1 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3 * src/buffer.C (readFile): make sure that the whole version number
4 is read after \lyxformat (even when it contains a comma)
6 * lib/ui/default.ui: change shortcut of math menu to M-a.
8 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10 * src/vspace.C (nextToken): use isStrDbl() to check for proper
13 * src/LyXView.C (updateWindowTitle): show the full files name in
14 window title, limited to 30 characters.
16 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
17 When a number of characters has been given, we should not assume
18 that the string is 0-terminated.
20 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
21 calls (fixes some memory leaks)
23 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
26 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
28 * src/converter.C (GetReachable): fix typo.
30 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
31 understand ',' instead of '.'.
32 (GetInteger): rewrite to use strToInt().
34 2000-09-26 Juergen Vigna <jug@sad.it>
36 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
37 better visibility and error-message on wrong VSpace input.
39 * src/language.C (initL): added english again.
41 2000-09-25 Juergen Vigna <jug@sad.it>
43 * src/frontends/kde/Dialogs.C (Dialogs):
44 * src/frontends/gnome/Dialogs.C (Dialogs):
45 * src/frontends/kde/Makefile.am:
46 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
48 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
50 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
52 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
54 * src/frontends/xforms/FormParagraph.C:
55 * src/frontends/xforms/FormParagraph.h:
56 * src/frontends/xforms/form_paragraph.C:
57 * src/frontends/xforms/form_paragraph.h:
58 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
61 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
63 * src/tabular.C (OldFormatRead): forgot to delete the temporary
64 Paragraph-Data after use.
66 * src/insets/insettext.C (LocalDispatch): don't set the layout on
67 non breakable paragraphs.
69 2000-09-25 Garst R. Reese <reese@isn.net>
71 * src/language.C (initL): added missing language_country codes.
73 2000-09-25 Juergen Vigna <jug@sad.it>
75 * src/insets/insettext.C (InsetText):
76 (deleteLyXText): remove the not released LyXText structure!
78 2000-09-24 Marko Vendelin <markov@ioc.ee>
80 * src/frontends/gnome/mainapp.C
81 * src/frontends/gnome/mainapp.h: added support for keyboard
84 * src/frontends/gnome/FormCitation.C
85 * src/frontends/gnome/FormCitation.h
86 * src/frontends/gnome/Makefile.am
87 * src/frontends/gnome/pixbutton.h: completed the rewrite of
88 FormCitation to use "action area" in mainapp window
90 * src/frontends/gnome/Menubar_pimpl.C
91 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
94 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
96 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
97 width/descent/ascent values if name is empty.
98 (mathed_string_height): Use std::max.
100 2000-09-25 Allan Rae <rae@lyx.org>
102 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
103 segfault. This will be completely redesigned soon.
105 * sigc++: updated libsigc++. Fixes struct timespec bug.
107 * development/tools/makeLyXsigc.sh: .cvsignore addition
109 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
111 * several files: removed almost all traces of the old table
114 * src/TableLayout.C: removed file
116 2000-09-22 Juergen Vigna <jug@sad.it>
118 * src/frontends/kde/Dialogs.C: added credits forms.
120 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
122 * src/frontends/gnome/Dialogs.C: added some forms.
124 * src/spellchecker.C (init_spell_checker): set language in pspell code
125 (RunSpellChecker): some modifications for setting language string.
127 * src/language.[Ch]: added language_country code.
129 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
131 * src/frontends/Dialogs.h: added new signal showError.
132 Rearranged existing signals in some sort of alphabetical order.
134 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
135 FormError.[Ch], form_error.[Ch]
136 * src/frontends/xforms/forms/makefile: added new file form_error.fd
137 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
139 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
140 dialogs. I think that this can be used as the base to all these
143 * src/frontends/xforms/FormError.[Ch]
144 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
145 implementation of InsetError dialog.
147 * src/insets/inseterror.[Ch]: rendered GUI-independent.
149 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
150 * src/frontends/kde/Makefile.am: ditto
152 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
154 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
155 macrobf. This fixes a bug of invisible text.
157 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
159 * lib/doc/LaTeXConfig.lyx.in: updated.
161 * src/language.C (initL): remove language "francais" and change a
162 bit the names of the two other french variations.
164 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
165 string that may not be 0-terminated.
167 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
169 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
171 2000-09-20 Marko Vendelin <markov@ioc.ee>
173 * src/frontends/gnome/FormCitation.C
174 * src/frontends/gnome/FormIndex.C
175 * src/frontends/gnome/FormToc.C
176 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
177 the variable initialization to shut up the warnings
179 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
181 * src/table.[Ch]: deleted files
183 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
186 2000-09-18 Juergen Vigna <jug@sad.it>
188 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
189 problems with selection. Inserted new LFUN_PASTESELECTION.
190 (InsetButtonPress): inserted handling of middle mouse-button paste.
192 * src/spellchecker.C: changed word to word.c_str().
194 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
196 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
197 included in the ``make dist'' tarball.
199 2000-09-15 Juergen Vigna <jug@sad.it>
201 * src/CutAndPaste.C (cutSelection): small fix return the right
202 end position after cut inside one paragraph only.
204 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
205 we are locked as otherwise we don't have a valid cursor position!
207 * src/insets/figinset.C (draw): small bugfix but why is this needed???
209 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
211 * src/frontends/kde/FormRef.C: added using directive.
212 * src/frontends/kde/FormToc.C: ditto
214 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
216 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
219 2000-09-19 Marko Vendelin <markov@ioc.ee>
221 * src/frontends/gnome/Menubar_pimpl.C
222 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
223 Toc, ViewFormats, UpdateFormats, and ExportFormats.
225 * src/frontends/gnome/mainapp.C
226 * src/frontends/gnome/mainapp.h: support for menu update used
229 * src/frontends/gnome/mainapp.C
230 * src/frontends/gnome/mainapp.h: support for "action" area in the
231 main window. This area is used by small simple dialogs, such as
234 * src/frontends/gnome/FormIndex.C
235 * src/frontends/gnome/FormIndex.h
236 * src/frontends/gnome/FormUrl.C
237 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
240 * src/frontends/gnome/FormCitation.C
241 * src/frontends/gnome/FormCitation.h: rewrite to use main window
242 action area. Only "Insert new citation" is implemented.
246 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
248 * src/buffer.C (Dispatch): fix call to Dispatch
249 * src/insets/insetref.C (Edit): likewise
250 * src/insets/insetparent.C (Edit): likewise
251 * src/insets/insetinclude.C (include_cb): likewise
252 * src/frontends/xforms/FormUrl.C (apply): likewise
253 * src/frontends/xforms/FormToc.C (apply): likewise
254 * src/frontends/xforms/FormRef.C (apply): likewise
255 * src/frontends/xforms/FormIndex.C (apply): likewise
256 * src/frontends/xforms/FormCitation.C (apply): likewise
257 * src/lyxserver.C (callback): likewise
258 * src/lyxfunc.C (processKeySym): likewise
261 * src/lyx_cb.C (LayoutsCB): likewise
263 * Makefile.am (sourcedoc): small change
265 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
267 * src/main.C (main): Don't make an empty GUIRunTime object. all
268 methods are static. constify a bit remove unneded using + headers.
270 * src/tabular.C: some more const to local vars move some loop vars
272 * src/spellchecker.C: added some c_str after some word for pspell
274 * src/frontends/GUIRunTime.h: add new static method setDefaults
275 * src/frontends/xforms/GUIRunTime.C (setDefaults):
276 * src/frontends/kde/GUIRunTime.C (setDefaults):
277 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
279 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
280 with strnew in arg, use correct emptystring when calling SetName.
282 * several files: remove all commented code with relation to
283 HAVE_SSTREAM beeing false. We now only support stringstream and
286 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
288 * src/lyxfunc.C: construct correctly the automatic new file
291 * src/text2.C (IsStringInText): change type of variable i to shut
294 * src/support/sstream.h: do not use namespaces if the compiler
295 does not support them.
297 2000-09-15 Marko Vendelin <markov@ioc.ee>
298 * src/frontends/gnome/FormCitation.C
299 * src/frontends/gnome/FormCitation.h
300 * src/frontends/gnome/diainsertcitation_interface.c
301 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
302 regexp support to FormCitation [Gnome].
304 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
307 * configure.in: remove unused KDE/GTKGUI define
309 * src/frontends/kde/FormRef.C
310 * src/frontends/kde/FormRef.h
311 * src/frontends/kde/formrefdialog.C
312 * src/frontends/kde/formrefdialog.h: double click will
313 go to reference, now it is possible to change a cross-ref
316 * src/frontends/kde/FormToc.C
317 * src/frontends/kde/FormToc.h
318 * src/frontends/kde/formtocdialog.C
319 * src/frontends/kde/formtocdialog.h: add a depth
322 * src/frontends/kde/Makefile.am: add QtLyXView.h
325 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
327 * src/frontends/kde/FormCitation.h: added some using directives.
329 * src/frontends/kde/FormToc.h: corrected definition of doTree.
331 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
334 * src/mathed/math_defs.h: redefine SetAlign to use string rather
337 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
339 * src/buffer.C (pop_tag): revert for the second time a change by
340 Lars, who seems to really hate having non-local loop variables :)
342 * src/Lsstream.h: add "using" statements.
344 * src/support/copy.C (copy): add a bunch of std:: qualifiers
345 * src/buffer.C (writeFile): ditto
347 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
349 * src/buffer.C (writeFile): try to fix the locale modified format
350 number to always be as we want it.
352 * src/WorkArea.C (work_area_handler): try to workaround the bugs
353 in XForms 0.89. C-space is now working again.
355 * src/Lsstream.h src/support/sstream.h: new files.
357 * also commented out all cases where strstream were used.
359 * src/Bullet.h (c_str): remove method.
361 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
363 * a lot of files: get rid of "char const *" and "char *" is as
364 many places as possible. We only want to use them in interaction
365 with system of other libraries, not inside lyx.
367 * a lot of files: return const object is not of pod type. This
368 helps ensure that temporary objects is not modified. And fits well
369 with "programming by contract".
371 * configure.in: check for the locale header too
373 * Makefile.am (sourcedoc): new tag for generation of doc++
376 2000-09-14 Juergen Vigna <jug@sad.it>
378 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
379 callback to check which combo called it and do the right action.
381 * src/combox.C (combo_cb): added combo * to the callbacks.
382 (Hide): moved call of callback after Ungrab of the pointer.
384 * src/intl.h: removed LCombo2 function.
386 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
387 function as this can now be handled in one function.
389 * src/combox.h: added Combox * to callback prototype.
391 * src/frontends/xforms/Toolbar_pimpl.C:
392 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
394 2000-09-14 Garst Reese <reese@isn.net>
396 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
397 moved usepackage{xxx}'s to beginning of file. Changed left margin
398 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
399 underlining from title. Thanks to John Culleton for useful suggestions.
401 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
403 * src/lyxlex_pimpl.C (setFile): change error message to debug
406 2000-09-13 Juergen Vigna <jug@sad.it>
408 * src/frontends/xforms/FormDocument.C: implemented choice_class
409 as combox and give callback to combo_language so OK/Apply is activated
412 * src/bufferlist.C (newFile): small fix so already named files
413 (via an open call) are not requested to be named again on the
416 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
418 * src/frontends/kde/Makefile.am
419 * src/frontends/kde/FormRef.C
420 * src/frontends/kde/FormRef.h
421 * src/frontends/kde/formrefdialog.C
422 * src/frontends/kde/formrefdialog.h: implement
425 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
427 * src/frontends/kde/formtocdialog.C
428 * src/frontends/kde/formtocdialog.h
429 * src/frontends/kde/FormToc.C
430 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
432 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
434 * src/frontends/kde/FormCitation.C: fix thinko
435 where we didn't always display the reference text
438 * src/frontends/kde/formurldialog.C
439 * src/frontends/kde/formurldialog.h
440 * src/frontends/kde/FormUrl.C
441 * src/frontends/kde/FormUrl.h: minor cleanups
443 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
445 * src/frontends/kde/Makefile.am
446 * src/frontends/kde/FormToc.C
447 * src/frontends/kde/FormToc.h
448 * src/frontends/kde/FormCitation.C
449 * src/frontends/kde/FormCitation.h
450 * src/frontends/kde/FormIndex.C
451 * src/frontends/kde/FormIndex.h
452 * src/frontends/kde/formtocdialog.C
453 * src/frontends/kde/formtocdialog.h
454 * src/frontends/kde/formcitationdialog.C
455 * src/frontends/kde/formcitationdialog.h
456 * src/frontends/kde/formindexdialog.C
457 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
459 2000-09-12 Juergen Vigna <jug@sad.it>
461 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
464 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
466 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
469 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
471 * src/converter.C (Add, Convert): Added support for converter flags:
472 needaux, resultdir, resultfile.
473 (Convert): Added new parameter view_file.
474 (dvips_options): Fixed letter paper option.
476 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
477 (Export, GetExportableFormats, GetViewableFormats): Added support
480 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
482 (easyParse): Fixed to work with new export code.
484 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
487 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
489 * lib/bind/*.bind: Replaced
490 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
491 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
493 2000-09-11 Juergen Vigna <jug@sad.it>
495 * src/lyx_gui.C (runTime): uses global guiruntime variable.
497 * src/main.C (main): now GUII defines global guiruntime!
499 * src/frontends/gnome/GUIRunTime.C (initApplication):
500 * src/frontends/kde/GUIRunTime.C (initApplication):
501 * src/frontends/xforms/GUIRunTime.C (initApplication):
502 * src/frontends/GUIRunTime.h: added new function initApplication.
504 * src/spellchecker.C (sc_accept_word): change to add_to_session.
506 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
508 2000-09-08 Juergen Vigna <jug@sad.it>
510 * src/lyx_gui.C (create_forms): don't display the "default" entry as
511 we have already "Reset".
513 * src/language.C (initL): inserted "default" language and made this
514 THE default language (and not american!)
516 * src/paragraph.C: inserted handling of "default" language!
518 * src/lyxfont.C: ditto
522 * src/paragraph.C: output the \\par only if we have a following
523 paragraph otherwise it's not needed.
525 2000-09-05 Juergen Vigna <jug@sad.it>
527 * config/pspell.m4: added entry to lyx-flags
529 * src/spellchecker.C: modified version from Kevin for using pspell
531 2000-09-01 Marko Vendelin <markov@ioc.ee>
532 * src/frontends/gnome/Makefile.am
533 * src/frontends/gnome/FormCitation.C
534 * src/frontends/gnome/FormCitation.h
535 * src/frontends/gnome/diainsertcitation_callbacks.c
536 * src/frontends/gnome/diainsertcitation_callbacks.h
537 * src/frontends/gnome/diainsertcitation_interface.c
538 * src/frontends/gnome/diainsertcitation_interface.h
539 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
540 dialog for Gnome frontend
542 * src/main.C: Gnome libraries require keeping application name
543 and its version as strings
545 * src/frontends/gnome/mainapp.C: Change the name of the main window
546 from GnomeLyX to PACKAGE
548 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
550 * src/frontends/Liason.C: add "using: declaration.
552 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
554 * src/mathed/math_macro.C (Metrics): Set the size of the template
556 * src/mathed/formulamacro.C (Latex): Fixed the returned value
558 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
560 * src/converter.C (add_options): New function.
561 (SetViewer): Change $$FName into '$$FName'.
562 (View): Add options when running xdvi
563 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
564 (Convert): The 3rd parameter is now the desired filename. Converts
565 calls to lyx::rename if necessary.
566 Add options when running dvips.
567 (dvi_papersize,dvips_options): New methods.
569 * src/exporter.C (Export): Use getLatexName() instead of fileName().
571 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
572 using a call to Converter::dvips_options.
573 Fixed to work with nex export code.
576 * src/support/rename.C: New files
578 * src/support/syscall.h
579 * src/support/syscall.C: Added Starttype SystemDontWait.
581 * lib/ui/default.ui: Changed to work with new export code
583 * lib/configure.m4: Changed to work with new export code
585 * src/encoding.C: Changed latex name for iso8859_7 encoding.
587 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
589 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
590 so that code compiles with DEC cxx.
592 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
593 to work correctly! Also now supports the additional elements
596 2000-09-01 Allan Rae <rae@lyx.org>
598 * src/frontends/ButtonPolicies.C: renamed all the references to
599 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
601 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
602 since it's a const not a type.
604 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
606 2000-08-31 Juergen Vigna <jug@sad.it>
608 * src/insets/figinset.C: Various changes to look if the filename has
609 an extension and if not add it for inline previewing.
611 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
613 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
614 make buttonStatus and isReadOnly be const methods. (also reflect
615 this in derived classes.)
617 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
618 (nextState): change to be static inline, pass the StateMachine as
620 (PreferencesPolicy): remove casts
621 (OkCancelPolicy): remvoe casts
622 (OkCancelReadOnlyPolicy): remove casts
623 (NoRepeatedApplyReadOnlyPolicy): remove casts
624 (OkApplyCancelReadOnlyPolicy): remove casts
625 (OkApplyCancelPolicy): remove casts
626 (NoRepeatedApplyPolicy): remove casts
628 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
630 * src/converter.C: added some using directives
632 * src/frontends/ButtonPolicies.C: changes to overcome
633 "need lvalue" error with DEC c++
635 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
636 to WMHideCB for DEC c++
638 * src/frontends/xforms/Menubar_pimpl.C: added using directive
640 * src/frontends/xforms/forms/form_document.C.patch: use C callback
641 to BulletBMTableCB for DEC c++
643 2000-08-31 Allan Rae <rae@lyx.org>
645 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
646 character dialog separately from old document dialogs combo_language.
649 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
651 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
652 Removed LFUN_REF_CREATE.
654 * src/MenuBackend.C: Added new tags: toc and references
656 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
657 (add_lastfiles, add_documents, add_formats): Removed the unused smn
659 (add_toc, add_references): New methods.
660 (create_submenu): Handle correctly the case when there is a
661 seperator after optional menu items.
663 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
664 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
665 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
667 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
669 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
671 * src/converter.[Ch]: New file for converting between different
674 * src/export.[Ch]: New file for exporting a LyX file to different
677 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
678 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
679 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
680 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
681 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
682 RunDocBook, MenuExport.
684 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
685 Exporter::Preview methods if NEW_EXPORT is defined.
687 * src/buffer.C (Dispatch): Use Exporter::Export.
689 * src/lyxrc.C: Added new tags: \converter and \viewer.
692 * src/LyXAction.C: Define new lyx-function: buffer-update.
693 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
694 when NEW_EXPORT is defined.
696 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
698 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
700 * lib/ui/default.ui: Added submenus "view" and "update" to the
703 * src/filetools.C (GetExtension): New function.
705 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
707 2000-08-29 Allan Rae <rae@lyx.org>
709 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
711 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
712 (EnableDocumentLayout): removed
713 (DisableDocumentLayout): removed
714 (build): make use of ButtonController's read-only handling to
715 de/activate various objects. Replaces both of the above functions.
717 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
718 (readOnly): was read_only
719 (refresh): fixed dumb mistakes with read_only_ handling
721 * src/frontends/xforms/forms/form_document.fd:
722 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
723 tabbed dialogs so the tabs look more like tabs and so its easier to
724 work out which is the current tab.
726 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
727 segfault with form_table
729 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
731 2000-08-28 Juergen Vigna <jug@sad.it>
733 * acconfig.h: added USE_PSPELL.
735 * src/config.h.in: added USE_PSPELL.
737 * autogen.sh: added pspell.m4
739 * config/pspell.m4: new file.
741 * src/spellchecker.C: implemented support for pspell libary.
743 2000-08-25 Juergen Vigna <jug@sad.it>
745 * src/LyXAction.C (init): renamed LFUN_TABLE to
746 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
748 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
750 * src/lyxscreen.h: add force_clear variable and fuction to force
751 a clear area when redrawing in LyXText.
753 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
755 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
757 * some whitespace and comment changes.
759 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
761 * src/buffer.C: up te LYX_FORMAT to 2.17
763 2000-08-23 Juergen Vigna <jug@sad.it>
765 * src/BufferView_pimpl.C (tripleClick): disable this when in a
768 * src/insets/insettabular.C (pasteSelection): delete the insets
769 LyXText as it is not valid anymore.
770 (copySelection): new function.
771 (pasteSelection): new function.
772 (cutSelection): new function.
773 (LocalDispatch): implemented cut/copy/paste of cell selections.
775 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
776 don't have a LyXText.
778 * src/LyXAction.C (init): a NEW_TABULAR define too much.
780 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
783 2000-08-22 Juergen Vigna <jug@sad.it>
785 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
786 ifdef form_table out if NEW_TABULAR.
788 2000-08-21 Juergen Vigna <jug@sad.it>
790 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
791 (draw): fixed draw position so that the cursor is positioned in the
793 (InsetMotionNotify): hide/show cursor so the position is updated.
794 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
795 using cellstart() function where it should be used.
797 * src/insets/insettext.C (draw): ditto.
799 * src/tabular.C: fixed initialization of some missing variables and
800 made BoxType into an enum.
802 2000-08-22 Marko Vendelin <markov@ioc.ee>
803 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
804 stock menu item using action numerical value, not its string
808 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
810 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
811 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
813 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
815 * src/frontends/xforms/GUIRunTime.C: new file
817 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
818 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
820 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
822 * src/frontends/kde/GUIRunTime.C: new file
824 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
825 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
827 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
829 * src/frontends/gnome/GUIRunTime.C: new file
831 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
834 * src/frontends/GUIRunTime.h: removed constructor and destructor,
835 small change to documetentation.
837 * src/frontends/GUIRunTime.C: removed file
839 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
841 * src/lyxparagraph.h: enable NEW_TABULAR as default
843 * src/lyxfunc.C (processKeySym): remove some commented code
845 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
846 NEW_TABULAR around the fd_form_table_options.
848 * src/lyx_gui.C (runTime): call the static member function as
849 GUIRunTime::runTime().
851 2000-08-21 Allan Rae <rae@lyx.org>
853 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
856 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
858 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
860 2000-08-21 Allan Rae <rae@lyx.org>
862 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
864 * src/frontends/xforms/FormPreferences.C (build): use setOK
865 * src/frontends/xforms/FormDocument.C (build): use setOK
866 (FormDocument): use the appropriate policy.
868 2000-08-21 Allan Rae <rae@lyx.org>
870 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
871 automatic [de]activation of arbitrary objects when in a read-only state.
873 * src/frontends/ButtonPolicies.h: More documentation
874 (isReadOnly): added to support the above.
876 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
878 2000-08-18 Juergen Vigna <jug@sad.it>
880 * src/insets/insettabular.C (getStatus): changed to return func_status.
882 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
883 display toggle menu entries if they are.
885 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
886 new document layout now.
888 * src/lyxfunc.C: ditto
890 * src/lyx_gui_misc.C: ditto
892 * src/lyx_gui.C: ditto
894 * lib/ui/default.ui: removed paper and quotes layout as they are now
895 all in the document layout tabbed folder.
897 * src/frontends/xforms/forms/form_document.fd: added Restore
898 button and callbacks for all inputs for Allan's ButtonPolicy.
900 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
901 (CheckChoiceClass): added missing params setting on class change.
902 (UpdateLayoutDocument): added for updating the layout on params.
903 (build): forgot to RETURN_ALWAYS input_doc_spacing.
904 (FormDocument): Implemented Allan's ButtonPolicy with the
907 2000-08-17 Allan Rae <rae@lyx.org>
909 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
910 so we can at least see the credits again.
912 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
913 controller calls for the appropriate callbacks. Note that since Ok
914 calls apply followed by cancel, and apply isn't a valid input for the
915 APPLIED state, the bc_ calls have to be made in the static callback not
916 within each of the real callbacks.
918 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
919 (setOk): renamed from setOkay()
921 2000-08-17 Juergen Vigna <jug@sad.it>
923 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
924 in the implementation part.
925 (composeUIInfo): don't show optional menu-items.
927 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
929 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
931 * src/bufferview_funcs.C (CurrentState): fixed to show also the
932 text-state when in a text-inset.
934 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
936 2000-08-17 Marko Vendelin <markov@ioc.ee>
937 * src/frontends/gnome/FormIndex.C
938 * src/frontends/gnome/FormIndex.h
939 * src/frontends/gnome/FormToc.C
940 * src/frontends/gnome/FormToc.h
941 * src/frontends/gnome/dialogs
942 * src/frontends/gnome/diatoc_callbacks.c
943 * src/frontends/gnome/diatoc_callbacks.h
944 * src/frontends/gnome/diainsertindex_callbacks.h
945 * src/frontends/gnome/diainsertindex_callbacks.c
946 * src/frontends/gnome/diainsertindex_interface.c
947 * src/frontends/gnome/diainsertindex_interface.h
948 * src/frontends/gnome/diatoc_interface.h
949 * src/frontends/gnome/diatoc_interface.c
950 * src/frontends/gnome/Makefile.am: Table of Contents and
951 Insert Index dialogs implementation for Gnome frontend
953 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
955 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
957 * src/frontends/gnome/diainserturl_interface.c: make the dialog
960 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
962 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
963 destructor. Don't definde if you don't need it
964 (processEvents): made static, non-blocking events processing for
966 (runTime): static method. event loop for xforms
967 * similar as above for kde and gnome.
969 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
971 (runTime): new method calss the real frontends runtime func.
973 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
975 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
977 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
979 2000-08-16 Juergen Vigna <jug@sad.it>
981 * src/lyx_gui.C (runTime): added GUII RunTime support.
983 * src/frontends/Makefile.am:
984 * src/frontends/GUIRunTime.[Ch]:
985 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
986 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
987 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
989 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
991 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
992 as this is already set in ${FRONTEND_INCLUDE} if needed.
994 * configure.in (CPPFLAGS): setting the include dir for the frontend
995 directory and don't set FRONTEND=xforms for now as this is executed
998 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
1000 * src/frontends/kde/Makefile.am:
1001 * src/frontends/kde/FormUrl.C:
1002 * src/frontends/kde/FormUrl.h:
1003 * src/frontends/kde/formurldialog.h:
1004 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
1006 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
1008 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
1010 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1012 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
1015 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
1017 * src/WorkArea.C (work_area_handler): more work to get te
1018 FL_KEYBOARD to work with xforms 0.88 too, please test.
1020 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
1022 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
1024 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
1027 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1029 * src/Timeout.h: remove Qt::emit hack.
1031 * several files: changes to allo doc++ compilation
1033 * src/lyxfunc.C (processKeySym): new method
1034 (processKeyEvent): comment out if FL_REVISION < 89
1036 * src/WorkArea.C: change some debugging levels.
1037 (WorkArea): set wantkey to FL_KEY_ALL
1038 (work_area_handler): enable the FL_KEYBOARD clause, this enables
1039 clearer code and the use of compose with XForms 0.89. Change to
1040 use signals instead of calling methods in bufferview directly.
1042 * src/Painter.C: change some debugging levels.
1044 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
1047 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
1048 (workAreaKeyPress): new method
1050 2000-08-14 Juergen Vigna <jug@sad.it>
1052 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
1054 * config/kde.m4: addes some features
1056 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
1057 include missing xforms dialogs.
1059 * src/Timeout.h: a hack to be able to compile with qt/kde.
1061 * sigc++/.cvsignore: added acinclude.m4
1063 * lib/.cvsignore: added listerros
1065 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
1066 xforms tree as objects are needed for other frontends.
1068 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
1069 linking with not yet implemented xforms objects.
1071 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
1073 2000-08-14 Baruch Even <baruch.even@writeme.com>
1075 * src/frontends/xforms/FormGraphics.h:
1076 * src/frontends/xforms/FormGraphics.C:
1077 * src/frontends/xforms/RadioButtonGroup.h:
1078 * src/frontends/xforms/RadioButtonGroup.C:
1079 * src/insets/insetgraphics.h:
1080 * src/insets/insetgraphics.C:
1081 * src/insets/insetgraphicsParams.h:
1082 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
1083 instead of spaces, and various other indentation issues to make the
1084 sources more consistent.
1086 2000-08-14 Marko Vendelin <markov@ioc.ee>
1088 * src/frontends/gnome/dialogs/diaprint.glade
1089 * src/frontends/gnome/FormPrint.C
1090 * src/frontends/gnome/FormPrint.h
1091 * src/frontends/gnome/diaprint_callbacks.c
1092 * src/frontends/gnome/diaprint_callbacks.h
1093 * src/frontends/gnome/diaprint_interface.c
1094 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
1097 * src/frontends/gnome/dialogs/diainserturl.glade
1098 * src/frontends/gnome/FormUrl.C
1099 * src/frontends/gnome/FormUrl.h
1100 * src/frontends/gnome/diainserturl_callbacks.c
1101 * src/frontends/gnome/diainserturl_callbacks.h
1102 * src/frontends/gnome/diainserturl_interface.c
1103 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
1104 Gnome implementation
1106 * src/frontends/gnome/Dialogs.C
1107 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
1108 all other dialogs. Copy all unimplemented dialogs from Xforms
1111 * src/frontends/gnome/support.c
1112 * src/frontends/gnome/support.h: support files generated by Glade
1116 * config/gnome.m4: Gnome configuration scripts
1118 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
1119 configure --help message
1121 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
1122 only if there are no events pendling in Gnome/Gtk. This enhances
1123 the performance of menus.
1126 2000-08-14 Allan Rae <rae@lyx.org>
1128 * lib/Makefile.am: listerrors cleaning
1130 * lib/listerrors: removed -- generated file
1131 * acinclude.m4: ditto
1132 * sigc++/acinclude.m4: ditto
1134 * src/frontends/xforms/forms/form_citation.fd:
1135 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
1138 * src/frontends/xforms/forms/makefile: I renamed the `install` target
1139 `updatesrc` and now we have a `test` target that does what `updatesrc`
1140 used to do. I didn't like having an install target that wasn't related
1143 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
1144 on all except FormGraphics. This may yet happen. Followed by a major
1145 cleanup including using FL_TRANSIENT for most of the dialogs. More
1146 changes to come when the ButtonController below is introduced.
1148 * src/frontends/xforms/ButtonController.h: New file for managing up to
1149 four buttons on a dialog according to an externally defined policy.
1150 * src/frontends/xforms/Makefile.am: added above
1152 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
1153 Apply and Cancel/Close buttons and everything in between and beyond.
1154 * src/frontends/Makefile.am: added above.
1156 * src/frontends/xforms/forms/form_preferences.fd:
1157 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
1158 and removed variable 'status' as a result. Fixed the set_minsize thing.
1159 Use the new screen-font-update after checking screen fonts were changed
1160 Added a "Restore" button to restore the original lyxrc values while
1161 editing. This restores everything not just the last input changed.
1162 That's still a tricky one. As is the "LyX: this shouldn't happen..."
1164 * src/LyXAction.C: screen-font-update added for updating buffers after
1165 screen font settings have been changed.
1166 * src/commandtags.h: ditto
1167 * src/lyxfunc.C: ditto
1169 * forms/lyx.fd: removed screen fonts dialog.
1170 * src/lyx_gui.C: ditto
1171 * src/menus.[Ch]: ditto
1172 * src/lyx.[Ch]: ditto
1173 * src/lyx_cb.C: ditto + code from here moved to make
1174 screen-font-update. And people wonder why progress on GUII is
1175 slow. Look at how scattered this stuff was! It takes forever
1178 * forms/fdfix.sh: Fixup the spacing after commas.
1179 * forms/makefile: Remove date from generated files. Fewer clashes now.
1180 * forms/bullet_forms.C.patch: included someones handwritten changes
1182 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
1183 once I've discovered why LyXRC was made noncopyable.
