1 2001-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
3 * src/tabular.C (ReadNew): new method
4 (Read): changed to call ReadNew or ReadOld depending on the
7 * src/tabular-old.C: new file with the support functions and the
11 * src/frontends/xforms/FormDocument.C (CheckChoiceClass): make tc
12 unsigned to remove a signed/usigned warning.
14 * src/tabular.C (tostr): new spesializations, replaces type2string
15 (Write): use the new spesializations
17 2001-01-09 Juergen Vigna <jug@sad.it>
19 * src/tabular.C (OldFormatRead): convert the footer/header information
21 (getTokenValue): chaned this functions again.
22 (string2type): added a bunch of this functions per type.
23 (Write): use type2string and write columns first.
24 (type2string): added a bunch of this functions per type.
26 (TeXTopHLine): check row parameter.
28 2001-01-08 Dekel Tsur <dekelts@tau.ac.il>
30 * src/tabular.C (getTokenValue): Fix crash with malformed files.
31 (Read): Read the rotate attribute.
33 2001-01-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
35 * src/frontends/xforms/FormDocument.C (CheckChoiceClass): fix
36 class switching; do not do anything if class has not been changed.
38 2001-01-07 Dekel Tsur <dekelts@tau.ac.il>
40 * lib/build-listerrors: Exit if literate-article doesn't appear in
43 2001-01-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
45 * src/combox.h (getline): small fix for sun CC 6.0
46 * src/combox.C (input_cb): ditto.
47 * src/spellchecker.C (sigchldhandler): ditto.
49 * src/lyx_main.C (init): do not query for creation of user
50 directory when running without a GUI.
52 2001-01-08 Dekel Tsur <dekelts@tau.ac.il>
54 * src/mathed/formula.C (LocalDispatch): Toggle font properties.
56 2001-01-07 Dekel Tsur <dekelts@tau.ac.il>
58 * BufferView2.C (open_new_inset): Added 2nd argument.
59 (getParentText, getParentLanguage): New methods.
61 * src/lyxfunc.C (Dispatch): Fixed handling of LFUN_LEFT and
62 LFUN_INSET_TABULAR for RTL text.
64 * src/tabular.C (Latex): Put \R{} around RTL cells.
66 * src/text2.C (InsertInset): Change cursor position for highly
69 * src/frontends/xforms/FormTabularCreate.C (apply): Create the
70 tabular inset by calling to LyXFunc::Dispatch(LFUN_INSET_TABULAR,...)
72 * src/insets/insettabular.C (LocalDispatch): When dispatching
73 LFUN_TAB/LFUN_SHIFT_TAB, if the insettext of the old cell was
74 locked, then the insettext of the new cell will be locked.
75 (moveLeft, moveRight): Fixed for RTL tabulars.
76 (moveNextCell, movePrevCell): Ditto.
77 (isRightToLeft): New method.
79 * src/insets/insettext.C (LocalDispatch): Fixed handling of
80 non-dispatched function in the locking inset.
81 (Edit): If the inset is empty set the language of the current font
82 to the language to the surronding text (this code was moved from
83 LocalDispatch to allow the user to change the languaeg before
85 (moveRight, moveLeft): Fixed for RTL text.
86 (checkAndActivateInset): Fixed.
88 * src/tabular.C (OldFormatRead): Use ALL_INHERIT font as the base font.
90 2001-01-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
92 * src/frontends/xforms/Toolbar_pimpl.C (BubbleTimerCB): translate
96 * src/spellchecker.C (sigchldhandler): add an #ifndef USE_PSPELL
97 around some ispell code.
99 * src/lyxcursor.[Ch]: add proper constructor, to avoid tons of
100 Unitialized Memory Read in purify.
102 * lib/examples/nl_splash.lyx: update from Tino Meinen.
104 2001-01-04 Dekel Tsur <dekelts@tau.ac.il>
106 * src/frontends/xforms/FormDocument.C (FormDocument::build):
107 Disable class_->choice_doc_class and language_->choice_language to
108 allow using the class/language combox with keyboard.
110 2001-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
112 * src/support/snprintf.c (va_copy): only define va_copy if undefined
114 2001-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
116 * src/lyxvc.C (showLog): give the tempfile a mask
118 * src/lyx_cb.C (AutoSave): five tempfile a mask, enter the failed
121 * src/support/filetools.C (IsDirWriteable): give the tempfile a
122 mask and unlink the tempfile after use.
124 2001-01-04 Juergen Vigna <jug@sad.it>
126 * src/insets/insettabular.C (resetPos): an extra scroll, but we
127 really should redo all this scrolling code!
128 (TabularFeatures): unlock the_locking_inset before add/del rows/colums.
130 * src/text.C (GetVisibleRow): check that y/h values are good otherwise
133 * src/insets/insettabular.C (LocalDispatch): fixes to PASTESELECTION.
134 (pasteSelection): pay attention to multicolumn cells.
135 (calculate_dimensions_of_cells): forgot to reset maxAsc/Desc.
137 2001-01-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
139 * src/mathed/math_panel.C (deco_cb): check the decoration index is
142 * src/frontends/xforms/FormPreferences.C (feedback): apply
143 formatting to the translated string, not to the original one.
144 (printWarning): ditto.
146 * src/gettext.C (_): translate empty string with empty string.
148 * src/frontends/xforms/FormCopyright.C (build): use _() instead of
153 * UPGRADING: mention that tabular format has been changed.
155 2001-01-03 Juergen Vigna <jug@sad.it>
157 * src/insets/insettabular.C (InsetButtonPress): look for button==2
158 and do Clipboard Paste!
160 * src/insets/insettext.C (SetText): added function.
162 * src/insets/insettabular.C (LocalDispatch): Fixed LFUN_PASTE and
163 new LFUN_PASTESELECTION.
165 * src/insets/insettext.C (draw): don't clear if top_x changes.
167 * src/insets/insettabular.C (draw): clear only if the inset didn't
168 change in the draw routine.
170 * src/insets/insettext.C (width): make the width dependant on the
173 * src/text.C (draw): comment out the UpdateInset call.
175 * src/screen.C (DrawOneRow):
176 (DrawFromTo): check for bv->text->status not text->status.
178 * src/insets/insettabular.C (calculate_dimensions_of_cells): calculate
179 dimensions of ascent-descent for the whole row.
181 * src/insets/insettext.C (draw): check also for need_update == INIT.
183 2001-01-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
185 * Makefile.am (EXTRA_DIST): add autogen.sh
187 2001-01-03 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
189 * development/OS2/quick_fix.patch:
190 * lib/configure.cmd: update OS/2 support files.
192 2001-01-02 Juergen Vigna <jug@sad.it>
194 * src/insets/insettabular.C (pasteSelection): rewritten correctly.
196 * src/tabular.C (TeXTopHLine):
197 (TeXBottomHLine): fixed Lars new code.
199 * src/insets/insettext.C (LocalDispatch): added support for math_greek.
201 * src/mathed/math_symbols.C (math_insert_greek): removed current_view
202 from this function and added a BufferView * parameter.
204 * src/mathed/math_symbols.C (math_insert_symbol): ditto
206 2000-12-31 Lars Gullik Bjønnes <larsbj@lyx.org>
208 * src/version.h: set to pre3
210 2000-12-31 Lars Gullik Bjønnes <larsbj@lyx.org>
212 * src/Makefile.am (lyx_SOURCES): added Floating.C
214 * src/Floating.h: moved all the inlines to Floating.C
216 * src/Floating.C: new file
218 2000-12-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
220 * src/frontends/xforms/FormPreferences.C (feedback): fix
221 description of RC_PRINTCOPIESFLAG and RC_PRINTCOLLCOPIESFLAG.
223 2000-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
225 * src/support/FileInfo.h: move unistd.h to after sys/types.h and
228 * src/support/FileInfo.C: don't include sys/types. and sys/stat.h
230 * src/mathed/math_inset.h: move LString.h to be included first
232 * src/insets/insetfloat.C: adjust for change in private variable names
234 * src/frontends/xforms/xform_helpers.h : don't include config.h
236 * src/frontends/xforms/xform_helpers.C: adjust the order of
237 includes, some whitespace changes.
239 * src/trans.C (Load): constify filename and res
241 * src/text2.C (SetCounter): call Floating::name()
243 * src/screen.C: change to not use owner from WorkArea, but from
246 * src/lyxfunc.C: adjust because of changes in Intl.
248 * src/intl.h: make trans a object instead of pointer, inlucd
249 trans_mgr.h in this file.
250 (getTrans): return a reference to TransManager
252 * src/intl.C: don't include trans_mgr.h here
253 modify calls to trans to work on object instead of on pointer
255 * src/WorkArea.h: add using for Signal1
256 comment out forward decl of BufferView.
258 remove class variable owner_ and getter method for this.
260 * src/WorkArea.C: don't include BufferView.h
261 (WorkArea): change to not take a BufferView.h, use signals
263 (scroll_cb): emit signal
265 * src/LaTeXFeatures.C: include Floatlist.h
266 (getPackages): only load float.sty when needed
267 (getMacros): prepare for outputting the correct code to preamble.
269 * src/Floating.h: make all variables private + rename to var_.
270 (Floating): default ctor
271 (Floating): complex ctor to set a complete Floating
277 * src/FloatList.C (FloatList): use Floating's constructor
280 (newFloat): call type()
281 (defaultPlacement): call placement()
282 (operator): new operator
284 * src/BufferView_pimpl.C (Pimpl): modify call to WorkArea
285 (scrollUp): call pimpl's scrollCB
287 (pasteClipboard): constify clip
289 * src/BufferView2.C (insertLyXFile): constify fname, fi and c.
290 (insertErrors): constify desctext, errortext, msgtxt and errorrow
291 (open_new_inset): delete some commented code.
293 * src/BufferView.[Ch] (enterView): comment out
296 (workAreaMotionNotify): ditto
297 (workAreaButtonPress): ditto
300 (workAreaButtonRelease): ditto
301 (workAreaExpose): ditto
303 * config/lyxinclude.m4 (cross_compiling): small stuff to be able
304 to compile with cvs gcc (2.97).
306 2000-12-28 Dekel Tsur <dekelts@tau.ac.il>
308 * lib/ui/default.ui: menu structure cleanup.
310 * lib/languages: add description of entries.
312 2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
314 * src/insets/ExternalTemplate.C (readTemplates): change debug
316 (readTemplate): use lyxlex.printError to report read errors.
319 * src/insets/insetexternal.C (Read): suppress debug message when
322 2000-12-21 Dekel Tsur <dekelts@tau.ac.il>
324 * src/insets/insetinclude.C (Ascii): New method. Currently
325 supports only verbatim input.
327 2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
329 * lib/bind/fi_menus.bind: update from Pauli Virtanen.
331 2000-12-22 Juergen Vigna <jug@sad.it>
333 * src/insets/insettabular.C (InsetButtonPress): do nothing if we
334 have a selection and button == 3.
335 (UpdateLocal): if what == INIT clear selection if existent!
336 (InsetButtonPress): don't activate the cell inset on button==3
338 (LocalDispatch): move curor up/down if exiting an inset which this
341 2000-12-20 Juergen Vigna <jug@sad.it>
343 * src/mathed/formula.C (LocalDispatch): return UNDISPATCHED when
344 calling for the math-panel (do not unlock the math-inset if locked)!
346 * src/text.C (GetVisibleRow): fixed drawing of depth lines inside
347 text-insets (with x-offset).
349 * src/tabular.C (TeXCellPreamble): fixed wrong output of special
350 alignment of multicolumn-cells.
352 2000-12-19 Juergen Vigna <jug@sad.it>
354 * src/lyxfunc.C (Dispatch):
355 * src/bufferview_funcs.C (changeDepth): implemented DEPTH functions
358 2000-12-19 Lars Gullik Bjønnes <larsbj@lyx.org>
360 * src/WorkArea.C (work_area_handler): simplify the key/keysym
361 handling for XForms 0.89, this might have rendered some cases
362 unusable. I have at least deadkeys, accent-xxx and KP_x working.
363 Please report proplems.
365 * src/lyxfunc.C (processKeySym): make the self-insert handling
368 2000-12-18 Baruch Even <baruch.even@writeme.com>
370 * src/LaTeX.C (deplog): fix spelling errors
371 * src/text2.C (CutSelection): ditto
372 * src/lyxfunc.C (Dispatch): ditto
374 2000-12-18 Lars Gullik Bjønnes <larsbj@lyx.org>
376 * lib/layouts/stdlayouts.inc: only allow align Center for Caption
378 * src/mathed/math_inset.C (MathMatrixInset): initialize v_align
379 and h_align in default init.
380 adjust calls to MathedRowSt
382 * src/mathed/math_iter.C: adjust calls to MathedRowSt
383 * src/mathed/math_iter.h (getAD): ditto
385 * src/mathed/math_defs.h (class MathedRowSt): remove friends, add
386 methods setBaseline, ascent, descent
387 (class MathMatrixInset): remove method GetAlign, change h_align
390 * src/lyxfunc.C (processKeySym): discover the correct argument if
391 the action is LFUN_SELFINSERT
393 2000-12-18 Dekel Tsur <dekelts@tau.ac.il>
395 * src/mathed/math_cursor.C (Interpret) Suppress a debug message
398 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
400 * src/support/copy.C: don't include filetools.h
402 * lib/images: revert to old banner, drop the cucumber.
404 2000-12-12 Dekel Tsur <dekelts@tau.ac.il>
406 * src/converter.C (Formats::View): Change the current directory to
407 the directory of the file.
409 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
411 * src/kbsequence.C (addkey): also clear sequence and modifiers if
414 * src/BufferView2.C (theLockingInset): return 0 if text is 0
416 2000-12-17 Dekel Tsur <dekelts@tau.ac.il>
418 * Many files: Fix RTL support for insettext.
420 2000-12-11 John Levon <moz@compsoc.man.ac.uk>
422 * README: add mention of broken ghostscript versions, remove
423 reference to non-existent BUGS file
425 2000-12-13 Angus Leeming <a.leeming@ic.ac.uk>
427 * src/support/lstrings.C (compare_no_case): small fix. When passed
428 length, should use it in the size comparison.
430 2000-12-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
432 * src/insets/insetexternal.C (getScreenLabel): Return a default
433 value if the template label is empty.
435 * src/lyxlookup.C: do not condition on FL_REVISION.
438 * src/sp_form.C: fix the font size of some text entries
440 * src/frontends/xforms/Menubar_pimpl.C (add_toc): honor separator
441 after TOC when there is no TOC.
443 * src/lyxrc.C (readBindFileIfNeeded): new method. Reads the main
444 bind file if it has not been done yet.
445 (read): remove local bindFile variable. Try to fix the handling of
446 RC_BIND and RC_BINDFILE.
448 * src/lyx_main.C (init): use readBindFileIfNeeded().
450 * lib/languages: Change description of german to "German (new
453 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
455 * src/frontends/xforms/FormInset.C (createInset): activate "Ok",
456 "Apply" buttons if arg is non-zero.
458 * src/lyxfunc.C (Dispatch): enable citation to be inserted without
459 launching the popup if sufficient info is passed to
460 LFUN_CITATION_CREATE.
462 2000-11-23 Dekel Tsur <dekelts@tau.ac.il>
464 * src/lyx_cb.C (MenuInsertLabel): Compute a default value for new
465 labels (disabled in 1.1.6).
467 * src/lyxrc.[Ch]: New variable label_init_length
469 * mathed/formula.C (LocalDispatch): Preserve the label when
470 changing from display math to eqnarray (however, the label
471 do not appear at the first line, as one might expects, but at the
473 (LocalDispatch): When inserting a label to a formula which already
474 have a label, the old label is used as default value.
475 Also, if the label is changed, then all references to the label
478 * src/mathed/math_iter.C (setLabel): Allow to set the label
479 even if it is empty. This is needed to allow deletion of a label
482 * src/BufferView2.C (ChangeRefsIfUnique): New method. Changes the
483 refernces only if the old label appears once in the document.
485 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
487 * lib/languages: added ngerman. Patch courtesy of Andreas Gehlert
488 <gehlert@Rcs1.urz.tu-dresden.de>
490 * src/frontends/xforms/FormBase.C: comment out debug.h
492 * src/frontends/xforms/FormGraphics.[Ch] (browseFile): removed. Reuse
493 code in xform_helpers instead.
494 (d-tor): comment out "delete dialog;" and so prevent a crash on exit.
496 * src/frontends/xforms/FormPreferences.C: use AddName() in more places.
497 Use N_(), rather than _() when creating strings to pass to browseFile()
498 because browseFile calls gettext() itself now.
500 * src/frontends/xforms/xform_helpers.C (browseFile): call gettext() and
501 display the filename correctly.
503 2000-12-09 Dekel Tsur <dekelts@tau.ac.il>
505 * src/converter.C (Move): New method. Used to move file or files
506 from temp dir to the output dir. (this fixes the bug that
507 exporting linuxdoc/docbook document to html would not move all
508 html file from temp directory).
510 * src/support/filetools.C (DirList): Fixed.
512 * src/lstrings.C (prefixIs): Fixed (how nobody noticed it before??).
514 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
516 * src/converter.C (Add): Remove $$i when setting latex_command.
518 * src/text.C (IsBoundary): Return false when pos = 0.
520 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
522 * lib/kbd/hebrew.kmap: Add Hebrew points (nikud).
524 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
526 * src/frontends/xforms/FormDocument.C (checkMarginValues): you don't
527 need to empty the fields to turn off use of the geometry package!
529 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
531 * src/lyxparagraph.h, src/paragraph.C (CopyIntoMinibuffer): pass a
532 (Buffer const &), not a (BufferParams const &) and so fix a crash
533 caused by using current_view before it had been initialised. Not
534 the best way to do this, but much easier than changing
535 Inset::Clone(Buffer const &) to Inset::Clone().
538 * src/tabular.C: changed call to CopyIntoMinibuffer().
540 2000-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
542 * lib/ui/default.ui: put TOC at the beginning of the TOC menu.
544 * src/lyxfunc.C (getStatus): disable insertion of floats in a
547 2000-12-06 Angus Leeming <a.leeming@ic.ac.uk>
549 * src/frontends/xforms/FormPreferences.C (ScreenFonts::build):
550 changed filter for screen fonts input filter from int to float
552 * src/frontends/xforms/input_validators.c: removed.
553 * src/frontends/xforms/input_validators.C: new file. Can now call C++
554 functions from within the filter functions.
556 * src/frontends/xforms/input_validators.[Ch]
557 (fl_unsigned_float_filter): new filter function.
559 * src/frontends/xforms/forms/fdfixc.sed: I defy gettext to get
560 confused now! And if you think I'm going to do this in
561 ./forms/fdfix.sh with its "sed -e" declarations, then think again!
563 2000-12-06 Lars Gullik Bjønnes <larsbj@lyx.org>
565 * src/buffer.C (asciiParagraph): small NEW_INSETS fix from Levon
567 * src/WorkArea.C (work_area_handler): don't handle button requests
568 if xbutton.button == 0
570 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
572 * lib/layouts/lyxmacros.inc: do not use \verbatim@font in lyxcode.
573 It creates a lot of interesting problems.
575 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
577 * src/frontends/xforms/Menubar_pimpl.C (openByName): check that
578 the menu exists in the current menubar before opening it.
580 * src/MenuBackend.C (hasSubmenu): new method.
582 * src/frontends/xforms/Menubar_pimpl.C: fix problem with bogus
583 action value by offsetting actions by a large constant (so that
584 bogs choice result will be less than this constant).
586 * lib/bind/fi_menus.bind: more cleanup to menus.
587 * lib/bind/sciword.bind: ditto.
588 * lib/bind/xemacs.bind: ditto.
589 * lib/bind/emacs.bind: ditto.
590 * lib/bind/pt_menus.bind: ditto.
591 * lib/bind/hu_menus.bind: ditto.
593 * src/gettext.h (locale_init): set locale LC_NUMERIC to "C".
595 * INSTALL: update PROBLEMS section.
597 * src/lyxlookup.h: remove condition on xforms version, since we
598 should not include it if not appropriate.
600 2000-12-05 John Levon <moz@compsoc.man.ac.uk>
602 * src/LColor.C: "latex text" -> "latex inset" (from
605 * src/lyxrc.C: "it's" -> "its" (from Angus Leeming)
607 * src/frontends/kde/FormTabularCreate.C:
608 * src/frontends/kde/citationdlg.C:
609 * src/frontends/kde/copyrightdlg.C:
610 * src/frontends/kde/paradlg.C:
611 * src/frontends/kde/paraextradlg.C:
612 * src/frontends/kde/parageneraldlg.C:
613 * src/frontends/kde/printdlg.C:
614 * src/frontends/kde/refdlg.C:
615 * src/frontends/kde/tabcreatedlg.C:
616 * src/frontends/kde/tocdlg.C:
617 * src/frontends/kde/urldlg.C: add necessary headers
620 * src/frontends/kde/dlg/emptytable.C:
621 * src/frontends/kde/dlg/tabstack.C: ctors shouldn't have
622 default parameters (from Angus Leeming)
624 * src/frontends/kde/dlg/moc/.cvsignore:
625 * src/frontends/kde/dlg/.cvsignore:
626 * src/frontends/kde/moc/.cvsignore: fix the library name
629 * src/frontends/kde/paradlg.C:
630 * src/frontends/kde/parageneraldlg.C:
631 * src/frontends/kde/dlg/para.dlg:
632 * src/frontends/kde/dlg/paradlgdata.C: added accelerators
634 * src/frontends/kde/dlg/README: clarified qtarch version
636 * src/frontends/kde/dlg/Makefile.am: removed the
637 dlg rules as they created spontaneous rebuilds
638 (not a good idea as it requires qtarch)
640 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
642 * config/lyxinclude.m4 (LYX_PATH_XFORMS): display also the
643 fixlevel along with xforms version.
645 * src/WorkArea.C (work_area_handler): use stuff in lyxlookup.h when
646 xforms version is strictly less than 0.89.5.
647 * src/lyx_gui.C (LyXGUI): ditto.
648 * src/LyXView.C (show): ditto.
650 2000-12-02 Dekel Tsur <dekelts@tau.ac.il>
652 * src/BufferView_pimpl.C (workAreaMotionNotify): Fixed mouse
653 movement in inset in RTL text.
654 (checkInsetHit): Fixed mouse movement in scrolled inset in RTL text.
655 (workAreaButtonRelease): Do not open a float when there is a selection.
657 * src/insets/insettext.C (cx): Fixed for insets in RTL text.
659 * src/spellchecker.C (RunSpellChecker): Open all floats before
662 * src/text.C (InsertChar): Consider "," as a part of a number
663 (for LTR numbers in RTL text code).
664 (IsBoundary): Fixed (and simplified).
665 (InsertChar): Recalculate cursor boundary.
668 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
670 * src/spellchecker.C: fix figures with pspell enabled
672 * src/insets/figinset.C: workaround for gs hang xforms bug
674 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
676 * lib/bind/??_menus.bind: comment out the entries corresponding to
677 real menus. They should be eventually removed, but I'll let the
678 language maintainers do that.
680 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
682 * src/frontends/kde/parageneraldlg.C:
683 * src/frontends/kde/parageneraldlg.h: don't use
684 a derived class for SpaceAbove/Below
686 * src/frontends/kde/dlg/README: add some info
688 * src/frontends/kde/dlg/*: update data files, update
691 * src/frontends/kde/dlg/moc/Makefile.am: add
694 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
696 * configure.in: add new KDE Makefiles
697 * src/vspace.h: return GlueLength not a normal one
698 * src/support/lstrings.h:
699 * src/support/lstrings.C: add isStrUnsignedInt(),
702 * src/frontends/kde/*: big reorganisation, update
703 FormParagraph, add FormTabCreate
705 2000-12-04 Angus Leeming <a.leeming@ic.ac.uk>
707 * lib/ui/default.ui: small grammatical change.
709 * src/frontends/xforms/xform_macros.h: removed.
711 * src/frontends/xforms/FormBase.C:
712 * src/frontends/xforms/FormPreferences.C:
713 * src/frontends/xforms/Makefile.am: changes associated with removing
714 xform_macros.h. Should make Lars' debugging a little easier.
716 * src/frontends/xforms/FormPreferences.C:
717 * src/frontends/xforms/FormPreferences.h:
718 * src/frontends/xforms/forms/form_preferences.fd (Colors tab): no
719 longer use X11 color name database. HSV and RGB dials/sliders.
720 Please let this be the end of this!
722 2000-11-30 Dekel Tsur <dekelts@tau.ac.il>
724 * Several files: Allow compilation when the compiler doesn't
727 2000-11-30 Angus Leeming <a.leeming@ic.ac.uk>
730 * src/lyx_main.C (commandLineHelp, easyParse): documented remaining
731 command line options.
733 2000-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
735 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use
736 FL_MENU_BUTTON for items in menu bar. Not sure what difference it
739 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
741 * src/frontends/xforms/FormRef.C (updateBrowser):
742 * src/frontends/xforms/forms/form_ref.fd: try clicking on
743 different insets with the sort key active. Now apply this patch!
745 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
747 * src/frontends/xforms/FormPrint.C: set to valid()
748 when we update from the passed parameters.
750 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
752 * src/LColor.C (getFromGUIName): internationalise the comparison.
754 * src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a
755 FormPreferences choice.
757 * src/frontends/xforms/FormPreferences.C: some additional Color safety.
760 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
762 * src/lyxrc.C: more detail for the printer program config
765 * src/LColor.C: ert->latex text. LColor needs a big revamp
766 but will have to wait till after 1.1.6
768 * src/buffer.C: bring up a dialog if we load a document
769 with an un-installed text class, rather than just complain
772 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
774 * src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
775 the browser form for a combox in a tabbed folder. Bug fix courtesy of
776 Steve Lamont <spl@ncmir.ucsd.edu>.
778 * src/frontends/xforms/FormDocument.C (build):
779 * src/frontends/xforms/FormPreferences.C (Language::build):
780 pass tabfolders to Combox::add() in order to use this work around.
782 * src/frontends/xforms/FormCitation.C (connect): remove max size
784 (update): sort list of bibliography keys.
786 * src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser,
788 No max size limitation. Same popup for new and existing insets. Fixes
789 bugs reported by Rob Lahaye.
791 * src/frontends/xforms/FormCitation.C (c-tor):
792 * src/frontends/xforms/FormCopyright.C (c-tor):
793 * src/frontends/xforms/FormError.C (c-tor):
794 * src/frontends/xforms/FormGraphics.C (c-tor):
795 * src/frontends/xforms/FormIndex.C (c-tor):
796 * src/frontends/xforms/FormRef.C (c-tor):
797 * src/frontends/xforms/FormToc.C (c-tor):
798 * src/frontends/xforms/FormUrl.C (c-tor):
799 use correct policy for ButtonController.
801 * src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more.
803 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr
806 * src/frontends/xforms/forms/form_citation.fd: some resizing changes.
808 * src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons.
809 Some resizing changes.
811 2000-11-28 Lars Gullik Bjønnes <larsbj@lyx.org>
813 * configure.in: fix typo
815 * lib/languages: add ukraninian and change no to no_NO
817 * src/lyxfont.[Ch] (setGUISize): comment out setGUISize
819 * src/bufferview_funcs.C (FontSize): use setLyXSize
821 2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
823 * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
824 to check for systems where mkstemp() is available but not declared
825 in headers. The new autoconf macro lyx_CHECK_DECL can be used
826 to check for declarations in headers.
828 2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
830 * forms/bibforms.fd: tiny fix to get it to run with fdesign.
832 * forms/makefile: added bibforms.fd, include_form.fd.
833 Removed lyx_sendfax.fd.
835 * src/LaTeXLog.C (ShowLatexLog):
836 * src/LyXAction.C (init):
837 * src/bufferparams.C (readLanguage): altered messages as suggested by
840 * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
843 * src/credits.C: made fd_form_credits non-static, so that it can be
844 redrawn should the xforms colors be re-mapped.
845 * src/spellchecker.C ditto fd_form_spell_options.
847 * src/filedlg.[Ch] (redraw):
848 * src/intl.[Ch] (redraw):
849 * src/lyxfr0.[Ch] (redraw):
850 * src/insets/figinset.[Ch] (redraw):
851 * src/insets/insetexternal.[Ch] (redraw):
852 new methods, connected to Dialogs::redrawGUI.
854 * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
855 to be connected to Dialogs::redrawGUI.
857 * src/frontends/xforms/FormCitation.C (build):
858 * src/frontends/xforms/FormCopyright.C (build):
859 * src/frontends/xforms/FormError.C (build):
860 * src/frontends/xforms/FormGraphics.C (build):
861 * src/frontends/xforms/FormIndex.C (build):
862 * src/frontends/xforms/FormTabularCreate.[Ch] (update):
863 * src/frontends/xforms/FormToc.C (build):
864 * src/frontends/xforms/FormUrl.C (build):
865 use the ButtonController correctly.
867 * src/frontends/xforms/FormCopyright.C (build):
868 * src/frontends/xforms/forms/form_copyright.fd: moved the text out of
869 the .fd file and into build().
871 * src/frontends/xforms/FormPreferences.C: tiny clean-up.
873 * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
875 * src/frontends/xforms/forms/form_citation.fd:
876 * src/frontends/xforms/forms/form_copyright.fd:
877 * src/frontends/xforms/forms/form_error.fd:
878 * src/frontends/xforms/forms/form_graphics.fd:
879 * src/frontends/xforms/forms/form_index.fd:
880 * src/frontends/xforms/forms/form_toc.fd:
881 * src/frontends/xforms/forms/form_url.fd:
882 renamed some of the objects. Named others explicitly for the first time.
883 Added Restore and Apply buttons where appropriate.
885 * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
888 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
890 * src/version.h: try the pre2 again
892 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
894 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
896 * src/frontends/kde/FormParagraph.C: added using directive.
898 * src/frontends/kde/paradlg.C: added config.h and using directive.
900 * src/frontends/kde/paradlg.h: added std::qualifier.
902 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
904 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
906 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
908 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
910 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
912 * src/version.h: set back to 1.1.6cvs
914 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
916 * src/version.h: set to 1.1.6pre2
918 2000-11-20 Marko Vendelin <markov@ioc.ee>
920 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
922 * src/frontends/gnome/Makefile.am: updated list of XForms object files
924 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
926 * src/LColor.C (init):
927 * src/lyxrc.C (getDescription): changed some comments as suggested by
930 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
931 disconnect the redrawGUI signal in best-practice fashion.
933 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
934 long_opts_tab to reflect the change in name of this tabfolder, as
935 suggested by John Levon.
936 (connect, disconnect): new methods. Don't do much at present other than
937 ensuring that we can't resize the dialog. This just makes xforms go
939 (lots of methods in Colors): made void rather than bool. The idea is
940 to have an isOk() function that keeps track of whether any input is
941 genuinely invalid and should therefore block Save, Apply.
942 Easier to manipulate the counters rapidly.
943 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
944 compiler will like this code. Much cleaner way of doing things.
946 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
948 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
949 rather than simple counters, following suggestion by John Levon.
951 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
952 than engraved frame + text.
954 * src/frontends/xforms/forms/makefile: removed spurious command.
956 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
958 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
960 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
963 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
965 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
966 see what Lars has changed and what is just white space!
967 Now used X directly to ascertain the RGB color associated with the
969 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
971 Added some sort capability.
972 The X11 color name database input is only displayed if the database
973 isn't found in the standard place.
974 Got rid of struct compare_converter; it wasn't used.
975 Probably some other stuff that I've forgotten.
977 * src/frontends/xforms/FormPreferences.h: changed the names of some
978 methods in the Colors struct. Added a couple of structs to help sort
979 colors by name and by RGBColor.
981 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
982 functions into a new class RWInfo.
984 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
985 The dialog is now almost navigable using the keyboard. Unfortunately,
986 the cursor has to be inside a browser for it to be activated. There is
987 no visual feedback for the key shortcuts to the arrow keys (use
988 Alt-appropriate arrow key, Alt-x).
990 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
993 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
994 xform_helpers.[Ch]. See above.
996 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
998 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
1000 * src/screen.C (setCursorColor): new method. Sets the color of the
1002 (ShowManualCursor): call it.
1003 Constify some local variables.
1005 * src/LColor.[Ch] (LColor): add entry for cursor
1006 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
1009 2000-11-19 Juergen Vigna <jug@sad.it>
1011 * src/insets/insettabular.C (draw): fixed text border redraw problem.
1012 (calculate_dimensions_of_cells): try to boost up when inserting chars.
1014 2000-11-15 Rob Lahaye <lahaye@postech.edu>
1016 * lib/ui/default.ui: OptItem used for Fax entry
1018 2000-11-17 Matej Cepl <cepl@bigfoot.com>
1020 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
1022 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
1024 * src/vspace.C (nextToken): fix so it can handle length phrases like
1025 "10mm+-20mm", "40inplus16mmminus10cm" etc.
1027 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1029 * src/frontends/xforms/FormPreferences.C: constify several variables
1030 (BrowserLyX): rewrite to not need the choice variable
1031 (Modify): rewrite to not need the choide variable
1032 (compare_converter): make operator const
1034 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
1035 correct the writing of \set_color
1036 (getDescription): return a const string
1038 * src/kbsequence.[Ch] (addkey): remove dead code
1040 * src/Painter.C (text): remove some commented code
1042 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
1044 * src/ColorHandler.[Ch]: removed some header files from .h file.
1045 Included LColor.h in .C file.
1047 * src/LColor.[Ch]: made class copyable so that I could create a
1048 system_lcolor instance.
1050 * src/Painter.h: removed LColor.h.
1052 * src/lyx_gui.C (create_forms): used AddName.
1054 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
1055 of user preferences/lyxrc file.
1057 * src/lyxrc.C (output): output changes to lcolor.
1059 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
1061 Moved class xformColor to files xform_helpers.[Ch]. These files,
1062 Color.[Ch], could now be moved into src if they would be useful to
1065 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
1066 Also moved FormPreferences::browseFile here as it can be used by any
1067 xform dialog with a "Browse" button. FormGraphics is a perfect example.
1069 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
1070 ReadableFile): changed the FormPreferences methods a little and moved
1071 them here as they'll be useful elsewhere also.
1073 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
1074 Removed some header files and used forward declarations instead.
1076 Removed some methods as they'll be useful elsewhere (see above).
1078 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
1079 Can also now modify the LyX LColors. However, for reasons that I don't
1080 yet understand, it appears that we can use
1081 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
1082 present. The problem appears to lie in ColorHandler, because I can
1083 change the color using LColor.SetColor(). Similarly, when reading in a
1084 preferences file with some set_color instances, I'll get a warning
1085 like: Color sea green is undefined or may not be redefined
1086 Bad lyxrc set_color for sea green
1088 Once the buffer is loaded, however, I can happily change to this color.
1090 Finally, it appears that I have to set the color of "inset frame"
1091 explicitly, or it oscillates from "black" to "indian red" with each
1094 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
1096 * ANNOUNCE: corrected a spelling mistake.
1098 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
1101 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
1103 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
1105 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
1108 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
1109 match the requirements from the standard better. This is required
1110 to work with gnu libstdc++-v3
1112 * src/frontends/xforms/FormPreferences.C: add explict pair
1113 arguments to browse calls. include support/lyxmanip.h remvoe
1114 extern fmt. whitespace changes. reorder variables in
1115 FormPreferences.h, to match initalizaton order.
1117 * several files: constify more local variables.
1119 * src/buffer.C: remove some commented functions.
1121 * src/DepTable.C (remove_files_with_extension): temporary
1122 work around for gcc 2.97
1123 * src/filedlg.C (find): ditto
1124 * src/Variables.C (set): ditto
1125 * src/LyXAction.C (searchActionArg): ditto
1126 (retrieveActionArg): ditto
1128 * configure.in: check for mktemp too
1130 * UPGRADING: prepare for 1.1.6
1132 * Makefile.am (lgbtags): add backup tags for when etags are
1133 different than usual.
1135 * ANNOUNCE: prepare for 1.1.6
1137 * src/support/tempname.C (make_tempfile): new function, wrapper
1138 around mkstemp and mktemp. Only mkstemp has been tested.
1139 (tempName): call it.
1141 2000-11-14 Rob Lahaye <lahaye@postech.edu>
1143 * default.ui: capitalized some menu items to improve shortcuts.
1145 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1147 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
1149 * src/frontends/xforms/Dialogs.C: add "using" directive.
1151 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
1153 * src/filedlg.C (Select): highlight suggested file in browser, if
1156 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
1157 each tab folder is encapsulated in its own class.
1158 The Language keymaps are now chosen using a text input and a
1159 browser button, rather than a Combox.
1160 All the browser buttons are now functional, although LyXFileDlg
1161 still needs to be modified to make it straighhtforward to return a
1162 directory if that is what is desired.
1164 * src/frontends/xforms/forms/form_preferences.fd: use text input
1165 and browse button to input the Language keymaps. Add a few
1166 callbacks for the browse buttons.
1168 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1170 * src/support/tempname.C (tempName): small changes to make it
1171 safer. remove the '.' before XXXXXX
1173 * src/support/filetools.C (TmpFileName): remove func
1176 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
1177 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
1178 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
1179 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
1181 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
1182 (FormCommand): ditto
1184 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
1187 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
1188 for bp (this fixes a reproducible hard crash)
1190 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
1193 * src/frontends/xforms/FormBase.h: make bp_ private
1194 (FormBaseBI): remove default for bp
1197 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
1200 * src/frontends/xforms/Color.C (RGBColor): made several vars
1201 const, changed initialization of j to allow it to be const
1204 * several files: added const to local variables.
1206 * src/lyx_cb.C: removed several function prototypes and moved them
1210 (UpdateLayoutPreamble):
1212 (MenuInsertLabel): add BufferView as arguemnt
1213 (LayoutsCB): make tmp const
1215 * src/layout_forms.h: regenerated
1217 * src/debug.C: add Debug::FILES
1218 (showLevel) (showTags): translate the desc
1220 * src/debug.h: add FILES as debug target
1222 * src/bufferlist.C: use current_view as an interim measure becuase
1223 of added arguments to MenuWrite and MenuWriteAs
1225 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
1227 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
1229 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
1230 libstdc++ is compiled with.
1232 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
1234 * lib/layouts/docbook-book.layout
1235 * lib/layouts/docbook.layout
1236 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
1237 those paragraphs are expresse as SGML comments <!-- -->.
1239 * src/LaTeXFeatures.h
1240 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
1241 parameter, this allows to express all the include files as relative
1242 paths to the master buffer. The verbatim insert works as the other
1245 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
1247 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
1249 (MakeDocBookFile): top_element is always written. Some clean up, as
1250 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
1252 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
1253 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
1254 a reference is written instead of the name.
1255 (Validate): use the relative path for the filename.
1257 * src/insets/insetlabel.C (DocBook): write end tag, for XML
1260 * src/support/filetools.h
1261 * src/support/filetools.C (IsSGMLFilename): added.
1264 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
1266 * development/OS2/quick_fix.patch:
1267 * lib/configure.cmd:
1268 * README.OS2: quick update to the OS/2 port.
1270 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1272 * src/converter.C: add "using" directive.
1274 * src/frontends/xforms/FormPreferences.C: add "using" directive.
1275 (compare_converter): add "int" as return type.
1277 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
1280 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
1282 * src/lyx_gui.C (create_forms): map the xform colours, should a
1283 mapping exist. Ie, call XformColor::read().
1285 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
1286 and struct HSV as HSVColor.
1287 (XformColor::read, XformColor::write) : new methods that
1288 input/output any changes to the cform GUI colors.
1290 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
1293 * src/frontends/xforms/FormPreferences.C Lots of little changes
1294 associated with the changed name of the RGB and HSV structs. Can
1295 now save changes to xforms GUI to file. Commented out
1296 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
1297 used currently anyway.
1299 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
1301 * src/converter.C: A lot of changes:
1302 - It is no longer possible to choose between two or more ways to
1303 export to some format (the new code uses only the shortest path).
1304 However, it is still possible to choose between pdflatex/ps2pdf
1305 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
1306 - Added several methods that makes the FormPreferences code simpler.
1307 - Changed the tokens $$FName and $$OutName to $$i and $$o.
1309 * src/exporter.C (Export): lyxrc.use_pdf is set before
1310 makeLaTeXFile is called. This works but not very nice.
1312 * src/frontends/xforms/FormPreferences.C: The formats/converters
1313 tabs are now fully functional.
1315 * src/buffer.C (getTocList): Add numbers to the captions.
1317 * lib/lyxrc.example: Removed fax section
1319 * src/support/rename.C (rename): Delete the old file if lyx::copy
1322 2000-11-13 Rob Lahaye <lahaye@postech.edu>
1324 * lib/ui/default.ui: minor polishing.
1326 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1328 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
1331 * lib/Makefile.am (DOCINST): do not install everything in the
1332 documentation directory.
1334 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
1336 * src/bufferlist.C (newFile): set the filename to the constructed
1339 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
1340 constructed "newfileXX.lyx" name to the dialog
1342 * src/frontends/DialogBase.h: make update() non-abstract so
1343 KDE doesn't need to implement two update methods for every form
1345 * src/frontends/kde/Makefile.am: add missing xforms objects
1348 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
1350 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
1352 * src/frontends/xforms/Color.[Ch]: new files, defining the color
1353 structs RGB and HSV. May not be the best place for these files.
1354 Perhaps move them into src ?
1356 * src/frontends/xforms/Makefile.am: added new files.
1358 * src/frontends/xforms/forms/form_preferences.fd:
1359 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
1360 replaced all instances of "colour" with "color"!
1362 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
1365 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
1366 tab. Can now alter the colors of the xform's GUI on the fly. With
1367 the aid of a single static Signal (see below), can "Apply" these
1368 changes to all currently open dialogs. (Well, to all of the NEW
1369 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
1370 subsequently opened dialogs will, of course, also have the new
1371 color scheme. Cannot yet save (or load) the choices to file, so
1372 they are lost when exiting LyX.
1374 * src/frontends/Dialogs.h:
1375 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
1376 Used to trigger a redraw of any dialogs connected to it because,
1377 for example, the GUI colours have been re-mapped.
1379 * src/frontends/xforms/FormBase.[Ch]:
1380 * src/frontends/xforms/FormDocument.[Ch]:
1381 * src/frontends/xforms/FormParagraph.[Ch]:
1382 * src/frontends/xforms/FormPreferences.[Ch]:
1383 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
1384 method, to be connected to Dialogs::redrawGUI. Method must be
1385 virtual, because dialogs with tabbed folders need to redraw the
1386 forms of each tab folder.
1388 * src/LyXView.C (d-tor):
1389 * src/frontends/xforms/FormBase.C (d-tor): connected
1390 Dialogs::redrawGUI signal to redraw().
1392 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
1393 removed Assert, because it is identical to that in FormBase.
1395 2000-11-10 Rob Lahaye <lahaye@postech.edu>
1397 * lib/ui/default.ui: minor polishing.
1399 2000-11-10 Juergen Vigna <jug@sad.it>
1401 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
1402 (deleteLyXText): ditto
1404 * src/insets/insettabular.C (InsetButtonPress): don't clear the
1405 selection on mouse-button-3.
1407 * src/insets/insettabular.h: new function clearSelection(), use this
1408 functions inside insettabular.C.
1410 * src/insets/insettabular.C (TabularFeatures): clear the selection
1411 on remove_row/column.
1413 * src/insets/inset.C (scroll): fixed some scroll stuff.
1415 * src/insets/insettabular.C (draw): fixed another minor draw problem.
1417 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1419 * lib/CREDITS: add Yves Bastide
1421 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
1423 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
1424 check whether C library functions are in the global namespace.
1426 * configure.in: calls it.
1428 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
1429 #ifndef __GLIBCPP__.
1431 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
1433 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
1434 iterators to prevent crash.
1436 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
1438 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
1440 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
1441 shortcut for xforms CB to the preemptive or post-handler function.
1443 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
1444 removed the HIDDEN_TIMER as it's no longer used.
1445 Various other small changes.
1447 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
1448 preemptive handler to obtain feedback, rather than the post-handler.
1449 (ColoursLoadBrowser): find "black" and "white" based on RGB values
1451 Formats tab is now complete. Converters tab is nearly so.
1453 2000-11-09 Juergen Vigna <jug@sad.it>
1455 * src/insets/insettext.C (~InsetText):
1458 (SetParagraphData): set cache.second to 0 after deleting it!
1459 (getLyXText): check if cache.second is not 0 if finding it.
1461 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1463 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
1464 lyxlex to parse the rgb.txt file.
1467 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
1468 replace the default '#' comment character.
1470 * src/support/tempname.C: add "using" directive
1471 * src/frontends/ButtonPolicies.C: ditto.
1473 * src/support/filetools.C (DirList): add an explicit cast to avoid
1474 a compile error (probably not the right fix)
1476 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
1478 * src/support/filetools.C (DirList): implement using system functions
1480 * src/support/tempname.C: new file
1482 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
1484 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
1486 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
1489 * src/frontends/xforms/ButtonController.C: new file
1491 * src/os2_defines.h: remove getcwd define
1493 * src/lyxvc.C: include support/lyxlib.h
1494 (showLog): use lyx::tempName
1496 * src/lyx_cb.C: comment out includes that we don't need
1497 (AutoSave): use lyx::tempName
1499 * src/filedlg.C: include support/lyxlib.h
1500 (Reread): use lyx::getcwd
1502 * src/converter.C: include support/filetools.h
1503 (add_options): change to static inline, make tail const
1504 (Add): make old_viewer const
1505 (GetAllFormats): make it a const method, use const_iterator
1506 (enable): make static inline
1507 (SplitFormat): make using_format const
1509 * src/LaTeX.C (run): use lyx::getcwd
1511 * configure.in: check for mkstemp as well
1513 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1515 * src/converter.[Ch] (GetAllCommands): new method.
