1 2000-08-25 Juergen Vigna <jug@sad.it>
3 * src/LyXAction.C (init): renamed LFUN_TABLE to
4 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
6 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
8 * src/lyxscreen.h: add force_clear variable and fuction to force
9 a clear area when redrawing in LyXText.
11 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
13 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
15 * some whitespace and comment changes.
17 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
19 * src/buffer.C: up te LYX_FORMAT to 2.17
21 2000-08-23 Juergen Vigna <jug@sad.it>
23 * src/BufferView_pimpl.C (tripleClick): disable this when in a
26 * src/insets/insettabular.C (pasteSelection): delete the insets
27 LyXText as it is not valid anymore.
28 (copySelection): new function.
29 (pasteSelection): new function.
30 (cutSelection): new function.
31 (LocalDispatch): implemented cut/copy/paste of cell selections.
33 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
36 * src/LyXAction.C (init): a NEW_TABULAR define too much.
38 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
41 2000-08-22 Juergen Vigna <jug@sad.it>
43 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
44 ifdef form_table out if NEW_TABULAR.
46 2000-08-21 Juergen Vigna <jug@sad.it>
48 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
49 (draw): fixed draw position so that the cursor is positioned in the
51 (InsetMotionNotify): hide/show cursor so the position is updated.
52 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
53 using cellstart() function where it should be used.
55 * src/insets/insettext.C (draw): ditto.
57 * src/tabular.C: fixed initialization of some missing variables and
58 made BoxType into an enum.
60 2000-08-22 Marko Vendelin <markov@ioc.ee>
61 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
62 stock menu item using action numerical value, not its string
66 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
68 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
69 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
71 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
73 * src/frontends/xforms/GUIRunTime.C: new file
75 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
76 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
78 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
80 * src/frontends/kde/GUIRunTime.C: new file
82 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
83 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
85 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
87 * src/frontends/gnome/GUIRunTime.C: new file
89 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
92 * src/frontends/GUIRunTime.h: removed constructor and destructor,
93 small change to documetentation.
95 * src/frontends/GUIRunTime.C: removed file
97 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
99 * src/lyxparagraph.h: enable NEW_TABULAR as default
101 * src/lyxfunc.C (processKeySym): remove some commented code
103 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
104 NEW_TABULAR around the fd_form_table_options.
106 * src/lyx_gui.C (runTime): call the static member function as
107 GUIRunTime::runTime().
109 2000-08-21 Allan Rae <rae@lyx.org>
111 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
114 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
116 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
118 2000-08-21 Allan Rae <rae@lyx.org>
120 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
122 * src/frontends/xforms/FormPreferences.C (build): use setOK
123 * src/frontends/xforms/FormDocument.C (build): use setOK
124 (FormDocument): use the appropriate policy.
126 2000-08-21 Allan Rae <rae@lyx.org>
128 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
129 automatic [de]activation of arbitrary objects when in a read-only state.
131 * src/frontends/ButtonPolicies.h: More documentation
132 (isReadOnly): added to support the above.
134 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
136 2000-08-18 Juergen Vigna <jug@sad.it>
138 * src/insets/insettabular.C (getStatus): changed to return func_status.
140 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
141 display toggle menu entries if they are.
143 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
144 new document layout now.
146 * src/lyxfunc.C: ditto
148 * src/lyx_gui_misc.C: ditto
150 * src/lyx_gui.C: ditto
152 * lib/ui/default.ui: removed paper and quotes layout as they are now
153 all in the document layout tabbed folder.
155 * src/frontends/xforms/forms/form_document.fd: added Restore
156 button and callbacks for all inputs for Allan's ButtonPolicy.
158 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
159 (CheckChoiceClass): added missing params setting on class change.
160 (UpdateLayoutDocument): added for updating the layout on params.
161 (build): forgot to RETURN_ALWAYS input_doc_spacing.
162 (FormDocument): Implemented Allan's ButtonPolicy with the
165 2000-08-17 Allan Rae <rae@lyx.org>
167 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
168 so we can at least see the credits again.
170 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
171 controller calls for the appropriate callbacks. Note that since Ok
172 calls apply followed by cancel, and apply isn't a valid input for the
173 APPLIED state, the bc_ calls have to be made in the static callback not
174 within each of the real callbacks.
176 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
177 (setOk): renamed from setOkay()
179 2000-08-17 Juergen Vigna <jug@sad.it>
181 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
182 in the implementation part.
183 (composeUIInfo): don't show optional menu-items.
185 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
187 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
189 * src/bufferview_funcs.C (CurrentState): fixed to show also the
190 text-state when in a text-inset.
192 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
194 2000-08-17 Marko Vendelin <markov@ioc.ee>
195 * src/frontends/gnome/FormIndex.C
196 * src/frontends/gnome/FormIndex.h
197 * src/frontends/gnome/FormToc.C
198 * src/frontends/gnome/FormToc.h
199 * src/frontends/gnome/dialogs
200 * src/frontends/gnome/diatoc_callbacks.c
201 * src/frontends/gnome/diatoc_callbacks.h
202 * src/frontends/gnome/diainsertindex_callbacks.h
203 * src/frontends/gnome/diainsertindex_callbacks.c
204 * src/frontends/gnome/diainsertindex_interface.c
205 * src/frontends/gnome/diainsertindex_interface.h
206 * src/frontends/gnome/diatoc_interface.h
207 * src/frontends/gnome/diatoc_interface.c
208 * src/frontends/gnome/Makefile.am: Table of Contents and
209 Insert Index dialogs implementation for Gnome frontend
211 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
213 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
215 * src/frontends/gnome/diainserturl_interface.c: make the dialog
218 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
220 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
221 destructor. Don't definde if you don't need it
222 (processEvents): made static, non-blocking events processing for
224 (runTime): static method. event loop for xforms
225 * similar as above for kde and gnome.
227 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
229 (runTime): new method calss the real frontends runtime func.
231 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
233 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
235 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
237 2000-08-16 Juergen Vigna <jug@sad.it>
239 * src/lyx_gui.C (runTime): added GUII RunTime support.
241 * src/frontends/Makefile.am:
242 * src/frontends/GUIRunTime.[Ch]:
243 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
244 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
245 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
247 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
249 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
250 as this is already set in ${FRONTEND_INCLUDE} if needed.
252 * configure.in (CPPFLAGS): setting the include dir for the frontend
253 directory and don't set FRONTEND=xforms for now as this is executed
256 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
258 * src/frontends/kde/Makefile.am:
259 * src/frontends/kde/FormUrl.C:
260 * src/frontends/kde/FormUrl.h:
261 * src/frontends/kde/formurldialog.h:
262 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
264 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
266 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
268 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
270 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
273 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
275 * src/WorkArea.C (work_area_handler): more work to get te
276 FL_KEYBOARD to work with xforms 0.88 too, please test.
278 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
280 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
282 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
285 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
287 * src/Timeout.h: remove Qt::emit hack.
289 * several files: changes to allo doc++ compilation
291 * src/lyxfunc.C (processKeySym): new method
292 (processKeyEvent): comment out if FL_REVISION < 89
294 * src/WorkArea.C: change some debugging levels.
295 (WorkArea): set wantkey to FL_KEY_ALL
296 (work_area_handler): enable the FL_KEYBOARD clause, this enables
297 clearer code and the use of compose with XForms 0.89. Change to
298 use signals instead of calling methods in bufferview directly.
300 * src/Painter.C: change some debugging levels.
302 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
305 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
306 (workAreaKeyPress): new method
308 2000-08-14 Juergen Vigna <jug@sad.it>
310 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
312 * config/kde.m4: addes some features
314 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
315 include missing xforms dialogs.
317 * src/Timeout.h: a hack to be able to compile with qt/kde.
319 * sigc++/.cvsignore: added acinclude.m4
321 * lib/.cvsignore: added listerros
323 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
324 xforms tree as objects are needed for other frontends.
326 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
327 linking with not yet implemented xforms objects.
329 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
331 2000-08-14 Baruch Even <baruch.even@writeme.com>
333 * src/frontends/xforms/FormGraphics.h:
334 * src/frontends/xforms/FormGraphics.C:
335 * src/frontends/xforms/RadioButtonGroup.h:
336 * src/frontends/xforms/RadioButtonGroup.C:
337 * src/insets/insetgraphics.h:
338 * src/insets/insetgraphics.C:
339 * src/insets/insetgraphicsParams.h:
340 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
341 instead of spaces, and various other indentation issues to make the
342 sources more consistent.
344 2000-08-14 Marko Vendelin <markov@ioc.ee>
346 * src/frontends/gnome/dialogs/diaprint.glade
347 * src/frontends/gnome/FormPrint.C
348 * src/frontends/gnome/FormPrint.h
349 * src/frontends/gnome/diaprint_callbacks.c
350 * src/frontends/gnome/diaprint_callbacks.h
351 * src/frontends/gnome/diaprint_interface.c
352 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
355 * src/frontends/gnome/dialogs/diainserturl.glade
356 * src/frontends/gnome/FormUrl.C
357 * src/frontends/gnome/FormUrl.h
358 * src/frontends/gnome/diainserturl_callbacks.c
359 * src/frontends/gnome/diainserturl_callbacks.h
360 * src/frontends/gnome/diainserturl_interface.c
361 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
364 * src/frontends/gnome/Dialogs.C
365 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
366 all other dialogs. Copy all unimplemented dialogs from Xforms
369 * src/frontends/gnome/support.c
370 * src/frontends/gnome/support.h: support files generated by Glade
374 * config/gnome.m4: Gnome configuration scripts
376 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
377 configure --help message
379 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
380 only if there are no events pendling in Gnome/Gtk. This enhances
381 the performance of menus.
384 2000-08-14 Allan Rae <rae@lyx.org>
386 * lib/Makefile.am: listerrors cleaning
388 * lib/listerrors: removed -- generated file
389 * acinclude.m4: ditto
390 * sigc++/acinclude.m4: ditto
392 * src/frontends/xforms/forms/form_citation.fd:
393 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
396 * src/frontends/xforms/forms/makefile: I renamed the `install` target
397 `updatesrc` and now we have a `test` target that does what `updatesrc`
398 used to do. I didn't like having an install target that wasn't related
401 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
402 on all except FormGraphics. This may yet happen. Followed by a major
403 cleanup including using FL_TRANSIENT for most of the dialogs. More
404 changes to come when the ButtonController below is introduced.
406 * src/frontends/xforms/ButtonController.h: New file for managing up to
407 four buttons on a dialog according to an externally defined policy.
408 * src/frontends/xforms/Makefile.am: added above
410 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
411 Apply and Cancel/Close buttons and everything in between and beyond.
412 * src/frontends/Makefile.am: added above.
414 * src/frontends/xforms/forms/form_preferences.fd:
415 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
416 and removed variable 'status' as a result. Fixed the set_minsize thing.
417 Use the new screen-font-update after checking screen fonts were changed
418 Added a "Restore" button to restore the original lyxrc values while
419 editing. This restores everything not just the last input changed.
420 That's still a tricky one. As is the "LyX: this shouldn't happen..."
422 * src/LyXAction.C: screen-font-update added for updating buffers after
423 screen font settings have been changed.
424 * src/commandtags.h: ditto
425 * src/lyxfunc.C: ditto
427 * forms/lyx.fd: removed screen fonts dialog.
428 * src/lyx_gui.C: ditto
429 * src/menus.[Ch]: ditto
430 * src/lyx.[Ch]: ditto
431 * src/lyx_cb.C: ditto + code from here moved to make
432 screen-font-update. And people wonder why progress on GUII is
433 slow. Look at how scattered this stuff was! It takes forever
436 * forms/fdfix.sh: Fixup the spacing after commas.
437 * forms/makefile: Remove date from generated files. Fewer clashes now.
438 * forms/bullet_forms.C.patch: included someones handwritten changes
440 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
441 once I've discovered why LyXRC was made noncopyable.
442 * src/lyx_main.C: ditto
444 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
446 * src/frontends/xforms/forms/fdfix.sh:
447 * src/frontends/xforms/forms/fdfixh.sed:
448 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
449 * src/frontends/xforms/Form*.[hC]:
450 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
451 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
452 provide a destructor for the struct FD_form_xxxx. Another version of
453 the set_[max|min]size workaround and a few other cleanups. Actually,
454 Angus' patch from 20000809.
456 2000-08-13 Baruch Even <baruch.even@writeme.com>
458 * src/insets/insetgraphics.C (Clone): Added several fields that needed
461 2000-08-11 Juergen Vigna <jug@sad.it>
463 * src/insets/insetgraphics.C (InsetGraphics): changing init
464 order because of warnings.
466 * src/frontends/xforms/forms/makefile: adding patching .C with
469 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
470 from .C.patch to .c.patch
472 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
473 order because of warning.
475 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
477 * src/frontends/Liason.C (setMinibuffer): new helper function
479 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
481 * src/lyxfunc.C (Dispatch): calling new Document-Layout
483 * lib/ui/default.ui: commented out PaperLayout entry
485 * src/frontends/xforms/form_document.[Ch]: new added files
487 * src/frontends/xforms/FormDocument.[Ch]: ditto
489 * src/frontends/xforms/forms/form_document.fd: ditto
491 * src/frontends/xforms/forms/form_document.C.patch: ditto
493 2000-08-10 Juergen Vigna <jug@sad.it>
495 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
496 (InsetGraphics): initialized cacheHandle to 0.
497 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
499 2000-08-10 Baruch Even <baruch.even@writeme.com>
501 * src/graphics/GraphicsCache.h:
502 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
503 correctly as a cache.
505 * src/graphics/GraphicsCacheItem.h:
506 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
509 * src/graphics/GraphicsCacheItem_pimpl.h:
510 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
513 * src/insets/insetgraphics.h:
514 * src/insets/insetgraphics.C: Changed from using a signal notification
515 to polling when image is not loaded.
517 2000-08-10 Allan Rae <rae@lyx.org>
519 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
520 that there are two functions that have to been taken out of line by
521 hand and aren't taken care of in the script. (Just a reminder note)
523 * sigc++/macros/*.h.m4: Updated as above.
525 2000-08-09 Juergen Vigna <jug@sad.it>
527 * src/insets/insettext.C (draw): small fix for clearing rectangle.
529 * src/insets/insettabular.C: make drawing of single cell smarter.
531 2000-08-09 Marko Vendelin <markov@ioc.ee>
532 * src/frontends/gnome/Menubar_pimpl.C
533 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
534 implementation: new files
536 * src/frontends/gnome/mainapp.C
537 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
540 * src/main.C: create Gnome main window
542 * src/frontends/xforms/Menubar_pimpl.h
543 * src/frontends/Menubar.C
544 * src/frontends/Menubar.h: added method Menubar::update that calls
545 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
547 * src/LyXView.C: calls Menubar::update to update the state
550 * src/frontends/gnome/Makefile.am: added new files
552 * src/frontends/Makefile.am: added frontend compiler options
554 2000-08-08 Juergen Vigna <jug@sad.it>
556 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
558 * src/bufferlist.C (close):
559 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
560 documents if exiting without saving.
562 * src/buffer.C (save): use removeAutosaveFile()
564 * src/support/filetools.C (removeAutosaveFile): new function.
566 * src/lyx_cb.C (MenuWrite): returns a bool now.
567 (MenuWriteAs): check if file could really be saved and revert to the
569 (MenuWriteAs): removing old autosavefile if existant.
571 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
572 before Goto toggle declaration, because of compiler warning.
574 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
576 * src/lyxfunc.C (MenuNew): small fix.
578 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
580 * src/bufferlist.C (newFile):
581 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
583 * src/lyxrc.C: added new_ask_filename tag
585 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
587 * src/lyx.fd: removed code pertaining to form_ref
588 * src/lyx.[Ch]: ditto
589 * src/lyx_cb.C: ditto
590 * src/lyx_gui.C: ditto
591 * src/lyx_gui_misc.C: ditto
593 * src/BufferView_pimpl.C (restorePosition): update buffer only
596 * src/commandtags.h (LFUN_REFTOGGLE): removed
597 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
598 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
599 (LFUN_REFBACK): renamed LFUN_REF_BACK
601 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
603 * src/lyxfunc.C (Dispatch): ditto.
604 InsertRef dialog is now GUI-independent.
606 * src/texrow.C: added using std::endl;
608 * src/insets/insetref.[Ch]: strip out large amounts of code.
609 The inset is now a container and this functionality is now
610 managed by a new FormRef dialog
612 * src/frontends/Dialogs.h (showRef, createRef): new signals
614 * src/frontends/xforms/FormIndex.[Ch],
615 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
616 when setting dialog's min/max size
617 * src/frontends/xforms/FormIndex.[Ch]: ditto
619 * src/frontends/xforms/FormRef.[Ch],
620 src/frontends/xforms/forms/form_ref.fd: new xforms
621 implementation of an InsetRef dialog
623 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
626 * src/graphics/XPM_Renderer.C (isImageFormatOK):
627 ios::nocreate is not part of the standard. Removed.
629 2000-08-07 Baruch Even <baruch.even@writeme.com>
631 * src/graphics/Renderer.h:
632 * src/graphics/Renderer.C: Added base class for rendering of different
633 image formats into Pixmaps.
635 * src/graphics/XPM_Renderer.h:
636 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
637 in a different class.
639 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
640 easily add support for other formats.
642 * src/insets/figinset.C: plugged a leak of an X resource.
644 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
646 * src/CutAndPaste.[Ch]: make all metods static.
648 * development/Code_rules/Rules: more work, added section on
649 Exceptions, and a References section.
651 * a lot of header files: work to make doc++ able to generate the
652 source documentation, some workarounds of doc++ problems. Doc++ is
653 now able to generate the documentation.
655 2000-08-07 Juergen Vigna <jug@sad.it>
657 * src/insets/insettabular.C (recomputeTextInsets): removed function
659 * src/tabular.C (SetWidthOfMulticolCell):
661 (calculate_width_of_column_NMC): fixed return value so that it really
662 only returns true if the column-width has changed (there where
663 problems with muliticolumn-cells in this column).
665 2000-08-04 Juergen Vigna <jug@sad.it>
667 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
668 also on the scrollstatus of the inset.
669 (workAreaMotionNotify): ditto.
671 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
673 2000-08-01 Juergen Vigna <jug@sad.it>
675 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
678 * src/LyXAction.C (init):
679 * src/insets/inset.C (LocalDispatch): added support for
682 * src/insets/inset.C (scroll): new functions.
684 * src/insets/insettext.C (removeNewlines): new function.
685 (SetAutoBreakRows): removes forced newlines in the text of the
686 paragraph if autoBreakRows is set to false.
688 * src/tabular.C (Latex): generates a parbox around the cell contents
691 * src/frontends/xforms/FormTabular.C (local_update): removed
692 the radio_useparbox button.
694 * src/tabular.C (UseParbox): new function
696 2000-08-06 Baruch Even <baruch.even@writeme.com>
698 * src/graphics/GraphicsCache.h:
699 * src/graphics/GraphicsCache.C:
700 * src/graphics/GraphicsCacheItem.h:
701 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
704 * src/insets/insetgraphics.h:
705 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
706 drawing of the inline image.
708 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
709 into the wrong position.
711 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
714 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
716 * src/support/translator.h: move all typedefs to public section
718 * src/support/filetools.C (MakeLatexName): return string const
721 (FileOpenSearch): ditto
723 (LibFileSearch): ditto
724 (i18nLibFileSearch): ditto
727 (CreateTmpDir): ditto
728 (CreateBufferTmpDir): ditto
729 (CreateLyXTmpDir): ditto
734 (OnlyFilename): ditto
736 (NormalizePath): ditto
738 (GetFileContents): ditto
739 (ReplaceEnvironmentPath): ditto
742 (ChangeExtension): ditto
743 (MakeDisplayPath): ditto
744 (do_popen): return cmdret const
745 (findtexfile): return string const
747 * src/support/DebugStream.h: add some /// to please doc++
749 * src/frontends/DialogBase.h (endif): add some /// to please doc++
751 * src/texrow.C (same_rownumber): functor to use with find_if
752 (getIdFromRow): rewritten to use find_if and to not update the
753 positions. return true if row is found
754 (increasePos): new method, use to update positions
756 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
758 * src/lyxlex_pimpl.C (verifyTable): new method
761 (GetString): return string const
762 (pushTable): rewrite to use std::stack
764 (setFile): better check
767 * src/lyxlex.h: make LyXLex noncopyable
769 * src/lyxlex.C (text): return char const * const
770 (GetString): return string const
771 (getLongString): return string const
773 * src/lyx_gui_misc.C (askForText): return pair<...> const
775 * src/lastfiles.[Ch] (operator): return string const
777 * src/buffer.C (parseSingleLyXformat2Token): pass string to
778 istringstream not char const *.
779 move token.end() out of loop.
780 (readFile): move initializaton of token
782 * src/BufferView2.C (insertErrors): run texrow.increasePos if
783 getIdFromRow is successful.
785 * lib/bind/emacs.bind: don't include menus bind
787 * development/Code_rules/Rules: the beginnings of making this
788 better and covering more of the unwritten rules that we have.
790 * development/Code_rules/Recommendations: a couple of wording
793 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
795 * src/support/strerror.c: remove C++ comment.
797 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
799 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
800 LFUN_INDEX_INSERT_LAST
802 * src/texrow.C (getIdFromRow): changed from const_iterator to
803 iterator, allowing code to compile with DEC cxx
805 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
806 stores part of the class, as suggested by Allan. Will allow
808 (apply): test to apply uses InsetCommandParams operator!=
810 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
811 (apply): test to apply uses InsetCommandParams operator!=
813 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
814 stores part of the class.
815 (update): removed limits on min/max size.
817 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
818 (apply): test to apply uses InsetCommandParams operator!=
820 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
821 (Read, Write, scanCommand, getCommand): moved functionality
822 into InsetCommandParams.
824 (getScreenLabel): made pure virtual
825 new InsetCommandParams operators== and !=
827 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
828 c-tors based on InsetCommandParams. Removed others.
829 * src/insets/insetinclude.[Ch]: ditto
830 * src/insets/insetlabel.[Ch]: ditto
831 * src/insets/insetparent.[Ch]: ditto
832 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
834 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
835 insets derived from InsetCommand created using similar c-tors
836 based on InsetCommandParams
837 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
838 * src/menus.C (ShowRefsMenu): ditto
839 * src/paragraph.C (Clone): ditto
840 * src/text2.C (SetCounter): ditto
841 * src/lyxfunc.C (Dispatch) ditto
842 Also recreated old InsetIndex behaviour exactly. Can now
843 index-insert at the start of a paragraph and index-insert-last
844 without launching the pop-up.
846 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
848 * lib/lyxrc.example: mark te pdf options as non functional.
850 * src/support/lstrings.C (strToInt): move initalization of tmpstr
851 (isStrDbl): move tmpstr.end() out of loop.
852 (strToDbl): move intialization of tmpstr
853 (lowercase): return string const and move tmp.end() out of loop.
854 (uppercase): return string const and move tmp.edn() out of loop.
855 (prefixIs): add assertion
860 (containsOnly): ditto
861 (containsOnly): ditto
862 (containsOnly): ditto
863 (countChar): make last arg char not char const
864 (token): return string const
865 (subst): return string const, move tmp.end() out of loop.
866 (subst): return string const, add assertion
867 (strip): return string const
868 (frontStrip): return string const, add assertion
869 (frontStrip): return string const
874 * src/support/lstrings.C: add inclde "LAssert.h"
875 (isStrInt): move tmpstr.end() out of loop.
877 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
878 toollist.end() out of loop.
879 (deactivate): move toollist.end() out of loop.
880 (update): move toollist.end() out of loop.
881 (updateLayoutList): move tc.end() out of loop.
882 (add): move toollist.end() out of loop.
884 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
885 md.end() out of loop.
887 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
889 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
892 * src/paragraph.C (Erase): move fontlist.end() out of loop.
893 (Erase): move insetlist.end() out of loop.
895 * src/lyx_sendfax_main.C: make show_logfile static and to take a
896 ref to const string as first arg. Move initialization of some
897 variables, whitespace changes.
899 * src/kbmap.C (defkey): move table.end() out of loop.
900 (kb_keymap): move table.end() out of loop.
901 (findbinding): move table.end() out of loop.
903 * src/MenuBackend.C (hasMenu): move end() out of loop.
904 (getMenu): move end() out of loop.
905 (getMenu): move menulist_.end() out of loop.
907 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
909 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
912 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
913 (getFromLyXName): move infotab.end() out of loop.
915 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
916 -fvtable-thunks -ffunction-sections -fdata-sections
918 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
920 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
923 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
925 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
927 * src/frontends/xforms/FormCitation.[Ch],
928 src/frontends/xforms/FormIndex.[Ch],
929 src/frontends/xforms/FormToc.[Ch],
930 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
932 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
934 * src/commandtags.h: renamed, created some flags for citation
937 * src/lyx_gui_misc.C: stripped out old FD_index_form code
939 * src/lyxfunc.C (dispatch): use signals to insert index entry
941 * src/frontends/Dialogs.h: new signal createIndex
943 * src/frontends/xforms/FormCommand.[Ch],
944 src/frontends/xforms/FormCitation.[Ch],
945 src/frontends/xforms/FormToc.[Ch],
946 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
948 * src/insets/insetindex.[Ch]: GUI-independent
950 * src/frontends/xforms/FormIndex.[Ch],
951 * src/frontends/xforms/forms/form_index.fd: xforms implementation
954 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
956 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
957 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
959 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
961 * src/insets/insetref.C (Latex): rewrite so that there is now
962 question that a initialization is requested.
964 * src/insets/insetcommand.h: reenable the hide signal
966 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
968 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
969 fix handling of shortcuts (many bugs :)
970 (add_lastfiles): ditto.
972 * lib/ui/default.ui: fix a few shortcuts.
974 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
976 * Makefile.am: Fix ``rpmdist'' target to return the exit
977 status of the ``rpm'' command, instead of the last command in
978 the chain (the ``rm lyx.xpm'' command, which always returns
981 2000-08-02 Allan Rae <rae@lyx.org>
983 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
984 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
985 * src/frontends/xforms/FormToc.C (FormToc): ditto
987 * src/frontends/xforms/Makefile.am: A few forgotten files
989 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
990 Signals-not-copyable-problem Lars' started commenting out.
992 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
994 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
996 * src/insets/insetcommand.h: Signals is not copyable so anoter
997 scheme for automatic hiding of forms must be used.
999 * src/frontends/xforms/FormCitation.h: don't inerit from
1000 noncopyable, FormCommand already does that.
1001 * src/frontends/xforms/FormToc.h: ditto
1002 * src/frontends/xforms/FormUrl.h: ditto
1004 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1006 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
1008 * src/insets/insetcommand.h (hide): new SigC::Signal0
1009 (d-tor) new virtual destructor emits hide signal
1011 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
1012 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
1014 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
1015 LOF and LOT. Inset is now GUI-independent
1017 * src/insets/insetloa.[Ch]: redundant
1018 * src/insets/insetlof.[Ch]: ditto
1019 * src/insets/insetlot.[Ch]: ditto
1021 * src/frontends/xforms/forms/form_url.fd: tweaked!
1022 * src/frontends/xforms/forms/form_citation.fd: ditto
1024 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
1025 dialogs dealing with InsetCommand insets
1027 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
1028 FormCommand base class
1029 * src/frontends/xforms/FormUrl.[Ch]: ditto
1031 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
1033 * src/frontends/xforms/FormToc.[Ch]: ditto
1035 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
1036 passed a generic InsetCommand pointer
1037 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
1039 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
1040 and modified InsetTOC class
1041 * src/buffer.C: ditto
1043 * forms/lyx.fd: strip out old FD_form_toc code
1044 * src/lyx_gui_misc.C: ditto
1045 * src/lyx_gui.C: ditto
1046 * src/lyx_cb.C: ditto
1047 * src/lyx.[Ch]: ditto
1049 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1051 * src/support/utility.hpp: tr -d '\r'
1053 2000-08-01 Juergen Vigna <jug@sad.it>
1055 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
1057 * src/commandtags.h:
1058 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
1059 LFUN_TABULAR_FEATURES.
1061 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
1062 LFUN_LAYOUT_TABULAR.
1064 * src/insets/insettabular.C (getStatus): implemented helper function.
1066 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
1068 2000-07-31 Juergen Vigna <jug@sad.it>
1070 * src/text.C (draw): fixed screen update problem for text-insets.
1072 * src/text2.C (SetParagrpah): call an update of the inset-owner when
1073 something changed probably this has to be added in various other
1076 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
1078 2000-07-31 Baruch Even <baruch.even@writeme.com>
1080 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
1081 templates to satisfy compaq cxx.
1084 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1086 * src/support/translator.h (equal_1st_in_pair::operator()): take
1087 const ref pair_type as arg.
1088 (equal_2nd_in_pair::operator()): ditto
1089 (Translator::~Translator): remove empty d-tor.
1091 * src/graphics/GraphicsCache.C: move include config.h to top, also
1092 put initialization of GraphicsCache::singleton here.
