1 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3 * lib/images/*: rename a bunch of icons to match Dekel converter
6 * src/buffer.C (SimpleLinuxDocOnePar): add a const qualifier to
9 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
11 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
13 * sigc++/handle.h: ditto for class Handle.
15 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
17 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
19 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
21 * src/intl.C (InitKeyMapper): Correct the value of n due to the
22 removal of the "default" language.
24 * src/combox.h (getline): Check that sel > 0
26 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
28 * lib/examples/docbook_example.lyx
29 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
31 * lib/layouts/docbook-book.layout: new docbook book layout.
33 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
35 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
37 * src/insets/figinset.C (DocBook):fixed small typo.
39 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
41 * src/insets/insetinclude.h: string include_label doesn't need to be
44 2000-09-29 Allan Rae <rae@lyx.org>
46 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
47 Allow derived type to control connection and disconnection from signals
48 of its choice if desired.
50 2000-09-28 Juergen Vigna <jug@sad.it>
52 * src/insets/insettabular.C (update): fixed cursor setting when
53 the_locking_inset changed.
54 (draw): made this a bit cleaner.
55 (InsetButtonPress): fixed!
57 * various files: added LyXText Parameter to fitCursor call.
59 * src/BufferView.C (fitCursor): added LyXText parameter.
61 * src/insets/insettabular.C (draw): small draw fix.
63 * src/tabular.C: right setting of left/right celllines.
65 * src/tabular.[Ch]: fixed various types in funcions and structures.
66 * src/insets/insettabular.C: ditto
67 * src/frontends/xforms/FormTabular.C: ditto
69 2000-09-28 Allan Rae <rae@lyx.org>
71 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
72 that the #ifdef's had been applied to part of what should have been
73 a complete condition. It's possible there are other tests that
74 were specific to tables that are also wrong now that InsetTabular is
75 being used. Now we need to fix the output of '\n' after a table in a
76 float for the same reason as the original condition:
77 "don't insert this if we would be adding it before or after a table
78 in a float. This little trick is needed in order to allow use of
79 tables in \subfigures or \subtables."
80 Juergen can you check this?
82 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
84 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
85 outputed to the ostream.
87 * several files: fixed types based on warnings from cxx
89 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
91 * src/frontends/kde/Makefile.am: fix rule for
92 formindexdialogdata_moc.C
94 * src/.cvsignore: add ext_l10n.h to ignore
96 * acconfig.h: stop messing with __STRICT_ANSI__
97 * config/gnome.m4: remove option to set -ansi
98 * config/kde.m4: remove option to set -ansi
99 * config/lyxinclude.m4: don't set -ansi
101 2000-09-27 Juergen Vigna <jug@sad.it>
103 * various files: remove "default" language check.
105 * src/insets/insetquotes.C: removed use of current_view.
107 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
108 the one should have red ears by now!
110 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
111 in more then one paragraph. Fixed cursor-movement/selection.
113 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
114 paragraphs inside a text inset.
116 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
117 text-inset if this owner is an inset.
119 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
121 * src/Bullet.h: changed type of font, character and size to int
123 * src/buffer.C (asciiParagraph): remove actcell and fname1.
125 * src/insets/inseturl.[Ch]:
126 * src/insets/insetref.[Ch]:
127 * src/insets/insetlabel.[Ch]: add linelen to Ascii
129 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
131 * src/buffer.C (readFile): block-if statement rearranged to minimise
132 bloat. Patch does not reverse Jean-Marc's change ;-)
134 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
135 Class rewritten to store pointers to hide/update signals directly,
136 rather than Dialogs *. Also defined an enum to ease use. All xforms
137 forms can now be derived from this class.
139 * src/frontends/xforms/FormCommand.[Ch]
140 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
142 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
145 * src/frontends/xforms/forms/form_citation.fd
146 * src/frontends/xforms/forms/form_copyright.fd
147 * src/frontends/xforms/forms/form_error.fd
148 * src/frontends/xforms/forms/form_index.fd
149 * src/frontends/xforms/forms/form_ref.fd
150 * src/frontends/xforms/forms/form_toc.fd
151 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
153 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
155 * src/insets/insetfoot.C: removed redundent using directive.
157 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
159 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
160 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
162 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
163 created in the constructors in different groups. Then set() just
164 have to show the groups as needed. This fixes the redraw problems
165 (and is how the old menu code worked).
167 * src/support/lyxlib.h: declare the methods as static when we do
170 2000-09-26 Juergen Vigna <jug@sad.it>
172 * src/buffer.C (asciiParagraph): new function.
173 (writeFileAscii): new function with parameter ostream.
174 (writeFileAscii): use now asciiParagraph.
176 * various inset files: added the linelen parameter to the Ascii-func.
178 * src/tabular.C (Write): fixed error in writing file introduced by
179 the last changes from Lars.
181 * lib/bind/menus.bind: removed not supported functions.
183 * src/insets/insettext.C (Ascii): implemented this function.
185 * src/insets/lyxinset.h (Ascii): added linelen parameter.
187 * src/tabular.C (write_attribute[int,string,bool]): new functions.
188 (Write): use of the write_attribute functions.
190 * src/bufferlist.C (close): fixed reasking question!
192 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
194 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
195 new files use the everwhere possible.
198 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
199 src/log_form.C src/lyx.C:
202 * src/buffer.C (runLaTeX): remove func
204 * src/PaperLayout.C: removed file
205 * src/ParagraphExtra.C: likewise
206 * src/bullet_forms.C: likewise
207 * src/bullet_forms.h: likewise
208 * src/bullet_forms_cb.C: likewise
210 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
211 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
214 * several files: remove all traces of the old fd_form_paragraph,
215 and functions belonging to that.
217 * several files: remove all traces of the old fd_form_document,
218 and functions belonging to that.
220 * several files: constify local variables were possible.
222 * several files: remove all code that was dead when NEW_EXPORT was
225 * several files: removed string::c_str in as many places as
228 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
229 (e): be a bit more outspoken when patching
230 (updatesrc): only move files if changed.
232 * forms/layout_forms.h.patch: regenerated
234 * forms/layout_forms.fd: remove form_document and form_paragraph
235 and form_quotes and form_paper and form_table_options and
238 * forms/form1.fd: remove form_table
240 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
241 the fdui->... rewrite. Update some comments to xforms 0.88
243 * forms/bullet_forms.C.patch: removed file
244 * forms/bullet_forms.fd: likewise
245 * forms/bullet_forms.h.patch: likewise
247 * development/Code_rules/Rules: added a section on switch
248 statements. Updated some comment to xforms 0.88.
250 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
252 * src/buffer.C (readFile): make sure that the whole version number
253 is read after \lyxformat (even when it contains a comma)
255 * lib/ui/default.ui: change shortcut of math menu to M-a.
257 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
259 * src/vspace.C (nextToken): use isStrDbl() to check for proper
262 * src/LyXView.C (updateWindowTitle): show the full files name in
263 window title, limited to 30 characters.
265 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
266 When a number of characters has been given, we should not assume
267 that the string is 0-terminated.
269 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
270 calls (fixes some memory leaks)
272 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
273 trans member on exit.
275 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
277 * src/converter.C (GetReachable): fix typo.
279 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
280 understand ',' instead of '.'.
281 (GetInteger): rewrite to use strToInt().
283 2000-09-26 Juergen Vigna <jug@sad.it>
285 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
286 better visibility and error-message on wrong VSpace input.
288 * src/language.C (initL): added english again.
290 2000-09-25 Juergen Vigna <jug@sad.it>
292 * src/frontends/kde/Dialogs.C (Dialogs):
293 * src/frontends/gnome/Dialogs.C (Dialogs):
294 * src/frontends/kde/Makefile.am:
295 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
297 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
299 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
301 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
303 * src/frontends/xforms/FormParagraph.C:
304 * src/frontends/xforms/FormParagraph.h:
305 * src/frontends/xforms/form_paragraph.C:
306 * src/frontends/xforms/form_paragraph.h:
307 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
310 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
312 * src/tabular.C (OldFormatRead): forgot to delete the temporary
313 Paragraph-Data after use.
315 * src/insets/insettext.C (LocalDispatch): don't set the layout on
316 non breakable paragraphs.
318 2000-09-25 Garst R. Reese <reese@isn.net>
320 * src/language.C (initL): added missing language_country codes.
322 2000-09-25 Juergen Vigna <jug@sad.it>
324 * src/insets/insettext.C (InsetText):
325 (deleteLyXText): remove the not released LyXText structure!
327 2000-09-24 Marko Vendelin <markov@ioc.ee>
329 * src/frontends/gnome/mainapp.C
330 * src/frontends/gnome/mainapp.h: added support for keyboard
333 * src/frontends/gnome/FormCitation.C
334 * src/frontends/gnome/FormCitation.h
335 * src/frontends/gnome/Makefile.am
336 * src/frontends/gnome/pixbutton.h: completed the rewrite of
337 FormCitation to use "action area" in mainapp window
339 * src/frontends/gnome/Menubar_pimpl.C
340 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
343 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
345 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
346 width/descent/ascent values if name is empty.
347 (mathed_string_height): Use std::max.
349 2000-09-25 Allan Rae <rae@lyx.org>
351 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
352 segfault. This will be completely redesigned soon.
354 * sigc++: updated libsigc++. Fixes struct timespec bug.
356 * development/tools/makeLyXsigc.sh: .cvsignore addition
358 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
360 * several files: removed almost all traces of the old table
363 * src/TableLayout.C: removed file
365 2000-09-22 Juergen Vigna <jug@sad.it>
367 * src/frontends/kde/Dialogs.C: added credits forms.
369 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
371 * src/frontends/gnome/Dialogs.C: added some forms.
373 * src/spellchecker.C (init_spell_checker): set language in pspell code
374 (RunSpellChecker): some modifications for setting language string.
376 * src/language.[Ch]: added language_country code.
378 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
380 * src/frontends/Dialogs.h: added new signal showError.
381 Rearranged existing signals in some sort of alphabetical order.
383 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
384 FormError.[Ch], form_error.[Ch]
385 * src/frontends/xforms/forms/makefile: added new file form_error.fd
386 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
388 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
389 dialogs. I think that this can be used as the base to all these
392 * src/frontends/xforms/FormError.[Ch]
393 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
394 implementation of InsetError dialog.
396 * src/insets/inseterror.[Ch]: rendered GUI-independent.
398 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
399 * src/frontends/kde/Makefile.am: ditto
401 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
403 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
404 macrobf. This fixes a bug of invisible text.
406 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
408 * lib/doc/LaTeXConfig.lyx.in: updated.
410 * src/language.C (initL): remove language "francais" and change a
411 bit the names of the two other french variations.
413 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
414 string that may not be 0-terminated.
416 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
418 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
420 2000-09-20 Marko Vendelin <markov@ioc.ee>
422 * src/frontends/gnome/FormCitation.C
423 * src/frontends/gnome/FormIndex.C
424 * src/frontends/gnome/FormToc.C
425 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
426 the variable initialization to shut up the warnings
428 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
430 * src/table.[Ch]: deleted files
432 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
435 2000-09-18 Juergen Vigna <jug@sad.it>
437 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
438 problems with selection. Inserted new LFUN_PASTESELECTION.
439 (InsetButtonPress): inserted handling of middle mouse-button paste.
441 * src/spellchecker.C: changed word to word.c_str().
443 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
445 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
446 included in the ``make dist'' tarball.
448 2000-09-15 Juergen Vigna <jug@sad.it>
450 * src/CutAndPaste.C (cutSelection): small fix return the right
451 end position after cut inside one paragraph only.
453 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
454 we are locked as otherwise we don't have a valid cursor position!
456 * src/insets/figinset.C (draw): small bugfix but why is this needed???
458 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
460 * src/frontends/kde/FormRef.C: added using directive.
461 * src/frontends/kde/FormToc.C: ditto
463 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
465 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
467 2000-09-19 Marko Vendelin <markov@ioc.ee>
469 * src/frontends/gnome/Menubar_pimpl.C
470 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
471 Toc, ViewFormats, UpdateFormats, and ExportFormats.
473 * src/frontends/gnome/mainapp.C
474 * src/frontends/gnome/mainapp.h: support for menu update used
477 * src/frontends/gnome/mainapp.C
478 * src/frontends/gnome/mainapp.h: support for "action" area in the
479 main window. This area is used by small simple dialogs, such as
482 * src/frontends/gnome/FormIndex.C
483 * src/frontends/gnome/FormIndex.h
484 * src/frontends/gnome/FormUrl.C
485 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
488 * src/frontends/gnome/FormCitation.C
489 * src/frontends/gnome/FormCitation.h: rewrite to use main window
490 action area. Only "Insert new citation" is implemented.
492 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
494 * src/buffer.C (Dispatch): fix call to Dispatch
495 * src/insets/insetref.C (Edit): likewise
496 * src/insets/insetparent.C (Edit): likewise
497 * src/insets/insetinclude.C (include_cb): likewise
498 * src/frontends/xforms/FormUrl.C (apply): likewise
499 * src/frontends/xforms/FormToc.C (apply): likewise
500 * src/frontends/xforms/FormRef.C (apply): likewise
501 * src/frontends/xforms/FormIndex.C (apply): likewise
502 * src/frontends/xforms/FormCitation.C (apply): likewise
503 * src/lyxserver.C (callback): likewise
504 * src/lyxfunc.C (processKeySym): likewise
507 * src/lyx_cb.C (LayoutsCB): likewise
509 * Makefile.am (sourcedoc): small change
511 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
513 * src/main.C (main): Don't make an empty GUIRunTime object. all
514 methods are static. constify a bit remove unneded using + headers.
516 * src/tabular.C: some more const to local vars move some loop vars
518 * src/spellchecker.C: added some c_str after some word for pspell
520 * src/frontends/GUIRunTime.h: add new static method setDefaults
521 * src/frontends/xforms/GUIRunTime.C (setDefaults):
522 * src/frontends/kde/GUIRunTime.C (setDefaults):
523 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
525 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
526 with strnew in arg, use correct emptystring when calling SetName.
528 * several files: remove all commented code with relation to
529 HAVE_SSTREAM beeing false. We now only support stringstream and
532 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
534 * src/lyxfunc.C: construct correctly the automatic new file
537 * src/text2.C (IsStringInText): change type of variable i to shut
540 * src/support/sstream.h: do not use namespaces if the compiler
541 does not support them.
543 2000-09-15 Marko Vendelin <markov@ioc.ee>
544 * src/frontends/gnome/FormCitation.C
545 * src/frontends/gnome/FormCitation.h
546 * src/frontends/gnome/diainsertcitation_interface.c
547 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
548 regexp support to FormCitation [Gnome].
550 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
553 * configure.in: remove unused KDE/GTKGUI define
555 * src/frontends/kde/FormRef.C
556 * src/frontends/kde/FormRef.h
557 * src/frontends/kde/formrefdialog.C
558 * src/frontends/kde/formrefdialog.h: double click will
559 go to reference, now it is possible to change a cross-ref
562 * src/frontends/kde/FormToc.C
563 * src/frontends/kde/FormToc.h
564 * src/frontends/kde/formtocdialog.C
565 * src/frontends/kde/formtocdialog.h: add a depth
568 * src/frontends/kde/Makefile.am: add QtLyXView.h
571 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
573 * src/frontends/kde/FormCitation.h: added some using directives.
575 * src/frontends/kde/FormToc.h: corrected definition of doTree.
577 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
580 * src/mathed/math_defs.h: redefine SetAlign to use string rather
583 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
585 * src/buffer.C (pop_tag): revert for the second time a change by
586 Lars, who seems to really hate having non-local loop variables :)
588 * src/Lsstream.h: add "using" statements.
590 * src/support/copy.C (copy): add a bunch of std:: qualifiers
591 * src/buffer.C (writeFile): ditto
593 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
595 * src/buffer.C (writeFile): try to fix the locale modified format
596 number to always be as we want it.
598 * src/WorkArea.C (work_area_handler): try to workaround the bugs
599 in XForms 0.89. C-space is now working again.
601 * src/Lsstream.h src/support/sstream.h: new files.
603 * also commented out all cases where strstream were used.
605 * src/Bullet.h (c_str): remove method.
607 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
609 * a lot of files: get rid of "char const *" and "char *" is as
610 many places as possible. We only want to use them in interaction
611 with system of other libraries, not inside lyx.
613 * a lot of files: return const object is not of pod type. This
614 helps ensure that temporary objects is not modified. And fits well
615 with "programming by contract".
617 * configure.in: check for the locale header too
619 * Makefile.am (sourcedoc): new tag for generation of doc++
622 2000-09-14 Juergen Vigna <jug@sad.it>
624 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
625 callback to check which combo called it and do the right action.
627 * src/combox.C (combo_cb): added combo * to the callbacks.
628 (Hide): moved call of callback after Ungrab of the pointer.
630 * src/intl.h: removed LCombo2 function.
632 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
633 function as this can now be handled in one function.
635 * src/combox.h: added Combox * to callback prototype.
637 * src/frontends/xforms/Toolbar_pimpl.C:
638 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
640 2000-09-14 Garst Reese <reese@isn.net>
642 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
643 moved usepackage{xxx}'s to beginning of file. Changed left margin
644 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
645 underlining from title. Thanks to John Culleton for useful suggestions.
647 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
649 * src/lyxlex_pimpl.C (setFile): change error message to debug
652 2000-09-13 Juergen Vigna <jug@sad.it>
654 * src/frontends/xforms/FormDocument.C: implemented choice_class
655 as combox and give callback to combo_language so OK/Apply is activated
658 * src/bufferlist.C (newFile): small fix so already named files
659 (via an open call) are not requested to be named again on the
662 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
664 * src/frontends/kde/Makefile.am
665 * src/frontends/kde/FormRef.C
666 * src/frontends/kde/FormRef.h
667 * src/frontends/kde/formrefdialog.C
668 * src/frontends/kde/formrefdialog.h: implement
671 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
673 * src/frontends/kde/formtocdialog.C
674 * src/frontends/kde/formtocdialog.h
675 * src/frontends/kde/FormToc.C
676 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
678 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
680 * src/frontends/kde/FormCitation.C: fix thinko
681 where we didn't always display the reference text
684 * src/frontends/kde/formurldialog.C
685 * src/frontends/kde/formurldialog.h
686 * src/frontends/kde/FormUrl.C
687 * src/frontends/kde/FormUrl.h: minor cleanups
689 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
691 * src/frontends/kde/Makefile.am
692 * src/frontends/kde/FormToc.C
693 * src/frontends/kde/FormToc.h
694 * src/frontends/kde/FormCitation.C
695 * src/frontends/kde/FormCitation.h
696 * src/frontends/kde/FormIndex.C
697 * src/frontends/kde/FormIndex.h
698 * src/frontends/kde/formtocdialog.C
699 * src/frontends/kde/formtocdialog.h
700 * src/frontends/kde/formcitationdialog.C
701 * src/frontends/kde/formcitationdialog.h
702 * src/frontends/kde/formindexdialog.C
703 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
705 2000-09-12 Juergen Vigna <jug@sad.it>
707 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
710 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
712 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
715 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
717 * src/converter.C (Add, Convert): Added support for converter flags:
718 needaux, resultdir, resultfile.
719 (Convert): Added new parameter view_file.
720 (dvips_options): Fixed letter paper option.
722 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
723 (Export, GetExportableFormats, GetViewableFormats): Added support
726 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
728 (easyParse): Fixed to work with new export code.
730 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
733 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
735 * lib/bind/*.bind: Replaced
736 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
737 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
739 2000-09-11 Juergen Vigna <jug@sad.it>
741 * src/lyx_gui.C (runTime): uses global guiruntime variable.
743 * src/main.C (main): now GUII defines global guiruntime!
745 * src/frontends/gnome/GUIRunTime.C (initApplication):
746 * src/frontends/kde/GUIRunTime.C (initApplication):
747 * src/frontends/xforms/GUIRunTime.C (initApplication):
748 * src/frontends/GUIRunTime.h: added new function initApplication.
750 * src/spellchecker.C (sc_accept_word): change to add_to_session.
752 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
754 2000-09-08 Juergen Vigna <jug@sad.it>
756 * src/lyx_gui.C (create_forms): don't display the "default" entry as
757 we have already "Reset".
759 * src/language.C (initL): inserted "default" language and made this
760 THE default language (and not american!)
762 * src/paragraph.C: inserted handling of "default" language!
764 * src/lyxfont.C: ditto
768 * src/paragraph.C: output the \\par only if we have a following
769 paragraph otherwise it's not needed.
771 2000-09-05 Juergen Vigna <jug@sad.it>
773 * config/pspell.m4: added entry to lyx-flags
775 * src/spellchecker.C: modified version from Kevin for using pspell
777 2000-09-01 Marko Vendelin <markov@ioc.ee>
778 * src/frontends/gnome/Makefile.am
779 * src/frontends/gnome/FormCitation.C
780 * src/frontends/gnome/FormCitation.h
781 * src/frontends/gnome/diainsertcitation_callbacks.c
782 * src/frontends/gnome/diainsertcitation_callbacks.h
783 * src/frontends/gnome/diainsertcitation_interface.c
784 * src/frontends/gnome/diainsertcitation_interface.h
785 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
786 dialog for Gnome frontend
788 * src/main.C: Gnome libraries require keeping application name
789 and its version as strings
791 * src/frontends/gnome/mainapp.C: Change the name of the main window
792 from GnomeLyX to PACKAGE
794 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
796 * src/frontends/Liason.C: add "using: declaration.
798 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
800 * src/mathed/math_macro.C (Metrics): Set the size of the template
802 * src/mathed/formulamacro.C (Latex): Fixed the returned value
804 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
806 * src/converter.C (add_options): New function.
807 (SetViewer): Change $$FName into '$$FName'.
808 (View): Add options when running xdvi
809 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
810 (Convert): The 3rd parameter is now the desired filename. Converts
811 calls to lyx::rename if necessary.
812 Add options when running dvips.
813 (dvi_papersize,dvips_options): New methods.
815 * src/exporter.C (Export): Use getLatexName() instead of fileName().
817 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
818 using a call to Converter::dvips_options.
819 Fixed to work with nex export code.
822 * src/support/rename.C: New files
824 * src/support/syscall.h
825 * src/support/syscall.C: Added Starttype SystemDontWait.
827 * lib/ui/default.ui: Changed to work with new export code
829 * lib/configure.m4: Changed to work with new export code
831 * src/encoding.C: Changed latex name for iso8859_7 encoding.
833 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
835 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
836 so that code compiles with DEC cxx.
838 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
839 to work correctly! Also now supports the additional elements
842 2000-09-01 Allan Rae <rae@lyx.org>
844 * src/frontends/ButtonPolicies.C: renamed all the references to
845 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
847 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
848 since it's a const not a type.
850 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
852 2000-08-31 Juergen Vigna <jug@sad.it>
854 * src/insets/figinset.C: Various changes to look if the filename has
855 an extension and if not add it for inline previewing.
857 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
859 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
860 make buttonStatus and isReadOnly be const methods. (also reflect
861 this in derived classes.)
863 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
864 (nextState): change to be static inline, pass the StateMachine as
866 (PreferencesPolicy): remove casts
867 (OkCancelPolicy): remvoe casts
868 (OkCancelReadOnlyPolicy): remove casts
869 (NoRepeatedApplyReadOnlyPolicy): remove casts
870 (OkApplyCancelReadOnlyPolicy): remove casts
871 (OkApplyCancelPolicy): remove casts
872 (NoRepeatedApplyPolicy): remove casts
874 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
876 * src/converter.C: added some using directives
878 * src/frontends/ButtonPolicies.C: changes to overcome
879 "need lvalue" error with DEC c++
881 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
882 to WMHideCB for DEC c++
884 * src/frontends/xforms/Menubar_pimpl.C: added using directive
886 * src/frontends/xforms/forms/form_document.C.patch: use C callback
887 to BulletBMTableCB for DEC c++
889 2000-08-31 Allan Rae <rae@lyx.org>
891 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
892 character dialog separately from old document dialogs combo_language.
895 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
897 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
898 Removed LFUN_REF_CREATE.
900 * src/MenuBackend.C: Added new tags: toc and references
902 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
903 (add_lastfiles, add_documents, add_formats): Removed the unused smn
905 (add_toc, add_references): New methods.
906 (create_submenu): Handle correctly the case when there is a
907 seperator after optional menu items.
909 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
910 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
911 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
913 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
915 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
917 * src/converter.[Ch]: New file for converting between different
920 * src/export.[Ch]: New file for exporting a LyX file to different
923 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
924 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
925 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
926 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
927 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
928 RunDocBook, MenuExport.
930 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
931 Exporter::Preview methods if NEW_EXPORT is defined.
933 * src/buffer.C (Dispatch): Use Exporter::Export.
935 * src/lyxrc.C: Added new tags: \converter and \viewer.
938 * src/LyXAction.C: Define new lyx-function: buffer-update.
939 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
940 when NEW_EXPORT is defined.
942 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
944 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
946 * lib/ui/default.ui: Added submenus "view" and "update" to the
949 * src/filetools.C (GetExtension): New function.
951 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
953 2000-08-29 Allan Rae <rae@lyx.org>
955 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
957 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
958 (EnableDocumentLayout): removed
959 (DisableDocumentLayout): removed
960 (build): make use of ButtonController's read-only handling to
961 de/activate various objects. Replaces both of the above functions.
963 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
964 (readOnly): was read_only
965 (refresh): fixed dumb mistakes with read_only_ handling
967 * src/frontends/xforms/forms/form_document.fd:
968 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
969 tabbed dialogs so the tabs look more like tabs and so its easier to
970 work out which is the current tab.
972 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
973 segfault with form_table
975 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
977 2000-08-28 Juergen Vigna <jug@sad.it>
979 * acconfig.h: added USE_PSPELL.
981 * src/config.h.in: added USE_PSPELL.
983 * autogen.sh: added pspell.m4
985 * config/pspell.m4: new file.
987 * src/spellchecker.C: implemented support for pspell libary.
989 2000-08-25 Juergen Vigna <jug@sad.it>
991 * src/LyXAction.C (init): renamed LFUN_TABLE to
992 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
994 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
996 * src/lyxscreen.h: add force_clear variable and fuction to force
997 a clear area when redrawing in LyXText.
999 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
1001 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1003 * some whitespace and comment changes.
1005 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
1007 * src/buffer.C: up te LYX_FORMAT to 2.17
1009 2000-08-23 Juergen Vigna <jug@sad.it>
1011 * src/BufferView_pimpl.C (tripleClick): disable this when in a
1014 * src/insets/insettabular.C (pasteSelection): delete the insets
1015 LyXText as it is not valid anymore.
1016 (copySelection): new function.
1017 (pasteSelection): new function.
1018 (cutSelection): new function.
1019 (LocalDispatch): implemented cut/copy/paste of cell selections.
1021 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
1022 don't have a LyXText.
1024 * src/LyXAction.C (init): a NEW_TABULAR define too much.
1026 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
1029 2000-08-22 Juergen Vigna <jug@sad.it>
1031 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
1032 ifdef form_table out if NEW_TABULAR.
1034 2000-08-21 Juergen Vigna <jug@sad.it>
1036 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
1037 (draw): fixed draw position so that the cursor is positioned in the
1039 (InsetMotionNotify): hide/show cursor so the position is updated.
1040 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
1041 using cellstart() function where it should be used.
1043 * src/insets/insettext.C (draw): ditto.
1045 * src/tabular.C: fixed initialization of some missing variables and
1046 made BoxType into an enum.
1048 2000-08-22 Marko Vendelin <markov@ioc.ee>
1049 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
1050 stock menu item using action numerical value, not its string
1054 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
1056 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
1057 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
1059 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
1061 * src/frontends/xforms/GUIRunTime.C: new file
1063 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
1064 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1066 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
1068 * src/frontends/kde/GUIRunTime.C: new file
1070 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
1071 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1073 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
1075 * src/frontends/gnome/GUIRunTime.C: new file
1077 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
1080 * src/frontends/GUIRunTime.h: removed constructor and destructor,
1081 small change to documetentation.
1083 * src/frontends/GUIRunTime.C: removed file
1085 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
1087 * src/lyxparagraph.h: enable NEW_TABULAR as default
1089 * src/lyxfunc.C (processKeySym): remove some commented code
1091 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
1092 NEW_TABULAR around the fd_form_table_options.
1094 * src/lyx_gui.C (runTime): call the static member function as
1095 GUIRunTime::runTime().
1097 2000-08-21 Allan Rae <rae@lyx.org>
1099 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
1102 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
1104 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
1106 2000-08-21 Allan Rae <rae@lyx.org>
1108 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
1109 keep Garst happy ;-)
1110 * src/frontends/xforms/FormPreferences.C (build): use setOK
1111 * src/frontends/xforms/FormDocument.C (build): use setOK
1112 (FormDocument): use the appropriate policy.
1114 2000-08-21 Allan Rae <rae@lyx.org>
1116 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
1117 automatic [de]activation of arbitrary objects when in a read-only state.
1119 * src/frontends/ButtonPolicies.h: More documentation
1120 (isReadOnly): added to support the above.
1122 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
1124 2000-08-18 Juergen Vigna <jug@sad.it>
1126 * src/insets/insettabular.C (getStatus): changed to return func_status.
1128 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
1129 display toggle menu entries if they are.
1131 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
1132 new document layout now.
1134 * src/lyxfunc.C: ditto
1136 * src/lyx_gui_misc.C: ditto
1138 * src/lyx_gui.C: ditto
1140 * lib/ui/default.ui: removed paper and quotes layout as they are now
1141 all in the document layout tabbed folder.
1143 * src/frontends/xforms/forms/form_document.fd: added Restore
1144 button and callbacks for all inputs for Allan's ButtonPolicy.
1146 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
1147 (CheckChoiceClass): added missing params setting on class change.
1148 (UpdateLayoutDocument): added for updating the layout on params.
1149 (build): forgot to RETURN_ALWAYS input_doc_spacing.
1150 (FormDocument): Implemented Allan's ButtonPolicy with the
1153 2000-08-17 Allan Rae <rae@lyx.org>
1155 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
1156 so we can at least see the credits again.
1158 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
1159 controller calls for the appropriate callbacks. Note that since Ok
1160 calls apply followed by cancel, and apply isn't a valid input for the
1161 APPLIED state, the bc_ calls have to be made in the static callback not
1162 within each of the real callbacks.
1164 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
1165 (setOk): renamed from setOkay()
1167 2000-08-17 Juergen Vigna <jug@sad.it>
1169 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
1170 in the implementation part.
1171 (composeUIInfo): don't show optional menu-items.
1173 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
1175 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
1177 * src/bufferview_funcs.C (CurrentState): fixed to show also the
1178 text-state when in a text-inset.
1180 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
1182 2000-08-17 Marko Vendelin <markov@ioc.ee>
1183 * src/frontends/gnome/FormIndex.C
1184 * src/frontends/gnome/FormIndex.h
1185 * src/frontends/gnome/FormToc.C
1186 * src/frontends/gnome/FormToc.h
1187 * src/frontends/gnome/dialogs
1188 * src/frontends/gnome/diatoc_callbacks.c
1189 * src/frontends/gnome/diatoc_callbacks.h
1190 * src/frontends/gnome/diainsertindex_callbacks.h
1191 * src/frontends/gnome/diainsertindex_callbacks.c
1192 * src/frontends/gnome/diainsertindex_interface.c
1193 * src/frontends/gnome/diainsertindex_interface.h
1194 * src/frontends/gnome/diatoc_interface.h
1195 * src/frontends/gnome/diatoc_interface.c
1196 * src/frontends/gnome/Makefile.am: Table of Contents and
1197 Insert Index dialogs implementation for Gnome frontend
1199 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
1201 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
1203 * src/frontends/gnome/diainserturl_interface.c: make the dialog
1206 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1208 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
1209 destructor. Don't definde if you don't need it
1210 (processEvents): made static, non-blocking events processing for
1212 (runTime): static method. event loop for xforms
1213 * similar as above for kde and gnome.
1215 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
1216 new Pimpl is correct
1217 (runTime): new method calss the real frontends runtime func.
1219 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
1221 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1223 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
1225 2000-08-16 Juergen Vigna <jug@sad.it>
1227 * src/lyx_gui.C (runTime): added GUII RunTime support.
1229 * src/frontends/Makefile.am:
1230 * src/frontends/GUIRunTime.[Ch]:
1231 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
1232 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
1233 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
1235 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
1237 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
1238 as this is already set in ${FRONTEND_INCLUDE} if needed.