1517 * src/support/filetools.[Ch] (DirList): new method.
1519 * src/frontends/xforms/FormPreferences.C: started (just!) adding
1520 functionality to the converters tab.
1521 The formats tab is now nearly complete.
1522 The kbmap choices in Languages tab now display the contents of
1523 system_lyxdir/kbd/*.kmap in readable form.
1525 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
1526 Moved some variables into the class.
1528 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
1529 inactive tab folder to FL_COL1. Haven't yet worked out how to change
1530 colour of active folder to lighter grey instead. Any takers?
1531 (form_colours): added an "Apply" button.
1532 (form_converters): added a "Flags" input field.
1533 (form_formats): added a "Shortcut" input field. Note that we can't use
1534 names such as "input_shortcut" as this buggers up the sed script stuff.
1536 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1544 * src/lyx_sendfax_main.C:
1547 * src/spellchecker.C:
1548 * src/insets/figinset.C:
1549 * src/insets/insetbib.C:
1550 * src/insets/insetexternal.C:
1551 * src/insets/insetinclude.C:
1552 * src/insets/insetinfo.C:
1553 * src/mathed/math_panel.C:
1554 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
1555 all "daughter" dialogs now have identical "feel".
1557 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1559 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
1560 used (and was only used in one place prior to this patch. Incorrectly!)
1562 * src/frontends/xforms/FormDocument.C: changed some instances of
1563 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
1564 sense. Also added fl_set_input_return() for class_->input_doc_extra and
1565 for options_->input_float_placement. This fixes a bug reported by
1568 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
1569 functionality into d-tor.
1571 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
1572 input of numerals also.
1574 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
1575 fl_set_form_atclose(). Can now close dialog from window manager,
1576 fixing a bug reported by Rob Lahaye.
1578 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
1580 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
1581 are no longer dark. Haven't yet worked out how to lighten the colour of
1582 the active tabfolder. Any ideas anybody?
1583 Adjusted Colours tab a little.
1584 Added Shortcut field to converters tab. Note that we can't create an
1585 fdesign label like "input_shortcut" as this buggers up the sed-script
1588 * src/frontends/xforms/FormPreferences.[Ch]:
1589 (feedback): fixed crash due to to ob=0.
1590 (LanguagesXXX): the kbmap choices now contain the files
1591 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
1592 be replaced by an input with a file browse button, but since the browse
1593 buttons don'y yet work, this'll do for the moment.
1594 (FormatsXXX): think that this is now nearly fully functional.
1595 Some points/questions though:
1596 1. Does "Apply" remove formats if no longer present?
1597 2. I think that the browser should list the GUI names rather than the
1599 3. Must ensure that we can't delete Formats used by an existing
1602 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
1603 if this is the best way to do this.
1605 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1607 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
1609 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
1610 for variable assignment.
1612 2000-11-07 Rob Lahaye <lahaye@postech.edu>
1614 * src/lib/ui/default.ui: added sub/superscripts to menu as
1615 Insert->Special characters and cleaned-up the file a bit
1617 2000-11-07 Allan Rae <rae@lyx.org>
1619 * src/frontends/xforms/FormPreferences.C (feedback): make sure
1620 ob isn't 0 before using it. See comments in function.
1622 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
1624 * src/frontends/xforms/form_*.C: regenerated
1626 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1628 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
1630 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
1631 compiling with gcc-2.96
1633 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1635 * src/support/lyxstring.C: add a couple "using" directives.
1637 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
1638 a .c_str() here too for good measure.
1639 * src/Spacing.C (set): ditto.
1640 * src/lyxfunc.C (Dispatch): ditto.
1642 * src/insets/insettabular.C (copySelection): change .str() to
1643 .str().c_str() to fix problems with lyxstring.
1644 * src/support/filetools.C (GetFileContents): ditto.
1645 * src/buffer.C (asciiParagraph): ditto.
1646 * src/paragraph.C (String): ditto.
1648 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
1649 * lib/bind/sciword.bind: ditto.
1651 * src/LyXAction.C (init): remove "symbol-insert" function, which
1652 shared LFUN_INSERT_MATH with "math-insert".
1654 * lib/configure.m4: == is not a valid operator for command test.
1656 * src/lyxrc.C: add using directive.
1658 * src/converter.h: add std:: qualifier.
1660 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
1662 * src/converter.[Ch] and other files: Change the Format class to a
1663 real class, and create two instances: formats and system_format.
1665 * src/lyxrc.C (output): Output the difference between formats and
1668 * src/frontends/xforms/FormPreferences.C (input): Simplify.
1669 (buildFormats): Insert formats into browser.
1670 (inputFormats): Made the browser and add button functional.
1671 (applyFormats): Update formats from format_vec.
1673 * src/converter.C: Changed all (*it). to it->
1674 (Format::dummy): New method.
1675 (Format::importer): New format flag.
1676 (Formats::GetAllFormats): New method.
1677 (Formats::Add): Delete format from the map if prettyname is empty.
1678 (Converter::Convert): Print an error message if moving the file fails.
1679 (Converter::GetReachableTo): New method
1681 * src/MenuBackend.[Ch]: Add support for importformats tag.
1683 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
1685 * lib/configure.m4: Add word->tex and ps->fax converters.
1687 * lib/ui/default.ui: Use ImportFormats on file->import menu.
1688 Return fax to file menu.
1692 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
1694 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
1697 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
1700 * src/lyxfunc.C (processKeyEvent): removed
1702 * src/bufferlist.C (emergencyWrite): removed the out commented
1703 emergency write code.
1705 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
1707 * src/LyXView.[Ch]: remove the outcommented raw_callback code
1709 * many files: change formatting to be a bit more uniform for
1710 if,while,for,switch statements, remove some parantesis not needed.
1713 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
1715 * config/kde.m4: make config more robust when KDEDIR is set
1717 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1719 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
1720 not returned a pixmap for "math-insert".
1722 * src/LyXAction.C (init): sort the entries a bit.
1724 2000-11-03 Juergen Vigna <jug@sad.it>
1726 * src/insets/insettabular.h: added fixed number to update codes so
1727 that update is only in one direction.
1729 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
1732 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
1733 before call to edit because of redraw.
1735 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
1737 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1739 * lib/ui/default.ui: Populate "edit_float" menu
1741 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
1743 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
1744 "floats-operate". The name is ugly (and the func also), but this
1745 is just a band-aid until we switch to new insets.
1747 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1749 * lib/ui/default.ui: update again the menu layout (fix some
1752 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1754 * src/MenuBackend.h (fulllabel): new method.
1756 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
1757 the menu shortcuts of a menu are unique and whether they
1758 correspond to a letter of the label.
1759 (expand): call checkShortcuts when debugging.
1761 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
1763 * src/insets/insettext.C (InsetButtonPress): shut off warning.
1765 2000-11-02 Lior Silberman <lior@Princeton.EDU>
1767 * lib/examples/*.lyx : '\language default' => '\language english'
1769 * lib/examples/it_splash.lyx : except where it should be italian
1771 * lib/templates/*.lyx : the same
1773 * doc/*.lyx* : the same
1775 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1777 * lib/bind/menus.bind: remove the Layout menu entries, which I
1778 somehow forgot earlier.
1780 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1782 * lib/ui/old-default.ui: keep the old one here for reference (to
1785 * lib/ui/default.ui: update the menu layout
1787 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
1789 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
1790 Can now Apply to different insets without closing the dialog.
1792 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
1793 Can't actually DO anything with them yet, but I'd like a little
1796 * src/frontends/xforms/input_validators.[ch]
1797 (fl_lowercase_filter): new.
1799 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
1801 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
1802 of MATH_CODE. This fixes a bug with math-macros in RTL text.
1804 * src/text.C (PrepareToPrint): Show math-macros block aligned.
1806 2000-11-02 Juergen Vigna <jug@sad.it>
1808 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
1809 on char insertion as it has already be updated by bv->updateInset().
1811 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
1812 if an inset inside was updated.
1814 * lib/configure.cmd: commented out fax-search code
1816 2000-11-01 Yves Bastide <stid@acm.org>
1818 * src/tabular.C (OldFormatRead): set tabular language to the
1821 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1823 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
1824 class names with non-letter characters (from Yves Bastide).
1826 * lib/ui/default.ui: change Item to OptItem in import menu.
1827 Comment out fax stuff.
1829 * lib/configure.m4: comment out fax-related stuff.
1831 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
1833 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
1834 useful xforms helper functions. At present contains only formatted().
1835 Input a string and it returns it with line breaks so that in fits
1838 * src/frontends/xforms/Makefile.am: add new files.
1840 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
1841 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
1844 * src/frontends/xforms/FormPreferences.[Ch]:
1845 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
1846 but lots of little clean ups. Removed enum State. Make use of
1847 formatted(). Constify lots of methods. Perhaps best of all: removed
1848 requirement for that horrible reinterpret_cast from pointer to long in
1851 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1853 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
1854 conditionalize build on xforms < 0.89
1856 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
1858 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
1860 * src/LyXAction.C (init): comment out fax
1862 * src/lyxrc.h: comment out the fax enums
1863 comment out the fax variables
1865 * src/commandtags.h: comment out LFUN_FAX
1867 * src/lyxrc.C: disable fax variables.
1868 (read): disable parsing of fax variables
1869 (output): disable writing of fax variables
1870 (getFeedback): now description for fax variables
1872 * src/lyxfunc.C: comment out MenuFax
1873 (Dispatch): disable LFUN_FAX
1875 * src/lyx_cb.C (MenuFax): comment out
1877 * src/WorkArea.C: add <cctype>
1878 (work_area_handler): better key handling, should be ok now.
1879 for accented chars + etc
1881 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
1882 lyx_sendfax.h and lyx_sendfax_man.C
1884 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
1885 (show): don't call InitLyXLookup when using xforms 0.89
1887 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1889 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1891 * src/support/filetools.C (GetFileContents): close to dummy change
1893 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1895 * src/trans.C (AddDeadkey): workaround stupid compilers.
1897 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1899 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1900 of two-sided document.
1902 2000-10-31 Juergen Vigna <jug@sad.it>
1904 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1906 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1907 xposition to the Edit call.
1909 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1911 * src/trans.C (AddDeadkey): cast explicitly to char.
1913 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1915 * src/tabular.C (AsciiBottomHLine): simplify?
1916 (AsciiTopHLine): simplify?
1917 (print_n_chars): simplify
1918 (DocBook): remove most of the << endl; we should flush the stream
1919 as seldom as possible.
1921 (TeXBottomHLine): ditto
1922 (TeXTopHLine): ditto
1924 (write_attribute): try a templified version.
1925 (set_row_column_number_info): lesson scope of variables
1927 * src/support/lstrings.h (tostr): new specialization of tostr
1929 * src/trans.C (AddDeadkey): slightly cleaner fix.
1931 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1933 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1934 '%%' in Toc menu labels.
1937 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1938 font_norm is iso10646-1.
1940 * src/font.C (ascent): Fixed for 16bit fonts
1941 (descent,lbearing,rbearing): ditto
1943 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1945 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1946 (getFeedback): new static method.
1948 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1949 Now use combox rather than choice to display languages.
1950 Feedback is now output using a new timer callback mechanism, identical
1951 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1953 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1955 * src/minibuffer.C: fix for older compilers
1957 2000-10-30 Juergen Vigna <jug@sad.it>
1959 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1960 has to be Left of the inset otherwise LyXText won't find it!
1962 * src/BufferView2.C (open_new_inset): delete the inset if it can
1965 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1967 * lyx.man: fix typo.
1969 2000-10-29 Marko Vendelin <markov@ioc.ee>
1970 * src/frontends/gnome/FormCitation.C
1971 * src/frontends/gnome/FormCitation.h
1972 * src/frontends/gnome/FormCopyright.C
1973 * src/frontends/gnome/FormCopyright.h
1974 * src/frontends/gnome/FormError.C
1975 * src/frontends/gnome/FormError.h
1976 * src/frontends/gnome/FormIndex.C
1977 * src/frontends/gnome/FormIndex.h
1978 * src/frontends/gnome/FormPrint.C
1979 * src/frontends/gnome/FormPrint.h
1980 * src/frontends/gnome/FormRef.C
1981 * src/frontends/gnome/FormRef.h
1982 * src/frontends/gnome/FormToc.C
1983 * src/frontends/gnome/FormToc.h
1984 * src/frontends/gnome/FormUrl.C
1985 * src/frontends/gnome/FormUrl.h
1986 * src/frontends/gnome/Menubar_pimpl.C
1987 * src/frontends/gnome/mainapp.C
1988 * src/frontends/gnome/mainapp.h
1989 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1990 changing update() to updateSlot() where appropriate
1992 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1994 * src/frontends/xforms/FormPreferences.[Ch]:
1995 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1998 2000-10-28 Juergen Vigna <jug@sad.it>
2000 * src/insets/insettabular.C (draw): fixed drawing bug.
2002 * src/insets/insettext.C (clear):
2004 (SetParagraphData): clearing the TEXT buffers when deleting the
2005 paragraphs used by it.
2007 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
2009 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
2011 2000-10-27 Juergen Vigna <jug@sad.it>
2013 * src/tabular.C (~LyXTabular): removed not needed anymore.
2015 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
2018 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
2020 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
2023 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
2026 * src/frontends/xforms/FormPreferences.[Ch]:
2027 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
2028 Reorganised as modules based on tabs. Much easier to follow the
2029 flow and to add new tabs. Added warning and feedback messages.
2032 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2034 * src/tabular.h (DocBook): add std:: qualifier.
2036 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
2038 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
2039 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
2042 * insettabular.C (DocBook): uses the tabular methods to export
2045 * src/insets/insettext.h
2046 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
2048 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2050 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
2053 * src/lyxfunc.C (MenuNew): lessen the scope of fname
2054 moved misplaced AllowInput two lines up.
2056 * src/buffer.C (readFile): compare float with float, not with int
2058 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2060 * src/minibuffer.C: add "using SigC::slot" statement.
2062 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
2064 * src/frontends/xforms/forms/README: updated section about make.
2066 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
2067 Tidied some forms up, made two of form_tabular's tabs more
2068 self-consistent, fixed Jean-Marc's size problem in form_preferences,
2069 fixed translation problem with "Column".
2071 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2073 * src/minibuffer.h: use Timeout instead of the xforms timer
2075 (setTimer) rewrite for the Timeout, change to unsigned arg
2076 (set): change to unsigned timer arg
2079 * src/minibuffer.C (TimerCB): removed func
2080 (C_MiniBuffer_TimerCB): removed func
2081 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
2082 (peek_event): use a switch statement
2083 (add): don't use fl_add_timer.
2084 (Set): rewrite to use the Timeout
2087 * src/Timeout.[Ch] (setType): return a Timeout &
2088 (setTimeout): ditto, change to unsigned arg for timeout
2090 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
2092 * src/mathed/formula.C (mathed_string_width): Use string instead
2093 of a constant size char array.
2095 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2097 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
2098 the two recently added operator<< for SMInput and State.
2100 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
2102 (OkCancelPolicy): ditto
2103 (OkCancelReadOnlyPolicy): ditto
2104 (NoRepeatedApplyReadOnlyPolicy): ditto
2105 (OkApplyCancelReadOnlyPolicy): ditto
2106 (OkApplyCancelPolicy): ditto
2107 (NoRepeatedApplyPolicy): ditto
2109 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2111 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
2112 add the usual std:: qualifiers.
2114 2000-10-25 Juergen Vigna <jug@sad.it>
2116 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
2118 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2120 * src/support/filetools.C (MakeRelPath): change some types to
2123 * src/frontends/ButtonPolicies.h (operator<<): new operator for
2124 ButtonPolicy::SMInput and ButtonPolicy::State.
2126 * src/FontLoader.C (reset): small cleanup
2127 (unload): small cleanup
2129 * src/FontInfo.C (getFontname): initialize error to 10000.0
2131 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
2133 * src/frontends/xforms/FormPreferences.[Ch]:
2134 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
2135 TeX encoding and default paper size sections.
2137 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
2139 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
2142 * src/frontends/xforms/FormError.C (disconnect): use erase() to
2143 make the message_ empty.
2144 (FormError): don't initialize message_ in initializer list.
2146 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
2148 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
2150 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2152 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
2154 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
2156 * src/frontends/kde/*data.[Ch]: _("") is not
2159 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
2161 * src/buffer.C: removed redundant using directive.
2163 * src/frontends/DialogBase.h: revert to original definition of
2166 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
2167 stuff into two classes, one for each dialog, requires a new
2168 element in the dialogs vector, FormTabularCreate.
2170 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
2173 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
2174 method. Continues Allan's idea, but means that derived classes
2175 don't need to worry about "update or hide?".
2177 * src/frontends/xforms/FormError.C (showInset): add connection
2180 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
2181 one for each dialog. FormTabular now contains main tabular dialog
2184 * src/frontends/xforms/FormTabularCreate.[Ch]:
2185 * src/frontends/xforms/forms/form_tabular_create.fd: the create
2188 * src/frontends/xforms/FormGraphics.[Ch]:
2189 * src/frontends/xforms/forms/form_graphics.fd
2190 * src/frontends/xforms/FormTabular.[Ch]:
2191 * src/frontends/xforms/forms/form_tabular.fd: made daughter
2192 classes of FormInset.
2194 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
2195 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
2197 * src/frontends/xforms/Makefile.am:
2198 * src/frontends/xforms/forms/makefile: added new files.
2200 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
2201 variable. added Signal0 hide signal, in keeping with other GUI-I
2204 * src/support/lstrings.h: removed redundant std:: qualifier as
2205 it's already declared in Lsstream.h.
2207 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2209 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
2213 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
2215 * src/tabular.C (Ascii): minimize scope of cell.
2217 * src/BufferView2.C (nextWord): return string() instead of 0;
2219 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2221 * src/converter.h: add a std:: qualifier
2223 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
2225 * src/importer.[Ch]: New files. Used for importing files into LyX.
2227 * src/lyxfunc.C (doImport): Use the new Importer class.
2229 * src/converter.h: Add shortcut member to the Format class.
2230 Used for holding the menu shortcut.
2232 * src/converter.C and other files: Made a distinction between
2233 format name and format extension. New formats can be defined using
2234 the \format lyxrc tag.
2235 Added two new converter flags: latex and disable.
2237 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2239 * src/support/lyxlib.h: unify namespace/struct implementation.
2240 Remove extra declarations.
2242 * src/support/chdir.C (chdir): remove version taking char const *
2244 * src/support/rename.C: ditto.
2245 * src/support/lyxsum.C: ditto.
2247 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
2249 * src/frontends/xforms/FormBase.[Ch]:
2250 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
2251 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
2252 work only for the next call to fl_show_form(). The correct place to set
2253 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
2254 done. FormBase also stores minw_, minh_ itself. All dialogs derived
2255 from FormBase have the minimum size set; no more stupid crashes with
2258 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2260 * lib/ui/default.ui: fix shortcut for Insert->Include File.
2262 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2264 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
2266 * src/support/lyxlib.h: changed second argument of mkdir to
2267 unsigned long int (unsigned int would probably have been enough,
2268 but...). Removed <sys/types.h> header.
2269 * src/support/mkdir.C (mkdir): ditto.
2273 2000-10-19 Juergen Vigna <jug@sad.it>
2275 * src/lyxfunc.C (MenuNew): small fix (form John)
2277 * src/screen.C (Update): removed unneeded code.
2279 * src/tabular.C (Ascii): refixed int != uint bug!
2281 * src/support/lyxlib.h: added sys/types.h include for now permits
2282 compiling, but I don't like this!
2284 2000-10-18 Juergen Vigna <jug@sad.it>
2286 * src/text2.C (ClearSelection): if we clear the selection we need
2287 more refresh so set the status apropriately
2289 * src/insets/insettext.C (draw): hopefully finally fixed draw
2292 2000-10-12 Juergen Vigna <jug@sad.it>
2294 * src/insets/insettext.C (draw): another small fix and make a block
2295 so that variables are localized.
2297 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
2299 * src/support/lstrings.C (lowercase, uppercase):
2300 use explicit casts to remove compiler warnings.
2302 * src/support/LRegex.C (Impl):
2303 * src/support/StrPool.C (add):
2304 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
2305 (AddPath, MakeDisplayPath):
2306 * src/support/lstrings.C (prefixIs, subst):
2307 use correct type to remove compiler warnings.
2309 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
2311 * src/support/lyxlib.h:
2312 * src/support/mkdir.C (mkdir): change parameter to mode_t for
2313 portability and to remove compiler warning with DEC cxx.
2315 * src/support/FileInfo.[Ch] (flagRWX): ditto.
2317 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2319 * src/minibuffer.C (peek_event): retun 1 when there has been a
2320 mouseclick in the minibuffer.
2324 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
2326 * src/frontends/xforms/FormParagraph.C: more space above/below
2329 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
2331 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
2332 a char only if real_current_font was changed.
2334 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2336 * NEWS: update somewhat for 1.1.6
2338 * lib/ui/default.ui: clean up.
2340 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
2342 * lib/CREDITS: clean up
2344 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2346 * src/combox.[Ch] (select): changed argument back to int
2347 * src/combox.C (peek_event): removed num_bytes as it is declared but
2350 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
2351 modified calls to Combox::select() to remove warnings about type
2354 * src/insets/insetbutton.C (width): explicit cast to remove warning
2355 about type conversion.
2357 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
2360 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
2361 sel_pos_end, refering to cursor position are changed to
2362 LyXParagraph::size_type.
2364 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
2365 consistent with LyXCursor::pos().
2366 (inset_pos): changed to LyXParagraph::size_type for same reason.
2368 * src/insets/insettext.C (resizeLyXText): changed some temporary
2369 variables refing to cursor position to LyXParagraph::size_type.
2371 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
2373 * src/frontends/kde/<various>: The Great Renaming,
2376 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2378 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
2380 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2382 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
2383 0 when there are no arguments.
2385 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2387 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
2388 to segfaults when pressing Ok in InsetBibtex dialog.
2390 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2392 * forms/layout_forms.fd:
2393 * src/layout_forms.C (create_form_form_character): small change to use
2394 labelframe rather than engraved frame + text
2396 * src/lyx_gui.C (create_forms): initialise choice_language with some
2397 arbitrary value to prevent segfault when dialog is shown.
2399 2000-10-16 Baruch Even <baruch.even@writeme.com>
2401 * src/converter.C (runLaTeX, scanLog): Added a warning when there
2402 is no resulting file. This pertains only to LaTeX output.
2404 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
2406 * src/text.C (Backspace): Make sure that the row of the cursor is
2409 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
2412 * src/lyx_gui.C (init): Prevent a crash when only one font from
2413 menu/popup fonts is not found.
2415 * lib/lyxrc.example: Add an example for binding a key for language
2418 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
2420 * src/converter.C (GetReachable): Changed the returned type to
2422 (IsReachable): New method
2424 * src/MenuBackend.C (expand): Handle formats that appear more
2427 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2429 * src/frontends/support/Makefile.am
2430 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
2433 * lib/CREDITS: add Garst Reese.
2435 * src/support/snprintf.h: add extern "C" {} around the definitions.
2437 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
2439 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2442 * src/frontends/xforms/FormDocument.C:
2443 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
2444 compile without "conversion to integral type of smaller size"
2447 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2449 * src/text.C (GetColumnNearX): Fixed disabled code.
2451 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2453 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
2456 * src/support/snprintf.[ch]: new files
2458 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2460 * src/frontends/kde/formprintdialog.C: add
2461 file browser for selecting postscript output
2463 * src/frontends/kde/formprintdialogdata.C:
2464 * src/frontends/kde/formprintdialogdata.h: re-generate
2467 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2469 * src/frontends/gnome/Makefile.am:
2470 * src/frontends/kde/Makefile.am: FormCommand.C
2471 disappeared from xforms
2473 * src/frontends/kde/FormCitation.C:
2474 * src/frontends/kde/FormIndex.C: read-only
2477 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2479 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
2482 * src/bufferlist.C: add using directive.
2484 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2486 * src/support/lyxfunctional.h: version of class_fun for void
2487 returns added, const versions of back_inseter_fun and compare_fun
2490 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2492 * src/frontends/xforms/FormInset.C (showInset): fix typo.
2494 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2496 * ChangeLog: cleanup.
2498 * lib/CREDITS: update to add all the contributors we've forgotten.
2499 I have obviously missed some, so tell me whether there were
2502 2000-10-13 Marko Vendelin <markov@ioc.ee>
2504 * src/frontends/gnome/FormCitation.C
2505 * src/frontends/gnome/FormCitation.h
2506 * src/frontends/gnome/FormError.C
2507 * src/frontends/gnome/FormIndex.C
2508 * src/frontends/gnome/FormRef.C
2509 * src/frontends/gnome/FormRef.h
2510 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
2512 * src/frontends/gnome/FormCitation.C
2513 * src/frontends/gnome/FormCopyright.C
2514 * src/frontends/gnome/FormError.C
2515 * src/frontends/gnome/FormIndex.C
2516 * src/frontends/gnome/FormRef.C
2517 * src/frontends/gnome/FormToc.C
2518 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
2521 * src/frontends/gnome/Menubar_pimpl.C
2522 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
2525 2000-10-11 Baruch Even <baruch.even@writeme.com>
2528 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
2529 to convey its real action.
2531 * src/minibuffer.C (peek_event): Added action when mouse clicks to
2532 clear the minibuffer and prepare to enter a command.
2534 * src/mathed/formula.C (LocalDispatch): Changed to conform with
2535 the rename from ExecCommand to PrepareForCommand.
2536 * src/lyxfunc.C (Dispatch): ditto.
2538 2000-10-11 Baruch Even <baruch.even@writeme.com>
2540 * src/buffer.C (writeFile): Added test for errors on writing, this
2541 catches all errors and not only file system full errors as intended.
2543 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2545 * src/lyx_gui.C (create_forms): better fix for crash with
2546 translated interface.
2548 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
2550 * src/frontends/kde/Makefile.am:
2551 * src/frontends/kde/FormCopyright.C:
2552 * src/frontends/kde/formcopyrightdialog.C:
2553 * src/frontends/kde/formcopyrightdialog.h:
2554 * src/frontends/kde/formcopyrightdialogdata.C:
2555 * src/frontends/kde/formcopyrightdialogdata.h:
2556 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
2557 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
2558 copyright to use qtarch
2560 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
2562 * src/encoding.C (read): Fixed bug that caused an error message at
2563 the end of the file.
2565 * po/Makefile.in.in: Fixed rule for ext_l10n.h
2567 * lib/lyxrc.example: Fixed hebrew example.
2569 2000-10-13 Allan Rae <rae@lyx.org>
2571 * src/frontends/xforms/FormPreferences.C (input): reworking the
2573 (build, update, apply): New inputs in various tabfolders
2575 * src/frontends/xforms/FormToc.C: use new button policy.
2576 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
2577 dialogs that either can't use any existing policy or where it just
2580 * src/frontends/xforms/FormTabular.h: removed copyright notice that
2583 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
2584 added a bool parameter which is ignored.
2586 * src/buffer.C (setReadonly):
2587 * src/BufferView_pimpl.C (buffer):
2588 * src/frontends/kde/FormCopyright.h (update):
2589 * src/frontends/kde/FormCitation.[Ch] (update):
2590 * src/frontends/kde/FormIndex.[Ch] (update):
2591 * src/frontends/kde/FormPrint.[Ch] (update):
2592 * src/frontends/kde/FormRef.[Ch] (update):
2593 * src/frontends/kde/FormToc.[Ch] (update):
2594 * src/frontends/kde/FormUrl.[Ch] (update):
2595 * src/frontends/gnome/FormCopyright.h (update):
2596 * src/frontends/gnome/FormCitation.[Ch] (update):
2597 * src/frontends/gnome/FormError.[Ch] (update):
2598 * src/frontends/gnome/FormIndex.[Ch] (update):
2599 * src/frontends/gnome/FormPrint.[Ch] (update):
2600 * src/frontends/gnome/FormRef.h (update):
2601 * src/frontends/gnome/FormToc.[Ch] (update):
2602 * src/frontends/gnome/FormUrl.[Ch] (update):
2603 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
2604 to updateBufferDependent and DialogBase
2606 * src/frontends/xforms/FormCitation.[hC]:
2607 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
2608 * src/frontends/xforms/FormError.[Ch]:
2609 * src/frontends/xforms/FormGraphics.[Ch]:
2610 * src/frontends/xforms/FormIndex.[Ch]:
2611 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
2612 and fixed readOnly handling.
2613 * src/frontends/xforms/FormPrint.[Ch]:
2614 * src/frontends/xforms/FormRef.[Ch]:
2615 * src/frontends/xforms/FormTabular.[Ch]:
2616 * src/frontends/xforms/FormToc.[Ch]:
2617 * src/frontends/xforms/FormUrl.[Ch]:
2618 * src/frontends/xforms/FormInset.[Ch]:
2619 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
2620 form of updateBufferDependent.
2622 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
2623 if form()->visible just in case someone does stuff to the form in a
2626 * src/frontends/DialogBase.h (enum): removed enum since we can now use
2627 the buttoncontroller for everything the enum used to be used for.
2628 (update) It would seem we need to force all dialogs to use a bool
2629 parameter or have two update functions. I chose to go with one.
2630 I did try removing update() from here and FormBase and defining the
2631 appropriate update signatures in FormBaseB[DI] but then ran into the
2632 problem of the update() call in FormBase::show(). Whatever I did
2633 to get around that would require another function and that just
2634 got more confusing. Hence the decision to make everyone have an
2635 update(bool). An alternative might have been to override show() in
2636 FormBaseB[DI] and that would allow the different and appropriate
2639 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
2640 true == buffer change occurred. I decided against using a default
2641 template parameter since not all compilers support that at present.
2643 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
2645 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
2646 army knife" by removing functionality.
2647 (clearStore): removed. All such housekeeping on hide()ing the dialog
2648 is to be carried out by overloaded disconnect() methods.
2649 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
2650 superceded by Baruch's neat test (FormGraphics) to update an existing
2651 dialog if a new signal is recieved rather than block all new signals
2653 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
2654 only to Inset dialogs.
2655 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
2656 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
2658 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
2660 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
2661 as a base class to all inset dialogs. Used solely to connect/disconnect
2662 the Inset::hide signal and to define what action to take on receipt of
2663 a UpdateBufferDependent signal.
2664 (FormCommand): now derived from FormInset.
2666 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
2669 * src/frontends/xforms/FormCopyright.[Ch]:
2670 * src/frontends/xforms/FormPreferences.[Ch]:
2671 now derived from FormBaseBI.
2673 * src/frontends/xforms/FormDocument.[Ch]:
2674 * src/frontends/xforms/FormParagraph.[Ch]:
2675 * src/frontends/xforms/FormPrint.[Ch]:
2676 now derived from FormBaseBD.
2678 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
2680 * src/frontends/xforms/FormCitation.[Ch]:
2681 * src/frontends/xforms/FormError.[Ch]:
2682 * src/frontends/xforms/FormRef.[Ch]:
2683 * src/frontends/xforms/FormToc.[Ch]:
2684 (clearStore): reworked as disconnect().
2686 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
2689 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2691 * src/converter.C (runLaTeX): constify buffer argument
2694 * src/frontends/support/Makefile.am (INCLUDES): fix.
2696 * src/buffer.h: add std:: qualifier
2697 * src/insets/figinset.C (addpidwait): ditto
2698 * src/MenuBackend.C: ditto
2699 * src/buffer.C: ditto
2700 * src/bufferlist.C: ditto
2701 * src/layout.C: ditto
2702 * src/lyxfunc.C: ditto
2704 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2706 * src/lyxtext.h (bidi_level): change return type to
2707 LyXParagraph::size_type.
2709 * src/lyxparagraph.h: change size_type to
2710 TextContainer::difference_type. This should really be
2711 TextContainer::size_type, but we need currently to support signed
2714 2000-10-11 Marko Vendelin <markov@ioc.ee>
2715 * src/frontends/gnome/FormError.h
2716 * src/frontends/gnome/FormRef.C
2717 * src/frontends/gnome/FormRef.h
2718 * src/frontends/gnome/FormError.C
2719 * src/frontends/gnome/Makefile.am
2720 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
2721 to Gnome frontend. Both dialogs use "action" area.
2723 2000-10-12 Baruch Even <baruch.even@writeme.com>
2725 * src/graphics/GraphicsCacheItem_pimpl.C:
2726 * src/graphics/Renderer.C:
2727 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
2730 2000-10-12 Juergen Vigna <jug@sad.it>
2732 * src/insets/insettext.C (draw): fixed drawing bug (specifically
2733 visible when selecting).
2735 * development/Code_rules/Rules: fixed some typos.
2737 2000-10-09 Baruch Even <baruch.even@writeme.com>
2739 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
2740 compiling on egcs 1.1.2 possible.
2742 * src/filedlg.C (comp_direntry::operator() ): ditto.
2744 2000-08-31 Baruch Even <baruch.even@writeme.com>
2746 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
2749 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
2750 transient it now only gets freed when the object is destructed.
2752 2000-08-24 Baruch Even <baruch.even@writeme.com>
2754 * src/frontends/FormGraphics.h:
2755 * src/frontends/FormGraphics.C: Changed to use ButtonController and
2758 2000-08-20 Baruch Even <baruch.even@writeme.com>
2760 * src/insets/insetgraphics.C:
2761 (draw): Added messages to the drawn rectangle to report status.
2762 (updateInset): Disabled the use of the inline graphics,
2765 2000-08-17 Baruch Even <baruch.even@writeme.com>
2767 * src/frontends/support: Directory added for the support of GUII LyX.
2769 * src/frontends/support/LyXImage.h:
2770 * src/frontends/support/LyXImage.C: Base class for GUII holding of
2773 * src/frontends/support/LyXImage_X.h:
2774 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
2775 version of LyXImage, this uses the Xlib Pixmap.
2777 * src/PainterBase.h:
2778 * src/PainterBase.C:
2780 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
2781 replacement to Pixmap.
2783 * src/insets/insetgraphics.h:
2784 * src/insets/insetgraphics.C:
2785 * src/graphics/GraphicsCacheItem.h:
2786 * src/graphics/GraphicsCacheItem.C:
2787 * src/graphics/GraphicsCacheItem_pimpl.h:
2788 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
2791 * src/graphics/GraphicsCacheItem.h:
2792 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
2793 another copy of the object.
2795 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
2796 of cacheHandle, this fixed a bug that sent LyX crashing.
2798 * src/graphics/XPM_Renderer.h:
2799 * src/graphics/XPM_Renderer.C:
2800 * src/graphics/EPS_Renderer.h:
2801 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
2803 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2805 * src/lyxfunc.C (processKeySym): only handle the
2806 lockinginset/inset stuff if we have a buffer and text loaded...
2808 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
2810 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2812 * src/support/lyxfunctional.h: add operator= that takes a reference
2814 * src/lyxserver.C (mkfifo): make first arg const
2816 * src/layout.h: renamed name(...) to setName(...) to work around
2819 * src/buffer.C (setFileName): had to change name of function to
2820 work around bugs in egcs. (renamed from fileName)
2822 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
2824 * src/support/translator.h: move helper template classes to
2825 lyxfunctional.h, include "support/lyxfunctional.h"
2827 * src/support/lyxmanip.h: add delaration of fmt
2829 * src/support/lyxfunctional.h: new file
2830 (class_fun_t): new template class
2831 (class_fun): helper template function
2832 (back_insert_fun_iterator): new template class
2833 (back_inserter_fun): helper template function
2834 (compare_memfun_t): new template class
2835 (compare_memfun): helper template function
2836 (equal_1st_in_pair): moved here from translator
2837 (equal_2nd_in_pair): moved here from translator
2839 * src/support/fmt.C: new file
2840 (fmt): new func, can be used for a printf substitute when still
2841 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
2843 * src/support/StrPool.C: add some comments
2845 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
2848 * src/insets/figinset.C (addpidwait): use std::copy with
2849 ostream_iterator to fill the pidwaitlist
2851 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
2853 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
2856 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
2859 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
2861 * src/frontends/xforms/FormDocument.C (build): remove c_str()
2862 (class_update): ditto
2863 (BulletPanel): ditto
2864 (CheckChoiceClass): move initialization of tc and tct
2866 * src/tabular.C: remove current_view
2867 (OldFormatRead): similar to right below [istream::ignore]
2869 * src/lyxlex_pimpl.C (next): add code for faster skipping of
2870 chars, unfortunately this is buggy on gcc 2.95.2, so currently
2871 unused [istream::ignore]
2873 * src/lyxfunc.C: include "support/lyxfunctional.h"
2874 (getInsetByCode): use std::find_if and compare_memfun
2876 * src/lyxfont.C (stateText): remove c_str()
2878 * src/lyx_main.C (setDebuggingLevel): make static
2879 (commandLineHelp): make static
2881 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
2882 Screen* together with fl_get_display() and fl_screen
2884 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
2885 togheter with fl_get_display() and fl_screen
2886 (create_forms): remove c_str()
2888 * src/layout.C: include "support/lyxfunctional.h"
2889 (hasLayout): use std::find_if and compare_memfun
2890 (GetLayout): use std::find_if and comapre_memfun
2891 (delete_layout): use std::remove_if and compare_memfun
2892 (NumberOfClass): use std:.find_if and compare_memfun
2894 * src/gettext.h: change for the new functions
2896 * src/gettext.C: new file, make _(char const * str) and _(string
2897 const & str) real functions.
2899 * src/font.C (width): rewrite slightly to avoid one extra variable
2901 * src/debug.C: initialize Debug::ANY here
2903 * src/commandtags.h: update number comments
2905 * src/combox.h (get): make const func
2907 (getline): make const
2909 * src/combox.C (input_cb): handle case where fl_get_input can
2912 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2913 "support/lyxfunctional.h", remove current_view variable.
2914 (resize): use std::for_each with std::mem_fun
2915 (getFileNames): use std::copy with back_inserter_fun
2916 (getBuffer): change arg type to unsigned int
2917 (emergencyWriteAll): call emergencyWrite with std::for_each and
2919 (emergencyWrite): new method, the for loop in emergencyWriteAll
2921 (exists): use std::find_if with compare_memfun
2922 (getBuffer): use std::find_if and compare_memfun
2924 * src/buffer.h: add typedefs for iterator_category, value_type
2925 difference_type, pointer and reference for inset_iterator
2926 add postfix ++ for inset_iterator
2927 make inset_iterator::getPos() const
2929 * src/buffer.C: added support/lyxmanip.h
2930 (readFile): use lyxerr << fmt instead of printf
2931 (makeLaTeXFile): use std::copy to write out encodings
2933 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2935 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2936 free and the char * temp.
2937 (hasMenu): use std::find_if and compare_memfun
2940 * src/Makefile.am (lyx_SOURCES): added gettext.C
2942 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2943 string::insert small change to avoid temporary
2945 * src/LColor.C (getGUIName): remove c_str()
2947 * several files: change all occurrences of fl_display to
2950 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2951 that -pedantic is not used for gcc 2.97 (cvs gcc)
2953 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2955 2000-10-11 Allan Rae <rae@lyx.org>
2957 * src/frontends/xforms/FormPreferences.C (input): template path must be
2958 a readable directory. It doesn't need to be writeable.
2959 (build, delete, update, apply): New inputs in the various tabfolders
2961 * src/frontends/xforms/forms/form_preferences.fd:
2962 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2963 several new entries to existing folders. Shuffled some existing stuff
2966 * src/frontends/xforms/forms/form_print.fd:
2967 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2968 Should probably rework PrinterParams as well. Note that the switch to
2969 collated is effectively the same as !unsorted so changing PrinterParams
2970 will require a lot of fiddly changes to reverse the existing logic.
2972 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2974 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2976 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2978 2000-10-10 Allan Rae <rae@lyx.org>
2981 * src/lyxfunc.C (Dispatch):
2983 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2986 * src/lyxrc.C (output): Only write the differences between system lyxrc
2987 and the users settings.
2990 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2992 I'll rewrite this later, after 1.1.6 probably, to keep a single
2993 LyXRC but two instances of a LyXRCStruct.
2995 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2997 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2999 * src/tabular.h: add a few std:: qualifiers.
3001 * src/encoding.C: add using directive.
3002 * src/language.C: ditto.
3004 * src/insets/insetquotes.C (Validate): use languages->lang()
3005 instead of only language.
3007 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
3009 * lib/languages: New file.
3011 * lib/encodings: New file.
3013 * src/language.C (Languages): New class.
3014 (read): New method. Reads the languages from the 'languages' file.
3016 * src/encoding.C (Encodings): New class.
3017 (read): New method. Reads the encodings from the 'encodings' file.
3019 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
3022 * src/bufferparams.h and a lot of files: Deleted the member language,
3023 and renamed language_info to language
3025 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
3026 * src/lyxfont.C (latexWriteStartChanges): ditto.
3027 * src/paragraph.C (validate,TeXOnePar): ditto.
3029 * src/lyxfont.C (update): Restored deleted code.
3031 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
3033 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
3035 * src/BufferView_pimpl.C (buffer): cleaned up a little.
3037 * src/insets/figinset.[Ch]:
3038 * src/insets/insetinclude.[Ch]:
3039 * src/insets/insetinclude.[Ch]:
3040 * src/insets/insetparent.[Ch]:
3041 * src/insets/insetref.[Ch]:
3042 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
3044 * src/insets/*.[Ch]:
3045 * src/mathed/formula.[Ch]:
3046 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
3048 * src/buffer.C (parseSingleLyXformat2Token, readInset):
3049 * src/lyx_cb.C (FigureApplyCB):
3050 * src/lyxfunc.C (getStatus, Dispatch):
3051 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
3054 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
3056 * src/converter.[Ch] (Formats::View):
3057 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
3059 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
3060 *current_view->buffer(). This will change later, but this patch is way
3063 2000-10-09 Juergen Vigna <jug@sad.it>
3065 * src/text.C (GetRow): small fix.
3067 * src/BufferView_pimpl.C (cursorPrevious):
3068 (cursorNext): added LyXText parameter to function.
3070 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
3071 keypress depending on cursor position.
3073 2000-10-06 Juergen Vigna <jug@sad.it>
3075 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
3076 (copySelection): redone this function and also copy ascii representa-
3079 * src/tabular.C (Ascii):
3083 (print_n_chars): new functions to realize the ascii export of tabulars.
3085 2000-10-05 Juergen Vigna <jug@sad.it>
3087 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
3088 if we don't have a buffer.
3090 2000-10-10 Allan Rae <rae@lyx.org>
3092 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
3093 with closing dialog. It seems that nested tabfolders require hiding
3094 of inner tabfolders before hiding the dialog itself. Actually all I
3095 did was hide the active outer folder.
3097 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
3098 unless there really is a buffer. hideBufferDependent is called
3101 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
3102 POTFILES.in stays in $(srcdir).
3104 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
3106 * lib/lyxrc.example: Few changes.
3108 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
3110 * src/BufferView_pimpl.C (buffer): only need one the
3111 updateBufferDependent signal to be emitted once! Moved to the end of
3112 the method to allow bv_->text to be updated first.
3114 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
3115 and hSignal_ with Dialogs * and BufferDependency variables.
3116 New Buffer * parent_, initialised when the dialog is launched. Used to
3117 check whether to update() or hide() dialog in the new, private
3118 updateOrHide() method that is connected to the updateBufferDependent
3119 signal. Daughter classes dictate what to do using the
3120 ChangedBufferAction enum, passed to the c-tor.
3122 * src/frontends/xforms/FormCitation.C:
3123 * src/frontends/xforms/FormCommand.C:
3124 * src/frontends/xforms/FormCopyright.C:
3125 * src/frontends/xforms/FormDocument.C:
3126 * src/frontends/xforms/FormError.C:
3127 * src/frontends/xforms/FormIndex.C:
3128 * src/frontends/xforms/FormPreferences.C:
3129 * src/frontends/xforms/FormPrint.C:
3130 * src/frontends/xforms/FormRef.C:
3131 * src/frontends/xforms/FormToc.C:
3132 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
3135 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
3136 ChangedBufferAction enum.
3138 * src/frontends/xforms/FormParagraph.[Ch]
3139 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
3142 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3144 * lib/bind/cua.bind: fix a bit.
3145 * lib/bind/emacs.bind: ditto.
3147 * lib/bind/menus.bind: remove real menu entries from there.
3149 * src/spellchecker.C: make sure we only include strings.h when
3152 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
3154 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
3155 function. It enlarges the maximum number of pup when needed.
3156 (add_toc2): Open a new menu if maximum number of items per menu has
3159 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
3161 * src/frontends/kde/FormPrint.C: fix error reporting
3163 * src/frontends/xforms/FormDocument.C: fix compiler
3166 * lib/.cvsignore: add Literate.nw
3168 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
3171 * bufferview_funcs.[Ch]
3174 * text2.C: Add support for numbers in RTL text.
3176 2000-10-06 Allan Rae <rae@lyx.org>
3178 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
3179 to be gettext.m4 friendly again. ext_l10n.h is now
3180 generated into $top_srcdir instead of $top_builddir
3181 so that lyx.pot will be built correctly -- without
3182 duplicate parsing of ext_l10n.h.
