1 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3 * lib/ui/default.ui: Populate "edit_float" menu
5 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
7 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
8 "floats-operate". The name is ugly (and the func also), but this
9 is just a band-aid until we switch to new insets.
11 2000-11-03 Rob Lahaye <lahaye@postech.edu>
13 * lib/ui/default.ui: update again the menu layout (fix some
16 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
18 * src/MenuBackend.h (fulllabel): new method.
20 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
21 the menu shortcuts of a menu are unique and whether they
22 correspond to a letter of the label.
23 (expand): call checkShortcuts when debugging.
25 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
27 * src/insets/insettext.C (InsetButtonPress): shut off warning.
29 2000-11-02 Lior Silberman <lior@Princeton.EDU>
31 * lib/examples/*.lyx : '\language default' => '\language english'
33 * lib/examples/it_splash.lyx : except where it should be italian
35 * lib/templates/*.lyx : the same
37 * doc/*.lyx* : the same
39 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
41 * lib/bind/menus.bind: remove the Layout menu entries, which I
42 somehow forgot earlier.
44 2000-11-03 Rob Lahaye <lahaye@postech.edu>
46 * lib/ui/old-default.ui: keep the old one here for reference (to
49 * lib/ui/default.ui: update the menu layout
51 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
53 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
54 Can now Apply to different insets without closing the dialog.
56 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
57 Can't actually DO anything with them yet, but I'd like a little
60 * src/frontends/xforms/input_validators.[ch]
61 (fl_lowercase_filter): new.
63 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
65 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
66 of MATH_CODE. This fixes a bug with math-macros in RTL text.
68 * src/text.C (PrepareToPrint): Show math-macros block aligned.
70 2000-11-02 Juergen Vigna <jug@sad.it>
72 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
73 on char insertion as it has already be updated by bv->updateInset().
75 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
76 if an inset inside was updated.
78 * lib/configure.cmd: commented out fax-search code
80 2000-11-01 Yves Bastide <stid@acm.org>
82 * src/tabular.C (OldFormatRead): set tabular language to the
85 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
87 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
88 class names with non-letter characters (from Yves Bastide).
90 * lib/ui/default.ui: change Item to OptItem in import menu.
91 Comment out fax stuff.
93 * lib/configure.m4: comment out fax-related stuff.
95 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
97 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
98 useful xforms helper functions. At present contains only formatted().
99 Input a string and it returns it with line breaks so that in fits
102 * src/frontends/xforms/Makefile.am: add new files.
104 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
105 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
108 * src/frontends/xforms/FormPreferences.[Ch]:
109 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
110 but lots of little clean ups. Removed enum State. Make use of
111 formatted(). Constify lots of methods. Perhaps best of all: removed
112 requirement for that horrible reinterpret_cast from pointer to long in
115 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
117 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
118 conditionalize build on xforms < 0.89
120 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
122 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
124 * src/LyXAction.C (init): comment out fax
126 * src/lyxrc.h: comment out the fax enums
127 comment out the fax variables
129 * src/commandtags.h: comment out LFUN_FAX
131 * src/lyxrc.C: disable fax variables.
132 (read): disable parsing of fax variables
133 (output): disable writing of fax variables
134 (getFeedback): now description for fax variables
136 * src/lyxfunc.C: comment out MenuFax
137 (Dispatch): disable LFUN_FAX
139 * src/lyx_cb.C (MenuFax): comment out
141 * src/WorkArea.C: add <cctype>
142 (work_area_handler): better key handling, should be ok now.
143 for accented chars + etc
145 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
146 lyx_sendfax.h and lyx_sendfax_man.C
148 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
149 (show): don't call InitLyXLookup when using xforms 0.89
151 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
153 * src/trans.C (AddDeadkey): better fix, the other one could crash...
155 * src/support/filetools.C (GetFileContents): close to dummy change
157 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
159 * src/trans.C (AddDeadkey): workaround stupid compilers.
161 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
163 * src/frontends/xforms/FormDocument.C (class_update): fix setting
164 of two-sided document.
166 2000-10-31 Juergen Vigna <jug@sad.it>
168 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
170 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
171 xposition to the Edit call.
173 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
175 * src/trans.C (AddDeadkey): cast explicitly to char.
177 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
179 * src/tabular.C (AsciiBottomHLine): simplify?
180 (AsciiTopHLine): simplify?
181 (print_n_chars): simplify
182 (DocBook): remove most of the << endl; we should flush the stream
183 as seldom as possible.
185 (TeXBottomHLine): ditto
188 (write_attribute): try a templified version.
189 (set_row_column_number_info): lesson scope of variables
191 * src/support/lstrings.h (tostr): new specialization of tostr
193 * src/trans.C (AddDeadkey): slightly cleaner fix.
195 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
197 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
198 '%%' in Toc menu labels.
201 * src/insets/insetlatexaccent.C (draw): Correct rendering when
202 font_norm is iso10646-1.
204 * src/font.C (ascent): Fixed for 16bit fonts
205 (descent,lbearing,rbearing): ditto
207 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
209 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
210 (getFeedback): new static method.
212 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
213 Now use combox rather than choice to display languages.
214 Feedback is now output using a new timer callback mechanism, identical
215 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
217 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
219 * src/minibuffer.C: fix for older compilers
221 2000-10-30 Juergen Vigna <jug@sad.it>
223 * src/insets/insettext.C (InsertInset): fixed this as the cursor
224 has to be Left of the inset otherwise LyXText won't find it!
226 * src/BufferView2.C (open_new_inset): delete the inset if it can
229 2000-10-30 Rob Lahaye <lahaye@postech.edu>
233 2000-10-29 Marko Vendelin <markov@ioc.ee>
234 * src/frontends/gnome/FormCitation.C
235 * src/frontends/gnome/FormCitation.h
236 * src/frontends/gnome/FormCopyright.C
237 * src/frontends/gnome/FormCopyright.h
238 * src/frontends/gnome/FormError.C
239 * src/frontends/gnome/FormError.h
240 * src/frontends/gnome/FormIndex.C
241 * src/frontends/gnome/FormIndex.h
242 * src/frontends/gnome/FormPrint.C
243 * src/frontends/gnome/FormPrint.h
244 * src/frontends/gnome/FormRef.C
245 * src/frontends/gnome/FormRef.h
246 * src/frontends/gnome/FormToc.C
247 * src/frontends/gnome/FormToc.h
248 * src/frontends/gnome/FormUrl.C
249 * src/frontends/gnome/FormUrl.h
250 * src/frontends/gnome/Menubar_pimpl.C
251 * src/frontends/gnome/mainapp.C
252 * src/frontends/gnome/mainapp.h
253 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
254 changing update() to updateSlot() where appropriate
256 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
258 * src/frontends/xforms/FormPreferences.[Ch]:
259 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
262 2000-10-28 Juergen Vigna <jug@sad.it>
264 * src/insets/insettabular.C (draw): fixed drawing bug.
266 * src/insets/insettext.C (clear):
268 (SetParagraphData): clearing the TEXT buffers when deleting the
269 paragraphs used by it.
271 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
273 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
275 2000-10-27 Juergen Vigna <jug@sad.it>
277 * src/tabular.C (~LyXTabular): removed not needed anymore.
279 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
282 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
284 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
287 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
290 * src/frontends/xforms/FormPreferences.[Ch]:
291 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
292 Reorganised as modules based on tabs. Much easier to follow the
293 flow and to add new tabs. Added warning and feedback messages.
296 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
298 * src/tabular.h (DocBook): add std:: qualifier.
300 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
302 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
303 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
306 * insettabular.C (DocBook): uses the tabular methods to export
309 * src/insets/insettext.h
310 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
312 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
314 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
317 * src/lyxfunc.C (MenuNew): lessen the scope of fname
318 moved misplaced AllowInput two lines up.
320 * src/buffer.C (readFile): compare float with float, not with int
322 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
324 * src/minibuffer.C: add "using SigC::slot" statement.
326 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
328 * src/frontends/xforms/forms/README: updated section about make.
330 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
331 Tidied some forms up, made two of form_tabular's tabs more
332 self-consistent, fixed Jean-Marc's size problem in form_preferences,
333 fixed translation problem with "Column".
335 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
337 * src/minibuffer.h: use Timeout instead of the xforms timer
339 (setTimer) rewrite for the Timeout, change to unsigned arg
340 (set): change to unsigned timer arg
343 * src/minibuffer.C (TimerCB): removed func
344 (C_MiniBuffer_TimerCB): removed func
345 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
346 (peek_event): use a switch statement
347 (add): don't use fl_add_timer.
348 (Set): rewrite to use the Timeout
351 * src/Timeout.[Ch] (setType): return a Timeout &
352 (setTimeout): ditto, change to unsigned arg for timeout
354 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
356 * src/mathed/formula.C (mathed_string_width): Use string instead
357 of a constant size char array.
359 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
361 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
362 the two recently added operator<< for SMInput and State.
364 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
366 (OkCancelPolicy): ditto
367 (OkCancelReadOnlyPolicy): ditto
368 (NoRepeatedApplyReadOnlyPolicy): ditto
369 (OkApplyCancelReadOnlyPolicy): ditto
370 (OkApplyCancelPolicy): ditto
371 (NoRepeatedApplyPolicy): ditto
373 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
375 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
376 add the usual std:: qualifiers.
378 2000-10-25 Juergen Vigna <jug@sad.it>
380 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
382 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
384 * src/support/filetools.C (MakeRelPath): change some types to
387 * src/frontends/ButtonPolicies.h (operator<<): new operator for
388 ButtonPolicy::SMInput and ButtonPolicy::State.
390 * src/FontLoader.C (reset): small cleanup
391 (unload): small cleanup
393 * src/FontInfo.C (getFontname): initialize error to 10000.0
395 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
397 * src/frontends/xforms/FormPreferences.[Ch]:
398 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
399 TeX encoding and default paper size sections.
401 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
403 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
406 * src/frontends/xforms/FormError.C (disconnect): use erase() to
407 make the message_ empty.
408 (FormError): don't initialize message_ in initializer list.
410 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
412 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
414 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
416 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
418 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
420 * src/frontends/kde/*data.[Ch]: _("") is not
423 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
425 * src/buffer.C: removed redundant using directive.
427 * src/frontends/DialogBase.h: revert to original definition of
430 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
431 stuff into two classes, one for each dialog, requires a new
432 element in the dialogs vector, FormTabularCreate.
434 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
437 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
438 method. Continues Allan's idea, but means that derived classes
439 don't need to worry about "update or hide?".
441 * src/frontends/xforms/FormError.C (showInset): add connection
444 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
445 one for each dialog. FormTabular now contains main tabular dialog
448 * src/frontends/xforms/FormTabularCreate.[Ch]:
449 * src/frontends/xforms/forms/form_tabular_create.fd: the create
452 * src/frontends/xforms/FormGraphics.[Ch]:
453 * src/frontends/xforms/forms/form_graphics.fd
454 * src/frontends/xforms/FormTabular.[Ch]:
455 * src/frontends/xforms/forms/form_tabular.fd: made daughter
456 classes of FormInset.
458 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
459 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
461 * src/frontends/xforms/Makefile.am:
462 * src/frontends/xforms/forms/makefile: added new files.
464 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
465 variable. added Signal0 hide signal, in keeping with other GUI-I
468 * src/support/lstrings.h: removed redundant std:: qualifier as
469 it's already declared in Lsstream.h.
471 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
473 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
477 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
479 * src/tabular.C (Ascii): minimize scope of cell.
481 * src/BufferView2.C (nextWord): return string() instead of 0;
483 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
485 * src/converter.h: add a std:: qualifier
487 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
489 * src/importer.[Ch]: New files. Used for importing files into LyX.
491 * src/lyxfunc.C (doImport): Use the new Importer class.
493 * src/converter.h: Add shortcut member to the Format class.
494 Used for holding the menu shortcut.
496 * src/converter.C and other files: Made a distinction between
497 format name and format extension. New formats can be defined using
498 the \format lyxrc tag.
499 Added two new converter flags: latex and disable.
501 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
503 * src/support/lyxlib.h: unify namespace/struct implementation.
504 Remove extra declarations.
506 * src/support/chdir.C (chdir): remove version taking char const *
508 * src/support/rename.C: ditto.
509 * src/support/lyxsum.C: ditto.
511 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
513 * src/frontends/xforms/FormBase.[Ch]:
514 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
515 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
516 work only for the next call to fl_show_form(). The correct place to set
517 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
518 done. FormBase also stores minw_, minh_ itself. All dialogs derived
519 from FormBase have the minimum size set; no more stupid crashes with
522 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
524 * lib/ui/default.ui: fix shortcut for Insert->Include File.
