion,
8692 where a "struct utimbuf" is allocated with "new" and deleted with
8695 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8697 * src/text2.C (CutSelection): don't delete double spaces.
8698 (PasteSelection): ditto
8699 (CopySelection): ditto
8701 * src/text.C (Backspace): don't delete double spaces.
8703 * src/lyxlex.C (next): fix a bug that were only present with
8704 conformant std::istream::get to read comment lines, use
8705 std::istream::getline instead. This seems to fix the problem.
8707 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8709 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
8710 allowed to insert space before space" editing problem. Please read
8711 commends at the beginning of the function. Comments about usage
8714 * src/text.C (InsertChar): fix for the "not allowed to insert
8715 space before space" editing problem.
8717 * src/text2.C (DeleteEmptyParagraphMechanism): when
8718 IsEmptyTableRow can only return false this last "else if" will
8719 always be a no-op. Commented out.
8721 * src/text.C (RedoParagraph): As far as I can understand tmp
8722 cursor is not really needed.
8724 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
8725 present it could only return false anyway.
8726 (several functions): Did something not so smart...added a const
8727 specifier on a lot of methods.
8729 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
8730 and add a tmp->text.resize. The LyXParagraph constructor does the
8732 (BreakParagraphConservative): ditto
8734 * src/support/path.h (Path): add a define so that the wrong usage
8735 "Path("/tmp") will be flagged as a compilation error:
8736 "`unnamed_Path' undeclared (first use this function)"
8738 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8740 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
8741 which was bogus for several reasons.
8743 * src/LaTeX.C (scanAux): fix the regular expression used to scan
8747 * autogen.sh: do not use "type -path" (what's that anyway?).
8749 * src/support/filetools.C (findtexfile): remove extraneous space
8750 which caused a kpsewhich warning (at least with kpathsea version
8753 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8755 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
8757 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
8759 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
8761 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8763 * src/paragraph.C (BreakParagraph): do not reserve space on text
8764 if we don't need to (otherwise, if pos_end < pos, we end up
8765 reserving huge amounts of memory due to bad unsigned karma).
8766 (BreakParagraphConservative): ditto, although I have not seen
8767 evidence the bug can happen here.
8769 * src/lyxparagraph.h: add a using std::list.
8771 2000-01-11 Juergen Vigna <jug@sad.it>
8773 * src/menus.C (MenuDocu): output an Alert if the documentation-file
8776 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8778 * src/vc-backend.C (doVCCommand): change to be static and take one
8779 more parameter: the path to chdir too be fore executing the command.
8780 (retrive): new function equiv to "co -r"
8782 * src/bufferlist.C (loadLyXFile): implement the missing parts if
8783 file_not_found_hook is true.
8785 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
8787 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
8788 if a file is readwrite,readonly...anything else.
8790 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8792 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
8793 (CreatePostscript): name change from MenuRunDVIPS (or something)
8794 (PreviewPostscript): name change from MenuPreviewPS
8795 (PreviewDVI): name change from MenuPreviewDVI
8797 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
8798 \view_pdf_command., \pdf_to_ps_command
8800 * lib/configure.m4: added search for PDF viewer, and search for
8801 PDF to PS converter.
8802 (lyxrc.defaults output): add \pdflatex_command,
8803 \view_pdf_command and \pdf_to_ps_command.
8805 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
8807 * src/bufferlist.C (write): we don't use blocksize for anything so
8810 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8812 * src/support/block.h: disable operator T* (), since it causes
8813 problems with both compilers I tried. See comments in the file.
8815 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
8818 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
8819 variable LYX_DIR_10x to LYX_DIR_11x.
8821 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
8823 * INSTALL: document --with-lyxname.
8826 * configure.in: new configure flag --with-lyxname which allows to
8827 choose the name under which lyx is installed. Default is "lyx", of
8828 course. It used to be possible to do this with --program-suffix,
8829 but the later has in fact a different meaning for autoconf.
8831 * src/support/lstrings.h (lstrchr): reformat a bit.
8833 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
8834 * src/mathed/math_defs.h: ditto.
8836 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8838 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
8839 true, decides if we create a backup file or not when saving. New
8840 tag and variable \pdf_mode, defaults to false. New tag and
8841 variable \pdflatex_command, defaults to pdflatex. New tag and
8842 variable \view_pdf_command, defaults to xpdf. New tag and variable
8843 \pdf_to_ps_command, defaults to pdf2ps.
8845 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8847 * src/bufferlist.C (close): don't call insetUnlock if the buffer
8848 does not have a BufferView.
8849 (unlockInset): ditto + don't access the_locking_inset if the
8850 buffer does not have a BufferView.
8852 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
8853 certain circumstances so that we don't continue a keyboard
8854 operation long after the key was released. Try f.ex. to load a
8855 large document, press PageDown for some seconds and then release
8856 it. Before this change the document would contine to scroll for
8857 some time, with this change it stops imidiatly.
8859 * src/support/block.h: don't allocate more space than needed. As
8860 long as we don't try to write to the arr[x] in a array_type arr[x]
8861 it is perfectly ok. (if you write to it you might segfault).
8862 added operator value_type*() so that is possible to pass the array
8863 to functions expecting a C-pointer.
8865 * lib/Makefile.am (dist-hook): don't fail completely if unable to
8868 * intl/*: updated to gettext 0.10.35, tried to add our own
8869 required modifications. Please verify.
8871 * po/*: updated to gettext 0.10.35, tried to add our own required
8872 modifications. Please verify.
8874 * src/support/lstrings.C (tostr): go at fixing the problem with
8875 cxx and stringstream. When stringstream is used return
8876 oss.str().c_str() so that problems with lyxstring and basic_string
8877 are avoided. Note that the best solution would be for cxx to use
8878 basic_string all the way, but it is not conformant yet. (it seems)
8880 * src/lyx_cb.C + other files: moved several global functions to
8881 class BufferView, some have been moved to BufferView.[Ch] others
8882 are still located in lyx_cb.C. Code changes because of this. (part
8883 of "get rid of current_view project".)
8885 * src/buffer.C + other files: moved several Buffer functions to
8886 class BufferView, the functions are still present in buffer.C.
8887 Code changes because of this.
8889 * config/lcmessage.m4: updated to most recent. used when creating
8892 * config/progtest.m4: updated to most recent. used when creating
8895 * config/gettext.m4: updated to most recent. applied patch for
8898 * config/gettext.m4.patch: new file that shows what changes we
8899 have done to the local copy of gettext.m4.
8901 * config/libtool.m4: new file, used in creation of acinclude.m4
8903 * config/lyxinclude.m4: new file, this is the lyx created m4
8904 macros, used in making acinclude.m4.
8906 * autogen.sh: GNU m4 discovered as a separate task not as part of
8907 the lib/configure creation.
8908 Generate acinlucde from files in config. Actually cat
8909 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
8910 easier to upgrade .m4 files that really are external.
8912 * src/Spacing.h: moved using std::istringstream to right after
8913 <sstream>. This should fix the problem seen with some compilers.
8915 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8917 * src/lyx_cb.C: began some work to remove the dependency a lot of
8918 functions have on BufferView::text, even if not really needed.
8919 (GetCurrentTextClass): removed this func, it only hid the
8922 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
8923 forgot this in last commit.
8925 * src/Bullet.C (bulletEntry): use static char const *[] for the
8926 tables, becuase of this the return arg had to change to string.
8928 (~Bullet): removed unneeded destructor
8930 * src/BufferView.C (beforeChange): moved from lyx_cb.C
8931 (insetSleep): moved from Buffer
8932 (insetWakeup): moved from Buffer
8933 (insetUnlock): moved from Buffer
8935 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
8936 from Buffer to BufferView.
8938 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
8940 * config/ltmain.sh: updated to version 1.3.4 of libtool
8942 * config/ltconfig: updated to version 1.3.4 of libtool
8944 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8947 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
8948 Did I get that right?
8950 * src/lyxlex.h: add a "using" directive or two.
8951 * src/Spacing.h: ditto.
8952 * src/insets/figinset.C: ditto.
8953 * src/support/filetools.C: ditto.
8954 * src/support/lstrings.C: ditto.
8955 * src/BufferView.C: ditto.
8956 * src/bufferlist.C: ditto.
8957 * src/lyx_cb.C: ditto.
8958 * src/lyxlex.C: ditto.
8960 * NEWS: add some changes for 1.1.4.
8962 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8964 * src/BufferView.C: first go at a TextCache to speed up switching
8967 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8969 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
8970 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
8971 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
8972 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
8975 * src/mathed/math_defs.h (MathedRowSt): make sure that all
8976 members of the struct are correctly initialized to 0 (detected by
8978 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
8979 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
8981 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
8982 pidwait, since it was allocated with "new". This was potentially
8983 very bad. Thanks to Michael Schmitt for running purify for us.