3184 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
3186 * src/frontends/kde/FormCitation.C: make the dialog
3187 behave more sensibly
3189 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
3191 * config/kde.m4: fix consecutive ./configure runs,
3192 look for qtarch, fix library order
3194 * src/frontends/kde/Makefile.am: tidy up,
3195 add Print dialog, add .dlg dependencies
3197 * src/frontends/kde/FormPrint.C:
3198 * src/frontends/kde/FormPrint.h:
3199 * src/frontends/kde/formprintdialog.C:
3200 * src/frontends/kde/formprintdialog.h:
3201 * src/frontends/kde/formprintdialogdata.C:
3202 * src/frontends/kde/formprintdialogdata.h:
3203 * src/frontends/kde/dlg/formprintdialog.dlg: add
3206 * src/frontends/kde/dlg/README: Added explanatory readme
3208 * src/frontends/kde/dlg/checkinitorder.pl: small perl
3209 script to double-check qtarch's output
3211 * src/frontends/kde/formindexdialog.C:
3212 * src/frontends/kde/formindexdialogdata.C:
3213 * src/frontends/kde/formindexdialogdata.h:
3214 * src/frontends/kde/dlg/formindexdialog.dlg: update
3215 for qtarch, minor fixes
3217 2000-10-05 Allan Rae <rae@lyx.org>
3219 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
3220 dialogs when switching buffers update them instead. It's up to each
3221 dialog to decide if it should still be visible or not.
3222 update() should return a bool to control visiblity within show().
3223 Or perhaps better to set a member variable and use that to control
3226 * lib/build-listerrors: create an empty "listerrors" file just to stop
3227 make trying to regenerate it all the time if you don't have noweb
3230 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
3232 * po/Makefile.in.in (ext_l10n.h): added a rule to build
3233 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
3234 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
3235 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
3236 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
3238 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
3240 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
3242 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
3243 deleting buffer. Closes all buffer-dependent dialogs.
3245 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
3247 * src/frontends/xforms/FormCitation.[Ch]:
3248 * src/frontends/xforms/FormPreferences.[Ch]:
3249 * src/frontends/xforms/FormPrint.[Ch]:
3250 * src/frontends/xforms/FormRef.[Ch]:
3251 * src/frontends/xforms/FormUrl.[Ch]: ditto
3253 * src/frontends/xforms/FormDocument.[Ch]:
3254 * src/frontends/xforms/forms/form_document.C.patch:
3255 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
3256 pass through a single input() function.
3258 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
3260 * lib/build-listerrors: return status as OK
3262 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
3264 * lib/lyxrc.example: Updated to new export code
3266 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3268 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
3271 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
3274 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
3275 LyX-Code is defined.
3276 * lib/layouts/amsbook.layout: ditto.
3278 * boost/Makefile.am: fix typo.
3280 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
3282 (add_lastfiles): removed.
3283 (add_documents): removed.
3284 (add_formats): removed.
3286 * src/frontends/Menubar.C: remove useless "using" directive.
3288 * src/MenuBackend.h: add a new MenuItem constructor.
3290 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
3293 2000-10-04 Allan Rae <rae@lyx.org>
3295 * lib/Makefile.am (listerrors):
3296 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
3297 I haven't got notangle installed so Kayvan please test. The output
3298 should end up in $builddir. This also allows people who don't have
3299 noweb installed to complete the make process without error.
3301 * src/frontends/xforms/FormCommand.[Ch] (showInset):
3302 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
3303 by JMarc's picky compiler.
3305 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3308 * src/insets/insettabular.C (setPos): change for loop to not use
3309 sequencing operator. Please check this Jürgen.
3311 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
3313 * src/insets/insetcite.C (getScreenLabel): ditto
3314 * src/support/filetools.C (QuoteName): ditto
3315 (ChangeExtension): ditto
3317 * src/BufferView_pimpl.C (scrollCB): make heigt int
3319 * src/BufferView2.C (insertInset): comment out unused arg
3321 * boost/Makefile.am (EXTRADIST): new variable
3323 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
3325 * src/exporter.C (IsExportable): Fixed
3327 * lib/configure.m4: Small fix
3329 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
3331 * src/insets/insetbutton.C (width): Changed to work with no GUI.
3332 * src/insets/insetbib.C (bibitemWidest): ditto.
3333 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
3335 2000-10-03 Juergen Vigna <jug@sad.it>
3337 * src/BufferView2.C (theLockingInset): removed const because of
3338 Agnus's compile problems.
3340 * src/insets/insettext.C (LocalDispatch): set the language of the
3341 surronding paragraph on inserting the first character.
3343 * various files: changed use of BufferView::the_locking_inset.
3345 * src/BufferView2.C (theLockingInset):
3346 (theLockingInset): new functions.
3348 * src/BufferView.h: removed the_locking_inset.
3350 * src/lyxtext.h: added the_locking_inset
3352 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
3354 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
3356 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3358 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
3359 * src/mathed/math_cursor.C (IsAlpha): ditto.
3360 * src/mathed/math_inset.C (strnew): ditto.
3361 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
3362 (IMetrics): cxp set but never used; removed.
3363 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
3364 that the variable in question has been removed also!
3367 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
3368 using the Buffer * passed to Latex(), using the BufferView * passed to
3369 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
3371 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
3372 Linuxdoc() and DocBook() rather than the stored Buffer * master.
3374 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
3375 * src/buffer.C (readInset): used new InsetBibtex c-tor
3376 * (getBibkeyList): used new InsetBibtex::getKeys
3378 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3381 * lib/build-listerrors
3383 * src/exporter.C: Add literate programming support to the export code
3386 * src/lyx_cb.C: Remove old literate code.
3388 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
3391 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
3392 * src/converter.C (View, Convert): Use QuoteName.
3394 * src/insets/figinset.C (Preview): Use Formats::View.
3396 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
3398 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3400 * src/lyxfunc.C (Dispatch): move declaration of text variable at
3401 the top of the function, because compaq cxx complains that the
3402 "goto exit_with_message" when the function is disabled bypasses
3404 (MenuNew): try a better fix for the generation of new file names.
3405 This time, I used AddName() instead of AddPath(), hoping Juergen
3408 2000-10-03 Allan Rae <rae@lyx.org>
3410 * src/frontends/xforms/forms/form_preferences.fd:
3411 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
3412 nested tabfolders has begun. The old "Miscellaneous" was renamed as
3413 "Look and Feel"->"General" but will need to be split up further into
3414 general output and general input tabs. Current plan is for four outer
3415 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
3416 stuff; "Inputs" for input and import configuration; "Outputs" for
3417 output and export configuration; and one more whatever is left over
3418 called "General". The leftovers at present look like being which
3419 viewers to use, spellchecker, language support and might be better
3420 named "Support". I've put "Paths" in "Inputs" for the moment as this
3421 seems reasonable for now at least.
3422 One problem remains: X error kills LyX when you close Preferences.
3424 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3426 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
3427 qualifier from form()
3428 * src/frontends/xforms/FormCitation.[Ch]:
3429 * src/frontends/xforms/FormCopyright.[Ch]:
3430 * src/frontends/xforms/FormDocument.[Ch]:
3431 * src/frontends/xforms/FormError.[Ch]:
3432 * src/frontends/xforms/FormIndex.[Ch]:
3433 * src/frontends/xforms/FormPreferences.[Ch]:
3434 * src/frontends/xforms/FormPrint.[Ch]:
3435 * src/frontends/xforms/FormRef.[Ch]:
3436 * src/frontends/xforms/FormToc.[Ch]:
3437 * src/frontends/xforms/FormUrl.[Ch]: ditto.
3439 * src/frontends/xforms/FormCitation.[Ch]:
3440 * src/frontends/xforms/FormIndex.[Ch]:
3441 * src/frontends/xforms/FormRef.[Ch]:
3442 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
3443 with Allan's naming policy
3445 * src/frontends/xforms/FormCitation.C: some static casts to remove
3448 2000-10-02 Juergen Vigna <jug@sad.it>
3450 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
3451 now you can type or do stuff inside the table-cell also when in dummy
3452 position, fixed visible cursor.
3454 * src/insets/insettext.C (Edit): fixing cursor-view position.
3456 * src/lyxfunc.C (Dispatch): use * text variable so that it can
3457 be used for equal functions in lyxfunc and insettext.
3459 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
3461 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
3463 * src/frontends/gnome/FormCitation.h:
3464 * src/frontends/gnome/FormCopyright.h:
3465 * src/frontends/gnome/FormIndex.h:
3466 * src/frontends/gnome/FormPrint.h:
3467 * src/frontends/gnome/FormToc.h:
3468 * src/frontends/gnome/FormUrl.h:
3469 * src/frontends/kde/FormCitation.h:
3470 * src/frontends/kde/FormCopyright.h:
3471 * src/frontends/kde/FormIndex.h:
3472 * src/frontends/kde/FormRef.h:
3473 * src/frontends/kde/FormToc.h:
3474 * src/frontends/kde/FormUrl.h: fix remaining users of
3477 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3479 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
3480 from depth argument.
3481 (DocBookHandleCaption): ditto.
3482 (DocBookHandleFootnote): ditto.
3483 (SimpleDocBookOnePar): ditto.
3485 * src/frontends/xforms/FormDocument.h (form): remove extra
3486 FormDocument:: qualifier.
3488 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
3490 * sigc++/handle.h: ditto.
3492 * src/lyx_gui_misc.C: add "using" directive.
3494 * src/cheaders/cstddef: new file, needed by the boost library (for
3497 2000-10-02 Juergen Vigna <jug@sad.it>
3499 * src/insets/insettext.C (SetFont): better support.
3501 * src/insets/insettabular.C (draw): fixed drawing of single cell.
3503 * src/screen.C (DrawOneRow): some uint refixes!
3505 2000-10-02 Allan Rae <rae@lyx.org>
3507 * boost/.cvsignore: ignore Makefile as well
3509 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
3510 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
3512 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
3513 Left this one out by accident.
3515 * src/frontends/xforms/FormBase.h (restore): default to calling
3516 update() since that will restore the original/currently-applied values.
3517 Any input() triggered error messages will require the derived classes
3518 to redefine restore().
3520 * src/frontends/xforms/FormDocument.C: initialize a few variables to
3521 avoid a segfault. combo_doc_class is the main concern.
3523 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
3525 * Simplify build-listerrors in view of GUI-less export ability!
3527 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3529 * src/lyx_main.C (easyParse): Disable gui when exporting
3531 * src/insets/figinset.C:
3534 * src/lyx_gui_misc.C
3535 * src/tabular.C: Changes to allow no-gui.
3537 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3539 * src/support/utility.hpp: removed file
3540 * src/support/block.h: removed file
3542 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
3545 * src/mathed/formula.C: add support/lyxlib.h
3546 * src/mathed/formulamacro.C: ditto
3548 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
3549 * src/lyxparagraph.h: ditto
3551 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
3552 * src/frontends/Makefile.am (INCLUDES): ditto
3553 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
3554 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
3555 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
3556 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
3557 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
3558 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
3560 * src/BufferView.h: use boost/utility.hpp
3561 * src/LColor.h: ditto
3562 * src/LaTeX.h: ditto
3563 * src/LyXAction.h: ditto
3564 * src/LyXView.h: ditto
3565 * src/bufferlist.h: ditto
3566 * src/lastfiles.h: ditto
3567 * src/layout.h: ditto
3568 * src/lyx_gui.h: ditto
3569 * src/lyx_main.h: ditto
3570 * src/lyxlex.h: ditto
3571 * src/lyxrc.h: ditto
3572 * src/frontends/ButtonPolicies.h: ditto
3573 * src/frontends/Dialogs.h: ditto
3574 * src/frontends/xforms/FormBase.h: ditto
3575 * src/frontends/xforms/FormGraphics.h: ditto
3576 * src/frontends/xforms/FormParagraph.h: ditto
3577 * src/frontends/xforms/FormTabular.h: ditto
3578 * src/graphics/GraphicsCache.h: ditto
3579 * src/graphics/Renderer.h: ditto
3580 * src/insets/ExternalTemplate.h: ditto
3581 * src/insets/insetcommand.h: ditto
3582 * src/support/path.h: ditto
3584 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
3585 and introduce clause for 2.97.
3587 * boost/libs/README: new file
3589 * boost/boost/utility.hpp: new file
3591 * boost/boost/config.hpp: new file
3593 * boost/boost/array.hpp: new file
3595 * boost/Makefile.am: new file
3597 * boost/.cvsignore: new file
3599 * configure.in (AC_OUTPUT): add boost/Makefile
3601 * Makefile.am (SUBDIRS): add boost
3603 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3605 * src/support/lstrings.C (suffixIs): Fixed.
3607 2000-10-01 Allan Rae <rae@lyx.org>
3609 * src/PrinterParams.h: moved things around to avoid the "can't
3610 inline call" warning.
3612 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
3613 into doc++ documentation.
3615 * src/frontends/xforms/FormCommand.[Ch]: support button policy
3617 * src/frontends/xforms/FormRef.C: make use of button controller
3618 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
3619 cleaned up button controller usage.
3620 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
3621 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
3622 use the button controller
3624 * src/frontends/xforms/forms/*.fd: and associated generated files
3625 updated to reflect changes to FormBase. Some other FormXxxx files
3626 also got minor updates to reflect changes to FormBase.
3628 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
3629 (hide): made virtual.
3630 (input): return a bool. true == valid input
3631 (RestoreCB, restore): new
3632 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
3633 Changes to allow derived dialogs to use a ButtonController and
3634 make sense when doing so: OK button calls ok() and so on.
3636 * src/frontends/xforms/ButtonController.h (class ButtonController):
3637 Switch from template implementation to taking Policy parameter.
3638 Allows FormBase to provide a ButtonController for any dialog.
3640 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
3641 Probably should rename connect and disconnect.
3642 (apply): use the radio button groups
3643 (form): needed by FormBase
3644 (build): setup the radio button groups
3646 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
3648 * several files: type changes to reduce the number of warnings and
3649 to unify type hangling a bit. Still much to do.
3651 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3653 * lib/images/*: rename a bunch of icons to match Dekel converter
3656 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
3659 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
3661 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
3663 * sigc++/handle.h: ditto for class Handle.
3665 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
3667 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
3669 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
3671 * src/intl.C (InitKeyMapper): Correct the value of n due to the
3672 removal of the "default" language.
3674 * src/combox.h (getline): Check that sel > 0
3676 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
3678 * lib/examples/docbook_example.lyx
3679 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
3681 * lib/layouts/docbook-book.layout: new docbook book layout.
3683 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
3685 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
3687 * src/insets/figinset.C (DocBook):fixed small typo.
3689 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
3691 * src/insets/insetinclude.h: string include_label doesn't need to be
3694 2000-09-29 Allan Rae <rae@lyx.org>
3696 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
3697 Allow derived type to control connection and disconnection from signals
3698 of its choice if desired.
3700 2000-09-28 Juergen Vigna <jug@sad.it>
3702 * src/insets/insettabular.C (update): fixed cursor setting when
3703 the_locking_inset changed.
3704 (draw): made this a bit cleaner.
3705 (InsetButtonPress): fixed!
3707 * various files: added LyXText Parameter to fitCursor call.
3709 * src/BufferView.C (fitCursor): added LyXText parameter.
3711 * src/insets/insettabular.C (draw): small draw fix.
3713 * src/tabular.C: right setting of left/right celllines.
3715 * src/tabular.[Ch]: fixed various types in funcions and structures.
3716 * src/insets/insettabular.C: ditto
3717 * src/frontends/xforms/FormTabular.C: ditto
3719 2000-09-28 Allan Rae <rae@lyx.org>
3721 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
3722 that the #ifdef's had been applied to part of what should have been
3723 a complete condition. It's possible there are other tests that
3724 were specific to tables that are also wrong now that InsetTabular is
3725 being used. Now we need to fix the output of '\n' after a table in a
3726 float for the same reason as the original condition:
3727 "don't insert this if we would be adding it before or after a table
3728 in a float. This little trick is needed in order to allow use of
3729 tables in \subfigures or \subtables."
3730 Juergen can you check this?
3732 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3734 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
3735 output to the ostream.
3737 * several files: fixed types based on warnings from cxx
3739 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
3741 * src/frontends/kde/Makefile.am: fix rule for
3742 formindexdialogdata_moc.C
3744 * src/.cvsignore: add ext_l10n.h to ignore
3746 * acconfig.h: stop messing with __STRICT_ANSI__
3747 * config/gnome.m4: remove option to set -ansi
3748 * config/kde.m4: remove option to set -ansi
3749 * config/lyxinclude.m4: don't set -ansi
3751 2000-09-27 Juergen Vigna <jug@sad.it>
3753 * various files: remove "default" language check.
3755 * src/insets/insetquotes.C: removed use of current_view.
3757 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
3758 the one should have red ears by now!
3760 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
3761 in more then one paragraph. Fixed cursor-movement/selection.
3763 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
3764 paragraphs inside a text inset.
3766 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
3767 text-inset if this owner is an inset.
3769 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3771 * src/Bullet.h: changed type of font, character and size to int
3773 * src/buffer.C (asciiParagraph): remove actcell and fname1.
3775 * src/insets/inseturl.[Ch]:
3776 * src/insets/insetref.[Ch]:
3777 * src/insets/insetlabel.[Ch]: add linelen to Ascii
3779 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
3781 * src/buffer.C (readFile): block-if statement rearranged to minimise
3782 bloat. Patch does not reverse Jean-Marc's change ;-)
3784 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
3785 Class rewritten to store pointers to hide/update signals directly,
3786 rather than Dialogs *. Also defined an enum to ease use. All xforms
3787 forms can now be derived from this class.
3789 * src/frontends/xforms/FormCommand.[Ch]
3790 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
3792 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
3795 * src/frontends/xforms/forms/form_citation.fd
3796 * src/frontends/xforms/forms/form_copyright.fd
3797 * src/frontends/xforms/forms/form_error.fd
3798 * src/frontends/xforms/forms/form_index.fd
3799 * src/frontends/xforms/forms/form_ref.fd
3800 * src/frontends/xforms/forms/form_toc.fd
3801 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
3803 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
3805 * src/insets/insetfoot.C: removed redundent using directive.
3807 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3809 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
3810 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
3812 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
3813 created in the constructors in different groups. Then set() just
3814 have to show the groups as needed. This fixes the redraw problems
3815 (and is how the old menu code worked).
3817 * src/support/lyxlib.h: declare the methods as static when we do
3818 not have namespaces.
3820 2000-09-26 Juergen Vigna <jug@sad.it>
3822 * src/buffer.C (asciiParagraph): new function.
3823 (writeFileAscii): new function with parameter ostream.
3824 (writeFileAscii): use now asciiParagraph.
3826 * various inset files: added the linelen parameter to the Ascii-func.
3828 * src/tabular.C (Write): fixed error in writing file introduced by
3829 the last changes from Lars.
3831 * lib/bind/menus.bind: removed not supported functions.
3833 * src/insets/insettext.C (Ascii): implemented this function.
3835 * src/insets/lyxinset.h (Ascii): added linelen parameter.
3837 * src/tabular.C (write_attribute[int,string,bool]): new functions.
3838 (Write): use of the write_attribute functions.
3840 * src/bufferlist.C (close): fixed reasking question!
3842 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3844 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
3845 new files use the everwhere possible.
3848 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
3849 src/log_form.C src/lyx.C:
3852 * src/buffer.C (runLaTeX): remove func
3854 * src/PaperLayout.C: removed file
3855 * src/ParagraphExtra.C: likewise
3856 * src/bullet_forms.C: likewise
3857 * src/bullet_forms.h: likewise
3858 * src/bullet_forms_cb.C: likewise
3860 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
3861 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
3864 * several files: remove all traces of the old fd_form_paragraph,
3865 and functions belonging to that.
3867 * several files: remove all traces of the old fd_form_document,
3868 and functions belonging to that.
3870 * several files: constify local variables were possible.
3872 * several files: remove all code that was dead when NEW_EXPORT was
3875 * several files: removed string::c_str in as many places as
3878 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
3879 (e): be a bit more outspoken when patching
3880 (updatesrc): only move files if changed.
3882 * forms/layout_forms.h.patch: regenerated
3884 * forms/layout_forms.fd: remove form_document and form_paragraph
3885 and form_quotes and form_paper and form_table_options and
3886 form_paragraph_extra
3888 * forms/form1.fd: remove form_table
3890 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3891 the fdui->... rewrite. Update some comments to xforms 0.88
3893 * forms/bullet_forms.C.patch: removed file
3894 * forms/bullet_forms.fd: likewise
3895 * forms/bullet_forms.h.patch: likewise
3897 * development/Code_rules/Rules: added a section on switch
3898 statements. Updated some comment to xforms 0.88.
3900 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3902 * src/buffer.C (readFile): make sure that the whole version number
3903 is read after \lyxformat (even when it contains a comma)
3905 * lib/ui/default.ui: change shortcut of math menu to M-a.
3907 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3909 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3912 * src/LyXView.C (updateWindowTitle): show the full files name in
3913 window title, limited to 30 characters.
3915 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3916 When a number of characters has been given, we should not assume
3917 that the string is 0-terminated.
3919 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3920 calls (fixes some memory leaks)
3922 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3923 trans member on exit.
3925 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3927 * src/converter.C (GetReachable): fix typo.
3929 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3930 understand ',' instead of '.'.
3931 (GetInteger): rewrite to use strToInt().
3933 2000-09-26 Juergen Vigna <jug@sad.it>
3935 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3936 better visibility and error-message on wrong VSpace input.
3938 * src/language.C (initL): added english again.
3940 2000-09-25 Juergen Vigna <jug@sad.it>
3942 * src/frontends/kde/Dialogs.C (Dialogs):
3943 * src/frontends/gnome/Dialogs.C (Dialogs):
3944 * src/frontends/kde/Makefile.am:
3945 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3947 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3949 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3951 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3953 * src/frontends/xforms/FormParagraph.C:
3954 * src/frontends/xforms/FormParagraph.h:
3955 * src/frontends/xforms/form_paragraph.C:
3956 * src/frontends/xforms/form_paragraph.h:
3957 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3960 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3962 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3963 Paragraph-Data after use.
3965 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3966 non breakable paragraphs.
3968 2000-09-25 Garst R. Reese <reese@isn.net>
3970 * src/language.C (initL): added missing language_country codes.
3972 2000-09-25 Juergen Vigna <jug@sad.it>
3974 * src/insets/insettext.C (InsetText):
3975 (deleteLyXText): remove the not released LyXText structure!
3977 2000-09-24 Marko Vendelin <markov@ioc.ee>
3979 * src/frontends/gnome/mainapp.C
3980 * src/frontends/gnome/mainapp.h: added support for keyboard
3983 * src/frontends/gnome/FormCitation.C
3984 * src/frontends/gnome/FormCitation.h
3985 * src/frontends/gnome/Makefile.am
3986 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3987 FormCitation to use "action area" in mainapp window
3989 * src/frontends/gnome/Menubar_pimpl.C
3990 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3993 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3995 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3996 width/descent/ascent values if name is empty.
3997 (mathed_string_height): Use std::max.
3999 2000-09-25 Allan Rae <rae@lyx.org>
4001 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
4002 segfault. This will be completely redesigned soon.
4004 * sigc++: updated libsigc++. Fixes struct timespec bug.
4006 * development/tools/makeLyXsigc.sh: .cvsignore addition
4008 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
4010 * several files: removed almost all traces of the old table
4013 * src/TableLayout.C: removed file
4015 2000-09-22 Juergen Vigna <jug@sad.it>
4017 * src/frontends/kde/Dialogs.C: added credits forms.
4019 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
4021 * src/frontends/gnome/Dialogs.C: added some forms.
4023 * src/spellchecker.C (init_spell_checker): set language in pspell code
4024 (RunSpellChecker): some modifications for setting language string.
4026 * src/language.[Ch]: added language_country code.
4028 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
4030 * src/frontends/Dialogs.h: added new signal showError.
4031 Rearranged existing signals in some sort of alphabetical order.
4033 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
4034 FormError.[Ch], form_error.[Ch]
4035 * src/frontends/xforms/forms/makefile: added new file form_error.fd
4036 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
4038 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
4039 dialogs. I think that this can be used as the base to all these
4042 * src/frontends/xforms/FormError.[Ch]
4043 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
4044 implementation of InsetError dialog.
4046 * src/insets/inseterror.[Ch]: rendered GUI-independent.
4048 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
4049 * src/frontends/kde/Makefile.am: ditto
4051 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
4053 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
4054 macrobf. This fixes a bug of invisible text.
4056 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4058 * lib/doc/LaTeXConfig.lyx.in: updated.
4060 * src/language.C (initL): remove language "francais" and change a
4061 bit the names of the two other french variations.
4063 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
4064 string that may not be 0-terminated.
4066 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4068 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
4070 2000-09-20 Marko Vendelin <markov@ioc.ee>
4072 * src/frontends/gnome/FormCitation.C
4073 * src/frontends/gnome/FormIndex.C
4074 * src/frontends/gnome/FormToc.C
4075 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
4076 the variable initialization to shut up the warnings
4078 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4080 * src/table.[Ch]: deleted files
4082 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
4085 2000-09-18 Juergen Vigna <jug@sad.it>
4087 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
4088 problems with selection. Inserted new LFUN_PASTESELECTION.
4089 (InsetButtonPress): inserted handling of middle mouse-button paste.
4091 * src/spellchecker.C: changed word to word.c_str().
4093 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
4095 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
4096 included in the ``make dist'' tarball.
4098 2000-09-15 Juergen Vigna <jug@sad.it>
4100 * src/CutAndPaste.C (cutSelection): small fix return the right
4101 end position after cut inside one paragraph only.
4103 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
4104 we are locked as otherwise we don't have a valid cursor position!
4106 * src/insets/figinset.C (draw): small bugfix but why is this needed???
4108 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
4110 * src/frontends/kde/FormRef.C: added using directive.
4111 * src/frontends/kde/FormToc.C: ditto
4113 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
4115 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
4117 2000-09-19 Marko Vendelin <markov@ioc.ee>
4119 * src/frontends/gnome/Menubar_pimpl.C
4120 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
4121 Toc, ViewFormats, UpdateFormats, and ExportFormats.
4123 * src/frontends/gnome/mainapp.C
4124 * src/frontends/gnome/mainapp.h: support for menu update used
4127 * src/frontends/gnome/mainapp.C
4128 * src/frontends/gnome/mainapp.h: support for "action" area in the
4129 main window. This area is used by small simple dialogs, such as
4132 * src/frontends/gnome/FormIndex.C
4133 * src/frontends/gnome/FormIndex.h
4134 * src/frontends/gnome/FormUrl.C
4135 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
4138 * src/frontends/gnome/FormCitation.C
4139 * src/frontends/gnome/FormCitation.h: rewrite to use main window
4140 action area. Only "Insert new citation" is implemented.
4142 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4144 * src/buffer.C (Dispatch): fix call to Dispatch
4145 * src/insets/insetref.C (Edit): likewise
4146 * src/insets/insetparent.C (Edit): likewise
4147 * src/insets/insetinclude.C (include_cb): likewise
4148 * src/frontends/xforms/FormUrl.C (apply): likewise
4149 * src/frontends/xforms/FormToc.C (apply): likewise
4150 * src/frontends/xforms/FormRef.C (apply): likewise
4151 * src/frontends/xforms/FormIndex.C (apply): likewise
4152 * src/frontends/xforms/FormCitation.C (apply): likewise
4153 * src/lyxserver.C (callback): likewise
4154 * src/lyxfunc.C (processKeySym): likewise
4155 (Dispatch): likewise
4156 (Dispatch): likewise
4157 * src/lyx_cb.C (LayoutsCB): likewise
4159 * Makefile.am (sourcedoc): small change
4161 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4163 * src/main.C (main): Don't make an empty GUIRunTime object. all
4164 methods are static. constify a bit remove unneded using + headers.
4166 * src/tabular.C: some more const to local vars move some loop vars
4168 * src/spellchecker.C: added some c_str after some word for pspell
4170 * src/frontends/GUIRunTime.h: add new static method setDefaults
4171 * src/frontends/xforms/GUIRunTime.C (setDefaults):
4172 * src/frontends/kde/GUIRunTime.C (setDefaults):
4173 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
4175 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
4176 with strnew in arg, use correct emptystring when calling SetName.
4178 * several files: remove all commented code with relation to
4179 HAVE_SSTREAM beeing false. We now only support stringstream and
4182 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4184 * src/lyxfunc.C: construct correctly the automatic new file
4187 * src/text2.C (IsStringInText): change type of variable i to shut
4190 * src/support/sstream.h: do not use namespaces if the compiler
4191 does not support them.
4193 2000-09-15 Marko Vendelin <markov@ioc.ee>
4194 * src/frontends/gnome/FormCitation.C
4195 * src/frontends/gnome/FormCitation.h
4196 * src/frontends/gnome/diainsertcitation_interface.c
4197 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
4198 regexp support to FormCitation [Gnome].
4200 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
4203 * configure.in: remove unused KDE/GTKGUI define
4205 * src/frontends/kde/FormRef.C
4206 * src/frontends/kde/FormRef.h
4207 * src/frontends/kde/formrefdialog.C
4208 * src/frontends/kde/formrefdialog.h: double click will
4209 go to reference, now it is possible to change a cross-ref
4212 * src/frontends/kde/FormToc.C
4213 * src/frontends/kde/FormToc.h
4214 * src/frontends/kde/formtocdialog.C
4215 * src/frontends/kde/formtocdialog.h: add a depth
4218 * src/frontends/kde/Makefile.am: add QtLyXView.h
4221 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
4223 * src/frontends/kde/FormCitation.h: added some using directives.
4225 * src/frontends/kde/FormToc.h: corrected definition of doTree.
4227 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
4230 * src/mathed/math_defs.h: redefine SetAlign to use string rather
4233 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4235 * src/buffer.C (pop_tag): revert for the second time a change by
4236 Lars, who seems to really hate having non-local loop variables :)
4238 * src/Lsstream.h: add "using" statements.
4240 * src/support/copy.C (copy): add a bunch of std:: qualifiers
4241 * src/buffer.C (writeFile): ditto
4243 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4245 * src/buffer.C (writeFile): try to fix the locale modified format
4246 number to always be as we want it.
4248 * src/WorkArea.C (work_area_handler): try to workaround the bugs
4249 in XForms 0.89. C-space is now working again.
4251 * src/Lsstream.h src/support/sstream.h: new files.
4253 * also commented out all cases where strstream were used.
4255 * src/Bullet.h (c_str): remove method.
4257 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
4259 * a lot of files: get rid of "char const *" and "char *" is as
4260 many places as possible. We only want to use them in interaction
4261 with system of other libraries, not inside lyx.
4263 * a lot of files: return const object is not of pod type. This
4264 helps ensure that temporary objects is not modified. And fits well
4265 with "programming by contract".
4267 * configure.in: check for the locale header too
4269 * Makefile.am (sourcedoc): new tag for generation of doc++
4272 2000-09-14 Juergen Vigna <jug@sad.it>
4274 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
4275 callback to check which combo called it and do the right action.
4277 * src/combox.C (combo_cb): added combo * to the callbacks.
4278 (Hide): moved call of callback after Ungrab of the pointer.
4280 * src/intl.h: removed LCombo2 function.
4282 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
4283 function as this can now be handled in one function.
4285 * src/combox.h: added Combox * to callback prototype.
4287 * src/frontends/xforms/Toolbar_pimpl.C:
4288 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
4290 2000-09-14 Garst Reese <reese@isn.net>
4292 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
4293 moved usepackage{xxx}'s to beginning of file. Changed left margin
4294 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
4295 underlining from title. Thanks to John Culleton for useful suggestions.
4297 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4299 * src/lyxlex_pimpl.C (setFile): change error message to debug
4302 2000-09-13 Juergen Vigna <jug@sad.it>
4304 * src/frontends/xforms/FormDocument.C: implemented choice_class
4305 as combox and give callback to combo_language so OK/Apply is activated
4308 * src/bufferlist.C (newFile): small fix so already named files
4309 (via an open call) are not requested to be named again on the
4312 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
4314 * src/frontends/kde/Makefile.am
4315 * src/frontends/kde/FormRef.C
4316 * src/frontends/kde/FormRef.h
4317 * src/frontends/kde/formrefdialog.C
4318 * src/frontends/kde/formrefdialog.h: implement
4321 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
4323 * src/frontends/kde/formtocdialog.C
4324 * src/frontends/kde/formtocdialog.h
4325 * src/frontends/kde/FormToc.C
4326 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
4328 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
4330 * src/frontends/kde/FormCitation.C: fix thinko
4331 where we didn't always display the reference text
4334 * src/frontends/kde/formurldialog.C
4335 * src/frontends/kde/formurldialog.h
4336 * src/frontends/kde/FormUrl.C
4337 * src/frontends/kde/FormUrl.h: minor cleanups
4339 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
4341 * src/frontends/kde/Makefile.am
4342 * src/frontends/kde/FormToc.C
4343 * src/frontends/kde/FormToc.h
4344 * src/frontends/kde/FormCitation.C
4345 * src/frontends/kde/FormCitation.h
4346 * src/frontends/kde/FormIndex.C
4347 * src/frontends/kde/FormIndex.h
4348 * src/frontends/kde/formtocdialog.C
4349 * src/frontends/kde/formtocdialog.h
4350 * src/frontends/kde/formcitationdialog.C
4351 * src/frontends/kde/formcitationdialog.h
4352 * src/frontends/kde/formindexdialog.C
4353 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
4355 2000-09-12 Juergen Vigna <jug@sad.it>
4357 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
4360 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4362 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
4365 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
4367 * src/converter.C (Add, Convert): Added support for converter flags:
4368 needaux, resultdir, resultfile.
4369 (Convert): Added new parameter view_file.
4370 (dvips_options): Fixed letter paper option.
4372 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
4373 (Export, GetExportableFormats, GetViewableFormats): Added support
4376 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
4378 (easyParse): Fixed to work with new export code.
4380 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
4383 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
4385 * lib/bind/*.bind: Replaced
4386 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
4387 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
4389 2000-09-11 Juergen Vigna <jug@sad.it>
4391 * src/lyx_gui.C (runTime): uses global guiruntime variable.
4393 * src/main.C (main): now GUII defines global guiruntime!
4395 * src/frontends/gnome/GUIRunTime.C (initApplication):
4396 * src/frontends/kde/GUIRunTime.C (initApplication):
4397 * src/frontends/xforms/GUIRunTime.C (initApplication):
4398 * src/frontends/GUIRunTime.h: added new function initApplication.
4400 * src/spellchecker.C (sc_accept_word): change to add_to_session.
4402 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
4404 2000-09-08 Juergen Vigna <jug@sad.it>
4406 * src/lyx_gui.C (create_forms): don't display the "default" entry as
4407 we have already "Reset".
4409 * src/language.C (initL): inserted "default" language and made this
4410 THE default language (and not american!)
4412 * src/paragraph.C: inserted handling of "default" language!
4414 * src/lyxfont.C: ditto
4418 * src/paragraph.C: output the \\par only if we have a following
4419 paragraph otherwise it's not needed.
4421 2000-09-05 Juergen Vigna <jug@sad.it>
4423 * config/pspell.m4: added entry to lyx-flags
4425 * src/spellchecker.C: modified version from Kevin for using pspell
4427 2000-09-01 Marko Vendelin <markov@ioc.ee>
4428 * src/frontends/gnome/Makefile.am
4429 * src/frontends/gnome/FormCitation.C
4430 * src/frontends/gnome/FormCitation.h
4431 * src/frontends/gnome/diainsertcitation_callbacks.c
4432 * src/frontends/gnome/diainsertcitation_callbacks.h
4433 * src/frontends/gnome/diainsertcitation_interface.c
4434 * src/frontends/gnome/diainsertcitation_interface.h
4435 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
4436 dialog for Gnome frontend
4438 * src/main.C: Gnome libraries require keeping application name
4439 and its version as strings
4441 * src/frontends/gnome/mainapp.C: Change the name of the main window
4442 from GnomeLyX to PACKAGE
4444 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4446 * src/frontends/Liason.C: add "using: declaration.
4448 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
4450 * src/mathed/math_macro.C (Metrics): Set the size of the template
4452 * src/mathed/formulamacro.C (Latex): Fixed the returned value
4454 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
4456 * src/converter.C (add_options): New function.
4457 (SetViewer): Change $$FName into '$$FName'.
4458 (View): Add options when running xdvi
4459 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
4460 (Convert): The 3rd parameter is now the desired filename. Converts
4461 calls to lyx::rename if necessary.
4462 Add options when running dvips.
4463 (dvi_papersize,dvips_options): New methods.
4465 * src/exporter.C (Export): Use getLatexName() instead of fileName().
4467 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
4468 using a call to Converter::dvips_options.
4469 Fixed to work with nex export code.
4471 * src/support/copy.C
4472 * src/support/rename.C: New files
4474 * src/support/syscall.h
4475 * src/support/syscall.C: Added Starttype SystemDontWait.
4477 * lib/ui/default.ui: Changed to work with new export code
4479 * lib/configure.m4: Changed to work with new export code
4481 * src/encoding.C: Changed latex name for iso8859_7 encoding.
4483 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
4485 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
4486 so that code compiles with DEC cxx.
4488 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
4489 to work correctly! Also now supports the additional elements
4492 2000-09-01 Allan Rae <rae@lyx.org>
4494 * src/frontends/ButtonPolicies.C: renamed all the references to
4495 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
4497 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
4498 since it's a const not a type.
4500 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
4502 2000-08-31 Juergen Vigna <jug@sad.it>
4504 * src/insets/figinset.C: Various changes to look if the filename has
4505 an extension and if not add it for inline previewing.
4507 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4509 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
4510 make buttonStatus and isReadOnly be const methods. (also reflect
4511 this in derived classes.)
4513 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
4514 (nextState): change to be static inline, pass the StateMachine as
4516 (PreferencesPolicy): remove casts
4517 (OkCancelPolicy): remvoe casts
4518 (OkCancelReadOnlyPolicy): remove casts
4519 (NoRepeatedApplyReadOnlyPolicy): remove casts
4520 (OkApplyCancelReadOnlyPolicy): remove casts
4521 (OkApplyCancelPolicy): remove casts
4522 (NoRepeatedApplyPolicy): remove casts
4524 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
4526 * src/converter.C: added some using directives
4528 * src/frontends/ButtonPolicies.C: changes to overcome
4529 "need lvalue" error with DEC c++
4531 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
4532 to WMHideCB for DEC c++
4534 * src/frontends/xforms/Menubar_pimpl.C: added using directive
4536 * src/frontends/xforms/forms/form_document.C.patch: use C callback
4537 to BulletBMTableCB for DEC c++
4539 2000-08-31 Allan Rae <rae@lyx.org>
4541 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
4542 character dialog separately from old document dialogs combo_language.
4545 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4547 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
4548 Removed LFUN_REF_CREATE.
4550 * src/MenuBackend.C: Added new tags: toc and references
4552 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
4553 (add_lastfiles, add_documents, add_formats): Removed the unused smn
4555 (add_toc, add_references): New methods.
4556 (create_submenu): Handle correctly the case when there is a
4557 seperator after optional menu items.
4559 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
4560 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
4561 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
4563 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
4565 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4567 * src/converter.[Ch]: New file for converting between different
4570 * src/export.[Ch]: New file for exporting a LyX file to different
4573 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
4574 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
4575 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
4576 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
4577 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
4578 RunDocBook, MenuExport.
4580 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
4581 Exporter::Preview methods if NEW_EXPORT is defined.
4583 * src/buffer.C (Dispatch): Use Exporter::Export.
4585 * src/lyxrc.C: Added new tags: \converter and \viewer.
4588 * src/LyXAction.C: Define new lyx-function: buffer-update.
4589 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
4590 when NEW_EXPORT is defined.
4592 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
4594 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
4596 * lib/ui/default.ui: Added submenus "view" and "update" to the
4599 * src/filetools.C (GetExtension): New function.
4601 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
4603 2000-08-29 Allan Rae <rae@lyx.org>
4605 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
4607 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
4608 (EnableDocumentLayout): removed
4609 (DisableDocumentLayout): removed
4610 (build): make use of ButtonController's read-only handling to
4611 de/activate various objects. Replaces both of the above functions.
4613 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
4614 (readOnly): was read_only
4615 (refresh): fixed dumb mistakes with read_only_ handling
4617 * src/frontends/xforms/forms/form_document.fd:
4618 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
4619 tabbed dialogs so the tabs look more like tabs and so its easier to
4620 work out which is the current tab.
4622 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
4623 segfault with form_table
4625 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
4627 2000-08-28 Juergen Vigna <jug@sad.it>
4629 * acconfig.h: added USE_PSPELL.
4631 * src/config.h.in: added USE_PSPELL.
4633 * autogen.sh: added pspell.m4
4635 * config/pspell.m4: new file.
4637 * src/spellchecker.C: implemented support for pspell libary.
4639 2000-08-25 Juergen Vigna <jug@sad.it>
4641 * src/LyXAction.C (init): renamed LFUN_TABLE to
4642 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
4644 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
4646 * src/lyxscreen.h: add force_clear variable and fuction to force
4647 a clear area when redrawing in LyXText.
4649 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
4651 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4653 * some whitespace and comment changes.
4655 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
4657 * src/buffer.C: up te LYX_FORMAT to 2.17
4659 2000-08-23 Juergen Vigna <jug@sad.it>
4661 * src/BufferView_pimpl.C (tripleClick): disable this when in a
4664 * src/insets/insettabular.C (pasteSelection): delete the insets
4665 LyXText as it is not valid anymore.
4666 (copySelection): new function.
4667 (pasteSelection): new function.
4668 (cutSelection): new function.
4669 (LocalDispatch): implemented cut/copy/paste of cell selections.
4671 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
4672 don't have a LyXText.
4674 * src/LyXAction.C (init): a NEW_TABULAR define too much.
4676 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
4679 2000-08-22 Juergen Vigna <jug@sad.it>
4681 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
4682 ifdef form_table out if NEW_TABULAR.
4684 2000-08-21 Juergen Vigna <jug@sad.it>
4686 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
4687 (draw): fixed draw position so that the cursor is positioned in the
4689 (InsetMotionNotify): hide/show cursor so the position is updated.
4690 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
4691 using cellstart() function where it should be used.
4693 * src/insets/insettext.C (draw): ditto.
4695 * src/tabular.C: fixed initialization of some missing variables and
4696 made BoxType into an enum.
4698 2000-08-22 Marko Vendelin <markov@ioc.ee>
4699 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
4700 stock menu item using action numerical value, not its string
4704 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4706 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
4707 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
4709 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
4711 * src/frontends/xforms/GUIRunTime.C: new file
4713 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
4714 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4716 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
4718 * src/frontends/kde/GUIRunTime.C: new file
4720 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
4721 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4723 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
4725 * src/frontends/gnome/GUIRunTime.C: new file
4727 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
4730 * src/frontends/GUIRunTime.h: removed constructor and destructor,
4731 small change to documetentation.
4733 * src/frontends/GUIRunTime.C: removed file
4735 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
4737 * src/lyxparagraph.h: enable NEW_TABULAR as default
4739 * src/lyxfunc.C (processKeySym): remove some commented code
4741 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
4742 NEW_TABULAR around the fd_form_table_options.
4744 * src/lyx_gui.C (runTime): call the static member function as
4745 GUIRunTime::runTime().
4747 2000-08-21 Allan Rae <rae@lyx.org>
4749 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
4752 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
4754 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
4756 2000-08-21 Allan Rae <rae@lyx.org>
4758 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
4759 keep Garst happy ;-)
4760 * src/frontends/xforms/FormPreferences.C (build): use setOK
4761 * src/frontends/xforms/FormDocument.C (build): use setOK
4762 (FormDocument): use the appropriate policy.
4764 2000-08-21 Allan Rae <rae@lyx.org>
4766 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
4767 automatic [de]activation of arbitrary objects when in a read-only state.
4769 * src/frontends/ButtonPolicies.h: More documentation
4770 (isReadOnly): added to support the above.
4772 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
4774 2000-08-18 Juergen Vigna <jug@sad.it>
4776 * src/insets/insettabular.C (getStatus): changed to return func_status.
4778 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
4779 display toggle menu entries if they are.
4781 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
4782 new document layout now.
4784 * src/lyxfunc.C: ditto
4786 * src/lyx_gui_misc.C: ditto
4788 * src/lyx_gui.C: ditto
4790 * lib/ui/default.ui: removed paper and quotes layout as they are now
4791 all in the document layout tabbed folder.
4793 * src/frontends/xforms/forms/form_document.fd: added Restore
4794 button and callbacks for all inputs for Allan's ButtonPolicy.
4796 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
4797 (CheckChoiceClass): added missing params setting on class change.
4798 (UpdateLayoutDocument): added for updating the layout on params.
4799 (build): forgot to RETURN_ALWAYS input_doc_spacing.
4800 (FormDocument): Implemented Allan's ButtonPolicy with the
4803 2000-08-17 Allan Rae <rae@lyx.org>
4805 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
4806 so we can at least see the credits again.
4808 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
4809 controller calls for the appropriate callbacks. Note that since Ok
4810 calls apply followed by cancel, and apply isn't a valid input for the
4811 APPLIED state, the bc_ calls have to be made in the static callback not
4812 within each of the real callbacks.
4814 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
4815 (setOk): renamed from setOkay()
4817 2000-08-17 Juergen Vigna <jug@sad.it>
4819 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
4820 in the implementation part.
4821 (composeUIInfo): don't show optional menu-items.