1240 * configure.in (CPPFLAGS): setting the include dir for the frontend
1241 directory and don't set FRONTEND=xforms for now as this is executed
1244 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
1246 * src/frontends/kde/Makefile.am:
1247 * src/frontends/kde/FormUrl.C:
1248 * src/frontends/kde/FormUrl.h:
1249 * src/frontends/kde/formurldialog.h:
1250 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
1252 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
1254 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
1256 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1258 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
1261 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
1263 * src/WorkArea.C (work_area_handler): more work to get te
1264 FL_KEYBOARD to work with xforms 0.88 too, please test.
1266 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
1268 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
1270 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
1273 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1275 * src/Timeout.h: remove Qt::emit hack.
1277 * several files: changes to allo doc++ compilation
1279 * src/lyxfunc.C (processKeySym): new method
1280 (processKeyEvent): comment out if FL_REVISION < 89
1282 * src/WorkArea.C: change some debugging levels.
1283 (WorkArea): set wantkey to FL_KEY_ALL
1284 (work_area_handler): enable the FL_KEYBOARD clause, this enables
1285 clearer code and the use of compose with XForms 0.89. Change to
1286 use signals instead of calling methods in bufferview directly.
1288 * src/Painter.C: change some debugging levels.
1290 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
1293 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
1294 (workAreaKeyPress): new method
1296 2000-08-14 Juergen Vigna <jug@sad.it>
1298 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
1300 * config/kde.m4: addes some features
1302 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
1303 include missing xforms dialogs.
1305 * src/Timeout.h: a hack to be able to compile with qt/kde.
1307 * sigc++/.cvsignore: added acinclude.m4
1309 * lib/.cvsignore: added listerros
1311 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
1312 xforms tree as objects are needed for other frontends.
1314 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
1315 linking with not yet implemented xforms objects.
1317 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
1319 2000-08-14 Baruch Even <baruch.even@writeme.com>
1321 * src/frontends/xforms/FormGraphics.h:
1322 * src/frontends/xforms/FormGraphics.C:
1323 * src/frontends/xforms/RadioButtonGroup.h:
1324 * src/frontends/xforms/RadioButtonGroup.C:
1325 * src/insets/insetgraphics.h:
1326 * src/insets/insetgraphics.C:
1327 * src/insets/insetgraphicsParams.h:
1328 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
1329 instead of spaces, and various other indentation issues to make the
1330 sources more consistent.
1332 2000-08-14 Marko Vendelin <markov@ioc.ee>
1334 * src/frontends/gnome/dialogs/diaprint.glade
1335 * src/frontends/gnome/FormPrint.C
1336 * src/frontends/gnome/FormPrint.h
1337 * src/frontends/gnome/diaprint_callbacks.c
1338 * src/frontends/gnome/diaprint_callbacks.h
1339 * src/frontends/gnome/diaprint_interface.c
1340 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
1343 * src/frontends/gnome/dialogs/diainserturl.glade
1344 * src/frontends/gnome/FormUrl.C
1345 * src/frontends/gnome/FormUrl.h
1346 * src/frontends/gnome/diainserturl_callbacks.c
1347 * src/frontends/gnome/diainserturl_callbacks.h
1348 * src/frontends/gnome/diainserturl_interface.c
1349 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
1350 Gnome implementation
1352 * src/frontends/gnome/Dialogs.C
1353 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
1354 all other dialogs. Copy all unimplemented dialogs from Xforms
1357 * src/frontends/gnome/support.c
1358 * src/frontends/gnome/support.h: support files generated by Glade
1362 * config/gnome.m4: Gnome configuration scripts
1364 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
1365 configure --help message
1367 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
1368 only if there are no events pendling in Gnome/Gtk. This enhances
1369 the performance of menus.
1372 2000-08-14 Allan Rae <rae@lyx.org>
1374 * lib/Makefile.am: listerrors cleaning
1376 * lib/listerrors: removed -- generated file
1377 * acinclude.m4: ditto
1378 * sigc++/acinclude.m4: ditto
1380 * src/frontends/xforms/forms/form_citation.fd:
1381 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
1384 * src/frontends/xforms/forms/makefile: I renamed the `install` target
1385 `updatesrc` and now we have a `test` target that does what `updatesrc`
1386 used to do. I didn't like having an install target that wasn't related
1389 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
1390 on all except FormGraphics. This may yet happen. Followed by a major
1391 cleanup including using FL_TRANSIENT for most of the dialogs. More
1392 changes to come when the ButtonController below is introduced.
1394 * src/frontends/xforms/ButtonController.h: New file for managing up to
1395 four buttons on a dialog according to an externally defined policy.
1396 * src/frontends/xforms/Makefile.am: added above
1398 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
1399 Apply and Cancel/Close buttons and everything in between and beyond.
1400 * src/frontends/Makefile.am: added above.
1402 * src/frontends/xforms/forms/form_preferences.fd:
1403 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
1404 and removed variable 'status' as a result. Fixed the set_minsize thing.
1405 Use the new screen-font-update after checking screen fonts were changed
1406 Added a "Restore" button to restore the original lyxrc values while
1407 editing. This restores everything not just the last input changed.
1408 That's still a tricky one. As is the "LyX: this shouldn't happen..."
1410 * src/LyXAction.C: screen-font-update added for updating buffers after
1411 screen font settings have been changed.
1412 * src/commandtags.h: ditto
1413 * src/lyxfunc.C: ditto
1415 * forms/lyx.fd: removed screen fonts dialog.
1416 * src/lyx_gui.C: ditto
1417 * src/menus.[Ch]: ditto
1418 * src/lyx.[Ch]: ditto
1419 * src/lyx_cb.C: ditto + code from here moved to make
1420 screen-font-update. And people wonder why progress on GUII is
1421 slow. Look at how scattered this stuff was! It takes forever
1424 * forms/fdfix.sh: Fixup the spacing after commas.
1425 * forms/makefile: Remove date from generated files. Fewer clashes now.
1426 * forms/bullet_forms.C.patch: included someones handwritten changes
1428 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
1429 once I've discovered why LyXRC was made noncopyable.
1430 * src/lyx_main.C: ditto
1432 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
1434 * src/frontends/xforms/forms/fdfix.sh:
1435 * src/frontends/xforms/forms/fdfixh.sed:
1436 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
1437 * src/frontends/xforms/Form*.[hC]:
1438 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
1439 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
1440 provide a destructor for the struct FD_form_xxxx. Another version of
1441 the set_[max|min]size workaround and a few other cleanups. Actually,
1442 Angus' patch from 20000809.
1444 2000-08-13 Baruch Even <baruch.even@writeme.com>
1446 * src/insets/insetgraphics.C (Clone): Added several fields that needed
1449 2000-08-11 Juergen Vigna <jug@sad.it>
1451 * src/insets/insetgraphics.C (InsetGraphics): changing init
1452 order because of warnings.
1454 * src/frontends/xforms/forms/makefile: adding patching .C with
1457 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
1458 from .C.patch to .c.patch
1460 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
1461 order because of warning.
1463 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
1465 * src/frontends/Liason.C (setMinibuffer): new helper function
1467 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
1469 * src/lyxfunc.C (Dispatch): calling new Document-Layout
1471 * lib/ui/default.ui: commented out PaperLayout entry
1473 * src/frontends/xforms/form_document.[Ch]: new added files
1475 * src/frontends/xforms/FormDocument.[Ch]: ditto
1477 * src/frontends/xforms/forms/form_document.fd: ditto
1479 * src/frontends/xforms/forms/form_document.C.patch: ditto
1481 2000-08-10 Juergen Vigna <jug@sad.it>
1483 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
1484 (InsetGraphics): initialized cacheHandle to 0.
1485 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
1487 2000-08-10 Baruch Even <baruch.even@writeme.com>
1489 * src/graphics/GraphicsCache.h:
1490 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
1491 correctly as a cache.
1493 * src/graphics/GraphicsCacheItem.h:
1494 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
1497 * src/graphics/GraphicsCacheItem_pimpl.h:
1498 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
1501 * src/insets/insetgraphics.h:
1502 * src/insets/insetgraphics.C: Changed from using a signal notification
1503 to polling when image is not loaded.
1505 2000-08-10 Allan Rae <rae@lyx.org>
1507 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
1508 that there are two functions that have to been taken out of line by
1509 hand and aren't taken care of in the script. (Just a reminder note)
1511 * sigc++/macros/*.h.m4: Updated as above.
1513 2000-08-09 Juergen Vigna <jug@sad.it>
1515 * src/insets/insettext.C (draw): small fix for clearing rectangle.
1517 * src/insets/insettabular.C: make drawing of single cell smarter.
1519 2000-08-09 Marko Vendelin <markov@ioc.ee>
1520 * src/frontends/gnome/Menubar_pimpl.C
1521 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
1522 implementation: new files
1524 * src/frontends/gnome/mainapp.C
1525 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
1528 * src/main.C: create Gnome main window
1530 * src/frontends/xforms/Menubar_pimpl.h
1531 * src/frontends/Menubar.C
1532 * src/frontends/Menubar.h: added method Menubar::update that calls
1533 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
1535 * src/LyXView.C: calls Menubar::update to update the state
1538 * src/frontends/gnome/Makefile.am: added new files
1540 * src/frontends/Makefile.am: added frontend compiler options
1542 2000-08-08 Juergen Vigna <jug@sad.it>
1544 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
1546 * src/bufferlist.C (close):
1547 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
1548 documents if exiting without saving.
1550 * src/buffer.C (save): use removeAutosaveFile()
1552 * src/support/filetools.C (removeAutosaveFile): new function.
1554 * src/lyx_cb.C (MenuWrite): returns a bool now.
1555 (MenuWriteAs): check if file could really be saved and revert to the
1557 (MenuWriteAs): removing old autosavefile if existant.
1559 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
1560 before Goto toggle declaration, because of compiler warning.
1562 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
1564 * src/lyxfunc.C (MenuNew): small fix.
1566 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
1568 * src/bufferlist.C (newFile):
1569 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
1571 * src/lyxrc.C: added new_ask_filename tag
1573 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
1575 * src/lyx.fd: removed code pertaining to form_ref
1576 * src/lyx.[Ch]: ditto
1577 * src/lyx_cb.C: ditto
1578 * src/lyx_gui.C: ditto
1579 * src/lyx_gui_misc.C: ditto
1581 * src/BufferView_pimpl.C (restorePosition): update buffer only
1584 * src/commandtags.h (LFUN_REFTOGGLE): removed
1585 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
1586 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
1587 (LFUN_REFBACK): renamed LFUN_REF_BACK
1589 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
1590 * src/menus.C: ditto
1591 * src/lyxfunc.C (Dispatch): ditto.
1592 InsertRef dialog is now GUI-independent.
1594 * src/texrow.C: added using std::endl;
1596 * src/insets/insetref.[Ch]: strip out large amounts of code.
1597 The inset is now a container and this functionality is now
1598 managed by a new FormRef dialog
1600 * src/frontends/Dialogs.h (showRef, createRef): new signals
1602 * src/frontends/xforms/FormIndex.[Ch],
1603 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
1604 when setting dialog's min/max size
1605 * src/frontends/xforms/FormIndex.[Ch]: ditto
1607 * src/frontends/xforms/FormRef.[Ch],
1608 src/frontends/xforms/forms/form_ref.fd: new xforms
1609 implementation of an InsetRef dialog
1611 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
1614 * src/graphics/XPM_Renderer.C (isImageFormatOK):
1615 ios::nocreate is not part of the standard. Removed.
1617 2000-08-07 Baruch Even <baruch.even@writeme.com>
1619 * src/graphics/Renderer.h:
1620 * src/graphics/Renderer.C: Added base class for rendering of different
1621 image formats into Pixmaps.
1623 * src/graphics/XPM_Renderer.h:
1624 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
1625 in a different class.
1627 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
1628 easily add support for other formats.
1630 * src/insets/figinset.C: plugged a leak of an X resource.
1632 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1634 * src/CutAndPaste.[Ch]: make all metods static.
1636 * development/Code_rules/Rules: more work, added section on
1637 Exceptions, and a References section.
1639 * a lot of header files: work to make doc++ able to generate the
1640 source documentation, some workarounds of doc++ problems. Doc++ is
1641 now able to generate the documentation.
1643 2000-08-07 Juergen Vigna <jug@sad.it>
1645 * src/insets/insettabular.C (recomputeTextInsets): removed function
1647 * src/tabular.C (SetWidthOfMulticolCell):
1649 (calculate_width_of_column_NMC): fixed return value so that it really
1650 only returns true if the column-width has changed (there where
1651 problems with muliticolumn-cells in this column).
1653 2000-08-04 Juergen Vigna <jug@sad.it>
1655 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
1656 also on the scrollstatus of the inset.
1657 (workAreaMotionNotify): ditto.
1659 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
1661 2000-08-01 Juergen Vigna <jug@sad.it>
1663 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
1665 * src/commandtags.h:
1666 * src/LyXAction.C (init):
1667 * src/insets/inset.C (LocalDispatch): added support for
1670 * src/insets/inset.C (scroll): new functions.
1672 * src/insets/insettext.C (removeNewlines): new function.
1673 (SetAutoBreakRows): removes forced newlines in the text of the
1674 paragraph if autoBreakRows is set to false.
1676 * src/tabular.C (Latex): generates a parbox around the cell contents
1679 * src/frontends/xforms/FormTabular.C (local_update): removed
1680 the radio_useparbox button.
1682 * src/tabular.C (UseParbox): new function
1684 2000-08-06 Baruch Even <baruch.even@writeme.com>
1686 * src/graphics/GraphicsCache.h:
1687 * src/graphics/GraphicsCache.C:
1688 * src/graphics/GraphicsCacheItem.h:
1689 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
1692 * src/insets/insetgraphics.h:
1693 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
1694 drawing of the inline image.
1696 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
1697 into the wrong position.
1699 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
1702 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
1704 * src/support/translator.h: move all typedefs to public section
1706 * src/support/filetools.C (MakeLatexName): return string const
1708 (TmpFileName): ditto
1709 (FileOpenSearch): ditto
1711 (LibFileSearch): ditto
1712 (i18nLibFileSearch): ditto
1715 (CreateTmpDir): ditto
1716 (CreateBufferTmpDir): ditto
1717 (CreateLyXTmpDir): ditto
1720 (MakeAbsPath): ditto
1722 (OnlyFilename): ditto
1724 (NormalizePath): ditto
1725 (CleanupPath): ditto
1726 (GetFileContents): ditto
1727 (ReplaceEnvironmentPath): ditto
1728 (MakeRelPath): ditto
1730 (ChangeExtension): ditto
1731 (MakeDisplayPath): ditto
1732 (do_popen): return cmdret const
1733 (findtexfile): return string const
1735 * src/support/DebugStream.h: add some /// to please doc++
1737 * src/frontends/DialogBase.h (endif): add some /// to please doc++
1739 * src/texrow.C (same_rownumber): functor to use with find_if
1740 (getIdFromRow): rewritten to use find_if and to not update the
1741 positions. return true if row is found
1742 (increasePos): new method, use to update positions
1744 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
1746 * src/lyxlex_pimpl.C (verifyTable): new method
1749 (GetString): return string const
1750 (pushTable): rewrite to use std::stack
1752 (setFile): better check
1755 * src/lyxlex.h: make LyXLex noncopyable
1757 * src/lyxlex.C (text): return char const * const
1758 (GetString): return string const
1759 (getLongString): return string const
1761 * src/lyx_gui_misc.C (askForText): return pair<...> const
1763 * src/lastfiles.[Ch] (operator): return string const
1765 * src/buffer.C (parseSingleLyXformat2Token): pass string to
1766 istringstream not char const *.
1767 move token.end() out of loop.
1768 (readFile): move initializaton of token
1770 * src/BufferView2.C (insertErrors): run texrow.increasePos if
1771 getIdFromRow is successful.
1773 * lib/bind/emacs.bind: don't include menus bind
1775 * development/Code_rules/Rules: the beginnings of making this
1776 better and covering more of the unwritten rules that we have.
1778 * development/Code_rules/Recommendations: a couple of wording
1781 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1783 * src/support/strerror.c: remove C++ comment.
1785 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
1787 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
1788 LFUN_INDEX_INSERT_LAST
1790 * src/texrow.C (getIdFromRow): changed from const_iterator to
1791 iterator, allowing code to compile with DEC cxx
1793 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
1794 stores part of the class, as suggested by Allan. Will allow
1796 (apply): test to apply uses InsetCommandParams operator!=
1798 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
1799 (apply): test to apply uses InsetCommandParams operator!=
1801 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
1802 stores part of the class.
1803 (update): removed limits on min/max size.
1805 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
1806 (apply): test to apply uses InsetCommandParams operator!=
1808 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
1809 (Read, Write, scanCommand, getCommand): moved functionality
1810 into InsetCommandParams.
1812 (getScreenLabel): made pure virtual
1813 new InsetCommandParams operators== and !=
1815 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
1816 c-tors based on InsetCommandParams. Removed others.
1817 * src/insets/insetinclude.[Ch]: ditto
1818 * src/insets/insetlabel.[Ch]: ditto
1819 * src/insets/insetparent.[Ch]: ditto
1820 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
1822 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
1823 insets derived from InsetCommand created using similar c-tors
1824 based on InsetCommandParams
1825 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
1826 * src/menus.C (ShowRefsMenu): ditto
1827 * src/paragraph.C (Clone): ditto
1828 * src/text2.C (SetCounter): ditto
1829 * src/lyxfunc.C (Dispatch) ditto
1830 Also recreated old InsetIndex behaviour exactly. Can now
1831 index-insert at the start of a paragraph and index-insert-last
1832 without launching the pop-up.
1834 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1836 * lib/lyxrc.example: mark te pdf options as non functional.
1838 * src/support/lstrings.C (strToInt): move initalization of tmpstr
1839 (isStrDbl): move tmpstr.end() out of loop.
1840 (strToDbl): move intialization of tmpstr
1841 (lowercase): return string const and move tmp.end() out of loop.
1842 (uppercase): return string const and move tmp.edn() out of loop.
1843 (prefixIs): add assertion
1848 (containsOnly): ditto
1849 (containsOnly): ditto
1850 (containsOnly): ditto
1851 (countChar): make last arg char not char const
1852 (token): return string const
1853 (subst): return string const, move tmp.end() out of loop.
1854 (subst): return string const, add assertion
1855 (strip): return string const
1856 (frontStrip): return string const, add assertion
1857 (frontStrip): return string const
1862 * src/support/lstrings.C: add inclde "LAssert.h"
1863 (isStrInt): move tmpstr.end() out of loop.
1865 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
1866 toollist.end() out of loop.
1867 (deactivate): move toollist.end() out of loop.
1868 (update): move toollist.end() out of loop.
1869 (updateLayoutList): move tc.end() out of loop.
1870 (add): move toollist.end() out of loop.
1872 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
1873 md.end() out of loop.
1875 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
1877 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
1880 * src/paragraph.C (Erase): move fontlist.end() out of loop.
1881 (Erase): move insetlist.end() out of loop.
1883 * src/lyx_sendfax_main.C: make show_logfile static and to take a
1884 ref to const string as first arg. Move initialization of some
1885 variables, whitespace changes.
1887 * src/kbmap.C (defkey): move table.end() out of loop.
1888 (kb_keymap): move table.end() out of loop.
1889 (findbinding): move table.end() out of loop.
1891 * src/MenuBackend.C (hasMenu): move end() out of loop.
1892 (getMenu): move end() out of loop.
1893 (getMenu): move menulist_.end() out of loop.
1895 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
1897 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
1900 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
1901 (getFromLyXName): move infotab.end() out of loop.
1903 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
1904 -fvtable-thunks -ffunction-sections -fdata-sections
1906 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
1908 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
1911 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1913 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
1915 * src/frontends/xforms/FormCitation.[Ch],
1916 src/frontends/xforms/FormIndex.[Ch],
1917 src/frontends/xforms/FormToc.[Ch],
1918 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
1920 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1922 * src/commandtags.h: renamed, created some flags for citation
1925 * src/lyx_gui_misc.C: stripped out old FD_index_form code
1927 * src/lyxfunc.C (dispatch): use signals to insert index entry
1929 * src/frontends/Dialogs.h: new signal createIndex
1931 * src/frontends/xforms/FormCommand.[Ch],
1932 src/frontends/xforms/FormCitation.[Ch],
1933 src/frontends/xforms/FormToc.[Ch],
1934 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
1936 * src/insets/insetindex.[Ch]: GUI-independent
1938 * src/frontends/xforms/FormIndex.[Ch],
1939 * src/frontends/xforms/forms/form_index.fd: xforms implementation
1942 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
1944 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
1945 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
1947 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1949 * src/insets/insetref.C (Latex): rewrite so that there is now
1950 question that a initialization is requested.
1952 * src/insets/insetcommand.h: reenable the hide signal
1954 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1956 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
1957 fix handling of shortcuts (many bugs :)
1958 (add_lastfiles): ditto.
1960 * lib/ui/default.ui: fix a few shortcuts.
1962 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
1964 * Makefile.am: Fix ``rpmdist'' target to return the exit
1965 status of the ``rpm'' command, instead of the last command in
1966 the chain (the ``rm lyx.xpm'' command, which always returns
1969 2000-08-02 Allan Rae <rae@lyx.org>
1971 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
1972 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
1973 * src/frontends/xforms/FormToc.C (FormToc): ditto
1975 * src/frontends/xforms/Makefile.am: A few forgotten files
1977 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
1978 Signals-not-copyable-problem Lars' started commenting out.
1980 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
1982 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1984 * src/insets/insetcommand.h: Signals is not copyable so anoter
1985 scheme for automatic hiding of forms must be used.
1987 * src/frontends/xforms/FormCitation.h: don't inerit from
1988 noncopyable, FormCommand already does that.
1989 * src/frontends/xforms/FormToc.h: ditto
1990 * src/frontends/xforms/FormUrl.h: ditto
1992 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1994 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
1996 * src/insets/insetcommand.h (hide): new SigC::Signal0
1997 (d-tor) new virtual destructor emits hide signal
1999 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
2000 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
2002 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
2003 LOF and LOT. Inset is now GUI-independent
2005 * src/insets/insetloa.[Ch]: redundant
2006 * src/insets/insetlof.[Ch]: ditto
2007 * src/insets/insetlot.[Ch]: ditto
2009 * src/frontends/xforms/forms/form_url.fd: tweaked!
2010 * src/frontends/xforms/forms/form_citation.fd: ditto
2012 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
2013 dialogs dealing with InsetCommand insets
2015 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
2016 FormCommand base class
2017 * src/frontends/xforms/FormUrl.[Ch]: ditto
2019 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
2021 * src/frontends/xforms/FormToc.[Ch]: ditto
2023 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
2024 passed a generic InsetCommand pointer
2025 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
2027 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
2028 and modified InsetTOC class
2029 * src/buffer.C: ditto
2031 * forms/lyx.fd: strip out old FD_form_toc code
2032 * src/lyx_gui_misc.C: ditto
2033 * src/lyx_gui.C: ditto
2034 * src/lyx_cb.C: ditto
2035 * src/lyx.[Ch]: ditto
2037 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2039 * src/support/utility.hpp: tr -d '\r'
2041 2000-08-01 Juergen Vigna <jug@sad.it>
2043 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
2045 * src/commandtags.h:
2046 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
2047 LFUN_TABULAR_FEATURES.
2049 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
2050 LFUN_LAYOUT_TABULAR.
2052 * src/insets/insettabular.C (getStatus): implemented helper function.
2054 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
2056 2000-07-31 Juergen Vigna <jug@sad.it>
2058 * src/text.C (draw): fixed screen update problem for text-insets.
2060 * src/text2.C (SetParagrpah): call an update of the inset-owner when
2061 something changed probably this has to be added in various other
2064 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
2066 2000-07-31 Baruch Even <baruch.even@writeme.com>
2068 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
2069 templates to satisfy compaq cxx.
2072 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2074 * src/support/translator.h (equal_1st_in_pair::operator()): take
2075 const ref pair_type as arg.
2076 (equal_2nd_in_pair::operator()): ditto
2077 (Translator::~Translator): remove empty d-tor.
2079 * src/graphics/GraphicsCache.C: move include config.h to top, also
2080 put initialization of GraphicsCache::singleton here.
2081 (~GraphicsCache): move here
2082 (addFile): take const ref as arg
2085 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
2087 * src/BufferView2.C (insertLyXFile): change te with/without header
2090 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2092 * src/frontends/xforms/FormGraphics.C (apply): add some
2093 static_cast. Not very nice, but required by compaq cxx.
2095 * src/frontends/xforms/RadioButtonGroup.h: include header
2096 <utility> instead of <pair.h>
2098 * src/insets/insetgraphicsParams.C: add using directive.
2099 (readResize): change return type to void.
2100 (readOrigin): ditto.
2102 * src/lyxfunc.C (getStatus): add missing break for build-program
2103 function; add test for Literate for export functions.
2105 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
2106 entries in Options menu.
2108 2000-07-31 Baruch Even <baruch.even@writeme.com>
2110 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
2111 protect against auto-allocation; release icon when needed.
2113 2000-07-31 Matej Cepl <CeplM@seznam.cz>
2115 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
2116 on usual typewriter.
2118 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
2119 earlier czech.kmap), useful only for programming.
2121 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2123 * src/frontends/xforms/FormCitation.h: fix conditioning around
2126 2000-07-31 Juergen Vigna <jug@sad.it>
2128 * src/frontends/xforms/FormTabular.C (local_update): changed
2129 radio_linebreaks to radio_useparbox and added radio_useminipage.
2131 * src/tabular.C: made support for using minipages/parboxes.
2133 * src/bufferlist.C (QwriteAll): small fix for asking for save.
2135 * src/insets/insetgraphics.C (draw): just draw the inset so that the
2137 (descent): so the cursor is in the middle.
2138 (width): bit smaller box.
2140 * src/insets/insetgraphics.h: added display() function.
2142 2000-07-31 Baruch Even <baruch.even@writeme.com>
2144 * src/frontends/Dialogs.h: Added showGraphics signals.
2146 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
2147 xforms form definition of the graphics dialog.
2149 * src/frontends/xforms/FormGraphics.h:
2150 * src/frontends/xforms/FormGraphics.C: Added files, the
2151 GUIndependent code of InsetGraphics
2153 * src/insets/insetgraphics.h:
2154 * src/insets/insetgraphics.C: Major writing to make it work.
2156 * src/insets/insetgraphicsParams.h:
2157 * src/insets/insetgraphicsParams.C: Added files, parameter passing
2158 struct between InsetGraphics and GUI.
2160 * src/LaTeXFeatures.h:
2161 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
2162 support for graphicx package.
2164 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
2165 for the graphics inset.
2167 * src/support/translator.h: Added file, used in
2168 InsetGraphicsParams. this is a template to translate between two
2171 * src/frontends/xforms/RadioButtonGroup.h:
2172 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
2173 way to easily control a radio button group.
2175 2000-07-28 Juergen Vigna <jug@sad.it>
2177 * src/insets/insettabular.C (LocalDispatch):
2178 (TabularFeatures): added support for lyx-functions of tabular features.
2179 (cellstart): refixed this function after someone wrongly changed it.
2181 * src/commandtags.h:
2182 * src/LyXAction.C (init): added support for tabular-features
2184 2000-07-28 Allan Rae <rae@lyx.org>
2186 * src/frontends/xforms/FormPreferences.C (build): Setup input return
2187 checking. NOTE: It seems that pressing ESC to cancel the dialog also
2188 triggers the callback for input checking. As a result we sometimes get
2189 "LyX: This shouldn't happen..." printed to cerr.
2190 (input): Started using status variable since I only free() on
2191 destruction. Some input checking for paths and font sizes.
2193 * src/frontends/xforms/FormPreferences.h: Use status to control
2194 activation of Ok and Apply
2196 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
2197 callback. Also resized to stop segfaults with 0.88. The problem is
2198 that xforms-0.88 requires the folder to be wide enough to fit all the
2199 tabs. If it isn't it causes all sorts of problems.
2201 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
2203 * src/frontends/xforms/forms/README: Reflect reality.
2205 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
2206 * src/frontends/xforms/forms/makefile: ditto.
2208 * src/commandtags.h: Get access to new Preferences dialog
2209 * src/LyXAction.C: ditto
2210 * src/lyxfunc.C: ditto
2211 * lib/ui/default.ui: ditto
2213 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2215 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
2217 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
2220 * src/frontends/xforms/form_url.[Ch]: added.
2222 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2224 * src/insets/insetbib.h: fixed bug in previous commit
2226 * src/frontends/xforms/FormUrl.h: ditto
2228 * src/frontends/xforms/FormPrint.h: ditto
2230 * src/frontends/xforms/FormPreferences.h: ditto
2232 * src/frontends/xforms/FormCopyright.h: ditto
2234 * src/frontends/xforms/FormCitation.C: ditto
2236 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
2237 private copyconstructor and private default contructor
2239 * src/support/Makefile.am: add utility.hpp
2241 * src/support/utility.hpp: new file from boost
2243 * src/insets/insetbib.h: set owner in clone
2245 * src/frontends/xforms/FormCitation.C: added missing include
2248 * src/insets/form_url.[Ch]: removed
2250 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
2252 * development/lyx.spec.in
2253 * Makefile.am: Fix buglet for LyX RPM generation resulting from
2254 file/directory re-organization.
2256 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
2258 * src/insets/insetcommand.[Ch]: moved the string data and
2259 associated manipulation methods into a new stand-alone class
2260 InsetCommandParams. This class has two additional methods
2261 getAsString() and setFromString() allowing the contents to be
2262 moved around as a single string.
2263 (addContents) method removed.
2264 (setContents) method no longer virtual.
2266 * src/buffer.C (readInset): made use of new InsetCitation,
2267 InsetUrl constructors based on InsetCommandParams.
2269 * src/commandtags.h: add LFUN_INSERT_URL
2271 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
2272 independent InsetUrl and use InsetCommandParams to extract
2273 string info and create new Insets.
2275 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
2277 * src/frontends/xforms/FormCitation.C (apply): uses
2280 * src/frontends/xforms/form_url.C
2281 * src/frontends/xforms/form_url.h
2282 * src/frontends/xforms/FormUrl.h
2283 * src/frontends/xforms/FormUrl.C
2284 * src/frontends/xforms/forms/form_url.fd: new files
2286 * src/insets/insetcite.[Ch]: removed unused constructors.
2288 * src/insets/insetinclude.[Ch]: no longer store filename
2290 * src/insets/inseturl.[Ch]: GUI-independent.
2292 2000-07-26 Juergen Vigna <jug@sad.it>
2293 * renamed frontend from gtk to gnome as it is that what is realized
2294 and did the necessary changes in the files.
2296 2000-07-26 Marko Vendelin <markov@ioc.ee>
2298 * configure.in: cleaning up gnome configuration scripts
2300 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2302 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
2303 shortcuts syndrom by redrawing them explicitely (a better solution
2304 would be appreciated).
2306 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
2308 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
2311 * src/lyx_cb.C (MenuExport): change html export to do the right
2312 thing depending of the document type (instead of having
2313 html-linuxdoc and html-docbook).
2314 * src/lyxfunc.C (getStatus): update for html
2315 * lib/ui/default.ui: simplify due to the above change.
2316 * src/menus.C (ShowFileMenu): update too (in case we need it).
2318 * src/MenuBackend.C (read): if a menu is defined twice, add the
2319 new entries to the exiting one.
2321 2000-07-26 Juergen Vigna <jug@sad.it>
2323 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
2325 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
2326 and return a bool if it did actual save the file.
2327 (AutoSave): don't autosave a unnamed doc.
2329 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
2330 check if this is an UNNAMED new file and react to it.
2331 (newFile): set buffer to unnamed and change to not mark a new
2332 buffer dirty if I didn't do anything with it.
2334 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
2336 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2338 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
2339 friend as per Angus's patch posted to lyx-devel.
2341 * src/ext_l10n.h: updated
2343 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
2344 gettext on the style string right before inserting them into the
2347 * autogen.sh: add code to extract style strings form layout files,
2348 not good enough yet.
2350 * src/frontends/gtk/.cvsignore: add MAKEFILE
2352 * src/MenuBackend.C (read): run the label strings through gettext
2353 before storing them in the containers.