1093 (~GraphicsCache): move here
1094 (addFile): take const ref as arg
1097 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
1099 * src/BufferView2.C (insertLyXFile): change te with/without header
1102 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1104 * src/frontends/xforms/FormGraphics.C (apply): add some
1105 static_cast. Not very nice, but required by compaq cxx.
1107 * src/frontends/xforms/RadioButtonGroup.h: include header
1108 <utility> instead of <pair.h>
1110 * src/insets/insetgraphicsParams.C: add using directive.
1111 (readResize): change return type to void.
1112 (readOrigin): ditto.
1114 * src/lyxfunc.C (getStatus): add missing break for build-program
1115 function; add test for Literate for export functions.
1117 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
1118 entries in Options menu.
1120 2000-07-31 Baruch Even <baruch.even@writeme.com>
1122 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
1123 protect against auto-allocation; release icon when needed.
1125 2000-07-31 Matej Cepl <CeplM@seznam.cz>
1127 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
1128 on usual typewriter.
1130 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
1131 earlier czech.kmap), useful only for programming.
1133 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1135 * src/frontends/xforms/FormCitation.h: fix conditioning around
1138 2000-07-31 Juergen Vigna <jug@sad.it>
1140 * src/frontends/xforms/FormTabular.C (local_update): changed
1141 radio_linebreaks to radio_useparbox and added radio_useminipage.
1143 * src/tabular.C: made support for using minipages/parboxes.
1145 * src/bufferlist.C (QwriteAll): small fix for asking for save.
1147 * src/insets/insetgraphics.C (draw): just draw the inset so that the
1149 (descent): so the cursor is in the middle.
1150 (width): bit smaller box.
1152 * src/insets/insetgraphics.h: added display() function.
1154 2000-07-31 Baruch Even <baruch.even@writeme.com>
1156 * src/frontends/Dialogs.h: Added showGraphics signals.
1158 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
1159 xforms form definition of the graphics dialog.
1161 * src/frontends/xforms/FormGraphics.h:
1162 * src/frontends/xforms/FormGraphics.C: Added files, the
1163 GUIndependent code of InsetGraphics
1165 * src/insets/insetgraphics.h:
1166 * src/insets/insetgraphics.C: Major writing to make it work.
1168 * src/insets/insetgraphicsParams.h:
1169 * src/insets/insetgraphicsParams.C: Added files, parameter passing
1170 struct between InsetGraphics and GUI.
1172 * src/LaTeXFeatures.h:
1173 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
1174 support for graphicx package.
1176 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
1177 for the graphics inset.
1179 * src/support/translator.h: Added file, used in
1180 InsetGraphicsParams. this is a template to translate between two
1183 * src/frontends/xforms/RadioButtonGroup.h:
1184 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
1185 way to easily control a radio button group.
1187 2000-07-28 Juergen Vigna <jug@sad.it>
1189 * src/insets/insettabular.C (LocalDispatch):
1190 (TabularFeatures): added support for lyx-functions of tabular features.
1191 (cellstart): refixed this function after someone wrongly changed it.
1193 * src/commandtags.h:
1194 * src/LyXAction.C (init): added support for tabular-features
1196 2000-07-28 Allan Rae <rae@lyx.org>
1198 * src/frontends/xforms/FormPreferences.C (build): Setup input return
1199 checking. NOTE: It seems that pressing ESC to cancel the dialog also
1200 triggers the callback for input checking. As a result we sometimes get
1201 "LyX: This shouldn't happen..." printed to cerr.
1202 (input): Started using status variable since I only free() on
1203 destruction. Some input checking for paths and font sizes.
1205 * src/frontends/xforms/FormPreferences.h: Use status to control
1206 activation of Ok and Apply
1208 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
1209 callback. Also resized to stop segfaults with 0.88. The problem is
1210 that xforms-0.88 requires the folder to be wide enough to fit all the
1211 tabs. If it isn't it causes all sorts of problems.
1213 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
1215 * src/frontends/xforms/forms/README: Reflect reality.
1217 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
1218 * src/frontends/xforms/forms/makefile: ditto.
1220 * src/commandtags.h: Get access to new Preferences dialog
1221 * src/LyXAction.C: ditto
1222 * src/lyxfunc.C: ditto
1223 * lib/ui/default.ui: ditto
1225 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1227 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
1229 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
1232 * src/frontends/xforms/form_url.[Ch]: added.
1234 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1236 * src/insets/insetbib.h: fixed bug in previous commit
1238 * src/frontends/xforms/FormUrl.h: ditto
1240 * src/frontends/xforms/FormPrint.h: ditto
1242 * src/frontends/xforms/FormPreferences.h: ditto
1244 * src/frontends/xforms/FormCopyright.h: ditto
1246 * src/frontends/xforms/FormCitation.C: ditto
1248 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
1249 private copyconstructor and private default contructor
1251 * src/support/Makefile.am: add utility.hpp
1253 * src/support/utility.hpp: new file from boost
1255 * src/insets/insetbib.h: set owner in clone
1257 * src/frontends/xforms/FormCitation.C: added missing include
1260 * src/insets/form_url.[Ch]: removed
1262 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
1264 * development/lyx.spec.in
1265 * Makefile.am: Fix buglet for LyX RPM generation resulting from
1266 file/directory re-organization.
1268 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
1270 * src/insets/insetcommand.[Ch]: moved the string data and
1271 associated manipulation methods into a new stand-alone class
1272 InsetCommandParams. This class has two additional methods
1273 getAsString() and setFromString() allowing the contents to be
1274 moved around as a single string.
1275 (addContents) method removed.
1276 (setContents) method no longer virtual.
1278 * src/buffer.C (readInset): made use of new InsetCitation,
1279 InsetUrl constructors based on InsetCommandParams.
1281 * src/commandtags.h: add LFUN_INSERT_URL
1283 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
1284 independent InsetUrl and use InsetCommandParams to extract
1285 string info and create new Insets.
1287 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
1289 * src/frontends/xforms/FormCitation.C (apply): uses
1292 * src/frontends/xforms/form_url.C
1293 * src/frontends/xforms/form_url.h
1294 * src/frontends/xforms/FormUrl.h
1295 * src/frontends/xforms/FormUrl.C
1296 * src/frontends/xforms/forms/form_url.fd: new files
1298 * src/insets/insetcite.[Ch]: removed unused constructors.
1300 * src/insets/insetinclude.[Ch]: no longer store filename
1302 * src/insets/inseturl.[Ch]: GUI-independent.
1304 2000-07-26 Juergen Vigna <jug@sad.it>
1305 * renamed frontend from gtk to gnome as it is that what is realized
1306 and did the necessary changes in the files.
1308 2000-07-26 Marko Vendelin <markov@ioc.ee>
1310 * configure.in: cleaning up gnome configuration scripts
1312 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1314 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
1315 shortcuts syndrom by redrawing them explicitely (a better solution
1316 would be appreciated).
1318 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
1320 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
1323 * src/lyx_cb.C (MenuExport): change html export to do the right
1324 thing depending of the document type (instead of having
1325 html-linuxdoc and html-docbook).
1326 * src/lyxfunc.C (getStatus): update for html
1327 * lib/ui/default.ui: simplify due to the above change.
1328 * src/menus.C (ShowFileMenu): update too (in case we need it).
1330 * src/MenuBackend.C (read): if a menu is defined twice, add the
1331 new entries to the exiting one.
1333 2000-07-26 Juergen Vigna <jug@sad.it>
1335 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
1337 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
1338 and return a bool if it did actual save the file.
1339 (AutoSave): don't autosave a unnamed doc.
1341 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
1342 check if this is an UNNAMED new file and react to it.
1343 (newFile): set buffer to unnamed and change to not mark a new
1344 buffer dirty if I didn't do anything with it.
1346 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
1348 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1350 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
1351 friend as per Angus's patch posted to lyx-devel.
1353 * src/ext_l10n.h: updated
1355 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
1356 gettext on the style string right before inserting them into the
1359 * autogen.sh: add code to extract style strings form layout files,
1360 not good enough yet.
1362 * src/frontends/gtk/.cvsignore: add MAKEFILE
1364 * src/MenuBackend.C (read): run the label strings through gettext
1365 before storing them in the containers.
1367 * src/ext_l10n.h: new file
1369 * autogen.sh : generate the ext_l10n.h file here
1371 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1373 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
1376 * lib/ui/default.ui: fix a couple of typos.
1378 * config/gnome/gtk.m4: added (and added to the list of files in
1381 * src/insets/insetinclude.C (unique_id): fix when we are using
1382 lyxstring instead of basic_string<>.
1383 * src/insets/insettext.C (LocalDispatch): ditto.
1384 * src/support/filetools.C: ditto.
1386 * lib/configure.m4: create the ui/ directory if necessary.
1388 * src/LyXView.[Ch] (updateToolbar): new method.
1390 * src/BufferView_pimpl.C (buffer): update the toolbar when
1391 opening/closing buffer.
1393 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1395 * src/LyXAction.C (getActionName): enhance to return also the name
1396 and options of pseudo-actions.
1397 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
1399 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
1400 as an example of what is possible). Used in File->Build too (more
1401 useful) and in the import/export menus (to mimick the complicated
1402 handling of linuxdoc and friends). Try to update all the entries.
1404 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
1407 * src/MenuBackend.C (read): Parse the new OptItem tag.
1409 * src/MenuBackend.h: Add a new optional_ data member (used if the
1410 entry should be omitted when the lyxfunc is disabled).
1412 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
1413 function, used as a shortcut.
1414 (create_submenu): align correctly the shortcuts on the widest
1417 * src/MenuBackend.h: MenuItem.label() only returns the label of
1418 the menu without shortcut; new method shortcut().
1420 2000-07-14 Marko Vendelin <markov@ioc.ee>
1422 * src/frontends/gtk/Dialogs.C:
1423 * src/frontends/gtk/FormCopyright.C:
1424 * src/frontends/gtk/FormCopyright.h:
1425 * src/frontends/gtk/Makefile.am: added these source-files for the
1426 Gtk/Gnome support of the Copyright-Dialog.
1428 * src/main.C: added Gnome::Main initialization if using
1429 Gtk/Gnome frontend-GUI.
1431 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
1433 * config/gnome/aclocal-include.m4
1434 * config/gnome/compiler-flags.m4
1435 * config/gnome/curses.m4
1436 * config/gnome/gnome--.m4
1437 * config/gnome/gnome-bonobo-check.m4
1438 * config/gnome/gnome-common.m4
1439 * config/gnome/gnome-fileutils.m4
1440 * config/gnome/gnome-ghttp-check.m4
1441 * config/gnome/gnome-gnorba-check.m4
1442 * config/gnome/gnome-guile-checks.m4
1443 * config/gnome/gnome-libgtop-check.m4
1444 * config/gnome/gnome-objc-checks.m4
1445 * config/gnome/gnome-orbit-check.m4
1446 * config/gnome/gnome-print-check.m4
1447 * config/gnome/gnome-pthread-check.m4
1448 * config/gnome/gnome-support.m4
1449 * config/gnome/gnome-undelfs.m4
1450 * config/gnome/gnome-vfs.m4
1451 * config/gnome/gnome-x-checks.m4
1452 * config/gnome/gnome-xml-check.m4
1453 * config/gnome/gnome.m4
1454 * config/gnome/gperf-check.m4
1455 * config/gnome/gtk--.m4
1456 * config/gnome/linger.m4
1457 * config/gnome/need-declaration.m4: added configuration scripts
1458 for Gtk/Gnome frontend-GUI
1460 * configure.in: added support for the --with-frontend=gtk option
1462 * autogen.sh: added config/gnome/* to list of config-files
1464 * acconfig.h: added define for GTKGUI-support
1466 * config/lyxinclude.m4: added --with-frontend[=value] option value
1467 for Gtk/Gnome frontend-GUI support.
1469 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1471 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
1475 * src/paragraph.C (GetChar): remove non-const version
1477 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
1478 (search_kw): use it.
1480 * src/lyx_main.C (init): if "preferences" exist, read that instead
1482 (ReadRcFile): return bool if the file could be read ok.
1483 (ReadUIFile): add a check to see if lex file is set ok.
1485 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
1486 bastring can be used instead of lyxstring (still uses the old code
1487 if std::string is good enough or if lyxstring is used.)
1489 * src/encoding.C: make the arrays static, move ininle functions
1491 * src/encoding.h: from here.
1493 * src/buffer.C: have last_isnet_read as a file scope variable for now.
1494 (parseSingleLyXformat2Token): move inset parsing to separate method
1495 (readInset): new private method
1497 * src/Variables.h: remove virtual from get().
1499 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
1500 access to NEW_INSETS and NEW_TABULAR
1502 * src/MenuBackend.h: remove superfluous forward declaration of
1503 MenuItem. Add documentations tags "///", remove empty MenuItem
1504 destructor, remove private default contructor.
1506 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
1508 (read): more string mlabel and mname to where they are used
1509 (read): remove unused variables mlabel and mname
1510 (defaults): unconditional clear, make menusetup take advantage of
1511 add returning Menu &.
1513 * src/LyXView.h: define NEW_MENUBAR as default
1515 * src/LyXAction.C: include lyxparagraph.h temporary to get access
1516 to NEW_INSETS and NEW_TABULAR.
1517 (init): commetn out some funcs that is obsolete when NEW_INSETS is
1518 defined. Change some of the "xxxx-inset-insert" functions names to
1521 * several files: more enahncements to NEW_INSETS and the resulting
1524 * lib/lyxrc.example (\date_insert_format): move to misc section
1526 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
1527 bastring and use AC_CACHE_CHECK.
1528 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
1529 the system have the newest methods. uses AC_CACHE_CHECK
1530 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
1531 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
1532 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
1534 * configure.in: add LYX_CXX_GOOD_STD_STRING
1536 * acinclude.m4: recreated
1538 2000-07-24 Amir Karger
1540 * README: add Hebrew, Arabic kmaps
1543 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1545 * src/buffer.C (writeFileAscii): Define actcell as an int instead
1548 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1550 * Lot of files: add pragma interface/implementation.
1552 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
1554 * lib/ui/default.ui: new file (ans new directory). Contains the
1555 default menu and toolbar.
1557 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
1558 global space. Toolbars are now read (as menus) in ui files.
1560 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
1562 * src/lyxfunc.C (getStatus): do not exit immediately if a command
1563 is disabled because the document is read-only. We want to have the
1564 toggle state of the function anyway.
1565 (getStatus): add code for LFUN_VC* functions (mimicking what is
1566 done in old-style menus)
1568 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
1569 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
1571 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
1572 * src/BufferView_pimpl.C: ditto.
1573 * src/lyxfunc.C: ditto.
1575 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
1576 default). This replaces old-style menus by new ones.
1578 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
1579 MenuItem. Contain the data structure of a menu.
1581 * src/insets/insettext.C: use LyXView::setLayout instead of
1582 accessing directly the toolbar combox.
1583 * src/lyxfunc.C (Dispatch): ditto.
1585 * src/LyXView.C (setLayout): new method, which just calls
1586 Toolbar::setLayout().
1587 (updateLayoutChoice): move part of this method in Toolbar.
1589 * src/toolbar.[Ch]: removed.
1591 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
1592 implementation the toolbar.
1594 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
1595 the toolbar. It might make sense to merge it with ToolbarDefaults
1597 (setLayout): new function.
1598 (updateLayoutList): ditto.
1599 (openLayoutList): ditto.
1601 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
1602 xforms implementation of the toolbar.
1603 (get_toolbar_func): comment out, since I do not
1604 know what it is good for.
1606 * src/ToolbarDefaults.h: Add the ItemType enum.
1608 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
1609 for a list of allocated C strings. Used in Menubar xforms
1610 implementation to avoid memory leaks.
1612 * src/support/lstrings.[Ch] (uppercase): new version taking and
1616 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
1617 * lib/bind/emacs.bind: ditto.
1619 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
1621 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
1622 forward decl of LyXView.
1624 * src/toolbar.C (toolbarItem): moved from toolbar.h
1625 (toolbarItem::clean): ditto
1626 (toolbarItem::~toolbarItem): ditto
1627 (toolbarItem::operator): ditto
1629 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
1631 * src/paragraph.h: control the NEW_TABULAR define from here
1633 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
1634 USE_TABULAR_INSETS to NEW_TABULAR
1636 * src/ToolbarDefaults.C: add include "lyxlex.h"
1638 * files using the old table/tabular: use NEW_TABULAR to control
1639 compilation of old tabular stuff.
1641 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
1644 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
1645 planemet in reading of old style floats, fix the \end_deeper
1646 problem when reading old style floats.
1648 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1650 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
1652 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
1654 * lib/bind/sciword.bind: updated.
1656 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1658 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
1659 layout write problem
1661 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1663 * src/Makefile.am (INCLUDES): remove image directory from include
1666 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
1667 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
1669 * src/LyXView.C (create_form_form_main): read the application icon
1672 * lib/images/*.xpm: change the icons to use transparent color for
1675 * src/toolbar.C (update): change the color of the button when it
1678 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1680 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
1681 setting explicitely the minibuffer.
1682 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
1684 * src/LyXView.C (showState): new function. Shows font information
1685 in minibuffer and update toolbar state.
1686 (LyXView): call Toolbar::update after creating the
1689 * src/toolbar.C: change toollist to be a vector instead of a
1691 (BubbleTimerCB): get help string directly from the callback
1692 argument of the corresponding icon (which is the action)
1693 (set): remove unnecessary ugliness.
1694 (update): new function. update the icons (depressed, disabled)
1695 depending of the status of the corresponding action.
1697 * src/toolbar.h: remove help in toolbarItem
1699 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
1701 * src/Painter.C (text): Added code for using symbol glyphs from
1702 iso10646 fonts. Currently diabled.
1704 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
1707 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
1708 magyar,turkish and usorbian.
1710 * src/paragraph.C (isMultiLingual): Made more efficient.
1712 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
1715 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
1716 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
1717 Also changed the prototype to "bool math_insert_greek(char)".
1719 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1721 * lots of files: apply the NEW_INSETS on all code that will not be
1722 needed when we move to use the new insets. Enable the define in
1723 lyxparagrah.h to try it.
1725 * src/insets/insettabular.C (cellstart): change to be a static
1727 (InsetTabular): initialize buffer in the initializer list.
1729 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
1731 * src/frontends/xforms/FormPrint.[Ch] : moved #include
1732 form_print.h out of the header file. Replaced with forward
1733 declarations of the relevant struct.
1735 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
1738 * src/commandtags.h: do not include "debug.h" which does not
1739 belong there. #include it in some other places because of this
1742 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1744 * src/insets/insetcaption.C: add a couple "using" directives.
1746 * src/toolbar.C (add): get the help text directly from lyxaction.
1748 (setPixmap): new function. Loads from disk and sets a pixmap on a
1749 botton; the name of the pixmap file is derived from the command
1752 * src/toolbar.h: remove members isBitmap and pixmap from
1755 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
1756 * lib/images/: move many files from images/banner.xpm.
1758 * src/lyx_gui.C (create_forms): read banner pixmap from file.
1760 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
1761 * src/toolbar.C: ditto.
1762 * configure.in: ditto.
1763 * INSTALL: document.
1765 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
1766 the spellchecker popup is closed from the WM.
1768 2000-07-19 Juergen Vigna <jug@sad.it>
1770 * src/insets/insetfloat.C (Write): small fix because we use the
1771 insetname for the type now!
1773 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
1775 * src/frontends/xforms/forms/form_citation.fd: object sizes are
1778 * src/frontends/Dialogs.h: removed hideCitation signal
1780 * src/insets/insetcite.h: added hide signal
1782 * src/insets/insetcite.C (~InsetCitation): emits new signal
1783 (getScreenLabel): "intelligent" label should now fit on the screen!
1785 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
1787 * src/frontends/xforms/FormCitation.C (showInset): connects
1788 hide() to the inset's hide signal
1789 (show): modified to use fl_set_object_position rather than
1790 fl_set_object_geometry wherever possible
1792 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1794 * src/insets/lyxinset.h: add caption code
1796 * src/insets/insetfloat.C (type): new method
1798 * src/insets/insetcaption.C (Write): new method
1800 (LyxCode): new method
1802 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
1803 to get it right together with using the FloatList.
1805 * src/commandtags.h: add LFUN_INSET_CAPTION
1806 * src/lyxfunc.C (Dispatch): handle it
1808 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
1811 * src/Variables.[Ch]: make expand take a const reference, remove
1812 the destructor, some whitespace changes.
1814 * src/LyXAction.C (init): add caption-inset-insert
1816 * src/FloatList.C (FloatList): update the default floats a bit.
1818 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1820 * src/Variables.[Ch]: new files. Intended to be used for language
1821 specific strings (like \chaptername) and filename substitution in
1824 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
1826 * lib/kbd/american.kmap: update
1828 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
1830 * src/bufferparams.[Ch]: remove member allowAccents.
1832 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
1834 * src/LaTeXLog.C: use the log_form.h header.
1835 * src/lyx_gui.C: ditto.
1836 * src/lyx_gui_misc.C: ditto.
1837 * src/lyxvc.h: ditto.
1839 * forms/log_form.fd: new file, created from latexoptions.fd. I
1840 kept the log popup and nuked the options form.
1842 * src/{la,}texoptions.[Ch]: removed.
1843 * src/lyx_cb.C (LaTeXOptions): ditto
1845 * src/lyx_gui.C (create_forms): do not handle the
1846 fd_latex_options form.
1848 2000-07-18 Juergen Vigna <jug@sad.it>
1850 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
1851 name of the inset so that it can be requested outside (text2.C).
1853 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
1856 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1858 * src/mathed/formula.h (ConvertFont): constify
1860 * src/mathed/formula.C (Read): add warning if \end_inset is not
1861 found on expected place.
1863 * src/insets/lyxinset.h (ConvertFont): consify
1865 * src/insets/insetquotes.C (ConvertFont): constify
1866 * src/insets/insetquotes.h: ditto
1868 * src/insets/insetinfo.h: add labelfont
1870 * src/insets/insetinfo.C (InsetInfo): set the labelfont
1871 (ascent): use labelfont
1875 (Write): make .lyx file a bit nicer
1877 * src/insets/insetfloat.C (Write): simplify somewhat...
1878 (Read): add warning if arg is not found
1880 * src/insets/insetcollapsable.C: add using std::max
1881 (Read): move string token and add warning in arg is not found
1882 (draw): use std::max to get the right ty
1883 (getMaxWidth): simplify by using std::max
1885 * src/insets/insetsection.h: new file
1886 * src/insets/insetsection.C: new file
1887 * src/insets/insetcaption.h: new file
1888 * src/insets/insetcaption.C: new file
1890 * src/insets/inset.C (ConvertFont): constify signature
1892 * src/insets/Makefile.am (libinsets_la_SOURCES): add
1893 insetcaption.[Ch] and insetsection.[Ch]
1895 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
1896 uses to use LABEL_COUNTER_CHAPTER instead.
1897 * src/text2.C (SetCounter): here
1899 * src/counters.h: new file
1900 * src/counters.C: new file
1901 * src/Sectioning.h: new file
1902 * src/Sectioning.C: new file
1904 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
1906 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1908 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
1911 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
1914 2000-07-17 Juergen Vigna <jug@sad.it>
1916 * src/tabular.C (Validate): check if array-package is needed.
1917 (SetVAlignment): added support for vertical alignment.
1918 (SetLTFoot): better support for longtable header/footers
1919 (Latex): modified to support added features.
1921 * src/LaTeXFeatures.[Ch]: added array-package.
1923 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
1925 * src/lyx_gui.C (LyXGUI): make sure that the height is large
1928 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
1930 * configure.in: do not forget to put a space after -isystem.
1932 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
1934 * lib/kbd/arabic.kmap: a few fixes.
1936 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1938 * some whitespace chagnes to a number of files.
1940 * src/support/DebugStream.h: change to make it easier for
1941 doc++ to parse correctly.
1942 * src/support/lyxstring.h: ditto
1944 * src/mathed/math_utils.C (compara): change to have only one
1946 (MathedLookupBOP): change because of the above.
1948 * src/mathed/math_delim.C (math_deco_compare): change to have only
1950 (search_deco): change becasue of the above.
1952 * src/insets/insettabular.C (DrawCellSelection): use std::swap
1953 instead of manually coded one.
1955 * src/insets/insetquotes.C (Read): read the \end_inset too
1957 * src/insets/insetlatex.h: remove file
1958 * src/insets/insetlatex.C: remove file
1960 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
1962 (InsetPrintIndex): remove destructor
1964 * src/insets/insetinclude.h: remove default constructor
1966 * src/insets/insetfloat.C: work to make it work better
1968 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
1970 * src/insets/insetcite.h (InsetCitation): remove default constructor
1972 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
1974 * src/text.C (GetColumnNearX): comment out some currently unused code.
1976 * src/paragraph.C (writeFile): move some initializations closer to
1978 (CutIntoMinibuffer): small change to use new matchIT operator
1982 (InsertInset): ditto
1985 (InsetIterator): ditto
1986 (Erase): small change to use new matchFT operator
1988 (GetFontSettings): ditto
1989 (HighestFontInRange): ditto
1992 * src/lyxparagraph.h: some chars changed to value_type
1993 (matchIT): because of some stronger checking (perhaps too strong)
1994 in SGI STL, the two operator() unified to one.
1997 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
1999 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
2000 the last inset read added
2001 (parseSingleLyXformat2Token): some more (future) compability code added
2002 (parseSingleLyXformat2Token): warning about solitary \end_inset added
2003 (parseSingleLyXformat2Token): set last_inset_read
2004 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2005 (parseSingleLyXformat2Token): don't double intializw string next_token
2007 * src/TextCache.C (text_fits::operator()): add const's to the signature
2008 (has_buffer::operator()): ditto
2010 * src/Floating.h: add some comments on the class
2012 * src/FloatList.[Ch] (typeExist): new method
2015 * src/BackStack.h: added default constructor, wanted by Gcc.
2017 2000-07-14 Juergen Vigna <jug@sad.it>
2019 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
2021 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
2023 * src/insets/insettabular.C (resizeLyXText): need this to be able to
2024 do a redraw when the window is resized!
2025 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
2027 * src/insets/insettext.C (resizeLyXText): added function to correctly
2028 being able to resize the LyXWindow.
2030 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
2032 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
2034 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
2035 crashes when closing dialog to a deleted inset.
2037 * src/insets/insetcite.[Ch] (Edit) : the return of this former
2038 method! Now similar to other insets.
2040 2000-07-13 Juergen Vigna <jug@sad.it>
2042 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
2044 * lib/examples/Literate.lyx: small patch!
2046 * src/insets/insetbib.C (Read): added this function because of wrong
2047 Write (without [begin|end]_inset).
2049 2000-07-11 Juergen Vigna <jug@sad.it>
2051 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
2052 as the insertInset could not be good!
2054 * src/screen.C (ToggleSelection): fixed toggle selection bug as
2055 the bool param should not be last.
2057 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2059 * sigc++/configure.in: fix bug in threading-related code (Yes, I
2060 did submit that to Karl).
2062 * configure.in: use -isystem instead of -I for X headers. This
2063 fixes a problem on solaris with a recent gcc;
2064 put the front-end code after the X detection code;
2065 configure in sigc++ before lib/
2067 * src/lyx_main.C (commandLineHelp): remove -display from command
2070 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
2072 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
2073 Also put in Makefile rules for building the ``listerrors''
2074 program for parsing errors from literate programs written in LyX.
2076 * lib/build-listerrors: Added small shell script as part of compile
2077 process. This builds a working ``listerrors'' binary if noweb is
2078 installed and either 1) the VNC X server is installed on the machine,
2079 or 2) the user is compiling from within a GUI. The existence of a GUI
2080 is necessary to use the ``lyx --export'' feature for now. This
2081 hack can be removed once ``lyx --export'' no longer requires a GUI to
2084 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
2086 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
2087 now passed back correctly from gcc and placed "under" error
2088 buttons in a Literate LyX source.
2090 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2092 * src/text.C (GetColumnNearX): Better behavior when a RTL
2093 paragraph is ended by LTR text.
2095 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
2098 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2100 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
2101 true when clipboard is empty.
2103 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2105 * text.C (Backspace): Prevent rebreaking of a row if it is the last
2106 row of the paragraph.
2107 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
2108 to prevent calculation of bidi tables
2110 2000-07-07 Juergen Vigna <jug@sad.it>
2112 * src/screen.C (ToggleSelection): added y_offset and x_offset
2115 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
2118 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
2120 * src/insets/insettext.C: fixed Layout-Display!
2122 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2124 * configure.in: add check for strings.h header.
2126 * src/spellchecker.C: include <strings.h> in order to have a
2127 definition for bzero().
2129 2000-07-07 Juergen Vigna <jug@sad.it>
2131 * src/insets/insettext.C (draw): set the status of the bv->text to
2132 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
2134 * src/screen.C (DrawOneRow):
2135 (DrawFromTo): redraw the actual row if something has changed in it
2138 * src/text.C (draw): call an update of the toplevel-inset if something
2139 has changed inside while drawing.