8986 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8988 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
8990 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
8992 1999-12-30 Allan Rae <rae@lyx.org>
8994 * lib/templates/IEEEtran.lyx: minor change
8996 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
8997 src/mathed/formula.C (LocalDispatch): askForText changes
8999 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
9000 know when a user has cancelled input. Fixes annoying problems with
9001 inserting labels and version control.
9003 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9005 * src/support/lstrings.C (tostr): rewritten to use strstream and
9008 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9010 * src/support/filetools.C (IsFileWriteable): use fstream to check
9011 (IsDirWriteable): use fileinfo to check
9013 * src/support/filetools.h (FilePtr): whole class deleted
9015 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
9017 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
9019 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
9021 * src/bufferlist.C (write): use ifstream and ofstream instead of
9024 * src/Spacing.h: use istrstream instead of sscanf
9026 * src/mathed/math_defs.h: change first arg to istream from FILE*
9028 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
9030 * src/mathed/math_parser.C: have yyis to be an istream
9031 (LexGetArg): use istream (yyis)
9033 (mathed_parse): ditto
9034 (mathed_parser_file): first arg istream instead of FILE*, set yyis
9036 * src/mathed/formula.C (Read): rewritten to use istream
9038 * src/mathed/formulamacro.C (Read): rewritten to use istream
9040 * src/lyxlex.h (~LyXLex): deleted desturctor
9041 (getStream): new function, returns an istream
9042 (getFile): deleted funtion
9043 (IsOK): return is.good();
9045 * src/lyxlex.C (LyXLex): delete file and owns_file
9046 (setFile): open an filebuf and assign that to a istream instead of
9048 (setStream): new function, takes an istream as arg.
9049 (setFile): deleted function
9050 (EatLine): rewritten us use istream instead of FILE*
9054 * src/table.C (LyXTable): use istream instead of FILE*
9055 (Read): rewritten to take an istream instead of FILE*
9057 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9059 * src/buffer.C (Dispatch): remove an extraneous break statement.
9061 * src/support/filetools.C (QuoteName): change to do simple
9062 'quoting'. More work is necessary. Also changed to do nothing
9063 under emx (needs fix too).
9064 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
9066 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
9067 config.h.in to the AC_DEFINE_UNQUOTED() call.
9068 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
9069 needs char * as argument (because Solaris 7 declares it like
9072 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
9073 remove definition of BZERO.
9075 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9077 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
9078 defined, "lyxregex.h" if not.
9080 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
9082 (REGEX): new variable that is set to regex.c lyxregex.h when
9083 AM_CONDITIONAL USE_REGEX is set.
9084 (libsupport_la_SOURCES): add $(REGEX)
9086 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
9089 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
9092 * configure.in: add call to LYX_REGEX
9094 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
9095 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
9097 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9099 * lib/bind/fi_menus.bind: new file, from
9100 pauli.virtanen@saunalahti.fi.
9102 * src/buffer.C (getBibkeyList): pass the parameter delim to
9103 InsetInclude::getKeys and InsetBibtex::getKeys.
9105 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
9106 is passed to Buffer::getBibkeyList
9108 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
9109 instead of the hardcoded comma.
9111 * src/insets/insetbib.C (getKeys): make sure that there are not
9112 leading blanks in bibtex keys. Normal latex does not care, but
9113 harvard.sty seems to dislike blanks at the beginning of citation
9114 keys. In particular, the retturn value of the function is
9116 * INSTALL: make it clear that libstdc++ is needed and that gcc
9117 2.7.x probably does not work.
9119 * src/support/filetools.C (findtexfile): make debug message go to
9121 * src/insets/insetbib.C (getKeys): ditto
9123 * src/debug.C (showTags): make sure that the output is correctly
9126 * configure.in: add a comment for TWO_COLOR_ICON define.
9128 * acconfig.h: remove all the entries that already defined in
9129 configure.in or acinclude.m4.
9131 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
9132 to avoid user name, date and copyright.
9134 1999-12-21 Juergen Vigna <jug@sad.it>
9136 * src/table.C (Read): Now read bogus row format informations
9137 if the format is < 5 so that afterwards the table can
9138 be read by lyx but without any format-info. Fixed the
9139 crash we experienced when not doing this.
9141 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9143 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
9144 (RedoDrawingOfParagraph): ditto
9145 (RedoParagraphs): ditto
9146 (RemoveTableRow): ditto
9148 * src/text.C (Fill): rename arg paperwidth -> paper_width
9150 * src/buffer.C (insertLyXFile): rename var filename -> fname
9151 (writeFile): rename arg filename -> fname
9152 (writeFileAscii): ditto
9153 (makeLaTeXFile): ditto
9154 (makeLinuxDocFile): ditto
9155 (makeDocBookFile): ditto
9157 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
9160 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
9162 * src/bmtable.h: add extern "C" on this file when __cplusplus is
9165 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
9166 compiled by a C compiler not C++.
9168 * src/layout.h (LyXTextClass): added typedef for const_iterator
9169 (LyXTextClassList): added typedef for const_iterator + member
9170 functions begin and end.
9172 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
9173 iterators to fill the choice_class.
9174 (updateLayoutChoice): rewritten to use iterators to fill the
9175 layoutlist in the toolbar.
9177 * src/BufferView.h (BufferView::work_area_width): removed unused
9180 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
9182 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
9183 (sgmlCloseTag): ditto
9185 * src/support/lstrings.h: return type of countChar changed to
9188 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
9189 what version of this func to use. Also made to return unsigned int.
9191 * configure.in: call LYX_STD_COUNT
9193 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
9194 conforming std::count.
9196 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9198 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
9199 and a subscript would give bad display (patch from Dekel Tsur
9200 <dekel@math.tau.ac.il>).
9202 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
9204 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
9207 * src/chset.h: add a few 'using' directives
9209 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
9210 triggered when no buffer is active
9212 * src/layout.C: removed `break' after `return' in switch(), since
9215 * src/lyx_main.C (init): make sure LyX can be ran in place even
9216 when libtool has done its magic with shared libraries. Fix the
9217 test for the case when the system directory has not been found.
9219 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
9220 name for the latex file.
9221 (MenuMakeHTML): ditto
9223 * src/buffer.h: add an optional boolean argument, which is passed
9226 1999-12-20 Allan Rae <rae@lyx.org>
9228 * lib/templates/IEEEtran.lyx: small correction and update.
9230 * configure.in: Attempted to use LYX_PATH_HEADER
9232 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
9234 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
9235 input from JMarc. Now use preprocessor to find the header.
9236 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
9237 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
9238 LYX_STL_STRING_FWD. See comments in file.
9240 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
9242 * The global MiniBuffer * minibuffer variable is dead.
9244 * The global FD_form_main * fd_form_main variable is dead.
9246 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9248 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
9250 * src/table.h: add the LOstream.h header
9251 * src/debug.h: ditto
9253 * src/LyXAction.h: change the explaination of the ReadOnly
9254 attribute: is indicates that the function _can_ be used.
9256 * src/LyXAction.C (init): find-replace _can_ be used in read-only
9259 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9261 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
9267 * src/paragraph.C (GetWord): assert on pos>=0
9270 * src/support/lyxstring.C: condition the use of an invariant on
9272 * src/support/lyxstring.h: ditto
9274 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
9275 Use LAssert.h instead of plain assert().
9277 * src/support/lstrings.h: add LAssert.h, in case it is needed.
9279 * src/lyxfunc.C: do not include LAssert.h, it is not used.
9280 * src/support/filetools.C: ditto
9282 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
9285 * INSTALL: document the new configure flags
9287 * configure.in: suppress --with-debug; add --enable-assertions
9289 * acinclude.m4: various changes in alignment of help strings.
9291 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9293 * src/kbmap.C: commented out the use of the hash map in kb_map,
9294 beginning of movement to a stl::container.
9296 * several files: removed code that was not in effect when
9297 MOVE_TEXT was defined.
9299 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
9300 for escaping should not be used. We can discuss if the string
9301 should be enclosed in f.ex. [] instead of "".
9303 * src/trans_mgr.C (insert): use the new returned value from
9304 encodeString to get deadkeys and keymaps done correctly.
9306 * src/chset.C (encodeString): changed to return a pair, to tell
9307 what to use if we know the string.
9309 * src/lyxscreen.h (fillArc): new function.
9311 * src/FontInfo.C (resize): rewritten to use more std::string like
9312 structore, especially string::replace.
9314 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
9317 * configure.in (chmod +x some scripts): remove config/gcc-hack
9319 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9321 * src/buffer.C (writeFile): change once again the top comment in a
9322 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
9323 instead of an hardcoded version number.