526 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
528 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
530 * src/support/lyxlib.h: changed second argument of mkdir to
531 unsigned long int (unsigned int would probably have been enough,
532 but...). Removed <sys/types.h> header.
533 * src/support/mkdir.C (mkdir): ditto.
537 2000-10-19 Juergen Vigna <jug@sad.it>
539 * src/lyxfunc.C (MenuNew): small fix (form John)
541 * src/screen.C (Update): removed unneeded code.
543 * src/tabular.C (Ascii): refixed int != uint bug!
545 * src/support/lyxlib.h: added sys/types.h include for now permits
546 compiling, but I don't like this!
548 2000-10-18 Juergen Vigna <jug@sad.it>
550 * src/text2.C (ClearSelection): if we clear the selection we need
551 more refresh so set the status apropriately
553 * src/insets/insettext.C (draw): hopefully finally fixed draw
556 2000-10-12 Juergen Vigna <jug@sad.it>
558 * src/insets/insettext.C (draw): another small fix and make a block
559 so that variables are localized.
561 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
563 * src/support/lstrings.C (lowercase, uppercase):
564 use explicit casts to remove compiler warnings.
566 * src/support/LRegex.C (Impl):
567 * src/support/StrPool.C (add):
568 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
569 (AddPath, MakeDisplayPath):
570 * src/support/lstrings.C (prefixIs, subst):
571 use correct type to remove compiler warnings.
573 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
575 * src/support/lyxlib.h:
576 * src/support/mkdir.C (mkdir): change parameter to mode_t for
577 portability and to remove compiler warning with DEC cxx.
579 * src/support/FileInfo.[Ch] (flagRWX): ditto.
581 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
583 * src/minibuffer.C (peek_event): retun 1 when there has been a
584 mouseclick in the minibuffer.
588 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
590 * src/frontends/xforms/FormParagraph.C: more space above/below
593 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
595 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
596 a char only if real_current_font was changed.
598 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
600 * NEWS: update somewhat for 1.1.6
602 * lib/ui/default.ui: clean up.
604 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
606 * lib/CREDITS: clean up
608 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
610 * src/combox.[Ch] (select): changed argument back to int
611 * src/combox.C (peek_event): removed num_bytes as it is declared but
614 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
615 modified calls to Combox::select() to remove warnings about type
618 * src/insets/insetbutton.C (width): explicit cast to remove warning
619 about type conversion.
621 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
624 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
625 sel_pos_end, refering to cursor position are changed to
626 LyXParagraph::size_type.
628 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
629 consistent with LyXCursor::pos().
630 (inset_pos): changed to LyXParagraph::size_type for same reason.
632 * src/insets/insettext.C (resizeLyXText): changed some temporary
633 variables refing to cursor position to LyXParagraph::size_type.
635 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
637 * src/frontends/kde/<various>: The Great Renaming,
640 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
642 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
644 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
646 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
647 0 when there are no arguments.
649 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
651 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
652 to segfaults when pressing Ok in InsetBibtex dialog.
654 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
656 * forms/layout_forms.fd:
657 * src/layout_forms.C (create_form_form_character): small change to use
658 labelframe rather than engraved frame + text
660 * src/lyx_gui.C (create_forms): initialise choice_language with some
661 arbitrary value to prevent segfault when dialog is shown.
663 2000-10-16 Baruch Even <baruch.even@writeme.com>
665 * src/converter.C (runLaTeX, scanLog): Added a warning when there
666 is no resulting file. This pertains only to LaTeX output.
668 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
670 * src/text.C (Backspace): Make sure that the row of the cursor is
673 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
676 * src/lyx_gui.C (init): Prevent a crash when only one font from
677 menu/popup fonts is not found.
679 * lib/lyxrc.example: Add an example for binding a key for language
682 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
684 * src/converter.C (GetReachable): Changed the returned type to
686 (IsReachable): New method
688 * src/MenuBackend.C (expand): Handle formats that appear more
691 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
693 * src/frontends/support/Makefile.am
694 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
697 * lib/CREDITS: add Garst Reese.
699 * src/support/snprintf.h: add extern "C" {} around the definitions.
701 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
703 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
706 * src/frontends/xforms/FormDocument.C:
707 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
708 compile without "conversion to integral type of smaller size"
711 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
713 * src/text.C (GetColumnNearX): Fixed disabled code.
715 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
717 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
720 * src/support/snprintf.[ch]: new files
722 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
724 * src/frontends/kde/formprintdialog.C: add
725 file browser for selecting postscript output
727 * src/frontends/kde/formprintdialogdata.C:
728 * src/frontends/kde/formprintdialogdata.h: re-generate
731 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
733 * src/frontends/gnome/Makefile.am:
734 * src/frontends/kde/Makefile.am: FormCommand.C
735 disappeared from xforms
737 * src/frontends/kde/FormCitation.C:
738 * src/frontends/kde/FormIndex.C: read-only
741 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
743 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
746 * src/bufferlist.C: add using directive.
748 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
750 * src/support/lyxfunctional.h: version of class_fun for void
751 returns added, const versions of back_inseter_fun and compare_fun
754 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
756 * src/frontends/xforms/FormInset.C (showInset): fix typo.
758 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
760 * ChangeLog: cleanup.
762 * lib/CREDITS: update to add all the contributors we've forgotten.
763 I have obviously missed some, so tell me whether there were
766 2000-10-13 Marko Vendelin <markov@ioc.ee>
768 * src/frontends/gnome/FormCitation.C
769 * src/frontends/gnome/FormCitation.h
770 * src/frontends/gnome/FormError.C
771 * src/frontends/gnome/FormIndex.C
772 * src/frontends/gnome/FormRef.C
773 * src/frontends/gnome/FormRef.h
774 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
776 * src/frontends/gnome/FormCitation.C
777 * src/frontends/gnome/FormCopyright.C
778 * src/frontends/gnome/FormError.C
779 * src/frontends/gnome/FormIndex.C
780 * src/frontends/gnome/FormRef.C
781 * src/frontends/gnome/FormToc.C
782 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
785 * src/frontends/gnome/Menubar_pimpl.C
786 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
789 2000-10-11 Baruch Even <baruch.even@writeme.com>
792 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
793 to convey its real action.
795 * src/minibuffer.C (peek_event): Added action when mouse clicks to
796 clear the minibuffer and prepare to enter a command.
798 * src/mathed/formula.C (LocalDispatch): Changed to conform with
799 the rename from ExecCommand to PrepareForCommand.
800 * src/lyxfunc.C (Dispatch): ditto.
802 2000-10-11 Baruch Even <baruch.even@writeme.com>
804 * src/buffer.C (writeFile): Added test for errors on writing, this
805 catches all errors and not only file system full errors as intended.
807 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
809 * src/lyx_gui.C (create_forms): better fix for crash with
810 translated interface.
812 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
814 * src/frontends/kde/Makefile.am:
815 * src/frontends/kde/FormCopyright.C:
816 * src/frontends/kde/formcopyrightdialog.C:
817 * src/frontends/kde/formcopyrightdialog.h:
818 * src/frontends/kde/formcopyrightdialogdata.C:
819 * src/frontends/kde/formcopyrightdialogdata.h:
820 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
821 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
822 copyright to use qtarch
824 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
826 * src/encoding.C (read): Fixed bug that caused an error message at
829 * po/Makefile.in.in: Fixed rule for ext_l10n.h
831 * lib/lyxrc.example: Fixed hebrew example.
833 2000-10-13 Allan Rae <rae@lyx.org>
835 * src/frontends/xforms/FormPreferences.C (input): reworking the
837 (build, update, apply): New inputs in various tabfolders
839 * src/frontends/xforms/FormToc.C: use new button policy.
840 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
841 dialogs that either can't use any existing policy or where it just
844 * src/frontends/xforms/FormTabular.h: removed copyright notice that
847 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
848 added a bool parameter which is ignored.
850 * src/buffer.C (setReadonly):
851 * src/BufferView_pimpl.C (buffer):
852 * src/frontends/kde/FormCopyright.h (update):
853 * src/frontends/kde/FormCitation.[Ch] (update):
854 * src/frontends/kde/FormIndex.[Ch] (update):
855 * src/frontends/kde/FormPrint.[Ch] (update):
856 * src/frontends/kde/FormRef.[Ch] (update):
857 * src/frontends/kde/FormToc.[Ch] (update):
858 * src/frontends/kde/FormUrl.[Ch] (update):
859 * src/frontends/gnome/FormCopyright.h (update):
860 * src/frontends/gnome/FormCitation.[Ch] (update):
861 * src/frontends/gnome/FormError.[Ch] (update):
862 * src/frontends/gnome/FormIndex.[Ch] (update):
863 * src/frontends/gnome/FormPrint.[Ch] (update):
864 * src/frontends/gnome/FormRef.h (update):
865 * src/frontends/gnome/FormToc.[Ch] (update):
866 * src/frontends/gnome/FormUrl.[Ch] (update):
867 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
868 to updateBufferDependent and DialogBase
870 * src/frontends/xforms/FormCitation.[hC]:
871 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
872 * src/frontends/xforms/FormError.[Ch]:
873 * src/frontends/xforms/FormGraphics.[Ch]:
874 * src/frontends/xforms/FormIndex.[Ch]:
875 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
876 and fixed readOnly handling.
877 * src/frontends/xforms/FormPrint.[Ch]:
878 * src/frontends/xforms/FormRef.[Ch]:
879 * src/frontends/xforms/FormTabular.[Ch]:
880 * src/frontends/xforms/FormToc.[Ch]:
881 * src/frontends/xforms/FormUrl.[Ch]:
882 * src/frontends/xforms/FormInset.[Ch]:
883 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
884 form of updateBufferDependent.
886 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
887 if form()->visible just in case someone does stuff to the form in a
890 * src/frontends/DialogBase.h (enum): removed enum since we can now use
891 the buttoncontroller for everything the enum used to be used for.
892 (update) It would seem we need to force all dialogs to use a bool
893 parameter or have two update functions. I chose to go with one.
894 I did try removing update() from here and FormBase and defining the
895 appropriate update signatures in FormBaseB[DI] but then ran into the
896 problem of the update() call in FormBase::show(). Whatever I did
897 to get around that would require another function and that just
898 got more confusing. Hence the decision to make everyone have an
899 update(bool). An alternative might have been to override show() in
900 FormBaseB[DI] and that would allow the different and appropriate
903 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
904 true == buffer change occurred. I decided against using a default
905 template parameter since not all compilers support that at present.
907 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
909 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
910 army knife" by removing functionality.
911 (clearStore): removed. All such housekeeping on hide()ing the dialog
912 is to be carried out by overloaded disconnect() methods.
913 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
914 superceded by Baruch's neat test (FormGraphics) to update an existing
915 dialog if a new signal is recieved rather than block all new signals
917 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
918 only to Inset dialogs.
919 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
920 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
922 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
924 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
925 as a base class to all inset dialogs. Used solely to connect/disconnect
926 the Inset::hide signal and to define what action to take on receipt of
927 a UpdateBufferDependent signal.
928 (FormCommand): now derived from FormInset.
930 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
933 * src/frontends/xforms/FormCopyright.[Ch]:
934 * src/frontends/xforms/FormPreferences.[Ch]:
935 now derived from FormBaseBI.
937 * src/frontends/xforms/FormDocument.[Ch]:
938 * src/frontends/xforms/FormParagraph.[Ch]:
939 * src/frontends/xforms/FormPrint.[Ch]:
940 now derived from FormBaseBD.
942 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
944 * src/frontends/xforms/FormCitation.[Ch]:
945 * src/frontends/xforms/FormError.[Ch]:
946 * src/frontends/xforms/FormRef.[Ch]:
947 * src/frontends/xforms/FormToc.[Ch]:
948 (clearStore): reworked as disconnect().
950 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
953 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
955 * src/converter.C (runLaTeX): constify buffer argument
958 * src/frontends/support/Makefile.am (INCLUDES): fix.
960 * src/buffer.h: add std:: qualifier
961 * src/insets/figinset.C (addpidwait): ditto
962 * src/MenuBackend.C: ditto
963 * src/buffer.C: ditto
964 * src/bufferlist.C: ditto
965 * src/layout.C: ditto
966 * src/lyxfunc.C: ditto
968 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
970 * src/lyxtext.h (bidi_level): change return type to
971 LyXParagraph::size_type.
973 * src/lyxparagraph.h: change size_type to
974 TextContainer::difference_type. This should really be
975 TextContainer::size_type, but we need currently to support signed
978 2000-10-11 Marko Vendelin <markov@ioc.ee>
979 * src/frontends/gnome/FormError.h
980 * src/frontends/gnome/FormRef.C
981 * src/frontends/gnome/FormRef.h
982 * src/frontends/gnome/FormError.C
983 * src/frontends/gnome/Makefile.am
984 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
985 to Gnome frontend. Both dialogs use "action" area.