4823 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
4825 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
4827 * src/bufferview_funcs.C (CurrentState): fixed to show also the
4828 text-state when in a text-inset.
4830 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
4832 2000-08-17 Marko Vendelin <markov@ioc.ee>
4833 * src/frontends/gnome/FormIndex.C
4834 * src/frontends/gnome/FormIndex.h
4835 * src/frontends/gnome/FormToc.C
4836 * src/frontends/gnome/FormToc.h
4837 * src/frontends/gnome/dialogs
4838 * src/frontends/gnome/diatoc_callbacks.c
4839 * src/frontends/gnome/diatoc_callbacks.h
4840 * src/frontends/gnome/diainsertindex_callbacks.h
4841 * src/frontends/gnome/diainsertindex_callbacks.c
4842 * src/frontends/gnome/diainsertindex_interface.c
4843 * src/frontends/gnome/diainsertindex_interface.h
4844 * src/frontends/gnome/diatoc_interface.h
4845 * src/frontends/gnome/diatoc_interface.c
4846 * src/frontends/gnome/Makefile.am: Table of Contents and
4847 Insert Index dialogs implementation for Gnome frontend
4849 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
4851 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
4853 * src/frontends/gnome/diainserturl_interface.c: make the dialog
4856 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4858 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
4859 destructor. Don't definde if you don't need it
4860 (processEvents): made static, non-blocking events processing for
4862 (runTime): static method. event loop for xforms
4863 * similar as above for kde and gnome.
4865 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
4866 new Pimpl is correct
4867 (runTime): new method calss the real frontends runtime func.
4869 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
4871 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4873 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
4875 2000-08-16 Juergen Vigna <jug@sad.it>
4877 * src/lyx_gui.C (runTime): added GUII RunTime support.
4879 * src/frontends/Makefile.am:
4880 * src/frontends/GUIRunTime.[Ch]:
4881 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
4882 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
4883 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
4885 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
4887 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
4888 as this is already set in ${FRONTEND_INCLUDE} if needed.
4890 * configure.in (CPPFLAGS): setting the include dir for the frontend
4891 directory and don't set FRONTEND=xforms for now as this is executed
4894 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4896 * src/frontends/kde/Makefile.am:
4897 * src/frontends/kde/FormUrl.C:
4898 * src/frontends/kde/FormUrl.h:
4899 * src/frontends/kde/formurldialog.h:
4900 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4902 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4904 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4906 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4908 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4911 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4913 * src/WorkArea.C (work_area_handler): more work to get te
4914 FL_KEYBOARD to work with xforms 0.88 too, please test.
4916 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4918 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4920 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4923 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4925 * src/Timeout.h: remove Qt::emit hack.
4927 * several files: changes to allo doc++ compilation
4929 * src/lyxfunc.C (processKeySym): new method
4930 (processKeyEvent): comment out if FL_REVISION < 89
4932 * src/WorkArea.C: change some debugging levels.
4933 (WorkArea): set wantkey to FL_KEY_ALL
4934 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4935 clearer code and the use of compose with XForms 0.89. Change to
4936 use signals instead of calling methods in bufferview directly.
4938 * src/Painter.C: change some debugging levels.
4940 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4943 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4944 (workAreaKeyPress): new method
4946 2000-08-14 Juergen Vigna <jug@sad.it>
4948 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4950 * config/kde.m4: addes some features
4952 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4953 include missing xforms dialogs.
4955 * src/Timeout.h: a hack to be able to compile with qt/kde.
4957 * sigc++/.cvsignore: added acinclude.m4
4959 * lib/.cvsignore: added listerros
4961 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4962 xforms tree as objects are needed for other frontends.
4964 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4965 linking with not yet implemented xforms objects.
4967 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4969 2000-08-14 Baruch Even <baruch.even@writeme.com>
4971 * src/frontends/xforms/FormGraphics.h:
4972 * src/frontends/xforms/FormGraphics.C:
4973 * src/frontends/xforms/RadioButtonGroup.h:
4974 * src/frontends/xforms/RadioButtonGroup.C:
4975 * src/insets/insetgraphics.h:
4976 * src/insets/insetgraphics.C:
4977 * src/insets/insetgraphicsParams.h:
4978 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4979 instead of spaces, and various other indentation issues to make the
4980 sources more consistent.
4982 2000-08-14 Marko Vendelin <markov@ioc.ee>
4984 * src/frontends/gnome/dialogs/diaprint.glade
4985 * src/frontends/gnome/FormPrint.C
4986 * src/frontends/gnome/FormPrint.h
4987 * src/frontends/gnome/diaprint_callbacks.c
4988 * src/frontends/gnome/diaprint_callbacks.h
4989 * src/frontends/gnome/diaprint_interface.c
4990 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4993 * src/frontends/gnome/dialogs/diainserturl.glade
4994 * src/frontends/gnome/FormUrl.C
4995 * src/frontends/gnome/FormUrl.h
4996 * src/frontends/gnome/diainserturl_callbacks.c
4997 * src/frontends/gnome/diainserturl_callbacks.h
4998 * src/frontends/gnome/diainserturl_interface.c
4999 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
5000 Gnome implementation
5002 * src/frontends/gnome/Dialogs.C
5003 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
5004 all other dialogs. Copy all unimplemented dialogs from Xforms
5007 * src/frontends/gnome/support.c
5008 * src/frontends/gnome/support.h: support files generated by Glade
5012 * config/gnome.m4: Gnome configuration scripts
5014 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
5015 configure --help message
5017 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
5018 only if there are no events pendling in Gnome/Gtk. This enhances
5019 the performance of menus.
5022 2000-08-14 Allan Rae <rae@lyx.org>
5024 * lib/Makefile.am: listerrors cleaning
5026 * lib/listerrors: removed -- generated file
5027 * acinclude.m4: ditto
5028 * sigc++/acinclude.m4: ditto
5030 * src/frontends/xforms/forms/form_citation.fd:
5031 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
5034 * src/frontends/xforms/forms/makefile: I renamed the `install` target
5035 `updatesrc` and now we have a `test` target that does what `updatesrc`
5036 used to do. I didn't like having an install target that wasn't related
5039 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
5040 on all except FormGraphics. This may yet happen. Followed by a major
5041 cleanup including using FL_TRANSIENT for most of the dialogs. More
5042 changes to come when the ButtonController below is introduced.
5044 * src/frontends/xforms/ButtonController.h: New file for managing up to
5045 four buttons on a dialog according to an externally defined policy.
5046 * src/frontends/xforms/Makefile.am: added above
5048 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
5049 Apply and Cancel/Close buttons and everything in between and beyond.
5050 * src/frontends/Makefile.am: added above.
5052 * src/frontends/xforms/forms/form_preferences.fd:
5053 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
5054 and removed variable 'status' as a result. Fixed the set_minsize thing.
5055 Use the new screen-font-update after checking screen fonts were changed
5056 Added a "Restore" button to restore the original lyxrc values while
5057 editing. This restores everything not just the last input changed.
5058 That's still a tricky one. As is the "LyX: this shouldn't happen..."
5060 * src/LyXAction.C: screen-font-update added for updating buffers after
5061 screen font settings have been changed.
5062 * src/commandtags.h: ditto
5063 * src/lyxfunc.C: ditto
5065 * forms/lyx.fd: removed screen fonts dialog.
5066 * src/lyx_gui.C: ditto
5067 * src/menus.[Ch]: ditto
5068 * src/lyx.[Ch]: ditto
5069 * src/lyx_cb.C: ditto + code from here moved to make
5070 screen-font-update. And people wonder why progress on GUII is
5071 slow. Look at how scattered this stuff was! It takes forever
5074 * forms/fdfix.sh: Fixup the spacing after commas.
5075 * forms/makefile: Remove date from generated files. Fewer clashes now.
5076 * forms/bullet_forms.C.patch: included someones handwritten changes
5078 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
5079 once I've discovered why LyXRC was made noncopyable.
5080 * src/lyx_main.C: ditto
5082 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
5084 * src/frontends/xforms/forms/fdfix.sh:
5085 * src/frontends/xforms/forms/fdfixh.sed:
5086 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
5087 * src/frontends/xforms/Form*.[hC]:
5088 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
5089 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
5090 provide a destructor for the struct FD_form_xxxx. Another version of
5091 the set_[max|min]size workaround and a few other cleanups. Actually,
5092 Angus' patch from 20000809.
5094 2000-08-13 Baruch Even <baruch.even@writeme.com>
5096 * src/insets/insetgraphics.C (Clone): Added several fields that needed
5099 2000-08-11 Juergen Vigna <jug@sad.it>
5101 * src/insets/insetgraphics.C (InsetGraphics): changing init
5102 order because of warnings.
5104 * src/frontends/xforms/forms/makefile: adding patching .C with
5107 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
5108 from .C.patch to .c.patch
5110 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
5111 order because of warning.
5113 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
5115 * src/frontends/Liason.C (setMinibuffer): new helper function
5117 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
5119 * src/lyxfunc.C (Dispatch): calling new Document-Layout
5121 * lib/ui/default.ui: commented out PaperLayout entry
5123 * src/frontends/xforms/form_document.[Ch]: new added files
5125 * src/frontends/xforms/FormDocument.[Ch]: ditto
5127 * src/frontends/xforms/forms/form_document.fd: ditto
5129 * src/frontends/xforms/forms/form_document.C.patch: ditto
5131 2000-08-10 Juergen Vigna <jug@sad.it>
5133 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
5134 (InsetGraphics): initialized cacheHandle to 0.
5135 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
5137 2000-08-10 Baruch Even <baruch.even@writeme.com>
5139 * src/graphics/GraphicsCache.h:
5140 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
5141 correctly as a cache.
5143 * src/graphics/GraphicsCacheItem.h:
5144 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
5147 * src/graphics/GraphicsCacheItem_pimpl.h:
5148 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
5151 * src/insets/insetgraphics.h:
5152 * src/insets/insetgraphics.C: Changed from using a signal notification
5153 to polling when image is not loaded.
5155 2000-08-10 Allan Rae <rae@lyx.org>
5157 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
5158 that there are two functions that have to been taken out of line by
5159 hand and aren't taken care of in the script. (Just a reminder note)
5161 * sigc++/macros/*.h.m4: Updated as above.
5163 2000-08-09 Juergen Vigna <jug@sad.it>
5165 * src/insets/insettext.C (draw): small fix for clearing rectangle.
5167 * src/insets/insettabular.C: make drawing of single cell smarter.
5169 2000-08-09 Marko Vendelin <markov@ioc.ee>
5170 * src/frontends/gnome/Menubar_pimpl.C
5171 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
5172 implementation: new files
5174 * src/frontends/gnome/mainapp.C
5175 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
5178 * src/main.C: create Gnome main window
5180 * src/frontends/xforms/Menubar_pimpl.h
5181 * src/frontends/Menubar.C
5182 * src/frontends/Menubar.h: added method Menubar::update that calls
5183 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
5185 * src/LyXView.C: calls Menubar::update to update the state
5188 * src/frontends/gnome/Makefile.am: added new files
5190 * src/frontends/Makefile.am: added frontend compiler options
5192 2000-08-08 Juergen Vigna <jug@sad.it>
5194 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
5196 * src/bufferlist.C (close):
5197 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
5198 documents if exiting without saving.
5200 * src/buffer.C (save): use removeAutosaveFile()
5202 * src/support/filetools.C (removeAutosaveFile): new function.
5204 * src/lyx_cb.C (MenuWrite): returns a bool now.
5205 (MenuWriteAs): check if file could really be saved and revert to the
5207 (MenuWriteAs): removing old autosavefile if existant.
5209 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
5210 before Goto toggle declaration, because of compiler warning.
5212 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
5214 * src/lyxfunc.C (MenuNew): small fix.
5216 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
5218 * src/bufferlist.C (newFile):
5219 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
5221 * src/lyxrc.C: added new_ask_filename tag
5223 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
5225 * src/lyx.fd: removed code pertaining to form_ref
5226 * src/lyx.[Ch]: ditto
5227 * src/lyx_cb.C: ditto
5228 * src/lyx_gui.C: ditto
5229 * src/lyx_gui_misc.C: ditto
5231 * src/BufferView_pimpl.C (restorePosition): update buffer only
5234 * src/commandtags.h (LFUN_REFTOGGLE): removed
5235 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
5236 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
5237 (LFUN_REFBACK): renamed LFUN_REF_BACK
5239 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
5240 * src/menus.C: ditto
5241 * src/lyxfunc.C (Dispatch): ditto.
5242 InsertRef dialog is now GUI-independent.
5244 * src/texrow.C: added using std::endl;
5246 * src/insets/insetref.[Ch]: strip out large amounts of code.
5247 The inset is now a container and this functionality is now
5248 managed by a new FormRef dialog
5250 * src/frontends/Dialogs.h (showRef, createRef): new signals
5252 * src/frontends/xforms/FormIndex.[Ch],
5253 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
5254 when setting dialog's min/max size
5255 * src/frontends/xforms/FormIndex.[Ch]: ditto
5257 * src/frontends/xforms/FormRef.[Ch],
5258 src/frontends/xforms/forms/form_ref.fd: new xforms
5259 implementation of an InsetRef dialog
5261 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
5264 * src/graphics/XPM_Renderer.C (isImageFormatOK):
5265 ios::nocreate is not part of the standard. Removed.
5267 2000-08-07 Baruch Even <baruch.even@writeme.com>
5269 * src/graphics/Renderer.h:
5270 * src/graphics/Renderer.C: Added base class for rendering of different
5271 image formats into Pixmaps.
5273 * src/graphics/XPM_Renderer.h:
5274 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
5275 in a different class.
5277 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
5278 easily add support for other formats.
5280 * src/insets/figinset.C: plugged a leak of an X resource.
5282 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5284 * src/CutAndPaste.[Ch]: make all metods static.
5286 * development/Code_rules/Rules: more work, added section on
5287 Exceptions, and a References section.
5289 * a lot of header files: work to make doc++ able to generate the
5290 source documentation, some workarounds of doc++ problems. Doc++ is
5291 now able to generate the documentation.
5293 2000-08-07 Juergen Vigna <jug@sad.it>
5295 * src/insets/insettabular.C (recomputeTextInsets): removed function
5297 * src/tabular.C (SetWidthOfMulticolCell):
5299 (calculate_width_of_column_NMC): fixed return value so that it really
5300 only returns true if the column-width has changed (there where
5301 problems with muliticolumn-cells in this column).
5303 2000-08-04 Juergen Vigna <jug@sad.it>
5305 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
5306 also on the scrollstatus of the inset.
5307 (workAreaMotionNotify): ditto.
5309 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
5311 2000-08-01 Juergen Vigna <jug@sad.it>
5313 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
5315 * src/commandtags.h:
5316 * src/LyXAction.C (init):
5317 * src/insets/inset.C (LocalDispatch): added support for
5320 * src/insets/inset.C (scroll): new functions.
5322 * src/insets/insettext.C (removeNewlines): new function.
5323 (SetAutoBreakRows): removes forced newlines in the text of the
5324 paragraph if autoBreakRows is set to false.
5326 * src/tabular.C (Latex): generates a parbox around the cell contents
5329 * src/frontends/xforms/FormTabular.C (local_update): removed
5330 the radio_useparbox button.
5332 * src/tabular.C (UseParbox): new function
5334 2000-08-06 Baruch Even <baruch.even@writeme.com>
5336 * src/graphics/GraphicsCache.h:
5337 * src/graphics/GraphicsCache.C:
5338 * src/graphics/GraphicsCacheItem.h:
5339 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
5342 * src/insets/insetgraphics.h:
5343 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
5344 and the drawing of the inline image.
5346 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
5347 loaded into the wrong position.
5349 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
5352 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5354 * src/support/translator.h: move all typedefs to public section
5356 * src/support/filetools.C (MakeLatexName): return string const
5358 (TmpFileName): ditto
5359 (FileOpenSearch): ditto
5361 (LibFileSearch): ditto
5362 (i18nLibFileSearch): ditto
5365 (CreateTmpDir): ditto
5366 (CreateBufferTmpDir): ditto
5367 (CreateLyXTmpDir): ditto
5370 (MakeAbsPath): ditto
5372 (OnlyFilename): ditto
5374 (NormalizePath): ditto
5375 (CleanupPath): ditto
5376 (GetFileContents): ditto
5377 (ReplaceEnvironmentPath): ditto
5378 (MakeRelPath): ditto
5380 (ChangeExtension): ditto
5381 (MakeDisplayPath): ditto
5382 (do_popen): return cmdret const
5383 (findtexfile): return string const
5385 * src/support/DebugStream.h: add some /// to please doc++
5387 * src/frontends/DialogBase.h (endif): add some /// to please doc++
5389 * src/texrow.C (same_rownumber): functor to use with find_if
5390 (getIdFromRow): rewritten to use find_if and to not update the
5391 positions. return true if row is found
5392 (increasePos): new method, use to update positions
5394 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
5396 * src/lyxlex_pimpl.C (verifyTable): new method
5399 (GetString): return string const
5400 (pushTable): rewrite to use std::stack
5402 (setFile): better check
5405 * src/lyxlex.h: make LyXLex noncopyable
5407 * src/lyxlex.C (text): return char const * const
5408 (GetString): return string const
5409 (getLongString): return string const
5411 * src/lyx_gui_misc.C (askForText): return pair<...> const
5413 * src/lastfiles.[Ch] (operator): return string const
5415 * src/buffer.C (parseSingleLyXformat2Token): pass string to
5416 istringstream not char const *.
5417 move token.end() out of loop.
5418 (readFile): move initializaton of token
5420 * src/BufferView2.C (insertErrors): run texrow.increasePos if
5421 getIdFromRow is successful.
5423 * lib/bind/emacs.bind: don't include menus bind
5425 * development/Code_rules/Rules: the beginnings of making this
5426 better and covering more of the unwritten rules that we have.
5428 * development/Code_rules/Recommendations: a couple of wording
5431 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5433 * src/support/strerror.c: remove C++ comment.
5435 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
5437 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
5438 LFUN_INDEX_INSERT_LAST
5440 * src/texrow.C (getIdFromRow): changed from const_iterator to
5441 iterator, allowing code to compile with DEC cxx
5443 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
5444 stores part of the class, as suggested by Allan. Will allow
5446 (apply): test to apply uses InsetCommandParams operator!=
5448 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
5449 (apply): test to apply uses InsetCommandParams operator!=
5451 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
5452 stores part of the class.
5453 (update): removed limits on min/max size.
5455 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
5456 (apply): test to apply uses InsetCommandParams operator!=
5458 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
5459 (Read, Write, scanCommand, getCommand): moved functionality
5460 into InsetCommandParams.
5462 (getScreenLabel): made pure virtual
5463 new InsetCommandParams operators== and !=
5465 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
5466 c-tors based on InsetCommandParams. Removed others.
5467 * src/insets/insetinclude.[Ch]: ditto
5468 * src/insets/insetlabel.[Ch]: ditto
5469 * src/insets/insetparent.[Ch]: ditto
5470 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
5472 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
5473 insets derived from InsetCommand created using similar c-tors
5474 based on InsetCommandParams
5475 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
5476 * src/menus.C (ShowRefsMenu): ditto
5477 * src/paragraph.C (Clone): ditto
5478 * src/text2.C (SetCounter): ditto
5479 * src/lyxfunc.C (Dispatch) ditto
5480 Also recreated old InsetIndex behaviour exactly. Can now
5481 index-insert at the start of a paragraph and index-insert-last
5482 without launching the pop-up.
5484 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5486 * lib/lyxrc.example: mark te pdf options as non functional.
5488 * src/support/lstrings.C (strToInt): move initalization of tmpstr
5489 (isStrDbl): move tmpstr.end() out of loop.
5490 (strToDbl): move intialization of tmpstr
5491 (lowercase): return string const and move tmp.end() out of loop.
5492 (uppercase): return string const and move tmp.edn() out of loop.
5493 (prefixIs): add assertion
5498 (containsOnly): ditto
5499 (containsOnly): ditto
5500 (containsOnly): ditto
5501 (countChar): make last arg char not char const
5502 (token): return string const
5503 (subst): return string const, move tmp.end() out of loop.
5504 (subst): return string const, add assertion
5505 (strip): return string const
5506 (frontStrip): return string const, add assertion
5507 (frontStrip): return string const
5512 * src/support/lstrings.C: add inclde "LAssert.h"
5513 (isStrInt): move tmpstr.end() out of loop.
5515 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
5516 toollist.end() out of loop.
5517 (deactivate): move toollist.end() out of loop.
5518 (update): move toollist.end() out of loop.
5519 (updateLayoutList): move tc.end() out of loop.
5520 (add): move toollist.end() out of loop.
5522 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
5523 md.end() out of loop.
5525 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
5527 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
5530 * src/paragraph.C (Erase): move fontlist.end() out of loop.
5531 (Erase): move insetlist.end() out of loop.
5533 * src/lyx_sendfax_main.C: make show_logfile static and to take a
5534 ref to const string as first arg. Move initialization of some
5535 variables, whitespace changes.
5537 * src/kbmap.C (defkey): move table.end() out of loop.
5538 (kb_keymap): move table.end() out of loop.
5539 (findbinding): move table.end() out of loop.
5541 * src/MenuBackend.C (hasMenu): move end() out of loop.
5542 (getMenu): move end() out of loop.
5543 (getMenu): move menulist_.end() out of loop.
5545 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
5547 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
5550 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
5551 (getFromLyXName): move infotab.end() out of loop.
5553 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
5554 -fvtable-thunks -ffunction-sections -fdata-sections
5556 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
5558 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
5561 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5563 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
5565 * src/frontends/xforms/FormCitation.[Ch],
5566 src/frontends/xforms/FormIndex.[Ch],
5567 src/frontends/xforms/FormToc.[Ch],
5568 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
5570 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5572 * src/commandtags.h: renamed, created some flags for citation
5575 * src/lyx_gui_misc.C: stripped out old FD_index_form code
5577 * src/lyxfunc.C (dispatch): use signals to insert index entry
5579 * src/frontends/Dialogs.h: new signal createIndex
5581 * src/frontends/xforms/FormCommand.[Ch],
5582 src/frontends/xforms/FormCitation.[Ch],
5583 src/frontends/xforms/FormToc.[Ch],
5584 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
5586 * src/insets/insetindex.[Ch]: GUI-independent
5588 * src/frontends/xforms/FormIndex.[Ch],
5589 * src/frontends/xforms/forms/form_index.fd: xforms implementation
5592 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
5594 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
5595 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
5597 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5599 * src/insets/insetref.C (Latex): rewrite so that there is now
5600 question that a initialization is requested.
5602 * src/insets/insetcommand.h: reenable the hide signal
5604 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5606 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
5607 fix handling of shortcuts (many bugs :)
5608 (add_lastfiles): ditto.
5610 * lib/ui/default.ui: fix a few shortcuts.
5612 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
5614 * Makefile.am: Fix ``rpmdist'' target to return the exit
5615 status of the ``rpm'' command, instead of the last command in
5616 the chain (the ``rm lyx.xpm'' command, which always returns
5619 2000-08-02 Allan Rae <rae@lyx.org>
5621 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
5622 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
5623 * src/frontends/xforms/FormToc.C (FormToc): ditto
5625 * src/frontends/xforms/Makefile.am: A few forgotten files
5627 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
5628 Signals-not-copyable-problem Lars' started commenting out.
5630 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
5632 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5634 * src/insets/insetcommand.h: Signals is not copyable so anoter
5635 scheme for automatic hiding of forms must be used.
5637 * src/frontends/xforms/FormCitation.h: don't inerit from
5638 noncopyable, FormCommand already does that.
5639 * src/frontends/xforms/FormToc.h: ditto
5640 * src/frontends/xforms/FormUrl.h: ditto
5642 * src/frontends/xforms/FormCitation.C: add include <algorithm>
5644 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
5646 * src/insets/insetcommand.h (hide): new SigC::Signal0
5647 (d-tor) new virtual destructor emits hide signal
5649 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
5650 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
5652 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
5653 LOF and LOT. Inset is now GUI-independent
5655 * src/insets/insetloa.[Ch]: redundant
5656 * src/insets/insetlof.[Ch]: ditto
5657 * src/insets/insetlot.[Ch]: ditto
5659 * src/frontends/xforms/forms/form_url.fd: tweaked!
5660 * src/frontends/xforms/forms/form_citation.fd: ditto
5662 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
5663 dialogs dealing with InsetCommand insets
5665 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
5666 FormCommand base class
5667 * src/frontends/xforms/FormUrl.[Ch]: ditto
5669 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
5671 * src/frontends/xforms/FormToc.[Ch]: ditto
5673 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
5674 passed a generic InsetCommand pointer
5675 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
5677 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
5678 and modified InsetTOC class
5679 * src/buffer.C: ditto
5681 * forms/lyx.fd: strip out old FD_form_toc code
5682 * src/lyx_gui_misc.C: ditto
5683 * src/lyx_gui.C: ditto
5684 * src/lyx_cb.C: ditto
5685 * src/lyx.[Ch]: ditto
5687 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5689 * src/support/utility.hpp: tr -d '\r'
5691 2000-08-01 Juergen Vigna <jug@sad.it>
5693 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
5695 * src/commandtags.h:
5696 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
5697 LFUN_TABULAR_FEATURES.
5699 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
5700 LFUN_LAYOUT_TABULAR.
5702 * src/insets/insettabular.C (getStatus): implemented helper function.
5704 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
5706 2000-07-31 Juergen Vigna <jug@sad.it>
5708 * src/text.C (draw): fixed screen update problem for text-insets.
5710 * src/text2.C (SetParagrpah): call an update of the inset-owner when
5711 something changed probably this has to be added in various other
5714 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
5716 2000-07-31 Baruch Even <baruch.even@writeme.com>
5718 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
5719 templates to satisfy compaq cxx.
5722 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5724 * src/support/translator.h (equal_1st_in_pair::operator()): take
5725 const ref pair_type as arg.
5726 (equal_2nd_in_pair::operator()): ditto
5727 (Translator::~Translator): remove empty d-tor.
5729 * src/graphics/GraphicsCache.C: move include config.h to top, also
5730 put initialization of GraphicsCache::singleton here.
5731 (~GraphicsCache): move here
5732 (addFile): take const ref as arg
5735 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
5737 * src/BufferView2.C (insertLyXFile): change te with/without header
5740 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5742 * src/frontends/xforms/FormGraphics.C (apply): add some
5743 static_cast. Not very nice, but required by compaq cxx.
5745 * src/frontends/xforms/RadioButtonGroup.h: include header
5746 <utility> instead of <pair.h>
5748 * src/insets/insetgraphicsParams.C: add using directive.
5749 (readResize): change return type to void.
5750 (readOrigin): ditto.
5752 * src/lyxfunc.C (getStatus): add missing break for build-program
5753 function; add test for Literate for export functions.
5755 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
5756 entries in Options menu.
5758 2000-07-31 Baruch Even <baruch.even@writeme.com>
5760 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
5761 protect against auto-allocation; release icon when needed.
5763 2000-07-31 Matej Cepl <CeplM@seznam.cz>
5765 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
5766 on usual typewriter.
5768 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
5769 earlier czech.kmap), useful only for programming.
5771 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5773 * src/frontends/xforms/FormCitation.h: fix conditioning around
5776 2000-07-31 Juergen Vigna <jug@sad.it>
5778 * src/frontends/xforms/FormTabular.C (local_update): changed
5779 radio_linebreaks to radio_useparbox and added radio_useminipage.
5781 * src/tabular.C: made support for using minipages/parboxes.
5783 * src/bufferlist.C (QwriteAll): small fix for asking for save.
5785 * src/insets/insetgraphics.C (draw): just draw the inset so that the
5787 (descent): so the cursor is in the middle.
5788 (width): bit smaller box.
5790 * src/insets/insetgraphics.h: added display() function.
5792 2000-07-31 Baruch Even <baruch.even@writeme.com>
5794 * src/frontends/Dialogs.h: Added showGraphics signals.
5796 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
5797 xforms form definition of the graphics dialog.
5799 * src/frontends/xforms/FormGraphics.h:
5800 * src/frontends/xforms/FormGraphics.C: Added files, the
5801 GUIndependent code of InsetGraphics
5803 * src/insets/insetgraphics.h:
5804 * src/insets/insetgraphics.C: Major writing to make it work.
5806 * src/insets/insetgraphicsParams.h:
5807 * src/insets/insetgraphicsParams.C: Added files, parameter passing
5808 struct between InsetGraphics and GUI.
5810 * src/LaTeXFeatures.h:
5811 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
5812 support for graphicx package.
5814 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
5815 for the graphics inset.
5817 * src/support/translator.h: Added file, used in
5818 InsetGraphicsParams. this is a template to translate between two
5821 * src/frontends/xforms/RadioButtonGroup.h:
5822 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
5823 way to easily control a radio button group.
5825 2000-07-28 Juergen Vigna <jug@sad.it>
5827 * src/insets/insettabular.C (LocalDispatch):
5828 (TabularFeatures): added support for lyx-functions of tabular features.
5829 (cellstart): refixed this function after someone wrongly changed it.
5831 * src/commandtags.h:
5832 * src/LyXAction.C (init): added support for tabular-features
5834 2000-07-28 Allan Rae <rae@lyx.org>
5836 * src/frontends/xforms/FormPreferences.C (build): Setup input return
5837 checking. NOTE: It seems that pressing ESC to cancel the dialog also
5838 triggers the callback for input checking. As a result we sometimes get
5839 "LyX: This shouldn't happen..." printed to cerr.
5840 (input): Started using status variable since I only free() on
5841 destruction. Some input checking for paths and font sizes.
5843 * src/frontends/xforms/FormPreferences.h: Use status to control
5844 activation of Ok and Apply
5846 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
5847 callback. Also resized to stop segfaults with 0.88. The problem is
5848 that xforms-0.88 requires the folder to be wide enough to fit all the
5849 tabs. If it isn't it causes all sorts of problems.
5851 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
5853 * src/frontends/xforms/forms/README: Reflect reality.
5855 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
5856 * src/frontends/xforms/forms/makefile: ditto.
5858 * src/commandtags.h: Get access to new Preferences dialog
5859 * src/LyXAction.C: ditto
5860 * src/lyxfunc.C: ditto
5861 * lib/ui/default.ui: ditto
5863 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5865 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
5867 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
5870 * src/frontends/xforms/form_url.[Ch]: added.
5872 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5874 * src/insets/insetbib.h: fixed bug in previous commit
5876 * src/frontends/xforms/FormUrl.h: ditto
5878 * src/frontends/xforms/FormPrint.h: ditto
5880 * src/frontends/xforms/FormPreferences.h: ditto
5882 * src/frontends/xforms/FormCopyright.h: ditto
5884 * src/frontends/xforms/FormCitation.C: ditto
5886 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
5887 private copyconstructor and private default contructor
5889 * src/support/Makefile.am: add utility.hpp
5891 * src/support/utility.hpp: new file from boost
5893 * src/insets/insetbib.h: set owner in clone
5895 * src/frontends/xforms/FormCitation.C: added missing include
5898 * src/insets/form_url.[Ch]: removed
5900 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5902 * development/lyx.spec.in
5903 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5904 file/directory re-organization.
5906 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5908 * src/insets/insetcommand.[Ch]: moved the string data and
5909 associated manipulation methods into a new stand-alone class
5910 InsetCommandParams. This class has two additional methods
5911 getAsString() and setFromString() allowing the contents to be
5912 moved around as a single string.
5913 (addContents) method removed.
5914 (setContents) method no longer virtual.
5916 * src/buffer.C (readInset): made use of new InsetCitation,
5917 InsetUrl constructors based on InsetCommandParams.
5919 * src/commandtags.h: add LFUN_INSERT_URL
5921 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5922 independent InsetUrl and use InsetCommandParams to extract
5923 string info and create new Insets.
5925 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5927 * src/frontends/xforms/FormCitation.C (apply): uses
5930 * src/frontends/xforms/form_url.C
5931 * src/frontends/xforms/form_url.h
5932 * src/frontends/xforms/FormUrl.h
5933 * src/frontends/xforms/FormUrl.C
5934 * src/frontends/xforms/forms/form_url.fd: new files
5936 * src/insets/insetcite.[Ch]: removed unused constructors.
5938 * src/insets/insetinclude.[Ch]: no longer store filename
5940 * src/insets/inseturl.[Ch]: GUI-independent.
5942 2000-07-26 Juergen Vigna <jug@sad.it>
5943 * renamed frontend from gtk to gnome as it is that what is realized
5944 and did the necessary changes in the files.
5946 2000-07-26 Marko Vendelin <markov@ioc.ee>
5948 * configure.in: cleaning up gnome configuration scripts
5950 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5952 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5953 shortcuts syndrom by redrawing them explicitely (a better solution
5954 would be appreciated).
5956 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5958 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5961 * src/lyx_cb.C (MenuExport): change html export to do the right
5962 thing depending of the document type (instead of having
5963 html-linuxdoc and html-docbook).
5964 * src/lyxfunc.C (getStatus): update for html
5965 * lib/ui/default.ui: simplify due to the above change.
5966 * src/menus.C (ShowFileMenu): update too (in case we need it).
5968 * src/MenuBackend.C (read): if a menu is defined twice, add the
5969 new entries to the exiting one.
5971 2000-07-26 Juergen Vigna <jug@sad.it>
5973 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5975 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5976 and return a bool if it did actual save the file.
5977 (AutoSave): don't autosave a unnamed doc.
5979 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5980 check if this is an UNNAMED new file and react to it.
5981 (newFile): set buffer to unnamed and change to not mark a new
5982 buffer dirty if I didn't do anything with it.
5984 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5986 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5988 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5989 friend as per Angus's patch posted to lyx-devel.
5991 * src/ext_l10n.h: updated
5993 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5994 gettext on the style string right before inserting them into the
5997 * autogen.sh: add code to extract style strings form layout files,
5998 not good enough yet.
6000 * src/frontends/gtk/.cvsignore: add MAKEFILE
6002 * src/MenuBackend.C (read): run the label strings through gettext
6003 before storing them in the containers.
6005 * src/ext_l10n.h: new file
6007 * autogen.sh : generate the ext_l10n.h file here
6009 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6011 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
6014 * lib/ui/default.ui: fix a couple of typos.
6016 * config/gnome/gtk.m4: added (and added to the list of files in
6019 * src/insets/insetinclude.C (unique_id): fix when we are using
6020 lyxstring instead of basic_string<>.
6021 * src/insets/insettext.C (LocalDispatch): ditto.
6022 * src/support/filetools.C: ditto.
6024 * lib/configure.m4: create the ui/ directory if necessary.
6026 * src/LyXView.[Ch] (updateToolbar): new method.
6028 * src/BufferView_pimpl.C (buffer): update the toolbar when
6029 opening/closing buffer.
6031 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6033 * src/LyXAction.C (getActionName): enhance to return also the name
6034 and options of pseudo-actions.
6035 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
6037 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
6038 as an example of what is possible). Used in File->Build too (more
6039 useful) and in the import/export menus (to mimick the complicated
6040 handling of linuxdoc and friends). Try to update all the entries.
6042 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
6045 * src/MenuBackend.C (read): Parse the new OptItem tag.
6047 * src/MenuBackend.h: Add a new optional_ data member (used if the
6048 entry should be omitted when the lyxfunc is disabled).
6050 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
6051 function, used as a shortcut.
6052 (create_submenu): align correctly the shortcuts on the widest
6055 * src/MenuBackend.h: MenuItem.label() only returns the label of
6056 the menu without shortcut; new method shortcut().
6058 2000-07-14 Marko Vendelin <markov@ioc.ee>
6060 * src/frontends/gtk/Dialogs.C:
6061 * src/frontends/gtk/FormCopyright.C:
6062 * src/frontends/gtk/FormCopyright.h:
6063 * src/frontends/gtk/Makefile.am: added these source-files for the
6064 Gtk/Gnome support of the Copyright-Dialog.
6066 * src/main.C: added Gnome::Main initialization if using
6067 Gtk/Gnome frontend-GUI.
6069 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
6071 * config/gnome/aclocal-include.m4
6072 * config/gnome/compiler-flags.m4
6073 * config/gnome/curses.m4
6074 * config/gnome/gnome--.m4
6075 * config/gnome/gnome-bonobo-check.m4
6076 * config/gnome/gnome-common.m4
6077 * config/gnome/gnome-fileutils.m4
6078 * config/gnome/gnome-ghttp-check.m4
6079 * config/gnome/gnome-gnorba-check.m4
6080 * config/gnome/gnome-guile-checks.m4
6081 * config/gnome/gnome-libgtop-check.m4
6082 * config/gnome/gnome-objc-checks.m4
6083 * config/gnome/gnome-orbit-check.m4
6084 * config/gnome/gnome-print-check.m4
6085 * config/gnome/gnome-pthread-check.m4
6086 * config/gnome/gnome-support.m4
6087 * config/gnome/gnome-undelfs.m4
6088 * config/gnome/gnome-vfs.m4
6089 * config/gnome/gnome-x-checks.m4
6090 * config/gnome/gnome-xml-check.m4
6091 * config/gnome/gnome.m4
6092 * config/gnome/gperf-check.m4
6093 * config/gnome/gtk--.m4
6094 * config/gnome/linger.m4
6095 * config/gnome/need-declaration.m4: added configuration scripts
6096 for Gtk/Gnome frontend-GUI
6098 * configure.in: added support for the --with-frontend=gtk option
6100 * autogen.sh: added config/gnome/* to list of config-files
6102 * acconfig.h: added define for GTKGUI-support
6104 * config/lyxinclude.m4: added --with-frontend[=value] option value
6105 for Gtk/Gnome frontend-GUI support.
6107 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6109 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
6113 * src/paragraph.C (GetChar): remove non-const version
6115 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
6116 (search_kw): use it.
6118 * src/lyx_main.C (init): if "preferences" exist, read that instead
6120 (ReadRcFile): return bool if the file could be read ok.
6121 (ReadUIFile): add a check to see if lex file is set ok.
6123 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
6124 bastring can be used instead of lyxstring (still uses the old code
6125 if std::string is good enough or if lyxstring is used.)
6127 * src/encoding.C: make the arrays static, move ininle functions
6129 * src/encoding.h: from here.
6131 * src/buffer.C: have last_isnet_read as a file scope variable for now.
6132 (parseSingleLyXformat2Token): move inset parsing to separate method
6133 (readInset): new private method
6135 * src/Variables.h: remove virtual from get().
6137 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
6138 access to NEW_INSETS and NEW_TABULAR
6140 * src/MenuBackend.h: remove superfluous forward declaration of
6141 MenuItem. Add documentations tags "///", remove empty MenuItem
6142 destructor, remove private default contructor.
6144 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
6146 (read): more string mlabel and mname to where they are used
6147 (read): remove unused variables mlabel and mname
6148 (defaults): unconditional clear, make menusetup take advantage of
6149 add returning Menu &.
6151 * src/LyXView.h: define NEW_MENUBAR as default
6153 * src/LyXAction.C: include lyxparagraph.h temporary to get access
6154 to NEW_INSETS and NEW_TABULAR.
6155 (init): commetn out some funcs that is obsolete when NEW_INSETS is
6156 defined. Change some of the "xxxx-inset-insert" functions names to
6159 * several files: more enahncements to NEW_INSETS and the resulting
6162 * lib/lyxrc.example (\date_insert_format): move to misc section
6164 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
6165 bastring and use AC_CACHE_CHECK.
6166 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
6167 the system have the newest methods. uses AC_CACHE_CHECK
6168 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
6169 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
6170 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
6172 * configure.in: add LYX_CXX_GOOD_STD_STRING
6174 * acinclude.m4: recreated
6176 2000-07-24 Amir Karger <karger@lyx.org>
6178 * README: add Hebrew, Arabic kmaps
6181 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6183 * src/buffer.C (writeFileAscii): Define actcell as an int instead
6186 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6188 * Lot of files: add pragma interface/implementation.
6190 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
6192 * lib/ui/default.ui: new file (ans new directory). Contains the
6193 default menu and toolbar.
6195 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
6196 global space. Toolbars are now read (as menus) in ui files.
6198 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
6200 * src/lyxfunc.C (getStatus): do not exit immediately if a command
6201 is disabled because the document is read-only. We want to have the
6202 toggle state of the function anyway.
6203 (getStatus): add code for LFUN_VC* functions (mimicking what is
6204 done in old-style menus)
6206 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
6207 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
6209 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
6210 * src/BufferView_pimpl.C: ditto.
6211 * src/lyxfunc.C: ditto.
6213 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
6214 default). This replaces old-style menus by new ones.
6216 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
6217 MenuItem. Contain the data structure of a menu.
6219 * src/insets/insettext.C: use LyXView::setLayout instead of
6220 accessing directly the toolbar combox.
6221 * src/lyxfunc.C (Dispatch): ditto.
6223 * src/LyXView.C (setLayout): new method, which just calls
6224 Toolbar::setLayout().
6225 (updateLayoutChoice): move part of this method in Toolbar.
6227 * src/toolbar.[Ch]: removed.
6229 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
6230 implementation the toolbar.
6232 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
6233 the toolbar. It might make sense to merge it with ToolbarDefaults
6235 (setLayout): new function.
6236 (updateLayoutList): ditto.
6237 (openLayoutList): ditto.
6239 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
6240 xforms implementation of the toolbar.
6241 (get_toolbar_func): comment out, since I do not
6242 know what it is good for.
6244 * src/ToolbarDefaults.h: Add the ItemType enum.
6246 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
6247 for a list of allocated C strings. Used in Menubar xforms
6248 implementation to avoid memory leaks.
6250 * src/support/lstrings.[Ch] (uppercase): new version taking and
6254 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
6255 * lib/bind/emacs.bind: ditto.
6257 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6259 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
6260 forward decl of LyXView.
6262 * src/toolbar.C (toolbarItem): moved from toolbar.h
6263 (toolbarItem::clean): ditto
6264 (toolbarItem::~toolbarItem): ditto
6265 (toolbarItem::operator): ditto
6267 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
6269 * src/paragraph.h: control the NEW_TABULAR define from here
6271 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
6272 USE_TABULAR_INSETS to NEW_TABULAR
6274 * src/ToolbarDefaults.C: add include "lyxlex.h"
6276 * files using the old table/tabular: use NEW_TABULAR to control
6277 compilation of old tabular stuff.
6279 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
6282 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
6283 planemet in reading of old style floats, fix the \end_deeper
6284 problem when reading old style floats.
6286 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6288 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
6290 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
6292 * lib/bind/sciword.bind: updated.
6294 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6296 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
6297 layout write problem
6299 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6301 * src/Makefile.am (INCLUDES): remove image directory from include
6304 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
6305 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
6307 * src/LyXView.C (create_form_form_main): read the application icon
6310 * lib/images/*.xpm: change the icons to use transparent color for
6313 * src/toolbar.C (update): change the color of the button when it
6316 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6318 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
6319 setting explicitely the minibuffer.
6320 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
6322 * src/LyXView.C (showState): new function. Shows font information
6323 in minibuffer and update toolbar state.
6324 (LyXView): call Toolbar::update after creating the
6327 * src/toolbar.C: change toollist to be a vector instead of a
6329 (BubbleTimerCB): get help string directly from the callback
6330 argument of the corresponding icon (which is the action)
6331 (set): remove unnecessary ugliness.
6332 (update): new function. update the icons (depressed, disabled)
6333 depending of the status of the corresponding action.
6335 * src/toolbar.h: remove help in toolbarItem
6337 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
6339 * src/Painter.C (text): Added code for using symbol glyphs from
6340 iso10646 fonts. Currently diabled.
6342 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
6345 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
6346 magyar,turkish and usorbian.
6348 * src/paragraph.C (isMultiLingual): Made more efficient.
6350 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
6353 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
6354 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
6355 Also changed the prototype to "bool math_insert_greek(char)".
6357 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6359 * lots of files: apply the NEW_INSETS on all code that will not be
6360 needed when we move to use the new insets. Enable the define in
6361 lyxparagrah.h to try it.
6363 * src/insets/insettabular.C (cellstart): change to be a static
6365 (InsetTabular): initialize buffer in the initializer list.
6367 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
6369 * src/frontends/xforms/FormPrint.[Ch] : moved #include
6370 form_print.h out of the header file. Replaced with forward
6371 declarations of the relevant struct.
6373 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
6376 * src/commandtags.h: do not include "debug.h" which does not
6377 belong there. #include it in some other places because of this
6380 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6382 * src/insets/insetcaption.C: add a couple "using" directives.
6384 * src/toolbar.C (add): get the help text directly from lyxaction.
6386 (setPixmap): new function. Loads from disk and sets a pixmap on a
6387 botton; the name of the pixmap file is derived from the command
6390 * src/toolbar.h: remove members isBitmap and pixmap from
6393 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
6394 * lib/images/: move many files from images/banner.xpm.
6396 * src/lyx_gui.C (create_forms): read banner pixmap from file.
6398 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
6399 * src/toolbar.C: ditto.
6400 * configure.in: ditto.
6401 * INSTALL: document.
6403 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
6404 the spellchecker popup is closed from the WM.
6406 2000-07-19 Juergen Vigna <jug@sad.it>
6408 * src/insets/insetfloat.C (Write): small fix because we use the
6409 insetname for the type now!
6411 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
6413 * src/frontends/xforms/forms/form_citation.fd: object sizes are
6416 * src/frontends/Dialogs.h: removed hideCitation signal
6418 * src/insets/insetcite.h: added hide signal
6420 * src/insets/insetcite.C (~InsetCitation): emits new signal
6421 (getScreenLabel): "intelligent" label should now fit on the screen!
