1 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
7 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9 * src/tabular.C (Ascii): minimize scope of cell.
11 * src/BufferView2.C (nextWord): return string() instead of 0;
13 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
15 * src/converter.h: add a std:: qualifier
17 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
19 * src/importer.[Ch]: New files. Used for importing files into LyX.
21 * src/lyxfunc.C (doImport): Use the new Importer class.
23 * src/converter.h: Add shortcut member to the Format class.
24 Used for holding the menu shortcut.
26 * src/converter.C and other files: Made a distinction between
27 format name and format extension. New formats can be defined using
28 the \format lyxrc tag.
29 Added two new converter flags: latex and disable.
31 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
33 * src/support/lyxlib.h: unify namespace/struct implementation.
34 Remove extra declarations.
36 * src/support/chdir.C (chdir): remove version taking char const *
38 * src/support/rename.C: ditto.
39 * src/support/lyxsum.C: ditto.
41 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
43 * src/frontends/xforms/FormBase.[Ch]:
44 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
45 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
46 work only for the next call to fl_show_form(). The correct place to set
47 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
48 done. FormBase also stores minw_, minh_ itself. All dialogs derived
49 from FormBase have the minimum size set; no more stupid crashes with
52 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
54 * lib/ui/default.ui: fix shortcut for Insert->Include File.
56 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
58 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
60 * src/support/lyxlib.h: changed second argument of mkdir to
61 unsigned long int (unsigned int would probably have been enough,
62 but...). Removed <sys/types.h> header.
63 * src/support/mkdir.C (mkdir): ditto.
67 2000-10-19 Juergen Vigna <jug@sad.it>
69 * src/lyxfunc.C (MenuNew): small fix (form John)
71 * src/screen.C (Update): removed unneeded code.
73 * src/tabular.C (Ascii): refixed int != uint bug!
75 * src/support/lyxlib.h: added sys/types.h include for now permits
76 compiling, but I don't like this!
78 2000-10-18 Juergen Vigna <jug@sad.it>
80 * src/text2.C (ClearSelection): if we clear the selection we need
81 more refresh so set the status apropriately
83 * src/insets/insettext.C (draw): hopefully finally fixed draw
86 2000-10-12 Juergen Vigna <jug@sad.it>
88 * src/insets/insettext.C (draw): another small fix and make a block
89 so that variables are localized.
91 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
93 * src/support/lstrings.C (lowercase, uppercase):
94 use explicit casts to remove compiler warnings.
96 * src/support/LRegex.C (Impl):
97 * src/support/StrPool.C (add):
98 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
99 (AddPath, MakeDisplayPath):
100 * src/support/lstrings.C (prefixIs, subst):
101 use correct type to remove compiler warnings.
103 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
105 * src/support/lyxlib.h:
106 * src/support/mkdir.C (mkdir): change parameter to mode_t for
107 portability and to remove compiler warning with DEC cxx.
109 * src/support/FileInfo.[Ch] (flagRWX): ditto.
111 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
113 * src/minibuffer.C (peek_event): retun 1 when there has been a
114 mouseclick in the minibuffer.
118 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
120 * src/frontends/xforms/FormParagraph.C: more space above/below
123 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
125 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
126 a char only if real_current_font was changed.
128 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
130 * NEWS: update somewhat for 1.1.6
132 * lib/ui/default.ui: clean up.
134 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
136 * lib/CREDITS: clean up
138 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
140 * src/combox.[Ch] (select): changed argument back to int
141 * src/combox.C (peek_event): removed num_bytes as it is declared but
144 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
145 modified calls to Combox::select() to remove warnings about type
148 * src/insets/insetbutton.C (width): explicit cast to remove warning
149 about type conversion.
151 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
154 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
155 sel_pos_end, refering to cursor position are changed to
156 LyXParagraph::size_type.
158 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
159 consistent with LyXCursor::pos().
160 (inset_pos): changed to LyXParagraph::size_type for same reason.
162 * src/insets/insettext.C (resizeLyXText): changed some temporary
163 variables refing to cursor position to LyXParagraph::size_type.
165 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
167 * src/frontends/kde/<various>: The Great Renaming,
170 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
172 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
174 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
176 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
177 0 when there are no arguments.
179 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
181 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
182 to segfaults when pressing Ok in InsetBibtex dialog.
184 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
186 * forms/layout_forms.fd:
187 * src/layout_forms.C (create_form_form_character): small change to use
188 labelframe rather than engraved frame + text
190 * src/lyx_gui.C (create_forms): initialise choice_language with some
191 arbitrary value to prevent segfault when dialog is shown.
193 2000-10-16 Baruch Even <baruch.even@writeme.com>
195 * src/converter.C (runLaTeX, scanLog): Added a warning when there
196 is no resulting file. This pertains only to LaTeX output.
198 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
200 * src/text.C (Backspace): Make sure that the row of the cursor is
203 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
206 * src/lyx_gui.C (init): Prevent a crash when only one font from
207 menu/popup fonts is not found.
209 * lib/lyxrc.example: Add an example for binding a key for language
212 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
214 * src/converter.C (GetReachable): Changed the returned type to
216 (IsReachable): New method
218 * src/MenuBackend.C (expand): Handle formats that appear more
221 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
223 * src/frontends/support/Makefile.am
224 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
227 * lib/CREDITS: add Garst Reese.
229 * src/support/snprintf.h: add extern "C" {} around the definitions.
231 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
233 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
236 * src/frontends/xforms/FormDocument.C:
237 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
238 compile without "conversion to integral type of smaller size"
241 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
243 * src/text.C (GetColumnNearX): Fixed disabled code.
245 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
247 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
250 * src/support/snprintf.[ch]: new files
252 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
254 * src/frontends/kde/formprintdialog.C: add
255 file browser for selecting postscript output
257 * src/frontends/kde/formprintdialogdata.C:
258 * src/frontends/kde/formprintdialogdata.h: re-generate
261 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
263 * src/frontends/gnome/Makefile.am:
264 * src/frontends/kde/Makefile.am: FormCommand.C
265 disappeared from xforms
267 * src/frontends/kde/FormCitation.C:
268 * src/frontends/kde/FormIndex.C: read-only
271 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
273 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
276 * src/bufferlist.C: add using directive.
278 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
280 * src/support/lyxfunctional.h: version of class_fun for void
281 returns added, const versions of back_inseter_fun and compare_fun
284 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
286 * src/frontends/xforms/FormInset.C (showInset): fix typo.
288 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
290 * ChangeLog: cleanup.
292 * lib/CREDITS: update to add all the contributors we've forgotten.
293 I have obviously missed some, so tell me whether there were
296 2000-10-13 Marko Vendelin <markov@ioc.ee>
298 * src/frontends/gnome/FormCitation.C
299 * src/frontends/gnome/FormCitation.h
300 * src/frontends/gnome/FormError.C
301 * src/frontends/gnome/FormIndex.C
302 * src/frontends/gnome/FormRef.C
303 * src/frontends/gnome/FormRef.h
304 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
306 * src/frontends/gnome/FormCitation.C
307 * src/frontends/gnome/FormCopyright.C
308 * src/frontends/gnome/FormError.C
309 * src/frontends/gnome/FormIndex.C
310 * src/frontends/gnome/FormRef.C
311 * src/frontends/gnome/FormToc.C
312 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
315 * src/frontends/gnome/Menubar_pimpl.C
316 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
319 2000-10-11 Baruch Even <baruch.even@writeme.com>
322 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
323 to convey its real action.
325 * src/minibuffer.C (peek_event): Added action when mouse clicks to
326 clear the minibuffer and prepare to enter a command.
328 * src/mathed/formula.C (LocalDispatch): Changed to conform with
329 the rename from ExecCommand to PrepareForCommand.
330 * src/lyxfunc.C (Dispatch): ditto.
332 2000-10-11 Baruch Even <baruch.even@writeme.com>
334 * src/buffer.C (writeFile): Added test for errors on writing, this
335 catches all errors and not only file system full errors as intended.
337 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
339 * src/lyx_gui.C (create_forms): better fix for crash with
340 translated interface.
342 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
344 * src/frontends/kde/Makefile.am:
345 * src/frontends/kde/FormCopyright.C:
346 * src/frontends/kde/formcopyrightdialog.C:
347 * src/frontends/kde/formcopyrightdialog.h:
348 * src/frontends/kde/formcopyrightdialogdata.C:
349 * src/frontends/kde/formcopyrightdialogdata.h:
350 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
351 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
352 copyright to use qtarch
354 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
356 * src/encoding.C (read): Fixed bug that caused an error message at
359 * po/Makefile.in.in: Fixed rule for ext_l10n.h
361 * lib/lyxrc.example: Fixed hebrew example.
363 2000-10-13 Allan Rae <rae@lyx.org>
365 * src/frontends/xforms/FormPreferences.C (input): reworking the
367 (build, update, apply): New inputs in various tabfolders
369 * src/frontends/xforms/FormToc.C: use new button policy.
370 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
371 dialogs that either can't use any existing policy or where it just
374 * src/frontends/xforms/FormTabular.h: removed copyright notice that
377 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
378 added a bool parameter which is ignored.
380 * src/buffer.C (setReadonly):
381 * src/BufferView_pimpl.C (buffer):
382 * src/frontends/kde/FormCopyright.h (update):
383 * src/frontends/kde/FormCitation.[Ch] (update):
384 * src/frontends/kde/FormIndex.[Ch] (update):
385 * src/frontends/kde/FormPrint.[Ch] (update):
386 * src/frontends/kde/FormRef.[Ch] (update):
387 * src/frontends/kde/FormToc.[Ch] (update):
388 * src/frontends/kde/FormUrl.[Ch] (update):
389 * src/frontends/gnome/FormCopyright.h (update):
390 * src/frontends/gnome/FormCitation.[Ch] (update):
391 * src/frontends/gnome/FormError.[Ch] (update):
392 * src/frontends/gnome/FormIndex.[Ch] (update):
393 * src/frontends/gnome/FormPrint.[Ch] (update):
394 * src/frontends/gnome/FormRef.h (update):
395 * src/frontends/gnome/FormToc.[Ch] (update):
396 * src/frontends/gnome/FormUrl.[Ch] (update):
397 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
398 to updateBufferDependent and DialogBase
400 * src/frontends/xforms/FormCitation.[hC]:
401 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
402 * src/frontends/xforms/FormError.[Ch]:
403 * src/frontends/xforms/FormGraphics.[Ch]:
404 * src/frontends/xforms/FormIndex.[Ch]:
405 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
406 and fixed readOnly handling.
407 * src/frontends/xforms/FormPrint.[Ch]:
408 * src/frontends/xforms/FormRef.[Ch]:
409 * src/frontends/xforms/FormTabular.[Ch]:
410 * src/frontends/xforms/FormToc.[Ch]:
411 * src/frontends/xforms/FormUrl.[Ch]:
412 * src/frontends/xforms/FormInset.[Ch]:
413 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
414 form of updateBufferDependent.
416 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
417 if form()->visible just in case someone does stuff to the form in a
420 * src/frontends/DialogBase.h (enum): removed enum since we can now use
421 the buttoncontroller for everything the enum used to be used for.
422 (update) It would seem we need to force all dialogs to use a bool
423 parameter or have two update functions. I chose to go with one.
424 I did try removing update() from here and FormBase and defining the
425 appropriate update signatures in FormBaseB[DI] but then ran into the
426 problem of the update() call in FormBase::show(). Whatever I did
427 to get around that would require another function and that just
428 got more confusing. Hence the decision to make everyone have an
429 update(bool). An alternative might have been to override show() in
430 FormBaseB[DI] and that would allow the different and appropriate
433 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
434 true == buffer change occurred. I decided against using a default
435 template parameter since not all compilers support that at present.
437 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
439 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
440 army knife" by removing functionality.
441 (clearStore): removed. All such housekeeping on hide()ing the dialog
442 is to be carried out by overloaded disconnect() methods.
443 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
444 superceded by Baruch's neat test (FormGraphics) to update an existing
445 dialog if a new signal is recieved rather than block all new signals
447 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
448 only to Inset dialogs.
449 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
450 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
452 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
454 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
455 as a base class to all inset dialogs. Used solely to connect/disconnect
456 the Inset::hide signal and to define what action to take on receipt of
457 a UpdateBufferDependent signal.
458 (FormCommand): now derived from FormInset.
460 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
463 * src/frontends/xforms/FormCopyright.[Ch]:
464 * src/frontends/xforms/FormPreferences.[Ch]:
465 now derived from FormBaseBI.
467 * src/frontends/xforms/FormDocument.[Ch]:
468 * src/frontends/xforms/FormParagraph.[Ch]:
469 * src/frontends/xforms/FormPrint.[Ch]:
470 now derived from FormBaseBD.
472 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
474 * src/frontends/xforms/FormCitation.[Ch]:
475 * src/frontends/xforms/FormError.[Ch]:
476 * src/frontends/xforms/FormRef.[Ch]:
477 * src/frontends/xforms/FormToc.[Ch]:
478 (clearStore): reworked as disconnect().
480 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
483 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
485 * src/converter.C (runLaTeX): constify buffer argument
488 * src/frontends/support/Makefile.am (INCLUDES): fix.
490 * src/buffer.h: add std:: qualifier
491 * src/insets/figinset.C (addpidwait): ditto
492 * src/MenuBackend.C: ditto
493 * src/buffer.C: ditto
494 * src/bufferlist.C: ditto
495 * src/layout.C: ditto
496 * src/lyxfunc.C: ditto
498 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
500 * src/lyxtext.h (bidi_level): change return type to
501 LyXParagraph::size_type.
503 * src/lyxparagraph.h: change size_type to
504 TextContainer::difference_type. This should really be
505 TextContainer::size_type, but we need currently to support signed
508 2000-10-11 Marko Vendelin <markov@ioc.ee>
509 * src/frontends/gnome/FormError.h
510 * src/frontends/gnome/FormRef.C
511 * src/frontends/gnome/FormRef.h
512 * src/frontends/gnome/FormError.C
513 * src/frontends/gnome/Makefile.am
514 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
515 to Gnome frontend. Both dialogs use "action" area.
517 2000-10-12 Baruch Even <baruch.even@writeme.com>
519 * src/graphics/GraphicsCacheItem_pimpl.C:
520 * src/graphics/Renderer.C:
521 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
524 2000-10-12 Juergen Vigna <jug@sad.it>
526 * src/insets/insettext.C (draw): fixed drawing bug (specifically
527 visible when selecting).
529 * development/Code_rules/Rules: fixed some typos.
531 2000-10-09 Baruch Even <baruch.even@writeme.com>
533 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
534 compiling on egcs 1.1.2 possible.
536 * src/filedlg.C (comp_direntry::operator() ): ditto.
538 2000-08-31 Baruch Even <baruch.even@writeme.com>
540 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
543 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
544 transient it now only gets freed when the object is destructed.
546 2000-08-24 Baruch Even <baruch.even@writeme.com>
548 * src/frontends/FormGraphics.h:
549 * src/frontends/FormGraphics.C: Changed to use ButtonController and
552 2000-08-20 Baruch Even <baruch.even@writeme.com>
554 * src/insets/insetgraphics.C:
555 (draw): Added messages to the drawn rectangle to report status.
556 (updateInset): Disabled the use of the inline graphics,
559 2000-08-17 Baruch Even <baruch.even@writeme.com>
561 * src/frontends/support: Directory added for the support of GUII LyX.
563 * src/frontends/support/LyXImage.h:
564 * src/frontends/support/LyXImage.C: Base class for GUII holding of
567 * src/frontends/support/LyXImage_X.h:
568 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
569 version of LyXImage, this uses the Xlib Pixmap.
574 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
575 replacement to Pixmap.
577 * src/insets/insetgraphics.h:
578 * src/insets/insetgraphics.C:
579 * src/graphics/GraphicsCacheItem.h:
580 * src/graphics/GraphicsCacheItem.C:
581 * src/graphics/GraphicsCacheItem_pimpl.h:
582 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
585 * src/graphics/GraphicsCacheItem.h:
586 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
587 another copy of the object.
589 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
590 of cacheHandle, this fixed a bug that sent LyX crashing.
592 * src/graphics/XPM_Renderer.h:
593 * src/graphics/XPM_Renderer.C:
594 * src/graphics/EPS_Renderer.h:
595 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
597 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
599 * src/lyxfunc.C (processKeySym): only handle the
600 lockinginset/inset stuff if we have a buffer and text loaded...
602 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
604 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
606 * src/support/lyxfunctional.h: add operator= that takes a reference
608 * src/lyxserver.C (mkfifo): make first arg const
610 * src/layout.h: renamed name(...) to setName(...) to work around
613 * src/buffer.C (setFileName): had to change name of function to
614 work around bugs in egcs. (renamed from fileName)
616 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
618 * src/support/translator.h: move helper template classes to
619 lyxfunctional.h, include "support/lyxfunctional.h"
621 * src/support/lyxmanip.h: add delaration of fmt
623 * src/support/lyxfunctional.h: new file
624 (class_fun_t): new template class
625 (class_fun): helper template function
626 (back_insert_fun_iterator): new template class
627 (back_inserter_fun): helper template function
628 (compare_memfun_t): new template class
629 (compare_memfun): helper template function
630 (equal_1st_in_pair): moved here from translator
631 (equal_2nd_in_pair): moved here from translator
633 * src/support/fmt.C: new file
634 (fmt): new func, can be used for a printf substitute when still
635 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
637 * src/support/StrPool.C: add some comments
639 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
642 * src/insets/figinset.C (addpidwait): use std::copy with
643 ostream_iterator to fill the pidwaitlist
645 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
647 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
650 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
653 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
655 * src/frontends/xforms/FormDocument.C (build): remove c_str()
656 (class_update): ditto
658 (CheckChoiceClass): move initialization of tc and tct
660 * src/tabular.C: remove current_view
661 (OldFormatRead): similar to right below [istream::ignore]
663 * src/lyxlex_pimpl.C (next): add code for faster skipping of
664 chars, unfortunately this is buggy on gcc 2.95.2, so currently
665 unused [istream::ignore]
667 * src/lyxfunc.C: include "support/lyxfunctional.h"
668 (getInsetByCode): use std::find_if and compare_memfun
670 * src/lyxfont.C (stateText): remove c_str()
672 * src/lyx_main.C (setDebuggingLevel): make static
673 (commandLineHelp): make static
675 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
676 Screen* together with fl_get_display() and fl_screen
678 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
679 togheter with fl_get_display() and fl_screen
680 (create_forms): remove c_str()
682 * src/layout.C: include "support/lyxfunctional.h"
683 (hasLayout): use std::find_if and compare_memfun
684 (GetLayout): use std::find_if and comapre_memfun
685 (delete_layout): use std::remove_if and compare_memfun
686 (NumberOfClass): use std:.find_if and compare_memfun
688 * src/gettext.h: change for the new functions
690 * src/gettext.C: new file, make _(char const * str) and _(string
691 const & str) real functions.
693 * src/font.C (width): rewrite slightly to avoid one extra variable
695 * src/debug.C: initialize Debug::ANY here
697 * src/commandtags.h: update number comments
699 * src/combox.h (get): make const func
701 (getline): make const
703 * src/combox.C (input_cb): handle case where fl_get_input can
706 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
707 "support/lyxfunctional.h", remove current_view variable.
708 (resize): use std::for_each with std::mem_fun
709 (getFileNames): use std::copy with back_inserter_fun
710 (getBuffer): change arg type to unsigned int
711 (emergencyWriteAll): call emergencyWrite with std::for_each and
713 (emergencyWrite): new method, the for loop in emergencyWriteAll
715 (exists): use std::find_if with compare_memfun
716 (getBuffer): use std::find_if and compare_memfun
718 * src/buffer.h: add typedefs for iterator_category, value_type
719 difference_type, pointer and reference for inset_iterator
720 add postfix ++ for inset_iterator
721 make inset_iterator::getPos() const
723 * src/buffer.C: added support/lyxmanip.h
724 (readFile): use lyxerr << fmt instead of printf
725 (makeLaTeXFile): use std::copy to write out encodings
727 * src/Painter.C (text): rewrite slightly to avoid extra font variable
729 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
730 free and the char * temp.
731 (hasMenu): use std::find_if and compare_memfun
734 * src/Makefile.am (lyx_SOURCES): added gettext.C
736 * src/LyXAction.C (retrieveActionArg): clear the arg, use
737 string::insert small change to avoid temporary
739 * src/LColor.C (getGUIName): remove c_str()
741 * several files: change all occurrences of fl_display to
744 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
745 that -pedantic is not used for gcc 2.97 (cvs gcc)
747 * boost/Makefile.am: begin slowly to prepare for a real boost lib
749 2000-10-11 Allan Rae <rae@lyx.org>
751 * src/frontends/xforms/FormPreferences.C (input): template path must be
752 a readable directory. It doesn't need to be writeable.
753 (build, delete, update, apply): New inputs in the various tabfolders
755 * src/frontends/xforms/forms/form_preferences.fd:
756 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
757 several new entries to existing folders. Shuffled some existing stuff
760 * src/frontends/xforms/forms/form_print.fd:
761 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
762 Should probably rework PrinterParams as well. Note that the switch to
763 collated is effectively the same as !unsorted so changing PrinterParams
764 will require a lot of fiddly changes to reverse the existing logic.
766 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
768 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
770 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
772 2000-10-10 Allan Rae <rae@lyx.org>
775 * src/lyxfunc.C (Dispatch):
777 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
780 * src/lyxrc.C (output): Only write the differences between system lyxrc
781 and the users settings.
784 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
786 I'll rewrite this later, after 1.1.6 probably, to keep a single
787 LyXRC but two instances of a LyXRCStruct.
789 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
791 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
793 * src/tabular.h: add a few std:: qualifiers.
795 * src/encoding.C: add using directive.
796 * src/language.C: ditto.
798 * src/insets/insetquotes.C (Validate): use languages->lang()
799 instead of only language.
801 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
803 * lib/languages: New file.
805 * lib/encodings: New file.
807 * src/language.C (Languages): New class.
808 (read): New method. Reads the languages from the 'languages' file.
810 * src/encoding.C (Encodings): New class.
811 (read): New method. Reads the encodings from the 'encodings' file.
813 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
816 * src/bufferparams.h and a lot of files: Deleted the member language,
817 and renamed language_info to language
819 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
820 * src/lyxfont.C (latexWriteStartChanges): ditto.
821 * src/paragraph.C (validate,TeXOnePar): ditto.
823 * src/lyxfont.C (update): Restored deleted code.
825 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
827 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
829 * src/BufferView_pimpl.C (buffer): cleaned up a little.
831 * src/insets/figinset.[Ch]:
832 * src/insets/insetinclude.[Ch]:
833 * src/insets/insetinclude.[Ch]:
834 * src/insets/insetparent.[Ch]:
835 * src/insets/insetref.[Ch]:
836 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
839 * src/mathed/formula.[Ch]:
840 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
842 * src/buffer.C (parseSingleLyXformat2Token, readInset):
843 * src/lyx_cb.C (FigureApplyCB):
844 * src/lyxfunc.C (getStatus, Dispatch):
845 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
848 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
850 * src/converter.[Ch] (Formats::View):
851 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
853 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
854 *current_view->buffer(). This will change later, but this patch is way
857 2000-10-09 Juergen Vigna <jug@sad.it>
859 * src/text.C (GetRow): small fix.
861 * src/BufferView_pimpl.C (cursorPrevious):
862 (cursorNext): added LyXText parameter to function.
864 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
865 keypress depending on cursor position.
867 2000-10-06 Juergen Vigna <jug@sad.it>
869 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
870 (copySelection): redone this function and also copy ascii representa-
873 * src/tabular.C (Ascii):
877 (print_n_chars): new functions to realize the ascii export of tabulars.
879 2000-10-05 Juergen Vigna <jug@sad.it>
881 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
882 if we don't have a buffer.
884 2000-10-10 Allan Rae <rae@lyx.org>
886 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
887 with closing dialog. It seems that nested tabfolders require hiding
888 of inner tabfolders before hiding the dialog itself. Actually all I
889 did was hide the active outer folder.
891 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
892 unless there really is a buffer. hideBufferDependent is called
895 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
896 POTFILES.in stays in $(srcdir).
898 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
900 * lib/lyxrc.example: Few changes.
902 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
904 * src/BufferView_pimpl.C (buffer): only need one the
905 updateBufferDependent signal to be emitted once! Moved to the end of
906 the method to allow bv_->text to be updated first.
908 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
909 and hSignal_ with Dialogs * and BufferDependency variables.
910 New Buffer * parent_, initialised when the dialog is launched. Used to
911 check whether to update() or hide() dialog in the new, private
912 updateOrHide() method that is connected to the updateBufferDependent
913 signal. Daughter classes dictate what to do using the
914 ChangedBufferAction enum, passed to the c-tor.
916 * src/frontends/xforms/FormCitation.C:
917 * src/frontends/xforms/FormCommand.C:
918 * src/frontends/xforms/FormCopyright.C:
919 * src/frontends/xforms/FormDocument.C:
920 * src/frontends/xforms/FormError.C:
921 * src/frontends/xforms/FormIndex.C:
922 * src/frontends/xforms/FormPreferences.C:
923 * src/frontends/xforms/FormPrint.C:
924 * src/frontends/xforms/FormRef.C:
925 * src/frontends/xforms/FormToc.C:
926 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
929 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
930 ChangedBufferAction enum.
932 * src/frontends/xforms/FormParagraph.[Ch]
933 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
936 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
938 * lib/bind/cua.bind: fix a bit.
939 * lib/bind/emacs.bind: ditto.
941 * lib/bind/menus.bind: remove real menu entries from there.
943 * src/spellchecker.C: make sure we only include strings.h when
946 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
948 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
949 function. It enlarges the maximum number of pup when needed.
950 (add_toc2): Open a new menu if maximum number of items per menu has
953 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
955 * src/frontends/kde/FormPrint.C: fix error reporting
957 * src/frontends/xforms/FormDocument.C: fix compiler
960 * lib/.cvsignore: add Literate.nw
962 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
965 * bufferview_funcs.[Ch]
968 * text2.C: Add support for numbers in RTL text.
970 2000-10-06 Allan Rae <rae@lyx.org>
972 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
973 to be gettext.m4 friendly again. ext_l10n.h is now
974 generated into $top_srcdir instead of $top_builddir
975 so that lyx.pot will be built correctly -- without
976 duplicate parsing of ext_l10n.h.
978 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
980 * src/frontends/kde/FormCitation.C: make the dialog
983 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
985 * config/kde.m4: fix consecutive ./configure runs,
986 look for qtarch, fix library order
988 * src/frontends/kde/Makefile.am: tidy up,
989 add Print dialog, add .dlg dependencies
991 * src/frontends/kde/FormPrint.C:
992 * src/frontends/kde/FormPrint.h:
993 * src/frontends/kde/formprintdialog.C:
994 * src/frontends/kde/formprintdialog.h:
995 * src/frontends/kde/formprintdialogdata.C:
996 * src/frontends/kde/formprintdialogdata.h:
997 * src/frontends/kde/dlg/formprintdialog.dlg: add
1000 * src/frontends/kde/dlg/README: Added explanatory readme
1002 * src/frontends/kde/dlg/checkinitorder.pl: small perl
1003 script to double-check qtarch's output
1005 * src/frontends/kde/formindexdialog.C:
1006 * src/frontends/kde/formindexdialogdata.C:
1007 * src/frontends/kde/formindexdialogdata.h:
1008 * src/frontends/kde/dlg/formindexdialog.dlg: update
1009 for qtarch, minor fixes
1011 2000-10-05 Allan Rae <rae@lyx.org>
1013 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
1014 dialogs when switching buffers update them instead. It's up to each
1015 dialog to decide if it should still be visible or not.
1016 update() should return a bool to control visiblity within show().
1017 Or perhaps better to set a member variable and use that to control
1020 * lib/build-listerrors: create an empty "listerrors" file just to stop
1021 make trying to regenerate it all the time if you don't have noweb
1024 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
1026 * po/Makefile.in.in (ext_l10n.h): added a rule to build
1027 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
1028 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
1029 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
1030 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
1032 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
1034 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
1036 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
1037 deleting buffer. Closes all buffer-dependent dialogs.
1039 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
1041 * src/frontends/xforms/FormCitation.[Ch]:
1042 * src/frontends/xforms/FormPreferences.[Ch]:
1043 * src/frontends/xforms/FormPrint.[Ch]:
1044 * src/frontends/xforms/FormRef.[Ch]:
1045 * src/frontends/xforms/FormUrl.[Ch]: ditto
1047 * src/frontends/xforms/FormDocument.[Ch]:
1048 * src/frontends/xforms/forms/form_document.C.patch:
1049 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
1050 pass through a single input() function.
1052 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1054 * lib/build-listerrors: return status as OK
1056 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
1058 * lib/lyxrc.example: Updated to new export code
1060 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1062 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
1065 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
1068 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
1069 LyX-Code is defined.
1070 * lib/layouts/amsbook.layout: ditto.
1072 * boost/Makefile.am: fix typo.
1074 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
1076 (add_lastfiles): removed.
1077 (add_documents): removed.
1078 (add_formats): removed.
1080 * src/frontends/Menubar.C: remove useless "using" directive.
1082 * src/MenuBackend.h: add a new MenuItem constructor.
1084 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
1087 2000-10-04 Allan Rae <rae@lyx.org>
1089 * lib/Makefile.am (listerrors):
1090 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
1091 I haven't got notangle installed so Kayvan please test. The output
1092 should end up in $builddir. This also allows people who don't have
1093 noweb installed to complete the make process without error.
1095 * src/frontends/xforms/FormCommand.[Ch] (showInset):
1096 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
1097 by JMarc's picky compiler.
1099 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1102 * src/insets/insettabular.C (setPos): change for loop to not use
1103 sequencing operator. Please check this Jürgen.
1105 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
1107 * src/insets/insetcite.C (getScreenLabel): ditto
1108 * src/support/filetools.C (QuoteName): ditto
1109 (ChangeExtension): ditto
1111 * src/BufferView_pimpl.C (scrollCB): make heigt int
1113 * src/BufferView2.C (insertInset): comment out unused arg
1115 * boost/Makefile.am (EXTRADIST): new variable
1117 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1119 * src/exporter.C (IsExportable): Fixed
1121 * lib/configure.m4: Small fix
1123 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1125 * src/insets/insetbutton.C (width): Changed to work with no GUI.
1126 * src/insets/insetbib.C (bibitemWidest): ditto.
1127 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
1129 2000-10-03 Juergen Vigna <jug@sad.it>
1131 * src/BufferView2.C (theLockingInset): removed const because of
1132 Agnus's compile problems.
1134 * src/insets/insettext.C (LocalDispatch): set the language of the
1135 surronding paragraph on inserting the first character.
1137 * various files: changed use of BufferView::the_locking_inset.
1139 * src/BufferView2.C (theLockingInset):
1140 (theLockingInset): new functions.
1142 * src/BufferView.h: removed the_locking_inset.
1144 * src/lyxtext.h: added the_locking_inset
1146 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
1148 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
1150 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1152 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
1153 * src/mathed/math_cursor.C (IsAlpha): ditto.
1154 * src/mathed/math_inset.C (strnew): ditto.
1155 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
1156 (IMetrics): cxp set but never used; removed.
1157 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
1158 that the variable in question has been removed also!
1161 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
1162 using the Buffer * passed to Latex(), using the BufferView * passed to
1163 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
1165 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
1166 Linuxdoc() and DocBook() rather than the stored Buffer * master.
1168 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
1169 * src/buffer.C (readInset): used new InsetBibtex c-tor
1170 * (getBibkeyList): used new InsetBibtex::getKeys
1172 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1175 * lib/build-listerrors
1177 * src/exporter.C: Add literate programming support to the export code
1180 * src/lyx_cb.C: Remove old literate code.
1182 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
1185 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
1186 * src/converter.C (View, Convert): Use QuoteName.
1188 * src/insets/figinset.C (Preview): Use Formats::View.
1190 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
1192 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1194 * src/lyxfunc.C (Dispatch): move declaration of text variable at
1195 the top of the function, because compaq cxx complains that the
1196 "goto exit_with_message" when the function is disabled bypasses
1198 (MenuNew): try a better fix for the generation of new file names.
1199 This time, I used AddName() instead of AddPath(), hoping Juergen
1202 2000-10-03 Allan Rae <rae@lyx.org>
1204 * src/frontends/xforms/forms/form_preferences.fd:
1205 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
1206 nested tabfolders has begun. The old "Miscellaneous" was renamed as
1207 "Look and Feel"->"General" but will need to be split up further into
1208 general output and general input tabs. Current plan is for four outer
1209 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
1210 stuff; "Inputs" for input and import configuration; "Outputs" for
1211 output and export configuration; and one more whatever is left over
1212 called "General". The leftovers at present look like being which
1213 viewers to use, spellchecker, language support and might be better
1214 named "Support". I've put "Paths" in "Inputs" for the moment as this
1215 seems reasonable for now at least.
1216 One problem remains: X error kills LyX when you close Preferences.
1218 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1220 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
1221 qualifier from form()
1222 * src/frontends/xforms/FormCitation.[Ch]:
1223 * src/frontends/xforms/FormCopyright.[Ch]:
1224 * src/frontends/xforms/FormDocument.[Ch]:
1225 * src/frontends/xforms/FormError.[Ch]:
1226 * src/frontends/xforms/FormIndex.[Ch]:
1227 * src/frontends/xforms/FormPreferences.[Ch]:
1228 * src/frontends/xforms/FormPrint.[Ch]:
1229 * src/frontends/xforms/FormRef.[Ch]:
1230 * src/frontends/xforms/FormToc.[Ch]:
1231 * src/frontends/xforms/FormUrl.[Ch]: ditto.
1233 * src/frontends/xforms/FormCitation.[Ch]:
1234 * src/frontends/xforms/FormIndex.[Ch]:
1235 * src/frontends/xforms/FormRef.[Ch]:
1236 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
1237 with Allan's naming policy
1239 * src/frontends/xforms/FormCitation.C: some static casts to remove
1242 2000-10-02 Juergen Vigna <jug@sad.it>
1244 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
1245 now you can type or do stuff inside the table-cell also when in dummy
1246 position, fixed visible cursor.
1248 * src/insets/insettext.C (Edit): fixing cursor-view position.
1250 * src/lyxfunc.C (Dispatch): use * text variable so that it can
1251 be used for equal functions in lyxfunc and insettext.
1253 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
1255 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
1257 * src/frontends/gnome/FormCitation.h:
1258 * src/frontends/gnome/FormCopyright.h:
1259 * src/frontends/gnome/FormIndex.h:
1260 * src/frontends/gnome/FormPrint.h:
1261 * src/frontends/gnome/FormToc.h:
1262 * src/frontends/gnome/FormUrl.h:
1263 * src/frontends/kde/FormCitation.h:
1264 * src/frontends/kde/FormCopyright.h:
1265 * src/frontends/kde/FormIndex.h:
1266 * src/frontends/kde/FormRef.h:
1267 * src/frontends/kde/FormToc.h:
1268 * src/frontends/kde/FormUrl.h: fix remaining users of
1271 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1273 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
1274 from depth argument.
1275 (DocBookHandleCaption): ditto.
1276 (DocBookHandleFootnote): ditto.
1277 (SimpleDocBookOnePar): ditto.
1279 * src/frontends/xforms/FormDocument.h (form): remove extra
1280 FormDocument:: qualifier.
1282 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
1284 * sigc++/handle.h: ditto.
1286 * src/lyx_gui_misc.C: add "using" directive.
1288 * src/cheaders/cstddef: new file, needed by the boost library (for
1291 2000-10-02 Juergen Vigna <jug@sad.it>
1293 * src/insets/insettext.C (SetFont): better support.
1295 * src/insets/insettabular.C (draw): fixed drawing of single cell.
1297 * src/screen.C (DrawOneRow): some uint refixes!
1299 2000-10-02 Allan Rae <rae@lyx.org>
1301 * boost/.cvsignore: ignore Makefile as well
1303 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
1304 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
1306 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
1307 Left this one out by accident.
1309 * src/frontends/xforms/FormBase.h (restore): default to calling
1310 update() since that will restore the original/currently-applied values.
1311 Any input() triggered error messages will require the derived classes
1312 to redefine restore().
1314 * src/frontends/xforms/FormDocument.C: initialize a few variables to
1315 avoid a segfault. combo_doc_class is the main concern.
1317 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
1319 * Simplify build-listerrors in view of GUI-less export ability!
1321 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1323 * src/lyx_main.C (easyParse): Disable gui when exporting
1325 * src/insets/figinset.C:
1328 * src/lyx_gui_misc.C
1329 * src/tabular.C: Changes to allow no-gui.
1331 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1333 * src/support/utility.hpp: removed file
1334 * src/support/block.h: removed file
1336 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
1339 * src/mathed/formula.C: add support/lyxlib.h
1340 * src/mathed/formulamacro.C: ditto
1342 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
1343 * src/lyxparagraph.h: ditto
1345 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
1346 * src/frontends/Makefile.am (INCLUDES): ditto
1347 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
1348 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
1349 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
1350 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
1351 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
1352 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
1354 * src/BufferView.h: use boost/utility.hpp
1355 * src/LColor.h: ditto
1356 * src/LaTeX.h: ditto
1357 * src/LyXAction.h: ditto
1358 * src/LyXView.h: ditto
1359 * src/bufferlist.h: ditto
1360 * src/lastfiles.h: ditto
1361 * src/layout.h: ditto
1362 * src/lyx_gui.h: ditto
1363 * src/lyx_main.h: ditto
1364 * src/lyxlex.h: ditto
1365 * src/lyxrc.h: ditto
1366 * src/frontends/ButtonPolicies.h: ditto
1367 * src/frontends/Dialogs.h: ditto
1368 * src/frontends/xforms/FormBase.h: ditto
1369 * src/frontends/xforms/FormGraphics.h: ditto
1370 * src/frontends/xforms/FormParagraph.h: ditto
1371 * src/frontends/xforms/FormTabular.h: ditto
1372 * src/graphics/GraphicsCache.h: ditto
1373 * src/graphics/Renderer.h: ditto
1374 * src/insets/ExternalTemplate.h: ditto
1375 * src/insets/insetcommand.h: ditto
1376 * src/support/path.h: ditto
1378 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
1379 and introduce clause for 2.97.