987 2000-10-12 Baruch Even <baruch.even@writeme.com>
989 * src/graphics/GraphicsCacheItem_pimpl.C:
990 * src/graphics/Renderer.C:
991 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
994 2000-10-12 Juergen Vigna <jug@sad.it>
996 * src/insets/insettext.C (draw): fixed drawing bug (specifically
997 visible when selecting).
999 * development/Code_rules/Rules: fixed some typos.
1001 2000-10-09 Baruch Even <baruch.even@writeme.com>
1003 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
1004 compiling on egcs 1.1.2 possible.
1006 * src/filedlg.C (comp_direntry::operator() ): ditto.
1008 2000-08-31 Baruch Even <baruch.even@writeme.com>
1010 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
1013 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
1014 transient it now only gets freed when the object is destructed.
1016 2000-08-24 Baruch Even <baruch.even@writeme.com>
1018 * src/frontends/FormGraphics.h:
1019 * src/frontends/FormGraphics.C: Changed to use ButtonController and
1022 2000-08-20 Baruch Even <baruch.even@writeme.com>
1024 * src/insets/insetgraphics.C:
1025 (draw): Added messages to the drawn rectangle to report status.
1026 (updateInset): Disabled the use of the inline graphics,
1029 2000-08-17 Baruch Even <baruch.even@writeme.com>
1031 * src/frontends/support: Directory added for the support of GUII LyX.
1033 * src/frontends/support/LyXImage.h:
1034 * src/frontends/support/LyXImage.C: Base class for GUII holding of
1037 * src/frontends/support/LyXImage_X.h:
1038 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
1039 version of LyXImage, this uses the Xlib Pixmap.
1041 * src/PainterBase.h:
1042 * src/PainterBase.C:
1044 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
1045 replacement to Pixmap.
1047 * src/insets/insetgraphics.h:
1048 * src/insets/insetgraphics.C:
1049 * src/graphics/GraphicsCacheItem.h:
1050 * src/graphics/GraphicsCacheItem.C:
1051 * src/graphics/GraphicsCacheItem_pimpl.h:
1052 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
1055 * src/graphics/GraphicsCacheItem.h:
1056 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
1057 another copy of the object.
1059 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
1060 of cacheHandle, this fixed a bug that sent LyX crashing.
1062 * src/graphics/XPM_Renderer.h:
1063 * src/graphics/XPM_Renderer.C:
1064 * src/graphics/EPS_Renderer.h:
1065 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
1067 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1069 * src/lyxfunc.C (processKeySym): only handle the
1070 lockinginset/inset stuff if we have a buffer and text loaded...
1072 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
1074 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1076 * src/support/lyxfunctional.h: add operator= that takes a reference
1078 * src/lyxserver.C (mkfifo): make first arg const
1080 * src/layout.h: renamed name(...) to setName(...) to work around
1083 * src/buffer.C (setFileName): had to change name of function to
1084 work around bugs in egcs. (renamed from fileName)
1086 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
1088 * src/support/translator.h: move helper template classes to
1089 lyxfunctional.h, include "support/lyxfunctional.h"
1091 * src/support/lyxmanip.h: add delaration of fmt
1093 * src/support/lyxfunctional.h: new file
1094 (class_fun_t): new template class
1095 (class_fun): helper template function
1096 (back_insert_fun_iterator): new template class
1097 (back_inserter_fun): helper template function
1098 (compare_memfun_t): new template class
1099 (compare_memfun): helper template function
1100 (equal_1st_in_pair): moved here from translator
1101 (equal_2nd_in_pair): moved here from translator
1103 * src/support/fmt.C: new file
1104 (fmt): new func, can be used for a printf substitute when still
1105 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
1107 * src/support/StrPool.C: add some comments
1109 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
1112 * src/insets/figinset.C (addpidwait): use std::copy with
1113 ostream_iterator to fill the pidwaitlist
1115 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
1117 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
1120 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
1123 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
1125 * src/frontends/xforms/FormDocument.C (build): remove c_str()
1126 (class_update): ditto
1127 (BulletPanel): ditto
1128 (CheckChoiceClass): move initialization of tc and tct
1130 * src/tabular.C: remove current_view
1131 (OldFormatRead): similar to right below [istream::ignore]
1133 * src/lyxlex_pimpl.C (next): add code for faster skipping of
1134 chars, unfortunately this is buggy on gcc 2.95.2, so currently
1135 unused [istream::ignore]
1137 * src/lyxfunc.C: include "support/lyxfunctional.h"
1138 (getInsetByCode): use std::find_if and compare_memfun
1140 * src/lyxfont.C (stateText): remove c_str()
1142 * src/lyx_main.C (setDebuggingLevel): make static
1143 (commandLineHelp): make static
1145 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
1146 Screen* together with fl_get_display() and fl_screen
1148 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
1149 togheter with fl_get_display() and fl_screen
1150 (create_forms): remove c_str()
1152 * src/layout.C: include "support/lyxfunctional.h"
1153 (hasLayout): use std::find_if and compare_memfun
1154 (GetLayout): use std::find_if and comapre_memfun
1155 (delete_layout): use std::remove_if and compare_memfun
1156 (NumberOfClass): use std:.find_if and compare_memfun
1158 * src/gettext.h: change for the new functions
1160 * src/gettext.C: new file, make _(char const * str) and _(string
1161 const & str) real functions.
1163 * src/font.C (width): rewrite slightly to avoid one extra variable
1165 * src/debug.C: initialize Debug::ANY here
1167 * src/commandtags.h: update number comments
1169 * src/combox.h (get): make const func
1171 (getline): make const
1173 * src/combox.C (input_cb): handle case where fl_get_input can
1176 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
1177 "support/lyxfunctional.h", remove current_view variable.
1178 (resize): use std::for_each with std::mem_fun
1179 (getFileNames): use std::copy with back_inserter_fun
1180 (getBuffer): change arg type to unsigned int
1181 (emergencyWriteAll): call emergencyWrite with std::for_each and
1183 (emergencyWrite): new method, the for loop in emergencyWriteAll
1185 (exists): use std::find_if with compare_memfun
1186 (getBuffer): use std::find_if and compare_memfun
1188 * src/buffer.h: add typedefs for iterator_category, value_type
1189 difference_type, pointer and reference for inset_iterator
1190 add postfix ++ for inset_iterator
1191 make inset_iterator::getPos() const
1193 * src/buffer.C: added support/lyxmanip.h
1194 (readFile): use lyxerr << fmt instead of printf
1195 (makeLaTeXFile): use std::copy to write out encodings
1197 * src/Painter.C (text): rewrite slightly to avoid extra font variable
1199 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
1200 free and the char * temp.
1201 (hasMenu): use std::find_if and compare_memfun
1204 * src/Makefile.am (lyx_SOURCES): added gettext.C
1206 * src/LyXAction.C (retrieveActionArg): clear the arg, use
1207 string::insert small change to avoid temporary
1209 * src/LColor.C (getGUIName): remove c_str()
1211 * several files: change all occurrences of fl_display to
1214 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
1215 that -pedantic is not used for gcc 2.97 (cvs gcc)
1217 * boost/Makefile.am: begin slowly to prepare for a real boost lib
1219 2000-10-11 Allan Rae <rae@lyx.org>
1221 * src/frontends/xforms/FormPreferences.C (input): template path must be
1222 a readable directory. It doesn't need to be writeable.
1223 (build, delete, update, apply): New inputs in the various tabfolders
1225 * src/frontends/xforms/forms/form_preferences.fd:
1226 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
1227 several new entries to existing folders. Shuffled some existing stuff
1230 * src/frontends/xforms/forms/form_print.fd:
1231 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
1232 Should probably rework PrinterParams as well. Note that the switch to
1233 collated is effectively the same as !unsorted so changing PrinterParams
1234 will require a lot of fiddly changes to reverse the existing logic.
1236 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
1238 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1240 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
1242 2000-10-10 Allan Rae <rae@lyx.org>
1245 * src/lyxfunc.C (Dispatch):
1247 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
1250 * src/lyxrc.C (output): Only write the differences between system lyxrc
1251 and the users settings.
1254 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
1256 I'll rewrite this later, after 1.1.6 probably, to keep a single
1257 LyXRC but two instances of a LyXRCStruct.
1259 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1261 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
1263 * src/tabular.h: add a few std:: qualifiers.
1265 * src/encoding.C: add using directive.
1266 * src/language.C: ditto.
1268 * src/insets/insetquotes.C (Validate): use languages->lang()
1269 instead of only language.
1271 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
1273 * lib/languages: New file.
1275 * lib/encodings: New file.
1277 * src/language.C (Languages): New class.
1278 (read): New method. Reads the languages from the 'languages' file.
1280 * src/encoding.C (Encodings): New class.
1281 (read): New method. Reads the encodings from the 'encodings' file.
1283 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
1286 * src/bufferparams.h and a lot of files: Deleted the member language,
1287 and renamed language_info to language
1289 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
1290 * src/lyxfont.C (latexWriteStartChanges): ditto.
1291 * src/paragraph.C (validate,TeXOnePar): ditto.
1293 * src/lyxfont.C (update): Restored deleted code.
1295 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
1297 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1299 * src/BufferView_pimpl.C (buffer): cleaned up a little.
1301 * src/insets/figinset.[Ch]:
1302 * src/insets/insetinclude.[Ch]:
1303 * src/insets/insetinclude.[Ch]:
1304 * src/insets/insetparent.[Ch]:
1305 * src/insets/insetref.[Ch]:
1306 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
1308 * src/insets/*.[Ch]:
1309 * src/mathed/formula.[Ch]:
1310 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
1312 * src/buffer.C (parseSingleLyXformat2Token, readInset):
1313 * src/lyx_cb.C (FigureApplyCB):
1314 * src/lyxfunc.C (getStatus, Dispatch):
1315 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
1318 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
1320 * src/converter.[Ch] (Formats::View):
1321 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
1323 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
1324 *current_view->buffer(). This will change later, but this patch is way
1327 2000-10-09 Juergen Vigna <jug@sad.it>
1329 * src/text.C (GetRow): small fix.
1331 * src/BufferView_pimpl.C (cursorPrevious):
1332 (cursorNext): added LyXText parameter to function.
1334 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
1335 keypress depending on cursor position.
1337 2000-10-06 Juergen Vigna <jug@sad.it>
1339 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
1340 (copySelection): redone this function and also copy ascii representa-
1343 * src/tabular.C (Ascii):
1347 (print_n_chars): new functions to realize the ascii export of tabulars.
1349 2000-10-05 Juergen Vigna <jug@sad.it>
1351 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
1352 if we don't have a buffer.
1354 2000-10-10 Allan Rae <rae@lyx.org>
1356 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
1357 with closing dialog. It seems that nested tabfolders require hiding
1358 of inner tabfolders before hiding the dialog itself. Actually all I
1359 did was hide the active outer folder.
1361 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
1362 unless there really is a buffer. hideBufferDependent is called
1365 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
1366 POTFILES.in stays in $(srcdir).
1368 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
1370 * lib/lyxrc.example: Few changes.
1372 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
1374 * src/BufferView_pimpl.C (buffer): only need one the
1375 updateBufferDependent signal to be emitted once! Moved to the end of
1376 the method to allow bv_->text to be updated first.
1378 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
1379 and hSignal_ with Dialogs * and BufferDependency variables.
1380 New Buffer * parent_, initialised when the dialog is launched. Used to
1381 check whether to update() or hide() dialog in the new, private
1382 updateOrHide() method that is connected to the updateBufferDependent
1383 signal. Daughter classes dictate what to do using the
1384 ChangedBufferAction enum, passed to the c-tor.
1386 * src/frontends/xforms/FormCitation.C:
1387 * src/frontends/xforms/FormCommand.C:
1388 * src/frontends/xforms/FormCopyright.C:
1389 * src/frontends/xforms/FormDocument.C:
1390 * src/frontends/xforms/FormError.C:
1391 * src/frontends/xforms/FormIndex.C:
1392 * src/frontends/xforms/FormPreferences.C:
1393 * src/frontends/xforms/FormPrint.C:
1394 * src/frontends/xforms/FormRef.C:
1395 * src/frontends/xforms/FormToc.C:
1396 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
1399 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
1400 ChangedBufferAction enum.
1402 * src/frontends/xforms/FormParagraph.[Ch]
1403 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
1406 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1408 * lib/bind/cua.bind: fix a bit.
1409 * lib/bind/emacs.bind: ditto.
1411 * lib/bind/menus.bind: remove real menu entries from there.
1413 * src/spellchecker.C: make sure we only include strings.h when
1416 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1418 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
1419 function. It enlarges the maximum number of pup when needed.