9324 (makeDocBookFile): ditto
9326 * src/version.h: add new define LYX_DOCVERSION
9328 * po/de.po: update from Pit Sütterlin
9329 * lib/bind/de_menus.bind: ditto.
9331 * src/lyxfunc.C (Dispatch): call MenuExport()
9332 * src/buffer.C (Dispatch): ditto
9334 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
9335 LyXFunc::Dispatch().
9336 (MenuExport): new function, moved from
9337 LyXFunc::Dispatch().
9339 * src/trans_mgr.C (insert): small cleanup
9340 * src/chset.C (loadFile): ditto
9342 * lib/kbd/iso8859-1.cdef: add missing backslashes
9344 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9346 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
9347 help with placing the manually drawn accents better.
9349 (Draw): x2 and hg changed to float to minimize rounding errors and
9350 help place the accents better.
9352 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
9353 unsigned short to char is just wrong...cast the char to unsigned
9354 char instead so that the two values can compare sanely. This
9355 should also make the display of insetlatexaccents better and
9356 perhaps also some other insets.
9358 (lbearing): new function
9361 1999-12-15 Allan Rae <rae@lyx.org>
9363 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
9364 header that provides a wrapper around the very annoying SGI STL header
9367 * src/support/lyxstring.C, src/LString.h:
9368 removed old SGI-STL-compatability attempts.
9370 * configure.in: Use LYX_STL_STRING_FWD.
9372 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
9373 stl_string_fwd.h is around and try to determine it's location.
9374 Major improvement over previous SGI STL 3.2 compatability.
9375 Three small problems remain with this function due to my zero
9376 knowledge of autoconf. JMarc and lgb see the comments in the code.
9378 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9380 * src/broken_const.h, config/hack-gcc, config/README: removed
9382 * configure.in: remove --with-gcc-hack option; do not call
9385 * INSTALL: remove documentation of --with-broken-const and
9388 * acconfig.h: remove all trace of BROKEN_CONST define
9390 * src/buffer.C (makeDocBookFile): update version number in output
9392 (SimpleDocBookOnePar): fix an assert when trying to a character
9393 access beyond string length
9396 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9398 * po/de.po: fix the Export menu
9400 * lyx.man: update the description of -dbg
9402 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
9403 (commandLineHelp): updated
9404 (easyParse): show list of available debug levels if -dbg is passed
9407 * src/Makefile.am: add debug.C
9409 * src/debug.h: moved some code to debug.C
9411 * src/debug.C: new file. Contains code to set and show debug
9414 * src/layout.C: remove 'break' after 'continue' in switch
9415 statements, since these cannot be reached.
9417 1999-12-13 Allan Rae <rae@lyx.org>
9419 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
9420 (in_word_set): hash() -> math_hash()
9422 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
9424 * acconfig.h: Added a test for whether we are using exceptions in the
9425 current compilation run. If so USING_EXCEPTIONS is defined.
9427 * config.in: Check for existance of stl_string_fwd.h
9428 * src/LString.h: If compiling --with-included-string and SGI's
9429 STL version 3.2 is present (see above test) we need to block their
9430 forward declaration of string and supply a __get_c_string().
9431 However, it turns out this is only necessary if compiling with
9432 exceptions enabled so I've a bit more to add yet.
9434 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
9435 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
9436 src/support/LRegex.h, src/undo.h:
9437 Shuffle the order of the included files a little to ensure that
9438 LString.h gets included before anything that includes stl_string_fwd.h
9440 * src/support/lyxstring.C: We need to #include LString.h instead of
9441 lyxstring.h to get the necessary definition of __get_c_string.
9442 (__get_c_string): New function. This is defined static just like SGI's
9443 although why they need to do this I'm not sure. Perhaps it should be
9444 in lstrings.C instead.
9446 * lib/templates/IEEEtran.lyx: New template file.
9448 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9450 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
9451 * intl/Makefile.in (MKINSTALLDIRS): ditto
9453 * src/LyXAction.C (init): changed to hold the LFUN data in a
9454 automatic array in stead of in callso to newFunc, this speeds up
9455 compilation a lot. Also all the memory used by the array is
9456 returned when the init is completed.
9458 * a lot of files: compiled with -Wold-style-cast, changed most of
9459 the reported offenders to C++ style casts. Did not change the
9460 offenders in C files.
9462 * src/trans.h (Match): change argument type to unsigned int.
9464 * src/support/DebugStream.C: fix some types on the streambufs so
9465 that it works on a conforming implementation.
9467 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9469 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
9471 * src/support/lyxstring.C: remove the inline added earlier since
9472 they cause a bunch of unsatisfied symbols when linking with dec
9473 cxx. Cxx likes to have the body of inlines at the place where they
9476 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
9477 accessing negative bounds in array. This fixes the crash when
9478 inserting accented characters.
9479 * src/trans.h (Match): ditto
9481 * src/buffer.C (Dispatch): since this is a void, it should not try
9482 to return anything...
9484 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9486 * src/buffer.h: removed the two friends from Buffer. Some changes
9487 because of this. Buffer::getFileName and Buffer::setFileName
9488 renamed to Buffer::fileName() and Buffer::fileName(...).
9490 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9492 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
9493 and Buffer::update(short) to BufferView. This move is currently
9494 controlled by a define MOVE_TEXT, this will be removed when all
9495 shows to be ok. This move paves the way for better separation
9496 between buffer contents and buffer view. One side effect is that
9497 the BufferView needs a rebreak when swiching buffers, if we want
9498 to avoid this we can add a cache that holds pointers to LyXText's
9499 that is not currently in use.
9501 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
9504 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9506 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
9508 * lyx_main.C: new command line option -x (or --execute) and
9509 -e (or --export). Now direct conversion from .lyx to .tex
9510 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
9511 Unfortunately, X is still needed and the GUI pops up during the
9514 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9516 * src/Spacing.C: add a using directive to bring stream stuff into
9518 * src/paragraph.C: ditto
9519 * src/buffer.C: ditto
9521 * NEWS: updated a bit the new features of 1.1.3 (took a few things
9522 from Lars' announcement).
9524 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
9525 example files from Tino Meinen.
9527 1999-12-06 Allan Rae <rae@lyx.org>
9529 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
9531 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9533 * src/support/lyxstring.C: added a lot of inline for no good
9536 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
9537 latexWriteEndChanges, they were not used.
9539 * src/layout.h (operator<<): output operator for PageSides
9541 * src/mathed/math_iter.C (my_memcpy): slightly changed.
9543 * some example files: loaded in LyX 1.0.4 and saved again to update
9544 certain constructs (table format)
9546 * a lot of files: did the change to use fstream/iostream for all
9547 writing of files. Done with a close look at Andre Poenitz's patch.
9549 * some files: whitespace changes.
9551 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9553 * src/mathed/math_iter.C (my_memcpy): new function. Since the
9554 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
9555 architecture, we provide our own. It is used unconditionnally, but
9556 I do not think this is a performance problem. Thanks to Angus
9557 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
9558 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
9560 (GetInset): use my_memcpy.
9564 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
9565 it is easier to understand, but it uses less TeX-only constructs now.
9567 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
9568 elements contain spaces
9570 * lib/configure: regenerated
9572 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
9573 elements contain spaces; display the list of programs that are
9576 * autogen.sh: make sure lib/configure is executable
9578 * lib/examples/*: rename the tutorial examples to begin with the
9579 two-letters language code.
9581 * src/lyxfunc.C (getStatus): do not query current font if no
9584 * src/lyx_cb.C (RunScript): use QuoteName
9585 (MenuRunDvips): ditto
9586 (PrintApplyCB): ditto
9588 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
9589 around argument, so that it works well with the current shell.
9590 Does not work properly with OS/2 shells currently.
9592 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
9593 * src/LyXSendto.C (SendtoApplyCB): ditto
9594 * src/lyxfunc.C (Dispatch): ditto
9595 * src/buffer.C (runLaTeX): ditto
9596 (runLiterate): ditto
9597 (buildProgram): ditto
9599 * src/lyx_cb.C (RunScript): ditto
9600 (MenuMakeLaTeX): ditto
9602 * src/buffer.h (getLatexName): new method
9604 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
9606 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9608 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
9609 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
9610 (create_math_panel): ditto
9612 * src/lyxfunc.C (getStatus): re-activate the code which gets
9613 current font and cursor; add test for export to html.
9615 * src/lyxrc.C (read): remove unreachable break statements; add a
9618 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
9620 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9622 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
9623 introduced by faulty regex.
9624 * src/buffer.C: ditto
9625 * src/lastfiles.C: ditto
9626 * src/paragraph.C: ditto
9627 * src/table.C: ditto
9628 * src/vspace.C: ditto
9629 * src/insets/figinset.C: ditto
9630 Note: most of these is absolutely harmless, except the one in
9631 src/mathed formula.C.