2141 * src/lyxtext.h: added CHANGED_IN_DRAW status.
2143 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
2145 * src/insets/insetbib.[Ch] (callback) new method, moving callback
2146 processing inside class.
2148 * src/insets/insetindex.[Ch] (callback) new method, moving callback
2149 processing inside class.
2151 * src/insets/insetindex.h new struct Holder, consistent with other
2154 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
2155 citation dialog from main code and placed it in src/frontends/xforms.
2156 Dialog launched through signals instead of callbacks
2158 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
2160 * lyx.man: update the options description.
2162 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
2164 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
2165 handle neg values, set min width to 590, add doc about -display
2167 2000-07-05 Juergen Vigna <jug@sad.it>
2169 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
2170 calls to BufferView *.
2172 * src/insets/insettext.C (checkAndActivateInset): small fix non
2173 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
2175 * src/insets/insetcommand.C (Read): Fixed as insets should read till
2176 their \end_inset token!
2178 2000-07-04 edscott <edscott@imp.mx>
2180 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
2181 lib/lyxrc.example: added option \wheel_jump
2183 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
2185 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
2186 remove support for -width,-height,-xpos and -ypos.
2188 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
2190 * src/encoding.[Ch]: New files.
2192 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
2193 (text): Call to the underline() method only when needed.
2195 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
2197 * src/buffer.C (makeLaTeXFile): Compute automatically the input
2198 encoding(s) for the document.
2200 * src/bufferparams.C (BufferParams): Changed default value of
2203 * src/language.C (newLang): Removed.
2204 (items[]): Added encoding information for all defined languages.
2206 * src/lyx_gui.C (create_forms): Added "auto" option to the input
2207 encoding choice button.
2209 * src/lyxrc.h (font_norm_type): New member variable.
2210 (set_font_norm_type): New method.
2212 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
2213 paragraphs with different encodings.
2215 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
2216 (TransformChar): Changed to work correctly with Arabic points.
2217 (draw): Added support for drawing Arabic points.
2218 (draw): Removed code for drawing underbars (this is done by
2221 * src/support/textutils.h (IsPrintableNonspace): New function.
2223 * src/BufferView_pimpl.h: Added "using SigC::Object".
2224 * src/LyXView.h: ditto.
2226 * src/insets/insetinclude.h (include_label): Changed to mutable.
2228 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
2230 * src/mathed/math_iter.h: remove empty destructor
2232 * src/mathed/math_cursor.h: remove empty destructor
2234 * src/insets/lyxinset.h: add THEOREM_CODE
2236 * src/insets/insettheorem.[Ch]: new files
2238 * src/insets/insetminipage.C: (InsertInset): remove
2240 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
2242 (InsertInset): remove
2244 * src/insets/insetlist.C: (InsertList): remove
2246 * src/insets/insetfootlike.[Ch]: new files
2248 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
2251 (InsertInset): ditto
2253 * src/insets/insetert.C: remove include Painter.h, reindent
2254 (InsertInset): move to header
2256 * src/insets/insetcollapsable.h: remove explicit from default
2257 contructor, remove empty destructor, add InsertInset
2259 * src/insets/insetcollapsable.C (InsertInset): new func
2261 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2263 * src/vspace.h: add explicit to constructor
2265 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
2266 \textcompwordmark, please test this.
2268 * src/lyxrc.C: set ascii_linelen to 65 by default
2270 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
2272 * src/commandtags.h: add LFUN_INSET_THEOREM
2274 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
2275 (makeLinuxDocFile): remove _some_ of the nice logic
2276 (makeDocBookFile): ditto
2278 * src/Painter.[Ch]: (~Painter): removed
2280 * src/LyXAction.C (init): entry for insettheorem added
2282 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
2284 (deplog): code to detect files generated by LaTeX, needs testing
2287 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2289 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
2291 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2293 * src/LaTeX.C (deplog): Add a check for files that are going to be
2294 created by the first latex run, part of the project to remove the
2297 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
2298 contents to the extension list.
2300 2000-07-04 Juergen Vigna <jug@sad.it>
2302 * src/text.C (NextBreakPoint): added support for needFullRow()
2304 * src/insets/lyxinset.h: added needFullRow()
2306 * src/insets/insetcollapsable.C: redone now this uses a text-inset
2309 * src/insets/insettext.C: lots of changes for update!
2311 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
2313 * src/LaTeXFeatures.h: add a missing std:: qualifier.
2315 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
2317 * src/insets/insetinclude.C (InsetInclude): fixed
2318 initialization of include_label.
2319 (unique_id): now returns a string.
2321 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
2323 * src/LaTeXFeatures.h: new member IncludedFiles, for
2324 a map of key, included file name.
2326 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
2327 with the included files for inclusion in SGML preamble,
2328 i. e., linuxdoc and docbook.
2331 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
2332 nice (is the generated linuxdoc code to be exported?), that
2333 allows to remove column, and only_body that will be true for
2334 slave documents. Insets are allowed inside SGML font type.
2335 New handling of the SGML preamble for included files.
2336 (makeDocBookFile): the same for docbook.
2338 * src/insets/insetinclude.h:
2339 * src/insets/insetinclude.C (Validate): keeps a list of included files.
2341 (DocBook): new export methods.
2343 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
2344 and makeDocBookFile.
2346 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
2347 formats to export with command line argument -x.
2349 2000-06-29 Juergen Vigna <jug@sad.it>
2351 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
2352 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
2354 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
2355 region could already been cleared by an inset!
2357 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2359 * src/BufferView_pimpl.h: remove member variables lyx_focus and
2362 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
2364 (cursorToggle): remove special handling of lyx focus.
2366 2000-06-28 Juergen Vigna <jug@sad.it>
2368 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
2371 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2373 * src/insets/insetindex.C (Edit): add a callback when popup is
2376 * src/insets/insettext.C (LocalDispatch):
2377 * src/insets/insetmarginal.h:
2378 * src/insets/insetlist.h:
2379 * src/insets/insetfoot.h:
2380 * src/insets/insetfloat.h:
2381 * src/insets/insetert.h: add a missing std:: qualifier.
2383 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2385 * src/support/lyxsum.C (sum): '\0' teminate file read when using
2388 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
2390 * src/insets/insettext.C (Read): remove tmptok unused variable
2391 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
2392 (InsertInset): change for new InsetInset code
2394 * src/insets/insettext.h: add TEXT inline method
2396 * src/insets/insettext.C: remove TEXT macro
2398 * src/insets/insetmarginal.C (Write): new method
2399 (Latex): change output slightly
2401 * src/insets/insetfoot.C (Write): new method
2402 (Latex): change output slightly (don't use endl when no need)
2404 * src/insets/insetert.C (Write): new method
2406 * src/insets/insetcollapsable.h: make button_length, button_top_y
2407 and button_bottm_y protected.
2409 * src/insets/insetcollapsable.C (Write): simplify code by using
2410 tostr. Also do not output the float name, the children class
2411 should to that to get control over own arguments
2413 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
2414 src/insets/insetminipage.[Ch]:
2417 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2419 * src/lyxfunc.C (Dispatch): cases for new insets/commands
2421 * src/Makefile.am (lyx_SOURCES): add the new files
2423 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
2424 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
2425 * src/commandtags.h: ditto
2427 * src/LaTeXFeatures.h: add a std::set of used floattypes
2429 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
2431 * src/FloatList.[Ch] src/Floating.h: new files
2433 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
2435 * src/lyx_cb.C (TableApplyCB): ditto
2437 * src/text2.C: ditto
2438 * src/buffer.C (SimpleLinuxDocOnePar): ditto
2439 (parseSingleLyXformat2Token): ditto + add code for
2440 backwards compability for old float styles + add code for new insets
2442 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
2444 (InsertInset(size_type, Inset *, LyXFont)): new method
2445 (InsetChar(size_type, char)): changed to use the other InsetChar
2446 with a LyXFont(ALL_INHERIT).
2447 (InsetInset(size_type, Inset*)): changed to use InsetChar to
2448 insert the META_INSET.
2450 * sigc++/thread.cc (Privete<int>::operator int&): move definition
2452 * sigc++/thread.h (Threads): from here
2454 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
2455 definition out of line
2456 * sigc++/scope.h: from here
2458 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2460 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
2461 is specified (adapted from a patch from edscott <edscott@imp.mx>).
2463 * Makefile.am (bindist): new target.
2465 * INSTALL: add instructions for doing a binary distribution.
2467 * development/tools/README.bin.example: update a bit.
2469 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
2472 * lib/lyxrc.example: new lyxrc tag \set_color.
2474 * src/lyxfunc.C (Dispatch):
2475 * src/commandtags.h:
2476 * src/LyXAction.C: new lyxfunc "set-color".
2478 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
2479 and an x11name given as strings.
2481 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
2482 cache when a color is changed.
2484 2000-06-26 Juergen Vigna <jug@sad.it>
2486 * src/lyxrow.C (width): added this functions and variable.
2488 * src/insets/insetcite.C (create_form_citation_form): some Gravity
2491 * src/text.C (SetHeightOfRow): fixed calcualting of width.
2493 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2495 * images/undo_bw.xpm: new icon.
2496 * images/redo_bw.xpm: ditto.
2498 * configure.in (INSTALL_SCRIPT): change value to
2499 ${INSTALL} to avoid failures of install-script target.
2500 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
2502 * src/BufferView.h: add a magic "friend" declaration to please
2505 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
2507 * forms/cite.fd: modified to allow resizing without messing
2510 * src/insetcite.C: Uses code from cite.fd almost without
2512 User can now resize dialog in the x-direction.
2513 Resizing the dialog in the y-direction is prevented, as the
2514 code does this intelligently already.
2516 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2518 * INSTALL: remove obsolete entry in "problems" section.
2520 * lib/examples/sl_*.lyx: update of the slovenian examples.
2522 * src/support/FileInfo.[Ch] (getBlockSize): remove.
2524 2000-06-23 Juergen Vigna <jug@sad.it>
2526 * src/lyxtext.h: added a 'cleared' flag to draw() function.
2528 * src/buffer.C (resize): delete the LyXText of textinsets.
2530 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
2532 * src/insets/lyxinset.h: added another parameter 'cleared' to
2533 the draw() function.
2535 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
2536 unlocking inset in inset.
2538 2000-06-22 Juergen Vigna <jug@sad.it>
2540 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
2541 of insets and moved first to LyXText.
2543 * src/mathed/formulamacro.[Ch]:
2544 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
2546 2000-06-21 Juergen Vigna <jug@sad.it>
2548 * src/text.C (GetVisibleRow): look if I should clear the area or not
2549 using Inset::doClearArea() function.
2551 * src/insets/lyxinset.h: added doClearArea() function and
2552 modified draw(Painter &, ...) to draw(BufferView *, ...)
2554 * src/text2.C (UpdateInset): return bool insted of int
2556 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
2558 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
2559 combox in the character popup
2561 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
2562 BufferParams const & params
2564 2000-06-20 Juergen Vigna <jug@sad.it>
2566 * src/insets/insettext.C (SetParagraphData): set insetowner on
2569 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2571 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
2572 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
2574 (form_main_): remove
2576 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
2577 (create_form_form_main): remove FD_form_main stuff, connect to
2578 autosave_timeout signal
2580 * src/LyXView.[Ch] (getMainForm): remove
2581 (UpdateTimerCB): remove
2582 * src/BufferView_pimpl.h: inherit from SigC::Object
2584 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
2585 signal instead of callback
2587 * src/BufferView.[Ch] (cursorToggleCB): remove
2589 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2591 * src/BufferView_pimpl.C: changes because of the one below
2593 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
2594 instead of storing a pointer to a LyXText.
2596 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
2598 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
2600 * src/lyxparagraph.h
2602 * src/paragraph.C: Changed fontlist to a sorted vector.
2604 2000-06-19 Juergen Vigna <jug@sad.it>
2606 * src/BufferView.h: added screen() function.
2608 * src/insets/insettext.C (LocalDispatch): some selection code
2611 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
2613 * src/insets/insettext.C (SetParagraphData):
2615 (InsetText): fixes for multiple paragraphs.
2617 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
2619 * development/lyx.spec.in: Call configure with ``--without-warnings''
2620 to work around a bug with the Makefiles when doing ``make lyxrpm''.
2621 This should be fine, however, since we generally don't want to be
2622 verbose when making an RPM.
2624 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
2626 * lib/scripts/fig2pstex.py: New file
2628 2000-06-16 Juergen Vigna <jug@sad.it>
2630 * src/insets/insettabular.C (UpdateLocal):
2631 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
2632 (LocalDispatch): Changed all functions to use LyXText.
2634 2000-06-15 Juergen Vigna <jug@sad.it>
2636 * src/text.C (SetHeightOfRow): call inset::update before requesting
2639 * src/insets/insettext.C (update):
2640 * src/insets/insettabular.C (update): added implementation
2642 * src/insets/lyxinset.h: added update function
2644 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2646 * src/text.C (SelectNextWord): protect against null pointers with
2647 old-style string streams. (fix from Paul Theo Gonciari
2650 * src/cite.[Ch]: remove erroneous files.
2652 * lib/configure.m4: update the list of created directories.
2654 * src/lyxrow.C: include <config.h>
2655 * src/lyxcursor.C: ditto.
2657 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2659 * lib/examples/decimal.lyx: new example file from Mike.
2661 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
2662 to find template definitions (from Dekel)
2664 * src/frontends/.cvsignore: add a few things.
2666 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
2668 * src/Timeout.C (TimeOut): remove default argument.
2670 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
2673 * src/insets/ExternalTemplate.C: add a "using" directive.
2675 * src/lyx_main.h: remove the act_ struct, which seems unused
2678 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2680 * LyX Developers Meeting: All files changed, due to random C++ (by
2681 coincidence) code generator script.
2683 - external inset (cool!)
2684 - initial online editing of preferences
2685 - insettabular breaks insettext(s contents)
2687 - some DocBook fixes
2688 - example files update
2689 - other cool stuff, create a diff and look for yourself.
2691 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
2693 * src/insets/insettext.C (computeTextRows): if the maxWidth is
2694 -1 this is a non-line-breaking textinset.
2696 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
2697 if there is no width set.
2699 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
2701 * Lots of files: Merged the dialogbase branch.
2703 2000-06-09 Allan Rae <rae@lyx.org>
2705 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
2706 and the Dispatch methods that used it.
2708 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
2709 access to functions formerly kept in Dispatch.
2711 2000-05-19 Allan Rae <rae@lyx.org>
2713 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
2714 made to_page and count_copies integers again. from_page remains a
2715 string however because I want to allow entry of a print range like
2716 "1,4,22-25" using this field.
2718 * src/LyXAction.C: added action info and commands for buffer-print-xtl
2719 and printer-params-get. These aren't useful from the minibuffer but
2720 could be used by a script/LyXServer app provided it passes a suitable
2721 auto_mem_buffer. I guess I should take a look at how the LyXServer
2722 works and make it support xtl buffers.
2724 * sigc++/: updated to libsigc++-1.0.1
2726 * src/xtl/: updated to xtl-1.3.pl.11
2728 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
2729 those changes done to the files in src/ are actually recreated when
2730 they get regenerated. Please don't ever accept a patch that changes a
2731 dialog unless that patch includes the changes to the corresponding *.fd
2734 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
2735 stringOnlyContains, renamed it and generalised it.
2737 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
2738 branch. Removed the remaining old form_print code.
2740 2000-04-26 Allan Rae <rae@lyx.org>
2742 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
2743 trap I was trying to fix with the ID: fields in src/xtl/ :-)
2745 2000-04-25 Allan Rae <rae@lyx.org>
2747 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
2748 against a base of xtl-1.3.pl.4
2750 * development/tools/lxtl.sh: fixed a couple of silly typos and now
2751 filter the Id: entries so they still show the xtl version number
2754 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
2755 into the src/xtl code. Patch still pending with José (XTL)
2757 2000-04-24 Allan Rae <rae@lyx.org>
2759 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
2760 both more generic and much safer. Use the new template functions.
2761 * src/buffer.[Ch] (Dispatch): ditto.
2763 * src/frontends/xforms/FormPrint.C (update): Use new template functions
2764 and mem buffer more intelligently. Also a little general cleanup.
2767 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
2768 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
2769 * src/xtl/Makefile.am: ditto.
2770 * src/xtl/.cvsignore: ditto.
2771 * src/Makefile.am: ditto.
2773 * src/PrinterParams.h: Removed the macros member functions. Added a
2774 testInvariant member function. A bit of tidying up and commenting.
2775 Included Angus's idea for fixing operation with egcs-1.1.2.
2777 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
2778 cool expansion of XTL's mem_buffer to support automatic memory
2779 management within the buffer itself. Removed the various macros and
2780 replaced them with template functions that use either auto_mem_buffer
2781 or mem_buffer depending on a #define. The mem_buffer support will
2782 disappear as soon as the auto_mem_buffer is confirmed to be good on
2783 other platforms/compilers. That is, it's there so you've got something
2786 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
2787 effectively forked XTL. However I expect José will include my code
2788 into the next major release. Also fixed a memory leak.
2789 * src/xtl/text.h: ditto.
2790 * src/xtl/xdr.h: ditto.
2791 * src/xtl/giop.h: ditto.
2793 2000-04-16 Allan Rae <rae@lyx.org>
2795 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
2796 by autogen.sh and removed by maintainer-clean anyway.
2797 * .cvsignore, sigc++/.cvsignore: Support the above.
2799 * sigc++/.cvsignore: Forgot that retbind.h was generated.
2801 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
2803 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
2804 macros, renamed static callback-target member functions to suit new
2805 scheme and made them public.
2806 * src/frontends/xforms/forms/form_print.fd: ditto.
2807 * src/frontends/xforms/forms/form_copyright.fd: ditto.
2809 * src/support/lxtl.h: small cleanup to use typedef instead of #define
2812 * src/xtl/: New directory containing a minimal distribution of XTL.
2813 This is XTL-1.3.pl.4.
2815 * development/tools/lxtl.sh: A script to generate the above mini-dist.
2817 2000-04-15 Allan Rae <rae@lyx.org>
2819 * development/tools/makeLyXsigc.sh: Remove the library version numbers
2821 * sigc++/: Updated to libsigc++-1.0.0
2823 2000-04-14 Allan Rae <rae@lyx.org>
2825 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
2826 use the generic ones in future. I'll modify my conversion script.
2828 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
2830 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
2831 (CloseAllBufferRelatedDialogs): Renamed.
2832 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
2834 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
2835 of the generic ones. These are the same ones my conversion script
2838 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
2839 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
2840 * src/buffer.C (Dispatch): ditto
2842 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
2843 functions for updating and hiding buffer dependent dialogs.
2844 * src/BufferView.C (buffer): ditto
2845 * src/buffer.C (setReadonly): ditto
2846 * src/lyxfunc.C (CloseBuffer): ditto
2848 * src/buffer.h: Take setReadonly() out of line so I don't have to include
2849 Dialogs.h, and hence all the SigC stuff, into every file that includes
2850 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
2852 * src/BufferView2.C: reduce the number of headers included by buffer.h
2854 2000-04-11 Allan Rae <rae@lyx.org>
2856 * src/frontends/xforms/xform_macros.h: A small collection of macros
2857 for building C callbacks.
2859 * src/frontends/xforms/Makefile.am: Added above file.
2861 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
2862 scheme again. This time it should work for JMarc. If this is
2863 successful I'll revise my conversion script to automate some of this.
2864 The static member functions in the class also have to be public for
2865 this scheme will work. If the scheme works (it's almost identical to
2866 the way BufferView::cursorToggleCB is handled so it should work) then
2867 FormCopyright and FormPrint will be ready for inclusion into the main
2868 trunk immediately after 1.1.5 is released -- provided we're prepared
2869 for complaints about lame compilers not handling XTL.
2871 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
2873 2000-04-07 Allan Rae <rae@lyx.org>
2875 * config/lyxinclude.m4: A bit more tidying up (Angus)
2877 * src/LString.h: JMarc's <string> header fix
2879 * src/PrinterParams.h: Used string for most data to remove some
2880 ugly code in the Print dialog and avoid even uglier code when
2881 appending the ints to a string for output.
2883 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
2884 and moved "default:" back to the end of switch statement. Cleaned
2885 up the printing so it uses the right function calls and so the
2886 "print to file" option actually puts the file in the right directory.
2888 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
2890 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
2891 and Ok+Apply button control into a separate method: input (Angus).
2892 (input) Cleaned it up and improved it to be very thorough now.
2893 (All CB) static_cast used instead of C style cast (Angus). This will
2894 probably change again once we've worked out how to keep gcc-2.8.1 happy
2895 with real C callbacks.
2896 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
2897 ignore some of the bool settings and has random numbers instead. Needs
2898 some more investigation. Added other input length checks and checking
2899 of file and printer names.
2901 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
2902 would link (Angus). Seems the old code doesn't compile with the pragma
2903 statement either. Separated callback entries from internal methods.
2905 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
2907 2000-03-17 Allan Rae <rae@lyx.org>
2909 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
2910 need it? Maybe it could go in Dialogs instead? I could make it a
2911 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
2912 values to get the bool return value.
2913 (Dispatch): New overloaded method for xtl support.
2915 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
2916 extern "C" callback instead of static member functions. Hopefully,
2917 JMarc will be able to compile this. I haven't changed
2918 forms/form_copyright.fd yet. Breaking one of my own rules already.
2920 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
2921 because they aren't useful from the minibuffer. Maybe a LyXServer
2922 might want a help message though?
2924 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
2926 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
2927 xtl which needs both rtti and exceptions.
2929 * src/support/Makefile.am:
2930 * src/support/lxtl.h: New file. Some helper macros for using XTL.
2932 * src/frontends/xforms/input_validators.[ch]: input filters and
2933 validators. These conrol what keys are valid in input boxes.
2934 Use them and write some more. Much better idea than waiting till
2935 after the user has pressed Ok to say that the input fields don't make
2938 * src/frontends/xforms/Makefile.am:
2939 * src/frontends/xforms/forms/form_print.fd:
2940 * src/frontends/xforms/forms/makefile:
2941 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
2942 new scheme. Still have to make sure I haven't missed anything from
2943 the current implementation.
2945 * src/Makefile.am, src/PrinterParams.h: New data store.
2947 * other files: Added a couple of copyright notices.
2949 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2951 * src/insets/insetbib.h: move Holder struct in public space.
2953 * src/frontends/include/DialogBase.h: use SigC:: only when
2954 SIGC_CXX_NAMESPACES is defined.
2955 * src/frontends/include/Dialogs.h: ditto.
2957 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
2959 * src/frontends/xforms/FormCopyright.[Ch]: do not
2960 mention SigC:: explicitely.
2962 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2964 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
2965 deals with testing KDE in main configure.in
2966 * configure.in: ditto.
2968 2000-02-22 Allan Rae <rae@lyx.org>
2970 * Lots of files: Merged from HEAD
2972 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
2973 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
2975 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
2977 * sigc++/: new minidist.
2979 2000-02-14 Allan Rae <rae@lyx.org>
2981 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
2983 2000-02-08 Juergen Vigna <jug@sad.it>
2985 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
2986 file for the buildin GUI builder of KDevelop of the copyright-dialog.
2988 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
2989 for this port and so it is much easier for other people to port
2990 dialogs in a common development environment.
2992 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
2993 the QT/KDE implementation.
2995 * src/frontends/kde/Dialogs.C:
2996 * src/frontends/kde/FormCopyright.C:
2997 * src/frontends/kde/FormCopyright.h:
2998 * src/frontends/kde/Makefile.am:
2999 * src/frontends/kde/formcopyrightdialog.C:
3000 * src/frontends/kde/formcopyrightdialog.h:
3001 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
3002 for the kde support of the Copyright-Dialog.
3004 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3005 subdir-substitution instead of hardcoded 'xforms' as we now have also
3008 * src/frontends/include/DialogBase.h (Object): just commented the
3009 label after #endif (nasty warning and I don't like warnings ;)
3011 * src/main.C (main): added KApplication initialization if using
3014 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
3015 For now only the KDE event-loop is added if frontend==kde.
3017 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
3019 * configure.in: added support for the --with-frontend[=value] option
3021 * autogen.sh: added kde.m4 file to list of config-files
3023 * acconfig.h: added define for KDEGUI-support
3025 * config/kde.m4: added configuration functions for KDE-port
3027 * config/lyxinclude.m4: added --with-frontend[=value] option with
3028 support for xforms and KDE.
3030 2000-02-08 Allan Rae <rae@lyx.org>
3032 * all Makefile.am: Fixed up so the make targets dist, distclean,
3033 install and uninstall all work even if builddir != srcdir. Still
3034 have a new sigc++ minidist update to come.
3036 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
3038 2000-02-01 Allan Rae <rae@lyx.org>
3040 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
3041 Many mods to get builddir != srcdir working.
3043 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
3044 for building on NT and so we can do the builddir != srcdir stuff.
3046 2000-01-30 Allan Rae <rae@lyx.org>
3048 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
3049 This will stay in "rae" branch. We probably don't really need it in
3050 the main trunk as anyone who wants to help programming it should get
3051 a full library installed also. So they can check both included and
3052 system supplied library compilation.
3054 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
3055 Added a 'mini' distribution of libsigc++. If you feel the urge to
3056 change something in these directories - Resist it. If you can't
3057 resist the urge then you should modify the following script and rebuild
3058 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
3059 all happen. Still uses a hacked version of libsigc++'s configure.in.
3060 I'm quite happy with the results. I'm not sure the extra work to turn
3061 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
3062 worth the trouble and would probably lead to extra maintenance
3064 I haven't tested the following important make targets: install, dist.
3065 Not ready for prime time but very close. Maybe 1.1.5.
3067 * development/tools/makeLyXsigc.sh: A shell script to automatically
3068 generate our mini-dist of libsigc++. It can only be used with a CVS
3069 checkout of libsigc++ not a tarball distribution. It's well commented.
3070 This will end up as part of the libsigc++ distribution so other apps
3071 can easily have an included mini-dist. If someone makes mods to the
3072 sigc++ subpackage without modifying this script to generate those
3073 changes I'll be very upset!
3075 * src/frontends/: Started the gui/system indep structure.
3077 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
3078 to access the gui-indep dialogs are in this class. Much improved
3079 design compared to previous revision. Lars, please refrain from
3080 moving this header into src/ like you did with Popups.h last time.
3082 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
3084 * src/frontends/xforms/: Started the gui-indep system with a single
3085 dialog: FormCopyright. Initial testing of use of libsigc++ was very
3088 * src/frontends/xforms/forms: Repository for the xforms .fd files.
3089 Here you'll find a very useful makefile and automated fdfix.sh that
3090 makes updating dailogs a no-brainer -- provided you follow the rules
3091 set out in the README. I'm thinking about adding another script to
3092 automatically generate skeleton code for a new dialog given just the
3095 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
3096 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
3097 Made FormCopyright gui-indep and added a lyxfunc to get to it.
3099 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
3101 * src/support/LSubstring.C (operator): simplify
3103 * src/lyxtext.h: removed bparams, use buffer_->params instead
3105 * src/lyxrow.h: make Row a real class, move all variables to
3106 private and use accessors.
3108 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
3110 (isRightToLeftPar): ditto
3111 (ChangeLanguage): ditto
3112 (isMultiLingual): ditto
3115 (SimpleTeXOnePar): ditto
3116 (TeXEnvironment): ditto
3117 (GetEndLabel): ditto
3119 (SetOnlyLayout): ditto
3120 (BreakParagraph): ditto
3121 (BreakParagraphConservative): ditto
3122 (GetFontSettings): ditto
3124 (CopyIntoMinibuffer): ditto
3125 (CutIntoMinibuffer): ditto
3126 (PasteParagraph): ditto
3127 (SetPExtraType): ditto
3128 (UnsetPExtraType): ditto
3129 (DocBookContTableRows): ditto
3130 (SimpleDocBookOneTablePar): ditto
3132 (TeXFootnote): ditto
3133 (SimpleTeXOneTablePar): ditto
3134 (TeXContTableRows): ditto
3135 (SimpleTeXSpecialChars): ditto
3138 * src/lyxcursor.h: make LyXCursor a real class, move all variables
3139 to private and use accessors.
3141 * src/lyx_cb.C: remove char updatetimer, and all code that uses
3142 this, we did not use it anymore and has not been for ages. Just a
3143 waste of cpu cycles.
3145 * src/language.h: make Language a real class, move all variables
3146 to private and use accessors.
3148 * src/BufferView_pimpl.C (Pimpl): use new timer code.
3149 (create_view): remove
3150 (update): some changes for new timer
3151 (cursorToggle): use new timer
3152 (beforeChange): change for new timer
3154 * src/BufferView.h (cursorToggleCB): removed last paramter because
3157 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
3158 (cursorToggleCB): change because of new timer code
3160 * lib/CREDITS: updated own mailaddress
3162 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3164 * src/support/filetools.C (PutEnv): fix the code in case neither
3165 putenv() nor setenv() have been found.