1381 * boost/libs/README: new file
1383 * boost/boost/utility.hpp: new file
1385 * boost/boost/config.hpp: new file
1387 * boost/boost/array.hpp: new file
1389 * boost/Makefile.am: new file
1391 * boost/.cvsignore: new file
1393 * configure.in (AC_OUTPUT): add boost/Makefile
1395 * Makefile.am (SUBDIRS): add boost
1397 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1399 * src/support/lstrings.C (suffixIs): Fixed.
1401 2000-10-01 Allan Rae <rae@lyx.org>
1403 * src/PrinterParams.h: moved things around to avoid the "can't
1404 inline call" warning.
1406 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
1407 into doc++ documentation.
1409 * src/frontends/xforms/FormCommand.[Ch]: support button policy
1411 * src/frontends/xforms/FormRef.C: make use of button controller
1412 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
1413 cleaned up button controller usage.
1414 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
1415 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
1416 use the button controller
1418 * src/frontends/xforms/forms/*.fd: and associated generated files
1419 updated to reflect changes to FormBase. Some other FormXxxx files
1420 also got minor updates to reflect changes to FormBase.
1422 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
1423 (hide): made virtual.
1424 (input): return a bool. true == valid input
1425 (RestoreCB, restore): new
1426 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
1427 Changes to allow derived dialogs to use a ButtonController and
1428 make sense when doing so: OK button calls ok() and so on.
1430 * src/frontends/xforms/ButtonController.h (class ButtonController):
1431 Switch from template implementation to taking Policy parameter.
1432 Allows FormBase to provide a ButtonController for any dialog.
1434 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
1435 Probably should rename connect and disconnect.
1436 (apply): use the radio button groups
1437 (form): needed by FormBase
1438 (build): setup the radio button groups
1440 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
1442 * several files: type changes to reduce the number of warnings and
1443 to unify type hangling a bit. Still much to do.
1445 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1447 * lib/images/*: rename a bunch of icons to match Dekel converter
1450 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
1453 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
1455 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
1457 * sigc++/handle.h: ditto for class Handle.
1459 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
1461 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
1463 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
1465 * src/intl.C (InitKeyMapper): Correct the value of n due to the
1466 removal of the "default" language.
1468 * src/combox.h (getline): Check that sel > 0
1470 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
1472 * lib/examples/docbook_example.lyx
1473 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
1475 * lib/layouts/docbook-book.layout: new docbook book layout.
1477 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
1479 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
1481 * src/insets/figinset.C (DocBook):fixed small typo.
1483 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
1485 * src/insets/insetinclude.h: string include_label doesn't need to be
1488 2000-09-29 Allan Rae <rae@lyx.org>
1490 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
1491 Allow derived type to control connection and disconnection from signals
1492 of its choice if desired.
1494 2000-09-28 Juergen Vigna <jug@sad.it>
1496 * src/insets/insettabular.C (update): fixed cursor setting when
1497 the_locking_inset changed.
1498 (draw): made this a bit cleaner.
1499 (InsetButtonPress): fixed!
1501 * various files: added LyXText Parameter to fitCursor call.
1503 * src/BufferView.C (fitCursor): added LyXText parameter.
1505 * src/insets/insettabular.C (draw): small draw fix.
1507 * src/tabular.C: right setting of left/right celllines.
1509 * src/tabular.[Ch]: fixed various types in funcions and structures.
1510 * src/insets/insettabular.C: ditto
1511 * src/frontends/xforms/FormTabular.C: ditto
1513 2000-09-28 Allan Rae <rae@lyx.org>
1515 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
1516 that the #ifdef's had been applied to part of what should have been
1517 a complete condition. It's possible there are other tests that
1518 were specific to tables that are also wrong now that InsetTabular is
1519 being used. Now we need to fix the output of '\n' after a table in a
1520 float for the same reason as the original condition:
1521 "don't insert this if we would be adding it before or after a table
1522 in a float. This little trick is needed in order to allow use of
1523 tables in \subfigures or \subtables."
1524 Juergen can you check this?
1526 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1528 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
1529 output to the ostream.
1531 * several files: fixed types based on warnings from cxx
1533 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
1535 * src/frontends/kde/Makefile.am: fix rule for
1536 formindexdialogdata_moc.C
1538 * src/.cvsignore: add ext_l10n.h to ignore
1540 * acconfig.h: stop messing with __STRICT_ANSI__
1541 * config/gnome.m4: remove option to set -ansi
1542 * config/kde.m4: remove option to set -ansi
1543 * config/lyxinclude.m4: don't set -ansi
1545 2000-09-27 Juergen Vigna <jug@sad.it>
1547 * various files: remove "default" language check.
1549 * src/insets/insetquotes.C: removed use of current_view.
1551 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
1552 the one should have red ears by now!
1554 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
1555 in more then one paragraph. Fixed cursor-movement/selection.
1557 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
1558 paragraphs inside a text inset.
1560 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
1561 text-inset if this owner is an inset.
1563 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1565 * src/Bullet.h: changed type of font, character and size to int
1567 * src/buffer.C (asciiParagraph): remove actcell and fname1.
1569 * src/insets/inseturl.[Ch]:
1570 * src/insets/insetref.[Ch]:
1571 * src/insets/insetlabel.[Ch]: add linelen to Ascii
1573 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
1575 * src/buffer.C (readFile): block-if statement rearranged to minimise
1576 bloat. Patch does not reverse Jean-Marc's change ;-)
1578 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
1579 Class rewritten to store pointers to hide/update signals directly,
1580 rather than Dialogs *. Also defined an enum to ease use. All xforms
1581 forms can now be derived from this class.
1583 * src/frontends/xforms/FormCommand.[Ch]
1584 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
1586 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
1589 * src/frontends/xforms/forms/form_citation.fd
1590 * src/frontends/xforms/forms/form_copyright.fd
1591 * src/frontends/xforms/forms/form_error.fd
1592 * src/frontends/xforms/forms/form_index.fd
1593 * src/frontends/xforms/forms/form_ref.fd
1594 * src/frontends/xforms/forms/form_toc.fd
1595 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
1597 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
1599 * src/insets/insetfoot.C: removed redundent using directive.
1601 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1603 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
1604 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
1606 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
1607 created in the constructors in different groups. Then set() just
1608 have to show the groups as needed. This fixes the redraw problems
1609 (and is how the old menu code worked).
1611 * src/support/lyxlib.h: declare the methods as static when we do
1612 not have namespaces.
1614 2000-09-26 Juergen Vigna <jug@sad.it>
1616 * src/buffer.C (asciiParagraph): new function.
1617 (writeFileAscii): new function with parameter ostream.
1618 (writeFileAscii): use now asciiParagraph.
1620 * various inset files: added the linelen parameter to the Ascii-func.
1622 * src/tabular.C (Write): fixed error in writing file introduced by
1623 the last changes from Lars.
1625 * lib/bind/menus.bind: removed not supported functions.
1627 * src/insets/insettext.C (Ascii): implemented this function.
1629 * src/insets/lyxinset.h (Ascii): added linelen parameter.
1631 * src/tabular.C (write_attribute[int,string,bool]): new functions.
1632 (Write): use of the write_attribute functions.
1634 * src/bufferlist.C (close): fixed reasking question!
1636 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1638 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
1639 new files use the everwhere possible.
1642 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
1643 src/log_form.C src/lyx.C:
1646 * src/buffer.C (runLaTeX): remove func
1648 * src/PaperLayout.C: removed file
1649 * src/ParagraphExtra.C: likewise
1650 * src/bullet_forms.C: likewise
1651 * src/bullet_forms.h: likewise
1652 * src/bullet_forms_cb.C: likewise
1654 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
1655 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
1658 * several files: remove all traces of the old fd_form_paragraph,
1659 and functions belonging to that.
1661 * several files: remove all traces of the old fd_form_document,
1662 and functions belonging to that.
1664 * several files: constify local variables were possible.
1666 * several files: remove all code that was dead when NEW_EXPORT was
1669 * several files: removed string::c_str in as many places as
1672 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
1673 (e): be a bit more outspoken when patching
1674 (updatesrc): only move files if changed.
1676 * forms/layout_forms.h.patch: regenerated
1678 * forms/layout_forms.fd: remove form_document and form_paragraph
1679 and form_quotes and form_paper and form_table_options and
1680 form_paragraph_extra
1682 * forms/form1.fd: remove form_table
1684 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
1685 the fdui->... rewrite. Update some comments to xforms 0.88
1687 * forms/bullet_forms.C.patch: removed file
1688 * forms/bullet_forms.fd: likewise
1689 * forms/bullet_forms.h.patch: likewise
1691 * development/Code_rules/Rules: added a section on switch
1692 statements. Updated some comment to xforms 0.88.
1694 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1696 * src/buffer.C (readFile): make sure that the whole version number
1697 is read after \lyxformat (even when it contains a comma)
1699 * lib/ui/default.ui: change shortcut of math menu to M-a.
1701 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1703 * src/vspace.C (nextToken): use isStrDbl() to check for proper
1706 * src/LyXView.C (updateWindowTitle): show the full files name in
1707 window title, limited to 30 characters.
1709 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
1710 When a number of characters has been given, we should not assume
1711 that the string is 0-terminated.
1713 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
1714 calls (fixes some memory leaks)
1716 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
1717 trans member on exit.
1719 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1721 * src/converter.C (GetReachable): fix typo.
1723 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
1724 understand ',' instead of '.'.
1725 (GetInteger): rewrite to use strToInt().
1727 2000-09-26 Juergen Vigna <jug@sad.it>
1729 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
1730 better visibility and error-message on wrong VSpace input.
1732 * src/language.C (initL): added english again.
1734 2000-09-25 Juergen Vigna <jug@sad.it>
1736 * src/frontends/kde/Dialogs.C (Dialogs):
1737 * src/frontends/gnome/Dialogs.C (Dialogs):
1738 * src/frontends/kde/Makefile.am:
1739 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
1741 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
1743 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
1745 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
1747 * src/frontends/xforms/FormParagraph.C:
1748 * src/frontends/xforms/FormParagraph.h:
1749 * src/frontends/xforms/form_paragraph.C:
1750 * src/frontends/xforms/form_paragraph.h:
1751 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
1754 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
1756 * src/tabular.C (OldFormatRead): forgot to delete the temporary
1757 Paragraph-Data after use.
1759 * src/insets/insettext.C (LocalDispatch): don't set the layout on
1760 non breakable paragraphs.
1762 2000-09-25 Garst R. Reese <reese@isn.net>
1764 * src/language.C (initL): added missing language_country codes.
1766 2000-09-25 Juergen Vigna <jug@sad.it>
1768 * src/insets/insettext.C (InsetText):
1769 (deleteLyXText): remove the not released LyXText structure!
1771 2000-09-24 Marko Vendelin <markov@ioc.ee>
1773 * src/frontends/gnome/mainapp.C
1774 * src/frontends/gnome/mainapp.h: added support for keyboard
1777 * src/frontends/gnome/FormCitation.C
1778 * src/frontends/gnome/FormCitation.h
1779 * src/frontends/gnome/Makefile.am
1780 * src/frontends/gnome/pixbutton.h: completed the rewrite of
1781 FormCitation to use "action area" in mainapp window
1783 * src/frontends/gnome/Menubar_pimpl.C
1784 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
1787 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
1789 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
1790 width/descent/ascent values if name is empty.
1791 (mathed_string_height): Use std::max.
1793 2000-09-25 Allan Rae <rae@lyx.org>
1795 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
1796 segfault. This will be completely redesigned soon.
1798 * sigc++: updated libsigc++. Fixes struct timespec bug.
1800 * development/tools/makeLyXsigc.sh: .cvsignore addition
1802 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
1804 * several files: removed almost all traces of the old table
1807 * src/TableLayout.C: removed file
1809 2000-09-22 Juergen Vigna <jug@sad.it>
1811 * src/frontends/kde/Dialogs.C: added credits forms.
1813 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
1815 * src/frontends/gnome/Dialogs.C: added some forms.
1817 * src/spellchecker.C (init_spell_checker): set language in pspell code
1818 (RunSpellChecker): some modifications for setting language string.
1820 * src/language.[Ch]: added language_country code.
1822 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
1824 * src/frontends/Dialogs.h: added new signal showError.
1825 Rearranged existing signals in some sort of alphabetical order.
1827 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
1828 FormError.[Ch], form_error.[Ch]
1829 * src/frontends/xforms/forms/makefile: added new file form_error.fd
1830 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
1832 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
1833 dialogs. I think that this can be used as the base to all these
1836 * src/frontends/xforms/FormError.[Ch]
1837 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
1838 implementation of InsetError dialog.
1840 * src/insets/inseterror.[Ch]: rendered GUI-independent.
1842 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
1843 * src/frontends/kde/Makefile.am: ditto
1845 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
1847 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
1848 macrobf. This fixes a bug of invisible text.
1850 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1852 * lib/doc/LaTeXConfig.lyx.in: updated.
1854 * src/language.C (initL): remove language "francais" and change a
1855 bit the names of the two other french variations.
1857 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
1858 string that may not be 0-terminated.
1860 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1862 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
1864 2000-09-20 Marko Vendelin <markov@ioc.ee>
1866 * src/frontends/gnome/FormCitation.C
1867 * src/frontends/gnome/FormIndex.C
1868 * src/frontends/gnome/FormToc.C
1869 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
1870 the variable initialization to shut up the warnings
1872 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1874 * src/table.[Ch]: deleted files
1876 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
1879 2000-09-18 Juergen Vigna <jug@sad.it>
1881 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
1882 problems with selection. Inserted new LFUN_PASTESELECTION.
1883 (InsetButtonPress): inserted handling of middle mouse-button paste.
1885 * src/spellchecker.C: changed word to word.c_str().
1887 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
1889 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
1890 included in the ``make dist'' tarball.
1892 2000-09-15 Juergen Vigna <jug@sad.it>
1894 * src/CutAndPaste.C (cutSelection): small fix return the right
1895 end position after cut inside one paragraph only.
1897 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
1898 we are locked as otherwise we don't have a valid cursor position!
1900 * src/insets/figinset.C (draw): small bugfix but why is this needed???
1902 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
1904 * src/frontends/kde/FormRef.C: added using directive.
1905 * src/frontends/kde/FormToc.C: ditto
1907 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
1909 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
1911 2000-09-19 Marko Vendelin <markov@ioc.ee>
1913 * src/frontends/gnome/Menubar_pimpl.C
1914 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
1915 Toc, ViewFormats, UpdateFormats, and ExportFormats.
1917 * src/frontends/gnome/mainapp.C
1918 * src/frontends/gnome/mainapp.h: support for menu update used
1921 * src/frontends/gnome/mainapp.C
1922 * src/frontends/gnome/mainapp.h: support for "action" area in the
1923 main window. This area is used by small simple dialogs, such as
1926 * src/frontends/gnome/FormIndex.C
1927 * src/frontends/gnome/FormIndex.h
1928 * src/frontends/gnome/FormUrl.C
1929 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
1932 * src/frontends/gnome/FormCitation.C
1933 * src/frontends/gnome/FormCitation.h: rewrite to use main window
1934 action area. Only "Insert new citation" is implemented.
1936 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1938 * src/buffer.C (Dispatch): fix call to Dispatch
1939 * src/insets/insetref.C (Edit): likewise
1940 * src/insets/insetparent.C (Edit): likewise
1941 * src/insets/insetinclude.C (include_cb): likewise
1942 * src/frontends/xforms/FormUrl.C (apply): likewise
1943 * src/frontends/xforms/FormToc.C (apply): likewise
1944 * src/frontends/xforms/FormRef.C (apply): likewise
1945 * src/frontends/xforms/FormIndex.C (apply): likewise
1946 * src/frontends/xforms/FormCitation.C (apply): likewise
1947 * src/lyxserver.C (callback): likewise
1948 * src/lyxfunc.C (processKeySym): likewise
1949 (Dispatch): likewise
1950 (Dispatch): likewise
1951 * src/lyx_cb.C (LayoutsCB): likewise
1953 * Makefile.am (sourcedoc): small change
1955 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1957 * src/main.C (main): Don't make an empty GUIRunTime object. all
1958 methods are static. constify a bit remove unneded using + headers.
1960 * src/tabular.C: some more const to local vars move some loop vars
1962 * src/spellchecker.C: added some c_str after some word for pspell
1964 * src/frontends/GUIRunTime.h: add new static method setDefaults
1965 * src/frontends/xforms/GUIRunTime.C (setDefaults):
1966 * src/frontends/kde/GUIRunTime.C (setDefaults):
1967 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
1969 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
1970 with strnew in arg, use correct emptystring when calling SetName.
1972 * several files: remove all commented code with relation to
1973 HAVE_SSTREAM beeing false. We now only support stringstream and
1976 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1978 * src/lyxfunc.C: construct correctly the automatic new file
1981 * src/text2.C (IsStringInText): change type of variable i to shut
1984 * src/support/sstream.h: do not use namespaces if the compiler
1985 does not support them.
1987 2000-09-15 Marko Vendelin <markov@ioc.ee>
1988 * src/frontends/gnome/FormCitation.C
1989 * src/frontends/gnome/FormCitation.h
1990 * src/frontends/gnome/diainsertcitation_interface.c
1991 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
1992 regexp support to FormCitation [Gnome].
1994 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
1997 * configure.in: remove unused KDE/GTKGUI define
1999 * src/frontends/kde/FormRef.C
2000 * src/frontends/kde/FormRef.h
2001 * src/frontends/kde/formrefdialog.C
2002 * src/frontends/kde/formrefdialog.h: double click will
2003 go to reference, now it is possible to change a cross-ref
2006 * src/frontends/kde/FormToc.C
2007 * src/frontends/kde/FormToc.h
2008 * src/frontends/kde/formtocdialog.C
2009 * src/frontends/kde/formtocdialog.h: add a depth
2012 * src/frontends/kde/Makefile.am: add QtLyXView.h
2015 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
2017 * src/frontends/kde/FormCitation.h: added some using directives.
2019 * src/frontends/kde/FormToc.h: corrected definition of doTree.
2021 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
2024 * src/mathed/math_defs.h: redefine SetAlign to use string rather
2027 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2029 * src/buffer.C (pop_tag): revert for the second time a change by
2030 Lars, who seems to really hate having non-local loop variables :)
2032 * src/Lsstream.h: add "using" statements.
2034 * src/support/copy.C (copy): add a bunch of std:: qualifiers
2035 * src/buffer.C (writeFile): ditto
2037 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2039 * src/buffer.C (writeFile): try to fix the locale modified format
2040 number to always be as we want it.
2042 * src/WorkArea.C (work_area_handler): try to workaround the bugs
2043 in XForms 0.89. C-space is now working again.
2045 * src/Lsstream.h src/support/sstream.h: new files.
2047 * also commented out all cases where strstream were used.
2049 * src/Bullet.h (c_str): remove method.
2051 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
2053 * a lot of files: get rid of "char const *" and "char *" is as
2054 many places as possible. We only want to use them in interaction
2055 with system of other libraries, not inside lyx.
2057 * a lot of files: return const object is not of pod type. This
2058 helps ensure that temporary objects is not modified. And fits well
2059 with "programming by contract".
2061 * configure.in: check for the locale header too
2063 * Makefile.am (sourcedoc): new tag for generation of doc++
2066 2000-09-14 Juergen Vigna <jug@sad.it>
2068 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
2069 callback to check which combo called it and do the right action.
2071 * src/combox.C (combo_cb): added combo * to the callbacks.
2072 (Hide): moved call of callback after Ungrab of the pointer.
2074 * src/intl.h: removed LCombo2 function.
2076 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
2077 function as this can now be handled in one function.
2079 * src/combox.h: added Combox * to callback prototype.
2081 * src/frontends/xforms/Toolbar_pimpl.C:
2082 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
2084 2000-09-14 Garst Reese <reese@isn.net>
2086 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
2087 moved usepackage{xxx}'s to beginning of file. Changed left margin
2088 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
2089 underlining from title. Thanks to John Culleton for useful suggestions.
2091 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2093 * src/lyxlex_pimpl.C (setFile): change error message to debug
2096 2000-09-13 Juergen Vigna <jug@sad.it>
2098 * src/frontends/xforms/FormDocument.C: implemented choice_class
2099 as combox and give callback to combo_language so OK/Apply is activated
2102 * src/bufferlist.C (newFile): small fix so already named files
2103 (via an open call) are not requested to be named again on the
2106 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2108 * src/frontends/kde/Makefile.am
2109 * src/frontends/kde/FormRef.C
2110 * src/frontends/kde/FormRef.h
2111 * src/frontends/kde/formrefdialog.C
2112 * src/frontends/kde/formrefdialog.h: implement
2115 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2117 * src/frontends/kde/formtocdialog.C
2118 * src/frontends/kde/formtocdialog.h
2119 * src/frontends/kde/FormToc.C
2120 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
2122 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
2124 * src/frontends/kde/FormCitation.C: fix thinko
2125 where we didn't always display the reference text
2128 * src/frontends/kde/formurldialog.C
2129 * src/frontends/kde/formurldialog.h
2130 * src/frontends/kde/FormUrl.C
2131 * src/frontends/kde/FormUrl.h: minor cleanups
2133 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
2135 * src/frontends/kde/Makefile.am
2136 * src/frontends/kde/FormToc.C
2137 * src/frontends/kde/FormToc.h
2138 * src/frontends/kde/FormCitation.C
2139 * src/frontends/kde/FormCitation.h
2140 * src/frontends/kde/FormIndex.C
2141 * src/frontends/kde/FormIndex.h
2142 * src/frontends/kde/formtocdialog.C
2143 * src/frontends/kde/formtocdialog.h
2144 * src/frontends/kde/formcitationdialog.C
2145 * src/frontends/kde/formcitationdialog.h
2146 * src/frontends/kde/formindexdialog.C
2147 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
2149 2000-09-12 Juergen Vigna <jug@sad.it>
2151 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
2154 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2156 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
2159 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
2161 * src/converter.C (Add, Convert): Added support for converter flags:
2162 needaux, resultdir, resultfile.
2163 (Convert): Added new parameter view_file.
2164 (dvips_options): Fixed letter paper option.
2166 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
2167 (Export, GetExportableFormats, GetViewableFormats): Added support
2170 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
2172 (easyParse): Fixed to work with new export code.
2174 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
2177 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
2179 * lib/bind/*.bind: Replaced
2180 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
2181 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
2183 2000-09-11 Juergen Vigna <jug@sad.it>
2185 * src/lyx_gui.C (runTime): uses global guiruntime variable.
2187 * src/main.C (main): now GUII defines global guiruntime!
2189 * src/frontends/gnome/GUIRunTime.C (initApplication):
2190 * src/frontends/kde/GUIRunTime.C (initApplication):
2191 * src/frontends/xforms/GUIRunTime.C (initApplication):
2192 * src/frontends/GUIRunTime.h: added new function initApplication.
2194 * src/spellchecker.C (sc_accept_word): change to add_to_session.
2196 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
2198 2000-09-08 Juergen Vigna <jug@sad.it>
2200 * src/lyx_gui.C (create_forms): don't display the "default" entry as
2201 we have already "Reset".
2203 * src/language.C (initL): inserted "default" language and made this
2204 THE default language (and not american!)
2206 * src/paragraph.C: inserted handling of "default" language!
2208 * src/lyxfont.C: ditto
2212 * src/paragraph.C: output the \\par only if we have a following
2213 paragraph otherwise it's not needed.
2215 2000-09-05 Juergen Vigna <jug@sad.it>
2217 * config/pspell.m4: added entry to lyx-flags
2219 * src/spellchecker.C: modified version from Kevin for using pspell
2221 2000-09-01 Marko Vendelin <markov@ioc.ee>
2222 * src/frontends/gnome/Makefile.am
2223 * src/frontends/gnome/FormCitation.C
2224 * src/frontends/gnome/FormCitation.h
2225 * src/frontends/gnome/diainsertcitation_callbacks.c
2226 * src/frontends/gnome/diainsertcitation_callbacks.h
2227 * src/frontends/gnome/diainsertcitation_interface.c
2228 * src/frontends/gnome/diainsertcitation_interface.h
2229 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
2230 dialog for Gnome frontend
2232 * src/main.C: Gnome libraries require keeping application name
2233 and its version as strings
2235 * src/frontends/gnome/mainapp.C: Change the name of the main window
2236 from GnomeLyX to PACKAGE
2238 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2240 * src/frontends/Liason.C: add "using: declaration.
2242 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
2244 * src/mathed/math_macro.C (Metrics): Set the size of the template
2246 * src/mathed/formulamacro.C (Latex): Fixed the returned value
2248 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
2250 * src/converter.C (add_options): New function.
2251 (SetViewer): Change $$FName into '$$FName'.
2252 (View): Add options when running xdvi
2253 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
2254 (Convert): The 3rd parameter is now the desired filename. Converts
2255 calls to lyx::rename if necessary.
2256 Add options when running dvips.
2257 (dvi_papersize,dvips_options): New methods.
2259 * src/exporter.C (Export): Use getLatexName() instead of fileName().
2261 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
2262 using a call to Converter::dvips_options.
2263 Fixed to work with nex export code.
2265 * src/support/copy.C
2266 * src/support/rename.C: New files
2268 * src/support/syscall.h
2269 * src/support/syscall.C: Added Starttype SystemDontWait.
2271 * lib/ui/default.ui: Changed to work with new export code
2273 * lib/configure.m4: Changed to work with new export code
2275 * src/encoding.C: Changed latex name for iso8859_7 encoding.
2277 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
2279 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
2280 so that code compiles with DEC cxx.
2282 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
2283 to work correctly! Also now supports the additional elements
2286 2000-09-01 Allan Rae <rae@lyx.org>
2288 * src/frontends/ButtonPolicies.C: renamed all the references to
2289 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
2291 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
2292 since it's a const not a type.
2294 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
2296 2000-08-31 Juergen Vigna <jug@sad.it>
2298 * src/insets/figinset.C: Various changes to look if the filename has
2299 an extension and if not add it for inline previewing.
2301 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2303 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
2304 make buttonStatus and isReadOnly be const methods. (also reflect
2305 this in derived classes.)
2307 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
2308 (nextState): change to be static inline, pass the StateMachine as
2310 (PreferencesPolicy): remove casts
2311 (OkCancelPolicy): remvoe casts
2312 (OkCancelReadOnlyPolicy): remove casts
2313 (NoRepeatedApplyReadOnlyPolicy): remove casts
2314 (OkApplyCancelReadOnlyPolicy): remove casts
2315 (OkApplyCancelPolicy): remove casts
2316 (NoRepeatedApplyPolicy): remove casts
2318 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
2320 * src/converter.C: added some using directives
2322 * src/frontends/ButtonPolicies.C: changes to overcome
2323 "need lvalue" error with DEC c++
2325 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
2326 to WMHideCB for DEC c++
2328 * src/frontends/xforms/Menubar_pimpl.C: added using directive
2330 * src/frontends/xforms/forms/form_document.C.patch: use C callback
2331 to BulletBMTableCB for DEC c++
2333 2000-08-31 Allan Rae <rae@lyx.org>
2335 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
2336 character dialog separately from old document dialogs combo_language.
2339 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2341 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
2342 Removed LFUN_REF_CREATE.
2344 * src/MenuBackend.C: Added new tags: toc and references
2346 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
2347 (add_lastfiles, add_documents, add_formats): Removed the unused smn
2349 (add_toc, add_references): New methods.
2350 (create_submenu): Handle correctly the case when there is a
2351 seperator after optional menu items.
2353 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
2354 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
2355 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
2357 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
2359 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2361 * src/converter.[Ch]: New file for converting between different
2364 * src/export.[Ch]: New file for exporting a LyX file to different
2367 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
2368 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
2369 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
2370 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
2371 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
2372 RunDocBook, MenuExport.
2374 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
2375 Exporter::Preview methods if NEW_EXPORT is defined.
2377 * src/buffer.C (Dispatch): Use Exporter::Export.
2379 * src/lyxrc.C: Added new tags: \converter and \viewer.
2382 * src/LyXAction.C: Define new lyx-function: buffer-update.
2383 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
2384 when NEW_EXPORT is defined.
2386 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
2388 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
2390 * lib/ui/default.ui: Added submenus "view" and "update" to the
2393 * src/filetools.C (GetExtension): New function.
2395 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
2397 2000-08-29 Allan Rae <rae@lyx.org>
2399 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
2401 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
2402 (EnableDocumentLayout): removed
2403 (DisableDocumentLayout): removed
2404 (build): make use of ButtonController's read-only handling to
2405 de/activate various objects. Replaces both of the above functions.
2407 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
2408 (readOnly): was read_only
2409 (refresh): fixed dumb mistakes with read_only_ handling
2411 * src/frontends/xforms/forms/form_document.fd:
2412 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
2413 tabbed dialogs so the tabs look more like tabs and so its easier to
2414 work out which is the current tab.
2416 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
2417 segfault with form_table
2419 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
2421 2000-08-28 Juergen Vigna <jug@sad.it>
2423 * acconfig.h: added USE_PSPELL.
2425 * src/config.h.in: added USE_PSPELL.
2427 * autogen.sh: added pspell.m4
2429 * config/pspell.m4: new file.
2431 * src/spellchecker.C: implemented support for pspell libary.
2433 2000-08-25 Juergen Vigna <jug@sad.it>
2435 * src/LyXAction.C (init): renamed LFUN_TABLE to
2436 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
2438 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
2440 * src/lyxscreen.h: add force_clear variable and fuction to force
2441 a clear area when redrawing in LyXText.
2443 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
2445 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2447 * some whitespace and comment changes.
2449 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
2451 * src/buffer.C: up te LYX_FORMAT to 2.17
2453 2000-08-23 Juergen Vigna <jug@sad.it>
2455 * src/BufferView_pimpl.C (tripleClick): disable this when in a
2458 * src/insets/insettabular.C (pasteSelection): delete the insets
2459 LyXText as it is not valid anymore.
2460 (copySelection): new function.
2461 (pasteSelection): new function.
2462 (cutSelection): new function.
2463 (LocalDispatch): implemented cut/copy/paste of cell selections.
2465 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
2466 don't have a LyXText.
2468 * src/LyXAction.C (init): a NEW_TABULAR define too much.
2470 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
2473 2000-08-22 Juergen Vigna <jug@sad.it>
2475 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
2476 ifdef form_table out if NEW_TABULAR.
2478 2000-08-21 Juergen Vigna <jug@sad.it>
2480 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
2481 (draw): fixed draw position so that the cursor is positioned in the
2483 (InsetMotionNotify): hide/show cursor so the position is updated.
2484 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
2485 using cellstart() function where it should be used.
2487 * src/insets/insettext.C (draw): ditto.
2489 * src/tabular.C: fixed initialization of some missing variables and
2490 made BoxType into an enum.
2492 2000-08-22 Marko Vendelin <markov@ioc.ee>
2493 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
2494 stock menu item using action numerical value, not its string
2498 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
2500 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
2501 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
2503 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
2505 * src/frontends/xforms/GUIRunTime.C: new file
2507 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
2508 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2510 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
2512 * src/frontends/kde/GUIRunTime.C: new file
2514 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
2515 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2517 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
2519 * src/frontends/gnome/GUIRunTime.C: new file
2521 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
2524 * src/frontends/GUIRunTime.h: removed constructor and destructor,
2525 small change to documetentation.
2527 * src/frontends/GUIRunTime.C: removed file
2529 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
2531 * src/lyxparagraph.h: enable NEW_TABULAR as default
2533 * src/lyxfunc.C (processKeySym): remove some commented code
2535 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
2536 NEW_TABULAR around the fd_form_table_options.
2538 * src/lyx_gui.C (runTime): call the static member function as
2539 GUIRunTime::runTime().
2541 2000-08-21 Allan Rae <rae@lyx.org>
2543 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
2546 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
2548 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
2550 2000-08-21 Allan Rae <rae@lyx.org>
2552 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
2553 keep Garst happy ;-)
2554 * src/frontends/xforms/FormPreferences.C (build): use setOK
2555 * src/frontends/xforms/FormDocument.C (build): use setOK
2556 (FormDocument): use the appropriate policy.
2558 2000-08-21 Allan Rae <rae@lyx.org>
2560 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
2561 automatic [de]activation of arbitrary objects when in a read-only state.
2563 * src/frontends/ButtonPolicies.h: More documentation
2564 (isReadOnly): added to support the above.
2566 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
2568 2000-08-18 Juergen Vigna <jug@sad.it>
2570 * src/insets/insettabular.C (getStatus): changed to return func_status.
2572 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
2573 display toggle menu entries if they are.
2575 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
2576 new document layout now.
2578 * src/lyxfunc.C: ditto
2580 * src/lyx_gui_misc.C: ditto
2582 * src/lyx_gui.C: ditto
2584 * lib/ui/default.ui: removed paper and quotes layout as they are now
2585 all in the document layout tabbed folder.
2587 * src/frontends/xforms/forms/form_document.fd: added Restore
2588 button and callbacks for all inputs for Allan's ButtonPolicy.
2590 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
2591 (CheckChoiceClass): added missing params setting on class change.
2592 (UpdateLayoutDocument): added for updating the layout on params.
2593 (build): forgot to RETURN_ALWAYS input_doc_spacing.
2594 (FormDocument): Implemented Allan's ButtonPolicy with the
2597 2000-08-17 Allan Rae <rae@lyx.org>
2599 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
2600 so we can at least see the credits again.
2602 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
2603 controller calls for the appropriate callbacks. Note that since Ok
2604 calls apply followed by cancel, and apply isn't a valid input for the
2605 APPLIED state, the bc_ calls have to be made in the static callback not
2606 within each of the real callbacks.
2608 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
2609 (setOk): renamed from setOkay()
2611 2000-08-17 Juergen Vigna <jug@sad.it>
2613 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
2614 in the implementation part.
2615 (composeUIInfo): don't show optional menu-items.
2617 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
2619 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
2621 * src/bufferview_funcs.C (CurrentState): fixed to show also the
2622 text-state when in a text-inset.
2624 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
2626 2000-08-17 Marko Vendelin <markov@ioc.ee>
2627 * src/frontends/gnome/FormIndex.C
2628 * src/frontends/gnome/FormIndex.h
2629 * src/frontends/gnome/FormToc.C
2630 * src/frontends/gnome/FormToc.h
2631 * src/frontends/gnome/dialogs
2632 * src/frontends/gnome/diatoc_callbacks.c
2633 * src/frontends/gnome/diatoc_callbacks.h
2634 * src/frontends/gnome/diainsertindex_callbacks.h
2635 * src/frontends/gnome/diainsertindex_callbacks.c
2636 * src/frontends/gnome/diainsertindex_interface.c
2637 * src/frontends/gnome/diainsertindex_interface.h
2638 * src/frontends/gnome/diatoc_interface.h
2639 * src/frontends/gnome/diatoc_interface.c
2640 * src/frontends/gnome/Makefile.am: Table of Contents and
2641 Insert Index dialogs implementation for Gnome frontend
2643 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
2645 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
2647 * src/frontends/gnome/diainserturl_interface.c: make the dialog
2650 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2652 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
2653 destructor. Don't definde if you don't need it
2654 (processEvents): made static, non-blocking events processing for
2656 (runTime): static method. event loop for xforms
2657 * similar as above for kde and gnome.
2659 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
2660 new Pimpl is correct
2661 (runTime): new method calss the real frontends runtime func.
2663 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
2665 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2667 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
2669 2000-08-16 Juergen Vigna <jug@sad.it>
2671 * src/lyx_gui.C (runTime): added GUII RunTime support.
2673 * src/frontends/Makefile.am:
2674 * src/frontends/GUIRunTime.[Ch]:
2675 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
2676 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
2677 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
2679 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
2681 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
2682 as this is already set in ${FRONTEND_INCLUDE} if needed.
2684 * configure.in (CPPFLAGS): setting the include dir for the frontend
2685 directory and don't set FRONTEND=xforms for now as this is executed
2688 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
2690 * src/frontends/kde/Makefile.am:
2691 * src/frontends/kde/FormUrl.C:
2692 * src/frontends/kde/FormUrl.h:
2693 * src/frontends/kde/formurldialog.h:
2694 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
2696 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
2698 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
2700 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2702 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
2705 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
2707 * src/WorkArea.C (work_area_handler): more work to get te
2708 FL_KEYBOARD to work with xforms 0.88 too, please test.
2710 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
2712 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
2714 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
2717 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2719 * src/Timeout.h: remove Qt::emit hack.
2721 * several files: changes to allo doc++ compilation
2723 * src/lyxfunc.C (processKeySym): new method
2724 (processKeyEvent): comment out if FL_REVISION < 89
2726 * src/WorkArea.C: change some debugging levels.
2727 (WorkArea): set wantkey to FL_KEY_ALL
2728 (work_area_handler): enable the FL_KEYBOARD clause, this enables
2729 clearer code and the use of compose with XForms 0.89. Change to
2730 use signals instead of calling methods in bufferview directly.