9633 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9635 * src/ImportNoweb.C (documentclass): fixed bounds for substr
9636 operation, yielding correct results for the reLyX command.
9638 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9640 * src/support/filetools.C (ExpandPath): removed an over eager
9642 (ReplaceEnvironmentPath): ditto
9644 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
9645 shows that we are doing something fishy in our code...
9649 * src/lyxrc.C (read): use a double switch trick to get more help
9650 from the compiler. (the same trick is used in layout.C)
9651 (write): new function. opens a ofstream and pass that to output
9652 (output): new function, takes a ostream and writes the lyxrc
9653 elemts to it. uses a dummy switch to make sure no elements are
9656 * src/lyxlex.h: added a struct pushpophelper for use in functions
9657 with more than one exit point.
9659 * src/lyxlex.[Ch] (GetInteger): made it const
9663 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
9665 * src/layout.[hC] : LayoutTags splitted into several enums, new
9666 methods created, better error handling cleaner use of lyxlex. Read
9669 * src/bmtable.[Ch]: change some member prototypes because of the
9670 image const changes.
9672 * commandtags.h, src/LyXAction.C (init): new function:
9673 "preferences-save", saves the lyxrc entries into .lyx/preferences.
9674 This file is not read automatically but you can add \input
9675 preferences to your lyxrc if you want to. We need to discuss how
9678 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
9679 in .aux, also remove .bib and .bst files from dependencies when
9682 * src/BufferView.C, src/LyXView.C: add const_cast several places
9683 because of changes to images.
9685 * lib/images/*: same change as for images/*
9687 * lib/lyxrc.example: Default for accept_compound is false not no.
9689 * images/*: changed to be const, however I have som misgivings
9690 about this change so it might be changed back.
9692 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9694 * lib/configure, po/POTFILES.in: regenerated
9696 * autogen.sh: autogenerate lib/configure from lib/configure.m4
9698 * config/lib_configure.m4: removed
9700 * lib/configure.m4: new file (was config/lib_configure.m4)
9702 * configure.in: do not test for rtti, since we do not use it.
9704 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9706 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
9707 doubling of allocated space scheme. This makes it faster for large
9708 strings end to use less memory for small strings. xtra rememoved.
9710 * src/insets/figinset.C (waitalarm): commented out.
9711 (GhostscriptMsg): use static_cast
9712 (GhostscriptMsg): use new instead of malloc to allocate memory for
9713 cmap. also delete the memory after use.
9715 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
9717 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
9718 for changes in bibtex database or style.
9719 (runBibTeX): remove all .bib and .bst files from dep before we
9721 (run): use scanAuc in when dep file already exist.
9723 * src/DepTable.C (remove_files_with_extension): new method
9726 * src/DepTable.[Ch]: made many of the methods const.
9728 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9730 * src/bufferparams.C: make sure that the default textclass is
9731 "article". It used to be the first one by description order, but
9732 now the first one is "docbook".
9734 * src/lyx_main.C (setDebuggingLevel): change type of argument to
9735 string; call Debug::value.
9736 (easyParse): pass complete argument to setDebuggingLevel().
9738 * src/debug.h (value): fix the code that parses debug levels.
9740 * src/debug.h: add new debug type ACTION, reserved for LyXAction
9743 * src/LyXAction.C: use Debug::ACTION as debug channel.
9745 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
9747 * NEWS: updated for the future 1.1.3 release.
9749 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
9750 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
9751 it should. This is of course a controversial change (since many
9752 people will find that their lyx workscreen is suddenly full of
9753 red), but done for the sake of correctness.
9755 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
9756 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
9758 * src/insets/inseterror.h, src/insets/inseturl.h,
9759 src/insets/insetinfo.h, src/insets/figinset.h,
9760 src/mathed/formulamacro.h, src/mathed/math_macro.h
9761 (EditMessage): add a missing const and add _() to make sure that
9764 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
9765 src/insets/insetbib.C, src/support/filetools.C: add `using'
9768 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
9769 doing 'Insert index of last word' at the beginning of a paragraph.
9771 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9773 * several files: white-space changes.
9775 * src/mathed/formula.C: removed IsAlpha and IsDigit
9777 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
9778 .bib file. use a ifstream instead of FilePtr when parsing the .bib
9781 * src/insets/figinset.C (GetPSSizes): don't break when
9782 "EndComments" is seen. But break when a boundingbox is read.
9784 * all classes inherited from Inset: return value of Clone
9785 changed back to Inset *.
9787 * all classes inherited form MathInset: return value of Clone
9788 changed back to MathedInset *.
9790 * src/insets/figinset.C (runqueue): use a ofstream to output the
9791 gs/ps file. Might need some setpresicion or setw. However I can
9792 see no problem with the current code.
9793 (runqueue): use sleep instead of the alarm/signal code. I just
9794 can't see the difference.
9796 * src/paragraph.C (LyXParagraph): reserve space in the new
9797 paragraph and resize the inserted paragraph to just fit.
9799 * src/lyxfunc.h (operator|=): added operator for func_status.
9801 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
9802 check for readable file.
9804 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
9805 check for readable file.
9806 (MenuMakeLinuxDoc): ditto
9807 (MenuMakeDocBook): ditto
9808 (MenuMakeAscii): ditto
9809 (InsertAsciiFile): split the test for openable and readable
9811 * src/bmtable.C (draw_bitmaptable): use
9812 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
9814 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
9815 findtexfile from LaTeX to filetools.
9817 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
9818 instead of FilePtr. Needs to be verified by a literate user.
9820 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9822 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
9823 (EditMessage): likewise.
9825 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
9826 respectively as \textasciitilde and \textasciicircum.
9828 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9830 * src/support/lyxstring.h: made the methods that take iterators
9833 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
9834 (regexMatch): made is use the real regex class.
9836 * src/support/Makefile.am: changed to use libtool
9838 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
9840 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
9842 (MathIsInset ++): changed several macros to be inline functions
9845 * src/mathed/Makefile.am: changed to use libtool
9847 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
9849 * src/insets/inset* : Clone changed to const and return type is
9850 the true insettype not just Inset*.
9852 * src/insets/Makefile.am: changed to use libtool
9854 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
9856 * src/undo.[Ch] : added empty() and changed some of the method
9859 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
9861 * src/lyxparagraph.h: use id() and id(...) instead of getID and
9862 setID use block<> for the bullets array, added const several places.
9864 * src/lyxfunc.C (getStatus): new function
9866 * src/lyxfunc.[Ch] : small changes to take advantage of the new
9867 LyXAction, added const to several funtions.
9869 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
9870 a std::map, and to store the dir items in a vector.
9872 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
9875 * src/LyXView.[Ch] + other files : changed currentView to view.
9877 * src/LyXAction.[Ch] : ported from the old devel branch.
9879 * src/.cvsignore: added .libs and a.out
9881 * configure.in : changes to use libtool.
9883 * acinclude.m4 : inserted libtool.m4
9885 * .cvsignore: added libtool
9887 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9889 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
9890 file name in insets and mathed directories (otherwise the
9891 dependency is not taken in account under cygwin).
9893 * src/text2.C (InsertString[AB]): make sure that we do not try to
9894 read characters past the string length.
9896 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9898 * lib/doc/LaTeXConfig.lyx.in,
9899 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
9901 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
9902 file saying who created them and when this heppened; this is
9903 useless and annoys tools like cvs.
9905 * lib/layouts/g-brief-{en,de}.layout,
9906 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
9907 from Thomas Hartkens <thomas@hartkens.de>.
9909 * src/{insets,mathed}/Makefile.am: do not declare an empty
9910 LDFLAGS, so that it can be set at configure time (useful on Irix
9913 * lib/reLyX/configure.in: make sure that the prefix is set
9914 correctly in LYX_DIR.
9916 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9918 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
9919 be used by 'command-sequence' this allows to bind a key to a
9920 sequence of LyX-commands
9921 (Example: 'command-sequence math-insert alpha; math-insert beta;")
9923 * src/LyXAction.C: add "command-sequence"
9925 * src/LyXFunction.C: handling of "command-sequence"
9927 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
9928 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
9930 * src/lyxserver.C, src/minibuffer.C: Use this new interface
9932 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9934 * src/buffer.C (writeFile): Do not output a comment giving user
9935 and date at the beginning of a .lyx file. This is useless and
9936 annoys cvs anyway; update version number to 1.1.
9938 * src/Makefile.am (LYX_DIR): add this definition, so that a
9939 default path is hardcoded in LyX.
9941 * configure.in: Use LYX_GNU_GETTEXT.