3167 * INSTALL: mention the install-strip Makefile target.
3169 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
3170 read-only documents.
3172 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3174 * lib/reLyX/configure.in (VERSION): avoid using a previously
3175 generated reLyX wrapper to find out $prefix.
3177 * lib/examples/eu_adibide_lyx-atua.lyx:
3178 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
3179 translation of the Tutorial (Dooteo)
3181 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
3183 * forms/cite.fd: new citation dialog
3185 * src/insetcite.[Ch]: the new citation dialog is moved into
3188 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
3191 * src/insets/insetcommand.h: data members made private.
3193 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3195 * LyX 1.1.5 released
3197 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3199 * src/version.h (LYX_RELEASE): to 1.1.5
3201 * src/spellchecker.C (RunSpellChecker): return false if the
3202 spellchecker dies upon creation.
3204 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3206 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
3207 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
3211 * lib/CREDITS: update entry for Martin Vermeer.
3213 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
3215 * src/text.C (draw): Draw foreign language bars at the bottom of
3216 the row instead of at the baseline.
3218 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
3220 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3222 * lib/bind/de_menus.bind: updated
3224 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3226 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
3228 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3230 * src/menus.C (Limit_string_length): New function
3231 (ShowTocMenu): Limit the number of items/length of items in the
3234 * src/paragraph.C (String): Correct result for a paragraph inside
3237 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3239 * src/bufferlist.C (close): test of buf->getuser() == NULL
3241 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
3243 * src/BufferView2.C (removeAutoInsets): Fix a bug:
3244 Do not call to SetCursor when the paragraph is a closed footnote!
3246 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
3248 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
3251 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
3253 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3256 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
3257 reference popup, that activates the reference-back action
3259 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
3261 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
3262 the menus. Also fixed a bug.
3264 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
3265 the math panels when switching buffers (unless new buffer is readonly).
3267 * src/BufferView.C (NoSavedPositions)
3268 * src/BufferView_pimpl.C (NoSavedPositions): New methods
3270 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3272 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
3273 less of dvi dirty or not.
3275 * src/trans_mgr.[Ch] (insert): change first parameter to string
3278 * src/chset.[Ch] (encodeString): add const to first parameter
3280 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3282 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
3286 * src/LaTeX.C (deplog): better searching for dependency files in
3287 the latex log. Uses now regexps.
3289 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
3290 instead of the box hack or \hfill.
3292 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3294 * src/lyxfunc.C (doImportHelper): do not create the file before
3295 doing the actual import.
3296 (doImportASCIIasLines): create a new file before doing the insert.
3297 (doImportASCIIasParagraphs): ditto.
3299 * lib/lyxrc.example: remove mention of non-existing commands
3301 * lyx.man: remove mention of color-related switches.
3303 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
3305 * src/lyx_gui.C: remove all the color-related ressources, which
3306 are not used anymore.
3308 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
3311 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3313 * src/lyxrc.C (read): Add a missing break in the switch
3315 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
3317 * src/text2.C (InsertStringA): Fix a bug with insertion into table
3319 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
3322 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3324 * src/text.C (draw): draw bars under foreign language words.
3326 * src/LColor.[Ch]: add LColor::language
3328 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3330 * src/lyxcursor.h (boundary): New member variable
3332 * src/text.C (IsBoundary): New methods
3334 * src/text.C: Use the above for currect cursor movement when there
3335 is both RTL & LTR text.
3337 * src/text2.C: ditto
3339 * src/bufferview_funcs.C (ToggleAndShow): ditto
3341 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3343 * src/text.C (DeleteLineForward): set selection to true to avoid
3344 that DeleteEmptyParagraphMechanism does some magic. This is how it
3345 is done in all other functions, and seems reasonable.
3346 (DeleteWordForward): do not jump over non-word stuff, since
3347 CursorRightOneWord() already does it.
3349 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
3350 DeleteWordBackward, since they seem safe to me (since selection is
3351 set to "true") DeleteEmptyParagraphMechanism does nothing.
3353 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3355 * src/lyx_main.C (easyParse): simplify the code by factoring the
3356 part that removes parameters from the command line.
3357 (LyX): check wether wrong command line options have been given.
3359 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
3361 * src/lyx_main.C : add support for specifying user LyX
3362 directory via command line option -userdir.
3364 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
3366 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
3367 the number of items per popup.
3368 (Add_to_refs_menu): Ditto.
3370 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3372 * src/lyxparagraph.h: renamed ClearParagraph() to
3373 StripLeadingSpaces() and moved it to paragraph.C. We pass the
3374 textclass as parameter, and do nothing if free_spacing is
3375 true. This fixes part of the line-delete-forward problems.
3377 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
3378 (pasteSelection): ditto.
3379 (SwitchLayoutsBetweenClasses): more translatable strings.
3381 * src/text2.C (CutSelection): use StripLeadingSpaces.
3382 (PasteSelection): ditto.
3383 (DeleteEmptyParagraphMechanism): ditto.
3385 2000-05-26 Juergen Vigna <jug@sad.it>
3387 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
3388 is not needed in tabular insets.
3390 * src/insets/insettabular.C (TabularFeatures): added missing features.
3392 * src/tabular.C (DeleteColumn):
3394 (AppendRow): implemented this functions
3395 (cellsturct::operator=): clone the inset too;
3397 2000-05-23 Juergen Vigna <jug@sad.it>
3399 * src/insets/insettabular.C (LocalDispatch): better selection support
3400 when having multicolumn-cells.
3402 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3404 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
3406 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3408 * src/ColorHandler.C (getGCForeground): put more test into _()
3410 * lib/examples/eu_splash.lyx: new file (Basque translation) from
3413 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
3416 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
3418 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
3419 there are no labels, or when buffer is readonly.
3421 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
3422 there are no labels, buffer is SGML, or when buffer is readonly.
3424 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3426 * src/LColor.C (LColor): change a couple of grey40 to grey60
3427 (LColor): rewore initalization to make compiles go some magnitude
3429 (getGUIName): don't use gettext until we need the string.
3431 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
3433 * src/Bullet.[Ch]: Fixed a small bug.
3435 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
3437 * src/paragraph.C (String): Several fixes/improvements
3439 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
3441 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3443 * src/paragraph.C (String): give more correct output.
3445 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
3447 * src/lyxfont.C (stateText) Do not output the language if it is
3448 eqaul to the language of the document.
3450 * src/paragraph.C (TeXOnePar): Do not put language switch commands
3451 between two paragraphs with the same language.
3453 * src/paragraph.C (getParLanguage) Return a correct answer for an
3454 empty dummy paragraph.
3456 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
3459 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
3462 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
3463 the menus/popup, if requested fonts are unavailable.
3465 2000-05-22 Juergen Vigna <jug@sad.it>
3467 * src/insets/insettabular.C (LocalDispatch): added some more cursor
3468 movement support (Up/Down/Tab/Shift-Tab).
3469 (LocalDispatch): added also preliminari cursor-selection.
3471 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
3473 * src/paragraph.C (PasteParagraph): Hopefully now right!
3475 2000-05-22 Garst R. Reese <reese@isn.net>
3477 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
3478 of list, change all references to Environment to Command
3479 * tex/hollywood.cls : rewrite environments as commands, add
3480 \uppercase to interiorshot and exteriorshot to force uppecase.
3481 * tex/broadway.cls : rewrite environments as commands. Tweak
3484 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3486 * src/menus.C (Add_to_toc_menu): fix the code which limits the
3487 size of items: use a constant intead of the hardcoded 40, and more
3488 importantly do not remove the %m and %x tags added at the end.
3489 (Add_to_refs_menu): use vector::size_type instead of
3490 unsigned int as basic types for the variables. _Please_ do not
3491 assume that size_t is equal to unsigned int. On an alpha, this is
3492 unsigned long, which is _not_ the same.
3494 * src/language.C (initL): remove language "hungarian", since it
3495 seems that "magyar" is better.
3497 2000-05-22 Juergen Vigna <jug@sad.it>
3499 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
3501 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
3504 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
3505 next was deleted but not set to 0.
3507 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3509 * src/language.C (initL): change the initialization of languages
3510 so that compiles goes _fast_.
3512 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
3515 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
3517 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3521 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3523 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
3525 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
3529 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
3532 * src/insets/insetlo*.[Ch]: Made editable
3534 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3536 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
3537 the current selection.
3539 * src/BufferView_pimpl.C (stuffClipboard): new method
3541 * src/BufferView.C (stuffClipboard): new method
3543 * src/paragraph.C (String): new method
3545 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
3546 LColor::ignore when lyxname is not found.
3548 * src/BufferView.C (pasteSelection): new method
3550 * src/BufferView_pimpl.C (pasteSelection): new method
3552 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
3554 * src/WorkArea.C (request_clipboard_cb): new static function
3555 (getClipboard): new method
3556 (putClipboard): new method
3558 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3560 * LyX 1.1.5pre2 released
3562 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3564 * src/vspace.C (operator=): removed
3565 (operator=): removed
3567 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
3569 * src/layout.C (NumberOfClass): manually set the type in make_pair
3570 (NumberOfLayout): ditto
3572 * src/language.C: use the Language constructor for ignore_lang
3574 * src/language.h: add constructors to struct Language
3576 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
3578 * src/text2.C (SetCursorIntern): comment out #warning
3580 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
3582 * src/mathed/math_iter.h: initialize sx and sw to 0
3584 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3586 * forms/lyx.fd: Redesign of form_ref
3588 * src/LaTeXFeatures.[Ch]
3592 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
3595 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
3596 and Buffer::inset_iterator.
3598 * src/menus.C: Added new menus: TOC and Refs.
3600 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
3602 * src/buffer.C (getTocList): New method.
3604 * src/BufferView2.C (ChangeRefs): New method.
3606 * src/buffer.C (getLabelList): New method. It replaces the old
3607 getReferenceList. The return type is vector<string> instead of
3610 * src/insets/insetinclude.C (getLabelList): New method. Replaces
3611 the old getLabel() and GetNumberOfLabels() methods.
3612 * src/insets/insetlabel.C (getLabelList): ditto
3613 * src/mathed/formula.C (getLabelList): ditto
3615 * src/paragraph.C (String): New method.
3617 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
3618 Uses the new getTocList() method.
3619 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
3620 which automatically updates the contents of the browser.
3621 (RefUpdateCB): Use the new getLabelList method.
3623 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
3625 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
3627 * src/spellchecker.C: Added using std::reverse;
3629 2000-05-19 Juergen Vigna <jug@sad.it>
3631 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
3633 * src/insets/insettext.C (computeTextRows): small fix for display of
3634 1 character after a newline.
3636 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
3639 2000-05-18 Juergen Vigna <jug@sad.it>
3641 * src/insets/insettabular.C (TabularFeatures): fixed update of display
3642 when changing width of column.
3644 * src/tabular.C (set_row_column_number_info): setting of
3645 autobreak rows if necessary.
3647 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3649 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
3651 * src/vc-backend.*: renamed stat() to status() and vcstat to
3652 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
3653 compilation broke. The new name seems more relevant, anyway.
3655 2000-05-17 Juergen Vigna <jug@sad.it>
3657 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
3658 which was wrong if the removing caused removing of rows!
3660 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
3661 (pushToken): new function.
3663 * src/text2.C (CutSelection): fix problem discovered with purify
3665 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3667 * src/debug.C (showTags): enlarge the first column, now that we
3668 have 6-digits debug codes.
3670 * lib/layouts/hollywood.layout:
3671 * lib/tex/hollywood.cls:
3672 * lib/tex/brodway.cls:
3673 * lib/layouts/brodway.layout: more commands and fewer
3674 environments. Preambles moved in the .cls files. Broadway now has
3675 more options on scene numbering and less whitespace (from Garst)
3677 * src/insets/insetbib.C (getKeys): make sure that we are in the
3678 document directory, in case the bib file is there.
3680 * src/insets/insetbib.C (Latex): revert bogus change.
3682 2000-05-16 Juergen Vigna <jug@sad.it>
3684 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
3685 the TabularLayout on cursor move.
3687 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
3689 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
3692 (draw): fixed cursor position and drawing so that the cursor is
3693 visible when before the tabular-inset.
3695 * src/insets/insettext.C (init): drawLockedFrame was not initialized
3696 when creating from old insettext.
3698 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
3700 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3702 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
3703 * lib/tex/brodway.cls: ditto
3705 * lib/layouts/brodway.layout: change alignment of parenthical
3708 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3710 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
3711 versions 0.88 and 0.89 are supported.
3713 2000-05-15 Juergen Vigna <jug@sad.it>
3715 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
3718 * src/insets/insettext.C (computeTextRows): redone completely this
3719 function in a much cleaner way, because of problems when having a
3721 (draw): added a frame border when the inset is locked.
3722 (SetDrawLockedFrame): this sets if we draw the border or not.
3723 (SetFrameColor): this sets the frame color (default=insetframe).
3725 * src/insets/lyxinset.h: added x() and y() functions which return
3726 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
3727 function which is needed to see if we have a locking inset of some
3728 type in this inset (needed for now in insettabular).
3730 * src/vspace.C (inPixels): the same function also without a BufferView
3731 parameter as so it is easier to use it in some ocasions.
3733 * src/lyxfunc.C: changed all places where insertInset was used so
3734 that now if it couldn't be inserted it is deleted!
3736 * src/TabularLayout.C:
3737 * src/TableLayout.C: added support for new tabular-inset!
3739 * src/BufferView2.C (insertInset): this now returns a bool if the
3740 inset was really inserted!!!
3742 * src/tabular.C (GetLastCellInRow):
3743 (GetFirstCellInRow): new helper functions.
3744 (Latex): implemented for new tabular class.
3748 (TeXTopHLine): new Latex() helper functions.
3750 2000-05-12 Juergen Vigna <jug@sad.it>
3752 * src/mathed/formulamacro.C (Read):
3753 * src/mathed/formula.C (Read): read also the \end_inset here!
3755 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3757 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
3758 crush when saving formulae with unbalanced parenthesis.
3760 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
3762 * src/layout.C: Add new keyword "endlabelstring" to layout file
3764 * src/text.C (GetVisibleRow): Draw endlabel string.
3766 * lib/layouts/broadway.layout
3767 * lib/layouts/hollywood.layout: Added endlabel for the
3768 Parenthetical layout.
3770 * lib/layouts/heb-article.layout: Do not use slanted font shape
3771 for Theorem like environments.
3773 * src/buffer.C (makeLaTeXFile): Always add "american" to
3774 the UsedLanguages list if document language is RTL.
3776 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3778 * add addendum to README.OS2 and small patch (from SMiyata)
3780 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3782 * many files: correct the calls to ChangeExtension().
3784 * src/support/filetools.C (ChangeExtension): remove the no_path
3785 argument, which does not belong there. Use OnlyFileName() instead.
3787 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
3788 files when LaTeXing a non-nice latex file.
3790 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
3791 a chain of "if". Return false when deadkeys are not handled.
3793 * src/lyx_main.C (LyX): adapted the code for default bindings.
3795 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
3796 bindings for basic functionality (except deadkeys).
3797 (deadKeyBindings): new method. Performs the bindings of deadkeys.
3799 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
3800 several methods: handle override_x_deadkeys.
3802 * src/lyxrc.h: remove the "bindings" map, which did not make much
3803 sense anyway. New variable override_x_deadkeys, defaulting to "true".
3805 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3807 * src/lyxfont.C (stateText): use a saner method to determine
3808 whether the font is "default". Seems to fix the crash with DEC
3811 * src/Bullet.[Ch] (Bullet): remove const on parameters.
3813 2000-05-08 Juergen Vigna <jug@sad.it>
3815 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
3816 TabularLayoutMenu with mouse-button-3
3817 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
3819 * src/TabularLayout.C: added this file for having a Layout for
3822 2000-05-05 Juergen Vigna <jug@sad.it>
3824 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
3825 recalculating inset-widths.
3826 (TabularFeatures): activated this function so that I can change
3827 tabular-features via menu.
3829 * src/menus.C (ShowEditMenu): inserted support for insettabular so
3830 that I can test some functions with the Table menu.
3832 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3834 * src/lyxfont.C (stateText): guard against stupid c++libs.
3836 * src/tabular.C: add using std::vector
3837 some whitespace changes, + removed som autogenerated code.
3839 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
3841 2000-05-05 Juergen Vigna <jug@sad.it>
3843 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
3844 row, columns and cellstructures.
3846 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3848 * lib/lyxrc.example: remove obsolete entries.
3850 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
3851 reading of protected_separator for free_spacing.
3853 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3855 * src/text.C (draw): do not display an exclamation mark in the
3856 margin for margin notes. This is confusing, ugly and
3859 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
3860 AMS math' is checked.
3862 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
3863 name to see whether including the amsmath package is needed.
3865 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
3867 * src/paragraph.C (validate): Compute UsedLanguages correctly
3868 (don't insert the american language if it doesn't appear in the
3871 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
3872 The argument of \thanks{} command is considered moving argument
3874 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
3877 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
3879 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
3880 for appendix/minipage/depth. The lines can be now both in the footnote
3881 frame, and outside the frame.
3883 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
3886 2000-05-05 Juergen Vigna <jug@sad.it>
3888 * src/table.[Ch]: removed the inset and buffer stuff as this is now
3889 neede only in tabular.[Ch].
3891 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3893 * src/insets/insetspecialchar.C (Read): allow command == '~' for
3895 (Write): write '~' for PROTECTED_SEPARATOR
3897 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3899 * src/lyxparagraph.h: add a friend struct matchIT after the struct
3902 * src/mathed/formula.C (drawStr): rename size to siz.
3904 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
3905 possibly fix a bug by not changing the pflags = flags to piflags =
3908 2000-05-05 Juergen Vigna <jug@sad.it>
3910 * src/insets/insetbib.C: moved using directive
3912 * src/ImportNoweb.C: small fix for being able to compile (missing
3915 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3917 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
3918 to use clear, since we don't depend on this in the code. Add test
3921 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3923 * (various *.C files): add using std::foo directives to please dec
3926 * replace calls to string::clear() to string::erase() (Angus)
3928 * src/cheaders/cmath: modified to provide std::abs.
3930 2000-05-04 Juergen Vigna <jug@sad.it>
3932 * src/insets/insettext.C: Prepared all for inserting of multiple
3933 paragraphs. Still display stuff to do (alignment and other things),
3934 but I would like to use LyXText to do this when we cleaned out the
3935 table-support stuff.
3937 * src/insets/insettabular.C: Changed lot of stuff and added lots
3938 of functionality still a lot to do.
3940 * src/tabular.C: Various functions changed name and moved to be
3941 const functions. Added new Read and Write functions and changed
3942 lots of things so it works good with tabular-insets (also removed
3943 some stuff which is not needed anymore * hacks *).
3945 * src/lyxcursor.h: added operators == and != which just look if
3946 par and pos are (not) equal.
3948 * src/buffer.C (latexParagraphs): inserted this function to latex
3949 all paragraphs form par to endpar as then I can use this too for
3952 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
3953 so that I can call this to from text insets with their own cursor.
3955 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
3956 output off all paragraphs (because of the fix below)!
3958 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
3959 the very last paragraph (this could be also the last paragraph of an
3962 * src/texrow.h: added rows() call which returns the count-variable.
3964 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3966 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
3968 * lib/configure.m4: better autodetection of DocBook tools.
3970 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3972 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
3974 * src/lyx_cb.C: add using std::reverse;
3976 * src/LaTeX.C (run): on error always run deleteFilesOnError before
3979 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
3980 selected files. Should fix repeated errors from generated files.
3982 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
3984 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
3986 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
3987 the spellchecker popup.
3989 * lib/lyxrc.example: Removed the \number_inset section
3991 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3993 * src/insets/figinset.C (various): Use IsFileReadable() to make
3994 sure that the file actually exist. Relying on ghostscripts errors
3995 is a bad idea since they can lead to X server crashes.
3997 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
3999 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
4002 * lib/lyxrc.example: smallish typo in description of
4003 \view_dvi_paper_option
4005 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4008 * src/lyxfunc.C: doImportHelper to factor out common code of the
4009 various import methods. New functions doImportASCIIasLines,
4010 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
4011 doImportLinuxDoc for the format specific parts.
4014 * buffer.C: Dispatch returns now a bool to indicate success
4017 * lyx_gui.C: Add getLyXView() for member access
4019 * lyx_main.C: Change logic for batch commands: First try
4020 Buffer::Dispatch (possibly without GUI), if that fails, use
4023 * lyx_main.C: Add support for --import command line switch.
4024 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
4025 Available Formats: Everything accepted by 'buffer-import <format>'
4027 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4029 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
4032 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
4033 documents will be reformatted upon reentry.
4035 2000-04-27 Juergen Vigna <jug@sad.it>
4037 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
4038 correctly only last pos this was a bug.
4040 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4042 * release of lyx-1.1.5pre1
4044 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4046 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
4048 * src/menus.C: revert the change of naming (Figure->Graphic...)
4049 from 2000-04-11. It was incomplete and bad.
4051 * src/LColor.[Ch]: add LColor::depthbar.
4052 * src/text.C (GetVisibleRow): use it.
4054 * README: update the languages list.
4056 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4058 * src/text.C (GetVisibleRow): show the depth of paragraphs using
4061 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4063 * README: remove sections that were just wrong.
4065 * src/text2.C (GetRowNearY): remove currentrow code
4067 * src/text.C (GetRow): remove currentrow code
4069 * src/screen.C (Update): rewritten a bit.
4070 (SmallUpdate): removed func
4072 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
4074 (FullRebreak): return bool
4075 (currentrow): remove var
4076 (currentrow_y): ditto
4078 * src/lyxscreen.h (Draw): change arg to unsigned long
4079 (FitCursor): return bool
4080 (FitManualCursor): ditto
4081 (Smallpdate): remove func
4082 (first): change to unsigned long
4083 (DrawOneRow): change second arg to long (from long &)
4084 (screen_refresh_y): remove var
4085 (scree_refresh_row): ditto
4087 * src/lyxrow.h: change baseline to usigned int from unsigned
4088 short, this brings some implicit/unsigned issues out in the open.
4090 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
4092 (Dispatch): don't call updateScrollbar after fitCursor. Use update
4093 instead of smallUpdate.
4095 * src/lyxcursor.h: change y to unsigned long
4097 * src/buffer.h: don't call updateScrollbar after fitcursor
4099 * src/buffer.C (parseSingleLyXformat2Token): move variables to
4100 where they are used. Removed "\\direction", this was not present
4101 in 1.1.4 and is already obsolete. Commented out some code that I
4102 believe to never be called.
4103 (runLiterate): don't call updateScrollbar after fitCursor
4105 (buildProgram): ditto
4108 * src/WorkArea.h (workWidth): change return val to unsigned
4111 (redraw): remove the button redraws
4112 (setScrollbarValue): change for scrollbar
4113 (getScrollbarValue): change for scrollbar
4114 (getScrollbarBounds): change for scrollbar
4116 * src/WorkArea.C (C_WorkArea_up_cb): removed func
4117 (C_WorkArea_down_cb): removed func
4118 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
4119 (resize): change for scrollbar
4120 (setScrollbar): ditto
4121 (setScrollbarBounds): ditto
4122 (setScrollbarIncrements): ditto
4123 (up_cb): removed func
4124 (down_cb): removed func
4125 (scroll_cb): change for scrollbar
4126 (work_area_handler): ditto
4128 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
4129 when FitCursor did something.
4130 (updateScrollbar): some unsigned changes
4131 (downCB): removed func
4132 (scrollUpOnePage): removed func
4133 (scrollDownOnePage): remvoed func
4134 (workAreaMotionNotify): don't call screen->FitCursor but use
4135 fitCursor instead. and bool return val
4136 (workAreaButtonPress): ditto
4137 (workAreaButtonRelease): some unsigned changes
4138 (checkInsetHit): ditto
4139 (workAreaExpose): ditto
4140 (update): parts rewritten, comments about the signed char arg added
4141 (smallUpdate): removed func
4142 (cursorPrevious): call needed updateScrollbar
4145 * src/BufferView2.C (allFloats): don't call updateScrollbar after
4148 * src/BufferView.[Ch] (upCB): removed func
4149 (downCB): removed func
4150 (smallUpdate): removed func
4152 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4154 * src/lyxtext.h src/text.C src/text2.C: removed support for the
4155 currentrow, currentrow_y optimization. This did not help a lot and
4156 if we want to do this kind of optimization we should rather use
4157 cursor.row instead of the currentrow.
4159 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
4160 buffer spacing and klyx spacing support.
4162 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4164 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
4167 2000-04-26 Juergen Vigna <jug@sad.it>
4169 * src/insets/figinset.C: fixes to Lars sstream changes!
4171 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
4173 * A lot of files: Added Ascii(ostream &) methods to all inset
4174 classes. Used when exporting to ASCII.
4176 * src/buffer.C (writeFileAscii,RoffAsciiTable)
4177 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
4180 * src/text2.C (ToggleFree): Disabled implicit word selection when
4181 there is a change in the language
4183 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
4184 no output was generated for end-of-sentence inset.
4186 * src/insets/lyxinset.h
4189 * src/paragraph.C: Removed the insetnumber code
4191 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
4193 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4195 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
4196 no_babel and no_epsfig completely from the file.
4197 (parseSingleLyXformat2Token): add handling for per-paragraph
4198 spacing as written by klyx.
4200 * src/insets/figinset.C: applied patch by Andre. Made it work with
4203 2000-04-20 Juergen Vigna <jug@sad.it>
4205 * src/insets/insettext.C (cutSelection):
4206 (copySelection): Fixed with selection from right to left.
4207 (draw): now the rows are not recalculated at every draw.
4208 (computeTextRows): for now reset the inset-owner here (this is
4209 important for an undo or copy where the inset-owner is not set
4212 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
4213 motion to the_locking_inset screen->first was forgotten, this was
4214 not important till we got multiline insets.
4216 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4218 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
4219 code seems to be alright (it is code changed by Dekel, and the
4220 intent is indeed that all macros should be defined \protect'ed)
4222 * NEWS: a bit of reorganisation of the new user-visible features.
4224 2000-04-19 Juergen Vigna <jug@sad.it>
4226 * src/insets/insettext.C (init): using a LyXCursor now for cursor
4227 position. Set the inset_owner of the used paragraph so that it knows
4228 that it is inside an inset. Fixed cursor handling with mouse and
4229 cursor keys. Fixed wrong timed inset redraws and lots of other changes
4230 and cleanups to make TextInsets work better.
4232 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
4233 Changed parameters of various functions and added LockInsetInInset().
4235 * src/insets/insettext.C:
4237 * src/insets/insetcollapsable.h:
4238 * src/insets/insetcollapsable.C:
4239 * src/insets/insetfoot.h:
4240 * src/insets/insetfoot.C:
4241 * src/insets/insetert.h:
4242 * src/insets/insetert.C: cleaned up the code so that it works now
4243 correctly with insettext.
4245 * src/insets/inset.C:
4246 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
4247 that insets in insets are supported right.
4250 * src/table.C: lots of changes for use with inset tabular (and cleanup)
4252 * src/paragraph.C: some small fixes
4254 * src/debug.h: inserted INSETS debug info
4256 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
4257 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
4259 * src/commandtags.h:
4260 * src/LyXAction.C: insert code for InsetTabular.
4262 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
4263 not Button1MotionMask.
4264 (workAreaButtonRelease): send always a InsetButtonRelease event to
4266 (checkInsetHit): some setCursor fixes (always with insets).
4268 * src/BufferView2.C (lockInset): returns a bool now and extended for
4269 locking insets inside insets.
4270 (showLockedInsetCursor): it is important to have the cursor always
4271 before the locked inset.
4272 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
4274 * src/BufferView.h: made lockInset return a bool.
4276 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
4278 * src/text2.C (SetCursor): This now has a version with a LyXCursor
4279 that is used also internally but can be called as public to have back
4280 a cursor pos which is not set internally.
4281 (SetCursorIntern): Changed to use above function.
4283 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
4285 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4290 * NEWS: updated for prerelease of 1.1.5. Please comment and send
4291 patches for things that should be in or should be changed.
4293 * src/* [insetfiles]: change "usigned char fragile" to bool
4294 fragile. There was only one point that could that be questioned
4295 and that is commented in formulamacro.C. Grep for "CHECK".
4297 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
4298 (DeleteBuffer): take it out of CutAndPaste and make it static.
4300 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4302 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
4303 output the spacing envir commands. Also the new commands used in
4304 the LaTeX output makes the result better.
4306 * src/Spacing.C (writeEnvirBegin): new method
4307 (writeEnvirEnd): new method
4309 2000-04-18 Juergen Vigna <jug@sad.it>
4311 * src/CutAndPaste.C: made textclass a static member of the class
4312 as otherwise it is not accesed right!!!