1420 (add_toc2): Open a new menu if maximum number of items per menu has
1423 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
1425 * src/frontends/kde/FormPrint.C: fix error reporting
1427 * src/frontends/xforms/FormDocument.C: fix compiler
1430 * lib/.cvsignore: add Literate.nw
1432 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1435 * bufferview_funcs.[Ch]
1438 * text2.C: Add support for numbers in RTL text.
1440 2000-10-06 Allan Rae <rae@lyx.org>
1442 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
1443 to be gettext.m4 friendly again. ext_l10n.h is now
1444 generated into $top_srcdir instead of $top_builddir
1445 so that lyx.pot will be built correctly -- without
1446 duplicate parsing of ext_l10n.h.
1448 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1450 * src/frontends/kde/FormCitation.C: make the dialog
1451 behave more sensibly
1453 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
1455 * config/kde.m4: fix consecutive ./configure runs,
1456 look for qtarch, fix library order
1458 * src/frontends/kde/Makefile.am: tidy up,
1459 add Print dialog, add .dlg dependencies
1461 * src/frontends/kde/FormPrint.C:
1462 * src/frontends/kde/FormPrint.h:
1463 * src/frontends/kde/formprintdialog.C:
1464 * src/frontends/kde/formprintdialog.h:
1465 * src/frontends/kde/formprintdialogdata.C:
1466 * src/frontends/kde/formprintdialogdata.h:
1467 * src/frontends/kde/dlg/formprintdialog.dlg: add
1470 * src/frontends/kde/dlg/README: Added explanatory readme
1472 * src/frontends/kde/dlg/checkinitorder.pl: small perl
1473 script to double-check qtarch's output
1475 * src/frontends/kde/formindexdialog.C:
1476 * src/frontends/kde/formindexdialogdata.C:
1477 * src/frontends/kde/formindexdialogdata.h:
1478 * src/frontends/kde/dlg/formindexdialog.dlg: update
1479 for qtarch, minor fixes
1481 2000-10-05 Allan Rae <rae@lyx.org>
1483 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
1484 dialogs when switching buffers update them instead. It's up to each
1485 dialog to decide if it should still be visible or not.
1486 update() should return a bool to control visiblity within show().
1487 Or perhaps better to set a member variable and use that to control
1490 * lib/build-listerrors: create an empty "listerrors" file just to stop
1491 make trying to regenerate it all the time if you don't have noweb
1494 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
1496 * po/Makefile.in.in (ext_l10n.h): added a rule to build
1497 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
1498 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
1499 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
1500 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
1502 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
1504 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
1506 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
1507 deleting buffer. Closes all buffer-dependent dialogs.
1509 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
1511 * src/frontends/xforms/FormCitation.[Ch]:
1512 * src/frontends/xforms/FormPreferences.[Ch]:
1513 * src/frontends/xforms/FormPrint.[Ch]:
1514 * src/frontends/xforms/FormRef.[Ch]:
1515 * src/frontends/xforms/FormUrl.[Ch]: ditto
1517 * src/frontends/xforms/FormDocument.[Ch]:
1518 * src/frontends/xforms/forms/form_document.C.patch:
1519 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
1520 pass through a single input() function.
1522 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1524 * lib/build-listerrors: return status as OK
1526 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
1528 * lib/lyxrc.example: Updated to new export code
1530 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1532 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
1535 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
1538 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
1539 LyX-Code is defined.
1540 * lib/layouts/amsbook.layout: ditto.
1542 * boost/Makefile.am: fix typo.
1544 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
1546 (add_lastfiles): removed.
1547 (add_documents): removed.
1548 (add_formats): removed.
1550 * src/frontends/Menubar.C: remove useless "using" directive.
1552 * src/MenuBackend.h: add a new MenuItem constructor.
1554 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
1557 2000-10-04 Allan Rae <rae@lyx.org>
1559 * lib/Makefile.am (listerrors):
1560 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
1561 I haven't got notangle installed so Kayvan please test. The output
1562 should end up in $builddir. This also allows people who don't have
1563 noweb installed to complete the make process without error.
1565 * src/frontends/xforms/FormCommand.[Ch] (showInset):
1566 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
1567 by JMarc's picky compiler.
1569 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1572 * src/insets/insettabular.C (setPos): change for loop to not use
1573 sequencing operator. Please check this Jürgen.
1575 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
1577 * src/insets/insetcite.C (getScreenLabel): ditto
1578 * src/support/filetools.C (QuoteName): ditto
1579 (ChangeExtension): ditto
1581 * src/BufferView_pimpl.C (scrollCB): make heigt int
1583 * src/BufferView2.C (insertInset): comment out unused arg
1585 * boost/Makefile.am (EXTRADIST): new variable
1587 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1589 * src/exporter.C (IsExportable): Fixed
1591 * lib/configure.m4: Small fix
1593 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1595 * src/insets/insetbutton.C (width): Changed to work with no GUI.
1596 * src/insets/insetbib.C (bibitemWidest): ditto.
1597 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
1599 2000-10-03 Juergen Vigna <jug@sad.it>
1601 * src/BufferView2.C (theLockingInset): removed const because of
1602 Agnus's compile problems.
1604 * src/insets/insettext.C (LocalDispatch): set the language of the
1605 surronding paragraph on inserting the first character.
1607 * various files: changed use of BufferView::the_locking_inset.
1609 * src/BufferView2.C (theLockingInset):
1610 (theLockingInset): new functions.
1612 * src/BufferView.h: removed the_locking_inset.
1614 * src/lyxtext.h: added the_locking_inset
1616 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
1618 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
1620 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1622 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
1623 * src/mathed/math_cursor.C (IsAlpha): ditto.
1624 * src/mathed/math_inset.C (strnew): ditto.
1625 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
1626 (IMetrics): cxp set but never used; removed.
1627 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
1628 that the variable in question has been removed also!
1631 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
1632 using the Buffer * passed to Latex(), using the BufferView * passed to
1633 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
1635 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
1636 Linuxdoc() and DocBook() rather than the stored Buffer * master.
1638 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
1639 * src/buffer.C (readInset): used new InsetBibtex c-tor
1640 * (getBibkeyList): used new InsetBibtex::getKeys
1642 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1645 * lib/build-listerrors
1647 * src/exporter.C: Add literate programming support to the export code
1650 * src/lyx_cb.C: Remove old literate code.
1652 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
1655 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
1656 * src/converter.C (View, Convert): Use QuoteName.
1658 * src/insets/figinset.C (Preview): Use Formats::View.
1660 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
1662 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1664 * src/lyxfunc.C (Dispatch): move declaration of text variable at
1665 the top of the function, because compaq cxx complains that the
1666 "goto exit_with_message" when the function is disabled bypasses
1668 (MenuNew): try a better fix for the generation of new file names.
1669 This time, I used AddName() instead of AddPath(), hoping Juergen
1672 2000-10-03 Allan Rae <rae@lyx.org>
1674 * src/frontends/xforms/forms/form_preferences.fd:
1675 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
1676 nested tabfolders has begun. The old "Miscellaneous" was renamed as
1677 "Look and Feel"->"General" but will need to be split up further into
1678 general output and general input tabs. Current plan is for four outer
1679 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
1680 stuff; "Inputs" for input and import configuration; "Outputs" for
1681 output and export configuration; and one more whatever is left over
1682 called "General". The leftovers at present look like being which
1683 viewers to use, spellchecker, language support and might be better
1684 named "Support". I've put "Paths" in "Inputs" for the moment as this
1685 seems reasonable for now at least.
1686 One problem remains: X error kills LyX when you close Preferences.
1688 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1690 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
1691 qualifier from form()
1692 * src/frontends/xforms/FormCitation.[Ch]:
1693 * src/frontends/xforms/FormCopyright.[Ch]:
1694 * src/frontends/xforms/FormDocument.[Ch]:
1695 * src/frontends/xforms/FormError.[Ch]:
1696 * src/frontends/xforms/FormIndex.[Ch]:
1697 * src/frontends/xforms/FormPreferences.[Ch]:
1698 * src/frontends/xforms/FormPrint.[Ch]:
1699 * src/frontends/xforms/FormRef.[Ch]:
1700 * src/frontends/xforms/FormToc.[Ch]:
1701 * src/frontends/xforms/FormUrl.[Ch]: ditto.
1703 * src/frontends/xforms/FormCitation.[Ch]:
1704 * src/frontends/xforms/FormIndex.[Ch]:
1705 * src/frontends/xforms/FormRef.[Ch]:
1706 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
1707 with Allan's naming policy
1709 * src/frontends/xforms/FormCitation.C: some static casts to remove
1712 2000-10-02 Juergen Vigna <jug@sad.it>
1714 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
1715 now you can type or do stuff inside the table-cell also when in dummy
1716 position, fixed visible cursor.
1718 * src/insets/insettext.C (Edit): fixing cursor-view position.
1720 * src/lyxfunc.C (Dispatch): use * text variable so that it can
1721 be used for equal functions in lyxfunc and insettext.
1723 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
1725 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
1727 * src/frontends/gnome/FormCitation.h:
1728 * src/frontends/gnome/FormCopyright.h:
1729 * src/frontends/gnome/FormIndex.h:
1730 * src/frontends/gnome/FormPrint.h:
1731 * src/frontends/gnome/FormToc.h:
1732 * src/frontends/gnome/FormUrl.h:
1733 * src/frontends/kde/FormCitation.h:
1734 * src/frontends/kde/FormCopyright.h:
1735 * src/frontends/kde/FormIndex.h:
1736 * src/frontends/kde/FormRef.h:
1737 * src/frontends/kde/FormToc.h:
1738 * src/frontends/kde/FormUrl.h: fix remaining users of
1741 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1743 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
1744 from depth argument.
1745 (DocBookHandleCaption): ditto.
1746 (DocBookHandleFootnote): ditto.
1747 (SimpleDocBookOnePar): ditto.
1749 * src/frontends/xforms/FormDocument.h (form): remove extra
1750 FormDocument:: qualifier.
1752 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
1754 * sigc++/handle.h: ditto.
1756 * src/lyx_gui_misc.C: add "using" directive.
1758 * src/cheaders/cstddef: new file, needed by the boost library (for
1761 2000-10-02 Juergen Vigna <jug@sad.it>
1763 * src/insets/insettext.C (SetFont): better support.
1765 * src/insets/insettabular.C (draw): fixed drawing of single cell.
1767 * src/screen.C (DrawOneRow): some uint refixes!
1769 2000-10-02 Allan Rae <rae@lyx.org>
1771 * boost/.cvsignore: ignore Makefile as well
1773 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
1774 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
1776 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
1777 Left this one out by accident.
1779 * src/frontends/xforms/FormBase.h (restore): default to calling
1780 update() since that will restore the original/currently-applied values.
1781 Any input() triggered error messages will require the derived classes
1782 to redefine restore().
1784 * src/frontends/xforms/FormDocument.C: initialize a few variables to
1785 avoid a segfault. combo_doc_class is the main concern.
1787 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
1789 * Simplify build-listerrors in view of GUI-less export ability!
1791 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1793 * src/lyx_main.C (easyParse): Disable gui when exporting
1795 * src/insets/figinset.C:
1798 * src/lyx_gui_misc.C
1799 * src/tabular.C: Changes to allow no-gui.
1801 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1803 * src/support/utility.hpp: removed file
1804 * src/support/block.h: removed file
1806 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
1809 * src/mathed/formula.C: add support/lyxlib.h
1810 * src/mathed/formulamacro.C: ditto
1812 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
1813 * src/lyxparagraph.h: ditto
1815 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
1816 * src/frontends/Makefile.am (INCLUDES): ditto
1817 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
1818 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
1819 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
1820 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
1821 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
1822 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
1824 * src/BufferView.h: use boost/utility.hpp
1825 * src/LColor.h: ditto
1826 * src/LaTeX.h: ditto
1827 * src/LyXAction.h: ditto
1828 * src/LyXView.h: ditto
1829 * src/bufferlist.h: ditto
1830 * src/lastfiles.h: ditto
1831 * src/layout.h: ditto
1832 * src/lyx_gui.h: ditto
1833 * src/lyx_main.h: ditto
1834 * src/lyxlex.h: ditto
1835 * src/lyxrc.h: ditto
1836 * src/frontends/ButtonPolicies.h: ditto
1837 * src/frontends/Dialogs.h: ditto
1838 * src/frontends/xforms/FormBase.h: ditto
1839 * src/frontends/xforms/FormGraphics.h: ditto
1840 * src/frontends/xforms/FormParagraph.h: ditto
1841 * src/frontends/xforms/FormTabular.h: ditto
1842 * src/graphics/GraphicsCache.h: ditto
1843 * src/graphics/Renderer.h: ditto
1844 * src/insets/ExternalTemplate.h: ditto
1845 * src/insets/insetcommand.h: ditto
1846 * src/support/path.h: ditto
1848 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
1849 and introduce clause for 2.97.