2355 * src/ext_l10n.h: new file
2357 * autogen.sh : generate the ext_l10n.h file here
2359 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2361 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
2364 * lib/ui/default.ui: fix a couple of typos.
2366 * config/gnome/gtk.m4: added (and added to the list of files in
2369 * src/insets/insetinclude.C (unique_id): fix when we are using
2370 lyxstring instead of basic_string<>.
2371 * src/insets/insettext.C (LocalDispatch): ditto.
2372 * src/support/filetools.C: ditto.
2374 * lib/configure.m4: create the ui/ directory if necessary.
2376 * src/LyXView.[Ch] (updateToolbar): new method.
2378 * src/BufferView_pimpl.C (buffer): update the toolbar when
2379 opening/closing buffer.
2381 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2383 * src/LyXAction.C (getActionName): enhance to return also the name
2384 and options of pseudo-actions.
2385 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
2387 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
2388 as an example of what is possible). Used in File->Build too (more
2389 useful) and in the import/export menus (to mimick the complicated
2390 handling of linuxdoc and friends). Try to update all the entries.
2392 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
2395 * src/MenuBackend.C (read): Parse the new OptItem tag.
2397 * src/MenuBackend.h: Add a new optional_ data member (used if the
2398 entry should be omitted when the lyxfunc is disabled).
2400 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
2401 function, used as a shortcut.
2402 (create_submenu): align correctly the shortcuts on the widest
2405 * src/MenuBackend.h: MenuItem.label() only returns the label of
2406 the menu without shortcut; new method shortcut().
2408 2000-07-14 Marko Vendelin <markov@ioc.ee>
2410 * src/frontends/gtk/Dialogs.C:
2411 * src/frontends/gtk/FormCopyright.C:
2412 * src/frontends/gtk/FormCopyright.h:
2413 * src/frontends/gtk/Makefile.am: added these source-files for the
2414 Gtk/Gnome support of the Copyright-Dialog.
2416 * src/main.C: added Gnome::Main initialization if using
2417 Gtk/Gnome frontend-GUI.
2419 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
2421 * config/gnome/aclocal-include.m4
2422 * config/gnome/compiler-flags.m4
2423 * config/gnome/curses.m4
2424 * config/gnome/gnome--.m4
2425 * config/gnome/gnome-bonobo-check.m4
2426 * config/gnome/gnome-common.m4
2427 * config/gnome/gnome-fileutils.m4
2428 * config/gnome/gnome-ghttp-check.m4
2429 * config/gnome/gnome-gnorba-check.m4
2430 * config/gnome/gnome-guile-checks.m4
2431 * config/gnome/gnome-libgtop-check.m4
2432 * config/gnome/gnome-objc-checks.m4
2433 * config/gnome/gnome-orbit-check.m4
2434 * config/gnome/gnome-print-check.m4
2435 * config/gnome/gnome-pthread-check.m4
2436 * config/gnome/gnome-support.m4
2437 * config/gnome/gnome-undelfs.m4
2438 * config/gnome/gnome-vfs.m4
2439 * config/gnome/gnome-x-checks.m4
2440 * config/gnome/gnome-xml-check.m4
2441 * config/gnome/gnome.m4
2442 * config/gnome/gperf-check.m4
2443 * config/gnome/gtk--.m4
2444 * config/gnome/linger.m4
2445 * config/gnome/need-declaration.m4: added configuration scripts
2446 for Gtk/Gnome frontend-GUI
2448 * configure.in: added support for the --with-frontend=gtk option
2450 * autogen.sh: added config/gnome/* to list of config-files
2452 * acconfig.h: added define for GTKGUI-support
2454 * config/lyxinclude.m4: added --with-frontend[=value] option value
2455 for Gtk/Gnome frontend-GUI support.
2457 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2459 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
2463 * src/paragraph.C (GetChar): remove non-const version
2465 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
2466 (search_kw): use it.
2468 * src/lyx_main.C (init): if "preferences" exist, read that instead
2470 (ReadRcFile): return bool if the file could be read ok.
2471 (ReadUIFile): add a check to see if lex file is set ok.
2473 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
2474 bastring can be used instead of lyxstring (still uses the old code
2475 if std::string is good enough or if lyxstring is used.)
2477 * src/encoding.C: make the arrays static, move ininle functions
2479 * src/encoding.h: from here.
2481 * src/buffer.C: have last_isnet_read as a file scope variable for now.
2482 (parseSingleLyXformat2Token): move inset parsing to separate method
2483 (readInset): new private method
2485 * src/Variables.h: remove virtual from get().
2487 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
2488 access to NEW_INSETS and NEW_TABULAR
2490 * src/MenuBackend.h: remove superfluous forward declaration of
2491 MenuItem. Add documentations tags "///", remove empty MenuItem
2492 destructor, remove private default contructor.
2494 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
2496 (read): more string mlabel and mname to where they are used
2497 (read): remove unused variables mlabel and mname
2498 (defaults): unconditional clear, make menusetup take advantage of
2499 add returning Menu &.
2501 * src/LyXView.h: define NEW_MENUBAR as default
2503 * src/LyXAction.C: include lyxparagraph.h temporary to get access
2504 to NEW_INSETS and NEW_TABULAR.
2505 (init): commetn out some funcs that is obsolete when NEW_INSETS is
2506 defined. Change some of the "xxxx-inset-insert" functions names to
2509 * several files: more enahncements to NEW_INSETS and the resulting
2512 * lib/lyxrc.example (\date_insert_format): move to misc section
2514 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
2515 bastring and use AC_CACHE_CHECK.
2516 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
2517 the system have the newest methods. uses AC_CACHE_CHECK
2518 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
2519 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
2520 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
2522 * configure.in: add LYX_CXX_GOOD_STD_STRING
2524 * acinclude.m4: recreated
2526 2000-07-24 Amir Karger
2528 * README: add Hebrew, Arabic kmaps
2531 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2533 * src/buffer.C (writeFileAscii): Define actcell as an int instead
2536 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2538 * Lot of files: add pragma interface/implementation.
2540 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
2542 * lib/ui/default.ui: new file (ans new directory). Contains the
2543 default menu and toolbar.
2545 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
2546 global space. Toolbars are now read (as menus) in ui files.
2548 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
2550 * src/lyxfunc.C (getStatus): do not exit immediately if a command
2551 is disabled because the document is read-only. We want to have the
2552 toggle state of the function anyway.
2553 (getStatus): add code for LFUN_VC* functions (mimicking what is
2554 done in old-style menus)
2556 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
2557 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
2559 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
2560 * src/BufferView_pimpl.C: ditto.
2561 * src/lyxfunc.C: ditto.
2563 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
2564 default). This replaces old-style menus by new ones.
2566 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
2567 MenuItem. Contain the data structure of a menu.
2569 * src/insets/insettext.C: use LyXView::setLayout instead of
2570 accessing directly the toolbar combox.
2571 * src/lyxfunc.C (Dispatch): ditto.
2573 * src/LyXView.C (setLayout): new method, which just calls
2574 Toolbar::setLayout().
2575 (updateLayoutChoice): move part of this method in Toolbar.
2577 * src/toolbar.[Ch]: removed.
2579 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
2580 implementation the toolbar.
2582 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
2583 the toolbar. It might make sense to merge it with ToolbarDefaults
2585 (setLayout): new function.
2586 (updateLayoutList): ditto.
2587 (openLayoutList): ditto.
2589 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
2590 xforms implementation of the toolbar.
2591 (get_toolbar_func): comment out, since I do not
2592 know what it is good for.
2594 * src/ToolbarDefaults.h: Add the ItemType enum.
2596 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
2597 for a list of allocated C strings. Used in Menubar xforms
2598 implementation to avoid memory leaks.
2600 * src/support/lstrings.[Ch] (uppercase): new version taking and
2604 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
2605 * lib/bind/emacs.bind: ditto.
2607 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2609 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
2610 forward decl of LyXView.
2612 * src/toolbar.C (toolbarItem): moved from toolbar.h
2613 (toolbarItem::clean): ditto
2614 (toolbarItem::~toolbarItem): ditto
2615 (toolbarItem::operator): ditto
2617 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
2619 * src/paragraph.h: control the NEW_TABULAR define from here
2621 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
2622 USE_TABULAR_INSETS to NEW_TABULAR
2624 * src/ToolbarDefaults.C: add include "lyxlex.h"
2626 * files using the old table/tabular: use NEW_TABULAR to control
2627 compilation of old tabular stuff.
2629 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
2632 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
2633 planemet in reading of old style floats, fix the \end_deeper
2634 problem when reading old style floats.
2636 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2638 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
2640 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
2642 * lib/bind/sciword.bind: updated.
2644 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2646 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
2647 layout write problem
2649 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2651 * src/Makefile.am (INCLUDES): remove image directory from include
2654 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
2655 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
2657 * src/LyXView.C (create_form_form_main): read the application icon
2660 * lib/images/*.xpm: change the icons to use transparent color for
2663 * src/toolbar.C (update): change the color of the button when it
2666 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2668 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
2669 setting explicitely the minibuffer.
2670 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
2672 * src/LyXView.C (showState): new function. Shows font information
2673 in minibuffer and update toolbar state.
2674 (LyXView): call Toolbar::update after creating the
2677 * src/toolbar.C: change toollist to be a vector instead of a
2679 (BubbleTimerCB): get help string directly from the callback
2680 argument of the corresponding icon (which is the action)
2681 (set): remove unnecessary ugliness.
2682 (update): new function. update the icons (depressed, disabled)
2683 depending of the status of the corresponding action.
2685 * src/toolbar.h: remove help in toolbarItem
2687 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
2689 * src/Painter.C (text): Added code for using symbol glyphs from
2690 iso10646 fonts. Currently diabled.
2692 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
2695 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
2696 magyar,turkish and usorbian.
2698 * src/paragraph.C (isMultiLingual): Made more efficient.
2700 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
2703 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
2704 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
2705 Also changed the prototype to "bool math_insert_greek(char)".
2707 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2709 * lots of files: apply the NEW_INSETS on all code that will not be
2710 needed when we move to use the new insets. Enable the define in
2711 lyxparagrah.h to try it.
2713 * src/insets/insettabular.C (cellstart): change to be a static
2715 (InsetTabular): initialize buffer in the initializer list.
2717 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
2719 * src/frontends/xforms/FormPrint.[Ch] : moved #include
2720 form_print.h out of the header file. Replaced with forward
2721 declarations of the relevant struct.
2723 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
2726 * src/commandtags.h: do not include "debug.h" which does not
2727 belong there. #include it in some other places because of this
2730 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2732 * src/insets/insetcaption.C: add a couple "using" directives.
2734 * src/toolbar.C (add): get the help text directly from lyxaction.
2736 (setPixmap): new function. Loads from disk and sets a pixmap on a
2737 botton; the name of the pixmap file is derived from the command
2740 * src/toolbar.h: remove members isBitmap and pixmap from
2743 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
2744 * lib/images/: move many files from images/banner.xpm.
2746 * src/lyx_gui.C (create_forms): read banner pixmap from file.
2748 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
2749 * src/toolbar.C: ditto.
2750 * configure.in: ditto.
2751 * INSTALL: document.
2753 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
2754 the spellchecker popup is closed from the WM.
2756 2000-07-19 Juergen Vigna <jug@sad.it>
2758 * src/insets/insetfloat.C (Write): small fix because we use the
2759 insetname for the type now!
2761 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
2763 * src/frontends/xforms/forms/form_citation.fd: object sizes are
2766 * src/frontends/Dialogs.h: removed hideCitation signal
2768 * src/insets/insetcite.h: added hide signal
2770 * src/insets/insetcite.C (~InsetCitation): emits new signal
2771 (getScreenLabel): "intelligent" label should now fit on the screen!
2773 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
2775 * src/frontends/xforms/FormCitation.C (showInset): connects
2776 hide() to the inset's hide signal
2777 (show): modified to use fl_set_object_position rather than
2778 fl_set_object_geometry wherever possible
2780 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2782 * src/insets/lyxinset.h: add caption code
2784 * src/insets/insetfloat.C (type): new method
2786 * src/insets/insetcaption.C (Write): new method
2788 (LyxCode): new method
2790 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
2791 to get it right together with using the FloatList.
2793 * src/commandtags.h: add LFUN_INSET_CAPTION
2794 * src/lyxfunc.C (Dispatch): handle it
2796 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
2799 * src/Variables.[Ch]: make expand take a const reference, remove
2800 the destructor, some whitespace changes.
2802 * src/LyXAction.C (init): add caption-inset-insert
2804 * src/FloatList.C (FloatList): update the default floats a bit.
2806 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2808 * src/Variables.[Ch]: new files. Intended to be used for language
2809 specific strings (like \chaptername) and filename substitution in
2812 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
2814 * lib/kbd/american.kmap: update
2816 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
2818 * src/bufferparams.[Ch]: remove member allowAccents.
2820 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
2822 * src/LaTeXLog.C: use the log_form.h header.
2823 * src/lyx_gui.C: ditto.
2824 * src/lyx_gui_misc.C: ditto.
2825 * src/lyxvc.h: ditto.
2827 * forms/log_form.fd: new file, created from latexoptions.fd. I
2828 kept the log popup and nuked the options form.
2830 * src/{la,}texoptions.[Ch]: removed.
2831 * src/lyx_cb.C (LaTeXOptions): ditto
2833 * src/lyx_gui.C (create_forms): do not handle the
2834 fd_latex_options form.
2836 2000-07-18 Juergen Vigna <jug@sad.it>
2838 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
2839 name of the inset so that it can be requested outside (text2.C).
2841 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
2844 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2846 * src/mathed/formula.h (ConvertFont): constify
2848 * src/mathed/formula.C (Read): add warning if \end_inset is not
2849 found on expected place.
2851 * src/insets/lyxinset.h (ConvertFont): consify
2853 * src/insets/insetquotes.C (ConvertFont): constify
2854 * src/insets/insetquotes.h: ditto
2856 * src/insets/insetinfo.h: add labelfont
2858 * src/insets/insetinfo.C (InsetInfo): set the labelfont
2859 (ascent): use labelfont
2863 (Write): make .lyx file a bit nicer
2865 * src/insets/insetfloat.C (Write): simplify somewhat...
2866 (Read): add warning if arg is not found
2868 * src/insets/insetcollapsable.C: add using std::max
2869 (Read): move string token and add warning in arg is not found
2870 (draw): use std::max to get the right ty
2871 (getMaxWidth): simplify by using std::max
2873 * src/insets/insetsection.h: new file
2874 * src/insets/insetsection.C: new file
2875 * src/insets/insetcaption.h: new file
2876 * src/insets/insetcaption.C: new file
2878 * src/insets/inset.C (ConvertFont): constify signature
2880 * src/insets/Makefile.am (libinsets_la_SOURCES): add
2881 insetcaption.[Ch] and insetsection.[Ch]
2883 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
2884 uses to use LABEL_COUNTER_CHAPTER instead.
2885 * src/text2.C (SetCounter): here
2887 * src/counters.h: new file
2888 * src/counters.C: new file
2889 * src/Sectioning.h: new file
2890 * src/Sectioning.C: new file
2892 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
2894 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2896 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
2899 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
2902 2000-07-17 Juergen Vigna <jug@sad.it>
2904 * src/tabular.C (Validate): check if array-package is needed.
2905 (SetVAlignment): added support for vertical alignment.
2906 (SetLTFoot): better support for longtable header/footers
2907 (Latex): modified to support added features.
2909 * src/LaTeXFeatures.[Ch]: added array-package.
2911 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
2913 * src/lyx_gui.C (LyXGUI): make sure that the height is large
2916 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
2918 * configure.in: do not forget to put a space after -isystem.
2920 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
2922 * lib/kbd/arabic.kmap: a few fixes.
2924 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2926 * some whitespace chagnes to a number of files.
2928 * src/support/DebugStream.h: change to make it easier for
2929 doc++ to parse correctly.
2930 * src/support/lyxstring.h: ditto
2932 * src/mathed/math_utils.C (compara): change to have only one
2934 (MathedLookupBOP): change because of the above.
2936 * src/mathed/math_delim.C (math_deco_compare): change to have only
2938 (search_deco): change becasue of the above.
2940 * src/insets/insettabular.C (DrawCellSelection): use std::swap
2941 instead of manually coded one.
2943 * src/insets/insetquotes.C (Read): read the \end_inset too
2945 * src/insets/insetlatex.h: remove file
2946 * src/insets/insetlatex.C: remove file
2948 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
2950 (InsetPrintIndex): remove destructor
2952 * src/insets/insetinclude.h: remove default constructor
2954 * src/insets/insetfloat.C: work to make it work better
2956 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
2958 * src/insets/insetcite.h (InsetCitation): remove default constructor
2960 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
2962 * src/text.C (GetColumnNearX): comment out some currently unused code.
2964 * src/paragraph.C (writeFile): move some initializations closer to
2966 (CutIntoMinibuffer): small change to use new matchIT operator
2970 (InsertInset): ditto
2973 (InsetIterator): ditto
2974 (Erase): small change to use new matchFT operator
2976 (GetFontSettings): ditto
2977 (HighestFontInRange): ditto
2980 * src/lyxparagraph.h: some chars changed to value_type
2981 (matchIT): because of some stronger checking (perhaps too strong)
2982 in SGI STL, the two operator() unified to one.
2985 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
2987 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
2988 the last inset read added
2989 (parseSingleLyXformat2Token): some more (future) compability code added
2990 (parseSingleLyXformat2Token): warning about solitary \end_inset added
2991 (parseSingleLyXformat2Token): set last_inset_read
2992 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2993 (parseSingleLyXformat2Token): don't double intializw string next_token
2995 * src/TextCache.C (text_fits::operator()): add const's to the signature
2996 (has_buffer::operator()): ditto
2998 * src/Floating.h: add some comments on the class
3000 * src/FloatList.[Ch] (typeExist): new method
3003 * src/BackStack.h: added default constructor, wanted by Gcc.
3005 2000-07-14 Juergen Vigna <jug@sad.it>
3007 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
3009 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
3011 * src/insets/insettabular.C (resizeLyXText): need this to be able to
3012 do a redraw when the window is resized!
3013 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
3015 * src/insets/insettext.C (resizeLyXText): added function to correctly
3016 being able to resize the LyXWindow.
3018 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
3020 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
3022 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
3023 crashes when closing dialog to a deleted inset.
3025 * src/insets/insetcite.[Ch] (Edit) : the return of this former
3026 method! Now similar to other insets.
3028 2000-07-13 Juergen Vigna <jug@sad.it>
3030 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
3032 * lib/examples/Literate.lyx: small patch!
3034 * src/insets/insetbib.C (Read): added this function because of wrong
3035 Write (without [begin|end]_inset).
3037 2000-07-11 Juergen Vigna <jug@sad.it>
3039 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
3040 as the insertInset could not be good!
3042 * src/screen.C (ToggleSelection): fixed toggle selection bug as
3043 the bool param should not be last.
3045 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3047 * sigc++/configure.in: fix bug in threading-related code (Yes, I
3048 did submit that to Karl).
3050 * configure.in: use -isystem instead of -I for X headers. This
3051 fixes a problem on solaris with a recent gcc;
3052 put the front-end code after the X detection code;
3053 configure in sigc++ before lib/
3055 * src/lyx_main.C (commandLineHelp): remove -display from command
3058 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
3060 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
3061 Also put in Makefile rules for building the ``listerrors''
3062 program for parsing errors from literate programs written in LyX.
3064 * lib/build-listerrors: Added small shell script as part of compile
3065 process. This builds a working ``listerrors'' binary if noweb is
3066 installed and either 1) the VNC X server is installed on the machine,
3067 or 2) the user is compiling from within a GUI. The existence of a GUI
3068 is necessary to use the ``lyx --export'' feature for now. This
3069 hack can be removed once ``lyx --export'' no longer requires a GUI to
3072 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
3074 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
3075 now passed back correctly from gcc and placed "under" error
3076 buttons in a Literate LyX source.
3078 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3080 * src/text.C (GetColumnNearX): Better behavior when a RTL
3081 paragraph is ended by LTR text.
3083 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
3086 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3088 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
3089 true when clipboard is empty.
3091 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3093 * text.C (Backspace): Prevent rebreaking of a row if it is the last
3094 row of the paragraph.
3095 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
3096 to prevent calculation of bidi tables
3098 2000-07-07 Juergen Vigna <jug@sad.it>
3100 * src/screen.C (ToggleSelection): added y_offset and x_offset
3103 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
3106 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
3108 * src/insets/insettext.C: fixed Layout-Display!
3110 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3112 * configure.in: add check for strings.h header.
3114 * src/spellchecker.C: include <strings.h> in order to have a
3115 definition for bzero().
3117 2000-07-07 Juergen Vigna <jug@sad.it>
3119 * src/insets/insettext.C (draw): set the status of the bv->text to
3120 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
3122 * src/screen.C (DrawOneRow):
3123 (DrawFromTo): redraw the actual row if something has changed in it
3126 * src/text.C (draw): call an update of the toplevel-inset if something
3127 has changed inside while drawing.
3129 * src/lyxtext.h: added CHANGED_IN_DRAW status.
3131 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
3133 * src/insets/insetbib.[Ch] (callback) new method, moving callback
3134 processing inside class.
3136 * src/insets/insetindex.[Ch] (callback) new method, moving callback
3137 processing inside class.
3139 * src/insets/insetindex.h new struct Holder, consistent with other
3142 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
3143 citation dialog from main code and placed it in src/frontends/xforms.
3144 Dialog launched through signals instead of callbacks
3146 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
3148 * lyx.man: update the options description.
3150 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
3152 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
3153 handle neg values, set min width to 590, add doc about -display
3155 2000-07-05 Juergen Vigna <jug@sad.it>
3157 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
3158 calls to BufferView *.
3160 * src/insets/insettext.C (checkAndActivateInset): small fix non
3161 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
3163 * src/insets/insetcommand.C (Read): Fixed as insets should read till
3164 their \end_inset token!
3166 2000-07-04 edscott <edscott@imp.mx>
3168 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
3169 lib/lyxrc.example: added option \wheel_jump
3171 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
3173 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
3174 remove support for -width,-height,-xpos and -ypos.
3176 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
3178 * src/encoding.[Ch]: New files.
3180 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
3181 (text): Call to the underline() method only when needed.
3183 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
3185 * src/buffer.C (makeLaTeXFile): Compute automatically the input
3186 encoding(s) for the document.
3188 * src/bufferparams.C (BufferParams): Changed default value of
3191 * src/language.C (newLang): Removed.
3192 (items[]): Added encoding information for all defined languages.
3194 * src/lyx_gui.C (create_forms): Added "auto" option to the input
3195 encoding choice button.
3197 * src/lyxrc.h (font_norm_type): New member variable.
3198 (set_font_norm_type): New method.
3200 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
3201 paragraphs with different encodings.
3203 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
3204 (TransformChar): Changed to work correctly with Arabic points.
3205 (draw): Added support for drawing Arabic points.
3206 (draw): Removed code for drawing underbars (this is done by
3209 * src/support/textutils.h (IsPrintableNonspace): New function.
3211 * src/BufferView_pimpl.h: Added "using SigC::Object".
3212 * src/LyXView.h: ditto.
3214 * src/insets/insetinclude.h (include_label): Changed to mutable.
3216 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3218 * src/mathed/math_iter.h: remove empty destructor
3220 * src/mathed/math_cursor.h: remove empty destructor
3222 * src/insets/lyxinset.h: add THEOREM_CODE
3224 * src/insets/insettheorem.[Ch]: new files
3226 * src/insets/insetminipage.C: (InsertInset): remove
3228 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
3230 (InsertInset): remove
3232 * src/insets/insetlist.C: (InsertList): remove
3234 * src/insets/insetfootlike.[Ch]: new files
3236 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
3239 (InsertInset): ditto
3241 * src/insets/insetert.C: remove include Painter.h, reindent
3242 (InsertInset): move to header
3244 * src/insets/insetcollapsable.h: remove explicit from default
3245 contructor, remove empty destructor, add InsertInset
3247 * src/insets/insetcollapsable.C (InsertInset): new func
3249 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3251 * src/vspace.h: add explicit to constructor
3253 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
3254 \textcompwordmark, please test this.
3256 * src/lyxrc.C: set ascii_linelen to 65 by default
3258 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
3260 * src/commandtags.h: add LFUN_INSET_THEOREM
3262 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
3263 (makeLinuxDocFile): remove _some_ of the nice logic
3264 (makeDocBookFile): ditto
3266 * src/Painter.[Ch]: (~Painter): removed
3268 * src/LyXAction.C (init): entry for insettheorem added
3270 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
3272 (deplog): code to detect files generated by LaTeX, needs testing
3275 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3277 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
3279 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3281 * src/LaTeX.C (deplog): Add a check for files that are going to be
3282 created by the first latex run, part of the project to remove the
3285 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
3286 contents to the extension list.
3288 2000-07-04 Juergen Vigna <jug@sad.it>
3290 * src/text.C (NextBreakPoint): added support for needFullRow()
3292 * src/insets/lyxinset.h: added needFullRow()
3294 * src/insets/insetcollapsable.C: redone now this uses a text-inset
3297 * src/insets/insettext.C: lots of changes for update!
3299 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
3301 * src/LaTeXFeatures.h: add a missing std:: qualifier.
3303 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
3305 * src/insets/insetinclude.C (InsetInclude): fixed
3306 initialization of include_label.
3307 (unique_id): now returns a string.
3309 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
3311 * src/LaTeXFeatures.h: new member IncludedFiles, for
3312 a map of key, included file name.
3314 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
3315 with the included files for inclusion in SGML preamble,
3316 i. e., linuxdoc and docbook.
3319 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
3320 nice (is the generated linuxdoc code to be exported?), that
3321 allows to remove column, and only_body that will be true for
3322 slave documents. Insets are allowed inside SGML font type.
3323 New handling of the SGML preamble for included files.
3324 (makeDocBookFile): the same for docbook.
3326 * src/insets/insetinclude.h:
3327 * src/insets/insetinclude.C (Validate): keeps a list of included files.
3329 (DocBook): new export methods.
3331 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
3332 and makeDocBookFile.
3334 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
3335 formats to export with command line argument -x.
3337 2000-06-29 Juergen Vigna <jug@sad.it>
3339 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
3340 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
3342 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
3343 region could already been cleared by an inset!
3345 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3347 * src/BufferView_pimpl.h: remove member variables lyx_focus and
3350 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
3352 (cursorToggle): remove special handling of lyx focus.
3354 2000-06-28 Juergen Vigna <jug@sad.it>
3356 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
3359 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3361 * src/insets/insetindex.C (Edit): add a callback when popup is
3364 * src/insets/insettext.C (LocalDispatch):
3365 * src/insets/insetmarginal.h:
3366 * src/insets/insetlist.h:
3367 * src/insets/insetfoot.h:
3368 * src/insets/insetfloat.h:
3369 * src/insets/insetert.h: add a missing std:: qualifier.
3371 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3373 * src/support/lyxsum.C (sum): '\0' teminate file read when using
3376 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
3378 * src/insets/insettext.C (Read): remove tmptok unused variable
3379 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
3380 (InsertInset): change for new InsetInset code
3382 * src/insets/insettext.h: add TEXT inline method
3384 * src/insets/insettext.C: remove TEXT macro
3386 * src/insets/insetmarginal.C (Write): new method
3387 (Latex): change output slightly
3389 * src/insets/insetfoot.C (Write): new method
3390 (Latex): change output slightly (don't use endl when no need)
3392 * src/insets/insetert.C (Write): new method
3394 * src/insets/insetcollapsable.h: make button_length, button_top_y
3395 and button_bottm_y protected.
3397 * src/insets/insetcollapsable.C (Write): simplify code by using
3398 tostr. Also do not output the float name, the children class
3399 should to that to get control over own arguments
3401 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
3402 src/insets/insetminipage.[Ch]:
3405 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3407 * src/lyxfunc.C (Dispatch): cases for new insets/commands
3409 * src/Makefile.am (lyx_SOURCES): add the new files
3411 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
3412 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
3413 * src/commandtags.h: ditto
3415 * src/LaTeXFeatures.h: add a std::set of used floattypes
3417 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
3419 * src/FloatList.[Ch] src/Floating.h: new files
3421 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
3423 * src/lyx_cb.C (TableApplyCB): ditto
3425 * src/text2.C: ditto
3426 * src/buffer.C (SimpleLinuxDocOnePar): ditto
3427 (parseSingleLyXformat2Token): ditto + add code for
3428 backwards compability for old float styles + add code for new insets
3430 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
3432 (InsertInset(size_type, Inset *, LyXFont)): new method
3433 (InsetChar(size_type, char)): changed to use the other InsetChar
3434 with a LyXFont(ALL_INHERIT).
3435 (InsetInset(size_type, Inset*)): changed to use InsetChar to
3436 insert the META_INSET.
3438 * sigc++/thread.cc (Privete<int>::operator int&): move definition
3440 * sigc++/thread.h (Threads): from here
3442 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
3443 definition out of line
3444 * sigc++/scope.h: from here
3446 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3448 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
3449 is specified (adapted from a patch from edscott <edscott@imp.mx>).
3451 * Makefile.am (bindist): new target.
3453 * INSTALL: add instructions for doing a binary distribution.
3455 * development/tools/README.bin.example: update a bit.
3457 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
3460 * lib/lyxrc.example: new lyxrc tag \set_color.
3462 * src/lyxfunc.C (Dispatch):
3463 * src/commandtags.h:
3464 * src/LyXAction.C: new lyxfunc "set-color".
3466 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
3467 and an x11name given as strings.
3469 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
3470 cache when a color is changed.
3472 2000-06-26 Juergen Vigna <jug@sad.it>
3474 * src/lyxrow.C (width): added this functions and variable.
3476 * src/insets/insetcite.C (create_form_citation_form): some Gravity
3479 * src/text.C (SetHeightOfRow): fixed calcualting of width.
3481 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3483 * images/undo_bw.xpm: new icon.
3484 * images/redo_bw.xpm: ditto.
3486 * configure.in (INSTALL_SCRIPT): change value to
3487 ${INSTALL} to avoid failures of install-script target.
3488 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
3490 * src/BufferView.h: add a magic "friend" declaration to please
3493 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
3495 * forms/cite.fd: modified to allow resizing without messing
3498 * src/insetcite.C: Uses code from cite.fd almost without
3500 User can now resize dialog in the x-direction.
3501 Resizing the dialog in the y-direction is prevented, as the
3502 code does this intelligently already.
3504 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3506 * INSTALL: remove obsolete entry in "problems" section.
3508 * lib/examples/sl_*.lyx: update of the slovenian examples.
3510 * src/support/FileInfo.[Ch] (getBlockSize): remove.
3512 2000-06-23 Juergen Vigna <jug@sad.it>
3514 * src/lyxtext.h: added a 'cleared' flag to draw() function.
3516 * src/buffer.C (resize): delete the LyXText of textinsets.
3518 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
3520 * src/insets/lyxinset.h: added another parameter 'cleared' to
3521 the draw() function.
3523 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
3524 unlocking inset in inset.
3526 2000-06-22 Juergen Vigna <jug@sad.it>
3528 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
3529 of insets and moved first to LyXText.
3531 * src/mathed/formulamacro.[Ch]:
3532 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
3534 2000-06-21 Juergen Vigna <jug@sad.it>
3536 * src/text.C (GetVisibleRow): look if I should clear the area or not
3537 using Inset::doClearArea() function.
3539 * src/insets/lyxinset.h: added doClearArea() function and
3540 modified draw(Painter &, ...) to draw(BufferView *, ...)
3542 * src/text2.C (UpdateInset): return bool insted of int
3544 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
3546 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
3547 combox in the character popup
3549 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
3550 BufferParams const & params
3552 2000-06-20 Juergen Vigna <jug@sad.it>
3554 * src/insets/insettext.C (SetParagraphData): set insetowner on
3557 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3559 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
3560 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
3562 (form_main_): remove
3564 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
3565 (create_form_form_main): remove FD_form_main stuff, connect to
3566 autosave_timeout signal
3568 * src/LyXView.[Ch] (getMainForm): remove
3569 (UpdateTimerCB): remove
3570 * src/BufferView_pimpl.h: inherit from SigC::Object
3572 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
3573 signal instead of callback
3575 * src/BufferView.[Ch] (cursorToggleCB): remove
3577 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3579 * src/BufferView_pimpl.C: changes because of the one below
3581 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
3582 instead of storing a pointer to a LyXText.