4314 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
4316 * forms/layout_forms.fd
4317 * src/layout_forms.h
4318 * src/layout_forms.C (create_form_form_character)
4319 * src/lyx_cb.C (UserFreeFont)
4320 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
4321 documents (in the layout->character popup).
4323 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4325 * src/spellchecker.C (create_ispell_pipe): fix a bug where
4326 \spell_command was in fact not honored (from Kevin Atkinson).
4328 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
4331 * src/lyx_gui.h: make lyxViews private (Angus)
4333 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
4335 * src/mathed/math_write.C
4336 (MathMatrixInset::Write) Put \protect before \begin{array} and
4337 \end{array} if fragile
4338 (MathParInset::Write): Put \protect before \\ if fragile
4340 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4342 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
4343 initialization if the LyXColorHandler must be done after the
4344 connections to the XServer has been established.
4346 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
4347 get the background pixel from the lyxColorhandler so that the
4348 figures are rendered with the correct background color.
4349 (NextToken): removed functions.
4350 (GetPSSizes): use ifs >> string instead of NextToken.
4352 * src/Painter.[Ch]: the color cache moved out of this file.
4354 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
4357 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4359 * src/WorkArea.C (work_area_handler): call BufferView::enterView
4360 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
4362 * src/BufferView.C (enterView): new func
4363 (leaveView): new func
4365 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
4367 (leaveView): new func, undefines xterm cursor when approp.
4369 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
4370 (AllowInput): delete the Workarea cursor handling from this func.
4372 * src/Painter.C (underline): draw a slimer underline in most cases.
4374 * src/lyx_main.C (error_handler): use extern "C"
4376 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4378 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
4379 sent directly to me.
4381 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
4382 to the list by Dekel.
4384 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
4387 * src/bufferview_funcs.[Ch]: two new files, moved several of the
4388 methods from lyx_cb.here.
4390 * src/lyx_cb.C: in addition to the above; removed input_prohibited
4393 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4395 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
4396 instead of using current_view directly.
4398 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
4400 * src/LyXAction.C (init): add the paragraph-spacing command.
4402 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
4404 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
4406 * src/lyx_cb.C (CurrentState): output a string when the spacing is
4407 different from the documents.
4409 * src/text.C (SetHeightOfRow): take paragraph spacing into
4410 account, paragraph spacing takes precedence over buffer spacing
4411 (GetVisibleRow): ditto
4413 * src/paragraph.C (writeFile): output the spacing parameter too.
4414 (validate): set the correct features if spacing is used in the
4416 (Clear): set spacing to default
4417 (MakeSameLayout): spacing too
4418 (HasSameLayout): spacing too
4419 (SetLayout): spacing too
4420 (TeXOnePar): output the spacing commands
4422 * src/lyxparagraph.h: added a spacing variable for use with
4423 per-paragraph spacing.
4425 * src/Spacing.h: add a Default spacing and a method to check if
4426 the current spacing is default. also added an operator==
4428 * src/text2.C (DeleteEmptyParagraphMechanism): added a
4431 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4433 * src/lyxserver.C (callback): fix dispatch of functions
4435 * src/insets/insetlatexaccent.C (checkContents): turn bogus
4436 printf() into lyxerr call.
4438 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
4441 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
4442 "Table" to "Table Box", "Float" to "Floating Material"; deletes
4443 the "Float" from each of the subitems.
4444 (ShowHelpMenu): add entry for "FAQ" and "TOC".
4446 * src/support/DebugStream.h: add an #ifdef to work around a gcc
4447 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
4448 documented the change so that the workaround can be nuked later.
4450 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
4453 * src/lyxlex_pimpl.C (next): do not re-declare the default value
4455 * src/buffer.C (getLatexName): ditto
4456 (setReadonly): ditto
4458 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4460 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
4461 avoid some uses of current_view. Added also a bufferParams()
4462 method to get at this.
4464 * src/lyxtext.h: changed params->buffer and paramters->bparams.
4466 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4468 * src/lyxparagraph.[Ch]: removed
4469 operator<(LyXParagraph::InsetTable..., added a struct matchIT
4470 with operators used by lower_bound and
4471 upper_bound in InsetTable's
4472 Make struct InsetTable private again. Used matchpos.
4474 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
4476 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
4477 document, the language of existing text is changed (unless the
4478 document is multi-lingual)
4480 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
4482 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
4484 * A lot of files: A rewrite of the Right-to-Left support.
4486 2000-04-10 Juergen Vigna <jug@sad.it>
4488 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
4489 misplaced cursor when inset in inset is locked.
4491 * src/insets/insettext.C (LocalDispatch): small fix so that a
4492 BREAKLINE is not inserted if we don't permit it with autBreakRows.
4494 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
4495 footnote font should be decreased in size twice when displaying.
4497 * src/insets/insettext.C (GetDrawFont): inserted this function as
4498 the drawing-font may differ from the real paragraph font.
4500 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
4501 insets (inset in inset!).
4503 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
4504 function here because we don't want footnotes inside footnotes.
4506 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
4508 (init): now set the inset_owner in paragraph.C
4509 (LocalDispatch): added some resetPos() in the right position
4512 (pasteSelection): changed to use the new CutAndPaste-Class.
4514 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
4515 which tells if it is allowed to insert another inset inside this one.
4517 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
4518 SwitchLayoutsBetweenClasses.
4520 * src/text2.C (InsertInset): checking of the new paragraph-function
4522 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
4523 is not needed anymore here!
4526 (PasteSelection): redone (also with #ifdef) so that now this uses
4527 the CutAndPaste-Class.
4528 (SwitchLayoutsBetweenClasses): removed here and implemented in the
4531 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
4532 from/to text/insets.
4534 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
4535 so that the paragraph knows if it is inside an (text)-inset.
4536 (InsertFromMinibuffer): changed return-value to bool as now it
4537 may happen that an inset is not inserted in the paragraph.
4538 (InsertInsetAllowed): this checks if it is allowed to insert an
4539 inset in this paragraph.
4541 (BreakParagraphConservative):
4542 (BreakParagraph) : small change for the above change of the return
4543 value of InsertFromMinibuffer.
4545 * src/lyxparagraph.h: added inset_owner and the functions to handle
4546 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
4548 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4550 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
4551 functions from BufferView to BufferView::Pimpl to ease maintence.
4553 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
4554 correctly. Also use SetCursorIntern instead of SetCursor.
4556 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
4559 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4561 * src/WorkArea.C (belowMouse): manually implement below mouse.
4563 * src/*: Add "explicit" on several constructors, I added probably
4564 some unneeded ones. A couple of changes to code because of this.
4566 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
4567 implementation and private parts from the users of BufferView. Not
4570 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
4571 implementation and private parts from the users of LyXLex. Not
4574 * src/BufferView_pimpl.[Ch]: new files
4576 * src/lyxlex_pimpl.[Ch]: new files
4578 * src/LyXView.[Ch]: some inline functions move out-of-line
4580 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4582 * src/lyxparagraph.h: make struct InsetTable public.
4584 * src/support/lyxstring.h: change lyxstring::difference_type to be
4585 ptrdiff_t. Add std:: modifiers to streams.
4587 * src/font.C: include the <cctype> header, for islower() and
4590 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4592 * src/font.[Ch]: new files. Contains the metric functions for
4593 fonts, takes a LyXFont as parameter. Better separation of concepts.
4595 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
4596 changes because of this.
4598 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
4600 * src/*: compile with -Winline and move functions that don't
4603 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
4606 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4608 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
4609 (various files changed because of this)
4611 * src/Painter.C (text): fixed the drawing of smallcaps.
4613 * src/lyxfont.[Ch] (drawText): removed unused member func.
4616 * src/*.C: added needed "using" statements and "std::" qualifiers.
4618 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4620 * src/*.h: removed all use of "using" from header files use
4621 qualifier std:: instead.
4623 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4625 * src/text.C (Backspace): some additional cleanups (we already
4626 know whether cursor.pos is 0 or not).
4628 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
4629 automake does not provide one).
4631 * src/bmtable.h: replace C++ comments with C comments.
4633 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
4635 * src/screen.C (ShowCursor): Change the shape of the cursor if
4636 the current language is not equal to the language of the document.
4637 (If the cursor change its shape unexpectedly, then you've found a bug)
4639 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
4642 * src/insets/insetnumber.[Ch]: New files.
4644 * src/LyXAction.C (init)
4645 * src/lyxfunc.C (dispatch): Add command number-inset-insert
4648 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
4650 * src/lyxparagraph.h
4651 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
4652 (the vector is kept sorted).
4654 * src/text.C (GetVisibleRow): Draw selection correctly when there
4655 is both LTR and RTL text.
4657 * src/paragraph.C (Clone): Use the assignment operator for cloning,
4658 which is much faster.
4660 * src/text.C (GetVisibleRow and other): Do not draw the last space
4661 in a row if the direction of the last letter is not equal to the
4662 direction of the paragraph.
4664 * src/lyxfont.C (latexWriteStartChanges):
4665 Check that font language is not equal to basefont language.
4666 (latexWriteEndChanges): ditto
4668 * src/lyx_cb.C (StyleReset): Don't change the language while using
4669 the font-default command.
4671 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
4672 empty paragraph before a footnote.
4674 * src/insets/insetcommand.C (draw): Increase x correctly.
4676 * src/screen.C (ShowCursor): Change cursor shape if
4677 current language != document language.
4679 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
4681 2000-03-31 Juergen Vigna <jug@sad.it>
4683 * src/paragraph.C (GetInset): commented out text[pos] = ' '
4684 (Clone): changed mode how the paragraph-data is copied to the
4685 new clone-paragraph.
4687 * src/lyxfunc.C (Dispatch): fixed small problem when calling
4688 GetInset(pos) with no inset anymore there (in inset UNDO)
4690 * src/insets/insetcommand.C (draw): small fix as here x is
4691 incremented not as much as width() returns (2 before, 2 behind = 4)
4693 2000-03-30 Juergen Vigna <jug@sad.it>
4695 * src/insets/insettext.C (InsetText): small fix in initialize
4696 widthOffset (should not be done in the init() function)
4698 2000-03-29 Amir Karger <karger@lyx.org>
4700 * lib/examples/it_ItemizeBullets.lyx: translation by
4703 * Implemented \textasciitilde and fixed a tiny bug in reLyX
4705 2000-03-29 Juergen Vigna <jug@sad.it>
4707 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
4709 * src/insets/insetfoot.C (Clone): small change as for the below
4710 new init function in the text-inset
4712 * src/insets/insettext.C (init): new function as I've seen that
4713 clone did not copy the Paragraph-Data!
4714 (LocalDispatch): Added code so that now we have some sort of Undo
4715 functionality (well actually we HAVE Undo ;)
4717 * src/text.C (Backspace): Small fix for the a | a Backspace problem
4719 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
4721 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
4724 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4726 * src/main.C: added a runtime check that verifies that the xforms
4727 header used when building LyX and the library used when running
4728 LyX match. Exit with a message if they don't match. This is a
4729 version number check only.
4731 * src/buffer.C (save): Don't allocate memory on the heap for
4732 struct utimbuf times.
4734 * *: some using changes, use iosfwd instead of the real headers.
4736 * src/lyxfont.C use char const * instead of string for the static
4737 strings. Rewrite some functions to use sstream.
4739 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4741 * src/text.C (Backspace): hopefully fix the dreaded backaspace
4744 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4746 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
4747 of Geodesy (from Martin Vermeer)
4749 * lib/layouts/svjour.inc: include file for the Springer svjour
4750 class. It can be used to support journals other than JoG.
4752 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
4753 Miskiewicz <misiek@pld.org.pl>)
4754 * lib/reLyX/Makefile.am: ditto.
4756 2000-03-27 Juergen Vigna <jug@sad.it>
4758 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
4759 also some modifications with operations on selected text.
4761 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
4762 problems with clicking on insets (last famous words ;)
4764 * src/insets/insetcommand.C (draw):
4765 (width): Changed to have a bit of space before and after the inset so
4766 that the blinking cursor can be seen (otherwise it was hidden)
4768 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4770 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
4771 would not be added to the link list when an installed gettext (not
4772 part of libc) is found.
4774 2000-03-24 Juergen Vigna <jug@sad.it>
4776 * src/insets/insetcollapsable.C (Edit):
4777 * src/mathed/formula.C (InsetButtonRelease):
4778 (InsetButtonPress): fixed for new handling of ButtonPress/Release
4781 * src/BufferView.C (workAreaButtonPress):
4782 (workAreaButtonRelease):
4783 (checkInsetHit): Finally fixed the clicking on insets be handled
4786 * src/insets/insetert.C (Edit): inserted this call so that ERT
4787 insets work always with LaTeX-font
4789 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
4791 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
4792 caused lyx to startup with no GUI in place, causing in a crash
4793 upon startup when called with arguments.
4795 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4797 * src/FontLoader.C: better initialization of dummyXFontStruct.
4799 2000-03-20 José Abílio Matos <jamatos@lyx.org>
4801 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
4802 for linuxdoc and docbook import and export format options.
4804 * lib/lyxrc.example Example of default values for the previous flags.
4806 * src/lyx_cb.C Use those flags instead of the hardwired values for
4807 linuxdoc and docbook export.
4809 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
4812 * src/menus.C Added menus entries for the new import/exports formats.
4814 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4816 * src/lyxrc.*: Added support for running without Gui
4819 * src/FontLoader.C: sensible defaults if no fonts are needed
4821 * src/lyx_cb.C: New function ShowMessage (writes either to the
4822 minibuffer or cout in case of no gui
4823 New function AskOverwrite for common stuff
4824 Consequently various changes to call these functions
4826 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
4827 wild guess at sensible screen resolution when having no gui
4829 * src/lyxfont.C: no gui, no fonts... set some defaults
4831 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4833 * src/LColor.C: made the command inset background a bit lighter.
4835 2000-03-20 Hartmut Goebel <goebel@noris.net>
4837 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
4838 stdstruct.inc. Koma-Script added some title elements which
4839 otherwise have been listed below "bibliography". This split allows
4840 adding title elements to where they belong.
4842 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
4843 define the additional tilte elements and then include
4846 * many other layout files: changed to include stdtitle.inc just
4847 before stdstruct.inc.
4849 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
4851 * src/buffer.C: (save) Added the option to store all backup files
4852 in a single directory
4854 * src/lyxrc.[Ch]: Added variable \backupdir_path
4856 * lib/lyxrc.example: Added descriptions of recently added variables
4858 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
4859 bibtex inset, not closing the bibtex popup when deleting the inset)
4861 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4863 * src/lyx_cb.C: add a couple using directives.
4865 2000-03-17 José Abílio Matos <jamatos@lyx.org>
4866 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
4867 import based on the filename.
4869 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
4870 file would be imported at start, if the filename where of a sgml file.
4872 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
4874 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
4876 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
4877 * src/lyxfont.h Replaced the member variable bits.direction by the
4878 member variable lang. Made many changes in other files.
4879 This allows having a multi-lingual document
4881 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
4882 that change the current language to <l>.
4883 Removed the command "font-rtl"
4885 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
4886 format for Hebrew documents)
4888 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
4889 When auto_mathmode is "true", pressing a digit key in normal mode
4890 will cause entering into mathmode.
4891 If auto_mathmode is "rtl" then this behavior will be active only
4892 when writing right-to-left text.
4894 * src/text2.C (InsertStringA) The string is inserted using the
4897 * src/paragraph.C (GetEndLabel) Gives a correct result for
4898 footnote paragraphs.
4900 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
4902 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4904 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
4905 front of PasteParagraph. Never insert a ' '. This should at least
4906 fix some cause for the segfaults that we have been experiencing,
4907 it also fixes backspace behaviour slightly. (Phu!)
4909 * src/support/lstrings.C (compare_no_case): some change to make it
4910 compile with gcc 2.95.2 and stdlibc++-v3
4912 * src/text2.C (MeltFootnoteEnvironment): change type o
4913 first_footnote_par_is_not_empty to bool.
4915 * src/lyxparagraph.h: make text private. Changes in other files
4917 (fitToSize): new function
4918 (setContentsFromPar): new function
4919 (clearContents): new function
4920 (SetChar): new function
4922 * src/paragraph.C (readSimpleWholeFile): deleted.
4924 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
4925 the file, just use a simple string instead. Also read the file in
4926 a more maintainable manner.
4928 * src/text2.C (InsertStringA): deleted.
4929 (InsertStringB): deleted.
4931 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4933 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
4934 RedoParagraphs from the doublespace handling part, just set status
4935 to NEED_MORE_REFRESH. Also don't update cursor position (should be
4936 done, but perhaps not like this.)
4938 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4940 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
4941 character when inserting an inset.
4943 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4945 * src/bufferparams.C (readLanguage): now takes "default" into
4948 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
4949 also initialize the toplevel_keymap with the default bindings from
4952 * src/buffer.C (Buffer): remove lyxrc from the parameters.
4954 * all files using lyxrc: have lyxrc as a real variable and not a
4955 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
4958 * src/lyxrc.C: remove double call to defaultKeyBindings
4960 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
4961 toolbar defauls using lyxlex. Remove enums, structs, functions
4964 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
4965 toolbar defaults. Also store default keybindings in a map.
4967 * src/ToolbarDefaults.[Ch]: New file. This class is used for
4968 storing the toolbar defaults without any xforms dependencies.
4970 * src/insets/figinset.C: patch posted to list by Andre Poenitz
4971 applied. Changed to use iterators.
4973 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
4975 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
4976 systems that don't have LINGUAS set to begin with.
4978 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4980 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
4981 the list by Dekel Tsur.
4983 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4985 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
4986 * src/insets/form_graphics.C: ditto.
4988 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
4990 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4992 * src/bufferparams.C (readLanguage): use the new language map
4994 * src/intl.C (InitKeyMapper): use the new language map
4996 * src/lyx_gui.C (create_forms): use the new language map
4998 * src/language.[Ch]: New files. Used for holding the information
4999 about each language. Now! Use this new language map enhance it and
5000 make it really usable for our needs.
5002 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
5004 * screen.C (ShowCursor): Removed duplicate code.
5005 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5006 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
5008 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
5011 * src/text.C Added TransformChar method. Used for rendering Arabic
5012 text correctly (change the glyphs of the letter according to the
5013 position in the word)
5018 * src/lyxrc.C Added lyxrc command {language_command_begin,
5019 language_command_end,language_command_ltr,language_command_rtl,
5020 language_package} which allows the use of either arabtex or Omega
5023 * src/lyx_gui.C (init)
5025 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
5026 to use encoding for menu fonts which is different than the encoding
5029 * src/buffer.C (makeLaTeXFile): If params.language = "default",
5030 do not load the babel package.
5031 To write an English document with Hebrew/Arabic, change the document
5032 language to "english".
5034 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
5035 (alphaCounter): changed to return char
5036 (loweralphaCounter, hebrewCounter, romanCounter): New functions
5038 * lib/lyxrc.example Added examples for Hebrew/Arabic
5041 * src/layout.C Added layout command endlabeltype
5043 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
5045 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
5047 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5049 * src/mathed/math_delim.C (search_deco): return a
5050 math_deco_struct* instead of index.
5052 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5054 * All files with a USE_OSTREAM_ONLY within: removed all code that
5055 was unused when USE_OSTREAM_ONLY is defined.
5057 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
5058 of any less. Removed header and using.
5060 * src/text.C (GetVisibleRow): draw the string "Page Break
5061 (top/bottom)" on screen when drawing a pagebreak line.
5063 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5065 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
5067 * src/mathed/math_macro.C (draw): do some cast magic.
5070 * src/mathed/math_defs.h: change byte* argument to byte const*.
5072 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
5074 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
5075 know it is right to return InsetFoot* too, but cxx does not like
5078 * src/insets/insetcollapsable.[Ch] (Clone): make const.
5080 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
5082 * src/mathed/math_delim.C: change == to proper assignment.
5084 2000-03-09 Juergen Vigna <jug@sad.it>
5086 * src/insets/insettext.C (setPos): fixed various cursor positioning
5087 problems (via mouse and cursor-keys)
5088 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
5089 inset (still a small display problem but it works ;)
5091 * src/insets/insetcollapsable.C (draw): added button_top_y and
5092 button_bottom_y to have correct values for clicking on the inset.
5094 * src/support/lyxalgo.h: commented out 'using std::less'
5096 2000-03-08 Juergen Vigna <jug@sad.it>
5098 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
5099 Button-Release event closes as it is alos the Release-Event
5102 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
5104 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5106 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
5107 can add multiple spaces in Scrap (literate programming) styles...
5108 which, by the way, is how I got hooked on LyX to begin with.
5110 * src/mathed/formula.C (Write): Added dummy variable to an
5111 inset::Latex() call.
5112 (Latex): Add free_spacing boolean to inset::Latex()
5114 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
5116 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
5117 virtual function to include the free_spacing boolean from
5118 the containing paragraph's style.
5120 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
5121 Added free_spacing boolean arg to match inset.h
5123 * src/insets/insettext.C, src/insets/insettext.h (Latex):
5124 Added free_spacing boolean arg to match inset.h
5126 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
5127 Added free_spacing boolean and made sure that if in a free_spacing
5128 paragraph, that we output normal space if there is a protected space.
5130 * src/insets/insetref.C, src/insets/insetref.h (Latex):
5131 Added free_spacing boolean arg to match inset.h
5133 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
5134 Added free_spacing boolean arg to match inset.h
5136 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
5137 Added free_spacing boolean arg to match inset.h
5139 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
5140 Added free_spacing boolean arg to match inset.h
5142 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
5143 Added free_spacing boolean arg to match inset.h
5145 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
5146 free_spacing boolean arg to match inset.h
5148 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
5149 Added free_spacing boolean arg to match inset.h
5151 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
5152 Added free_spacing boolean arg to match inset.h
5154 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
5155 Added free_spacing boolean arg to match inset.h
5157 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
5158 Added free_spacing boolean arg to match inset.h
5160 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
5161 Added free_spacing boolean arg to match inset.h
5163 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
5164 free_spacing boolean arg to match inset.h
5166 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
5167 free_spacing boolean arg to match inset.h
5169 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
5170 ignore free_spacing paragraphs. The user's spaces are left
5173 * src/text.C (InsertChar): Fixed the free_spacing layout
5174 attribute behavior. Now, if free_spacing is set, you can
5175 add multiple spaces in a paragraph with impunity (and they
5176 get output verbatim).
5177 (SelectSelectedWord): Added dummy argument to inset::Latex()
5180 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
5183 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
5184 paragraph layouts now only input a simple space instead.
5185 Special character insets don't make any sense in free-spacing
5188 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
5189 hard-spaces in the *input* file to simple spaces if the layout
5190 is free-spacing. This converts old files which had to have
5191 hard-spaces in free-spacing layouts where a simple space was
5193 (writeFileAscii): Added free_spacing check to pass to the newly
5194 reworked inset::Latex(...) methods. The inset::Latex() code
5195 ensures that hard-spaces in free-spacing paragraphs get output
5196 as spaces (rather than "~").
5198 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5200 * src/mathed/math_delim.C (draw): draw the empty placeholder
5201 delims with a onoffdash line.
5202 (struct math_deco_compare): struct that holds the "functors" used
5203 for the sort and the binary search in math_deco_table.
5204 (class init_deco_table): class used for initial sort of the
5206 (search_deco): use lower_bound to do a binary search in the
5209 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5211 * src/lyxrc.C: a small secret thingie...
5213 * src/lyxlex.C (printTable): changed to take a ostream as paramter
5214 and to not flush the stream as often as it used to.
5216 * src/support/lyxalgo.h: new file
5217 (sorted): template function used for checking if a sequence is
5218 sorted or not. Two versions with and without user supplied
5219 compare. Uses same compare as std::sort.
5221 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
5222 it and give warning on lyxerr.
5224 (struct compare_tags): struct with function operators used for
5225 checking if sorted, sorting and lower_bound.
5226 (search_kw): use lower_bound instead of manually implemented
5229 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5231 * src/insets/insetcollapsable.h: fix Clone() declaration.
5232 * src/insets/insetfoot.h: ditto.
5234 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
5236 2000-03-08 Juergen Vigna <jug@sad.it>
5238 * src/insets/lyxinset.h: added owner call which tells us if
5239 this inset is inside another inset. Changed also the return-type
5240 of Editable to an enum so it tells clearer what the return-value is.
5242 * src/insets/insettext.C (computeTextRows): fixed computing of
5243 textinsets which split automatically on more rows.
5245 * src/insets/insetert.[Ch]: changed this to be of BaseType
5248 * src/insets/insetfoot.[Ch]: added footnote inset
5250 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
5251 collapsable insets (like footnote, ert, ...)
5253 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5255 * src/lyxdraw.h: remvoe file
5257 * src/lyxdraw.C: remove file
5259 * src/insets/insettext.C: added <algorithm>.
5261 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5263 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
5264 (matrix_cb): case MM_OK use string stream
5266 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
5269 * src/mathed/math_macro.C (draw): use string stream
5270 (Metrics): use string stream
5272 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
5273 directly to the ostream.
5275 * src/vspace.C (asString): use string stream.
5276 (asString): use string stream
5277 (asLatexString): use string stream
5279 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
5280 setting Spacing::Other.
5282 * src/LaTeXFeatures.C (getPackages): use string stream instead of
5283 sprintf when creating the stretch vale.
5285 * src/text2.C (alphaCounter): changed to return a string and to
5286 not use a static variable internally. Also fixed a one-off bug.
5287 (SetCounter): changed the drawing of the labels to use string
5288 streams instead of sprintf.
5290 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
5291 manipulator to use a scheme that does not require library support.
5292 This is also the way it is done in the new GNU libstdc++. Should
5293 work with DEC cxx now.
5295 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5297 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
5298 end. This fixes a bug.
5300 * src/mathed (all files concerned with file writing): apply the
5301 USE_OSTREAM_ONLY changes to mathed too.
5303 * src/support/DebugStream.h: make the constructor explicit.
5305 * src/lyxfont.C (latexWriteStartChanges): small bug related to
5306 count and ostream squashed.
5308 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5310 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
5312 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
5313 ostringstream uses STL strings, and we might not.
5315 * src/insets/insetspecialchar.C: add using directive.
5316 * src/insets/insettext.C: ditto.
5318 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5320 * lib/layouts/seminar.layout: feeble attempt at a layout for
5321 seminar.cls, far from completet and could really use some looking
5322 at from people used to write layout files.
5324 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
5325 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
5326 a lot nicer and works nicely with ostreams.
5328 * src/mathed/formula.C (draw): a slightly different solution that
5329 the one posted to the list, but I think this one works too. (font
5330 size wrong in headers.)
5332 * src/insets/insettext.C (computeTextRows): some fiddling on
5333 Jürgens turf, added some comments that he should read.
5335 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
5336 used and it gave compiler warnings.
5337 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
5340 * src/lyx_gui.C (create_forms): do the right thing when
5341 show_banner is true/false.
5343 * src/lyx_cb.C (TimerCB): no need to close or do anything if
5344 show_banner is false.
5346 * most file writing files: Now use iostreams to do almost all of
5347 the writing. Also instead of passing string &, we now use
5348 stringstreams. mathed output is still not adapted to iostreams.
5349 This change can be turned off by commenting out all the occurences
5350 of the "#define USE_OSTREAM_ONLY 1" lines.
5352 * src/WorkArea.C (createPixmap): don't output debug messages.
5353 (WorkArea): don't output debug messages.
5355 * lib/lyxrc.example: added a comment about the new variable
5358 * development/Code_rules/Rules: Added some more commente about how
5359 to build class interfaces and on how better encapsulation can be
5362 2000-03-03 Juergen Vigna <jug@sad.it>
5364 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
5365 automatically with the width of the LyX-Window
5367 * src/insets/insettext.C (computeTextRows): fixed update bug in
5368 displaying text-insets (scrollvalues where not initialized!)
5370 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5372 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
5373 id in the check of the result from lower_bound is not enough since
5374 lower_bound can return last too, and then res->id will not be a
5377 * all insets and some code that use them: I have conditionalized
5378 removed the Latex(string & out, ...) this means that only the
5379 Latex(ostream &, ...) will be used. This is a work in progress to
5380 move towards using streams for all output of files.
5382 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
5385 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5387 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
5388 routine (this fixes bug where greek letters were surrounded by too
5391 * src/support/filetools.C (findtexfile): change a bit the search
5392 algorithm, to fix bug introduced in 1.1.4. Note that --format is
5393 no longer passed to kpsewhich, we may have to change that later.
5395 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
5396 warning options to avoid problems with X header files (from Angus
5398 * acinclude.m4: regenerated.
5400 2000-03-02 Juergen Vigna <jug@sad.it>
5402 * src/insets/insettext.C (WriteParagraphData): Using the
5403 par->writeFile() function for writing paragraph-data.
5404 (Read): Using buffer->parseSingleLyXformat2Token()-function
5405 for parsing paragraph data!
5407 * src/buffer.C (readLyXformat2): removed all parse data and using
5408 the new parseSingleLyXformat2Token()-function.
5409 (parseSingleLyXformat2Token): added this function to parse (read)
5410 lyx-file-format (this is called also from text-insets now!)