1184 * src/lyx_main.C: ditto
1186 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
1188 * src/frontends/xforms/forms/fdfix.sh:
1189 * src/frontends/xforms/forms/fdfixh.sed:
1190 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
1191 * src/frontends/xforms/Form*.[hC]:
1192 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
1193 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
1194 provide a destructor for the struct FD_form_xxxx. Another version of
1195 the set_[max|min]size workaround and a few other cleanups. Actually,
1196 Angus' patch from 20000809.
1198 2000-08-13 Baruch Even <baruch.even@writeme.com>
1200 * src/insets/insetgraphics.C (Clone): Added several fields that needed
1203 2000-08-11 Juergen Vigna <jug@sad.it>
1205 * src/insets/insetgraphics.C (InsetGraphics): changing init
1206 order because of warnings.
1208 * src/frontends/xforms/forms/makefile: adding patching .C with
1211 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
1212 from .C.patch to .c.patch
1214 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
1215 order because of warning.
1217 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
1219 * src/frontends/Liason.C (setMinibuffer): new helper function
1221 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
1223 * src/lyxfunc.C (Dispatch): calling new Document-Layout
1225 * lib/ui/default.ui: commented out PaperLayout entry
1227 * src/frontends/xforms/form_document.[Ch]: new added files
1229 * src/frontends/xforms/FormDocument.[Ch]: ditto
1231 * src/frontends/xforms/forms/form_document.fd: ditto
1233 * src/frontends/xforms/forms/form_document.C.patch: ditto
1235 2000-08-10 Juergen Vigna <jug@sad.it>
1237 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
1238 (InsetGraphics): initialized cacheHandle to 0.
1239 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
1241 2000-08-10 Baruch Even <baruch.even@writeme.com>
1243 * src/graphics/GraphicsCache.h:
1244 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
1245 correctly as a cache.
1247 * src/graphics/GraphicsCacheItem.h:
1248 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
1251 * src/graphics/GraphicsCacheItem_pimpl.h:
1252 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
1255 * src/insets/insetgraphics.h:
1256 * src/insets/insetgraphics.C: Changed from using a signal notification
1257 to polling when image is not loaded.
1259 2000-08-10 Allan Rae <rae@lyx.org>
1261 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
1262 that there are two functions that have to been taken out of line by
1263 hand and aren't taken care of in the script. (Just a reminder note)
1265 * sigc++/macros/*.h.m4: Updated as above.
1267 2000-08-09 Juergen Vigna <jug@sad.it>
1269 * src/insets/insettext.C (draw): small fix for clearing rectangle.
1271 * src/insets/insettabular.C: make drawing of single cell smarter.
1273 2000-08-09 Marko Vendelin <markov@ioc.ee>
1274 * src/frontends/gnome/Menubar_pimpl.C
1275 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
1276 implementation: new files
1278 * src/frontends/gnome/mainapp.C
1279 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
1282 * src/main.C: create Gnome main window
1284 * src/frontends/xforms/Menubar_pimpl.h
1285 * src/frontends/Menubar.C
1286 * src/frontends/Menubar.h: added method Menubar::update that calls
1287 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
1289 * src/LyXView.C: calls Menubar::update to update the state
1292 * src/frontends/gnome/Makefile.am: added new files
1294 * src/frontends/Makefile.am: added frontend compiler options
1296 2000-08-08 Juergen Vigna <jug@sad.it>
1298 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
1300 * src/bufferlist.C (close):
1301 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
1302 documents if exiting without saving.
1304 * src/buffer.C (save): use removeAutosaveFile()
1306 * src/support/filetools.C (removeAutosaveFile): new function.
1308 * src/lyx_cb.C (MenuWrite): returns a bool now.
1309 (MenuWriteAs): check if file could really be saved and revert to the
1311 (MenuWriteAs): removing old autosavefile if existant.
1313 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
1314 before Goto toggle declaration, because of compiler warning.
1316 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
1318 * src/lyxfunc.C (MenuNew): small fix.
1320 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
1322 * src/bufferlist.C (newFile):
1323 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
1325 * src/lyxrc.C: added new_ask_filename tag
1327 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
1329 * src/lyx.fd: removed code pertaining to form_ref
1330 * src/lyx.[Ch]: ditto
1331 * src/lyx_cb.C: ditto
1332 * src/lyx_gui.C: ditto
1333 * src/lyx_gui_misc.C: ditto
1335 * src/BufferView_pimpl.C (restorePosition): update buffer only
1338 * src/commandtags.h (LFUN_REFTOGGLE): removed
1339 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
1340 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
1341 (LFUN_REFBACK): renamed LFUN_REF_BACK
1343 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
1344 * src/menus.C: ditto
1345 * src/lyxfunc.C (Dispatch): ditto.
1346 InsertRef dialog is now GUI-independent.
1348 * src/texrow.C: added using std::endl;
1350 * src/insets/insetref.[Ch]: strip out large amounts of code.
1351 The inset is now a container and this functionality is now
1352 managed by a new FormRef dialog
1354 * src/frontends/Dialogs.h (showRef, createRef): new signals
1356 * src/frontends/xforms/FormIndex.[Ch],
1357 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
1358 when setting dialog's min/max size
1359 * src/frontends/xforms/FormIndex.[Ch]: ditto
1361 * src/frontends/xforms/FormRef.[Ch],
1362 src/frontends/xforms/forms/form_ref.fd: new xforms
1363 implementation of an InsetRef dialog
1365 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
1368 * src/graphics/XPM_Renderer.C (isImageFormatOK):
1369 ios::nocreate is not part of the standard. Removed.
1371 2000-08-07 Baruch Even <baruch.even@writeme.com>
1373 * src/graphics/Renderer.h:
1374 * src/graphics/Renderer.C: Added base class for rendering of different
1375 image formats into Pixmaps.
1377 * src/graphics/XPM_Renderer.h:
1378 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
1379 in a different class.
1381 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
1382 easily add support for other formats.
1384 * src/insets/figinset.C: plugged a leak of an X resource.
1386 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1388 * src/CutAndPaste.[Ch]: make all metods static.
1390 * development/Code_rules/Rules: more work, added section on
1391 Exceptions, and a References section.
1393 * a lot of header files: work to make doc++ able to generate the
1394 source documentation, some workarounds of doc++ problems. Doc++ is
1395 now able to generate the documentation.
1397 2000-08-07 Juergen Vigna <jug@sad.it>
1399 * src/insets/insettabular.C (recomputeTextInsets): removed function
1401 * src/tabular.C (SetWidthOfMulticolCell):
1403 (calculate_width_of_column_NMC): fixed return value so that it really
1404 only returns true if the column-width has changed (there where
1405 problems with muliticolumn-cells in this column).
1407 2000-08-04 Juergen Vigna <jug@sad.it>
1409 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
1410 also on the scrollstatus of the inset.
1411 (workAreaMotionNotify): ditto.
1413 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
1415 2000-08-01 Juergen Vigna <jug@sad.it>
1417 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
1419 * src/commandtags.h:
1420 * src/LyXAction.C (init):
1421 * src/insets/inset.C (LocalDispatch): added support for
1424 * src/insets/inset.C (scroll): new functions.
1426 * src/insets/insettext.C (removeNewlines): new function.
1427 (SetAutoBreakRows): removes forced newlines in the text of the
1428 paragraph if autoBreakRows is set to false.
1430 * src/tabular.C (Latex): generates a parbox around the cell contents
1433 * src/frontends/xforms/FormTabular.C (local_update): removed
1434 the radio_useparbox button.
1436 * src/tabular.C (UseParbox): new function
1438 2000-08-06 Baruch Even <baruch.even@writeme.com>
1440 * src/graphics/GraphicsCache.h:
1441 * src/graphics/GraphicsCache.C:
1442 * src/graphics/GraphicsCacheItem.h:
1443 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
1446 * src/insets/insetgraphics.h:
1447 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
1448 drawing of the inline image.
1450 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
1451 into the wrong position.
1453 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
1456 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
1458 * src/support/translator.h: move all typedefs to public section
1460 * src/support/filetools.C (MakeLatexName): return string const
1462 (TmpFileName): ditto
1463 (FileOpenSearch): ditto
1465 (LibFileSearch): ditto
1466 (i18nLibFileSearch): ditto
1469 (CreateTmpDir): ditto
1470 (CreateBufferTmpDir): ditto
1471 (CreateLyXTmpDir): ditto
1474 (MakeAbsPath): ditto
1476 (OnlyFilename): ditto
1478 (NormalizePath): ditto
1479 (CleanupPath): ditto
1480 (GetFileContents): ditto
1481 (ReplaceEnvironmentPath): ditto
1482 (MakeRelPath): ditto
1484 (ChangeExtension): ditto
1485 (MakeDisplayPath): ditto
1486 (do_popen): return cmdret const
1487 (findtexfile): return string const
1489 * src/support/DebugStream.h: add some /// to please doc++
1491 * src/frontends/DialogBase.h (endif): add some /// to please doc++
1493 * src/texrow.C (same_rownumber): functor to use with find_if
1494 (getIdFromRow): rewritten to use find_if and to not update the
1495 positions. return true if row is found
1496 (increasePos): new method, use to update positions
1498 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
1500 * src/lyxlex_pimpl.C (verifyTable): new method
1503 (GetString): return string const
1504 (pushTable): rewrite to use std::stack
1506 (setFile): better check
1509 * src/lyxlex.h: make LyXLex noncopyable
1511 * src/lyxlex.C (text): return char const * const
1512 (GetString): return string const
1513 (getLongString): return string const
1515 * src/lyx_gui_misc.C (askForText): return pair<...> const
1517 * src/lastfiles.[Ch] (operator): return string const
1519 * src/buffer.C (parseSingleLyXformat2Token): pass string to
1520 istringstream not char const *.
1521 move token.end() out of loop.
1522 (readFile): move initializaton of token
1524 * src/BufferView2.C (insertErrors): run texrow.increasePos if
1525 getIdFromRow is successful.
1527 * lib/bind/emacs.bind: don't include menus bind
1529 * development/Code_rules/Rules: the beginnings of making this
1530 better and covering more of the unwritten rules that we have.
1532 * development/Code_rules/Recommendations: a couple of wording
1535 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1537 * src/support/strerror.c: remove C++ comment.
1539 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
1541 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
1542 LFUN_INDEX_INSERT_LAST
1544 * src/texrow.C (getIdFromRow): changed from const_iterator to
1545 iterator, allowing code to compile with DEC cxx
1547 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
1548 stores part of the class, as suggested by Allan. Will allow
1550 (apply): test to apply uses InsetCommandParams operator!=
1552 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
1553 (apply): test to apply uses InsetCommandParams operator!=
1555 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
1556 stores part of the class.
1557 (update): removed limits on min/max size.
1559 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
1560 (apply): test to apply uses InsetCommandParams operator!=
1562 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
1563 (Read, Write, scanCommand, getCommand): moved functionality
1564 into InsetCommandParams.
1566 (getScreenLabel): made pure virtual
1567 new InsetCommandParams operators== and !=
1569 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
1570 c-tors based on InsetCommandParams. Removed others.
1571 * src/insets/insetinclude.[Ch]: ditto
1572 * src/insets/insetlabel.[Ch]: ditto
1573 * src/insets/insetparent.[Ch]: ditto
1574 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
1576 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
1577 insets derived from InsetCommand created using similar c-tors
1578 based on InsetCommandParams
1579 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
1580 * src/menus.C (ShowRefsMenu): ditto
1581 * src/paragraph.C (Clone): ditto
1582 * src/text2.C (SetCounter): ditto
1583 * src/lyxfunc.C (Dispatch) ditto
1584 Also recreated old InsetIndex behaviour exactly. Can now
1585 index-insert at the start of a paragraph and index-insert-last
1586 without launching the pop-up.
1588 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1590 * lib/lyxrc.example: mark te pdf options as non functional.
1592 * src/support/lstrings.C (strToInt): move initalization of tmpstr
1593 (isStrDbl): move tmpstr.end() out of loop.
1594 (strToDbl): move intialization of tmpstr
1595 (lowercase): return string const and move tmp.end() out of loop.
1596 (uppercase): return string const and move tmp.edn() out of loop.
1597 (prefixIs): add assertion
1602 (containsOnly): ditto
1603 (containsOnly): ditto
1604 (containsOnly): ditto
1605 (countChar): make last arg char not char const
1606 (token): return string const
1607 (subst): return string const, move tmp.end() out of loop.
1608 (subst): return string const, add assertion
1609 (strip): return string const
1610 (frontStrip): return string const, add assertion
1611 (frontStrip): return string const
1616 * src/support/lstrings.C: add inclde "LAssert.h"
1617 (isStrInt): move tmpstr.end() out of loop.
1619 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
1620 toollist.end() out of loop.
1621 (deactivate): move toollist.end() out of loop.
1622 (update): move toollist.end() out of loop.
1623 (updateLayoutList): move tc.end() out of loop.
1624 (add): move toollist.end() out of loop.
1626 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
1627 md.end() out of loop.
1629 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
1631 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
1634 * src/paragraph.C (Erase): move fontlist.end() out of loop.
1635 (Erase): move insetlist.end() out of loop.
1637 * src/lyx_sendfax_main.C: make show_logfile static and to take a
1638 ref to const string as first arg. Move initialization of some
1639 variables, whitespace changes.
1641 * src/kbmap.C (defkey): move table.end() out of loop.
1642 (kb_keymap): move table.end() out of loop.
1643 (findbinding): move table.end() out of loop.
1645 * src/MenuBackend.C (hasMenu): move end() out of loop.
1646 (getMenu): move end() out of loop.
1647 (getMenu): move menulist_.end() out of loop.
1649 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
1651 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
1654 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
1655 (getFromLyXName): move infotab.end() out of loop.
1657 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
1658 -fvtable-thunks -ffunction-sections -fdata-sections
1660 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
1662 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
1665 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1667 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
1669 * src/frontends/xforms/FormCitation.[Ch],
1670 src/frontends/xforms/FormIndex.[Ch],
1671 src/frontends/xforms/FormToc.[Ch],
1672 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
1674 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1676 * src/commandtags.h: renamed, created some flags for citation
1679 * src/lyx_gui_misc.C: stripped out old FD_index_form code
1681 * src/lyxfunc.C (dispatch): use signals to insert index entry
1683 * src/frontends/Dialogs.h: new signal createIndex
1685 * src/frontends/xforms/FormCommand.[Ch],
1686 src/frontends/xforms/FormCitation.[Ch],
1687 src/frontends/xforms/FormToc.[Ch],
1688 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
1690 * src/insets/insetindex.[Ch]: GUI-independent
1692 * src/frontends/xforms/FormIndex.[Ch],
1693 * src/frontends/xforms/forms/form_index.fd: xforms implementation
1696 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
1698 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
1699 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
1701 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1703 * src/insets/insetref.C (Latex): rewrite so that there is now
1704 question that a initialization is requested.
1706 * src/insets/insetcommand.h: reenable the hide signal
1708 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1710 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
1711 fix handling of shortcuts (many bugs :)
1712 (add_lastfiles): ditto.
1714 * lib/ui/default.ui: fix a few shortcuts.
1716 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
1718 * Makefile.am: Fix ``rpmdist'' target to return the exit
1719 status of the ``rpm'' command, instead of the last command in
1720 the chain (the ``rm lyx.xpm'' command, which always returns
1723 2000-08-02 Allan Rae <rae@lyx.org>
1725 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
1726 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
1727 * src/frontends/xforms/FormToc.C (FormToc): ditto
1729 * src/frontends/xforms/Makefile.am: A few forgotten files
1731 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
1732 Signals-not-copyable-problem Lars' started commenting out.
1734 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
1736 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1738 * src/insets/insetcommand.h: Signals is not copyable so anoter
1739 scheme for automatic hiding of forms must be used.
1741 * src/frontends/xforms/FormCitation.h: don't inerit from
1742 noncopyable, FormCommand already does that.
1743 * src/frontends/xforms/FormToc.h: ditto
1744 * src/frontends/xforms/FormUrl.h: ditto
1746 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1748 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
1750 * src/insets/insetcommand.h (hide): new SigC::Signal0
1751 (d-tor) new virtual destructor emits hide signal
1753 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
1754 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
1756 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
1757 LOF and LOT. Inset is now GUI-independent
1759 * src/insets/insetloa.[Ch]: redundant
1760 * src/insets/insetlof.[Ch]: ditto
1761 * src/insets/insetlot.[Ch]: ditto
1763 * src/frontends/xforms/forms/form_url.fd: tweaked!
1764 * src/frontends/xforms/forms/form_citation.fd: ditto
1766 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
1767 dialogs dealing with InsetCommand insets
1769 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
1770 FormCommand base class
1771 * src/frontends/xforms/FormUrl.[Ch]: ditto
1773 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
1775 * src/frontends/xforms/FormToc.[Ch]: ditto
1777 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
1778 passed a generic InsetCommand pointer
1779 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
1781 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
1782 and modified InsetTOC class
1783 * src/buffer.C: ditto
1785 * forms/lyx.fd: strip out old FD_form_toc code
1786 * src/lyx_gui_misc.C: ditto
1787 * src/lyx_gui.C: ditto
1788 * src/lyx_cb.C: ditto
1789 * src/lyx.[Ch]: ditto
1791 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1793 * src/support/utility.hpp: tr -d '\r'
1795 2000-08-01 Juergen Vigna <jug@sad.it>
1797 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
1799 * src/commandtags.h:
1800 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
1801 LFUN_TABULAR_FEATURES.
1803 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
1804 LFUN_LAYOUT_TABULAR.
1806 * src/insets/insettabular.C (getStatus): implemented helper function.
1808 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
1810 2000-07-31 Juergen Vigna <jug@sad.it>
1812 * src/text.C (draw): fixed screen update problem for text-insets.
1814 * src/text2.C (SetParagrpah): call an update of the inset-owner when
1815 something changed probably this has to be added in various other
1818 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
1820 2000-07-31 Baruch Even <baruch.even@writeme.com>
1822 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
1823 templates to satisfy compaq cxx.
1826 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1828 * src/support/translator.h (equal_1st_in_pair::operator()): take
1829 const ref pair_type as arg.
1830 (equal_2nd_in_pair::operator()): ditto
1831 (Translator::~Translator): remove empty d-tor.
1833 * src/graphics/GraphicsCache.C: move include config.h to top, also
1834 put initialization of GraphicsCache::singleton here.
1835 (~GraphicsCache): move here
1836 (addFile): take const ref as arg
1839 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
1841 * src/BufferView2.C (insertLyXFile): change te with/without header
1844 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1846 * src/frontends/xforms/FormGraphics.C (apply): add some
1847 static_cast. Not very nice, but required by compaq cxx.
1849 * src/frontends/xforms/RadioButtonGroup.h: include header
1850 <utility> instead of <pair.h>
1852 * src/insets/insetgraphicsParams.C: add using directive.
1853 (readResize): change return type to void.
1854 (readOrigin): ditto.
1856 * src/lyxfunc.C (getStatus): add missing break for build-program
1857 function; add test for Literate for export functions.
1859 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
1860 entries in Options menu.
1862 2000-07-31 Baruch Even <baruch.even@writeme.com>
1864 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
1865 protect against auto-allocation; release icon when needed.
1867 2000-07-31 Matej Cepl <CeplM@seznam.cz>
1869 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
1870 on usual typewriter.
1872 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
1873 earlier czech.kmap), useful only for programming.
1875 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1877 * src/frontends/xforms/FormCitation.h: fix conditioning around
1880 2000-07-31 Juergen Vigna <jug@sad.it>
1882 * src/frontends/xforms/FormTabular.C (local_update): changed
1883 radio_linebreaks to radio_useparbox and added radio_useminipage.
1885 * src/tabular.C: made support for using minipages/parboxes.
1887 * src/bufferlist.C (QwriteAll): small fix for asking for save.
1889 * src/insets/insetgraphics.C (draw): just draw the inset so that the
1891 (descent): so the cursor is in the middle.
1892 (width): bit smaller box.
1894 * src/insets/insetgraphics.h: added display() function.
1896 2000-07-31 Baruch Even <baruch.even@writeme.com>
1898 * src/frontends/Dialogs.h: Added showGraphics signals.
1900 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
1901 xforms form definition of the graphics dialog.
1903 * src/frontends/xforms/FormGraphics.h:
1904 * src/frontends/xforms/FormGraphics.C: Added files, the
1905 GUIndependent code of InsetGraphics
1907 * src/insets/insetgraphics.h:
1908 * src/insets/insetgraphics.C: Major writing to make it work.
1910 * src/insets/insetgraphicsParams.h:
1911 * src/insets/insetgraphicsParams.C: Added files, parameter passing
1912 struct between InsetGraphics and GUI.
1914 * src/LaTeXFeatures.h:
1915 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
1916 support for graphicx package.
1918 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
1919 for the graphics inset.
1921 * src/support/translator.h: Added file, used in
1922 InsetGraphicsParams. this is a template to translate between two
1925 * src/frontends/xforms/RadioButtonGroup.h:
1926 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
1927 way to easily control a radio button group.
1929 2000-07-28 Juergen Vigna <jug@sad.it>
1931 * src/insets/insettabular.C (LocalDispatch):
1932 (TabularFeatures): added support for lyx-functions of tabular features.
1933 (cellstart): refixed this function after someone wrongly changed it.
1935 * src/commandtags.h:
1936 * src/LyXAction.C (init): added support for tabular-features
1938 2000-07-28 Allan Rae <rae@lyx.org>
1940 * src/frontends/xforms/FormPreferences.C (build): Setup input return
1941 checking. NOTE: It seems that pressing ESC to cancel the dialog also
1942 triggers the callback for input checking. As a result we sometimes get
1943 "LyX: This shouldn't happen..." printed to cerr.
1944 (input): Started using status variable since I only free() on
1945 destruction. Some input checking for paths and font sizes.
1947 * src/frontends/xforms/FormPreferences.h: Use status to control
1948 activation of Ok and Apply
1950 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
1951 callback. Also resized to stop segfaults with 0.88. The problem is
1952 that xforms-0.88 requires the folder to be wide enough to fit all the
1953 tabs. If it isn't it causes all sorts of problems.
1955 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
1957 * src/frontends/xforms/forms/README: Reflect reality.
1959 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
1960 * src/frontends/xforms/forms/makefile: ditto.
1962 * src/commandtags.h: Get access to new Preferences dialog
1963 * src/LyXAction.C: ditto
1964 * src/lyxfunc.C: ditto
1965 * lib/ui/default.ui: ditto
1967 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1969 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
1971 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
1974 * src/frontends/xforms/form_url.[Ch]: added.
1976 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1978 * src/insets/insetbib.h: fixed bug in previous commit
1980 * src/frontends/xforms/FormUrl.h: ditto
1982 * src/frontends/xforms/FormPrint.h: ditto
1984 * src/frontends/xforms/FormPreferences.h: ditto
1986 * src/frontends/xforms/FormCopyright.h: ditto
1988 * src/frontends/xforms/FormCitation.C: ditto
1990 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
1991 private copyconstructor and private default contructor
1993 * src/support/Makefile.am: add utility.hpp
1995 * src/support/utility.hpp: new file from boost
1997 * src/insets/insetbib.h: set owner in clone
1999 * src/frontends/xforms/FormCitation.C: added missing include
2002 * src/insets/form_url.[Ch]: removed
2004 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
2006 * development/lyx.spec.in
2007 * Makefile.am: Fix buglet for LyX RPM generation resulting from
2008 file/directory re-organization.
2010 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
2012 * src/insets/insetcommand.[Ch]: moved the string data and
2013 associated manipulation methods into a new stand-alone class
2014 InsetCommandParams. This class has two additional methods
2015 getAsString() and setFromString() allowing the contents to be
2016 moved around as a single string.
2017 (addContents) method removed.
2018 (setContents) method no longer virtual.
2020 * src/buffer.C (readInset): made use of new InsetCitation,
2021 InsetUrl constructors based on InsetCommandParams.
2023 * src/commandtags.h: add LFUN_INSERT_URL
2025 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
2026 independent InsetUrl and use InsetCommandParams to extract
2027 string info and create new Insets.
2029 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
2031 * src/frontends/xforms/FormCitation.C (apply): uses
2034 * src/frontends/xforms/form_url.C
2035 * src/frontends/xforms/form_url.h
2036 * src/frontends/xforms/FormUrl.h
2037 * src/frontends/xforms/FormUrl.C
2038 * src/frontends/xforms/forms/form_url.fd: new files
2040 * src/insets/insetcite.[Ch]: removed unused constructors.
2042 * src/insets/insetinclude.[Ch]: no longer store filename
2044 * src/insets/inseturl.[Ch]: GUI-independent.
2046 2000-07-26 Juergen Vigna <jug@sad.it>
2047 * renamed frontend from gtk to gnome as it is that what is realized
2048 and did the necessary changes in the files.
2050 2000-07-26 Marko Vendelin <markov@ioc.ee>
2052 * configure.in: cleaning up gnome configuration scripts
2054 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2056 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
2057 shortcuts syndrom by redrawing them explicitely (a better solution
2058 would be appreciated).
2060 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
2062 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
2065 * src/lyx_cb.C (MenuExport): change html export to do the right
2066 thing depending of the document type (instead of having
2067 html-linuxdoc and html-docbook).
2068 * src/lyxfunc.C (getStatus): update for html
2069 * lib/ui/default.ui: simplify due to the above change.
2070 * src/menus.C (ShowFileMenu): update too (in case we need it).
2072 * src/MenuBackend.C (read): if a menu is defined twice, add the
2073 new entries to the exiting one.
2075 2000-07-26 Juergen Vigna <jug@sad.it>
2077 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
2079 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
2080 and return a bool if it did actual save the file.
2081 (AutoSave): don't autosave a unnamed doc.
2083 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
2084 check if this is an UNNAMED new file and react to it.
2085 (newFile): set buffer to unnamed and change to not mark a new
2086 buffer dirty if I didn't do anything with it.
2088 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
2090 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2092 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
2093 friend as per Angus's patch posted to lyx-devel.
2095 * src/ext_l10n.h: updated
2097 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
2098 gettext on the style string right before inserting them into the
2101 * autogen.sh: add code to extract style strings form layout files,
2102 not good enough yet.
2104 * src/frontends/gtk/.cvsignore: add MAKEFILE
2106 * src/MenuBackend.C (read): run the label strings through gettext
2107 before storing them in the containers.
2109 * src/ext_l10n.h: new file
2111 * autogen.sh : generate the ext_l10n.h file here
2113 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2115 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
2118 * lib/ui/default.ui: fix a couple of typos.
2120 * config/gnome/gtk.m4: added (and added to the list of files in
2123 * src/insets/insetinclude.C (unique_id): fix when we are using
2124 lyxstring instead of basic_string<>.
2125 * src/insets/insettext.C (LocalDispatch): ditto.
2126 * src/support/filetools.C: ditto.
2128 * lib/configure.m4: create the ui/ directory if necessary.
2130 * src/LyXView.[Ch] (updateToolbar): new method.
2132 * src/BufferView_pimpl.C (buffer): update the toolbar when
2133 opening/closing buffer.
2135 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2137 * src/LyXAction.C (getActionName): enhance to return also the name
2138 and options of pseudo-actions.
2139 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
2141 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
2142 as an example of what is possible). Used in File->Build too (more
2143 useful) and in the import/export menus (to mimick the complicated
2144 handling of linuxdoc and friends). Try to update all the entries.
2146 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
2149 * src/MenuBackend.C (read): Parse the new OptItem tag.
2151 * src/MenuBackend.h: Add a new optional_ data member (used if the
2152 entry should be omitted when the lyxfunc is disabled).
2154 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
2155 function, used as a shortcut.
2156 (create_submenu): align correctly the shortcuts on the widest
2159 * src/MenuBackend.h: MenuItem.label() only returns the label of
2160 the menu without shortcut; new method shortcut().
2162 2000-07-14 Marko Vendelin <markov@ioc.ee>
2164 * src/frontends/gtk/Dialogs.C:
2165 * src/frontends/gtk/FormCopyright.C:
2166 * src/frontends/gtk/FormCopyright.h:
2167 * src/frontends/gtk/Makefile.am: added these source-files for the
2168 Gtk/Gnome support of the Copyright-Dialog.
2170 * src/main.C: added Gnome::Main initialization if using
2171 Gtk/Gnome frontend-GUI.
2173 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
2175 * config/gnome/aclocal-include.m4
2176 * config/gnome/compiler-flags.m4
2177 * config/gnome/curses.m4
2178 * config/gnome/gnome--.m4
2179 * config/gnome/gnome-bonobo-check.m4
2180 * config/gnome/gnome-common.m4
2181 * config/gnome/gnome-fileutils.m4
2182 * config/gnome/gnome-ghttp-check.m4
2183 * config/gnome/gnome-gnorba-check.m4
2184 * config/gnome/gnome-guile-checks.m4
2185 * config/gnome/gnome-libgtop-check.m4
2186 * config/gnome/gnome-objc-checks.m4
2187 * config/gnome/gnome-orbit-check.m4
2188 * config/gnome/gnome-print-check.m4
2189 * config/gnome/gnome-pthread-check.m4
2190 * config/gnome/gnome-support.m4
2191 * config/gnome/gnome-undelfs.m4
2192 * config/gnome/gnome-vfs.m4
2193 * config/gnome/gnome-x-checks.m4
2194 * config/gnome/gnome-xml-check.m4
2195 * config/gnome/gnome.m4
2196 * config/gnome/gperf-check.m4
2197 * config/gnome/gtk--.m4
2198 * config/gnome/linger.m4
2199 * config/gnome/need-declaration.m4: added configuration scripts
2200 for Gtk/Gnome frontend-GUI
2202 * configure.in: added support for the --with-frontend=gtk option
2204 * autogen.sh: added config/gnome/* to list of config-files
2206 * acconfig.h: added define for GTKGUI-support
2208 * config/lyxinclude.m4: added --with-frontend[=value] option value
2209 for Gtk/Gnome frontend-GUI support.
2211 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2213 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
2217 * src/paragraph.C (GetChar): remove non-const version
2219 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
2220 (search_kw): use it.
2222 * src/lyx_main.C (init): if "preferences" exist, read that instead
2224 (ReadRcFile): return bool if the file could be read ok.
2225 (ReadUIFile): add a check to see if lex file is set ok.
2227 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
2228 bastring can be used instead of lyxstring (still uses the old code
2229 if std::string is good enough or if lyxstring is used.)
2231 * src/encoding.C: make the arrays static, move ininle functions
2233 * src/encoding.h: from here.
2235 * src/buffer.C: have last_isnet_read as a file scope variable for now.
2236 (parseSingleLyXformat2Token): move inset parsing to separate method
2237 (readInset): new private method
2239 * src/Variables.h: remove virtual from get().
2241 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
2242 access to NEW_INSETS and NEW_TABULAR
2244 * src/MenuBackend.h: remove superfluous forward declaration of
2245 MenuItem. Add documentations tags "///", remove empty MenuItem
2246 destructor, remove private default contructor.
2248 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
2250 (read): more string mlabel and mname to where they are used
2251 (read): remove unused variables mlabel and mname
2252 (defaults): unconditional clear, make menusetup take advantage of
2253 add returning Menu &.
2255 * src/LyXView.h: define NEW_MENUBAR as default
2257 * src/LyXAction.C: include lyxparagraph.h temporary to get access
2258 to NEW_INSETS and NEW_TABULAR.