3584 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
3586 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
3588 * src/lyxparagraph.h
3590 * src/paragraph.C: Changed fontlist to a sorted vector.
3592 2000-06-19 Juergen Vigna <jug@sad.it>
3594 * src/BufferView.h: added screen() function.
3596 * src/insets/insettext.C (LocalDispatch): some selection code
3599 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
3601 * src/insets/insettext.C (SetParagraphData):
3603 (InsetText): fixes for multiple paragraphs.
3605 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
3607 * development/lyx.spec.in: Call configure with ``--without-warnings''
3608 to work around a bug with the Makefiles when doing ``make lyxrpm''.
3609 This should be fine, however, since we generally don't want to be
3610 verbose when making an RPM.
3612 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
3614 * lib/scripts/fig2pstex.py: New file
3616 2000-06-16 Juergen Vigna <jug@sad.it>
3618 * src/insets/insettabular.C (UpdateLocal):
3619 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
3620 (LocalDispatch): Changed all functions to use LyXText.
3622 2000-06-15 Juergen Vigna <jug@sad.it>
3624 * src/text.C (SetHeightOfRow): call inset::update before requesting
3627 * src/insets/insettext.C (update):
3628 * src/insets/insettabular.C (update): added implementation
3630 * src/insets/lyxinset.h: added update function
3632 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3634 * src/text.C (SelectNextWord): protect against null pointers with
3635 old-style string streams. (fix from Paul Theo Gonciari
3638 * src/cite.[Ch]: remove erroneous files.
3640 * lib/configure.m4: update the list of created directories.
3642 * src/lyxrow.C: include <config.h>
3643 * src/lyxcursor.C: ditto.
3645 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3647 * lib/examples/decimal.lyx: new example file from Mike.
3649 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
3650 to find template definitions (from Dekel)
3652 * src/frontends/.cvsignore: add a few things.
3654 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
3656 * src/Timeout.C (TimeOut): remove default argument.
3658 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
3661 * src/insets/ExternalTemplate.C: add a "using" directive.
3663 * src/lyx_main.h: remove the act_ struct, which seems unused
3666 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
3668 * LyX Developers Meeting: All files changed, due to random C++ (by
3669 coincidence) code generator script.
3671 - external inset (cool!)
3672 - initial online editing of preferences
3673 - insettabular breaks insettext(s contents)
3675 - some DocBook fixes
3676 - example files update
3677 - other cool stuff, create a diff and look for yourself.
3679 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
3681 * src/insets/insettext.C (computeTextRows): if the maxWidth is
3682 -1 this is a non-line-breaking textinset.
3684 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
3685 if there is no width set.
3687 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
3689 * Lots of files: Merged the dialogbase branch.
3691 2000-06-09 Allan Rae <rae@lyx.org>
3693 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
3694 and the Dispatch methods that used it.
3696 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
3697 access to functions formerly kept in Dispatch.
3699 2000-05-19 Allan Rae <rae@lyx.org>
3701 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
3702 made to_page and count_copies integers again. from_page remains a
3703 string however because I want to allow entry of a print range like
3704 "1,4,22-25" using this field.
3706 * src/LyXAction.C: added action info and commands for buffer-print-xtl
3707 and printer-params-get. These aren't useful from the minibuffer but
3708 could be used by a script/LyXServer app provided it passes a suitable
3709 auto_mem_buffer. I guess I should take a look at how the LyXServer
3710 works and make it support xtl buffers.
3712 * sigc++/: updated to libsigc++-1.0.1
3714 * src/xtl/: updated to xtl-1.3.pl.11
3716 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
3717 those changes done to the files in src/ are actually recreated when
3718 they get regenerated. Please don't ever accept a patch that changes a
3719 dialog unless that patch includes the changes to the corresponding *.fd
3722 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
3723 stringOnlyContains, renamed it and generalised it.
3725 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
3726 branch. Removed the remaining old form_print code.
3728 2000-04-26 Allan Rae <rae@lyx.org>
3730 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
3731 trap I was trying to fix with the ID: fields in src/xtl/ :-)
3733 2000-04-25 Allan Rae <rae@lyx.org>
3735 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
3736 against a base of xtl-1.3.pl.4
3738 * development/tools/lxtl.sh: fixed a couple of silly typos and now
3739 filter the Id: entries so they still show the xtl version number
3742 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
3743 into the src/xtl code. Patch still pending with José (XTL)
3745 2000-04-24 Allan Rae <rae@lyx.org>
3747 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
3748 both more generic and much safer. Use the new template functions.
3749 * src/buffer.[Ch] (Dispatch): ditto.
3751 * src/frontends/xforms/FormPrint.C (update): Use new template functions
3752 and mem buffer more intelligently. Also a little general cleanup.
3755 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
3756 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
3757 * src/xtl/Makefile.am: ditto.
3758 * src/xtl/.cvsignore: ditto.
3759 * src/Makefile.am: ditto.
3761 * src/PrinterParams.h: Removed the macros member functions. Added a
3762 testInvariant member function. A bit of tidying up and commenting.
3763 Included Angus's idea for fixing operation with egcs-1.1.2.
3765 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
3766 cool expansion of XTL's mem_buffer to support automatic memory
3767 management within the buffer itself. Removed the various macros and
3768 replaced them with template functions that use either auto_mem_buffer
3769 or mem_buffer depending on a #define. The mem_buffer support will
3770 disappear as soon as the auto_mem_buffer is confirmed to be good on
3771 other platforms/compilers. That is, it's there so you've got something
3774 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
3775 effectively forked XTL. However I expect José will include my code
3776 into the next major release. Also fixed a memory leak.
3777 * src/xtl/text.h: ditto.
3778 * src/xtl/xdr.h: ditto.
3779 * src/xtl/giop.h: ditto.
3781 2000-04-16 Allan Rae <rae@lyx.org>
3783 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
3784 by autogen.sh and removed by maintainer-clean anyway.
3785 * .cvsignore, sigc++/.cvsignore: Support the above.
3787 * sigc++/.cvsignore: Forgot that retbind.h was generated.
3789 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
3791 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
3792 macros, renamed static callback-target member functions to suit new
3793 scheme and made them public.
3794 * src/frontends/xforms/forms/form_print.fd: ditto.
3795 * src/frontends/xforms/forms/form_copyright.fd: ditto.
3797 * src/support/lxtl.h: small cleanup to use typedef instead of #define
3800 * src/xtl/: New directory containing a minimal distribution of XTL.
3801 This is XTL-1.3.pl.4.
3803 * development/tools/lxtl.sh: A script to generate the above mini-dist.
3805 2000-04-15 Allan Rae <rae@lyx.org>
3807 * development/tools/makeLyXsigc.sh: Remove the library version numbers
3809 * sigc++/: Updated to libsigc++-1.0.0
3811 2000-04-14 Allan Rae <rae@lyx.org>
3813 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
3814 use the generic ones in future. I'll modify my conversion script.
3816 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
3818 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
3819 (CloseAllBufferRelatedDialogs): Renamed.
3820 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
3822 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
3823 of the generic ones. These are the same ones my conversion script
3826 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
3827 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
3828 * src/buffer.C (Dispatch): ditto
3830 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
3831 functions for updating and hiding buffer dependent dialogs.
3832 * src/BufferView.C (buffer): ditto
3833 * src/buffer.C (setReadonly): ditto
3834 * src/lyxfunc.C (CloseBuffer): ditto
3836 * src/buffer.h: Take setReadonly() out of line so I don't have to include
3837 Dialogs.h, and hence all the SigC stuff, into every file that includes
3838 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
3840 * src/BufferView2.C: reduce the number of headers included by buffer.h
3842 2000-04-11 Allan Rae <rae@lyx.org>
3844 * src/frontends/xforms/xform_macros.h: A small collection of macros
3845 for building C callbacks.
3847 * src/frontends/xforms/Makefile.am: Added above file.
3849 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
3850 scheme again. This time it should work for JMarc. If this is
3851 successful I'll revise my conversion script to automate some of this.
3852 The static member functions in the class also have to be public for
3853 this scheme will work. If the scheme works (it's almost identical to
3854 the way BufferView::cursorToggleCB is handled so it should work) then
3855 FormCopyright and FormPrint will be ready for inclusion into the main
3856 trunk immediately after 1.1.5 is released -- provided we're prepared
3857 for complaints about lame compilers not handling XTL.
3859 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
3861 2000-04-07 Allan Rae <rae@lyx.org>
3863 * config/lyxinclude.m4: A bit more tidying up (Angus)
3865 * src/LString.h: JMarc's <string> header fix
3867 * src/PrinterParams.h: Used string for most data to remove some
3868 ugly code in the Print dialog and avoid even uglier code when
3869 appending the ints to a string for output.
3871 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
3872 and moved "default:" back to the end of switch statement. Cleaned
3873 up the printing so it uses the right function calls and so the
3874 "print to file" option actually puts the file in the right directory.
3876 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
3878 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
3879 and Ok+Apply button control into a separate method: input (Angus).
3880 (input) Cleaned it up and improved it to be very thorough now.
3881 (All CB) static_cast used instead of C style cast (Angus). This will
3882 probably change again once we've worked out how to keep gcc-2.8.1 happy
3883 with real C callbacks.
3884 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
3885 ignore some of the bool settings and has random numbers instead. Needs
3886 some more investigation. Added other input length checks and checking
3887 of file and printer names.
3889 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
3890 would link (Angus). Seems the old code doesn't compile with the pragma
3891 statement either. Separated callback entries from internal methods.
3893 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
3895 2000-03-17 Allan Rae <rae@lyx.org>
3897 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
3898 need it? Maybe it could go in Dialogs instead? I could make it a
3899 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
3900 values to get the bool return value.
3901 (Dispatch): New overloaded method for xtl support.
3903 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
3904 extern "C" callback instead of static member functions. Hopefully,
3905 JMarc will be able to compile this. I haven't changed
3906 forms/form_copyright.fd yet. Breaking one of my own rules already.
3908 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
3909 because they aren't useful from the minibuffer. Maybe a LyXServer
3910 might want a help message though?
3912 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
3914 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
3915 xtl which needs both rtti and exceptions.
3917 * src/support/Makefile.am:
3918 * src/support/lxtl.h: New file. Some helper macros for using XTL.
3920 * src/frontends/xforms/input_validators.[ch]: input filters and
3921 validators. These conrol what keys are valid in input boxes.
3922 Use them and write some more. Much better idea than waiting till
3923 after the user has pressed Ok to say that the input fields don't make
3926 * src/frontends/xforms/Makefile.am:
3927 * src/frontends/xforms/forms/form_print.fd:
3928 * src/frontends/xforms/forms/makefile:
3929 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
3930 new scheme. Still have to make sure I haven't missed anything from
3931 the current implementation.
3933 * src/Makefile.am, src/PrinterParams.h: New data store.
3935 * other files: Added a couple of copyright notices.
3937 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3939 * src/insets/insetbib.h: move Holder struct in public space.
3941 * src/frontends/include/DialogBase.h: use SigC:: only when
3942 SIGC_CXX_NAMESPACES is defined.
3943 * src/frontends/include/Dialogs.h: ditto.
3945 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
3947 * src/frontends/xforms/FormCopyright.[Ch]: do not
3948 mention SigC:: explicitely.
3950 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3952 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
3953 deals with testing KDE in main configure.in
3954 * configure.in: ditto.
3956 2000-02-22 Allan Rae <rae@lyx.org>
3958 * Lots of files: Merged from HEAD
3960 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
3961 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
3963 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
3965 * sigc++/: new minidist.
3967 2000-02-14 Allan Rae <rae@lyx.org>
3969 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
3971 2000-02-08 Juergen Vigna <jug@sad.it>
3973 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
3974 file for the buildin GUI builder of KDevelop of the copyright-dialog.
3976 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
3977 for this port and so it is much easier for other people to port
3978 dialogs in a common development environment.
3980 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
3981 the QT/KDE implementation.
3983 * src/frontends/kde/Dialogs.C:
3984 * src/frontends/kde/FormCopyright.C:
3985 * src/frontends/kde/FormCopyright.h:
3986 * src/frontends/kde/Makefile.am:
3987 * src/frontends/kde/formcopyrightdialog.C:
3988 * src/frontends/kde/formcopyrightdialog.h:
3989 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
3990 for the kde support of the Copyright-Dialog.
3992 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3993 subdir-substitution instead of hardcoded 'xforms' as we now have also
3996 * src/frontends/include/DialogBase.h (Object): just commented the
3997 label after #endif (nasty warning and I don't like warnings ;)
3999 * src/main.C (main): added KApplication initialization if using
4002 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
4003 For now only the KDE event-loop is added if frontend==kde.
4005 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
4007 * configure.in: added support for the --with-frontend[=value] option
4009 * autogen.sh: added kde.m4 file to list of config-files
4011 * acconfig.h: added define for KDEGUI-support
4013 * config/kde.m4: added configuration functions for KDE-port
4015 * config/lyxinclude.m4: added --with-frontend[=value] option with
4016 support for xforms and KDE.
4018 2000-02-08 Allan Rae <rae@lyx.org>
4020 * all Makefile.am: Fixed up so the make targets dist, distclean,
4021 install and uninstall all work even if builddir != srcdir. Still
4022 have a new sigc++ minidist update to come.
4024 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
4026 2000-02-01 Allan Rae <rae@lyx.org>
4028 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
4029 Many mods to get builddir != srcdir working.
4031 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
4032 for building on NT and so we can do the builddir != srcdir stuff.
4034 2000-01-30 Allan Rae <rae@lyx.org>
4036 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
4037 This will stay in "rae" branch. We probably don't really need it in
4038 the main trunk as anyone who wants to help programming it should get
4039 a full library installed also. So they can check both included and
4040 system supplied library compilation.
4042 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
4043 Added a 'mini' distribution of libsigc++. If you feel the urge to
4044 change something in these directories - Resist it. If you can't
4045 resist the urge then you should modify the following script and rebuild
4046 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
4047 all happen. Still uses a hacked version of libsigc++'s configure.in.
4048 I'm quite happy with the results. I'm not sure the extra work to turn
4049 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
4050 worth the trouble and would probably lead to extra maintenance
4052 I haven't tested the following important make targets: install, dist.
4053 Not ready for prime time but very close. Maybe 1.1.5.
4055 * development/tools/makeLyXsigc.sh: A shell script to automatically
4056 generate our mini-dist of libsigc++. It can only be used with a CVS
4057 checkout of libsigc++ not a tarball distribution. It's well commented.
4058 This will end up as part of the libsigc++ distribution so other apps
4059 can easily have an included mini-dist. If someone makes mods to the
4060 sigc++ subpackage without modifying this script to generate those
4061 changes I'll be very upset!
4063 * src/frontends/: Started the gui/system indep structure.
4065 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
4066 to access the gui-indep dialogs are in this class. Much improved
4067 design compared to previous revision. Lars, please refrain from
4068 moving this header into src/ like you did with Popups.h last time.
4070 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
4072 * src/frontends/xforms/: Started the gui-indep system with a single
4073 dialog: FormCopyright. Initial testing of use of libsigc++ was very
4076 * src/frontends/xforms/forms: Repository for the xforms .fd files.
4077 Here you'll find a very useful makefile and automated fdfix.sh that
4078 makes updating dailogs a no-brainer -- provided you follow the rules
4079 set out in the README. I'm thinking about adding another script to
4080 automatically generate skeleton code for a new dialog given just the
4083 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
4084 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
4085 Made FormCopyright gui-indep and added a lyxfunc to get to it.
4087 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4089 * src/support/LSubstring.C (operator): simplify
4091 * src/lyxtext.h: removed bparams, use buffer_->params instead
4093 * src/lyxrow.h: make Row a real class, move all variables to
4094 private and use accessors.
4096 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
4098 (isRightToLeftPar): ditto
4099 (ChangeLanguage): ditto
4100 (isMultiLingual): ditto
4103 (SimpleTeXOnePar): ditto
4104 (TeXEnvironment): ditto
4105 (GetEndLabel): ditto
4107 (SetOnlyLayout): ditto
4108 (BreakParagraph): ditto
4109 (BreakParagraphConservative): ditto
4110 (GetFontSettings): ditto
4112 (CopyIntoMinibuffer): ditto
4113 (CutIntoMinibuffer): ditto
4114 (PasteParagraph): ditto
4115 (SetPExtraType): ditto
4116 (UnsetPExtraType): ditto
4117 (DocBookContTableRows): ditto
4118 (SimpleDocBookOneTablePar): ditto
4120 (TeXFootnote): ditto
4121 (SimpleTeXOneTablePar): ditto
4122 (TeXContTableRows): ditto
4123 (SimpleTeXSpecialChars): ditto
4126 * src/lyxcursor.h: make LyXCursor a real class, move all variables
4127 to private and use accessors.
4129 * src/lyx_cb.C: remove char updatetimer, and all code that uses
4130 this, we did not use it anymore and has not been for ages. Just a
4131 waste of cpu cycles.
4133 * src/language.h: make Language a real class, move all variables
4134 to private and use accessors.
4136 * src/BufferView_pimpl.C (Pimpl): use new timer code.
4137 (create_view): remove
4138 (update): some changes for new timer
4139 (cursorToggle): use new timer
4140 (beforeChange): change for new timer
4142 * src/BufferView.h (cursorToggleCB): removed last paramter because
4145 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
4146 (cursorToggleCB): change because of new timer code
4148 * lib/CREDITS: updated own mailaddress
4150 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4152 * src/support/filetools.C (PutEnv): fix the code in case neither
4153 putenv() nor setenv() have been found.
4155 * INSTALL: mention the install-strip Makefile target.
4157 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
4158 read-only documents.
4160 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4162 * lib/reLyX/configure.in (VERSION): avoid using a previously
4163 generated reLyX wrapper to find out $prefix.
4165 * lib/examples/eu_adibide_lyx-atua.lyx:
4166 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
4167 translation of the Tutorial (Dooteo)
4169 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
4171 * forms/cite.fd: new citation dialog
4173 * src/insetcite.[Ch]: the new citation dialog is moved into
4176 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
4179 * src/insets/insetcommand.h: data members made private.
4181 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4183 * LyX 1.1.5 released
4185 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4187 * src/version.h (LYX_RELEASE): to 1.1.5
4189 * src/spellchecker.C (RunSpellChecker): return false if the
4190 spellchecker dies upon creation.
4192 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4194 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
4195 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
4199 * lib/CREDITS: update entry for Martin Vermeer.
4201 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
4203 * src/text.C (draw): Draw foreign language bars at the bottom of
4204 the row instead of at the baseline.
4206 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
4208 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4210 * lib/bind/de_menus.bind: updated
4212 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4214 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
4216 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4218 * src/menus.C (Limit_string_length): New function
4219 (ShowTocMenu): Limit the number of items/length of items in the
4222 * src/paragraph.C (String): Correct result for a paragraph inside
4225 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4227 * src/bufferlist.C (close): test of buf->getuser() == NULL
4229 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
4231 * src/BufferView2.C (removeAutoInsets): Fix a bug:
4232 Do not call to SetCursor when the paragraph is a closed footnote!
4234 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
4236 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
4239 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
4241 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4244 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
4245 reference popup, that activates the reference-back action
4247 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
4249 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
4250 the menus. Also fixed a bug.
4252 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
4253 the math panels when switching buffers (unless new buffer is readonly).
4255 * src/BufferView.C (NoSavedPositions)
4256 * src/BufferView_pimpl.C (NoSavedPositions): New methods
4258 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4260 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
4261 less of dvi dirty or not.
4263 * src/trans_mgr.[Ch] (insert): change first parameter to string
4266 * src/chset.[Ch] (encodeString): add const to first parameter
4268 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4270 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
4274 * src/LaTeX.C (deplog): better searching for dependency files in
4275 the latex log. Uses now regexps.
4277 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
4278 instead of the box hack or \hfill.
4280 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4282 * src/lyxfunc.C (doImportHelper): do not create the file before
4283 doing the actual import.
4284 (doImportASCIIasLines): create a new file before doing the insert.
4285 (doImportASCIIasParagraphs): ditto.
4287 * lib/lyxrc.example: remove mention of non-existing commands
4289 * lyx.man: remove mention of color-related switches.
4291 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
4293 * src/lyx_gui.C: remove all the color-related ressources, which
4294 are not used anymore.
4296 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
4299 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4301 * src/lyxrc.C (read): Add a missing break in the switch
4303 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
4305 * src/text2.C (InsertStringA): Fix a bug with insertion into table
4307 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
4310 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4312 * src/text.C (draw): draw bars under foreign language words.
4314 * src/LColor.[Ch]: add LColor::language
4316 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4318 * src/lyxcursor.h (boundary): New member variable
4320 * src/text.C (IsBoundary): New methods
4322 * src/text.C: Use the above for currect cursor movement when there
4323 is both RTL & LTR text.
4325 * src/text2.C: ditto
4327 * src/bufferview_funcs.C (ToggleAndShow): ditto
4329 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4331 * src/text.C (DeleteLineForward): set selection to true to avoid
4332 that DeleteEmptyParagraphMechanism does some magic. This is how it
4333 is done in all other functions, and seems reasonable.
4334 (DeleteWordForward): do not jump over non-word stuff, since
4335 CursorRightOneWord() already does it.
4337 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
4338 DeleteWordBackward, since they seem safe to me (since selection is
4339 set to "true") DeleteEmptyParagraphMechanism does nothing.
4341 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4343 * src/lyx_main.C (easyParse): simplify the code by factoring the
4344 part that removes parameters from the command line.
4345 (LyX): check wether wrong command line options have been given.
4347 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
4349 * src/lyx_main.C : add support for specifying user LyX
4350 directory via command line option -userdir.
4352 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
4354 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
4355 the number of items per popup.
4356 (Add_to_refs_menu): Ditto.
4358 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4360 * src/lyxparagraph.h: renamed ClearParagraph() to
4361 StripLeadingSpaces() and moved it to paragraph.C. We pass the
4362 textclass as parameter, and do nothing if free_spacing is
4363 true. This fixes part of the line-delete-forward problems.
4365 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
4366 (pasteSelection): ditto.
4367 (SwitchLayoutsBetweenClasses): more translatable strings.
4369 * src/text2.C (CutSelection): use StripLeadingSpaces.
4370 (PasteSelection): ditto.
4371 (DeleteEmptyParagraphMechanism): ditto.
4373 2000-05-26 Juergen Vigna <jug@sad.it>
4375 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
4376 is not needed in tabular insets.
4378 * src/insets/insettabular.C (TabularFeatures): added missing features.
4380 * src/tabular.C (DeleteColumn):
4382 (AppendRow): implemented this functions
4383 (cellsturct::operator=): clone the inset too;
4385 2000-05-23 Juergen Vigna <jug@sad.it>
4387 * src/insets/insettabular.C (LocalDispatch): better selection support
4388 when having multicolumn-cells.
4390 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4392 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
4394 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4396 * src/ColorHandler.C (getGCForeground): put more test into _()
4398 * lib/examples/eu_splash.lyx: new file (Basque translation) from
4401 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
4404 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
4406 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
4407 there are no labels, or when buffer is readonly.
4409 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
4410 there are no labels, buffer is SGML, or when buffer is readonly.
4412 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4414 * src/LColor.C (LColor): change a couple of grey40 to grey60
4415 (LColor): rewore initalization to make compiles go some magnitude
4417 (getGUIName): don't use gettext until we need the string.
4419 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
4421 * src/Bullet.[Ch]: Fixed a small bug.
4423 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
4425 * src/paragraph.C (String): Several fixes/improvements
4427 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
4429 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4431 * src/paragraph.C (String): give more correct output.
4433 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
4435 * src/lyxfont.C (stateText) Do not output the language if it is
4436 eqaul to the language of the document.
4438 * src/paragraph.C (TeXOnePar): Do not put language switch commands
4439 between two paragraphs with the same language.
4441 * src/paragraph.C (getParLanguage) Return a correct answer for an
4442 empty dummy paragraph.
4444 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
4447 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
4450 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
4451 the menus/popup, if requested fonts are unavailable.
4453 2000-05-22 Juergen Vigna <jug@sad.it>
4455 * src/insets/insettabular.C (LocalDispatch): added some more cursor
4456 movement support (Up/Down/Tab/Shift-Tab).
4457 (LocalDispatch): added also preliminari cursor-selection.
4459 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
4461 * src/paragraph.C (PasteParagraph): Hopefully now right!
4463 2000-05-22 Garst R. Reese <reese@isn.net>
4465 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
4466 of list, change all references to Environment to Command
4467 * tex/hollywood.cls : rewrite environments as commands, add
4468 \uppercase to interiorshot and exteriorshot to force uppecase.
4469 * tex/broadway.cls : rewrite environments as commands. Tweak
4472 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4474 * src/menus.C (Add_to_toc_menu): fix the code which limits the
4475 size of items: use a constant intead of the hardcoded 40, and more
4476 importantly do not remove the %m and %x tags added at the end.
4477 (Add_to_refs_menu): use vector::size_type instead of
4478 unsigned int as basic types for the variables. _Please_ do not
4479 assume that size_t is equal to unsigned int. On an alpha, this is
4480 unsigned long, which is _not_ the same.
4482 * src/language.C (initL): remove language "hungarian", since it
4483 seems that "magyar" is better.
4485 2000-05-22 Juergen Vigna <jug@sad.it>
4487 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
4489 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
4492 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
4493 next was deleted but not set to 0.
4495 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4497 * src/language.C (initL): change the initialization of languages
4498 so that compiles goes _fast_.
4500 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
4503 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
4505 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4509 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4511 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
4513 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
4517 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
4520 * src/insets/insetlo*.[Ch]: Made editable
4522 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4524 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
4525 the current selection.
4527 * src/BufferView_pimpl.C (stuffClipboard): new method
4529 * src/BufferView.C (stuffClipboard): new method
4531 * src/paragraph.C (String): new method
4533 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
4534 LColor::ignore when lyxname is not found.
4536 * src/BufferView.C (pasteSelection): new method
4538 * src/BufferView_pimpl.C (pasteSelection): new method
4540 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
4542 * src/WorkArea.C (request_clipboard_cb): new static function
4543 (getClipboard): new method
4544 (putClipboard): new method
4546 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4548 * LyX 1.1.5pre2 released
4550 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4552 * src/vspace.C (operator=): removed
4553 (operator=): removed
4555 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
4557 * src/layout.C (NumberOfClass): manually set the type in make_pair
4558 (NumberOfLayout): ditto
4560 * src/language.C: use the Language constructor for ignore_lang
4562 * src/language.h: add constructors to struct Language
4564 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
4566 * src/text2.C (SetCursorIntern): comment out #warning
4568 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
4570 * src/mathed/math_iter.h: initialize sx and sw to 0
4572 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4574 * forms/lyx.fd: Redesign of form_ref
4576 * src/LaTeXFeatures.[Ch]
4580 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
4583 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
4584 and Buffer::inset_iterator.
4586 * src/menus.C: Added new menus: TOC and Refs.
4588 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
4590 * src/buffer.C (getTocList): New method.
4592 * src/BufferView2.C (ChangeRefs): New method.
4594 * src/buffer.C (getLabelList): New method. It replaces the old
4595 getReferenceList. The return type is vector<string> instead of
4598 * src/insets/insetinclude.C (getLabelList): New method. Replaces
4599 the old getLabel() and GetNumberOfLabels() methods.
4600 * src/insets/insetlabel.C (getLabelList): ditto
4601 * src/mathed/formula.C (getLabelList): ditto
4603 * src/paragraph.C (String): New method.
4605 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
4606 Uses the new getTocList() method.
4607 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
4608 which automatically updates the contents of the browser.
4609 (RefUpdateCB): Use the new getLabelList method.
4611 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
4613 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
4615 * src/spellchecker.C: Added using std::reverse;
4617 2000-05-19 Juergen Vigna <jug@sad.it>
4619 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
4621 * src/insets/insettext.C (computeTextRows): small fix for display of
4622 1 character after a newline.
4624 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
4627 2000-05-18 Juergen Vigna <jug@sad.it>
4629 * src/insets/insettabular.C (TabularFeatures): fixed update of display
4630 when changing width of column.
4632 * src/tabular.C (set_row_column_number_info): setting of
4633 autobreak rows if necessary.
4635 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4637 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
4639 * src/vc-backend.*: renamed stat() to status() and vcstat to
4640 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
4641 compilation broke. The new name seems more relevant, anyway.
4643 2000-05-17 Juergen Vigna <jug@sad.it>
4645 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
4646 which was wrong if the removing caused removing of rows!
4648 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
4649 (pushToken): new function.
4651 * src/text2.C (CutSelection): fix problem discovered with purify
4653 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4655 * src/debug.C (showTags): enlarge the first column, now that we
4656 have 6-digits debug codes.
4658 * lib/layouts/hollywood.layout:
4659 * lib/tex/hollywood.cls:
4660 * lib/tex/brodway.cls:
4661 * lib/layouts/brodway.layout: more commands and fewer
4662 environments. Preambles moved in the .cls files. Broadway now has
4663 more options on scene numbering and less whitespace (from Garst)
4665 * src/insets/insetbib.C (getKeys): make sure that we are in the
4666 document directory, in case the bib file is there.
4668 * src/insets/insetbib.C (Latex): revert bogus change.
4670 2000-05-16 Juergen Vigna <jug@sad.it>
4672 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
4673 the TabularLayout on cursor move.
4675 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
4677 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
4680 (draw): fixed cursor position and drawing so that the cursor is
4681 visible when before the tabular-inset.
4683 * src/insets/insettext.C (init): drawLockedFrame was not initialized
4684 when creating from old insettext.
4686 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
4688 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4690 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
4691 * lib/tex/brodway.cls: ditto
4693 * lib/layouts/brodway.layout: change alignment of parenthical
4696 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4698 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
4699 versions 0.88 and 0.89 are supported.
4701 2000-05-15 Juergen Vigna <jug@sad.it>
4703 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
4706 * src/insets/insettext.C (computeTextRows): redone completely this
4707 function in a much cleaner way, because of problems when having a
4709 (draw): added a frame border when the inset is locked.
4710 (SetDrawLockedFrame): this sets if we draw the border or not.
4711 (SetFrameColor): this sets the frame color (default=insetframe).
4713 * src/insets/lyxinset.h: added x() and y() functions which return
4714 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
4715 function which is needed to see if we have a locking inset of some
4716 type in this inset (needed for now in insettabular).
4718 * src/vspace.C (inPixels): the same function also without a BufferView
4719 parameter as so it is easier to use it in some ocasions.
4721 * src/lyxfunc.C: changed all places where insertInset was used so
4722 that now if it couldn't be inserted it is deleted!
4724 * src/TabularLayout.C:
4725 * src/TableLayout.C: added support for new tabular-inset!
4727 * src/BufferView2.C (insertInset): this now returns a bool if the
4728 inset was really inserted!!!
4730 * src/tabular.C (GetLastCellInRow):
4731 (GetFirstCellInRow): new helper functions.
4732 (Latex): implemented for new tabular class.
4736 (TeXTopHLine): new Latex() helper functions.
4738 2000-05-12 Juergen Vigna <jug@sad.it>
4740 * src/mathed/formulamacro.C (Read):
4741 * src/mathed/formula.C (Read): read also the \end_inset here!
4743 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4745 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
4746 crush when saving formulae with unbalanced parenthesis.
4748 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
4750 * src/layout.C: Add new keyword "endlabelstring" to layout file
4752 * src/text.C (GetVisibleRow): Draw endlabel string.
4754 * lib/layouts/broadway.layout
4755 * lib/layouts/hollywood.layout: Added endlabel for the
4756 Parenthetical layout.
4758 * lib/layouts/heb-article.layout: Do not use slanted font shape
4759 for Theorem like environments.
4761 * src/buffer.C (makeLaTeXFile): Always add "american" to
4762 the UsedLanguages list if document language is RTL.
4764 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4766 * add addendum to README.OS2 and small patch (from SMiyata)
4768 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4770 * many files: correct the calls to ChangeExtension().
4772 * src/support/filetools.C (ChangeExtension): remove the no_path
4773 argument, which does not belong there. Use OnlyFileName() instead.
4775 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
4776 files when LaTeXing a non-nice latex file.
4778 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
4779 a chain of "if". Return false when deadkeys are not handled.
4781 * src/lyx_main.C (LyX): adapted the code for default bindings.
4783 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
4784 bindings for basic functionality (except deadkeys).