5412 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5414 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
5417 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
5418 directly instead of going through a func. One very bad thing: a
5419 static LyXFindReplace, but I don't know where to place it.
5421 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
5422 string instead of char[]. Also changed to static.
5423 (GetSelectionOrWordAtCursor): changed to static inline
5424 (SetSelectionOverLenChars): ditto.
5426 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
5427 current_view and global variables. both classes has changed names
5428 and LyXFindReplace is not inherited from SearchForm.
5430 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
5431 fl_form_search form.
5433 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
5435 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5437 * lib/bind/*.bind: make sure 'buffer-previous' function is not
5438 bound (from Kayvan).
5440 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
5442 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
5444 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5446 * some things that I should comment but the local pub says head to
5449 * comment out all code that belongs to the Roff code for Ascii
5450 export of tables. (this is unused)
5452 * src/LyXView.C: use correct type for global variable
5453 current_layout. (LyXTextClass::size_type)
5455 * some code to get the new insetgraphics closer to working I'd be
5456 grateful for any help.
5458 * src/BufferView2.C (insertInset): use the return type of
5459 NumberOfLayout properly. (also changes in other files)
5461 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
5462 this as a test. I want to know what breaks because of this.
5464 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
5466 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
5468 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
5469 to use a \makebox in the label, this allows proper justification
5470 with out using protected spaces or multiple hfills. Now it is
5471 "label" for left justified, "\hfill label\hfill" for center, and
5472 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
5473 should be changed accordingly.
5475 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5477 * src/lyxtext.h: change SetLayout() to take a
5478 LyXTextClass::size_type instead of a char (when there is more than
5479 127 layouts in a class); also change type of copylayouttype.
5480 * src/text2.C (SetLayout): ditto.
5481 * src/LyXView.C (updateLayoutChoice): ditto.
5483 * src/LaTeX.C (scanLogFile): errors where the line number was not
5484 given just after the '!'-line were ignored (from Dekel Tsur).
5486 * lib/lyxrc.example: fix description of \date_insert_format
5488 * lib/layouts/llncs.layout: new layout, contributed by Martin
5491 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5493 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
5494 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
5495 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
5496 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
5497 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
5498 paragraph.C, text.C, text2.C)
5500 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5502 * src/insets/insettext.C (LocalDispatch): remove extra break
5505 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
5506 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
5508 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
5509 * src/insets/insettext.[Ch] (GetCursorPos): ditto
5511 * src/insets/insetbib.h: move InsetBibkey::Holder and
5512 InsetCitation::Holder in public space.
5514 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5516 * src/insets/insettext.h: small change to get the new files from
5517 Juergen to compile (use "string", not "class string").
5519 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
5520 const & as parameter to LocalDispatch, use LyXFont const & as
5521 paramter to some other func. This also had impacto on lyxinsets.h
5522 and the two mathed insets.
5524 2000-02-24 Juergen Vigna <jug@sad.it>
5527 * src/commandtags.h:
5529 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
5533 * src/BufferView2.C: added/updated code for various inset-functions
5535 * src/insets/insetert.[Ch]: added implementation of InsetERT
5537 * src/insets/insettext.[Ch]: added implementation of InsetText
5539 * src/insets/inset.C (Edit): added "unsigned int button" parameter
5540 (draw): added preliminary code for inset scrolling not finshed yet
5542 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
5543 as it is in lyxfunc.C now
5545 * src/insets/lyxinset.h: Added functions for text-insets
5547 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5549 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
5550 BufferView and reimplement the list as a queue put inside its own
5553 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
5555 * several files: use the new interface to the "updateinsetlist"
5557 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
5559 (work_area_handler): call BufferView::trippleClick on trippleclick.
5561 * src/BufferView.C (doubleClick): new function, selects word on
5563 (trippleClick): new function, selects line on trippleclick.
5565 2000-02-22 Allan Rae <rae@lyx.org>
5567 * lib/bind/xemacs.bind: buffer-previous not supported
5569 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5571 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
5574 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5576 * src/bufferlist.C: get rid of current_view from this file
5578 * src/spellchecker.C: get rid of current_view from this file
5580 * src/vspace.C: get rid of current_view from this file
5581 (inPixels): added BufferView parameter for this func
5582 (asLatexCommand): added a BufferParams for this func
5584 * src/text.C src/text2.C: get rid of current_view from these
5587 * src/lyxfont.C (getFontDirection): move this function here from
5590 * src/bufferparams.C (getDocumentDirection): move this function
5593 * src/paragraph.C (getParDirection): move this function here from
5595 (getLetterDirection): ditto
5597 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5599 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
5600 resize due to wrong pixmap beeing used. Also took the opurtunity
5601 to make the LyXScreen stateless on regard to WorkArea and some
5602 general cleanup in the same files.
5604 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5606 * src/Makefile.am: add missing direction.h
5608 * src/PainterBase.h: made the width functions const.
5610 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
5613 * src/insets/insetcommand.C (draw): draw Editable as buttons.
5615 * src/insets/insetlatexaccent.C (draw): make the accents draw
5616 better, at present this will only work well with iso8859-1.
5618 * several files: remove the old drawing code, now we use the new
5621 * several files: remove support for mono_video, reverse_video and
5624 2000-02-17 Juergen Vigna <jug@sad.it>
5626 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
5627 int ** as we have to return the pointer, otherwise we have only
5628 NULL pointers in the returning function.
5630 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5632 * src/LaTeX.C (operator()): quote file name when running latex.
5634 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5636 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
5637 (bubble tip), this removes our special handling of this.
5639 * Remove all code that is unused now that we have the new
5640 workarea. (Code that are not active when NEW_WA is defined.)
5642 * Make the uses of XSync not conditionalized on define USE_XSYNC.
5644 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5646 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
5647 nonexisting layout; correctly redirect obsoleted layouts.
5649 * lib/lyxrc.example: document \view_dvi_paper_option
5651 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
5654 * src/lyx_cb.C (RunScript): handle $$FName for command names.
5655 (PreviewDVI): handle the view_dvi_paper_option variable.
5656 [Both from Roland Krause]
5658 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5660 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
5661 char const *, int, LyXFont)
5662 (text(int, int, string, LyXFont)): ditto
5664 * src/text.C (InsertCharInTable): attempt to fix the double-space
5665 feature in tables too.
5666 (BackspaceInTable): ditto.
5667 (GetVisibleRow): make bottom pagebreak line be a onoff line.
5669 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5671 * src/text2.C (owner): only complain if owner_ is set and bv != 0
5673 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
5674 newly found text in textcache to this.
5675 (buffer): set the owner of the text put into the textcache to 0
5677 * src/insets/figinset.C (draw): fixed the drawing of figures with
5680 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
5681 drawing of mathframe, hfills, protected space, table lines. I have
5682 now no outstanding drawing problems with the new Painter code.
5684 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5686 * src/PainterBase.C (ellipse, circle): do not specify the default
5689 * src/LColor.h: add using directive.
5691 * src/Painter.[Ch]: change return type of methods from Painter& to
5692 PainterBase&. Add a using directive.
5694 * src/WorkArea.C: wrap xforms callbacks in C functions
5697 * lib/layouts/foils.layout: font fix and simplifications from Carl
5700 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5702 * a lot of files: The Painter, LColor and WorkArea from the old
5703 devel branch has been ported to lyx-devel. Some new files and a
5704 lot of #ifdeffed code. The new workarea is enabled by default, but
5705 if you want to test the new Painter and LColor you have to compile
5706 with USE_PAINTER defined (do this in config.h f.ex.) There are
5707 still some rought edges, and I'd like some help to clear those
5708 out. It looks stable (loads and displays the Userguide very well).
5711 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5713 * src/buffer.C (pop_tag): revert to the previous implementation
5714 (use a global variable for both loops).
5716 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
5718 * src/lyxrc.C (LyXRC): change slightly default date format.
5720 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
5721 there is an English text with a footnote that starts with a Hebrew
5722 paragraph, or vice versa.
5723 (TeXFootnote): ditto.
5725 * src/text.C (LeftMargin): allow for negative values for
5726 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
5729 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
5730 for input encoding (cyrillic)
5732 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5734 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
5737 * src/toolbar.C (set): ditto
5738 * src/insets/insetbib.C (create_form_citation_form): ditto
5740 * lib/CREDITS: added Dekel Tsur.
5742 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
5743 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
5744 hebrew supports files from Dekel Tsur.
5746 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
5747 <tzafrir@technion.ac.il>
5749 * src/lyxrc.C: put \date_insert_format at the right place.
5751 * src/buffer.C (makeLaTeXFile): fix the handling of
5752 BufferParams::sides when writing out latex files.
5754 * src/BufferView2.C: add a "using" directive.
5756 * src/support/lyxsum.C (sum): when we use lyxstring,
5757 ostringstream::str needs an additional .c_str().
5759 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5761 * src/support/filetools.C (ChangeExtension): patch from Etienne
5764 * src/TextCache.C (show): remove const_cast and make second
5765 parameter non-const LyXText *.
5767 * src/TextCache.h: use non const LyXText in show.
5769 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
5772 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5774 * src/support/lyxsum.C: rework to be more flexible.
5776 * several places: don't check if a pointer is 0 if you are going
5779 * src/text.C: remove some dead code.
5781 * src/insets/figinset.C: remove some dead code
5783 * src/buffer.C: move the BufferView funcs to BufferView2.C
5784 remove all support for insetlatexdel
5785 remove support for oldpapersize stuff
5786 made some member funcs const
5788 * src/kbmap.C: use a std::list to store the bindings in.
5790 * src/BufferView2.C: new file
5792 * src/kbsequence.[Ch]: new files
5794 * src/LyXAction.C + others: remove all trace of buffer-previous
5796 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
5797 only have one copy in the binary of this table.
5799 * hebrew patch: moved some functions from LyXText to more
5800 appropriate places. (LyXParagraph, BufferParams, LyXFont)
5802 * several files: remove support for XForms older than 0.88
5804 remove some #if 0 #endif code
5806 * src/TextCache.[Ch]: new file. Holds the textcache.
5808 * src/BufferView.C: changes to use the new TextCache interface.
5809 (waitForX): remove the now unused code.
5811 * src/BackStack.h: remove some commented code
5813 * lib/bind/emacs.bind: remove binding for buffer-previous
5815 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5817 * applied the hebrew patch.
5819 * src/lyxrow.h: make sure that all Row variables are initialized.
5821 * src/text2.C (TextHandleUndo): comment out a delete, this might
5822 introduce a memory leak, but should also help us to not try to
5823 read freed memory. We need to look at this one.
5825 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
5826 (LyXParagraph): initalize footnotekind.
5828 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
5829 forgot this when applying the patch. Please heed the warnings.
5831 * src/BufferView.C (buffer): a fix for the buffer-reload problem
5832 (aka. reformat problem)
5834 * src/bufferlist.C (exists): made const, and use const_iterator
5835 (isLoaded): new func.
5836 (release): use std::find to find the correct buffer.
5838 * src/bufferlist.h: made getState a const func.
5839 made empty a const func.
5840 made exists a const func.
5843 2000-02-01 Juergen Vigna <jug@sad.it>
5845 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
5847 * po/it.po: updated a bit the italian po file and also changed the
5848 'file nuovo' for newfile to 'filenuovo' without a space, this did
5851 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
5852 for the new insert_date command.
5854 * src/lyxfunc.C (Dispatch): added support for a insert_date function
5855 from jdblair, to insert a date into the current text conforming to
5856 a strftime format (for now only considering the locale-set and not
5857 the document-language).
5859 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5861 * src/lyxfont.C (textWidth): hopefully better fix for the Array
5862 Bounds Read error seen by purify. The problem was that islower is
5863 a macros which takes an unsigned char and uses it as an index for
5864 in array of characters properties (and is thus subject to the
5868 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
5869 correctly the paper sides radio buttons.
5870 (UpdateDocumentButtons): ditto.
5872 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5874 * src/kbmap.C (getsym + others): change to return unsigned int,
5875 returning a long can give problems on 64 bit systems. (I assume
5876 that int is 32bit on 64bit systems)
5878 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5880 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
5881 LyXLookupString to be zero-terminated. Really fixes problems seen
5884 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5886 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
5887 write a (char*)0 to the lyxerr stream.
5889 * src/lastfiles.C: move algorithm before the using statemets.
5891 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5893 * src/lastfiles.C: move using directives in global scope (egcs 1.x
5894 complains otherwise).
5895 * src/table.C: ditto
5897 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
5900 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
5901 that I removed earlier... It is really needed.
5903 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
5905 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5907 * INSTALL: update xforms home page URL.
5909 * lib/configure.m4: fix a bug with unreadable layout files.
5911 * src/table.C (calculate_width_of_column): add "using std::max"
5914 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5916 * several files: marked several lines with "DEL LINE", this is
5917 lines that can be deleted without changing anything.
5918 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
5919 checks this anyway */
5922 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
5924 * src/DepTable.C (update): add a "+" at the end when the checksum
5925 is different. (debugging string only)
5927 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
5928 the next inset to not be displayed. This should also fix the list
5929 of labels in the "Insert Crossreference" dialog.
5931 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
5933 * src/support/LSubstring.C (LSubstring): set pos to string::npos
5934 when regex was not found.
5936 * src/support/lstrings.C (lowercase): use handcoded transform always.
5939 * src/text.C (Delete): fixed the crash. cursor.par->prev and
5940 old_cursor.par->prev could be 0.
5942 * several files: changed post inc/dec to pre inc/dec
5944 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
5945 write the lastfiles to file.
5947 * src/BufferView.C (buffer): only show TextCache info when debugging
5949 (resizeCurrentBuffer): ditto
5950 (workAreaExpose): ditto
5952 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
5954 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
5956 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
5957 a bit better by removing the special case for \i and \j.
5959 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5961 * src/lyx_main.C (easyParse): remove test for bad comand line
5962 options, since this broke all xforms-related parsing.
5964 * src/kbmap.C (getsym): set return type to unsigned long, as
5965 declared in header. On an alpha, long is _not_ the same as int.
5967 * src/support/LOstream.h: add a "using std::flush;"
5969 * src/insets/figinset.C: ditto.
5971 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5973 * src/bufferlist.C (write): use blinding fast file copy instead of
5974 "a char at a time", now we are doing it the C++ way.
5976 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
5977 std::list<int> instead.
5978 (addpidwait): reflect move to std::list<int>
5979 (sigchldchecker): ditto
5981 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
5984 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
5985 that obviously was wrong...
5987 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
5988 c, this avoids warnings with purify and islower.
5990 * src/insets/figinset.C: rename struct queue to struct
5991 queue_element and rewrite to use a std::queue. gsqueue is now a
5992 std::queue<queue_element>
5993 (runqueue): reflect move to std::queue
5996 * src/support/lstrings.h (tostr): specialize for bool, otherwise
5997 we would get "1" "0" instead of "true" "false. Also make the tostr
6000 2000-01-21 Juergen Vigna <jug@sad.it>
6002 * src/buffer.C (writeFileAscii): Disabled code for special groff
6003 handling of tabulars till I fix this in table.C
6005 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6007 * src/support/mkdir.C (mkdir): change second argument of mkdir to
6009 * src/support/lyxlib.h: ditto.
6011 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6013 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
6014 and 'j' look better. This might fix the "macron" bug that has been
6017 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
6018 functions as one template function. Delete the old versions.
6020 * src/support/lyxsum.C: move using std::ifstream inside
6023 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
6026 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
6028 * src/mathed/formula.C: delete #include "bufferlist.h" never used
6030 * src/insets/figinset.C (InitFigures): use new instead of malloc
6031 to allocate memory for figures and bitmaps.
6032 (DoneFigures): use delete[] instead of free to deallocate memory
6033 for figures and bitmaps.
6034 (runqueue): use new to allocate
6035 (getfigdata): use new/delete[] instead of malloc/free
6036 (RegisterFigure): ditto
6038 * some files: moved some declarations closer to first use, small
6039 whitespace changes use preincrement instead of postincrement where
6040 it does not make a difference.
6042 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
6043 step on the way to use stl::containers for key maps.
6045 * src/bufferlist.h: add a typedef for const_iterator and const
6046 versions of begin and end.
6048 * src/bufferlist.[Ch]: change name of member variable _state to
6049 state_. (avoid reserved names)
6051 (getFileNames): returns the filenames of the buffers in a vector.
6053 * configure.in (ALL_LINGUAS): added ro
6055 * src/support/putenv.C: new file
6057 * src/support/mkdir.C: new file
6059 2000-01-20 Allan Rae <rae@lyx.org>
6061 * lib/layouts/IEEEtran.layout: Added several theorem environments
6063 * lib/templates/IEEEtran.lyx: Example theorem environments and a
6064 couple of minor additions.
6066 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
6067 (except for those in footnotes of course)
6069 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6071 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
6073 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
6074 std::sort and std::lower_bound instead of qsort and handwritten
6076 (struct compara): struct that holds the functors used by std::sort
6077 and std::lower_bound in MathedLookupBOP.
6079 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6081 * src/support/LAssert.h: do not do partial specialization. We do
6084 * src/support/lyxlib.h: note that lyx::getUserName() and
6085 lyx::date() are not in use right now. Should these be suppressed?
6087 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
6088 (makeLinuxDocFile): do not put date and user name in linuxdoc
6091 * src/support/lyxlib.h (kill): change first argument to long int,
6092 since that's what solaris uses.
6094 * src/support/kill.C (kill): fix declaration to match prototype.
6096 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
6097 actually check whether namespaces are supported. This is not what
6100 * src/support/lyxsum.C: add a using directive.
6102 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6104 * src/support/kill.C: if we have namespace support we don't have
6105 to include lyxlib.h.
6107 * src/support/lyxlib.h: use namespace lyx if supported.
6109 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6111 * src/support/date.C: new file
6113 * src/support/chdir.C: new file
6115 * src/support/getUserName.C: new file
6117 * src/support/getcwd.C: new file
6119 * src/support/abort.C: new file
6121 * src/support/kill.C: new file
6123 * src/support/lyxlib.h: moved all the functions in this file
6124 insede struct lyx. Added also kill and abort to this struct. This
6125 is a way to avoid the "kill is not defined in <csignal>", we make
6126 C++ wrappers for functions that are not ANSI C or ANSI C++.
6128 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
6129 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
6130 lyx it has been renamed to sum.
6132 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6134 * src/text.C: add using directives for std::min and std::max.
6136 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6138 * src/texrow.C (getIdFromRow): actually return something useful in
6139 id and pos. Hopefully fixes the bug with positionning of errorbox
6142 * src/lyx_main.C (easyParse): output an error and exit if an
6143 incorrect command line option has been given.
6145 * src/spellchecker.C (ispell_check_word): document a memory leak.
6147 * src/bufferlist.C (write): fix mismatched allocation/deletion,
6148 where a "struct utimbuf" is allocated with "new" and deleted with
6151 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
6153 * src/text2.C (CutSelection): don't delete double spaces.
6154 (PasteSelection): ditto
6155 (CopySelection): ditto
6157 * src/text.C (Backspace): don't delete double spaces.
6159 * src/lyxlex.C (next): fix a bug that were only present with
6160 conformant std::istream::get to read comment lines, use
6161 std::istream::getline instead. This seems to fix the problem.
6163 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6165 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
6166 allowed to insert space before space" editing problem. Please read
6167 commends at the beginning of the function. Comments about usage
6170 * src/text.C (InsertChar): fix for the "not allowed to insert
6171 space before space" editing problem.
6173 * src/text2.C (DeleteEmptyParagraphMechanism): when
6174 IsEmptyTableRow can only return false this last "else if" will
6175 always be a no-op. Commented out.
6177 * src/text.C (RedoParagraph): As far as I can understand tmp
6178 cursor is not really needed.
6180 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
6181 present it could only return false anyway.
6182 (several functions): Did something not so smart...added a const
6183 specifier on a lot of methods.
6185 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
6186 and add a tmp->text.resize. The LyXParagraph constructor does the
6188 (BreakParagraphConservative): ditto
6190 * src/support/path.h (Path): add a define so that the wrong usage
6191 "Path("/tmp") will be flagged as a compilation error:
6192 "`unnamed_Path' undeclared (first use this function)"
6194 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6196 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
6197 which was bogus for several reasons.
6199 * src/LaTeX.C (scanAux): fix the regular expression used to scan
6203 * autogen.sh: do not use "type -path" (what's that anyway?).
6205 * src/support/filetools.C (findtexfile): remove extraneous space
6206 which caused a kpsewhich warning (at least with kpathsea version
6209 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6211 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
6213 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
6215 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
6217 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6219 * src/paragraph.C (BreakParagraph): do not reserve space on text
6220 if we don't need to (otherwise, if pos_end < pos, we end up
6221 reserving huge amounts of memory due to bad unsigned karma).
6222 (BreakParagraphConservative): ditto, although I have not seen
6223 evidence the bug can happen here.
6225 * src/lyxparagraph.h: add a using std::list.
6227 2000-01-11 Juergen Vigna <jug@sad.it>
6229 * src/menus.C (MenuDocu): output an Alert if the documentation-file
6232 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6234 * src/vc-backend.C (doVCCommand): change to be static and take one
6235 more parameter: the path to chdir too be fore executing the command.
6236 (retrive): new function equiv to "co -r"
6238 * src/bufferlist.C (loadLyXFile): implement the missing parts if
6239 file_not_found_hook is true.
6241 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
6243 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
6244 if a file is readwrite,readonly...anything else.
6246 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6248 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
6249 (CreatePostscript): name change from MenuRunDVIPS (or something)
6250 (PreviewPostscript): name change from MenuPreviewPS
6251 (PreviewDVI): name change from MenuPreviewDVI
6253 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
6254 \view_pdf_command., \pdf_to_ps_command
6256 * lib/configure.m4: added search for PDF viewer, and search for
6257 PDF to PS converter.
6258 (lyxrc.defaults output): add \pdflatex_command,
6259 \view_pdf_command and \pdf_to_ps_command.
6261 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
6263 * src/bufferlist.C (write): we don't use blocksize for anything so
6266 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6268 * src/support/block.h: disable operator T* (), since it causes
6269 problems with both compilers I tried. See comments in the file.
6271 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
6274 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
6275 variable LYX_DIR_10x to LYX_DIR_11x.
6277 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
6279 * INSTALL: document --with-lyxname.
6282 * configure.in: new configure flag --with-lyxname which allows to
6283 choose the name under which lyx is installed. Default is "lyx", of
6284 course. It used to be possible to do this with --program-suffix,
6285 but the later has in fact a different meaning for autoconf.
6287 * src/support/lstrings.h (lstrchr): reformat a bit.
6289 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
6290 * src/mathed/math_defs.h: ditto.
6292 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6294 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
6295 true, decides if we create a backup file or not when saving. New
6296 tag and variable \pdf_mode, defaults to false. New tag and
6297 variable \pdflatex_command, defaults to pdflatex. New tag and
6298 variable \view_pdf_command, defaults to xpdf. New tag and variable
6299 \pdf_to_ps_command, defaults to pdf2ps.
6301 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6303 * src/bufferlist.C (close): don't call insetUnlock if the buffer
6304 does not have a BufferView.
6305 (unlockInset): ditto + don't access the_locking_inset if the
6306 buffer does not have a BufferView.
6308 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
6309 certain circumstances so that we don't continue a keyboard
6310 operation long after the key was released. Try f.ex. to load a
6311 large document, press PageDown for some seconds and then release
6312 it. Before this change the document would contine to scroll for
6313 some time, with this change it stops imidiatly.
6315 * src/support/block.h: don't allocate more space than needed. As
6316 long as we don't try to write to the arr[x] in a array_type arr[x]
6317 it is perfectly ok. (if you write to it you might segfault).
6318 added operator value_type*() so that is possible to pass the array
6319 to functions expecting a C-pointer.
6321 * lib/Makefile.am (dist-hook): don't fail completely if unable to
6324 * intl/*: updated to gettext 0.10.35, tried to add our own
6325 required modifications. Please verify.
6327 * po/*: updated to gettext 0.10.35, tried to add our own required
6328 modifications. Please verify.
6330 * src/support/lstrings.C (tostr): go at fixing the problem with
6331 cxx and stringstream. When stringstream is used return
6332 oss.str().c_str() so that problems with lyxstring and basic_string
6333 are avoided. Note that the best solution would be for cxx to use
6334 basic_string all the way, but it is not conformant yet. (it seems)
6336 * src/lyx_cb.C + other files: moved several global functions to
6337 class BufferView, some have been moved to BufferView.[Ch] others
6338 are still located in lyx_cb.C. Code changes because of this. (part
6339 of "get rid of current_view project".)
6341 * src/buffer.C + other files: moved several Buffer functions to
6342 class BufferView, the functions are still present in buffer.C.
6343 Code changes because of this.
6345 * config/lcmessage.m4: updated to most recent. used when creating
6348 * config/progtest.m4: updated to most recent. used when creating
6351 * config/gettext.m4: updated to most recent. applied patch for
6354 * config/gettext.m4.patch: new file that shows what changes we
6355 have done to the local copy of gettext.m4.
6357 * config/libtool.m4: new file, used in creation of acinclude.m4
6359 * config/lyxinclude.m4: new file, this is the lyx created m4
6360 macros, used in making acinclude.m4.
6362 * autogen.sh: GNU m4 discovered as a separate task not as part of
6363 the lib/configure creation.
6364 Generate acinlucde from files in config. Actually cat
6365 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
6366 easier to upgrade .m4 files that really are external.
6368 * src/Spacing.h: moved using std::istringstream to right after
6369 <sstream>. This should fix the problem seen with some compilers.
6371 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6373 * src/lyx_cb.C: began some work to remove the dependency a lot of
6374 functions have on BufferView::text, even if not really needed.
6375 (GetCurrentTextClass): removed this func, it only hid the
6378 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
6379 forgot this in last commit.
6381 * src/Bullet.C (bulletEntry): use static char const *[] for the
6382 tables, becuase of this the return arg had to change to string.
6384 (~Bullet): removed unneeded destructor
6386 * src/BufferView.C (beforeChange): moved from lyx_cb.C
6387 (insetSleep): moved from Buffer
6388 (insetWakeup): moved from Buffer
6389 (insetUnlock): moved from Buffer
6391 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
6392 from Buffer to BufferView.
6394 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
6396 * config/ltmain.sh: updated to version 1.3.4 of libtool
6398 * config/ltconfig: updated to version 1.3.4 of libtool
6400 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6403 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
6404 Did I get that right?
6406 * src/lyxlex.h: add a "using" directive or two.
6407 * src/Spacing.h: ditto.
6408 * src/insets/figinset.C: ditto.
6409 * src/support/filetools.C: ditto.
6410 * src/support/lstrings.C: ditto.
6411 * src/BufferView.C: ditto.
6412 * src/bufferlist.C: ditto.
6413 * src/lyx_cb.C: ditto.
6414 * src/lyxlex.C: ditto.
6416 * NEWS: add some changes for 1.1.4.
6418 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6420 * src/BufferView.C: first go at a TextCache to speed up switching
6423 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6425 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
6426 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
6427 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
6428 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
6431 * src/mathed/math_defs.h (MathedRowSt): make sure that all
6432 members of the struct are correctly initialized to 0 (detected by
6434 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
6435 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
6437 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
6438 pidwait, since it was allocated with "new". This was potentially
6439 very bad. Thanks to Michael Schmitt for running purify for us.
6442 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6444 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
6446 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
6448 1999-12-30 Allan Rae <rae@lyx.org>
6450 * lib/templates/IEEEtran.lyx: minor change
6452 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
6453 src/mathed/formula.C (LocalDispatch): askForText changes
6455 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
6456 know when a user has cancelled input. Fixes annoying problems with
6457 inserting labels and version control.
6459 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6461 * src/support/lstrings.C (tostr): rewritten to use strstream and
6464 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6466 * src/support/filetools.C (IsFileWriteable): use fstream to check
6467 (IsDirWriteable): use fileinfo to check
6469 * src/support/filetools.h (FilePtr): whole class deleted
6471 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
6473 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
6475 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
6477 * src/bufferlist.C (write): use ifstream and ofstream instead of
6480 * src/Spacing.h: use istrstream instead of sscanf
6482 * src/mathed/math_defs.h: change first arg to istream from FILE*
6484 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
6486 * src/mathed/math_parser.C: have yyis to be an istream
6487 (LexGetArg): use istream (yyis)
6489 (mathed_parse): ditto
6490 (mathed_parser_file): first arg istream instead of FILE*, set yyis
6492 * src/mathed/formula.C (Read): rewritten to use istream
6494 * src/mathed/formulamacro.C (Read): rewritten to use istream
6496 * src/lyxlex.h (~LyXLex): deleted desturctor
6497 (getStream): new function, returns an istream
6498 (getFile): deleted funtion
6499 (IsOK): return is.good();
6501 * src/lyxlex.C (LyXLex): delete file and owns_file
6502 (setFile): open an filebuf and assign that to a istream instead of
6504 (setStream): new function, takes an istream as arg.