1851 * boost/libs/README: new file
1853 * boost/boost/utility.hpp: new file
1855 * boost/boost/config.hpp: new file
1857 * boost/boost/array.hpp: new file
1859 * boost/Makefile.am: new file
1861 * boost/.cvsignore: new file
1863 * configure.in (AC_OUTPUT): add boost/Makefile
1865 * Makefile.am (SUBDIRS): add boost
1867 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1869 * src/support/lstrings.C (suffixIs): Fixed.
1871 2000-10-01 Allan Rae <rae@lyx.org>
1873 * src/PrinterParams.h: moved things around to avoid the "can't
1874 inline call" warning.
1876 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
1877 into doc++ documentation.
1879 * src/frontends/xforms/FormCommand.[Ch]: support button policy
1881 * src/frontends/xforms/FormRef.C: make use of button controller
1882 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
1883 cleaned up button controller usage.
1884 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
1885 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
1886 use the button controller
1888 * src/frontends/xforms/forms/*.fd: and associated generated files
1889 updated to reflect changes to FormBase. Some other FormXxxx files
1890 also got minor updates to reflect changes to FormBase.
1892 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
1893 (hide): made virtual.
1894 (input): return a bool. true == valid input
1895 (RestoreCB, restore): new
1896 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
1897 Changes to allow derived dialogs to use a ButtonController and
1898 make sense when doing so: OK button calls ok() and so on.
1900 * src/frontends/xforms/ButtonController.h (class ButtonController):
1901 Switch from template implementation to taking Policy parameter.
1902 Allows FormBase to provide a ButtonController for any dialog.
1904 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
1905 Probably should rename connect and disconnect.
1906 (apply): use the radio button groups
1907 (form): needed by FormBase
1908 (build): setup the radio button groups
1910 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
1912 * several files: type changes to reduce the number of warnings and
1913 to unify type hangling a bit. Still much to do.
1915 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1917 * lib/images/*: rename a bunch of icons to match Dekel converter
1920 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
1923 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
1925 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
1927 * sigc++/handle.h: ditto for class Handle.
1929 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
1931 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
1933 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
1935 * src/intl.C (InitKeyMapper): Correct the value of n due to the
1936 removal of the "default" language.
1938 * src/combox.h (getline): Check that sel > 0
1940 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
1942 * lib/examples/docbook_example.lyx
1943 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
1945 * lib/layouts/docbook-book.layout: new docbook book layout.
1947 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
1949 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
1951 * src/insets/figinset.C (DocBook):fixed small typo.
1953 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
1955 * src/insets/insetinclude.h: string include_label doesn't need to be
1958 2000-09-29 Allan Rae <rae@lyx.org>
1960 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
1961 Allow derived type to control connection and disconnection from signals
1962 of its choice if desired.
1964 2000-09-28 Juergen Vigna <jug@sad.it>
1966 * src/insets/insettabular.C (update): fixed cursor setting when
1967 the_locking_inset changed.
1968 (draw): made this a bit cleaner.
1969 (InsetButtonPress): fixed!
1971 * various files: added LyXText Parameter to fitCursor call.
1973 * src/BufferView.C (fitCursor): added LyXText parameter.
1975 * src/insets/insettabular.C (draw): small draw fix.
1977 * src/tabular.C: right setting of left/right celllines.
1979 * src/tabular.[Ch]: fixed various types in funcions and structures.
1980 * src/insets/insettabular.C: ditto
1981 * src/frontends/xforms/FormTabular.C: ditto
1983 2000-09-28 Allan Rae <rae@lyx.org>
1985 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
1986 that the #ifdef's had been applied to part of what should have been
1987 a complete condition. It's possible there are other tests that
1988 were specific to tables that are also wrong now that InsetTabular is
1989 being used. Now we need to fix the output of '\n' after a table in a
1990 float for the same reason as the original condition:
1991 "don't insert this if we would be adding it before or after a table
1992 in a float. This little trick is needed in order to allow use of
1993 tables in \subfigures or \subtables."
1994 Juergen can you check this?
1996 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1998 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
1999 output to the ostream.
2001 * several files: fixed types based on warnings from cxx
2003 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
2005 * src/frontends/kde/Makefile.am: fix rule for
2006 formindexdialogdata_moc.C
2008 * src/.cvsignore: add ext_l10n.h to ignore
2010 * acconfig.h: stop messing with __STRICT_ANSI__
2011 * config/gnome.m4: remove option to set -ansi
2012 * config/kde.m4: remove option to set -ansi
2013 * config/lyxinclude.m4: don't set -ansi
2015 2000-09-27 Juergen Vigna <jug@sad.it>
2017 * various files: remove "default" language check.
2019 * src/insets/insetquotes.C: removed use of current_view.
2021 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
2022 the one should have red ears by now!
2024 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
2025 in more then one paragraph. Fixed cursor-movement/selection.
2027 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
2028 paragraphs inside a text inset.
2030 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
2031 text-inset if this owner is an inset.
2033 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2035 * src/Bullet.h: changed type of font, character and size to int
2037 * src/buffer.C (asciiParagraph): remove actcell and fname1.
2039 * src/insets/inseturl.[Ch]:
2040 * src/insets/insetref.[Ch]:
2041 * src/insets/insetlabel.[Ch]: add linelen to Ascii
2043 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
2045 * src/buffer.C (readFile): block-if statement rearranged to minimise
2046 bloat. Patch does not reverse Jean-Marc's change ;-)
2048 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
2049 Class rewritten to store pointers to hide/update signals directly,
2050 rather than Dialogs *. Also defined an enum to ease use. All xforms
2051 forms can now be derived from this class.
2053 * src/frontends/xforms/FormCommand.[Ch]
2054 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
2056 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
2059 * src/frontends/xforms/forms/form_citation.fd
2060 * src/frontends/xforms/forms/form_copyright.fd
2061 * src/frontends/xforms/forms/form_error.fd
2062 * src/frontends/xforms/forms/form_index.fd
2063 * src/frontends/xforms/forms/form_ref.fd
2064 * src/frontends/xforms/forms/form_toc.fd
2065 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
2067 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
2069 * src/insets/insetfoot.C: removed redundent using directive.
2071 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2073 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
2074 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
2076 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
2077 created in the constructors in different groups. Then set() just
2078 have to show the groups as needed. This fixes the redraw problems
2079 (and is how the old menu code worked).
2081 * src/support/lyxlib.h: declare the methods as static when we do
2082 not have namespaces.
2084 2000-09-26 Juergen Vigna <jug@sad.it>
2086 * src/buffer.C (asciiParagraph): new function.
2087 (writeFileAscii): new function with parameter ostream.
2088 (writeFileAscii): use now asciiParagraph.
2090 * various inset files: added the linelen parameter to the Ascii-func.
2092 * src/tabular.C (Write): fixed error in writing file introduced by
2093 the last changes from Lars.
2095 * lib/bind/menus.bind: removed not supported functions.
2097 * src/insets/insettext.C (Ascii): implemented this function.
2099 * src/insets/lyxinset.h (Ascii): added linelen parameter.
2101 * src/tabular.C (write_attribute[int,string,bool]): new functions.
2102 (Write): use of the write_attribute functions.
2104 * src/bufferlist.C (close): fixed reasking question!
2106 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2108 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
2109 new files use the everwhere possible.
2112 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
2113 src/log_form.C src/lyx.C:
2116 * src/buffer.C (runLaTeX): remove func
2118 * src/PaperLayout.C: removed file
2119 * src/ParagraphExtra.C: likewise
2120 * src/bullet_forms.C: likewise
2121 * src/bullet_forms.h: likewise
2122 * src/bullet_forms_cb.C: likewise
2124 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
2125 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
2128 * several files: remove all traces of the old fd_form_paragraph,
2129 and functions belonging to that.
2131 * several files: remove all traces of the old fd_form_document,
2132 and functions belonging to that.
2134 * several files: constify local variables were possible.
2136 * several files: remove all code that was dead when NEW_EXPORT was
2139 * several files: removed string::c_str in as many places as
2142 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
2143 (e): be a bit more outspoken when patching
2144 (updatesrc): only move files if changed.
2146 * forms/layout_forms.h.patch: regenerated
2148 * forms/layout_forms.fd: remove form_document and form_paragraph
2149 and form_quotes and form_paper and form_table_options and
2150 form_paragraph_extra
2152 * forms/form1.fd: remove form_table
2154 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
2155 the fdui->... rewrite. Update some comments to xforms 0.88
2157 * forms/bullet_forms.C.patch: removed file
2158 * forms/bullet_forms.fd: likewise
2159 * forms/bullet_forms.h.patch: likewise
2161 * development/Code_rules/Rules: added a section on switch
2162 statements. Updated some comment to xforms 0.88.
2164 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2166 * src/buffer.C (readFile): make sure that the whole version number
2167 is read after \lyxformat (even when it contains a comma)
2169 * lib/ui/default.ui: change shortcut of math menu to M-a.
2171 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2173 * src/vspace.C (nextToken): use isStrDbl() to check for proper
2176 * src/LyXView.C (updateWindowTitle): show the full files name in
2177 window title, limited to 30 characters.
2179 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
2180 When a number of characters has been given, we should not assume
2181 that the string is 0-terminated.
2183 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
2184 calls (fixes some memory leaks)
2186 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
2187 trans member on exit.
2189 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2191 * src/converter.C (GetReachable): fix typo.
2193 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
2194 understand ',' instead of '.'.
2195 (GetInteger): rewrite to use strToInt().
2197 2000-09-26 Juergen Vigna <jug@sad.it>
2199 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
2200 better visibility and error-message on wrong VSpace input.
2202 * src/language.C (initL): added english again.
2204 2000-09-25 Juergen Vigna <jug@sad.it>
2206 * src/frontends/kde/Dialogs.C (Dialogs):
2207 * src/frontends/gnome/Dialogs.C (Dialogs):
2208 * src/frontends/kde/Makefile.am:
2209 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
2211 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
2213 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
2215 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
2217 * src/frontends/xforms/FormParagraph.C:
2218 * src/frontends/xforms/FormParagraph.h:
2219 * src/frontends/xforms/form_paragraph.C:
2220 * src/frontends/xforms/form_paragraph.h:
2221 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
2224 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
2226 * src/tabular.C (OldFormatRead): forgot to delete the temporary
2227 Paragraph-Data after use.
2229 * src/insets/insettext.C (LocalDispatch): don't set the layout on
2230 non breakable paragraphs.
2232 2000-09-25 Garst R. Reese <reese@isn.net>
2234 * src/language.C (initL): added missing language_country codes.
2236 2000-09-25 Juergen Vigna <jug@sad.it>
2238 * src/insets/insettext.C (InsetText):
2239 (deleteLyXText): remove the not released LyXText structure!
2241 2000-09-24 Marko Vendelin <markov@ioc.ee>
2243 * src/frontends/gnome/mainapp.C
2244 * src/frontends/gnome/mainapp.h: added support for keyboard
2247 * src/frontends/gnome/FormCitation.C
2248 * src/frontends/gnome/FormCitation.h
2249 * src/frontends/gnome/Makefile.am
2250 * src/frontends/gnome/pixbutton.h: completed the rewrite of
2251 FormCitation to use "action area" in mainapp window
2253 * src/frontends/gnome/Menubar_pimpl.C
2254 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
2257 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
2259 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
2260 width/descent/ascent values if name is empty.
2261 (mathed_string_height): Use std::max.
2263 2000-09-25 Allan Rae <rae@lyx.org>
2265 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
2266 segfault. This will be completely redesigned soon.
2268 * sigc++: updated libsigc++. Fixes struct timespec bug.
2270 * development/tools/makeLyXsigc.sh: .cvsignore addition
2272 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
2274 * several files: removed almost all traces of the old table
2277 * src/TableLayout.C: removed file
2279 2000-09-22 Juergen Vigna <jug@sad.it>
2281 * src/frontends/kde/Dialogs.C: added credits forms.
2283 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
2285 * src/frontends/gnome/Dialogs.C: added some forms.
2287 * src/spellchecker.C (init_spell_checker): set language in pspell code
2288 (RunSpellChecker): some modifications for setting language string.
2290 * src/language.[Ch]: added language_country code.
2292 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
2294 * src/frontends/Dialogs.h: added new signal showError.
2295 Rearranged existing signals in some sort of alphabetical order.
2297 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
2298 FormError.[Ch], form_error.[Ch]
2299 * src/frontends/xforms/forms/makefile: added new file form_error.fd
2300 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
2302 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
2303 dialogs. I think that this can be used as the base to all these
2306 * src/frontends/xforms/FormError.[Ch]
2307 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
2308 implementation of InsetError dialog.