4785 (deadKeyBindings): new method. Performs the bindings of deadkeys.
4787 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
4788 several methods: handle override_x_deadkeys.
4790 * src/lyxrc.h: remove the "bindings" map, which did not make much
4791 sense anyway. New variable override_x_deadkeys, defaulting to "true".
4793 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4795 * src/lyxfont.C (stateText): use a saner method to determine
4796 whether the font is "default". Seems to fix the crash with DEC
4799 * src/Bullet.[Ch] (Bullet): remove const on parameters.
4801 2000-05-08 Juergen Vigna <jug@sad.it>
4803 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
4804 TabularLayoutMenu with mouse-button-3
4805 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
4807 * src/TabularLayout.C: added this file for having a Layout for
4810 2000-05-05 Juergen Vigna <jug@sad.it>
4812 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
4813 recalculating inset-widths.
4814 (TabularFeatures): activated this function so that I can change
4815 tabular-features via menu.
4817 * src/menus.C (ShowEditMenu): inserted support for insettabular so
4818 that I can test some functions with the Table menu.
4820 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4822 * src/lyxfont.C (stateText): guard against stupid c++libs.
4824 * src/tabular.C: add using std::vector
4825 some whitespace changes, + removed som autogenerated code.
4827 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
4829 2000-05-05 Juergen Vigna <jug@sad.it>
4831 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
4832 row, columns and cellstructures.
4834 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4836 * lib/lyxrc.example: remove obsolete entries.
4838 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
4839 reading of protected_separator for free_spacing.
4841 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4843 * src/text.C (draw): do not display an exclamation mark in the
4844 margin for margin notes. This is confusing, ugly and
4847 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
4848 AMS math' is checked.
4850 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
4851 name to see whether including the amsmath package is needed.
4853 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
4855 * src/paragraph.C (validate): Compute UsedLanguages correctly
4856 (don't insert the american language if it doesn't appear in the
4859 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
4860 The argument of \thanks{} command is considered moving argument
4862 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
4865 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
4867 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
4868 for appendix/minipage/depth. The lines can be now both in the footnote
4869 frame, and outside the frame.
4871 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
4874 2000-05-05 Juergen Vigna <jug@sad.it>
4876 * src/table.[Ch]: removed the inset and buffer stuff as this is now
4877 neede only in tabular.[Ch].
4879 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4881 * src/insets/insetspecialchar.C (Read): allow command == '~' for
4883 (Write): write '~' for PROTECTED_SEPARATOR
4885 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4887 * src/lyxparagraph.h: add a friend struct matchIT after the struct
4890 * src/mathed/formula.C (drawStr): rename size to siz.
4892 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
4893 possibly fix a bug by not changing the pflags = flags to piflags =
4896 2000-05-05 Juergen Vigna <jug@sad.it>
4898 * src/insets/insetbib.C: moved using directive
4900 * src/ImportNoweb.C: small fix for being able to compile (missing
4903 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4905 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
4906 to use clear, since we don't depend on this in the code. Add test
4909 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4911 * (various *.C files): add using std::foo directives to please dec
4914 * replace calls to string::clear() to string::erase() (Angus)
4916 * src/cheaders/cmath: modified to provide std::abs.
4918 2000-05-04 Juergen Vigna <jug@sad.it>
4920 * src/insets/insettext.C: Prepared all for inserting of multiple
4921 paragraphs. Still display stuff to do (alignment and other things),
4922 but I would like to use LyXText to do this when we cleaned out the
4923 table-support stuff.
4925 * src/insets/insettabular.C: Changed lot of stuff and added lots
4926 of functionality still a lot to do.
4928 * src/tabular.C: Various functions changed name and moved to be
4929 const functions. Added new Read and Write functions and changed
4930 lots of things so it works good with tabular-insets (also removed
4931 some stuff which is not needed anymore * hacks *).
4933 * src/lyxcursor.h: added operators == and != which just look if
4934 par and pos are (not) equal.
4936 * src/buffer.C (latexParagraphs): inserted this function to latex
4937 all paragraphs form par to endpar as then I can use this too for
4940 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
4941 so that I can call this to from text insets with their own cursor.
4943 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
4944 output off all paragraphs (because of the fix below)!
4946 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
4947 the very last paragraph (this could be also the last paragraph of an
4950 * src/texrow.h: added rows() call which returns the count-variable.
4952 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4954 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
4956 * lib/configure.m4: better autodetection of DocBook tools.
4958 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4960 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
4962 * src/lyx_cb.C: add using std::reverse;
4964 * src/LaTeX.C (run): on error always run deleteFilesOnError before
4967 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
4968 selected files. Should fix repeated errors from generated files.
4970 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
4972 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
4974 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
4975 the spellchecker popup.
4977 * lib/lyxrc.example: Removed the \number_inset section
4979 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4981 * src/insets/figinset.C (various): Use IsFileReadable() to make
4982 sure that the file actually exist. Relying on ghostscripts errors
4983 is a bad idea since they can lead to X server crashes.
4985 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
4987 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
4990 * lib/lyxrc.example: smallish typo in description of
4991 \view_dvi_paper_option
4993 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4996 * src/lyxfunc.C: doImportHelper to factor out common code of the
4997 various import methods. New functions doImportASCIIasLines,
4998 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
4999 doImportLinuxDoc for the format specific parts.
5002 * buffer.C: Dispatch returns now a bool to indicate success
5005 * lyx_gui.C: Add getLyXView() for member access
5007 * lyx_main.C: Change logic for batch commands: First try
5008 Buffer::Dispatch (possibly without GUI), if that fails, use
5011 * lyx_main.C: Add support for --import command line switch.
5012 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
5013 Available Formats: Everything accepted by 'buffer-import <format>'
5015 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5017 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
5020 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
5021 documents will be reformatted upon reentry.
5023 2000-04-27 Juergen Vigna <jug@sad.it>
5025 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
5026 correctly only last pos this was a bug.
5028 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5030 * release of lyx-1.1.5pre1
5032 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5034 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
5036 * src/menus.C: revert the change of naming (Figure->Graphic...)
5037 from 2000-04-11. It was incomplete and bad.
5039 * src/LColor.[Ch]: add LColor::depthbar.
5040 * src/text.C (GetVisibleRow): use it.
5042 * README: update the languages list.
5044 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5046 * src/text.C (GetVisibleRow): show the depth of paragraphs using
5049 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5051 * README: remove sections that were just wrong.
5053 * src/text2.C (GetRowNearY): remove currentrow code
5055 * src/text.C (GetRow): remove currentrow code
5057 * src/screen.C (Update): rewritten a bit.
5058 (SmallUpdate): removed func
5060 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
5062 (FullRebreak): return bool
5063 (currentrow): remove var
5064 (currentrow_y): ditto
5066 * src/lyxscreen.h (Draw): change arg to unsigned long
5067 (FitCursor): return bool
5068 (FitManualCursor): ditto
5069 (Smallpdate): remove func
5070 (first): change to unsigned long
5071 (DrawOneRow): change second arg to long (from long &)
5072 (screen_refresh_y): remove var
5073 (scree_refresh_row): ditto
5075 * src/lyxrow.h: change baseline to usigned int from unsigned
5076 short, this brings some implicit/unsigned issues out in the open.
5078 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
5080 (Dispatch): don't call updateScrollbar after fitCursor. Use update
5081 instead of smallUpdate.
5083 * src/lyxcursor.h: change y to unsigned long
5085 * src/buffer.h: don't call updateScrollbar after fitcursor
5087 * src/buffer.C (parseSingleLyXformat2Token): move variables to
5088 where they are used. Removed "\\direction", this was not present
5089 in 1.1.4 and is already obsolete. Commented out some code that I
5090 believe to never be called.
5091 (runLiterate): don't call updateScrollbar after fitCursor
5093 (buildProgram): ditto
5096 * src/WorkArea.h (workWidth): change return val to unsigned
5099 (redraw): remove the button redraws
5100 (setScrollbarValue): change for scrollbar
5101 (getScrollbarValue): change for scrollbar
5102 (getScrollbarBounds): change for scrollbar
5104 * src/WorkArea.C (C_WorkArea_up_cb): removed func
5105 (C_WorkArea_down_cb): removed func
5106 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
5107 (resize): change for scrollbar
5108 (setScrollbar): ditto
5109 (setScrollbarBounds): ditto
5110 (setScrollbarIncrements): ditto
5111 (up_cb): removed func
5112 (down_cb): removed func
5113 (scroll_cb): change for scrollbar
5114 (work_area_handler): ditto
5116 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
5117 when FitCursor did something.
5118 (updateScrollbar): some unsigned changes
5119 (downCB): removed func
5120 (scrollUpOnePage): removed func
5121 (scrollDownOnePage): remvoed func
5122 (workAreaMotionNotify): don't call screen->FitCursor but use
5123 fitCursor instead. and bool return val
5124 (workAreaButtonPress): ditto
5125 (workAreaButtonRelease): some unsigned changes
5126 (checkInsetHit): ditto
5127 (workAreaExpose): ditto
5128 (update): parts rewritten, comments about the signed char arg added
5129 (smallUpdate): removed func
5130 (cursorPrevious): call needed updateScrollbar
5133 * src/BufferView2.C (allFloats): don't call updateScrollbar after
5136 * src/BufferView.[Ch] (upCB): removed func
5137 (downCB): removed func
5138 (smallUpdate): removed func
5140 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5142 * src/lyxtext.h src/text.C src/text2.C: removed support for the
5143 currentrow, currentrow_y optimization. This did not help a lot and
5144 if we want to do this kind of optimization we should rather use
5145 cursor.row instead of the currentrow.
5147 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
5148 buffer spacing and klyx spacing support.
5150 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5152 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
5155 2000-04-26 Juergen Vigna <jug@sad.it>
5157 * src/insets/figinset.C: fixes to Lars sstream changes!
5159 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
5161 * A lot of files: Added Ascii(ostream &) methods to all inset
5162 classes. Used when exporting to ASCII.
5164 * src/buffer.C (writeFileAscii,RoffAsciiTable)
5165 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
5168 * src/text2.C (ToggleFree): Disabled implicit word selection when
5169 there is a change in the language
5171 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
5172 no output was generated for end-of-sentence inset.
5174 * src/insets/lyxinset.h
5177 * src/paragraph.C: Removed the insetnumber code
5179 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
5181 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5183 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
5184 no_babel and no_epsfig completely from the file.
5185 (parseSingleLyXformat2Token): add handling for per-paragraph
5186 spacing as written by klyx.
5188 * src/insets/figinset.C: applied patch by Andre. Made it work with
5191 2000-04-20 Juergen Vigna <jug@sad.it>
5193 * src/insets/insettext.C (cutSelection):
5194 (copySelection): Fixed with selection from right to left.
5195 (draw): now the rows are not recalculated at every draw.
5196 (computeTextRows): for now reset the inset-owner here (this is
5197 important for an undo or copy where the inset-owner is not set
5200 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
5201 motion to the_locking_inset screen->first was forgotten, this was
5202 not important till we got multiline insets.
5204 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5206 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
5207 code seems to be alright (it is code changed by Dekel, and the
5208 intent is indeed that all macros should be defined \protect'ed)
5210 * NEWS: a bit of reorganisation of the new user-visible features.
5212 2000-04-19 Juergen Vigna <jug@sad.it>
5214 * src/insets/insettext.C (init): using a LyXCursor now for cursor
5215 position. Set the inset_owner of the used paragraph so that it knows
5216 that it is inside an inset. Fixed cursor handling with mouse and
5217 cursor keys. Fixed wrong timed inset redraws and lots of other changes
5218 and cleanups to make TextInsets work better.
5220 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
5221 Changed parameters of various functions and added LockInsetInInset().
5223 * src/insets/insettext.C:
5225 * src/insets/insetcollapsable.h:
5226 * src/insets/insetcollapsable.C:
5227 * src/insets/insetfoot.h:
5228 * src/insets/insetfoot.C:
5229 * src/insets/insetert.h:
5230 * src/insets/insetert.C: cleaned up the code so that it works now
5231 correctly with insettext.
5233 * src/insets/inset.C:
5234 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
5235 that insets in insets are supported right.
5238 * src/table.C: lots of changes for use with inset tabular (and cleanup)
5240 * src/paragraph.C: some small fixes
5242 * src/debug.h: inserted INSETS debug info
5244 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
5245 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
5247 * src/commandtags.h:
5248 * src/LyXAction.C: insert code for InsetTabular.
5250 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
5251 not Button1MotionMask.
5252 (workAreaButtonRelease): send always a InsetButtonRelease event to
5254 (checkInsetHit): some setCursor fixes (always with insets).
5256 * src/BufferView2.C (lockInset): returns a bool now and extended for
5257 locking insets inside insets.
5258 (showLockedInsetCursor): it is important to have the cursor always
5259 before the locked inset.
5260 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
5262 * src/BufferView.h: made lockInset return a bool.
5264 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
5266 * src/text2.C (SetCursor): This now has a version with a LyXCursor
5267 that is used also internally but can be called as public to have back
5268 a cursor pos which is not set internally.
5269 (SetCursorIntern): Changed to use above function.
5271 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
5273 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5278 * NEWS: updated for prerelease of 1.1.5. Please comment and send
5279 patches for things that should be in or should be changed.
5281 * src/* [insetfiles]: change "usigned char fragile" to bool
5282 fragile. There was only one point that could that be questioned
5283 and that is commented in formulamacro.C. Grep for "CHECK".
5285 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
5286 (DeleteBuffer): take it out of CutAndPaste and make it static.
5288 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5290 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
5291 output the spacing envir commands. Also the new commands used in
5292 the LaTeX output makes the result better.
5294 * src/Spacing.C (writeEnvirBegin): new method
5295 (writeEnvirEnd): new method
5297 2000-04-18 Juergen Vigna <jug@sad.it>
5299 * src/CutAndPaste.C: made textclass a static member of the class
5300 as otherwise it is not accesed right!!!
5302 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
5304 * forms/layout_forms.fd
5305 * src/layout_forms.h
5306 * src/layout_forms.C (create_form_form_character)
5307 * src/lyx_cb.C (UserFreeFont)
5308 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
5309 documents (in the layout->character popup).
5311 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5313 * src/spellchecker.C (create_ispell_pipe): fix a bug where
5314 \spell_command was in fact not honored (from Kevin Atkinson).
5316 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
5319 * src/lyx_gui.h: make lyxViews private (Angus)
5321 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
5323 * src/mathed/math_write.C
5324 (MathMatrixInset::Write) Put \protect before \begin{array} and
5325 \end{array} if fragile
5326 (MathParInset::Write): Put \protect before \\ if fragile
5328 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5330 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
5331 initialization if the LyXColorHandler must be done after the
5332 connections to the XServer has been established.
5334 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
5335 get the background pixel from the lyxColorhandler so that the
5336 figures are rendered with the correct background color.
5337 (NextToken): removed functions.
5338 (GetPSSizes): use ifs >> string instead of NextToken.
5340 * src/Painter.[Ch]: the color cache moved out of this file.
5342 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
5345 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5347 * src/WorkArea.C (work_area_handler): call BufferView::enterView
5348 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
5350 * src/BufferView.C (enterView): new func
5351 (leaveView): new func
5353 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
5355 (leaveView): new func, undefines xterm cursor when approp.
5357 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
5358 (AllowInput): delete the Workarea cursor handling from this func.
5360 * src/Painter.C (underline): draw a slimer underline in most cases.
5362 * src/lyx_main.C (error_handler): use extern "C"
5364 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5366 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
5367 sent directly to me.
5369 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
5370 to the list by Dekel.
5372 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
5375 * src/bufferview_funcs.[Ch]: two new files, moved several of the
5376 methods from lyx_cb.here.
5378 * src/lyx_cb.C: in addition to the above; removed input_prohibited
5381 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5383 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
5384 instead of using current_view directly.
5386 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
5388 * src/LyXAction.C (init): add the paragraph-spacing command.
5390 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
5392 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
5394 * src/lyx_cb.C (CurrentState): output a string when the spacing is
5395 different from the documents.
5397 * src/text.C (SetHeightOfRow): take paragraph spacing into
5398 account, paragraph spacing takes precedence over buffer spacing
5399 (GetVisibleRow): ditto
5401 * src/paragraph.C (writeFile): output the spacing parameter too.
5402 (validate): set the correct features if spacing is used in the
5404 (Clear): set spacing to default
5405 (MakeSameLayout): spacing too
5406 (HasSameLayout): spacing too
5407 (SetLayout): spacing too
5408 (TeXOnePar): output the spacing commands
5410 * src/lyxparagraph.h: added a spacing variable for use with
5411 per-paragraph spacing.
5413 * src/Spacing.h: add a Default spacing and a method to check if
5414 the current spacing is default. also added an operator==
5416 * src/text2.C (DeleteEmptyParagraphMechanism): added a
5419 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5421 * src/lyxserver.C (callback): fix dispatch of functions
5423 * src/insets/insetlatexaccent.C (checkContents): turn bogus
5424 printf() into lyxerr call.
5426 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
5429 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
5430 "Table" to "Table Box", "Float" to "Floating Material"; deletes
5431 the "Float" from each of the subitems.
5432 (ShowHelpMenu): add entry for "FAQ" and "TOC".
5434 * src/support/DebugStream.h: add an #ifdef to work around a gcc
5435 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
5436 documented the change so that the workaround can be nuked later.
5438 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
5441 * src/lyxlex_pimpl.C (next): do not re-declare the default value
5443 * src/buffer.C (getLatexName): ditto
5444 (setReadonly): ditto
5446 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5448 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
5449 avoid some uses of current_view. Added also a bufferParams()
5450 method to get at this.
5452 * src/lyxtext.h: changed params->buffer and paramters->bparams.
5454 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5456 * src/lyxparagraph.[Ch]: removed
5457 operator<(LyXParagraph::InsetTable..., added a struct matchIT
5458 with operators used by lower_bound and
5459 upper_bound in InsetTable's
5460 Make struct InsetTable private again. Used matchpos.
5462 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
5464 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
5465 document, the language of existing text is changed (unless the
5466 document is multi-lingual)
5468 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
5470 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
5472 * A lot of files: A rewrite of the Right-to-Left support.
5474 2000-04-10 Juergen Vigna <jug@sad.it>
5476 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
5477 misplaced cursor when inset in inset is locked.
5479 * src/insets/insettext.C (LocalDispatch): small fix so that a
5480 BREAKLINE is not inserted if we don't permit it with autBreakRows.
5482 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
5483 footnote font should be decreased in size twice when displaying.
5485 * src/insets/insettext.C (GetDrawFont): inserted this function as
5486 the drawing-font may differ from the real paragraph font.
5488 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
5489 insets (inset in inset!).
5491 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
5492 function here because we don't want footnotes inside footnotes.
5494 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
5496 (init): now set the inset_owner in paragraph.C
5497 (LocalDispatch): added some resetPos() in the right position
5500 (pasteSelection): changed to use the new CutAndPaste-Class.
5502 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
5503 which tells if it is allowed to insert another inset inside this one.
5505 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
5506 SwitchLayoutsBetweenClasses.
5508 * src/text2.C (InsertInset): checking of the new paragraph-function
5510 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
5511 is not needed anymore here!
5514 (PasteSelection): redone (also with #ifdef) so that now this uses
5515 the CutAndPaste-Class.
5516 (SwitchLayoutsBetweenClasses): removed here and implemented in the
5519 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
5520 from/to text/insets.
5522 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
5523 so that the paragraph knows if it is inside an (text)-inset.
5524 (InsertFromMinibuffer): changed return-value to bool as now it
5525 may happen that an inset is not inserted in the paragraph.
5526 (InsertInsetAllowed): this checks if it is allowed to insert an
5527 inset in this paragraph.
5529 (BreakParagraphConservative):
5530 (BreakParagraph) : small change for the above change of the return
5531 value of InsertFromMinibuffer.
5533 * src/lyxparagraph.h: added inset_owner and the functions to handle
5534 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
5536 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5538 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
5539 functions from BufferView to BufferView::Pimpl to ease maintence.
5541 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
5542 correctly. Also use SetCursorIntern instead of SetCursor.
5544 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
5547 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5549 * src/WorkArea.C (belowMouse): manually implement below mouse.
5551 * src/*: Add "explicit" on several constructors, I added probably
5552 some unneeded ones. A couple of changes to code because of this.
5554 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
5555 implementation and private parts from the users of BufferView. Not
5558 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
5559 implementation and private parts from the users of LyXLex. Not
5562 * src/BufferView_pimpl.[Ch]: new files
5564 * src/lyxlex_pimpl.[Ch]: new files
5566 * src/LyXView.[Ch]: some inline functions move out-of-line
5568 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5570 * src/lyxparagraph.h: make struct InsetTable public.
5572 * src/support/lyxstring.h: change lyxstring::difference_type to be
5573 ptrdiff_t. Add std:: modifiers to streams.
5575 * src/font.C: include the <cctype> header, for islower() and
5578 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5580 * src/font.[Ch]: new files. Contains the metric functions for
5581 fonts, takes a LyXFont as parameter. Better separation of concepts.
5583 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
5584 changes because of this.
5586 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
5588 * src/*: compile with -Winline and move functions that don't
5591 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
5594 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5596 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
5597 (various files changed because of this)
5599 * src/Painter.C (text): fixed the drawing of smallcaps.
5601 * src/lyxfont.[Ch] (drawText): removed unused member func.
5604 * src/*.C: added needed "using" statements and "std::" qualifiers.
5606 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5608 * src/*.h: removed all use of "using" from header files use
5609 qualifier std:: instead.
5611 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5613 * src/text.C (Backspace): some additional cleanups (we already
5614 know whether cursor.pos is 0 or not).
5616 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
5617 automake does not provide one).
5619 * src/bmtable.h: replace C++ comments with C comments.
5621 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
5623 * src/screen.C (ShowCursor): Change the shape of the cursor if
5624 the current language is not equal to the language of the document.
5625 (If the cursor change its shape unexpectedly, then you've found a bug)
5627 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
5630 * src/insets/insetnumber.[Ch]: New files.
5632 * src/LyXAction.C (init)
5633 * src/lyxfunc.C (dispatch): Add command number-inset-insert
5636 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
5638 * src/lyxparagraph.h
5639 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
5640 (the vector is kept sorted).
5642 * src/text.C (GetVisibleRow): Draw selection correctly when there
5643 is both LTR and RTL text.
5645 * src/paragraph.C (Clone): Use the assignment operator for cloning,
5646 which is much faster.
5648 * src/text.C (GetVisibleRow and other): Do not draw the last space
5649 in a row if the direction of the last letter is not equal to the
5650 direction of the paragraph.
5652 * src/lyxfont.C (latexWriteStartChanges):
5653 Check that font language is not equal to basefont language.
5654 (latexWriteEndChanges): ditto
5656 * src/lyx_cb.C (StyleReset): Don't change the language while using
5657 the font-default command.
5659 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
5660 empty paragraph before a footnote.
5662 * src/insets/insetcommand.C (draw): Increase x correctly.
5664 * src/screen.C (ShowCursor): Change cursor shape if
5665 current language != document language.
5667 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
5669 2000-03-31 Juergen Vigna <jug@sad.it>
5671 * src/paragraph.C (GetInset): commented out text[pos] = ' '
5672 (Clone): changed mode how the paragraph-data is copied to the
5673 new clone-paragraph.
5675 * src/lyxfunc.C (Dispatch): fixed small problem when calling
5676 GetInset(pos) with no inset anymore there (in inset UNDO)
5678 * src/insets/insetcommand.C (draw): small fix as here x is
5679 incremented not as much as width() returns (2 before, 2 behind = 4)
5681 2000-03-30 Juergen Vigna <jug@sad.it>
5683 * src/insets/insettext.C (InsetText): small fix in initialize
5684 widthOffset (should not be done in the init() function)
5686 2000-03-29 Amir Karger <karger@lyx.org>
5688 * lib/examples/it_ItemizeBullets.lyx: translation by
5691 * Implemented \textasciitilde and fixed a tiny bug in reLyX
5693 2000-03-29 Juergen Vigna <jug@sad.it>
5695 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
5697 * src/insets/insetfoot.C (Clone): small change as for the below
5698 new init function in the text-inset
5700 * src/insets/insettext.C (init): new function as I've seen that
5701 clone did not copy the Paragraph-Data!
5702 (LocalDispatch): Added code so that now we have some sort of Undo
5703 functionality (well actually we HAVE Undo ;)
5705 * src/text.C (Backspace): Small fix for the a | a Backspace problem
5707 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
5709 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
5712 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5714 * src/main.C: added a runtime check that verifies that the xforms
5715 header used when building LyX and the library used when running
5716 LyX match. Exit with a message if they don't match. This is a
5717 version number check only.
5719 * src/buffer.C (save): Don't allocate memory on the heap for
5720 struct utimbuf times.
5722 * *: some using changes, use iosfwd instead of the real headers.
5724 * src/lyxfont.C use char const * instead of string for the static
5725 strings. Rewrite some functions to use sstream.
5727 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5729 * src/text.C (Backspace): hopefully fix the dreaded backaspace
5732 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5734 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
5735 of Geodesy (from Martin Vermeer)
5737 * lib/layouts/svjour.inc: include file for the Springer svjour
5738 class. It can be used to support journals other than JoG.
5740 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
5741 Miskiewicz <misiek@pld.org.pl>)
5742 * lib/reLyX/Makefile.am: ditto.
5744 2000-03-27 Juergen Vigna <jug@sad.it>
5746 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
5747 also some modifications with operations on selected text.
5749 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
5750 problems with clicking on insets (last famous words ;)
5752 * src/insets/insetcommand.C (draw):
5753 (width): Changed to have a bit of space before and after the inset so
5754 that the blinking cursor can be seen (otherwise it was hidden)
5756 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5758 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
5759 would not be added to the link list when an installed gettext (not
5760 part of libc) is found.
5762 2000-03-24 Juergen Vigna <jug@sad.it>
5764 * src/insets/insetcollapsable.C (Edit):
5765 * src/mathed/formula.C (InsetButtonRelease):
5766 (InsetButtonPress): fixed for new handling of ButtonPress/Release
5769 * src/BufferView.C (workAreaButtonPress):
5770 (workAreaButtonRelease):
5771 (checkInsetHit): Finally fixed the clicking on insets be handled
5774 * src/insets/insetert.C (Edit): inserted this call so that ERT
5775 insets work always with LaTeX-font
5777 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5779 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
5780 caused lyx to startup with no GUI in place, causing in a crash
5781 upon startup when called with arguments.
5783 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5785 * src/FontLoader.C: better initialization of dummyXFontStruct.
5787 2000-03-20 José Abílio Matos <jamatos@lyx.org>
5789 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
5790 for linuxdoc and docbook import and export format options.
5792 * lib/lyxrc.example Example of default values for the previous flags.
5794 * src/lyx_cb.C Use those flags instead of the hardwired values for
5795 linuxdoc and docbook export.
5797 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
5800 * src/menus.C Added menus entries for the new import/exports formats.
5802 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5804 * src/lyxrc.*: Added support for running without Gui
5807 * src/FontLoader.C: sensible defaults if no fonts are needed
5809 * src/lyx_cb.C: New function ShowMessage (writes either to the
5810 minibuffer or cout in case of no gui
5811 New function AskOverwrite for common stuff
5812 Consequently various changes to call these functions
5814 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
5815 wild guess at sensible screen resolution when having no gui
5817 * src/lyxfont.C: no gui, no fonts... set some defaults
5819 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5821 * src/LColor.C: made the command inset background a bit lighter.
5823 2000-03-20 Hartmut Goebel <goebel@noris.net>
5825 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
5826 stdstruct.inc. Koma-Script added some title elements which
5827 otherwise have been listed below "bibliography". This split allows
5828 adding title elements to where they belong.
5830 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
5831 define the additional tilte elements and then include
5834 * many other layout files: changed to include stdtitle.inc just
5835 before stdstruct.inc.
5837 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
5839 * src/buffer.C: (save) Added the option to store all backup files
5840 in a single directory
5842 * src/lyxrc.[Ch]: Added variable \backupdir_path
5844 * lib/lyxrc.example: Added descriptions of recently added variables
5846 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
5847 bibtex inset, not closing the bibtex popup when deleting the inset)
5849 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5851 * src/lyx_cb.C: add a couple using directives.
5853 2000-03-17 José Abílio Matos <jamatos@lyx.org>
5854 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
5855 import based on the filename.
5857 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
5858 file would be imported at start, if the filename where of a sgml file.
5860 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
5862 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
5864 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
5865 * src/lyxfont.h Replaced the member variable bits.direction by the
5866 member variable lang. Made many changes in other files.
5867 This allows having a multi-lingual document
5869 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
5870 that change the current language to <l>.
5871 Removed the command "font-rtl"
5873 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
5874 format for Hebrew documents)
5876 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
5877 When auto_mathmode is "true", pressing a digit key in normal mode
5878 will cause entering into mathmode.
5879 If auto_mathmode is "rtl" then this behavior will be active only
5880 when writing right-to-left text.
5882 * src/text2.C (InsertStringA) The string is inserted using the
5885 * src/paragraph.C (GetEndLabel) Gives a correct result for
5886 footnote paragraphs.
5888 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
5890 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5892 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
5893 front of PasteParagraph. Never insert a ' '. This should at least
5894 fix some cause for the segfaults that we have been experiencing,
5895 it also fixes backspace behaviour slightly. (Phu!)
5897 * src/support/lstrings.C (compare_no_case): some change to make it
5898 compile with gcc 2.95.2 and stdlibc++-v3
5900 * src/text2.C (MeltFootnoteEnvironment): change type o
5901 first_footnote_par_is_not_empty to bool.
5903 * src/lyxparagraph.h: make text private. Changes in other files
5905 (fitToSize): new function
5906 (setContentsFromPar): new function
5907 (clearContents): new function
5908 (SetChar): new function
5910 * src/paragraph.C (readSimpleWholeFile): deleted.
5912 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
5913 the file, just use a simple string instead. Also read the file in
5914 a more maintainable manner.
5916 * src/text2.C (InsertStringA): deleted.
5917 (InsertStringB): deleted.
5919 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5921 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
5922 RedoParagraphs from the doublespace handling part, just set status
5923 to NEED_MORE_REFRESH. Also don't update cursor position (should be
5924 done, but perhaps not like this.)
5926 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5928 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
5929 character when inserting an inset.
5931 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5933 * src/bufferparams.C (readLanguage): now takes "default" into
5936 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
5937 also initialize the toplevel_keymap with the default bindings from
5940 * src/buffer.C (Buffer): remove lyxrc from the parameters.
5942 * all files using lyxrc: have lyxrc as a real variable and not a
5943 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
5946 * src/lyxrc.C: remove double call to defaultKeyBindings
5948 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
5949 toolbar defauls using lyxlex. Remove enums, structs, functions
5952 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
5953 toolbar defaults. Also store default keybindings in a map.
5955 * src/ToolbarDefaults.[Ch]: New file. This class is used for
5956 storing the toolbar defaults without any xforms dependencies.
5958 * src/insets/figinset.C: patch posted to list by Andre Poenitz
5959 applied. Changed to use iterators.
5961 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
5963 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
5964 systems that don't have LINGUAS set to begin with.
5966 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5968 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
5969 the list by Dekel Tsur.
5971 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5973 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
5974 * src/insets/form_graphics.C: ditto.
5976 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
5978 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5980 * src/bufferparams.C (readLanguage): use the new language map
5982 * src/intl.C (InitKeyMapper): use the new language map
5984 * src/lyx_gui.C (create_forms): use the new language map
5986 * src/language.[Ch]: New files. Used for holding the information
5987 about each language. Now! Use this new language map enhance it and
5988 make it really usable for our needs.
5990 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
5992 * screen.C (ShowCursor): Removed duplicate code.
5993 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5994 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
5996 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
5999 * src/text.C Added TransformChar method. Used for rendering Arabic
6000 text correctly (change the glyphs of the letter according to the
6001 position in the word)
6006 * src/lyxrc.C Added lyxrc command {language_command_begin,
6007 language_command_end,language_command_ltr,language_command_rtl,
6008 language_package} which allows the use of either arabtex or Omega
6011 * src/lyx_gui.C (init)
6013 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
6014 to use encoding for menu fonts which is different than the encoding
6017 * src/buffer.C (makeLaTeXFile): If params.language = "default",
6018 do not load the babel package.
6019 To write an English document with Hebrew/Arabic, change the document
6020 language to "english".