2259 (init): commetn out some funcs that is obsolete when NEW_INSETS is
2260 defined. Change some of the "xxxx-inset-insert" functions names to
2263 * several files: more enahncements to NEW_INSETS and the resulting
2266 * lib/lyxrc.example (\date_insert_format): move to misc section
2268 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
2269 bastring and use AC_CACHE_CHECK.
2270 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
2271 the system have the newest methods. uses AC_CACHE_CHECK
2272 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
2273 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
2274 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
2276 * configure.in: add LYX_CXX_GOOD_STD_STRING
2278 * acinclude.m4: recreated
2280 2000-07-24 Amir Karger
2282 * README: add Hebrew, Arabic kmaps
2285 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2287 * src/buffer.C (writeFileAscii): Define actcell as an int instead
2290 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2292 * Lot of files: add pragma interface/implementation.
2294 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
2296 * lib/ui/default.ui: new file (ans new directory). Contains the
2297 default menu and toolbar.
2299 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
2300 global space. Toolbars are now read (as menus) in ui files.
2302 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
2304 * src/lyxfunc.C (getStatus): do not exit immediately if a command
2305 is disabled because the document is read-only. We want to have the
2306 toggle state of the function anyway.
2307 (getStatus): add code for LFUN_VC* functions (mimicking what is
2308 done in old-style menus)
2310 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
2311 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
2313 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
2314 * src/BufferView_pimpl.C: ditto.
2315 * src/lyxfunc.C: ditto.
2317 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
2318 default). This replaces old-style menus by new ones.
2320 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
2321 MenuItem. Contain the data structure of a menu.
2323 * src/insets/insettext.C: use LyXView::setLayout instead of
2324 accessing directly the toolbar combox.
2325 * src/lyxfunc.C (Dispatch): ditto.
2327 * src/LyXView.C (setLayout): new method, which just calls
2328 Toolbar::setLayout().
2329 (updateLayoutChoice): move part of this method in Toolbar.
2331 * src/toolbar.[Ch]: removed.
2333 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
2334 implementation the toolbar.
2336 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
2337 the toolbar. It might make sense to merge it with ToolbarDefaults
2339 (setLayout): new function.
2340 (updateLayoutList): ditto.
2341 (openLayoutList): ditto.
2343 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
2344 xforms implementation of the toolbar.
2345 (get_toolbar_func): comment out, since I do not
2346 know what it is good for.
2348 * src/ToolbarDefaults.h: Add the ItemType enum.
2350 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
2351 for a list of allocated C strings. Used in Menubar xforms
2352 implementation to avoid memory leaks.
2354 * src/support/lstrings.[Ch] (uppercase): new version taking and
2358 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
2359 * lib/bind/emacs.bind: ditto.
2361 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2363 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
2364 forward decl of LyXView.
2366 * src/toolbar.C (toolbarItem): moved from toolbar.h
2367 (toolbarItem::clean): ditto
2368 (toolbarItem::~toolbarItem): ditto
2369 (toolbarItem::operator): ditto
2371 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
2373 * src/paragraph.h: control the NEW_TABULAR define from here
2375 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
2376 USE_TABULAR_INSETS to NEW_TABULAR
2378 * src/ToolbarDefaults.C: add include "lyxlex.h"
2380 * files using the old table/tabular: use NEW_TABULAR to control
2381 compilation of old tabular stuff.
2383 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
2386 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
2387 planemet in reading of old style floats, fix the \end_deeper
2388 problem when reading old style floats.
2390 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2392 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
2394 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
2396 * lib/bind/sciword.bind: updated.
2398 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2400 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
2401 layout write problem
2403 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2405 * src/Makefile.am (INCLUDES): remove image directory from include
2408 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
2409 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
2411 * src/LyXView.C (create_form_form_main): read the application icon
2414 * lib/images/*.xpm: change the icons to use transparent color for
2417 * src/toolbar.C (update): change the color of the button when it
2420 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2422 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
2423 setting explicitely the minibuffer.
2424 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
2426 * src/LyXView.C (showState): new function. Shows font information
2427 in minibuffer and update toolbar state.
2428 (LyXView): call Toolbar::update after creating the
2431 * src/toolbar.C: change toollist to be a vector instead of a
2433 (BubbleTimerCB): get help string directly from the callback
2434 argument of the corresponding icon (which is the action)
2435 (set): remove unnecessary ugliness.
2436 (update): new function. update the icons (depressed, disabled)
2437 depending of the status of the corresponding action.
2439 * src/toolbar.h: remove help in toolbarItem
2441 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
2443 * src/Painter.C (text): Added code for using symbol glyphs from
2444 iso10646 fonts. Currently diabled.
2446 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
2449 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
2450 magyar,turkish and usorbian.
2452 * src/paragraph.C (isMultiLingual): Made more efficient.
2454 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
2457 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
2458 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
2459 Also changed the prototype to "bool math_insert_greek(char)".
2461 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2463 * lots of files: apply the NEW_INSETS on all code that will not be
2464 needed when we move to use the new insets. Enable the define in
2465 lyxparagrah.h to try it.
2467 * src/insets/insettabular.C (cellstart): change to be a static
2469 (InsetTabular): initialize buffer in the initializer list.
2471 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
2473 * src/frontends/xforms/FormPrint.[Ch] : moved #include
2474 form_print.h out of the header file. Replaced with forward
2475 declarations of the relevant struct.
2477 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
2480 * src/commandtags.h: do not include "debug.h" which does not
2481 belong there. #include it in some other places because of this
2484 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2486 * src/insets/insetcaption.C: add a couple "using" directives.
2488 * src/toolbar.C (add): get the help text directly from lyxaction.
2490 (setPixmap): new function. Loads from disk and sets a pixmap on a
2491 botton; the name of the pixmap file is derived from the command
2494 * src/toolbar.h: remove members isBitmap and pixmap from
2497 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
2498 * lib/images/: move many files from images/banner.xpm.
2500 * src/lyx_gui.C (create_forms): read banner pixmap from file.
2502 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
2503 * src/toolbar.C: ditto.
2504 * configure.in: ditto.
2505 * INSTALL: document.
2507 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
2508 the spellchecker popup is closed from the WM.
2510 2000-07-19 Juergen Vigna <jug@sad.it>
2512 * src/insets/insetfloat.C (Write): small fix because we use the
2513 insetname for the type now!
2515 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
2517 * src/frontends/xforms/forms/form_citation.fd: object sizes are
2520 * src/frontends/Dialogs.h: removed hideCitation signal
2522 * src/insets/insetcite.h: added hide signal
2524 * src/insets/insetcite.C (~InsetCitation): emits new signal
2525 (getScreenLabel): "intelligent" label should now fit on the screen!
2527 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
2529 * src/frontends/xforms/FormCitation.C (showInset): connects
2530 hide() to the inset's hide signal
2531 (show): modified to use fl_set_object_position rather than
2532 fl_set_object_geometry wherever possible
2534 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2536 * src/insets/lyxinset.h: add caption code
2538 * src/insets/insetfloat.C (type): new method
2540 * src/insets/insetcaption.C (Write): new method
2542 (LyxCode): new method
2544 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
2545 to get it right together with using the FloatList.
2547 * src/commandtags.h: add LFUN_INSET_CAPTION
2548 * src/lyxfunc.C (Dispatch): handle it
2550 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
2553 * src/Variables.[Ch]: make expand take a const reference, remove
2554 the destructor, some whitespace changes.
2556 * src/LyXAction.C (init): add caption-inset-insert
2558 * src/FloatList.C (FloatList): update the default floats a bit.
2560 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2562 * src/Variables.[Ch]: new files. Intended to be used for language
2563 specific strings (like \chaptername) and filename substitution in
2566 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
2568 * lib/kbd/american.kmap: update
2570 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
2572 * src/bufferparams.[Ch]: remove member allowAccents.
2574 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
2576 * src/LaTeXLog.C: use the log_form.h header.
2577 * src/lyx_gui.C: ditto.
2578 * src/lyx_gui_misc.C: ditto.
2579 * src/lyxvc.h: ditto.
2581 * forms/log_form.fd: new file, created from latexoptions.fd. I
2582 kept the log popup and nuked the options form.
2584 * src/{la,}texoptions.[Ch]: removed.
2585 * src/lyx_cb.C (LaTeXOptions): ditto
2587 * src/lyx_gui.C (create_forms): do not handle the
2588 fd_latex_options form.
2590 2000-07-18 Juergen Vigna <jug@sad.it>
2592 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
2593 name of the inset so that it can be requested outside (text2.C).
2595 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
2598 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2600 * src/mathed/formula.h (ConvertFont): constify
2602 * src/mathed/formula.C (Read): add warning if \end_inset is not
2603 found on expected place.
2605 * src/insets/lyxinset.h (ConvertFont): consify
2607 * src/insets/insetquotes.C (ConvertFont): constify
2608 * src/insets/insetquotes.h: ditto
2610 * src/insets/insetinfo.h: add labelfont
2612 * src/insets/insetinfo.C (InsetInfo): set the labelfont
2613 (ascent): use labelfont
2617 (Write): make .lyx file a bit nicer
2619 * src/insets/insetfloat.C (Write): simplify somewhat...
2620 (Read): add warning if arg is not found
2622 * src/insets/insetcollapsable.C: add using std::max
2623 (Read): move string token and add warning in arg is not found
2624 (draw): use std::max to get the right ty
2625 (getMaxWidth): simplify by using std::max
2627 * src/insets/insetsection.h: new file
2628 * src/insets/insetsection.C: new file
2629 * src/insets/insetcaption.h: new file
2630 * src/insets/insetcaption.C: new file
2632 * src/insets/inset.C (ConvertFont): constify signature
2634 * src/insets/Makefile.am (libinsets_la_SOURCES): add
2635 insetcaption.[Ch] and insetsection.[Ch]
2637 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
2638 uses to use LABEL_COUNTER_CHAPTER instead.
2639 * src/text2.C (SetCounter): here
2641 * src/counters.h: new file
2642 * src/counters.C: new file
2643 * src/Sectioning.h: new file
2644 * src/Sectioning.C: new file
2646 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
2648 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2650 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
2653 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
2656 2000-07-17 Juergen Vigna <jug@sad.it>
2658 * src/tabular.C (Validate): check if array-package is needed.
2659 (SetVAlignment): added support for vertical alignment.
2660 (SetLTFoot): better support for longtable header/footers
2661 (Latex): modified to support added features.
2663 * src/LaTeXFeatures.[Ch]: added array-package.
2665 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
2667 * src/lyx_gui.C (LyXGUI): make sure that the height is large
2670 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
2672 * configure.in: do not forget to put a space after -isystem.
2674 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
2676 * lib/kbd/arabic.kmap: a few fixes.
2678 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2680 * some whitespace chagnes to a number of files.
2682 * src/support/DebugStream.h: change to make it easier for
2683 doc++ to parse correctly.
2684 * src/support/lyxstring.h: ditto
2686 * src/mathed/math_utils.C (compara): change to have only one
2688 (MathedLookupBOP): change because of the above.
2690 * src/mathed/math_delim.C (math_deco_compare): change to have only
2692 (search_deco): change becasue of the above.
2694 * src/insets/insettabular.C (DrawCellSelection): use std::swap
2695 instead of manually coded one.
2697 * src/insets/insetquotes.C (Read): read the \end_inset too
2699 * src/insets/insetlatex.h: remove file
2700 * src/insets/insetlatex.C: remove file
2702 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
2704 (InsetPrintIndex): remove destructor
2706 * src/insets/insetinclude.h: remove default constructor
2708 * src/insets/insetfloat.C: work to make it work better
2710 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
2712 * src/insets/insetcite.h (InsetCitation): remove default constructor
2714 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
2716 * src/text.C (GetColumnNearX): comment out some currently unused code.
2718 * src/paragraph.C (writeFile): move some initializations closer to
2720 (CutIntoMinibuffer): small change to use new matchIT operator
2724 (InsertInset): ditto
2727 (InsetIterator): ditto
2728 (Erase): small change to use new matchFT operator
2730 (GetFontSettings): ditto
2731 (HighestFontInRange): ditto
2734 * src/lyxparagraph.h: some chars changed to value_type
2735 (matchIT): because of some stronger checking (perhaps too strong)
2736 in SGI STL, the two operator() unified to one.
2739 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
2741 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
2742 the last inset read added
2743 (parseSingleLyXformat2Token): some more (future) compability code added
2744 (parseSingleLyXformat2Token): warning about solitary \end_inset added
2745 (parseSingleLyXformat2Token): set last_inset_read
2746 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2747 (parseSingleLyXformat2Token): don't double intializw string next_token
2749 * src/TextCache.C (text_fits::operator()): add const's to the signature
2750 (has_buffer::operator()): ditto
2752 * src/Floating.h: add some comments on the class
2754 * src/FloatList.[Ch] (typeExist): new method
2757 * src/BackStack.h: added default constructor, wanted by Gcc.
2759 2000-07-14 Juergen Vigna <jug@sad.it>
2761 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
2763 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
2765 * src/insets/insettabular.C (resizeLyXText): need this to be able to
2766 do a redraw when the window is resized!
2767 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
2769 * src/insets/insettext.C (resizeLyXText): added function to correctly
2770 being able to resize the LyXWindow.
2772 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
2774 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
2776 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
2777 crashes when closing dialog to a deleted inset.
2779 * src/insets/insetcite.[Ch] (Edit) : the return of this former
2780 method! Now similar to other insets.
2782 2000-07-13 Juergen Vigna <jug@sad.it>
2784 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
2786 * lib/examples/Literate.lyx: small patch!
2788 * src/insets/insetbib.C (Read): added this function because of wrong
2789 Write (without [begin|end]_inset).
2791 2000-07-11 Juergen Vigna <jug@sad.it>
2793 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
2794 as the insertInset could not be good!
2796 * src/screen.C (ToggleSelection): fixed toggle selection bug as
2797 the bool param should not be last.
2799 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2801 * sigc++/configure.in: fix bug in threading-related code (Yes, I
2802 did submit that to Karl).
2804 * configure.in: use -isystem instead of -I for X headers. This
2805 fixes a problem on solaris with a recent gcc;
2806 put the front-end code after the X detection code;
2807 configure in sigc++ before lib/
2809 * src/lyx_main.C (commandLineHelp): remove -display from command
2812 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
2814 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
2815 Also put in Makefile rules for building the ``listerrors''
2816 program for parsing errors from literate programs written in LyX.
2818 * lib/build-listerrors: Added small shell script as part of compile
2819 process. This builds a working ``listerrors'' binary if noweb is
2820 installed and either 1) the VNC X server is installed on the machine,
2821 or 2) the user is compiling from within a GUI. The existence of a GUI
2822 is necessary to use the ``lyx --export'' feature for now. This
2823 hack can be removed once ``lyx --export'' no longer requires a GUI to
2826 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
2828 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
2829 now passed back correctly from gcc and placed "under" error
2830 buttons in a Literate LyX source.
2832 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2834 * src/text.C (GetColumnNearX): Better behavior when a RTL
2835 paragraph is ended by LTR text.
2837 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
2840 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2842 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
2843 true when clipboard is empty.
2845 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2847 * text.C (Backspace): Prevent rebreaking of a row if it is the last
2848 row of the paragraph.
2849 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
2850 to prevent calculation of bidi tables
2852 2000-07-07 Juergen Vigna <jug@sad.it>
2854 * src/screen.C (ToggleSelection): added y_offset and x_offset
2857 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
2860 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
2862 * src/insets/insettext.C: fixed Layout-Display!
2864 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2866 * configure.in: add check for strings.h header.
2868 * src/spellchecker.C: include <strings.h> in order to have a
2869 definition for bzero().
2871 2000-07-07 Juergen Vigna <jug@sad.it>
2873 * src/insets/insettext.C (draw): set the status of the bv->text to
2874 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
2876 * src/screen.C (DrawOneRow):
2877 (DrawFromTo): redraw the actual row if something has changed in it
2880 * src/text.C (draw): call an update of the toplevel-inset if something
2881 has changed inside while drawing.
2883 * src/lyxtext.h: added CHANGED_IN_DRAW status.
2885 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
2887 * src/insets/insetbib.[Ch] (callback) new method, moving callback
2888 processing inside class.
2890 * src/insets/insetindex.[Ch] (callback) new method, moving callback
2891 processing inside class.
2893 * src/insets/insetindex.h new struct Holder, consistent with other
2896 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
2897 citation dialog from main code and placed it in src/frontends/xforms.
2898 Dialog launched through signals instead of callbacks
2900 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
2902 * lyx.man: update the options description.
2904 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
2906 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
2907 handle neg values, set min width to 590, add doc about -display
2909 2000-07-05 Juergen Vigna <jug@sad.it>
2911 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
2912 calls to BufferView *.
2914 * src/insets/insettext.C (checkAndActivateInset): small fix non
2915 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
2917 * src/insets/insetcommand.C (Read): Fixed as insets should read till
2918 their \end_inset token!
2920 2000-07-04 edscott <edscott@imp.mx>
2922 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
2923 lib/lyxrc.example: added option \wheel_jump
2925 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
2927 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
2928 remove support for -width,-height,-xpos and -ypos.
2930 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
2932 * src/encoding.[Ch]: New files.
2934 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
2935 (text): Call to the underline() method only when needed.
2937 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
2939 * src/buffer.C (makeLaTeXFile): Compute automatically the input
2940 encoding(s) for the document.
2942 * src/bufferparams.C (BufferParams): Changed default value of
2945 * src/language.C (newLang): Removed.
2946 (items[]): Added encoding information for all defined languages.
2948 * src/lyx_gui.C (create_forms): Added "auto" option to the input
2949 encoding choice button.
2951 * src/lyxrc.h (font_norm_type): New member variable.
2952 (set_font_norm_type): New method.
2954 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
2955 paragraphs with different encodings.
2957 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
2958 (TransformChar): Changed to work correctly with Arabic points.
2959 (draw): Added support for drawing Arabic points.
2960 (draw): Removed code for drawing underbars (this is done by
2963 * src/support/textutils.h (IsPrintableNonspace): New function.
2965 * src/BufferView_pimpl.h: Added "using SigC::Object".
2966 * src/LyXView.h: ditto.
2968 * src/insets/insetinclude.h (include_label): Changed to mutable.
2970 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
2972 * src/mathed/math_iter.h: remove empty destructor
2974 * src/mathed/math_cursor.h: remove empty destructor
2976 * src/insets/lyxinset.h: add THEOREM_CODE
2978 * src/insets/insettheorem.[Ch]: new files
2980 * src/insets/insetminipage.C: (InsertInset): remove
2982 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
2984 (InsertInset): remove
2986 * src/insets/insetlist.C: (InsertList): remove
2988 * src/insets/insetfootlike.[Ch]: new files
2990 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
2993 (InsertInset): ditto
2995 * src/insets/insetert.C: remove include Painter.h, reindent
2996 (InsertInset): move to header
2998 * src/insets/insetcollapsable.h: remove explicit from default
2999 contructor, remove empty destructor, add InsertInset
3001 * src/insets/insetcollapsable.C (InsertInset): new func
3003 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3005 * src/vspace.h: add explicit to constructor
3007 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
3008 \textcompwordmark, please test this.
3010 * src/lyxrc.C: set ascii_linelen to 65 by default
3012 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
3014 * src/commandtags.h: add LFUN_INSET_THEOREM
3016 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
3017 (makeLinuxDocFile): remove _some_ of the nice logic
3018 (makeDocBookFile): ditto
3020 * src/Painter.[Ch]: (~Painter): removed
3022 * src/LyXAction.C (init): entry for insettheorem added
3024 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
3026 (deplog): code to detect files generated by LaTeX, needs testing
3029 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3031 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
3033 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3035 * src/LaTeX.C (deplog): Add a check for files that are going to be
3036 created by the first latex run, part of the project to remove the
3039 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
3040 contents to the extension list.
3042 2000-07-04 Juergen Vigna <jug@sad.it>
3044 * src/text.C (NextBreakPoint): added support for needFullRow()
3046 * src/insets/lyxinset.h: added needFullRow()
3048 * src/insets/insetcollapsable.C: redone now this uses a text-inset
3051 * src/insets/insettext.C: lots of changes for update!
3053 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
3055 * src/LaTeXFeatures.h: add a missing std:: qualifier.
3057 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
3059 * src/insets/insetinclude.C (InsetInclude): fixed
3060 initialization of include_label.
3061 (unique_id): now returns a string.
3063 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
3065 * src/LaTeXFeatures.h: new member IncludedFiles, for
3066 a map of key, included file name.
3068 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
3069 with the included files for inclusion in SGML preamble,
3070 i. e., linuxdoc and docbook.
3073 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
3074 nice (is the generated linuxdoc code to be exported?), that
3075 allows to remove column, and only_body that will be true for
3076 slave documents. Insets are allowed inside SGML font type.
3077 New handling of the SGML preamble for included files.
3078 (makeDocBookFile): the same for docbook.
3080 * src/insets/insetinclude.h:
3081 * src/insets/insetinclude.C (Validate): keeps a list of included files.
3083 (DocBook): new export methods.
3085 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
3086 and makeDocBookFile.
3088 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
3089 formats to export with command line argument -x.
3091 2000-06-29 Juergen Vigna <jug@sad.it>
3093 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
3094 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
3096 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
3097 region could already been cleared by an inset!
3099 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3101 * src/BufferView_pimpl.h: remove member variables lyx_focus and
3104 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
3106 (cursorToggle): remove special handling of lyx focus.
3108 2000-06-28 Juergen Vigna <jug@sad.it>
3110 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
3113 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3115 * src/insets/insetindex.C (Edit): add a callback when popup is
3118 * src/insets/insettext.C (LocalDispatch):
3119 * src/insets/insetmarginal.h:
3120 * src/insets/insetlist.h:
3121 * src/insets/insetfoot.h:
3122 * src/insets/insetfloat.h:
3123 * src/insets/insetert.h: add a missing std:: qualifier.
3125 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3127 * src/support/lyxsum.C (sum): '\0' teminate file read when using
3130 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
3132 * src/insets/insettext.C (Read): remove tmptok unused variable
3133 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
3134 (InsertInset): change for new InsetInset code
3136 * src/insets/insettext.h: add TEXT inline method
3138 * src/insets/insettext.C: remove TEXT macro
3140 * src/insets/insetmarginal.C (Write): new method
3141 (Latex): change output slightly
3143 * src/insets/insetfoot.C (Write): new method
3144 (Latex): change output slightly (don't use endl when no need)
3146 * src/insets/insetert.C (Write): new method
3148 * src/insets/insetcollapsable.h: make button_length, button_top_y
3149 and button_bottm_y protected.
3151 * src/insets/insetcollapsable.C (Write): simplify code by using
3152 tostr. Also do not output the float name, the children class
3153 should to that to get control over own arguments
3155 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
3156 src/insets/insetminipage.[Ch]:
3159 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3161 * src/lyxfunc.C (Dispatch): cases for new insets/commands
3163 * src/Makefile.am (lyx_SOURCES): add the new files
3165 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
3166 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
3167 * src/commandtags.h: ditto
3169 * src/LaTeXFeatures.h: add a std::set of used floattypes
3171 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
3173 * src/FloatList.[Ch] src/Floating.h: new files
3175 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
3177 * src/lyx_cb.C (TableApplyCB): ditto
3179 * src/text2.C: ditto
3180 * src/buffer.C (SimpleLinuxDocOnePar): ditto
3181 (parseSingleLyXformat2Token): ditto + add code for
3182 backwards compability for old float styles + add code for new insets
3184 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
3186 (InsertInset(size_type, Inset *, LyXFont)): new method
3187 (InsetChar(size_type, char)): changed to use the other InsetChar
3188 with a LyXFont(ALL_INHERIT).
3189 (InsetInset(size_type, Inset*)): changed to use InsetChar to
3190 insert the META_INSET.
3192 * sigc++/thread.cc (Privete<int>::operator int&): move definition
3194 * sigc++/thread.h (Threads): from here
3196 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
3197 definition out of line
3198 * sigc++/scope.h: from here
3200 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3202 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
3203 is specified (adapted from a patch from edscott <edscott@imp.mx>).
3205 * Makefile.am (bindist): new target.
3207 * INSTALL: add instructions for doing a binary distribution.
3209 * development/tools/README.bin.example: update a bit.
3211 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
3214 * lib/lyxrc.example: new lyxrc tag \set_color.
3216 * src/lyxfunc.C (Dispatch):
3217 * src/commandtags.h:
3218 * src/LyXAction.C: new lyxfunc "set-color".
3220 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
3221 and an x11name given as strings.
3223 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
3224 cache when a color is changed.
3226 2000-06-26 Juergen Vigna <jug@sad.it>
3228 * src/lyxrow.C (width): added this functions and variable.
3230 * src/insets/insetcite.C (create_form_citation_form): some Gravity
3233 * src/text.C (SetHeightOfRow): fixed calcualting of width.
3235 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3237 * images/undo_bw.xpm: new icon.
3238 * images/redo_bw.xpm: ditto.
3240 * configure.in (INSTALL_SCRIPT): change value to
3241 ${INSTALL} to avoid failures of install-script target.
3242 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
3244 * src/BufferView.h: add a magic "friend" declaration to please
3247 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
3249 * forms/cite.fd: modified to allow resizing without messing
3252 * src/insetcite.C: Uses code from cite.fd almost without
3254 User can now resize dialog in the x-direction.
3255 Resizing the dialog in the y-direction is prevented, as the
3256 code does this intelligently already.
3258 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3260 * INSTALL: remove obsolete entry in "problems" section.
3262 * lib/examples/sl_*.lyx: update of the slovenian examples.
3264 * src/support/FileInfo.[Ch] (getBlockSize): remove.
3266 2000-06-23 Juergen Vigna <jug@sad.it>
3268 * src/lyxtext.h: added a 'cleared' flag to draw() function.
3270 * src/buffer.C (resize): delete the LyXText of textinsets.
3272 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
3274 * src/insets/lyxinset.h: added another parameter 'cleared' to
3275 the draw() function.
3277 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
3278 unlocking inset in inset.
3280 2000-06-22 Juergen Vigna <jug@sad.it>
3282 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
3283 of insets and moved first to LyXText.
3285 * src/mathed/formulamacro.[Ch]:
3286 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
3288 2000-06-21 Juergen Vigna <jug@sad.it>
3290 * src/text.C (GetVisibleRow): look if I should clear the area or not
3291 using Inset::doClearArea() function.
3293 * src/insets/lyxinset.h: added doClearArea() function and
3294 modified draw(Painter &, ...) to draw(BufferView *, ...)
3296 * src/text2.C (UpdateInset): return bool insted of int
3298 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
3300 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
3301 combox in the character popup
3303 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
3304 BufferParams const & params
3306 2000-06-20 Juergen Vigna <jug@sad.it>
3308 * src/insets/insettext.C (SetParagraphData): set insetowner on
3311 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3313 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
3314 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
3316 (form_main_): remove
3318 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
3319 (create_form_form_main): remove FD_form_main stuff, connect to
3320 autosave_timeout signal
3322 * src/LyXView.[Ch] (getMainForm): remove
3323 (UpdateTimerCB): remove
3324 * src/BufferView_pimpl.h: inherit from SigC::Object
3326 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
3327 signal instead of callback
3329 * src/BufferView.[Ch] (cursorToggleCB): remove
3331 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3333 * src/BufferView_pimpl.C: changes because of the one below
3335 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
3336 instead of storing a pointer to a LyXText.
3338 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
3340 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
3342 * src/lyxparagraph.h
3344 * src/paragraph.C: Changed fontlist to a sorted vector.
3346 2000-06-19 Juergen Vigna <jug@sad.it>
3348 * src/BufferView.h: added screen() function.
3350 * src/insets/insettext.C (LocalDispatch): some selection code
3353 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
3355 * src/insets/insettext.C (SetParagraphData):
3357 (InsetText): fixes for multiple paragraphs.
3359 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
3361 * development/lyx.spec.in: Call configure with ``--without-warnings''
3362 to work around a bug with the Makefiles when doing ``make lyxrpm''.
3363 This should be fine, however, since we generally don't want to be
3364 verbose when making an RPM.
3366 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
3368 * lib/scripts/fig2pstex.py: New file
3370 2000-06-16 Juergen Vigna <jug@sad.it>
3372 * src/insets/insettabular.C (UpdateLocal):
3373 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
3374 (LocalDispatch): Changed all functions to use LyXText.
3376 2000-06-15 Juergen Vigna <jug@sad.it>
3378 * src/text.C (SetHeightOfRow): call inset::update before requesting
3381 * src/insets/insettext.C (update):
3382 * src/insets/insettabular.C (update): added implementation
3384 * src/insets/lyxinset.h: added update function
3386 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3388 * src/text.C (SelectNextWord): protect against null pointers with
3389 old-style string streams. (fix from Paul Theo Gonciari
3392 * src/cite.[Ch]: remove erroneous files.
3394 * lib/configure.m4: update the list of created directories.
3396 * src/lyxrow.C: include <config.h>
3397 * src/lyxcursor.C: ditto.
3399 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3401 * lib/examples/decimal.lyx: new example file from Mike.
3403 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
3404 to find template definitions (from Dekel)
3406 * src/frontends/.cvsignore: add a few things.
3408 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
3410 * src/Timeout.C (TimeOut): remove default argument.
3412 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
3415 * src/insets/ExternalTemplate.C: add a "using" directive.
3417 * src/lyx_main.h: remove the act_ struct, which seems unused
3420 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
3422 * LyX Developers Meeting: All files changed, due to random C++ (by
3423 coincidence) code generator script.
3425 - external inset (cool!)
3426 - initial online editing of preferences
3427 - insettabular breaks insettext(s contents)
3429 - some DocBook fixes
3430 - example files update
3431 - other cool stuff, create a diff and look for yourself.
3433 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
3435 * src/insets/insettext.C (computeTextRows): if the maxWidth is
3436 -1 this is a non-line-breaking textinset.
3438 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
3439 if there is no width set.
3441 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
3443 * Lots of files: Merged the dialogbase branch.
3445 2000-06-09 Allan Rae <rae@lyx.org>
3447 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
3448 and the Dispatch methods that used it.
3450 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
3451 access to functions formerly kept in Dispatch.
3453 2000-05-19 Allan Rae <rae@lyx.org>
3455 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
3456 made to_page and count_copies integers again. from_page remains a
3457 string however because I want to allow entry of a print range like
3458 "1,4,22-25" using this field.
3460 * src/LyXAction.C: added action info and commands for buffer-print-xtl
3461 and printer-params-get. These aren't useful from the minibuffer but
3462 could be used by a script/LyXServer app provided it passes a suitable
3463 auto_mem_buffer. I guess I should take a look at how the LyXServer
3464 works and make it support xtl buffers.
3466 * sigc++/: updated to libsigc++-1.0.1
3468 * src/xtl/: updated to xtl-1.3.pl.11
3470 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
3471 those changes done to the files in src/ are actually recreated when
3472 they get regenerated. Please don't ever accept a patch that changes a
3473 dialog unless that patch includes the changes to the corresponding *.fd
3476 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
3477 stringOnlyContains, renamed it and generalised it.
3479 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
3480 branch. Removed the remaining old form_print code.
3482 2000-04-26 Allan Rae <rae@lyx.org>
3484 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
3485 trap I was trying to fix with the ID: fields in src/xtl/ :-)
3487 2000-04-25 Allan Rae <rae@lyx.org>
3489 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
3490 against a base of xtl-1.3.pl.4
3492 * development/tools/lxtl.sh: fixed a couple of silly typos and now
3493 filter the Id: entries so they still show the xtl version number
3496 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
3497 into the src/xtl code. Patch still pending with José (XTL)
3499 2000-04-24 Allan Rae <rae@lyx.org>
3501 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
3502 both more generic and much safer. Use the new template functions.