2732 * src/Painter.C: change some debugging levels.
2734 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
2737 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
2738 (workAreaKeyPress): new method
2740 2000-08-14 Juergen Vigna <jug@sad.it>
2742 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
2744 * config/kde.m4: addes some features
2746 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
2747 include missing xforms dialogs.
2749 * src/Timeout.h: a hack to be able to compile with qt/kde.
2751 * sigc++/.cvsignore: added acinclude.m4
2753 * lib/.cvsignore: added listerros
2755 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
2756 xforms tree as objects are needed for other frontends.
2758 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
2759 linking with not yet implemented xforms objects.
2761 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
2763 2000-08-14 Baruch Even <baruch.even@writeme.com>
2765 * src/frontends/xforms/FormGraphics.h:
2766 * src/frontends/xforms/FormGraphics.C:
2767 * src/frontends/xforms/RadioButtonGroup.h:
2768 * src/frontends/xforms/RadioButtonGroup.C:
2769 * src/insets/insetgraphics.h:
2770 * src/insets/insetgraphics.C:
2771 * src/insets/insetgraphicsParams.h:
2772 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
2773 instead of spaces, and various other indentation issues to make the
2774 sources more consistent.
2776 2000-08-14 Marko Vendelin <markov@ioc.ee>
2778 * src/frontends/gnome/dialogs/diaprint.glade
2779 * src/frontends/gnome/FormPrint.C
2780 * src/frontends/gnome/FormPrint.h
2781 * src/frontends/gnome/diaprint_callbacks.c
2782 * src/frontends/gnome/diaprint_callbacks.h
2783 * src/frontends/gnome/diaprint_interface.c
2784 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
2787 * src/frontends/gnome/dialogs/diainserturl.glade
2788 * src/frontends/gnome/FormUrl.C
2789 * src/frontends/gnome/FormUrl.h
2790 * src/frontends/gnome/diainserturl_callbacks.c
2791 * src/frontends/gnome/diainserturl_callbacks.h
2792 * src/frontends/gnome/diainserturl_interface.c
2793 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
2794 Gnome implementation
2796 * src/frontends/gnome/Dialogs.C
2797 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
2798 all other dialogs. Copy all unimplemented dialogs from Xforms
2801 * src/frontends/gnome/support.c
2802 * src/frontends/gnome/support.h: support files generated by Glade
2806 * config/gnome.m4: Gnome configuration scripts
2808 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
2809 configure --help message
2811 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
2812 only if there are no events pendling in Gnome/Gtk. This enhances
2813 the performance of menus.
2816 2000-08-14 Allan Rae <rae@lyx.org>
2818 * lib/Makefile.am: listerrors cleaning
2820 * lib/listerrors: removed -- generated file
2821 * acinclude.m4: ditto
2822 * sigc++/acinclude.m4: ditto
2824 * src/frontends/xforms/forms/form_citation.fd:
2825 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
2828 * src/frontends/xforms/forms/makefile: I renamed the `install` target
2829 `updatesrc` and now we have a `test` target that does what `updatesrc`
2830 used to do. I didn't like having an install target that wasn't related
2833 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
2834 on all except FormGraphics. This may yet happen. Followed by a major
2835 cleanup including using FL_TRANSIENT for most of the dialogs. More
2836 changes to come when the ButtonController below is introduced.
2838 * src/frontends/xforms/ButtonController.h: New file for managing up to
2839 four buttons on a dialog according to an externally defined policy.
2840 * src/frontends/xforms/Makefile.am: added above
2842 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
2843 Apply and Cancel/Close buttons and everything in between and beyond.
2844 * src/frontends/Makefile.am: added above.
2846 * src/frontends/xforms/forms/form_preferences.fd:
2847 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
2848 and removed variable 'status' as a result. Fixed the set_minsize thing.
2849 Use the new screen-font-update after checking screen fonts were changed
2850 Added a "Restore" button to restore the original lyxrc values while
2851 editing. This restores everything not just the last input changed.
2852 That's still a tricky one. As is the "LyX: this shouldn't happen..."
2854 * src/LyXAction.C: screen-font-update added for updating buffers after
2855 screen font settings have been changed.
2856 * src/commandtags.h: ditto
2857 * src/lyxfunc.C: ditto
2859 * forms/lyx.fd: removed screen fonts dialog.
2860 * src/lyx_gui.C: ditto
2861 * src/menus.[Ch]: ditto
2862 * src/lyx.[Ch]: ditto
2863 * src/lyx_cb.C: ditto + code from here moved to make
2864 screen-font-update. And people wonder why progress on GUII is
2865 slow. Look at how scattered this stuff was! It takes forever
2868 * forms/fdfix.sh: Fixup the spacing after commas.
2869 * forms/makefile: Remove date from generated files. Fewer clashes now.
2870 * forms/bullet_forms.C.patch: included someones handwritten changes
2872 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
2873 once I've discovered why LyXRC was made noncopyable.
2874 * src/lyx_main.C: ditto
2876 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
2878 * src/frontends/xforms/forms/fdfix.sh:
2879 * src/frontends/xforms/forms/fdfixh.sed:
2880 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
2881 * src/frontends/xforms/Form*.[hC]:
2882 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
2883 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
2884 provide a destructor for the struct FD_form_xxxx. Another version of
2885 the set_[max|min]size workaround and a few other cleanups. Actually,
2886 Angus' patch from 20000809.
2888 2000-08-13 Baruch Even <baruch.even@writeme.com>
2890 * src/insets/insetgraphics.C (Clone): Added several fields that needed
2893 2000-08-11 Juergen Vigna <jug@sad.it>
2895 * src/insets/insetgraphics.C (InsetGraphics): changing init
2896 order because of warnings.
2898 * src/frontends/xforms/forms/makefile: adding patching .C with
2901 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
2902 from .C.patch to .c.patch
2904 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
2905 order because of warning.
2907 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
2909 * src/frontends/Liason.C (setMinibuffer): new helper function
2911 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
2913 * src/lyxfunc.C (Dispatch): calling new Document-Layout
2915 * lib/ui/default.ui: commented out PaperLayout entry
2917 * src/frontends/xforms/form_document.[Ch]: new added files
2919 * src/frontends/xforms/FormDocument.[Ch]: ditto
2921 * src/frontends/xforms/forms/form_document.fd: ditto
2923 * src/frontends/xforms/forms/form_document.C.patch: ditto
2925 2000-08-10 Juergen Vigna <jug@sad.it>
2927 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
2928 (InsetGraphics): initialized cacheHandle to 0.
2929 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
2931 2000-08-10 Baruch Even <baruch.even@writeme.com>
2933 * src/graphics/GraphicsCache.h:
2934 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
2935 correctly as a cache.
2937 * src/graphics/GraphicsCacheItem.h:
2938 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
2941 * src/graphics/GraphicsCacheItem_pimpl.h:
2942 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
2945 * src/insets/insetgraphics.h:
2946 * src/insets/insetgraphics.C: Changed from using a signal notification
2947 to polling when image is not loaded.
2949 2000-08-10 Allan Rae <rae@lyx.org>
2951 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
2952 that there are two functions that have to been taken out of line by
2953 hand and aren't taken care of in the script. (Just a reminder note)
2955 * sigc++/macros/*.h.m4: Updated as above.
2957 2000-08-09 Juergen Vigna <jug@sad.it>
2959 * src/insets/insettext.C (draw): small fix for clearing rectangle.
2961 * src/insets/insettabular.C: make drawing of single cell smarter.
2963 2000-08-09 Marko Vendelin <markov@ioc.ee>
2964 * src/frontends/gnome/Menubar_pimpl.C
2965 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
2966 implementation: new files
2968 * src/frontends/gnome/mainapp.C
2969 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
2972 * src/main.C: create Gnome main window
2974 * src/frontends/xforms/Menubar_pimpl.h
2975 * src/frontends/Menubar.C
2976 * src/frontends/Menubar.h: added method Menubar::update that calls
2977 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
2979 * src/LyXView.C: calls Menubar::update to update the state
2982 * src/frontends/gnome/Makefile.am: added new files
2984 * src/frontends/Makefile.am: added frontend compiler options
2986 2000-08-08 Juergen Vigna <jug@sad.it>
2988 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
2990 * src/bufferlist.C (close):
2991 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
2992 documents if exiting without saving.
2994 * src/buffer.C (save): use removeAutosaveFile()
2996 * src/support/filetools.C (removeAutosaveFile): new function.
2998 * src/lyx_cb.C (MenuWrite): returns a bool now.
2999 (MenuWriteAs): check if file could really be saved and revert to the
3001 (MenuWriteAs): removing old autosavefile if existant.
3003 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
3004 before Goto toggle declaration, because of compiler warning.
3006 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
3008 * src/lyxfunc.C (MenuNew): small fix.
3010 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
3012 * src/bufferlist.C (newFile):
3013 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
3015 * src/lyxrc.C: added new_ask_filename tag
3017 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
3019 * src/lyx.fd: removed code pertaining to form_ref
3020 * src/lyx.[Ch]: ditto
3021 * src/lyx_cb.C: ditto
3022 * src/lyx_gui.C: ditto
3023 * src/lyx_gui_misc.C: ditto
3025 * src/BufferView_pimpl.C (restorePosition): update buffer only
3028 * src/commandtags.h (LFUN_REFTOGGLE): removed
3029 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
3030 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
3031 (LFUN_REFBACK): renamed LFUN_REF_BACK
3033 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
3034 * src/menus.C: ditto
3035 * src/lyxfunc.C (Dispatch): ditto.
3036 InsertRef dialog is now GUI-independent.
3038 * src/texrow.C: added using std::endl;
3040 * src/insets/insetref.[Ch]: strip out large amounts of code.
3041 The inset is now a container and this functionality is now
3042 managed by a new FormRef dialog
3044 * src/frontends/Dialogs.h (showRef, createRef): new signals
3046 * src/frontends/xforms/FormIndex.[Ch],
3047 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
3048 when setting dialog's min/max size
3049 * src/frontends/xforms/FormIndex.[Ch]: ditto
3051 * src/frontends/xforms/FormRef.[Ch],
3052 src/frontends/xforms/forms/form_ref.fd: new xforms
3053 implementation of an InsetRef dialog
3055 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
3058 * src/graphics/XPM_Renderer.C (isImageFormatOK):
3059 ios::nocreate is not part of the standard. Removed.
3061 2000-08-07 Baruch Even <baruch.even@writeme.com>
3063 * src/graphics/Renderer.h:
3064 * src/graphics/Renderer.C: Added base class for rendering of different
3065 image formats into Pixmaps.
3067 * src/graphics/XPM_Renderer.h:
3068 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
3069 in a different class.
3071 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
3072 easily add support for other formats.
3074 * src/insets/figinset.C: plugged a leak of an X resource.
3076 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
3078 * src/CutAndPaste.[Ch]: make all metods static.
3080 * development/Code_rules/Rules: more work, added section on
3081 Exceptions, and a References section.
3083 * a lot of header files: work to make doc++ able to generate the
3084 source documentation, some workarounds of doc++ problems. Doc++ is
3085 now able to generate the documentation.
3087 2000-08-07 Juergen Vigna <jug@sad.it>
3089 * src/insets/insettabular.C (recomputeTextInsets): removed function
3091 * src/tabular.C (SetWidthOfMulticolCell):
3093 (calculate_width_of_column_NMC): fixed return value so that it really
3094 only returns true if the column-width has changed (there where
3095 problems with muliticolumn-cells in this column).
3097 2000-08-04 Juergen Vigna <jug@sad.it>
3099 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
3100 also on the scrollstatus of the inset.
3101 (workAreaMotionNotify): ditto.
3103 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
3105 2000-08-01 Juergen Vigna <jug@sad.it>
3107 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
3109 * src/commandtags.h:
3110 * src/LyXAction.C (init):
3111 * src/insets/inset.C (LocalDispatch): added support for
3114 * src/insets/inset.C (scroll): new functions.
3116 * src/insets/insettext.C (removeNewlines): new function.
3117 (SetAutoBreakRows): removes forced newlines in the text of the
3118 paragraph if autoBreakRows is set to false.
3120 * src/tabular.C (Latex): generates a parbox around the cell contents
3123 * src/frontends/xforms/FormTabular.C (local_update): removed
3124 the radio_useparbox button.
3126 * src/tabular.C (UseParbox): new function
3128 2000-08-06 Baruch Even <baruch.even@writeme.com>
3130 * src/graphics/GraphicsCache.h:
3131 * src/graphics/GraphicsCache.C:
3132 * src/graphics/GraphicsCacheItem.h:
3133 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
3136 * src/insets/insetgraphics.h:
3137 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
3138 and the drawing of the inline image.
3140 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
3141 loaded into the wrong position.
3143 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
3146 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3148 * src/support/translator.h: move all typedefs to public section
3150 * src/support/filetools.C (MakeLatexName): return string const
3152 (TmpFileName): ditto
3153 (FileOpenSearch): ditto
3155 (LibFileSearch): ditto
3156 (i18nLibFileSearch): ditto
3159 (CreateTmpDir): ditto
3160 (CreateBufferTmpDir): ditto
3161 (CreateLyXTmpDir): ditto
3164 (MakeAbsPath): ditto
3166 (OnlyFilename): ditto
3168 (NormalizePath): ditto
3169 (CleanupPath): ditto
3170 (GetFileContents): ditto
3171 (ReplaceEnvironmentPath): ditto
3172 (MakeRelPath): ditto
3174 (ChangeExtension): ditto
3175 (MakeDisplayPath): ditto
3176 (do_popen): return cmdret const
3177 (findtexfile): return string const
3179 * src/support/DebugStream.h: add some /// to please doc++
3181 * src/frontends/DialogBase.h (endif): add some /// to please doc++
3183 * src/texrow.C (same_rownumber): functor to use with find_if
3184 (getIdFromRow): rewritten to use find_if and to not update the
3185 positions. return true if row is found
3186 (increasePos): new method, use to update positions
3188 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
3190 * src/lyxlex_pimpl.C (verifyTable): new method
3193 (GetString): return string const
3194 (pushTable): rewrite to use std::stack
3196 (setFile): better check
3199 * src/lyxlex.h: make LyXLex noncopyable
3201 * src/lyxlex.C (text): return char const * const
3202 (GetString): return string const
3203 (getLongString): return string const
3205 * src/lyx_gui_misc.C (askForText): return pair<...> const
3207 * src/lastfiles.[Ch] (operator): return string const
3209 * src/buffer.C (parseSingleLyXformat2Token): pass string to
3210 istringstream not char const *.
3211 move token.end() out of loop.
3212 (readFile): move initializaton of token
3214 * src/BufferView2.C (insertErrors): run texrow.increasePos if
3215 getIdFromRow is successful.
3217 * lib/bind/emacs.bind: don't include menus bind
3219 * development/Code_rules/Rules: the beginnings of making this
3220 better and covering more of the unwritten rules that we have.
3222 * development/Code_rules/Recommendations: a couple of wording
3225 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3227 * src/support/strerror.c: remove C++ comment.
3229 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
3231 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
3232 LFUN_INDEX_INSERT_LAST
3234 * src/texrow.C (getIdFromRow): changed from const_iterator to
3235 iterator, allowing code to compile with DEC cxx
3237 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
3238 stores part of the class, as suggested by Allan. Will allow
3240 (apply): test to apply uses InsetCommandParams operator!=
3242 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
3243 (apply): test to apply uses InsetCommandParams operator!=
3245 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
3246 stores part of the class.
3247 (update): removed limits on min/max size.
3249 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
3250 (apply): test to apply uses InsetCommandParams operator!=
3252 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
3253 (Read, Write, scanCommand, getCommand): moved functionality
3254 into InsetCommandParams.
3256 (getScreenLabel): made pure virtual
3257 new InsetCommandParams operators== and !=
3259 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
3260 c-tors based on InsetCommandParams. Removed others.
3261 * src/insets/insetinclude.[Ch]: ditto
3262 * src/insets/insetlabel.[Ch]: ditto
3263 * src/insets/insetparent.[Ch]: ditto
3264 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
3266 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
3267 insets derived from InsetCommand created using similar c-tors
3268 based on InsetCommandParams
3269 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
3270 * src/menus.C (ShowRefsMenu): ditto
3271 * src/paragraph.C (Clone): ditto
3272 * src/text2.C (SetCounter): ditto
3273 * src/lyxfunc.C (Dispatch) ditto
3274 Also recreated old InsetIndex behaviour exactly. Can now
3275 index-insert at the start of a paragraph and index-insert-last
3276 without launching the pop-up.
3278 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3280 * lib/lyxrc.example: mark te pdf options as non functional.
3282 * src/support/lstrings.C (strToInt): move initalization of tmpstr
3283 (isStrDbl): move tmpstr.end() out of loop.
3284 (strToDbl): move intialization of tmpstr
3285 (lowercase): return string const and move tmp.end() out of loop.
3286 (uppercase): return string const and move tmp.edn() out of loop.
3287 (prefixIs): add assertion
3292 (containsOnly): ditto
3293 (containsOnly): ditto
3294 (containsOnly): ditto
3295 (countChar): make last arg char not char const
3296 (token): return string const
3297 (subst): return string const, move tmp.end() out of loop.
3298 (subst): return string const, add assertion
3299 (strip): return string const
3300 (frontStrip): return string const, add assertion
3301 (frontStrip): return string const
3306 * src/support/lstrings.C: add inclde "LAssert.h"
3307 (isStrInt): move tmpstr.end() out of loop.
3309 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
3310 toollist.end() out of loop.
3311 (deactivate): move toollist.end() out of loop.
3312 (update): move toollist.end() out of loop.
3313 (updateLayoutList): move tc.end() out of loop.
3314 (add): move toollist.end() out of loop.
3316 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
3317 md.end() out of loop.
3319 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
3321 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
3324 * src/paragraph.C (Erase): move fontlist.end() out of loop.
3325 (Erase): move insetlist.end() out of loop.
3327 * src/lyx_sendfax_main.C: make show_logfile static and to take a
3328 ref to const string as first arg. Move initialization of some
3329 variables, whitespace changes.
3331 * src/kbmap.C (defkey): move table.end() out of loop.
3332 (kb_keymap): move table.end() out of loop.
3333 (findbinding): move table.end() out of loop.
3335 * src/MenuBackend.C (hasMenu): move end() out of loop.
3336 (getMenu): move end() out of loop.
3337 (getMenu): move menulist_.end() out of loop.
3339 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
3341 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
3344 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
3345 (getFromLyXName): move infotab.end() out of loop.
3347 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
3348 -fvtable-thunks -ffunction-sections -fdata-sections
3350 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
3352 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
3355 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3357 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
3359 * src/frontends/xforms/FormCitation.[Ch],
3360 src/frontends/xforms/FormIndex.[Ch],
3361 src/frontends/xforms/FormToc.[Ch],
3362 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
3364 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3366 * src/commandtags.h: renamed, created some flags for citation
3369 * src/lyx_gui_misc.C: stripped out old FD_index_form code
3371 * src/lyxfunc.C (dispatch): use signals to insert index entry
3373 * src/frontends/Dialogs.h: new signal createIndex
3375 * src/frontends/xforms/FormCommand.[Ch],
3376 src/frontends/xforms/FormCitation.[Ch],
3377 src/frontends/xforms/FormToc.[Ch],
3378 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
3380 * src/insets/insetindex.[Ch]: GUI-independent
3382 * src/frontends/xforms/FormIndex.[Ch],
3383 * src/frontends/xforms/forms/form_index.fd: xforms implementation
3386 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
3388 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
3389 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
3391 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3393 * src/insets/insetref.C (Latex): rewrite so that there is now
3394 question that a initialization is requested.
3396 * src/insets/insetcommand.h: reenable the hide signal
3398 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3400 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
3401 fix handling of shortcuts (many bugs :)
3402 (add_lastfiles): ditto.
3404 * lib/ui/default.ui: fix a few shortcuts.
3406 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
3408 * Makefile.am: Fix ``rpmdist'' target to return the exit
3409 status of the ``rpm'' command, instead of the last command in
3410 the chain (the ``rm lyx.xpm'' command, which always returns
3413 2000-08-02 Allan Rae <rae@lyx.org>
3415 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
3416 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
3417 * src/frontends/xforms/FormToc.C (FormToc): ditto
3419 * src/frontends/xforms/Makefile.am: A few forgotten files
3421 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
3422 Signals-not-copyable-problem Lars' started commenting out.
3424 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
3426 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3428 * src/insets/insetcommand.h: Signals is not copyable so anoter
3429 scheme for automatic hiding of forms must be used.
3431 * src/frontends/xforms/FormCitation.h: don't inerit from
3432 noncopyable, FormCommand already does that.
3433 * src/frontends/xforms/FormToc.h: ditto
3434 * src/frontends/xforms/FormUrl.h: ditto
3436 * src/frontends/xforms/FormCitation.C: add include <algorithm>
3438 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
3440 * src/insets/insetcommand.h (hide): new SigC::Signal0
3441 (d-tor) new virtual destructor emits hide signal
3443 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
3444 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
3446 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
3447 LOF and LOT. Inset is now GUI-independent
3449 * src/insets/insetloa.[Ch]: redundant
3450 * src/insets/insetlof.[Ch]: ditto
3451 * src/insets/insetlot.[Ch]: ditto
3453 * src/frontends/xforms/forms/form_url.fd: tweaked!
3454 * src/frontends/xforms/forms/form_citation.fd: ditto
3456 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
3457 dialogs dealing with InsetCommand insets
3459 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
3460 FormCommand base class
3461 * src/frontends/xforms/FormUrl.[Ch]: ditto
3463 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
3465 * src/frontends/xforms/FormToc.[Ch]: ditto
3467 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
3468 passed a generic InsetCommand pointer
3469 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
3471 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
3472 and modified InsetTOC class
3473 * src/buffer.C: ditto
3475 * forms/lyx.fd: strip out old FD_form_toc code
3476 * src/lyx_gui_misc.C: ditto
3477 * src/lyx_gui.C: ditto
3478 * src/lyx_cb.C: ditto
3479 * src/lyx.[Ch]: ditto
3481 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3483 * src/support/utility.hpp: tr -d '\r'
3485 2000-08-01 Juergen Vigna <jug@sad.it>
3487 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
3489 * src/commandtags.h:
3490 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
3491 LFUN_TABULAR_FEATURES.
3493 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
3494 LFUN_LAYOUT_TABULAR.
3496 * src/insets/insettabular.C (getStatus): implemented helper function.
3498 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
3500 2000-07-31 Juergen Vigna <jug@sad.it>
3502 * src/text.C (draw): fixed screen update problem for text-insets.
3504 * src/text2.C (SetParagrpah): call an update of the inset-owner when
3505 something changed probably this has to be added in various other
3508 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
3510 2000-07-31 Baruch Even <baruch.even@writeme.com>
3512 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
3513 templates to satisfy compaq cxx.
3516 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3518 * src/support/translator.h (equal_1st_in_pair::operator()): take
3519 const ref pair_type as arg.
3520 (equal_2nd_in_pair::operator()): ditto
3521 (Translator::~Translator): remove empty d-tor.
3523 * src/graphics/GraphicsCache.C: move include config.h to top, also
3524 put initialization of GraphicsCache::singleton here.
3525 (~GraphicsCache): move here
3526 (addFile): take const ref as arg
3529 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
3531 * src/BufferView2.C (insertLyXFile): change te with/without header
3534 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3536 * src/frontends/xforms/FormGraphics.C (apply): add some
3537 static_cast. Not very nice, but required by compaq cxx.
3539 * src/frontends/xforms/RadioButtonGroup.h: include header
3540 <utility> instead of <pair.h>
3542 * src/insets/insetgraphicsParams.C: add using directive.
3543 (readResize): change return type to void.
3544 (readOrigin): ditto.
3546 * src/lyxfunc.C (getStatus): add missing break for build-program
3547 function; add test for Literate for export functions.
3549 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
3550 entries in Options menu.
3552 2000-07-31 Baruch Even <baruch.even@writeme.com>
3554 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
3555 protect against auto-allocation; release icon when needed.
3557 2000-07-31 Matej Cepl <CeplM@seznam.cz>
3559 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
3560 on usual typewriter.
3562 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
3563 earlier czech.kmap), useful only for programming.
3565 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3567 * src/frontends/xforms/FormCitation.h: fix conditioning around
3570 2000-07-31 Juergen Vigna <jug@sad.it>
3572 * src/frontends/xforms/FormTabular.C (local_update): changed
3573 radio_linebreaks to radio_useparbox and added radio_useminipage.
3575 * src/tabular.C: made support for using minipages/parboxes.
3577 * src/bufferlist.C (QwriteAll): small fix for asking for save.
3579 * src/insets/insetgraphics.C (draw): just draw the inset so that the
3581 (descent): so the cursor is in the middle.
3582 (width): bit smaller box.
3584 * src/insets/insetgraphics.h: added display() function.
3586 2000-07-31 Baruch Even <baruch.even@writeme.com>
3588 * src/frontends/Dialogs.h: Added showGraphics signals.
3590 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
3591 xforms form definition of the graphics dialog.
3593 * src/frontends/xforms/FormGraphics.h:
3594 * src/frontends/xforms/FormGraphics.C: Added files, the
3595 GUIndependent code of InsetGraphics
3597 * src/insets/insetgraphics.h:
3598 * src/insets/insetgraphics.C: Major writing to make it work.
3600 * src/insets/insetgraphicsParams.h:
3601 * src/insets/insetgraphicsParams.C: Added files, parameter passing
3602 struct between InsetGraphics and GUI.
3604 * src/LaTeXFeatures.h:
3605 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
3606 support for graphicx package.
3608 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
3609 for the graphics inset.
3611 * src/support/translator.h: Added file, used in
3612 InsetGraphicsParams. this is a template to translate between two
3615 * src/frontends/xforms/RadioButtonGroup.h:
3616 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
3617 way to easily control a radio button group.
3619 2000-07-28 Juergen Vigna <jug@sad.it>
3621 * src/insets/insettabular.C (LocalDispatch):
3622 (TabularFeatures): added support for lyx-functions of tabular features.
3623 (cellstart): refixed this function after someone wrongly changed it.
3625 * src/commandtags.h:
3626 * src/LyXAction.C (init): added support for tabular-features
3628 2000-07-28 Allan Rae <rae@lyx.org>
3630 * src/frontends/xforms/FormPreferences.C (build): Setup input return
3631 checking. NOTE: It seems that pressing ESC to cancel the dialog also
3632 triggers the callback for input checking. As a result we sometimes get
3633 "LyX: This shouldn't happen..." printed to cerr.
3634 (input): Started using status variable since I only free() on
3635 destruction. Some input checking for paths and font sizes.
3637 * src/frontends/xforms/FormPreferences.h: Use status to control
3638 activation of Ok and Apply
3640 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
3641 callback. Also resized to stop segfaults with 0.88. The problem is
3642 that xforms-0.88 requires the folder to be wide enough to fit all the
3643 tabs. If it isn't it causes all sorts of problems.
3645 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
3647 * src/frontends/xforms/forms/README: Reflect reality.
3649 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
3650 * src/frontends/xforms/forms/makefile: ditto.
3652 * src/commandtags.h: Get access to new Preferences dialog
3653 * src/LyXAction.C: ditto
3654 * src/lyxfunc.C: ditto
3655 * lib/ui/default.ui: ditto
3657 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3659 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
3661 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
3664 * src/frontends/xforms/form_url.[Ch]: added.
3666 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3668 * src/insets/insetbib.h: fixed bug in previous commit
3670 * src/frontends/xforms/FormUrl.h: ditto
3672 * src/frontends/xforms/FormPrint.h: ditto
3674 * src/frontends/xforms/FormPreferences.h: ditto
3676 * src/frontends/xforms/FormCopyright.h: ditto
3678 * src/frontends/xforms/FormCitation.C: ditto
3680 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
3681 private copyconstructor and private default contructor
3683 * src/support/Makefile.am: add utility.hpp
3685 * src/support/utility.hpp: new file from boost
3687 * src/insets/insetbib.h: set owner in clone
3689 * src/frontends/xforms/FormCitation.C: added missing include
3692 * src/insets/form_url.[Ch]: removed
3694 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
3696 * development/lyx.spec.in
3697 * Makefile.am: Fix buglet for LyX RPM generation resulting from
3698 file/directory re-organization.
3700 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
3702 * src/insets/insetcommand.[Ch]: moved the string data and
3703 associated manipulation methods into a new stand-alone class
3704 InsetCommandParams. This class has two additional methods
3705 getAsString() and setFromString() allowing the contents to be
3706 moved around as a single string.
3707 (addContents) method removed.
3708 (setContents) method no longer virtual.
3710 * src/buffer.C (readInset): made use of new InsetCitation,
3711 InsetUrl constructors based on InsetCommandParams.
3713 * src/commandtags.h: add LFUN_INSERT_URL
3715 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
3716 independent InsetUrl and use InsetCommandParams to extract
3717 string info and create new Insets.
3719 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
3721 * src/frontends/xforms/FormCitation.C (apply): uses
3724 * src/frontends/xforms/form_url.C
3725 * src/frontends/xforms/form_url.h
3726 * src/frontends/xforms/FormUrl.h
3727 * src/frontends/xforms/FormUrl.C
3728 * src/frontends/xforms/forms/form_url.fd: new files
3730 * src/insets/insetcite.[Ch]: removed unused constructors.
3732 * src/insets/insetinclude.[Ch]: no longer store filename
3734 * src/insets/inseturl.[Ch]: GUI-independent.
3736 2000-07-26 Juergen Vigna <jug@sad.it>
3737 * renamed frontend from gtk to gnome as it is that what is realized
3738 and did the necessary changes in the files.
3740 2000-07-26 Marko Vendelin <markov@ioc.ee>
3742 * configure.in: cleaning up gnome configuration scripts
3744 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3746 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
3747 shortcuts syndrom by redrawing them explicitely (a better solution
3748 would be appreciated).
3750 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
3752 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
3755 * src/lyx_cb.C (MenuExport): change html export to do the right
3756 thing depending of the document type (instead of having
3757 html-linuxdoc and html-docbook).
3758 * src/lyxfunc.C (getStatus): update for html
3759 * lib/ui/default.ui: simplify due to the above change.
3760 * src/menus.C (ShowFileMenu): update too (in case we need it).
3762 * src/MenuBackend.C (read): if a menu is defined twice, add the
3763 new entries to the exiting one.
3765 2000-07-26 Juergen Vigna <jug@sad.it>
3767 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
3769 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
3770 and return a bool if it did actual save the file.
3771 (AutoSave): don't autosave a unnamed doc.
3773 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
3774 check if this is an UNNAMED new file and react to it.
3775 (newFile): set buffer to unnamed and change to not mark a new
3776 buffer dirty if I didn't do anything with it.
3778 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
3780 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3782 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
3783 friend as per Angus's patch posted to lyx-devel.
3785 * src/ext_l10n.h: updated
3787 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
3788 gettext on the style string right before inserting them into the
3791 * autogen.sh: add code to extract style strings form layout files,
3792 not good enough yet.
3794 * src/frontends/gtk/.cvsignore: add MAKEFILE
3796 * src/MenuBackend.C (read): run the label strings through gettext
3797 before storing them in the containers.
3799 * src/ext_l10n.h: new file
3801 * autogen.sh : generate the ext_l10n.h file here
3803 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3805 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
3808 * lib/ui/default.ui: fix a couple of typos.
3810 * config/gnome/gtk.m4: added (and added to the list of files in
3813 * src/insets/insetinclude.C (unique_id): fix when we are using
3814 lyxstring instead of basic_string<>.
3815 * src/insets/insettext.C (LocalDispatch): ditto.
3816 * src/support/filetools.C: ditto.
3818 * lib/configure.m4: create the ui/ directory if necessary.
3820 * src/LyXView.[Ch] (updateToolbar): new method.
3822 * src/BufferView_pimpl.C (buffer): update the toolbar when
3823 opening/closing buffer.
3825 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3827 * src/LyXAction.C (getActionName): enhance to return also the name
3828 and options of pseudo-actions.
3829 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
3831 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
3832 as an example of what is possible). Used in File->Build too (more
3833 useful) and in the import/export menus (to mimick the complicated
3834 handling of linuxdoc and friends). Try to update all the entries.
3836 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
3839 * src/MenuBackend.C (read): Parse the new OptItem tag.
3841 * src/MenuBackend.h: Add a new optional_ data member (used if the
3842 entry should be omitted when the lyxfunc is disabled).
3844 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
3845 function, used as a shortcut.
3846 (create_submenu): align correctly the shortcuts on the widest
3849 * src/MenuBackend.h: MenuItem.label() only returns the label of
3850 the menu without shortcut; new method shortcut().
3852 2000-07-14 Marko Vendelin <markov@ioc.ee>
3854 * src/frontends/gtk/Dialogs.C:
3855 * src/frontends/gtk/FormCopyright.C:
3856 * src/frontends/gtk/FormCopyright.h:
3857 * src/frontends/gtk/Makefile.am: added these source-files for the
3858 Gtk/Gnome support of the Copyright-Dialog.
3860 * src/main.C: added Gnome::Main initialization if using
3861 Gtk/Gnome frontend-GUI.
3863 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
3865 * config/gnome/aclocal-include.m4
3866 * config/gnome/compiler-flags.m4
3867 * config/gnome/curses.m4
3868 * config/gnome/gnome--.m4
3869 * config/gnome/gnome-bonobo-check.m4
3870 * config/gnome/gnome-common.m4
3871 * config/gnome/gnome-fileutils.m4
3872 * config/gnome/gnome-ghttp-check.m4
3873 * config/gnome/gnome-gnorba-check.m4
3874 * config/gnome/gnome-guile-checks.m4
3875 * config/gnome/gnome-libgtop-check.m4
3876 * config/gnome/gnome-objc-checks.m4
3877 * config/gnome/gnome-orbit-check.m4
3878 * config/gnome/gnome-print-check.m4
3879 * config/gnome/gnome-pthread-check.m4
3880 * config/gnome/gnome-support.m4
3881 * config/gnome/gnome-undelfs.m4
3882 * config/gnome/gnome-vfs.m4
3883 * config/gnome/gnome-x-checks.m4
3884 * config/gnome/gnome-xml-check.m4
3885 * config/gnome/gnome.m4
3886 * config/gnome/gperf-check.m4
3887 * config/gnome/gtk--.m4
3888 * config/gnome/linger.m4
3889 * config/gnome/need-declaration.m4: added configuration scripts
3890 for Gtk/Gnome frontend-GUI
3892 * configure.in: added support for the --with-frontend=gtk option
3894 * autogen.sh: added config/gnome/* to list of config-files
3896 * acconfig.h: added define for GTKGUI-support
3898 * config/lyxinclude.m4: added --with-frontend[=value] option value
3899 for Gtk/Gnome frontend-GUI support.
3901 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3903 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
3907 * src/paragraph.C (GetChar): remove non-const version
3909 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
3910 (search_kw): use it.
3912 * src/lyx_main.C (init): if "preferences" exist, read that instead
3914 (ReadRcFile): return bool if the file could be read ok.
3915 (ReadUIFile): add a check to see if lex file is set ok.
3917 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
3918 bastring can be used instead of lyxstring (still uses the old code
3919 if std::string is good enough or if lyxstring is used.)
3921 * src/encoding.C: make the arrays static, move ininle functions
3923 * src/encoding.h: from here.
3925 * src/buffer.C: have last_isnet_read as a file scope variable for now.
3926 (parseSingleLyXformat2Token): move inset parsing to separate method
3927 (readInset): new private method
3929 * src/Variables.h: remove virtual from get().
3931 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
3932 access to NEW_INSETS and NEW_TABULAR
3934 * src/MenuBackend.h: remove superfluous forward declaration of
3935 MenuItem. Add documentations tags "///", remove empty MenuItem
3936 destructor, remove private default contructor.
3938 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
3940 (read): more string mlabel and mname to where they are used
3941 (read): remove unused variables mlabel and mname
3942 (defaults): unconditional clear, make menusetup take advantage of
3943 add returning Menu &.
3945 * src/LyXView.h: define NEW_MENUBAR as default
3947 * src/LyXAction.C: include lyxparagraph.h temporary to get access
3948 to NEW_INSETS and NEW_TABULAR.
3949 (init): commetn out some funcs that is obsolete when NEW_INSETS is
3950 defined. Change some of the "xxxx-inset-insert" functions names to
3953 * several files: more enahncements to NEW_INSETS and the resulting
3956 * lib/lyxrc.example (\date_insert_format): move to misc section
3958 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
3959 bastring and use AC_CACHE_CHECK.
3960 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
3961 the system have the newest methods. uses AC_CACHE_CHECK
3962 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
3963 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
3964 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
3966 * configure.in: add LYX_CXX_GOOD_STD_STRING
3968 * acinclude.m4: recreated
3970 2000-07-24 Amir Karger <karger@lyx.org>
3972 * README: add Hebrew, Arabic kmaps
3975 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3977 * src/buffer.C (writeFileAscii): Define actcell as an int instead
3980 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3982 * Lot of files: add pragma interface/implementation.
3984 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
3986 * lib/ui/default.ui: new file (ans new directory). Contains the
3987 default menu and toolbar.
3989 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
3990 global space. Toolbars are now read (as menus) in ui files.
3992 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
3994 * src/lyxfunc.C (getStatus): do not exit immediately if a command
3995 is disabled because the document is read-only. We want to have the
3996 toggle state of the function anyway.
3997 (getStatus): add code for LFUN_VC* functions (mimicking what is
3998 done in old-style menus)
4000 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
4001 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
4003 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
4004 * src/BufferView_pimpl.C: ditto.