6423 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
6425 * src/frontends/xforms/FormCitation.C (showInset): connects
6426 hide() to the inset's hide signal
6427 (show): modified to use fl_set_object_position rather than
6428 fl_set_object_geometry wherever possible
6430 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6432 * src/insets/lyxinset.h: add caption code
6434 * src/insets/insetfloat.C (type): new method
6436 * src/insets/insetcaption.C (Write): new method
6438 (LyxCode): new method
6440 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
6441 to get it right together with using the FloatList.
6443 * src/commandtags.h: add LFUN_INSET_CAPTION
6444 * src/lyxfunc.C (Dispatch): handle it
6446 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
6449 * src/Variables.[Ch]: make expand take a const reference, remove
6450 the destructor, some whitespace changes.
6452 * src/LyXAction.C (init): add caption-inset-insert
6454 * src/FloatList.C (FloatList): update the default floats a bit.
6456 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6458 * src/Variables.[Ch]: new files. Intended to be used for language
6459 specific strings (like \chaptername) and filename substitution in
6462 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
6464 * lib/kbd/american.kmap: update
6466 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
6468 * src/bufferparams.[Ch]: remove member allowAccents.
6470 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
6472 * src/LaTeXLog.C: use the log_form.h header.
6473 * src/lyx_gui.C: ditto.
6474 * src/lyx_gui_misc.C: ditto.
6475 * src/lyxvc.h: ditto.
6477 * forms/log_form.fd: new file, created from latexoptions.fd. I
6478 kept the log popup and nuked the options form.
6480 * src/{la,}texoptions.[Ch]: removed.
6481 * src/lyx_cb.C (LaTeXOptions): ditto
6483 * src/lyx_gui.C (create_forms): do not handle the
6484 fd_latex_options form.
6486 2000-07-18 Juergen Vigna <jug@sad.it>
6488 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
6489 name of the inset so that it can be requested outside (text2.C).
6491 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
6494 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6496 * src/mathed/formula.h (ConvertFont): constify
6498 * src/mathed/formula.C (Read): add warning if \end_inset is not
6499 found on expected place.
6501 * src/insets/lyxinset.h (ConvertFont): consify
6503 * src/insets/insetquotes.C (ConvertFont): constify
6504 * src/insets/insetquotes.h: ditto
6506 * src/insets/insetinfo.h: add labelfont
6508 * src/insets/insetinfo.C (InsetInfo): set the labelfont
6509 (ascent): use labelfont
6513 (Write): make .lyx file a bit nicer
6515 * src/insets/insetfloat.C (Write): simplify somewhat...
6516 (Read): add warning if arg is not found
6518 * src/insets/insetcollapsable.C: add using std::max
6519 (Read): move string token and add warning in arg is not found
6520 (draw): use std::max to get the right ty
6521 (getMaxWidth): simplify by using std::max
6523 * src/insets/insetsection.h: new file
6524 * src/insets/insetsection.C: new file
6525 * src/insets/insetcaption.h: new file
6526 * src/insets/insetcaption.C: new file
6528 * src/insets/inset.C (ConvertFont): constify signature
6530 * src/insets/Makefile.am (libinsets_la_SOURCES): add
6531 insetcaption.[Ch] and insetsection.[Ch]
6533 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
6534 uses to use LABEL_COUNTER_CHAPTER instead.
6535 * src/text2.C (SetCounter): here
6537 * src/counters.h: new file
6538 * src/counters.C: new file
6539 * src/Sectioning.h: new file
6540 * src/Sectioning.C: new file
6542 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
6544 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6546 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
6549 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
6552 2000-07-17 Juergen Vigna <jug@sad.it>
6554 * src/tabular.C (Validate): check if array-package is needed.
6555 (SetVAlignment): added support for vertical alignment.
6556 (SetLTFoot): better support for longtable header/footers
6557 (Latex): modified to support added features.
6559 * src/LaTeXFeatures.[Ch]: added array-package.
6561 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
6563 * src/lyx_gui.C (LyXGUI): make sure that the height is large
6566 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
6568 * configure.in: do not forget to put a space after -isystem.
6570 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
6572 * lib/kbd/arabic.kmap: a few fixes.
6574 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6576 * some whitespace chagnes to a number of files.
6578 * src/support/DebugStream.h: change to make it easier for
6579 doc++ to parse correctly.
6580 * src/support/lyxstring.h: ditto
6582 * src/mathed/math_utils.C (compara): change to have only one
6584 (MathedLookupBOP): change because of the above.
6586 * src/mathed/math_delim.C (math_deco_compare): change to have only
6588 (search_deco): change becasue of the above.
6590 * src/insets/insettabular.C (DrawCellSelection): use std::swap
6591 instead of manually coded one.
6593 * src/insets/insetquotes.C (Read): read the \end_inset too
6595 * src/insets/insetlatex.h: remove file
6596 * src/insets/insetlatex.C: remove file
6598 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
6600 (InsetPrintIndex): remove destructor
6602 * src/insets/insetinclude.h: remove default constructor
6604 * src/insets/insetfloat.C: work to make it work better
6606 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
6608 * src/insets/insetcite.h (InsetCitation): remove default constructor
6610 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
6612 * src/text.C (GetColumnNearX): comment out some currently unused code.
6614 * src/paragraph.C (writeFile): move some initializations closer to
6616 (CutIntoMinibuffer): small change to use new matchIT operator
6620 (InsertInset): ditto
6623 (InsetIterator): ditto
6624 (Erase): small change to use new matchFT operator
6626 (GetFontSettings): ditto
6627 (HighestFontInRange): ditto
6630 * src/lyxparagraph.h: some chars changed to value_type
6631 (matchIT): because of some stronger checking (perhaps too strong)
6632 in SGI STL, the two operator() unified to one.
6635 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
6637 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
6638 the last inset read added
6639 (parseSingleLyXformat2Token): some more (future) compability code added
6640 (parseSingleLyXformat2Token): warning about solitary \end_inset added
6641 (parseSingleLyXformat2Token): set last_inset_read
6642 (parseSingleLyXformat2Token): more code to read new "Float" correctly
6643 (parseSingleLyXformat2Token): don't double intializw string next_token
6645 * src/TextCache.C (text_fits::operator()): add const's to the signature
6646 (has_buffer::operator()): ditto
6648 * src/Floating.h: add some comments on the class
6650 * src/FloatList.[Ch] (typeExist): new method
6653 * src/BackStack.h: added default constructor, wanted by Gcc.
6655 2000-07-14 Juergen Vigna <jug@sad.it>
6657 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
6659 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
6661 * src/insets/insettabular.C (resizeLyXText): need this to be able to
6662 do a redraw when the window is resized!
6663 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
6665 * src/insets/insettext.C (resizeLyXText): added function to correctly
6666 being able to resize the LyXWindow.
6668 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
6670 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
6672 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
6673 crashes when closing dialog to a deleted inset.
6675 * src/insets/insetcite.[Ch] (Edit) : the return of this former
6676 method! Now similar to other insets.
6678 2000-07-13 Juergen Vigna <jug@sad.it>
6680 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
6682 * lib/examples/Literate.lyx: small patch!
6684 * src/insets/insetbib.C (Read): added this function because of wrong
6685 Write (without [begin|end]_inset).
6687 2000-07-11 Juergen Vigna <jug@sad.it>
6689 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
6690 as the insertInset could not be good!
6692 * src/screen.C (ToggleSelection): fixed toggle selection bug as
6693 the bool param should not be last.
6695 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6697 * sigc++/configure.in: fix bug in threading-related code (Yes, I
6698 did submit that to Karl).
6700 * configure.in: use -isystem instead of -I for X headers. This
6701 fixes a problem on solaris with a recent gcc;
6702 put the front-end code after the X detection code;
6703 configure in sigc++ before lib/
6705 * src/lyx_main.C (commandLineHelp): remove -display from command
6708 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
6710 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
6711 Also put in Makefile rules for building the ``listerrors''
6712 program for parsing errors from literate programs written in LyX.
6714 * lib/build-listerrors: Added small shell script as part of compile
6715 process. This builds a working ``listerrors'' binary if noweb is
6716 installed and either 1) the VNC X server is installed on the machine,
6717 or 2) the user is compiling from within a GUI. The existence of a GUI
6718 is necessary to use the ``lyx --export'' feature for now. This
6719 hack can be removed once ``lyx --export'' no longer requires a GUI to
6722 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
6724 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
6725 now passed back correctly from gcc and placed "under" error
6726 buttons in a Literate LyX source.
6728 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6730 * src/text.C (GetColumnNearX): Better behavior when a RTL
6731 paragraph is ended by LTR text.
6733 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
6736 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6738 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
6739 true when clipboard is empty.
6741 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6743 * text.C (Backspace): Prevent rebreaking of a row if it is the last
6744 row of the paragraph.
6745 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
6746 to prevent calculation of bidi tables
6748 2000-07-07 Juergen Vigna <jug@sad.it>
6750 * src/screen.C (ToggleSelection): added y_offset and x_offset
6753 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
6756 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
6758 * src/insets/insettext.C: fixed Layout-Display!
6760 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6762 * configure.in: add check for strings.h header.
6764 * src/spellchecker.C: include <strings.h> in order to have a
6765 definition for bzero().
6767 2000-07-07 Juergen Vigna <jug@sad.it>
6769 * src/insets/insettext.C (draw): set the status of the bv->text to
6770 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
6772 * src/screen.C (DrawOneRow):
6773 (DrawFromTo): redraw the actual row if something has changed in it
6776 * src/text.C (draw): call an update of the toplevel-inset if something
6777 has changed inside while drawing.
6779 * src/lyxtext.h: added CHANGED_IN_DRAW status.
6781 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
6783 * src/insets/insetbib.[Ch] (callback) new method, moving callback
6784 processing inside class.
6786 * src/insets/insetindex.[Ch] (callback) new method, moving callback
6787 processing inside class.
6789 * src/insets/insetindex.h new struct Holder, consistent with other
6792 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
6793 citation dialog from main code and placed it in src/frontends/xforms.
6794 Dialog launched through signals instead of callbacks
6796 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
6798 * lyx.man: update the options description.
6800 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
6802 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
6803 handle neg values, set min width to 590, add doc about -display
6805 2000-07-05 Juergen Vigna <jug@sad.it>
6807 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
6808 calls to BufferView *.
6810 * src/insets/insettext.C (checkAndActivateInset): small fix non
6811 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
6813 * src/insets/insetcommand.C (Read): Fixed as insets should read till
6814 their \end_inset token!
6816 2000-07-04 edscott <edscott@imp.mx>
6818 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
6819 lib/lyxrc.example: added option \wheel_jump
6821 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
6823 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
6824 remove support for -width,-height,-xpos and -ypos.
6826 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
6828 * src/encoding.[Ch]: New files.
6830 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
6831 (text): Call to the underline() method only when needed.
6833 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
6835 * src/buffer.C (makeLaTeXFile): Compute automatically the input
6836 encoding(s) for the document.
6838 * src/bufferparams.C (BufferParams): Changed default value of
6841 * src/language.C (newLang): Removed.
6842 (items[]): Added encoding information for all defined languages.
6844 * src/lyx_gui.C (create_forms): Added "auto" option to the input
6845 encoding choice button.
6847 * src/lyxrc.h (font_norm_type): New member variable.
6848 (set_font_norm_type): New method.
6850 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
6851 paragraphs with different encodings.
6853 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
6854 (TransformChar): Changed to work correctly with Arabic points.
6855 (draw): Added support for drawing Arabic points.
6856 (draw): Removed code for drawing underbars (this is done by
6859 * src/support/textutils.h (IsPrintableNonspace): New function.
6861 * src/BufferView_pimpl.h: Added "using SigC::Object".
6862 * src/LyXView.h: ditto.
6864 * src/insets/insetinclude.h (include_label): Changed to mutable.
6866 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6868 * src/mathed/math_iter.h: remove empty destructor
6870 * src/mathed/math_cursor.h: remove empty destructor
6872 * src/insets/lyxinset.h: add THEOREM_CODE
6874 * src/insets/insettheorem.[Ch]: new files
6876 * src/insets/insetminipage.C: (InsertInset): remove
6878 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
6880 (InsertInset): remove
6882 * src/insets/insetlist.C: (InsertList): remove
6884 * src/insets/insetfootlike.[Ch]: new files
6886 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
6889 (InsertInset): ditto
6891 * src/insets/insetert.C: remove include Painter.h, reindent
6892 (InsertInset): move to header
6894 * src/insets/insetcollapsable.h: remove explicit from default
6895 contructor, remove empty destructor, add InsertInset
6897 * src/insets/insetcollapsable.C (InsertInset): new func
6899 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6901 * src/vspace.h: add explicit to constructor
6903 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6904 \textcompwordmark, please test this.
6906 * src/lyxrc.C: set ascii_linelen to 65 by default
6908 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6910 * src/commandtags.h: add LFUN_INSET_THEOREM
6912 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6913 (makeLinuxDocFile): remove _some_ of the nice logic
6914 (makeDocBookFile): ditto
6916 * src/Painter.[Ch]: (~Painter): removed
6918 * src/LyXAction.C (init): entry for insettheorem added
6920 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6922 (deplog): code to detect files generated by LaTeX, needs testing
6925 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6927 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6929 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6931 * src/LaTeX.C (deplog): Add a check for files that are going to be
6932 created by the first latex run, part of the project to remove the
6935 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6936 contents to the extension list.
6938 2000-07-04 Juergen Vigna <jug@sad.it>
6940 * src/text.C (NextBreakPoint): added support for needFullRow()
6942 * src/insets/lyxinset.h: added needFullRow()
6944 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6947 * src/insets/insettext.C: lots of changes for update!
6949 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6951 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6953 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6955 * src/insets/insetinclude.C (InsetInclude): fixed
6956 initialization of include_label.
6957 (unique_id): now returns a string.
6959 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6961 * src/LaTeXFeatures.h: new member IncludedFiles, for
6962 a map of key, included file name.
6964 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6965 with the included files for inclusion in SGML preamble,
6966 i. e., linuxdoc and docbook.
6969 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6970 nice (is the generated linuxdoc code to be exported?), that
6971 allows to remove column, and only_body that will be true for
6972 slave documents. Insets are allowed inside SGML font type.
6973 New handling of the SGML preamble for included files.
6974 (makeDocBookFile): the same for docbook.
6976 * src/insets/insetinclude.h:
6977 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6979 (DocBook): new export methods.
6981 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6982 and makeDocBookFile.
6984 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6985 formats to export with command line argument -x.
6987 2000-06-29 Juergen Vigna <jug@sad.it>
6989 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6990 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6992 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6993 region could already been cleared by an inset!
6995 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6997 * src/BufferView_pimpl.h: remove member variables lyx_focus and
7000 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
7002 (cursorToggle): remove special handling of lyx focus.
7004 2000-06-28 Juergen Vigna <jug@sad.it>
7006 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
7009 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7011 * src/insets/insetindex.C (Edit): add a callback when popup is
7014 * src/insets/insettext.C (LocalDispatch):
7015 * src/insets/insetmarginal.h:
7016 * src/insets/insetlist.h:
7017 * src/insets/insetfoot.h:
7018 * src/insets/insetfloat.h:
7019 * src/insets/insetert.h: add a missing std:: qualifier.
7021 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7023 * src/support/lyxsum.C (sum): '\0' teminate file read when using
7026 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
7028 * src/insets/insettext.C (Read): remove tmptok unused variable
7029 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
7030 (InsertInset): change for new InsetInset code
7032 * src/insets/insettext.h: add TEXT inline method
7034 * src/insets/insettext.C: remove TEXT macro
7036 * src/insets/insetmarginal.C (Write): new method
7037 (Latex): change output slightly
7039 * src/insets/insetfoot.C (Write): new method
7040 (Latex): change output slightly (don't use endl when no need)
7042 * src/insets/insetert.C (Write): new method
7044 * src/insets/insetcollapsable.h: make button_length, button_top_y
7045 and button_bottm_y protected.
7047 * src/insets/insetcollapsable.C (Write): simplify code by using
7048 tostr. Also do not output the float name, the children class
7049 should to that to get control over own arguments
7051 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
7052 src/insets/insetminipage.[Ch]:
7055 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
7057 * src/lyxfunc.C (Dispatch): cases for new insets/commands
7059 * src/Makefile.am (lyx_SOURCES): add the new files
7061 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
7062 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
7063 * src/commandtags.h: ditto
7065 * src/LaTeXFeatures.h: add a std::set of used floattypes
7067 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
7069 * src/FloatList.[Ch] src/Floating.h: new files
7071 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
7073 * src/lyx_cb.C (TableApplyCB): ditto
7075 * src/text2.C: ditto
7076 * src/buffer.C (SimpleLinuxDocOnePar): ditto
7077 (parseSingleLyXformat2Token): ditto + add code for
7078 backwards compability for old float styles + add code for new insets
7080 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
7082 (InsertInset(size_type, Inset *, LyXFont)): new method
7083 (InsetChar(size_type, char)): changed to use the other InsetChar
7084 with a LyXFont(ALL_INHERIT).
7085 (InsetInset(size_type, Inset*)): changed to use InsetChar to
7086 insert the META_INSET.
7088 * sigc++/thread.cc (Privete<int>::operator int&): move definition
7090 * sigc++/thread.h (Threads): from here
7092 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
7093 definition out of line
7094 * sigc++/scope.h: from here
7096 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7098 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
7099 is specified (adapted from a patch from edscott <edscott@imp.mx>).
7101 * Makefile.am (bindist): new target.
7103 * INSTALL: add instructions for doing a binary distribution.
7105 * development/tools/README.bin.example: update a bit.
7107 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
7110 * lib/lyxrc.example: new lyxrc tag \set_color.
7112 * src/lyxfunc.C (Dispatch):
7113 * src/commandtags.h:
7114 * src/LyXAction.C: new lyxfunc "set-color".
7116 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
7117 and an x11name given as strings.
7119 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
7120 cache when a color is changed.
7122 2000-06-26 Juergen Vigna <jug@sad.it>
7124 * src/lyxrow.C (width): added this functions and variable.
7126 * src/insets/insetcite.C (create_form_citation_form): some Gravity
7129 * src/text.C (SetHeightOfRow): fixed calcualting of width.
7131 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7133 * images/undo_bw.xpm: new icon.
7134 * images/redo_bw.xpm: ditto.
7136 * configure.in (INSTALL_SCRIPT): change value to
7137 ${INSTALL} to avoid failures of install-script target.
7138 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
7140 * src/BufferView.h: add a magic "friend" declaration to please
7143 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
7145 * forms/cite.fd: modified to allow resizing without messing
7148 * src/insetcite.C: Uses code from cite.fd almost without
7150 User can now resize dialog in the x-direction.
7151 Resizing the dialog in the y-direction is prevented, as the
7152 code does this intelligently already.
7154 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7156 * INSTALL: remove obsolete entry in "problems" section.
7158 * lib/examples/sl_*.lyx: update of the slovenian examples.
7160 * src/support/FileInfo.[Ch] (getBlockSize): remove.
7162 2000-06-23 Juergen Vigna <jug@sad.it>
7164 * src/lyxtext.h: added a 'cleared' flag to draw() function.
7166 * src/buffer.C (resize): delete the LyXText of textinsets.
7168 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
7170 * src/insets/lyxinset.h: added another parameter 'cleared' to
7171 the draw() function.
7173 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
7174 unlocking inset in inset.
7176 2000-06-22 Juergen Vigna <jug@sad.it>
7178 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
7179 of insets and moved first to LyXText.
7181 * src/mathed/formulamacro.[Ch]:
7182 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
7184 2000-06-21 Juergen Vigna <jug@sad.it>
7186 * src/text.C (GetVisibleRow): look if I should clear the area or not
7187 using Inset::doClearArea() function.
7189 * src/insets/lyxinset.h: added doClearArea() function and
7190 modified draw(Painter &, ...) to draw(BufferView *, ...)
7192 * src/text2.C (UpdateInset): return bool insted of int
7194 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
7196 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
7197 combox in the character popup
7199 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
7200 BufferParams const & params
7202 2000-06-20 Juergen Vigna <jug@sad.it>
7204 * src/insets/insettext.C (SetParagraphData): set insetowner on
7207 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7209 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
7210 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
7212 (form_main_): remove
7214 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
7215 (create_form_form_main): remove FD_form_main stuff, connect to
7216 autosave_timeout signal
7218 * src/LyXView.[Ch] (getMainForm): remove
7219 (UpdateTimerCB): remove
7220 * src/BufferView_pimpl.h: inherit from SigC::Object
7222 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
7223 signal instead of callback
7225 * src/BufferView.[Ch] (cursorToggleCB): remove
7227 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7229 * src/BufferView_pimpl.C: changes because of the one below
7231 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
7232 instead of storing a pointer to a LyXText.
7234 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
7236 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
7238 * src/lyxparagraph.h
7240 * src/paragraph.C: Changed fontlist to a sorted vector.
7242 2000-06-19 Juergen Vigna <jug@sad.it>
7244 * src/BufferView.h: added screen() function.
7246 * src/insets/insettext.C (LocalDispatch): some selection code
7249 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
7251 * src/insets/insettext.C (SetParagraphData):
7253 (InsetText): fixes for multiple paragraphs.
7255 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
7257 * development/lyx.spec.in: Call configure with ``--without-warnings''
7258 to work around a bug with the Makefiles when doing ``make lyxrpm''.
7259 This should be fine, however, since we generally don't want to be
7260 verbose when making an RPM.
7262 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
7264 * lib/scripts/fig2pstex.py: New file
7266 2000-06-16 Juergen Vigna <jug@sad.it>
7268 * src/insets/insettabular.C (UpdateLocal):
7269 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
7270 (LocalDispatch): Changed all functions to use LyXText.
7272 2000-06-15 Juergen Vigna <jug@sad.it>
7274 * src/text.C (SetHeightOfRow): call inset::update before requesting
7277 * src/insets/insettext.C (update):
7278 * src/insets/insettabular.C (update): added implementation
7280 * src/insets/lyxinset.h: added update function
7282 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7284 * src/text.C (SelectNextWord): protect against null pointers with
7285 old-style string streams. (fix from Paul Theo Gonciari
7288 * src/cite.[Ch]: remove erroneous files.
7290 * lib/configure.m4: update the list of created directories.
7292 * src/lyxrow.C: include <config.h>
7293 * src/lyxcursor.C: ditto.
7295 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7297 * lib/examples/decimal.lyx: new example file from Mike.
7299 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
7300 to find template definitions (from Dekel)
7302 * src/frontends/.cvsignore: add a few things.
7304 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
7306 * src/Timeout.C (TimeOut): remove default argument.
7308 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
7311 * src/insets/ExternalTemplate.C: add a "using" directive.
7313 * src/lyx_main.h: remove the act_ struct, which seems unused
7316 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7318 * LyX Developers Meeting: All files changed, due to random C++ (by
7319 coincidence) code generator script.
7321 - external inset (cool!)
7322 - initial online editing of preferences
7323 - insettabular breaks insettext(s contents)
7325 - some DocBook fixes
7326 - example files update
7327 - other cool stuff, create a diff and look for yourself.
7329 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
7331 * src/insets/insettext.C (computeTextRows): if the maxWidth is
7332 -1 this is a non-line-breaking textinset.
7334 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
7335 if there is no width set.
7337 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7339 * Lots of files: Merged the dialogbase branch.
7341 2000-06-09 Allan Rae <rae@lyx.org>
7343 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
7344 and the Dispatch methods that used it.
7346 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
7347 access to functions formerly kept in Dispatch.
7349 2000-05-19 Allan Rae <rae@lyx.org>
7351 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
7352 made to_page and count_copies integers again. from_page remains a
7353 string however because I want to allow entry of a print range like
7354 "1,4,22-25" using this field.
7356 * src/LyXAction.C: added action info and commands for buffer-print-xtl
7357 and printer-params-get. These aren't useful from the minibuffer but
7358 could be used by a script/LyXServer app provided it passes a suitable
7359 auto_mem_buffer. I guess I should take a look at how the LyXServer
7360 works and make it support xtl buffers.
7362 * sigc++/: updated to libsigc++-1.0.1
7364 * src/xtl/: updated to xtl-1.3.pl.11
7366 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
7367 those changes done to the files in src/ are actually recreated when
7368 they get regenerated. Please don't ever accept a patch that changes a
7369 dialog unless that patch includes the changes to the corresponding *.fd
7372 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
7373 stringOnlyContains, renamed it and generalised it.
7375 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
7376 branch. Removed the remaining old form_print code.
7378 2000-04-26 Allan Rae <rae@lyx.org>
7380 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
7381 trap I was trying to fix with the ID: fields in src/xtl/ :-)
7383 2000-04-25 Allan Rae <rae@lyx.org>
7385 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
7386 against a base of xtl-1.3.pl.4
7388 * development/tools/lxtl.sh: fixed a couple of silly typos and now
7389 filter the Id: entries so they still show the xtl version number
7392 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
7393 into the src/xtl code. Patch still pending with José (XTL)
7395 2000-04-24 Allan Rae <rae@lyx.org>
7397 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
7398 both more generic and much safer. Use the new template functions.
7399 * src/buffer.[Ch] (Dispatch): ditto.
7401 * src/frontends/xforms/FormPrint.C (update): Use new template functions
7402 and mem buffer more intelligently. Also a little general cleanup.
7405 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
7406 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
7407 * src/xtl/Makefile.am: ditto.
7408 * src/xtl/.cvsignore: ditto.
7409 * src/Makefile.am: ditto.
7411 * src/PrinterParams.h: Removed the macros member functions. Added a
7412 testInvariant member function. A bit of tidying up and commenting.
7413 Included Angus's idea for fixing operation with egcs-1.1.2.
7415 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
7416 cool expansion of XTL's mem_buffer to support automatic memory
7417 management within the buffer itself. Removed the various macros and
7418 replaced them with template functions that use either auto_mem_buffer
7419 or mem_buffer depending on a #define. The mem_buffer support will
7420 disappear as soon as the auto_mem_buffer is confirmed to be good on
7421 other platforms/compilers. That is, it's there so you've got something
7424 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
7425 effectively forked XTL. However I expect José will include my code
7426 into the next major release. Also fixed a memory leak.
7427 * src/xtl/text.h: ditto.
7428 * src/xtl/xdr.h: ditto.
7429 * src/xtl/giop.h: ditto.
7431 2000-04-16 Allan Rae <rae@lyx.org>
7433 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
7434 by autogen.sh and removed by maintainer-clean anyway.
7435 * .cvsignore, sigc++/.cvsignore: Support the above.
7437 * sigc++/.cvsignore: Forgot that retbind.h was generated.
7439 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
7441 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
7442 macros, renamed static callback-target member functions to suit new
7443 scheme and made them public.
7444 * src/frontends/xforms/forms/form_print.fd: ditto.
7445 * src/frontends/xforms/forms/form_copyright.fd: ditto.
7447 * src/support/lxtl.h: small cleanup to use typedef instead of #define
7450 * src/xtl/: New directory containing a minimal distribution of XTL.
7451 This is XTL-1.3.pl.4.
7453 * development/tools/lxtl.sh: A script to generate the above mini-dist.
7455 2000-04-15 Allan Rae <rae@lyx.org>
7457 * development/tools/makeLyXsigc.sh: Remove the library version numbers
7459 * sigc++/: Updated to libsigc++-1.0.0
7461 2000-04-14 Allan Rae <rae@lyx.org>
7463 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
7464 use the generic ones in future. I'll modify my conversion script.
7466 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
7468 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
7469 (CloseAllBufferRelatedDialogs): Renamed.
7470 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
7472 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
7473 of the generic ones. These are the same ones my conversion script
7476 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
7477 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
7478 * src/buffer.C (Dispatch): ditto
7480 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
7481 functions for updating and hiding buffer dependent dialogs.
7482 * src/BufferView.C (buffer): ditto
7483 * src/buffer.C (setReadonly): ditto
7484 * src/lyxfunc.C (CloseBuffer): ditto
7486 * src/buffer.h: Take setReadonly() out of line so I don't have to include
7487 Dialogs.h, and hence all the SigC stuff, into every file that includes
7488 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
7490 * src/BufferView2.C: reduce the number of headers included by buffer.h
7492 2000-04-11 Allan Rae <rae@lyx.org>
7494 * src/frontends/xforms/xform_macros.h: A small collection of macros
7495 for building C callbacks.
7497 * src/frontends/xforms/Makefile.am: Added above file.
7499 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
7500 scheme again. This time it should work for JMarc. If this is
7501 successful I'll revise my conversion script to automate some of this.
7502 The static member functions in the class also have to be public for
7503 this scheme will work. If the scheme works (it's almost identical to
7504 the way BufferView::cursorToggleCB is handled so it should work) then
7505 FormCopyright and FormPrint will be ready for inclusion into the main
7506 trunk immediately after 1.1.5 is released -- provided we're prepared
7507 for complaints about lame compilers not handling XTL.
7509 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
7511 2000-04-07 Allan Rae <rae@lyx.org>
7513 * config/lyxinclude.m4: A bit more tidying up (Angus)
7515 * src/LString.h: JMarc's <string> header fix
7517 * src/PrinterParams.h: Used string for most data to remove some
7518 ugly code in the Print dialog and avoid even uglier code when
7519 appending the ints to a string for output.
7521 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
7522 and moved "default:" back to the end of switch statement. Cleaned
7523 up the printing so it uses the right function calls and so the
7524 "print to file" option actually puts the file in the right directory.
7526 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
7528 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
7529 and Ok+Apply button control into a separate method: input (Angus).
7530 (input) Cleaned it up and improved it to be very thorough now.
7531 (All CB) static_cast used instead of C style cast (Angus). This will
7532 probably change again once we've worked out how to keep gcc-2.8.1 happy
7533 with real C callbacks.
7534 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
7535 ignore some of the bool settings and has random numbers instead. Needs
7536 some more investigation. Added other input length checks and checking
7537 of file and printer names.
7539 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
7540 would link (Angus). Seems the old code doesn't compile with the pragma
7541 statement either. Separated callback entries from internal methods.
7543 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
7545 2000-03-17 Allan Rae <rae@lyx.org>
7547 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
7548 need it? Maybe it could go in Dialogs instead? I could make it a
7549 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
7550 values to get the bool return value.
7551 (Dispatch): New overloaded method for xtl support.
7553 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
7554 extern "C" callback instead of static member functions. Hopefully,
7555 JMarc will be able to compile this. I haven't changed
7556 forms/form_copyright.fd yet. Breaking one of my own rules already.
7558 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
7559 because they aren't useful from the minibuffer. Maybe a LyXServer
7560 might want a help message though?
7562 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
7564 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
7565 xtl which needs both rtti and exceptions.
7567 * src/support/Makefile.am:
7568 * src/support/lxtl.h: New file. Some helper macros for using XTL.
7570 * src/frontends/xforms/input_validators.[ch]: input filters and
7571 validators. These conrol what keys are valid in input boxes.
7572 Use them and write some more. Much better idea than waiting till
7573 after the user has pressed Ok to say that the input fields don't make
7576 * src/frontends/xforms/Makefile.am:
7577 * src/frontends/xforms/forms/form_print.fd:
7578 * src/frontends/xforms/forms/makefile:
7579 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
7580 new scheme. Still have to make sure I haven't missed anything from
7581 the current implementation.
7583 * src/Makefile.am, src/PrinterParams.h: New data store.
7585 * other files: Added a couple of copyright notices.
7587 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7589 * src/insets/insetbib.h: move Holder struct in public space.
7591 * src/frontends/include/DialogBase.h: use SigC:: only when
7592 SIGC_CXX_NAMESPACES is defined.
7593 * src/frontends/include/Dialogs.h: ditto.
7595 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
7597 * src/frontends/xforms/FormCopyright.[Ch]: do not
7598 mention SigC:: explicitely.
7600 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7602 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
7603 deals with testing KDE in main configure.in
7604 * configure.in: ditto.
7606 2000-02-22 Allan Rae <rae@lyx.org>
7608 * Lots of files: Merged from HEAD
7610 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
7611 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
7613 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
7615 * sigc++/: new minidist.
7617 2000-02-14 Allan Rae <rae@lyx.org>
7619 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
7621 2000-02-08 Juergen Vigna <jug@sad.it>
7623 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
7624 file for the buildin GUI builder of KDevelop of the copyright-dialog.
7626 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
7627 for this port and so it is much easier for other people to port
7628 dialogs in a common development environment.
7630 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
7631 the QT/KDE implementation.
7633 * src/frontends/kde/Dialogs.C:
7634 * src/frontends/kde/FormCopyright.C:
7635 * src/frontends/kde/FormCopyright.h:
7636 * src/frontends/kde/Makefile.am:
7637 * src/frontends/kde/formcopyrightdialog.C:
7638 * src/frontends/kde/formcopyrightdialog.h:
7639 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
7640 for the kde support of the Copyright-Dialog.
7642 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
7643 subdir-substitution instead of hardcoded 'xforms' as we now have also
7646 * src/frontends/include/DialogBase.h (Object): just commented the
7647 label after #endif (nasty warning and I don't like warnings ;)
7649 * src/main.C (main): added KApplication initialization if using
7652 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
7653 For now only the KDE event-loop is added if frontend==kde.
7655 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
7657 * configure.in: added support for the --with-frontend[=value] option
7659 * autogen.sh: added kde.m4 file to list of config-files
7661 * acconfig.h: added define for KDEGUI-support
7663 * config/kde.m4: added configuration functions for KDE-port
7665 * config/lyxinclude.m4: added --with-frontend[=value] option with
7666 support for xforms and KDE.
7668 2000-02-08 Allan Rae <rae@lyx.org>
7670 * all Makefile.am: Fixed up so the make targets dist, distclean,
7671 install and uninstall all work even if builddir != srcdir. Still
7672 have a new sigc++ minidist update to come.
7674 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
7676 2000-02-01 Allan Rae <rae@lyx.org>
7678 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
7679 Many mods to get builddir != srcdir working.
7681 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
7682 for building on NT and so we can do the builddir != srcdir stuff.
7684 2000-01-30 Allan Rae <rae@lyx.org>
7686 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
7687 This will stay in "rae" branch. We probably don't really need it in
7688 the main trunk as anyone who wants to help programming it should get
7689 a full library installed also. So they can check both included and
7690 system supplied library compilation.
7692 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
7693 Added a 'mini' distribution of libsigc++. If you feel the urge to
7694 change something in these directories - Resist it. If you can't
7695 resist the urge then you should modify the following script and rebuild
7696 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
7697 all happen. Still uses a hacked version of libsigc++'s configure.in.
7698 I'm quite happy with the results. I'm not sure the extra work to turn
7699 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
7700 worth the trouble and would probably lead to extra maintenance
7702 I haven't tested the following important make targets: install, dist.
7703 Not ready for prime time but very close. Maybe 1.1.5.
7705 * development/tools/makeLyXsigc.sh: A shell script to automatically
7706 generate our mini-dist of libsigc++. It can only be used with a CVS
7707 checkout of libsigc++ not a tarball distribution. It's well commented.
7708 This will end up as part of the libsigc++ distribution so other apps
7709 can easily have an included mini-dist. If someone makes mods to the
7710 sigc++ subpackage without modifying this script to generate those
7711 changes I'll be very upset!
7713 * src/frontends/: Started the gui/system indep structure.
7715 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
7716 to access the gui-indep dialogs are in this class. Much improved
7717 design compared to previous revision. Lars, please refrain from
7718 moving this header into src/ like you did with Popups.h last time.
7720 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
7722 * src/frontends/xforms/: Started the gui-indep system with a single
7723 dialog: FormCopyright. Initial testing of use of libsigc++ was very
7726 * src/frontends/xforms/forms: Repository for the xforms .fd files.
7727 Here you'll find a very useful makefile and automated fdfix.sh that
7728 makes updating dailogs a no-brainer -- provided you follow the rules
7729 set out in the README. I'm thinking about adding another script to
7730 automatically generate skeleton code for a new dialog given just the
7733 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
7734 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
7735 Made FormCopyright gui-indep and added a lyxfunc to get to it.
7737 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7739 * src/support/LSubstring.C (operator): simplify
7741 * src/lyxtext.h: removed bparams, use buffer_->params instead
7743 * src/lyxrow.h: make Row a real class, move all variables to
7744 private and use accessors.
7746 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
7748 (isRightToLeftPar): ditto
7749 (ChangeLanguage): ditto
7750 (isMultiLingual): ditto
7753 (SimpleTeXOnePar): ditto
7754 (TeXEnvironment): ditto
7755 (GetEndLabel): ditto
7757 (SetOnlyLayout): ditto
7758 (BreakParagraph): ditto
7759 (BreakParagraphConservative): ditto
7760 (GetFontSettings): ditto
7762 (CopyIntoMinibuffer): ditto
7763 (CutIntoMinibuffer): ditto
7764 (PasteParagraph): ditto
7765 (SetPExtraType): ditto
7766 (UnsetPExtraType): ditto
7767 (DocBookContTableRows): ditto
7768 (SimpleDocBookOneTablePar): ditto
7770 (TeXFootnote): ditto
7771 (SimpleTeXOneTablePar): ditto
7772 (TeXContTableRows): ditto
7773 (SimpleTeXSpecialChars): ditto
7776 * src/lyxcursor.h: make LyXCursor a real class, move all variables
7777 to private and use accessors.
7779 * src/lyx_cb.C: remove char updatetimer, and all code that uses
7780 this, we did not use it anymore and has not been for ages. Just a
7781 waste of cpu cycles.
7783 * src/language.h: make Language a real class, move all variables
7784 to private and use accessors.
7786 * src/BufferView_pimpl.C (Pimpl): use new timer code.
7787 (create_view): remove
7788 (update): some changes for new timer
7789 (cursorToggle): use new timer
7790 (beforeChange): change for new timer
7792 * src/BufferView.h (cursorToggleCB): removed last paramter because
7795 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
7796 (cursorToggleCB): change because of new timer code
7798 * lib/CREDITS: updated own mailaddress
7800 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7802 * src/support/filetools.C (PutEnv): fix the code in case neither
7803 putenv() nor setenv() have been found.
7805 * INSTALL: mention the install-strip Makefile target.
7807 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
7808 read-only documents.
7810 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7812 * lib/reLyX/configure.in (VERSION): avoid using a previously
7813 generated reLyX wrapper to find out $prefix.
7815 * lib/examples/eu_adibide_lyx-atua.lyx:
7816 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
7817 translation of the Tutorial (Dooteo)
7819 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
7821 * forms/cite.fd: new citation dialog
7823 * src/insetcite.[Ch]: the new citation dialog is moved into
7826 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
7829 * src/insets/insetcommand.h: data members made private.
7831 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7833 * LyX 1.1.5 released
7835 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7837 * src/version.h (LYX_RELEASE): to 1.1.5
7839 * src/spellchecker.C (RunSpellChecker): return false if the
7840 spellchecker dies upon creation.
7842 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7844 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
7845 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
7849 * lib/CREDITS: update entry for Martin Vermeer.
7851 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
7853 * src/text.C (draw): Draw foreign language bars at the bottom of
7854 the row instead of at the baseline.
7856 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
7858 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7860 * lib/bind/de_menus.bind: updated
7862 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7864 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
7866 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7868 * src/menus.C (Limit_string_length): New function
7869 (ShowTocMenu): Limit the number of items/length of items in the
7872 * src/paragraph.C (String): Correct result for a paragraph inside
7875 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7877 * src/bufferlist.C (close): test of buf->getuser() == NULL
7879 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
7881 * src/BufferView2.C (removeAutoInsets): Fix a bug:
7882 Do not call to SetCursor when the paragraph is a closed footnote!
7884 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
7886 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
7889 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7891 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7894 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7895 reference popup, that activates the reference-back action
7897 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7899 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7900 the menus. Also fixed a bug.
7902 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7903 the math panels when switching buffers (unless new buffer is readonly).
7905 * src/BufferView.C (NoSavedPositions)
7906 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7908 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7910 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7911 less of dvi dirty or not.
7913 * src/trans_mgr.[Ch] (insert): change first parameter to string
7916 * src/chset.[Ch] (encodeString): add const to first parameter
7918 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7920 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7924 * src/LaTeX.C (deplog): better searching for dependency files in
7925 the latex log. Uses now regexps.
7927 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7928 instead of the box hack or \hfill.
7930 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7932 * src/lyxfunc.C (doImportHelper): do not create the file before
7933 doing the actual import.
7934 (doImportASCIIasLines): create a new file before doing the insert.
7935 (doImportASCIIasParagraphs): ditto.
7937 * lib/lyxrc.example: remove mention of non-existing commands
7939 * lyx.man: remove mention of color-related switches.
7941 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7943 * src/lyx_gui.C: remove all the color-related ressources, which
7944 are not used anymore.
7946 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7949 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7951 * src/lyxrc.C (read): Add a missing break in the switch
7953 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7955 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7957 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7960 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7962 * src/text.C (draw): draw bars under foreign language words.
7964 * src/LColor.[Ch]: add LColor::language
7966 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7968 * src/lyxcursor.h (boundary): New member variable
7970 * src/text.C (IsBoundary): New methods
7972 * src/text.C: Use the above for currect cursor movement when there
7973 is both RTL & LTR text.
7975 * src/text2.C: ditto
7977 * src/bufferview_funcs.C (ToggleAndShow): ditto
7979 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7981 * src/text.C (DeleteLineForward): set selection to true to avoid
7982 that DeleteEmptyParagraphMechanism does some magic. This is how it
7983 is done in all other functions, and seems reasonable.
7984 (DeleteWordForward): do not jump over non-word stuff, since
7985 CursorRightOneWord() already does it.
7987 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7988 DeleteWordBackward, since they seem safe to me (since selection is
7989 set to "true") DeleteEmptyParagraphMechanism does nothing.
7991 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7993 * src/lyx_main.C (easyParse): simplify the code by factoring the
7994 part that removes parameters from the command line.
7995 (LyX): check wether wrong command line options have been given.
7997 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7999 * src/lyx_main.C : add support for specifying user LyX
8000 directory via command line option -userdir.
8002 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
8004 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
8005 the number of items per popup.
8006 (Add_to_refs_menu): Ditto.
8008 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8010 * src/lyxparagraph.h: renamed ClearParagraph() to
8011 StripLeadingSpaces() and moved it to paragraph.C. We pass the
8012 textclass as parameter, and do nothing if free_spacing is
8013 true. This fixes part of the line-delete-forward problems.
8015 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
8016 (pasteSelection): ditto.
8017 (SwitchLayoutsBetweenClasses): more translatable strings.
8019 * src/text2.C (CutSelection): use StripLeadingSpaces.
8020 (PasteSelection): ditto.
8021 (DeleteEmptyParagraphMechanism): ditto.
8023 2000-05-26 Juergen Vigna <jug@sad.it>
8025 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
8026 is not needed in tabular insets.
8028 * src/insets/insettabular.C (TabularFeatures): added missing features.
8030 * src/tabular.C (DeleteColumn):
8032 (AppendRow): implemented this functions
8033 (cellsturct::operator=): clone the inset too;
8035 2000-05-23 Juergen Vigna <jug@sad.it>
8037 * src/insets/insettabular.C (LocalDispatch): better selection support
8038 when having multicolumn-cells.
8040 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
8042 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
8044 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8046 * src/ColorHandler.C (getGCForeground): put more test into _()
8048 * lib/examples/eu_splash.lyx: new file (Basque translation) from
8051 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
8054 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
8056 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
8057 there are no labels, or when buffer is readonly.
8059 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
8060 there are no labels, buffer is SGML, or when buffer is readonly.
8062 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8064 * src/LColor.C (LColor): change a couple of grey40 to grey60
8065 (LColor): rewore initalization to make compiles go some magnitude
8067 (getGUIName): don't use gettext until we need the string.
8069 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
8071 * src/Bullet.[Ch]: Fixed a small bug.
8073 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
8075 * src/paragraph.C (String): Several fixes/improvements
8077 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
8079 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8081 * src/paragraph.C (String): give more correct output.
8083 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
8085 * src/lyxfont.C (stateText) Do not output the language if it is
8086 eqaul to the language of the document.
8088 * src/paragraph.C (TeXOnePar): Do not put language switch commands
8089 between two paragraphs with the same language.
8091 * src/paragraph.C (getParLanguage) Return a correct answer for an
8092 empty dummy paragraph.
8094 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
8097 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
8100 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
8101 the menus/popup, if requested fonts are unavailable.
8103 2000-05-22 Juergen Vigna <jug@sad.it>
8105 * src/insets/insettabular.C (LocalDispatch): added some more cursor
8106 movement support (Up/Down/Tab/Shift-Tab).
8107 (LocalDispatch): added also preliminari cursor-selection.
8109 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
8111 * src/paragraph.C (PasteParagraph): Hopefully now right!
8113 2000-05-22 Garst R. Reese <reese@isn.net>
8115 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
8116 of list, change all references to Environment to Command
8117 * tex/hollywood.cls : rewrite environments as commands, add
8118 \uppercase to interiorshot and exteriorshot to force uppecase.
8119 * tex/broadway.cls : rewrite environments as commands. Tweak
8122 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8124 * src/menus.C (Add_to_toc_menu): fix the code which limits the
8125 size of items: use a constant intead of the hardcoded 40, and more
8126 importantly do not remove the %m and %x tags added at the end.
8127 (Add_to_refs_menu): use vector::size_type instead of
8128 unsigned int as basic types for the variables. _Please_ do not
8129 assume that size_t is equal to unsigned int. On an alpha, this is
8130 unsigned long, which is _not_ the same.