6022 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
6023 (alphaCounter): changed to return char
6024 (loweralphaCounter, hebrewCounter, romanCounter): New functions
6026 * lib/lyxrc.example Added examples for Hebrew/Arabic
6029 * src/layout.C Added layout command endlabeltype
6031 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
6033 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
6035 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6037 * src/mathed/math_delim.C (search_deco): return a
6038 math_deco_struct* instead of index.
6040 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6042 * All files with a USE_OSTREAM_ONLY within: removed all code that
6043 was unused when USE_OSTREAM_ONLY is defined.
6045 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
6046 of any less. Removed header and using.
6048 * src/text.C (GetVisibleRow): draw the string "Page Break
6049 (top/bottom)" on screen when drawing a pagebreak line.
6051 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6053 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
6055 * src/mathed/math_macro.C (draw): do some cast magic.
6058 * src/mathed/math_defs.h: change byte* argument to byte const*.
6060 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
6062 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
6063 know it is right to return InsetFoot* too, but cxx does not like
6066 * src/insets/insetcollapsable.[Ch] (Clone): make const.
6068 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
6070 * src/mathed/math_delim.C: change == to proper assignment.
6072 2000-03-09 Juergen Vigna <jug@sad.it>
6074 * src/insets/insettext.C (setPos): fixed various cursor positioning
6075 problems (via mouse and cursor-keys)
6076 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
6077 inset (still a small display problem but it works ;)
6079 * src/insets/insetcollapsable.C (draw): added button_top_y and
6080 button_bottom_y to have correct values for clicking on the inset.
6082 * src/support/lyxalgo.h: commented out 'using std::less'
6084 2000-03-08 Juergen Vigna <jug@sad.it>
6086 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
6087 Button-Release event closes as it is alos the Release-Event
6090 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
6092 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6094 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
6095 can add multiple spaces in Scrap (literate programming) styles...
6096 which, by the way, is how I got hooked on LyX to begin with.
6098 * src/mathed/formula.C (Write): Added dummy variable to an
6099 inset::Latex() call.
6100 (Latex): Add free_spacing boolean to inset::Latex()
6102 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
6104 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
6105 virtual function to include the free_spacing boolean from
6106 the containing paragraph's style.
6108 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
6109 Added free_spacing boolean arg to match inset.h
6111 * src/insets/insettext.C, src/insets/insettext.h (Latex):
6112 Added free_spacing boolean arg to match inset.h
6114 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
6115 Added free_spacing boolean and made sure that if in a free_spacing
6116 paragraph, that we output normal space if there is a protected space.
6118 * src/insets/insetref.C, src/insets/insetref.h (Latex):
6119 Added free_spacing boolean arg to match inset.h
6121 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
6122 Added free_spacing boolean arg to match inset.h
6124 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
6125 Added free_spacing boolean arg to match inset.h
6127 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
6128 Added free_spacing boolean arg to match inset.h
6130 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
6131 Added free_spacing boolean arg to match inset.h
6133 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
6134 free_spacing boolean arg to match inset.h
6136 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
6137 Added free_spacing boolean arg to match inset.h
6139 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
6140 Added free_spacing boolean arg to match inset.h
6142 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
6143 Added free_spacing boolean arg to match inset.h
6145 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
6146 Added free_spacing boolean arg to match inset.h
6148 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
6149 Added free_spacing boolean arg to match inset.h
6151 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
6152 free_spacing boolean arg to match inset.h
6154 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
6155 free_spacing boolean arg to match inset.h
6157 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
6158 ignore free_spacing paragraphs. The user's spaces are left
6161 * src/text.C (InsertChar): Fixed the free_spacing layout
6162 attribute behavior. Now, if free_spacing is set, you can
6163 add multiple spaces in a paragraph with impunity (and they
6164 get output verbatim).
6165 (SelectSelectedWord): Added dummy argument to inset::Latex()
6168 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
6171 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
6172 paragraph layouts now only input a simple space instead.
6173 Special character insets don't make any sense in free-spacing
6176 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
6177 hard-spaces in the *input* file to simple spaces if the layout
6178 is free-spacing. This converts old files which had to have
6179 hard-spaces in free-spacing layouts where a simple space was
6181 (writeFileAscii): Added free_spacing check to pass to the newly
6182 reworked inset::Latex(...) methods. The inset::Latex() code
6183 ensures that hard-spaces in free-spacing paragraphs get output
6184 as spaces (rather than "~").
6186 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6188 * src/mathed/math_delim.C (draw): draw the empty placeholder
6189 delims with a onoffdash line.
6190 (struct math_deco_compare): struct that holds the "functors" used
6191 for the sort and the binary search in math_deco_table.
6192 (class init_deco_table): class used for initial sort of the
6194 (search_deco): use lower_bound to do a binary search in the
6197 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6199 * src/lyxrc.C: a small secret thingie...
6201 * src/lyxlex.C (printTable): changed to take a ostream as paramter
6202 and to not flush the stream as often as it used to.
6204 * src/support/lyxalgo.h: new file
6205 (sorted): template function used for checking if a sequence is
6206 sorted or not. Two versions with and without user supplied
6207 compare. Uses same compare as std::sort.
6209 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
6210 it and give warning on lyxerr.
6212 (struct compare_tags): struct with function operators used for
6213 checking if sorted, sorting and lower_bound.
6214 (search_kw): use lower_bound instead of manually implemented
6217 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6219 * src/insets/insetcollapsable.h: fix Clone() declaration.
6220 * src/insets/insetfoot.h: ditto.
6222 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
6224 2000-03-08 Juergen Vigna <jug@sad.it>
6226 * src/insets/lyxinset.h: added owner call which tells us if
6227 this inset is inside another inset. Changed also the return-type
6228 of Editable to an enum so it tells clearer what the return-value is.
6230 * src/insets/insettext.C (computeTextRows): fixed computing of
6231 textinsets which split automatically on more rows.
6233 * src/insets/insetert.[Ch]: changed this to be of BaseType
6236 * src/insets/insetfoot.[Ch]: added footnote inset
6238 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
6239 collapsable insets (like footnote, ert, ...)
6241 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6243 * src/lyxdraw.h: remvoe file
6245 * src/lyxdraw.C: remove file
6247 * src/insets/insettext.C: added <algorithm>.
6249 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6251 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
6252 (matrix_cb): case MM_OK use string stream
6254 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
6257 * src/mathed/math_macro.C (draw): use string stream
6258 (Metrics): use string stream
6260 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
6261 directly to the ostream.
6263 * src/vspace.C (asString): use string stream.
6264 (asString): use string stream
6265 (asLatexString): use string stream
6267 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
6268 setting Spacing::Other.
6270 * src/LaTeXFeatures.C (getPackages): use string stream instead of
6271 sprintf when creating the stretch vale.
6273 * src/text2.C (alphaCounter): changed to return a string and to
6274 not use a static variable internally. Also fixed a one-off bug.
6275 (SetCounter): changed the drawing of the labels to use string
6276 streams instead of sprintf.
6278 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
6279 manipulator to use a scheme that does not require library support.
6280 This is also the way it is done in the new GNU libstdc++. Should
6281 work with DEC cxx now.
6283 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6285 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
6286 end. This fixes a bug.
6288 * src/mathed (all files concerned with file writing): apply the
6289 USE_OSTREAM_ONLY changes to mathed too.
6291 * src/support/DebugStream.h: make the constructor explicit.
6293 * src/lyxfont.C (latexWriteStartChanges): small bug related to
6294 count and ostream squashed.
6296 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6298 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
6300 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
6301 ostringstream uses STL strings, and we might not.
6303 * src/insets/insetspecialchar.C: add using directive.
6304 * src/insets/insettext.C: ditto.
6306 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6308 * lib/layouts/seminar.layout: feeble attempt at a layout for
6309 seminar.cls, far from completet and could really use some looking
6310 at from people used to write layout files.
6312 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
6313 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
6314 a lot nicer and works nicely with ostreams.
6316 * src/mathed/formula.C (draw): a slightly different solution that
6317 the one posted to the list, but I think this one works too. (font
6318 size wrong in headers.)
6320 * src/insets/insettext.C (computeTextRows): some fiddling on
6321 Jürgens turf, added some comments that he should read.
6323 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
6324 used and it gave compiler warnings.
6325 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
6328 * src/lyx_gui.C (create_forms): do the right thing when
6329 show_banner is true/false.
6331 * src/lyx_cb.C (TimerCB): no need to close or do anything if
6332 show_banner is false.
6334 * most file writing files: Now use iostreams to do almost all of
6335 the writing. Also instead of passing string &, we now use
6336 stringstreams. mathed output is still not adapted to iostreams.
6337 This change can be turned off by commenting out all the occurences
6338 of the "#define USE_OSTREAM_ONLY 1" lines.
6340 * src/WorkArea.C (createPixmap): don't output debug messages.
6341 (WorkArea): don't output debug messages.
6343 * lib/lyxrc.example: added a comment about the new variable
6346 * development/Code_rules/Rules: Added some more commente about how
6347 to build class interfaces and on how better encapsulation can be
6350 2000-03-03 Juergen Vigna <jug@sad.it>
6352 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
6353 automatically with the width of the LyX-Window
6355 * src/insets/insettext.C (computeTextRows): fixed update bug in
6356 displaying text-insets (scrollvalues where not initialized!)
6358 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6360 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
6361 id in the check of the result from lower_bound is not enough since
6362 lower_bound can return last too, and then res->id will not be a
6365 * all insets and some code that use them: I have conditionalized
6366 removed the Latex(string & out, ...) this means that only the
6367 Latex(ostream &, ...) will be used. This is a work in progress to
6368 move towards using streams for all output of files.
6370 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
6373 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6375 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
6376 routine (this fixes bug where greek letters were surrounded by too
6379 * src/support/filetools.C (findtexfile): change a bit the search
6380 algorithm, to fix bug introduced in 1.1.4. Note that --format is
6381 no longer passed to kpsewhich, we may have to change that later.
6383 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
6384 warning options to avoid problems with X header files (from Angus
6386 * acinclude.m4: regenerated.
6388 2000-03-02 Juergen Vigna <jug@sad.it>
6390 * src/insets/insettext.C (WriteParagraphData): Using the
6391 par->writeFile() function for writing paragraph-data.
6392 (Read): Using buffer->parseSingleLyXformat2Token()-function
6393 for parsing paragraph data!
6395 * src/buffer.C (readLyXformat2): removed all parse data and using
6396 the new parseSingleLyXformat2Token()-function.
6397 (parseSingleLyXformat2Token): added this function to parse (read)
6398 lyx-file-format (this is called also from text-insets now!)
6400 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6402 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
6405 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
6406 directly instead of going through a func. One very bad thing: a
6407 static LyXFindReplace, but I don't know where to place it.
6409 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
6410 string instead of char[]. Also changed to static.
6411 (GetSelectionOrWordAtCursor): changed to static inline
6412 (SetSelectionOverLenChars): ditto.
6414 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
6415 current_view and global variables. both classes has changed names
6416 and LyXFindReplace is not inherited from SearchForm.
6418 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
6419 fl_form_search form.
6421 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
6423 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6425 * lib/bind/*.bind: make sure 'buffer-previous' function is not
6426 bound (from Kayvan).
6428 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
6430 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
6432 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6434 * some things that I should comment but the local pub says head to
6437 * comment out all code that belongs to the Roff code for Ascii
6438 export of tables. (this is unused)
6440 * src/LyXView.C: use correct type for global variable
6441 current_layout. (LyXTextClass::size_type)
6443 * some code to get the new insetgraphics closer to working I'd be
6444 grateful for any help.
6446 * src/BufferView2.C (insertInset): use the return type of
6447 NumberOfLayout properly. (also changes in other files)
6449 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
6450 this as a test. I want to know what breaks because of this.
6452 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
6454 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6456 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
6457 to use a \makebox in the label, this allows proper justification
6458 with out using protected spaces or multiple hfills. Now it is
6459 "label" for left justified, "\hfill label\hfill" for center, and
6460 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
6461 should be changed accordingly.
6463 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6465 * src/lyxtext.h: change SetLayout() to take a
6466 LyXTextClass::size_type instead of a char (when there is more than
6467 127 layouts in a class); also change type of copylayouttype.
6468 * src/text2.C (SetLayout): ditto.
6469 * src/LyXView.C (updateLayoutChoice): ditto.
6471 * src/LaTeX.C (scanLogFile): errors where the line number was not
6472 given just after the '!'-line were ignored (from Dekel Tsur).
6474 * lib/lyxrc.example: fix description of \date_insert_format
6476 * lib/layouts/llncs.layout: new layout, contributed by Martin
6479 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6481 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
6482 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
6483 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
6484 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
6485 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
6486 paragraph.C, text.C, text2.C)
6488 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6490 * src/insets/insettext.C (LocalDispatch): remove extra break
6493 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
6494 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
6496 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
6497 * src/insets/insettext.[Ch] (GetCursorPos): ditto
6499 * src/insets/insetbib.h: move InsetBibkey::Holder and
6500 InsetCitation::Holder in public space.
6502 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6504 * src/insets/insettext.h: small change to get the new files from
6505 Juergen to compile (use "string", not "class string").
6507 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
6508 const & as parameter to LocalDispatch, use LyXFont const & as
6509 paramter to some other func. This also had impacto on lyxinsets.h
6510 and the two mathed insets.
6512 2000-02-24 Juergen Vigna <jug@sad.it>
6515 * src/commandtags.h:
6517 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
6521 * src/BufferView2.C: added/updated code for various inset-functions
6523 * src/insets/insetert.[Ch]: added implementation of InsetERT
6525 * src/insets/insettext.[Ch]: added implementation of InsetText
6527 * src/insets/inset.C (Edit): added "unsigned int button" parameter
6528 (draw): added preliminary code for inset scrolling not finshed yet
6530 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
6531 as it is in lyxfunc.C now
6533 * src/insets/lyxinset.h: Added functions for text-insets
6535 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6537 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
6538 BufferView and reimplement the list as a queue put inside its own
6541 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
6543 * several files: use the new interface to the "updateinsetlist"
6545 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
6547 (work_area_handler): call BufferView::trippleClick on trippleclick.
6549 * src/BufferView.C (doubleClick): new function, selects word on
6551 (trippleClick): new function, selects line on trippleclick.
6553 2000-02-22 Allan Rae <rae@lyx.org>
6555 * lib/bind/xemacs.bind: buffer-previous not supported
6557 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6559 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
6562 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6564 * src/bufferlist.C: get rid of current_view from this file
6566 * src/spellchecker.C: get rid of current_view from this file
6568 * src/vspace.C: get rid of current_view from this file
6569 (inPixels): added BufferView parameter for this func
6570 (asLatexCommand): added a BufferParams for this func
6572 * src/text.C src/text2.C: get rid of current_view from these
6575 * src/lyxfont.C (getFontDirection): move this function here from
6578 * src/bufferparams.C (getDocumentDirection): move this function
6581 * src/paragraph.C (getParDirection): move this function here from
6583 (getLetterDirection): ditto
6585 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6587 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
6588 resize due to wrong pixmap beeing used. Also took the opurtunity
6589 to make the LyXScreen stateless on regard to WorkArea and some
6590 general cleanup in the same files.
6592 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6594 * src/Makefile.am: add missing direction.h
6596 * src/PainterBase.h: made the width functions const.
6598 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
6601 * src/insets/insetcommand.C (draw): draw Editable as buttons.
6603 * src/insets/insetlatexaccent.C (draw): make the accents draw
6604 better, at present this will only work well with iso8859-1.
6606 * several files: remove the old drawing code, now we use the new
6609 * several files: remove support for mono_video, reverse_video and
6612 2000-02-17 Juergen Vigna <jug@sad.it>
6614 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
6615 int ** as we have to return the pointer, otherwise we have only
6616 NULL pointers in the returning function.
6618 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6620 * src/LaTeX.C (operator()): quote file name when running latex.
6622 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6624 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
6625 (bubble tip), this removes our special handling of this.
6627 * Remove all code that is unused now that we have the new
6628 workarea. (Code that are not active when NEW_WA is defined.)
6630 * Make the uses of XSync not conditionalized on define USE_XSYNC.
6632 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6634 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
6635 nonexisting layout; correctly redirect obsoleted layouts.
6637 * lib/lyxrc.example: document \view_dvi_paper_option
6639 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
6642 * src/lyx_cb.C (RunScript): handle $$FName for command names.
6643 (PreviewDVI): handle the view_dvi_paper_option variable.
6644 [Both from Roland Krause]
6646 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6648 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
6649 char const *, int, LyXFont)
6650 (text(int, int, string, LyXFont)): ditto
6652 * src/text.C (InsertCharInTable): attempt to fix the double-space
6653 feature in tables too.
6654 (BackspaceInTable): ditto.
6655 (GetVisibleRow): make bottom pagebreak line be a onoff line.
6657 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6659 * src/text2.C (owner): only complain if owner_ is set and bv != 0
6661 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
6662 newly found text in textcache to this.
6663 (buffer): set the owner of the text put into the textcache to 0
6665 * src/insets/figinset.C (draw): fixed the drawing of figures with
6668 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
6669 drawing of mathframe, hfills, protected space, table lines. I have
6670 now no outstanding drawing problems with the new Painter code.
6672 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6674 * src/PainterBase.C (ellipse, circle): do not specify the default
6677 * src/LColor.h: add using directive.
6679 * src/Painter.[Ch]: change return type of methods from Painter& to
6680 PainterBase&. Add a using directive.
6682 * src/WorkArea.C: wrap xforms callbacks in C functions
6685 * lib/layouts/foils.layout: font fix and simplifications from Carl
6688 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6690 * a lot of files: The Painter, LColor and WorkArea from the old
6691 devel branch has been ported to lyx-devel. Some new files and a
6692 lot of #ifdeffed code. The new workarea is enabled by default, but
6693 if you want to test the new Painter and LColor you have to compile
6694 with USE_PAINTER defined (do this in config.h f.ex.) There are
6695 still some rought edges, and I'd like some help to clear those
6696 out. It looks stable (loads and displays the Userguide very well).
6699 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6701 * src/buffer.C (pop_tag): revert to the previous implementation
6702 (use a global variable for both loops).
6704 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
6706 * src/lyxrc.C (LyXRC): change slightly default date format.
6708 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
6709 there is an English text with a footnote that starts with a Hebrew
6710 paragraph, or vice versa.
6711 (TeXFootnote): ditto.
6713 * src/text.C (LeftMargin): allow for negative values for
6714 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
6717 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
6718 for input encoding (cyrillic)
6720 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6722 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
6725 * src/toolbar.C (set): ditto
6726 * src/insets/insetbib.C (create_form_citation_form): ditto
6728 * lib/CREDITS: added Dekel Tsur.
6730 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
6731 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
6732 hebrew supports files from Dekel Tsur.
6734 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
6735 <tzafrir@technion.ac.il>
6737 * src/lyxrc.C: put \date_insert_format at the right place.
6739 * src/buffer.C (makeLaTeXFile): fix the handling of
6740 BufferParams::sides when writing out latex files.
6742 * src/BufferView2.C: add a "using" directive.
6744 * src/support/lyxsum.C (sum): when we use lyxstring,
6745 ostringstream::str needs an additional .c_str().
6747 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6749 * src/support/filetools.C (ChangeExtension): patch from Etienne
6752 * src/TextCache.C (show): remove const_cast and make second
6753 parameter non-const LyXText *.
6755 * src/TextCache.h: use non const LyXText in show.
6757 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
6760 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6762 * src/support/lyxsum.C: rework to be more flexible.
6764 * several places: don't check if a pointer is 0 if you are going
6767 * src/text.C: remove some dead code.
6769 * src/insets/figinset.C: remove some dead code
6771 * src/buffer.C: move the BufferView funcs to BufferView2.C
6772 remove all support for insetlatexdel
6773 remove support for oldpapersize stuff
6774 made some member funcs const
6776 * src/kbmap.C: use a std::list to store the bindings in.
6778 * src/BufferView2.C: new file
6780 * src/kbsequence.[Ch]: new files
6782 * src/LyXAction.C + others: remove all trace of buffer-previous
6784 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
6785 only have one copy in the binary of this table.
6787 * hebrew patch: moved some functions from LyXText to more
6788 appropriate places. (LyXParagraph, BufferParams, LyXFont)
6790 * several files: remove support for XForms older than 0.88
6792 remove some #if 0 #endif code
6794 * src/TextCache.[Ch]: new file. Holds the textcache.
6796 * src/BufferView.C: changes to use the new TextCache interface.
6797 (waitForX): remove the now unused code.
6799 * src/BackStack.h: remove some commented code
6801 * lib/bind/emacs.bind: remove binding for buffer-previous
6803 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6805 * applied the hebrew patch.
6807 * src/lyxrow.h: make sure that all Row variables are initialized.
6809 * src/text2.C (TextHandleUndo): comment out a delete, this might
6810 introduce a memory leak, but should also help us to not try to
6811 read freed memory. We need to look at this one.
6813 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
6814 (LyXParagraph): initalize footnotekind.
6816 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
6817 forgot this when applying the patch. Please heed the warnings.
6819 * src/BufferView.C (buffer): a fix for the buffer-reload problem
6820 (aka. reformat problem)
6822 * src/bufferlist.C (exists): made const, and use const_iterator
6823 (isLoaded): new func.
6824 (release): use std::find to find the correct buffer.
6826 * src/bufferlist.h: made getState a const func.
6827 made empty a const func.
6828 made exists a const func.
6831 2000-02-01 Juergen Vigna <jug@sad.it>
6833 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
6835 * po/it.po: updated a bit the italian po file and also changed the
6836 'file nuovo' for newfile to 'filenuovo' without a space, this did
6839 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
6840 for the new insert_date command.
6842 * src/lyxfunc.C (Dispatch): added support for a insert_date function
6843 from jdblair, to insert a date into the current text conforming to
6844 a strftime format (for now only considering the locale-set and not
6845 the document-language).
6847 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6849 * src/lyxfont.C (textWidth): hopefully better fix for the Array
6850 Bounds Read error seen by purify. The problem was that islower is
6851 a macros which takes an unsigned char and uses it as an index for
6852 in array of characters properties (and is thus subject to the
6856 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
6857 correctly the paper sides radio buttons.
6858 (UpdateDocumentButtons): ditto.
6860 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6862 * src/kbmap.C (getsym + others): change to return unsigned int,
6863 returning a long can give problems on 64 bit systems. (I assume
6864 that int is 32bit on 64bit systems)
6866 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6868 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
6869 LyXLookupString to be zero-terminated. Really fixes problems seen
6872 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6874 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
6875 write a (char*)0 to the lyxerr stream.
6877 * src/lastfiles.C: move algorithm before the using statemets.
6879 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6881 * src/lastfiles.C: move using directives in global scope (egcs 1.x
6882 complains otherwise).
6883 * src/table.C: ditto
6885 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
6888 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
6889 that I removed earlier... It is really needed.
6891 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
6893 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6895 * INSTALL: update xforms home page URL.
6897 * lib/configure.m4: fix a bug with unreadable layout files.
6899 * src/table.C (calculate_width_of_column): add "using std::max"
6902 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6904 * several files: marked several lines with "DEL LINE", this is
6905 lines that can be deleted without changing anything.
6906 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
6907 checks this anyway */
6910 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
6912 * src/DepTable.C (update): add a "+" at the end when the checksum
6913 is different. (debugging string only)
6915 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
6916 the next inset to not be displayed. This should also fix the list
6917 of labels in the "Insert Crossreference" dialog.
6919 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6921 * src/support/LSubstring.C (LSubstring): set pos to string::npos
6922 when regex was not found.
6924 * src/support/lstrings.C (lowercase): use handcoded transform always.
6927 * src/text.C (Delete): fixed the crash. cursor.par->prev and
6928 old_cursor.par->prev could be 0.
6930 * several files: changed post inc/dec to pre inc/dec
6932 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
6933 write the lastfiles to file.
6935 * src/BufferView.C (buffer): only show TextCache info when debugging
6937 (resizeCurrentBuffer): ditto
6938 (workAreaExpose): ditto
6940 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
6942 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
6944 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
6945 a bit better by removing the special case for \i and \j.
6947 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6949 * src/lyx_main.C (easyParse): remove test for bad comand line
6950 options, since this broke all xforms-related parsing.
6952 * src/kbmap.C (getsym): set return type to unsigned long, as
6953 declared in header. On an alpha, long is _not_ the same as int.
6955 * src/support/LOstream.h: add a "using std::flush;"
6957 * src/insets/figinset.C: ditto.
6959 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6961 * src/bufferlist.C (write): use blinding fast file copy instead of
6962 "a char at a time", now we are doing it the C++ way.
6964 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
6965 std::list<int> instead.
6966 (addpidwait): reflect move to std::list<int>
6967 (sigchldchecker): ditto
6969 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
6972 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
6973 that obviously was wrong...
6975 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
6976 c, this avoids warnings with purify and islower.
6978 * src/insets/figinset.C: rename struct queue to struct
6979 queue_element and rewrite to use a std::queue. gsqueue is now a
6980 std::queue<queue_element>
6981 (runqueue): reflect move to std::queue
6984 * src/support/lstrings.h (tostr): specialize for bool, otherwise
6985 we would get "1" "0" instead of "true" "false. Also make the tostr
6988 2000-01-21 Juergen Vigna <jug@sad.it>
6990 * src/buffer.C (writeFileAscii): Disabled code for special groff
6991 handling of tabulars till I fix this in table.C
6993 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6995 * src/support/mkdir.C (mkdir): change second argument of mkdir to
6997 * src/support/lyxlib.h: ditto.
6999 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7001 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
7002 and 'j' look better. This might fix the "macron" bug that has been
7005 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
7006 functions as one template function. Delete the old versions.
7008 * src/support/lyxsum.C: move using std::ifstream inside
7011 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
7014 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
7016 * src/mathed/formula.C: delete #include "bufferlist.h" never used
7018 * src/insets/figinset.C (InitFigures): use new instead of malloc
7019 to allocate memory for figures and bitmaps.
7020 (DoneFigures): use delete[] instead of free to deallocate memory
7021 for figures and bitmaps.
7022 (runqueue): use new to allocate
7023 (getfigdata): use new/delete[] instead of malloc/free
7024 (RegisterFigure): ditto
7026 * some files: moved some declarations closer to first use, small
7027 whitespace changes use preincrement instead of postincrement where
7028 it does not make a difference.
7030 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
7031 step on the way to use stl::containers for key maps.
7033 * src/bufferlist.h: add a typedef for const_iterator and const
7034 versions of begin and end.
7036 * src/bufferlist.[Ch]: change name of member variable _state to
7037 state_. (avoid reserved names)
7039 (getFileNames): returns the filenames of the buffers in a vector.
7041 * configure.in (ALL_LINGUAS): added ro
7043 * src/support/putenv.C: new file
7045 * src/support/mkdir.C: new file
7047 2000-01-20 Allan Rae <rae@lyx.org>
7049 * lib/layouts/IEEEtran.layout: Added several theorem environments
7051 * lib/templates/IEEEtran.lyx: Example theorem environments and a
7052 couple of minor additions.
7054 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
7055 (except for those in footnotes of course)
7057 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7059 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
7061 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
7062 std::sort and std::lower_bound instead of qsort and handwritten
7064 (struct compara): struct that holds the functors used by std::sort
7065 and std::lower_bound in MathedLookupBOP.
7067 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7069 * src/support/LAssert.h: do not do partial specialization. We do
7072 * src/support/lyxlib.h: note that lyx::getUserName() and
7073 lyx::date() are not in use right now. Should these be suppressed?
7075 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
7076 (makeLinuxDocFile): do not put date and user name in linuxdoc
7079 * src/support/lyxlib.h (kill): change first argument to long int,
7080 since that's what solaris uses.
7082 * src/support/kill.C (kill): fix declaration to match prototype.
7084 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
7085 actually check whether namespaces are supported. This is not what
7088 * src/support/lyxsum.C: add a using directive.
7090 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7092 * src/support/kill.C: if we have namespace support we don't have
7093 to include lyxlib.h.
7095 * src/support/lyxlib.h: use namespace lyx if supported.
7097 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7099 * src/support/date.C: new file
7101 * src/support/chdir.C: new file
7103 * src/support/getUserName.C: new file
7105 * src/support/getcwd.C: new file
7107 * src/support/abort.C: new file
7109 * src/support/kill.C: new file
7111 * src/support/lyxlib.h: moved all the functions in this file
7112 insede struct lyx. Added also kill and abort to this struct. This
7113 is a way to avoid the "kill is not defined in <csignal>", we make
7114 C++ wrappers for functions that are not ANSI C or ANSI C++.
7116 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
7117 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
7118 lyx it has been renamed to sum.
7120 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7122 * src/text.C: add using directives for std::min and std::max.
7124 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7126 * src/texrow.C (getIdFromRow): actually return something useful in
7127 id and pos. Hopefully fixes the bug with positionning of errorbox
7130 * src/lyx_main.C (easyParse): output an error and exit if an
7131 incorrect command line option has been given.
7133 * src/spellchecker.C (ispell_check_word): document a memory leak.
7135 * src/bufferlist.C (write): fix mismatched allocation/deletion,
7136 where a "struct utimbuf" is allocated with "new" and deleted with
7139 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
7141 * src/text2.C (CutSelection): don't delete double spaces.
7142 (PasteSelection): ditto
7143 (CopySelection): ditto
7145 * src/text.C (Backspace): don't delete double spaces.
7147 * src/lyxlex.C (next): fix a bug that were only present with
7148 conformant std::istream::get to read comment lines, use
7149 std::istream::getline instead. This seems to fix the problem.
7151 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7153 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
7154 allowed to insert space before space" editing problem. Please read
7155 commends at the beginning of the function. Comments about usage
7158 * src/text.C (InsertChar): fix for the "not allowed to insert
7159 space before space" editing problem.
7161 * src/text2.C (DeleteEmptyParagraphMechanism): when
7162 IsEmptyTableRow can only return false this last "else if" will
7163 always be a no-op. Commented out.
7165 * src/text.C (RedoParagraph): As far as I can understand tmp
7166 cursor is not really needed.
7168 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
7169 present it could only return false anyway.
7170 (several functions): Did something not so smart...added a const
7171 specifier on a lot of methods.
7173 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
7174 and add a tmp->text.resize. The LyXParagraph constructor does the
7176 (BreakParagraphConservative): ditto
7178 * src/support/path.h (Path): add a define so that the wrong usage
7179 "Path("/tmp") will be flagged as a compilation error:
7180 "`unnamed_Path' undeclared (first use this function)"
7182 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7184 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
7185 which was bogus for several reasons.
7187 * src/LaTeX.C (scanAux): fix the regular expression used to scan
7191 * autogen.sh: do not use "type -path" (what's that anyway?).
7193 * src/support/filetools.C (findtexfile): remove extraneous space
7194 which caused a kpsewhich warning (at least with kpathsea version
7197 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7199 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
7201 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
7203 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
7205 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7207 * src/paragraph.C (BreakParagraph): do not reserve space on text
7208 if we don't need to (otherwise, if pos_end < pos, we end up
7209 reserving huge amounts of memory due to bad unsigned karma).
7210 (BreakParagraphConservative): ditto, although I have not seen
7211 evidence the bug can happen here.
7213 * src/lyxparagraph.h: add a using std::list.
7215 2000-01-11 Juergen Vigna <jug@sad.it>
7217 * src/menus.C (MenuDocu): output an Alert if the documentation-file
7220 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7222 * src/vc-backend.C (doVCCommand): change to be static and take one
7223 more parameter: the path to chdir too be fore executing the command.
7224 (retrive): new function equiv to "co -r"
7226 * src/bufferlist.C (loadLyXFile): implement the missing parts if
7227 file_not_found_hook is true.
7229 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
7231 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
7232 if a file is readwrite,readonly...anything else.
7234 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7236 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
7237 (CreatePostscript): name change from MenuRunDVIPS (or something)
7238 (PreviewPostscript): name change from MenuPreviewPS
7239 (PreviewDVI): name change from MenuPreviewDVI
7241 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
7242 \view_pdf_command., \pdf_to_ps_command
7244 * lib/configure.m4: added search for PDF viewer, and search for
7245 PDF to PS converter.
7246 (lyxrc.defaults output): add \pdflatex_command,
7247 \view_pdf_command and \pdf_to_ps_command.