2310 * src/insets/inseterror.[Ch]: rendered GUI-independent.
2312 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
2313 * src/frontends/kde/Makefile.am: ditto
2315 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
2317 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
2318 macrobf. This fixes a bug of invisible text.
2320 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2322 * lib/doc/LaTeXConfig.lyx.in: updated.
2324 * src/language.C (initL): remove language "francais" and change a
2325 bit the names of the two other french variations.
2327 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
2328 string that may not be 0-terminated.
2330 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2332 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
2334 2000-09-20 Marko Vendelin <markov@ioc.ee>
2336 * src/frontends/gnome/FormCitation.C
2337 * src/frontends/gnome/FormIndex.C
2338 * src/frontends/gnome/FormToc.C
2339 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
2340 the variable initialization to shut up the warnings
2342 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2344 * src/table.[Ch]: deleted files
2346 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
2349 2000-09-18 Juergen Vigna <jug@sad.it>
2351 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
2352 problems with selection. Inserted new LFUN_PASTESELECTION.
2353 (InsetButtonPress): inserted handling of middle mouse-button paste.
2355 * src/spellchecker.C: changed word to word.c_str().
2357 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
2359 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
2360 included in the ``make dist'' tarball.
2362 2000-09-15 Juergen Vigna <jug@sad.it>
2364 * src/CutAndPaste.C (cutSelection): small fix return the right
2365 end position after cut inside one paragraph only.
2367 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
2368 we are locked as otherwise we don't have a valid cursor position!
2370 * src/insets/figinset.C (draw): small bugfix but why is this needed???
2372 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
2374 * src/frontends/kde/FormRef.C: added using directive.
2375 * src/frontends/kde/FormToc.C: ditto
2377 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
2379 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
2381 2000-09-19 Marko Vendelin <markov@ioc.ee>
2383 * src/frontends/gnome/Menubar_pimpl.C
2384 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
2385 Toc, ViewFormats, UpdateFormats, and ExportFormats.
2387 * src/frontends/gnome/mainapp.C
2388 * src/frontends/gnome/mainapp.h: support for menu update used
2391 * src/frontends/gnome/mainapp.C
2392 * src/frontends/gnome/mainapp.h: support for "action" area in the
2393 main window. This area is used by small simple dialogs, such as
2396 * src/frontends/gnome/FormIndex.C
2397 * src/frontends/gnome/FormIndex.h
2398 * src/frontends/gnome/FormUrl.C
2399 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
2402 * src/frontends/gnome/FormCitation.C
2403 * src/frontends/gnome/FormCitation.h: rewrite to use main window
2404 action area. Only "Insert new citation" is implemented.
2406 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2408 * src/buffer.C (Dispatch): fix call to Dispatch
2409 * src/insets/insetref.C (Edit): likewise
2410 * src/insets/insetparent.C (Edit): likewise
2411 * src/insets/insetinclude.C (include_cb): likewise
2412 * src/frontends/xforms/FormUrl.C (apply): likewise
2413 * src/frontends/xforms/FormToc.C (apply): likewise
2414 * src/frontends/xforms/FormRef.C (apply): likewise
2415 * src/frontends/xforms/FormIndex.C (apply): likewise
2416 * src/frontends/xforms/FormCitation.C (apply): likewise
2417 * src/lyxserver.C (callback): likewise
2418 * src/lyxfunc.C (processKeySym): likewise
2419 (Dispatch): likewise
2420 (Dispatch): likewise
2421 * src/lyx_cb.C (LayoutsCB): likewise
2423 * Makefile.am (sourcedoc): small change
2425 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2427 * src/main.C (main): Don't make an empty GUIRunTime object. all
2428 methods are static. constify a bit remove unneded using + headers.
2430 * src/tabular.C: some more const to local vars move some loop vars
2432 * src/spellchecker.C: added some c_str after some word for pspell
2434 * src/frontends/GUIRunTime.h: add new static method setDefaults
2435 * src/frontends/xforms/GUIRunTime.C (setDefaults):
2436 * src/frontends/kde/GUIRunTime.C (setDefaults):
2437 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
2439 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
2440 with strnew in arg, use correct emptystring when calling SetName.
2442 * several files: remove all commented code with relation to
2443 HAVE_SSTREAM beeing false. We now only support stringstream and
2446 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2448 * src/lyxfunc.C: construct correctly the automatic new file
2451 * src/text2.C (IsStringInText): change type of variable i to shut
2454 * src/support/sstream.h: do not use namespaces if the compiler
2455 does not support them.
2457 2000-09-15 Marko Vendelin <markov@ioc.ee>
2458 * src/frontends/gnome/FormCitation.C
2459 * src/frontends/gnome/FormCitation.h
2460 * src/frontends/gnome/diainsertcitation_interface.c
2461 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
2462 regexp support to FormCitation [Gnome].
2464 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
2467 * configure.in: remove unused KDE/GTKGUI define
2469 * src/frontends/kde/FormRef.C
2470 * src/frontends/kde/FormRef.h
2471 * src/frontends/kde/formrefdialog.C
2472 * src/frontends/kde/formrefdialog.h: double click will
2473 go to reference, now it is possible to change a cross-ref
2476 * src/frontends/kde/FormToc.C
2477 * src/frontends/kde/FormToc.h
2478 * src/frontends/kde/formtocdialog.C
2479 * src/frontends/kde/formtocdialog.h: add a depth
2482 * src/frontends/kde/Makefile.am: add QtLyXView.h
2485 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
2487 * src/frontends/kde/FormCitation.h: added some using directives.
2489 * src/frontends/kde/FormToc.h: corrected definition of doTree.
2491 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
2494 * src/mathed/math_defs.h: redefine SetAlign to use string rather
2497 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2499 * src/buffer.C (pop_tag): revert for the second time a change by
2500 Lars, who seems to really hate having non-local loop variables :)
2502 * src/Lsstream.h: add "using" statements.
2504 * src/support/copy.C (copy): add a bunch of std:: qualifiers
2505 * src/buffer.C (writeFile): ditto
2507 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2509 * src/buffer.C (writeFile): try to fix the locale modified format
2510 number to always be as we want it.
2512 * src/WorkArea.C (work_area_handler): try to workaround the bugs
2513 in XForms 0.89. C-space is now working again.
2515 * src/Lsstream.h src/support/sstream.h: new files.
2517 * also commented out all cases where strstream were used.
2519 * src/Bullet.h (c_str): remove method.
2521 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
2523 * a lot of files: get rid of "char const *" and "char *" is as
2524 many places as possible. We only want to use them in interaction
2525 with system of other libraries, not inside lyx.
2527 * a lot of files: return const object is not of pod type. This
2528 helps ensure that temporary objects is not modified. And fits well
2529 with "programming by contract".
2531 * configure.in: check for the locale header too
2533 * Makefile.am (sourcedoc): new tag for generation of doc++
2536 2000-09-14 Juergen Vigna <jug@sad.it>
2538 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
2539 callback to check which combo called it and do the right action.
2541 * src/combox.C (combo_cb): added combo * to the callbacks.
2542 (Hide): moved call of callback after Ungrab of the pointer.
2544 * src/intl.h: removed LCombo2 function.
2546 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
2547 function as this can now be handled in one function.
2549 * src/combox.h: added Combox * to callback prototype.
2551 * src/frontends/xforms/Toolbar_pimpl.C:
2552 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
2554 2000-09-14 Garst Reese <reese@isn.net>
2556 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
2557 moved usepackage{xxx}'s to beginning of file. Changed left margin
2558 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
2559 underlining from title. Thanks to John Culleton for useful suggestions.
2561 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2563 * src/lyxlex_pimpl.C (setFile): change error message to debug
2566 2000-09-13 Juergen Vigna <jug@sad.it>
2568 * src/frontends/xforms/FormDocument.C: implemented choice_class
2569 as combox and give callback to combo_language so OK/Apply is activated
2572 * src/bufferlist.C (newFile): small fix so already named files
2573 (via an open call) are not requested to be named again on the
2576 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2578 * src/frontends/kde/Makefile.am
2579 * src/frontends/kde/FormRef.C
2580 * src/frontends/kde/FormRef.h
2581 * src/frontends/kde/formrefdialog.C
2582 * src/frontends/kde/formrefdialog.h: implement
2585 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2587 * src/frontends/kde/formtocdialog.C
2588 * src/frontends/kde/formtocdialog.h
2589 * src/frontends/kde/FormToc.C
2590 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
2592 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
2594 * src/frontends/kde/FormCitation.C: fix thinko
2595 where we didn't always display the reference text
2598 * src/frontends/kde/formurldialog.C
2599 * src/frontends/kde/formurldialog.h
2600 * src/frontends/kde/FormUrl.C
2601 * src/frontends/kde/FormUrl.h: minor cleanups
2603 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
2605 * src/frontends/kde/Makefile.am
2606 * src/frontends/kde/FormToc.C
2607 * src/frontends/kde/FormToc.h
2608 * src/frontends/kde/FormCitation.C
2609 * src/frontends/kde/FormCitation.h
2610 * src/frontends/kde/FormIndex.C
2611 * src/frontends/kde/FormIndex.h
2612 * src/frontends/kde/formtocdialog.C
2613 * src/frontends/kde/formtocdialog.h
2614 * src/frontends/kde/formcitationdialog.C
2615 * src/frontends/kde/formcitationdialog.h
2616 * src/frontends/kde/formindexdialog.C
2617 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
2619 2000-09-12 Juergen Vigna <jug@sad.it>
2621 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
2624 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2626 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
2629 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
2631 * src/converter.C (Add, Convert): Added support for converter flags:
2632 needaux, resultdir, resultfile.
2633 (Convert): Added new parameter view_file.
2634 (dvips_options): Fixed letter paper option.
2636 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
2637 (Export, GetExportableFormats, GetViewableFormats): Added support
2640 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
2642 (easyParse): Fixed to work with new export code.
2644 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
2647 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
2649 * lib/bind/*.bind: Replaced
2650 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
2651 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
2653 2000-09-11 Juergen Vigna <jug@sad.it>
2655 * src/lyx_gui.C (runTime): uses global guiruntime variable.
2657 * src/main.C (main): now GUII defines global guiruntime!
2659 * src/frontends/gnome/GUIRunTime.C (initApplication):
2660 * src/frontends/kde/GUIRunTime.C (initApplication):
2661 * src/frontends/xforms/GUIRunTime.C (initApplication):
2662 * src/frontends/GUIRunTime.h: added new function initApplication.
2664 * src/spellchecker.C (sc_accept_word): change to add_to_session.
2666 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
2668 2000-09-08 Juergen Vigna <jug@sad.it>
2670 * src/lyx_gui.C (create_forms): don't display the "default" entry as
2671 we have already "Reset".
2673 * src/language.C (initL): inserted "default" language and made this
2674 THE default language (and not american!)
2676 * src/paragraph.C: inserted handling of "default" language!
2678 * src/lyxfont.C: ditto
2682 * src/paragraph.C: output the \\par only if we have a following
2683 paragraph otherwise it's not needed.
2685 2000-09-05 Juergen Vigna <jug@sad.it>
2687 * config/pspell.m4: added entry to lyx-flags
2689 * src/spellchecker.C: modified version from Kevin for using pspell
2691 2000-09-01 Marko Vendelin <markov@ioc.ee>
2692 * src/frontends/gnome/Makefile.am
2693 * src/frontends/gnome/FormCitation.C
2694 * src/frontends/gnome/FormCitation.h
2695 * src/frontends/gnome/diainsertcitation_callbacks.c
2696 * src/frontends/gnome/diainsertcitation_callbacks.h
2697 * src/frontends/gnome/diainsertcitation_interface.c
2698 * src/frontends/gnome/diainsertcitation_interface.h
2699 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
2700 dialog for Gnome frontend
2702 * src/main.C: Gnome libraries require keeping application name
2703 and its version as strings
2705 * src/frontends/gnome/mainapp.C: Change the name of the main window
2706 from GnomeLyX to PACKAGE
2708 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2710 * src/frontends/Liason.C: add "using: declaration.
2712 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
2714 * src/mathed/math_macro.C (Metrics): Set the size of the template
2716 * src/mathed/formulamacro.C (Latex): Fixed the returned value
2718 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
2720 * src/converter.C (add_options): New function.
2721 (SetViewer): Change $$FName into '$$FName'.
2722 (View): Add options when running xdvi
2723 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
2724 (Convert): The 3rd parameter is now the desired filename. Converts
2725 calls to lyx::rename if necessary.
2726 Add options when running dvips.
2727 (dvi_papersize,dvips_options): New methods.
2729 * src/exporter.C (Export): Use getLatexName() instead of fileName().
2731 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
2732 using a call to Converter::dvips_options.