8132 * src/language.C (initL): remove language "hungarian", since it
8133 seems that "magyar" is better.
8135 2000-05-22 Juergen Vigna <jug@sad.it>
8137 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
8139 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
8142 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
8143 next was deleted but not set to 0.
8145 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8147 * src/language.C (initL): change the initialization of languages
8148 so that compiles goes _fast_.
8150 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
8153 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
8155 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8159 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8161 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
8163 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
8167 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
8170 * src/insets/insetlo*.[Ch]: Made editable
8172 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8174 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
8175 the current selection.
8177 * src/BufferView_pimpl.C (stuffClipboard): new method
8179 * src/BufferView.C (stuffClipboard): new method
8181 * src/paragraph.C (String): new method
8183 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
8184 LColor::ignore when lyxname is not found.
8186 * src/BufferView.C (pasteSelection): new method
8188 * src/BufferView_pimpl.C (pasteSelection): new method
8190 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
8192 * src/WorkArea.C (request_clipboard_cb): new static function
8193 (getClipboard): new method
8194 (putClipboard): new method
8196 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8198 * LyX 1.1.5pre2 released
8200 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8202 * src/vspace.C (operator=): removed
8203 (operator=): removed
8205 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
8207 * src/layout.C (NumberOfClass): manually set the type in make_pair
8208 (NumberOfLayout): ditto
8210 * src/language.C: use the Language constructor for ignore_lang
8212 * src/language.h: add constructors to struct Language
8214 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
8216 * src/text2.C (SetCursorIntern): comment out #warning
8218 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
8220 * src/mathed/math_iter.h: initialize sx and sw to 0
8222 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
8224 * forms/lyx.fd: Redesign of form_ref
8226 * src/LaTeXFeatures.[Ch]
8230 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
8233 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
8234 and Buffer::inset_iterator.
8236 * src/menus.C: Added new menus: TOC and Refs.
8238 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
8240 * src/buffer.C (getTocList): New method.
8242 * src/BufferView2.C (ChangeRefs): New method.
8244 * src/buffer.C (getLabelList): New method. It replaces the old
8245 getReferenceList. The return type is vector<string> instead of
8248 * src/insets/insetinclude.C (getLabelList): New method. Replaces
8249 the old getLabel() and GetNumberOfLabels() methods.
8250 * src/insets/insetlabel.C (getLabelList): ditto
8251 * src/mathed/formula.C (getLabelList): ditto
8253 * src/paragraph.C (String): New method.
8255 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
8256 Uses the new getTocList() method.
8257 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
8258 which automatically updates the contents of the browser.
8259 (RefUpdateCB): Use the new getLabelList method.
8261 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
8263 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
8265 * src/spellchecker.C: Added using std::reverse;
8267 2000-05-19 Juergen Vigna <jug@sad.it>
8269 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
8271 * src/insets/insettext.C (computeTextRows): small fix for display of
8272 1 character after a newline.
8274 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
8277 2000-05-18 Juergen Vigna <jug@sad.it>
8279 * src/insets/insettabular.C (TabularFeatures): fixed update of display
8280 when changing width of column.
8282 * src/tabular.C (set_row_column_number_info): setting of
8283 autobreak rows if necessary.
8285 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8287 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
8289 * src/vc-backend.*: renamed stat() to status() and vcstat to
8290 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
8291 compilation broke. The new name seems more relevant, anyway.
8293 2000-05-17 Juergen Vigna <jug@sad.it>
8295 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
8296 which was wrong if the removing caused removing of rows!
8298 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
8299 (pushToken): new function.
8301 * src/text2.C (CutSelection): fix problem discovered with purify
8303 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8305 * src/debug.C (showTags): enlarge the first column, now that we
8306 have 6-digits debug codes.
8308 * lib/layouts/hollywood.layout:
8309 * lib/tex/hollywood.cls:
8310 * lib/tex/brodway.cls:
8311 * lib/layouts/brodway.layout: more commands and fewer
8312 environments. Preambles moved in the .cls files. Broadway now has
8313 more options on scene numbering and less whitespace (from Garst)
8315 * src/insets/insetbib.C (getKeys): make sure that we are in the
8316 document directory, in case the bib file is there.
8318 * src/insets/insetbib.C (Latex): revert bogus change.
8320 2000-05-16 Juergen Vigna <jug@sad.it>
8322 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
8323 the TabularLayout on cursor move.
8325 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
8327 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
8330 (draw): fixed cursor position and drawing so that the cursor is
8331 visible when before the tabular-inset.
8333 * src/insets/insettext.C (init): drawLockedFrame was not initialized
8334 when creating from old insettext.
8336 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
8338 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8340 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
8341 * lib/tex/brodway.cls: ditto
8343 * lib/layouts/brodway.layout: change alignment of parenthical
8346 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8348 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
8349 versions 0.88 and 0.89 are supported.
8351 2000-05-15 Juergen Vigna <jug@sad.it>
8353 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
8356 * src/insets/insettext.C (computeTextRows): redone completely this
8357 function in a much cleaner way, because of problems when having a
8359 (draw): added a frame border when the inset is locked.
8360 (SetDrawLockedFrame): this sets if we draw the border or not.
8361 (SetFrameColor): this sets the frame color (default=insetframe).
8363 * src/insets/lyxinset.h: added x() and y() functions which return
8364 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
8365 function which is needed to see if we have a locking inset of some
8366 type in this inset (needed for now in insettabular).
8368 * src/vspace.C (inPixels): the same function also without a BufferView
8369 parameter as so it is easier to use it in some ocasions.
8371 * src/lyxfunc.C: changed all places where insertInset was used so
8372 that now if it couldn't be inserted it is deleted!
8374 * src/TabularLayout.C:
8375 * src/TableLayout.C: added support for new tabular-inset!
8377 * src/BufferView2.C (insertInset): this now returns a bool if the
8378 inset was really inserted!!!
8380 * src/tabular.C (GetLastCellInRow):
8381 (GetFirstCellInRow): new helper functions.
8382 (Latex): implemented for new tabular class.
8386 (TeXTopHLine): new Latex() helper functions.
8388 2000-05-12 Juergen Vigna <jug@sad.it>
8390 * src/mathed/formulamacro.C (Read):
8391 * src/mathed/formula.C (Read): read also the \end_inset here!
8393 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
8395 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
8396 crush when saving formulae with unbalanced parenthesis.
8398 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
8400 * src/layout.C: Add new keyword "endlabelstring" to layout file
8402 * src/text.C (GetVisibleRow): Draw endlabel string.
8404 * lib/layouts/broadway.layout
8405 * lib/layouts/hollywood.layout: Added endlabel for the
8406 Parenthetical layout.
8408 * lib/layouts/heb-article.layout: Do not use slanted font shape
8409 for Theorem like environments.
8411 * src/buffer.C (makeLaTeXFile): Always add "american" to
8412 the UsedLanguages list if document language is RTL.
8414 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8416 * add addendum to README.OS2 and small patch (from SMiyata)
8418 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8420 * many files: correct the calls to ChangeExtension().
8422 * src/support/filetools.C (ChangeExtension): remove the no_path
8423 argument, which does not belong there. Use OnlyFileName() instead.
8425 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
8426 files when LaTeXing a non-nice latex file.
8428 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
8429 a chain of "if". Return false when deadkeys are not handled.
8431 * src/lyx_main.C (LyX): adapted the code for default bindings.
8433 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
8434 bindings for basic functionality (except deadkeys).
8435 (deadKeyBindings): new method. Performs the bindings of deadkeys.
8437 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
8438 several methods: handle override_x_deadkeys.
8440 * src/lyxrc.h: remove the "bindings" map, which did not make much
8441 sense anyway. New variable override_x_deadkeys, defaulting to "true".
8443 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8445 * src/lyxfont.C (stateText): use a saner method to determine
8446 whether the font is "default". Seems to fix the crash with DEC
8449 * src/Bullet.[Ch] (Bullet): remove const on parameters.
8451 2000-05-08 Juergen Vigna <jug@sad.it>
8453 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
8454 TabularLayoutMenu with mouse-button-3
8455 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
8457 * src/TabularLayout.C: added this file for having a Layout for
8460 2000-05-05 Juergen Vigna <jug@sad.it>
8462 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
8463 recalculating inset-widths.
8464 (TabularFeatures): activated this function so that I can change
8465 tabular-features via menu.
8467 * src/menus.C (ShowEditMenu): inserted support for insettabular so
8468 that I can test some functions with the Table menu.
8470 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8472 * src/lyxfont.C (stateText): guard against stupid c++libs.
8474 * src/tabular.C: add using std::vector
8475 some whitespace changes, + removed som autogenerated code.
8477 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
8479 2000-05-05 Juergen Vigna <jug@sad.it>
8481 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
8482 row, columns and cellstructures.
8484 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8486 * lib/lyxrc.example: remove obsolete entries.
8488 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
8489 reading of protected_separator for free_spacing.
8491 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8493 * src/text.C (draw): do not display an exclamation mark in the
8494 margin for margin notes. This is confusing, ugly and
8497 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
8498 AMS math' is checked.
8500 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
8501 name to see whether including the amsmath package is needed.
8503 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
8505 * src/paragraph.C (validate): Compute UsedLanguages correctly
8506 (don't insert the american language if it doesn't appear in the
8509 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
8510 The argument of \thanks{} command is considered moving argument
8512 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
8515 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
8517 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
8518 for appendix/minipage/depth. The lines can be now both in the footnote
8519 frame, and outside the frame.
8521 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
8524 2000-05-05 Juergen Vigna <jug@sad.it>
8526 * src/table.[Ch]: removed the inset and buffer stuff as this is now
8527 neede only in tabular.[Ch].
8529 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8531 * src/insets/insetspecialchar.C (Read): allow command == '~' for
8533 (Write): write '~' for PROTECTED_SEPARATOR
8535 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8537 * src/lyxparagraph.h: add a friend struct matchIT after the struct
8540 * src/mathed/formula.C (drawStr): rename size to siz.
8542 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
8543 possibly fix a bug by not changing the pflags = flags to piflags =
8546 2000-05-05 Juergen Vigna <jug@sad.it>
8548 * src/insets/insetbib.C: moved using directive
8550 * src/ImportNoweb.C: small fix for being able to compile (missing
8553 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8555 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
8556 to use clear, since we don't depend on this in the code. Add test
8559 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8561 * (various *.C files): add using std::foo directives to please dec
8564 * replace calls to string::clear() to string::erase() (Angus)
8566 * src/cheaders/cmath: modified to provide std::abs.
8568 2000-05-04 Juergen Vigna <jug@sad.it>
8570 * src/insets/insettext.C: Prepared all for inserting of multiple
8571 paragraphs. Still display stuff to do (alignment and other things),
8572 but I would like to use LyXText to do this when we cleaned out the
8573 table-support stuff.
8575 * src/insets/insettabular.C: Changed lot of stuff and added lots
8576 of functionality still a lot to do.
8578 * src/tabular.C: Various functions changed name and moved to be
8579 const functions. Added new Read and Write functions and changed
8580 lots of things so it works good with tabular-insets (also removed
8581 some stuff which is not needed anymore * hacks *).
8583 * src/lyxcursor.h: added operators == and != which just look if
8584 par and pos are (not) equal.
8586 * src/buffer.C (latexParagraphs): inserted this function to latex
8587 all paragraphs form par to endpar as then I can use this too for
8590 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
8591 so that I can call this to from text insets with their own cursor.
8593 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
8594 output off all paragraphs (because of the fix below)!
8596 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
8597 the very last paragraph (this could be also the last paragraph of an
8600 * src/texrow.h: added rows() call which returns the count-variable.
8602 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
8604 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
8606 * lib/configure.m4: better autodetection of DocBook tools.
8608 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8610 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
8612 * src/lyx_cb.C: add using std::reverse;
8614 * src/LaTeX.C (run): on error always run deleteFilesOnError before
8617 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
8618 selected files. Should fix repeated errors from generated files.
8620 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
8622 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
8624 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
8625 the spellchecker popup.
8627 * lib/lyxrc.example: Removed the \number_inset section
8629 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8631 * src/insets/figinset.C (various): Use IsFileReadable() to make
8632 sure that the file actually exist. Relying on ghostscripts errors
8633 is a bad idea since they can lead to X server crashes.
8635 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
8637 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
8640 * lib/lyxrc.example: smallish typo in description of
8641 \view_dvi_paper_option
8643 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8646 * src/lyxfunc.C: doImportHelper to factor out common code of the
8647 various import methods. New functions doImportASCIIasLines,
8648 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
8649 doImportLinuxDoc for the format specific parts.
8652 * buffer.C: Dispatch returns now a bool to indicate success
8655 * lyx_gui.C: Add getLyXView() for member access
8657 * lyx_main.C: Change logic for batch commands: First try
8658 Buffer::Dispatch (possibly without GUI), if that fails, use
8661 * lyx_main.C: Add support for --import command line switch.
8662 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
8663 Available Formats: Everything accepted by 'buffer-import <format>'
8665 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8667 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
8670 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
8671 documents will be reformatted upon reentry.
8673 2000-04-27 Juergen Vigna <jug@sad.it>
8675 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
8676 correctly only last pos this was a bug.
8678 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8680 * release of lyx-1.1.5pre1
8682 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8684 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
8686 * src/menus.C: revert the change of naming (Figure->Graphic...)
8687 from 2000-04-11. It was incomplete and bad.
8689 * src/LColor.[Ch]: add LColor::depthbar.
8690 * src/text.C (GetVisibleRow): use it.
8692 * README: update the languages list.
8694 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8696 * src/text.C (GetVisibleRow): show the depth of paragraphs using
8699 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8701 * README: remove sections that were just wrong.
8703 * src/text2.C (GetRowNearY): remove currentrow code
8705 * src/text.C (GetRow): remove currentrow code
8707 * src/screen.C (Update): rewritten a bit.
8708 (SmallUpdate): removed func
8710 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
8712 (FullRebreak): return bool
8713 (currentrow): remove var
8714 (currentrow_y): ditto
8716 * src/lyxscreen.h (Draw): change arg to unsigned long
8717 (FitCursor): return bool
8718 (FitManualCursor): ditto
8719 (Smallpdate): remove func
8720 (first): change to unsigned long
8721 (DrawOneRow): change second arg to long (from long &)
8722 (screen_refresh_y): remove var
8723 (scree_refresh_row): ditto
8725 * src/lyxrow.h: change baseline to usigned int from unsigned
8726 short, this brings some implicit/unsigned issues out in the open.
8728 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
8730 (Dispatch): don't call updateScrollbar after fitCursor. Use update
8731 instead of smallUpdate.
8733 * src/lyxcursor.h: change y to unsigned long
8735 * src/buffer.h: don't call updateScrollbar after fitcursor
8737 * src/buffer.C (parseSingleLyXformat2Token): move variables to
8738 where they are used. Removed "\\direction", this was not present
8739 in 1.1.4 and is already obsolete. Commented out some code that I
8740 believe to never be called.
8741 (runLiterate): don't call updateScrollbar after fitCursor
8743 (buildProgram): ditto
8746 * src/WorkArea.h (workWidth): change return val to unsigned
8749 (redraw): remove the button redraws
8750 (setScrollbarValue): change for scrollbar
8751 (getScrollbarValue): change for scrollbar
8752 (getScrollbarBounds): change for scrollbar
8754 * src/WorkArea.C (C_WorkArea_up_cb): removed func
8755 (C_WorkArea_down_cb): removed func
8756 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
8757 (resize): change for scrollbar
8758 (setScrollbar): ditto
8759 (setScrollbarBounds): ditto
8760 (setScrollbarIncrements): ditto
8761 (up_cb): removed func
8762 (down_cb): removed func
8763 (scroll_cb): change for scrollbar
8764 (work_area_handler): ditto
8766 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
8767 when FitCursor did something.
8768 (updateScrollbar): some unsigned changes
8769 (downCB): removed func
8770 (scrollUpOnePage): removed func
8771 (scrollDownOnePage): remvoed func
8772 (workAreaMotionNotify): don't call screen->FitCursor but use
8773 fitCursor instead. and bool return val
8774 (workAreaButtonPress): ditto
8775 (workAreaButtonRelease): some unsigned changes
8776 (checkInsetHit): ditto
8777 (workAreaExpose): ditto
8778 (update): parts rewritten, comments about the signed char arg added
8779 (smallUpdate): removed func
8780 (cursorPrevious): call needed updateScrollbar
8783 * src/BufferView2.C (allFloats): don't call updateScrollbar after
8786 * src/BufferView.[Ch] (upCB): removed func
8787 (downCB): removed func
8788 (smallUpdate): removed func
8790 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8792 * src/lyxtext.h src/text.C src/text2.C: removed support for the
8793 currentrow, currentrow_y optimization. This did not help a lot and
8794 if we want to do this kind of optimization we should rather use
8795 cursor.row instead of the currentrow.
8797 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
8798 buffer spacing and klyx spacing support.
8800 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8802 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
8805 2000-04-26 Juergen Vigna <jug@sad.it>
8807 * src/insets/figinset.C: fixes to Lars sstream changes!
8809 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
8811 * A lot of files: Added Ascii(ostream &) methods to all inset
8812 classes. Used when exporting to ASCII.
8814 * src/buffer.C (writeFileAscii,RoffAsciiTable)
8815 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
8818 * src/text2.C (ToggleFree): Disabled implicit word selection when
8819 there is a change in the language
8821 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
8822 no output was generated for end-of-sentence inset.
8824 * src/insets/lyxinset.h
8827 * src/paragraph.C: Removed the insetnumber code
8829 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
8831 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8833 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
8834 no_babel and no_epsfig completely from the file.
8835 (parseSingleLyXformat2Token): add handling for per-paragraph
8836 spacing as written by klyx.
8838 * src/insets/figinset.C: applied patch by Andre. Made it work with
8841 2000-04-20 Juergen Vigna <jug@sad.it>
8843 * src/insets/insettext.C (cutSelection):
8844 (copySelection): Fixed with selection from right to left.
8845 (draw): now the rows are not recalculated at every draw.
8846 (computeTextRows): for now reset the inset-owner here (this is
8847 important for an undo or copy where the inset-owner is not set
8850 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
8851 motion to the_locking_inset screen->first was forgotten, this was
8852 not important till we got multiline insets.
8854 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8856 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
8857 code seems to be alright (it is code changed by Dekel, and the
8858 intent is indeed that all macros should be defined \protect'ed)
8860 * NEWS: a bit of reorganisation of the new user-visible features.
8862 2000-04-19 Juergen Vigna <jug@sad.it>
8864 * src/insets/insettext.C (init): using a LyXCursor now for cursor
8865 position. Set the inset_owner of the used paragraph so that it knows
8866 that it is inside an inset. Fixed cursor handling with mouse and
8867 cursor keys. Fixed wrong timed inset redraws and lots of other changes
8868 and cleanups to make TextInsets work better.
8870 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
8871 Changed parameters of various functions and added LockInsetInInset().
8873 * src/insets/insettext.C:
8875 * src/insets/insetcollapsable.h:
8876 * src/insets/insetcollapsable.C:
8877 * src/insets/insetfoot.h:
8878 * src/insets/insetfoot.C:
8879 * src/insets/insetert.h:
8880 * src/insets/insetert.C: cleaned up the code so that it works now
8881 correctly with insettext.
8883 * src/insets/inset.C:
8884 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
8885 that insets in insets are supported right.
8888 * src/table.C: lots of changes for use with inset tabular (and cleanup)
8890 * src/paragraph.C: some small fixes
8892 * src/debug.h: inserted INSETS debug info
8894 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8895 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8897 * src/commandtags.h:
8898 * src/LyXAction.C: insert code for InsetTabular.
8900 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8901 not Button1MotionMask.
8902 (workAreaButtonRelease): send always a InsetButtonRelease event to
8904 (checkInsetHit): some setCursor fixes (always with insets).
8906 * src/BufferView2.C (lockInset): returns a bool now and extended for
8907 locking insets inside insets.
8908 (showLockedInsetCursor): it is important to have the cursor always
8909 before the locked inset.
8910 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8912 * src/BufferView.h: made lockInset return a bool.
8914 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8916 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8917 that is used also internally but can be called as public to have back
8918 a cursor pos which is not set internally.
8919 (SetCursorIntern): Changed to use above function.
8921 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8923 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8928 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8929 patches for things that should be in or should be changed.
8931 * src/* [insetfiles]: change "usigned char fragile" to bool
8932 fragile. There was only one point that could that be questioned
8933 and that is commented in formulamacro.C. Grep for "CHECK".
8935 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8936 (DeleteBuffer): take it out of CutAndPaste and make it static.
8938 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8940 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8941 output the spacing envir commands. Also the new commands used in
8942 the LaTeX output makes the result better.
8944 * src/Spacing.C (writeEnvirBegin): new method
8945 (writeEnvirEnd): new method
8947 2000-04-18 Juergen Vigna <jug@sad.it>
8949 * src/CutAndPaste.C: made textclass a static member of the class
8950 as otherwise it is not accesed right!!!
8952 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8954 * forms/layout_forms.fd
8955 * src/layout_forms.h
8956 * src/layout_forms.C (create_form_form_character)
8957 * src/lyx_cb.C (UserFreeFont)
8958 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8959 documents (in the layout->character popup).
8961 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8963 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8964 \spell_command was in fact not honored (from Kevin Atkinson).
8966 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8969 * src/lyx_gui.h: make lyxViews private (Angus)
8971 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8973 * src/mathed/math_write.C
8974 (MathMatrixInset::Write) Put \protect before \begin{array} and
8975 \end{array} if fragile
8976 (MathParInset::Write): Put \protect before \\ if fragile
8978 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8980 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8981 initialization if the LyXColorHandler must be done after the
8982 connections to the XServer has been established.
8984 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8985 get the background pixel from the lyxColorhandler so that the
8986 figures are rendered with the correct background color.
8987 (NextToken): removed functions.
8988 (GetPSSizes): use ifs >> string instead of NextToken.
8990 * src/Painter.[Ch]: the color cache moved out of this file.
8992 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8995 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8997 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8998 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
9000 * src/BufferView.C (enterView): new func
9001 (leaveView): new func
9003 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
9005 (leaveView): new func, undefines xterm cursor when approp.
9007 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
9008 (AllowInput): delete the Workarea cursor handling from this func.
9010 * src/Painter.C (underline): draw a slimer underline in most cases.
9012 * src/lyx_main.C (error_handler): use extern "C"
9014 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9016 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
9017 sent directly to me.
9019 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
9020 to the list by Dekel.
9022 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
9025 * src/bufferview_funcs.[Ch]: two new files, moved several of the
9026 methods from lyx_cb.here.
9028 * src/lyx_cb.C: in addition to the above; removed input_prohibited
9031 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9033 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
9034 instead of using current_view directly.
9036 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
9038 * src/LyXAction.C (init): add the paragraph-spacing command.
9040 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
9042 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
9044 * src/lyx_cb.C (CurrentState): output a string when the spacing is
9045 different from the documents.
9047 * src/text.C (SetHeightOfRow): take paragraph spacing into
9048 account, paragraph spacing takes precedence over buffer spacing
9049 (GetVisibleRow): ditto
9051 * src/paragraph.C (writeFile): output the spacing parameter too.
9052 (validate): set the correct features if spacing is used in the
9054 (Clear): set spacing to default
9055 (MakeSameLayout): spacing too
9056 (HasSameLayout): spacing too
9057 (SetLayout): spacing too
9058 (TeXOnePar): output the spacing commands
9060 * src/lyxparagraph.h: added a spacing variable for use with
9061 per-paragraph spacing.
9063 * src/Spacing.h: add a Default spacing and a method to check if
9064 the current spacing is default. also added an operator==
9066 * src/text2.C (DeleteEmptyParagraphMechanism): added a
9069 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9071 * src/lyxserver.C (callback): fix dispatch of functions
9073 * src/insets/insetlatexaccent.C (checkContents): turn bogus
9074 printf() into lyxerr call.
9076 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
9079 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
9080 "Table" to "Table Box", "Float" to "Floating Material"; deletes
9081 the "Float" from each of the subitems.
9082 (ShowHelpMenu): add entry for "FAQ" and "TOC".
9084 * src/support/DebugStream.h: add an #ifdef to work around a gcc
9085 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
9086 documented the change so that the workaround can be nuked later.
9088 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
9091 * src/lyxlex_pimpl.C (next): do not re-declare the default value
9093 * src/buffer.C (getLatexName): ditto
9094 (setReadonly): ditto
9096 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9098 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
9099 avoid some uses of current_view. Added also a bufferParams()
9100 method to get at this.
9102 * src/lyxtext.h: changed params->buffer and paramters->bparams.
9104 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9106 * src/lyxparagraph.[Ch]: removed
9107 operator<(LyXParagraph::InsetTable..., added a struct matchIT
9108 with operators used by lower_bound and
9109 upper_bound in InsetTable's
9110 Make struct InsetTable private again. Used matchpos.
9112 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
9114 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
9115 document, the language of existing text is changed (unless the
9116 document is multi-lingual)
9118 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
9120 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
9122 * A lot of files: A rewrite of the Right-to-Left support.
9124 2000-04-10 Juergen Vigna <jug@sad.it>
9126 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
9127 misplaced cursor when inset in inset is locked.
9129 * src/insets/insettext.C (LocalDispatch): small fix so that a
9130 BREAKLINE is not inserted if we don't permit it with autBreakRows.
9132 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
9133 footnote font should be decreased in size twice when displaying.
9135 * src/insets/insettext.C (GetDrawFont): inserted this function as
9136 the drawing-font may differ from the real paragraph font.
9138 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
9139 insets (inset in inset!).
9141 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
9142 function here because we don't want footnotes inside footnotes.
9144 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
9146 (init): now set the inset_owner in paragraph.C
9147 (LocalDispatch): added some resetPos() in the right position
9150 (pasteSelection): changed to use the new CutAndPaste-Class.
9152 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
9153 which tells if it is allowed to insert another inset inside this one.
9155 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
9156 SwitchLayoutsBetweenClasses.
9158 * src/text2.C (InsertInset): checking of the new paragraph-function
9160 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
9161 is not needed anymore here!
9164 (PasteSelection): redone (also with #ifdef) so that now this uses
9165 the CutAndPaste-Class.
9166 (SwitchLayoutsBetweenClasses): removed here and implemented in the
9169 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
9170 from/to text/insets.
9172 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
9173 so that the paragraph knows if it is inside an (text)-inset.
9174 (InsertFromMinibuffer): changed return-value to bool as now it
9175 may happen that an inset is not inserted in the paragraph.
9176 (InsertInsetAllowed): this checks if it is allowed to insert an
9177 inset in this paragraph.
9179 (BreakParagraphConservative):
9180 (BreakParagraph) : small change for the above change of the return
9181 value of InsertFromMinibuffer.
9183 * src/lyxparagraph.h: added inset_owner and the functions to handle
9184 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
9186 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9188 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
9189 functions from BufferView to BufferView::Pimpl to ease maintence.
9191 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
9192 correctly. Also use SetCursorIntern instead of SetCursor.
9194 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
9197 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9199 * src/WorkArea.C (belowMouse): manually implement below mouse.
9201 * src/*: Add "explicit" on several constructors, I added probably
9202 some unneeded ones. A couple of changes to code because of this.
9204 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
9205 implementation and private parts from the users of BufferView. Not
9208 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
9209 implementation and private parts from the users of LyXLex. Not
9212 * src/BufferView_pimpl.[Ch]: new files
9214 * src/lyxlex_pimpl.[Ch]: new files
9216 * src/LyXView.[Ch]: some inline functions move out-of-line
9218 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9220 * src/lyxparagraph.h: make struct InsetTable public.
9222 * src/support/lyxstring.h: change lyxstring::difference_type to be
9223 ptrdiff_t. Add std:: modifiers to streams.
9225 * src/font.C: include the <cctype> header, for islower() and
9228 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9230 * src/font.[Ch]: new files. Contains the metric functions for
9231 fonts, takes a LyXFont as parameter. Better separation of concepts.
9233 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
9234 changes because of this.
9236 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
9238 * src/*: compile with -Winline and move functions that don't
9241 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
9244 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9246 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
9247 (various files changed because of this)
9249 * src/Painter.C (text): fixed the drawing of smallcaps.
9251 * src/lyxfont.[Ch] (drawText): removed unused member func.
9254 * src/*.C: added needed "using" statements and "std::" qualifiers.
9256 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
9258 * src/*.h: removed all use of "using" from header files use
9259 qualifier std:: instead.
9261 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9263 * src/text.C (Backspace): some additional cleanups (we already
9264 know whether cursor.pos is 0 or not).
9266 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
9267 automake does not provide one).
9269 * src/bmtable.h: replace C++ comments with C comments.
9271 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
9273 * src/screen.C (ShowCursor): Change the shape of the cursor if
9274 the current language is not equal to the language of the document.
9275 (If the cursor change its shape unexpectedly, then you've found a bug)
9277 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
9280 * src/insets/insetnumber.[Ch]: New files.
9282 * src/LyXAction.C (init)
9283 * src/lyxfunc.C (dispatch): Add command number-inset-insert
9286 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
9288 * src/lyxparagraph.h
9289 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
9290 (the vector is kept sorted).
9292 * src/text.C (GetVisibleRow): Draw selection correctly when there
9293 is both LTR and RTL text.
9295 * src/paragraph.C (Clone): Use the assignment operator for cloning,
9296 which is much faster.
9298 * src/text.C (GetVisibleRow and other): Do not draw the last space
9299 in a row if the direction of the last letter is not equal to the
9300 direction of the paragraph.
9302 * src/lyxfont.C (latexWriteStartChanges):
9303 Check that font language is not equal to basefont language.
9304 (latexWriteEndChanges): ditto
9306 * src/lyx_cb.C (StyleReset): Don't change the language while using
9307 the font-default command.
9309 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
9310 empty paragraph before a footnote.
9312 * src/insets/insetcommand.C (draw): Increase x correctly.
9314 * src/screen.C (ShowCursor): Change cursor shape if
9315 current language != document language.
9317 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
9319 2000-03-31 Juergen Vigna <jug@sad.it>
9321 * src/paragraph.C (GetInset): commented out text[pos] = ' '
9322 (Clone): changed mode how the paragraph-data is copied to the
9323 new clone-paragraph.
9325 * src/lyxfunc.C (Dispatch): fixed small problem when calling
9326 GetInset(pos) with no inset anymore there (in inset UNDO)
9328 * src/insets/insetcommand.C (draw): small fix as here x is
9329 incremented not as much as width() returns (2 before, 2 behind = 4)
9331 2000-03-30 Juergen Vigna <jug@sad.it>
9333 * src/insets/insettext.C (InsetText): small fix in initialize
9334 widthOffset (should not be done in the init() function)
9336 2000-03-29 Amir Karger <karger@lyx.org>
9338 * lib/examples/it_ItemizeBullets.lyx: translation by
9341 * Implemented \textasciitilde and fixed a tiny bug in reLyX
9343 2000-03-29 Juergen Vigna <jug@sad.it>
9345 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
9347 * src/insets/insetfoot.C (Clone): small change as for the below
9348 new init function in the text-inset
9350 * src/insets/insettext.C (init): new function as I've seen that
9351 clone did not copy the Paragraph-Data!
9352 (LocalDispatch): Added code so that now we have some sort of Undo
9353 functionality (well actually we HAVE Undo ;)
9355 * src/text.C (Backspace): Small fix for the a | a Backspace problem
9357 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
9359 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
9362 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9364 * src/main.C: added a runtime check that verifies that the xforms
9365 header used when building LyX and the library used when running
9366 LyX match. Exit with a message if they don't match. This is a
9367 version number check only.
9369 * src/buffer.C (save): Don't allocate memory on the heap for
9370 struct utimbuf times.
9372 * *: some using changes, use iosfwd instead of the real headers.
9374 * src/lyxfont.C use char const * instead of string for the static
9375 strings. Rewrite some functions to use sstream.
9377 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9379 * src/text.C (Backspace): hopefully fix the dreaded backaspace
9382 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9384 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
9385 of Geodesy (from Martin Vermeer)
9387 * lib/layouts/svjour.inc: include file for the Springer svjour
9388 class. It can be used to support journals other than JoG.
9390 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
9391 Miskiewicz <misiek@pld.org.pl>)
9392 * lib/reLyX/Makefile.am: ditto.
9394 2000-03-27 Juergen Vigna <jug@sad.it>
9396 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
9397 also some modifications with operations on selected text.
9399 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
9400 problems with clicking on insets (last famous words ;)
9402 * src/insets/insetcommand.C (draw):
9403 (width): Changed to have a bit of space before and after the inset so
9404 that the blinking cursor can be seen (otherwise it was hidden)
9406 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9408 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
9409 would not be added to the link list when an installed gettext (not
9410 part of libc) is found.
9412 2000-03-24 Juergen Vigna <jug@sad.it>
9414 * src/insets/insetcollapsable.C (Edit):
9415 * src/mathed/formula.C (InsetButtonRelease):
9416 (InsetButtonPress): fixed for new handling of ButtonPress/Release
9419 * src/BufferView.C (workAreaButtonPress):
9420 (workAreaButtonRelease):
9421 (checkInsetHit): Finally fixed the clicking on insets be handled
9424 * src/insets/insetert.C (Edit): inserted this call so that ERT
9425 insets work always with LaTeX-font
9427 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9429 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
9430 caused lyx to startup with no GUI in place, causing in a crash
9431 upon startup when called with arguments.
9433 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9435 * src/FontLoader.C: better initialization of dummyXFontStruct.
9437 2000-03-20 José Abílio Matos <jamatos@lyx.org>
9439 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
9440 for linuxdoc and docbook import and export format options.
9442 * lib/lyxrc.example Example of default values for the previous flags.
9444 * src/lyx_cb.C Use those flags instead of the hardwired values for
9445 linuxdoc and docbook export.
9447 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
9450 * src/menus.C Added menus entries for the new import/exports formats.
9452 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9454 * src/lyxrc.*: Added support for running without Gui
9457 * src/FontLoader.C: sensible defaults if no fonts are needed
9459 * src/lyx_cb.C: New function ShowMessage (writes either to the
9460 minibuffer or cout in case of no gui
9461 New function AskOverwrite for common stuff
9462 Consequently various changes to call these functions
9464 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
9465 wild guess at sensible screen resolution when having no gui
9467 * src/lyxfont.C: no gui, no fonts... set some defaults
9469 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9471 * src/LColor.C: made the command inset background a bit lighter.
9473 2000-03-20 Hartmut Goebel <goebel@noris.net>
9475 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
9476 stdstruct.inc. Koma-Script added some title elements which
9477 otherwise have been listed below "bibliography". This split allows
9478 adding title elements to where they belong.
9480 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
9481 define the additional title elements and then include
9484 * many other layout files: changed to include stdtitle.inc just
9485 before stdstruct.inc.
9487 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
9489 * src/buffer.C: (save) Added the option to store all backup files
9490 in a single directory
9492 * src/lyxrc.[Ch]: Added variable \backupdir_path
9494 * lib/lyxrc.example: Added descriptions of recently added variables
9496 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
9497 bibtex inset, not closing the bibtex popup when deleting the inset)
9499 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9501 * src/lyx_cb.C: add a couple using directives.
9503 2000-03-17 José Abílio Matos <jamatos@lyx.org>
9504 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
9505 import based on the filename.
9507 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
9508 file would be imported at start, if the filename where of a sgml file.
9510 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
9512 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
9514 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
9515 * src/lyxfont.h Replaced the member variable bits.direction by the
9516 member variable lang. Made many changes in other files.
9517 This allows having a multi-lingual document
9519 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
9520 that change the current language to <l>.
9521 Removed the command "font-rtl"
9523 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
9524 format for Hebrew documents)
9526 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
9527 When auto_mathmode is "true", pressing a digit key in normal mode
9528 will cause entering into mathmode.
9529 If auto_mathmode is "rtl" then this behavior will be active only
9530 when writing right-to-left text.
9532 * src/text2.C (InsertStringA) The string is inserted using the
9535 * src/paragraph.C (GetEndLabel) Gives a correct result for
9536 footnote paragraphs.
9538 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
9540 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9542 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
9543 front of PasteParagraph. Never insert a ' '. This should at least
9544 fix some cause for the segfaults that we have been experiencing,
9545 it also fixes backspace behaviour slightly. (Phu!)
9547 * src/support/lstrings.C (compare_no_case): some change to make it
9548 compile with gcc 2.95.2 and stdlibc++-v3
9550 * src/text2.C (MeltFootnoteEnvironment): change type o
9551 first_footnote_par_is_not_empty to bool.
9553 * src/lyxparagraph.h: make text private. Changes in other files
9555 (fitToSize): new function
9556 (setContentsFromPar): new function
9557 (clearContents): new function
9558 (SetChar): new function
9560 * src/paragraph.C (readSimpleWholeFile): deleted.
9562 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
9563 the file, just use a simple string instead. Also read the file in
9564 a more maintainable manner.
9566 * src/text2.C (InsertStringA): deleted.
9567 (InsertStringB): deleted.
9569 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9571 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
9572 RedoParagraphs from the doublespace handling part, just set status
9573 to NEED_MORE_REFRESH. Also don't update cursor position (should be
9574 done, but perhaps not like this.)
9576 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9578 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
9579 character when inserting an inset.
9581 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9583 * src/bufferparams.C (readLanguage): now takes "default" into
9586 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
9587 also initialize the toplevel_keymap with the default bindings from
9590 * src/buffer.C (Buffer): remove lyxrc from the parameters.
9592 * all files using lyxrc: have lyxrc as a real variable and not a
9593 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
9596 * src/lyxrc.C: remove double call to defaultKeyBindings
9598 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
9599 toolbar defauls using lyxlex. Remove enums, structs, functions
9602 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
9603 toolbar defaults. Also store default keybindings in a map.
9605 * src/ToolbarDefaults.[Ch]: New file. This class is used for
9606 storing the toolbar defaults without any xforms dependencies.
9608 * src/insets/figinset.C: patch posted to list by Andre Poenitz
9609 applied. Changed to use iterators.
9611 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9613 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
9614 systems that don't have LINGUAS set to begin with.
9616 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9618 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
9619 the list by Dekel Tsur.
9621 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9623 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
9624 * src/insets/form_graphics.C: ditto.
9626 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
9628 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9630 * src/bufferparams.C (readLanguage): use the new language map
9632 * src/intl.C (InitKeyMapper): use the new language map
9634 * src/lyx_gui.C (create_forms): use the new language map
9636 * src/language.[Ch]: New files. Used for holding the information
9637 about each language. Now! Use this new language map enhance it and
9638 make it really usable for our needs.
9640 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
9642 * screen.C (ShowCursor): Removed duplicate code.
9643 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
9644 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
9646 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
9649 * src/text.C Added TransformChar method. Used for rendering Arabic
9650 text correctly (change the glyphs of the letter according to the
9651 position in the word)
9656 * src/lyxrc.C Added lyxrc command {language_command_begin,
9657 language_command_end,language_command_ltr,language_command_rtl,
9658 language_package} which allows the use of either arabtex or Omega
9661 * src/lyx_gui.C (init)
9663 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
9664 to use encoding for menu fonts which is different than the encoding
9667 * src/buffer.C (makeLaTeXFile): If params.language = "default",
9668 do not load the babel package.
9669 To write an English document with Hebrew/Arabic, change the document
9670 language to "english".
9672 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
9673 (alphaCounter): changed to return char
9674 (loweralphaCounter, hebrewCounter, romanCounter): New functions
9676 * lib/lyxrc.example Added examples for Hebrew/Arabic
9679 * src/layout.C Added layout command endlabeltype
9681 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
9683 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
9685 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9687 * src/mathed/math_delim.C (search_deco): return a
9688 math_deco_struct* instead of index.
9690 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9692 * All files with a USE_OSTREAM_ONLY within: removed all code that
9693 was unused when USE_OSTREAM_ONLY is defined.
9695 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
9696 of any less. Removed header and using.
9698 * src/text.C (GetVisibleRow): draw the string "Page Break
9699 (top/bottom)" on screen when drawing a pagebreak line.
9701 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9703 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
9705 * src/mathed/math_macro.C (draw): do some cast magic.
9708 * src/mathed/math_defs.h: change byte* argument to byte const*.
9710 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
9712 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
9713 know it is right to return InsetFoot* too, but cxx does not like
9716 * src/insets/insetcollapsable.[Ch] (Clone): make const.
9718 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
9720 * src/mathed/math_delim.C: change == to proper assignment.
9722 2000-03-09 Juergen Vigna <jug@sad.it>
9724 * src/insets/insettext.C (setPos): fixed various cursor positioning
9725 problems (via mouse and cursor-keys)
9726 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
9727 inset (still a small display problem but it works ;)
9729 * src/insets/insetcollapsable.C (draw): added button_top_y and
9730 button_bottom_y to have correct values for clicking on the inset.
9732 * src/support/lyxalgo.h: commented out 'using std::less'
9734 2000-03-08 Juergen Vigna <jug@sad.it>
9736 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
9737 Button-Release event closes as it is alos the Release-Event
9740 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
9742 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9744 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
9745 can add multiple spaces in Scrap (literate programming) styles...
9746 which, by the way, is how I got hooked on LyX to begin with.
9748 * src/mathed/formula.C (Write): Added dummy variable to an
9749 inset::Latex() call.
9750 (Latex): Add free_spacing boolean to inset::Latex()
9752 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
9754 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
9755 virtual function to include the free_spacing boolean from
9756 the containing paragraph's style.
9758 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
9759 Added free_spacing boolean arg to match inset.h
9761 * src/insets/insettext.C, src/insets/insettext.h (Latex):
9762 Added free_spacing boolean arg to match inset.h
9764 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
9765 Added free_spacing boolean and made sure that if in a free_spacing
9766 paragraph, that we output normal space if there is a protected space.
9768 * src/insets/insetref.C, src/insets/insetref.h (Latex):
9769 Added free_spacing boolean arg to match inset.h
9771 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
9772 Added free_spacing boolean arg to match inset.h
9774 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
9775 Added free_spacing boolean arg to match inset.h
9777 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
9778 Added free_spacing boolean arg to match inset.h
9780 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
9781 Added free_spacing boolean arg to match inset.h
9783 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
9784 free_spacing boolean arg to match inset.h
9786 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
9787 Added free_spacing boolean arg to match inset.h
9789 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
9790 Added free_spacing boolean arg to match inset.h
9792 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
9793 Added free_spacing boolean arg to match inset.h
9795 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
9796 Added free_spacing boolean arg to match inset.h
9798 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
9799 Added free_spacing boolean arg to match inset.h
9801 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
9802 free_spacing boolean arg to match inset.h
9804 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
9805 free_spacing boolean arg to match inset.h
9807 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
9808 ignore free_spacing paragraphs. The user's spaces are left
9811 * src/text.C (InsertChar): Fixed the free_spacing layout
9812 attribute behavior. Now, if free_spacing is set, you can
9813 add multiple spaces in a paragraph with impunity (and they
9814 get output verbatim).
9815 (SelectSelectedWord): Added dummy argument to inset::Latex()
9818 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
9821 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
9822 paragraph layouts now only input a simple space instead.
9823 Special character insets don't make any sense in free-spacing
9826 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
9827 hard-spaces in the *input* file to simple spaces if the layout
9828 is free-spacing. This converts old files which had to have
9829 hard-spaces in free-spacing layouts where a simple space was
9831 (writeFileAscii): Added free_spacing check to pass to the newly
9832 reworked inset::Latex(...) methods. The inset::Latex() code
9833 ensures that hard-spaces in free-spacing paragraphs get output
9834 as spaces (rather than "~").
9836 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9838 * src/mathed/math_delim.C (draw): draw the empty placeholder
9839 delims with a onoffdash line.
9840 (struct math_deco_compare): struct that holds the "functors" used
9841 for the sort and the binary search in math_deco_table.
9842 (class init_deco_table): class used for initial sort of the
9844 (search_deco): use lower_bound to do a binary search in the
9847 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9849 * src/lyxrc.C: a small secret thingie...
9851 * src/lyxlex.C (printTable): changed to take a ostream as paramter
9852 and to not flush the stream as often as it used to.
9854 * src/support/lyxalgo.h: new file
9855 (sorted): template function used for checking if a sequence is
9856 sorted or not. Two versions with and without user supplied
9857 compare. Uses same compare as std::sort.
9859 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
9860 it and give warning on lyxerr.
9862 (struct compare_tags): struct with function operators used for
9863 checking if sorted, sorting and lower_bound.
9864 (search_kw): use lower_bound instead of manually implemented
9867 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9869 * src/insets/insetcollapsable.h: fix Clone() declaration.
9870 * src/insets/insetfoot.h: ditto.
9872 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
9874 2000-03-08 Juergen Vigna <jug@sad.it>
9876 * src/insets/lyxinset.h: added owner call which tells us if
9877 this inset is inside another inset. Changed also the return-type
9878 of Editable to an enum so it tells clearer what the return-value is.
9880 * src/insets/insettext.C (computeTextRows): fixed computing of
9881 textinsets which split automatically on more rows.
9883 * src/insets/insetert.[Ch]: changed this to be of BaseType
9886 * src/insets/insetfoot.[Ch]: added footnote inset
9888 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
9889 collapsable insets (like footnote, ert, ...)
9891 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9893 * src/lyxdraw.h: remvoe file
9895 * src/lyxdraw.C: remove file
9897 * src/insets/insettext.C: added <algorithm>.