9943 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
9944 AM_GNU_GETTEXT with a bug fixed.
9946 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
9948 * src/chset.C: add "using std::ifstream;" to please dec cxx.
9950 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
9951 which is used to point to LyX data is now LYX_DIR_11x.
9953 * lyx.man: convert to a unix text file; small updates.
9955 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9957 * src/support/LSubstring.[Ch]: made the second arg of most of the
9958 constructors be a const reference.
9960 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
9963 * src/support/lyxstring.[Ch] (swap): added missing member function
9964 and specialization of swap(str, str);
9966 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
9968 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
9969 trace of the old one.
9971 * src/undo.[Ch]: made the undostack use std::list to store undo's in
9972 put the member definitions in undo.C.
9974 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
9975 NEW_TEXT and have now only code that was included when this was
9978 * src/intl.C (LCombo): use static_cast
9980 (DispatchCallback): ditto
9982 * src/definitions.h: removed whole file
9984 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
9986 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
9987 parsing and stores in a std:map. a regex defines the file format.
9988 removed unneeded members.
9990 * src/bufferparams.h: added several enums from definitions.h here.
9991 Removed unsused destructor. Changed some types to use proper enum
9992 types. use block to have the temp_bullets and user_defined_bullets
9993 and to make the whole class assignable.
9995 * src/bufferparams.C (Copy): removed this functions, use a default
9998 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
10001 * src/buffer.C (readLyXformat2): commend out all that have with
10002 oldpapersize to do. also comment out all that hve to do with
10003 insetlatex and insetlatexdel.
10004 (setOldPaperStuff): commented out
10006 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
10008 * src/LyXAction.C: remove use of inset-latex-insert
10010 * src/mathed/math_panel.C (button_cb): use static_cast
10012 * src/insets/Makefile.am (insets_o_SOURCES): removed
10015 * src/support/lyxstring.C (helper): use the unsigned long
10016 specifier, UL, instead of a static_cast.
10018 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
10020 * src/support/block.h: new file. to be used as a c-style array in
10021 classes, so that the class can be assignable.
10023 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10025 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
10026 NULL, make sure to return an empty string (it is not possible to
10027 set a string to NULL).
10029 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10031 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
10033 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
10035 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
10036 link line, so that Irix users (for example) can set it explicitely to
10039 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
10040 it can be overidden at make time (static or dynamic link, for
10043 * src/vc-backend.C, src/LaTeXFeatures.h,
10044 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
10045 statements to bring templates to global namespace.
10047 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10049 * src/support/lyxstring.C (operator[] const): make it standard
10052 * src/minibuffer.C (Init): changed to reflect that more
10053 information is given from the lyxvc and need not be provided here.
10055 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
10057 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
10059 * src/LyXView.C (UpdateTimerCB): use static_cast
10060 (KeyPressMask_raw_callback): ditto
10062 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
10063 buffer_, a lot of changes because of this. currentBuffer() ->
10064 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
10065 also changes to other files because of this.
10067 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10069 * src/vc-backend.[Ch]: new files. The backends for vc handling,
10070 have no support for RCS and partial support for CVS, will be
10073 * src/insets/ several files: changes because of function name
10074 changes in Bufferview and LyXView.
10076 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
10078 * src/support/LSubstring.[Ch]: new files. These implement a
10079 Substring that can be very convenient to use. i.e. is this
10081 string a = "Mary had a little sheep";
10082 Substring(a, "sheep") = "lamb";
10083 a is now "Mary has a little lamb".
10085 * src/support/LRegex.[Ch]: a regex class that can be used to pick
10086 out patterns and subpatterns of strings. It is used by LSubstring
10087 and also by vc-backend.C
10089 * src/support/lyxstring.C: went over all the assertions used and
10090 tried to correct the wrong ones and flag which of them is required
10091 by the standard. some bugs found because of this. Also removed a
10092 couple of assertions.
10094 * src/support/Makefile.am (libsupport_a_SOURCES): added
10095 LSubstring.[Ch] and LRegex.[Ch]
10097 * src/support/FileInfo.h: have struct stat buf as an object and
10098 not a pointer to one, some changes because of this.
10100 * src/LaTeXFeatures.C (getTClassPreamble): also use the
10101 information in layout when adding the layouts preamble to the
10102 textclass preamble.
10104 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
10107 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
10108 because of bug in OS/2.
10110 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10112 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
10113 \verbatim@font instead of \ttfamily, so that it can be redefined.
10115 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
10116 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
10117 src/layout.h, src/text2.C: add 'using' directive to bring the
10118 STL templates we need from the std:: namespace to the global one.
10119 Needed by DEC cxx in strict ansi mode.
10121 * src/support/LIstream.h,src/support/LOstream.h,
10122 src/support/lyxstring.h,src/table.h,
10123 src/lyxlookup.h: do not include <config.h> in header
10124 files. This should be done in the .C files only.
10126 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
10130 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10132 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
10133 from Kayvan to fix the tth invokation.
10135 * development/lyx.spec.in: updates from Kayvan to reflect the
10136 changes of file names.
10138 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10140 * src/text2.C (InsertStringB): use std::copy
10141 (InsertStringA): use std::copy
10143 * src/bufferlist.C: use a vector to store the buffers in. This is
10144 an internal change and should not affect any other thing.
10146 * src/BufferView.C (waitForX): use XSync instead of the lengthy
10149 * src/text.C (Fill): fix potential bug, one off bug.
10151 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10153 * src/Makefile.am (lyx_main.o): add more files it depends on.
10155 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
10157 * src/support/lyxstring.C: use size_t for the reference count,
10158 size, reserved memory and xtra.
10159 (internal_compare): new private member function. Now the compare
10160 functions should work for std::strings that have embedded '\0'
10162 (compare): all compare functions rewritten to use
10165 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10167 * src/support/lyxstring.C (compare): pass c_str()
10168 (compare): pass c_str
10169 (compare): pass c_str
10171 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10173 * src/support/DebugStream.C: <config.h> was not included correctly.
10175 * lib/configure: forgot to re-generate it :( I'll make this file
10176 auto generated soon.
10178 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10180 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
10183 * src/support/lyxstring.C: some changes from length() to rep->sz.
10184 avoids a function call.
10186 * src/support/filetools.C (SpaceLess): yet another version of the
10187 algorithm...now per Jean-Marc's suggestions.
10189 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10191 * src/layout.C (less_textclass_desc): functor for use in sorting
10193 (LyXTextClass::Read): sort the textclasses after reading.
10195 * src/support/filetools.C (SpaceLess): new version of the
10196 SpaceLess functions. What problems does this one give? Please
10199 * images/banner_bw.xbm: made the arrays unsigned char *
10201 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10203 * src/support/lyxstring.C (find): remove bogus assertion in the
10204 two versions of find where this has not been done yet.
10206 * src/support/lyxlib.h: add missing int return type to
10209 * src/menus.C (ShowFileMenu): disable exporting to html if no
10210 html export command is present.
10212 * config/lib_configure.m4: add a test for an HTML converter. The
10213 programs checked for are, in this order: tth, latex2html and
10216 * lib/configure: generated from config/lib_configure.m4.
10218 * src/lyxfunc.C (Dispatch): update and improve the execution of an
10219 html converter. The parameters are now passed through $$FName and
10220 $$OutName, instead of standard input/output.
10222 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
10224 * lib/lyxrc.example: update description of \html_command.
10225 add "quotes" around \screen_font_xxx font setting examples to help
10226 people who use fonts with spaces in their names.
10228 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10230 * Distribution files: updates for v1.1.2
10232 * src/support/lyxstring.C (find): remove bogus assert and return
10233 npos for the same condition.
10235 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10237 * added patch for OS/2 from SMiyata.
10239 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10241 * src/text2.C (CutSelection): make space_wrapped a bool
10242 (CutSelection): dont declare int i until we have to.
10243 (alphaCounter): return a char const *.
10245 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10247 * src/support/syscall.C (Systemcalls::kill):
10248 src/support/filetools.C (PutEnv, PutEnvPath):
10249 src/lyx_cb.C (addNewlineAndDepth):
10250 src/FontInfo.C (FontInfo::resize): condition some #warning
10251 directives with WITH_WARNINGS.
10254 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10256 * src/layout.[Ch] + several files: access to class variables
10257 limited and made accessor functions instead a lot of code changed
10258 becuase of this. Also instead of returning pointers often a const
10259 reference is returned instead.
10261 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
10263 * src/Makefile.am (dist-hook): added used to remove the CVS from
10264 cheaders upon creating a dist
10265 (EXTRA_DIST): added cheaders
10267 * src/support/lstrings.C (tostr(char)): fix it to handle param as
10268 a character not as a small integer.
10270 * src/support/lyxstring.C (find): removed Assert and added i >=
10271 rep->sz to the first if.