3503 * src/buffer.[Ch] (Dispatch): ditto.
3505 * src/frontends/xforms/FormPrint.C (update): Use new template functions
3506 and mem buffer more intelligently. Also a little general cleanup.
3509 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
3510 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
3511 * src/xtl/Makefile.am: ditto.
3512 * src/xtl/.cvsignore: ditto.
3513 * src/Makefile.am: ditto.
3515 * src/PrinterParams.h: Removed the macros member functions. Added a
3516 testInvariant member function. A bit of tidying up and commenting.
3517 Included Angus's idea for fixing operation with egcs-1.1.2.
3519 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
3520 cool expansion of XTL's mem_buffer to support automatic memory
3521 management within the buffer itself. Removed the various macros and
3522 replaced them with template functions that use either auto_mem_buffer
3523 or mem_buffer depending on a #define. The mem_buffer support will
3524 disappear as soon as the auto_mem_buffer is confirmed to be good on
3525 other platforms/compilers. That is, it's there so you've got something
3528 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
3529 effectively forked XTL. However I expect José will include my code
3530 into the next major release. Also fixed a memory leak.
3531 * src/xtl/text.h: ditto.
3532 * src/xtl/xdr.h: ditto.
3533 * src/xtl/giop.h: ditto.
3535 2000-04-16 Allan Rae <rae@lyx.org>
3537 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
3538 by autogen.sh and removed by maintainer-clean anyway.
3539 * .cvsignore, sigc++/.cvsignore: Support the above.
3541 * sigc++/.cvsignore: Forgot that retbind.h was generated.
3543 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
3545 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
3546 macros, renamed static callback-target member functions to suit new
3547 scheme and made them public.
3548 * src/frontends/xforms/forms/form_print.fd: ditto.
3549 * src/frontends/xforms/forms/form_copyright.fd: ditto.
3551 * src/support/lxtl.h: small cleanup to use typedef instead of #define
3554 * src/xtl/: New directory containing a minimal distribution of XTL.
3555 This is XTL-1.3.pl.4.
3557 * development/tools/lxtl.sh: A script to generate the above mini-dist.
3559 2000-04-15 Allan Rae <rae@lyx.org>
3561 * development/tools/makeLyXsigc.sh: Remove the library version numbers
3563 * sigc++/: Updated to libsigc++-1.0.0
3565 2000-04-14 Allan Rae <rae@lyx.org>
3567 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
3568 use the generic ones in future. I'll modify my conversion script.
3570 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
3572 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
3573 (CloseAllBufferRelatedDialogs): Renamed.
3574 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
3576 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
3577 of the generic ones. These are the same ones my conversion script
3580 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
3581 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
3582 * src/buffer.C (Dispatch): ditto
3584 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
3585 functions for updating and hiding buffer dependent dialogs.
3586 * src/BufferView.C (buffer): ditto
3587 * src/buffer.C (setReadonly): ditto
3588 * src/lyxfunc.C (CloseBuffer): ditto
3590 * src/buffer.h: Take setReadonly() out of line so I don't have to include
3591 Dialogs.h, and hence all the SigC stuff, into every file that includes
3592 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
3594 * src/BufferView2.C: reduce the number of headers included by buffer.h
3596 2000-04-11 Allan Rae <rae@lyx.org>
3598 * src/frontends/xforms/xform_macros.h: A small collection of macros
3599 for building C callbacks.
3601 * src/frontends/xforms/Makefile.am: Added above file.
3603 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
3604 scheme again. This time it should work for JMarc. If this is
3605 successful I'll revise my conversion script to automate some of this.
3606 The static member functions in the class also have to be public for
3607 this scheme will work. If the scheme works (it's almost identical to
3608 the way BufferView::cursorToggleCB is handled so it should work) then
3609 FormCopyright and FormPrint will be ready for inclusion into the main
3610 trunk immediately after 1.1.5 is released -- provided we're prepared
3611 for complaints about lame compilers not handling XTL.
3613 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
3615 2000-04-07 Allan Rae <rae@lyx.org>
3617 * config/lyxinclude.m4: A bit more tidying up (Angus)
3619 * src/LString.h: JMarc's <string> header fix
3621 * src/PrinterParams.h: Used string for most data to remove some
3622 ugly code in the Print dialog and avoid even uglier code when
3623 appending the ints to a string for output.
3625 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
3626 and moved "default:" back to the end of switch statement. Cleaned
3627 up the printing so it uses the right function calls and so the
3628 "print to file" option actually puts the file in the right directory.
3630 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
3632 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
3633 and Ok+Apply button control into a separate method: input (Angus).
3634 (input) Cleaned it up and improved it to be very thorough now.
3635 (All CB) static_cast used instead of C style cast (Angus). This will
3636 probably change again once we've worked out how to keep gcc-2.8.1 happy
3637 with real C callbacks.
3638 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
3639 ignore some of the bool settings and has random numbers instead. Needs
3640 some more investigation. Added other input length checks and checking
3641 of file and printer names.
3643 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
3644 would link (Angus). Seems the old code doesn't compile with the pragma
3645 statement either. Separated callback entries from internal methods.
3647 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
3649 2000-03-17 Allan Rae <rae@lyx.org>
3651 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
3652 need it? Maybe it could go in Dialogs instead? I could make it a
3653 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
3654 values to get the bool return value.
3655 (Dispatch): New overloaded method for xtl support.
3657 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
3658 extern "C" callback instead of static member functions. Hopefully,
3659 JMarc will be able to compile this. I haven't changed
3660 forms/form_copyright.fd yet. Breaking one of my own rules already.
3662 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
3663 because they aren't useful from the minibuffer. Maybe a LyXServer
3664 might want a help message though?
3666 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
3668 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
3669 xtl which needs both rtti and exceptions.
3671 * src/support/Makefile.am:
3672 * src/support/lxtl.h: New file. Some helper macros for using XTL.
3674 * src/frontends/xforms/input_validators.[ch]: input filters and
3675 validators. These conrol what keys are valid in input boxes.
3676 Use them and write some more. Much better idea than waiting till
3677 after the user has pressed Ok to say that the input fields don't make
3680 * src/frontends/xforms/Makefile.am:
3681 * src/frontends/xforms/forms/form_print.fd:
3682 * src/frontends/xforms/forms/makefile:
3683 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
3684 new scheme. Still have to make sure I haven't missed anything from
3685 the current implementation.
3687 * src/Makefile.am, src/PrinterParams.h: New data store.
3689 * other files: Added a couple of copyright notices.
3691 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3693 * src/insets/insetbib.h: move Holder struct in public space.
3695 * src/frontends/include/DialogBase.h: use SigC:: only when
3696 SIGC_CXX_NAMESPACES is defined.
3697 * src/frontends/include/Dialogs.h: ditto.
3699 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
3701 * src/frontends/xforms/FormCopyright.[Ch]: do not
3702 mention SigC:: explicitely.
3704 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3706 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
3707 deals with testing KDE in main configure.in
3708 * configure.in: ditto.
3710 2000-02-22 Allan Rae <rae@lyx.org>
3712 * Lots of files: Merged from HEAD
3714 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
3715 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
3717 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
3719 * sigc++/: new minidist.
3721 2000-02-14 Allan Rae <rae@lyx.org>
3723 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
3725 2000-02-08 Juergen Vigna <jug@sad.it>
3727 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
3728 file for the buildin GUI builder of KDevelop of the copyright-dialog.
3730 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
3731 for this port and so it is much easier for other people to port
3732 dialogs in a common development environment.
3734 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
3735 the QT/KDE implementation.
3737 * src/frontends/kde/Dialogs.C:
3738 * src/frontends/kde/FormCopyright.C:
3739 * src/frontends/kde/FormCopyright.h:
3740 * src/frontends/kde/Makefile.am:
3741 * src/frontends/kde/formcopyrightdialog.C:
3742 * src/frontends/kde/formcopyrightdialog.h:
3743 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
3744 for the kde support of the Copyright-Dialog.
3746 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3747 subdir-substitution instead of hardcoded 'xforms' as we now have also
3750 * src/frontends/include/DialogBase.h (Object): just commented the
3751 label after #endif (nasty warning and I don't like warnings ;)
3753 * src/main.C (main): added KApplication initialization if using
3756 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
3757 For now only the KDE event-loop is added if frontend==kde.
3759 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
3761 * configure.in: added support for the --with-frontend[=value] option
3763 * autogen.sh: added kde.m4 file to list of config-files
3765 * acconfig.h: added define for KDEGUI-support
3767 * config/kde.m4: added configuration functions for KDE-port
3769 * config/lyxinclude.m4: added --with-frontend[=value] option with
3770 support for xforms and KDE.
3772 2000-02-08 Allan Rae <rae@lyx.org>
3774 * all Makefile.am: Fixed up so the make targets dist, distclean,
3775 install and uninstall all work even if builddir != srcdir. Still
3776 have a new sigc++ minidist update to come.
3778 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
3780 2000-02-01 Allan Rae <rae@lyx.org>
3782 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
3783 Many mods to get builddir != srcdir working.
3785 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
3786 for building on NT and so we can do the builddir != srcdir stuff.
3788 2000-01-30 Allan Rae <rae@lyx.org>
3790 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
3791 This will stay in "rae" branch. We probably don't really need it in
3792 the main trunk as anyone who wants to help programming it should get
3793 a full library installed also. So they can check both included and
3794 system supplied library compilation.
3796 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
3797 Added a 'mini' distribution of libsigc++. If you feel the urge to
3798 change something in these directories - Resist it. If you can't
3799 resist the urge then you should modify the following script and rebuild
3800 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
3801 all happen. Still uses a hacked version of libsigc++'s configure.in.
3802 I'm quite happy with the results. I'm not sure the extra work to turn
3803 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
3804 worth the trouble and would probably lead to extra maintenance
3806 I haven't tested the following important make targets: install, dist.
3807 Not ready for prime time but very close. Maybe 1.1.5.
3809 * development/tools/makeLyXsigc.sh: A shell script to automatically
3810 generate our mini-dist of libsigc++. It can only be used with a CVS
3811 checkout of libsigc++ not a tarball distribution. It's well commented.
3812 This will end up as part of the libsigc++ distribution so other apps
3813 can easily have an included mini-dist. If someone makes mods to the
3814 sigc++ subpackage without modifying this script to generate those
3815 changes I'll be very upset!
3817 * src/frontends/: Started the gui/system indep structure.
3819 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
3820 to access the gui-indep dialogs are in this class. Much improved
3821 design compared to previous revision. Lars, please refrain from
3822 moving this header into src/ like you did with Popups.h last time.
3824 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
3826 * src/frontends/xforms/: Started the gui-indep system with a single
3827 dialog: FormCopyright. Initial testing of use of libsigc++ was very
3830 * src/frontends/xforms/forms: Repository for the xforms .fd files.
3831 Here you'll find a very useful makefile and automated fdfix.sh that
3832 makes updating dailogs a no-brainer -- provided you follow the rules
3833 set out in the README. I'm thinking about adding another script to
3834 automatically generate skeleton code for a new dialog given just the
3837 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
3838 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
3839 Made FormCopyright gui-indep and added a lyxfunc to get to it.
3841 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
3843 * src/support/LSubstring.C (operator): simplify
3845 * src/lyxtext.h: removed bparams, use buffer_->params instead
3847 * src/lyxrow.h: make Row a real class, move all variables to
3848 private and use accessors.
3850 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
3852 (isRightToLeftPar): ditto
3853 (ChangeLanguage): ditto
3854 (isMultiLingual): ditto
3857 (SimpleTeXOnePar): ditto
3858 (TeXEnvironment): ditto
3859 (GetEndLabel): ditto
3861 (SetOnlyLayout): ditto
3862 (BreakParagraph): ditto
3863 (BreakParagraphConservative): ditto
3864 (GetFontSettings): ditto
3866 (CopyIntoMinibuffer): ditto
3867 (CutIntoMinibuffer): ditto
3868 (PasteParagraph): ditto
3869 (SetPExtraType): ditto
3870 (UnsetPExtraType): ditto
3871 (DocBookContTableRows): ditto
3872 (SimpleDocBookOneTablePar): ditto
3874 (TeXFootnote): ditto
3875 (SimpleTeXOneTablePar): ditto
3876 (TeXContTableRows): ditto
3877 (SimpleTeXSpecialChars): ditto
3880 * src/lyxcursor.h: make LyXCursor a real class, move all variables
3881 to private and use accessors.
3883 * src/lyx_cb.C: remove char updatetimer, and all code that uses
3884 this, we did not use it anymore and has not been for ages. Just a
3885 waste of cpu cycles.
3887 * src/language.h: make Language a real class, move all variables
3888 to private and use accessors.
3890 * src/BufferView_pimpl.C (Pimpl): use new timer code.
3891 (create_view): remove
3892 (update): some changes for new timer
3893 (cursorToggle): use new timer
3894 (beforeChange): change for new timer
3896 * src/BufferView.h (cursorToggleCB): removed last paramter because
3899 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
3900 (cursorToggleCB): change because of new timer code
3902 * lib/CREDITS: updated own mailaddress
3904 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3906 * src/support/filetools.C (PutEnv): fix the code in case neither
3907 putenv() nor setenv() have been found.
3909 * INSTALL: mention the install-strip Makefile target.
3911 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
3912 read-only documents.
3914 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3916 * lib/reLyX/configure.in (VERSION): avoid using a previously
3917 generated reLyX wrapper to find out $prefix.
3919 * lib/examples/eu_adibide_lyx-atua.lyx:
3920 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
3921 translation of the Tutorial (Dooteo)
3923 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
3925 * forms/cite.fd: new citation dialog
3927 * src/insetcite.[Ch]: the new citation dialog is moved into
3930 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
3933 * src/insets/insetcommand.h: data members made private.
3935 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3937 * LyX 1.1.5 released
3939 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3941 * src/version.h (LYX_RELEASE): to 1.1.5
3943 * src/spellchecker.C (RunSpellChecker): return false if the
3944 spellchecker dies upon creation.
3946 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3948 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
3949 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
3953 * lib/CREDITS: update entry for Martin Vermeer.
3955 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
3957 * src/text.C (draw): Draw foreign language bars at the bottom of
3958 the row instead of at the baseline.
3960 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
3962 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3964 * lib/bind/de_menus.bind: updated
3966 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3968 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
3970 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3972 * src/menus.C (Limit_string_length): New function
3973 (ShowTocMenu): Limit the number of items/length of items in the
3976 * src/paragraph.C (String): Correct result for a paragraph inside
3979 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3981 * src/bufferlist.C (close): test of buf->getuser() == NULL
3983 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
3985 * src/BufferView2.C (removeAutoInsets): Fix a bug:
3986 Do not call to SetCursor when the paragraph is a closed footnote!
3988 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
3990 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
3993 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
3995 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3998 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
3999 reference popup, that activates the reference-back action
4001 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
4003 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
4004 the menus. Also fixed a bug.
4006 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
4007 the math panels when switching buffers (unless new buffer is readonly).
4009 * src/BufferView.C (NoSavedPositions)
4010 * src/BufferView_pimpl.C (NoSavedPositions): New methods
4012 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4014 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
4015 less of dvi dirty or not.
4017 * src/trans_mgr.[Ch] (insert): change first parameter to string
4020 * src/chset.[Ch] (encodeString): add const to first parameter
4022 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4024 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
4028 * src/LaTeX.C (deplog): better searching for dependency files in
4029 the latex log. Uses now regexps.
4031 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
4032 instead of the box hack or \hfill.
4034 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4036 * src/lyxfunc.C (doImportHelper): do not create the file before
4037 doing the actual import.
4038 (doImportASCIIasLines): create a new file before doing the insert.
4039 (doImportASCIIasParagraphs): ditto.
4041 * lib/lyxrc.example: remove mention of non-existing commands
4043 * lyx.man: remove mention of color-related switches.
4045 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
4047 * src/lyx_gui.C: remove all the color-related ressources, which
4048 are not used anymore.
4050 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
4053 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4055 * src/lyxrc.C (read): Add a missing break in the switch
4057 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
4059 * src/text2.C (InsertStringA): Fix a bug with insertion into table
4061 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
4064 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4066 * src/text.C (draw): draw bars under foreign language words.
4068 * src/LColor.[Ch]: add LColor::language
4070 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4072 * src/lyxcursor.h (boundary): New member variable
4074 * src/text.C (IsBoundary): New methods
4076 * src/text.C: Use the above for currect cursor movement when there
4077 is both RTL & LTR text.
4079 * src/text2.C: ditto
4081 * src/bufferview_funcs.C (ToggleAndShow): ditto
4083 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4085 * src/text.C (DeleteLineForward): set selection to true to avoid
4086 that DeleteEmptyParagraphMechanism does some magic. This is how it
4087 is done in all other functions, and seems reasonable.
4088 (DeleteWordForward): do not jump over non-word stuff, since
4089 CursorRightOneWord() already does it.
4091 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
4092 DeleteWordBackward, since they seem safe to me (since selection is
4093 set to "true") DeleteEmptyParagraphMechanism does nothing.
4095 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4097 * src/lyx_main.C (easyParse): simplify the code by factoring the
4098 part that removes parameters from the command line.
4099 (LyX): check wether wrong command line options have been given.
4101 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
4103 * src/lyx_main.C : add support for specifying user LyX
4104 directory via command line option -userdir.
4106 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
4108 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
4109 the number of items per popup.
4110 (Add_to_refs_menu): Ditto.
4112 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4114 * src/lyxparagraph.h: renamed ClearParagraph() to
4115 StripLeadingSpaces() and moved it to paragraph.C. We pass the
4116 textclass as parameter, and do nothing if free_spacing is
4117 true. This fixes part of the line-delete-forward problems.
4119 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
4120 (pasteSelection): ditto.
4121 (SwitchLayoutsBetweenClasses): more translatable strings.
4123 * src/text2.C (CutSelection): use StripLeadingSpaces.
4124 (PasteSelection): ditto.
4125 (DeleteEmptyParagraphMechanism): ditto.
4127 2000-05-26 Juergen Vigna <jug@sad.it>
4129 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
4130 is not needed in tabular insets.
4132 * src/insets/insettabular.C (TabularFeatures): added missing features.
4134 * src/tabular.C (DeleteColumn):
4136 (AppendRow): implemented this functions
4137 (cellsturct::operator=): clone the inset too;
4139 2000-05-23 Juergen Vigna <jug@sad.it>
4141 * src/insets/insettabular.C (LocalDispatch): better selection support
4142 when having multicolumn-cells.
4144 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4146 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
4148 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4150 * src/ColorHandler.C (getGCForeground): put more test into _()
4152 * lib/examples/eu_splash.lyx: new file (Basque translation) from
4155 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
4158 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
4160 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
4161 there are no labels, or when buffer is readonly.
4163 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
4164 there are no labels, buffer is SGML, or when buffer is readonly.
4166 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4168 * src/LColor.C (LColor): change a couple of grey40 to grey60
4169 (LColor): rewore initalization to make compiles go some magnitude
4171 (getGUIName): don't use gettext until we need the string.
4173 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
4175 * src/Bullet.[Ch]: Fixed a small bug.
4177 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
4179 * src/paragraph.C (String): Several fixes/improvements
4181 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
4183 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4185 * src/paragraph.C (String): give more correct output.
4187 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
4189 * src/lyxfont.C (stateText) Do not output the language if it is
4190 eqaul to the language of the document.
4192 * src/paragraph.C (TeXOnePar): Do not put language switch commands
4193 between two paragraphs with the same language.
4195 * src/paragraph.C (getParLanguage) Return a correct answer for an
4196 empty dummy paragraph.
4198 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
4201 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
4204 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
4205 the menus/popup, if requested fonts are unavailable.
4207 2000-05-22 Juergen Vigna <jug@sad.it>
4209 * src/insets/insettabular.C (LocalDispatch): added some more cursor
4210 movement support (Up/Down/Tab/Shift-Tab).
4211 (LocalDispatch): added also preliminari cursor-selection.
4213 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
4215 * src/paragraph.C (PasteParagraph): Hopefully now right!
4217 2000-05-22 Garst R. Reese <reese@isn.net>
4219 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
4220 of list, change all references to Environment to Command
4221 * tex/hollywood.cls : rewrite environments as commands, add
4222 \uppercase to interiorshot and exteriorshot to force uppecase.
4223 * tex/broadway.cls : rewrite environments as commands. Tweak
4226 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4228 * src/menus.C (Add_to_toc_menu): fix the code which limits the
4229 size of items: use a constant intead of the hardcoded 40, and more
4230 importantly do not remove the %m and %x tags added at the end.
4231 (Add_to_refs_menu): use vector::size_type instead of
4232 unsigned int as basic types for the variables. _Please_ do not
4233 assume that size_t is equal to unsigned int. On an alpha, this is
4234 unsigned long, which is _not_ the same.
4236 * src/language.C (initL): remove language "hungarian", since it
4237 seems that "magyar" is better.
4239 2000-05-22 Juergen Vigna <jug@sad.it>
4241 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
4243 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
4246 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
4247 next was deleted but not set to 0.
4249 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4251 * src/language.C (initL): change the initialization of languages
4252 so that compiles goes _fast_.
4254 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
4257 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
4259 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4263 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4265 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
4267 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
4271 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
4274 * src/insets/insetlo*.[Ch]: Made editable
4276 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4278 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
4279 the current selection.
4281 * src/BufferView_pimpl.C (stuffClipboard): new method
4283 * src/BufferView.C (stuffClipboard): new method
4285 * src/paragraph.C (String): new method
4287 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
4288 LColor::ignore when lyxname is not found.
4290 * src/BufferView.C (pasteSelection): new method
4292 * src/BufferView_pimpl.C (pasteSelection): new method
4294 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
4296 * src/WorkArea.C (request_clipboard_cb): new static function
4297 (getClipboard): new method
4298 (putClipboard): new method
4300 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4302 * LyX 1.1.5pre2 released
4304 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4306 * src/vspace.C (operator=): removed
4307 (operator=): removed
4309 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
4311 * src/layout.C (NumberOfClass): manually set the type in make_pair
4312 (NumberOfLayout): ditto
4314 * src/language.C: use the Language constructor for ignore_lang
4316 * src/language.h: add constructors to struct Language
4318 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
4320 * src/text2.C (SetCursorIntern): comment out #warning
4322 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
4324 * src/mathed/math_iter.h: initialize sx and sw to 0
4326 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4328 * forms/lyx.fd: Redesign of form_ref
4330 * src/LaTeXFeatures.[Ch]
4334 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
4337 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
4338 and Buffer::inset_iterator.
4340 * src/menus.C: Added new menus: TOC and Refs.
4342 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
4344 * src/buffer.C (getTocList): New method.
4346 * src/BufferView2.C (ChangeRefs): New method.
4348 * src/buffer.C (getLabelList): New method. It replaces the old
4349 getReferenceList. The return type is vector<string> instead of
4352 * src/insets/insetinclude.C (getLabelList): New method. Replaces
4353 the old getLabel() and GetNumberOfLabels() methods.
4354 * src/insets/insetlabel.C (getLabelList): ditto
4355 * src/mathed/formula.C (getLabelList): ditto
4357 * src/paragraph.C (String): New method.
4359 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
4360 Uses the new getTocList() method.
4361 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
4362 which automatically updates the contents of the browser.
4363 (RefUpdateCB): Use the new getLabelList method.
4365 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
4367 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
4369 * src/spellchecker.C: Added using std::reverse;
4371 2000-05-19 Juergen Vigna <jug@sad.it>
4373 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
4375 * src/insets/insettext.C (computeTextRows): small fix for display of
4376 1 character after a newline.
4378 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
4381 2000-05-18 Juergen Vigna <jug@sad.it>
4383 * src/insets/insettabular.C (TabularFeatures): fixed update of display
4384 when changing width of column.
4386 * src/tabular.C (set_row_column_number_info): setting of
4387 autobreak rows if necessary.
4389 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4391 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
4393 * src/vc-backend.*: renamed stat() to status() and vcstat to
4394 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
4395 compilation broke. The new name seems more relevant, anyway.
4397 2000-05-17 Juergen Vigna <jug@sad.it>
4399 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
4400 which was wrong if the removing caused removing of rows!
4402 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
4403 (pushToken): new function.
4405 * src/text2.C (CutSelection): fix problem discovered with purify
4407 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4409 * src/debug.C (showTags): enlarge the first column, now that we
4410 have 6-digits debug codes.
4412 * lib/layouts/hollywood.layout:
4413 * lib/tex/hollywood.cls:
4414 * lib/tex/brodway.cls:
4415 * lib/layouts/brodway.layout: more commands and fewer
4416 environments. Preambles moved in the .cls files. Broadway now has
4417 more options on scene numbering and less whitespace (from Garst)
4419 * src/insets/insetbib.C (getKeys): make sure that we are in the
4420 document directory, in case the bib file is there.
4422 * src/insets/insetbib.C (Latex): revert bogus change.
4424 2000-05-16 Juergen Vigna <jug@sad.it>
4426 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
4427 the TabularLayout on cursor move.
4429 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
4431 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
4434 (draw): fixed cursor position and drawing so that the cursor is
4435 visible when before the tabular-inset.
4437 * src/insets/insettext.C (init): drawLockedFrame was not initialized
4438 when creating from old insettext.
4440 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
4442 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4444 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
4445 * lib/tex/brodway.cls: ditto
4447 * lib/layouts/brodway.layout: change alignment of parenthical
4450 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4452 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
4453 versions 0.88 and 0.89 are supported.
4455 2000-05-15 Juergen Vigna <jug@sad.it>
4457 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
4460 * src/insets/insettext.C (computeTextRows): redone completely this
4461 function in a much cleaner way, because of problems when having a
4463 (draw): added a frame border when the inset is locked.
4464 (SetDrawLockedFrame): this sets if we draw the border or not.
4465 (SetFrameColor): this sets the frame color (default=insetframe).
4467 * src/insets/lyxinset.h: added x() and y() functions which return
4468 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
4469 function which is needed to see if we have a locking inset of some
4470 type in this inset (needed for now in insettabular).
4472 * src/vspace.C (inPixels): the same function also without a BufferView
4473 parameter as so it is easier to use it in some ocasions.
4475 * src/lyxfunc.C: changed all places where insertInset was used so
4476 that now if it couldn't be inserted it is deleted!
4478 * src/TabularLayout.C:
4479 * src/TableLayout.C: added support for new tabular-inset!
4481 * src/BufferView2.C (insertInset): this now returns a bool if the
4482 inset was really inserted!!!
4484 * src/tabular.C (GetLastCellInRow):
4485 (GetFirstCellInRow): new helper functions.
4486 (Latex): implemented for new tabular class.
4490 (TeXTopHLine): new Latex() helper functions.
4492 2000-05-12 Juergen Vigna <jug@sad.it>
4494 * src/mathed/formulamacro.C (Read):
4495 * src/mathed/formula.C (Read): read also the \end_inset here!
4497 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4499 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
4500 crush when saving formulae with unbalanced parenthesis.
4502 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
4504 * src/layout.C: Add new keyword "endlabelstring" to layout file
4506 * src/text.C (GetVisibleRow): Draw endlabel string.
4508 * lib/layouts/broadway.layout
4509 * lib/layouts/hollywood.layout: Added endlabel for the
4510 Parenthetical layout.
4512 * lib/layouts/heb-article.layout: Do not use slanted font shape
4513 for Theorem like environments.
4515 * src/buffer.C (makeLaTeXFile): Always add "american" to
4516 the UsedLanguages list if document language is RTL.
4518 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4520 * add addendum to README.OS2 and small patch (from SMiyata)
4522 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4524 * many files: correct the calls to ChangeExtension().
4526 * src/support/filetools.C (ChangeExtension): remove the no_path
4527 argument, which does not belong there. Use OnlyFileName() instead.
4529 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
4530 files when LaTeXing a non-nice latex file.
4532 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
4533 a chain of "if". Return false when deadkeys are not handled.
4535 * src/lyx_main.C (LyX): adapted the code for default bindings.
4537 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
4538 bindings for basic functionality (except deadkeys).
4539 (deadKeyBindings): new method. Performs the bindings of deadkeys.
4541 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
4542 several methods: handle override_x_deadkeys.
4544 * src/lyxrc.h: remove the "bindings" map, which did not make much
4545 sense anyway. New variable override_x_deadkeys, defaulting to "true".
4547 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4549 * src/lyxfont.C (stateText): use a saner method to determine
4550 whether the font is "default". Seems to fix the crash with DEC
4553 * src/Bullet.[Ch] (Bullet): remove const on parameters.
4555 2000-05-08 Juergen Vigna <jug@sad.it>
4557 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
4558 TabularLayoutMenu with mouse-button-3
4559 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
4561 * src/TabularLayout.C: added this file for having a Layout for
4564 2000-05-05 Juergen Vigna <jug@sad.it>
4566 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
4567 recalculating inset-widths.
4568 (TabularFeatures): activated this function so that I can change
4569 tabular-features via menu.
4571 * src/menus.C (ShowEditMenu): inserted support for insettabular so
4572 that I can test some functions with the Table menu.
4574 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4576 * src/lyxfont.C (stateText): guard against stupid c++libs.
4578 * src/tabular.C: add using std::vector
4579 some whitespace changes, + removed som autogenerated code.
4581 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
4583 2000-05-05 Juergen Vigna <jug@sad.it>
4585 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
4586 row, columns and cellstructures.
4588 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4590 * lib/lyxrc.example: remove obsolete entries.
4592 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
4593 reading of protected_separator for free_spacing.
4595 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4597 * src/text.C (draw): do not display an exclamation mark in the
4598 margin for margin notes. This is confusing, ugly and
4601 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
4602 AMS math' is checked.
4604 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
4605 name to see whether including the amsmath package is needed.
4607 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
4609 * src/paragraph.C (validate): Compute UsedLanguages correctly
4610 (don't insert the american language if it doesn't appear in the
4613 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
4614 The argument of \thanks{} command is considered moving argument
4616 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
4619 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
4621 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
4622 for appendix/minipage/depth. The lines can be now both in the footnote
4623 frame, and outside the frame.
4625 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
4628 2000-05-05 Juergen Vigna <jug@sad.it>
4630 * src/table.[Ch]: removed the inset and buffer stuff as this is now
4631 neede only in tabular.[Ch].
4633 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4635 * src/insets/insetspecialchar.C (Read): allow command == '~' for
4637 (Write): write '~' for PROTECTED_SEPARATOR
4639 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4641 * src/lyxparagraph.h: add a friend struct matchIT after the struct
4644 * src/mathed/formula.C (drawStr): rename size to siz.
4646 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
4647 possibly fix a bug by not changing the pflags = flags to piflags =
4650 2000-05-05 Juergen Vigna <jug@sad.it>
4652 * src/insets/insetbib.C: moved using directive
4654 * src/ImportNoweb.C: small fix for being able to compile (missing
4657 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4659 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
4660 to use clear, since we don't depend on this in the code. Add test
4663 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4665 * (various *.C files): add using std::foo directives to please dec
4668 * replace calls to string::clear() to string::erase() (Angus)
4670 * src/cheaders/cmath: modified to provide std::abs.
4672 2000-05-04 Juergen Vigna <jug@sad.it>
4674 * src/insets/insettext.C: Prepared all for inserting of multiple
4675 paragraphs. Still display stuff to do (alignment and other things),
4676 but I would like to use LyXText to do this when we cleaned out the
4677 table-support stuff.
4679 * src/insets/insettabular.C: Changed lot of stuff and added lots
4680 of functionality still a lot to do.