4005 * src/lyxfunc.C: ditto.
4007 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
4008 default). This replaces old-style menus by new ones.
4010 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
4011 MenuItem. Contain the data structure of a menu.
4013 * src/insets/insettext.C: use LyXView::setLayout instead of
4014 accessing directly the toolbar combox.
4015 * src/lyxfunc.C (Dispatch): ditto.
4017 * src/LyXView.C (setLayout): new method, which just calls
4018 Toolbar::setLayout().
4019 (updateLayoutChoice): move part of this method in Toolbar.
4021 * src/toolbar.[Ch]: removed.
4023 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
4024 implementation the toolbar.
4026 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
4027 the toolbar. It might make sense to merge it with ToolbarDefaults
4029 (setLayout): new function.
4030 (updateLayoutList): ditto.
4031 (openLayoutList): ditto.
4033 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
4034 xforms implementation of the toolbar.
4035 (get_toolbar_func): comment out, since I do not
4036 know what it is good for.
4038 * src/ToolbarDefaults.h: Add the ItemType enum.
4040 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
4041 for a list of allocated C strings. Used in Menubar xforms
4042 implementation to avoid memory leaks.
4044 * src/support/lstrings.[Ch] (uppercase): new version taking and
4048 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
4049 * lib/bind/emacs.bind: ditto.
4051 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4053 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
4054 forward decl of LyXView.
4056 * src/toolbar.C (toolbarItem): moved from toolbar.h
4057 (toolbarItem::clean): ditto
4058 (toolbarItem::~toolbarItem): ditto
4059 (toolbarItem::operator): ditto
4061 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
4063 * src/paragraph.h: control the NEW_TABULAR define from here
4065 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
4066 USE_TABULAR_INSETS to NEW_TABULAR
4068 * src/ToolbarDefaults.C: add include "lyxlex.h"
4070 * files using the old table/tabular: use NEW_TABULAR to control
4071 compilation of old tabular stuff.
4073 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
4076 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
4077 planemet in reading of old style floats, fix the \end_deeper
4078 problem when reading old style floats.
4080 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4082 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
4084 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
4086 * lib/bind/sciword.bind: updated.
4088 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4090 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
4091 layout write problem
4093 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4095 * src/Makefile.am (INCLUDES): remove image directory from include
4098 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
4099 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
4101 * src/LyXView.C (create_form_form_main): read the application icon
4104 * lib/images/*.xpm: change the icons to use transparent color for
4107 * src/toolbar.C (update): change the color of the button when it
4110 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4112 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
4113 setting explicitely the minibuffer.
4114 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
4116 * src/LyXView.C (showState): new function. Shows font information
4117 in minibuffer and update toolbar state.
4118 (LyXView): call Toolbar::update after creating the
4121 * src/toolbar.C: change toollist to be a vector instead of a
4123 (BubbleTimerCB): get help string directly from the callback
4124 argument of the corresponding icon (which is the action)
4125 (set): remove unnecessary ugliness.
4126 (update): new function. update the icons (depressed, disabled)
4127 depending of the status of the corresponding action.
4129 * src/toolbar.h: remove help in toolbarItem
4131 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
4133 * src/Painter.C (text): Added code for using symbol glyphs from
4134 iso10646 fonts. Currently diabled.
4136 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
4139 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
4140 magyar,turkish and usorbian.
4142 * src/paragraph.C (isMultiLingual): Made more efficient.
4144 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
4147 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
4148 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
4149 Also changed the prototype to "bool math_insert_greek(char)".
4151 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4153 * lots of files: apply the NEW_INSETS on all code that will not be
4154 needed when we move to use the new insets. Enable the define in
4155 lyxparagrah.h to try it.
4157 * src/insets/insettabular.C (cellstart): change to be a static
4159 (InsetTabular): initialize buffer in the initializer list.
4161 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
4163 * src/frontends/xforms/FormPrint.[Ch] : moved #include
4164 form_print.h out of the header file. Replaced with forward
4165 declarations of the relevant struct.
4167 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
4170 * src/commandtags.h: do not include "debug.h" which does not
4171 belong there. #include it in some other places because of this
4174 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4176 * src/insets/insetcaption.C: add a couple "using" directives.
4178 * src/toolbar.C (add): get the help text directly from lyxaction.
4180 (setPixmap): new function. Loads from disk and sets a pixmap on a
4181 botton; the name of the pixmap file is derived from the command
4184 * src/toolbar.h: remove members isBitmap and pixmap from
4187 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
4188 * lib/images/: move many files from images/banner.xpm.
4190 * src/lyx_gui.C (create_forms): read banner pixmap from file.
4192 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
4193 * src/toolbar.C: ditto.
4194 * configure.in: ditto.
4195 * INSTALL: document.
4197 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
4198 the spellchecker popup is closed from the WM.
4200 2000-07-19 Juergen Vigna <jug@sad.it>
4202 * src/insets/insetfloat.C (Write): small fix because we use the
4203 insetname for the type now!
4205 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
4207 * src/frontends/xforms/forms/form_citation.fd: object sizes are
4210 * src/frontends/Dialogs.h: removed hideCitation signal
4212 * src/insets/insetcite.h: added hide signal
4214 * src/insets/insetcite.C (~InsetCitation): emits new signal
4215 (getScreenLabel): "intelligent" label should now fit on the screen!
4217 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
4219 * src/frontends/xforms/FormCitation.C (showInset): connects
4220 hide() to the inset's hide signal
4221 (show): modified to use fl_set_object_position rather than
4222 fl_set_object_geometry wherever possible
4224 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4226 * src/insets/lyxinset.h: add caption code
4228 * src/insets/insetfloat.C (type): new method
4230 * src/insets/insetcaption.C (Write): new method
4232 (LyxCode): new method
4234 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
4235 to get it right together with using the FloatList.
4237 * src/commandtags.h: add LFUN_INSET_CAPTION
4238 * src/lyxfunc.C (Dispatch): handle it
4240 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
4243 * src/Variables.[Ch]: make expand take a const reference, remove
4244 the destructor, some whitespace changes.
4246 * src/LyXAction.C (init): add caption-inset-insert
4248 * src/FloatList.C (FloatList): update the default floats a bit.
4250 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4252 * src/Variables.[Ch]: new files. Intended to be used for language
4253 specific strings (like \chaptername) and filename substitution in
4256 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
4258 * lib/kbd/american.kmap: update
4260 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
4262 * src/bufferparams.[Ch]: remove member allowAccents.
4264 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
4266 * src/LaTeXLog.C: use the log_form.h header.
4267 * src/lyx_gui.C: ditto.
4268 * src/lyx_gui_misc.C: ditto.
4269 * src/lyxvc.h: ditto.
4271 * forms/log_form.fd: new file, created from latexoptions.fd. I
4272 kept the log popup and nuked the options form.
4274 * src/{la,}texoptions.[Ch]: removed.
4275 * src/lyx_cb.C (LaTeXOptions): ditto
4277 * src/lyx_gui.C (create_forms): do not handle the
4278 fd_latex_options form.
4280 2000-07-18 Juergen Vigna <jug@sad.it>
4282 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
4283 name of the inset so that it can be requested outside (text2.C).
4285 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
4288 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4290 * src/mathed/formula.h (ConvertFont): constify
4292 * src/mathed/formula.C (Read): add warning if \end_inset is not
4293 found on expected place.
4295 * src/insets/lyxinset.h (ConvertFont): consify
4297 * src/insets/insetquotes.C (ConvertFont): constify
4298 * src/insets/insetquotes.h: ditto
4300 * src/insets/insetinfo.h: add labelfont
4302 * src/insets/insetinfo.C (InsetInfo): set the labelfont
4303 (ascent): use labelfont
4307 (Write): make .lyx file a bit nicer
4309 * src/insets/insetfloat.C (Write): simplify somewhat...
4310 (Read): add warning if arg is not found
4312 * src/insets/insetcollapsable.C: add using std::max
4313 (Read): move string token and add warning in arg is not found
4314 (draw): use std::max to get the right ty
4315 (getMaxWidth): simplify by using std::max
4317 * src/insets/insetsection.h: new file
4318 * src/insets/insetsection.C: new file
4319 * src/insets/insetcaption.h: new file
4320 * src/insets/insetcaption.C: new file
4322 * src/insets/inset.C (ConvertFont): constify signature
4324 * src/insets/Makefile.am (libinsets_la_SOURCES): add
4325 insetcaption.[Ch] and insetsection.[Ch]
4327 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
4328 uses to use LABEL_COUNTER_CHAPTER instead.
4329 * src/text2.C (SetCounter): here
4331 * src/counters.h: new file
4332 * src/counters.C: new file
4333 * src/Sectioning.h: new file
4334 * src/Sectioning.C: new file
4336 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
4338 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4340 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
4343 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
4346 2000-07-17 Juergen Vigna <jug@sad.it>
4348 * src/tabular.C (Validate): check if array-package is needed.
4349 (SetVAlignment): added support for vertical alignment.
4350 (SetLTFoot): better support for longtable header/footers
4351 (Latex): modified to support added features.
4353 * src/LaTeXFeatures.[Ch]: added array-package.
4355 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
4357 * src/lyx_gui.C (LyXGUI): make sure that the height is large
4360 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
4362 * configure.in: do not forget to put a space after -isystem.
4364 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
4366 * lib/kbd/arabic.kmap: a few fixes.
4368 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4370 * some whitespace chagnes to a number of files.
4372 * src/support/DebugStream.h: change to make it easier for
4373 doc++ to parse correctly.
4374 * src/support/lyxstring.h: ditto
4376 * src/mathed/math_utils.C (compara): change to have only one
4378 (MathedLookupBOP): change because of the above.
4380 * src/mathed/math_delim.C (math_deco_compare): change to have only
4382 (search_deco): change becasue of the above.
4384 * src/insets/insettabular.C (DrawCellSelection): use std::swap
4385 instead of manually coded one.
4387 * src/insets/insetquotes.C (Read): read the \end_inset too
4389 * src/insets/insetlatex.h: remove file
4390 * src/insets/insetlatex.C: remove file
4392 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
4394 (InsetPrintIndex): remove destructor
4396 * src/insets/insetinclude.h: remove default constructor
4398 * src/insets/insetfloat.C: work to make it work better
4400 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
4402 * src/insets/insetcite.h (InsetCitation): remove default constructor
4404 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
4406 * src/text.C (GetColumnNearX): comment out some currently unused code.
4408 * src/paragraph.C (writeFile): move some initializations closer to
4410 (CutIntoMinibuffer): small change to use new matchIT operator
4414 (InsertInset): ditto
4417 (InsetIterator): ditto
4418 (Erase): small change to use new matchFT operator
4420 (GetFontSettings): ditto
4421 (HighestFontInRange): ditto
4424 * src/lyxparagraph.h: some chars changed to value_type
4425 (matchIT): because of some stronger checking (perhaps too strong)
4426 in SGI STL, the two operator() unified to one.
4429 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
4431 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
4432 the last inset read added
4433 (parseSingleLyXformat2Token): some more (future) compability code added
4434 (parseSingleLyXformat2Token): warning about solitary \end_inset added
4435 (parseSingleLyXformat2Token): set last_inset_read
4436 (parseSingleLyXformat2Token): more code to read new "Float" correctly
4437 (parseSingleLyXformat2Token): don't double intializw string next_token
4439 * src/TextCache.C (text_fits::operator()): add const's to the signature
4440 (has_buffer::operator()): ditto
4442 * src/Floating.h: add some comments on the class
4444 * src/FloatList.[Ch] (typeExist): new method
4447 * src/BackStack.h: added default constructor, wanted by Gcc.
4449 2000-07-14 Juergen Vigna <jug@sad.it>
4451 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
4453 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
4455 * src/insets/insettabular.C (resizeLyXText): need this to be able to
4456 do a redraw when the window is resized!
4457 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
4459 * src/insets/insettext.C (resizeLyXText): added function to correctly
4460 being able to resize the LyXWindow.
4462 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
4464 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
4466 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
4467 crashes when closing dialog to a deleted inset.
4469 * src/insets/insetcite.[Ch] (Edit) : the return of this former
4470 method! Now similar to other insets.
4472 2000-07-13 Juergen Vigna <jug@sad.it>
4474 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
4476 * lib/examples/Literate.lyx: small patch!
4478 * src/insets/insetbib.C (Read): added this function because of wrong
4479 Write (without [begin|end]_inset).
4481 2000-07-11 Juergen Vigna <jug@sad.it>
4483 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
4484 as the insertInset could not be good!
4486 * src/screen.C (ToggleSelection): fixed toggle selection bug as
4487 the bool param should not be last.
4489 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4491 * sigc++/configure.in: fix bug in threading-related code (Yes, I
4492 did submit that to Karl).
4494 * configure.in: use -isystem instead of -I for X headers. This
4495 fixes a problem on solaris with a recent gcc;
4496 put the front-end code after the X detection code;
4497 configure in sigc++ before lib/
4499 * src/lyx_main.C (commandLineHelp): remove -display from command
4502 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
4504 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
4505 Also put in Makefile rules for building the ``listerrors''
4506 program for parsing errors from literate programs written in LyX.
4508 * lib/build-listerrors: Added small shell script as part of compile
4509 process. This builds a working ``listerrors'' binary if noweb is
4510 installed and either 1) the VNC X server is installed on the machine,
4511 or 2) the user is compiling from within a GUI. The existence of a GUI
4512 is necessary to use the ``lyx --export'' feature for now. This
4513 hack can be removed once ``lyx --export'' no longer requires a GUI to
4516 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
4518 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
4519 now passed back correctly from gcc and placed "under" error
4520 buttons in a Literate LyX source.
4522 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4524 * src/text.C (GetColumnNearX): Better behavior when a RTL
4525 paragraph is ended by LTR text.
4527 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
4530 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4532 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
4533 true when clipboard is empty.
4535 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4537 * text.C (Backspace): Prevent rebreaking of a row if it is the last
4538 row of the paragraph.
4539 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
4540 to prevent calculation of bidi tables
4542 2000-07-07 Juergen Vigna <jug@sad.it>
4544 * src/screen.C (ToggleSelection): added y_offset and x_offset
4547 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
4550 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
4552 * src/insets/insettext.C: fixed Layout-Display!
4554 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4556 * configure.in: add check for strings.h header.
4558 * src/spellchecker.C: include <strings.h> in order to have a
4559 definition for bzero().
4561 2000-07-07 Juergen Vigna <jug@sad.it>
4563 * src/insets/insettext.C (draw): set the status of the bv->text to
4564 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
4566 * src/screen.C (DrawOneRow):
4567 (DrawFromTo): redraw the actual row if something has changed in it
4570 * src/text.C (draw): call an update of the toplevel-inset if something
4571 has changed inside while drawing.
4573 * src/lyxtext.h: added CHANGED_IN_DRAW status.
4575 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
4577 * src/insets/insetbib.[Ch] (callback) new method, moving callback
4578 processing inside class.
4580 * src/insets/insetindex.[Ch] (callback) new method, moving callback
4581 processing inside class.
4583 * src/insets/insetindex.h new struct Holder, consistent with other
4586 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
4587 citation dialog from main code and placed it in src/frontends/xforms.
4588 Dialog launched through signals instead of callbacks
4590 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
4592 * lyx.man: update the options description.
4594 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
4596 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
4597 handle neg values, set min width to 590, add doc about -display
4599 2000-07-05 Juergen Vigna <jug@sad.it>
4601 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
4602 calls to BufferView *.
4604 * src/insets/insettext.C (checkAndActivateInset): small fix non
4605 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
4607 * src/insets/insetcommand.C (Read): Fixed as insets should read till
4608 their \end_inset token!
4610 2000-07-04 edscott <edscott@imp.mx>
4612 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
4613 lib/lyxrc.example: added option \wheel_jump
4615 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
4617 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
4618 remove support for -width,-height,-xpos and -ypos.
4620 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
4622 * src/encoding.[Ch]: New files.
4624 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
4625 (text): Call to the underline() method only when needed.
4627 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
4629 * src/buffer.C (makeLaTeXFile): Compute automatically the input
4630 encoding(s) for the document.
4632 * src/bufferparams.C (BufferParams): Changed default value of
4635 * src/language.C (newLang): Removed.
4636 (items[]): Added encoding information for all defined languages.
4638 * src/lyx_gui.C (create_forms): Added "auto" option to the input
4639 encoding choice button.
4641 * src/lyxrc.h (font_norm_type): New member variable.
4642 (set_font_norm_type): New method.
4644 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
4645 paragraphs with different encodings.
4647 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
4648 (TransformChar): Changed to work correctly with Arabic points.
4649 (draw): Added support for drawing Arabic points.
4650 (draw): Removed code for drawing underbars (this is done by
4653 * src/support/textutils.h (IsPrintableNonspace): New function.
4655 * src/BufferView_pimpl.h: Added "using SigC::Object".
4656 * src/LyXView.h: ditto.
4658 * src/insets/insetinclude.h (include_label): Changed to mutable.
4660 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4662 * src/mathed/math_iter.h: remove empty destructor
4664 * src/mathed/math_cursor.h: remove empty destructor
4666 * src/insets/lyxinset.h: add THEOREM_CODE
4668 * src/insets/insettheorem.[Ch]: new files
4670 * src/insets/insetminipage.C: (InsertInset): remove
4672 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
4674 (InsertInset): remove
4676 * src/insets/insetlist.C: (InsertList): remove
4678 * src/insets/insetfootlike.[Ch]: new files
4680 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
4683 (InsertInset): ditto
4685 * src/insets/insetert.C: remove include Painter.h, reindent
4686 (InsertInset): move to header
4688 * src/insets/insetcollapsable.h: remove explicit from default
4689 contructor, remove empty destructor, add InsertInset
4691 * src/insets/insetcollapsable.C (InsertInset): new func
4693 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
4695 * src/vspace.h: add explicit to constructor
4697 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
4698 \textcompwordmark, please test this.
4700 * src/lyxrc.C: set ascii_linelen to 65 by default
4702 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
4704 * src/commandtags.h: add LFUN_INSET_THEOREM
4706 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
4707 (makeLinuxDocFile): remove _some_ of the nice logic
4708 (makeDocBookFile): ditto
4710 * src/Painter.[Ch]: (~Painter): removed
4712 * src/LyXAction.C (init): entry for insettheorem added
4714 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
4716 (deplog): code to detect files generated by LaTeX, needs testing
4719 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4721 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
4723 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4725 * src/LaTeX.C (deplog): Add a check for files that are going to be
4726 created by the first latex run, part of the project to remove the
4729 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
4730 contents to the extension list.
4732 2000-07-04 Juergen Vigna <jug@sad.it>
4734 * src/text.C (NextBreakPoint): added support for needFullRow()
4736 * src/insets/lyxinset.h: added needFullRow()
4738 * src/insets/insetcollapsable.C: redone now this uses a text-inset
4741 * src/insets/insettext.C: lots of changes for update!
4743 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
4745 * src/LaTeXFeatures.h: add a missing std:: qualifier.
4747 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
4749 * src/insets/insetinclude.C (InsetInclude): fixed
4750 initialization of include_label.
4751 (unique_id): now returns a string.
4753 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
4755 * src/LaTeXFeatures.h: new member IncludedFiles, for
4756 a map of key, included file name.
4758 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
4759 with the included files for inclusion in SGML preamble,
4760 i. e., linuxdoc and docbook.
4763 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
4764 nice (is the generated linuxdoc code to be exported?), that
4765 allows to remove column, and only_body that will be true for
4766 slave documents. Insets are allowed inside SGML font type.
4767 New handling of the SGML preamble for included files.
4768 (makeDocBookFile): the same for docbook.
4770 * src/insets/insetinclude.h:
4771 * src/insets/insetinclude.C (Validate): keeps a list of included files.
4773 (DocBook): new export methods.
4775 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
4776 and makeDocBookFile.
4778 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
4779 formats to export with command line argument -x.
4781 2000-06-29 Juergen Vigna <jug@sad.it>
4783 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
4784 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
4786 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
4787 region could already been cleared by an inset!
4789 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4791 * src/BufferView_pimpl.h: remove member variables lyx_focus and
4794 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
4796 (cursorToggle): remove special handling of lyx focus.
4798 2000-06-28 Juergen Vigna <jug@sad.it>
4800 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
4803 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4805 * src/insets/insetindex.C (Edit): add a callback when popup is
4808 * src/insets/insettext.C (LocalDispatch):
4809 * src/insets/insetmarginal.h:
4810 * src/insets/insetlist.h:
4811 * src/insets/insetfoot.h:
4812 * src/insets/insetfloat.h:
4813 * src/insets/insetert.h: add a missing std:: qualifier.
4815 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4817 * src/support/lyxsum.C (sum): '\0' teminate file read when using
4820 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
4822 * src/insets/insettext.C (Read): remove tmptok unused variable
4823 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
4824 (InsertInset): change for new InsetInset code
4826 * src/insets/insettext.h: add TEXT inline method
4828 * src/insets/insettext.C: remove TEXT macro
4830 * src/insets/insetmarginal.C (Write): new method
4831 (Latex): change output slightly
4833 * src/insets/insetfoot.C (Write): new method
4834 (Latex): change output slightly (don't use endl when no need)
4836 * src/insets/insetert.C (Write): new method
4838 * src/insets/insetcollapsable.h: make button_length, button_top_y
4839 and button_bottm_y protected.
4841 * src/insets/insetcollapsable.C (Write): simplify code by using
4842 tostr. Also do not output the float name, the children class
4843 should to that to get control over own arguments
4845 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
4846 src/insets/insetminipage.[Ch]:
4849 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
4851 * src/lyxfunc.C (Dispatch): cases for new insets/commands
4853 * src/Makefile.am (lyx_SOURCES): add the new files
4855 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
4856 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
4857 * src/commandtags.h: ditto
4859 * src/LaTeXFeatures.h: add a std::set of used floattypes
4861 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
4863 * src/FloatList.[Ch] src/Floating.h: new files
4865 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
4867 * src/lyx_cb.C (TableApplyCB): ditto
4869 * src/text2.C: ditto
4870 * src/buffer.C (SimpleLinuxDocOnePar): ditto
4871 (parseSingleLyXformat2Token): ditto + add code for
4872 backwards compability for old float styles + add code for new insets
4874 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
4876 (InsertInset(size_type, Inset *, LyXFont)): new method
4877 (InsetChar(size_type, char)): changed to use the other InsetChar
4878 with a LyXFont(ALL_INHERIT).
4879 (InsetInset(size_type, Inset*)): changed to use InsetChar to
4880 insert the META_INSET.
4882 * sigc++/thread.cc (Privete<int>::operator int&): move definition
4884 * sigc++/thread.h (Threads): from here
4886 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
4887 definition out of line
4888 * sigc++/scope.h: from here
4890 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4892 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
4893 is specified (adapted from a patch from edscott <edscott@imp.mx>).
4895 * Makefile.am (bindist): new target.
4897 * INSTALL: add instructions for doing a binary distribution.
4899 * development/tools/README.bin.example: update a bit.
4901 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
4904 * lib/lyxrc.example: new lyxrc tag \set_color.
4906 * src/lyxfunc.C (Dispatch):
4907 * src/commandtags.h:
4908 * src/LyXAction.C: new lyxfunc "set-color".
4910 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
4911 and an x11name given as strings.
4913 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
4914 cache when a color is changed.
4916 2000-06-26 Juergen Vigna <jug@sad.it>
4918 * src/lyxrow.C (width): added this functions and variable.
4920 * src/insets/insetcite.C (create_form_citation_form): some Gravity
4923 * src/text.C (SetHeightOfRow): fixed calcualting of width.
4925 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4927 * images/undo_bw.xpm: new icon.
4928 * images/redo_bw.xpm: ditto.
4930 * configure.in (INSTALL_SCRIPT): change value to
4931 ${INSTALL} to avoid failures of install-script target.
4932 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
4934 * src/BufferView.h: add a magic "friend" declaration to please
4937 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
4939 * forms/cite.fd: modified to allow resizing without messing
4942 * src/insetcite.C: Uses code from cite.fd almost without
4944 User can now resize dialog in the x-direction.
4945 Resizing the dialog in the y-direction is prevented, as the
4946 code does this intelligently already.
4948 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4950 * INSTALL: remove obsolete entry in "problems" section.
4952 * lib/examples/sl_*.lyx: update of the slovenian examples.
4954 * src/support/FileInfo.[Ch] (getBlockSize): remove.
4956 2000-06-23 Juergen Vigna <jug@sad.it>
4958 * src/lyxtext.h: added a 'cleared' flag to draw() function.
4960 * src/buffer.C (resize): delete the LyXText of textinsets.
4962 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
4964 * src/insets/lyxinset.h: added another parameter 'cleared' to
4965 the draw() function.
4967 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
4968 unlocking inset in inset.
4970 2000-06-22 Juergen Vigna <jug@sad.it>
4972 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
4973 of insets and moved first to LyXText.
4975 * src/mathed/formulamacro.[Ch]:
4976 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
4978 2000-06-21 Juergen Vigna <jug@sad.it>
4980 * src/text.C (GetVisibleRow): look if I should clear the area or not
4981 using Inset::doClearArea() function.
4983 * src/insets/lyxinset.h: added doClearArea() function and
4984 modified draw(Painter &, ...) to draw(BufferView *, ...)
4986 * src/text2.C (UpdateInset): return bool insted of int
4988 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
4990 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
4991 combox in the character popup
4993 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
4994 BufferParams const & params
4996 2000-06-20 Juergen Vigna <jug@sad.it>
4998 * src/insets/insettext.C (SetParagraphData): set insetowner on
5001 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5003 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
5004 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
5006 (form_main_): remove
5008 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
5009 (create_form_form_main): remove FD_form_main stuff, connect to
5010 autosave_timeout signal
5012 * src/LyXView.[Ch] (getMainForm): remove
5013 (UpdateTimerCB): remove
5014 * src/BufferView_pimpl.h: inherit from SigC::Object
5016 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
5017 signal instead of callback
5019 * src/BufferView.[Ch] (cursorToggleCB): remove
5021 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5023 * src/BufferView_pimpl.C: changes because of the one below
5025 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
5026 instead of storing a pointer to a LyXText.
5028 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
5030 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
5032 * src/lyxparagraph.h
5034 * src/paragraph.C: Changed fontlist to a sorted vector.
5036 2000-06-19 Juergen Vigna <jug@sad.it>
5038 * src/BufferView.h: added screen() function.
5040 * src/insets/insettext.C (LocalDispatch): some selection code
5043 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
5045 * src/insets/insettext.C (SetParagraphData):
5047 (InsetText): fixes for multiple paragraphs.
5049 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
5051 * development/lyx.spec.in: Call configure with ``--without-warnings''
5052 to work around a bug with the Makefiles when doing ``make lyxrpm''.
5053 This should be fine, however, since we generally don't want to be
5054 verbose when making an RPM.
5056 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
5058 * lib/scripts/fig2pstex.py: New file
5060 2000-06-16 Juergen Vigna <jug@sad.it>
5062 * src/insets/insettabular.C (UpdateLocal):
5063 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
5064 (LocalDispatch): Changed all functions to use LyXText.
5066 2000-06-15 Juergen Vigna <jug@sad.it>
5068 * src/text.C (SetHeightOfRow): call inset::update before requesting
5071 * src/insets/insettext.C (update):
5072 * src/insets/insettabular.C (update): added implementation
5074 * src/insets/lyxinset.h: added update function
5076 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5078 * src/text.C (SelectNextWord): protect against null pointers with
5079 old-style string streams. (fix from Paul Theo Gonciari
5082 * src/cite.[Ch]: remove erroneous files.
5084 * lib/configure.m4: update the list of created directories.
5086 * src/lyxrow.C: include <config.h>
5087 * src/lyxcursor.C: ditto.
5089 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5091 * lib/examples/decimal.lyx: new example file from Mike.
5093 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
5094 to find template definitions (from Dekel)
5096 * src/frontends/.cvsignore: add a few things.
5098 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
5100 * src/Timeout.C (TimeOut): remove default argument.
5102 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
5105 * src/insets/ExternalTemplate.C: add a "using" directive.
5107 * src/lyx_main.h: remove the act_ struct, which seems unused
5110 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5112 * LyX Developers Meeting: All files changed, due to random C++ (by
5113 coincidence) code generator script.
5115 - external inset (cool!)
5116 - initial online editing of preferences
5117 - insettabular breaks insettext(s contents)
5119 - some DocBook fixes
5120 - example files update
5121 - other cool stuff, create a diff and look for yourself.
5123 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
5125 * src/insets/insettext.C (computeTextRows): if the maxWidth is
5126 -1 this is a non-line-breaking textinset.
5128 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
5129 if there is no width set.
5131 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5133 * Lots of files: Merged the dialogbase branch.
5135 2000-06-09 Allan Rae <rae@lyx.org>
5137 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
5138 and the Dispatch methods that used it.
5140 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
5141 access to functions formerly kept in Dispatch.
5143 2000-05-19 Allan Rae <rae@lyx.org>
5145 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
5146 made to_page and count_copies integers again. from_page remains a
5147 string however because I want to allow entry of a print range like
5148 "1,4,22-25" using this field.
5150 * src/LyXAction.C: added action info and commands for buffer-print-xtl
5151 and printer-params-get. These aren't useful from the minibuffer but
5152 could be used by a script/LyXServer app provided it passes a suitable
5153 auto_mem_buffer. I guess I should take a look at how the LyXServer
5154 works and make it support xtl buffers.
5156 * sigc++/: updated to libsigc++-1.0.1
5158 * src/xtl/: updated to xtl-1.3.pl.11
5160 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
5161 those changes done to the files in src/ are actually recreated when
5162 they get regenerated. Please don't ever accept a patch that changes a
5163 dialog unless that patch includes the changes to the corresponding *.fd
5166 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
5167 stringOnlyContains, renamed it and generalised it.
5169 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
5170 branch. Removed the remaining old form_print code.
5172 2000-04-26 Allan Rae <rae@lyx.org>
5174 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
5175 trap I was trying to fix with the ID: fields in src/xtl/ :-)
5177 2000-04-25 Allan Rae <rae@lyx.org>
5179 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
5180 against a base of xtl-1.3.pl.4
5182 * development/tools/lxtl.sh: fixed a couple of silly typos and now
5183 filter the Id: entries so they still show the xtl version number
5186 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
5187 into the src/xtl code. Patch still pending with José (XTL)
5189 2000-04-24 Allan Rae <rae@lyx.org>
5191 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
5192 both more generic and much safer. Use the new template functions.
5193 * src/buffer.[Ch] (Dispatch): ditto.
5195 * src/frontends/xforms/FormPrint.C (update): Use new template functions
5196 and mem buffer more intelligently. Also a little general cleanup.
5199 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
5200 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
5201 * src/xtl/Makefile.am: ditto.
5202 * src/xtl/.cvsignore: ditto.
5203 * src/Makefile.am: ditto.
5205 * src/PrinterParams.h: Removed the macros member functions. Added a
5206 testInvariant member function. A bit of tidying up and commenting.
5207 Included Angus's idea for fixing operation with egcs-1.1.2.
5209 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
5210 cool expansion of XTL's mem_buffer to support automatic memory
5211 management within the buffer itself. Removed the various macros and
5212 replaced them with template functions that use either auto_mem_buffer
5213 or mem_buffer depending on a #define. The mem_buffer support will
5214 disappear as soon as the auto_mem_buffer is confirmed to be good on
5215 other platforms/compilers. That is, it's there so you've got something
5218 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
5219 effectively forked XTL. However I expect José will include my code
5220 into the next major release. Also fixed a memory leak.
5221 * src/xtl/text.h: ditto.
5222 * src/xtl/xdr.h: ditto.
5223 * src/xtl/giop.h: ditto.
5225 2000-04-16 Allan Rae <rae@lyx.org>
5227 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
5228 by autogen.sh and removed by maintainer-clean anyway.
5229 * .cvsignore, sigc++/.cvsignore: Support the above.
5231 * sigc++/.cvsignore: Forgot that retbind.h was generated.
5233 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
5235 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
5236 macros, renamed static callback-target member functions to suit new
5237 scheme and made them public.
5238 * src/frontends/xforms/forms/form_print.fd: ditto.
5239 * src/frontends/xforms/forms/form_copyright.fd: ditto.
5241 * src/support/lxtl.h: small cleanup to use typedef instead of #define
5244 * src/xtl/: New directory containing a minimal distribution of XTL.
5245 This is XTL-1.3.pl.4.
5247 * development/tools/lxtl.sh: A script to generate the above mini-dist.
5249 2000-04-15 Allan Rae <rae@lyx.org>
5251 * development/tools/makeLyXsigc.sh: Remove the library version numbers
5253 * sigc++/: Updated to libsigc++-1.0.0
5255 2000-04-14 Allan Rae <rae@lyx.org>
5257 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
5258 use the generic ones in future. I'll modify my conversion script.
5260 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
5262 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
5263 (CloseAllBufferRelatedDialogs): Renamed.
5264 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
5266 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
5267 of the generic ones. These are the same ones my conversion script
5270 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
5271 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
5272 * src/buffer.C (Dispatch): ditto
5274 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
5275 functions for updating and hiding buffer dependent dialogs.
5276 * src/BufferView.C (buffer): ditto
5277 * src/buffer.C (setReadonly): ditto
5278 * src/lyxfunc.C (CloseBuffer): ditto
5280 * src/buffer.h: Take setReadonly() out of line so I don't have to include
5281 Dialogs.h, and hence all the SigC stuff, into every file that includes
5282 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
5284 * src/BufferView2.C: reduce the number of headers included by buffer.h
5286 2000-04-11 Allan Rae <rae@lyx.org>
5288 * src/frontends/xforms/xform_macros.h: A small collection of macros
5289 for building C callbacks.
5291 * src/frontends/xforms/Makefile.am: Added above file.
5293 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
5294 scheme again. This time it should work for JMarc. If this is
5295 successful I'll revise my conversion script to automate some of this.
5296 The static member functions in the class also have to be public for
5297 this scheme will work. If the scheme works (it's almost identical to
5298 the way BufferView::cursorToggleCB is handled so it should work) then
5299 FormCopyright and FormPrint will be ready for inclusion into the main
5300 trunk immediately after 1.1.5 is released -- provided we're prepared
5301 for complaints about lame compilers not handling XTL.
5303 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
5305 2000-04-07 Allan Rae <rae@lyx.org>
5307 * config/lyxinclude.m4: A bit more tidying up (Angus)
5309 * src/LString.h: JMarc's <string> header fix
5311 * src/PrinterParams.h: Used string for most data to remove some
5312 ugly code in the Print dialog and avoid even uglier code when
5313 appending the ints to a string for output.
5315 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
5316 and moved "default:" back to the end of switch statement. Cleaned
5317 up the printing so it uses the right function calls and so the
5318 "print to file" option actually puts the file in the right directory.
5320 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
5322 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
5323 and Ok+Apply button control into a separate method: input (Angus).
5324 (input) Cleaned it up and improved it to be very thorough now.
5325 (All CB) static_cast used instead of C style cast (Angus). This will
5326 probably change again once we've worked out how to keep gcc-2.8.1 happy
5327 with real C callbacks.
5328 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
5329 ignore some of the bool settings and has random numbers instead. Needs
5330 some more investigation. Added other input length checks and checking
5331 of file and printer names.
5333 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
5334 would link (Angus). Seems the old code doesn't compile with the pragma
5335 statement either. Separated callback entries from internal methods.
5337 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
5339 2000-03-17 Allan Rae <rae@lyx.org>
5341 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
5342 need it? Maybe it could go in Dialogs instead? I could make it a
5343 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
5344 values to get the bool return value.
5345 (Dispatch): New overloaded method for xtl support.
5347 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
5348 extern "C" callback instead of static member functions. Hopefully,
5349 JMarc will be able to compile this. I haven't changed
5350 forms/form_copyright.fd yet. Breaking one of my own rules already.
5352 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
5353 because they aren't useful from the minibuffer. Maybe a LyXServer
5354 might want a help message though?
5356 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
5358 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
5359 xtl which needs both rtti and exceptions.
5361 * src/support/Makefile.am:
5362 * src/support/lxtl.h: New file. Some helper macros for using XTL.
5364 * src/frontends/xforms/input_validators.[ch]: input filters and
5365 validators. These conrol what keys are valid in input boxes.
5366 Use them and write some more. Much better idea than waiting till
5367 after the user has pressed Ok to say that the input fields don't make
5370 * src/frontends/xforms/Makefile.am:
5371 * src/frontends/xforms/forms/form_print.fd:
5372 * src/frontends/xforms/forms/makefile:
5373 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
5374 new scheme. Still have to make sure I haven't missed anything from
5375 the current implementation.
5377 * src/Makefile.am, src/PrinterParams.h: New data store.
5379 * other files: Added a couple of copyright notices.
5381 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5383 * src/insets/insetbib.h: move Holder struct in public space.
5385 * src/frontends/include/DialogBase.h: use SigC:: only when
5386 SIGC_CXX_NAMESPACES is defined.
5387 * src/frontends/include/Dialogs.h: ditto.
5389 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
5391 * src/frontends/xforms/FormCopyright.[Ch]: do not
5392 mention SigC:: explicitely.
5394 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5396 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
5397 deals with testing KDE in main configure.in
5398 * configure.in: ditto.
5400 2000-02-22 Allan Rae <rae@lyx.org>
5402 * Lots of files: Merged from HEAD
5404 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
5405 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
5407 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
5409 * sigc++/: new minidist.
5411 2000-02-14 Allan Rae <rae@lyx.org>
5413 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
5415 2000-02-08 Juergen Vigna <jug@sad.it>
5417 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
5418 file for the buildin GUI builder of KDevelop of the copyright-dialog.