10273 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10275 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
10276 src/LyXView.C src/buffer.C src/bufferparams.C
10277 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
10278 src/text2.C src/insets/insetinclude.C:
10279 lyxlayout renamed to textclasslist.
10281 * src/layout.C: some lyxerr changes.
10283 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
10284 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
10285 (LyXLayoutList): removed all traces of this class.
10286 (LyXTextClass::Read): rewrote LT_STYLE
10287 (LyXTextClass::hasLayout): new function
10288 (LyXTextClass::GetLayout): rewritten to return an iterator + has
10289 both const and nonconst version.
10290 (LyXTextClass::delete_layout): new function.
10291 (LyXTextClassList::Style): bug fix. do the right thing if layout
10293 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
10294 (LyXTextClassList::NameOfLayout): ditto
10295 (LyXTextClassList::Load): ditto
10297 * src/buffer.C (makeLaTeXFile): new access to layoutlist
10299 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
10301 * src/LyXAction.C (LookupFunc): added a workaround for sun
10302 compiler, on the other hand...we don't know if the current code
10303 compiles on sun at all...
10305 * src/support/filetools.C (CleanupPath): subst fix
10307 * src/insets/insetbib.C (delDatabase): subst fix, this looks
10310 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
10311 complained about this one?
10313 * src/insets/insetinclude.C (Latex): subst fix
10315 * src/insets/insetbib.C (getKeys): subst fix
10317 * src/LyXSendto.C (SendtoApplyCB): subst fix
10319 * src/lyx_main.C (init): subst fix
10321 * src/layout.C (Read): subst fix
10323 * src/lyx_sendfax_main.C (button_send): subst fix
10325 * src/buffer.C (RoffAsciiTable): subst fix
10327 * src/lyx_cb.C (MenuFax): subst fix
10328 (PrintApplyCB): subst fix
10330 1999-10-26 Juergen Vigna <jug@sad.it>
10332 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
10334 (Read): Cleaned up this code so now we read only format vestion >= 5
10336 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10338 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
10339 come nobody has complained about this one?
10341 * src/insets/insetinclude.C (Latex): subst fix
10343 * src/insets/insetbib.C (getKeys): subst fix
10345 * src/lyx_main.C (init): subst fix
10347 * src/layout.C (Read): subst fix
10349 * src/buffer.C (RoffAsciiTable): subst fix
10351 * src/lyx_cb.C (MenuFax): subst fix.
10353 * src/layout.[hC] + some other files: rewrote to use
10354 std::container to store textclasses and layouts in.
10355 Simplified, removed a lot of code. Make all classes
10356 assignable. Further simplifications and review of type
10357 use still to be one.
10359 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
10360 lastfiles to create the lastfiles partr of the menu.
10362 * src/lastfiles.[Ch]: rewritten to use deque to store the
10363 lastfiles in. Uses fstream for reading and writing. Simplifies
10366 * src/support/syscall.C: remove explicit cast.
10368 * src/BufferView.C (CursorToggleCB): removed code snippets that
10369 were commented out.
10370 use explicat C++ style casts instead of C style casts. also use
10371 u_vdata instea of passing pointers in longs.
10373 * src/PaperLayout.C: removed code snippets that were commented out.
10375 * src/lyx_gui_misc.C: removed code snippets that were commented out.
10377 * src/lyx_main.C: removed code snippets that wer commented out.
10379 * src/paragraph.C: removed code snippets that were commented out.
10381 * src/lyxvc.C (logClose): use static_cast
10383 (viewLog): remove explicit cast to void*
10384 (showLog): removed old commented code
10386 * src/menus.C: use static_cast instead of C style casts. use
10387 u_vdata instead of u_ldata. remove explicit cast to (long) for
10388 pointers. Removed old code that was commented out.
10390 * src/insets/inset.C: removed old commented func
10392 * src/insets/insetref.C (InsetRef): removed old code that had been
10393 commented out for a long time.
10395 (escape): removed C style cast
10397 * src/insets/insetlatexaccent.C (Draw): removed old commented code
10399 * src/insets/insetlatex.C (Draw): removed old commented code
10400 (Read): rewritten to use string
10402 * src/insets/insetlabel.C (escape): removed C style cast
10404 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
10406 * src/insets/insetindex.C: use static_cast and u_vdata, removed
10407 old commented code.
10409 * src/insets/insetinclude.h: removed a couple of stupid bools
10411 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
10412 (Clone): remove C style cast
10413 (getKeys): changed list to lst because of std::list
10415 * src/insets/inseterror.C (Draw): removed som old commented code.
10417 * src/insets/insetcommand.C (Draw): removed some old commented code.
10419 * src/insets/insetbib.C (bibitem_cb): removed code that has been
10420 commented out forever.
10421 (bibitem_cb): use static_cast instead of C style cast
10422 use of vdata changed to u_vdata.
10424 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
10426 (CloseUrlCB): use static_cast instead of C style cast.
10427 (CloseUrlCB): added a fl_free form...it seemed to be missing.
10429 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
10430 (C_InsetInfo_CloseInfoCB): forward the ob parameter
10431 (CloseInfoCB): static_cast from ob->u_vdata instead.
10432 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
10435 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
10436 (C_InsetError_CloseErrorCB): forward the ob parameter
10437 (CloseErrorCB): static_cast from ob->u_vdata instead.
10439 * src/vspace.h: include LString.h since we use string in this class.
10441 * src/vspace.C (lyx_advance): changed name from advance because of
10442 nameclash with stl. And since we cannot use namespaces yet...I
10443 used a lyx_ prefix instead. Expect this to change when we begin
10446 * src/BufferView.[Ch] (BufferView::~BufferView): removed
10448 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
10449 and removed now defunct constructor and deconstructor.
10451 * src/BufferView.h: have backstack as a object not as a pointer.
10452 removed initialization from constructor. added include for BackStack
10454 * development/lyx.spec.in (%build): add CFLAGS also.
10456 * src/screen.C (drawFrame): removed another warning.
10458 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10460 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
10461 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
10462 README and ANNOUNCE a bit for the next release. More work is
10465 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
10466 unbreakable if we are in freespacing mode (LyX-Code), but not in
10469 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10471 * src/BackStack.h: fixed initialization order in constructor
10473 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
10475 * acinclude.m4 (VERSION): new rules for when a version is
10476 development, added also a variable for prerelease.
10477 (warnings): we set with_warnings=yes for prereleases
10478 (lyx_opt): prereleases compile with same optimization as development
10479 (CXXFLAGS): only use pedantic if we are a development version
10481 * src/BufferView.C (restorePosition): don't do anything if the
10482 backstack is empty.
10484 * src/BackStack.h: added member empty, use this to test if there
10485 is anything to pop...
10487 1999-10-25 Juergen Vigna <jug@sad.it>
10490 * forms/layout_forms.fd +
10491 * forms/latexoptions.fd +
10492 * lyx.fd: changed for various form resize issues
10494 * src/mathed/math_panel.C +
10495 * src/insets/inseterror.C +
10496 * src/insets/insetinfo.C +
10497 * src/insets/inseturl.C +
10498 * src/insets/inseturl.h +
10500 * src/LyXSendto.C +
10501 * src/PaperLayout.C +
10502 * src/ParagraphExtra.C +
10503 * src/TableLayout.C +
10505 * src/layout_forms.C +
10512 * src/menus.C: fixed various resize issues. So now forms can be
10513 resized savely or not be resized at all.
10515 * forms/form_url.fd +
10516 * src/insets/form_url.[Ch]: added because it's cleaner and easier
10519 * src/insets/Makefile.am: added files form_url.[Ch]
10521 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10523 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
10524 (and presumably 6.2).
10526 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
10527 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
10528 remaining static member callbacks.
10530 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
10533 * src/support/lyxstring.h: declare struct Srep as friend of
10534 lyxstring, since DEC cxx complains otherwise.
10536 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10538 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10540 * src/LaTeX.C (run): made run_bibtex also depend on files with
10542 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
10543 are put into the dependency file.
10545 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
10546 the code has shown itself to work
10547 (create_ispell_pipe): removed another warning, added a comment
10550 * src/minibuffer.C (ExecutingCB): removed code that has been
10551 commented out a long time
10553 * src/lyxfunc.C (processKeyEvent): removed some very old commented
10554 out code + a warning.
10556 * src/support/lyxstring.h: comment out the three private
10557 operators, when compiling with string ansi conforming compilers
10558 they make problems.