4682 * src/tabular.C: Various functions changed name and moved to be
4683 const functions. Added new Read and Write functions and changed
4684 lots of things so it works good with tabular-insets (also removed
4685 some stuff which is not needed anymore * hacks *).
4687 * src/lyxcursor.h: added operators == and != which just look if
4688 par and pos are (not) equal.
4690 * src/buffer.C (latexParagraphs): inserted this function to latex
4691 all paragraphs form par to endpar as then I can use this too for
4694 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
4695 so that I can call this to from text insets with their own cursor.
4697 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
4698 output off all paragraphs (because of the fix below)!
4700 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
4701 the very last paragraph (this could be also the last paragraph of an
4704 * src/texrow.h: added rows() call which returns the count-variable.
4706 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4708 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
4710 * lib/configure.m4: better autodetection of DocBook tools.
4712 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4714 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
4716 * src/lyx_cb.C: add using std::reverse;
4718 * src/LaTeX.C (run): on error always run deleteFilesOnError before
4721 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
4722 selected files. Should fix repeated errors from generated files.
4724 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
4726 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
4728 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
4729 the spellchecker popup.
4731 * lib/lyxrc.example: Removed the \number_inset section
4733 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4735 * src/insets/figinset.C (various): Use IsFileReadable() to make
4736 sure that the file actually exist. Relying on ghostscripts errors
4737 is a bad idea since they can lead to X server crashes.
4739 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
4741 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
4744 * lib/lyxrc.example: smallish typo in description of
4745 \view_dvi_paper_option
4747 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4750 * src/lyxfunc.C: doImportHelper to factor out common code of the
4751 various import methods. New functions doImportASCIIasLines,
4752 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
4753 doImportLinuxDoc for the format specific parts.
4756 * buffer.C: Dispatch returns now a bool to indicate success
4759 * lyx_gui.C: Add getLyXView() for member access
4761 * lyx_main.C: Change logic for batch commands: First try
4762 Buffer::Dispatch (possibly without GUI), if that fails, use
4765 * lyx_main.C: Add support for --import command line switch.
4766 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
4767 Available Formats: Everything accepted by 'buffer-import <format>'
4769 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4771 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
4774 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
4775 documents will be reformatted upon reentry.
4777 2000-04-27 Juergen Vigna <jug@sad.it>
4779 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
4780 correctly only last pos this was a bug.
4782 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4784 * release of lyx-1.1.5pre1
4786 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4788 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
4790 * src/menus.C: revert the change of naming (Figure->Graphic...)
4791 from 2000-04-11. It was incomplete and bad.
4793 * src/LColor.[Ch]: add LColor::depthbar.
4794 * src/text.C (GetVisibleRow): use it.
4796 * README: update the languages list.
4798 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4800 * src/text.C (GetVisibleRow): show the depth of paragraphs using
4803 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4805 * README: remove sections that were just wrong.
4807 * src/text2.C (GetRowNearY): remove currentrow code
4809 * src/text.C (GetRow): remove currentrow code
4811 * src/screen.C (Update): rewritten a bit.
4812 (SmallUpdate): removed func
4814 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
4816 (FullRebreak): return bool
4817 (currentrow): remove var
4818 (currentrow_y): ditto
4820 * src/lyxscreen.h (Draw): change arg to unsigned long
4821 (FitCursor): return bool
4822 (FitManualCursor): ditto
4823 (Smallpdate): remove func
4824 (first): change to unsigned long
4825 (DrawOneRow): change second arg to long (from long &)
4826 (screen_refresh_y): remove var
4827 (scree_refresh_row): ditto
4829 * src/lyxrow.h: change baseline to usigned int from unsigned
4830 short, this brings some implicit/unsigned issues out in the open.
4832 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
4834 (Dispatch): don't call updateScrollbar after fitCursor. Use update
4835 instead of smallUpdate.
4837 * src/lyxcursor.h: change y to unsigned long
4839 * src/buffer.h: don't call updateScrollbar after fitcursor
4841 * src/buffer.C (parseSingleLyXformat2Token): move variables to
4842 where they are used. Removed "\\direction", this was not present
4843 in 1.1.4 and is already obsolete. Commented out some code that I
4844 believe to never be called.
4845 (runLiterate): don't call updateScrollbar after fitCursor
4847 (buildProgram): ditto
4850 * src/WorkArea.h (workWidth): change return val to unsigned
4853 (redraw): remove the button redraws
4854 (setScrollbarValue): change for scrollbar
4855 (getScrollbarValue): change for scrollbar
4856 (getScrollbarBounds): change for scrollbar
4858 * src/WorkArea.C (C_WorkArea_up_cb): removed func
4859 (C_WorkArea_down_cb): removed func
4860 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
4861 (resize): change for scrollbar
4862 (setScrollbar): ditto
4863 (setScrollbarBounds): ditto
4864 (setScrollbarIncrements): ditto
4865 (up_cb): removed func
4866 (down_cb): removed func
4867 (scroll_cb): change for scrollbar
4868 (work_area_handler): ditto
4870 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
4871 when FitCursor did something.
4872 (updateScrollbar): some unsigned changes
4873 (downCB): removed func
4874 (scrollUpOnePage): removed func
4875 (scrollDownOnePage): remvoed func
4876 (workAreaMotionNotify): don't call screen->FitCursor but use
4877 fitCursor instead. and bool return val
4878 (workAreaButtonPress): ditto
4879 (workAreaButtonRelease): some unsigned changes
4880 (checkInsetHit): ditto
4881 (workAreaExpose): ditto
4882 (update): parts rewritten, comments about the signed char arg added
4883 (smallUpdate): removed func
4884 (cursorPrevious): call needed updateScrollbar
4887 * src/BufferView2.C (allFloats): don't call updateScrollbar after
4890 * src/BufferView.[Ch] (upCB): removed func
4891 (downCB): removed func
4892 (smallUpdate): removed func
4894 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4896 * src/lyxtext.h src/text.C src/text2.C: removed support for the
4897 currentrow, currentrow_y optimization. This did not help a lot and
4898 if we want to do this kind of optimization we should rather use
4899 cursor.row instead of the currentrow.
4901 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
4902 buffer spacing and klyx spacing support.
4904 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4906 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
4909 2000-04-26 Juergen Vigna <jug@sad.it>
4911 * src/insets/figinset.C: fixes to Lars sstream changes!
4913 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
4915 * A lot of files: Added Ascii(ostream &) methods to all inset
4916 classes. Used when exporting to ASCII.
4918 * src/buffer.C (writeFileAscii,RoffAsciiTable)
4919 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
4922 * src/text2.C (ToggleFree): Disabled implicit word selection when
4923 there is a change in the language
4925 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
4926 no output was generated for end-of-sentence inset.
4928 * src/insets/lyxinset.h
4931 * src/paragraph.C: Removed the insetnumber code
4933 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
4935 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4937 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
4938 no_babel and no_epsfig completely from the file.
4939 (parseSingleLyXformat2Token): add handling for per-paragraph
4940 spacing as written by klyx.
4942 * src/insets/figinset.C: applied patch by Andre. Made it work with
4945 2000-04-20 Juergen Vigna <jug@sad.it>
4947 * src/insets/insettext.C (cutSelection):
4948 (copySelection): Fixed with selection from right to left.
4949 (draw): now the rows are not recalculated at every draw.
4950 (computeTextRows): for now reset the inset-owner here (this is
4951 important for an undo or copy where the inset-owner is not set
4954 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
4955 motion to the_locking_inset screen->first was forgotten, this was
4956 not important till we got multiline insets.
4958 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4960 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
4961 code seems to be alright (it is code changed by Dekel, and the
4962 intent is indeed that all macros should be defined \protect'ed)
4964 * NEWS: a bit of reorganisation of the new user-visible features.
4966 2000-04-19 Juergen Vigna <jug@sad.it>
4968 * src/insets/insettext.C (init): using a LyXCursor now for cursor
4969 position. Set the inset_owner of the used paragraph so that it knows
4970 that it is inside an inset. Fixed cursor handling with mouse and
4971 cursor keys. Fixed wrong timed inset redraws and lots of other changes
4972 and cleanups to make TextInsets work better.
4974 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
4975 Changed parameters of various functions and added LockInsetInInset().
4977 * src/insets/insettext.C:
4979 * src/insets/insetcollapsable.h:
4980 * src/insets/insetcollapsable.C:
4981 * src/insets/insetfoot.h:
4982 * src/insets/insetfoot.C:
4983 * src/insets/insetert.h:
4984 * src/insets/insetert.C: cleaned up the code so that it works now
4985 correctly with insettext.
4987 * src/insets/inset.C:
4988 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
4989 that insets in insets are supported right.
4992 * src/table.C: lots of changes for use with inset tabular (and cleanup)
4994 * src/paragraph.C: some small fixes
4996 * src/debug.h: inserted INSETS debug info
4998 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
4999 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
5001 * src/commandtags.h:
5002 * src/LyXAction.C: insert code for InsetTabular.
5004 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
5005 not Button1MotionMask.
5006 (workAreaButtonRelease): send always a InsetButtonRelease event to
5008 (checkInsetHit): some setCursor fixes (always with insets).
5010 * src/BufferView2.C (lockInset): returns a bool now and extended for
5011 locking insets inside insets.
5012 (showLockedInsetCursor): it is important to have the cursor always
5013 before the locked inset.
5014 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
5016 * src/BufferView.h: made lockInset return a bool.
5018 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
5020 * src/text2.C (SetCursor): This now has a version with a LyXCursor
5021 that is used also internally but can be called as public to have back
5022 a cursor pos which is not set internally.
5023 (SetCursorIntern): Changed to use above function.
5025 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
5027 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5032 * NEWS: updated for prerelease of 1.1.5. Please comment and send
5033 patches for things that should be in or should be changed.
5035 * src/* [insetfiles]: change "usigned char fragile" to bool
5036 fragile. There was only one point that could that be questioned
5037 and that is commented in formulamacro.C. Grep for "CHECK".
5039 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
5040 (DeleteBuffer): take it out of CutAndPaste and make it static.
5042 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5044 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
5045 output the spacing envir commands. Also the new commands used in
5046 the LaTeX output makes the result better.
5048 * src/Spacing.C (writeEnvirBegin): new method
5049 (writeEnvirEnd): new method
5051 2000-04-18 Juergen Vigna <jug@sad.it>
5053 * src/CutAndPaste.C: made textclass a static member of the class
5054 as otherwise it is not accesed right!!!
5056 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
5058 * forms/layout_forms.fd
5059 * src/layout_forms.h
5060 * src/layout_forms.C (create_form_form_character)
5061 * src/lyx_cb.C (UserFreeFont)
5062 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
5063 documents (in the layout->character popup).
5065 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5067 * src/spellchecker.C (create_ispell_pipe): fix a bug where
5068 \spell_command was in fact not honored (from Kevin Atkinson).
5070 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
5073 * src/lyx_gui.h: make lyxViews private (Angus)
5075 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
5077 * src/mathed/math_write.C
5078 (MathMatrixInset::Write) Put \protect before \begin{array} and
5079 \end{array} if fragile
5080 (MathParInset::Write): Put \protect before \\ if fragile
5082 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5084 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
5085 initialization if the LyXColorHandler must be done after the
5086 connections to the XServer has been established.
5088 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
5089 get the background pixel from the lyxColorhandler so that the
5090 figures are rendered with the correct background color.
5091 (NextToken): removed functions.
5092 (GetPSSizes): use ifs >> string instead of NextToken.
5094 * src/Painter.[Ch]: the color cache moved out of this file.
5096 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
5099 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5101 * src/WorkArea.C (work_area_handler): call BufferView::enterView
5102 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
5104 * src/BufferView.C (enterView): new func
5105 (leaveView): new func
5107 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
5109 (leaveView): new func, undefines xterm cursor when approp.
5111 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
5112 (AllowInput): delete the Workarea cursor handling from this func.
5114 * src/Painter.C (underline): draw a slimer underline in most cases.
5116 * src/lyx_main.C (error_handler): use extern "C"
5118 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5120 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
5121 sent directly to me.
5123 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
5124 to the list by Dekel.
5126 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
5129 * src/bufferview_funcs.[Ch]: two new files, moved several of the
5130 methods from lyx_cb.here.
5132 * src/lyx_cb.C: in addition to the above; removed input_prohibited
5135 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5137 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
5138 instead of using current_view directly.
5140 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
5142 * src/LyXAction.C (init): add the paragraph-spacing command.
5144 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
5146 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
5148 * src/lyx_cb.C (CurrentState): output a string when the spacing is
5149 different from the documents.
5151 * src/text.C (SetHeightOfRow): take paragraph spacing into
5152 account, paragraph spacing takes precedence over buffer spacing
5153 (GetVisibleRow): ditto
5155 * src/paragraph.C (writeFile): output the spacing parameter too.
5156 (validate): set the correct features if spacing is used in the
5158 (Clear): set spacing to default
5159 (MakeSameLayout): spacing too
5160 (HasSameLayout): spacing too
5161 (SetLayout): spacing too
5162 (TeXOnePar): output the spacing commands
5164 * src/lyxparagraph.h: added a spacing variable for use with
5165 per-paragraph spacing.
5167 * src/Spacing.h: add a Default spacing and a method to check if
5168 the current spacing is default. also added an operator==
5170 * src/text2.C (DeleteEmptyParagraphMechanism): added a
5173 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5175 * src/lyxserver.C (callback): fix dispatch of functions
5177 * src/insets/insetlatexaccent.C (checkContents): turn bogus
5178 printf() into lyxerr call.
5180 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
5183 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
5184 "Table" to "Table Box", "Float" to "Floating Material"; deletes
5185 the "Float" from each of the subitems.
5186 (ShowHelpMenu): add entry for "FAQ" and "TOC".
5188 * src/support/DebugStream.h: add an #ifdef to work around a gcc
5189 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
5190 documented the change so that the workaround can be nuked later.
5192 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
5195 * src/lyxlex_pimpl.C (next): do not re-declare the default value
5197 * src/buffer.C (getLatexName): ditto
5198 (setReadonly): ditto
5200 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5202 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
5203 avoid some uses of current_view. Added also a bufferParams()
5204 method to get at this.
5206 * src/lyxtext.h: changed params->buffer and paramters->bparams.
5208 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5210 * src/lyxparagraph.[Ch]: removed
5211 operator<(LyXParagraph::InsetTable..., added a struct matchIT
5212 with operators used by lower_bound and
5213 upper_bound in InsetTable's
5214 Make struct InsetTable private again. Used matchpos.
5216 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
5218 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
5219 document, the language of existing text is changed (unless the
5220 document is multi-lingual)
5222 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
5224 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
5226 * A lot of files: A rewrite of the Right-to-Left support.
5228 2000-04-10 Juergen Vigna <jug@sad.it>
5230 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
5231 misplaced cursor when inset in inset is locked.
5233 * src/insets/insettext.C (LocalDispatch): small fix so that a
5234 BREAKLINE is not inserted if we don't permit it with autBreakRows.
5236 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
5237 footnote font should be decreased in size twice when displaying.
5239 * src/insets/insettext.C (GetDrawFont): inserted this function as
5240 the drawing-font may differ from the real paragraph font.
5242 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
5243 insets (inset in inset!).
5245 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
5246 function here because we don't want footnotes inside footnotes.
5248 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
5250 (init): now set the inset_owner in paragraph.C
5251 (LocalDispatch): added some resetPos() in the right position
5254 (pasteSelection): changed to use the new CutAndPaste-Class.
5256 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
5257 which tells if it is allowed to insert another inset inside this one.
5259 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
5260 SwitchLayoutsBetweenClasses.
5262 * src/text2.C (InsertInset): checking of the new paragraph-function
5264 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
5265 is not needed anymore here!
5268 (PasteSelection): redone (also with #ifdef) so that now this uses
5269 the CutAndPaste-Class.
5270 (SwitchLayoutsBetweenClasses): removed here and implemented in the
5273 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
5274 from/to text/insets.
5276 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
5277 so that the paragraph knows if it is inside an (text)-inset.
5278 (InsertFromMinibuffer): changed return-value to bool as now it
5279 may happen that an inset is not inserted in the paragraph.
5280 (InsertInsetAllowed): this checks if it is allowed to insert an
5281 inset in this paragraph.
5283 (BreakParagraphConservative):
5284 (BreakParagraph) : small change for the above change of the return
5285 value of InsertFromMinibuffer.
5287 * src/lyxparagraph.h: added inset_owner and the functions to handle
5288 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
5290 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5292 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
5293 functions from BufferView to BufferView::Pimpl to ease maintence.
5295 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
5296 correctly. Also use SetCursorIntern instead of SetCursor.
5298 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
5301 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5303 * src/WorkArea.C (belowMouse): manually implement below mouse.
5305 * src/*: Add "explicit" on several constructors, I added probably
5306 some unneeded ones. A couple of changes to code because of this.
5308 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
5309 implementation and private parts from the users of BufferView. Not
5312 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
5313 implementation and private parts from the users of LyXLex. Not
5316 * src/BufferView_pimpl.[Ch]: new files
5318 * src/lyxlex_pimpl.[Ch]: new files
5320 * src/LyXView.[Ch]: some inline functions move out-of-line
5322 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5324 * src/lyxparagraph.h: make struct InsetTable public.
5326 * src/support/lyxstring.h: change lyxstring::difference_type to be
5327 ptrdiff_t. Add std:: modifiers to streams.
5329 * src/font.C: include the <cctype> header, for islower() and
5332 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5334 * src/font.[Ch]: new files. Contains the metric functions for
5335 fonts, takes a LyXFont as parameter. Better separation of concepts.
5337 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
5338 changes because of this.
5340 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
5342 * src/*: compile with -Winline and move functions that don't
5345 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
5348 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5350 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
5351 (various files changed because of this)
5353 * src/Painter.C (text): fixed the drawing of smallcaps.
5355 * src/lyxfont.[Ch] (drawText): removed unused member func.
5358 * src/*.C: added needed "using" statements and "std::" qualifiers.
5360 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5362 * src/*.h: removed all use of "using" from header files use
5363 qualifier std:: instead.
5365 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5367 * src/text.C (Backspace): some additional cleanups (we already
5368 know whether cursor.pos is 0 or not).
5370 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
5371 automake does not provide one).
5373 * src/bmtable.h: replace C++ comments with C comments.
5375 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
5377 * src/screen.C (ShowCursor): Change the shape of the cursor if
5378 the current language is not equal to the language of the document.
5379 (If the cursor change its shape unexpectedly, then you've found a bug)
5381 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
5384 * src/insets/insetnumber.[Ch]: New files.
5386 * src/LyXAction.C (init)
5387 * src/lyxfunc.C (dispatch): Add command number-inset-insert
5390 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
5392 * src/lyxparagraph.h
5393 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
5394 (the vector is kept sorted).
5396 * src/text.C (GetVisibleRow): Draw selection correctly when there
5397 is both LTR and RTL text.
5399 * src/paragraph.C (Clone): Use the assignment operator for cloning,
5400 which is much faster.
5402 * src/text.C (GetVisibleRow and other): Do not draw the last space
5403 in a row if the direction of the last letter is not equal to the
5404 direction of the paragraph.
5406 * src/lyxfont.C (latexWriteStartChanges):
5407 Check that font language is not equal to basefont language.
5408 (latexWriteEndChanges): ditto
5410 * src/lyx_cb.C (StyleReset): Don't change the language while using
5411 the font-default command.
5413 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
5414 empty paragraph before a footnote.
5416 * src/insets/insetcommand.C (draw): Increase x correctly.
5418 * src/screen.C (ShowCursor): Change cursor shape if
5419 current language != document language.
5421 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
5423 2000-03-31 Juergen Vigna <jug@sad.it>
5425 * src/paragraph.C (GetInset): commented out text[pos] = ' '
5426 (Clone): changed mode how the paragraph-data is copied to the
5427 new clone-paragraph.
5429 * src/lyxfunc.C (Dispatch): fixed small problem when calling
5430 GetInset(pos) with no inset anymore there (in inset UNDO)
5432 * src/insets/insetcommand.C (draw): small fix as here x is
5433 incremented not as much as width() returns (2 before, 2 behind = 4)
5435 2000-03-30 Juergen Vigna <jug@sad.it>
5437 * src/insets/insettext.C (InsetText): small fix in initialize
5438 widthOffset (should not be done in the init() function)
5440 2000-03-29 Amir Karger <karger@lyx.org>
5442 * lib/examples/it_ItemizeBullets.lyx: translation by
5445 * Implemented \textasciitilde and fixed a tiny bug in reLyX
5447 2000-03-29 Juergen Vigna <jug@sad.it>
5449 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
5451 * src/insets/insetfoot.C (Clone): small change as for the below
5452 new init function in the text-inset
5454 * src/insets/insettext.C (init): new function as I've seen that
5455 clone did not copy the Paragraph-Data!
5456 (LocalDispatch): Added code so that now we have some sort of Undo
5457 functionality (well actually we HAVE Undo ;)
5459 * src/text.C (Backspace): Small fix for the a | a Backspace problem
5461 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
5463 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
5466 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5468 * src/main.C: added a runtime check that verifies that the xforms
5469 header used when building LyX and the library used when running
5470 LyX match. Exit with a message if they don't match. This is a
5471 version number check only.
5473 * src/buffer.C (save): Don't allocate memory on the heap for
5474 struct utimbuf times.
5476 * *: some using changes, use iosfwd instead of the real headers.
5478 * src/lyxfont.C use char const * instead of string for the static
5479 strings. Rewrite some functions to use sstream.
5481 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5483 * src/text.C (Backspace): hopefully fix the dreaded backaspace
5486 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5488 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
5489 of Geodesy (from Martin Vermeer)
5491 * lib/layouts/svjour.inc: include file for the Springer svjour
5492 class. It can be used to support journals other than JoG.
5494 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
5495 Miskiewicz <misiek@pld.org.pl>)
5496 * lib/reLyX/Makefile.am: ditto.
5498 2000-03-27 Juergen Vigna <jug@sad.it>
5500 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
5501 also some modifications with operations on selected text.
5503 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
5504 problems with clicking on insets (last famous words ;)
5506 * src/insets/insetcommand.C (draw):
5507 (width): Changed to have a bit of space before and after the inset so
5508 that the blinking cursor can be seen (otherwise it was hidden)
5510 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5512 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
5513 would not be added to the link list when an installed gettext (not
5514 part of libc) is found.
5516 2000-03-24 Juergen Vigna <jug@sad.it>
5518 * src/insets/insetcollapsable.C (Edit):
5519 * src/mathed/formula.C (InsetButtonRelease):
5520 (InsetButtonPress): fixed for new handling of ButtonPress/Release
5523 * src/BufferView.C (workAreaButtonPress):
5524 (workAreaButtonRelease):
5525 (checkInsetHit): Finally fixed the clicking on insets be handled
5528 * src/insets/insetert.C (Edit): inserted this call so that ERT
5529 insets work always with LaTeX-font
5531 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5533 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
5534 caused lyx to startup with no GUI in place, causing in a crash
5535 upon startup when called with arguments.
5537 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5539 * src/FontLoader.C: better initialization of dummyXFontStruct.
5541 2000-03-20 José Abílio Matos <jamatos@lyx.org>
5543 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
5544 for linuxdoc and docbook import and export format options.
5546 * lib/lyxrc.example Example of default values for the previous flags.
5548 * src/lyx_cb.C Use those flags instead of the hardwired values for
5549 linuxdoc and docbook export.
5551 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
5554 * src/menus.C Added menus entries for the new import/exports formats.
5556 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5558 * src/lyxrc.*: Added support for running without Gui
5561 * src/FontLoader.C: sensible defaults if no fonts are needed
5563 * src/lyx_cb.C: New function ShowMessage (writes either to the
5564 minibuffer or cout in case of no gui
5565 New function AskOverwrite for common stuff
5566 Consequently various changes to call these functions
5568 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
5569 wild guess at sensible screen resolution when having no gui
5571 * src/lyxfont.C: no gui, no fonts... set some defaults
5573 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5575 * src/LColor.C: made the command inset background a bit lighter.
5577 2000-03-20 Hartmut Goebel <goebel@noris.net>
5579 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
5580 stdstruct.inc. Koma-Script added some title elements which
5581 otherwise have been listed below "bibliography". This split allows
5582 adding title elements to where they belong.
5584 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
5585 define the additional tilte elements and then include
5588 * many other layout files: changed to include stdtitle.inc just
5589 before stdstruct.inc.
5591 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
5593 * src/buffer.C: (save) Added the option to store all backup files
5594 in a single directory
5596 * src/lyxrc.[Ch]: Added variable \backupdir_path
5598 * lib/lyxrc.example: Added descriptions of recently added variables
5600 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
5601 bibtex inset, not closing the bibtex popup when deleting the inset)
5603 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5605 * src/lyx_cb.C: add a couple using directives.
5607 2000-03-17 José Abílio Matos <jamatos@lyx.org>
5608 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
5609 import based on the filename.
5611 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
5612 file would be imported at start, if the filename where of a sgml file.
5614 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
5616 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
5618 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
5619 * src/lyxfont.h Replaced the member variable bits.direction by the
5620 member variable lang. Made many changes in other files.
5621 This allows having a multi-lingual document
5623 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
5624 that change the current language to <l>.
5625 Removed the command "font-rtl"
5627 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
5628 format for Hebrew documents)
5630 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
5631 When auto_mathmode is "true", pressing a digit key in normal mode
5632 will cause entering into mathmode.
5633 If auto_mathmode is "rtl" then this behavior will be active only
5634 when writing right-to-left text.
5636 * src/text2.C (InsertStringA) The string is inserted using the
5639 * src/paragraph.C (GetEndLabel) Gives a correct result for
5640 footnote paragraphs.
5642 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
5644 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5646 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
5647 front of PasteParagraph. Never insert a ' '. This should at least
5648 fix some cause for the segfaults that we have been experiencing,
5649 it also fixes backspace behaviour slightly. (Phu!)
5651 * src/support/lstrings.C (compare_no_case): some change to make it
5652 compile with gcc 2.95.2 and stdlibc++-v3
5654 * src/text2.C (MeltFootnoteEnvironment): change type o
5655 first_footnote_par_is_not_empty to bool.
5657 * src/lyxparagraph.h: make text private. Changes in other files
5659 (fitToSize): new function
5660 (setContentsFromPar): new function
5661 (clearContents): new function
5662 (SetChar): new function
5664 * src/paragraph.C (readSimpleWholeFile): deleted.
5666 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
5667 the file, just use a simple string instead. Also read the file in
5668 a more maintainable manner.
5670 * src/text2.C (InsertStringA): deleted.
5671 (InsertStringB): deleted.
5673 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5675 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
5676 RedoParagraphs from the doublespace handling part, just set status
5677 to NEED_MORE_REFRESH. Also don't update cursor position (should be
5678 done, but perhaps not like this.)
5680 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5682 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
5683 character when inserting an inset.
5685 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5687 * src/bufferparams.C (readLanguage): now takes "default" into
5690 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
5691 also initialize the toplevel_keymap with the default bindings from
5694 * src/buffer.C (Buffer): remove lyxrc from the parameters.
5696 * all files using lyxrc: have lyxrc as a real variable and not a
5697 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
5700 * src/lyxrc.C: remove double call to defaultKeyBindings
5702 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
5703 toolbar defauls using lyxlex. Remove enums, structs, functions
5706 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
5707 toolbar defaults. Also store default keybindings in a map.
5709 * src/ToolbarDefaults.[Ch]: New file. This class is used for
5710 storing the toolbar defaults without any xforms dependencies.
5712 * src/insets/figinset.C: patch posted to list by Andre Poenitz
5713 applied. Changed to use iterators.
5715 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
5717 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
5718 systems that don't have LINGUAS set to begin with.
5720 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5722 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
5723 the list by Dekel Tsur.
5725 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5727 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
5728 * src/insets/form_graphics.C: ditto.
5730 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
5732 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5734 * src/bufferparams.C (readLanguage): use the new language map
5736 * src/intl.C (InitKeyMapper): use the new language map
5738 * src/lyx_gui.C (create_forms): use the new language map
5740 * src/language.[Ch]: New files. Used for holding the information
5741 about each language. Now! Use this new language map enhance it and
5742 make it really usable for our needs.
5744 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
5746 * screen.C (ShowCursor): Removed duplicate code.
5747 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5748 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
5750 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
5753 * src/text.C Added TransformChar method. Used for rendering Arabic
5754 text correctly (change the glyphs of the letter according to the
5755 position in the word)
5760 * src/lyxrc.C Added lyxrc command {language_command_begin,
5761 language_command_end,language_command_ltr,language_command_rtl,
5762 language_package} which allows the use of either arabtex or Omega
5765 * src/lyx_gui.C (init)
5767 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
5768 to use encoding for menu fonts which is different than the encoding
5771 * src/buffer.C (makeLaTeXFile): If params.language = "default",
5772 do not load the babel package.
5773 To write an English document with Hebrew/Arabic, change the document
5774 language to "english".
5776 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
5777 (alphaCounter): changed to return char
5778 (loweralphaCounter, hebrewCounter, romanCounter): New functions
5780 * lib/lyxrc.example Added examples for Hebrew/Arabic
5783 * src/layout.C Added layout command endlabeltype
5785 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
5787 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
5789 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5791 * src/mathed/math_delim.C (search_deco): return a
5792 math_deco_struct* instead of index.
5794 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5796 * All files with a USE_OSTREAM_ONLY within: removed all code that
5797 was unused when USE_OSTREAM_ONLY is defined.
5799 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
5800 of any less. Removed header and using.
5802 * src/text.C (GetVisibleRow): draw the string "Page Break
5803 (top/bottom)" on screen when drawing a pagebreak line.
5805 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5807 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
5809 * src/mathed/math_macro.C (draw): do some cast magic.
5812 * src/mathed/math_defs.h: change byte* argument to byte const*.
5814 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
5816 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
5817 know it is right to return InsetFoot* too, but cxx does not like
5820 * src/insets/insetcollapsable.[Ch] (Clone): make const.
5822 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
5824 * src/mathed/math_delim.C: change == to proper assignment.
5826 2000-03-09 Juergen Vigna <jug@sad.it>
5828 * src/insets/insettext.C (setPos): fixed various cursor positioning
5829 problems (via mouse and cursor-keys)
5830 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
5831 inset (still a small display problem but it works ;)
5833 * src/insets/insetcollapsable.C (draw): added button_top_y and
5834 button_bottom_y to have correct values for clicking on the inset.
5836 * src/support/lyxalgo.h: commented out 'using std::less'
5838 2000-03-08 Juergen Vigna <jug@sad.it>
5840 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
5841 Button-Release event closes as it is alos the Release-Event
5844 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
5846 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5848 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
5849 can add multiple spaces in Scrap (literate programming) styles...
5850 which, by the way, is how I got hooked on LyX to begin with.
5852 * src/mathed/formula.C (Write): Added dummy variable to an
5853 inset::Latex() call.
5854 (Latex): Add free_spacing boolean to inset::Latex()
5856 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
5858 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
5859 virtual function to include the free_spacing boolean from
5860 the containing paragraph's style.
5862 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
5863 Added free_spacing boolean arg to match inset.h
5865 * src/insets/insettext.C, src/insets/insettext.h (Latex):
5866 Added free_spacing boolean arg to match inset.h
5868 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
5869 Added free_spacing boolean and made sure that if in a free_spacing
5870 paragraph, that we output normal space if there is a protected space.