5420 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
5421 for this port and so it is much easier for other people to port
5422 dialogs in a common development environment.
5424 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
5425 the QT/KDE implementation.
5427 * src/frontends/kde/Dialogs.C:
5428 * src/frontends/kde/FormCopyright.C:
5429 * src/frontends/kde/FormCopyright.h:
5430 * src/frontends/kde/Makefile.am:
5431 * src/frontends/kde/formcopyrightdialog.C:
5432 * src/frontends/kde/formcopyrightdialog.h:
5433 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
5434 for the kde support of the Copyright-Dialog.
5436 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
5437 subdir-substitution instead of hardcoded 'xforms' as we now have also
5440 * src/frontends/include/DialogBase.h (Object): just commented the
5441 label after #endif (nasty warning and I don't like warnings ;)
5443 * src/main.C (main): added KApplication initialization if using
5446 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
5447 For now only the KDE event-loop is added if frontend==kde.
5449 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
5451 * configure.in: added support for the --with-frontend[=value] option
5453 * autogen.sh: added kde.m4 file to list of config-files
5455 * acconfig.h: added define for KDEGUI-support
5457 * config/kde.m4: added configuration functions for KDE-port
5459 * config/lyxinclude.m4: added --with-frontend[=value] option with
5460 support for xforms and KDE.
5462 2000-02-08 Allan Rae <rae@lyx.org>
5464 * all Makefile.am: Fixed up so the make targets dist, distclean,
5465 install and uninstall all work even if builddir != srcdir. Still
5466 have a new sigc++ minidist update to come.
5468 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
5470 2000-02-01 Allan Rae <rae@lyx.org>
5472 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
5473 Many mods to get builddir != srcdir working.
5475 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
5476 for building on NT and so we can do the builddir != srcdir stuff.
5478 2000-01-30 Allan Rae <rae@lyx.org>
5480 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
5481 This will stay in "rae" branch. We probably don't really need it in
5482 the main trunk as anyone who wants to help programming it should get
5483 a full library installed also. So they can check both included and
5484 system supplied library compilation.
5486 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
5487 Added a 'mini' distribution of libsigc++. If you feel the urge to
5488 change something in these directories - Resist it. If you can't
5489 resist the urge then you should modify the following script and rebuild
5490 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
5491 all happen. Still uses a hacked version of libsigc++'s configure.in.
5492 I'm quite happy with the results. I'm not sure the extra work to turn
5493 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
5494 worth the trouble and would probably lead to extra maintenance
5496 I haven't tested the following important make targets: install, dist.
5497 Not ready for prime time but very close. Maybe 1.1.5.
5499 * development/tools/makeLyXsigc.sh: A shell script to automatically
5500 generate our mini-dist of libsigc++. It can only be used with a CVS
5501 checkout of libsigc++ not a tarball distribution. It's well commented.
5502 This will end up as part of the libsigc++ distribution so other apps
5503 can easily have an included mini-dist. If someone makes mods to the
5504 sigc++ subpackage without modifying this script to generate those
5505 changes I'll be very upset!
5507 * src/frontends/: Started the gui/system indep structure.
5509 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
5510 to access the gui-indep dialogs are in this class. Much improved
5511 design compared to previous revision. Lars, please refrain from
5512 moving this header into src/ like you did with Popups.h last time.
5514 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
5516 * src/frontends/xforms/: Started the gui-indep system with a single
5517 dialog: FormCopyright. Initial testing of use of libsigc++ was very
5520 * src/frontends/xforms/forms: Repository for the xforms .fd files.
5521 Here you'll find a very useful makefile and automated fdfix.sh that
5522 makes updating dailogs a no-brainer -- provided you follow the rules
5523 set out in the README. I'm thinking about adding another script to
5524 automatically generate skeleton code for a new dialog given just the
5527 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
5528 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
5529 Made FormCopyright gui-indep and added a lyxfunc to get to it.
5531 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5533 * src/support/LSubstring.C (operator): simplify
5535 * src/lyxtext.h: removed bparams, use buffer_->params instead
5537 * src/lyxrow.h: make Row a real class, move all variables to
5538 private and use accessors.
5540 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
5542 (isRightToLeftPar): ditto
5543 (ChangeLanguage): ditto
5544 (isMultiLingual): ditto
5547 (SimpleTeXOnePar): ditto
5548 (TeXEnvironment): ditto
5549 (GetEndLabel): ditto
5551 (SetOnlyLayout): ditto
5552 (BreakParagraph): ditto
5553 (BreakParagraphConservative): ditto
5554 (GetFontSettings): ditto
5556 (CopyIntoMinibuffer): ditto
5557 (CutIntoMinibuffer): ditto
5558 (PasteParagraph): ditto
5559 (SetPExtraType): ditto
5560 (UnsetPExtraType): ditto
5561 (DocBookContTableRows): ditto
5562 (SimpleDocBookOneTablePar): ditto
5564 (TeXFootnote): ditto
5565 (SimpleTeXOneTablePar): ditto
5566 (TeXContTableRows): ditto
5567 (SimpleTeXSpecialChars): ditto
5570 * src/lyxcursor.h: make LyXCursor a real class, move all variables
5571 to private and use accessors.
5573 * src/lyx_cb.C: remove char updatetimer, and all code that uses
5574 this, we did not use it anymore and has not been for ages. Just a
5575 waste of cpu cycles.
5577 * src/language.h: make Language a real class, move all variables
5578 to private and use accessors.
5580 * src/BufferView_pimpl.C (Pimpl): use new timer code.
5581 (create_view): remove
5582 (update): some changes for new timer
5583 (cursorToggle): use new timer
5584 (beforeChange): change for new timer
5586 * src/BufferView.h (cursorToggleCB): removed last paramter because
5589 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
5590 (cursorToggleCB): change because of new timer code
5592 * lib/CREDITS: updated own mailaddress
5594 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5596 * src/support/filetools.C (PutEnv): fix the code in case neither
5597 putenv() nor setenv() have been found.
5599 * INSTALL: mention the install-strip Makefile target.
5601 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
5602 read-only documents.
5604 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5606 * lib/reLyX/configure.in (VERSION): avoid using a previously
5607 generated reLyX wrapper to find out $prefix.
5609 * lib/examples/eu_adibide_lyx-atua.lyx:
5610 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
5611 translation of the Tutorial (Dooteo)
5613 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
5615 * forms/cite.fd: new citation dialog
5617 * src/insetcite.[Ch]: the new citation dialog is moved into
5620 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
5623 * src/insets/insetcommand.h: data members made private.
5625 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5627 * LyX 1.1.5 released
5629 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5631 * src/version.h (LYX_RELEASE): to 1.1.5
5633 * src/spellchecker.C (RunSpellChecker): return false if the
5634 spellchecker dies upon creation.
5636 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5638 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
5639 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
5643 * lib/CREDITS: update entry for Martin Vermeer.
5645 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
5647 * src/text.C (draw): Draw foreign language bars at the bottom of
5648 the row instead of at the baseline.
5650 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
5652 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5654 * lib/bind/de_menus.bind: updated
5656 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5658 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
5660 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5662 * src/menus.C (Limit_string_length): New function
5663 (ShowTocMenu): Limit the number of items/length of items in the
5666 * src/paragraph.C (String): Correct result for a paragraph inside
5669 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5671 * src/bufferlist.C (close): test of buf->getuser() == NULL
5673 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
5675 * src/BufferView2.C (removeAutoInsets): Fix a bug:
5676 Do not call to SetCursor when the paragraph is a closed footnote!
5678 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
5680 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
5683 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
5685 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5688 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
5689 reference popup, that activates the reference-back action
5691 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
5693 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
5694 the menus. Also fixed a bug.
5696 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
5697 the math panels when switching buffers (unless new buffer is readonly).
5699 * src/BufferView.C (NoSavedPositions)
5700 * src/BufferView_pimpl.C (NoSavedPositions): New methods
5702 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5704 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
5705 less of dvi dirty or not.
5707 * src/trans_mgr.[Ch] (insert): change first parameter to string
5710 * src/chset.[Ch] (encodeString): add const to first parameter
5712 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5714 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
5718 * src/LaTeX.C (deplog): better searching for dependency files in
5719 the latex log. Uses now regexps.
5721 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
5722 instead of the box hack or \hfill.
5724 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5726 * src/lyxfunc.C (doImportHelper): do not create the file before
5727 doing the actual import.
5728 (doImportASCIIasLines): create a new file before doing the insert.
5729 (doImportASCIIasParagraphs): ditto.
5731 * lib/lyxrc.example: remove mention of non-existing commands
5733 * lyx.man: remove mention of color-related switches.
5735 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
5737 * src/lyx_gui.C: remove all the color-related ressources, which
5738 are not used anymore.
5740 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
5743 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5745 * src/lyxrc.C (read): Add a missing break in the switch
5747 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
5749 * src/text2.C (InsertStringA): Fix a bug with insertion into table
5751 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
5754 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
5756 * src/text.C (draw): draw bars under foreign language words.
5758 * src/LColor.[Ch]: add LColor::language
5760 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
5762 * src/lyxcursor.h (boundary): New member variable
5764 * src/text.C (IsBoundary): New methods
5766 * src/text.C: Use the above for currect cursor movement when there
5767 is both RTL & LTR text.
5769 * src/text2.C: ditto
5771 * src/bufferview_funcs.C (ToggleAndShow): ditto
5773 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5775 * src/text.C (DeleteLineForward): set selection to true to avoid
5776 that DeleteEmptyParagraphMechanism does some magic. This is how it
5777 is done in all other functions, and seems reasonable.
5778 (DeleteWordForward): do not jump over non-word stuff, since
5779 CursorRightOneWord() already does it.
5781 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
5782 DeleteWordBackward, since they seem safe to me (since selection is
5783 set to "true") DeleteEmptyParagraphMechanism does nothing.
5785 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5787 * src/lyx_main.C (easyParse): simplify the code by factoring the
5788 part that removes parameters from the command line.
5789 (LyX): check wether wrong command line options have been given.
5791 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
5793 * src/lyx_main.C : add support for specifying user LyX
5794 directory via command line option -userdir.
5796 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
5798 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
5799 the number of items per popup.
5800 (Add_to_refs_menu): Ditto.
5802 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5804 * src/lyxparagraph.h: renamed ClearParagraph() to
5805 StripLeadingSpaces() and moved it to paragraph.C. We pass the
5806 textclass as parameter, and do nothing if free_spacing is
5807 true. This fixes part of the line-delete-forward problems.
5809 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
5810 (pasteSelection): ditto.
5811 (SwitchLayoutsBetweenClasses): more translatable strings.
5813 * src/text2.C (CutSelection): use StripLeadingSpaces.
5814 (PasteSelection): ditto.
5815 (DeleteEmptyParagraphMechanism): ditto.
5817 2000-05-26 Juergen Vigna <jug@sad.it>
5819 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
5820 is not needed in tabular insets.
5822 * src/insets/insettabular.C (TabularFeatures): added missing features.
5824 * src/tabular.C (DeleteColumn):
5826 (AppendRow): implemented this functions
5827 (cellsturct::operator=): clone the inset too;
5829 2000-05-23 Juergen Vigna <jug@sad.it>
5831 * src/insets/insettabular.C (LocalDispatch): better selection support
5832 when having multicolumn-cells.
5834 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
5836 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
5838 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5840 * src/ColorHandler.C (getGCForeground): put more test into _()
5842 * lib/examples/eu_splash.lyx: new file (Basque translation) from
5845 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
5848 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
5850 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
5851 there are no labels, or when buffer is readonly.
5853 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
5854 there are no labels, buffer is SGML, or when buffer is readonly.
5856 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5858 * src/LColor.C (LColor): change a couple of grey40 to grey60
5859 (LColor): rewore initalization to make compiles go some magnitude
5861 (getGUIName): don't use gettext until we need the string.
5863 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
5865 * src/Bullet.[Ch]: Fixed a small bug.
5867 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
5869 * src/paragraph.C (String): Several fixes/improvements
5871 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
5873 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5875 * src/paragraph.C (String): give more correct output.
5877 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
5879 * src/lyxfont.C (stateText) Do not output the language if it is
5880 eqaul to the language of the document.
5882 * src/paragraph.C (TeXOnePar): Do not put language switch commands
5883 between two paragraphs with the same language.
5885 * src/paragraph.C (getParLanguage) Return a correct answer for an
5886 empty dummy paragraph.
5888 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
5891 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
5894 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
5895 the menus/popup, if requested fonts are unavailable.
5897 2000-05-22 Juergen Vigna <jug@sad.it>
5899 * src/insets/insettabular.C (LocalDispatch): added some more cursor
5900 movement support (Up/Down/Tab/Shift-Tab).
5901 (LocalDispatch): added also preliminari cursor-selection.
5903 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
5905 * src/paragraph.C (PasteParagraph): Hopefully now right!
5907 2000-05-22 Garst R. Reese <reese@isn.net>
5909 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
5910 of list, change all references to Environment to Command
5911 * tex/hollywood.cls : rewrite environments as commands, add
5912 \uppercase to interiorshot and exteriorshot to force uppecase.
5913 * tex/broadway.cls : rewrite environments as commands. Tweak
5916 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5918 * src/menus.C (Add_to_toc_menu): fix the code which limits the
5919 size of items: use a constant intead of the hardcoded 40, and more
5920 importantly do not remove the %m and %x tags added at the end.
5921 (Add_to_refs_menu): use vector::size_type instead of
5922 unsigned int as basic types for the variables. _Please_ do not
5923 assume that size_t is equal to unsigned int. On an alpha, this is
5924 unsigned long, which is _not_ the same.
5926 * src/language.C (initL): remove language "hungarian", since it
5927 seems that "magyar" is better.
5929 2000-05-22 Juergen Vigna <jug@sad.it>
5931 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
5933 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
5936 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
5937 next was deleted but not set to 0.
5939 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5941 * src/language.C (initL): change the initialization of languages
5942 so that compiles goes _fast_.
5944 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
5947 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
5949 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5953 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5955 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
5957 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
5961 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
5964 * src/insets/insetlo*.[Ch]: Made editable
5966 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5968 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
5969 the current selection.
5971 * src/BufferView_pimpl.C (stuffClipboard): new method
5973 * src/BufferView.C (stuffClipboard): new method
5975 * src/paragraph.C (String): new method
5977 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
5978 LColor::ignore when lyxname is not found.
5980 * src/BufferView.C (pasteSelection): new method
5982 * src/BufferView_pimpl.C (pasteSelection): new method
5984 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
5986 * src/WorkArea.C (request_clipboard_cb): new static function
5987 (getClipboard): new method
5988 (putClipboard): new method
5990 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5992 * LyX 1.1.5pre2 released
5994 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5996 * src/vspace.C (operator=): removed
5997 (operator=): removed
5999 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
6001 * src/layout.C (NumberOfClass): manually set the type in make_pair
6002 (NumberOfLayout): ditto
6004 * src/language.C: use the Language constructor for ignore_lang
6006 * src/language.h: add constructors to struct Language
6008 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
6010 * src/text2.C (SetCursorIntern): comment out #warning
6012 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
6014 * src/mathed/math_iter.h: initialize sx and sw to 0
6016 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6018 * forms/lyx.fd: Redesign of form_ref
6020 * src/LaTeXFeatures.[Ch]
6024 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
6027 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
6028 and Buffer::inset_iterator.
6030 * src/menus.C: Added new menus: TOC and Refs.
6032 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
6034 * src/buffer.C (getTocList): New method.
6036 * src/BufferView2.C (ChangeRefs): New method.
6038 * src/buffer.C (getLabelList): New method. It replaces the old
6039 getReferenceList. The return type is vector<string> instead of
6042 * src/insets/insetinclude.C (getLabelList): New method. Replaces
6043 the old getLabel() and GetNumberOfLabels() methods.
6044 * src/insets/insetlabel.C (getLabelList): ditto
6045 * src/mathed/formula.C (getLabelList): ditto
6047 * src/paragraph.C (String): New method.
6049 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
6050 Uses the new getTocList() method.
6051 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
6052 which automatically updates the contents of the browser.
6053 (RefUpdateCB): Use the new getLabelList method.
6055 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
6057 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
6059 * src/spellchecker.C: Added using std::reverse;
6061 2000-05-19 Juergen Vigna <jug@sad.it>
6063 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
6065 * src/insets/insettext.C (computeTextRows): small fix for display of
6066 1 character after a newline.
6068 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
6071 2000-05-18 Juergen Vigna <jug@sad.it>
6073 * src/insets/insettabular.C (TabularFeatures): fixed update of display
6074 when changing width of column.
6076 * src/tabular.C (set_row_column_number_info): setting of
6077 autobreak rows if necessary.
6079 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6081 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
6083 * src/vc-backend.*: renamed stat() to status() and vcstat to
6084 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
6085 compilation broke. The new name seems more relevant, anyway.
6087 2000-05-17 Juergen Vigna <jug@sad.it>
6089 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
6090 which was wrong if the removing caused removing of rows!
6092 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
6093 (pushToken): new function.
6095 * src/text2.C (CutSelection): fix problem discovered with purify
6097 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6099 * src/debug.C (showTags): enlarge the first column, now that we
6100 have 6-digits debug codes.
6102 * lib/layouts/hollywood.layout:
6103 * lib/tex/hollywood.cls:
6104 * lib/tex/brodway.cls:
6105 * lib/layouts/brodway.layout: more commands and fewer
6106 environments. Preambles moved in the .cls files. Broadway now has
6107 more options on scene numbering and less whitespace (from Garst)
6109 * src/insets/insetbib.C (getKeys): make sure that we are in the
6110 document directory, in case the bib file is there.
6112 * src/insets/insetbib.C (Latex): revert bogus change.
6114 2000-05-16 Juergen Vigna <jug@sad.it>
6116 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
6117 the TabularLayout on cursor move.
6119 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
6121 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
6124 (draw): fixed cursor position and drawing so that the cursor is
6125 visible when before the tabular-inset.
6127 * src/insets/insettext.C (init): drawLockedFrame was not initialized
6128 when creating from old insettext.
6130 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
6132 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6134 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
6135 * lib/tex/brodway.cls: ditto
6137 * lib/layouts/brodway.layout: change alignment of parenthical
6140 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6142 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
6143 versions 0.88 and 0.89 are supported.
6145 2000-05-15 Juergen Vigna <jug@sad.it>
6147 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
6150 * src/insets/insettext.C (computeTextRows): redone completely this
6151 function in a much cleaner way, because of problems when having a
6153 (draw): added a frame border when the inset is locked.
6154 (SetDrawLockedFrame): this sets if we draw the border or not.
6155 (SetFrameColor): this sets the frame color (default=insetframe).
6157 * src/insets/lyxinset.h: added x() and y() functions which return
6158 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
6159 function which is needed to see if we have a locking inset of some
6160 type in this inset (needed for now in insettabular).
6162 * src/vspace.C (inPixels): the same function also without a BufferView
6163 parameter as so it is easier to use it in some ocasions.
6165 * src/lyxfunc.C: changed all places where insertInset was used so
6166 that now if it couldn't be inserted it is deleted!
6168 * src/TabularLayout.C:
6169 * src/TableLayout.C: added support for new tabular-inset!
6171 * src/BufferView2.C (insertInset): this now returns a bool if the
6172 inset was really inserted!!!
6174 * src/tabular.C (GetLastCellInRow):
6175 (GetFirstCellInRow): new helper functions.
6176 (Latex): implemented for new tabular class.
6180 (TeXTopHLine): new Latex() helper functions.
6182 2000-05-12 Juergen Vigna <jug@sad.it>
6184 * src/mathed/formulamacro.C (Read):
6185 * src/mathed/formula.C (Read): read also the \end_inset here!
6187 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6189 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
6190 crush when saving formulae with unbalanced parenthesis.
6192 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
6194 * src/layout.C: Add new keyword "endlabelstring" to layout file
6196 * src/text.C (GetVisibleRow): Draw endlabel string.
6198 * lib/layouts/broadway.layout
6199 * lib/layouts/hollywood.layout: Added endlabel for the
6200 Parenthetical layout.
6202 * lib/layouts/heb-article.layout: Do not use slanted font shape
6203 for Theorem like environments.
6205 * src/buffer.C (makeLaTeXFile): Always add "american" to
6206 the UsedLanguages list if document language is RTL.
6208 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6210 * add addendum to README.OS2 and small patch (from SMiyata)
6212 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6214 * many files: correct the calls to ChangeExtension().
6216 * src/support/filetools.C (ChangeExtension): remove the no_path
6217 argument, which does not belong there. Use OnlyFileName() instead.
6219 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
6220 files when LaTeXing a non-nice latex file.
6222 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
6223 a chain of "if". Return false when deadkeys are not handled.
6225 * src/lyx_main.C (LyX): adapted the code for default bindings.
6227 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
6228 bindings for basic functionality (except deadkeys).
6229 (deadKeyBindings): new method. Performs the bindings of deadkeys.
6231 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
6232 several methods: handle override_x_deadkeys.
6234 * src/lyxrc.h: remove the "bindings" map, which did not make much
6235 sense anyway. New variable override_x_deadkeys, defaulting to "true".
6237 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6239 * src/lyxfont.C (stateText): use a saner method to determine
6240 whether the font is "default". Seems to fix the crash with DEC
6243 * src/Bullet.[Ch] (Bullet): remove const on parameters.
6245 2000-05-08 Juergen Vigna <jug@sad.it>
6247 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
6248 TabularLayoutMenu with mouse-button-3
6249 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
6251 * src/TabularLayout.C: added this file for having a Layout for
6254 2000-05-05 Juergen Vigna <jug@sad.it>
6256 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
6257 recalculating inset-widths.
6258 (TabularFeatures): activated this function so that I can change
6259 tabular-features via menu.
6261 * src/menus.C (ShowEditMenu): inserted support for insettabular so
6262 that I can test some functions with the Table menu.
6264 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6266 * src/lyxfont.C (stateText): guard against stupid c++libs.
6268 * src/tabular.C: add using std::vector
6269 some whitespace changes, + removed som autogenerated code.
6271 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
6273 2000-05-05 Juergen Vigna <jug@sad.it>
6275 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
6276 row, columns and cellstructures.
6278 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6280 * lib/lyxrc.example: remove obsolete entries.
6282 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
6283 reading of protected_separator for free_spacing.
6285 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6287 * src/text.C (draw): do not display an exclamation mark in the
6288 margin for margin notes. This is confusing, ugly and
6291 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
6292 AMS math' is checked.
6294 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
6295 name to see whether including the amsmath package is needed.
6297 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
6299 * src/paragraph.C (validate): Compute UsedLanguages correctly
6300 (don't insert the american language if it doesn't appear in the
6303 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
6304 The argument of \thanks{} command is considered moving argument
6306 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
6309 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
6311 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
6312 for appendix/minipage/depth. The lines can be now both in the footnote
6313 frame, and outside the frame.
6315 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
6318 2000-05-05 Juergen Vigna <jug@sad.it>
6320 * src/table.[Ch]: removed the inset and buffer stuff as this is now
6321 neede only in tabular.[Ch].
6323 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6325 * src/insets/insetspecialchar.C (Read): allow command == '~' for
6327 (Write): write '~' for PROTECTED_SEPARATOR
6329 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6331 * src/lyxparagraph.h: add a friend struct matchIT after the struct
6334 * src/mathed/formula.C (drawStr): rename size to siz.
6336 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
6337 possibly fix a bug by not changing the pflags = flags to piflags =
6340 2000-05-05 Juergen Vigna <jug@sad.it>
6342 * src/insets/insetbib.C: moved using directive
6344 * src/ImportNoweb.C: small fix for being able to compile (missing
6347 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6349 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
6350 to use clear, since we don't depend on this in the code. Add test
6353 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6355 * (various *.C files): add using std::foo directives to please dec
6358 * replace calls to string::clear() to string::erase() (Angus)
6360 * src/cheaders/cmath: modified to provide std::abs.
6362 2000-05-04 Juergen Vigna <jug@sad.it>
6364 * src/insets/insettext.C: Prepared all for inserting of multiple
6365 paragraphs. Still display stuff to do (alignment and other things),
6366 but I would like to use LyXText to do this when we cleaned out the
6367 table-support stuff.
6369 * src/insets/insettabular.C: Changed lot of stuff and added lots
6370 of functionality still a lot to do.
6372 * src/tabular.C: Various functions changed name and moved to be
6373 const functions. Added new Read and Write functions and changed
6374 lots of things so it works good with tabular-insets (also removed
6375 some stuff which is not needed anymore * hacks *).
6377 * src/lyxcursor.h: added operators == and != which just look if
6378 par and pos are (not) equal.
6380 * src/buffer.C (latexParagraphs): inserted this function to latex
6381 all paragraphs form par to endpar as then I can use this too for
6384 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
6385 so that I can call this to from text insets with their own cursor.
6387 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
6388 output off all paragraphs (because of the fix below)!
6390 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
6391 the very last paragraph (this could be also the last paragraph of an
6394 * src/texrow.h: added rows() call which returns the count-variable.
6396 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6398 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
6400 * lib/configure.m4: better autodetection of DocBook tools.
6402 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6404 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
6406 * src/lyx_cb.C: add using std::reverse;
6408 * src/LaTeX.C (run): on error always run deleteFilesOnError before
6411 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
6412 selected files. Should fix repeated errors from generated files.
6414 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
6416 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
6418 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
6419 the spellchecker popup.
6421 * lib/lyxrc.example: Removed the \number_inset section
6423 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6425 * src/insets/figinset.C (various): Use IsFileReadable() to make
6426 sure that the file actually exist. Relying on ghostscripts errors
6427 is a bad idea since they can lead to X server crashes.
6429 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
6431 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
6434 * lib/lyxrc.example: smallish typo in description of
6435 \view_dvi_paper_option
6437 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6440 * src/lyxfunc.C: doImportHelper to factor out common code of the
6441 various import methods. New functions doImportASCIIasLines,
6442 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
6443 doImportLinuxDoc for the format specific parts.
6446 * buffer.C: Dispatch returns now a bool to indicate success
6449 * lyx_gui.C: Add getLyXView() for member access
6451 * lyx_main.C: Change logic for batch commands: First try
6452 Buffer::Dispatch (possibly without GUI), if that fails, use
6455 * lyx_main.C: Add support for --import command line switch.
6456 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
6457 Available Formats: Everything accepted by 'buffer-import <format>'
6459 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6461 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
6464 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
6465 documents will be reformatted upon reentry.
6467 2000-04-27 Juergen Vigna <jug@sad.it>
6469 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
6470 correctly only last pos this was a bug.
6472 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6474 * release of lyx-1.1.5pre1
6476 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6478 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
6480 * src/menus.C: revert the change of naming (Figure->Graphic...)
6481 from 2000-04-11. It was incomplete and bad.
6483 * src/LColor.[Ch]: add LColor::depthbar.
6484 * src/text.C (GetVisibleRow): use it.
6486 * README: update the languages list.
6488 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6490 * src/text.C (GetVisibleRow): show the depth of paragraphs using
6493 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6495 * README: remove sections that were just wrong.
6497 * src/text2.C (GetRowNearY): remove currentrow code
6499 * src/text.C (GetRow): remove currentrow code
6501 * src/screen.C (Update): rewritten a bit.
6502 (SmallUpdate): removed func
6504 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
6506 (FullRebreak): return bool
6507 (currentrow): remove var
6508 (currentrow_y): ditto
6510 * src/lyxscreen.h (Draw): change arg to unsigned long
6511 (FitCursor): return bool
6512 (FitManualCursor): ditto
6513 (Smallpdate): remove func
6514 (first): change to unsigned long
6515 (DrawOneRow): change second arg to long (from long &)
6516 (screen_refresh_y): remove var
6517 (scree_refresh_row): ditto
6519 * src/lyxrow.h: change baseline to usigned int from unsigned
6520 short, this brings some implicit/unsigned issues out in the open.
6522 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
6524 (Dispatch): don't call updateScrollbar after fitCursor. Use update
6525 instead of smallUpdate.
6527 * src/lyxcursor.h: change y to unsigned long
6529 * src/buffer.h: don't call updateScrollbar after fitcursor
6531 * src/buffer.C (parseSingleLyXformat2Token): move variables to
6532 where they are used. Removed "\\direction", this was not present
6533 in 1.1.4 and is already obsolete. Commented out some code that I
6534 believe to never be called.
6535 (runLiterate): don't call updateScrollbar after fitCursor
6537 (buildProgram): ditto
6540 * src/WorkArea.h (workWidth): change return val to unsigned
6543 (redraw): remove the button redraws
6544 (setScrollbarValue): change for scrollbar
6545 (getScrollbarValue): change for scrollbar
6546 (getScrollbarBounds): change for scrollbar
6548 * src/WorkArea.C (C_WorkArea_up_cb): removed func
6549 (C_WorkArea_down_cb): removed func
6550 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
6551 (resize): change for scrollbar
6552 (setScrollbar): ditto
6553 (setScrollbarBounds): ditto
6554 (setScrollbarIncrements): ditto
6555 (up_cb): removed func
6556 (down_cb): removed func
6557 (scroll_cb): change for scrollbar
6558 (work_area_handler): ditto
6560 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
6561 when FitCursor did something.
6562 (updateScrollbar): some unsigned changes
6563 (downCB): removed func
6564 (scrollUpOnePage): removed func
6565 (scrollDownOnePage): remvoed func
6566 (workAreaMotionNotify): don't call screen->FitCursor but use
6567 fitCursor instead. and bool return val
6568 (workAreaButtonPress): ditto
6569 (workAreaButtonRelease): some unsigned changes
6570 (checkInsetHit): ditto
6571 (workAreaExpose): ditto
6572 (update): parts rewritten, comments about the signed char arg added
6573 (smallUpdate): removed func
6574 (cursorPrevious): call needed updateScrollbar
6577 * src/BufferView2.C (allFloats): don't call updateScrollbar after
6580 * src/BufferView.[Ch] (upCB): removed func
6581 (downCB): removed func
6582 (smallUpdate): removed func
6584 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6586 * src/lyxtext.h src/text.C src/text2.C: removed support for the
6587 currentrow, currentrow_y optimization. This did not help a lot and
6588 if we want to do this kind of optimization we should rather use
6589 cursor.row instead of the currentrow.
6591 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
6592 buffer spacing and klyx spacing support.
6594 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6596 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
6599 2000-04-26 Juergen Vigna <jug@sad.it>
6601 * src/insets/figinset.C: fixes to Lars sstream changes!
6603 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
6605 * A lot of files: Added Ascii(ostream &) methods to all inset
6606 classes. Used when exporting to ASCII.
6608 * src/buffer.C (writeFileAscii,RoffAsciiTable)
6609 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
6612 * src/text2.C (ToggleFree): Disabled implicit word selection when
6613 there is a change in the language
6615 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
6616 no output was generated for end-of-sentence inset.
6618 * src/insets/lyxinset.h
6621 * src/paragraph.C: Removed the insetnumber code
6623 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
6625 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6627 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
6628 no_babel and no_epsfig completely from the file.
6629 (parseSingleLyXformat2Token): add handling for per-paragraph
6630 spacing as written by klyx.
6632 * src/insets/figinset.C: applied patch by Andre. Made it work with
6635 2000-04-20 Juergen Vigna <jug@sad.it>
6637 * src/insets/insettext.C (cutSelection):
6638 (copySelection): Fixed with selection from right to left.
6639 (draw): now the rows are not recalculated at every draw.
6640 (computeTextRows): for now reset the inset-owner here (this is
6641 important for an undo or copy where the inset-owner is not set
6644 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
6645 motion to the_locking_inset screen->first was forgotten, this was
6646 not important till we got multiline insets.
6648 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6650 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
6651 code seems to be alright (it is code changed by Dekel, and the
6652 intent is indeed that all macros should be defined \protect'ed)
6654 * NEWS: a bit of reorganisation of the new user-visible features.
6656 2000-04-19 Juergen Vigna <jug@sad.it>
6658 * src/insets/insettext.C (init): using a LyXCursor now for cursor
6659 position. Set the inset_owner of the used paragraph so that it knows
6660 that it is inside an inset. Fixed cursor handling with mouse and
6661 cursor keys. Fixed wrong timed inset redraws and lots of other changes
6662 and cleanups to make TextInsets work better.
6664 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
6665 Changed parameters of various functions and added LockInsetInInset().
6667 * src/insets/insettext.C:
6669 * src/insets/insetcollapsable.h:
6670 * src/insets/insetcollapsable.C:
6671 * src/insets/insetfoot.h:
6672 * src/insets/insetfoot.C:
6673 * src/insets/insetert.h:
6674 * src/insets/insetert.C: cleaned up the code so that it works now
6675 correctly with insettext.
6677 * src/insets/inset.C:
6678 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
6679 that insets in insets are supported right.
6682 * src/table.C: lots of changes for use with inset tabular (and cleanup)
6684 * src/paragraph.C: some small fixes
6686 * src/debug.h: inserted INSETS debug info
6688 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
6689 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
6691 * src/commandtags.h:
6692 * src/LyXAction.C: insert code for InsetTabular.
6694 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
6695 not Button1MotionMask.
6696 (workAreaButtonRelease): send always a InsetButtonRelease event to
6698 (checkInsetHit): some setCursor fixes (always with insets).
6700 * src/BufferView2.C (lockInset): returns a bool now and extended for
6701 locking insets inside insets.
6702 (showLockedInsetCursor): it is important to have the cursor always
6703 before the locked inset.
6704 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
6706 * src/BufferView.h: made lockInset return a bool.
6708 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
6710 * src/text2.C (SetCursor): This now has a version with a LyXCursor
6711 that is used also internally but can be called as public to have back
6712 a cursor pos which is not set internally.
6713 (SetCursorIntern): Changed to use above function.
6715 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
6717 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6722 * NEWS: updated for prerelease of 1.1.5. Please comment and send
6723 patches for things that should be in or should be changed.
6725 * src/* [insetfiles]: change "usigned char fragile" to bool
6726 fragile. There was only one point that could that be questioned
6727 and that is commented in formulamacro.C. Grep for "CHECK".
6729 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
6730 (DeleteBuffer): take it out of CutAndPaste and make it static.
6732 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6734 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
6735 output the spacing envir commands. Also the new commands used in
6736 the LaTeX output makes the result better.
6738 * src/Spacing.C (writeEnvirBegin): new method
6739 (writeEnvirEnd): new method
6741 2000-04-18 Juergen Vigna <jug@sad.it>
6743 * src/CutAndPaste.C: made textclass a static member of the class
6744 as otherwise it is not accesed right!!!
6746 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
6748 * forms/layout_forms.fd
6749 * src/layout_forms.h
6750 * src/layout_forms.C (create_form_form_character)
6751 * src/lyx_cb.C (UserFreeFont)
6752 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
6753 documents (in the layout->character popup).
6755 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6757 * src/spellchecker.C (create_ispell_pipe): fix a bug where
6758 \spell_command was in fact not honored (from Kevin Atkinson).
6760 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
6763 * src/lyx_gui.h: make lyxViews private (Angus)
6765 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
6767 * src/mathed/math_write.C
6768 (MathMatrixInset::Write) Put \protect before \begin{array} and
6769 \end{array} if fragile
6770 (MathParInset::Write): Put \protect before \\ if fragile
6772 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6774 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
6775 initialization if the LyXColorHandler must be done after the
6776 connections to the XServer has been established.
6778 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
6779 get the background pixel from the lyxColorhandler so that the
6780 figures are rendered with the correct background color.
6781 (NextToken): removed functions.
6782 (GetPSSizes): use ifs >> string instead of NextToken.
6784 * src/Painter.[Ch]: the color cache moved out of this file.
6786 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
6789 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6791 * src/WorkArea.C (work_area_handler): call BufferView::enterView
6792 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
6794 * src/BufferView.C (enterView): new func
6795 (leaveView): new func
6797 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
6799 (leaveView): new func, undefines xterm cursor when approp.
6801 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
6802 (AllowInput): delete the Workarea cursor handling from this func.
6804 * src/Painter.C (underline): draw a slimer underline in most cases.
6806 * src/lyx_main.C (error_handler): use extern "C"
6808 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6810 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
6811 sent directly to me.
6813 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
6814 to the list by Dekel.
6816 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
6819 * src/bufferview_funcs.[Ch]: two new files, moved several of the
6820 methods from lyx_cb.here.
6822 * src/lyx_cb.C: in addition to the above; removed input_prohibited
6825 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6827 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
6828 instead of using current_view directly.
6830 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
6832 * src/LyXAction.C (init): add the paragraph-spacing command.
6834 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
6836 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
6838 * src/lyx_cb.C (CurrentState): output a string when the spacing is
6839 different from the documents.
6841 * src/text.C (SetHeightOfRow): take paragraph spacing into
6842 account, paragraph spacing takes precedence over buffer spacing
6843 (GetVisibleRow): ditto
6845 * src/paragraph.C (writeFile): output the spacing parameter too.
6846 (validate): set the correct features if spacing is used in the
6848 (Clear): set spacing to default
6849 (MakeSameLayout): spacing too
6850 (HasSameLayout): spacing too
6851 (SetLayout): spacing too
6852 (TeXOnePar): output the spacing commands
6854 * src/lyxparagraph.h: added a spacing variable for use with
6855 per-paragraph spacing.
6857 * src/Spacing.h: add a Default spacing and a method to check if
6858 the current spacing is default. also added an operator==
6860 * src/text2.C (DeleteEmptyParagraphMechanism): added a
6863 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6865 * src/lyxserver.C (callback): fix dispatch of functions
6867 * src/insets/insetlatexaccent.C (checkContents): turn bogus
6868 printf() into lyxerr call.