6505 (setFile): deleted function
6506 (EatLine): rewritten us use istream instead of FILE*
6510 * src/table.C (LyXTable): use istream instead of FILE*
6511 (Read): rewritten to take an istream instead of FILE*
6513 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6515 * src/buffer.C (Dispatch): remove an extraneous break statement.
6517 * src/support/filetools.C (QuoteName): change to do simple
6518 'quoting'. More work is necessary. Also changed to do nothing
6519 under emx (needs fix too).
6520 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
6522 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
6523 config.h.in to the AC_DEFINE_UNQUOTED() call.
6524 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
6525 needs char * as argument (because Solaris 7 declares it like
6528 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
6529 remove definition of BZERO.
6531 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6533 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
6534 defined, "lyxregex.h" if not.
6536 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
6538 (REGEX): new variable that is set to regex.c lyxregex.h when
6539 AM_CONDITIONAL USE_REGEX is set.
6540 (libsupport_la_SOURCES): add $(REGEX)
6542 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
6545 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
6548 * configure.in: add call to LYX_REGEX
6550 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
6551 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
6553 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6555 * lib/bind/fi_menus.bind: new file, from
6556 pauli.virtanen@saunalahti.fi.
6558 * src/buffer.C (getBibkeyList): pass the parameter delim to
6559 InsetInclude::getKeys and InsetBibtex::getKeys.
6561 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
6562 is passed to Buffer::getBibkeyList
6564 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
6565 instead of the hardcoded comma.
6567 * src/insets/insetbib.C (getKeys): make sure that there are not
6568 leading blanks in bibtex keys. Normal latex does not care, but
6569 harvard.sty seems to dislike blanks at the beginning of citation
6570 keys. In particular, the retturn value of the function is
6572 * INSTALL: make it clear that libstdc++ is needed and that gcc
6573 2.7.x probably does not work.
6575 * src/support/filetools.C (findtexfile): make debug message go to
6577 * src/insets/insetbib.C (getKeys): ditto
6579 * src/debug.C (showTags): make sure that the output is correctly
6582 * configure.in: add a comment for TWO_COLOR_ICON define.
6584 * acconfig.h: remove all the entries that already defined in
6585 configure.in or acinclude.m4.
6587 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
6588 to avoid user name, date and copyright.
6590 1999-12-21 Juergen Vigna <jug@sad.it>
6592 * src/table.C (Read): Now read bogus row format informations
6593 if the format is < 5 so that afterwards the table can
6594 be read by lyx but without any format-info. Fixed the
6595 crash we experienced when not doing this.
6597 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6599 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
6600 (RedoDrawingOfParagraph): ditto
6601 (RedoParagraphs): ditto
6602 (RemoveTableRow): ditto
6604 * src/text.C (Fill): rename arg paperwidth -> paper_width
6606 * src/buffer.C (insertLyXFile): rename var filename -> fname
6607 (writeFile): rename arg filename -> fname
6608 (writeFileAscii): ditto
6609 (makeLaTeXFile): ditto
6610 (makeLinuxDocFile): ditto
6611 (makeDocBookFile): ditto
6613 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
6616 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
6618 * src/bmtable.h: add extern "C" on this file when __cplusplus is
6621 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
6622 compiled by a C compiler not C++.
6624 * src/layout.h (LyXTextClass): added typedef for const_iterator
6625 (LyXTextClassList): added typedef for const_iterator + member
6626 functions begin and end.
6628 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
6629 iterators to fill the choice_class.
6630 (updateLayoutChoice): rewritten to use iterators to fill the
6631 layoutlist in the toolbar.
6633 * src/BufferView.h (BufferView::work_area_width): removed unused
6636 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
6638 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
6639 (sgmlCloseTag): ditto
6641 * src/support/lstrings.h: return type of countChar changed to
6644 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
6645 what version of this func to use. Also made to return unsigned int.
6647 * configure.in: call LYX_STD_COUNT
6649 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
6650 conforming std::count.
6652 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6654 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
6655 and a subscript would give bad display (patch from Dekel Tsur
6656 <dekel@math.tau.ac.il>).
6658 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
6660 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
6663 * src/chset.h: add a few 'using' directives
6665 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
6666 triggered when no buffer is active
6668 * src/layout.C: removed `break' after `return' in switch(), since
6671 * src/lyx_main.C (init): make sure LyX can be ran in place even
6672 when libtool has done its magic with shared libraries. Fix the
6673 test for the case when the system directory has not been found.
6675 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
6676 name for the latex file.
6677 (MenuMakeHTML): ditto
6679 * src/buffer.h: add an optional boolean argument, which is passed
6682 1999-12-20 Allan Rae <rae@lyx.org>
6684 * lib/templates/IEEEtran.lyx: small correction and update.
6686 * configure.in: Attempted to use LYX_PATH_HEADER
6688 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
6690 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
6691 input from JMarc. Now use preprocessor to find the header.
6692 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
6693 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
6694 LYX_STL_STRING_FWD. See comments in file.
6696 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
6698 * The global MiniBuffer * minibuffer variable is dead.
6700 * The global FD_form_main * fd_form_main variable is dead.
6702 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6704 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
6706 * src/table.h: add the LOstream.h header
6707 * src/debug.h: ditto
6709 * src/LyXAction.h: change the explaination of the ReadOnly
6710 attribute: is indicates that the function _can_ be used.
6712 * src/LyXAction.C (init): find-replace _can_ be used in read-only
6715 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6717 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
6723 * src/paragraph.C (GetWord): assert on pos>=0
6726 * src/support/lyxstring.C: condition the use of an invariant on
6728 * src/support/lyxstring.h: ditto
6730 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
6731 Use LAssert.h instead of plain assert().
6733 * src/support/lstrings.h: add LAssert.h, in case it is needed.
6735 * src/lyxfunc.C: do not include LAssert.h, it is not used.
6736 * src/support/filetools.C: ditto
6738 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
6741 * INSTALL: document the new configure flags
6743 * configure.in: suppress --with-debug; add --enable-assertions
6745 * acinclude.m4: various changes in alignment of help strings.
6747 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6749 * src/kbmap.C: commented out the use of the hash map in kb_map,
6750 beginning of movement to a stl::container.
6752 * several files: removed code that was not in effect when
6753 MOVE_TEXT was defined.
6755 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
6756 for escaping should not be used. We can discuss if the string
6757 should be enclosed in f.ex. [] instead of "".
6759 * src/trans_mgr.C (insert): use the new returned value from
6760 encodeString to get deadkeys and keymaps done correctly.
6762 * src/chset.C (encodeString): changed to return a pair, to tell
6763 what to use if we know the string.
6765 * src/lyxscreen.h (fillArc): new function.
6767 * src/FontInfo.C (resize): rewritten to use more std::string like
6768 structore, especially string::replace.
6770 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
6773 * configure.in (chmod +x some scripts): remove config/gcc-hack
6775 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6777 * src/buffer.C (writeFile): change once again the top comment in a
6778 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
6779 instead of an hardcoded version number.
6780 (makeDocBookFile): ditto
6782 * src/version.h: add new define LYX_DOCVERSION
6784 * po/de.po: update from Pit Sütterlin
6785 * lib/bind/de_menus.bind: ditto.
6787 * src/lyxfunc.C (Dispatch): call MenuExport()
6788 * src/buffer.C (Dispatch): ditto
6790 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
6791 LyXFunc::Dispatch().
6792 (MenuExport): new function, moved from
6793 LyXFunc::Dispatch().
6795 * src/trans_mgr.C (insert): small cleanup
6796 * src/chset.C (loadFile): ditto
6798 * lib/kbd/iso8859-1.cdef: add missing backslashes
6800 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6802 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
6803 help with placing the manually drawn accents better.
6805 (Draw): x2 and hg changed to float to minimize rounding errors and
6806 help place the accents better.
6808 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
6809 unsigned short to char is just wrong...cast the char to unsigned
6810 char instead so that the two values can compare sanely. This
6811 should also make the display of insetlatexaccents better and
6812 perhaps also some other insets.
6814 (lbearing): new function
6817 1999-12-15 Allan Rae <rae@lyx.org>
6819 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
6820 header that provides a wrapper around the very annoying SGI STL header
6823 * src/support/lyxstring.C, src/LString.h:
6824 removed old SGI-STL-compatability attempts.
6826 * configure.in: Use LYX_STL_STRING_FWD.
6828 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
6829 stl_string_fwd.h is around and try to determine it's location.
6830 Major improvement over previous SGI STL 3.2 compatability.
6831 Three small problems remain with this function due to my zero
6832 knowledge of autoconf. JMarc and lgb see the comments in the code.
6834 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6836 * src/broken_const.h, config/hack-gcc, config/README: removed
6838 * configure.in: remove --with-gcc-hack option; do not call
6841 * INSTALL: remove documentation of --with-broken-const and
6844 * acconfig.h: remove all trace of BROKEN_CONST define
6846 * src/buffer.C (makeDocBookFile): update version number in output
6848 (SimpleDocBookOnePar): fix an assert when trying to a character
6849 access beyond string length
6852 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6854 * po/de.po: fix the Export menu
6856 * lyx.man: update the description of -dbg
6858 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
6859 (commandLineHelp): updated
6860 (easyParse): show list of available debug levels if -dbg is passed
6863 * src/Makefile.am: add debug.C
6865 * src/debug.h: moved some code to debug.C
6867 * src/debug.C: new file. Contains code to set and show debug
6870 * src/layout.C: remove 'break' after 'continue' in switch
6871 statements, since these cannot be reached.
6873 1999-12-13 Allan Rae <rae@lyx.org>
6875 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
6876 (in_word_set): hash() -> math_hash()
6878 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
6880 * acconfig.h: Added a test for whether we are using exceptions in the
6881 current compilation run. If so USING_EXCEPTIONS is defined.
6883 * config.in: Check for existance of stl_string_fwd.h
6884 * src/LString.h: If compiling --with-included-string and SGI's
6885 STL version 3.2 is present (see above test) we need to block their
6886 forward declaration of string and supply a __get_c_string().
6887 However, it turns out this is only necessary if compiling with
6888 exceptions enabled so I've a bit more to add yet.
6890 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
6891 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
6892 src/support/LRegex.h, src/undo.h:
6893 Shuffle the order of the included files a little to ensure that
6894 LString.h gets included before anything that includes stl_string_fwd.h
6896 * src/support/lyxstring.C: We need to #include LString.h instead of
6897 lyxstring.h to get the necessary definition of __get_c_string.
6898 (__get_c_string): New function. This is defined static just like SGI's
6899 although why they need to do this I'm not sure. Perhaps it should be
6900 in lstrings.C instead.
6902 * lib/templates/IEEEtran.lyx: New template file.
6904 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6906 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
6907 * intl/Makefile.in (MKINSTALLDIRS): ditto
6909 * src/LyXAction.C (init): changed to hold the LFUN data in a
6910 automatic array in stead of in callso to newFunc, this speeds up
6911 compilation a lot. Also all the memory used by the array is
6912 returned when the init is completed.
6914 * a lot of files: compiled with -Wold-style-cast, changed most of
6915 the reported offenders to C++ style casts. Did not change the
6916 offenders in C files.
6918 * src/trans.h (Match): change argument type to unsigned int.
6920 * src/support/DebugStream.C: fix some types on the streambufs so
6921 that it works on a conforming implementation.
6923 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6925 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
6927 * src/support/lyxstring.C: remove the inline added earlier since
6928 they cause a bunch of unsatisfied symbols when linking with dec
6929 cxx. Cxx likes to have the body of inlines at the place where they
6932 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
6933 accessing negative bounds in array. This fixes the crash when
6934 inserting accented characters.
6935 * src/trans.h (Match): ditto
6937 * src/buffer.C (Dispatch): since this is a void, it should not try
6938 to return anything...
6940 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6942 * src/buffer.h: removed the two friends from Buffer. Some changes
6943 because of this. Buffer::getFileName and Buffer::setFileName
6944 renamed to Buffer::fileName() and Buffer::fileName(...).
6946 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6948 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
6949 and Buffer::update(short) to BufferView. This move is currently
6950 controlled by a define MOVE_TEXT, this will be removed when all
6951 shows to be ok. This move paves the way for better separation
6952 between buffer contents and buffer view. One side effect is that
6953 the BufferView needs a rebreak when swiching buffers, if we want
6954 to avoid this we can add a cache that holds pointers to LyXText's
6955 that is not currently in use.
6957 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
6960 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6962 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
6964 * lyx_main.C: new command line option -x (or --execute) and
6965 -e (or --export). Now direct conversion from .lyx to .tex
6966 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
6967 Unfortunately, X is still needed and the GUI pops up during the
6970 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6972 * src/Spacing.C: add a using directive to bring stream stuff into
6974 * src/paragraph.C: ditto
6975 * src/buffer.C: ditto
6977 * NEWS: updated a bit the new features of 1.1.3 (took a few things
6978 from Lars' announcement).
6980 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
6981 example files from Tino Meinen.
6983 1999-12-06 Allan Rae <rae@lyx.org>
6985 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
6987 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6989 * src/support/lyxstring.C: added a lot of inline for no good
6992 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
6993 latexWriteEndChanges, they were not used.
6995 * src/layout.h (operator<<): output operator for PageSides
6997 * src/mathed/math_iter.C (my_memcpy): slightly changed.
6999 * some example files: loaded in LyX 1.0.4 and saved again to update
7000 certain constructs (table format)
7002 * a lot of files: did the change to use fstream/iostream for all
7003 writing of files. Done with a close look at Andre Poenitz's patch.
7005 * some files: whitespace changes.
7007 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7009 * src/mathed/math_iter.C (my_memcpy): new function. Since the
7010 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
7011 architecture, we provide our own. It is used unconditionnally, but
7012 I do not think this is a performance problem. Thanks to Angus
7013 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
7014 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
7016 (GetInset): use my_memcpy.
7020 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
7021 it is easier to understand, but it uses less TeX-only constructs now.
7023 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
7024 elements contain spaces
7026 * lib/configure: regenerated
7028 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
7029 elements contain spaces; display the list of programs that are
7032 * autogen.sh: make sure lib/configure is executable
7034 * lib/examples/*: rename the tutorial examples to begin with the
7035 two-letters language code.
7037 * src/lyxfunc.C (getStatus): do not query current font if no
7040 * src/lyx_cb.C (RunScript): use QuoteName
7041 (MenuRunDvips): ditto
7042 (PrintApplyCB): ditto
7044 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
7045 around argument, so that it works well with the current shell.
7046 Does not work properly with OS/2 shells currently.
7048 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
7049 * src/LyXSendto.C (SendtoApplyCB): ditto
7050 * src/lyxfunc.C (Dispatch): ditto
7051 * src/buffer.C (runLaTeX): ditto
7052 (runLiterate): ditto
7053 (buildProgram): ditto
7055 * src/lyx_cb.C (RunScript): ditto
7056 (MenuMakeLaTeX): ditto
7058 * src/buffer.h (getLatexName): new method
7060 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
7062 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7064 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
7065 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
7066 (create_math_panel): ditto
7068 * src/lyxfunc.C (getStatus): re-activate the code which gets
7069 current font and cursor; add test for export to html.
7071 * src/lyxrc.C (read): remove unreachable break statements; add a
7074 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
7076 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7078 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
7079 introduced by faulty regex.
7080 * src/buffer.C: ditto
7081 * src/lastfiles.C: ditto
7082 * src/paragraph.C: ditto
7083 * src/table.C: ditto
7084 * src/vspace.C: ditto
7085 * src/insets/figinset.C: ditto
7086 Note: most of these is absolutely harmless, except the one in
7087 src/mathed formula.C.
7089 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7091 * src/ImportNoweb.C (documentclass): fixed bounds for substr
7092 operation, yielding correct results for the reLyX command.
7094 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7096 * src/support/filetools.C (ExpandPath): removed an over eager
7098 (ReplaceEnvironmentPath): ditto
7100 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
7101 shows that we are doing something fishy in our code...
7105 * src/lyxrc.C (read): use a double switch trick to get more help
7106 from the compiler. (the same trick is used in layout.C)
7107 (write): new function. opens a ofstream and pass that to output
7108 (output): new function, takes a ostream and writes the lyxrc
7109 elemts to it. uses a dummy switch to make sure no elements are
7112 * src/lyxlex.h: added a struct pushpophelper for use in functions
7113 with more than one exit point.
7115 * src/lyxlex.[Ch] (GetInteger): made it const
7119 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
7121 * src/layout.[hC] : LayoutTags splitted into several enums, new
7122 methods created, better error handling cleaner use of lyxlex. Read
7125 * src/bmtable.[Ch]: change some member prototypes because of the
7126 image const changes.
7128 * commandtags.h, src/LyXAction.C (init): new function:
7129 "preferences-save", saves the lyxrc entries into .lyx/preferences.
7130 This file is not read automatically but you can add \input
7131 preferences to your lyxrc if you want to. We need to discuss how
7134 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
7135 in .aux, also remove .bib and .bst files from dependencies when
7138 * src/BufferView.C, src/LyXView.C: add const_cast several places
7139 because of changes to images.
7141 * lib/images/*: same change as for images/*
7143 * lib/lyxrc.example: Default for accept_compound is false not no.
7145 * images/*: changed to be const, however I have som misgivings
7146 about this change so it might be changed back.
7148 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7150 * lib/configure, po/POTFILES.in: regenerated
7152 * autogen.sh: autogenerate lib/configure from lib/configure.m4
7154 * config/lib_configure.m4: removed
7156 * lib/configure.m4: new file (was config/lib_configure.m4)
7158 * configure.in: do not test for rtti, since we do not use it.
7160 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7162 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
7163 doubling of allocated space scheme. This makes it faster for large
7164 strings end to use less memory for small strings. xtra rememoved.
7166 * src/insets/figinset.C (waitalarm): commented out.
7167 (GhostscriptMsg): use static_cast
7168 (GhostscriptMsg): use new instead of malloc to allocate memory for
7169 cmap. also delete the memory after use.
7171 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
7173 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
7174 for changes in bibtex database or style.
7175 (runBibTeX): remove all .bib and .bst files from dep before we
7177 (run): use scanAuc in when dep file already exist.
7179 * src/DepTable.C (remove_files_with_extension): new method
7182 * src/DepTable.[Ch]: made many of the methods const.
7184 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7186 * src/bufferparams.C: make sure that the default textclass is
7187 "article". It used to be the first one by description order, but
7188 now the first one is "docbook".
7190 * src/lyx_main.C (setDebuggingLevel): change type of argument to
7191 string; call Debug::value.
7192 (easyParse): pass complete argument to setDebuggingLevel().
7194 * src/debug.h (value): fix the code that parses debug levels.
7196 * src/debug.h: add new debug type ACTION, reserved for LyXAction
7199 * src/LyXAction.C: use Debug::ACTION as debug channel.
7201 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
7203 * NEWS: updated for the future 1.1.3 release.
7205 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
7206 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
7207 it should. This is of course a controversial change (since many
7208 people will find that their lyx workscreen is suddenly full of
7209 red), but done for the sake of correctness.
7211 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
7212 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
7214 * src/insets/inseterror.h, src/insets/inseturl.h,
7215 src/insets/insetinfo.h, src/insets/figinset.h,
7216 src/mathed/formulamacro.h, src/mathed/math_macro.h
7217 (EditMessage): add a missing const and add _() to make sure that
7220 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
7221 src/insets/insetbib.C, src/support/filetools.C: add `using'
7224 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
7225 doing 'Insert index of last word' at the beginning of a paragraph.
7227 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7229 * several files: white-space changes.
7231 * src/mathed/formula.C: removed IsAlpha and IsDigit
7233 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
7234 .bib file. use a ifstream instead of FilePtr when parsing the .bib
7237 * src/insets/figinset.C (GetPSSizes): don't break when
7238 "EndComments" is seen. But break when a boundingbox is read.
7240 * all classes inherited from Inset: return value of Clone
7241 changed back to Inset *.
7243 * all classes inherited form MathInset: return value of Clone
7244 changed back to MathedInset *.
7246 * src/insets/figinset.C (runqueue): use a ofstream to output the
7247 gs/ps file. Might need some setpresicion or setw. However I can
7248 see no problem with the current code.
7249 (runqueue): use sleep instead of the alarm/signal code. I just
7250 can't see the difference.
7252 * src/paragraph.C (LyXParagraph): reserve space in the new
7253 paragraph and resize the inserted paragraph to just fit.
7255 * src/lyxfunc.h (operator|=): added operator for func_status.
7257 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
7258 check for readable file.
7260 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
7261 check for readable file.
7262 (MenuMakeLinuxDoc): ditto
7263 (MenuMakeDocBook): ditto
7264 (MenuMakeAscii): ditto
7265 (InsertAsciiFile): split the test for openable and readable
7267 * src/bmtable.C (draw_bitmaptable): use
7268 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
7270 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
7271 findtexfile from LaTeX to filetools.
7273 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
7274 instead of FilePtr. Needs to be verified by a literate user.
7276 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7278 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
7279 (EditMessage): likewise.
7281 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
7282 respectively as \textasciitilde and \textasciicircum.
7284 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7286 * src/support/lyxstring.h: made the methods that take iterators
7289 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
7290 (regexMatch): made is use the real regex class.
7292 * src/support/Makefile.am: changed to use libtool
7294 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
7296 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
7298 (MathIsInset ++): changed several macros to be inline functions
7301 * src/mathed/Makefile.am: changed to use libtool
7303 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
7305 * src/insets/inset* : Clone changed to const and return type is
7306 the true insettype not just Inset*.
7308 * src/insets/Makefile.am: changed to use libtool
7310 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
7312 * src/undo.[Ch] : added empty() and changed some of the method
7315 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
7317 * src/lyxparagraph.h: use id() and id(...) instead of getID and
7318 setID use block<> for the bullets array, added const several places.
7320 * src/lyxfunc.C (getStatus): new function
7322 * src/lyxfunc.[Ch] : small changes to take advantage of the new
7323 LyXAction, added const to several funtions.
7325 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
7326 a std::map, and to store the dir items in a vector.
7328 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
7331 * src/LyXView.[Ch] + other files : changed currentView to view.
7333 * src/LyXAction.[Ch] : ported from the old devel branch.
7335 * src/.cvsignore: added .libs and a.out
7337 * configure.in : changes to use libtool.
7339 * acinclude.m4 : inserted libtool.m4
7341 * .cvsignore: added libtool
7343 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7345 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
7346 file name in insets and mathed directories (otherwise the
7347 dependency is not taken in account under cygwin).
7349 * src/text2.C (InsertString[AB]): make sure that we do not try to
7350 read characters past the string length.
7352 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7354 * lib/doc/LaTeXConfig.lyx.in,
7355 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
7357 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
7358 file saying who created them and when this heppened; this is
7359 useless and annoys tools like cvs.
7361 * lib/layouts/g-brief-{en,de}.layout,
7362 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
7363 from Thomas Hartkens <thomas@hartkens.de>.
7365 * src/{insets,mathed}/Makefile.am: do not declare an empty
7366 LDFLAGS, so that it can be set at configure time (useful on Irix
7369 * lib/reLyX/configure.in: make sure that the prefix is set
7370 correctly in LYX_DIR.
7372 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7374 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
7375 be used by 'command-sequence' this allows to bind a key to a
7376 sequence of LyX-commands
7377 (Example: 'command-sequence math-insert alpha; math-insert beta;")
7379 * src/LyXAction.C: add "command-sequence"
7381 * src/LyXFunction.C: handling of "command-sequence"
7383 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
7384 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
7386 * src/lyxserver.C, src/minibuffer.C: Use this new interface
7388 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7390 * src/buffer.C (writeFile): Do not output a comment giving user
7391 and date at the beginning of a .lyx file. This is useless and
7392 annoys cvs anyway; update version number to 1.1.
7394 * src/Makefile.am (LYX_DIR): add this definition, so that a
7395 default path is hardcoded in LyX.
7397 * configure.in: Use LYX_GNU_GETTEXT.
7399 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
7400 AM_GNU_GETTEXT with a bug fixed.
7402 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
7404 * src/chset.C: add "using std::ifstream;" to please dec cxx.
7406 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
7407 which is used to point to LyX data is now LYX_DIR_11x.
7409 * lyx.man: convert to a unix text file; small updates.
7411 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7413 * src/support/LSubstring.[Ch]: made the second arg of most of the
7414 constructors be a const reference.
7416 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
7419 * src/support/lyxstring.[Ch] (swap): added missing member function
7420 and specialization of swap(str, str);
7422 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
7424 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
7425 trace of the old one.
7427 * src/undo.[Ch]: made the undostack use std::list to store undo's in
7428 put the member definitions in undo.C.
7430 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
7431 NEW_TEXT and have now only code that was included when this was
7434 * src/intl.C (LCombo): use static_cast
7436 (DispatchCallback): ditto
7438 * src/definitions.h: removed whole file
7440 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
7442 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
7443 parsing and stores in a std:map. a regex defines the file format.
7444 removed unneeded members.
7446 * src/bufferparams.h: added several enums from definitions.h here.
7447 Removed unsused destructor. Changed some types to use proper enum
7448 types. use block to have the temp_bullets and user_defined_bullets
7449 and to make the whole class assignable.
7451 * src/bufferparams.C (Copy): removed this functions, use a default
7454 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
7457 * src/buffer.C (readLyXformat2): commend out all that have with
7458 oldpapersize to do. also comment out all that hve to do with
7459 insetlatex and insetlatexdel.
7460 (setOldPaperStuff): commented out
7462 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
7464 * src/LyXAction.C: remove use of inset-latex-insert
7466 * src/mathed/math_panel.C (button_cb): use static_cast
7468 * src/insets/Makefile.am (insets_o_SOURCES): removed
7471 * src/support/lyxstring.C (helper): use the unsigned long
7472 specifier, UL, instead of a static_cast.
7474 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
7476 * src/support/block.h: new file. to be used as a c-style array in
7477 classes, so that the class can be assignable.
7479 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7481 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
7482 NULL, make sure to return an empty string (it is not possible to
7483 set a string to NULL).
7485 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7487 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
7489 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
7491 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
7492 link line, so that Irix users (for example) can set it explicitely to
7495 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
7496 it can be overidden at make time (static or dynamic link, for
7499 * src/vc-backend.C, src/LaTeXFeatures.h,
7500 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
7501 statements to bring templates to global namespace.
7503 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7505 * src/support/lyxstring.C (operator[] const): make it standard
7508 * src/minibuffer.C (Init): changed to reflect that more
7509 information is given from the lyxvc and need not be provided here.
7511 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
7513 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
7515 * src/LyXView.C (UpdateTimerCB): use static_cast
7516 (KeyPressMask_raw_callback): ditto
7518 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
7519 buffer_, a lot of changes because of this. currentBuffer() ->
7520 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
7521 also changes to other files because of this.
7523 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7525 * src/vc-backend.[Ch]: new files. The backends for vc handling,
7526 have no support for RCS and partial support for CVS, will be
7529 * src/insets/ several files: changes because of function name
7530 changes in Bufferview and LyXView.
7532 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
7534 * src/support/LSubstring.[Ch]: new files. These implement a
7535 Substring that can be very convenient to use. i.e. is this
7537 string a = "Mary had a little sheep";
7538 Substring(a, "sheep") = "lamb";
7539 a is now "Mary has a little lamb".
7541 * src/support/LRegex.[Ch]: a regex class that can be used to pick
7542 out patterns and subpatterns of strings. It is used by LSubstring
7543 and also by vc-backend.C
7545 * src/support/lyxstring.C: went over all the assertions used and
7546 tried to correct the wrong ones and flag which of them is required
7547 by the standard. some bugs found because of this. Also removed a
7548 couple of assertions.
7550 * src/support/Makefile.am (libsupport_a_SOURCES): added
7551 LSubstring.[Ch] and LRegex.[Ch]
7553 * src/support/FileInfo.h: have struct stat buf as an object and
7554 not a pointer to one, some changes because of this.
7556 * src/LaTeXFeatures.C (getTClassPreamble): also use the
7557 information in layout when adding the layouts preamble to the
7560 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
7563 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
7564 because of bug in OS/2.
7566 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7568 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
7569 \verbatim@font instead of \ttfamily, so that it can be redefined.
7571 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
7572 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
7573 src/layout.h, src/text2.C: add 'using' directive to bring the
7574 STL templates we need from the std:: namespace to the global one.
7575 Needed by DEC cxx in strict ansi mode.
7577 * src/support/LIstream.h,src/support/LOstream.h,
7578 src/support/lyxstring.h,src/table.h,
7579 src/lyxlookup.h: do not include <config.h> in header
7580 files. This should be done in the .C files only.
7582 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
7586 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7588 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
7589 from Kayvan to fix the tth invokation.
7591 * development/lyx.spec.in: updates from Kayvan to reflect the
7592 changes of file names.
7594 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7596 * src/text2.C (InsertStringB): use std::copy
7597 (InsertStringA): use std::copy
7599 * src/bufferlist.C: use a vector to store the buffers in. This is
7600 an internal change and should not affect any other thing.