5872 * src/insets/insetref.C, src/insets/insetref.h (Latex):
5873 Added free_spacing boolean arg to match inset.h
5875 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
5876 Added free_spacing boolean arg to match inset.h
5878 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
5879 Added free_spacing boolean arg to match inset.h
5881 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
5882 Added free_spacing boolean arg to match inset.h
5884 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
5885 Added free_spacing boolean arg to match inset.h
5887 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
5888 free_spacing boolean arg to match inset.h
5890 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
5891 Added free_spacing boolean arg to match inset.h
5893 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
5894 Added free_spacing boolean arg to match inset.h
5896 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
5897 Added free_spacing boolean arg to match inset.h
5899 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
5900 Added free_spacing boolean arg to match inset.h
5902 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
5903 Added free_spacing boolean arg to match inset.h
5905 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
5906 free_spacing boolean arg to match inset.h
5908 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
5909 free_spacing boolean arg to match inset.h
5911 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
5912 ignore free_spacing paragraphs. The user's spaces are left
5915 * src/text.C (InsertChar): Fixed the free_spacing layout
5916 attribute behavior. Now, if free_spacing is set, you can
5917 add multiple spaces in a paragraph with impunity (and they
5918 get output verbatim).
5919 (SelectSelectedWord): Added dummy argument to inset::Latex()
5922 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
5925 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
5926 paragraph layouts now only input a simple space instead.
5927 Special character insets don't make any sense in free-spacing
5930 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
5931 hard-spaces in the *input* file to simple spaces if the layout
5932 is free-spacing. This converts old files which had to have
5933 hard-spaces in free-spacing layouts where a simple space was
5935 (writeFileAscii): Added free_spacing check to pass to the newly
5936 reworked inset::Latex(...) methods. The inset::Latex() code
5937 ensures that hard-spaces in free-spacing paragraphs get output
5938 as spaces (rather than "~").
5940 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5942 * src/mathed/math_delim.C (draw): draw the empty placeholder
5943 delims with a onoffdash line.
5944 (struct math_deco_compare): struct that holds the "functors" used
5945 for the sort and the binary search in math_deco_table.
5946 (class init_deco_table): class used for initial sort of the
5948 (search_deco): use lower_bound to do a binary search in the
5951 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5953 * src/lyxrc.C: a small secret thingie...
5955 * src/lyxlex.C (printTable): changed to take a ostream as paramter
5956 and to not flush the stream as often as it used to.
5958 * src/support/lyxalgo.h: new file
5959 (sorted): template function used for checking if a sequence is
5960 sorted or not. Two versions with and without user supplied
5961 compare. Uses same compare as std::sort.
5963 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
5964 it and give warning on lyxerr.
5966 (struct compare_tags): struct with function operators used for
5967 checking if sorted, sorting and lower_bound.
5968 (search_kw): use lower_bound instead of manually implemented
5971 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5973 * src/insets/insetcollapsable.h: fix Clone() declaration.
5974 * src/insets/insetfoot.h: ditto.
5976 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
5978 2000-03-08 Juergen Vigna <jug@sad.it>
5980 * src/insets/lyxinset.h: added owner call which tells us if
5981 this inset is inside another inset. Changed also the return-type
5982 of Editable to an enum so it tells clearer what the return-value is.
5984 * src/insets/insettext.C (computeTextRows): fixed computing of
5985 textinsets which split automatically on more rows.
5987 * src/insets/insetert.[Ch]: changed this to be of BaseType
5990 * src/insets/insetfoot.[Ch]: added footnote inset
5992 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
5993 collapsable insets (like footnote, ert, ...)
5995 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5997 * src/lyxdraw.h: remvoe file
5999 * src/lyxdraw.C: remove file
6001 * src/insets/insettext.C: added <algorithm>.
6003 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6005 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
6006 (matrix_cb): case MM_OK use string stream
6008 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
6011 * src/mathed/math_macro.C (draw): use string stream
6012 (Metrics): use string stream
6014 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
6015 directly to the ostream.
6017 * src/vspace.C (asString): use string stream.
6018 (asString): use string stream
6019 (asLatexString): use string stream
6021 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
6022 setting Spacing::Other.
6024 * src/LaTeXFeatures.C (getPackages): use string stream instead of
6025 sprintf when creating the stretch vale.
6027 * src/text2.C (alphaCounter): changed to return a string and to
6028 not use a static variable internally. Also fixed a one-off bug.
6029 (SetCounter): changed the drawing of the labels to use string
6030 streams instead of sprintf.
6032 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
6033 manipulator to use a scheme that does not require library support.
6034 This is also the way it is done in the new GNU libstdc++. Should
6035 work with DEC cxx now.
6037 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6039 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
6040 end. This fixes a bug.
6042 * src/mathed (all files concerned with file writing): apply the
6043 USE_OSTREAM_ONLY changes to mathed too.
6045 * src/support/DebugStream.h: make the constructor explicit.
6047 * src/lyxfont.C (latexWriteStartChanges): small bug related to
6048 count and ostream squashed.
6050 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6052 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
6054 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
6055 ostringstream uses STL strings, and we might not.
6057 * src/insets/insetspecialchar.C: add using directive.
6058 * src/insets/insettext.C: ditto.
6060 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6062 * lib/layouts/seminar.layout: feeble attempt at a layout for
6063 seminar.cls, far from completet and could really use some looking
6064 at from people used to write layout files.
6066 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
6067 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
6068 a lot nicer and works nicely with ostreams.
6070 * src/mathed/formula.C (draw): a slightly different solution that
6071 the one posted to the list, but I think this one works too. (font
6072 size wrong in headers.)
6074 * src/insets/insettext.C (computeTextRows): some fiddling on
6075 Jürgens turf, added some comments that he should read.
6077 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
6078 used and it gave compiler warnings.
6079 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
6082 * src/lyx_gui.C (create_forms): do the right thing when
6083 show_banner is true/false.
6085 * src/lyx_cb.C (TimerCB): no need to close or do anything if
6086 show_banner is false.
6088 * most file writing files: Now use iostreams to do almost all of
6089 the writing. Also instead of passing string &, we now use
6090 stringstreams. mathed output is still not adapted to iostreams.
6091 This change can be turned off by commenting out all the occurences
6092 of the "#define USE_OSTREAM_ONLY 1" lines.
6094 * src/WorkArea.C (createPixmap): don't output debug messages.
6095 (WorkArea): don't output debug messages.
6097 * lib/lyxrc.example: added a comment about the new variable
6100 * development/Code_rules/Rules: Added some more commente about how
6101 to build class interfaces and on how better encapsulation can be
6104 2000-03-03 Juergen Vigna <jug@sad.it>
6106 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
6107 automatically with the width of the LyX-Window
6109 * src/insets/insettext.C (computeTextRows): fixed update bug in
6110 displaying text-insets (scrollvalues where not initialized!)
6112 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6114 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
6115 id in the check of the result from lower_bound is not enough since
6116 lower_bound can return last too, and then res->id will not be a
6119 * all insets and some code that use them: I have conditionalized
6120 removed the Latex(string & out, ...) this means that only the
6121 Latex(ostream &, ...) will be used. This is a work in progress to
6122 move towards using streams for all output of files.
6124 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
6127 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6129 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
6130 routine (this fixes bug where greek letters were surrounded by too
6133 * src/support/filetools.C (findtexfile): change a bit the search
6134 algorithm, to fix bug introduced in 1.1.4. Note that --format is
6135 no longer passed to kpsewhich, we may have to change that later.
6137 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
6138 warning options to avoid problems with X header files (from Angus
6140 * acinclude.m4: regenerated.
6142 2000-03-02 Juergen Vigna <jug@sad.it>
6144 * src/insets/insettext.C (WriteParagraphData): Using the
6145 par->writeFile() function for writing paragraph-data.
6146 (Read): Using buffer->parseSingleLyXformat2Token()-function
6147 for parsing paragraph data!
6149 * src/buffer.C (readLyXformat2): removed all parse data and using
6150 the new parseSingleLyXformat2Token()-function.
6151 (parseSingleLyXformat2Token): added this function to parse (read)
6152 lyx-file-format (this is called also from text-insets now!)
6154 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6156 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
6159 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
6160 directly instead of going through a func. One very bad thing: a
6161 static LyXFindReplace, but I don't know where to place it.
6163 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
6164 string instead of char[]. Also changed to static.
6165 (GetSelectionOrWordAtCursor): changed to static inline
6166 (SetSelectionOverLenChars): ditto.
6168 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
6169 current_view and global variables. both classes has changed names
6170 and LyXFindReplace is not inherited from SearchForm.
6172 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
6173 fl_form_search form.
6175 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
6177 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6179 * lib/bind/*.bind: make sure 'buffer-previous' function is not
6180 bound (from Kayvan).
6182 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
6184 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
6186 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6188 * some things that I should comment but the local pub says head to
6191 * comment out all code that belongs to the Roff code for Ascii
6192 export of tables. (this is unused)
6194 * src/LyXView.C: use correct type for global variable
6195 current_layout. (LyXTextClass::size_type)
6197 * some code to get the new insetgraphics closer to working I'd be
6198 grateful for any help.
6200 * src/BufferView2.C (insertInset): use the return type of
6201 NumberOfLayout properly. (also changes in other files)
6203 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
6204 this as a test. I want to know what breaks because of this.
6206 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
6208 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6210 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
6211 to use a \makebox in the label, this allows proper justification
6212 with out using protected spaces or multiple hfills. Now it is
6213 "label" for left justified, "\hfill label\hfill" for center, and
6214 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
6215 should be changed accordingly.
6217 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6219 * src/lyxtext.h: change SetLayout() to take a
6220 LyXTextClass::size_type instead of a char (when there is more than
6221 127 layouts in a class); also change type of copylayouttype.
6222 * src/text2.C (SetLayout): ditto.
6223 * src/LyXView.C (updateLayoutChoice): ditto.
6225 * src/LaTeX.C (scanLogFile): errors where the line number was not
6226 given just after the '!'-line were ignored (from Dekel Tsur).
6228 * lib/lyxrc.example: fix description of \date_insert_format
6230 * lib/layouts/llncs.layout: new layout, contributed by Martin
6233 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6235 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
6236 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
6237 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
6238 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
6239 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
6240 paragraph.C, text.C, text2.C)
6242 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6244 * src/insets/insettext.C (LocalDispatch): remove extra break
6247 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
6248 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
6250 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
6251 * src/insets/insettext.[Ch] (GetCursorPos): ditto
6253 * src/insets/insetbib.h: move InsetBibkey::Holder and
6254 InsetCitation::Holder in public space.
6256 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6258 * src/insets/insettext.h: small change to get the new files from
6259 Juergen to compile (use "string", not "class string").
6261 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
6262 const & as parameter to LocalDispatch, use LyXFont const & as
6263 paramter to some other func. This also had impacto on lyxinsets.h
6264 and the two mathed insets.
6266 2000-02-24 Juergen Vigna <jug@sad.it>
6269 * src/commandtags.h:
6271 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
6275 * src/BufferView2.C: added/updated code for various inset-functions
6277 * src/insets/insetert.[Ch]: added implementation of InsetERT
6279 * src/insets/insettext.[Ch]: added implementation of InsetText
6281 * src/insets/inset.C (Edit): added "unsigned int button" parameter
6282 (draw): added preliminary code for inset scrolling not finshed yet
6284 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
6285 as it is in lyxfunc.C now
6287 * src/insets/lyxinset.h: Added functions for text-insets
6289 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6291 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
6292 BufferView and reimplement the list as a queue put inside its own
6295 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
6297 * several files: use the new interface to the "updateinsetlist"
6299 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
6301 (work_area_handler): call BufferView::trippleClick on trippleclick.
6303 * src/BufferView.C (doubleClick): new function, selects word on
6305 (trippleClick): new function, selects line on trippleclick.
6307 2000-02-22 Allan Rae <rae@lyx.org>
6309 * lib/bind/xemacs.bind: buffer-previous not supported
6311 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6313 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
6316 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6318 * src/bufferlist.C: get rid of current_view from this file
6320 * src/spellchecker.C: get rid of current_view from this file
6322 * src/vspace.C: get rid of current_view from this file
6323 (inPixels): added BufferView parameter for this func
6324 (asLatexCommand): added a BufferParams for this func
6326 * src/text.C src/text2.C: get rid of current_view from these
6329 * src/lyxfont.C (getFontDirection): move this function here from
6332 * src/bufferparams.C (getDocumentDirection): move this function
6335 * src/paragraph.C (getParDirection): move this function here from
6337 (getLetterDirection): ditto
6339 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6341 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
6342 resize due to wrong pixmap beeing used. Also took the opurtunity
6343 to make the LyXScreen stateless on regard to WorkArea and some
6344 general cleanup in the same files.
6346 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6348 * src/Makefile.am: add missing direction.h
6350 * src/PainterBase.h: made the width functions const.
6352 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
6355 * src/insets/insetcommand.C (draw): draw Editable as buttons.
6357 * src/insets/insetlatexaccent.C (draw): make the accents draw
6358 better, at present this will only work well with iso8859-1.
6360 * several files: remove the old drawing code, now we use the new
6363 * several files: remove support for mono_video, reverse_video and
6366 2000-02-17 Juergen Vigna <jug@sad.it>
6368 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
6369 int ** as we have to return the pointer, otherwise we have only
6370 NULL pointers in the returning function.
6372 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6374 * src/LaTeX.C (operator()): quote file name when running latex.
6376 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6378 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
6379 (bubble tip), this removes our special handling of this.
6381 * Remove all code that is unused now that we have the new
6382 workarea. (Code that are not active when NEW_WA is defined.)
6384 * Make the uses of XSync not conditionalized on define USE_XSYNC.
6386 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6388 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
6389 nonexisting layout; correctly redirect obsoleted layouts.
6391 * lib/lyxrc.example: document \view_dvi_paper_option
6393 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
6396 * src/lyx_cb.C (RunScript): handle $$FName for command names.
6397 (PreviewDVI): handle the view_dvi_paper_option variable.
6398 [Both from Roland Krause]
6400 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6402 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
6403 char const *, int, LyXFont)
6404 (text(int, int, string, LyXFont)): ditto
6406 * src/text.C (InsertCharInTable): attempt to fix the double-space
6407 feature in tables too.
6408 (BackspaceInTable): ditto.
6409 (GetVisibleRow): make bottom pagebreak line be a onoff line.
6411 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6413 * src/text2.C (owner): only complain if owner_ is set and bv != 0
6415 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
6416 newly found text in textcache to this.
6417 (buffer): set the owner of the text put into the textcache to 0
6419 * src/insets/figinset.C (draw): fixed the drawing of figures with
6422 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
6423 drawing of mathframe, hfills, protected space, table lines. I have
6424 now no outstanding drawing problems with the new Painter code.
6426 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6428 * src/PainterBase.C (ellipse, circle): do not specify the default
6431 * src/LColor.h: add using directive.
6433 * src/Painter.[Ch]: change return type of methods from Painter& to
6434 PainterBase&. Add a using directive.
6436 * src/WorkArea.C: wrap xforms callbacks in C functions
6439 * lib/layouts/foils.layout: font fix and simplifications from Carl
6442 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6444 * a lot of files: The Painter, LColor and WorkArea from the old
6445 devel branch has been ported to lyx-devel. Some new files and a
6446 lot of #ifdeffed code. The new workarea is enabled by default, but
6447 if you want to test the new Painter and LColor you have to compile
6448 with USE_PAINTER defined (do this in config.h f.ex.) There are
6449 still some rought edges, and I'd like some help to clear those
6450 out. It looks stable (loads and displays the Userguide very well).
6453 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6455 * src/buffer.C (pop_tag): revert to the previous implementation
6456 (use a global variable for both loops).
6458 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
6460 * src/lyxrc.C (LyXRC): change slightly default date format.
6462 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
6463 there is an English text with a footnote that starts with a Hebrew
6464 paragraph, or vice versa.
6465 (TeXFootnote): ditto.
6467 * src/text.C (LeftMargin): allow for negative values for
6468 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
6471 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
6472 for input encoding (cyrillic)
6474 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6476 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
6479 * src/toolbar.C (set): ditto
6480 * src/insets/insetbib.C (create_form_citation_form): ditto
6482 * lib/CREDITS: added Dekel Tsur.
6484 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
6485 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
6486 hebrew supports files from Dekel Tsur.
6488 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
6489 <tzafrir@technion.ac.il>
6491 * src/lyxrc.C: put \date_insert_format at the right place.
6493 * src/buffer.C (makeLaTeXFile): fix the handling of
6494 BufferParams::sides when writing out latex files.
6496 * src/BufferView2.C: add a "using" directive.
6498 * src/support/lyxsum.C (sum): when we use lyxstring,
6499 ostringstream::str needs an additional .c_str().
6501 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6503 * src/support/filetools.C (ChangeExtension): patch from Etienne
6506 * src/TextCache.C (show): remove const_cast and make second
6507 parameter non-const LyXText *.
6509 * src/TextCache.h: use non const LyXText in show.
6511 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
6514 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6516 * src/support/lyxsum.C: rework to be more flexible.
6518 * several places: don't check if a pointer is 0 if you are going
6521 * src/text.C: remove some dead code.
6523 * src/insets/figinset.C: remove some dead code
6525 * src/buffer.C: move the BufferView funcs to BufferView2.C
6526 remove all support for insetlatexdel
6527 remove support for oldpapersize stuff
6528 made some member funcs const
6530 * src/kbmap.C: use a std::list to store the bindings in.
6532 * src/BufferView2.C: new file
6534 * src/kbsequence.[Ch]: new files
6536 * src/LyXAction.C + others: remove all trace of buffer-previous
6538 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
6539 only have one copy in the binary of this table.
6541 * hebrew patch: moved some functions from LyXText to more
6542 appropriate places. (LyXParagraph, BufferParams, LyXFont)
6544 * several files: remove support for XForms older than 0.88
6546 remove some #if 0 #endif code
6548 * src/TextCache.[Ch]: new file. Holds the textcache.
6550 * src/BufferView.C: changes to use the new TextCache interface.
6551 (waitForX): remove the now unused code.
6553 * src/BackStack.h: remove some commented code
6555 * lib/bind/emacs.bind: remove binding for buffer-previous
6557 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6559 * applied the hebrew patch.
6561 * src/lyxrow.h: make sure that all Row variables are initialized.
6563 * src/text2.C (TextHandleUndo): comment out a delete, this might
6564 introduce a memory leak, but should also help us to not try to
6565 read freed memory. We need to look at this one.
6567 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
6568 (LyXParagraph): initalize footnotekind.
6570 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
6571 forgot this when applying the patch. Please heed the warnings.
6573 * src/BufferView.C (buffer): a fix for the buffer-reload problem
6574 (aka. reformat problem)
6576 * src/bufferlist.C (exists): made const, and use const_iterator
6577 (isLoaded): new func.
6578 (release): use std::find to find the correct buffer.
6580 * src/bufferlist.h: made getState a const func.
6581 made empty a const func.
6582 made exists a const func.
6585 2000-02-01 Juergen Vigna <jug@sad.it>
6587 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
6589 * po/it.po: updated a bit the italian po file and also changed the
6590 'file nuovo' for newfile to 'filenuovo' without a space, this did
6593 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
6594 for the new insert_date command.
6596 * src/lyxfunc.C (Dispatch): added support for a insert_date function
6597 from jdblair, to insert a date into the current text conforming to
6598 a strftime format (for now only considering the locale-set and not
6599 the document-language).
6601 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6603 * src/lyxfont.C (textWidth): hopefully better fix for the Array
6604 Bounds Read error seen by purify. The problem was that islower is
6605 a macros which takes an unsigned char and uses it as an index for
6606 in array of characters properties (and is thus subject to the
6610 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
6611 correctly the paper sides radio buttons.
6612 (UpdateDocumentButtons): ditto.
6614 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6616 * src/kbmap.C (getsym + others): change to return unsigned int,
6617 returning a long can give problems on 64 bit systems. (I assume
6618 that int is 32bit on 64bit systems)
6620 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6622 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
6623 LyXLookupString to be zero-terminated. Really fixes problems seen
6626 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6628 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
6629 write a (char*)0 to the lyxerr stream.
6631 * src/lastfiles.C: move algorithm before the using statemets.
6633 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6635 * src/lastfiles.C: move using directives in global scope (egcs 1.x
6636 complains otherwise).
6637 * src/table.C: ditto
6639 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
6642 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
6643 that I removed earlier... It is really needed.
6645 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
6647 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6649 * INSTALL: update xforms home page URL.
6651 * lib/configure.m4: fix a bug with unreadable layout files.
6653 * src/table.C (calculate_width_of_column): add "using std::max"
6656 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6658 * several files: marked several lines with "DEL LINE", this is
6659 lines that can be deleted without changing anything.
6660 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
6661 checks this anyway */
6664 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
6666 * src/DepTable.C (update): add a "+" at the end when the checksum
6667 is different. (debugging string only)
6669 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
6670 the next inset to not be displayed. This should also fix the list
6671 of labels in the "Insert Crossreference" dialog.
6673 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6675 * src/support/LSubstring.C (LSubstring): set pos to string::npos
6676 when regex was not found.
6678 * src/support/lstrings.C (lowercase): use handcoded transform always.
6681 * src/text.C (Delete): fixed the crash. cursor.par->prev and
6682 old_cursor.par->prev could be 0.
6684 * several files: changed post inc/dec to pre inc/dec
6686 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
6687 write the lastfiles to file.
6689 * src/BufferView.C (buffer): only show TextCache info when debugging
6691 (resizeCurrentBuffer): ditto
6692 (workAreaExpose): ditto
6694 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
6696 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
6698 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
6699 a bit better by removing the special case for \i and \j.
6701 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6703 * src/lyx_main.C (easyParse): remove test for bad comand line
6704 options, since this broke all xforms-related parsing.
6706 * src/kbmap.C (getsym): set return type to unsigned long, as
6707 declared in header. On an alpha, long is _not_ the same as int.
6709 * src/support/LOstream.h: add a "using std::flush;"
6711 * src/insets/figinset.C: ditto.
6713 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6715 * src/bufferlist.C (write): use blinding fast file copy instead of
6716 "a char at a time", now we are doing it the C++ way.
6718 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
6719 std::list<int> instead.
6720 (addpidwait): reflect move to std::list<int>
6721 (sigchldchecker): ditto
6723 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
6726 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
6727 that obviously was wrong...
6729 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
6730 c, this avoids warnings with purify and islower.
6732 * src/insets/figinset.C: rename struct queue to struct
6733 queue_element and rewrite to use a std::queue. gsqueue is now a
6734 std::queue<queue_element>
6735 (runqueue): reflect move to std::queue
6738 * src/support/lstrings.h (tostr): specialize for bool, otherwise
6739 we would get "1" "0" instead of "true" "false. Also make the tostr
6742 2000-01-21 Juergen Vigna <jug@sad.it>
6744 * src/buffer.C (writeFileAscii): Disabled code for special groff
6745 handling of tabulars till I fix this in table.C
6747 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6749 * src/support/mkdir.C (mkdir): change second argument of mkdir to
6751 * src/support/lyxlib.h: ditto.
6753 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6755 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
6756 and 'j' look better. This might fix the "macron" bug that has been
6759 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
6760 functions as one template function. Delete the old versions.
6762 * src/support/lyxsum.C: move using std::ifstream inside
6765 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
6768 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
6770 * src/mathed/formula.C: delete #include "bufferlist.h" never used
6772 * src/insets/figinset.C (InitFigures): use new instead of malloc
6773 to allocate memory for figures and bitmaps.
6774 (DoneFigures): use delete[] instead of free to deallocate memory
6775 for figures and bitmaps.
6776 (runqueue): use new to allocate
6777 (getfigdata): use new/delete[] instead of malloc/free
6778 (RegisterFigure): ditto
6780 * some files: moved some declarations closer to first use, small
6781 whitespace changes use preincrement instead of postincrement where
6782 it does not make a difference.
6784 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
6785 step on the way to use stl::containers for key maps.
6787 * src/bufferlist.h: add a typedef for const_iterator and const
6788 versions of begin and end.
6790 * src/bufferlist.[Ch]: change name of member variable _state to
6791 state_. (avoid reserved names)
6793 (getFileNames): returns the filenames of the buffers in a vector.
6795 * configure.in (ALL_LINGUAS): added ro
6797 * src/support/putenv.C: new file
6799 * src/support/mkdir.C: new file
6801 2000-01-20 Allan Rae <rae@lyx.org>
6803 * lib/layouts/IEEEtran.layout: Added several theorem environments
6805 * lib/templates/IEEEtran.lyx: Example theorem environments and a
6806 couple of minor additions.
6808 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
6809 (except for those in footnotes of course)
6811 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6813 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
6815 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
6816 std::sort and std::lower_bound instead of qsort and handwritten
6818 (struct compara): struct that holds the functors used by std::sort
6819 and std::lower_bound in MathedLookupBOP.
6821 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6823 * src/support/LAssert.h: do not do partial specialization. We do
6826 * src/support/lyxlib.h: note that lyx::getUserName() and
6827 lyx::date() are not in use right now. Should these be suppressed?
6829 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
6830 (makeLinuxDocFile): do not put date and user name in linuxdoc
6833 * src/support/lyxlib.h (kill): change first argument to long int,
6834 since that's what solaris uses.
6836 * src/support/kill.C (kill): fix declaration to match prototype.
6838 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
6839 actually check whether namespaces are supported. This is not what
6842 * src/support/lyxsum.C: add a using directive.
6844 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6846 * src/support/kill.C: if we have namespace support we don't have
6847 to include lyxlib.h.
6849 * src/support/lyxlib.h: use namespace lyx if supported.
6851 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6853 * src/support/date.C: new file
6855 * src/support/chdir.C: new file
6857 * src/support/getUserName.C: new file
6859 * src/support/getcwd.C: new file
6861 * src/support/abort.C: new file
6863 * src/support/kill.C: new file
6865 * src/support/lyxlib.h: moved all the functions in this file
6866 insede struct lyx. Added also kill and abort to this struct. This
6867 is a way to avoid the "kill is not defined in <csignal>", we make
6868 C++ wrappers for functions that are not ANSI C or ANSI C++.
6870 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
6871 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
6872 lyx it has been renamed to sum.
6874 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6876 * src/text.C: add using directives for std::min and std::max.
6878 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6880 * src/texrow.C (getIdFromRow): actually return something useful in
6881 id and pos. Hopefully fixes the bug with positionning of errorbox
6884 * src/lyx_main.C (easyParse): output an error and exit if an
6885 incorrect command line option has been given.
6887 * src/spellchecker.C (ispell_check_word): document a memory leak.
6889 * src/bufferlist.C (write): fix mismatched allocation/deletion,
6890 where a "struct utimbuf" is allocated with "new" and deleted with
6893 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
6895 * src/text2.C (CutSelection): don't delete double spaces.
6896 (PasteSelection): ditto
6897 (CopySelection): ditto
6899 * src/text.C (Backspace): don't delete double spaces.
6901 * src/lyxlex.C (next): fix a bug that were only present with
6902 conformant std::istream::get to read comment lines, use
6903 std::istream::getline instead. This seems to fix the problem.
6905 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6907 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
6908 allowed to insert space before space" editing problem. Please read
6909 commends at the beginning of the function. Comments about usage
6912 * src/text.C (InsertChar): fix for the "not allowed to insert
6913 space before space" editing problem.
6915 * src/text2.C (DeleteEmptyParagraphMechanism): when
6916 IsEmptyTableRow can only return false this last "else if" will
6917 always be a no-op. Commented out.
6919 * src/text.C (RedoParagraph): As far as I can understand tmp
6920 cursor is not really needed.
6922 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
6923 present it could only return false anyway.
6924 (several functions): Did something not so smart...added a const
6925 specifier on a lot of methods.
6927 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
6928 and add a tmp->text.resize. The LyXParagraph constructor does the
6930 (BreakParagraphConservative): ditto
6932 * src/support/path.h (Path): add a define so that the wrong usage
6933 "Path("/tmp") will be flagged as a compilation error:
6934 "`unnamed_Path' undeclared (first use this function)"
6936 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6938 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
6939 which was bogus for several reasons.
6941 * src/LaTeX.C (scanAux): fix the regular expression used to scan
6945 * autogen.sh: do not use "type -path" (what's that anyway?).
6947 * src/support/filetools.C (findtexfile): remove extraneous space
6948 which caused a kpsewhich warning (at least with kpathsea version
6951 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6953 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
6955 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
6957 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
6959 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6961 * src/paragraph.C (BreakParagraph): do not reserve space on text
6962 if we don't need to (otherwise, if pos_end < pos, we end up
6963 reserving huge amounts of memory due to bad unsigned karma).
6964 (BreakParagraphConservative): ditto, although I have not seen
6965 evidence the bug can happen here.
6967 * src/lyxparagraph.h: add a using std::list.
6969 2000-01-11 Juergen Vigna <jug@sad.it>
6971 * src/menus.C (MenuDocu): output an Alert if the documentation-file
6974 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6976 * src/vc-backend.C (doVCCommand): change to be static and take one
6977 more parameter: the path to chdir too be fore executing the command.
6978 (retrive): new function equiv to "co -r"
6980 * src/bufferlist.C (loadLyXFile): implement the missing parts if
6981 file_not_found_hook is true.
6983 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
6985 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
6986 if a file is readwrite,readonly...anything else.
6988 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6990 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
6991 (CreatePostscript): name change from MenuRunDVIPS (or something)
6992 (PreviewPostscript): name change from MenuPreviewPS
6993 (PreviewDVI): name change from MenuPreviewDVI
6995 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
6996 \view_pdf_command., \pdf_to_ps_command
6998 * lib/configure.m4: added search for PDF viewer, and search for
6999 PDF to PS converter.
7000 (lyxrc.defaults output): add \pdflatex_command,
7001 \view_pdf_command and \pdf_to_ps_command.
7003 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
7005 * src/bufferlist.C (write): we don't use blocksize for anything so
7008 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7010 * src/support/block.h: disable operator T* (), since it causes
7011 problems with both compilers I tried. See comments in the file.
7013 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
7016 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
7017 variable LYX_DIR_10x to LYX_DIR_11x.
7019 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
7021 * INSTALL: document --with-lyxname.
7024 * configure.in: new configure flag --with-lyxname which allows to
7025 choose the name under which lyx is installed. Default is "lyx", of
7026 course. It used to be possible to do this with --program-suffix,
7027 but the later has in fact a different meaning for autoconf.
7029 * src/support/lstrings.h (lstrchr): reformat a bit.
7031 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
7032 * src/mathed/math_defs.h: ditto.
7034 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7036 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
7037 true, decides if we create a backup file or not when saving. New
7038 tag and variable \pdf_mode, defaults to false. New tag and
7039 variable \pdflatex_command, defaults to pdflatex. New tag and
7040 variable \view_pdf_command, defaults to xpdf. New tag and variable
7041 \pdf_to_ps_command, defaults to pdf2ps.
7043 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7045 * src/bufferlist.C (close): don't call insetUnlock if the buffer
7046 does not have a BufferView.
7047 (unlockInset): ditto + don't access the_locking_inset if the
7048 buffer does not have a BufferView.
7050 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
7051 certain circumstances so that we don't continue a keyboard
7052 operation long after the key was released. Try f.ex. to load a
7053 large document, press PageDown for some seconds and then release
7054 it. Before this change the document would contine to scroll for
7055 some time, with this change it stops imidiatly.
7057 * src/support/block.h: don't allocate more space than needed. As
7058 long as we don't try to write to the arr[x] in a array_type arr[x]
7059 it is perfectly ok. (if you write to it you might segfault).