6870 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
6873 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
6874 "Table" to "Table Box", "Float" to "Floating Material"; deletes
6875 the "Float" from each of the subitems.
6876 (ShowHelpMenu): add entry for "FAQ" and "TOC".
6878 * src/support/DebugStream.h: add an #ifdef to work around a gcc
6879 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
6880 documented the change so that the workaround can be nuked later.
6882 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
6885 * src/lyxlex_pimpl.C (next): do not re-declare the default value
6887 * src/buffer.C (getLatexName): ditto
6888 (setReadonly): ditto
6890 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6892 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
6893 avoid some uses of current_view. Added also a bufferParams()
6894 method to get at this.
6896 * src/lyxtext.h: changed params->buffer and paramters->bparams.
6898 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6900 * src/lyxparagraph.[Ch]: removed
6901 operator<(LyXParagraph::InsetTable..., added a struct matchIT
6902 with operators used by lower_bound and
6903 upper_bound in InsetTable's
6904 Make struct InsetTable private again. Used matchpos.
6906 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
6908 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
6909 document, the language of existing text is changed (unless the
6910 document is multi-lingual)
6912 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
6914 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
6916 * A lot of files: A rewrite of the Right-to-Left support.
6918 2000-04-10 Juergen Vigna <jug@sad.it>
6920 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
6921 misplaced cursor when inset in inset is locked.
6923 * src/insets/insettext.C (LocalDispatch): small fix so that a
6924 BREAKLINE is not inserted if we don't permit it with autBreakRows.
6926 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
6927 footnote font should be decreased in size twice when displaying.
6929 * src/insets/insettext.C (GetDrawFont): inserted this function as
6930 the drawing-font may differ from the real paragraph font.
6932 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
6933 insets (inset in inset!).
6935 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
6936 function here because we don't want footnotes inside footnotes.
6938 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
6940 (init): now set the inset_owner in paragraph.C
6941 (LocalDispatch): added some resetPos() in the right position
6944 (pasteSelection): changed to use the new CutAndPaste-Class.
6946 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
6947 which tells if it is allowed to insert another inset inside this one.
6949 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
6950 SwitchLayoutsBetweenClasses.
6952 * src/text2.C (InsertInset): checking of the new paragraph-function
6954 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
6955 is not needed anymore here!
6958 (PasteSelection): redone (also with #ifdef) so that now this uses
6959 the CutAndPaste-Class.
6960 (SwitchLayoutsBetweenClasses): removed here and implemented in the
6963 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
6964 from/to text/insets.
6966 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
6967 so that the paragraph knows if it is inside an (text)-inset.
6968 (InsertFromMinibuffer): changed return-value to bool as now it
6969 may happen that an inset is not inserted in the paragraph.
6970 (InsertInsetAllowed): this checks if it is allowed to insert an
6971 inset in this paragraph.
6973 (BreakParagraphConservative):
6974 (BreakParagraph) : small change for the above change of the return
6975 value of InsertFromMinibuffer.
6977 * src/lyxparagraph.h: added inset_owner and the functions to handle
6978 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
6980 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6982 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
6983 functions from BufferView to BufferView::Pimpl to ease maintence.
6985 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
6986 correctly. Also use SetCursorIntern instead of SetCursor.
6988 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
6991 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6993 * src/WorkArea.C (belowMouse): manually implement below mouse.
6995 * src/*: Add "explicit" on several constructors, I added probably
6996 some unneeded ones. A couple of changes to code because of this.
6998 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
6999 implementation and private parts from the users of BufferView. Not
7002 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
7003 implementation and private parts from the users of LyXLex. Not
7006 * src/BufferView_pimpl.[Ch]: new files
7008 * src/lyxlex_pimpl.[Ch]: new files
7010 * src/LyXView.[Ch]: some inline functions move out-of-line
7012 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7014 * src/lyxparagraph.h: make struct InsetTable public.
7016 * src/support/lyxstring.h: change lyxstring::difference_type to be
7017 ptrdiff_t. Add std:: modifiers to streams.
7019 * src/font.C: include the <cctype> header, for islower() and
7022 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7024 * src/font.[Ch]: new files. Contains the metric functions for
7025 fonts, takes a LyXFont as parameter. Better separation of concepts.
7027 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
7028 changes because of this.
7030 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
7032 * src/*: compile with -Winline and move functions that don't
7035 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
7038 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7040 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
7041 (various files changed because of this)
7043 * src/Painter.C (text): fixed the drawing of smallcaps.
7045 * src/lyxfont.[Ch] (drawText): removed unused member func.
7048 * src/*.C: added needed "using" statements and "std::" qualifiers.
7050 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7052 * src/*.h: removed all use of "using" from header files use
7053 qualifier std:: instead.
7055 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7057 * src/text.C (Backspace): some additional cleanups (we already
7058 know whether cursor.pos is 0 or not).
7060 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
7061 automake does not provide one).
7063 * src/bmtable.h: replace C++ comments with C comments.
7065 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
7067 * src/screen.C (ShowCursor): Change the shape of the cursor if
7068 the current language is not equal to the language of the document.
7069 (If the cursor change its shape unexpectedly, then you've found a bug)
7071 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
7074 * src/insets/insetnumber.[Ch]: New files.
7076 * src/LyXAction.C (init)
7077 * src/lyxfunc.C (dispatch): Add command number-inset-insert
7080 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
7082 * src/lyxparagraph.h
7083 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
7084 (the vector is kept sorted).
7086 * src/text.C (GetVisibleRow): Draw selection correctly when there
7087 is both LTR and RTL text.
7089 * src/paragraph.C (Clone): Use the assignment operator for cloning,
7090 which is much faster.
7092 * src/text.C (GetVisibleRow and other): Do not draw the last space
7093 in a row if the direction of the last letter is not equal to the
7094 direction of the paragraph.
7096 * src/lyxfont.C (latexWriteStartChanges):
7097 Check that font language is not equal to basefont language.
7098 (latexWriteEndChanges): ditto
7100 * src/lyx_cb.C (StyleReset): Don't change the language while using
7101 the font-default command.
7103 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
7104 empty paragraph before a footnote.
7106 * src/insets/insetcommand.C (draw): Increase x correctly.
7108 * src/screen.C (ShowCursor): Change cursor shape if
7109 current language != document language.
7111 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
7113 2000-03-31 Juergen Vigna <jug@sad.it>
7115 * src/paragraph.C (GetInset): commented out text[pos] = ' '
7116 (Clone): changed mode how the paragraph-data is copied to the
7117 new clone-paragraph.
7119 * src/lyxfunc.C (Dispatch): fixed small problem when calling
7120 GetInset(pos) with no inset anymore there (in inset UNDO)
7122 * src/insets/insetcommand.C (draw): small fix as here x is
7123 incremented not as much as width() returns (2 before, 2 behind = 4)
7125 2000-03-30 Juergen Vigna <jug@sad.it>
7127 * src/insets/insettext.C (InsetText): small fix in initialize
7128 widthOffset (should not be done in the init() function)
7130 2000-03-29 Amir Karger <karger@lyx.org>
7132 * lib/examples/it_ItemizeBullets.lyx: translation by
7135 * Implemented \textasciitilde and fixed a tiny bug in reLyX
7137 2000-03-29 Juergen Vigna <jug@sad.it>
7139 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
7141 * src/insets/insetfoot.C (Clone): small change as for the below
7142 new init function in the text-inset
7144 * src/insets/insettext.C (init): new function as I've seen that
7145 clone did not copy the Paragraph-Data!
7146 (LocalDispatch): Added code so that now we have some sort of Undo
7147 functionality (well actually we HAVE Undo ;)
7149 * src/text.C (Backspace): Small fix for the a | a Backspace problem
7151 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
7153 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
7156 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7158 * src/main.C: added a runtime check that verifies that the xforms
7159 header used when building LyX and the library used when running
7160 LyX match. Exit with a message if they don't match. This is a
7161 version number check only.
7163 * src/buffer.C (save): Don't allocate memory on the heap for
7164 struct utimbuf times.
7166 * *: some using changes, use iosfwd instead of the real headers.
7168 * src/lyxfont.C use char const * instead of string for the static
7169 strings. Rewrite some functions to use sstream.
7171 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7173 * src/text.C (Backspace): hopefully fix the dreaded backaspace
7176 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7178 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
7179 of Geodesy (from Martin Vermeer)
7181 * lib/layouts/svjour.inc: include file for the Springer svjour
7182 class. It can be used to support journals other than JoG.
7184 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
7185 Miskiewicz <misiek@pld.org.pl>)
7186 * lib/reLyX/Makefile.am: ditto.
7188 2000-03-27 Juergen Vigna <jug@sad.it>
7190 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
7191 also some modifications with operations on selected text.
7193 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
7194 problems with clicking on insets (last famous words ;)
7196 * src/insets/insetcommand.C (draw):
7197 (width): Changed to have a bit of space before and after the inset so
7198 that the blinking cursor can be seen (otherwise it was hidden)
7200 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7202 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
7203 would not be added to the link list when an installed gettext (not
7204 part of libc) is found.
7206 2000-03-24 Juergen Vigna <jug@sad.it>
7208 * src/insets/insetcollapsable.C (Edit):
7209 * src/mathed/formula.C (InsetButtonRelease):
7210 (InsetButtonPress): fixed for new handling of ButtonPress/Release
7213 * src/BufferView.C (workAreaButtonPress):
7214 (workAreaButtonRelease):
7215 (checkInsetHit): Finally fixed the clicking on insets be handled
7218 * src/insets/insetert.C (Edit): inserted this call so that ERT
7219 insets work always with LaTeX-font
7221 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7223 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
7224 caused lyx to startup with no GUI in place, causing in a crash
7225 upon startup when called with arguments.
7227 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7229 * src/FontLoader.C: better initialization of dummyXFontStruct.
7231 2000-03-20 José Abílio Matos <jamatos@lyx.org>
7233 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
7234 for linuxdoc and docbook import and export format options.
7236 * lib/lyxrc.example Example of default values for the previous flags.
7238 * src/lyx_cb.C Use those flags instead of the hardwired values for
7239 linuxdoc and docbook export.
7241 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
7244 * src/menus.C Added menus entries for the new import/exports formats.
7246 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7248 * src/lyxrc.*: Added support for running without Gui
7251 * src/FontLoader.C: sensible defaults if no fonts are needed
7253 * src/lyx_cb.C: New function ShowMessage (writes either to the
7254 minibuffer or cout in case of no gui
7255 New function AskOverwrite for common stuff
7256 Consequently various changes to call these functions
7258 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
7259 wild guess at sensible screen resolution when having no gui
7261 * src/lyxfont.C: no gui, no fonts... set some defaults
7263 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7265 * src/LColor.C: made the command inset background a bit lighter.
7267 2000-03-20 Hartmut Goebel <goebel@noris.net>
7269 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
7270 stdstruct.inc. Koma-Script added some title elements which
7271 otherwise have been listed below "bibliography". This split allows
7272 adding title elements to where they belong.
7274 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
7275 define the additional title elements and then include
7278 * many other layout files: changed to include stdtitle.inc just
7279 before stdstruct.inc.
7281 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
7283 * src/buffer.C: (save) Added the option to store all backup files
7284 in a single directory
7286 * src/lyxrc.[Ch]: Added variable \backupdir_path
7288 * lib/lyxrc.example: Added descriptions of recently added variables
7290 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
7291 bibtex inset, not closing the bibtex popup when deleting the inset)
7293 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7295 * src/lyx_cb.C: add a couple using directives.
7297 2000-03-17 José Abílio Matos <jamatos@lyx.org>
7298 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
7299 import based on the filename.
7301 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
7302 file would be imported at start, if the filename where of a sgml file.
7304 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
7306 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
7308 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
7309 * src/lyxfont.h Replaced the member variable bits.direction by the
7310 member variable lang. Made many changes in other files.
7311 This allows having a multi-lingual document
7313 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
7314 that change the current language to <l>.
7315 Removed the command "font-rtl"
7317 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
7318 format for Hebrew documents)
7320 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
7321 When auto_mathmode is "true", pressing a digit key in normal mode
7322 will cause entering into mathmode.
7323 If auto_mathmode is "rtl" then this behavior will be active only
7324 when writing right-to-left text.
7326 * src/text2.C (InsertStringA) The string is inserted using the
7329 * src/paragraph.C (GetEndLabel) Gives a correct result for
7330 footnote paragraphs.
7332 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
7334 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7336 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
7337 front of PasteParagraph. Never insert a ' '. This should at least
7338 fix some cause for the segfaults that we have been experiencing,
7339 it also fixes backspace behaviour slightly. (Phu!)
7341 * src/support/lstrings.C (compare_no_case): some change to make it
7342 compile with gcc 2.95.2 and stdlibc++-v3
7344 * src/text2.C (MeltFootnoteEnvironment): change type o
7345 first_footnote_par_is_not_empty to bool.
7347 * src/lyxparagraph.h: make text private. Changes in other files
7349 (fitToSize): new function
7350 (setContentsFromPar): new function
7351 (clearContents): new function
7352 (SetChar): new function
7354 * src/paragraph.C (readSimpleWholeFile): deleted.
7356 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
7357 the file, just use a simple string instead. Also read the file in
7358 a more maintainable manner.
7360 * src/text2.C (InsertStringA): deleted.
7361 (InsertStringB): deleted.
7363 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7365 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
7366 RedoParagraphs from the doublespace handling part, just set status
7367 to NEED_MORE_REFRESH. Also don't update cursor position (should be
7368 done, but perhaps not like this.)
7370 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7372 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
7373 character when inserting an inset.
7375 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7377 * src/bufferparams.C (readLanguage): now takes "default" into
7380 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
7381 also initialize the toplevel_keymap with the default bindings from
7384 * src/buffer.C (Buffer): remove lyxrc from the parameters.
7386 * all files using lyxrc: have lyxrc as a real variable and not a
7387 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
7390 * src/lyxrc.C: remove double call to defaultKeyBindings
7392 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
7393 toolbar defauls using lyxlex. Remove enums, structs, functions
7396 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
7397 toolbar defaults. Also store default keybindings in a map.
7399 * src/ToolbarDefaults.[Ch]: New file. This class is used for
7400 storing the toolbar defaults without any xforms dependencies.
7402 * src/insets/figinset.C: patch posted to list by Andre Poenitz
7403 applied. Changed to use iterators.
7405 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7407 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
7408 systems that don't have LINGUAS set to begin with.
7410 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7412 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
7413 the list by Dekel Tsur.
7415 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7417 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
7418 * src/insets/form_graphics.C: ditto.
7420 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
7422 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7424 * src/bufferparams.C (readLanguage): use the new language map
7426 * src/intl.C (InitKeyMapper): use the new language map
7428 * src/lyx_gui.C (create_forms): use the new language map
7430 * src/language.[Ch]: New files. Used for holding the information
7431 about each language. Now! Use this new language map enhance it and
7432 make it really usable for our needs.
7434 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
7436 * screen.C (ShowCursor): Removed duplicate code.
7437 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
7438 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
7440 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
7443 * src/text.C Added TransformChar method. Used for rendering Arabic
7444 text correctly (change the glyphs of the letter according to the
7445 position in the word)
7450 * src/lyxrc.C Added lyxrc command {language_command_begin,
7451 language_command_end,language_command_ltr,language_command_rtl,
7452 language_package} which allows the use of either arabtex or Omega
7455 * src/lyx_gui.C (init)
7457 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
7458 to use encoding for menu fonts which is different than the encoding
7461 * src/buffer.C (makeLaTeXFile): If params.language = "default",
7462 do not load the babel package.
7463 To write an English document with Hebrew/Arabic, change the document
7464 language to "english".
7466 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
7467 (alphaCounter): changed to return char
7468 (loweralphaCounter, hebrewCounter, romanCounter): New functions
7470 * lib/lyxrc.example Added examples for Hebrew/Arabic
7473 * src/layout.C Added layout command endlabeltype
7475 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
7477 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
7479 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7481 * src/mathed/math_delim.C (search_deco): return a
7482 math_deco_struct* instead of index.
7484 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7486 * All files with a USE_OSTREAM_ONLY within: removed all code that
7487 was unused when USE_OSTREAM_ONLY is defined.
7489 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
7490 of any less. Removed header and using.
7492 * src/text.C (GetVisibleRow): draw the string "Page Break
7493 (top/bottom)" on screen when drawing a pagebreak line.
7495 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7497 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
7499 * src/mathed/math_macro.C (draw): do some cast magic.
7502 * src/mathed/math_defs.h: change byte* argument to byte const*.
7504 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
7506 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
7507 know it is right to return InsetFoot* too, but cxx does not like
7510 * src/insets/insetcollapsable.[Ch] (Clone): make const.
7512 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
7514 * src/mathed/math_delim.C: change == to proper assignment.
7516 2000-03-09 Juergen Vigna <jug@sad.it>
7518 * src/insets/insettext.C (setPos): fixed various cursor positioning
7519 problems (via mouse and cursor-keys)
7520 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
7521 inset (still a small display problem but it works ;)
7523 * src/insets/insetcollapsable.C (draw): added button_top_y and
7524 button_bottom_y to have correct values for clicking on the inset.
7526 * src/support/lyxalgo.h: commented out 'using std::less'
7528 2000-03-08 Juergen Vigna <jug@sad.it>
7530 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
7531 Button-Release event closes as it is alos the Release-Event
7534 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
7536 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7538 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
7539 can add multiple spaces in Scrap (literate programming) styles...
7540 which, by the way, is how I got hooked on LyX to begin with.
7542 * src/mathed/formula.C (Write): Added dummy variable to an
7543 inset::Latex() call.
7544 (Latex): Add free_spacing boolean to inset::Latex()
7546 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
7548 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
7549 virtual function to include the free_spacing boolean from
7550 the containing paragraph's style.
7552 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
7553 Added free_spacing boolean arg to match inset.h
7555 * src/insets/insettext.C, src/insets/insettext.h (Latex):
7556 Added free_spacing boolean arg to match inset.h
7558 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
7559 Added free_spacing boolean and made sure that if in a free_spacing
7560 paragraph, that we output normal space if there is a protected space.
7562 * src/insets/insetref.C, src/insets/insetref.h (Latex):
7563 Added free_spacing boolean arg to match inset.h
7565 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
7566 Added free_spacing boolean arg to match inset.h
7568 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
7569 Added free_spacing boolean arg to match inset.h
7571 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
7572 Added free_spacing boolean arg to match inset.h
7574 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
7575 Added free_spacing boolean arg to match inset.h
7577 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
7578 free_spacing boolean arg to match inset.h
7580 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
7581 Added free_spacing boolean arg to match inset.h
7583 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
7584 Added free_spacing boolean arg to match inset.h
7586 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
7587 Added free_spacing boolean arg to match inset.h
7589 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
7590 Added free_spacing boolean arg to match inset.h
7592 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
7593 Added free_spacing boolean arg to match inset.h
7595 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
7596 free_spacing boolean arg to match inset.h
7598 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
7599 free_spacing boolean arg to match inset.h
7601 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
7602 ignore free_spacing paragraphs. The user's spaces are left
7605 * src/text.C (InsertChar): Fixed the free_spacing layout
7606 attribute behavior. Now, if free_spacing is set, you can
7607 add multiple spaces in a paragraph with impunity (and they
7608 get output verbatim).
7609 (SelectSelectedWord): Added dummy argument to inset::Latex()
7612 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
7615 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
7616 paragraph layouts now only input a simple space instead.
7617 Special character insets don't make any sense in free-spacing
7620 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
7621 hard-spaces in the *input* file to simple spaces if the layout
7622 is free-spacing. This converts old files which had to have
7623 hard-spaces in free-spacing layouts where a simple space was
7625 (writeFileAscii): Added free_spacing check to pass to the newly
7626 reworked inset::Latex(...) methods. The inset::Latex() code
7627 ensures that hard-spaces in free-spacing paragraphs get output
7628 as spaces (rather than "~").
7630 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7632 * src/mathed/math_delim.C (draw): draw the empty placeholder
7633 delims with a onoffdash line.
7634 (struct math_deco_compare): struct that holds the "functors" used
7635 for the sort and the binary search in math_deco_table.
7636 (class init_deco_table): class used for initial sort of the
7638 (search_deco): use lower_bound to do a binary search in the
7641 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7643 * src/lyxrc.C: a small secret thingie...
7645 * src/lyxlex.C (printTable): changed to take a ostream as paramter
7646 and to not flush the stream as often as it used to.
7648 * src/support/lyxalgo.h: new file
7649 (sorted): template function used for checking if a sequence is
7650 sorted or not. Two versions with and without user supplied
7651 compare. Uses same compare as std::sort.
7653 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
7654 it and give warning on lyxerr.
7656 (struct compare_tags): struct with function operators used for
7657 checking if sorted, sorting and lower_bound.
7658 (search_kw): use lower_bound instead of manually implemented
7661 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7663 * src/insets/insetcollapsable.h: fix Clone() declaration.
7664 * src/insets/insetfoot.h: ditto.
7666 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
7668 2000-03-08 Juergen Vigna <jug@sad.it>
7670 * src/insets/lyxinset.h: added owner call which tells us if
7671 this inset is inside another inset. Changed also the return-type
7672 of Editable to an enum so it tells clearer what the return-value is.
7674 * src/insets/insettext.C (computeTextRows): fixed computing of
7675 textinsets which split automatically on more rows.
7677 * src/insets/insetert.[Ch]: changed this to be of BaseType
7680 * src/insets/insetfoot.[Ch]: added footnote inset
7682 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
7683 collapsable insets (like footnote, ert, ...)
7685 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7687 * src/lyxdraw.h: remvoe file
7689 * src/lyxdraw.C: remove file
7691 * src/insets/insettext.C: added <algorithm>.
7693 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7695 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
7696 (matrix_cb): case MM_OK use string stream
7698 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
7701 * src/mathed/math_macro.C (draw): use string stream
7702 (Metrics): use string stream
7704 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
7705 directly to the ostream.
7707 * src/vspace.C (asString): use string stream.
7708 (asString): use string stream
7709 (asLatexString): use string stream
7711 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
7712 setting Spacing::Other.
7714 * src/LaTeXFeatures.C (getPackages): use string stream instead of
7715 sprintf when creating the stretch vale.
7717 * src/text2.C (alphaCounter): changed to return a string and to
7718 not use a static variable internally. Also fixed a one-off bug.
7719 (SetCounter): changed the drawing of the labels to use string
7720 streams instead of sprintf.
7722 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
7723 manipulator to use a scheme that does not require library support.
7724 This is also the way it is done in the new GNU libstdc++. Should
7725 work with DEC cxx now.
7727 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7729 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
7730 end. This fixes a bug.
7732 * src/mathed (all files concerned with file writing): apply the
7733 USE_OSTREAM_ONLY changes to mathed too.
7735 * src/support/DebugStream.h: make the constructor explicit.
7737 * src/lyxfont.C (latexWriteStartChanges): small bug related to
7738 count and ostream squashed.
7740 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7742 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
7744 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
7745 ostringstream uses STL strings, and we might not.
7747 * src/insets/insetspecialchar.C: add using directive.
7748 * src/insets/insettext.C: ditto.
7750 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7752 * lib/layouts/seminar.layout: feeble attempt at a layout for
7753 seminar.cls, far from completet and could really use some looking
7754 at from people used to write layout files.
7756 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
7757 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
7758 a lot nicer and works nicely with ostreams.
7760 * src/mathed/formula.C (draw): a slightly different solution that
7761 the one posted to the list, but I think this one works too. (font
7762 size wrong in headers.)
7764 * src/insets/insettext.C (computeTextRows): some fiddling on
7765 Jürgens turf, added some comments that he should read.
7767 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
7768 used and it gave compiler warnings.
7769 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
7772 * src/lyx_gui.C (create_forms): do the right thing when
7773 show_banner is true/false.
7775 * src/lyx_cb.C (TimerCB): no need to close or do anything if
7776 show_banner is false.
7778 * most file writing files: Now use iostreams to do almost all of
7779 the writing. Also instead of passing string &, we now use
7780 stringstreams. mathed output is still not adapted to iostreams.
7781 This change can be turned off by commenting out all the occurences
7782 of the "#define USE_OSTREAM_ONLY 1" lines.
7784 * src/WorkArea.C (createPixmap): don't output debug messages.
7785 (WorkArea): don't output debug messages.
7787 * lib/lyxrc.example: added a comment about the new variable
7790 * development/Code_rules/Rules: Added some more commente about how
7791 to build class interfaces and on how better encapsulation can be
7794 2000-03-03 Juergen Vigna <jug@sad.it>
7796 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
7797 automatically with the width of the LyX-Window
7799 * src/insets/insettext.C (computeTextRows): fixed update bug in
7800 displaying text-insets (scrollvalues where not initialized!)
7802 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7804 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
7805 id in the check of the result from lower_bound is not enough since
7806 lower_bound can return last too, and then res->id will not be a
7809 * all insets and some code that use them: I have conditionalized
7810 removed the Latex(string & out, ...) this means that only the
7811 Latex(ostream &, ...) will be used. This is a work in progress to
7812 move towards using streams for all output of files.
7814 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
7817 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7819 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
7820 routine (this fixes bug where greek letters were surrounded by too
7823 * src/support/filetools.C (findtexfile): change a bit the search
7824 algorithm, to fix bug introduced in 1.1.4. Note that --format is
7825 no longer passed to kpsewhich, we may have to change that later.
7827 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
7828 warning options to avoid problems with X header files (from Angus
7830 * acinclude.m4: regenerated.
7832 2000-03-02 Juergen Vigna <jug@sad.it>
7834 * src/insets/insettext.C (WriteParagraphData): Using the
7835 par->writeFile() function for writing paragraph-data.
7836 (Read): Using buffer->parseSingleLyXformat2Token()-function
7837 for parsing paragraph data!
7839 * src/buffer.C (readLyXformat2): removed all parse data and using
7840 the new parseSingleLyXformat2Token()-function.
7841 (parseSingleLyXformat2Token): added this function to parse (read)
7842 lyx-file-format (this is called also from text-insets now!)
7844 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7846 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
7849 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
7850 directly instead of going through a func. One very bad thing: a
7851 static LyXFindReplace, but I don't know where to place it.
7853 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
7854 string instead of char[]. Also changed to static.
7855 (GetSelectionOrWordAtCursor): changed to static inline
7856 (SetSelectionOverLenChars): ditto.
7858 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
7859 current_view and global variables. both classes has changed names
7860 and LyXFindReplace is not inherited from SearchForm.
7862 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
7863 fl_form_search form.
7865 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
7867 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7869 * lib/bind/*.bind: make sure 'buffer-previous' function is not
7870 bound (from Kayvan).
7872 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
7874 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
7876 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7878 * some things that I should comment but the local pub says head to
7881 * comment out all code that belongs to the Roff code for Ascii
7882 export of tables. (this is unused)
7884 * src/LyXView.C: use correct type for global variable
7885 current_layout. (LyXTextClass::size_type)
7887 * some code to get the new insetgraphics closer to working I'd be
7888 grateful for any help.
7890 * src/BufferView2.C (insertInset): use the return type of
7891 NumberOfLayout properly. (also changes in other files)
7893 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
7894 this as a test. I want to know what breaks because of this.
7896 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
7898 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7900 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
7901 to use a \makebox in the label, this allows proper justification
7902 with out using protected spaces or multiple hfills. Now it is
7903 "label" for left justified, "\hfill label\hfill" for center, and
7904 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
7905 should be changed accordingly.
7907 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7909 * src/lyxtext.h: change SetLayout() to take a
7910 LyXTextClass::size_type instead of a char (when there is more than
7911 127 layouts in a class); also change type of copylayouttype.
7912 * src/text2.C (SetLayout): ditto.
7913 * src/LyXView.C (updateLayoutChoice): ditto.
7915 * src/LaTeX.C (scanLogFile): errors where the line number was not
7916 given just after the '!'-line were ignored (from Dekel Tsur).
7918 * lib/lyxrc.example: fix description of \date_insert_format
7920 * lib/layouts/llncs.layout: new layout, contributed by Martin
7923 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7925 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
7926 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
7927 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
7928 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
7929 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
7930 paragraph.C, text.C, text2.C)
7932 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7934 * src/insets/insettext.C (LocalDispatch): remove extra break
7937 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
7938 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
7940 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
7941 * src/insets/insettext.[Ch] (GetCursorPos): ditto
7943 * src/insets/insetbib.h: move InsetBibkey::Holder and
7944 InsetCitation::Holder in public space.
7946 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7948 * src/insets/insettext.h: small change to get the new files from
7949 Juergen to compile (use "string", not "class string").
7951 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
7952 const & as parameter to LocalDispatch, use LyXFont const & as
7953 paramter to some other func. This also had impacto on lyxinsets.h
7954 and the two mathed insets.
7956 2000-02-24 Juergen Vigna <jug@sad.it>
7959 * src/commandtags.h:
7961 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
7965 * src/BufferView2.C: added/updated code for various inset-functions
7967 * src/insets/insetert.[Ch]: added implementation of InsetERT
7969 * src/insets/insettext.[Ch]: added implementation of InsetText
7971 * src/insets/inset.C (Edit): added "unsigned int button" parameter
7972 (draw): added preliminary code for inset scrolling not finshed yet
7974 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
7975 as it is in lyxfunc.C now
7977 * src/insets/lyxinset.h: Added functions for text-insets
7979 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7981 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
7982 BufferView and reimplement the list as a queue put inside its own
7985 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
7987 * several files: use the new interface to the "updateinsetlist"
7989 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
7991 (work_area_handler): call BufferView::trippleClick on trippleclick.
7993 * src/BufferView.C (doubleClick): new function, selects word on
7995 (trippleClick): new function, selects line on trippleclick.
7997 2000-02-22 Allan Rae <rae@lyx.org>
7999 * lib/bind/xemacs.bind: buffer-previous not supported
8001 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8003 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
8006 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8008 * src/bufferlist.C: get rid of current_view from this file
8010 * src/spellchecker.C: get rid of current_view from this file
8012 * src/vspace.C: get rid of current_view from this file
8013 (inPixels): added BufferView parameter for this func
8014 (asLatexCommand): added a BufferParams for this func
8016 * src/text.C src/text2.C: get rid of current_view from these
8019 * src/lyxfont.C (getFontDirection): move this function here from
8022 * src/bufferparams.C (getDocumentDirection): move this function
8025 * src/paragraph.C (getParDirection): move this function here from
8027 (getLetterDirection): ditto
8029 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
8031 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
8032 resize due to wrong pixmap beeing used. Also took the opurtunity
8033 to make the LyXScreen stateless on regard to WorkArea and some
8034 general cleanup in the same files.
8036 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8038 * src/Makefile.am: add missing direction.h
8040 * src/PainterBase.h: made the width functions const.
8042 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
8045 * src/insets/insetcommand.C (draw): draw Editable as buttons.
8047 * src/insets/insetlatexaccent.C (draw): make the accents draw
8048 better, at present this will only work well with iso8859-1.
8050 * several files: remove the old drawing code, now we use the new
8053 * several files: remove support for mono_video, reverse_video and
8056 2000-02-17 Juergen Vigna <jug@sad.it>
8058 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
8059 int ** as we have to return the pointer, otherwise we have only
8060 NULL pointers in the returning function.
8062 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8064 * src/LaTeX.C (operator()): quote file name when running latex.
8066 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8068 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
8069 (bubble tip), this removes our special handling of this.
8071 * Remove all code that is unused now that we have the new
8072 workarea. (Code that are not active when NEW_WA is defined.)
8074 * Make the uses of XSync not conditionalized on define USE_XSYNC.
8076 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8078 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
8079 nonexisting layout; correctly redirect obsoleted layouts.
8081 * lib/lyxrc.example: document \view_dvi_paper_option
8083 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
8086 * src/lyx_cb.C (RunScript): handle $$FName for command names.
8087 (PreviewDVI): handle the view_dvi_paper_option variable.
8088 [Both from Roland Krause]
8090 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8092 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
8093 char const *, int, LyXFont)
8094 (text(int, int, string, LyXFont)): ditto
8096 * src/text.C (InsertCharInTable): attempt to fix the double-space
8097 feature in tables too.
8098 (BackspaceInTable): ditto.
8099 (GetVisibleRow): make bottom pagebreak line be a onoff line.
8101 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8103 * src/text2.C (owner): only complain if owner_ is set and bv != 0
8105 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
8106 newly found text in textcache to this.
8107 (buffer): set the owner of the text put into the textcache to 0
8109 * src/insets/figinset.C (draw): fixed the drawing of figures with
8112 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
8113 drawing of mathframe, hfills, protected space, table lines. I have
8114 now no outstanding drawing problems with the new Painter code.
8116 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8118 * src/PainterBase.C (ellipse, circle): do not specify the default
8121 * src/LColor.h: add using directive.
8123 * src/Painter.[Ch]: change return type of methods from Painter& to
8124 PainterBase&. Add a using directive.
8126 * src/WorkArea.C: wrap xforms callbacks in C functions
8129 * lib/layouts/foils.layout: font fix and simplifications from Carl
8132 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8134 * a lot of files: The Painter, LColor and WorkArea from the old
8135 devel branch has been ported to lyx-devel. Some new files and a
8136 lot of #ifdeffed code. The new workarea is enabled by default, but
8137 if you want to test the new Painter and LColor you have to compile
8138 with USE_PAINTER defined (do this in config.h f.ex.) There are
8139 still some rought edges, and I'd like some help to clear those
8140 out. It looks stable (loads and displays the Userguide very well).
8143 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8145 * src/buffer.C (pop_tag): revert to the previous implementation
8146 (use a global variable for both loops).
8148 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
8150 * src/lyxrc.C (LyXRC): change slightly default date format.
8152 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
8153 there is an English text with a footnote that starts with a Hebrew
8154 paragraph, or vice versa.
8155 (TeXFootnote): ditto.
8157 * src/text.C (LeftMargin): allow for negative values for
8158 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
8161 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
8162 for input encoding (cyrillic)
8164 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8166 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
8169 * src/toolbar.C (set): ditto
8170 * src/insets/insetbib.C (create_form_citation_form): ditto
8172 * lib/CREDITS: added Dekel Tsur.
8174 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
8175 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
8176 hebrew supports files from Dekel Tsur.
8178 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
8179 <tzafrir@technion.ac.il>
8181 * src/lyxrc.C: put \date_insert_format at the right place.
8183 * src/buffer.C (makeLaTeXFile): fix the handling of
8184 BufferParams::sides when writing out latex files.
8186 * src/BufferView2.C: add a "using" directive.
8188 * src/support/lyxsum.C (sum): when we use lyxstring,
8189 ostringstream::str needs an additional .c_str().
8191 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8193 * src/support/filetools.C (ChangeExtension): patch from Etienne
8196 * src/TextCache.C (show): remove const_cast and make second
8197 parameter non-const LyXText *.
8199 * src/TextCache.h: use non const LyXText in show.
8201 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
8204 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8206 * src/support/lyxsum.C: rework to be more flexible.
8208 * several places: don't check if a pointer is 0 if you are going
8211 * src/text.C: remove some dead code.
8213 * src/insets/figinset.C: remove some dead code
8215 * src/buffer.C: move the BufferView funcs to BufferView2.C
8216 remove all support for insetlatexdel
8217 remove support for oldpapersize stuff
8218 made some member funcs const
8220 * src/kbmap.C: use a std::list to store the bindings in.
8222 * src/BufferView2.C: new file
8224 * src/kbsequence.[Ch]: new files
8226 * src/LyXAction.C + others: remove all trace of buffer-previous
8228 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
8229 only have one copy in the binary of this table.
8231 * hebrew patch: moved some functions from LyXText to more
8232 appropriate places. (LyXParagraph, BufferParams, LyXFont)
8234 * several files: remove support for XForms older than 0.88
8236 remove some #if 0 #endif code
8238 * src/TextCache.[Ch]: new file. Holds the textcache.
8240 * src/BufferView.C: changes to use the new TextCache interface.
8241 (waitForX): remove the now unused code.
8243 * src/BackStack.h: remove some commented code
8245 * lib/bind/emacs.bind: remove binding for buffer-previous
8247 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8249 * applied the hebrew patch.
8251 * src/lyxrow.h: make sure that all Row variables are initialized.
8253 * src/text2.C (TextHandleUndo): comment out a delete, this might
8254 introduce a memory leak, but should also help us to not try to
8255 read freed memory. We need to look at this one.
8257 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
8258 (LyXParagraph): initalize footnotekind.
8260 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
8261 forgot this when applying the patch. Please heed the warnings.
8263 * src/BufferView.C (buffer): a fix for the buffer-reload problem
8264 (aka. reformat problem)
8266 * src/bufferlist.C (exists): made const, and use const_iterator
8267 (isLoaded): new func.
8268 (release): use std::find to find the correct buffer.
8270 * src/bufferlist.h: made getState a const func.
8271 made empty a const func.
8272 made exists a const func.
8275 2000-02-01 Juergen Vigna <jug@sad.it>
8277 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
8279 * po/it.po: updated a bit the italian po file and also changed the
8280 'file nuovo' for newfile to 'filenuovo' without a space, this did
8283 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
8284 for the new insert_date command.
8286 * src/lyxfunc.C (Dispatch): added support for a insert_date function
8287 from jdblair, to insert a date into the current text conforming to
8288 a strftime format (for now only considering the locale-set and not
8289 the document-language).
8291 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8293 * src/lyxfont.C (textWidth): hopefully better fix for the Array
8294 Bounds Read error seen by purify. The problem was that islower is
8295 a macros which takes an unsigned char and uses it as an index for
8296 in array of characters properties (and is thus subject to the
8300 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
8301 correctly the paper sides radio buttons.