7249 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
7251 * src/bufferlist.C (write): we don't use blocksize for anything so
7254 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7256 * src/support/block.h: disable operator T* (), since it causes
7257 problems with both compilers I tried. See comments in the file.
7259 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
7262 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
7263 variable LYX_DIR_10x to LYX_DIR_11x.
7265 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
7267 * INSTALL: document --with-lyxname.
7270 * configure.in: new configure flag --with-lyxname which allows to
7271 choose the name under which lyx is installed. Default is "lyx", of
7272 course. It used to be possible to do this with --program-suffix,
7273 but the later has in fact a different meaning for autoconf.
7275 * src/support/lstrings.h (lstrchr): reformat a bit.
7277 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
7278 * src/mathed/math_defs.h: ditto.
7280 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7282 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
7283 true, decides if we create a backup file or not when saving. New
7284 tag and variable \pdf_mode, defaults to false. New tag and
7285 variable \pdflatex_command, defaults to pdflatex. New tag and
7286 variable \view_pdf_command, defaults to xpdf. New tag and variable
7287 \pdf_to_ps_command, defaults to pdf2ps.
7289 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7291 * src/bufferlist.C (close): don't call insetUnlock if the buffer
7292 does not have a BufferView.
7293 (unlockInset): ditto + don't access the_locking_inset if the
7294 buffer does not have a BufferView.
7296 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
7297 certain circumstances so that we don't continue a keyboard
7298 operation long after the key was released. Try f.ex. to load a
7299 large document, press PageDown for some seconds and then release
7300 it. Before this change the document would contine to scroll for
7301 some time, with this change it stops imidiatly.
7303 * src/support/block.h: don't allocate more space than needed. As
7304 long as we don't try to write to the arr[x] in a array_type arr[x]
7305 it is perfectly ok. (if you write to it you might segfault).
7306 added operator value_type*() so that is possible to pass the array
7307 to functions expecting a C-pointer.
7309 * lib/Makefile.am (dist-hook): don't fail completely if unable to
7312 * intl/*: updated to gettext 0.10.35, tried to add our own
7313 required modifications. Please verify.
7315 * po/*: updated to gettext 0.10.35, tried to add our own required
7316 modifications. Please verify.
7318 * src/support/lstrings.C (tostr): go at fixing the problem with
7319 cxx and stringstream. When stringstream is used return
7320 oss.str().c_str() so that problems with lyxstring and basic_string
7321 are avoided. Note that the best solution would be for cxx to use
7322 basic_string all the way, but it is not conformant yet. (it seems)
7324 * src/lyx_cb.C + other files: moved several global functions to
7325 class BufferView, some have been moved to BufferView.[Ch] others
7326 are still located in lyx_cb.C. Code changes because of this. (part
7327 of "get rid of current_view project".)
7329 * src/buffer.C + other files: moved several Buffer functions to
7330 class BufferView, the functions are still present in buffer.C.
7331 Code changes because of this.
7333 * config/lcmessage.m4: updated to most recent. used when creating
7336 * config/progtest.m4: updated to most recent. used when creating
7339 * config/gettext.m4: updated to most recent. applied patch for
7342 * config/gettext.m4.patch: new file that shows what changes we
7343 have done to the local copy of gettext.m4.
7345 * config/libtool.m4: new file, used in creation of acinclude.m4
7347 * config/lyxinclude.m4: new file, this is the lyx created m4
7348 macros, used in making acinclude.m4.
7350 * autogen.sh: GNU m4 discovered as a separate task not as part of
7351 the lib/configure creation.
7352 Generate acinlucde from files in config. Actually cat
7353 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
7354 easier to upgrade .m4 files that really are external.
7356 * src/Spacing.h: moved using std::istringstream to right after
7357 <sstream>. This should fix the problem seen with some compilers.
7359 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7361 * src/lyx_cb.C: began some work to remove the dependency a lot of
7362 functions have on BufferView::text, even if not really needed.
7363 (GetCurrentTextClass): removed this func, it only hid the
7366 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
7367 forgot this in last commit.
7369 * src/Bullet.C (bulletEntry): use static char const *[] for the
7370 tables, becuase of this the return arg had to change to string.
7372 (~Bullet): removed unneeded destructor
7374 * src/BufferView.C (beforeChange): moved from lyx_cb.C
7375 (insetSleep): moved from Buffer
7376 (insetWakeup): moved from Buffer
7377 (insetUnlock): moved from Buffer
7379 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
7380 from Buffer to BufferView.
7382 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
7384 * config/ltmain.sh: updated to version 1.3.4 of libtool
7386 * config/ltconfig: updated to version 1.3.4 of libtool
7388 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7391 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
7392 Did I get that right?
7394 * src/lyxlex.h: add a "using" directive or two.
7395 * src/Spacing.h: ditto.
7396 * src/insets/figinset.C: ditto.
7397 * src/support/filetools.C: ditto.
7398 * src/support/lstrings.C: ditto.
7399 * src/BufferView.C: ditto.
7400 * src/bufferlist.C: ditto.
7401 * src/lyx_cb.C: ditto.
7402 * src/lyxlex.C: ditto.
7404 * NEWS: add some changes for 1.1.4.
7406 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7408 * src/BufferView.C: first go at a TextCache to speed up switching
7411 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7413 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
7414 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
7415 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
7416 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
7419 * src/mathed/math_defs.h (MathedRowSt): make sure that all
7420 members of the struct are correctly initialized to 0 (detected by
7422 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
7423 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
7425 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
7426 pidwait, since it was allocated with "new". This was potentially
7427 very bad. Thanks to Michael Schmitt for running purify for us.
7430 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7432 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
7434 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
7436 1999-12-30 Allan Rae <rae@lyx.org>
7438 * lib/templates/IEEEtran.lyx: minor change
7440 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
7441 src/mathed/formula.C (LocalDispatch): askForText changes
7443 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
7444 know when a user has cancelled input. Fixes annoying problems with
7445 inserting labels and version control.
7447 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7449 * src/support/lstrings.C (tostr): rewritten to use strstream and
7452 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7454 * src/support/filetools.C (IsFileWriteable): use fstream to check
7455 (IsDirWriteable): use fileinfo to check
7457 * src/support/filetools.h (FilePtr): whole class deleted
7459 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
7461 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
7463 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
7465 * src/bufferlist.C (write): use ifstream and ofstream instead of
7468 * src/Spacing.h: use istrstream instead of sscanf
7470 * src/mathed/math_defs.h: change first arg to istream from FILE*
7472 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
7474 * src/mathed/math_parser.C: have yyis to be an istream
7475 (LexGetArg): use istream (yyis)
7477 (mathed_parse): ditto
7478 (mathed_parser_file): first arg istream instead of FILE*, set yyis
7480 * src/mathed/formula.C (Read): rewritten to use istream
7482 * src/mathed/formulamacro.C (Read): rewritten to use istream
7484 * src/lyxlex.h (~LyXLex): deleted desturctor
7485 (getStream): new function, returns an istream
7486 (getFile): deleted funtion
7487 (IsOK): return is.good();
7489 * src/lyxlex.C (LyXLex): delete file and owns_file
7490 (setFile): open an filebuf and assign that to a istream instead of
7492 (setStream): new function, takes an istream as arg.
7493 (setFile): deleted function
7494 (EatLine): rewritten us use istream instead of FILE*
7498 * src/table.C (LyXTable): use istream instead of FILE*
7499 (Read): rewritten to take an istream instead of FILE*
7501 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7503 * src/buffer.C (Dispatch): remove an extraneous break statement.
7505 * src/support/filetools.C (QuoteName): change to do simple
7506 'quoting'. More work is necessary. Also changed to do nothing
7507 under emx (needs fix too).
7508 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
7510 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
7511 config.h.in to the AC_DEFINE_UNQUOTED() call.
7512 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
7513 needs char * as argument (because Solaris 7 declares it like
7516 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
7517 remove definition of BZERO.
7519 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7521 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
7522 defined, "lyxregex.h" if not.
7524 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
7526 (REGEX): new variable that is set to regex.c lyxregex.h when
7527 AM_CONDITIONAL USE_REGEX is set.
7528 (libsupport_la_SOURCES): add $(REGEX)
7530 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
7533 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
7536 * configure.in: add call to LYX_REGEX
7538 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
7539 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
7541 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7543 * lib/bind/fi_menus.bind: new file, from
7544 pauli.virtanen@saunalahti.fi.
7546 * src/buffer.C (getBibkeyList): pass the parameter delim to
7547 InsetInclude::getKeys and InsetBibtex::getKeys.
7549 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
7550 is passed to Buffer::getBibkeyList
7552 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
7553 instead of the hardcoded comma.
7555 * src/insets/insetbib.C (getKeys): make sure that there are not
7556 leading blanks in bibtex keys. Normal latex does not care, but
7557 harvard.sty seems to dislike blanks at the beginning of citation
7558 keys. In particular, the retturn value of the function is
7560 * INSTALL: make it clear that libstdc++ is needed and that gcc
7561 2.7.x probably does not work.
7563 * src/support/filetools.C (findtexfile): make debug message go to
7565 * src/insets/insetbib.C (getKeys): ditto
7567 * src/debug.C (showTags): make sure that the output is correctly
7570 * configure.in: add a comment for TWO_COLOR_ICON define.
7572 * acconfig.h: remove all the entries that already defined in
7573 configure.in or acinclude.m4.
7575 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
7576 to avoid user name, date and copyright.
7578 1999-12-21 Juergen Vigna <jug@sad.it>
7580 * src/table.C (Read): Now read bogus row format informations
7581 if the format is < 5 so that afterwards the table can
7582 be read by lyx but without any format-info. Fixed the
7583 crash we experienced when not doing this.
7585 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7587 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
7588 (RedoDrawingOfParagraph): ditto
7589 (RedoParagraphs): ditto
7590 (RemoveTableRow): ditto
7592 * src/text.C (Fill): rename arg paperwidth -> paper_width
7594 * src/buffer.C (insertLyXFile): rename var filename -> fname
7595 (writeFile): rename arg filename -> fname
7596 (writeFileAscii): ditto
7597 (makeLaTeXFile): ditto
7598 (makeLinuxDocFile): ditto
7599 (makeDocBookFile): ditto
7601 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
7604 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
7606 * src/bmtable.h: add extern "C" on this file when __cplusplus is
7609 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
7610 compiled by a C compiler not C++.
7612 * src/layout.h (LyXTextClass): added typedef for const_iterator
7613 (LyXTextClassList): added typedef for const_iterator + member
7614 functions begin and end.
7616 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
7617 iterators to fill the choice_class.
7618 (updateLayoutChoice): rewritten to use iterators to fill the
7619 layoutlist in the toolbar.
7621 * src/BufferView.h (BufferView::work_area_width): removed unused
7624 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
7626 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
7627 (sgmlCloseTag): ditto
7629 * src/support/lstrings.h: return type of countChar changed to
7632 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
7633 what version of this func to use. Also made to return unsigned int.
7635 * configure.in: call LYX_STD_COUNT
7637 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
7638 conforming std::count.
7640 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7642 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
7643 and a subscript would give bad display (patch from Dekel Tsur
7644 <dekel@math.tau.ac.il>).
7646 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
7648 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
7651 * src/chset.h: add a few 'using' directives
7653 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
7654 triggered when no buffer is active
7656 * src/layout.C: removed `break' after `return' in switch(), since
7659 * src/lyx_main.C (init): make sure LyX can be ran in place even
7660 when libtool has done its magic with shared libraries. Fix the
7661 test for the case when the system directory has not been found.
7663 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
7664 name for the latex file.
7665 (MenuMakeHTML): ditto
7667 * src/buffer.h: add an optional boolean argument, which is passed
7670 1999-12-20 Allan Rae <rae@lyx.org>
7672 * lib/templates/IEEEtran.lyx: small correction and update.
7674 * configure.in: Attempted to use LYX_PATH_HEADER
7676 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
7678 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
7679 input from JMarc. Now use preprocessor to find the header.
7680 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
7681 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
7682 LYX_STL_STRING_FWD. See comments in file.
7684 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
7686 * The global MiniBuffer * minibuffer variable is dead.
7688 * The global FD_form_main * fd_form_main variable is dead.
7690 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7692 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
7694 * src/table.h: add the LOstream.h header
7695 * src/debug.h: ditto
7697 * src/LyXAction.h: change the explaination of the ReadOnly
7698 attribute: is indicates that the function _can_ be used.
7700 * src/LyXAction.C (init): find-replace _can_ be used in read-only
7703 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7705 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
7711 * src/paragraph.C (GetWord): assert on pos>=0
7714 * src/support/lyxstring.C: condition the use of an invariant on
7716 * src/support/lyxstring.h: ditto
7718 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
7719 Use LAssert.h instead of plain assert().
7721 * src/support/lstrings.h: add LAssert.h, in case it is needed.
7723 * src/lyxfunc.C: do not include LAssert.h, it is not used.
7724 * src/support/filetools.C: ditto
7726 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
7729 * INSTALL: document the new configure flags
7731 * configure.in: suppress --with-debug; add --enable-assertions
7733 * acinclude.m4: various changes in alignment of help strings.
7735 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7737 * src/kbmap.C: commented out the use of the hash map in kb_map,
7738 beginning of movement to a stl::container.
7740 * several files: removed code that was not in effect when
7741 MOVE_TEXT was defined.
7743 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
7744 for escaping should not be used. We can discuss if the string
7745 should be enclosed in f.ex. [] instead of "".
7747 * src/trans_mgr.C (insert): use the new returned value from
7748 encodeString to get deadkeys and keymaps done correctly.
7750 * src/chset.C (encodeString): changed to return a pair, to tell
7751 what to use if we know the string.
7753 * src/lyxscreen.h (fillArc): new function.
7755 * src/FontInfo.C (resize): rewritten to use more std::string like
7756 structore, especially string::replace.
7758 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
7761 * configure.in (chmod +x some scripts): remove config/gcc-hack
7763 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7765 * src/buffer.C (writeFile): change once again the top comment in a
7766 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
7767 instead of an hardcoded version number.
7768 (makeDocBookFile): ditto
7770 * src/version.h: add new define LYX_DOCVERSION
7772 * po/de.po: update from Pit Sütterlin
7773 * lib/bind/de_menus.bind: ditto.
7775 * src/lyxfunc.C (Dispatch): call MenuExport()
7776 * src/buffer.C (Dispatch): ditto
7778 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
7779 LyXFunc::Dispatch().
7780 (MenuExport): new function, moved from
7781 LyXFunc::Dispatch().
7783 * src/trans_mgr.C (insert): small cleanup
7784 * src/chset.C (loadFile): ditto
7786 * lib/kbd/iso8859-1.cdef: add missing backslashes
7788 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7790 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
7791 help with placing the manually drawn accents better.
7793 (Draw): x2 and hg changed to float to minimize rounding errors and
7794 help place the accents better.
7796 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
7797 unsigned short to char is just wrong...cast the char to unsigned
7798 char instead so that the two values can compare sanely. This
7799 should also make the display of insetlatexaccents better and
7800 perhaps also some other insets.
7802 (lbearing): new function
7805 1999-12-15 Allan Rae <rae@lyx.org>
7807 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
7808 header that provides a wrapper around the very annoying SGI STL header
7811 * src/support/lyxstring.C, src/LString.h:
7812 removed old SGI-STL-compatability attempts.
7814 * configure.in: Use LYX_STL_STRING_FWD.
7816 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
7817 stl_string_fwd.h is around and try to determine it's location.
7818 Major improvement over previous SGI STL 3.2 compatability.
7819 Three small problems remain with this function due to my zero
7820 knowledge of autoconf. JMarc and lgb see the comments in the code.
7822 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7824 * src/broken_const.h, config/hack-gcc, config/README: removed
7826 * configure.in: remove --with-gcc-hack option; do not call
7829 * INSTALL: remove documentation of --with-broken-const and
7832 * acconfig.h: remove all trace of BROKEN_CONST define
7834 * src/buffer.C (makeDocBookFile): update version number in output
7836 (SimpleDocBookOnePar): fix an assert when trying to a character
7837 access beyond string length
7840 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7842 * po/de.po: fix the Export menu
7844 * lyx.man: update the description of -dbg
7846 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
7847 (commandLineHelp): updated
7848 (easyParse): show list of available debug levels if -dbg is passed
7851 * src/Makefile.am: add debug.C
7853 * src/debug.h: moved some code to debug.C
7855 * src/debug.C: new file. Contains code to set and show debug
7858 * src/layout.C: remove 'break' after 'continue' in switch
7859 statements, since these cannot be reached.
7861 1999-12-13 Allan Rae <rae@lyx.org>
7863 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
7864 (in_word_set): hash() -> math_hash()
7866 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
7868 * acconfig.h: Added a test for whether we are using exceptions in the
7869 current compilation run. If so USING_EXCEPTIONS is defined.
7871 * config.in: Check for existance of stl_string_fwd.h
7872 * src/LString.h: If compiling --with-included-string and SGI's
7873 STL version 3.2 is present (see above test) we need to block their
7874 forward declaration of string and supply a __get_c_string().
7875 However, it turns out this is only necessary if compiling with
7876 exceptions enabled so I've a bit more to add yet.
7878 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
7879 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
7880 src/support/LRegex.h, src/undo.h:
7881 Shuffle the order of the included files a little to ensure that
7882 LString.h gets included before anything that includes stl_string_fwd.h
7884 * src/support/lyxstring.C: We need to #include LString.h instead of
7885 lyxstring.h to get the necessary definition of __get_c_string.
7886 (__get_c_string): New function. This is defined static just like SGI's
7887 although why they need to do this I'm not sure. Perhaps it should be
7888 in lstrings.C instead.
7890 * lib/templates/IEEEtran.lyx: New template file.
7892 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7894 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
7895 * intl/Makefile.in (MKINSTALLDIRS): ditto
7897 * src/LyXAction.C (init): changed to hold the LFUN data in a
7898 automatic array in stead of in callso to newFunc, this speeds up
7899 compilation a lot. Also all the memory used by the array is
7900 returned when the init is completed.
7902 * a lot of files: compiled with -Wold-style-cast, changed most of
7903 the reported offenders to C++ style casts. Did not change the
7904 offenders in C files.
7906 * src/trans.h (Match): change argument type to unsigned int.
7908 * src/support/DebugStream.C: fix some types on the streambufs so
7909 that it works on a conforming implementation.
7911 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7913 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
7915 * src/support/lyxstring.C: remove the inline added earlier since
7916 they cause a bunch of unsatisfied symbols when linking with dec
7917 cxx. Cxx likes to have the body of inlines at the place where they
7920 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
7921 accessing negative bounds in array. This fixes the crash when
7922 inserting accented characters.
7923 * src/trans.h (Match): ditto
7925 * src/buffer.C (Dispatch): since this is a void, it should not try
7926 to return anything...
7928 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7930 * src/buffer.h: removed the two friends from Buffer. Some changes
7931 because of this. Buffer::getFileName and Buffer::setFileName
7932 renamed to Buffer::fileName() and Buffer::fileName(...).
7934 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7936 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
7937 and Buffer::update(short) to BufferView. This move is currently
7938 controlled by a define MOVE_TEXT, this will be removed when all
7939 shows to be ok. This move paves the way for better separation
7940 between buffer contents and buffer view. One side effect is that
7941 the BufferView needs a rebreak when swiching buffers, if we want
7942 to avoid this we can add a cache that holds pointers to LyXText's
7943 that is not currently in use.
7945 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
7948 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7950 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
7952 * lyx_main.C: new command line option -x (or --execute) and
7953 -e (or --export). Now direct conversion from .lyx to .tex
7954 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
7955 Unfortunately, X is still needed and the GUI pops up during the
7958 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7960 * src/Spacing.C: add a using directive to bring stream stuff into
7962 * src/paragraph.C: ditto
7963 * src/buffer.C: ditto
7965 * NEWS: updated a bit the new features of 1.1.3 (took a few things
7966 from Lars' announcement).
7968 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
7969 example files from Tino Meinen.
7971 1999-12-06 Allan Rae <rae@lyx.org>
7973 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
7975 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7977 * src/support/lyxstring.C: added a lot of inline for no good
7980 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
7981 latexWriteEndChanges, they were not used.
7983 * src/layout.h (operator<<): output operator for PageSides
7985 * src/mathed/math_iter.C (my_memcpy): slightly changed.
7987 * some example files: loaded in LyX 1.0.4 and saved again to update
7988 certain constructs (table format)
7990 * a lot of files: did the change to use fstream/iostream for all
7991 writing of files. Done with a close look at Andre Poenitz's patch.
7993 * some files: whitespace changes.
7995 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7997 * src/mathed/math_iter.C (my_memcpy): new function. Since the
7998 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
7999 architecture, we provide our own. It is used unconditionnally, but
8000 I do not think this is a performance problem. Thanks to Angus
8001 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
8002 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
8004 (GetInset): use my_memcpy.
8008 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
8009 it is easier to understand, but it uses less TeX-only constructs now.
8011 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
8012 elements contain spaces
8014 * lib/configure: regenerated
8016 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
8017 elements contain spaces; display the list of programs that are
8020 * autogen.sh: make sure lib/configure is executable
8022 * lib/examples/*: rename the tutorial examples to begin with the
8023 two-letters language code.
8025 * src/lyxfunc.C (getStatus): do not query current font if no
8028 * src/lyx_cb.C (RunScript): use QuoteName
8029 (MenuRunDvips): ditto
8030 (PrintApplyCB): ditto
8032 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
8033 around argument, so that it works well with the current shell.
8034 Does not work properly with OS/2 shells currently.
8036 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
8037 * src/LyXSendto.C (SendtoApplyCB): ditto
8038 * src/lyxfunc.C (Dispatch): ditto
8039 * src/buffer.C (runLaTeX): ditto
8040 (runLiterate): ditto
8041 (buildProgram): ditto
8043 * src/lyx_cb.C (RunScript): ditto
8044 (MenuMakeLaTeX): ditto
8046 * src/buffer.h (getLatexName): new method
8048 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
8050 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8052 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
8053 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
8054 (create_math_panel): ditto
8056 * src/lyxfunc.C (getStatus): re-activate the code which gets
8057 current font and cursor; add test for export to html.
8059 * src/lyxrc.C (read): remove unreachable break statements; add a
8062 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
8064 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8066 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
8067 introduced by faulty regex.
8068 * src/buffer.C: ditto
8069 * src/lastfiles.C: ditto
8070 * src/paragraph.C: ditto
8071 * src/table.C: ditto
8072 * src/vspace.C: ditto
8073 * src/insets/figinset.C: ditto
8074 Note: most of these is absolutely harmless, except the one in
8075 src/mathed formula.C.
8077 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8079 * src/ImportNoweb.C (documentclass): fixed bounds for substr
8080 operation, yielding correct results for the reLyX command.
8082 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8084 * src/support/filetools.C (ExpandPath): removed an over eager
8086 (ReplaceEnvironmentPath): ditto
8088 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
8089 shows that we are doing something fishy in our code...
8093 * src/lyxrc.C (read): use a double switch trick to get more help
8094 from the compiler. (the same trick is used in layout.C)
8095 (write): new function. opens a ofstream and pass that to output
8096 (output): new function, takes a ostream and writes the lyxrc
8097 elemts to it. uses a dummy switch to make sure no elements are
8100 * src/lyxlex.h: added a struct pushpophelper for use in functions
8101 with more than one exit point.
8103 * src/lyxlex.[Ch] (GetInteger): made it const
8107 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
8109 * src/layout.[hC] : LayoutTags splitted into several enums, new
8110 methods created, better error handling cleaner use of lyxlex. Read
8113 * src/bmtable.[Ch]: change some member prototypes because of the
8114 image const changes.
8116 * commandtags.h, src/LyXAction.C (init): new function:
8117 "preferences-save", saves the lyxrc entries into .lyx/preferences.
8118 This file is not read automatically but you can add \input
8119 preferences to your lyxrc if you want to. We need to discuss how
8122 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
8123 in .aux, also remove .bib and .bst files from dependencies when
8126 * src/BufferView.C, src/LyXView.C: add const_cast several places
8127 because of changes to images.
8129 * lib/images/*: same change as for images/*
8131 * lib/lyxrc.example: Default for accept_compound is false not no.
8133 * images/*: changed to be const, however I have som misgivings
8134 about this change so it might be changed back.
8136 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8138 * lib/configure, po/POTFILES.in: regenerated
8140 * autogen.sh: autogenerate lib/configure from lib/configure.m4
8142 * config/lib_configure.m4: removed
8144 * lib/configure.m4: new file (was config/lib_configure.m4)
8146 * configure.in: do not test for rtti, since we do not use it.
8148 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8150 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
8151 doubling of allocated space scheme. This makes it faster for large
8152 strings end to use less memory for small strings. xtra rememoved.
8154 * src/insets/figinset.C (waitalarm): commented out.
8155 (GhostscriptMsg): use static_cast
8156 (GhostscriptMsg): use new instead of malloc to allocate memory for
8157 cmap. also delete the memory after use.
8159 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
8161 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
8162 for changes in bibtex database or style.
8163 (runBibTeX): remove all .bib and .bst files from dep before we
8165 (run): use scanAuc in when dep file already exist.
8167 * src/DepTable.C (remove_files_with_extension): new method
8170 * src/DepTable.[Ch]: made many of the methods const.
8172 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8174 * src/bufferparams.C: make sure that the default textclass is
8175 "article". It used to be the first one by description order, but
8176 now the first one is "docbook".
8178 * src/lyx_main.C (setDebuggingLevel): change type of argument to
8179 string; call Debug::value.
8180 (easyParse): pass complete argument to setDebuggingLevel().
8182 * src/debug.h (value): fix the code that parses debug levels.
8184 * src/debug.h: add new debug type ACTION, reserved for LyXAction
8187 * src/LyXAction.C: use Debug::ACTION as debug channel.
8189 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
8191 * NEWS: updated for the future 1.1.3 release.
8193 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
8194 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
8195 it should. This is of course a controversial change (since many
8196 people will find that their lyx workscreen is suddenly full of
8197 red), but done for the sake of correctness.
8199 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
8200 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
8202 * src/insets/inseterror.h, src/insets/inseturl.h,
8203 src/insets/insetinfo.h, src/insets/figinset.h,
8204 src/mathed/formulamacro.h, src/mathed/math_macro.h
8205 (EditMessage): add a missing const and add _() to make sure that
8208 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
8209 src/insets/insetbib.C, src/support/filetools.C: add `using'
8212 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
8213 doing 'Insert index of last word' at the beginning of a paragraph.
8215 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8217 * several files: white-space changes.
8219 * src/mathed/formula.C: removed IsAlpha and IsDigit
8221 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
8222 .bib file. use a ifstream instead of FilePtr when parsing the .bib
8225 * src/insets/figinset.C (GetPSSizes): don't break when
8226 "EndComments" is seen. But break when a boundingbox is read.
8228 * all classes inherited from Inset: return value of Clone
8229 changed back to Inset *.
8231 * all classes inherited form MathInset: return value of Clone
8232 changed back to MathedInset *.
8234 * src/insets/figinset.C (runqueue): use a ofstream to output the
8235 gs/ps file. Might need some setpresicion or setw. However I can
8236 see no problem with the current code.
8237 (runqueue): use sleep instead of the alarm/signal code. I just
8238 can't see the difference.
8240 * src/paragraph.C (LyXParagraph): reserve space in the new
8241 paragraph and resize the inserted paragraph to just fit.
8243 * src/lyxfunc.h (operator|=): added operator for func_status.
8245 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
8246 check for readable file.
8248 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
8249 check for readable file.
8250 (MenuMakeLinuxDoc): ditto
8251 (MenuMakeDocBook): ditto
8252 (MenuMakeAscii): ditto
8253 (InsertAsciiFile): split the test for openable and readable
8255 * src/bmtable.C (draw_bitmaptable): use
8256 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
8258 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
8259 findtexfile from LaTeX to filetools.
8261 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
8262 instead of FilePtr. Needs to be verified by a literate user.
8264 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8266 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
8267 (EditMessage): likewise.
8269 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
8270 respectively as \textasciitilde and \textasciicircum.
8272 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8274 * src/support/lyxstring.h: made the methods that take iterators
8277 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
8278 (regexMatch): made is use the real regex class.
8280 * src/support/Makefile.am: changed to use libtool
8282 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
8284 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
8286 (MathIsInset ++): changed several macros to be inline functions
8289 * src/mathed/Makefile.am: changed to use libtool
8291 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
8293 * src/insets/inset* : Clone changed to const and return type is
8294 the true insettype not just Inset*.
8296 * src/insets/Makefile.am: changed to use libtool
8298 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
8300 * src/undo.[Ch] : added empty() and changed some of the method
8303 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
8305 * src/lyxparagraph.h: use id() and id(...) instead of getID and
8306 setID use block<> for the bullets array, added const several places.
8308 * src/lyxfunc.C (getStatus): new function
8310 * src/lyxfunc.[Ch] : small changes to take advantage of the new
8311 LyXAction, added const to several funtions.
8313 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
8314 a std::map, and to store the dir items in a vector.
8316 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
8319 * src/LyXView.[Ch] + other files : changed currentView to view.
8321 * src/LyXAction.[Ch] : ported from the old devel branch.
8323 * src/.cvsignore: added .libs and a.out
8325 * configure.in : changes to use libtool.
8327 * acinclude.m4 : inserted libtool.m4
8329 * .cvsignore: added libtool
8331 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8333 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
8334 file name in insets and mathed directories (otherwise the
8335 dependency is not taken in account under cygwin).
8337 * src/text2.C (InsertString[AB]): make sure that we do not try to
8338 read characters past the string length.
8340 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8342 * lib/doc/LaTeXConfig.lyx.in,
8343 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
8345 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
8346 file saying who created them and when this heppened; this is
8347 useless and annoys tools like cvs.
8349 * lib/layouts/g-brief-{en,de}.layout,
8350 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
8351 from Thomas Hartkens <thomas@hartkens.de>.
8353 * src/{insets,mathed}/Makefile.am: do not declare an empty
8354 LDFLAGS, so that it can be set at configure time (useful on Irix
8357 * lib/reLyX/configure.in: make sure that the prefix is set
8358 correctly in LYX_DIR.
8360 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8362 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
8363 be used by 'command-sequence' this allows to bind a key to a
8364 sequence of LyX-commands
8365 (Example: 'command-sequence math-insert alpha; math-insert beta;")
8367 * src/LyXAction.C: add "command-sequence"
8369 * src/LyXFunction.C: handling of "command-sequence"
8371 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
8372 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
8374 * src/lyxserver.C, src/minibuffer.C: Use this new interface
8376 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8378 * src/buffer.C (writeFile): Do not output a comment giving user
8379 and date at the beginning of a .lyx file. This is useless and
8380 annoys cvs anyway; update version number to 1.1.
8382 * src/Makefile.am (LYX_DIR): add this definition, so that a
8383 default path is hardcoded in LyX.
8385 * configure.in: Use LYX_GNU_GETTEXT.
8387 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
8388 AM_GNU_GETTEXT with a bug fixed.
8390 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
8392 * src/chset.C: add "using std::ifstream;" to please dec cxx.
8394 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
8395 which is used to point to LyX data is now LYX_DIR_11x.
8397 * lyx.man: convert to a unix text file; small updates.
8399 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8401 * src/support/LSubstring.[Ch]: made the second arg of most of the
8402 constructors be a const reference.
8404 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
8407 * src/support/lyxstring.[Ch] (swap): added missing member function
8408 and specialization of swap(str, str);
8410 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
8412 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
8413 trace of the old one.
8415 * src/undo.[Ch]: made the undostack use std::list to store undo's in
8416 put the member definitions in undo.C.
8418 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
8419 NEW_TEXT and have now only code that was included when this was
8422 * src/intl.C (LCombo): use static_cast
8424 (DispatchCallback): ditto
8426 * src/definitions.h: removed whole file
8428 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
8430 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
8431 parsing and stores in a std:map. a regex defines the file format.
8432 removed unneeded members.
8434 * src/bufferparams.h: added several enums from definitions.h here.
8435 Removed unsused destructor. Changed some types to use proper enum
8436 types. use block to have the temp_bullets and user_defined_bullets
8437 and to make the whole class assignable.
8439 * src/bufferparams.C (Copy): removed this functions, use a default
8442 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
8445 * src/buffer.C (readLyXformat2): commend out all that have with
8446 oldpapersize to do. also comment out all that hve to do with
8447 insetlatex and insetlatexdel.