7060 added operator value_type*() so that is possible to pass the array
7061 to functions expecting a C-pointer.
7063 * lib/Makefile.am (dist-hook): don't fail completely if unable to
7066 * intl/*: updated to gettext 0.10.35, tried to add our own
7067 required modifications. Please verify.
7069 * po/*: updated to gettext 0.10.35, tried to add our own required
7070 modifications. Please verify.
7072 * src/support/lstrings.C (tostr): go at fixing the problem with
7073 cxx and stringstream. When stringstream is used return
7074 oss.str().c_str() so that problems with lyxstring and basic_string
7075 are avoided. Note that the best solution would be for cxx to use
7076 basic_string all the way, but it is not conformant yet. (it seems)
7078 * src/lyx_cb.C + other files: moved several global functions to
7079 class BufferView, some have been moved to BufferView.[Ch] others
7080 are still located in lyx_cb.C. Code changes because of this. (part
7081 of "get rid of current_view project".)
7083 * src/buffer.C + other files: moved several Buffer functions to
7084 class BufferView, the functions are still present in buffer.C.
7085 Code changes because of this.
7087 * config/lcmessage.m4: updated to most recent. used when creating
7090 * config/progtest.m4: updated to most recent. used when creating
7093 * config/gettext.m4: updated to most recent. applied patch for
7096 * config/gettext.m4.patch: new file that shows what changes we
7097 have done to the local copy of gettext.m4.
7099 * config/libtool.m4: new file, used in creation of acinclude.m4
7101 * config/lyxinclude.m4: new file, this is the lyx created m4
7102 macros, used in making acinclude.m4.
7104 * autogen.sh: GNU m4 discovered as a separate task not as part of
7105 the lib/configure creation.
7106 Generate acinlucde from files in config. Actually cat
7107 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
7108 easier to upgrade .m4 files that really are external.
7110 * src/Spacing.h: moved using std::istringstream to right after
7111 <sstream>. This should fix the problem seen with some compilers.
7113 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7115 * src/lyx_cb.C: began some work to remove the dependency a lot of
7116 functions have on BufferView::text, even if not really needed.
7117 (GetCurrentTextClass): removed this func, it only hid the
7120 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
7121 forgot this in last commit.
7123 * src/Bullet.C (bulletEntry): use static char const *[] for the
7124 tables, becuase of this the return arg had to change to string.
7126 (~Bullet): removed unneeded destructor
7128 * src/BufferView.C (beforeChange): moved from lyx_cb.C
7129 (insetSleep): moved from Buffer
7130 (insetWakeup): moved from Buffer
7131 (insetUnlock): moved from Buffer
7133 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
7134 from Buffer to BufferView.
7136 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
7138 * config/ltmain.sh: updated to version 1.3.4 of libtool
7140 * config/ltconfig: updated to version 1.3.4 of libtool
7142 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7145 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
7146 Did I get that right?
7148 * src/lyxlex.h: add a "using" directive or two.
7149 * src/Spacing.h: ditto.
7150 * src/insets/figinset.C: ditto.
7151 * src/support/filetools.C: ditto.
7152 * src/support/lstrings.C: ditto.
7153 * src/BufferView.C: ditto.
7154 * src/bufferlist.C: ditto.
7155 * src/lyx_cb.C: ditto.
7156 * src/lyxlex.C: ditto.
7158 * NEWS: add some changes for 1.1.4.
7160 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7162 * src/BufferView.C: first go at a TextCache to speed up switching
7165 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7167 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
7168 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
7169 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
7170 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
7173 * src/mathed/math_defs.h (MathedRowSt): make sure that all
7174 members of the struct are correctly initialized to 0 (detected by
7176 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
7177 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
7179 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
7180 pidwait, since it was allocated with "new". This was potentially
7181 very bad. Thanks to Michael Schmitt for running purify for us.
7184 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7186 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
7188 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
7190 1999-12-30 Allan Rae <rae@lyx.org>
7192 * lib/templates/IEEEtran.lyx: minor change
7194 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
7195 src/mathed/formula.C (LocalDispatch): askForText changes
7197 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
7198 know when a user has cancelled input. Fixes annoying problems with
7199 inserting labels and version control.
7201 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7203 * src/support/lstrings.C (tostr): rewritten to use strstream and
7206 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7208 * src/support/filetools.C (IsFileWriteable): use fstream to check
7209 (IsDirWriteable): use fileinfo to check
7211 * src/support/filetools.h (FilePtr): whole class deleted
7213 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
7215 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
7217 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
7219 * src/bufferlist.C (write): use ifstream and ofstream instead of
7222 * src/Spacing.h: use istrstream instead of sscanf
7224 * src/mathed/math_defs.h: change first arg to istream from FILE*
7226 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
7228 * src/mathed/math_parser.C: have yyis to be an istream
7229 (LexGetArg): use istream (yyis)
7231 (mathed_parse): ditto
7232 (mathed_parser_file): first arg istream instead of FILE*, set yyis
7234 * src/mathed/formula.C (Read): rewritten to use istream
7236 * src/mathed/formulamacro.C (Read): rewritten to use istream
7238 * src/lyxlex.h (~LyXLex): deleted desturctor
7239 (getStream): new function, returns an istream
7240 (getFile): deleted funtion
7241 (IsOK): return is.good();
7243 * src/lyxlex.C (LyXLex): delete file and owns_file
7244 (setFile): open an filebuf and assign that to a istream instead of
7246 (setStream): new function, takes an istream as arg.
7247 (setFile): deleted function
7248 (EatLine): rewritten us use istream instead of FILE*
7252 * src/table.C (LyXTable): use istream instead of FILE*
7253 (Read): rewritten to take an istream instead of FILE*
7255 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7257 * src/buffer.C (Dispatch): remove an extraneous break statement.
7259 * src/support/filetools.C (QuoteName): change to do simple
7260 'quoting'. More work is necessary. Also changed to do nothing
7261 under emx (needs fix too).
7262 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
7264 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
7265 config.h.in to the AC_DEFINE_UNQUOTED() call.
7266 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
7267 needs char * as argument (because Solaris 7 declares it like
7270 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
7271 remove definition of BZERO.
7273 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7275 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
7276 defined, "lyxregex.h" if not.
7278 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
7280 (REGEX): new variable that is set to regex.c lyxregex.h when
7281 AM_CONDITIONAL USE_REGEX is set.
7282 (libsupport_la_SOURCES): add $(REGEX)
7284 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
7287 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
7290 * configure.in: add call to LYX_REGEX
7292 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
7293 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
7295 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7297 * lib/bind/fi_menus.bind: new file, from
7298 pauli.virtanen@saunalahti.fi.
7300 * src/buffer.C (getBibkeyList): pass the parameter delim to
7301 InsetInclude::getKeys and InsetBibtex::getKeys.
7303 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
7304 is passed to Buffer::getBibkeyList
7306 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
7307 instead of the hardcoded comma.
7309 * src/insets/insetbib.C (getKeys): make sure that there are not
7310 leading blanks in bibtex keys. Normal latex does not care, but
7311 harvard.sty seems to dislike blanks at the beginning of citation
7312 keys. In particular, the retturn value of the function is
7314 * INSTALL: make it clear that libstdc++ is needed and that gcc
7315 2.7.x probably does not work.
7317 * src/support/filetools.C (findtexfile): make debug message go to
7319 * src/insets/insetbib.C (getKeys): ditto
7321 * src/debug.C (showTags): make sure that the output is correctly
7324 * configure.in: add a comment for TWO_COLOR_ICON define.
7326 * acconfig.h: remove all the entries that already defined in
7327 configure.in or acinclude.m4.
7329 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
7330 to avoid user name, date and copyright.
7332 1999-12-21 Juergen Vigna <jug@sad.it>
7334 * src/table.C (Read): Now read bogus row format informations
7335 if the format is < 5 so that afterwards the table can
7336 be read by lyx but without any format-info. Fixed the
7337 crash we experienced when not doing this.
7339 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7341 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
7342 (RedoDrawingOfParagraph): ditto
7343 (RedoParagraphs): ditto
7344 (RemoveTableRow): ditto
7346 * src/text.C (Fill): rename arg paperwidth -> paper_width
7348 * src/buffer.C (insertLyXFile): rename var filename -> fname
7349 (writeFile): rename arg filename -> fname
7350 (writeFileAscii): ditto
7351 (makeLaTeXFile): ditto
7352 (makeLinuxDocFile): ditto
7353 (makeDocBookFile): ditto
7355 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
7358 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
7360 * src/bmtable.h: add extern "C" on this file when __cplusplus is
7363 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
7364 compiled by a C compiler not C++.
7366 * src/layout.h (LyXTextClass): added typedef for const_iterator
7367 (LyXTextClassList): added typedef for const_iterator + member
7368 functions begin and end.
7370 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
7371 iterators to fill the choice_class.
7372 (updateLayoutChoice): rewritten to use iterators to fill the
7373 layoutlist in the toolbar.
7375 * src/BufferView.h (BufferView::work_area_width): removed unused
7378 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
7380 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
7381 (sgmlCloseTag): ditto
7383 * src/support/lstrings.h: return type of countChar changed to
7386 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
7387 what version of this func to use. Also made to return unsigned int.
7389 * configure.in: call LYX_STD_COUNT
7391 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
7392 conforming std::count.
7394 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7396 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
7397 and a subscript would give bad display (patch from Dekel Tsur
7398 <dekel@math.tau.ac.il>).
7400 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
7402 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
7405 * src/chset.h: add a few 'using' directives
7407 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
7408 triggered when no buffer is active
7410 * src/layout.C: removed `break' after `return' in switch(), since
7413 * src/lyx_main.C (init): make sure LyX can be ran in place even
7414 when libtool has done its magic with shared libraries. Fix the
7415 test for the case when the system directory has not been found.
7417 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
7418 name for the latex file.
7419 (MenuMakeHTML): ditto
7421 * src/buffer.h: add an optional boolean argument, which is passed
7424 1999-12-20 Allan Rae <rae@lyx.org>
7426 * lib/templates/IEEEtran.lyx: small correction and update.
7428 * configure.in: Attempted to use LYX_PATH_HEADER
7430 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
7432 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
7433 input from JMarc. Now use preprocessor to find the header.
7434 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
7435 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
7436 LYX_STL_STRING_FWD. See comments in file.
7438 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
7440 * The global MiniBuffer * minibuffer variable is dead.
7442 * The global FD_form_main * fd_form_main variable is dead.
7444 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7446 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
7448 * src/table.h: add the LOstream.h header
7449 * src/debug.h: ditto
7451 * src/LyXAction.h: change the explaination of the ReadOnly
7452 attribute: is indicates that the function _can_ be used.
7454 * src/LyXAction.C (init): find-replace _can_ be used in read-only
7457 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7459 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
7465 * src/paragraph.C (GetWord): assert on pos>=0
7468 * src/support/lyxstring.C: condition the use of an invariant on
7470 * src/support/lyxstring.h: ditto
7472 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
7473 Use LAssert.h instead of plain assert().
7475 * src/support/lstrings.h: add LAssert.h, in case it is needed.
7477 * src/lyxfunc.C: do not include LAssert.h, it is not used.
7478 * src/support/filetools.C: ditto
7480 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
7483 * INSTALL: document the new configure flags
7485 * configure.in: suppress --with-debug; add --enable-assertions
7487 * acinclude.m4: various changes in alignment of help strings.
7489 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7491 * src/kbmap.C: commented out the use of the hash map in kb_map,
7492 beginning of movement to a stl::container.
7494 * several files: removed code that was not in effect when
7495 MOVE_TEXT was defined.
7497 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
7498 for escaping should not be used. We can discuss if the string
7499 should be enclosed in f.ex. [] instead of "".
7501 * src/trans_mgr.C (insert): use the new returned value from
7502 encodeString to get deadkeys and keymaps done correctly.
7504 * src/chset.C (encodeString): changed to return a pair, to tell
7505 what to use if we know the string.
7507 * src/lyxscreen.h (fillArc): new function.
7509 * src/FontInfo.C (resize): rewritten to use more std::string like
7510 structore, especially string::replace.
7512 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
7515 * configure.in (chmod +x some scripts): remove config/gcc-hack
7517 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7519 * src/buffer.C (writeFile): change once again the top comment in a
7520 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
7521 instead of an hardcoded version number.
7522 (makeDocBookFile): ditto
7524 * src/version.h: add new define LYX_DOCVERSION
7526 * po/de.po: update from Pit Sütterlin
7527 * lib/bind/de_menus.bind: ditto.
7529 * src/lyxfunc.C (Dispatch): call MenuExport()
7530 * src/buffer.C (Dispatch): ditto
7532 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
7533 LyXFunc::Dispatch().
7534 (MenuExport): new function, moved from
7535 LyXFunc::Dispatch().
7537 * src/trans_mgr.C (insert): small cleanup
7538 * src/chset.C (loadFile): ditto
7540 * lib/kbd/iso8859-1.cdef: add missing backslashes
7542 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7544 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
7545 help with placing the manually drawn accents better.
7547 (Draw): x2 and hg changed to float to minimize rounding errors and
7548 help place the accents better.
7550 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
7551 unsigned short to char is just wrong...cast the char to unsigned
7552 char instead so that the two values can compare sanely. This
7553 should also make the display of insetlatexaccents better and
7554 perhaps also some other insets.
7556 (lbearing): new function
7559 1999-12-15 Allan Rae <rae@lyx.org>
7561 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
7562 header that provides a wrapper around the very annoying SGI STL header
7565 * src/support/lyxstring.C, src/LString.h:
7566 removed old SGI-STL-compatability attempts.
7568 * configure.in: Use LYX_STL_STRING_FWD.
7570 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
7571 stl_string_fwd.h is around and try to determine it's location.
7572 Major improvement over previous SGI STL 3.2 compatability.
7573 Three small problems remain with this function due to my zero
7574 knowledge of autoconf. JMarc and lgb see the comments in the code.
7576 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7578 * src/broken_const.h, config/hack-gcc, config/README: removed
7580 * configure.in: remove --with-gcc-hack option; do not call
7583 * INSTALL: remove documentation of --with-broken-const and
7586 * acconfig.h: remove all trace of BROKEN_CONST define
7588 * src/buffer.C (makeDocBookFile): update version number in output
7590 (SimpleDocBookOnePar): fix an assert when trying to a character
7591 access beyond string length
7594 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7596 * po/de.po: fix the Export menu
7598 * lyx.man: update the description of -dbg
7600 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
7601 (commandLineHelp): updated
7602 (easyParse): show list of available debug levels if -dbg is passed
7605 * src/Makefile.am: add debug.C
7607 * src/debug.h: moved some code to debug.C
7609 * src/debug.C: new file. Contains code to set and show debug
7612 * src/layout.C: remove 'break' after 'continue' in switch
7613 statements, since these cannot be reached.
7615 1999-12-13 Allan Rae <rae@lyx.org>
7617 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
7618 (in_word_set): hash() -> math_hash()
7620 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
7622 * acconfig.h: Added a test for whether we are using exceptions in the
7623 current compilation run. If so USING_EXCEPTIONS is defined.
7625 * config.in: Check for existance of stl_string_fwd.h
7626 * src/LString.h: If compiling --with-included-string and SGI's
7627 STL version 3.2 is present (see above test) we need to block their
7628 forward declaration of string and supply a __get_c_string().
7629 However, it turns out this is only necessary if compiling with
7630 exceptions enabled so I've a bit more to add yet.
7632 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
7633 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
7634 src/support/LRegex.h, src/undo.h:
7635 Shuffle the order of the included files a little to ensure that
7636 LString.h gets included before anything that includes stl_string_fwd.h
7638 * src/support/lyxstring.C: We need to #include LString.h instead of
7639 lyxstring.h to get the necessary definition of __get_c_string.
7640 (__get_c_string): New function. This is defined static just like SGI's
7641 although why they need to do this I'm not sure. Perhaps it should be
7642 in lstrings.C instead.
7644 * lib/templates/IEEEtran.lyx: New template file.
7646 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7648 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
7649 * intl/Makefile.in (MKINSTALLDIRS): ditto
7651 * src/LyXAction.C (init): changed to hold the LFUN data in a
7652 automatic array in stead of in callso to newFunc, this speeds up
7653 compilation a lot. Also all the memory used by the array is
7654 returned when the init is completed.
7656 * a lot of files: compiled with -Wold-style-cast, changed most of
7657 the reported offenders to C++ style casts. Did not change the
7658 offenders in C files.
7660 * src/trans.h (Match): change argument type to unsigned int.
7662 * src/support/DebugStream.C: fix some types on the streambufs so
7663 that it works on a conforming implementation.
7665 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7667 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
7669 * src/support/lyxstring.C: remove the inline added earlier since
7670 they cause a bunch of unsatisfied symbols when linking with dec
7671 cxx. Cxx likes to have the body of inlines at the place where they
7674 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
7675 accessing negative bounds in array. This fixes the crash when
7676 inserting accented characters.
7677 * src/trans.h (Match): ditto
7679 * src/buffer.C (Dispatch): since this is a void, it should not try
7680 to return anything...
7682 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7684 * src/buffer.h: removed the two friends from Buffer. Some changes
7685 because of this. Buffer::getFileName and Buffer::setFileName
7686 renamed to Buffer::fileName() and Buffer::fileName(...).
7688 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7690 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
7691 and Buffer::update(short) to BufferView. This move is currently
7692 controlled by a define MOVE_TEXT, this will be removed when all
7693 shows to be ok. This move paves the way for better separation
7694 between buffer contents and buffer view. One side effect is that
7695 the BufferView needs a rebreak when swiching buffers, if we want
7696 to avoid this we can add a cache that holds pointers to LyXText's
7697 that is not currently in use.
7699 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
7702 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7704 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
7706 * lyx_main.C: new command line option -x (or --execute) and
7707 -e (or --export). Now direct conversion from .lyx to .tex
7708 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
7709 Unfortunately, X is still needed and the GUI pops up during the
7712 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7714 * src/Spacing.C: add a using directive to bring stream stuff into
7716 * src/paragraph.C: ditto
7717 * src/buffer.C: ditto
7719 * NEWS: updated a bit the new features of 1.1.3 (took a few things
7720 from Lars' announcement).
7722 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
7723 example files from Tino Meinen.
7725 1999-12-06 Allan Rae <rae@lyx.org>
7727 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
7729 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7731 * src/support/lyxstring.C: added a lot of inline for no good
7734 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
7735 latexWriteEndChanges, they were not used.
7737 * src/layout.h (operator<<): output operator for PageSides
7739 * src/mathed/math_iter.C (my_memcpy): slightly changed.
7741 * some example files: loaded in LyX 1.0.4 and saved again to update
7742 certain constructs (table format)
7744 * a lot of files: did the change to use fstream/iostream for all
7745 writing of files. Done with a close look at Andre Poenitz's patch.
7747 * some files: whitespace changes.
7749 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7751 * src/mathed/math_iter.C (my_memcpy): new function. Since the
7752 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
7753 architecture, we provide our own. It is used unconditionnally, but
7754 I do not think this is a performance problem. Thanks to Angus
7755 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
7756 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
7758 (GetInset): use my_memcpy.
7762 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
7763 it is easier to understand, but it uses less TeX-only constructs now.
7765 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
7766 elements contain spaces
7768 * lib/configure: regenerated
7770 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
7771 elements contain spaces; display the list of programs that are
7774 * autogen.sh: make sure lib/configure is executable
7776 * lib/examples/*: rename the tutorial examples to begin with the
7777 two-letters language code.
7779 * src/lyxfunc.C (getStatus): do not query current font if no
7782 * src/lyx_cb.C (RunScript): use QuoteName
7783 (MenuRunDvips): ditto
7784 (PrintApplyCB): ditto
7786 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
7787 around argument, so that it works well with the current shell.
7788 Does not work properly with OS/2 shells currently.
7790 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
7791 * src/LyXSendto.C (SendtoApplyCB): ditto
7792 * src/lyxfunc.C (Dispatch): ditto
7793 * src/buffer.C (runLaTeX): ditto
7794 (runLiterate): ditto
7795 (buildProgram): ditto
7797 * src/lyx_cb.C (RunScript): ditto
7798 (MenuMakeLaTeX): ditto
7800 * src/buffer.h (getLatexName): new method
7802 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
7804 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7806 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
7807 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
7808 (create_math_panel): ditto
7810 * src/lyxfunc.C (getStatus): re-activate the code which gets
7811 current font and cursor; add test for export to html.
7813 * src/lyxrc.C (read): remove unreachable break statements; add a
7816 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
7818 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7820 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
7821 introduced by faulty regex.
7822 * src/buffer.C: ditto
7823 * src/lastfiles.C: ditto
7824 * src/paragraph.C: ditto
7825 * src/table.C: ditto
7826 * src/vspace.C: ditto
7827 * src/insets/figinset.C: ditto
7828 Note: most of these is absolutely harmless, except the one in
7829 src/mathed formula.C.
7831 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7833 * src/ImportNoweb.C (documentclass): fixed bounds for substr
7834 operation, yielding correct results for the reLyX command.
7836 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7838 * src/support/filetools.C (ExpandPath): removed an over eager
7840 (ReplaceEnvironmentPath): ditto
7842 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
7843 shows that we are doing something fishy in our code...
7847 * src/lyxrc.C (read): use a double switch trick to get more help
7848 from the compiler. (the same trick is used in layout.C)
7849 (write): new function. opens a ofstream and pass that to output
7850 (output): new function, takes a ostream and writes the lyxrc
7851 elemts to it. uses a dummy switch to make sure no elements are
7854 * src/lyxlex.h: added a struct pushpophelper for use in functions
7855 with more than one exit point.
7857 * src/lyxlex.[Ch] (GetInteger): made it const
7861 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
7863 * src/layout.[hC] : LayoutTags splitted into several enums, new
7864 methods created, better error handling cleaner use of lyxlex. Read
7867 * src/bmtable.[Ch]: change some member prototypes because of the
7868 image const changes.
7870 * commandtags.h, src/LyXAction.C (init): new function:
7871 "preferences-save", saves the lyxrc entries into .lyx/preferences.
7872 This file is not read automatically but you can add \input
7873 preferences to your lyxrc if you want to. We need to discuss how
7876 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
7877 in .aux, also remove .bib and .bst files from dependencies when
7880 * src/BufferView.C, src/LyXView.C: add const_cast several places
7881 because of changes to images.
7883 * lib/images/*: same change as for images/*
7885 * lib/lyxrc.example: Default for accept_compound is false not no.
7887 * images/*: changed to be const, however I have som misgivings
7888 about this change so it might be changed back.
7890 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7892 * lib/configure, po/POTFILES.in: regenerated
7894 * autogen.sh: autogenerate lib/configure from lib/configure.m4
7896 * config/lib_configure.m4: removed
7898 * lib/configure.m4: new file (was config/lib_configure.m4)
7900 * configure.in: do not test for rtti, since we do not use it.
7902 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7904 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
7905 doubling of allocated space scheme. This makes it faster for large
7906 strings end to use less memory for small strings. xtra rememoved.
7908 * src/insets/figinset.C (waitalarm): commented out.
7909 (GhostscriptMsg): use static_cast
7910 (GhostscriptMsg): use new instead of malloc to allocate memory for
7911 cmap. also delete the memory after use.
7913 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
7915 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
7916 for changes in bibtex database or style.
7917 (runBibTeX): remove all .bib and .bst files from dep before we
7919 (run): use scanAuc in when dep file already exist.
7921 * src/DepTable.C (remove_files_with_extension): new method
7924 * src/DepTable.[Ch]: made many of the methods const.
7926 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7928 * src/bufferparams.C: make sure that the default textclass is
7929 "article". It used to be the first one by description order, but
7930 now the first one is "docbook".
7932 * src/lyx_main.C (setDebuggingLevel): change type of argument to
7933 string; call Debug::value.
7934 (easyParse): pass complete argument to setDebuggingLevel().
7936 * src/debug.h (value): fix the code that parses debug levels.
7938 * src/debug.h: add new debug type ACTION, reserved for LyXAction
7941 * src/LyXAction.C: use Debug::ACTION as debug channel.
7943 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
7945 * NEWS: updated for the future 1.1.3 release.
7947 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
7948 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
7949 it should. This is of course a controversial change (since many
7950 people will find that their lyx workscreen is suddenly full of
7951 red), but done for the sake of correctness.
7953 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
7954 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
7956 * src/insets/inseterror.h, src/insets/inseturl.h,
7957 src/insets/insetinfo.h, src/insets/figinset.h,
7958 src/mathed/formulamacro.h, src/mathed/math_macro.h
7959 (EditMessage): add a missing const and add _() to make sure that
7962 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
7963 src/insets/insetbib.C, src/support/filetools.C: add `using'
7966 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
7967 doing 'Insert index of last word' at the beginning of a paragraph.
7969 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7971 * several files: white-space changes.
7973 * src/mathed/formula.C: removed IsAlpha and IsDigit
7975 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
7976 .bib file. use a ifstream instead of FilePtr when parsing the .bib
7979 * src/insets/figinset.C (GetPSSizes): don't break when
7980 "EndComments" is seen. But break when a boundingbox is read.
7982 * all classes inherited from Inset: return value of Clone
7983 changed back to Inset *.
7985 * all classes inherited form MathInset: return value of Clone
7986 changed back to MathedInset *.
7988 * src/insets/figinset.C (runqueue): use a ofstream to output the
7989 gs/ps file. Might need some setpresicion or setw. However I can
7990 see no problem with the current code.
7991 (runqueue): use sleep instead of the alarm/signal code. I just
7992 can't see the difference.
7994 * src/paragraph.C (LyXParagraph): reserve space in the new
7995 paragraph and resize the inserted paragraph to just fit.
7997 * src/lyxfunc.h (operator|=): added operator for func_status.
7999 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
8000 check for readable file.
8002 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
8003 check for readable file.
8004 (MenuMakeLinuxDoc): ditto
8005 (MenuMakeDocBook): ditto
8006 (MenuMakeAscii): ditto
8007 (InsertAsciiFile): split the test for openable and readable
8009 * src/bmtable.C (draw_bitmaptable): use
8010 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
8012 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
8013 findtexfile from LaTeX to filetools.
8015 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
8016 instead of FilePtr. Needs to be verified by a literate user.
8018 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8020 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
8021 (EditMessage): likewise.
8023 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
8024 respectively as \textasciitilde and \textasciicircum.
8026 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8028 * src/support/lyxstring.h: made the methods that take iterators
8031 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
8032 (regexMatch): made is use the real regex class.
8034 * src/support/Makefile.am: changed to use libtool
8036 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
8038 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
8040 (MathIsInset ++): changed several macros to be inline functions
8043 * src/mathed/Makefile.am: changed to use libtool
8045 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
8047 * src/insets/inset* : Clone changed to const and return type is
8048 the true insettype not just Inset*.
8050 * src/insets/Makefile.am: changed to use libtool
8052 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
8054 * src/undo.[Ch] : added empty() and changed some of the method
8057 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
8059 * src/lyxparagraph.h: use id() and id(...) instead of getID and
8060 setID use block<> for the bullets array, added const several places.
8062 * src/lyxfunc.C (getStatus): new function
8064 * src/lyxfunc.[Ch] : small changes to take advantage of the new
8065 LyXAction, added const to several funtions.
8067 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
8068 a std::map, and to store the dir items in a vector.
8070 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
8073 * src/LyXView.[Ch] + other files : changed currentView to view.
8075 * src/LyXAction.[Ch] : ported from the old devel branch.
8077 * src/.cvsignore: added .libs and a.out
8079 * configure.in : changes to use libtool.
8081 * acinclude.m4 : inserted libtool.m4
8083 * .cvsignore: added libtool
8085 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8087 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
8088 file name in insets and mathed directories (otherwise the
8089 dependency is not taken in account under cygwin).
8091 * src/text2.C (InsertString[AB]): make sure that we do not try to
8092 read characters past the string length.
8094 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8096 * lib/doc/LaTeXConfig.lyx.in,
8097 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
8099 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
8100 file saying who created them and when this heppened; this is
8101 useless and annoys tools like cvs.
8103 * lib/layouts/g-brief-{en,de}.layout,
8104 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
8105 from Thomas Hartkens <thomas@hartkens.de>.
8107 * src/{insets,mathed}/Makefile.am: do not declare an empty
8108 LDFLAGS, so that it can be set at configure time (useful on Irix
8111 * lib/reLyX/configure.in: make sure that the prefix is set
8112 correctly in LYX_DIR.
8114 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8116 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
8117 be used by 'command-sequence' this allows to bind a key to a
8118 sequence of LyX-commands
8119 (Example: 'command-sequence math-insert alpha; math-insert beta;")
8121 * src/LyXAction.C: add "command-sequence"
8123 * src/LyXFunction.C: handling of "command-sequence"
8125 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
8126 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
8128 * src/lyxserver.C, src/minibuffer.C: Use this new interface
8130 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8132 * src/buffer.C (writeFile): Do not output a comment giving user
8133 and date at the beginning of a .lyx file. This is useless and
8134 annoys cvs anyway; update version number to 1.1.
8136 * src/Makefile.am (LYX_DIR): add this definition, so that a
8137 default path is hardcoded in LyX.
8139 * configure.in: Use LYX_GNU_GETTEXT.
8141 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
8142 AM_GNU_GETTEXT with a bug fixed.
8144 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
8146 * src/chset.C: add "using std::ifstream;" to please dec cxx.
8148 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
8149 which is used to point to LyX data is now LYX_DIR_11x.
8151 * lyx.man: convert to a unix text file; small updates.
8153 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8155 * src/support/LSubstring.[Ch]: made the second arg of most of the
8156 constructors be a const reference.
8158 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
8161 * src/support/lyxstring.[Ch] (swap): added missing member function
8162 and specialization of swap(str, str);
8164 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
8166 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
8167 trace of the old one.
8169 * src/undo.[Ch]: made the undostack use std::list to store undo's in
8170 put the member definitions in undo.C.
8172 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
8173 NEW_TEXT and have now only code that was included when this was
8176 * src/intl.C (LCombo): use static_cast
8178 (DispatchCallback): ditto
8180 * src/definitions.h: removed whole file
8182 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
8184 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
8185 parsing and stores in a std:map. a regex defines the file format.
8186 removed unneeded members.
8188 * src/bufferparams.h: added several enums from definitions.h here.
8189 Removed unsused destructor. Changed some types to use proper enum
8190 types. use block to have the temp_bullets and user_defined_bullets
8191 and to make the whole class assignable.
8193 * src/bufferparams.C (Copy): removed this functions, use a default
8196 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
8199 * src/buffer.C (readLyXformat2): commend out all that have with
8200 oldpapersize to do. also comment out all that hve to do with
8201 insetlatex and insetlatexdel.
8202 (setOldPaperStuff): commented out
8204 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
8206 * src/LyXAction.C: remove use of inset-latex-insert
8208 * src/mathed/math_panel.C (button_cb): use static_cast
8210 * src/insets/Makefile.am (insets_o_SOURCES): removed
8213 * src/support/lyxstring.C (helper): use the unsigned long
8214 specifier, UL, instead of a static_cast.
8216 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
8218 * src/support/block.h: new file. to be used as a c-style array in
8219 classes, so that the class can be assignable.
8221 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8223 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
8224 NULL, make sure to return an empty string (it is not possible to
8225 set a string to NULL).
8227 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8229 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
8231 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
8233 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
8234 link line, so that Irix users (for example) can set it explicitely to
8237 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
8238 it can be overidden at make time (static or dynamic link, for
8241 * src/vc-backend.C, src/LaTeXFeatures.h,
8242 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
8243 statements to bring templates to global namespace.