8302 (UpdateDocumentButtons): ditto.
8304 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8306 * src/kbmap.C (getsym + others): change to return unsigned int,
8307 returning a long can give problems on 64 bit systems. (I assume
8308 that int is 32bit on 64bit systems)
8310 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8312 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
8313 LyXLookupString to be zero-terminated. Really fixes problems seen
8316 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8318 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
8319 write a (char*)0 to the lyxerr stream.
8321 * src/lastfiles.C: move algorithm before the using statemets.
8323 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8325 * src/lastfiles.C: move using directives in global scope (egcs 1.x
8326 complains otherwise).
8327 * src/table.C: ditto
8329 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
8332 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
8333 that I removed earlier... It is really needed.
8335 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
8337 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8339 * INSTALL: update xforms home page URL.
8341 * lib/configure.m4: fix a bug with unreadable layout files.
8343 * src/table.C (calculate_width_of_column): add "using std::max"
8346 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8348 * several files: marked several lines with "DEL LINE", this is
8349 lines that can be deleted without changing anything.
8350 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
8351 checks this anyway */
8354 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
8356 * src/DepTable.C (update): add a "+" at the end when the checksum
8357 is different. (debugging string only)
8359 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
8360 the next inset to not be displayed. This should also fix the list
8361 of labels in the "Insert Crossreference" dialog.
8363 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8365 * src/support/LSubstring.C (LSubstring): set pos to string::npos
8366 when regex was not found.
8368 * src/support/lstrings.C (lowercase): use handcoded transform always.
8371 * src/text.C (Delete): fixed the crash. cursor.par->prev and
8372 old_cursor.par->prev could be 0.
8374 * several files: changed post inc/dec to pre inc/dec
8376 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
8377 write the lastfiles to file.
8379 * src/BufferView.C (buffer): only show TextCache info when debugging
8381 (resizeCurrentBuffer): ditto
8382 (workAreaExpose): ditto
8384 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
8386 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
8388 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
8389 a bit better by removing the special case for \i and \j.
8391 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8393 * src/lyx_main.C (easyParse): remove test for bad comand line
8394 options, since this broke all xforms-related parsing.
8396 * src/kbmap.C (getsym): set return type to unsigned long, as
8397 declared in header. On an alpha, long is _not_ the same as int.
8399 * src/support/LOstream.h: add a "using std::flush;"
8401 * src/insets/figinset.C: ditto.
8403 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8405 * src/bufferlist.C (write): use blinding fast file copy instead of
8406 "a char at a time", now we are doing it the C++ way.
8408 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
8409 std::list<int> instead.
8410 (addpidwait): reflect move to std::list<int>
8411 (sigchldchecker): ditto
8413 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
8416 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
8417 that obviously was wrong...
8419 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
8420 c, this avoids warnings with purify and islower.
8422 * src/insets/figinset.C: rename struct queue to struct
8423 queue_element and rewrite to use a std::queue. gsqueue is now a
8424 std::queue<queue_element>
8425 (runqueue): reflect move to std::queue
8428 * src/support/lstrings.h (tostr): specialize for bool, otherwise
8429 we would get "1" "0" instead of "true" "false. Also make the tostr
8432 2000-01-21 Juergen Vigna <jug@sad.it>
8434 * src/buffer.C (writeFileAscii): Disabled code for special groff
8435 handling of tabulars till I fix this in table.C
8437 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8439 * src/support/mkdir.C (mkdir): change second argument of mkdir to
8441 * src/support/lyxlib.h: ditto.
8443 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8445 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
8446 and 'j' look better. This might fix the "macron" bug that has been
8449 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
8450 functions as one template function. Delete the old versions.
8452 * src/support/lyxsum.C: move using std::ifstream inside
8455 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
8458 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
8460 * src/mathed/formula.C: delete #include "bufferlist.h" never used
8462 * src/insets/figinset.C (InitFigures): use new instead of malloc
8463 to allocate memory for figures and bitmaps.
8464 (DoneFigures): use delete[] instead of free to deallocate memory
8465 for figures and bitmaps.
8466 (runqueue): use new to allocate
8467 (getfigdata): use new/delete[] instead of malloc/free
8468 (RegisterFigure): ditto
8470 * some files: moved some declarations closer to first use, small
8471 whitespace changes use preincrement instead of postincrement where
8472 it does not make a difference.
8474 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
8475 step on the way to use stl::containers for key maps.
8477 * src/bufferlist.h: add a typedef for const_iterator and const
8478 versions of begin and end.
8480 * src/bufferlist.[Ch]: change name of member variable _state to
8481 state_. (avoid reserved names)
8483 (getFileNames): returns the filenames of the buffers in a vector.
8485 * configure.in (ALL_LINGUAS): added ro
8487 * src/support/putenv.C: new file
8489 * src/support/mkdir.C: new file
8491 2000-01-20 Allan Rae <rae@lyx.org>
8493 * lib/layouts/IEEEtran.layout: Added several theorem environments
8495 * lib/templates/IEEEtran.lyx: Example theorem environments and a
8496 couple of minor additions.
8498 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
8499 (except for those in footnotes of course)
8501 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8503 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
8505 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
8506 std::sort and std::lower_bound instead of qsort and handwritten
8508 (struct compara): struct that holds the functors used by std::sort
8509 and std::lower_bound in MathedLookupBOP.
8511 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8513 * src/support/LAssert.h: do not do partial specialization. We do
8516 * src/support/lyxlib.h: note that lyx::getUserName() and
8517 lyx::date() are not in use right now. Should these be suppressed?
8519 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
8520 (makeLinuxDocFile): do not put date and user name in linuxdoc
8523 * src/support/lyxlib.h (kill): change first argument to long int,
8524 since that's what solaris uses.
8526 * src/support/kill.C (kill): fix declaration to match prototype.
8528 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
8529 actually check whether namespaces are supported. This is not what
8532 * src/support/lyxsum.C: add a using directive.
8534 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8536 * src/support/kill.C: if we have namespace support we don't have
8537 to include lyxlib.h.
8539 * src/support/lyxlib.h: use namespace lyx if supported.
8541 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8543 * src/support/date.C: new file
8545 * src/support/chdir.C: new file
8547 * src/support/getUserName.C: new file
8549 * src/support/getcwd.C: new file
8551 * src/support/abort.C: new file
8553 * src/support/kill.C: new file
8555 * src/support/lyxlib.h: moved all the functions in this file
8556 insede struct lyx. Added also kill and abort to this struct. This
8557 is a way to avoid the "kill is not defined in <csignal>", we make
8558 C++ wrappers for functions that are not ANSI C or ANSI C++.
8560 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
8561 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
8562 lyx it has been renamed to sum.
8564 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8566 * src/text.C: add using directives for std::min and std::max.
8568 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8570 * src/texrow.C (getIdFromRow): actually return something useful in
8571 id and pos. Hopefully fixes the bug with positionning of errorbox
8574 * src/lyx_main.C (easyParse): output an error and exit if an
8575 incorrect command line option has been given.
8577 * src/spellchecker.C (ispell_check_word): document a memory leak.
8579 * src/bufferlist.C (write): fix mismatched allocation/deletion,
8580 where a "struct utimbuf" is allocated with "new" and deleted with
8583 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8585 * src/text2.C (CutSelection): don't delete double spaces.
8586 (PasteSelection): ditto
8587 (CopySelection): ditto
8589 * src/text.C (Backspace): don't delete double spaces.
8591 * src/lyxlex.C (next): fix a bug that were only present with
8592 conformant std::istream::get to read comment lines, use
8593 std::istream::getline instead. This seems to fix the problem.
8595 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8597 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
8598 allowed to insert space before space" editing problem. Please read
8599 commends at the beginning of the function. Comments about usage
8602 * src/text.C (InsertChar): fix for the "not allowed to insert
8603 space before space" editing problem.
8605 * src/text2.C (DeleteEmptyParagraphMechanism): when
8606 IsEmptyTableRow can only return false this last "else if" will
8607 always be a no-op. Commented out.
8609 * src/text.C (RedoParagraph): As far as I can understand tmp
8610 cursor is not really needed.
8612 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
8613 present it could only return false anyway.
8614 (several functions): Did something not so smart...added a const
8615 specifier on a lot of methods.
8617 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
8618 and add a tmp->text.resize. The LyXParagraph constructor does the
8620 (BreakParagraphConservative): ditto
8622 * src/support/path.h (Path): add a define so that the wrong usage
8623 "Path("/tmp") will be flagged as a compilation error:
8624 "`unnamed_Path' undeclared (first use this function)"
8626 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8628 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
8629 which was bogus for several reasons.
8631 * src/LaTeX.C (scanAux): fix the regular expression used to scan
8635 * autogen.sh: do not use "type -path" (what's that anyway?).
8637 * src/support/filetools.C (findtexfile): remove extraneous space
8638 which caused a kpsewhich warning (at least with kpathsea version
8641 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8643 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
8645 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
8647 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
8649 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8651 * src/paragraph.C (BreakParagraph): do not reserve space on text
8652 if we don't need to (otherwise, if pos_end < pos, we end up
8653 reserving huge amounts of memory due to bad unsigned karma).
8654 (BreakParagraphConservative): ditto, although I have not seen
8655 evidence the bug can happen here.
8657 * src/lyxparagraph.h: add a using std::list.
8659 2000-01-11 Juergen Vigna <jug@sad.it>
8661 * src/menus.C (MenuDocu): output an Alert if the documentation-file
8664 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8666 * src/vc-backend.C (doVCCommand): change to be static and take one
8667 more parameter: the path to chdir too be fore executing the command.
8668 (retrive): new function equiv to "co -r"
8670 * src/bufferlist.C (loadLyXFile): implement the missing parts if
8671 file_not_found_hook is true.
8673 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
8675 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
8676 if a file is readwrite,readonly...anything else.
8678 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8680 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
8681 (CreatePostscript): name change from MenuRunDVIPS (or something)
8682 (PreviewPostscript): name change from MenuPreviewPS
8683 (PreviewDVI): name change from MenuPreviewDVI
8685 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
8686 \view_pdf_command., \pdf_to_ps_command
8688 * lib/configure.m4: added search for PDF viewer, and search for
8689 PDF to PS converter.
8690 (lyxrc.defaults output): add \pdflatex_command,
8691 \view_pdf_command and \pdf_to_ps_command.
8693 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
8695 * src/bufferlist.C (write): we don't use blocksize for anything so
8698 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8700 * src/support/block.h: disable operator T* (), since it causes
8701 problems with both compilers I tried. See comments in the file.
8703 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
8706 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
8707 variable LYX_DIR_10x to LYX_DIR_11x.
8709 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
8711 * INSTALL: document --with-lyxname.
8714 * configure.in: new configure flag --with-lyxname which allows to
8715 choose the name under which lyx is installed. Default is "lyx", of
8716 course. It used to be possible to do this with --program-suffix,
8717 but the later has in fact a different meaning for autoconf.
8719 * src/support/lstrings.h (lstrchr): reformat a bit.
8721 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
8722 * src/mathed/math_defs.h: ditto.
8724 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8726 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
8727 true, decides if we create a backup file or not when saving. New
8728 tag and variable \pdf_mode, defaults to false. New tag and
8729 variable \pdflatex_command, defaults to pdflatex. New tag and
8730 variable \view_pdf_command, defaults to xpdf. New tag and variable
8731 \pdf_to_ps_command, defaults to pdf2ps.
8733 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8735 * src/bufferlist.C (close): don't call insetUnlock if the buffer
8736 does not have a BufferView.
8737 (unlockInset): ditto + don't access the_locking_inset if the
8738 buffer does not have a BufferView.
8740 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
8741 certain circumstances so that we don't continue a keyboard
8742 operation long after the key was released. Try f.ex. to load a
8743 large document, press PageDown for some seconds and then release
8744 it. Before this change the document would contine to scroll for
8745 some time, with this change it stops imidiatly.
8747 * src/support/block.h: don't allocate more space than needed. As
8748 long as we don't try to write to the arr[x] in a array_type arr[x]
8749 it is perfectly ok. (if you write to it you might segfault).
8750 added operator value_type*() so that is possible to pass the array
8751 to functions expecting a C-pointer.
8753 * lib/Makefile.am (dist-hook): don't fail completely if unable to
8756 * intl/*: updated to gettext 0.10.35, tried to add our own
8757 required modifications. Please verify.
8759 * po/*: updated to gettext 0.10.35, tried to add our own required
8760 modifications. Please verify.
8762 * src/support/lstrings.C (tostr): go at fixing the problem with
8763 cxx and stringstream. When stringstream is used return
8764 oss.str().c_str() so that problems with lyxstring and basic_string
8765 are avoided. Note that the best solution would be for cxx to use
8766 basic_string all the way, but it is not conformant yet. (it seems)
8768 * src/lyx_cb.C + other files: moved several global functions to
8769 class BufferView, some have been moved to BufferView.[Ch] others
8770 are still located in lyx_cb.C. Code changes because of this. (part
8771 of "get rid of current_view project".)
8773 * src/buffer.C + other files: moved several Buffer functions to
8774 class BufferView, the functions are still present in buffer.C.
8775 Code changes because of this.
8777 * config/lcmessage.m4: updated to most recent. used when creating
8780 * config/progtest.m4: updated to most recent. used when creating
8783 * config/gettext.m4: updated to most recent. applied patch for
8786 * config/gettext.m4.patch: new file that shows what changes we
8787 have done to the local copy of gettext.m4.
8789 * config/libtool.m4: new file, used in creation of acinclude.m4
8791 * config/lyxinclude.m4: new file, this is the lyx created m4
8792 macros, used in making acinclude.m4.
8794 * autogen.sh: GNU m4 discovered as a separate task not as part of
8795 the lib/configure creation.
8796 Generate acinlucde from files in config. Actually cat
8797 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
8798 easier to upgrade .m4 files that really are external.
8800 * src/Spacing.h: moved using std::istringstream to right after
8801 <sstream>. This should fix the problem seen with some compilers.
8803 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8805 * src/lyx_cb.C: began some work to remove the dependency a lot of
8806 functions have on BufferView::text, even if not really needed.
8807 (GetCurrentTextClass): removed this func, it only hid the
8810 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
8811 forgot this in last commit.
8813 * src/Bullet.C (bulletEntry): use static char const *[] for the
8814 tables, becuase of this the return arg had to change to string.
8816 (~Bullet): removed unneeded destructor
8818 * src/BufferView.C (beforeChange): moved from lyx_cb.C
8819 (insetSleep): moved from Buffer
8820 (insetWakeup): moved from Buffer
8821 (insetUnlock): moved from Buffer
8823 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
8824 from Buffer to BufferView.
8826 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
8828 * config/ltmain.sh: updated to version 1.3.4 of libtool
8830 * config/ltconfig: updated to version 1.3.4 of libtool
8832 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8835 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
8836 Did I get that right?
8838 * src/lyxlex.h: add a "using" directive or two.
8839 * src/Spacing.h: ditto.
8840 * src/insets/figinset.C: ditto.
8841 * src/support/filetools.C: ditto.
8842 * src/support/lstrings.C: ditto.
8843 * src/BufferView.C: ditto.
8844 * src/bufferlist.C: ditto.
8845 * src/lyx_cb.C: ditto.
8846 * src/lyxlex.C: ditto.
8848 * NEWS: add some changes for 1.1.4.
8850 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8852 * src/BufferView.C: first go at a TextCache to speed up switching
8855 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8857 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
8858 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
8859 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
8860 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
8863 * src/mathed/math_defs.h (MathedRowSt): make sure that all
8864 members of the struct are correctly initialized to 0 (detected by
8866 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
8867 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
8869 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
8870 pidwait, since it was allocated with "new". This was potentially
8871 very bad. Thanks to Michael Schmitt for running purify for us.
8874 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8876 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
8878 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
8880 1999-12-30 Allan Rae <rae@lyx.org>
8882 * lib/templates/IEEEtran.lyx: minor change
8884 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
8885 src/mathed/formula.C (LocalDispatch): askForText changes
8887 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
8888 know when a user has cancelled input. Fixes annoying problems with
8889 inserting labels and version control.
8891 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8893 * src/support/lstrings.C (tostr): rewritten to use strstream and
8896 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8898 * src/support/filetools.C (IsFileWriteable): use fstream to check
8899 (IsDirWriteable): use fileinfo to check
8901 * src/support/filetools.h (FilePtr): whole class deleted
8903 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
8905 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
8907 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
8909 * src/bufferlist.C (write): use ifstream and ofstream instead of
8912 * src/Spacing.h: use istrstream instead of sscanf
8914 * src/mathed/math_defs.h: change first arg to istream from FILE*
8916 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
8918 * src/mathed/math_parser.C: have yyis to be an istream
8919 (LexGetArg): use istream (yyis)
8921 (mathed_parse): ditto
8922 (mathed_parser_file): first arg istream instead of FILE*, set yyis
8924 * src/mathed/formula.C (Read): rewritten to use istream
8926 * src/mathed/formulamacro.C (Read): rewritten to use istream
8928 * src/lyxlex.h (~LyXLex): deleted desturctor
8929 (getStream): new function, returns an istream
8930 (getFile): deleted funtion
8931 (IsOK): return is.good();
8933 * src/lyxlex.C (LyXLex): delete file and owns_file
8934 (setFile): open an filebuf and assign that to a istream instead of
8936 (setStream): new function, takes an istream as arg.
8937 (setFile): deleted function
8938 (EatLine): rewritten us use istream instead of FILE*
8942 * src/table.C (LyXTable): use istream instead of FILE*
8943 (Read): rewritten to take an istream instead of FILE*
8945 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8947 * src/buffer.C (Dispatch): remove an extraneous break statement.
8949 * src/support/filetools.C (QuoteName): change to do simple
8950 'quoting'. More work is necessary. Also changed to do nothing
8951 under emx (needs fix too).
8952 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
8954 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
8955 config.h.in to the AC_DEFINE_UNQUOTED() call.
8956 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
8957 needs char * as argument (because Solaris 7 declares it like
8960 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
8961 remove definition of BZERO.
8963 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8965 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
8966 defined, "lyxregex.h" if not.
8968 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
8970 (REGEX): new variable that is set to regex.c lyxregex.h when
8971 AM_CONDITIONAL USE_REGEX is set.
8972 (libsupport_la_SOURCES): add $(REGEX)
8974 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
8977 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
8980 * configure.in: add call to LYX_REGEX
8982 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
8983 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
8985 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8987 * lib/bind/fi_menus.bind: new file, from
8988 pauli.virtanen@saunalahti.fi.
8990 * src/buffer.C (getBibkeyList): pass the parameter delim to
8991 InsetInclude::getKeys and InsetBibtex::getKeys.
8993 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
8994 is passed to Buffer::getBibkeyList
8996 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
8997 instead of the hardcoded comma.
8999 * src/insets/insetbib.C (getKeys): make sure that there are not
9000 leading blanks in bibtex keys. Normal latex does not care, but
9001 harvard.sty seems to dislike blanks at the beginning of citation
9002 keys. In particular, the retturn value of the function is
9004 * INSTALL: make it clear that libstdc++ is needed and that gcc
9005 2.7.x probably does not work.
9007 * src/support/filetools.C (findtexfile): make debug message go to
9009 * src/insets/insetbib.C (getKeys): ditto
9011 * src/debug.C (showTags): make sure that the output is correctly
9014 * configure.in: add a comment for TWO_COLOR_ICON define.
9016 * acconfig.h: remove all the entries that already defined in
9017 configure.in or acinclude.m4.
9019 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
9020 to avoid user name, date and copyright.
9022 1999-12-21 Juergen Vigna <jug@sad.it>
9024 * src/table.C (Read): Now read bogus row format informations
9025 if the format is < 5 so that afterwards the table can
9026 be read by lyx but without any format-info. Fixed the
9027 crash we experienced when not doing this.
9029 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9031 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
9032 (RedoDrawingOfParagraph): ditto
9033 (RedoParagraphs): ditto
9034 (RemoveTableRow): ditto
9036 * src/text.C (Fill): rename arg paperwidth -> paper_width
9038 * src/buffer.C (insertLyXFile): rename var filename -> fname
9039 (writeFile): rename arg filename -> fname
9040 (writeFileAscii): ditto
9041 (makeLaTeXFile): ditto
9042 (makeLinuxDocFile): ditto
9043 (makeDocBookFile): ditto
9045 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
9048 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
9050 * src/bmtable.h: add extern "C" on this file when __cplusplus is
9053 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
9054 compiled by a C compiler not C++.
9056 * src/layout.h (LyXTextClass): added typedef for const_iterator
9057 (LyXTextClassList): added typedef for const_iterator + member
9058 functions begin and end.
9060 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
9061 iterators to fill the choice_class.
9062 (updateLayoutChoice): rewritten to use iterators to fill the
9063 layoutlist in the toolbar.
9065 * src/BufferView.h (BufferView::work_area_width): removed unused
9068 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
9070 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
9071 (sgmlCloseTag): ditto
9073 * src/support/lstrings.h: return type of countChar changed to
9076 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
9077 what version of this func to use. Also made to return unsigned int.
9079 * configure.in: call LYX_STD_COUNT
9081 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
9082 conforming std::count.
9084 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9086 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
9087 and a subscript would give bad display (patch from Dekel Tsur
9088 <dekel@math.tau.ac.il>).
9090 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
9092 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
9095 * src/chset.h: add a few 'using' directives
9097 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
9098 triggered when no buffer is active
9100 * src/layout.C: removed `break' after `return' in switch(), since
9103 * src/lyx_main.C (init): make sure LyX can be ran in place even
9104 when libtool has done its magic with shared libraries. Fix the
9105 test for the case when the system directory has not been found.
9107 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
9108 name for the latex file.
9109 (MenuMakeHTML): ditto
9111 * src/buffer.h: add an optional boolean argument, which is passed
9114 1999-12-20 Allan Rae <rae@lyx.org>
9116 * lib/templates/IEEEtran.lyx: small correction and update.
9118 * configure.in: Attempted to use LYX_PATH_HEADER
9120 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
9122 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
9123 input from JMarc. Now use preprocessor to find the header.
9124 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
9125 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
9126 LYX_STL_STRING_FWD. See comments in file.
9128 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
9130 * The global MiniBuffer * minibuffer variable is dead.
9132 * The global FD_form_main * fd_form_main variable is dead.
9134 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9136 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
9138 * src/table.h: add the LOstream.h header
9139 * src/debug.h: ditto
9141 * src/LyXAction.h: change the explaination of the ReadOnly
9142 attribute: is indicates that the function _can_ be used.
9144 * src/LyXAction.C (init): find-replace _can_ be used in read-only
9147 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9149 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
9155 * src/paragraph.C (GetWord): assert on pos>=0
9158 * src/support/lyxstring.C: condition the use of an invariant on
9160 * src/support/lyxstring.h: ditto
9162 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
9163 Use LAssert.h instead of plain assert().
9165 * src/support/lstrings.h: add LAssert.h, in case it is needed.
9167 * src/lyxfunc.C: do not include LAssert.h, it is not used.
9168 * src/support/filetools.C: ditto
9170 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
9173 * INSTALL: document the new configure flags
9175 * configure.in: suppress --with-debug; add --enable-assertions
9177 * acinclude.m4: various changes in alignment of help strings.
9179 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9181 * src/kbmap.C: commented out the use of the hash map in kb_map,
9182 beginning of movement to a stl::container.
9184 * several files: removed code that was not in effect when
9185 MOVE_TEXT was defined.
9187 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
9188 for escaping should not be used. We can discuss if the string
9189 should be enclosed in f.ex. [] instead of "".
9191 * src/trans_mgr.C (insert): use the new returned value from
9192 encodeString to get deadkeys and keymaps done correctly.
9194 * src/chset.C (encodeString): changed to return a pair, to tell
9195 what to use if we know the string.
9197 * src/lyxscreen.h (fillArc): new function.
9199 * src/FontInfo.C (resize): rewritten to use more std::string like
9200 structore, especially string::replace.
9202 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
9205 * configure.in (chmod +x some scripts): remove config/gcc-hack
9207 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9209 * src/buffer.C (writeFile): change once again the top comment in a
9210 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
9211 instead of an hardcoded version number.
9212 (makeDocBookFile): ditto
9214 * src/version.h: add new define LYX_DOCVERSION
9216 * po/de.po: update from Pit Sütterlin
9217 * lib/bind/de_menus.bind: ditto.
9219 * src/lyxfunc.C (Dispatch): call MenuExport()
9220 * src/buffer.C (Dispatch): ditto
9222 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
9223 LyXFunc::Dispatch().
9224 (MenuExport): new function, moved from
9225 LyXFunc::Dispatch().
9227 * src/trans_mgr.C (insert): small cleanup
9228 * src/chset.C (loadFile): ditto
9230 * lib/kbd/iso8859-1.cdef: add missing backslashes
9232 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9234 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
9235 help with placing the manually drawn accents better.
9237 (Draw): x2 and hg changed to float to minimize rounding errors and
9238 help place the accents better.
9240 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
9241 unsigned short to char is just wrong...cast the char to unsigned
9242 char instead so that the two values can compare sanely. This
9243 should also make the display of insetlatexaccents better and
9244 perhaps also some other insets.
9246 (lbearing): new function
9249 1999-12-15 Allan Rae <rae@lyx.org>
9251 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
9252 header that provides a wrapper around the very annoying SGI STL header
9255 * src/support/lyxstring.C, src/LString.h:
9256 removed old SGI-STL-compatability attempts.
9258 * configure.in: Use LYX_STL_STRING_FWD.
9260 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
9261 stl_string_fwd.h is around and try to determine it's location.
9262 Major improvement over previous SGI STL 3.2 compatability.
9263 Three small problems remain with this function due to my zero
9264 knowledge of autoconf. JMarc and lgb see the comments in the code.
9266 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9268 * src/broken_const.h, config/hack-gcc, config/README: removed
9270 * configure.in: remove --with-gcc-hack option; do not call
9273 * INSTALL: remove documentation of --with-broken-const and
9276 * acconfig.h: remove all trace of BROKEN_CONST define
9278 * src/buffer.C (makeDocBookFile): update version number in output
9280 (SimpleDocBookOnePar): fix an assert when trying to a character
9281 access beyond string length
9284 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9286 * po/de.po: fix the Export menu
9288 * lyx.man: update the description of -dbg
9290 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
9291 (commandLineHelp): updated
9292 (easyParse): show list of available debug levels if -dbg is passed
9295 * src/Makefile.am: add debug.C
9297 * src/debug.h: moved some code to debug.C
9299 * src/debug.C: new file. Contains code to set and show debug
9302 * src/layout.C: remove 'break' after 'continue' in switch
9303 statements, since these cannot be reached.
9305 1999-12-13 Allan Rae <rae@lyx.org>
9307 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
9308 (in_word_set): hash() -> math_hash()
9310 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
9312 * acconfig.h: Added a test for whether we are using exceptions in the
9313 current compilation run. If so USING_EXCEPTIONS is defined.
9315 * config.in: Check for existance of stl_string_fwd.h
9316 * src/LString.h: If compiling --with-included-string and SGI's
9317 STL version 3.2 is present (see above test) we need to block their
9318 forward declaration of string and supply a __get_c_string().
9319 However, it turns out this is only necessary if compiling with
9320 exceptions enabled so I've a bit more to add yet.
9322 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
9323 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
9324 src/support/LRegex.h, src/undo.h:
9325 Shuffle the order of the included files a little to ensure that
9326 LString.h gets included before anything that includes stl_string_fwd.h
9328 * src/support/lyxstring.C: We need to #include LString.h instead of
9329 lyxstring.h to get the necessary definition of __get_c_string.
9330 (__get_c_string): New function. This is defined static just like SGI's
9331 although why they need to do this I'm not sure. Perhaps it should be
9332 in lstrings.C instead.
9334 * lib/templates/IEEEtran.lyx: New template file.
9336 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9338 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
9339 * intl/Makefile.in (MKINSTALLDIRS): ditto
9341 * src/LyXAction.C (init): changed to hold the LFUN data in a
9342 automatic array in stead of in callso to newFunc, this speeds up
9343 compilation a lot. Also all the memory used by the array is
9344 returned when the init is completed.
9346 * a lot of files: compiled with -Wold-style-cast, changed most of
9347 the reported offenders to C++ style casts. Did not change the
9348 offenders in C files.
9350 * src/trans.h (Match): change argument type to unsigned int.
9352 * src/support/DebugStream.C: fix some types on the streambufs so
9353 that it works on a conforming implementation.
9355 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9357 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
9359 * src/support/lyxstring.C: remove the inline added earlier since
9360 they cause a bunch of unsatisfied symbols when linking with dec
9361 cxx. Cxx likes to have the body of inlines at the place where they
9364 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
9365 accessing negative bounds in array. This fixes the crash when
9366 inserting accented characters.
9367 * src/trans.h (Match): ditto
9369 * src/buffer.C (Dispatch): since this is a void, it should not try
9370 to return anything...
9372 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9374 * src/buffer.h: removed the two friends from Buffer. Some changes
9375 because of this. Buffer::getFileName and Buffer::setFileName
9376 renamed to Buffer::fileName() and Buffer::fileName(...).
9378 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9380 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
9381 and Buffer::update(short) to BufferView. This move is currently
9382 controlled by a define MOVE_TEXT, this will be removed when all
9383 shows to be ok. This move paves the way for better separation
9384 between buffer contents and buffer view. One side effect is that
9385 the BufferView needs a rebreak when swiching buffers, if we want
9386 to avoid this we can add a cache that holds pointers to LyXText's
9387 that is not currently in use.
9389 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
9392 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9394 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
9396 * lyx_main.C: new command line option -x (or --execute) and
9397 -e (or --export). Now direct conversion from .lyx to .tex
9398 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
9399 Unfortunately, X is still needed and the GUI pops up during the
9402 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9404 * src/Spacing.C: add a using directive to bring stream stuff into
9406 * src/paragraph.C: ditto
9407 * src/buffer.C: ditto
9409 * NEWS: updated a bit the new features of 1.1.3 (took a few things
9410 from Lars' announcement).
9412 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
9413 example files from Tino Meinen.
9415 1999-12-06 Allan Rae <rae@lyx.org>
9417 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
9419 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9421 * src/support/lyxstring.C: added a lot of inline for no good
9424 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
9425 latexWriteEndChanges, they were not used.
9427 * src/layout.h (operator<<): output operator for PageSides
9429 * src/mathed/math_iter.C (my_memcpy): slightly changed.
9431 * some example files: loaded in LyX 1.0.4 and saved again to update
9432 certain constructs (table format)
9434 * a lot of files: did the change to use fstream/iostream for all
9435 writing of files. Done with a close look at Andre Poenitz's patch.
9437 * some files: whitespace changes.
9439 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9441 * src/mathed/math_iter.C (my_memcpy): new function. Since the
9442 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
9443 architecture, we provide our own. It is used unconditionnally, but
9444 I do not think this is a performance problem. Thanks to Angus
9445 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
9446 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
9448 (GetInset): use my_memcpy.
9452 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
9453 it is easier to understand, but it uses less TeX-only constructs now.
9455 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
9456 elements contain spaces
9458 * lib/configure: regenerated
9460 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
9461 elements contain spaces; display the list of programs that are
9464 * autogen.sh: make sure lib/configure is executable
9466 * lib/examples/*: rename the tutorial examples to begin with the
9467 two-letters language code.
9469 * src/lyxfunc.C (getStatus): do not query current font if no
9472 * src/lyx_cb.C (RunScript): use QuoteName
9473 (MenuRunDvips): ditto
9474 (PrintApplyCB): ditto
9476 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
9477 around argument, so that it works well with the current shell.
9478 Does not work properly with OS/2 shells currently.
9480 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
9481 * src/LyXSendto.C (SendtoApplyCB): ditto
9482 * src/lyxfunc.C (Dispatch): ditto
9483 * src/buffer.C (runLaTeX): ditto
9484 (runLiterate): ditto
9485 (buildProgram): ditto
9487 * src/lyx_cb.C (RunScript): ditto
9488 (MenuMakeLaTeX): ditto
9490 * src/buffer.h (getLatexName): new method
9492 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
9494 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9496 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
9497 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
9498 (create_math_panel): ditto
9500 * src/lyxfunc.C (getStatus): re-activate the code which gets
9501 current font and cursor; add test for export to html.
9503 * src/lyxrc.C (read): remove unreachable break statements; add a
9506 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
9508 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9510 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
9511 introduced by faulty regex.
9512 * src/buffer.C: ditto
9513 * src/lastfiles.C: ditto
9514 * src/paragraph.C: ditto
9515 * src/table.C: ditto
9516 * src/vspace.C: ditto
9517 * src/insets/figinset.C: ditto
9518 Note: most of these is absolutely harmless, except the one in
9519 src/mathed formula.C.
9521 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9523 * src/ImportNoweb.C (documentclass): fixed bounds for substr
9524 operation, yielding correct results for the reLyX command.
9526 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9528 * src/support/filetools.C (ExpandPath): removed an over eager
9530 (ReplaceEnvironmentPath): ditto
9532 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
9533 shows that we are doing something fishy in our code...
9537 * src/lyxrc.C (read): use a double switch trick to get more help
9538 from the compiler. (the same trick is used in layout.C)
9539 (write): new function. opens a ofstream and pass that to output
9540 (output): new function, takes a ostream and writes the lyxrc
9541 elemts to it. uses a dummy switch to make sure no elements are
9544 * src/lyxlex.h: added a struct pushpophelper for use in functions
9545 with more than one exit point.
9547 * src/lyxlex.[Ch] (GetInteger): made it const
9551 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
9553 * src/layout.[hC] : LayoutTags splitted into several enums, new
9554 methods created, better error handling cleaner use of lyxlex. Read
9557 * src/bmtable.[Ch]: change some member prototypes because of the
9558 image const changes.
9560 * commandtags.h, src/LyXAction.C (init): new function:
9561 "preferences-save", saves the lyxrc entries into .lyx/preferences.
9562 This file is not read automatically but you can add \input
9563 preferences to your lyxrc if you want to. We need to discuss how
9566 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
9567 in .aux, also remove .bib and .bst files from dependencies when
9570 * src/BufferView.C, src/LyXView.C: add const_cast several places
9571 because of changes to images.
9573 * lib/images/*: same change as for images/*
9575 * lib/lyxrc.example: Default for accept_compound is false not no.
9577 * images/*: changed to be const, however I have som misgivings
9578 about this change so it might be changed back.
9580 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9582 * lib/configure, po/POTFILES.in: regenerated
9584 * autogen.sh: autogenerate lib/configure from lib/configure.m4
9586 * config/lib_configure.m4: removed
9588 * lib/configure.m4: new file (was config/lib_configure.m4)
9590 * configure.in: do not test for rtti, since we do not use it.
9592 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9594 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
9595 doubling of allocated space scheme. This makes it faster for large
9596 strings end to use less memory for small strings. xtra rememoved.
9598 * src/insets/figinset.C (waitalarm): commented out.
9599 (GhostscriptMsg): use static_cast
9600 (GhostscriptMsg): use new instead of malloc to allocate memory for
9601 cmap. also delete the memory after use.
9603 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
9605 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
9606 for changes in bibtex database or style.
9607 (runBibTeX): remove all .bib and .bst files from dep before we
9609 (run): use scanAuc in when dep file already exist.
9611 * src/DepTable.C (remove_files_with_extension): new method
9614 * src/DepTable.[Ch]: made many of the methods const.
9616 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9618 * src/bufferparams.C: make sure that the default textclass is
9619 "article". It used to be the first one by description order, but
9620 now the first one is "docbook".
9622 * src/lyx_main.C (setDebuggingLevel): change type of argument to
9623 string; call Debug::value.
9624 (easyParse): pass complete argument to setDebuggingLevel().
9626 * src/debug.h (value): fix the code that parses debug levels.
9628 * src/debug.h: add new debug type ACTION, reserved for LyXAction
9631 * src/LyXAction.C: use Debug::ACTION as debug channel.
9633 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
9635 * NEWS: updated for the future 1.1.3 release.
9637 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
9638 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
9639 it should. This is of course a controversial change (since many
9640 people will find that their lyx workscreen is suddenly full of
9641 red), but done for the sake of correctness.
9643 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
9644 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
9646 * src/insets/inseterror.h, src/insets/inseturl.h,
9647 src/insets/insetinfo.h, src/insets/figinset.h,
9648 src/mathed/formulamacro.h, src/mathed/math_macro.h
9649 (EditMessage): add a missing const and add _() to make sure that
9652 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
9653 src/insets/insetbib.C, src/support/filetools.C: add `using'
9656 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
9657 doing 'Insert index of last word' at the beginning of a paragraph.
9659 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9661 * several files: white-space changes.
9663 * src/mathed/formula.C: removed IsAlpha and IsDigit
9665 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
9666 .bib file. use a ifstream instead of FilePtr when parsing the .bib
9669 * src/insets/figinset.C (GetPSSizes): don't break when
9670 "EndComments" is seen. But break when a boundingbox is read.
9672 * all classes inherited from Inset: return value of Clone
9673 changed back to Inset *.
9675 * all classes inherited form MathInset: return value of Clone
9676 changed back to MathedInset *.
9678 * src/insets/figinset.C (runqueue): use a ofstream to output the
9679 gs/ps file. Might need some setpresicion or setw. However I can
9680 see no problem with the current code.
9681 (runqueue): use sleep instead of the alarm/signal code. I just
9682 can't see the difference.
9684 * src/paragraph.C (LyXParagraph): reserve space in the new
9685 paragraph and resize the inserted paragraph to just fit.
9687 * src/lyxfunc.h (operator|=): added operator for func_status.
9689 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
9690 check for readable file.