9899 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9901 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9902 (matrix_cb): case MM_OK use string stream
9904 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9907 * src/mathed/math_macro.C (draw): use string stream
9908 (Metrics): use string stream
9910 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9911 directly to the ostream.
9913 * src/vspace.C (asString): use string stream.
9914 (asString): use string stream
9915 (asLatexString): use string stream
9917 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9918 setting Spacing::Other.
9920 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9921 sprintf when creating the stretch vale.
9923 * src/text2.C (alphaCounter): changed to return a string and to
9924 not use a static variable internally. Also fixed a one-off bug.
9925 (SetCounter): changed the drawing of the labels to use string
9926 streams instead of sprintf.
9928 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9929 manipulator to use a scheme that does not require library support.
9930 This is also the way it is done in the new GNU libstdc++. Should
9931 work with DEC cxx now.
9933 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9935 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9936 end. This fixes a bug.
9938 * src/mathed (all files concerned with file writing): apply the
9939 USE_OSTREAM_ONLY changes to mathed too.
9941 * src/support/DebugStream.h: make the constructor explicit.
9943 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9944 count and ostream squashed.
9946 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9948 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9950 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9951 ostringstream uses STL strings, and we might not.
9953 * src/insets/insetspecialchar.C: add using directive.
9954 * src/insets/insettext.C: ditto.
9956 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9958 * lib/layouts/seminar.layout: feeble attempt at a layout for
9959 seminar.cls, far from completet and could really use some looking
9960 at from people used to write layout files.
9962 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9963 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9964 a lot nicer and works nicely with ostreams.
9966 * src/mathed/formula.C (draw): a slightly different solution that
9967 the one posted to the list, but I think this one works too. (font
9968 size wrong in headers.)
9970 * src/insets/insettext.C (computeTextRows): some fiddling on
9971 Jürgens turf, added some comments that he should read.
9973 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9974 used and it gave compiler warnings.
9975 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9978 * src/lyx_gui.C (create_forms): do the right thing when
9979 show_banner is true/false.
9981 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9982 show_banner is false.
9984 * most file writing files: Now use iostreams to do almost all of
9985 the writing. Also instead of passing string &, we now use
9986 stringstreams. mathed output is still not adapted to iostreams.
9987 This change can be turned off by commenting out all the occurences
9988 of the "#define USE_OSTREAM_ONLY 1" lines.
9990 * src/WorkArea.C (createPixmap): don't output debug messages.
9991 (WorkArea): don't output debug messages.
9993 * lib/lyxrc.example: added a comment about the new variable
9996 * development/Code_rules/Rules: Added some more commente about how
9997 to build class interfaces and on how better encapsulation can be
10000 2000-03-03 Juergen Vigna <jug@sad.it>
10002 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
10003 automatically with the width of the LyX-Window
10005 * src/insets/insettext.C (computeTextRows): fixed update bug in
10006 displaying text-insets (scrollvalues where not initialized!)
10008 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10010 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
10011 id in the check of the result from lower_bound is not enough since
10012 lower_bound can return last too, and then res->id will not be a
10015 * all insets and some code that use them: I have conditionalized
10016 removed the Latex(string & out, ...) this means that only the
10017 Latex(ostream &, ...) will be used. This is a work in progress to
10018 move towards using streams for all output of files.
10020 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
10023 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10025 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
10026 routine (this fixes bug where greek letters were surrounded by too
10029 * src/support/filetools.C (findtexfile): change a bit the search
10030 algorithm, to fix bug introduced in 1.1.4. Note that --format is
10031 no longer passed to kpsewhich, we may have to change that later.
10033 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
10034 warning options to avoid problems with X header files (from Angus
10036 * acinclude.m4: regenerated.
10038 2000-03-02 Juergen Vigna <jug@sad.it>
10040 * src/insets/insettext.C (WriteParagraphData): Using the
10041 par->writeFile() function for writing paragraph-data.
10042 (Read): Using buffer->parseSingleLyXformat2Token()-function
10043 for parsing paragraph data!
10045 * src/buffer.C (readLyXformat2): removed all parse data and using
10046 the new parseSingleLyXformat2Token()-function.
10047 (parseSingleLyXformat2Token): added this function to parse (read)
10048 lyx-file-format (this is called also from text-insets now!)
10050 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10052 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
10055 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
10056 directly instead of going through a func. One very bad thing: a
10057 static LyXFindReplace, but I don't know where to place it.
10059 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
10060 string instead of char[]. Also changed to static.
10061 (GetSelectionOrWordAtCursor): changed to static inline
10062 (SetSelectionOverLenChars): ditto.
10064 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
10065 current_view and global variables. both classes has changed names
10066 and LyXFindReplace is not inherited from SearchForm.
10068 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
10069 fl_form_search form.
10071 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
10073 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10075 * lib/bind/*.bind: make sure 'buffer-previous' function is not
10076 bound (from Kayvan).
10078 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
10080 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
10082 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10084 * some things that I should comment but the local pub says head to
10087 * comment out all code that belongs to the Roff code for Ascii
10088 export of tables. (this is unused)
10090 * src/LyXView.C: use correct type for global variable
10091 current_layout. (LyXTextClass::size_type)
10093 * some code to get the new insetgraphics closer to working I'd be
10094 grateful for any help.
10096 * src/BufferView2.C (insertInset): use the return type of
10097 NumberOfLayout properly. (also changes in other files)
10099 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
10100 this as a test. I want to know what breaks because of this.
10102 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
10104 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10106 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
10107 to use a \makebox in the label, this allows proper justification
10108 with out using protected spaces or multiple hfills. Now it is
10109 "label" for left justified, "\hfill label\hfill" for center, and
10110 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
10111 should be changed accordingly.
10113 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10115 * src/lyxtext.h: change SetLayout() to take a
10116 LyXTextClass::size_type instead of a char (when there is more than
10117 127 layouts in a class); also change type of copylayouttype.
10118 * src/text2.C (SetLayout): ditto.
10119 * src/LyXView.C (updateLayoutChoice): ditto.
10121 * src/LaTeX.C (scanLogFile): errors where the line number was not
10122 given just after the '!'-line were ignored (from Dekel Tsur).
10124 * lib/lyxrc.example: fix description of \date_insert_format
10126 * lib/layouts/llncs.layout: new layout, contributed by Martin
10129 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10131 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
10132 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
10133 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
10134 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
10135 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
10136 paragraph.C, text.C, text2.C)
10138 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10140 * src/insets/insettext.C (LocalDispatch): remove extra break
10143 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
10144 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
10146 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
10147 * src/insets/insettext.[Ch] (GetCursorPos): ditto
10149 * src/insets/insetbib.h: move InsetBibkey::Holder and
10150 InsetCitation::Holder in public space.
10152 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10154 * src/insets/insettext.h: small change to get the new files from
10155 Juergen to compile (use "string", not "class string").
10157 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
10158 const & as parameter to LocalDispatch, use LyXFont const & as
10159 paramter to some other func. This also had impacto on lyxinsets.h
10160 and the two mathed insets.
10162 2000-02-24 Juergen Vigna <jug@sad.it>
10165 * src/commandtags.h:
10167 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
10171 * src/BufferView2.C: added/updated code for various inset-functions
10173 * src/insets/insetert.[Ch]: added implementation of InsetERT
10175 * src/insets/insettext.[Ch]: added implementation of InsetText
10177 * src/insets/inset.C (Edit): added "unsigned int button" parameter
10178 (draw): added preliminary code for inset scrolling not finshed yet
10180 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
10181 as it is in lyxfunc.C now
10183 * src/insets/lyxinset.h: Added functions for text-insets
10185 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10187 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
10188 BufferView and reimplement the list as a queue put inside its own
10191 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
10193 * several files: use the new interface to the "updateinsetlist"
10195 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
10197 (work_area_handler): call BufferView::trippleClick on trippleclick.
10199 * src/BufferView.C (doubleClick): new function, selects word on
10201 (trippleClick): new function, selects line on trippleclick.
10203 2000-02-22 Allan Rae <rae@lyx.org>
10205 * lib/bind/xemacs.bind: buffer-previous not supported
10207 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10209 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
10212 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10214 * src/bufferlist.C: get rid of current_view from this file
10216 * src/spellchecker.C: get rid of current_view from this file
10218 * src/vspace.C: get rid of current_view from this file
10219 (inPixels): added BufferView parameter for this func
10220 (asLatexCommand): added a BufferParams for this func
10222 * src/text.C src/text2.C: get rid of current_view from these
10225 * src/lyxfont.C (getFontDirection): move this function here from
10228 * src/bufferparams.C (getDocumentDirection): move this function
10231 * src/paragraph.C (getParDirection): move this function here from
10233 (getLetterDirection): ditto
10235 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
10237 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
10238 resize due to wrong pixmap beeing used. Also took the opurtunity
10239 to make the LyXScreen stateless on regard to WorkArea and some
10240 general cleanup in the same files.
10242 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10244 * src/Makefile.am: add missing direction.h
10246 * src/PainterBase.h: made the width functions const.
10248 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
10251 * src/insets/insetcommand.C (draw): draw Editable as buttons.
10253 * src/insets/insetlatexaccent.C (draw): make the accents draw
10254 better, at present this will only work well with iso8859-1.
10256 * several files: remove the old drawing code, now we use the new
10259 * several files: remove support for mono_video, reverse_video and
10262 2000-02-17 Juergen Vigna <jug@sad.it>
10264 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
10265 int ** as we have to return the pointer, otherwise we have only
10266 NULL pointers in the returning function.
10268 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10270 * src/LaTeX.C (operator()): quote file name when running latex.
10272 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10274 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
10275 (bubble tip), this removes our special handling of this.
10277 * Remove all code that is unused now that we have the new
10278 workarea. (Code that are not active when NEW_WA is defined.)
10280 * Make the uses of XSync not conditionalized on define USE_XSYNC.
10282 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10284 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
10285 nonexisting layout; correctly redirect obsoleted layouts.
10287 * lib/lyxrc.example: document \view_dvi_paper_option
10289 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
10292 * src/lyx_cb.C (RunScript): handle $$FName for command names.
10293 (PreviewDVI): handle the view_dvi_paper_option variable.
10294 [Both from Roland Krause]
10296 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10298 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
10299 char const *, int, LyXFont)
10300 (text(int, int, string, LyXFont)): ditto
10302 * src/text.C (InsertCharInTable): attempt to fix the double-space
10303 feature in tables too.
10304 (BackspaceInTable): ditto.
10305 (GetVisibleRow): make bottom pagebreak line be a onoff line.
10307 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10309 * src/text2.C (owner): only complain if owner_ is set and bv != 0
10311 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
10312 newly found text in textcache to this.
10313 (buffer): set the owner of the text put into the textcache to 0
10315 * src/insets/figinset.C (draw): fixed the drawing of figures with
10318 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
10319 drawing of mathframe, hfills, protected space, table lines. I have
10320 now no outstanding drawing problems with the new Painter code.
10322 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10324 * src/PainterBase.C (ellipse, circle): do not specify the default
10327 * src/LColor.h: add using directive.
10329 * src/Painter.[Ch]: change return type of methods from Painter& to
10330 PainterBase&. Add a using directive.
10332 * src/WorkArea.C: wrap xforms callbacks in C functions
10335 * lib/layouts/foils.layout: font fix and simplifications from Carl
10338 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10340 * a lot of files: The Painter, LColor and WorkArea from the old
10341 devel branch has been ported to lyx-devel. Some new files and a
10342 lot of #ifdeffed code. The new workarea is enabled by default, but
10343 if you want to test the new Painter and LColor you have to compile
10344 with USE_PAINTER defined (do this in config.h f.ex.) There are
10345 still some rought edges, and I'd like some help to clear those
10346 out. It looks stable (loads and displays the Userguide very well).
10349 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10351 * src/buffer.C (pop_tag): revert to the previous implementation
10352 (use a global variable for both loops).
10354 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
10356 * src/lyxrc.C (LyXRC): change slightly default date format.
10358 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
10359 there is an English text with a footnote that starts with a Hebrew
10360 paragraph, or vice versa.
10361 (TeXFootnote): ditto.
10363 * src/text.C (LeftMargin): allow for negative values for
10364 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
10367 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
10368 for input encoding (cyrillic)
10370 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10372 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
10375 * src/toolbar.C (set): ditto
10376 * src/insets/insetbib.C (create_form_citation_form): ditto
10378 * lib/CREDITS: added Dekel Tsur.
10380 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
10381 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
10382 hebrew supports files from Dekel Tsur.
10384 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
10385 <tzafrir@technion.ac.il>
10387 * src/lyxrc.C: put \date_insert_format at the right place.
10389 * src/buffer.C (makeLaTeXFile): fix the handling of
10390 BufferParams::sides when writing out latex files.
10392 * src/BufferView2.C: add a "using" directive.
10394 * src/support/lyxsum.C (sum): when we use lyxstring,
10395 ostringstream::str needs an additional .c_str().
10397 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10399 * src/support/filetools.C (ChangeExtension): patch from Etienne
10402 * src/TextCache.C (show): remove const_cast and make second
10403 parameter non-const LyXText *.
10405 * src/TextCache.h: use non const LyXText in show.
10407 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
10410 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10412 * src/support/lyxsum.C: rework to be more flexible.
10414 * several places: don't check if a pointer is 0 if you are going
10417 * src/text.C: remove some dead code.
10419 * src/insets/figinset.C: remove some dead code
10421 * src/buffer.C: move the BufferView funcs to BufferView2.C
10422 remove all support for insetlatexdel
10423 remove support for oldpapersize stuff
10424 made some member funcs const
10426 * src/kbmap.C: use a std::list to store the bindings in.
10428 * src/BufferView2.C: new file
10430 * src/kbsequence.[Ch]: new files
10432 * src/LyXAction.C + others: remove all trace of buffer-previous
10434 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
10435 only have one copy in the binary of this table.
10437 * hebrew patch: moved some functions from LyXText to more
10438 appropriate places. (LyXParagraph, BufferParams, LyXFont)
10440 * several files: remove support for XForms older than 0.88
10441 whitespace changes.
10442 remove some #if 0 #endif code
10444 * src/TextCache.[Ch]: new file. Holds the textcache.
10446 * src/BufferView.C: changes to use the new TextCache interface.
10447 (waitForX): remove the now unused code.
10449 * src/BackStack.h: remove some commented code
10451 * lib/bind/emacs.bind: remove binding for buffer-previous
10453 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10455 * applied the hebrew patch.
10457 * src/lyxrow.h: make sure that all Row variables are initialized.
10459 * src/text2.C (TextHandleUndo): comment out a delete, this might
10460 introduce a memory leak, but should also help us to not try to
10461 read freed memory. We need to look at this one.
10463 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
10464 (LyXParagraph): initalize footnotekind.
10466 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
10467 forgot this when applying the patch. Please heed the warnings.
10469 * src/BufferView.C (buffer): a fix for the buffer-reload problem
10470 (aka. reformat problem)
10472 * src/bufferlist.C (exists): made const, and use const_iterator
10473 (isLoaded): new func.
10474 (release): use std::find to find the correct buffer.
10476 * src/bufferlist.h: made getState a const func.
10477 made empty a const func.
10478 made exists a const func.
10481 2000-02-01 Juergen Vigna <jug@sad.it>
10483 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
10485 * po/it.po: updated a bit the italian po file and also changed the
10486 'file nuovo' for newfile to 'filenuovo' without a space, this did
10489 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
10490 for the new insert_date command.
10492 * src/lyxfunc.C (Dispatch): added support for a insert_date function
10493 from jdblair, to insert a date into the current text conforming to
10494 a strftime format (for now only considering the locale-set and not
10495 the document-language).
10497 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10499 * src/lyxfont.C (textWidth): hopefully better fix for the Array
10500 Bounds Read error seen by purify. The problem was that islower is
10501 a macros which takes an unsigned char and uses it as an index for
10502 in array of characters properties (and is thus subject to the
10506 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
10507 correctly the paper sides radio buttons.
10508 (UpdateDocumentButtons): ditto.
10510 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10512 * src/kbmap.C (getsym + others): change to return unsigned int,
10513 returning a long can give problems on 64 bit systems. (I assume
10514 that int is 32bit on 64bit systems)
10516 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10518 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
10519 LyXLookupString to be zero-terminated. Really fixes problems seen
10520 by purify, I think.
10522 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10524 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
10525 write a (char*)0 to the lyxerr stream.
10527 * src/lastfiles.C: move algorithm before the using statemets.
10529 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10531 * src/lastfiles.C: move using directives in global scope (egcs 1.x
10532 complains otherwise).
10533 * src/table.C: ditto
10535 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
10538 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
10539 that I removed earlier... It is really needed.
10541 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
10543 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10545 * INSTALL: update xforms home page URL.
10547 * lib/configure.m4: fix a bug with unreadable layout files.
10549 * src/table.C (calculate_width_of_column): add "using std::max"
10552 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10554 * several files: marked several lines with "DEL LINE", this is
10555 lines that can be deleted without changing anything.
10556 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
10557 checks this anyway */
10560 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
10562 * src/DepTable.C (update): add a "+" at the end when the checksum
10563 is different. (debugging string only)
10565 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
10566 the next inset to not be displayed. This should also fix the list
10567 of labels in the "Insert Crossreference" dialog.
10569 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10571 * src/support/LSubstring.C (LSubstring): set pos to string::npos
10572 when regex was not found.
10574 * src/support/lstrings.C (lowercase): use handcoded transform always.
10577 * src/text.C (Delete): fixed the crash. cursor.par->prev and
10578 old_cursor.par->prev could be 0.
10580 * several files: changed post inc/dec to pre inc/dec
10582 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
10583 write the lastfiles to file.
10585 * src/BufferView.C (buffer): only show TextCache info when debugging
10587 (resizeCurrentBuffer): ditto
10588 (workAreaExpose): ditto
10590 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
10592 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
10594 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
10595 a bit better by removing the special case for \i and \j.
10597 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10599 * src/lyx_main.C (easyParse): remove test for bad comand line
10600 options, since this broke all xforms-related parsing.
10602 * src/kbmap.C (getsym): set return type to unsigned long, as
10603 declared in header. On an alpha, long is _not_ the same as int.
10605 * src/support/LOstream.h: add a "using std::flush;"
10607 * src/insets/figinset.C: ditto.
10609 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10611 * src/bufferlist.C (write): use blinding fast file copy instead of
10612 "a char at a time", now we are doing it the C++ way.
10614 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
10615 std::list<int> instead.
10616 (addpidwait): reflect move to std::list<int>
10617 (sigchldchecker): ditto
10619 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
10622 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
10623 that obviously was wrong...
10625 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
10626 c, this avoids warnings with purify and islower.
10628 * src/insets/figinset.C: rename struct queue to struct
10629 queue_element and rewrite to use a std::queue. gsqueue is now a
10630 std::queue<queue_element>
10631 (runqueue): reflect move to std::queue
10634 * src/support/lstrings.h (tostr): specialize for bool, otherwise
10635 we would get "1" "0" instead of "true" "false. Also make the tostr
10638 2000-01-21 Juergen Vigna <jug@sad.it>
10640 * src/buffer.C (writeFileAscii): Disabled code for special groff
10641 handling of tabulars till I fix this in table.C
10643 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10645 * src/support/mkdir.C (mkdir): change second argument of mkdir to
10647 * src/support/lyxlib.h: ditto.
10649 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10651 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
10652 and 'j' look better. This might fix the "macron" bug that has been
10655 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
10656 functions as one template function. Delete the old versions.
10658 * src/support/lyxsum.C: move using std::ifstream inside
10661 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
10664 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
10666 * src/mathed/formula.C: delete #include "bufferlist.h" never used
10668 * src/insets/figinset.C (InitFigures): use new instead of malloc
10669 to allocate memory for figures and bitmaps.
10670 (DoneFigures): use delete[] instead of free to deallocate memory
10671 for figures and bitmaps.
10672 (runqueue): use new to allocate
10673 (getfigdata): use new/delete[] instead of malloc/free
10674 (RegisterFigure): ditto
10676 * some files: moved some declarations closer to first use, small
10677 whitespace changes use preincrement instead of postincrement where
10678 it does not make a difference.
10680 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
10681 step on the way to use stl::containers for key maps.
10683 * src/bufferlist.h: add a typedef for const_iterator and const
10684 versions of begin and end.
10686 * src/bufferlist.[Ch]: change name of member variable _state to
10687 state_. (avoid reserved names)
10689 (getFileNames): returns the filenames of the buffers in a vector.
10691 * configure.in (ALL_LINGUAS): added ro
10693 * src/support/putenv.C: new file
10695 * src/support/mkdir.C: new file
10697 2000-01-20 Allan Rae <rae@lyx.org>
10699 * lib/layouts/IEEEtran.layout: Added several theorem environments
10701 * lib/templates/IEEEtran.lyx: Example theorem environments and a
10702 couple of minor additions.
10704 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
10705 (except for those in footnotes of course)
10707 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10709 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
10711 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
10712 std::sort and std::lower_bound instead of qsort and handwritten
10714 (struct compara): struct that holds the functors used by std::sort
10715 and std::lower_bound in MathedLookupBOP.
10717 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10719 * src/support/LAssert.h: do not do partial specialization. We do
10720 not really need it.
10722 * src/support/lyxlib.h: note that lyx::getUserName() and
10723 lyx::date() are not in use right now. Should these be suppressed?
10725 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
10726 (makeLinuxDocFile): do not put date and user name in linuxdoc
10729 * src/support/lyxlib.h (kill): change first argument to long int,
10730 since that's what solaris uses.
10732 * src/support/kill.C (kill): fix declaration to match prototype.
10734 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
10735 actually check whether namespaces are supported. This is not what
10738 * src/support/lyxsum.C: add a using directive.
10740 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10742 * src/support/kill.C: if we have namespace support we don't have
10743 to include lyxlib.h.
10745 * src/support/lyxlib.h: use namespace lyx if supported.
10747 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10749 * src/support/date.C: new file
10751 * src/support/chdir.C: new file
10753 * src/support/getUserName.C: new file
10755 * src/support/getcwd.C: new file
10757 * src/support/abort.C: new file
10759 * src/support/kill.C: new file
10761 * src/support/lyxlib.h: moved all the functions in this file
10762 insede struct lyx. Added also kill and abort to this struct. This
10763 is a way to avoid the "kill is not defined in <csignal>", we make
10764 C++ wrappers for functions that are not ANSI C or ANSI C++.
10766 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
10767 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
10768 lyx it has been renamed to sum.
10770 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10772 * src/text.C: add using directives for std::min and std::max.
10774 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10776 * src/texrow.C (getIdFromRow): actually return something useful in
10777 id and pos. Hopefully fixes the bug with positionning of errorbox
10780 * src/lyx_main.C (easyParse): output an error and exit if an
10781 incorrect command line option has been given.
10783 * src/spellchecker.C (ispell_check_word): document a memory leak.
10785 * src/bufferlist.C (write): fix mismatched allocation/deletion,
10786 where a "struct utimbuf" is allocated with "new" and deleted with
10789 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10791 * src/text2.C (CutSelection): don't delete double spaces.
10792 (PasteSelection): ditto
10793 (CopySelection): ditto
10795 * src/text.C (Backspace): don't delete double spaces.
10797 * src/lyxlex.C (next): fix a bug that were only present with
10798 conformant std::istream::get to read comment lines, use
10799 std::istream::getline instead. This seems to fix the problem.
10801 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10803 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
10804 allowed to insert space before space" editing problem. Please read
10805 commends at the beginning of the function. Comments about usage
10808 * src/text.C (InsertChar): fix for the "not allowed to insert
10809 space before space" editing problem.
10811 * src/text2.C (DeleteEmptyParagraphMechanism): when
10812 IsEmptyTableRow can only return false this last "else if" will
10813 always be a no-op. Commented out.
10815 * src/text.C (RedoParagraph): As far as I can understand tmp
10816 cursor is not really needed.
10818 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
10819 present it could only return false anyway.
10820 (several functions): Did something not so smart...added a const
10821 specifier on a lot of methods.
10823 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
10824 and add a tmp->text.resize. The LyXParagraph constructor does the
10826 (BreakParagraphConservative): ditto
10828 * src/support/path.h (Path): add a define so that the wrong usage
10829 "Path("/tmp") will be flagged as a compilation error:
10830 "`unnamed_Path' undeclared (first use this function)"
10832 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10834 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
10835 which was bogus for several reasons.
10837 * src/LaTeX.C (scanAux): fix the regular expression used to scan
10839 (runBibTeX): ditto.
10841 * autogen.sh: do not use "type -path" (what's that anyway?).
10843 * src/support/filetools.C (findtexfile): remove extraneous space
10844 which caused a kpsewhich warning (at least with kpathsea version
10847 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10849 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
10851 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
10853 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
10855 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10857 * src/paragraph.C (BreakParagraph): do not reserve space on text
10858 if we don't need to (otherwise, if pos_end < pos, we end up
10859 reserving huge amounts of memory due to bad unsigned karma).
10860 (BreakParagraphConservative): ditto, although I have not seen
10861 evidence the bug can happen here.
10863 * src/lyxparagraph.h: add a using std::list.
10865 2000-01-11 Juergen Vigna <jug@sad.it>
10867 * src/menus.C (MenuDocu): output an Alert if the documentation-file
10868 could not be found.
10870 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10872 * src/vc-backend.C (doVCCommand): change to be static and take one
10873 more parameter: the path to chdir too be fore executing the command.
10874 (retrive): new function equiv to "co -r"
10876 * src/bufferlist.C (loadLyXFile): implement the missing parts if
10877 file_not_found_hook is true.
10879 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
10881 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
10882 if a file is readwrite,readonly...anything else.
10884 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10886 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
10887 (CreatePostscript): name change from MenuRunDVIPS (or something)
10888 (PreviewPostscript): name change from MenuPreviewPS
10889 (PreviewDVI): name change from MenuPreviewDVI
10891 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10892 \view_pdf_command., \pdf_to_ps_command
10894 * lib/configure.m4: added search for PDF viewer, and search for
10895 PDF to PS converter.
10896 (lyxrc.defaults output): add \pdflatex_command,
10897 \view_pdf_command and \pdf_to_ps_command.
10899 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10901 * src/bufferlist.C (write): we don't use blocksize for anything so
10904 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10906 * src/support/block.h: disable operator T* (), since it causes
10907 problems with both compilers I tried. See comments in the file.
10909 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10912 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10913 variable LYX_DIR_10x to LYX_DIR_11x.
10915 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10917 * INSTALL: document --with-lyxname.
10920 * configure.in: new configure flag --with-lyxname which allows to
10921 choose the name under which lyx is installed. Default is "lyx", of
10922 course. It used to be possible to do this with --program-suffix,
10923 but the later has in fact a different meaning for autoconf.
10925 * src/support/lstrings.h (lstrchr): reformat a bit.
10927 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10928 * src/mathed/math_defs.h: ditto.
10930 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10932 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10933 true, decides if we create a backup file or not when saving. New
10934 tag and variable \pdf_mode, defaults to false. New tag and
10935 variable \pdflatex_command, defaults to pdflatex. New tag and
10936 variable \view_pdf_command, defaults to xpdf. New tag and variable
10937 \pdf_to_ps_command, defaults to pdf2ps.
10939 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10941 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10942 does not have a BufferView.
10943 (unlockInset): ditto + don't access the_locking_inset if the
10944 buffer does not have a BufferView.
10946 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10947 certain circumstances so that we don't continue a keyboard
10948 operation long after the key was released. Try f.ex. to load a
10949 large document, press PageDown for some seconds and then release
10950 it. Before this change the document would contine to scroll for
10951 some time, with this change it stops imidiatly.
10953 * src/support/block.h: don't allocate more space than needed. As
10954 long as we don't try to write to the arr[x] in a array_type arr[x]
10955 it is perfectly ok. (if you write to it you might segfault).
10956 added operator value_type*() so that is possible to pass the array
10957 to functions expecting a C-pointer.
10959 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10962 * intl/*: updated to gettext 0.10.35, tried to add our own
10963 required modifications. Please verify.
10965 * po/*: updated to gettext 0.10.35, tried to add our own required
10966 modifications. Please verify.
10968 * src/support/lstrings.C (tostr): go at fixing the problem with
10969 cxx and stringstream. When stringstream is used return
10970 oss.str().c_str() so that problems with lyxstring and basic_string
10971 are avoided. Note that the best solution would be for cxx to use
10972 basic_string all the way, but it is not conformant yet. (it seems)
10974 * src/lyx_cb.C + other files: moved several global functions to
10975 class BufferView, some have been moved to BufferView.[Ch] others
10976 are still located in lyx_cb.C. Code changes because of this. (part
10977 of "get rid of current_view project".)
10979 * src/buffer.C + other files: moved several Buffer functions to
10980 class BufferView, the functions are still present in buffer.C.
10981 Code changes because of this.
10983 * config/lcmessage.m4: updated to most recent. used when creating
10986 * config/progtest.m4: updated to most recent. used when creating
10989 * config/gettext.m4: updated to most recent. applied patch for
10992 * config/gettext.m4.patch: new file that shows what changes we
10993 have done to the local copy of gettext.m4.
10995 * config/libtool.m4: new file, used in creation of acinclude.m4
10997 * config/lyxinclude.m4: new file, this is the lyx created m4
10998 macros, used in making acinclude.m4.
11000 * autogen.sh: GNU m4 discovered as a separate task not as part of
11001 the lib/configure creation.
11002 Generate acinlucde from files in config. Actually cat
11003 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
11004 easier to upgrade .m4 files that really are external.
11006 * src/Spacing.h: moved using std::istringstream to right after
11007 <sstream>. This should fix the problem seen with some compilers.
11009 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
11011 * src/lyx_cb.C: began some work to remove the dependency a lot of
11012 functions have on BufferView::text, even if not really needed.
11013 (GetCurrentTextClass): removed this func, it only hid the
11016 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
11017 forgot this in last commit.
11019 * src/Bullet.C (bulletEntry): use static char const *[] for the
11020 tables, becuase of this the return arg had to change to string.
11021 (bulletSize): ditto
11022 (~Bullet): removed unneeded destructor
11024 * src/BufferView.C (beforeChange): moved from lyx_cb.C
11025 (insetSleep): moved from Buffer
11026 (insetWakeup): moved from Buffer
11027 (insetUnlock): moved from Buffer
11029 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
11030 from Buffer to BufferView.
11032 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
11034 * config/ltmain.sh: updated to version 1.3.4 of libtool
11036 * config/ltconfig: updated to version 1.3.4 of libtool
11038 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11041 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
11042 Did I get that right?
11044 * src/lyxlex.h: add a "using" directive or two.
11045 * src/Spacing.h: ditto.
11046 * src/insets/figinset.C: ditto.
11047 * src/support/filetools.C: ditto.
11048 * src/support/lstrings.C: ditto.
11049 * src/BufferView.C: ditto.
11050 * src/bufferlist.C: ditto.
11051 * src/lyx_cb.C: ditto.
11052 * src/lyxlex.C: ditto.
11054 * NEWS: add some changes for 1.1.4.
11056 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
11058 * src/BufferView.C: first go at a TextCache to speed up switching
11061 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11063 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
11064 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
11065 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
11066 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
11069 * src/mathed/math_defs.h (MathedRowSt): make sure that all
11070 members of the struct are correctly initialized to 0 (detected by
11072 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
11073 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
11075 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
11076 pidwait, since it was allocated with "new". This was potentially
11077 very bad. Thanks to Michael Schmitt for running purify for us.
11080 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11082 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
11084 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
11086 1999-12-30 Allan Rae <rae@lyx.org>
11088 * lib/templates/IEEEtran.lyx: minor change
11090 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
11091 src/mathed/formula.C (LocalDispatch): askForText changes
11093 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
11094 know when a user has cancelled input. Fixes annoying problems with
11095 inserting labels and version control.
11097 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11099 * src/support/lstrings.C (tostr): rewritten to use strstream and
11102 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11104 * src/support/filetools.C (IsFileWriteable): use fstream to check
11105 (IsDirWriteable): use fileinfo to check
11107 * src/support/filetools.h (FilePtr): whole class deleted
11109 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
11111 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
11113 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
11115 * src/bufferlist.C (write): use ifstream and ofstream instead of
11118 * src/Spacing.h: use istrstream instead of sscanf
11120 * src/mathed/math_defs.h: change first arg to istream from FILE*
11122 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
11124 * src/mathed/math_parser.C: have yyis to be an istream
11125 (LexGetArg): use istream (yyis)
11127 (mathed_parse): ditto
11128 (mathed_parser_file): first arg istream instead of FILE*, set yyis
11130 * src/mathed/formula.C (Read): rewritten to use istream
11132 * src/mathed/formulamacro.C (Read): rewritten to use istream
11134 * src/lyxlex.h (~LyXLex): deleted desturctor
11135 (getStream): new function, returns an istream
11136 (getFile): deleted funtion
11137 (IsOK): return is.good();
11139 * src/lyxlex.C (LyXLex): delete file and owns_file
11140 (setFile): open an filebuf and assign that to a istream instead of
11142 (setStream): new function, takes an istream as arg.
11143 (setFile): deleted function
11144 (EatLine): rewritten us use istream instead of FILE*
11148 * src/table.C (LyXTable): use istream instead of FILE*
11149 (Read): rewritten to take an istream instead of FILE*
11151 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11153 * src/buffer.C (Dispatch): remove an extraneous break statement.
11155 * src/support/filetools.C (QuoteName): change to do simple
11156 'quoting'. More work is necessary. Also changed to do nothing
11157 under emx (needs fix too).
11158 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
11160 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
11161 config.h.in to the AC_DEFINE_UNQUOTED() call.
11162 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
11163 needs char * as argument (because Solaris 7 declares it like
11166 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
11167 remove definition of BZERO.
11169 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11171 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
11172 defined, "lyxregex.h" if not.
11174 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
11176 (REGEX): new variable that is set to regex.c lyxregex.h when
11177 AM_CONDITIONAL USE_REGEX is set.
11178 (libsupport_la_SOURCES): add $(REGEX)
11180 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
11183 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
11186 * configure.in: add call to LYX_REGEX
11188 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
11189 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
11191 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11193 * lib/bind/fi_menus.bind: new file, from
11194 pauli.virtanen@saunalahti.fi.
11196 * src/buffer.C (getBibkeyList): pass the parameter delim to
11197 InsetInclude::getKeys and InsetBibtex::getKeys.
11199 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
11200 is passed to Buffer::getBibkeyList
11202 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
11203 instead of the hardcoded comma.
11205 * src/insets/insetbib.C (getKeys): make sure that there are not
11206 leading blanks in bibtex keys. Normal latex does not care, but
11207 harvard.sty seems to dislike blanks at the beginning of citation
11208 keys. In particular, the retturn value of the function is
11210 * INSTALL: make it clear that libstdc++ is needed and that gcc
11211 2.7.x probably does not work.
11213 * src/support/filetools.C (findtexfile): make debug message go to
11215 * src/insets/insetbib.C (getKeys): ditto
11217 * src/debug.C (showTags): make sure that the output is correctly
11220 * configure.in: add a comment for TWO_COLOR_ICON define.
11222 * acconfig.h: remove all the entries that already defined in
11223 configure.in or acinclude.m4.
11225 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
11226 to avoid user name, date and copyright.
11228 1999-12-21 Juergen Vigna <jug@sad.it>
11230 * src/table.C (Read): Now read bogus row format informations
11231 if the format is < 5 so that afterwards the table can
11232 be read by lyx but without any format-info. Fixed the
11233 crash we experienced when not doing this.
11235 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
11237 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
11238 (RedoDrawingOfParagraph): ditto
11239 (RedoParagraphs): ditto
11240 (RemoveTableRow): ditto
11242 * src/text.C (Fill): rename arg paperwidth -> paper_width
11244 * src/buffer.C (insertLyXFile): rename var filename -> fname
11245 (writeFile): rename arg filename -> fname
11246 (writeFileAscii): ditto
11247 (makeLaTeXFile): ditto
11248 (makeLinuxDocFile): ditto
11249 (makeDocBookFile): ditto
11251 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
11254 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
11256 * src/bmtable.h: add extern "C" on this file when __cplusplus is
11259 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
11260 compiled by a C compiler not C++.
11262 * src/layout.h (LyXTextClass): added typedef for const_iterator
11263 (LyXTextClassList): added typedef for const_iterator + member
11264 functions begin and end.
11266 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
11267 iterators to fill the choice_class.
11268 (updateLayoutChoice): rewritten to use iterators to fill the
11269 layoutlist in the toolbar.
11271 * src/BufferView.h (BufferView::work_area_width): removed unused
11274 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
11276 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
11277 (sgmlCloseTag): ditto
11279 * src/support/lstrings.h: return type of countChar changed to
11282 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
11283 what version of this func to use. Also made to return unsigned int.
11285 * configure.in: call LYX_STD_COUNT
11287 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
11288 conforming std::count.
11290 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11292 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
11293 and a subscript would give bad display (patch from Dekel Tsur
11294 <dekel@math.tau.ac.il>).
11296 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
11298 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
11301 * src/chset.h: add a few 'using' directives
11303 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
11304 triggered when no buffer is active
11306 * src/layout.C: removed `break' after `return' in switch(), since
11309 * src/lyx_main.C (init): make sure LyX can be ran in place even
11310 when libtool has done its magic with shared libraries. Fix the
11311 test for the case when the system directory has not been found.
11313 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
11314 name for the latex file.
11315 (MenuMakeHTML): ditto
11317 * src/buffer.h: add an optional boolean argument, which is passed
11318 to ChangeExtension.
11320 1999-12-20 Allan Rae <rae@lyx.org>
11322 * lib/templates/IEEEtran.lyx: small correction and update.
11324 * configure.in: Attempted to use LYX_PATH_HEADER
11326 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
11328 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
11329 input from JMarc. Now use preprocessor to find the header.
11330 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
11331 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
11332 LYX_STL_STRING_FWD. See comments in file.
11334 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
11336 * The global MiniBuffer * minibuffer variable is dead.
11338 * The global FD_form_main * fd_form_main variable is dead.
11340 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11342 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
11344 * src/table.h: add the LOstream.h header
11345 * src/debug.h: ditto
11347 * src/LyXAction.h: change the explaination of the ReadOnly
11348 attribute: is indicates that the function _can_ be used.
11350 * src/LyXAction.C (init): find-replace _can_ be used in read-only
11353 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11355 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
11361 * src/paragraph.C (GetWord): assert on pos>=0
11364 * src/support/lyxstring.C: condition the use of an invariant on
11366 * src/support/lyxstring.h: ditto
11368 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
11369 Use LAssert.h instead of plain assert().
11371 * src/support/lstrings.h: add LAssert.h, in case it is needed.
11373 * src/lyxfunc.C: do not include LAssert.h, it is not used.
11374 * src/support/filetools.C: ditto
11376 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
11379 * INSTALL: document the new configure flags
11381 * configure.in: suppress --with-debug; add --enable-assertions
11383 * acinclude.m4: various changes in alignment of help strings.
11385 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11387 * src/kbmap.C: commented out the use of the hash map in kb_map,
11388 beginning of movement to a stl::container.
11390 * several files: removed code that was not in effect when
11391 MOVE_TEXT was defined.
11393 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
11394 for escaping should not be used. We can discuss if the string
11395 should be enclosed in f.ex. [] instead of "".
11397 * src/trans_mgr.C (insert): use the new returned value from
11398 encodeString to get deadkeys and keymaps done correctly.
11400 * src/chset.C (encodeString): changed to return a pair, to tell
11401 what to use if we know the string.
11403 * src/lyxscreen.h (fillArc): new function.
11405 * src/FontInfo.C (resize): rewritten to use more std::string like
11406 structore, especially string::replace.
11408 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
11411 * configure.in (chmod +x some scripts): remove config/gcc-hack
11413 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11415 * src/buffer.C (writeFile): change once again the top comment in a
11416 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
11417 instead of an hardcoded version number.
11418 (makeDocBookFile): ditto
11420 * src/version.h: add new define LYX_DOCVERSION
11422 * po/de.po: update from Pit Sütterlin
11423 * lib/bind/de_menus.bind: ditto.
11425 * src/lyxfunc.C (Dispatch): call MenuExport()
11426 * src/buffer.C (Dispatch): ditto
11428 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
11429 LyXFunc::Dispatch().
11430 (MenuExport): new function, moved from
11431 LyXFunc::Dispatch().
11433 * src/trans_mgr.C (insert): small cleanup
11434 * src/chset.C (loadFile): ditto
11436 * lib/kbd/iso8859-1.cdef: add missing backslashes
11438 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11440 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
11441 help with placing the manually drawn accents better.
11443 (Draw): x2 and hg changed to float to minimize rounding errors and
11444 help place the accents better.
11446 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
11447 unsigned short to char is just wrong...cast the char to unsigned
11448 char instead so that the two values can compare sanely. This
11449 should also make the display of insetlatexaccents better and
11450 perhaps also some other insets.
11452 (lbearing): new function
11455 1999-12-15 Allan Rae <rae@lyx.org>
11457 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
11458 header that provides a wrapper around the very annoying SGI STL header
11461 * src/support/lyxstring.C, src/LString.h:
11462 removed old SGI-STL-compatability attempts.
11464 * configure.in: Use LYX_STL_STRING_FWD.
11466 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
11467 stl_string_fwd.h is around and try to determine it's location.
11468 Major improvement over previous SGI STL 3.2 compatability.
11469 Three small problems remain with this function due to my zero
11470 knowledge of autoconf. JMarc and lgb see the comments in the code.
11472 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11474 * src/broken_const.h, config/hack-gcc, config/README: removed
11476 * configure.in: remove --with-gcc-hack option; do not call
11479 * INSTALL: remove documentation of --with-broken-const and
11482 * acconfig.h: remove all trace of BROKEN_CONST define
11484 * src/buffer.C (makeDocBookFile): update version number in output
11486 (SimpleDocBookOnePar): fix an assert when trying to a character
11487 access beyond string length
11490 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11492 * po/de.po: fix the Export menu
11494 * lyx.man: update the description of -dbg
11496 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
11497 (commandLineHelp): updated
11498 (easyParse): show list of available debug levels if -dbg is passed
11501 * src/Makefile.am: add debug.C
11503 * src/debug.h: moved some code to debug.C
11505 * src/debug.C: new file. Contains code to set and show debug
11508 * src/layout.C: remove 'break' after 'continue' in switch
11509 statements, since these cannot be reached.
11511 1999-12-13 Allan Rae <rae@lyx.org>
11513 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
11514 (in_word_set): hash() -> math_hash()
11516 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
11518 * acconfig.h: Added a test for whether we are using exceptions in the
11519 current compilation run. If so USING_EXCEPTIONS is defined.
11521 * config.in: Check for existance of stl_string_fwd.h
11522 * src/LString.h: If compiling --with-included-string and SGI's
11523 STL version 3.2 is present (see above test) we need to block their
11524 forward declaration of string and supply a __get_c_string().
11525 However, it turns out this is only necessary if compiling with
11526 exceptions enabled so I've a bit more to add yet.
11528 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
11529 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
11530 src/support/LRegex.h, src/undo.h:
11531 Shuffle the order of the included files a little to ensure that
11532 LString.h gets included before anything that includes stl_string_fwd.h
11534 * src/support/lyxstring.C: We need to #include LString.h instead of
11535 lyxstring.h to get the necessary definition of __get_c_string.
11536 (__get_c_string): New function. This is defined static just like SGI's
11537 although why they need to do this I'm not sure. Perhaps it should be
11538 in lstrings.C instead.
11540 * lib/templates/IEEEtran.lyx: New template file.
11542 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11544 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
11545 * intl/Makefile.in (MKINSTALLDIRS): ditto
11547 * src/LyXAction.C (init): changed to hold the LFUN data in a
11548 automatic array in stead of in callso to newFunc, this speeds up
11549 compilation a lot. Also all the memory used by the array is
11550 returned when the init is completed.
11552 * a lot of files: compiled with -Wold-style-cast, changed most of
11553 the reported offenders to C++ style casts. Did not change the
11554 offenders in C files.
11556 * src/trans.h (Match): change argument type to unsigned int.
11558 * src/support/DebugStream.C: fix some types on the streambufs so
11559 that it works on a conforming implementation.
11561 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11563 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
11565 * src/support/lyxstring.C: remove the inline added earlier since
11566 they cause a bunch of unsatisfied symbols when linking with dec
11567 cxx. Cxx likes to have the body of inlines at the place where they
11570 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
11571 accessing negative bounds in array. This fixes the crash when
11572 inserting accented characters.
11573 * src/trans.h (Match): ditto
11575 * src/buffer.C (Dispatch): since this is a void, it should not try
11576 to return anything...
11578 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11580 * src/buffer.h: removed the two friends from Buffer. Some changes
11581 because of this. Buffer::getFileName and Buffer::setFileName
11582 renamed to Buffer::fileName() and Buffer::fileName(...).
11584 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11586 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
11587 and Buffer::update(short) to BufferView. This move is currently
11588 controlled by a define MOVE_TEXT, this will be removed when all
11589 shows to be ok. This move paves the way for better separation
11590 between buffer contents and buffer view. One side effect is that
11591 the BufferView needs a rebreak when swiching buffers, if we want
11592 to avoid this we can add a cache that holds pointers to LyXText's
11593 that is not currently in use.