2733 Fixed to work with nex export code.
2735 * src/support/copy.C
2736 * src/support/rename.C: New files
2738 * src/support/syscall.h
2739 * src/support/syscall.C: Added Starttype SystemDontWait.
2741 * lib/ui/default.ui: Changed to work with new export code
2743 * lib/configure.m4: Changed to work with new export code
2745 * src/encoding.C: Changed latex name for iso8859_7 encoding.
2747 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
2749 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
2750 so that code compiles with DEC cxx.
2752 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
2753 to work correctly! Also now supports the additional elements
2756 2000-09-01 Allan Rae <rae@lyx.org>
2758 * src/frontends/ButtonPolicies.C: renamed all the references to
2759 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
2761 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
2762 since it's a const not a type.
2764 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
2766 2000-08-31 Juergen Vigna <jug@sad.it>
2768 * src/insets/figinset.C: Various changes to look if the filename has
2769 an extension and if not add it for inline previewing.
2771 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2773 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
2774 make buttonStatus and isReadOnly be const methods. (also reflect
2775 this in derived classes.)
2777 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
2778 (nextState): change to be static inline, pass the StateMachine as
2780 (PreferencesPolicy): remove casts
2781 (OkCancelPolicy): remvoe casts
2782 (OkCancelReadOnlyPolicy): remove casts
2783 (NoRepeatedApplyReadOnlyPolicy): remove casts
2784 (OkApplyCancelReadOnlyPolicy): remove casts
2785 (OkApplyCancelPolicy): remove casts
2786 (NoRepeatedApplyPolicy): remove casts
2788 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
2790 * src/converter.C: added some using directives
2792 * src/frontends/ButtonPolicies.C: changes to overcome
2793 "need lvalue" error with DEC c++
2795 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
2796 to WMHideCB for DEC c++
2798 * src/frontends/xforms/Menubar_pimpl.C: added using directive
2800 * src/frontends/xforms/forms/form_document.C.patch: use C callback
2801 to BulletBMTableCB for DEC c++
2803 2000-08-31 Allan Rae <rae@lyx.org>
2805 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
2806 character dialog separately from old document dialogs combo_language.
2809 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2811 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
2812 Removed LFUN_REF_CREATE.
2814 * src/MenuBackend.C: Added new tags: toc and references
2816 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
2817 (add_lastfiles, add_documents, add_formats): Removed the unused smn
2819 (add_toc, add_references): New methods.
2820 (create_submenu): Handle correctly the case when there is a
2821 seperator after optional menu items.
2823 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
2824 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
2825 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
2827 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
2829 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2831 * src/converter.[Ch]: New file for converting between different
2834 * src/export.[Ch]: New file for exporting a LyX file to different
2837 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
2838 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
2839 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
2840 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
2841 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
2842 RunDocBook, MenuExport.
2844 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
2845 Exporter::Preview methods if NEW_EXPORT is defined.
2847 * src/buffer.C (Dispatch): Use Exporter::Export.
2849 * src/lyxrc.C: Added new tags: \converter and \viewer.
2852 * src/LyXAction.C: Define new lyx-function: buffer-update.
2853 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
2854 when NEW_EXPORT is defined.
2856 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
2858 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
2860 * lib/ui/default.ui: Added submenus "view" and "update" to the
2863 * src/filetools.C (GetExtension): New function.
2865 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
2867 2000-08-29 Allan Rae <rae@lyx.org>
2869 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
2871 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
2872 (EnableDocumentLayout): removed
2873 (DisableDocumentLayout): removed
2874 (build): make use of ButtonController's read-only handling to
2875 de/activate various objects. Replaces both of the above functions.
2877 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
2878 (readOnly): was read_only
2879 (refresh): fixed dumb mistakes with read_only_ handling
2881 * src/frontends/xforms/forms/form_document.fd:
2882 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
2883 tabbed dialogs so the tabs look more like tabs and so its easier to
2884 work out which is the current tab.
2886 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
2887 segfault with form_table
2889 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
2891 2000-08-28 Juergen Vigna <jug@sad.it>
2893 * acconfig.h: added USE_PSPELL.
2895 * src/config.h.in: added USE_PSPELL.
2897 * autogen.sh: added pspell.m4
2899 * config/pspell.m4: new file.
2901 * src/spellchecker.C: implemented support for pspell libary.
2903 2000-08-25 Juergen Vigna <jug@sad.it>
2905 * src/LyXAction.C (init): renamed LFUN_TABLE to
2906 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
2908 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
2910 * src/lyxscreen.h: add force_clear variable and fuction to force
2911 a clear area when redrawing in LyXText.
2913 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
2915 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2917 * some whitespace and comment changes.
2919 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
2921 * src/buffer.C: up te LYX_FORMAT to 2.17
2923 2000-08-23 Juergen Vigna <jug@sad.it>
2925 * src/BufferView_pimpl.C (tripleClick): disable this when in a
2928 * src/insets/insettabular.C (pasteSelection): delete the insets
2929 LyXText as it is not valid anymore.
2930 (copySelection): new function.
2931 (pasteSelection): new function.
2932 (cutSelection): new function.
2933 (LocalDispatch): implemented cut/copy/paste of cell selections.
2935 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
2936 don't have a LyXText.
2938 * src/LyXAction.C (init): a NEW_TABULAR define too much.
2940 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
2943 2000-08-22 Juergen Vigna <jug@sad.it>
2945 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
2946 ifdef form_table out if NEW_TABULAR.
2948 2000-08-21 Juergen Vigna <jug@sad.it>
2950 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
2951 (draw): fixed draw position so that the cursor is positioned in the
2953 (InsetMotionNotify): hide/show cursor so the position is updated.
2954 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
2955 using cellstart() function where it should be used.
2957 * src/insets/insettext.C (draw): ditto.
2959 * src/tabular.C: fixed initialization of some missing variables and
2960 made BoxType into an enum.
2962 2000-08-22 Marko Vendelin <markov@ioc.ee>
2963 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
2964 stock menu item using action numerical value, not its string
2968 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
2970 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
2971 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
2973 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
2975 * src/frontends/xforms/GUIRunTime.C: new file
2977 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
2978 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2980 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
2982 * src/frontends/kde/GUIRunTime.C: new file
2984 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
2985 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2987 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
2989 * src/frontends/gnome/GUIRunTime.C: new file
2991 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
2994 * src/frontends/GUIRunTime.h: removed constructor and destructor,
2995 small change to documetentation.
2997 * src/frontends/GUIRunTime.C: removed file
2999 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
3001 * src/lyxparagraph.h: enable NEW_TABULAR as default
3003 * src/lyxfunc.C (processKeySym): remove some commented code
3005 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
3006 NEW_TABULAR around the fd_form_table_options.
3008 * src/lyx_gui.C (runTime): call the static member function as
3009 GUIRunTime::runTime().
3011 2000-08-21 Allan Rae <rae@lyx.org>
3013 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
3016 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
3018 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
3020 2000-08-21 Allan Rae <rae@lyx.org>
3022 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
3023 keep Garst happy ;-)
3024 * src/frontends/xforms/FormPreferences.C (build): use setOK
3025 * src/frontends/xforms/FormDocument.C (build): use setOK
3026 (FormDocument): use the appropriate policy.
3028 2000-08-21 Allan Rae <rae@lyx.org>
3030 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
3031 automatic [de]activation of arbitrary objects when in a read-only state.
3033 * src/frontends/ButtonPolicies.h: More documentation
3034 (isReadOnly): added to support the above.
3036 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
3038 2000-08-18 Juergen Vigna <jug@sad.it>
3040 * src/insets/insettabular.C (getStatus): changed to return func_status.
3042 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
3043 display toggle menu entries if they are.
3045 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
3046 new document layout now.
3048 * src/lyxfunc.C: ditto
3050 * src/lyx_gui_misc.C: ditto
3052 * src/lyx_gui.C: ditto
3054 * lib/ui/default.ui: removed paper and quotes layout as they are now
3055 all in the document layout tabbed folder.
3057 * src/frontends/xforms/forms/form_document.fd: added Restore
3058 button and callbacks for all inputs for Allan's ButtonPolicy.
3060 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
3061 (CheckChoiceClass): added missing params setting on class change.
3062 (UpdateLayoutDocument): added for updating the layout on params.
3063 (build): forgot to RETURN_ALWAYS input_doc_spacing.
3064 (FormDocument): Implemented Allan's ButtonPolicy with the
3067 2000-08-17 Allan Rae <rae@lyx.org>
3069 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
3070 so we can at least see the credits again.
3072 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
3073 controller calls for the appropriate callbacks. Note that since Ok
3074 calls apply followed by cancel, and apply isn't a valid input for the
3075 APPLIED state, the bc_ calls have to be made in the static callback not
3076 within each of the real callbacks.
3078 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
3079 (setOk): renamed from setOkay()
3081 2000-08-17 Juergen Vigna <jug@sad.it>
3083 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
3084 in the implementation part.
3085 (composeUIInfo): don't show optional menu-items.
3087 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
3089 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
3091 * src/bufferview_funcs.C (CurrentState): fixed to show also the
3092 text-state when in a text-inset.
3094 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
3096 2000-08-17 Marko Vendelin <markov@ioc.ee>
3097 * src/frontends/gnome/FormIndex.C
3098 * src/frontends/gnome/FormIndex.h
3099 * src/frontends/gnome/FormToc.C
3100 * src/frontends/gnome/FormToc.h
3101 * src/frontends/gnome/dialogs
3102 * src/frontends/gnome/diatoc_callbacks.c
3103 * src/frontends/gnome/diatoc_callbacks.h
3104 * src/frontends/gnome/diainsertindex_callbacks.h
3105 * src/frontends/gnome/diainsertindex_callbacks.c
3106 * src/frontends/gnome/diainsertindex_interface.c
3107 * src/frontends/gnome/diainsertindex_interface.h
3108 * src/frontends/gnome/diatoc_interface.h
3109 * src/frontends/gnome/diatoc_interface.c
3110 * src/frontends/gnome/Makefile.am: Table of Contents and
3111 Insert Index dialogs implementation for Gnome frontend
3113 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
3115 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
3117 * src/frontends/gnome/diainserturl_interface.c: make the dialog
3120 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3122 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
3123 destructor. Don't definde if you don't need it
3124 (processEvents): made static, non-blocking events processing for
3126 (runTime): static method. event loop for xforms
3127 * similar as above for kde and gnome.
3129 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
3130 new Pimpl is correct
3131 (runTime): new method calss the real frontends runtime func.
3133 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
3135 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3137 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
3139 2000-08-16 Juergen Vigna <jug@sad.it>
3141 * src/lyx_gui.C (runTime): added GUII RunTime support.
3143 * src/frontends/Makefile.am:
3144 * src/frontends/GUIRunTime.[Ch]:
3145 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
3146 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
3147 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
3149 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
3151 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
3152 as this is already set in ${FRONTEND_INCLUDE} if needed.
3154 * configure.in (CPPFLAGS): setting the include dir for the frontend
3155 directory and don't set FRONTEND=xforms for now as this is executed
3158 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
3160 * src/frontends/kde/Makefile.am:
3161 * src/frontends/kde/FormUrl.C:
3162 * src/frontends/kde/FormUrl.h:
3163 * src/frontends/kde/formurldialog.h:
3164 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
3166 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
3168 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
3170 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3172 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
3175 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
3177 * src/WorkArea.C (work_area_handler): more work to get te
3178 FL_KEYBOARD to work with xforms 0.88 too, please test.
3180 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
3182 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
3184 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
3187 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3189 * src/Timeout.h: remove Qt::emit hack.
3191 * several files: changes to allo doc++ compilation
3193 * src/lyxfunc.C (processKeySym): new method
3194 (processKeyEvent): comment out if FL_REVISION < 89
3196 * src/WorkArea.C: change some debugging levels.
3197 (WorkArea): set wantkey to FL_KEY_ALL
3198 (work_area_handler): enable the FL_KEYBOARD clause, this enables
3199 clearer code and the use of compose with XForms 0.89. Change to
3200 use signals instead of calling methods in bufferview directly.
3202 * src/Painter.C: change some debugging levels.
3204 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
3207 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
3208 (workAreaKeyPress): new method
3210 2000-08-14 Juergen Vigna <jug@sad.it>
3212 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
3214 * config/kde.m4: addes some features
3216 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
3217 include missing xforms dialogs.
3219 * src/Timeout.h: a hack to be able to compile with qt/kde.
3221 * sigc++/.cvsignore: added acinclude.m4
3223 * lib/.cvsignore: added listerros
3225 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
3226 xforms tree as objects are needed for other frontends.
3228 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
3229 linking with not yet implemented xforms objects.