7602 * src/BufferView.C (waitForX): use XSync instead of the lengthy
7605 * src/text.C (Fill): fix potential bug, one off bug.
7607 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7609 * src/Makefile.am (lyx_main.o): add more files it depends on.
7611 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
7613 * src/support/lyxstring.C: use size_t for the reference count,
7614 size, reserved memory and xtra.
7615 (internal_compare): new private member function. Now the compare
7616 functions should work for std::strings that have embedded '\0'
7618 (compare): all compare functions rewritten to use
7621 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7623 * src/support/lyxstring.C (compare): pass c_str()
7624 (compare): pass c_str
7625 (compare): pass c_str
7627 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7629 * src/support/DebugStream.C: <config.h> was not included correctly.
7631 * lib/configure: forgot to re-generate it :( I'll make this file
7632 auto generated soon.
7634 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7636 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
7639 * src/support/lyxstring.C: some changes from length() to rep->sz.
7640 avoids a function call.
7642 * src/support/filetools.C (SpaceLess): yet another version of the
7643 algorithm...now per Jean-Marc's suggestions.
7645 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7647 * src/layout.C (less_textclass_desc): functor for use in sorting
7649 (LyXTextClass::Read): sort the textclasses after reading.
7651 * src/support/filetools.C (SpaceLess): new version of the
7652 SpaceLess functions. What problems does this one give? Please
7655 * images/banner_bw.xbm: made the arrays unsigned char *
7657 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7659 * src/support/lyxstring.C (find): remove bogus assertion in the
7660 two versions of find where this has not been done yet.
7662 * src/support/lyxlib.h: add missing int return type to
7665 * src/menus.C (ShowFileMenu): disable exporting to html if no
7666 html export command is present.
7668 * config/lib_configure.m4: add a test for an HTML converter. The
7669 programs checked for are, in this order: tth, latex2html and
7672 * lib/configure: generated from config/lib_configure.m4.
7674 * src/lyxfunc.C (Dispatch): update and improve the execution of an
7675 html converter. The parameters are now passed through $$FName and
7676 $$OutName, instead of standard input/output.
7678 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
7680 * lib/lyxrc.example: update description of \html_command.
7681 add "quotes" around \screen_font_xxx font setting examples to help
7682 people who use fonts with spaces in their names.
7684 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7686 * Distribution files: updates for v1.1.2
7688 * src/support/lyxstring.C (find): remove bogus assert and return
7689 npos for the same condition.
7691 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7693 * added patch for OS/2 from SMiyata.
7695 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7697 * src/text2.C (CutSelection): make space_wrapped a bool
7698 (CutSelection): dont declare int i until we have to.
7699 (alphaCounter): return a char const *.
7701 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7703 * src/support/syscall.C (Systemcalls::kill):
7704 src/support/filetools.C (PutEnv, PutEnvPath):
7705 src/lyx_cb.C (addNewlineAndDepth):
7706 src/FontInfo.C (FontInfo::resize): condition some #warning
7707 directives with WITH_WARNINGS.
7710 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7712 * src/layout.[Ch] + several files: access to class variables
7713 limited and made accessor functions instead a lot of code changed
7714 becuase of this. Also instead of returning pointers often a const
7715 reference is returned instead.
7717 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
7719 * src/Makefile.am (dist-hook): added used to remove the CVS from
7720 cheaders upon creating a dist
7721 (EXTRA_DIST): added cheaders
7723 * src/support/lstrings.C (tostr(char)): fix it to handle param as
7724 a character not as a small integer.
7726 * src/support/lyxstring.C (find): removed Assert and added i >=
7727 rep->sz to the first if.
7729 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7731 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
7732 src/LyXView.C src/buffer.C src/bufferparams.C
7733 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
7734 src/text2.C src/insets/insetinclude.C:
7735 lyxlayout renamed to textclasslist.
7737 * src/layout.C: some lyxerr changes.
7739 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
7740 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
7741 (LyXLayoutList): removed all traces of this class.
7742 (LyXTextClass::Read): rewrote LT_STYLE
7743 (LyXTextClass::hasLayout): new function
7744 (LyXTextClass::GetLayout): rewritten to return an iterator + has
7745 both const and nonconst version.
7746 (LyXTextClass::delete_layout): new function.
7747 (LyXTextClassList::Style): bug fix. do the right thing if layout
7749 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
7750 (LyXTextClassList::NameOfLayout): ditto
7751 (LyXTextClassList::Load): ditto
7753 * src/buffer.C (makeLaTeXFile): new access to layoutlist
7755 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
7757 * src/LyXAction.C (LookupFunc): added a workaround for sun
7758 compiler, on the other hand...we don't know if the current code
7759 compiles on sun at all...
7761 * src/support/filetools.C (CleanupPath): subst fix
7763 * src/insets/insetbib.C (delDatabase): subst fix, this looks
7766 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
7767 complained about this one?
7769 * src/insets/insetinclude.C (Latex): subst fix
7771 * src/insets/insetbib.C (getKeys): subst fix
7773 * src/LyXSendto.C (SendtoApplyCB): subst fix
7775 * src/lyx_main.C (init): subst fix
7777 * src/layout.C (Read): subst fix
7779 * src/lyx_sendfax_main.C (button_send): subst fix
7781 * src/buffer.C (RoffAsciiTable): subst fix
7783 * src/lyx_cb.C (MenuFax): subst fix
7784 (PrintApplyCB): subst fix
7786 1999-10-26 Juergen Vigna <jug@sad.it>
7788 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
7790 (Read): Cleaned up this code so now we read only format vestion >= 5
7792 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7794 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
7795 come nobody has complained about this one?
7797 * src/insets/insetinclude.C (Latex): subst fix
7799 * src/insets/insetbib.C (getKeys): subst fix
7801 * src/lyx_main.C (init): subst fix
7803 * src/layout.C (Read): subst fix
7805 * src/buffer.C (RoffAsciiTable): subst fix
7807 * src/lyx_cb.C (MenuFax): subst fix.
7809 * src/layout.[hC] + some other files: rewrote to use
7810 std::container to store textclasses and layouts in.
7811 Simplified, removed a lot of code. Make all classes
7812 assignable. Further simplifications and review of type
7813 use still to be one.
7815 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
7816 lastfiles to create the lastfiles partr of the menu.
7818 * src/lastfiles.[Ch]: rewritten to use deque to store the
7819 lastfiles in. Uses fstream for reading and writing. Simplifies
7822 * src/support/syscall.C: remove explicit cast.
7824 * src/BufferView.C (CursorToggleCB): removed code snippets that
7826 use explicat C++ style casts instead of C style casts. also use
7827 u_vdata instea of passing pointers in longs.
7829 * src/PaperLayout.C: removed code snippets that were commented out.
7831 * src/lyx_gui_misc.C: removed code snippets that were commented out.
7833 * src/lyx_main.C: removed code snippets that wer commented out.
7835 * src/paragraph.C: removed code snippets that were commented out.
7837 * src/lyxvc.C (logClose): use static_cast
7839 (viewLog): remove explicit cast to void*
7840 (showLog): removed old commented code
7842 * src/menus.C: use static_cast instead of C style casts. use
7843 u_vdata instead of u_ldata. remove explicit cast to (long) for
7844 pointers. Removed old code that was commented out.
7846 * src/insets/inset.C: removed old commented func
7848 * src/insets/insetref.C (InsetRef): removed old code that had been
7849 commented out for a long time.
7851 (escape): removed C style cast
7853 * src/insets/insetlatexaccent.C (Draw): removed old commented code
7855 * src/insets/insetlatex.C (Draw): removed old commented code
7856 (Read): rewritten to use string
7858 * src/insets/insetlabel.C (escape): removed C style cast
7860 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
7862 * src/insets/insetindex.C: use static_cast and u_vdata, removed
7865 * src/insets/insetinclude.h: removed a couple of stupid bools
7867 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
7868 (Clone): remove C style cast
7869 (getKeys): changed list to lst because of std::list
7871 * src/insets/inseterror.C (Draw): removed som old commented code.
7873 * src/insets/insetcommand.C (Draw): removed some old commented code.
7875 * src/insets/insetbib.C (bibitem_cb): removed code that has been
7876 commented out forever.
7877 (bibitem_cb): use static_cast instead of C style cast
7878 use of vdata changed to u_vdata.
7880 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
7882 (CloseUrlCB): use static_cast instead of C style cast.
7883 (CloseUrlCB): added a fl_free form...it seemed to be missing.
7885 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
7886 (C_InsetInfo_CloseInfoCB): forward the ob parameter
7887 (CloseInfoCB): static_cast from ob->u_vdata instead.
7888 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
7891 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
7892 (C_InsetError_CloseErrorCB): forward the ob parameter
7893 (CloseErrorCB): static_cast from ob->u_vdata instead.
7895 * src/vspace.h: include LString.h since we use string in this class.
7897 * src/vspace.C (lyx_advance): changed name from advance because of
7898 nameclash with stl. And since we cannot use namespaces yet...I
7899 used a lyx_ prefix instead. Expect this to change when we begin
7902 * src/BufferView.[Ch] (BufferView::~BufferView): removed
7904 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
7905 and removed now defunct constructor and deconstructor.
7907 * src/BufferView.h: have backstack as a object not as a pointer.
7908 removed initialization from constructor. added include for BackStack
7910 * development/lyx.spec.in (%build): add CFLAGS also.
7912 * src/screen.C (drawFrame): removed another warning.
7914 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7916 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
7917 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
7918 README and ANNOUNCE a bit for the next release. More work is
7921 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
7922 unbreakable if we are in freespacing mode (LyX-Code), but not in
7925 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7927 * src/BackStack.h: fixed initialization order in constructor
7929 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
7931 * acinclude.m4 (VERSION): new rules for when a version is
7932 development, added also a variable for prerelease.
7933 (warnings): we set with_warnings=yes for prereleases
7934 (lyx_opt): prereleases compile with same optimization as development
7935 (CXXFLAGS): only use pedantic if we are a development version
7937 * src/BufferView.C (restorePosition): don't do anything if the
7940 * src/BackStack.h: added member empty, use this to test if there
7941 is anything to pop...
7943 1999-10-25 Juergen Vigna <jug@sad.it>
7946 * forms/layout_forms.fd +
7947 * forms/latexoptions.fd +
7948 * lyx.fd: changed for various form resize issues
7950 * src/mathed/math_panel.C +
7951 * src/insets/inseterror.C +
7952 * src/insets/insetinfo.C +
7953 * src/insets/inseturl.C +
7954 * src/insets/inseturl.h +
7957 * src/PaperLayout.C +
7958 * src/ParagraphExtra.C +
7959 * src/TableLayout.C +
7961 * src/layout_forms.C +
7968 * src/menus.C: fixed various resize issues. So now forms can be
7969 resized savely or not be resized at all.
7971 * forms/form_url.fd +
7972 * src/insets/form_url.[Ch]: added because it's cleaner and easier
7975 * src/insets/Makefile.am: added files form_url.[Ch]
7977 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7979 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
7980 (and presumably 6.2).
7982 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
7983 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
7984 remaining static member callbacks.
7986 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
7989 * src/support/lyxstring.h: declare struct Srep as friend of
7990 lyxstring, since DEC cxx complains otherwise.
7992 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7994 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7996 * src/LaTeX.C (run): made run_bibtex also depend on files with
7998 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
7999 are put into the dependency file.
8001 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
8002 the code has shown itself to work
8003 (create_ispell_pipe): removed another warning, added a comment
8006 * src/minibuffer.C (ExecutingCB): removed code that has been
8007 commented out a long time
8009 * src/lyxfunc.C (processKeyEvent): removed some very old commented
8010 out code + a warning.
8012 * src/support/lyxstring.h: comment out the three private
8013 operators, when compiling with string ansi conforming compilers
8016 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
8018 (pixmapFromBitmapData): change type of bdata to be unsigned char *
8019 (pixmapFromBitmapData): add a reinterpret_cast in the call to
8022 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
8025 * src/mathed/math_panel.C (create_math_panel): remove explicit
8028 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
8031 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
8032 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
8033 to XCreatePixmapFromBitmapData
8034 (fl_set_bmtable_data): change the last argument to be unsigned
8036 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
8037 and bh to be unsigned int, remove explicit casts in call to
8038 XReadBitmapFileData.
8040 * images/arrows.xbm: made the arrays unsigned char *
8041 * images/varsz.xbm: ditto
8042 * images/misc.xbm: ditto
8043 * images/greek.xbm: ditto
8044 * images/dots.xbm: ditto
8045 * images/brel.xbm: ditto
8046 * images/bop.xbm: ditto
8048 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
8050 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
8051 (LYX_PROG_CXX): added -pedantic to g++ compile options when
8052 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
8054 (LYX_CXX_CHEADERS): added <clocale> to the test.
8056 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
8058 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
8060 * src/support/lyxstring.C (append): fixed something that must be a
8061 bug, rep->assign was used instead of rep->append.
8063 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
8066 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
8067 lyx insert double chars. Fix spotted by Kayvan.
8069 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8071 * Fixed the tth support. I messed up with the Emacs patch apply feature
8072 and omitted the changes in lyxrc.C.
8074 1999-10-22 Juergen Vigna <jug@sad.it>
8076 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
8078 * src/lyx_cb.C (MenuInsertRef) +
8079 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
8080 the form cannot be resized under it limits (fixes a segfault)
8082 * src/lyx.C (create_form_form_ref) +
8083 * forms/lyx.fd: Changed Gravity on name input field so that it is
8086 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8088 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
8089 <ostream> and <istream>.
8091 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
8092 whether <fstream> provides the latest standard features, or if we
8093 have an oldstyle library (like in egcs).
8094 (LYX_CXX_STL_STRING): fix the test.
8096 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
8097 code on MODERN_STL_STREAM.
8099 * src/support/lyxstring.h: use L{I,O}stream.h.
8101 * src/support/L{I,O}stream.h: new files, designed to setup
8102 correctly streams for our use
8103 - includes the right header depending on STL capabilities
8104 - puts std::ostream and std::endl (for LOStream.h) or
8105 std::istream (LIStream.h) in toplevel namespace.
8107 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8109 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
8110 was a bib file that had been changed we ensure that bibtex is run.
8111 (runBibTeX): enhanced to extract the names of the bib files and
8112 getting their absolute path and enter them into the dep file.
8113 (findtexfile): static func that is used to look for tex-files,
8114 checks for absolute patchs and tries also with kpsewhich.
8115 Alternative ways of finding the correct files are wanted. Will
8117 (do_popen): function that runs a command using popen and returns
8118 the whole output of that command in a string. Should be moved to
8121 * src/DepTable.[Ch] (extchanged): new function that returns true if a
8122 file with extension ext has changed.
8124 * src/insets/figinset.C: added ifdef guards around the fl_free
8125 code that jug commented out. Now it is commented out when
8126 compiling with XForms == 0.89.
8128 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
8129 to lyxstring.C, and only keep a forward declaration in
8130 lyxstring.h. Simplifies the header file a bit and should help a
8131 bit on compile time too. Also changes to Srep will not mandate a
8132 recompile of code just using string.
8133 (~lyxstring): definition moved here since it uses srep.
8134 (size): definition moved here since it uses srep.
8136 * src/support/lyxstring.h: removed a couple of "inline" that should
8139 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8141 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
8144 1999-10-21 Juergen Vigna <jug@sad.it>
8146 * src/table.C (SetPWidth): Just a small fix so the alignment is not
8147 set to left if I just remove the width entry (or it is empty).
8149 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
8150 paragraph when having dummy paragraphs.
8152 1999-10-20 Juergen Vigna <jug@sad.it>
8154 * src/insets/figinset.C: just commented some fl_free_form calls
8155 and added warnings so that this calls should be activated later
8156 again. This avoids for now a segfault, but we have a memory leak!
8158 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
8159 'const char * argument' to 'string argument', this should
8160 fix some Asserts() in lyxstring.C.
8162 * src/lyxfunc.h: Removed the function argAsString(const char *)
8163 as it is not used anymore.
8165 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8167 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
8170 * src/Literate.h: some funcs moved from public to private to make
8171 interface clearer. Unneeded args removed.
8173 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
8175 (scanBuildLogFile): ditto
8177 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
8178 normal TeX Error. Still room for improvement.
8180 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
8182 * src/buffer.C (insertErrors): changes to make the error
8183 desctription show properly.
8185 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
8188 * src/support/lyxstring.C (helper): changed to use
8189 sizeof(object->rep->ref).
8190 (operator>>): changed to use a pointer instead.
8192 * src/support/lyxstring.h: changed const reference & to value_type
8193 const & lets see if that helps.
8195 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8197 * Makefile.am (rpmdist): fixed to have non static package and
8200 * src/support/lyxstring.C: removed the compilation guards
8202 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
8205 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
8206 conditional compile of lyxstring.Ch
8208 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
8209 stupid check, but it is a lot better than the bastring hack.
8210 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
8212 * several files: changed string::erase into string::clear. Not
8215 * src/chset.C (encodeString): use a char temporary instead
8217 * src/table.C (TexEndOfCell): added tostr around
8218 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
8219 (TexEndOfCell): ditto
8220 (TexEndOfCell): ditto
8221 (TexEndOfCell): ditto
8222 (DocBookEndOfCell): ditto
8223 (DocBookEndOfCell): ditto
8224 (DocBookEndOfCell): ditto
8225 (DocBookEndOfCell): ditto
8227 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
8229 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
8231 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
8232 (MenuBuildProg): added tostr around ret
8233 (MenuRunChktex): added tostr around ret
8234 (DocumentApplyCB): added tostr around ret
8236 * src/chset.C (encodeString): added tostr around t->ic
8238 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
8239 (makeLaTeXFile): added tostr around tocdepth
8240 (makeLaTeXFile): added tostr around ftcound - 1
8242 * src/insets/insetbib.C (setCounter): added tostr around counter.
8244 * src/support/lyxstring.h: added an operator+=(int) to catch more
8247 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
8248 (lyxstring): We DON'T allow NULL pointers.
8250 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8252 * src/mathed/math_macro.C (MathMacroArgument::Write,
8253 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
8254 when writing them out.
8256 * src/LString.C: remove, since it is not used anymore.
8258 * src/support/lyxstring.C: condition the content to
8259 USE_INCLUDED_STRING macro.
8261 * src/mathed/math_symbols.C, src/support/lstrings.C,
8262 src/support/lyxstring.C: add `using' directive to specify what
8263 we need in <algorithm>. I do not think that we need to
8264 conditionalize this, but any thought is appreciated.
8266 * many files: change all callback functions to "C" linkage
8267 functions to please strict C++ compilers like DEC cxx 6.1 in mode
8268 strict_ansi. Those who were static are now global.
8269 The case of callbacks which are static class members is
8270 trickier, since we have to make C wrappers around them (see
8271 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
8272 did not finish this yet, since it defeats the purpose of
8273 encapsulation, and I am not sure what the best route is.
8275 1999-10-19 Juergen Vigna <jug@sad.it>
8277 * src/support/lyxstring.C (lyxstring): we permit to have a null
8278 pointer as assignment value and just don't assign it.
8280 * src/vspace.C (nextToken): corrected this function substituting
8281 find_first(_not)_of with find_last_of.
8283 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
8284 (TableOptCloseCB) (TableSpeCloseCB):
8285 inserted fl_set_focus call for problem with fl_hide_form() in
8288 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8290 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
8293 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8295 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
8296 LyXLex::next() and not eatline() to get its argument.
8298 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8300 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
8301 instead, use fstreams for io of the depfile, removed unneeded
8302 functions and variables.
8304 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
8305 vector instead, removed all functions and variables that is not in
8308 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8310 * src/buffer.C (insertErrors): use new interface to TeXError
8312 * Makefile.am (rpmdist): added a rpmdist target
8314 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
8315 per Kayvan's instructions.
8317 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8319 * src/Makefile.am: add a definition for localedir, so that locales
8320 are found after installation (Kayvan)
8322 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8324 * development/.cvsignore: new file.
8326 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8328 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
8329 C++ compiler provides wrappers for C headers and use our alternate
8332 * configure.in: use LYX_CXX_CHEADERS.
8334 * src/cheader/: new directory, populated with cname headers from
8335 libstdc++-2.8.1. They are a bit old, but probably good enough for
8336 what we want (support compilers who lack them).
8338 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
8339 from includes. It turns out is was stupid.
8341 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8343 * lib/Makefile.am (install-data-local): forgot a ';'
8344 (install-data-local): forgot a '\'
8345 (libinstalldirs): needed after all. reintroduced.
8347 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8349 * configure.in (AC_OUTPUT): added lyx.spec
8351 * development/lyx.spec: removed file
8353 * development/lyx.spec.in: new file
8355 * po/*.po: merged with lyx.pot becuase of make distcheck
8357 * lib/Makefile.am (dist-hook): added dist-hook so that
8358 documentation files will be included when doing a make
8359 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
8360 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
8362 more: tried to make install do the right thing, exclude CVS dirs
8365 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
8366 Path would fit in more nicely.
8368 * all files that used to use pathstack: uses now Path instead.
8369 This change was a lot easier than expected.
8371 * src/support/path.h: new file
8373 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
8375 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
8377 * src/support/lyxstring.C (getline): Default arg was given for
8380 * Configure.cmd: removed file
8382 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8384 * src/support/DebugStream.[Ch]: remove the explicit std:: before
8385 streams classes and types, add the proper 'using' statements when
8386 MODERN_STL is defined.
8388 * src/debug.h: move the << operator definition after the inclusion
8391 * src/support/filetools.C: include "LAssert.h", which is needed
8394 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
8397 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
8398 include "debug.h" to define a proper ostream.
8400 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8402 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
8403 method to the SystemCall class which can kill a process, but it's
8404 not fully implemented yet.
8406 * src/*.C: Changed Systemcalls::Startscript() to startscript()
8408 * src/support/FileInfo.h: Better documentation
8410 * src/lyxfunc.C: Added support for buffer-export html
8412 * src/menus.C: Added Export->As HTML...
8414 * lib/bind/*.bind: Added short-cut for buffer-export html
8416 * src/lyxrc.*: Added support for new \tth_command
8418 * lib/lyxrc.example: Added stuff for new \tth_command
8420 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8422 * lib/Makefile.am (IMAGES): removed images/README
8423 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
8424 installes in correct place. Check permisions is installed
8427 * src/LaTeX.C: some no-op changes moved declaration of some
8430 * src/LaTeX.h (LATEX_H): changed include guard name
8432 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8434 * lib/reLyX/Makefile.am: install noweb2lyx.
8436 * lib/Makefile.am: install configure.
8438 * lib/reLyX/configure.in: declare a config aux dir; set package
8439 name to lyx (not sure what the best solution is); generate noweb2lyx.
8441 * lib/layouts/egs.layout: fix the bibliography layout.
8443 1999-10-08 Jürgen Vigna <jug@sad.it>
8445 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
8446 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
8447 it returned without continuing to search the path.
8449 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8451 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
8452 also fixes a bug. It is not allowed to do tricks with std::strings
8453 like: string a("hei"); &a[e]; this will not give what you
8454 think... Any reason for the complexity in this func?
8456 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
8458 * Updated README and INSTALL a bit, mostly to check that my
8459 CVS rights are correctly set up.
8461 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8463 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
8464 does not allow '\0' chars but lyxstring and std::string does.
8466 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8468 * autogen.sh (AUTOCONF): let the autogen script create the
8469 POTFILES.in file too. POTFILES.in should perhaps now not be
8470 included in the cvs module.
8472 * some more files changed to use C++ includes instead of C ones.
8474 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
8476 (Reread): added tostr to nlink. buggy output otherwise.
8477 (Reread): added a string() around szMode when assigning to Buffer,
8478 without this I got a log of garbled info strings.
8480 * acconfig.h: commented out the PTR_AS_INT macros. They should not
8483 * I have added several ostream & operator<<(ostream &, some_type)
8484 functions. This has been done to avoid casting and warnings when
8485 outputting enums to lyxerr. This as thus eliminated a lot of
8486 explicit casts and has made the code clearer. Among the enums
8487 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
8488 mathed enums, some font enum the Debug::type enum.
8490 * src/support/lyxstring.h (clear): missing method. equivalent of
8493 * all files that contained "stderr": rewrote constructs that used
8494 stderr to use lyxerr instead. (except bmtable)
8496 * src/support/DebugStream.h (level): and the passed t with
8497 Debug::ANY to avoid spurious bits set.
8499 * src/debug.h (Debug::type value): made it accept strings of the
8502 * configure.in (Check for programs): Added a check for kpsewhich,
8503 the latex generation will use this later to better the dicovery of
8506 * src/BufferView.C (create_view): we don't need to cast this to
8507 (void*) that is done automatically.
8508 (WorkAreaButtonPress): removed some dead code.
8510 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8512 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
8513 is not overwritten when translated (David Sua'rez de Lis).
8515 * lib/CREDITS: Added David Sua'rez de Lis
8517 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
8519 * src/bufferparams.C (BufferParams): default input encoding is now
8522 * acinclude.m4 (cross_compiling): comment out macro
8523 LYX_GXX_STRENGTH_REDUCE.
8525 * acconfig.h: make sure that const is not defined (to empty) when
8526 we are compiling C++. Remove commented out code using SIZEOF_xx
8529 * configure.in : move the test for const and inline as late as
8530 possible so that these C tests do not interefere with C++ ones.
8531 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
8532 has not been proven.
8534 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8536 * src/table.C (getDocBookAlign): remove bad default value for
8539 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
8541 (ShowFileMenu2): ditto.
8543 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
8546 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8548 * Most files: finished the change from the old error code to use
8549 DebugStream for all lyxerr debugging. Only minor changes remain
8550 (e.g. the setting of debug levels using strings instead of number)
8552 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8554 * src/layout.C (Add): Changed to use compare_no_case instead of
8557 * src/FontInfo.C: changed loop variable type too string::size_type.
8559 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8561 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
8562 set ETAGS_ARGS to --c++
8564 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
8566 * src/table.C (DocBookEndOfCell): commented out two unused variables
8568 * src/paragraph.C: commented out four unused variables.
8570 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
8571 insed a if clause with type string::size_type.
8573 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
8576 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
8578 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
8579 variable, also changed loop to go from 0 to lenght + 1, instead of
8580 -1 to length. This should be correct.
8582 * src/LaTeX.C (scanError): use string::size_type as loop variable
8585 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
8586 (l.896) since y_tmp and row was not used anyway.
8588 * src/insets/insetref.C (escape): use string::size_type as loop
8591 * src/insets/insetquotes.C (Width): use string::size_type as loop
8593 (Draw): use string::size_type as loop variable type.
8595 * src/insets/insetlatexaccent.C (checkContents): use
8596 string::size_type as loop variable type.
8598 * src/insets/insetlabel.C (escape): use string::size_type as loop
8601 * src/insets/insetinfo.C: added an extern for current_view.
8603 * src/insets/insetcommand.C (scanCommand): use string::size_type
8604 as loop variable type.
8606 * most files: removed the RCS tags. With them we had to recompile
8607 a lot of files after a simple cvs commit. Also we have never used
8608 them for anything meaningful.
8610 * most files: tags-query-replace NULL 0. As adviced several plases
8611 we now use "0" instead of "NULL" in our code.
8613 * src/support/filetools.C (SpaceLess): use string::size_type as
8616 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8618 * src/paragraph.C: fixed up some more string stuff.
8620 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8622 * src/support/filetools.h: make modestr a std::string.
8624 * src/filetools.C (GetEnv): made ch really const.
8626 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
8627 made code that used these use max/min from <algorithm> instead.
8629 * changed several c library include files to their equivalent c++
8630 library include files. All is not changed yet.
8632 * created a support subdir in src, put lyxstring and lstrings
8633 there + the extra files atexit, fileblock, strerror. Created
8634 Makefile.am. edited configure.in and src/Makefile.am to use this
8635 new subdir. More files moved to support.
8637 * imported som of the functions from repository lyx, filetools
8639 * ran tags-query-replace on LString -> string, corrected the bogus
8640 cases. Tried to make use of lstrings.[hC], debugged a lot. There
8641 is still some errors in there. This is errors where too much or
8642 too litle get deleted from strings (string::erase, string::substr,
8643 string::replace), there can also be some off by one errors, or
8644 just plain wrong use of functions from lstrings. Viewing of quotes
8647 * LyX is now running fairly well with string, but there are
8648 certainly some bugs yet (see above) also string is quite different
8649 from LString among others in that it does not allow null pointers
8650 passed in and will abort if it gets any.
8652 * Added the revtex4 files I forgot when setting up the repository.
8654 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8656 * All over: Tried to clean everything up so that only the files
8657 that we really need are included in the cvs repository.
8658 * Switched to use automake.
8659 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
8660 * Install has not been checked.
8662 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8664 * po/pt.po: Three errors:
8665 l.533 and l.538 format specification error
8666 l. 402 duplicate entry, I just deleted it.