11595 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
11598 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11600 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
11602 * lyx_main.C: new command line option -x (or --execute) and
11603 -e (or --export). Now direct conversion from .lyx to .tex
11604 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
11605 Unfortunately, X is still needed and the GUI pops up during the
11608 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11610 * src/Spacing.C: add a using directive to bring stream stuff into
11612 * src/paragraph.C: ditto
11613 * src/buffer.C: ditto
11615 * NEWS: updated a bit the new features of 1.1.3 (took a few things
11616 from Lars' announcement).
11618 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
11619 example files from Tino Meinen.
11621 1999-12-06 Allan Rae <rae@lyx.org>
11623 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
11625 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11627 * src/support/lyxstring.C: added a lot of inline for no good
11630 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
11631 latexWriteEndChanges, they were not used.
11633 * src/layout.h (operator<<): output operator for PageSides
11635 * src/mathed/math_iter.C (my_memcpy): slightly changed.
11637 * some example files: loaded in LyX 1.0.4 and saved again to update
11638 certain constructs (table format)
11640 * a lot of files: did the change to use fstream/iostream for all
11641 writing of files. Done with a close look at Andre Poenitz's patch.
11643 * some files: whitespace changes.
11645 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11647 * src/mathed/math_iter.C (my_memcpy): new function. Since the
11648 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
11649 architecture, we provide our own. It is used unconditionnally, but
11650 I do not think this is a performance problem. Thanks to Angus
11651 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
11652 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
11654 (GetInset): use my_memcpy.
11658 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
11659 it is easier to understand, but it uses less TeX-only constructs now.
11661 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
11662 elements contain spaces
11664 * lib/configure: regenerated
11666 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
11667 elements contain spaces; display the list of programs that are
11670 * autogen.sh: make sure lib/configure is executable
11672 * lib/examples/*: rename the tutorial examples to begin with the
11673 two-letters language code.
11675 * src/lyxfunc.C (getStatus): do not query current font if no
11678 * src/lyx_cb.C (RunScript): use QuoteName
11679 (MenuRunDvips): ditto
11680 (PrintApplyCB): ditto
11682 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
11683 around argument, so that it works well with the current shell.
11684 Does not work properly with OS/2 shells currently.
11686 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
11687 * src/LyXSendto.C (SendtoApplyCB): ditto
11688 * src/lyxfunc.C (Dispatch): ditto
11689 * src/buffer.C (runLaTeX): ditto
11690 (runLiterate): ditto
11691 (buildProgram): ditto
11693 * src/lyx_cb.C (RunScript): ditto
11694 (MenuMakeLaTeX): ditto
11696 * src/buffer.h (getLatexName): new method
11698 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
11700 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11702 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
11703 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
11704 (create_math_panel): ditto
11706 * src/lyxfunc.C (getStatus): re-activate the code which gets
11707 current font and cursor; add test for export to html.
11709 * src/lyxrc.C (read): remove unreachable break statements; add a
11712 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
11714 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11716 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
11717 introduced by faulty regex.
11718 * src/buffer.C: ditto
11719 * src/lastfiles.C: ditto
11720 * src/paragraph.C: ditto
11721 * src/table.C: ditto
11722 * src/vspace.C: ditto
11723 * src/insets/figinset.C: ditto
11724 Note: most of these is absolutely harmless, except the one in
11725 src/mathed formula.C.
11727 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
11729 * src/ImportNoweb.C (documentclass): fixed bounds for substr
11730 operation, yielding correct results for the reLyX command.
11732 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11734 * src/support/filetools.C (ExpandPath): removed an over eager
11736 (ReplaceEnvironmentPath): ditto
11738 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
11739 shows that we are doing something fishy in our code...
11740 (BubblePost): ditto
11743 * src/lyxrc.C (read): use a double switch trick to get more help
11744 from the compiler. (the same trick is used in layout.C)
11745 (write): new function. opens a ofstream and pass that to output
11746 (output): new function, takes a ostream and writes the lyxrc
11747 elemts to it. uses a dummy switch to make sure no elements are
11750 * src/lyxlex.h: added a struct pushpophelper for use in functions
11751 with more than one exit point.
11753 * src/lyxlex.[Ch] (GetInteger): made it const
11757 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
11759 * src/layout.[hC] : LayoutTags splitted into several enums, new
11760 methods created, better error handling cleaner use of lyxlex. Read
11763 * src/bmtable.[Ch]: change some member prototypes because of the
11764 image const changes.
11766 * commandtags.h, src/LyXAction.C (init): new function:
11767 "preferences-save", saves the lyxrc entries into .lyx/preferences.
11768 This file is not read automatically but you can add \input
11769 preferences to your lyxrc if you want to. We need to discuss how
11772 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
11773 in .aux, also remove .bib and .bst files from dependencies when
11776 * src/BufferView.C, src/LyXView.C: add const_cast several places
11777 because of changes to images.
11779 * lib/images/*: same change as for images/*
11781 * lib/lyxrc.example: Default for accept_compound is false not no.
11783 * images/*: changed to be const, however I have som misgivings
11784 about this change so it might be changed back.
11786 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11788 * lib/configure, po/POTFILES.in: regenerated
11790 * autogen.sh: autogenerate lib/configure from lib/configure.m4
11792 * config/lib_configure.m4: removed
11794 * lib/configure.m4: new file (was config/lib_configure.m4)
11796 * configure.in: do not test for rtti, since we do not use it.
11798 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11800 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
11801 doubling of allocated space scheme. This makes it faster for large
11802 strings end to use less memory for small strings. xtra rememoved.
11804 * src/insets/figinset.C (waitalarm): commented out.
11805 (GhostscriptMsg): use static_cast
11806 (GhostscriptMsg): use new instead of malloc to allocate memory for
11807 cmap. also delete the memory after use.
11809 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
11811 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
11812 for changes in bibtex database or style.
11813 (runBibTeX): remove all .bib and .bst files from dep before we
11815 (run): use scanAuc in when dep file already exist.
11817 * src/DepTable.C (remove_files_with_extension): new method
11818 (exist): new method
11820 * src/DepTable.[Ch]: made many of the methods const.
11822 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11824 * src/bufferparams.C: make sure that the default textclass is
11825 "article". It used to be the first one by description order, but
11826 now the first one is "docbook".
11828 * src/lyx_main.C (setDebuggingLevel): change type of argument to
11829 string; call Debug::value.
11830 (easyParse): pass complete argument to setDebuggingLevel().
11832 * src/debug.h (value): fix the code that parses debug levels.
11834 * src/debug.h: add new debug type ACTION, reserved for LyXAction
11837 * src/LyXAction.C: use Debug::ACTION as debug channel.
11839 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
11841 * NEWS: updated for the future 1.1.3 release.
11843 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
11844 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
11845 it should. This is of course a controversial change (since many
11846 people will find that their lyx workscreen is suddenly full of
11847 red), but done for the sake of correctness.
11849 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
11850 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
11852 * src/insets/inseterror.h, src/insets/inseturl.h,
11853 src/insets/insetinfo.h, src/insets/figinset.h,
11854 src/mathed/formulamacro.h, src/mathed/math_macro.h
11855 (EditMessage): add a missing const and add _() to make sure that
11856 translation happens
11858 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
11859 src/insets/insetbib.C, src/support/filetools.C: add `using'
11860 directives for cxx.
11862 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
11863 doing 'Insert index of last word' at the beginning of a paragraph.
11865 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11867 * several files: white-space changes.
11869 * src/mathed/formula.C: removed IsAlpha and IsDigit
11871 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
11872 .bib file. use a ifstream instead of FilePtr when parsing the .bib
11875 * src/insets/figinset.C (GetPSSizes): don't break when
11876 "EndComments" is seen. But break when a boundingbox is read.
11878 * all classes inherited from Inset: return value of Clone
11879 changed back to Inset *.
11881 * all classes inherited form MathInset: return value of Clone
11882 changed back to MathedInset *.
11884 * src/insets/figinset.C (runqueue): use a ofstream to output the
11885 gs/ps file. Might need some setpresicion or setw. However I can
11886 see no problem with the current code.
11887 (runqueue): use sleep instead of the alarm/signal code. I just
11888 can't see the difference.
11890 * src/paragraph.C (LyXParagraph): reserve space in the new
11891 paragraph and resize the inserted paragraph to just fit.
11893 * src/lyxfunc.h (operator|=): added operator for func_status.
11895 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11896 check for readable file.
11898 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11899 check for readable file.
11900 (MenuMakeLinuxDoc): ditto
11901 (MenuMakeDocBook): ditto
11902 (MenuMakeAscii): ditto
11903 (InsertAsciiFile): split the test for openable and readable
11905 * src/bmtable.C (draw_bitmaptable): use
11906 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11908 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11909 findtexfile from LaTeX to filetools.
11911 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11912 instead of FilePtr. Needs to be verified by a literate user.
11914 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11916 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11917 (EditMessage): likewise.
11919 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11920 respectively as \textasciitilde and \textasciicircum.
11922 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11924 * src/support/lyxstring.h: made the methods that take iterators
11925 use const_iterator.
11927 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11928 (regexMatch): made is use the real regex class.
11930 * src/support/Makefile.am: changed to use libtool
11932 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11934 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11936 (MathIsInset ++): changed several macros to be inline functions
11939 * src/mathed/Makefile.am: changed to use libtool
11941 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11943 * src/insets/inset* : Clone changed to const and return type is
11944 the true insettype not just Inset*.
11946 * src/insets/Makefile.am: changed to use libtool
11948 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11950 * src/undo.[Ch] : added empty() and changed some of the method
11953 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11955 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11956 setID use block<> for the bullets array, added const several places.
11958 * src/lyxfunc.C (getStatus): new function
11960 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11961 LyXAction, added const to several funtions.
11963 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11964 a std::map, and to store the dir items in a vector.
11966 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11969 * src/LyXView.[Ch] + other files : changed currentView to view.
11971 * src/LyXAction.[Ch] : ported from the old devel branch.
11973 * src/.cvsignore: added .libs and a.out
11975 * configure.in : changes to use libtool.
11977 * acinclude.m4 : inserted libtool.m4
11979 * .cvsignore: added libtool
11981 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11983 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11984 file name in insets and mathed directories (otherwise the
11985 dependency is not taken in account under cygwin).
11987 * src/text2.C (InsertString[AB]): make sure that we do not try to
11988 read characters past the string length.
11990 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11992 * lib/doc/LaTeXConfig.lyx.in,
11993 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11995 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11996 file saying who created them and when this heppened; this is
11997 useless and annoys tools like cvs.
11999 * lib/layouts/g-brief-{en,de}.layout,
12000 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
12001 from Thomas Hartkens <thomas@hartkens.de>.
12003 * src/{insets,mathed}/Makefile.am: do not declare an empty
12004 LDFLAGS, so that it can be set at configure time (useful on Irix
12007 * lib/reLyX/configure.in: make sure that the prefix is set
12008 correctly in LYX_DIR.
12010 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
12012 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
12013 be used by 'command-sequence' this allows to bind a key to a
12014 sequence of LyX-commands
12015 (Example: 'command-sequence math-insert alpha; math-insert beta;")
12017 * src/LyXAction.C: add "command-sequence"
12019 * src/LyXFunction.C: handling of "command-sequence"
12021 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
12022 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
12024 * src/lyxserver.C, src/minibuffer.C: Use this new interface
12026 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12028 * src/buffer.C (writeFile): Do not output a comment giving user
12029 and date at the beginning of a .lyx file. This is useless and
12030 annoys cvs anyway; update version number to 1.1.
12032 * src/Makefile.am (LYX_DIR): add this definition, so that a
12033 default path is hardcoded in LyX.
12035 * configure.in: Use LYX_GNU_GETTEXT.
12037 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
12038 AM_GNU_GETTEXT with a bug fixed.
12040 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
12042 * src/chset.C: add "using std::ifstream;" to please dec cxx.
12044 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
12045 which is used to point to LyX data is now LYX_DIR_11x.
12047 * lyx.man: convert to a unix text file; small updates.
12049 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
12051 * src/support/LSubstring.[Ch]: made the second arg of most of the
12052 constructors be a const reference.
12054 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
12057 * src/support/lyxstring.[Ch] (swap): added missing member function
12058 and specialization of swap(str, str);
12060 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
12062 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
12063 trace of the old one.
12065 * src/undo.[Ch]: made the undostack use std::list to store undo's in
12066 put the member definitions in undo.C.
12068 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
12069 NEW_TEXT and have now only code that was included when this was
12072 * src/intl.C (LCombo): use static_cast
12074 (DispatchCallback): ditto
12076 * src/definitions.h: removed whole file
12078 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
12080 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
12081 parsing and stores in a std:map. a regex defines the file format.
12082 removed unneeded members.
12084 * src/bufferparams.h: added several enums from definitions.h here.
12085 Removed unsused destructor. Changed some types to use proper enum
12086 types. use block to have the temp_bullets and user_defined_bullets
12087 and to make the whole class assignable.
12089 * src/bufferparams.C (Copy): removed this functions, use a default
12090 assignment instead.
12092 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
12095 * src/buffer.C (readLyXformat2): commend out all that have with
12096 oldpapersize to do. also comment out all that hve to do with
12097 insetlatex and insetlatexdel.
12098 (setOldPaperStuff): commented out
12100 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
12102 * src/LyXAction.C: remove use of inset-latex-insert
12104 * src/mathed/math_panel.C (button_cb): use static_cast
12106 * src/insets/Makefile.am (insets_o_SOURCES): removed
12109 * src/support/lyxstring.C (helper): use the unsigned long
12110 specifier, UL, instead of a static_cast.
12112 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
12114 * src/support/block.h: new file. to be used as a c-style array in
12115 classes, so that the class can be assignable.
12117 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12119 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
12120 NULL, make sure to return an empty string (it is not possible to
12121 set a string to NULL).
12123 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12125 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
12127 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
12129 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
12130 link line, so that Irix users (for example) can set it explicitely to
12133 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
12134 it can be overidden at make time (static or dynamic link, for
12137 * src/vc-backend.C, src/LaTeXFeatures.h,
12138 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
12139 statements to bring templates to global namespace.
12141 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
12143 * src/support/lyxstring.C (operator[] const): make it standard
12146 * src/minibuffer.C (Init): changed to reflect that more
12147 information is given from the lyxvc and need not be provided here.
12149 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
12151 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
12153 * src/LyXView.C (UpdateTimerCB): use static_cast
12154 (KeyPressMask_raw_callback): ditto
12156 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
12157 buffer_, a lot of changes because of this. currentBuffer() ->
12158 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
12159 also changes to other files because of this.
12161 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
12163 * src/vc-backend.[Ch]: new files. The backends for vc handling,
12164 have no support for RCS and partial support for CVS, will be
12167 * src/insets/ several files: changes because of function name
12168 changes in Bufferview and LyXView.
12170 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
12172 * src/support/LSubstring.[Ch]: new files. These implement a
12173 Substring that can be very convenient to use. i.e. is this
12175 string a = "Mary had a little sheep";
12176 Substring(a, "sheep") = "lamb";
12177 a is now "Mary has a little lamb".
12179 * src/support/LRegex.[Ch]: a regex class that can be used to pick
12180 out patterns and subpatterns of strings. It is used by LSubstring
12181 and also by vc-backend.C
12183 * src/support/lyxstring.C: went over all the assertions used and
12184 tried to correct the wrong ones and flag which of them is required
12185 by the standard. some bugs found because of this. Also removed a
12186 couple of assertions.
12188 * src/support/Makefile.am (libsupport_a_SOURCES): added
12189 LSubstring.[Ch] and LRegex.[Ch]
12191 * src/support/FileInfo.h: have struct stat buf as an object and
12192 not a pointer to one, some changes because of this.
12194 * src/LaTeXFeatures.C (getTClassPreamble): also use the
12195 information in layout when adding the layouts preamble to the
12196 textclass preamble.
12198 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
12201 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
12202 because of bug in OS/2.
12204 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12206 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
12207 \verbatim@font instead of \ttfamily, so that it can be redefined.
12209 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
12210 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
12211 src/layout.h, src/text2.C: add 'using' directive to bring the
12212 STL templates we need from the std:: namespace to the global one.
12213 Needed by DEC cxx in strict ansi mode.
12215 * src/support/LIstream.h,src/support/LOstream.h,
12216 src/support/lyxstring.h,src/table.h,
12217 src/lyxlookup.h: do not include <config.h> in header
12218 files. This should be done in the .C files only.
12220 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
12224 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12226 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
12227 from Kayvan to fix the tth invokation.
12229 * development/lyx.spec.in: updates from Kayvan to reflect the
12230 changes of file names.
12232 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12234 * src/text2.C (InsertStringB): use std::copy
12235 (InsertStringA): use std::copy
12237 * src/bufferlist.C: use a vector to store the buffers in. This is
12238 an internal change and should not affect any other thing.
12240 * src/BufferView.C (waitForX): use XSync instead of the lengthy
12243 * src/text.C (Fill): fix potential bug, one off bug.
12245 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12247 * src/Makefile.am (lyx_main.o): add more files it depends on.
12249 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
12251 * src/support/lyxstring.C: use size_t for the reference count,
12252 size, reserved memory and xtra.
12253 (internal_compare): new private member function. Now the compare
12254 functions should work for std::strings that have embedded '\0'
12256 (compare): all compare functions rewritten to use
12259 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
12261 * src/support/lyxstring.C (compare): pass c_str()
12262 (compare): pass c_str
12263 (compare): pass c_str
12265 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12267 * src/support/DebugStream.C: <config.h> was not included correctly.
12269 * lib/configure: forgot to re-generate it :( I'll make this file
12270 auto generated soon.
12272 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
12274 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
12277 * src/support/lyxstring.C: some changes from length() to rep->sz.
12278 avoids a function call.
12280 * src/support/filetools.C (SpaceLess): yet another version of the
12281 algorithm...now per Jean-Marc's suggestions.
12283 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12285 * src/layout.C (less_textclass_desc): functor for use in sorting
12287 (LyXTextClass::Read): sort the textclasses after reading.
12289 * src/support/filetools.C (SpaceLess): new version of the
12290 SpaceLess functions. What problems does this one give? Please
12293 * images/banner_bw.xbm: made the arrays unsigned char *
12295 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12297 * src/support/lyxstring.C (find): remove bogus assertion in the
12298 two versions of find where this has not been done yet.
12300 * src/support/lyxlib.h: add missing int return type to
12303 * src/menus.C (ShowFileMenu): disable exporting to html if no
12304 html export command is present.
12306 * config/lib_configure.m4: add a test for an HTML converter. The
12307 programs checked for are, in this order: tth, latex2html and
12310 * lib/configure: generated from config/lib_configure.m4.
12312 * src/lyxfunc.C (Dispatch): update and improve the execution of an
12313 html converter. The parameters are now passed through $$FName and
12314 $$OutName, instead of standard input/output.
12316 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
12318 * lib/lyxrc.example: update description of \html_command.
12319 add "quotes" around \screen_font_xxx font setting examples to help
12320 people who use fonts with spaces in their names.
12322 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12324 * Distribution files: updates for v1.1.2
12326 * src/support/lyxstring.C (find): remove bogus assert and return
12327 npos for the same condition.
12329 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12331 * added patch for OS/2 from SMiyata.
12333 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12335 * src/text2.C (CutSelection): make space_wrapped a bool
12336 (CutSelection): dont declare int i until we have to.
12337 (alphaCounter): return a char const *.
12339 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12341 * src/support/syscall.C (Systemcalls::kill):
12342 src/support/filetools.C (PutEnv, PutEnvPath):
12343 src/lyx_cb.C (addNewlineAndDepth):
12344 src/FontInfo.C (FontInfo::resize): condition some #warning
12345 directives with WITH_WARNINGS.
12348 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12350 * src/layout.[Ch] + several files: access to class variables
12351 limited and made accessor functions instead a lot of code changed
12352 becuase of this. Also instead of returning pointers often a const
12353 reference is returned instead.
12355 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
12357 * src/Makefile.am (dist-hook): added used to remove the CVS from
12358 cheaders upon creating a dist
12359 (EXTRA_DIST): added cheaders
12361 * src/support/lstrings.C (tostr(char)): fix it to handle param as
12362 a character not as a small integer.
12364 * src/support/lyxstring.C (find): removed Assert and added i >=
12365 rep->sz to the first if.
12367 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12369 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
12370 src/LyXView.C src/buffer.C src/bufferparams.C
12371 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
12372 src/text2.C src/insets/insetinclude.C:
12373 lyxlayout renamed to textclasslist.
12375 * src/layout.C: some lyxerr changes.
12377 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
12378 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
12379 (LyXLayoutList): removed all traces of this class.
12380 (LyXTextClass::Read): rewrote LT_STYLE
12381 (LyXTextClass::hasLayout): new function
12382 (LyXTextClass::GetLayout): rewritten to return an iterator + has
12383 both const and nonconst version.
12384 (LyXTextClass::delete_layout): new function.
12385 (LyXTextClassList::Style): bug fix. do the right thing if layout
12387 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
12388 (LyXTextClassList::NameOfLayout): ditto
12389 (LyXTextClassList::Load): ditto
12391 * src/buffer.C (makeLaTeXFile): new access to layoutlist
12393 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
12395 * src/LyXAction.C (LookupFunc): added a workaround for sun
12396 compiler, on the other hand...we don't know if the current code
12397 compiles on sun at all...
12399 * src/support/filetools.C (CleanupPath): subst fix
12401 * src/insets/insetbib.C (delDatabase): subst fix, this looks
12404 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
12405 complained about this one?
12407 * src/insets/insetinclude.C (Latex): subst fix
12409 * src/insets/insetbib.C (getKeys): subst fix
12411 * src/LyXSendto.C (SendtoApplyCB): subst fix
12413 * src/lyx_main.C (init): subst fix
12415 * src/layout.C (Read): subst fix
12417 * src/lyx_sendfax_main.C (button_send): subst fix
12419 * src/buffer.C (RoffAsciiTable): subst fix
12421 * src/lyx_cb.C (MenuFax): subst fix
12422 (PrintApplyCB): subst fix
12424 1999-10-26 Juergen Vigna <jug@sad.it>
12426 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
12428 (Read): Cleaned up this code so now we read only format vestion >= 5
12430 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
12432 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
12433 come nobody has complained about this one?
12435 * src/insets/insetinclude.C (Latex): subst fix
12437 * src/insets/insetbib.C (getKeys): subst fix
12439 * src/lyx_main.C (init): subst fix
12441 * src/layout.C (Read): subst fix
12443 * src/buffer.C (RoffAsciiTable): subst fix
12445 * src/lyx_cb.C (MenuFax): subst fix.
12447 * src/layout.[hC] + some other files: rewrote to use
12448 std::container to store textclasses and layouts in.
12449 Simplified, removed a lot of code. Make all classes
12450 assignable. Further simplifications and review of type
12451 use still to be one.
12453 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
12454 lastfiles to create the lastfiles partr of the menu.
12456 * src/lastfiles.[Ch]: rewritten to use deque to store the
12457 lastfiles in. Uses fstream for reading and writing. Simplifies
12460 * src/support/syscall.C: remove explicit cast.
12462 * src/BufferView.C (CursorToggleCB): removed code snippets that
12463 were commented out.
12464 use explicat C++ style casts instead of C style casts. also use
12465 u_vdata instea of passing pointers in longs.
12467 * src/PaperLayout.C: removed code snippets that were commented out.
12469 * src/lyx_gui_misc.C: removed code snippets that were commented out.
12471 * src/lyx_main.C: removed code snippets that wer commented out.
12473 * src/paragraph.C: removed code snippets that were commented out.
12475 * src/lyxvc.C (logClose): use static_cast
12477 (viewLog): remove explicit cast to void*
12478 (showLog): removed old commented code
12480 * src/menus.C: use static_cast instead of C style casts. use
12481 u_vdata instead of u_ldata. remove explicit cast to (long) for
12482 pointers. Removed old code that was commented out.
12484 * src/insets/inset.C: removed old commented func
12486 * src/insets/insetref.C (InsetRef): removed old code that had been
12487 commented out for a long time.
12489 (escape): removed C style cast
12491 * src/insets/insetlatexaccent.C (Draw): removed old commented code
12493 * src/insets/insetlatex.C (Draw): removed old commented code
12494 (Read): rewritten to use string
12496 * src/insets/insetlabel.C (escape): removed C style cast
12498 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
12500 * src/insets/insetindex.C: use static_cast and u_vdata, removed
12501 old commented code.
12503 * src/insets/insetinclude.h: removed a couple of stupid bools
12505 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
12506 (Clone): remove C style cast
12507 (getKeys): changed list to lst because of std::list
12509 * src/insets/inseterror.C (Draw): removed som old commented code.
12511 * src/insets/insetcommand.C (Draw): removed some old commented code.
12513 * src/insets/insetbib.C (bibitem_cb): removed code that has been
12514 commented out forever.
12515 (bibitem_cb): use static_cast instead of C style cast
12516 use of vdata changed to u_vdata.
12518 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
12520 (CloseUrlCB): use static_cast instead of C style cast.
12521 (CloseUrlCB): added a fl_free form...it seemed to be missing.
12523 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
12524 (C_InsetInfo_CloseInfoCB): forward the ob parameter
12525 (CloseInfoCB): static_cast from ob->u_vdata instead.
12526 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
12529 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
12530 (C_InsetError_CloseErrorCB): forward the ob parameter
12531 (CloseErrorCB): static_cast from ob->u_vdata instead.
12533 * src/vspace.h: include LString.h since we use string in this class.
12535 * src/vspace.C (lyx_advance): changed name from advance because of
12536 nameclash with stl. And since we cannot use namespaces yet...I
12537 used a lyx_ prefix instead. Expect this to change when we begin
12540 * src/BufferView.[Ch] (BufferView::~BufferView): removed
12542 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
12543 and removed now defunct constructor and deconstructor.
12545 * src/BufferView.h: have backstack as a object not as a pointer.
12546 removed initialization from constructor. added include for BackStack
12548 * development/lyx.spec.in (%build): add CFLAGS also.
12550 * src/screen.C (drawFrame): removed another warning.
12552 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12554 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
12555 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
12556 README and ANNOUNCE a bit for the next release. More work is
12559 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
12560 unbreakable if we are in freespacing mode (LyX-Code), but not in
12563 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
12565 * src/BackStack.h: fixed initialization order in constructor
12567 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
12569 * acinclude.m4 (VERSION): new rules for when a version is
12570 development, added also a variable for prerelease.
12571 (warnings): we set with_warnings=yes for prereleases
12572 (lyx_opt): prereleases compile with same optimization as development
12573 (CXXFLAGS): only use pedantic if we are a development version
12575 * src/BufferView.C (restorePosition): don't do anything if the
12576 backstack is empty.
12578 * src/BackStack.h: added member empty, use this to test if there
12579 is anything to pop...
12581 1999-10-25 Juergen Vigna <jug@sad.it>
12584 * forms/layout_forms.fd +
12585 * forms/latexoptions.fd +
12586 * lyx.fd: changed for various form resize issues
12588 * src/mathed/math_panel.C +
12589 * src/insets/inseterror.C +
12590 * src/insets/insetinfo.C +
12591 * src/insets/inseturl.C +
12592 * src/insets/inseturl.h +
12594 * src/LyXSendto.C +
12595 * src/PaperLayout.C +
12596 * src/ParagraphExtra.C +
12597 * src/TableLayout.C +
12599 * src/layout_forms.C +
12606 * src/menus.C: fixed various resize issues. So now forms can be
12607 resized savely or not be resized at all.
12609 * forms/form_url.fd +
12610 * src/insets/form_url.[Ch]: added because it's cleaner and easier
12613 * src/insets/Makefile.am: added files form_url.[Ch]
12615 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12617 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
12618 (and presumably 6.2).
12620 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
12621 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
12622 remaining static member callbacks.
12624 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
12627 * src/support/lyxstring.h: declare struct Srep as friend of
12628 lyxstring, since DEC cxx complains otherwise.
12630 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12632 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12634 * src/LaTeX.C (run): made run_bibtex also depend on files with
12636 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
12637 are put into the dependency file.
12639 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
12640 the code has shown itself to work
12641 (create_ispell_pipe): removed another warning, added a comment
12644 * src/minibuffer.C (ExecutingCB): removed code that has been
12645 commented out a long time
12647 * src/lyxfunc.C (processKeyEvent): removed some very old commented
12648 out code + a warning.
12650 * src/support/lyxstring.h: comment out the three private
12651 operators, when compiling with string ansi conforming compilers
12652 they make problems.
12654 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
12656 (pixmapFromBitmapData): change type of bdata to be unsigned char *
12657 (pixmapFromBitmapData): add a reinterpret_cast in the call to
12660 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
12663 * src/mathed/math_panel.C (create_math_panel): remove explicit
12666 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
12669 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
12670 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
12671 to XCreatePixmapFromBitmapData
12672 (fl_set_bmtable_data): change the last argument to be unsigned
12674 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
12675 and bh to be unsigned int, remove explicit casts in call to
12676 XReadBitmapFileData.
12678 * images/arrows.xbm: made the arrays unsigned char *
12679 * images/varsz.xbm: ditto
12680 * images/misc.xbm: ditto
12681 * images/greek.xbm: ditto
12682 * images/dots.xbm: ditto
12683 * images/brel.xbm: ditto
12684 * images/bop.xbm: ditto
12686 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
12688 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
12689 (LYX_PROG_CXX): added -pedantic to g++ compile options when
12690 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
12692 (LYX_CXX_CHEADERS): added <clocale> to the test.
12694 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
12696 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
12698 * src/support/lyxstring.C (append): fixed something that must be a
12699 bug, rep->assign was used instead of rep->append.
12701 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
12704 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
12705 lyx insert double chars. Fix spotted by Kayvan.
12707 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12709 * Fixed the tth support. I messed up with the Emacs patch apply feature
12710 and omitted the changes in lyxrc.C.
12712 1999-10-22 Juergen Vigna <jug@sad.it>
12714 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
12716 * src/lyx_cb.C (MenuInsertRef) +
12717 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
12718 the form cannot be resized under it limits (fixes a segfault)
12720 * src/lyx.C (create_form_form_ref) +
12721 * forms/lyx.fd: Changed Gravity on name input field so that it is
12724 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12726 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
12727 <ostream> and <istream>.
12729 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
12730 whether <fstream> provides the latest standard features, or if we
12731 have an oldstyle library (like in egcs).
12732 (LYX_CXX_STL_STRING): fix the test.
12734 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
12735 code on MODERN_STL_STREAM.
12737 * src/support/lyxstring.h: use L{I,O}stream.h.
12739 * src/support/L{I,O}stream.h: new files, designed to setup
12740 correctly streams for our use
12741 - includes the right header depending on STL capabilities
12742 - puts std::ostream and std::endl (for LOStream.h) or
12743 std::istream (LIStream.h) in toplevel namespace.
12745 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12747 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
12748 was a bib file that had been changed we ensure that bibtex is run.
12749 (runBibTeX): enhanced to extract the names of the bib files and
12750 getting their absolute path and enter them into the dep file.
12751 (findtexfile): static func that is used to look for tex-files,
12752 checks for absolute patchs and tries also with kpsewhich.
12753 Alternative ways of finding the correct files are wanted. Will
12755 (do_popen): function that runs a command using popen and returns
12756 the whole output of that command in a string. Should be moved to
12759 * src/DepTable.[Ch] (extchanged): new function that returns true if a
12760 file with extension ext has changed.
12762 * src/insets/figinset.C: added ifdef guards around the fl_free
12763 code that jug commented out. Now it is commented out when
12764 compiling with XForms == 0.89.
12766 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
12767 to lyxstring.C, and only keep a forward declaration in
12768 lyxstring.h. Simplifies the header file a bit and should help a
12769 bit on compile time too. Also changes to Srep will not mandate a
12770 recompile of code just using string.
12771 (~lyxstring): definition moved here since it uses srep.
12772 (size): definition moved here since it uses srep.
12774 * src/support/lyxstring.h: removed a couple of "inline" that should
12777 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12779 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
12782 1999-10-21 Juergen Vigna <jug@sad.it>
12784 * src/table.C (SetPWidth): Just a small fix so the alignment is not
12785 set to left if I just remove the width entry (or it is empty).
12787 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
12788 paragraph when having dummy paragraphs.
12790 1999-10-20 Juergen Vigna <jug@sad.it>
12792 * src/insets/figinset.C: just commented some fl_free_form calls
12793 and added warnings so that this calls should be activated later
12794 again. This avoids for now a segfault, but we have a memory leak!
12796 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
12797 'const char * argument' to 'string argument', this should
12798 fix some Asserts() in lyxstring.C.
12800 * src/lyxfunc.h: Removed the function argAsString(const char *)
12801 as it is not used anymore.
12803 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
12805 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
12808 * src/Literate.h: some funcs moved from public to private to make
12809 interface clearer. Unneeded args removed.
12811 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
12813 (scanBuildLogFile): ditto
12815 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
12816 normal TeX Error. Still room for improvement.
12818 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
12820 * src/buffer.C (insertErrors): changes to make the error
12821 desctription show properly.
12823 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
12826 * src/support/lyxstring.C (helper): changed to use
12827 sizeof(object->rep->ref).
12828 (operator>>): changed to use a pointer instead.
12830 * src/support/lyxstring.h: changed const reference & to value_type
12831 const & lets see if that helps.
12833 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
12835 * Makefile.am (rpmdist): fixed to have non static package and
12838 * src/support/lyxstring.C: removed the compilation guards
12840 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
12843 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
12844 conditional compile of lyxstring.Ch
12846 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
12847 stupid check, but it is a lot better than the bastring hack.
12848 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
12850 * several files: changed string::erase into string::clear. Not
12853 * src/chset.C (encodeString): use a char temporary instead
12855 * src/table.C (TexEndOfCell): added tostr around
12856 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
12857 (TexEndOfCell): ditto
12858 (TexEndOfCell): ditto
12859 (TexEndOfCell): ditto
12860 (DocBookEndOfCell): ditto
12861 (DocBookEndOfCell): ditto
12862 (DocBookEndOfCell): ditto
12863 (DocBookEndOfCell): ditto
12865 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
12867 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
12869 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
12870 (MenuBuildProg): added tostr around ret
12871 (MenuRunChktex): added tostr around ret
12872 (DocumentApplyCB): added tostr around ret
12874 * src/chset.C (encodeString): added tostr around t->ic
12876 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
12877 (makeLaTeXFile): added tostr around tocdepth
12878 (makeLaTeXFile): added tostr around ftcound - 1
12880 * src/insets/insetbib.C (setCounter): added tostr around counter.
12882 * src/support/lyxstring.h: added an operator+=(int) to catch more
12885 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
12886 (lyxstring): We DON'T allow NULL pointers.
12888 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12890 * src/mathed/math_macro.C (MathMacroArgument::Write,
12891 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12892 when writing them out.
12894 * src/LString.C: remove, since it is not used anymore.
12896 * src/support/lyxstring.C: condition the content to
12897 USE_INCLUDED_STRING macro.
12899 * src/mathed/math_symbols.C, src/support/lstrings.C,
12900 src/support/lyxstring.C: add `using' directive to specify what
12901 we need in <algorithm>. I do not think that we need to
12902 conditionalize this, but any thought is appreciated.
12904 * many files: change all callback functions to "C" linkage
12905 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12906 strict_ansi. Those who were static are now global.
12907 The case of callbacks which are static class members is
12908 trickier, since we have to make C wrappers around them (see
12909 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12910 did not finish this yet, since it defeats the purpose of
12911 encapsulation, and I am not sure what the best route is.
12913 1999-10-19 Juergen Vigna <jug@sad.it>
12915 * src/support/lyxstring.C (lyxstring): we permit to have a null
12916 pointer as assignment value and just don't assign it.
12918 * src/vspace.C (nextToken): corrected this function substituting
12919 find_first(_not)_of with find_last_of.
12921 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12922 (TableOptCloseCB) (TableSpeCloseCB):
12923 inserted fl_set_focus call for problem with fl_hide_form() in
12926 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12928 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12931 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12933 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12934 LyXLex::next() and not eatline() to get its argument.
12936 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12938 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12939 instead, use fstreams for io of the depfile, removed unneeded
12940 functions and variables.
12942 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12943 vector instead, removed all functions and variables that is not in
12946 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12948 * src/buffer.C (insertErrors): use new interface to TeXError
12950 * Makefile.am (rpmdist): added a rpmdist target
12952 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12953 per Kayvan's instructions.
12955 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12957 * src/Makefile.am: add a definition for localedir, so that locales
12958 are found after installation (Kayvan)
12960 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12962 * development/.cvsignore: new file.
12964 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12966 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12967 C++ compiler provides wrappers for C headers and use our alternate
12970 * configure.in: use LYX_CXX_CHEADERS.
12972 * src/cheader/: new directory, populated with cname headers from
12973 libstdc++-2.8.1. They are a bit old, but probably good enough for
12974 what we want (support compilers who lack them).
12976 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12977 from includes. It turns out is was stupid.
12979 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12981 * lib/Makefile.am (install-data-local): forgot a ';'
12982 (install-data-local): forgot a '\'
12983 (libinstalldirs): needed after all. reintroduced.
12985 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12987 * configure.in (AC_OUTPUT): added lyx.spec
12989 * development/lyx.spec: removed file
12991 * development/lyx.spec.in: new file
12993 * po/*.po: merged with lyx.pot becuase of make distcheck
12995 * lib/Makefile.am (dist-hook): added dist-hook so that
12996 documentation files will be included when doing a make
12997 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12998 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
13000 more: tried to make install do the right thing, exclude CVS dirs
13003 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
13004 Path would fit in more nicely.
13006 * all files that used to use pathstack: uses now Path instead.
13007 This change was a lot easier than expected.
13009 * src/support/path.h: new file
13011 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
13013 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
13015 * src/support/lyxstring.C (getline): Default arg was given for
13018 * Configure.cmd: removed file
13020 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
13022 * src/support/DebugStream.[Ch]: remove the explicit std:: before
13023 streams classes and types, add the proper 'using' statements when
13024 MODERN_STL is defined.
13026 * src/debug.h: move the << operator definition after the inclusion
13029 * src/support/filetools.C: include "LAssert.h", which is needed
13032 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
13035 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
13036 include "debug.h" to define a proper ostream.
13038 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
13040 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
13041 method to the SystemCall class which can kill a process, but it's
13042 not fully implemented yet.
13044 * src/*.C: Changed Systemcalls::Startscript() to startscript()
13046 * src/support/FileInfo.h: Better documentation
13048 * src/lyxfunc.C: Added support for buffer-export html
13050 * src/menus.C: Added Export->As HTML...
13052 * lib/bind/*.bind: Added short-cut for buffer-export html
13054 * src/lyxrc.*: Added support for new \tth_command
13056 * lib/lyxrc.example: Added stuff for new \tth_command
13058 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
13060 * lib/Makefile.am (IMAGES): removed images/README
13061 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
13062 installes in correct place. Check permisions is installed
13065 * src/LaTeX.C: some no-op changes moved declaration of some
13068 * src/LaTeX.h (LATEX_H): changed include guard name
13070 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
13072 * lib/reLyX/Makefile.am: install noweb2lyx.
13074 * lib/Makefile.am: install configure.
13076 * lib/reLyX/configure.in: declare a config aux dir; set package
13077 name to lyx (not sure what the best solution is); generate noweb2lyx.
13079 * lib/layouts/egs.layout: fix the bibliography layout.
13081 1999-10-08 Jürgen Vigna <jug@sad.it>
13083 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
13084 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
13085 it returned without continuing to search the path.
13087 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
13089 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
13090 also fixes a bug. It is not allowed to do tricks with std::strings
13091 like: string a("hei"); &a[e]; this will not give what you
13092 think... Any reason for the complexity in this func?
13094 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
13096 * Updated README and INSTALL a bit, mostly to check that my
13097 CVS rights are correctly set up.
13099 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
13101 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
13102 does not allow '\0' chars but lyxstring and std::string does.
13104 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
13106 * autogen.sh (AUTOCONF): let the autogen script create the
13107 POTFILES.in file too. POTFILES.in should perhaps now not be
13108 included in the cvs module.
13110 * some more files changed to use C++ includes instead of C ones.
13112 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
13114 (Reread): added tostr to nlink. buggy output otherwise.
13115 (Reread): added a string() around szMode when assigning to Buffer,
13116 without this I got a log of garbled info strings.
13118 * acconfig.h: commented out the PTR_AS_INT macros. They should not
13121 * I have added several ostream & operator<<(ostream &, some_type)
13122 functions. This has been done to avoid casting and warnings when
13123 outputting enums to lyxerr. This as thus eliminated a lot of
13124 explicit casts and has made the code clearer. Among the enums
13125 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
13126 mathed enums, some font enum the Debug::type enum.
13128 * src/support/lyxstring.h (clear): missing method. equivalent of
13131 * all files that contained "stderr": rewrote constructs that used
13132 stderr to use lyxerr instead. (except bmtable)
13134 * src/support/DebugStream.h (level): and the passed t with
13135 Debug::ANY to avoid spurious bits set.
13137 * src/debug.h (Debug::type value): made it accept strings of the
13138 type INFO,INIT,KEY.
13140 * configure.in (Check for programs): Added a check for kpsewhich,
13141 the latex generation will use this later to better the dicovery of
13144 * src/BufferView.C (create_view): we don't need to cast this to
13145 (void*) that is done automatically.
13146 (WorkAreaButtonPress): removed some dead code.
13148 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
13150 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
13151 is not overwritten when translated (David Sua'rez de Lis).
13153 * lib/CREDITS: Added David Sua'rez de Lis
13155 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
13157 * src/bufferparams.C (BufferParams): default input encoding is now
13160 * acinclude.m4 (cross_compiling): comment out macro
13161 LYX_GXX_STRENGTH_REDUCE.
13163 * acconfig.h: make sure that const is not defined (to empty) when
13164 we are compiling C++. Remove commented out code using SIZEOF_xx
13167 * configure.in : move the test for const and inline as late as
13168 possible so that these C tests do not interefere with C++ ones.
13169 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
13170 has not been proven.
13172 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
13174 * src/table.C (getDocBookAlign): remove bad default value for
13175 isColumn parameter.
13177 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
13179 (ShowFileMenu2): ditto.
13181 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
13182 of files to ignore.
13184 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
13186 * Most files: finished the change from the old error code to use
13187 DebugStream for all lyxerr debugging. Only minor changes remain
13188 (e.g. the setting of debug levels using strings instead of number)
13190 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
13192 * src/layout.C (Add): Changed to use compare_no_case instead of
13195 * src/FontInfo.C: changed loop variable type too string::size_type.
13197 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
13199 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
13200 set ETAGS_ARGS to --c++
13202 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
13204 * src/table.C (DocBookEndOfCell): commented out two unused variables
13206 * src/paragraph.C: commented out four unused variables.
13208 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
13209 insed a if clause with type string::size_type.
13211 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
13214 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
13216 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
13217 variable, also changed loop to go from 0 to lenght + 1, instead of
13218 -1 to length. This should be correct.
13220 * src/LaTeX.C (scanError): use string::size_type as loop variable
13223 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
13224 (l.896) since y_tmp and row was not used anyway.
13226 * src/insets/insetref.C (escape): use string::size_type as loop
13229 * src/insets/insetquotes.C (Width): use string::size_type as loop
13231 (Draw): use string::size_type as loop variable type.
13233 * src/insets/insetlatexaccent.C (checkContents): use
13234 string::size_type as loop variable type.
13236 * src/insets/insetlabel.C (escape): use string::size_type as loop
13239 * src/insets/insetinfo.C: added an extern for current_view.
13241 * src/insets/insetcommand.C (scanCommand): use string::size_type
13242 as loop variable type.
13244 * most files: removed the RCS tags. With them we had to recompile
13245 a lot of files after a simple cvs commit. Also we have never used
13246 them for anything meaningful.
13248 * most files: tags-query-replace NULL 0. As adviced several plases
13249 we now use "0" instead of "NULL" in our code.
13251 * src/support/filetools.C (SpaceLess): use string::size_type as
13252 loop variable type.
13254 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
13256 * src/paragraph.C: fixed up some more string stuff.
13258 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
13260 * src/support/filetools.h: make modestr a std::string.
13262 * src/filetools.C (GetEnv): made ch really const.
13264 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
13265 made code that used these use max/min from <algorithm> instead.
13267 * changed several c library include files to their equivalent c++
13268 library include files. All is not changed yet.
13270 * created a support subdir in src, put lyxstring and lstrings
13271 there + the extra files atexit, fileblock, strerror. Created
13272 Makefile.am. edited configure.in and src/Makefile.am to use this
13273 new subdir. More files moved to support.
13275 * imported som of the functions from repository lyx, filetools
13277 * ran tags-query-replace on LString -> string, corrected the bogus
13278 cases. Tried to make use of lstrings.[hC], debugged a lot. There
13279 is still some errors in there. This is errors where too much or
13280 too litle get deleted from strings (string::erase, string::substr,
13281 string::replace), there can also be some off by one errors, or
13282 just plain wrong use of functions from lstrings. Viewing of quotes
13285 * LyX is now running fairly well with string, but there are
13286 certainly some bugs yet (see above) also string is quite different
13287 from LString among others in that it does not allow null pointers
13288 passed in and will abort if it gets any.
13290 * Added the revtex4 files I forgot when setting up the repository.
13292 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
13294 * All over: Tried to clean everything up so that only the files
13295 that we really need are included in the cvs repository.
13296 * Switched to use automake.
13297 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
13298 * Install has not been checked.
13300 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
13302 * po/pt.po: Three errors:
13303 l.533 and l.538 format specification error
13304 l. 402 duplicate entry, I just deleted it.