8448 (setOldPaperStuff): commented out
8450 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
8452 * src/LyXAction.C: remove use of inset-latex-insert
8454 * src/mathed/math_panel.C (button_cb): use static_cast
8456 * src/insets/Makefile.am (insets_o_SOURCES): removed
8459 * src/support/lyxstring.C (helper): use the unsigned long
8460 specifier, UL, instead of a static_cast.
8462 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
8464 * src/support/block.h: new file. to be used as a c-style array in
8465 classes, so that the class can be assignable.
8467 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8469 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
8470 NULL, make sure to return an empty string (it is not possible to
8471 set a string to NULL).
8473 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8475 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
8477 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
8479 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
8480 link line, so that Irix users (for example) can set it explicitely to
8483 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
8484 it can be overidden at make time (static or dynamic link, for
8487 * src/vc-backend.C, src/LaTeXFeatures.h,
8488 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
8489 statements to bring templates to global namespace.
8491 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8493 * src/support/lyxstring.C (operator[] const): make it standard
8496 * src/minibuffer.C (Init): changed to reflect that more
8497 information is given from the lyxvc and need not be provided here.
8499 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
8501 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
8503 * src/LyXView.C (UpdateTimerCB): use static_cast
8504 (KeyPressMask_raw_callback): ditto
8506 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
8507 buffer_, a lot of changes because of this. currentBuffer() ->
8508 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
8509 also changes to other files because of this.
8511 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8513 * src/vc-backend.[Ch]: new files. The backends for vc handling,
8514 have no support for RCS and partial support for CVS, will be
8517 * src/insets/ several files: changes because of function name
8518 changes in Bufferview and LyXView.
8520 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
8522 * src/support/LSubstring.[Ch]: new files. These implement a
8523 Substring that can be very convenient to use. i.e. is this
8525 string a = "Mary had a little sheep";
8526 Substring(a, "sheep") = "lamb";
8527 a is now "Mary has a little lamb".
8529 * src/support/LRegex.[Ch]: a regex class that can be used to pick
8530 out patterns and subpatterns of strings. It is used by LSubstring
8531 and also by vc-backend.C
8533 * src/support/lyxstring.C: went over all the assertions used and
8534 tried to correct the wrong ones and flag which of them is required
8535 by the standard. some bugs found because of this. Also removed a
8536 couple of assertions.
8538 * src/support/Makefile.am (libsupport_a_SOURCES): added
8539 LSubstring.[Ch] and LRegex.[Ch]
8541 * src/support/FileInfo.h: have struct stat buf as an object and
8542 not a pointer to one, some changes because of this.
8544 * src/LaTeXFeatures.C (getTClassPreamble): also use the
8545 information in layout when adding the layouts preamble to the
8548 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
8551 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
8552 because of bug in OS/2.
8554 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8556 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
8557 \verbatim@font instead of \ttfamily, so that it can be redefined.
8559 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
8560 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
8561 src/layout.h, src/text2.C: add 'using' directive to bring the
8562 STL templates we need from the std:: namespace to the global one.
8563 Needed by DEC cxx in strict ansi mode.
8565 * src/support/LIstream.h,src/support/LOstream.h,
8566 src/support/lyxstring.h,src/table.h,
8567 src/lyxlookup.h: do not include <config.h> in header
8568 files. This should be done in the .C files only.
8570 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
8574 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8576 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
8577 from Kayvan to fix the tth invokation.
8579 * development/lyx.spec.in: updates from Kayvan to reflect the
8580 changes of file names.
8582 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8584 * src/text2.C (InsertStringB): use std::copy
8585 (InsertStringA): use std::copy
8587 * src/bufferlist.C: use a vector to store the buffers in. This is
8588 an internal change and should not affect any other thing.
8590 * src/BufferView.C (waitForX): use XSync instead of the lengthy
8593 * src/text.C (Fill): fix potential bug, one off bug.
8595 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8597 * src/Makefile.am (lyx_main.o): add more files it depends on.
8599 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
8601 * src/support/lyxstring.C: use size_t for the reference count,
8602 size, reserved memory and xtra.
8603 (internal_compare): new private member function. Now the compare
8604 functions should work for std::strings that have embedded '\0'
8606 (compare): all compare functions rewritten to use
8609 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8611 * src/support/lyxstring.C (compare): pass c_str()
8612 (compare): pass c_str
8613 (compare): pass c_str
8615 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8617 * src/support/DebugStream.C: <config.h> was not included correctly.
8619 * lib/configure: forgot to re-generate it :( I'll make this file
8620 auto generated soon.
8622 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8624 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
8627 * src/support/lyxstring.C: some changes from length() to rep->sz.
8628 avoids a function call.
8630 * src/support/filetools.C (SpaceLess): yet another version of the
8631 algorithm...now per Jean-Marc's suggestions.
8633 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8635 * src/layout.C (less_textclass_desc): functor for use in sorting
8637 (LyXTextClass::Read): sort the textclasses after reading.
8639 * src/support/filetools.C (SpaceLess): new version of the
8640 SpaceLess functions. What problems does this one give? Please
8643 * images/banner_bw.xbm: made the arrays unsigned char *
8645 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8647 * src/support/lyxstring.C (find): remove bogus assertion in the
8648 two versions of find where this has not been done yet.
8650 * src/support/lyxlib.h: add missing int return type to
8653 * src/menus.C (ShowFileMenu): disable exporting to html if no
8654 html export command is present.
8656 * config/lib_configure.m4: add a test for an HTML converter. The
8657 programs checked for are, in this order: tth, latex2html and
8660 * lib/configure: generated from config/lib_configure.m4.
8662 * src/lyxfunc.C (Dispatch): update and improve the execution of an
8663 html converter. The parameters are now passed through $$FName and
8664 $$OutName, instead of standard input/output.
8666 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
8668 * lib/lyxrc.example: update description of \html_command.
8669 add "quotes" around \screen_font_xxx font setting examples to help
8670 people who use fonts with spaces in their names.
8672 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8674 * Distribution files: updates for v1.1.2
8676 * src/support/lyxstring.C (find): remove bogus assert and return
8677 npos for the same condition.
8679 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8681 * added patch for OS/2 from SMiyata.
8683 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8685 * src/text2.C (CutSelection): make space_wrapped a bool
8686 (CutSelection): dont declare int i until we have to.
8687 (alphaCounter): return a char const *.
8689 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8691 * src/support/syscall.C (Systemcalls::kill):
8692 src/support/filetools.C (PutEnv, PutEnvPath):
8693 src/lyx_cb.C (addNewlineAndDepth):
8694 src/FontInfo.C (FontInfo::resize): condition some #warning
8695 directives with WITH_WARNINGS.
8698 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8700 * src/layout.[Ch] + several files: access to class variables
8701 limited and made accessor functions instead a lot of code changed
8702 becuase of this. Also instead of returning pointers often a const
8703 reference is returned instead.
8705 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
8707 * src/Makefile.am (dist-hook): added used to remove the CVS from
8708 cheaders upon creating a dist
8709 (EXTRA_DIST): added cheaders
8711 * src/support/lstrings.C (tostr(char)): fix it to handle param as
8712 a character not as a small integer.
8714 * src/support/lyxstring.C (find): removed Assert and added i >=
8715 rep->sz to the first if.
8717 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8719 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
8720 src/LyXView.C src/buffer.C src/bufferparams.C
8721 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
8722 src/text2.C src/insets/insetinclude.C:
8723 lyxlayout renamed to textclasslist.
8725 * src/layout.C: some lyxerr changes.
8727 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
8728 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
8729 (LyXLayoutList): removed all traces of this class.
8730 (LyXTextClass::Read): rewrote LT_STYLE
8731 (LyXTextClass::hasLayout): new function
8732 (LyXTextClass::GetLayout): rewritten to return an iterator + has
8733 both const and nonconst version.
8734 (LyXTextClass::delete_layout): new function.
8735 (LyXTextClassList::Style): bug fix. do the right thing if layout
8737 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
8738 (LyXTextClassList::NameOfLayout): ditto
8739 (LyXTextClassList::Load): ditto
8741 * src/buffer.C (makeLaTeXFile): new access to layoutlist
8743 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
8745 * src/LyXAction.C (LookupFunc): added a workaround for sun
8746 compiler, on the other hand...we don't know if the current code
8747 compiles on sun at all...
8749 * src/support/filetools.C (CleanupPath): subst fix
8751 * src/insets/insetbib.C (delDatabase): subst fix, this looks
8754 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
8755 complained about this one?
8757 * src/insets/insetinclude.C (Latex): subst fix
8759 * src/insets/insetbib.C (getKeys): subst fix
8761 * src/LyXSendto.C (SendtoApplyCB): subst fix
8763 * src/lyx_main.C (init): subst fix
8765 * src/layout.C (Read): subst fix
8767 * src/lyx_sendfax_main.C (button_send): subst fix
8769 * src/buffer.C (RoffAsciiTable): subst fix
8771 * src/lyx_cb.C (MenuFax): subst fix
8772 (PrintApplyCB): subst fix
8774 1999-10-26 Juergen Vigna <jug@sad.it>
8776 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
8778 (Read): Cleaned up this code so now we read only format vestion >= 5
8780 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8782 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
8783 come nobody has complained about this one?
8785 * src/insets/insetinclude.C (Latex): subst fix
8787 * src/insets/insetbib.C (getKeys): subst fix
8789 * src/lyx_main.C (init): subst fix
8791 * src/layout.C (Read): subst fix
8793 * src/buffer.C (RoffAsciiTable): subst fix
8795 * src/lyx_cb.C (MenuFax): subst fix.
8797 * src/layout.[hC] + some other files: rewrote to use
8798 std::container to store textclasses and layouts in.
8799 Simplified, removed a lot of code. Make all classes
8800 assignable. Further simplifications and review of type
8801 use still to be one.
8803 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
8804 lastfiles to create the lastfiles partr of the menu.
8806 * src/lastfiles.[Ch]: rewritten to use deque to store the
8807 lastfiles in. Uses fstream for reading and writing. Simplifies
8810 * src/support/syscall.C: remove explicit cast.
8812 * src/BufferView.C (CursorToggleCB): removed code snippets that
8814 use explicat C++ style casts instead of C style casts. also use
8815 u_vdata instea of passing pointers in longs.
8817 * src/PaperLayout.C: removed code snippets that were commented out.
8819 * src/lyx_gui_misc.C: removed code snippets that were commented out.
8821 * src/lyx_main.C: removed code snippets that wer commented out.
8823 * src/paragraph.C: removed code snippets that were commented out.
8825 * src/lyxvc.C (logClose): use static_cast
8827 (viewLog): remove explicit cast to void*
8828 (showLog): removed old commented code
8830 * src/menus.C: use static_cast instead of C style casts. use
8831 u_vdata instead of u_ldata. remove explicit cast to (long) for
8832 pointers. Removed old code that was commented out.
8834 * src/insets/inset.C: removed old commented func
8836 * src/insets/insetref.C (InsetRef): removed old code that had been
8837 commented out for a long time.
8839 (escape): removed C style cast
8841 * src/insets/insetlatexaccent.C (Draw): removed old commented code
8843 * src/insets/insetlatex.C (Draw): removed old commented code
8844 (Read): rewritten to use string
8846 * src/insets/insetlabel.C (escape): removed C style cast
8848 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
8850 * src/insets/insetindex.C: use static_cast and u_vdata, removed
8853 * src/insets/insetinclude.h: removed a couple of stupid bools
8855 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
8856 (Clone): remove C style cast
8857 (getKeys): changed list to lst because of std::list
8859 * src/insets/inseterror.C (Draw): removed som old commented code.
8861 * src/insets/insetcommand.C (Draw): removed some old commented code.
8863 * src/insets/insetbib.C (bibitem_cb): removed code that has been
8864 commented out forever.
8865 (bibitem_cb): use static_cast instead of C style cast
8866 use of vdata changed to u_vdata.
8868 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
8870 (CloseUrlCB): use static_cast instead of C style cast.
8871 (CloseUrlCB): added a fl_free form...it seemed to be missing.
8873 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
8874 (C_InsetInfo_CloseInfoCB): forward the ob parameter
8875 (CloseInfoCB): static_cast from ob->u_vdata instead.
8876 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
8879 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
8880 (C_InsetError_CloseErrorCB): forward the ob parameter
8881 (CloseErrorCB): static_cast from ob->u_vdata instead.
8883 * src/vspace.h: include LString.h since we use string in this class.
8885 * src/vspace.C (lyx_advance): changed name from advance because of
8886 nameclash with stl. And since we cannot use namespaces yet...I
8887 used a lyx_ prefix instead. Expect this to change when we begin
8890 * src/BufferView.[Ch] (BufferView::~BufferView): removed
8892 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
8893 and removed now defunct constructor and deconstructor.
8895 * src/BufferView.h: have backstack as a object not as a pointer.
8896 removed initialization from constructor. added include for BackStack
8898 * development/lyx.spec.in (%build): add CFLAGS also.
8900 * src/screen.C (drawFrame): removed another warning.
8902 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8904 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
8905 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
8906 README and ANNOUNCE a bit for the next release. More work is
8909 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
8910 unbreakable if we are in freespacing mode (LyX-Code), but not in
8913 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8915 * src/BackStack.h: fixed initialization order in constructor
8917 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
8919 * acinclude.m4 (VERSION): new rules for when a version is
8920 development, added also a variable for prerelease.
8921 (warnings): we set with_warnings=yes for prereleases
8922 (lyx_opt): prereleases compile with same optimization as development
8923 (CXXFLAGS): only use pedantic if we are a development version
8925 * src/BufferView.C (restorePosition): don't do anything if the
8928 * src/BackStack.h: added member empty, use this to test if there
8929 is anything to pop...
8931 1999-10-25 Juergen Vigna <jug@sad.it>
8934 * forms/layout_forms.fd +
8935 * forms/latexoptions.fd +
8936 * lyx.fd: changed for various form resize issues
8938 * src/mathed/math_panel.C +
8939 * src/insets/inseterror.C +
8940 * src/insets/insetinfo.C +
8941 * src/insets/inseturl.C +
8942 * src/insets/inseturl.h +
8945 * src/PaperLayout.C +
8946 * src/ParagraphExtra.C +
8947 * src/TableLayout.C +
8949 * src/layout_forms.C +
8956 * src/menus.C: fixed various resize issues. So now forms can be
8957 resized savely or not be resized at all.
8959 * forms/form_url.fd +
8960 * src/insets/form_url.[Ch]: added because it's cleaner and easier
8963 * src/insets/Makefile.am: added files form_url.[Ch]
8965 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8967 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
8968 (and presumably 6.2).
8970 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
8971 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
8972 remaining static member callbacks.
8974 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
8977 * src/support/lyxstring.h: declare struct Srep as friend of
8978 lyxstring, since DEC cxx complains otherwise.
8980 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8982 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8984 * src/LaTeX.C (run): made run_bibtex also depend on files with
8986 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
8987 are put into the dependency file.
8989 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
8990 the code has shown itself to work
8991 (create_ispell_pipe): removed another warning, added a comment
8994 * src/minibuffer.C (ExecutingCB): removed code that has been
8995 commented out a long time
8997 * src/lyxfunc.C (processKeyEvent): removed some very old commented
8998 out code + a warning.
9000 * src/support/lyxstring.h: comment out the three private
9001 operators, when compiling with string ansi conforming compilers
9004 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
9006 (pixmapFromBitmapData): change type of bdata to be unsigned char *
9007 (pixmapFromBitmapData): add a reinterpret_cast in the call to
9010 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
9013 * src/mathed/math_panel.C (create_math_panel): remove explicit
9016 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
9019 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
9020 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
9021 to XCreatePixmapFromBitmapData
9022 (fl_set_bmtable_data): change the last argument to be unsigned
9024 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
9025 and bh to be unsigned int, remove explicit casts in call to
9026 XReadBitmapFileData.
9028 * images/arrows.xbm: made the arrays unsigned char *
9029 * images/varsz.xbm: ditto
9030 * images/misc.xbm: ditto
9031 * images/greek.xbm: ditto
9032 * images/dots.xbm: ditto
9033 * images/brel.xbm: ditto
9034 * images/bop.xbm: ditto
9036 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
9038 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
9039 (LYX_PROG_CXX): added -pedantic to g++ compile options when
9040 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
9042 (LYX_CXX_CHEADERS): added <clocale> to the test.
9044 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
9046 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
9048 * src/support/lyxstring.C (append): fixed something that must be a
9049 bug, rep->assign was used instead of rep->append.
9051 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
9054 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
9055 lyx insert double chars. Fix spotted by Kayvan.
9057 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9059 * Fixed the tth support. I messed up with the Emacs patch apply feature
9060 and omitted the changes in lyxrc.C.
9062 1999-10-22 Juergen Vigna <jug@sad.it>
9064 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
9066 * src/lyx_cb.C (MenuInsertRef) +
9067 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
9068 the form cannot be resized under it limits (fixes a segfault)
9070 * src/lyx.C (create_form_form_ref) +
9071 * forms/lyx.fd: Changed Gravity on name input field so that it is
9074 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9076 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
9077 <ostream> and <istream>.
9079 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
9080 whether <fstream> provides the latest standard features, or if we
9081 have an oldstyle library (like in egcs).
9082 (LYX_CXX_STL_STRING): fix the test.
9084 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
9085 code on MODERN_STL_STREAM.
9087 * src/support/lyxstring.h: use L{I,O}stream.h.
9089 * src/support/L{I,O}stream.h: new files, designed to setup
9090 correctly streams for our use
9091 - includes the right header depending on STL capabilities
9092 - puts std::ostream and std::endl (for LOStream.h) or
9093 std::istream (LIStream.h) in toplevel namespace.
9095 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9097 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
9098 was a bib file that had been changed we ensure that bibtex is run.
9099 (runBibTeX): enhanced to extract the names of the bib files and
9100 getting their absolute path and enter them into the dep file.
9101 (findtexfile): static func that is used to look for tex-files,
9102 checks for absolute patchs and tries also with kpsewhich.
9103 Alternative ways of finding the correct files are wanted. Will
9105 (do_popen): function that runs a command using popen and returns
9106 the whole output of that command in a string. Should be moved to
9109 * src/DepTable.[Ch] (extchanged): new function that returns true if a
9110 file with extension ext has changed.
9112 * src/insets/figinset.C: added ifdef guards around the fl_free
9113 code that jug commented out. Now it is commented out when
9114 compiling with XForms == 0.89.
9116 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
9117 to lyxstring.C, and only keep a forward declaration in
9118 lyxstring.h. Simplifies the header file a bit and should help a
9119 bit on compile time too. Also changes to Srep will not mandate a
9120 recompile of code just using string.
9121 (~lyxstring): definition moved here since it uses srep.
9122 (size): definition moved here since it uses srep.
9124 * src/support/lyxstring.h: removed a couple of "inline" that should
9127 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9129 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
9132 1999-10-21 Juergen Vigna <jug@sad.it>
9134 * src/table.C (SetPWidth): Just a small fix so the alignment is not
9135 set to left if I just remove the width entry (or it is empty).
9137 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
9138 paragraph when having dummy paragraphs.
9140 1999-10-20 Juergen Vigna <jug@sad.it>
9142 * src/insets/figinset.C: just commented some fl_free_form calls
9143 and added warnings so that this calls should be activated later
9144 again. This avoids for now a segfault, but we have a memory leak!
9146 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
9147 'const char * argument' to 'string argument', this should
9148 fix some Asserts() in lyxstring.C.
9150 * src/lyxfunc.h: Removed the function argAsString(const char *)
9151 as it is not used anymore.
9153 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9155 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
9158 * src/Literate.h: some funcs moved from public to private to make
9159 interface clearer. Unneeded args removed.
9161 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
9163 (scanBuildLogFile): ditto
9165 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
9166 normal TeX Error. Still room for improvement.
9168 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
9170 * src/buffer.C (insertErrors): changes to make the error
9171 desctription show properly.
9173 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
9176 * src/support/lyxstring.C (helper): changed to use
9177 sizeof(object->rep->ref).
9178 (operator>>): changed to use a pointer instead.
9180 * src/support/lyxstring.h: changed const reference & to value_type
9181 const & lets see if that helps.
9183 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9185 * Makefile.am (rpmdist): fixed to have non static package and
9188 * src/support/lyxstring.C: removed the compilation guards
9190 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
9193 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
9194 conditional compile of lyxstring.Ch
9196 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
9197 stupid check, but it is a lot better than the bastring hack.
9198 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
9200 * several files: changed string::erase into string::clear. Not
9203 * src/chset.C (encodeString): use a char temporary instead
9205 * src/table.C (TexEndOfCell): added tostr around
9206 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
9207 (TexEndOfCell): ditto
9208 (TexEndOfCell): ditto
9209 (TexEndOfCell): ditto
9210 (DocBookEndOfCell): ditto
9211 (DocBookEndOfCell): ditto
9212 (DocBookEndOfCell): ditto
9213 (DocBookEndOfCell): ditto
9215 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
9217 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
9219 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
9220 (MenuBuildProg): added tostr around ret
9221 (MenuRunChktex): added tostr around ret
9222 (DocumentApplyCB): added tostr around ret
9224 * src/chset.C (encodeString): added tostr around t->ic
9226 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
9227 (makeLaTeXFile): added tostr around tocdepth
9228 (makeLaTeXFile): added tostr around ftcound - 1
9230 * src/insets/insetbib.C (setCounter): added tostr around counter.
9232 * src/support/lyxstring.h: added an operator+=(int) to catch more
9235 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
9236 (lyxstring): We DON'T allow NULL pointers.
9238 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9240 * src/mathed/math_macro.C (MathMacroArgument::Write,
9241 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
9242 when writing them out.
9244 * src/LString.C: remove, since it is not used anymore.
9246 * src/support/lyxstring.C: condition the content to
9247 USE_INCLUDED_STRING macro.
9249 * src/mathed/math_symbols.C, src/support/lstrings.C,
9250 src/support/lyxstring.C: add `using' directive to specify what
9251 we need in <algorithm>. I do not think that we need to
9252 conditionalize this, but any thought is appreciated.
9254 * many files: change all callback functions to "C" linkage
9255 functions to please strict C++ compilers like DEC cxx 6.1 in mode
9256 strict_ansi. Those who were static are now global.
9257 The case of callbacks which are static class members is
9258 trickier, since we have to make C wrappers around them (see
9259 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
9260 did not finish this yet, since it defeats the purpose of
9261 encapsulation, and I am not sure what the best route is.
9263 1999-10-19 Juergen Vigna <jug@sad.it>
9265 * src/support/lyxstring.C (lyxstring): we permit to have a null
9266 pointer as assignment value and just don't assign it.
9268 * src/vspace.C (nextToken): corrected this function substituting
9269 find_first(_not)_of with find_last_of.
9271 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
9272 (TableOptCloseCB) (TableSpeCloseCB):
9273 inserted fl_set_focus call for problem with fl_hide_form() in
9276 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9278 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
9281 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9283 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
9284 LyXLex::next() and not eatline() to get its argument.
9286 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9288 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
9289 instead, use fstreams for io of the depfile, removed unneeded
9290 functions and variables.
9292 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
9293 vector instead, removed all functions and variables that is not in
9296 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9298 * src/buffer.C (insertErrors): use new interface to TeXError
9300 * Makefile.am (rpmdist): added a rpmdist target
9302 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
9303 per Kayvan's instructions.
9305 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9307 * src/Makefile.am: add a definition for localedir, so that locales
9308 are found after installation (Kayvan)
9310 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9312 * development/.cvsignore: new file.
9314 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9316 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
9317 C++ compiler provides wrappers for C headers and use our alternate
9320 * configure.in: use LYX_CXX_CHEADERS.
9322 * src/cheader/: new directory, populated with cname headers from
9323 libstdc++-2.8.1. They are a bit old, but probably good enough for
9324 what we want (support compilers who lack them).
9326 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
9327 from includes. It turns out is was stupid.
9329 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9331 * lib/Makefile.am (install-data-local): forgot a ';'
9332 (install-data-local): forgot a '\'
9333 (libinstalldirs): needed after all. reintroduced.
9335 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9337 * configure.in (AC_OUTPUT): added lyx.spec
9339 * development/lyx.spec: removed file
9341 * development/lyx.spec.in: new file
9343 * po/*.po: merged with lyx.pot becuase of make distcheck
9345 * lib/Makefile.am (dist-hook): added dist-hook so that
9346 documentation files will be included when doing a make
9347 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
9348 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
9350 more: tried to make install do the right thing, exclude CVS dirs
9353 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
9354 Path would fit in more nicely.
9356 * all files that used to use pathstack: uses now Path instead.
9357 This change was a lot easier than expected.
9359 * src/support/path.h: new file
9361 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
9363 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
9365 * src/support/lyxstring.C (getline): Default arg was given for
9368 * Configure.cmd: removed file
9370 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9372 * src/support/DebugStream.[Ch]: remove the explicit std:: before
9373 streams classes and types, add the proper 'using' statements when
9374 MODERN_STL is defined.
9376 * src/debug.h: move the << operator definition after the inclusion
9379 * src/support/filetools.C: include "LAssert.h", which is needed
9382 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
9385 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
9386 include "debug.h" to define a proper ostream.
9388 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9390 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
9391 method to the SystemCall class which can kill a process, but it's
9392 not fully implemented yet.
9394 * src/*.C: Changed Systemcalls::Startscript() to startscript()
9396 * src/support/FileInfo.h: Better documentation
9398 * src/lyxfunc.C: Added support for buffer-export html
9400 * src/menus.C: Added Export->As HTML...
9402 * lib/bind/*.bind: Added short-cut for buffer-export html
9404 * src/lyxrc.*: Added support for new \tth_command
9406 * lib/lyxrc.example: Added stuff for new \tth_command
9408 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9410 * lib/Makefile.am (IMAGES): removed images/README
9411 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
9412 installes in correct place. Check permisions is installed
9415 * src/LaTeX.C: some no-op changes moved declaration of some
9418 * src/LaTeX.h (LATEX_H): changed include guard name
9420 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9422 * lib/reLyX/Makefile.am: install noweb2lyx.
9424 * lib/Makefile.am: install configure.
9426 * lib/reLyX/configure.in: declare a config aux dir; set package
9427 name to lyx (not sure what the best solution is); generate noweb2lyx.
9429 * lib/layouts/egs.layout: fix the bibliography layout.
9431 1999-10-08 Jürgen Vigna <jug@sad.it>
9433 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
9434 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
9435 it returned without continuing to search the path.
9437 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9439 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
9440 also fixes a bug. It is not allowed to do tricks with std::strings
9441 like: string a("hei"); &a[e]; this will not give what you
9442 think... Any reason for the complexity in this func?
9444 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
9446 * Updated README and INSTALL a bit, mostly to check that my
9447 CVS rights are correctly set up.
9449 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9451 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
9452 does not allow '\0' chars but lyxstring and std::string does.
9454 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9456 * autogen.sh (AUTOCONF): let the autogen script create the
9457 POTFILES.in file too. POTFILES.in should perhaps now not be
9458 included in the cvs module.
9460 * some more files changed to use C++ includes instead of C ones.
9462 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
9464 (Reread): added tostr to nlink. buggy output otherwise.
9465 (Reread): added a string() around szMode when assigning to Buffer,
9466 without this I got a log of garbled info strings.
9468 * acconfig.h: commented out the PTR_AS_INT macros. They should not
9471 * I have added several ostream & operator<<(ostream &, some_type)
9472 functions. This has been done to avoid casting and warnings when
9473 outputting enums to lyxerr. This as thus eliminated a lot of
9474 explicit casts and has made the code clearer. Among the enums
9475 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
9476 mathed enums, some font enum the Debug::type enum.
9478 * src/support/lyxstring.h (clear): missing method. equivalent of
9481 * all files that contained "stderr": rewrote constructs that used
9482 stderr to use lyxerr instead. (except bmtable)
9484 * src/support/DebugStream.h (level): and the passed t with
9485 Debug::ANY to avoid spurious bits set.
9487 * src/debug.h (Debug::type value): made it accept strings of the
9490 * configure.in (Check for programs): Added a check for kpsewhich,
9491 the latex generation will use this later to better the dicovery of
9494 * src/BufferView.C (create_view): we don't need to cast this to
9495 (void*) that is done automatically.
9496 (WorkAreaButtonPress): removed some dead code.
9498 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9500 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
9501 is not overwritten when translated (David Sua'rez de Lis).
9503 * lib/CREDITS: Added David Sua'rez de Lis
9505 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
9507 * src/bufferparams.C (BufferParams): default input encoding is now
9510 * acinclude.m4 (cross_compiling): comment out macro
9511 LYX_GXX_STRENGTH_REDUCE.
9513 * acconfig.h: make sure that const is not defined (to empty) when
9514 we are compiling C++. Remove commented out code using SIZEOF_xx
9517 * configure.in : move the test for const and inline as late as
9518 possible so that these C tests do not interefere with C++ ones.
9519 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
9520 has not been proven.
9522 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9524 * src/table.C (getDocBookAlign): remove bad default value for
9527 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
9529 (ShowFileMenu2): ditto.
9531 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
9534 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9536 * Most files: finished the change from the old error code to use
9537 DebugStream for all lyxerr debugging. Only minor changes remain
9538 (e.g. the setting of debug levels using strings instead of number)
9540 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9542 * src/layout.C (Add): Changed to use compare_no_case instead of
9545 * src/FontInfo.C: changed loop variable type too string::size_type.
9547 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9549 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
9550 set ETAGS_ARGS to --c++
9552 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
9554 * src/table.C (DocBookEndOfCell): commented out two unused variables
9556 * src/paragraph.C: commented out four unused variables.
9558 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
9559 insed a if clause with type string::size_type.
9561 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
9564 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
9566 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
9567 variable, also changed loop to go from 0 to lenght + 1, instead of
9568 -1 to length. This should be correct.
9570 * src/LaTeX.C (scanError): use string::size_type as loop variable
9573 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
9574 (l.896) since y_tmp and row was not used anyway.
9576 * src/insets/insetref.C (escape): use string::size_type as loop
9579 * src/insets/insetquotes.C (Width): use string::size_type as loop
9581 (Draw): use string::size_type as loop variable type.
9583 * src/insets/insetlatexaccent.C (checkContents): use
9584 string::size_type as loop variable type.
9586 * src/insets/insetlabel.C (escape): use string::size_type as loop
9589 * src/insets/insetinfo.C: added an extern for current_view.
9591 * src/insets/insetcommand.C (scanCommand): use string::size_type
9592 as loop variable type.
9594 * most files: removed the RCS tags. With them we had to recompile
9595 a lot of files after a simple cvs commit. Also we have never used
9596 them for anything meaningful.
9598 * most files: tags-query-replace NULL 0. As adviced several plases
9599 we now use "0" instead of "NULL" in our code.
9601 * src/support/filetools.C (SpaceLess): use string::size_type as
9604 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9606 * src/paragraph.C: fixed up some more string stuff.
9608 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9610 * src/support/filetools.h: make modestr a std::string.
9612 * src/filetools.C (GetEnv): made ch really const.
9614 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
9615 made code that used these use max/min from <algorithm> instead.
9617 * changed several c library include files to their equivalent c++
9618 library include files. All is not changed yet.
9620 * created a support subdir in src, put lyxstring and lstrings
9621 there + the extra files atexit, fileblock, strerror. Created
9622 Makefile.am. edited configure.in and src/Makefile.am to use this
9623 new subdir. More files moved to support.
9625 * imported som of the functions from repository lyx, filetools
9627 * ran tags-query-replace on LString -> string, corrected the bogus
9628 cases. Tried to make use of lstrings.[hC], debugged a lot. There
9629 is still some errors in there. This is errors where too much or
9630 too litle get deleted from strings (string::erase, string::substr,
9631 string::replace), there can also be some off by one errors, or
9632 just plain wrong use of functions from lstrings. Viewing of quotes
9635 * LyX is now running fairly well with string, but there are
9636 certainly some bugs yet (see above) also string is quite different
9637 from LString among others in that it does not allow null pointers
9638 passed in and will abort if it gets any.
9640 * Added the revtex4 files I forgot when setting up the repository.
9642 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9644 * All over: Tried to clean everything up so that only the files
9645 that we really need are included in the cvs repository.
9646 * Switched to use automake.
9647 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
9648 * Install has not been checked.
9650 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9652 * po/pt.po: Three errors:
9653 l.533 and l.538 format specification error
9654 l. 402 duplicate entry, I just deleted it.