10560 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
10562 (pixmapFromBitmapData): change type of bdata to be unsigned char *
10563 (pixmapFromBitmapData): add a reinterpret_cast in the call to
10566 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
10569 * src/mathed/math_panel.C (create_math_panel): remove explicit
10572 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
10575 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
10576 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
10577 to XCreatePixmapFromBitmapData
10578 (fl_set_bmtable_data): change the last argument to be unsigned
10580 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
10581 and bh to be unsigned int, remove explicit casts in call to
10582 XReadBitmapFileData.
10584 * images/arrows.xbm: made the arrays unsigned char *
10585 * images/varsz.xbm: ditto
10586 * images/misc.xbm: ditto
10587 * images/greek.xbm: ditto
10588 * images/dots.xbm: ditto
10589 * images/brel.xbm: ditto
10590 * images/bop.xbm: ditto
10592 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
10594 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
10595 (LYX_PROG_CXX): added -pedantic to g++ compile options when
10596 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
10598 (LYX_CXX_CHEADERS): added <clocale> to the test.
10600 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
10602 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
10604 * src/support/lyxstring.C (append): fixed something that must be a
10605 bug, rep->assign was used instead of rep->append.
10607 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
10610 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
10611 lyx insert double chars. Fix spotted by Kayvan.
10613 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10615 * Fixed the tth support. I messed up with the Emacs patch apply feature
10616 and omitted the changes in lyxrc.C.
10618 1999-10-22 Juergen Vigna <jug@sad.it>
10620 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
10622 * src/lyx_cb.C (MenuInsertRef) +
10623 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
10624 the form cannot be resized under it limits (fixes a segfault)
10626 * src/lyx.C (create_form_form_ref) +
10627 * forms/lyx.fd: Changed Gravity on name input field so that it is
10630 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10632 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
10633 <ostream> and <istream>.
10635 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
10636 whether <fstream> provides the latest standard features, or if we
10637 have an oldstyle library (like in egcs).
10638 (LYX_CXX_STL_STRING): fix the test.
10640 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
10641 code on MODERN_STL_STREAM.
10643 * src/support/lyxstring.h: use L{I,O}stream.h.
10645 * src/support/L{I,O}stream.h: new files, designed to setup
10646 correctly streams for our use
10647 - includes the right header depending on STL capabilities
10648 - puts std::ostream and std::endl (for LOStream.h) or
10649 std::istream (LIStream.h) in toplevel namespace.
10651 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10653 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
10654 was a bib file that had been changed we ensure that bibtex is run.
10655 (runBibTeX): enhanced to extract the names of the bib files and
10656 getting their absolute path and enter them into the dep file.
10657 (findtexfile): static func that is used to look for tex-files,
10658 checks for absolute patchs and tries also with kpsewhich.
10659 Alternative ways of finding the correct files are wanted. Will
10661 (do_popen): function that runs a command using popen and returns
10662 the whole output of that command in a string. Should be moved to
10665 * src/DepTable.[Ch] (extchanged): new function that returns true if a
10666 file with extension ext has changed.
10668 * src/insets/figinset.C: added ifdef guards around the fl_free
10669 code that jug commented out. Now it is commented out when
10670 compiling with XForms == 0.89.
10672 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
10673 to lyxstring.C, and only keep a forward declaration in
10674 lyxstring.h. Simplifies the header file a bit and should help a
10675 bit on compile time too. Also changes to Srep will not mandate a
10676 recompile of code just using string.
10677 (~lyxstring): definition moved here since it uses srep.
10678 (size): definition moved here since it uses srep.
10680 * src/support/lyxstring.h: removed a couple of "inline" that should
10683 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10685 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
10688 1999-10-21 Juergen Vigna <jug@sad.it>
10690 * src/table.C (SetPWidth): Just a small fix so the alignment is not
10691 set to left if I just remove the width entry (or it is empty).
10693 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
10694 paragraph when having dummy paragraphs.
10696 1999-10-20 Juergen Vigna <jug@sad.it>
10698 * src/insets/figinset.C: just commented some fl_free_form calls
10699 and added warnings so that this calls should be activated later
10700 again. This avoids for now a segfault, but we have a memory leak!
10702 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
10703 'const char * argument' to 'string argument', this should
10704 fix some Asserts() in lyxstring.C.
10706 * src/lyxfunc.h: Removed the function argAsString(const char *)
10707 as it is not used anymore.
10709 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10711 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
10714 * src/Literate.h: some funcs moved from public to private to make
10715 interface clearer. Unneeded args removed.
10717 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
10719 (scanBuildLogFile): ditto
10721 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
10722 normal TeX Error. Still room for improvement.
10724 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
10726 * src/buffer.C (insertErrors): changes to make the error
10727 desctription show properly.
10729 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
10732 * src/support/lyxstring.C (helper): changed to use
10733 sizeof(object->rep->ref).
10734 (operator>>): changed to use a pointer instead.
10736 * src/support/lyxstring.h: changed const reference & to value_type
10737 const & lets see if that helps.
10739 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10741 * Makefile.am (rpmdist): fixed to have non static package and
10744 * src/support/lyxstring.C: removed the compilation guards
10746 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
10749 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
10750 conditional compile of lyxstring.Ch
10752 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
10753 stupid check, but it is a lot better than the bastring hack.
10754 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
10756 * several files: changed string::erase into string::clear. Not
10759 * src/chset.C (encodeString): use a char temporary instead
10761 * src/table.C (TexEndOfCell): added tostr around
10762 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
10763 (TexEndOfCell): ditto
10764 (TexEndOfCell): ditto
10765 (TexEndOfCell): ditto
10766 (DocBookEndOfCell): ditto
10767 (DocBookEndOfCell): ditto
10768 (DocBookEndOfCell): ditto
10769 (DocBookEndOfCell): ditto
10771 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
10773 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
10775 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
10776 (MenuBuildProg): added tostr around ret
10777 (MenuRunChktex): added tostr around ret
10778 (DocumentApplyCB): added tostr around ret
10780 * src/chset.C (encodeString): added tostr around t->ic
10782 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
10783 (makeLaTeXFile): added tostr around tocdepth
10784 (makeLaTeXFile): added tostr around ftcound - 1
10786 * src/insets/insetbib.C (setCounter): added tostr around counter.
10788 * src/support/lyxstring.h: added an operator+=(int) to catch more
10791 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
10792 (lyxstring): We DON'T allow NULL pointers.
10794 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10796 * src/mathed/math_macro.C (MathMacroArgument::Write,
10797 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
10798 when writing them out.
10800 * src/LString.C: remove, since it is not used anymore.
10802 * src/support/lyxstring.C: condition the content to
10803 USE_INCLUDED_STRING macro.
10805 * src/mathed/math_symbols.C, src/support/lstrings.C,
10806 src/support/lyxstring.C: add `using' directive to specify what
10807 we need in <algorithm>. I do not think that we need to
10808 conditionalize this, but any thought is appreciated.
10810 * many files: change all callback functions to "C" linkage
10811 functions to please strict C++ compilers like DEC cxx 6.1 in mode
10812 strict_ansi. Those who were static are now global.
10813 The case of callbacks which are static class members is
10814 trickier, since we have to make C wrappers around them (see
10815 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
10816 did not finish this yet, since it defeats the purpose of
10817 encapsulation, and I am not sure what the best route is.
10819 1999-10-19 Juergen Vigna <jug@sad.it>
10821 * src/support/lyxstring.C (lyxstring): we permit to have a null
10822 pointer as assignment value and just don't assign it.
10824 * src/vspace.C (nextToken): corrected this function substituting
10825 find_first(_not)_of with find_last_of.
10827 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
10828 (TableOptCloseCB) (TableSpeCloseCB):
10829 inserted fl_set_focus call for problem with fl_hide_form() in
10832 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10834 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
10837 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10839 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
10840 LyXLex::next() and not eatline() to get its argument.
10842 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10844 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
10845 instead, use fstreams for io of the depfile, removed unneeded
10846 functions and variables.
10848 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
10849 vector instead, removed all functions and variables that is not in
10852 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10854 * src/buffer.C (insertErrors): use new interface to TeXError
10856 * Makefile.am (rpmdist): added a rpmdist target
10858 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
10859 per Kayvan's instructions.
10861 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10863 * src/Makefile.am: add a definition for localedir, so that locales
10864 are found after installation (Kayvan)
10866 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10868 * development/.cvsignore: new file.
10870 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10872 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
10873 C++ compiler provides wrappers for C headers and use our alternate
10876 * configure.in: use LYX_CXX_CHEADERS.
10878 * src/cheader/: new directory, populated with cname headers from
10879 libstdc++-2.8.1. They are a bit old, but probably good enough for
10880 what we want (support compilers who lack them).
10882 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
10883 from includes. It turns out is was stupid.
10885 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10887 * lib/Makefile.am (install-data-local): forgot a ';'
10888 (install-data-local): forgot a '\'
10889 (libinstalldirs): needed after all. reintroduced.