8245 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8247 * src/support/lyxstring.C (operator[] const): make it standard
8250 * src/minibuffer.C (Init): changed to reflect that more
8251 information is given from the lyxvc and need not be provided here.
8253 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
8255 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
8257 * src/LyXView.C (UpdateTimerCB): use static_cast
8258 (KeyPressMask_raw_callback): ditto
8260 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
8261 buffer_, a lot of changes because of this. currentBuffer() ->
8262 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
8263 also changes to other files because of this.
8265 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8267 * src/vc-backend.[Ch]: new files. The backends for vc handling,
8268 have no support for RCS and partial support for CVS, will be
8271 * src/insets/ several files: changes because of function name
8272 changes in Bufferview and LyXView.
8274 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
8276 * src/support/LSubstring.[Ch]: new files. These implement a
8277 Substring that can be very convenient to use. i.e. is this
8279 string a = "Mary had a little sheep";
8280 Substring(a, "sheep") = "lamb";
8281 a is now "Mary has a little lamb".
8283 * src/support/LRegex.[Ch]: a regex class that can be used to pick
8284 out patterns and subpatterns of strings. It is used by LSubstring
8285 and also by vc-backend.C
8287 * src/support/lyxstring.C: went over all the assertions used and
8288 tried to correct the wrong ones and flag which of them is required
8289 by the standard. some bugs found because of this. Also removed a
8290 couple of assertions.
8292 * src/support/Makefile.am (libsupport_a_SOURCES): added
8293 LSubstring.[Ch] and LRegex.[Ch]
8295 * src/support/FileInfo.h: have struct stat buf as an object and
8296 not a pointer to one, some changes because of this.
8298 * src/LaTeXFeatures.C (getTClassPreamble): also use the
8299 information in layout when adding the layouts preamble to the
8302 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
8305 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
8306 because of bug in OS/2.
8308 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8310 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
8311 \verbatim@font instead of \ttfamily, so that it can be redefined.
8313 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
8314 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
8315 src/layout.h, src/text2.C: add 'using' directive to bring the
8316 STL templates we need from the std:: namespace to the global one.
8317 Needed by DEC cxx in strict ansi mode.
8319 * src/support/LIstream.h,src/support/LOstream.h,
8320 src/support/lyxstring.h,src/table.h,
8321 src/lyxlookup.h: do not include <config.h> in header
8322 files. This should be done in the .C files only.
8324 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
8328 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8330 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
8331 from Kayvan to fix the tth invokation.
8333 * development/lyx.spec.in: updates from Kayvan to reflect the
8334 changes of file names.
8336 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8338 * src/text2.C (InsertStringB): use std::copy
8339 (InsertStringA): use std::copy
8341 * src/bufferlist.C: use a vector to store the buffers in. This is
8342 an internal change and should not affect any other thing.
8344 * src/BufferView.C (waitForX): use XSync instead of the lengthy
8347 * src/text.C (Fill): fix potential bug, one off bug.
8349 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8351 * src/Makefile.am (lyx_main.o): add more files it depends on.
8353 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
8355 * src/support/lyxstring.C: use size_t for the reference count,
8356 size, reserved memory and xtra.
8357 (internal_compare): new private member function. Now the compare
8358 functions should work for std::strings that have embedded '\0'
8360 (compare): all compare functions rewritten to use
8363 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8365 * src/support/lyxstring.C (compare): pass c_str()
8366 (compare): pass c_str
8367 (compare): pass c_str
8369 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8371 * src/support/DebugStream.C: <config.h> was not included correctly.
8373 * lib/configure: forgot to re-generate it :( I'll make this file
8374 auto generated soon.
8376 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8378 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
8381 * src/support/lyxstring.C: some changes from length() to rep->sz.
8382 avoids a function call.
8384 * src/support/filetools.C (SpaceLess): yet another version of the
8385 algorithm...now per Jean-Marc's suggestions.
8387 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8389 * src/layout.C (less_textclass_desc): functor for use in sorting
8391 (LyXTextClass::Read): sort the textclasses after reading.
8393 * src/support/filetools.C (SpaceLess): new version of the
8394 SpaceLess functions. What problems does this one give? Please
8397 * images/banner_bw.xbm: made the arrays unsigned char *
8399 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8401 * src/support/lyxstring.C (find): remove bogus assertion in the
8402 two versions of find where this has not been done yet.
8404 * src/support/lyxlib.h: add missing int return type to
8407 * src/menus.C (ShowFileMenu): disable exporting to html if no
8408 html export command is present.
8410 * config/lib_configure.m4: add a test for an HTML converter. The
8411 programs checked for are, in this order: tth, latex2html and
8414 * lib/configure: generated from config/lib_configure.m4.
8416 * src/lyxfunc.C (Dispatch): update and improve the execution of an
8417 html converter. The parameters are now passed through $$FName and
8418 $$OutName, instead of standard input/output.
8420 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
8422 * lib/lyxrc.example: update description of \html_command.
8423 add "quotes" around \screen_font_xxx font setting examples to help
8424 people who use fonts with spaces in their names.
8426 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8428 * Distribution files: updates for v1.1.2
8430 * src/support/lyxstring.C (find): remove bogus assert and return
8431 npos for the same condition.
8433 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8435 * added patch for OS/2 from SMiyata.
8437 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8439 * src/text2.C (CutSelection): make space_wrapped a bool
8440 (CutSelection): dont declare int i until we have to.
8441 (alphaCounter): return a char const *.
8443 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8445 * src/support/syscall.C (Systemcalls::kill):
8446 src/support/filetools.C (PutEnv, PutEnvPath):
8447 src/lyx_cb.C (addNewlineAndDepth):
8448 src/FontInfo.C (FontInfo::resize): condition some #warning
8449 directives with WITH_WARNINGS.
8452 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8454 * src/layout.[Ch] + several files: access to class variables
8455 limited and made accessor functions instead a lot of code changed
8456 becuase of this. Also instead of returning pointers often a const
8457 reference is returned instead.
8459 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
8461 * src/Makefile.am (dist-hook): added used to remove the CVS from
8462 cheaders upon creating a dist
8463 (EXTRA_DIST): added cheaders
8465 * src/support/lstrings.C (tostr(char)): fix it to handle param as
8466 a character not as a small integer.
8468 * src/support/lyxstring.C (find): removed Assert and added i >=
8469 rep->sz to the first if.
8471 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8473 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
8474 src/LyXView.C src/buffer.C src/bufferparams.C
8475 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
8476 src/text2.C src/insets/insetinclude.C:
8477 lyxlayout renamed to textclasslist.
8479 * src/layout.C: some lyxerr changes.
8481 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
8482 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
8483 (LyXLayoutList): removed all traces of this class.
8484 (LyXTextClass::Read): rewrote LT_STYLE
8485 (LyXTextClass::hasLayout): new function
8486 (LyXTextClass::GetLayout): rewritten to return an iterator + has
8487 both const and nonconst version.
8488 (LyXTextClass::delete_layout): new function.
8489 (LyXTextClassList::Style): bug fix. do the right thing if layout
8491 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
8492 (LyXTextClassList::NameOfLayout): ditto
8493 (LyXTextClassList::Load): ditto
8495 * src/buffer.C (makeLaTeXFile): new access to layoutlist
8497 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
8499 * src/LyXAction.C (LookupFunc): added a workaround for sun
8500 compiler, on the other hand...we don't know if the current code
8501 compiles on sun at all...
8503 * src/support/filetools.C (CleanupPath): subst fix
8505 * src/insets/insetbib.C (delDatabase): subst fix, this looks
8508 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
8509 complained about this one?
8511 * src/insets/insetinclude.C (Latex): subst fix
8513 * src/insets/insetbib.C (getKeys): subst fix
8515 * src/LyXSendto.C (SendtoApplyCB): subst fix
8517 * src/lyx_main.C (init): subst fix
8519 * src/layout.C (Read): subst fix
8521 * src/lyx_sendfax_main.C (button_send): subst fix
8523 * src/buffer.C (RoffAsciiTable): subst fix
8525 * src/lyx_cb.C (MenuFax): subst fix
8526 (PrintApplyCB): subst fix
8528 1999-10-26 Juergen Vigna <jug@sad.it>
8530 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
8532 (Read): Cleaned up this code so now we read only format vestion >= 5
8534 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8536 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
8537 come nobody has complained about this one?
8539 * src/insets/insetinclude.C (Latex): subst fix
8541 * src/insets/insetbib.C (getKeys): subst fix
8543 * src/lyx_main.C (init): subst fix
8545 * src/layout.C (Read): subst fix
8547 * src/buffer.C (RoffAsciiTable): subst fix
8549 * src/lyx_cb.C (MenuFax): subst fix.
8551 * src/layout.[hC] + some other files: rewrote to use
8552 std::container to store textclasses and layouts in.
8553 Simplified, removed a lot of code. Make all classes
8554 assignable. Further simplifications and review of type
8555 use still to be one.
8557 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
8558 lastfiles to create the lastfiles partr of the menu.
8560 * src/lastfiles.[Ch]: rewritten to use deque to store the
8561 lastfiles in. Uses fstream for reading and writing. Simplifies
8564 * src/support/syscall.C: remove explicit cast.
8566 * src/BufferView.C (CursorToggleCB): removed code snippets that
8568 use explicat C++ style casts instead of C style casts. also use
8569 u_vdata instea of passing pointers in longs.
8571 * src/PaperLayout.C: removed code snippets that were commented out.
8573 * src/lyx_gui_misc.C: removed code snippets that were commented out.
8575 * src/lyx_main.C: removed code snippets that wer commented out.
8577 * src/paragraph.C: removed code snippets that were commented out.
8579 * src/lyxvc.C (logClose): use static_cast
8581 (viewLog): remove explicit cast to void*
8582 (showLog): removed old commented code
8584 * src/menus.C: use static_cast instead of C style casts. use
8585 u_vdata instead of u_ldata. remove explicit cast to (long) for
8586 pointers. Removed old code that was commented out.
8588 * src/insets/inset.C: removed old commented func
8590 * src/insets/insetref.C (InsetRef): removed old code that had been
8591 commented out for a long time.
8593 (escape): removed C style cast
8595 * src/insets/insetlatexaccent.C (Draw): removed old commented code
8597 * src/insets/insetlatex.C (Draw): removed old commented code
8598 (Read): rewritten to use string
8600 * src/insets/insetlabel.C (escape): removed C style cast
8602 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
8604 * src/insets/insetindex.C: use static_cast and u_vdata, removed
8607 * src/insets/insetinclude.h: removed a couple of stupid bools
8609 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
8610 (Clone): remove C style cast
8611 (getKeys): changed list to lst because of std::list
8613 * src/insets/inseterror.C (Draw): removed som old commented code.
8615 * src/insets/insetcommand.C (Draw): removed some old commented code.
8617 * src/insets/insetbib.C (bibitem_cb): removed code that has been
8618 commented out forever.
8619 (bibitem_cb): use static_cast instead of C style cast
8620 use of vdata changed to u_vdata.
8622 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
8624 (CloseUrlCB): use static_cast instead of C style cast.
8625 (CloseUrlCB): added a fl_free form...it seemed to be missing.
8627 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
8628 (C_InsetInfo_CloseInfoCB): forward the ob parameter
8629 (CloseInfoCB): static_cast from ob->u_vdata instead.
8630 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
8633 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
8634 (C_InsetError_CloseErrorCB): forward the ob parameter
8635 (CloseErrorCB): static_cast from ob->u_vdata instead.
8637 * src/vspace.h: include LString.h since we use string in this class.
8639 * src/vspace.C (lyx_advance): changed name from advance because of
8640 nameclash with stl. And since we cannot use namespaces yet...I
8641 used a lyx_ prefix instead. Expect this to change when we begin
8644 * src/BufferView.[Ch] (BufferView::~BufferView): removed
8646 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
8647 and removed now defunct constructor and deconstructor.
8649 * src/BufferView.h: have backstack as a object not as a pointer.
8650 removed initialization from constructor. added include for BackStack
8652 * development/lyx.spec.in (%build): add CFLAGS also.
8654 * src/screen.C (drawFrame): removed another warning.
8656 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8658 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
8659 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
8660 README and ANNOUNCE a bit for the next release. More work is
8663 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
8664 unbreakable if we are in freespacing mode (LyX-Code), but not in
8667 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8669 * src/BackStack.h: fixed initialization order in constructor
8671 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
8673 * acinclude.m4 (VERSION): new rules for when a version is
8674 development, added also a variable for prerelease.
8675 (warnings): we set with_warnings=yes for prereleases
8676 (lyx_opt): prereleases compile with same optimization as development
8677 (CXXFLAGS): only use pedantic if we are a development version
8679 * src/BufferView.C (restorePosition): don't do anything if the
8682 * src/BackStack.h: added member empty, use this to test if there
8683 is anything to pop...
8685 1999-10-25 Juergen Vigna <jug@sad.it>
8688 * forms/layout_forms.fd +
8689 * forms/latexoptions.fd +
8690 * lyx.fd: changed for various form resize issues
8692 * src/mathed/math_panel.C +
8693 * src/insets/inseterror.C +
8694 * src/insets/insetinfo.C +
8695 * src/insets/inseturl.C +
8696 * src/insets/inseturl.h +
8699 * src/PaperLayout.C +
8700 * src/ParagraphExtra.C +
8701 * src/TableLayout.C +
8703 * src/layout_forms.C +
8710 * src/menus.C: fixed various resize issues. So now forms can be
8711 resized savely or not be resized at all.
8713 * forms/form_url.fd +
8714 * src/insets/form_url.[Ch]: added because it's cleaner and easier
8717 * src/insets/Makefile.am: added files form_url.[Ch]
8719 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8721 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
8722 (and presumably 6.2).
8724 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
8725 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
8726 remaining static member callbacks.
8728 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
8731 * src/support/lyxstring.h: declare struct Srep as friend of
8732 lyxstring, since DEC cxx complains otherwise.
8734 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8736 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8738 * src/LaTeX.C (run): made run_bibtex also depend on files with
8740 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
8741 are put into the dependency file.
8743 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
8744 the code has shown itself to work
8745 (create_ispell_pipe): removed another warning, added a comment
8748 * src/minibuffer.C (ExecutingCB): removed code that has been
8749 commented out a long time
8751 * src/lyxfunc.C (processKeyEvent): removed some very old commented
8752 out code + a warning.
8754 * src/support/lyxstring.h: comment out the three private
8755 operators, when compiling with string ansi conforming compilers
8758 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
8760 (pixmapFromBitmapData): change type of bdata to be unsigned char *
8761 (pixmapFromBitmapData): add a reinterpret_cast in the call to
8764 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
8767 * src/mathed/math_panel.C (create_math_panel): remove explicit
8770 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
8773 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
8774 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
8775 to XCreatePixmapFromBitmapData
8776 (fl_set_bmtable_data): change the last argument to be unsigned
8778 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
8779 and bh to be unsigned int, remove explicit casts in call to
8780 XReadBitmapFileData.
8782 * images/arrows.xbm: made the arrays unsigned char *
8783 * images/varsz.xbm: ditto
8784 * images/misc.xbm: ditto
8785 * images/greek.xbm: ditto
8786 * images/dots.xbm: ditto
8787 * images/brel.xbm: ditto
8788 * images/bop.xbm: ditto
8790 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
8792 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
8793 (LYX_PROG_CXX): added -pedantic to g++ compile options when
8794 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
8796 (LYX_CXX_CHEADERS): added <clocale> to the test.
8798 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
8800 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
8802 * src/support/lyxstring.C (append): fixed something that must be a
8803 bug, rep->assign was used instead of rep->append.
8805 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
8808 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
8809 lyx insert double chars. Fix spotted by Kayvan.
8811 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8813 * Fixed the tth support. I messed up with the Emacs patch apply feature
8814 and omitted the changes in lyxrc.C.
8816 1999-10-22 Juergen Vigna <jug@sad.it>
8818 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
8820 * src/lyx_cb.C (MenuInsertRef) +
8821 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
8822 the form cannot be resized under it limits (fixes a segfault)
8824 * src/lyx.C (create_form_form_ref) +
8825 * forms/lyx.fd: Changed Gravity on name input field so that it is
8828 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8830 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
8831 <ostream> and <istream>.
8833 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
8834 whether <fstream> provides the latest standard features, or if we
8835 have an oldstyle library (like in egcs).
8836 (LYX_CXX_STL_STRING): fix the test.
8838 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
8839 code on MODERN_STL_STREAM.
8841 * src/support/lyxstring.h: use L{I,O}stream.h.
8843 * src/support/L{I,O}stream.h: new files, designed to setup
8844 correctly streams for our use
8845 - includes the right header depending on STL capabilities
8846 - puts std::ostream and std::endl (for LOStream.h) or
8847 std::istream (LIStream.h) in toplevel namespace.
8849 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8851 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
8852 was a bib file that had been changed we ensure that bibtex is run.
8853 (runBibTeX): enhanced to extract the names of the bib files and
8854 getting their absolute path and enter them into the dep file.
8855 (findtexfile): static func that is used to look for tex-files,
8856 checks for absolute patchs and tries also with kpsewhich.
8857 Alternative ways of finding the correct files are wanted. Will
8859 (do_popen): function that runs a command using popen and returns
8860 the whole output of that command in a string. Should be moved to
8863 * src/DepTable.[Ch] (extchanged): new function that returns true if a
8864 file with extension ext has changed.
8866 * src/insets/figinset.C: added ifdef guards around the fl_free
8867 code that jug commented out. Now it is commented out when
8868 compiling with XForms == 0.89.
8870 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
8871 to lyxstring.C, and only keep a forward declaration in
8872 lyxstring.h. Simplifies the header file a bit and should help a
8873 bit on compile time too. Also changes to Srep will not mandate a
8874 recompile of code just using string.
8875 (~lyxstring): definition moved here since it uses srep.
8876 (size): definition moved here since it uses srep.
8878 * src/support/lyxstring.h: removed a couple of "inline" that should
8881 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8883 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
8886 1999-10-21 Juergen Vigna <jug@sad.it>
8888 * src/table.C (SetPWidth): Just a small fix so the alignment is not
8889 set to left if I just remove the width entry (or it is empty).
8891 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
8892 paragraph when having dummy paragraphs.
8894 1999-10-20 Juergen Vigna <jug@sad.it>
8896 * src/insets/figinset.C: just commented some fl_free_form calls
8897 and added warnings so that this calls should be activated later
8898 again. This avoids for now a segfault, but we have a memory leak!
8900 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
8901 'const char * argument' to 'string argument', this should
8902 fix some Asserts() in lyxstring.C.
8904 * src/lyxfunc.h: Removed the function argAsString(const char *)
8905 as it is not used anymore.
8907 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8909 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
8912 * src/Literate.h: some funcs moved from public to private to make
8913 interface clearer. Unneeded args removed.
8915 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
8917 (scanBuildLogFile): ditto
8919 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
8920 normal TeX Error. Still room for improvement.
8922 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
8924 * src/buffer.C (insertErrors): changes to make the error
8925 desctription show properly.
8927 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
8930 * src/support/lyxstring.C (helper): changed to use
8931 sizeof(object->rep->ref).
8932 (operator>>): changed to use a pointer instead.
8934 * src/support/lyxstring.h: changed const reference & to value_type
8935 const & lets see if that helps.
8937 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8939 * Makefile.am (rpmdist): fixed to have non static package and
8942 * src/support/lyxstring.C: removed the compilation guards
8944 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
8947 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
8948 conditional compile of lyxstring.Ch
8950 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
8951 stupid check, but it is a lot better than the bastring hack.
8952 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
8954 * several files: changed string::erase into string::clear. Not
8957 * src/chset.C (encodeString): use a char temporary instead
8959 * src/table.C (TexEndOfCell): added tostr around
8960 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
8961 (TexEndOfCell): ditto
8962 (TexEndOfCell): ditto
8963 (TexEndOfCell): ditto
8964 (DocBookEndOfCell): ditto
8965 (DocBookEndOfCell): ditto
8966 (DocBookEndOfCell): ditto
8967 (DocBookEndOfCell): ditto
8969 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
8971 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
8973 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
8974 (MenuBuildProg): added tostr around ret
8975 (MenuRunChktex): added tostr around ret
8976 (DocumentApplyCB): added tostr around ret
8978 * src/chset.C (encodeString): added tostr around t->ic
8980 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
8981 (makeLaTeXFile): added tostr around tocdepth
8982 (makeLaTeXFile): added tostr around ftcound - 1
8984 * src/insets/insetbib.C (setCounter): added tostr around counter.
8986 * src/support/lyxstring.h: added an operator+=(int) to catch more
8989 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
8990 (lyxstring): We DON'T allow NULL pointers.
8992 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8994 * src/mathed/math_macro.C (MathMacroArgument::Write,
8995 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
8996 when writing them out.
8998 * src/LString.C: remove, since it is not used anymore.
9000 * src/support/lyxstring.C: condition the content to
9001 USE_INCLUDED_STRING macro.
9003 * src/mathed/math_symbols.C, src/support/lstrings.C,
9004 src/support/lyxstring.C: add `using' directive to specify what
9005 we need in <algorithm>. I do not think that we need to
9006 conditionalize this, but any thought is appreciated.
9008 * many files: change all callback functions to "C" linkage
9009 functions to please strict C++ compilers like DEC cxx 6.1 in mode
9010 strict_ansi. Those who were static are now global.
9011 The case of callbacks which are static class members is
9012 trickier, since we have to make C wrappers around them (see
9013 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
9014 did not finish this yet, since it defeats the purpose of
9015 encapsulation, and I am not sure what the best route is.
9017 1999-10-19 Juergen Vigna <jug@sad.it>
9019 * src/support/lyxstring.C (lyxstring): we permit to have a null
9020 pointer as assignment value and just don't assign it.
9022 * src/vspace.C (nextToken): corrected this function substituting
9023 find_first(_not)_of with find_last_of.
9025 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
9026 (TableOptCloseCB) (TableSpeCloseCB):
9027 inserted fl_set_focus call for problem with fl_hide_form() in
9030 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9032 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
9035 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9037 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
9038 LyXLex::next() and not eatline() to get its argument.
9040 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9042 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
9043 instead, use fstreams for io of the depfile, removed unneeded
9044 functions and variables.
9046 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
9047 vector instead, removed all functions and variables that is not in
9050 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9052 * src/buffer.C (insertErrors): use new interface to TeXError
9054 * Makefile.am (rpmdist): added a rpmdist target
9056 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
9057 per Kayvan's instructions.
9059 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9061 * src/Makefile.am: add a definition for localedir, so that locales
9062 are found after installation (Kayvan)
9064 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9066 * development/.cvsignore: new file.
9068 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9070 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
9071 C++ compiler provides wrappers for C headers and use our alternate
9074 * configure.in: use LYX_CXX_CHEADERS.
9076 * src/cheader/: new directory, populated with cname headers from
9077 libstdc++-2.8.1. They are a bit old, but probably good enough for
9078 what we want (support compilers who lack them).
9080 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
9081 from includes. It turns out is was stupid.
9083 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9085 * lib/Makefile.am (install-data-local): forgot a ';'
9086 (install-data-local): forgot a '\'
9087 (libinstalldirs): needed after all. reintroduced.
9089 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9091 * configure.in (AC_OUTPUT): added lyx.spec
9093 * development/lyx.spec: removed file
9095 * development/lyx.spec.in: new file
9097 * po/*.po: merged with lyx.pot becuase of make distcheck
9099 * lib/Makefile.am (dist-hook): added dist-hook so that
9100 documentation files will be included when doing a make
9101 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
9102 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
9104 more: tried to make install do the right thing, exclude CVS dirs
9107 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
9108 Path would fit in more nicely.
9110 * all files that used to use pathstack: uses now Path instead.
9111 This change was a lot easier than expected.
9113 * src/support/path.h: new file
9115 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
9117 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
9119 * src/support/lyxstring.C (getline): Default arg was given for
9122 * Configure.cmd: removed file
9124 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9126 * src/support/DebugStream.[Ch]: remove the explicit std:: before
9127 streams classes and types, add the proper 'using' statements when
9128 MODERN_STL is defined.
9130 * src/debug.h: move the << operator definition after the inclusion
9133 * src/support/filetools.C: include "LAssert.h", which is needed
9136 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
9139 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
9140 include "debug.h" to define a proper ostream.
9142 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9144 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
9145 method to the SystemCall class which can kill a process, but it's
9146 not fully implemented yet.
9148 * src/*.C: Changed Systemcalls::Startscript() to startscript()
9150 * src/support/FileInfo.h: Better documentation
9152 * src/lyxfunc.C: Added support for buffer-export html
9154 * src/menus.C: Added Export->As HTML...
9156 * lib/bind/*.bind: Added short-cut for buffer-export html
9158 * src/lyxrc.*: Added support for new \tth_command
9160 * lib/lyxrc.example: Added stuff for new \tth_command
9162 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9164 * lib/Makefile.am (IMAGES): removed images/README
9165 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
9166 installes in correct place. Check permisions is installed
9169 * src/LaTeX.C: some no-op changes moved declaration of some
9172 * src/LaTeX.h (LATEX_H): changed include guard name
9174 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9176 * lib/reLyX/Makefile.am: install noweb2lyx.
9178 * lib/Makefile.am: install configure.
9180 * lib/reLyX/configure.in: declare a config aux dir; set package
9181 name to lyx (not sure what the best solution is); generate noweb2lyx.
9183 * lib/layouts/egs.layout: fix the bibliography layout.
9185 1999-10-08 Jürgen Vigna <jug@sad.it>
9187 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
9188 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
9189 it returned without continuing to search the path.
9191 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9193 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
9194 also fixes a bug. It is not allowed to do tricks with std::strings
9195 like: string a("hei"); &a[e]; this will not give what you
9196 think... Any reason for the complexity in this func?
9198 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
9200 * Updated README and INSTALL a bit, mostly to check that my
9201 CVS rights are correctly set up.
9203 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9205 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
9206 does not allow '\0' chars but lyxstring and std::string does.
9208 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9210 * autogen.sh (AUTOCONF): let the autogen script create the
9211 POTFILES.in file too. POTFILES.in should perhaps now not be
9212 included in the cvs module.
9214 * some more files changed to use C++ includes instead of C ones.
9216 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
9218 (Reread): added tostr to nlink. buggy output otherwise.
9219 (Reread): added a string() around szMode when assigning to Buffer,
9220 without this I got a log of garbled info strings.
9222 * acconfig.h: commented out the PTR_AS_INT macros. They should not
9225 * I have added several ostream & operator<<(ostream &, some_type)
9226 functions. This has been done to avoid casting and warnings when
9227 outputting enums to lyxerr. This as thus eliminated a lot of
9228 explicit casts and has made the code clearer. Among the enums
9229 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
9230 mathed enums, some font enum the Debug::type enum.
9232 * src/support/lyxstring.h (clear): missing method. equivalent of
9235 * all files that contained "stderr": rewrote constructs that used
9236 stderr to use lyxerr instead. (except bmtable)
9238 * src/support/DebugStream.h (level): and the passed t with
9239 Debug::ANY to avoid spurious bits set.
9241 * src/debug.h (Debug::type value): made it accept strings of the
9244 * configure.in (Check for programs): Added a check for kpsewhich,
9245 the latex generation will use this later to better the dicovery of
9248 * src/BufferView.C (create_view): we don't need to cast this to
9249 (void*) that is done automatically.
9250 (WorkAreaButtonPress): removed some dead code.
9252 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9254 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
9255 is not overwritten when translated (David Sua'rez de Lis).
9257 * lib/CREDITS: Added David Sua'rez de Lis
9259 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
9261 * src/bufferparams.C (BufferParams): default input encoding is now
9264 * acinclude.m4 (cross_compiling): comment out macro
9265 LYX_GXX_STRENGTH_REDUCE.
9267 * acconfig.h: make sure that const is not defined (to empty) when
9268 we are compiling C++. Remove commented out code using SIZEOF_xx
9271 * configure.in : move the test for const and inline as late as
9272 possible so that these C tests do not interefere with C++ ones.
9273 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
9274 has not been proven.
9276 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9278 * src/table.C (getDocBookAlign): remove bad default value for
9281 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
9283 (ShowFileMenu2): ditto.
9285 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
9288 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9290 * Most files: finished the change from the old error code to use
9291 DebugStream for all lyxerr debugging. Only minor changes remain
9292 (e.g. the setting of debug levels using strings instead of number)
9294 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9296 * src/layout.C (Add): Changed to use compare_no_case instead of
9299 * src/FontInfo.C: changed loop variable type too string::size_type.
9301 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9303 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
9304 set ETAGS_ARGS to --c++
9306 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
9308 * src/table.C (DocBookEndOfCell): commented out two unused variables
9310 * src/paragraph.C: commented out four unused variables.
9312 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
9313 insed a if clause with type string::size_type.
9315 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
9318 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
9320 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
9321 variable, also changed loop to go from 0 to lenght + 1, instead of
9322 -1 to length. This should be correct.
9324 * src/LaTeX.C (scanError): use string::size_type as loop variable
9327 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
9328 (l.896) since y_tmp and row was not used anyway.
9330 * src/insets/insetref.C (escape): use string::size_type as loop
9333 * src/insets/insetquotes.C (Width): use string::size_type as loop
9335 (Draw): use string::size_type as loop variable type.
9337 * src/insets/insetlatexaccent.C (checkContents): use
9338 string::size_type as loop variable type.
9340 * src/insets/insetlabel.C (escape): use string::size_type as loop
9343 * src/insets/insetinfo.C: added an extern for current_view.
9345 * src/insets/insetcommand.C (scanCommand): use string::size_type
9346 as loop variable type.
9348 * most files: removed the RCS tags. With them we had to recompile
9349 a lot of files after a simple cvs commit. Also we have never used
9350 them for anything meaningful.
9352 * most files: tags-query-replace NULL 0. As adviced several plases
9353 we now use "0" instead of "NULL" in our code.
9355 * src/support/filetools.C (SpaceLess): use string::size_type as
9358 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9360 * src/paragraph.C: fixed up some more string stuff.
9362 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9364 * src/support/filetools.h: make modestr a std::string.
9366 * src/filetools.C (GetEnv): made ch really const.
9368 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
9369 made code that used these use max/min from <algorithm> instead.
9371 * changed several c library include files to their equivalent c++
9372 library include files. All is not changed yet.
9374 * created a support subdir in src, put lyxstring and lstrings
9375 there + the extra files atexit, fileblock, strerror. Created
9376 Makefile.am. edited configure.in and src/Makefile.am to use this
9377 new subdir. More files moved to support.
9379 * imported som of the functions from repository lyx, filetools
9381 * ran tags-query-replace on LString -> string, corrected the bogus
9382 cases. Tried to make use of lstrings.[hC], debugged a lot. There
9383 is still some errors in there. This is errors where too much or
9384 too litle get deleted from strings (string::erase, string::substr,
9385 string::replace), there can also be some off by one errors, or
9386 just plain wrong use of functions from lstrings. Viewing of quotes
9389 * LyX is now running fairly well with string, but there are
9390 certainly some bugs yet (see above) also string is quite different
9391 from LString among others in that it does not allow null pointers
9392 passed in and will abort if it gets any.
9394 * Added the revtex4 files I forgot when setting up the repository.
9396 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9398 * All over: Tried to clean everything up so that only the files
9399 that we really need are included in the cvs repository.
9400 * Switched to use automake.
9401 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
9402 * Install has not been checked.
9404 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9406 * po/pt.po: Three errors:
9407 l.533 and l.538 format specification error
9408 l. 402 duplicate entry, I just deleted it.