9692 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
9693 check for readable file.
9694 (MenuMakeLinuxDoc): ditto
9695 (MenuMakeDocBook): ditto
9696 (MenuMakeAscii): ditto
9697 (InsertAsciiFile): split the test for openable and readable
9699 * src/bmtable.C (draw_bitmaptable): use
9700 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
9702 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
9703 findtexfile from LaTeX to filetools.
9705 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
9706 instead of FilePtr. Needs to be verified by a literate user.
9708 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9710 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
9711 (EditMessage): likewise.
9713 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
9714 respectively as \textasciitilde and \textasciicircum.
9716 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9718 * src/support/lyxstring.h: made the methods that take iterators
9721 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
9722 (regexMatch): made is use the real regex class.
9724 * src/support/Makefile.am: changed to use libtool
9726 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
9728 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
9730 (MathIsInset ++): changed several macros to be inline functions
9733 * src/mathed/Makefile.am: changed to use libtool
9735 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
9737 * src/insets/inset* : Clone changed to const and return type is
9738 the true insettype not just Inset*.
9740 * src/insets/Makefile.am: changed to use libtool
9742 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
9744 * src/undo.[Ch] : added empty() and changed some of the method
9747 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
9749 * src/lyxparagraph.h: use id() and id(...) instead of getID and
9750 setID use block<> for the bullets array, added const several places.
9752 * src/lyxfunc.C (getStatus): new function
9754 * src/lyxfunc.[Ch] : small changes to take advantage of the new
9755 LyXAction, added const to several funtions.
9757 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
9758 a std::map, and to store the dir items in a vector.
9760 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
9763 * src/LyXView.[Ch] + other files : changed currentView to view.
9765 * src/LyXAction.[Ch] : ported from the old devel branch.
9767 * src/.cvsignore: added .libs and a.out
9769 * configure.in : changes to use libtool.
9771 * acinclude.m4 : inserted libtool.m4
9773 * .cvsignore: added libtool
9775 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9777 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
9778 file name in insets and mathed directories (otherwise the
9779 dependency is not taken in account under cygwin).
9781 * src/text2.C (InsertString[AB]): make sure that we do not try to
9782 read characters past the string length.
9784 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9786 * lib/doc/LaTeXConfig.lyx.in,
9787 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
9789 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
9790 file saying who created them and when this heppened; this is
9791 useless and annoys tools like cvs.
9793 * lib/layouts/g-brief-{en,de}.layout,
9794 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
9795 from Thomas Hartkens <thomas@hartkens.de>.
9797 * src/{insets,mathed}/Makefile.am: do not declare an empty
9798 LDFLAGS, so that it can be set at configure time (useful on Irix
9801 * lib/reLyX/configure.in: make sure that the prefix is set
9802 correctly in LYX_DIR.
9804 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9806 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
9807 be used by 'command-sequence' this allows to bind a key to a
9808 sequence of LyX-commands
9809 (Example: 'command-sequence math-insert alpha; math-insert beta;")
9811 * src/LyXAction.C: add "command-sequence"
9813 * src/LyXFunction.C: handling of "command-sequence"
9815 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
9816 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
9818 * src/lyxserver.C, src/minibuffer.C: Use this new interface
9820 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9822 * src/buffer.C (writeFile): Do not output a comment giving user
9823 and date at the beginning of a .lyx file. This is useless and
9824 annoys cvs anyway; update version number to 1.1.
9826 * src/Makefile.am (LYX_DIR): add this definition, so that a
9827 default path is hardcoded in LyX.
9829 * configure.in: Use LYX_GNU_GETTEXT.
9831 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
9832 AM_GNU_GETTEXT with a bug fixed.
9834 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
9836 * src/chset.C: add "using std::ifstream;" to please dec cxx.
9838 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
9839 which is used to point to LyX data is now LYX_DIR_11x.
9841 * lyx.man: convert to a unix text file; small updates.
9843 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9845 * src/support/LSubstring.[Ch]: made the second arg of most of the
9846 constructors be a const reference.
9848 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
9851 * src/support/lyxstring.[Ch] (swap): added missing member function
9852 and specialization of swap(str, str);
9854 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
9856 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
9857 trace of the old one.
9859 * src/undo.[Ch]: made the undostack use std::list to store undo's in
9860 put the member definitions in undo.C.
9862 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
9863 NEW_TEXT and have now only code that was included when this was
9866 * src/intl.C (LCombo): use static_cast
9868 (DispatchCallback): ditto
9870 * src/definitions.h: removed whole file
9872 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
9874 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
9875 parsing and stores in a std:map. a regex defines the file format.
9876 removed unneeded members.
9878 * src/bufferparams.h: added several enums from definitions.h here.
9879 Removed unsused destructor. Changed some types to use proper enum
9880 types. use block to have the temp_bullets and user_defined_bullets
9881 and to make the whole class assignable.
9883 * src/bufferparams.C (Copy): removed this functions, use a default
9886 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
9889 * src/buffer.C (readLyXformat2): commend out all that have with
9890 oldpapersize to do. also comment out all that hve to do with
9891 insetlatex and insetlatexdel.
9892 (setOldPaperStuff): commented out
9894 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
9896 * src/LyXAction.C: remove use of inset-latex-insert
9898 * src/mathed/math_panel.C (button_cb): use static_cast
9900 * src/insets/Makefile.am (insets_o_SOURCES): removed
9903 * src/support/lyxstring.C (helper): use the unsigned long
9904 specifier, UL, instead of a static_cast.
9906 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
9908 * src/support/block.h: new file. to be used as a c-style array in
9909 classes, so that the class can be assignable.
9911 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9913 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
9914 NULL, make sure to return an empty string (it is not possible to
9915 set a string to NULL).
9917 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9919 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
9921 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
9923 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
9924 link line, so that Irix users (for example) can set it explicitely to
9927 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
9928 it can be overidden at make time (static or dynamic link, for
9931 * src/vc-backend.C, src/LaTeXFeatures.h,
9932 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
9933 statements to bring templates to global namespace.
9935 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9937 * src/support/lyxstring.C (operator[] const): make it standard
9940 * src/minibuffer.C (Init): changed to reflect that more
9941 information is given from the lyxvc and need not be provided here.
9943 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
9945 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
9947 * src/LyXView.C (UpdateTimerCB): use static_cast
9948 (KeyPressMask_raw_callback): ditto
9950 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
9951 buffer_, a lot of changes because of this. currentBuffer() ->
9952 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
9953 also changes to other files because of this.
9955 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9957 * src/vc-backend.[Ch]: new files. The backends for vc handling,
9958 have no support for RCS and partial support for CVS, will be
9961 * src/insets/ several files: changes because of function name
9962 changes in Bufferview and LyXView.
9964 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
9966 * src/support/LSubstring.[Ch]: new files. These implement a
9967 Substring that can be very convenient to use. i.e. is this
9969 string a = "Mary had a little sheep";
9970 Substring(a, "sheep") = "lamb";
9971 a is now "Mary has a little lamb".
9973 * src/support/LRegex.[Ch]: a regex class that can be used to pick
9974 out patterns and subpatterns of strings. It is used by LSubstring
9975 and also by vc-backend.C
9977 * src/support/lyxstring.C: went over all the assertions used and
9978 tried to correct the wrong ones and flag which of them is required
9979 by the standard. some bugs found because of this. Also removed a
9980 couple of assertions.
9982 * src/support/Makefile.am (libsupport_a_SOURCES): added
9983 LSubstring.[Ch] and LRegex.[Ch]
9985 * src/support/FileInfo.h: have struct stat buf as an object and
9986 not a pointer to one, some changes because of this.
9988 * src/LaTeXFeatures.C (getTClassPreamble): also use the
9989 information in layout when adding the layouts preamble to the
9992 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
9995 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
9996 because of bug in OS/2.
9998 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10000 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
10001 \verbatim@font instead of \ttfamily, so that it can be redefined.
10003 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
10004 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
10005 src/layout.h, src/text2.C: add 'using' directive to bring the
10006 STL templates we need from the std:: namespace to the global one.
10007 Needed by DEC cxx in strict ansi mode.
10009 * src/support/LIstream.h,src/support/LOstream.h,
10010 src/support/lyxstring.h,src/table.h,
10011 src/lyxlookup.h: do not include <config.h> in header
10012 files. This should be done in the .C files only.
10014 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
10018 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10020 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
10021 from Kayvan to fix the tth invokation.
10023 * development/lyx.spec.in: updates from Kayvan to reflect the
10024 changes of file names.
10026 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10028 * src/text2.C (InsertStringB): use std::copy
10029 (InsertStringA): use std::copy
10031 * src/bufferlist.C: use a vector to store the buffers in. This is
10032 an internal change and should not affect any other thing.
10034 * src/BufferView.C (waitForX): use XSync instead of the lengthy
10037 * src/text.C (Fill): fix potential bug, one off bug.
10039 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10041 * src/Makefile.am (lyx_main.o): add more files it depends on.
10043 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
10045 * src/support/lyxstring.C: use size_t for the reference count,
10046 size, reserved memory and xtra.
10047 (internal_compare): new private member function. Now the compare
10048 functions should work for std::strings that have embedded '\0'
10050 (compare): all compare functions rewritten to use
10053 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10055 * src/support/lyxstring.C (compare): pass c_str()
10056 (compare): pass c_str
10057 (compare): pass c_str
10059 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10061 * src/support/DebugStream.C: <config.h> was not included correctly.
10063 * lib/configure: forgot to re-generate it :( I'll make this file
10064 auto generated soon.
10066 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10068 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
10071 * src/support/lyxstring.C: some changes from length() to rep->sz.
10072 avoids a function call.
10074 * src/support/filetools.C (SpaceLess): yet another version of the
10075 algorithm...now per Jean-Marc's suggestions.
10077 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10079 * src/layout.C (less_textclass_desc): functor for use in sorting
10081 (LyXTextClass::Read): sort the textclasses after reading.
10083 * src/support/filetools.C (SpaceLess): new version of the
10084 SpaceLess functions. What problems does this one give? Please
10087 * images/banner_bw.xbm: made the arrays unsigned char *
10089 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10091 * src/support/lyxstring.C (find): remove bogus assertion in the
10092 two versions of find where this has not been done yet.
10094 * src/support/lyxlib.h: add missing int return type to
10097 * src/menus.C (ShowFileMenu): disable exporting to html if no
10098 html export command is present.
10100 * config/lib_configure.m4: add a test for an HTML converter. The
10101 programs checked for are, in this order: tth, latex2html and
10104 * lib/configure: generated from config/lib_configure.m4.
10106 * src/lyxfunc.C (Dispatch): update and improve the execution of an
10107 html converter. The parameters are now passed through $$FName and
10108 $$OutName, instead of standard input/output.
10110 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
10112 * lib/lyxrc.example: update description of \html_command.
10113 add "quotes" around \screen_font_xxx font setting examples to help
10114 people who use fonts with spaces in their names.
10116 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10118 * Distribution files: updates for v1.1.2
10120 * src/support/lyxstring.C (find): remove bogus assert and return
10121 npos for the same condition.
10123 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10125 * added patch for OS/2 from SMiyata.
10127 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10129 * src/text2.C (CutSelection): make space_wrapped a bool
10130 (CutSelection): dont declare int i until we have to.
10131 (alphaCounter): return a char const *.
10133 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10135 * src/support/syscall.C (Systemcalls::kill):
10136 src/support/filetools.C (PutEnv, PutEnvPath):
10137 src/lyx_cb.C (addNewlineAndDepth):
10138 src/FontInfo.C (FontInfo::resize): condition some #warning
10139 directives with WITH_WARNINGS.
10142 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10144 * src/layout.[Ch] + several files: access to class variables
10145 limited and made accessor functions instead a lot of code changed
10146 becuase of this. Also instead of returning pointers often a const
10147 reference is returned instead.
10149 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
10151 * src/Makefile.am (dist-hook): added used to remove the CVS from
10152 cheaders upon creating a dist
10153 (EXTRA_DIST): added cheaders
10155 * src/support/lstrings.C (tostr(char)): fix it to handle param as
10156 a character not as a small integer.
10158 * src/support/lyxstring.C (find): removed Assert and added i >=
10159 rep->sz to the first if.
10161 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10163 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
10164 src/LyXView.C src/buffer.C src/bufferparams.C
10165 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
10166 src/text2.C src/insets/insetinclude.C:
10167 lyxlayout renamed to textclasslist.
10169 * src/layout.C: some lyxerr changes.
10171 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
10172 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
10173 (LyXLayoutList): removed all traces of this class.
10174 (LyXTextClass::Read): rewrote LT_STYLE
10175 (LyXTextClass::hasLayout): new function
10176 (LyXTextClass::GetLayout): rewritten to return an iterator + has
10177 both const and nonconst version.
10178 (LyXTextClass::delete_layout): new function.
10179 (LyXTextClassList::Style): bug fix. do the right thing if layout
10181 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
10182 (LyXTextClassList::NameOfLayout): ditto
10183 (LyXTextClassList::Load): ditto
10185 * src/buffer.C (makeLaTeXFile): new access to layoutlist
10187 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
10189 * src/LyXAction.C (LookupFunc): added a workaround for sun
10190 compiler, on the other hand...we don't know if the current code
10191 compiles on sun at all...
10193 * src/support/filetools.C (CleanupPath): subst fix
10195 * src/insets/insetbib.C (delDatabase): subst fix, this looks
10198 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
10199 complained about this one?
10201 * src/insets/insetinclude.C (Latex): subst fix
10203 * src/insets/insetbib.C (getKeys): subst fix
10205 * src/LyXSendto.C (SendtoApplyCB): subst fix
10207 * src/lyx_main.C (init): subst fix
10209 * src/layout.C (Read): subst fix
10211 * src/lyx_sendfax_main.C (button_send): subst fix
10213 * src/buffer.C (RoffAsciiTable): subst fix
10215 * src/lyx_cb.C (MenuFax): subst fix
10216 (PrintApplyCB): subst fix
10218 1999-10-26 Juergen Vigna <jug@sad.it>
10220 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
10222 (Read): Cleaned up this code so now we read only format vestion >= 5
10224 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10226 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
10227 come nobody has complained about this one?
10229 * src/insets/insetinclude.C (Latex): subst fix
10231 * src/insets/insetbib.C (getKeys): subst fix
10233 * src/lyx_main.C (init): subst fix
10235 * src/layout.C (Read): subst fix
10237 * src/buffer.C (RoffAsciiTable): subst fix
10239 * src/lyx_cb.C (MenuFax): subst fix.
10241 * src/layout.[hC] + some other files: rewrote to use
10242 std::container to store textclasses and layouts in.
10243 Simplified, removed a lot of code. Make all classes
10244 assignable. Further simplifications and review of type
10245 use still to be one.
10247 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
10248 lastfiles to create the lastfiles partr of the menu.
10250 * src/lastfiles.[Ch]: rewritten to use deque to store the
10251 lastfiles in. Uses fstream for reading and writing. Simplifies
10254 * src/support/syscall.C: remove explicit cast.
10256 * src/BufferView.C (CursorToggleCB): removed code snippets that
10257 were commented out.
10258 use explicat C++ style casts instead of C style casts. also use
10259 u_vdata instea of passing pointers in longs.
10261 * src/PaperLayout.C: removed code snippets that were commented out.
10263 * src/lyx_gui_misc.C: removed code snippets that were commented out.
10265 * src/lyx_main.C: removed code snippets that wer commented out.
10267 * src/paragraph.C: removed code snippets that were commented out.
10269 * src/lyxvc.C (logClose): use static_cast
10271 (viewLog): remove explicit cast to void*
10272 (showLog): removed old commented code
10274 * src/menus.C: use static_cast instead of C style casts. use
10275 u_vdata instead of u_ldata. remove explicit cast to (long) for
10276 pointers. Removed old code that was commented out.
10278 * src/insets/inset.C: removed old commented func
10280 * src/insets/insetref.C (InsetRef): removed old code that had been
10281 commented out for a long time.
10283 (escape): removed C style cast
10285 * src/insets/insetlatexaccent.C (Draw): removed old commented code
10287 * src/insets/insetlatex.C (Draw): removed old commented code
10288 (Read): rewritten to use string
10290 * src/insets/insetlabel.C (escape): removed C style cast
10292 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
10294 * src/insets/insetindex.C: use static_cast and u_vdata, removed
10295 old commented code.
10297 * src/insets/insetinclude.h: removed a couple of stupid bools
10299 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
10300 (Clone): remove C style cast
10301 (getKeys): changed list to lst because of std::list
10303 * src/insets/inseterror.C (Draw): removed som old commented code.
10305 * src/insets/insetcommand.C (Draw): removed some old commented code.
10307 * src/insets/insetbib.C (bibitem_cb): removed code that has been
10308 commented out forever.
10309 (bibitem_cb): use static_cast instead of C style cast
10310 use of vdata changed to u_vdata.
10312 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
10314 (CloseUrlCB): use static_cast instead of C style cast.
10315 (CloseUrlCB): added a fl_free form...it seemed to be missing.
10317 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
10318 (C_InsetInfo_CloseInfoCB): forward the ob parameter
10319 (CloseInfoCB): static_cast from ob->u_vdata instead.
10320 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
10323 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
10324 (C_InsetError_CloseErrorCB): forward the ob parameter
10325 (CloseErrorCB): static_cast from ob->u_vdata instead.
10327 * src/vspace.h: include LString.h since we use string in this class.
10329 * src/vspace.C (lyx_advance): changed name from advance because of
10330 nameclash with stl. And since we cannot use namespaces yet...I
10331 used a lyx_ prefix instead. Expect this to change when we begin
10334 * src/BufferView.[Ch] (BufferView::~BufferView): removed
10336 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
10337 and removed now defunct constructor and deconstructor.
10339 * src/BufferView.h: have backstack as a object not as a pointer.
10340 removed initialization from constructor. added include for BackStack
10342 * development/lyx.spec.in (%build): add CFLAGS also.
10344 * src/screen.C (drawFrame): removed another warning.
10346 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10348 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
10349 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
10350 README and ANNOUNCE a bit for the next release. More work is
10353 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
10354 unbreakable if we are in freespacing mode (LyX-Code), but not in
10357 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10359 * src/BackStack.h: fixed initialization order in constructor
10361 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
10363 * acinclude.m4 (VERSION): new rules for when a version is
10364 development, added also a variable for prerelease.
10365 (warnings): we set with_warnings=yes for prereleases
10366 (lyx_opt): prereleases compile with same optimization as development
10367 (CXXFLAGS): only use pedantic if we are a development version
10369 * src/BufferView.C (restorePosition): don't do anything if the
10370 backstack is empty.
10372 * src/BackStack.h: added member empty, use this to test if there
10373 is anything to pop...
10375 1999-10-25 Juergen Vigna <jug@sad.it>
10378 * forms/layout_forms.fd +
10379 * forms/latexoptions.fd +
10380 * lyx.fd: changed for various form resize issues
10382 * src/mathed/math_panel.C +
10383 * src/insets/inseterror.C +
10384 * src/insets/insetinfo.C +
10385 * src/insets/inseturl.C +
10386 * src/insets/inseturl.h +
10388 * src/LyXSendto.C +
10389 * src/PaperLayout.C +
10390 * src/ParagraphExtra.C +
10391 * src/TableLayout.C +
10393 * src/layout_forms.C +
10400 * src/menus.C: fixed various resize issues. So now forms can be
10401 resized savely or not be resized at all.
10403 * forms/form_url.fd +
10404 * src/insets/form_url.[Ch]: added because it's cleaner and easier
10407 * src/insets/Makefile.am: added files form_url.[Ch]
10409 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10411 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
10412 (and presumably 6.2).
10414 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
10415 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
10416 remaining static member callbacks.
10418 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
10421 * src/support/lyxstring.h: declare struct Srep as friend of
10422 lyxstring, since DEC cxx complains otherwise.
10424 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10426 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10428 * src/LaTeX.C (run): made run_bibtex also depend on files with
10430 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
10431 are put into the dependency file.
10433 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
10434 the code has shown itself to work
10435 (create_ispell_pipe): removed another warning, added a comment
10438 * src/minibuffer.C (ExecutingCB): removed code that has been
10439 commented out a long time
10441 * src/lyxfunc.C (processKeyEvent): removed some very old commented
10442 out code + a warning.
10444 * src/support/lyxstring.h: comment out the three private
10445 operators, when compiling with string ansi conforming compilers
10446 they make problems.
10448 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
10450 (pixmapFromBitmapData): change type of bdata to be unsigned char *
10451 (pixmapFromBitmapData): add a reinterpret_cast in the call to
10454 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
10457 * src/mathed/math_panel.C (create_math_panel): remove explicit
10460 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
10463 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
10464 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
10465 to XCreatePixmapFromBitmapData
10466 (fl_set_bmtable_data): change the last argument to be unsigned
10468 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
10469 and bh to be unsigned int, remove explicit casts in call to
10470 XReadBitmapFileData.
10472 * images/arrows.xbm: made the arrays unsigned char *
10473 * images/varsz.xbm: ditto
10474 * images/misc.xbm: ditto
10475 * images/greek.xbm: ditto
10476 * images/dots.xbm: ditto
10477 * images/brel.xbm: ditto
10478 * images/bop.xbm: ditto
10480 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
10482 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
10483 (LYX_PROG_CXX): added -pedantic to g++ compile options when
10484 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
10486 (LYX_CXX_CHEADERS): added <clocale> to the test.
10488 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
10490 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
10492 * src/support/lyxstring.C (append): fixed something that must be a
10493 bug, rep->assign was used instead of rep->append.
10495 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
10498 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
10499 lyx insert double chars. Fix spotted by Kayvan.
10501 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10503 * Fixed the tth support. I messed up with the Emacs patch apply feature
10504 and omitted the changes in lyxrc.C.
10506 1999-10-22 Juergen Vigna <jug@sad.it>
10508 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
10510 * src/lyx_cb.C (MenuInsertRef) +
10511 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
10512 the form cannot be resized under it limits (fixes a segfault)
10514 * src/lyx.C (create_form_form_ref) +
10515 * forms/lyx.fd: Changed Gravity on name input field so that it is
10518 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10520 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
10521 <ostream> and <istream>.
10523 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
10524 whether <fstream> provides the latest standard features, or if we
10525 have an oldstyle library (like in egcs).
10526 (LYX_CXX_STL_STRING): fix the test.
10528 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
10529 code on MODERN_STL_STREAM.
10531 * src/support/lyxstring.h: use L{I,O}stream.h.
10533 * src/support/L{I,O}stream.h: new files, designed to setup
10534 correctly streams for our use
10535 - includes the right header depending on STL capabilities
10536 - puts std::ostream and std::endl (for LOStream.h) or
10537 std::istream (LIStream.h) in toplevel namespace.
10539 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10541 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
10542 was a bib file that had been changed we ensure that bibtex is run.
10543 (runBibTeX): enhanced to extract the names of the bib files and
10544 getting their absolute path and enter them into the dep file.
10545 (findtexfile): static func that is used to look for tex-files,
10546 checks for absolute patchs and tries also with kpsewhich.
10547 Alternative ways of finding the correct files are wanted. Will
10549 (do_popen): function that runs a command using popen and returns
10550 the whole output of that command in a string. Should be moved to
10553 * src/DepTable.[Ch] (extchanged): new function that returns true if a
10554 file with extension ext has changed.
10556 * src/insets/figinset.C: added ifdef guards around the fl_free
10557 code that jug commented out. Now it is commented out when
10558 compiling with XForms == 0.89.
10560 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
10561 to lyxstring.C, and only keep a forward declaration in
10562 lyxstring.h. Simplifies the header file a bit and should help a
10563 bit on compile time too. Also changes to Srep will not mandate a
10564 recompile of code just using string.
10565 (~lyxstring): definition moved here since it uses srep.
10566 (size): definition moved here since it uses srep.
10568 * src/support/lyxstring.h: removed a couple of "inline" that should
10571 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10573 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
10576 1999-10-21 Juergen Vigna <jug@sad.it>
10578 * src/table.C (SetPWidth): Just a small fix so the alignment is not
10579 set to left if I just remove the width entry (or it is empty).
10581 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
10582 paragraph when having dummy paragraphs.
10584 1999-10-20 Juergen Vigna <jug@sad.it>
10586 * src/insets/figinset.C: just commented some fl_free_form calls
10587 and added warnings so that this calls should be activated later
10588 again. This avoids for now a segfault, but we have a memory leak!
10590 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
10591 'const char * argument' to 'string argument', this should
10592 fix some Asserts() in lyxstring.C.
10594 * src/lyxfunc.h: Removed the function argAsString(const char *)
10595 as it is not used anymore.
10597 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10599 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
10602 * src/Literate.h: some funcs moved from public to private to make
10603 interface clearer. Unneeded args removed.
10605 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
10607 (scanBuildLogFile): ditto
10609 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
10610 normal TeX Error. Still room for improvement.
10612 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
10614 * src/buffer.C (insertErrors): changes to make the error
10615 desctription show properly.
10617 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
10620 * src/support/lyxstring.C (helper): changed to use
10621 sizeof(object->rep->ref).
10622 (operator>>): changed to use a pointer instead.
10624 * src/support/lyxstring.h: changed const reference & to value_type
10625 const & lets see if that helps.
10627 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10629 * Makefile.am (rpmdist): fixed to have non static package and
10632 * src/support/lyxstring.C: removed the compilation guards
10634 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
10637 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
10638 conditional compile of lyxstring.Ch
10640 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
10641 stupid check, but it is a lot better than the bastring hack.
10642 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
10644 * several files: changed string::erase into string::clear. Not
10647 * src/chset.C (encodeString): use a char temporary instead
10649 * src/table.C (TexEndOfCell): added tostr around
10650 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
10651 (TexEndOfCell): ditto
10652 (TexEndOfCell): ditto
10653 (TexEndOfCell): ditto
10654 (DocBookEndOfCell): ditto
10655 (DocBookEndOfCell): ditto
10656 (DocBookEndOfCell): ditto
10657 (DocBookEndOfCell): ditto
10659 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
10661 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
10663 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
10664 (MenuBuildProg): added tostr around ret
10665 (MenuRunChktex): added tostr around ret
10666 (DocumentApplyCB): added tostr around ret
10668 * src/chset.C (encodeString): added tostr around t->ic
10670 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
10671 (makeLaTeXFile): added tostr around tocdepth
10672 (makeLaTeXFile): added tostr around ftcound - 1
10674 * src/insets/insetbib.C (setCounter): added tostr around counter.
10676 * src/support/lyxstring.h: added an operator+=(int) to catch more
10679 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
10680 (lyxstring): We DON'T allow NULL pointers.
10682 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10684 * src/mathed/math_macro.C (MathMacroArgument::Write,
10685 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
10686 when writing them out.
10688 * src/LString.C: remove, since it is not used anymore.
10690 * src/support/lyxstring.C: condition the content to
10691 USE_INCLUDED_STRING macro.
10693 * src/mathed/math_symbols.C, src/support/lstrings.C,
10694 src/support/lyxstring.C: add `using' directive to specify what
10695 we need in <algorithm>. I do not think that we need to
10696 conditionalize this, but any thought is appreciated.
10698 * many files: change all callback functions to "C" linkage
10699 functions to please strict C++ compilers like DEC cxx 6.1 in mode
10700 strict_ansi. Those who were static are now global.
10701 The case of callbacks which are static class members is
10702 trickier, since we have to make C wrappers around them (see
10703 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
10704 did not finish this yet, since it defeats the purpose of
10705 encapsulation, and I am not sure what the best route is.
10707 1999-10-19 Juergen Vigna <jug@sad.it>
10709 * src/support/lyxstring.C (lyxstring): we permit to have a null
10710 pointer as assignment value and just don't assign it.
10712 * src/vspace.C (nextToken): corrected this function substituting
10713 find_first(_not)_of with find_last_of.
10715 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
10716 (TableOptCloseCB) (TableSpeCloseCB):
10717 inserted fl_set_focus call for problem with fl_hide_form() in
10720 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10722 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
10725 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10727 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
10728 LyXLex::next() and not eatline() to get its argument.
10730 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10732 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
10733 instead, use fstreams for io of the depfile, removed unneeded
10734 functions and variables.
10736 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
10737 vector instead, removed all functions and variables that is not in
10740 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10742 * src/buffer.C (insertErrors): use new interface to TeXError
10744 * Makefile.am (rpmdist): added a rpmdist target
10746 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
10747 per Kayvan's instructions.
10749 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10751 * src/Makefile.am: add a definition for localedir, so that locales
10752 are found after installation (Kayvan)
10754 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10756 * development/.cvsignore: new file.
10758 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10760 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
10761 C++ compiler provides wrappers for C headers and use our alternate
10764 * configure.in: use LYX_CXX_CHEADERS.
10766 * src/cheader/: new directory, populated with cname headers from
10767 libstdc++-2.8.1. They are a bit old, but probably good enough for
10768 what we want (support compilers who lack them).
10770 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
10771 from includes. It turns out is was stupid.
10773 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10775 * lib/Makefile.am (install-data-local): forgot a ';'
10776 (install-data-local): forgot a '\'
10777 (libinstalldirs): needed after all. reintroduced.
10779 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10781 * configure.in (AC_OUTPUT): added lyx.spec
10783 * development/lyx.spec: removed file
10785 * development/lyx.spec.in: new file
10787 * po/*.po: merged with lyx.pot becuase of make distcheck
10789 * lib/Makefile.am (dist-hook): added dist-hook so that
10790 documentation files will be included when doing a make
10791 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
10792 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
10794 more: tried to make install do the right thing, exclude CVS dirs
10797 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
10798 Path would fit in more nicely.
10800 * all files that used to use pathstack: uses now Path instead.
10801 This change was a lot easier than expected.
10803 * src/support/path.h: new file
10805 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
10807 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
10809 * src/support/lyxstring.C (getline): Default arg was given for
10812 * Configure.cmd: removed file
10814 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10816 * src/support/DebugStream.[Ch]: remove the explicit std:: before
10817 streams classes and types, add the proper 'using' statements when
10818 MODERN_STL is defined.
10820 * src/debug.h: move the << operator definition after the inclusion
10823 * src/support/filetools.C: include "LAssert.h", which is needed
10826 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
10829 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
10830 include "debug.h" to define a proper ostream.
10832 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10834 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
10835 method to the SystemCall class which can kill a process, but it's
10836 not fully implemented yet.
10838 * src/*.C: Changed Systemcalls::Startscript() to startscript()
10840 * src/support/FileInfo.h: Better documentation
10842 * src/lyxfunc.C: Added support for buffer-export html
10844 * src/menus.C: Added Export->As HTML...
10846 * lib/bind/*.bind: Added short-cut for buffer-export html
10848 * src/lyxrc.*: Added support for new \tth_command
10850 * lib/lyxrc.example: Added stuff for new \tth_command
10852 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10854 * lib/Makefile.am (IMAGES): removed images/README
10855 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
10856 installes in correct place. Check permisions is installed
10859 * src/LaTeX.C: some no-op changes moved declaration of some
10862 * src/LaTeX.h (LATEX_H): changed include guard name
10864 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10866 * lib/reLyX/Makefile.am: install noweb2lyx.
10868 * lib/Makefile.am: install configure.
10870 * lib/reLyX/configure.in: declare a config aux dir; set package
10871 name to lyx (not sure what the best solution is); generate noweb2lyx.
10873 * lib/layouts/egs.layout: fix the bibliography layout.
10875 1999-10-08 Jürgen Vigna <jug@sad.it>
10877 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
10878 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
10879 it returned without continuing to search the path.
10881 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10883 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
10884 also fixes a bug. It is not allowed to do tricks with std::strings
10885 like: string a("hei"); &a[e]; this will not give what you
10886 think... Any reason for the complexity in this func?
10888 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
10890 * Updated README and INSTALL a bit, mostly to check that my
10891 CVS rights are correctly set up.
10893 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10895 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
10896 does not allow '\0' chars but lyxstring and std::string does.
10898 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10900 * autogen.sh (AUTOCONF): let the autogen script create the
10901 POTFILES.in file too. POTFILES.in should perhaps now not be
10902 included in the cvs module.
10904 * some more files changed to use C++ includes instead of C ones.
10906 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
10908 (Reread): added tostr to nlink. buggy output otherwise.
10909 (Reread): added a string() around szMode when assigning to Buffer,
10910 without this I got a log of garbled info strings.
10912 * acconfig.h: commented out the PTR_AS_INT macros. They should not
10915 * I have added several ostream & operator<<(ostream &, some_type)
10916 functions. This has been done to avoid casting and warnings when
10917 outputting enums to lyxerr. This as thus eliminated a lot of
10918 explicit casts and has made the code clearer. Among the enums
10919 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
10920 mathed enums, some font enum the Debug::type enum.
10922 * src/support/lyxstring.h (clear): missing method. equivalent of
10925 * all files that contained "stderr": rewrote constructs that used
10926 stderr to use lyxerr instead. (except bmtable)
10928 * src/support/DebugStream.h (level): and the passed t with
10929 Debug::ANY to avoid spurious bits set.
10931 * src/debug.h (Debug::type value): made it accept strings of the
10932 type INFO,INIT,KEY.
10934 * configure.in (Check for programs): Added a check for kpsewhich,
10935 the latex generation will use this later to better the dicovery of
10938 * src/BufferView.C (create_view): we don't need to cast this to
10939 (void*) that is done automatically.
10940 (WorkAreaButtonPress): removed some dead code.
10942 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10944 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
10945 is not overwritten when translated (David Sua'rez de Lis).
10947 * lib/CREDITS: Added David Sua'rez de Lis
10949 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
10951 * src/bufferparams.C (BufferParams): default input encoding is now
10954 * acinclude.m4 (cross_compiling): comment out macro
10955 LYX_GXX_STRENGTH_REDUCE.
10957 * acconfig.h: make sure that const is not defined (to empty) when
10958 we are compiling C++. Remove commented out code using SIZEOF_xx
10961 * configure.in : move the test for const and inline as late as
10962 possible so that these C tests do not interefere with C++ ones.
10963 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
10964 has not been proven.
10966 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10968 * src/table.C (getDocBookAlign): remove bad default value for
10969 isColumn parameter.
10971 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
10973 (ShowFileMenu2): ditto.
10975 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
10976 of files to ignore.
10978 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10980 * Most files: finished the change from the old error code to use
10981 DebugStream for all lyxerr debugging. Only minor changes remain
10982 (e.g. the setting of debug levels using strings instead of number)
10984 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10986 * src/layout.C (Add): Changed to use compare_no_case instead of
10989 * src/FontInfo.C: changed loop variable type too string::size_type.
10991 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10993 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
10994 set ETAGS_ARGS to --c++
10996 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
10998 * src/table.C (DocBookEndOfCell): commented out two unused variables
11000 * src/paragraph.C: commented out four unused variables.
11002 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
11003 insed a if clause with type string::size_type.
11005 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
11008 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
11010 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
11011 variable, also changed loop to go from 0 to lenght + 1, instead of
11012 -1 to length. This should be correct.
11014 * src/LaTeX.C (scanError): use string::size_type as loop variable
11017 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
11018 (l.896) since y_tmp and row was not used anyway.
11020 * src/insets/insetref.C (escape): use string::size_type as loop
11023 * src/insets/insetquotes.C (Width): use string::size_type as loop
11025 (Draw): use string::size_type as loop variable type.
11027 * src/insets/insetlatexaccent.C (checkContents): use
11028 string::size_type as loop variable type.
11030 * src/insets/insetlabel.C (escape): use string::size_type as loop
11033 * src/insets/insetinfo.C: added an extern for current_view.
11035 * src/insets/insetcommand.C (scanCommand): use string::size_type
11036 as loop variable type.
11038 * most files: removed the RCS tags. With them we had to recompile
11039 a lot of files after a simple cvs commit. Also we have never used
11040 them for anything meaningful.
11042 * most files: tags-query-replace NULL 0. As adviced several plases
11043 we now use "0" instead of "NULL" in our code.
11045 * src/support/filetools.C (SpaceLess): use string::size_type as
11046 loop variable type.
11048 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11050 * src/paragraph.C: fixed up some more string stuff.
11052 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11054 * src/support/filetools.h: make modestr a std::string.
11056 * src/filetools.C (GetEnv): made ch really const.
11058 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
11059 made code that used these use max/min from <algorithm> instead.
11061 * changed several c library include files to their equivalent c++
11062 library include files. All is not changed yet.
11064 * created a support subdir in src, put lyxstring and lstrings
11065 there + the extra files atexit, fileblock, strerror. Created
11066 Makefile.am. edited configure.in and src/Makefile.am to use this
11067 new subdir. More files moved to support.
11069 * imported som of the functions from repository lyx, filetools
11071 * ran tags-query-replace on LString -> string, corrected the bogus
11072 cases. Tried to make use of lstrings.[hC], debugged a lot. There
11073 is still some errors in there. This is errors where too much or
11074 too litle get deleted from strings (string::erase, string::substr,
11075 string::replace), there can also be some off by one errors, or
11076 just plain wrong use of functions from lstrings. Viewing of quotes
11079 * LyX is now running fairly well with string, but there are
11080 certainly some bugs yet (see above) also string is quite different
11081 from LString among others in that it does not allow null pointers
11082 passed in and will abort if it gets any.
11084 * Added the revtex4 files I forgot when setting up the repository.
11086 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11088 * All over: Tried to clean everything up so that only the files
11089 that we really need are included in the cvs repository.
11090 * Switched to use automake.
11091 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
11092 * Install has not been checked.
11094 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11096 * po/pt.po: Three errors:
11097 l.533 and l.538 format specification error
11098 l. 402 duplicate entry, I just deleted it.