10891 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10893 * configure.in (AC_OUTPUT): added lyx.spec
10895 * development/lyx.spec: removed file
10897 * development/lyx.spec.in: new file
10899 * po/*.po: merged with lyx.pot becuase of make distcheck
10901 * lib/Makefile.am (dist-hook): added dist-hook so that
10902 documentation files will be included when doing a make
10903 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
10904 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
10906 more: tried to make install do the right thing, exclude CVS dirs
10909 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
10910 Path would fit in more nicely.
10912 * all files that used to use pathstack: uses now Path instead.
10913 This change was a lot easier than expected.
10915 * src/support/path.h: new file
10917 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
10919 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
10921 * src/support/lyxstring.C (getline): Default arg was given for
10924 * Configure.cmd: removed file
10926 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10928 * src/support/DebugStream.[Ch]: remove the explicit std:: before
10929 streams classes and types, add the proper 'using' statements when
10930 MODERN_STL is defined.
10932 * src/debug.h: move the << operator definition after the inclusion
10935 * src/support/filetools.C: include "LAssert.h", which is needed
10938 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
10941 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
10942 include "debug.h" to define a proper ostream.
10944 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10946 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
10947 method to the SystemCall class which can kill a process, but it's
10948 not fully implemented yet.
10950 * src/*.C: Changed Systemcalls::Startscript() to startscript()
10952 * src/support/FileInfo.h: Better documentation
10954 * src/lyxfunc.C: Added support for buffer-export html
10956 * src/menus.C: Added Export->As HTML...
10958 * lib/bind/*.bind: Added short-cut for buffer-export html
10960 * src/lyxrc.*: Added support for new \tth_command
10962 * lib/lyxrc.example: Added stuff for new \tth_command
10964 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10966 * lib/Makefile.am (IMAGES): removed images/README
10967 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
10968 installes in correct place. Check permisions is installed
10971 * src/LaTeX.C: some no-op changes moved declaration of some
10974 * src/LaTeX.h (LATEX_H): changed include guard name
10976 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10978 * lib/reLyX/Makefile.am: install noweb2lyx.
10980 * lib/Makefile.am: install configure.
10982 * lib/reLyX/configure.in: declare a config aux dir; set package
10983 name to lyx (not sure what the best solution is); generate noweb2lyx.
10985 * lib/layouts/egs.layout: fix the bibliography layout.
10987 1999-10-08 Jürgen Vigna <jug@sad.it>
10989 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
10990 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
10991 it returned without continuing to search the path.
10993 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10995 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
10996 also fixes a bug. It is not allowed to do tricks with std::strings
10997 like: string a("hei"); &a[e]; this will not give what you
10998 think... Any reason for the complexity in this func?
11000 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
11002 * Updated README and INSTALL a bit, mostly to check that my
11003 CVS rights are correctly set up.
11005 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
11007 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
11008 does not allow '\0' chars but lyxstring and std::string does.
11010 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11012 * autogen.sh (AUTOCONF): let the autogen script create the
11013 POTFILES.in file too. POTFILES.in should perhaps now not be
11014 included in the cvs module.
11016 * some more files changed to use C++ includes instead of C ones.
11018 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
11020 (Reread): added tostr to nlink. buggy output otherwise.
11021 (Reread): added a string() around szMode when assigning to Buffer,
11022 without this I got a log of garbled info strings.
11024 * acconfig.h: commented out the PTR_AS_INT macros. They should not
11027 * I have added several ostream & operator<<(ostream &, some_type)
11028 functions. This has been done to avoid casting and warnings when
11029 outputting enums to lyxerr. This as thus eliminated a lot of
11030 explicit casts and has made the code clearer. Among the enums
11031 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
11032 mathed enums, some font enum the Debug::type enum.
11034 * src/support/lyxstring.h (clear): missing method. equivalent of
11037 * all files that contained "stderr": rewrote constructs that used
11038 stderr to use lyxerr instead. (except bmtable)
11040 * src/support/DebugStream.h (level): and the passed t with
11041 Debug::ANY to avoid spurious bits set.
11043 * src/debug.h (Debug::type value): made it accept strings of the
11044 type INFO,INIT,KEY.
11046 * configure.in (Check for programs): Added a check for kpsewhich,
11047 the latex generation will use this later to better the dicovery of
11050 * src/BufferView.C (create_view): we don't need to cast this to
11051 (void*) that is done automatically.
11052 (WorkAreaButtonPress): removed some dead code.
11054 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11056 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
11057 is not overwritten when translated (David Sua'rez de Lis).
11059 * lib/CREDITS: Added David Sua'rez de Lis
11061 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
11063 * src/bufferparams.C (BufferParams): default input encoding is now
11066 * acinclude.m4 (cross_compiling): comment out macro
11067 LYX_GXX_STRENGTH_REDUCE.
11069 * acconfig.h: make sure that const is not defined (to empty) when
11070 we are compiling C++. Remove commented out code using SIZEOF_xx
11073 * configure.in : move the test for const and inline as late as
11074 possible so that these C tests do not interefere with C++ ones.
11075 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
11076 has not been proven.
11078 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11080 * src/table.C (getDocBookAlign): remove bad default value for
11081 isColumn parameter.
11083 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
11085 (ShowFileMenu2): ditto.
11087 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
11088 of files to ignore.
11090 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11092 * Most files: finished the change from the old error code to use
11093 DebugStream for all lyxerr debugging. Only minor changes remain
11094 (e.g. the setting of debug levels using strings instead of number)
11096 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11098 * src/layout.C (Add): Changed to use compare_no_case instead of
11101 * src/FontInfo.C: changed loop variable type too string::size_type.
11103 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11105 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
11106 set ETAGS_ARGS to --c++
11108 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
11110 * src/table.C (DocBookEndOfCell): commented out two unused variables
11112 * src/paragraph.C: commented out four unused variables.
11114 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
11115 insed a if clause with type string::size_type.
11117 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
11120 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
11122 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
11123 variable, also changed loop to go from 0 to lenght + 1, instead of
11124 -1 to length. This should be correct.
11126 * src/LaTeX.C (scanError): use string::size_type as loop variable
11129 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
11130 (l.896) since y_tmp and row was not used anyway.
11132 * src/insets/insetref.C (escape): use string::size_type as loop
11135 * src/insets/insetquotes.C (Width): use string::size_type as loop
11137 (Draw): use string::size_type as loop variable type.
11139 * src/insets/insetlatexaccent.C (checkContents): use
11140 string::size_type as loop variable type.
11142 * src/insets/insetlabel.C (escape): use string::size_type as loop
11145 * src/insets/insetinfo.C: added an extern for current_view.
11147 * src/insets/insetcommand.C (scanCommand): use string::size_type
11148 as loop variable type.
11150 * most files: removed the RCS tags. With them we had to recompile
11151 a lot of files after a simple cvs commit. Also we have never used
11152 them for anything meaningful.
11154 * most files: tags-query-replace NULL 0. As adviced several plases
11155 we now use "0" instead of "NULL" in our code.
11157 * src/support/filetools.C (SpaceLess): use string::size_type as
11158 loop variable type.
11160 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11162 * src/paragraph.C: fixed up some more string stuff.
11164 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11166 * src/support/filetools.h: make modestr a std::string.
11168 * src/filetools.C (GetEnv): made ch really const.
11170 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
11171 made code that used these use max/min from <algorithm> instead.
11173 * changed several c library include files to their equivalent c++
11174 library include files. All is not changed yet.
11176 * created a support subdir in src, put lyxstring and lstrings
11177 there + the extra files atexit, fileblock, strerror. Created
11178 Makefile.am. edited configure.in and src/Makefile.am to use this
11179 new subdir. More files moved to support.
11181 * imported som of the functions from repository lyx, filetools
11183 * ran tags-query-replace on LString -> string, corrected the bogus
11184 cases. Tried to make use of lstrings.[hC], debugged a lot. There
11185 is still some errors in there. This is errors where too much or
11186 too litle get deleted from strings (string::erase, string::substr,
11187 string::replace), there can also be some off by one errors, or
11188 just plain wrong use of functions from lstrings. Viewing of quotes
11191 * LyX is now running fairly well with string, but there are
11192 certainly some bugs yet (see above) also string is quite different
11193 from LString among others in that it does not allow null pointers
11194 passed in and will abort if it gets any.
11196 * Added the revtex4 files I forgot when setting up the repository.
11198 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11200 * All over: Tried to clean everything up so that only the files
11201 that we really need are included in the cvs repository.
11202 * Switched to use automake.
11203 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
11204 * Install has not been checked.
11206 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11208 * po/pt.po: Three errors:
11209 l.533 and l.538 format specification error
11210 l. 402 duplicate entry, I just deleted it.