3231 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
3233 2000-08-14 Baruch Even <baruch.even@writeme.com>
3235 * src/frontends/xforms/FormGraphics.h:
3236 * src/frontends/xforms/FormGraphics.C:
3237 * src/frontends/xforms/RadioButtonGroup.h:
3238 * src/frontends/xforms/RadioButtonGroup.C:
3239 * src/insets/insetgraphics.h:
3240 * src/insets/insetgraphics.C:
3241 * src/insets/insetgraphicsParams.h:
3242 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
3243 instead of spaces, and various other indentation issues to make the
3244 sources more consistent.
3246 2000-08-14 Marko Vendelin <markov@ioc.ee>
3248 * src/frontends/gnome/dialogs/diaprint.glade
3249 * src/frontends/gnome/FormPrint.C
3250 * src/frontends/gnome/FormPrint.h
3251 * src/frontends/gnome/diaprint_callbacks.c
3252 * src/frontends/gnome/diaprint_callbacks.h
3253 * src/frontends/gnome/diaprint_interface.c
3254 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
3257 * src/frontends/gnome/dialogs/diainserturl.glade
3258 * src/frontends/gnome/FormUrl.C
3259 * src/frontends/gnome/FormUrl.h
3260 * src/frontends/gnome/diainserturl_callbacks.c
3261 * src/frontends/gnome/diainserturl_callbacks.h
3262 * src/frontends/gnome/diainserturl_interface.c
3263 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
3264 Gnome implementation
3266 * src/frontends/gnome/Dialogs.C
3267 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
3268 all other dialogs. Copy all unimplemented dialogs from Xforms
3271 * src/frontends/gnome/support.c
3272 * src/frontends/gnome/support.h: support files generated by Glade
3276 * config/gnome.m4: Gnome configuration scripts
3278 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
3279 configure --help message
3281 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
3282 only if there are no events pendling in Gnome/Gtk. This enhances
3283 the performance of menus.
3286 2000-08-14 Allan Rae <rae@lyx.org>
3288 * lib/Makefile.am: listerrors cleaning
3290 * lib/listerrors: removed -- generated file
3291 * acinclude.m4: ditto
3292 * sigc++/acinclude.m4: ditto
3294 * src/frontends/xforms/forms/form_citation.fd:
3295 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
3298 * src/frontends/xforms/forms/makefile: I renamed the `install` target
3299 `updatesrc` and now we have a `test` target that does what `updatesrc`
3300 used to do. I didn't like having an install target that wasn't related
3303 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
3304 on all except FormGraphics. This may yet happen. Followed by a major
3305 cleanup including using FL_TRANSIENT for most of the dialogs. More
3306 changes to come when the ButtonController below is introduced.
3308 * src/frontends/xforms/ButtonController.h: New file for managing up to
3309 four buttons on a dialog according to an externally defined policy.
3310 * src/frontends/xforms/Makefile.am: added above
3312 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
3313 Apply and Cancel/Close buttons and everything in between and beyond.
3314 * src/frontends/Makefile.am: added above.
3316 * src/frontends/xforms/forms/form_preferences.fd:
3317 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
3318 and removed variable 'status' as a result. Fixed the set_minsize thing.
3319 Use the new screen-font-update after checking screen fonts were changed
3320 Added a "Restore" button to restore the original lyxrc values while
3321 editing. This restores everything not just the last input changed.
3322 That's still a tricky one. As is the "LyX: this shouldn't happen..."
3324 * src/LyXAction.C: screen-font-update added for updating buffers after
3325 screen font settings have been changed.
3326 * src/commandtags.h: ditto
3327 * src/lyxfunc.C: ditto
3329 * forms/lyx.fd: removed screen fonts dialog.
3330 * src/lyx_gui.C: ditto
3331 * src/menus.[Ch]: ditto
3332 * src/lyx.[Ch]: ditto
3333 * src/lyx_cb.C: ditto + code from here moved to make
3334 screen-font-update. And people wonder why progress on GUII is
3335 slow. Look at how scattered this stuff was! It takes forever
3338 * forms/fdfix.sh: Fixup the spacing after commas.
3339 * forms/makefile: Remove date from generated files. Fewer clashes now.
3340 * forms/bullet_forms.C.patch: included someones handwritten changes
3342 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
3343 once I've discovered why LyXRC was made noncopyable.
3344 * src/lyx_main.C: ditto
3346 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
3348 * src/frontends/xforms/forms/fdfix.sh:
3349 * src/frontends/xforms/forms/fdfixh.sed:
3350 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
3351 * src/frontends/xforms/Form*.[hC]:
3352 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
3353 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
3354 provide a destructor for the struct FD_form_xxxx. Another version of
3355 the set_[max|min]size workaround and a few other cleanups. Actually,
3356 Angus' patch from 20000809.
3358 2000-08-13 Baruch Even <baruch.even@writeme.com>
3360 * src/insets/insetgraphics.C (Clone): Added several fields that needed
3363 2000-08-11 Juergen Vigna <jug@sad.it>
3365 * src/insets/insetgraphics.C (InsetGraphics): changing init
3366 order because of warnings.
3368 * src/frontends/xforms/forms/makefile: adding patching .C with
3371 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
3372 from .C.patch to .c.patch
3374 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
3375 order because of warning.
3377 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
3379 * src/frontends/Liason.C (setMinibuffer): new helper function
3381 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
3383 * src/lyxfunc.C (Dispatch): calling new Document-Layout
3385 * lib/ui/default.ui: commented out PaperLayout entry
3387 * src/frontends/xforms/form_document.[Ch]: new added files
3389 * src/frontends/xforms/FormDocument.[Ch]: ditto
3391 * src/frontends/xforms/forms/form_document.fd: ditto
3393 * src/frontends/xforms/forms/form_document.C.patch: ditto
3395 2000-08-10 Juergen Vigna <jug@sad.it>
3397 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
3398 (InsetGraphics): initialized cacheHandle to 0.
3399 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
3401 2000-08-10 Baruch Even <baruch.even@writeme.com>
3403 * src/graphics/GraphicsCache.h:
3404 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
3405 correctly as a cache.
3407 * src/graphics/GraphicsCacheItem.h:
3408 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
3411 * src/graphics/GraphicsCacheItem_pimpl.h:
3412 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
3415 * src/insets/insetgraphics.h:
3416 * src/insets/insetgraphics.C: Changed from using a signal notification
3417 to polling when image is not loaded.
3419 2000-08-10 Allan Rae <rae@lyx.org>
3421 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
3422 that there are two functions that have to been taken out of line by
3423 hand and aren't taken care of in the script. (Just a reminder note)
3425 * sigc++/macros/*.h.m4: Updated as above.
3427 2000-08-09 Juergen Vigna <jug@sad.it>
3429 * src/insets/insettext.C (draw): small fix for clearing rectangle.
3431 * src/insets/insettabular.C: make drawing of single cell smarter.
3433 2000-08-09 Marko Vendelin <markov@ioc.ee>
3434 * src/frontends/gnome/Menubar_pimpl.C
3435 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
3436 implementation: new files
3438 * src/frontends/gnome/mainapp.C
3439 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
3442 * src/main.C: create Gnome main window
3444 * src/frontends/xforms/Menubar_pimpl.h
3445 * src/frontends/Menubar.C
3446 * src/frontends/Menubar.h: added method Menubar::update that calls
3447 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
3449 * src/LyXView.C: calls Menubar::update to update the state
3452 * src/frontends/gnome/Makefile.am: added new files
3454 * src/frontends/Makefile.am: added frontend compiler options
3456 2000-08-08 Juergen Vigna <jug@sad.it>
3458 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
3460 * src/bufferlist.C (close):
3461 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
3462 documents if exiting without saving.
3464 * src/buffer.C (save): use removeAutosaveFile()
3466 * src/support/filetools.C (removeAutosaveFile): new function.
3468 * src/lyx_cb.C (MenuWrite): returns a bool now.
3469 (MenuWriteAs): check if file could really be saved and revert to the
3471 (MenuWriteAs): removing old autosavefile if existant.
3473 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
3474 before Goto toggle declaration, because of compiler warning.
3476 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
3478 * src/lyxfunc.C (MenuNew): small fix.
3480 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
3482 * src/bufferlist.C (newFile):
3483 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
3485 * src/lyxrc.C: added new_ask_filename tag
3487 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
3489 * src/lyx.fd: removed code pertaining to form_ref
3490 * src/lyx.[Ch]: ditto
3491 * src/lyx_cb.C: ditto
3492 * src/lyx_gui.C: ditto
3493 * src/lyx_gui_misc.C: ditto
3495 * src/BufferView_pimpl.C (restorePosition): update buffer only
3498 * src/commandtags.h (LFUN_REFTOGGLE): removed
3499 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
3500 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
3501 (LFUN_REFBACK): renamed LFUN_REF_BACK
3503 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
3504 * src/menus.C: ditto
3505 * src/lyxfunc.C (Dispatch): ditto.
3506 InsertRef dialog is now GUI-independent.
3508 * src/texrow.C: added using std::endl;
3510 * src/insets/insetref.[Ch]: strip out large amounts of code.
3511 The inset is now a container and this functionality is now
3512 managed by a new FormRef dialog
3514 * src/frontends/Dialogs.h (showRef, createRef): new signals
3516 * src/frontends/xforms/FormIndex.[Ch],
3517 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
3518 when setting dialog's min/max size
3519 * src/frontends/xforms/FormIndex.[Ch]: ditto
3521 * src/frontends/xforms/FormRef.[Ch],
3522 src/frontends/xforms/forms/form_ref.fd: new xforms
3523 implementation of an InsetRef dialog
3525 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
3528 * src/graphics/XPM_Renderer.C (isImageFormatOK):
3529 ios::nocreate is not part of the standard. Removed.
3531 2000-08-07 Baruch Even <baruch.even@writeme.com>
3533 * src/graphics/Renderer.h:
3534 * src/graphics/Renderer.C: Added base class for rendering of different
3535 image formats into Pixmaps.
3537 * src/graphics/XPM_Renderer.h:
3538 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
3539 in a different class.
3541 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
3542 easily add support for other formats.
3544 * src/insets/figinset.C: plugged a leak of an X resource.
3546 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
3548 * src/CutAndPaste.[Ch]: make all metods static.
3550 * development/Code_rules/Rules: more work, added section on
3551 Exceptions, and a References section.
3553 * a lot of header files: work to make doc++ able to generate the
3554 source documentation, some workarounds of doc++ problems. Doc++ is
3555 now able to generate the documentation.
3557 2000-08-07 Juergen Vigna <jug@sad.it>
3559 * src/insets/insettabular.C (recomputeTextInsets): removed function
3561 * src/tabular.C (SetWidthOfMulticolCell):
3563 (calculate_width_of_column_NMC): fixed return value so that it really
3564 only returns true if the column-width has changed (there where
3565 problems with muliticolumn-cells in this column).
3567 2000-08-04 Juergen Vigna <jug@sad.it>
3569 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
3570 also on the scrollstatus of the inset.
3571 (workAreaMotionNotify): ditto.
3573 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
3575 2000-08-01 Juergen Vigna <jug@sad.it>
3577 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
3579 * src/commandtags.h:
3580 * src/LyXAction.C (init):
3581 * src/insets/inset.C (LocalDispatch): added support for
3584 * src/insets/inset.C (scroll): new functions.
3586 * src/insets/insettext.C (removeNewlines): new function.
3587 (SetAutoBreakRows): removes forced newlines in the text of the
3588 paragraph if autoBreakRows is set to false.
3590 * src/tabular.C (Latex): generates a parbox around the cell contents
3593 * src/frontends/xforms/FormTabular.C (local_update): removed
3594 the radio_useparbox button.
3596 * src/tabular.C (UseParbox): new function
3598 2000-08-06 Baruch Even <baruch.even@writeme.com>
3600 * src/graphics/GraphicsCache.h:
3601 * src/graphics/GraphicsCache.C:
3602 * src/graphics/GraphicsCacheItem.h:
3603 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
3606 * src/insets/insetgraphics.h:
3607 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
3608 and the drawing of the inline image.
3610 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
3611 loaded into the wrong position.
3613 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
3616 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3618 * src/support/translator.h: move all typedefs to public section
3620 * src/support/filetools.C (MakeLatexName): return string const
3622 (TmpFileName): ditto
3623 (FileOpenSearch): ditto
3625 (LibFileSearch): ditto
3626 (i18nLibFileSearch): ditto
3629 (CreateTmpDir): ditto
3630 (CreateBufferTmpDir): ditto
3631 (CreateLyXTmpDir): ditto
3634 (MakeAbsPath): ditto
3636 (OnlyFilename): ditto
3638 (NormalizePath): ditto
3639 (CleanupPath): ditto
3640 (GetFileContents): ditto
3641 (ReplaceEnvironmentPath): ditto
3642 (MakeRelPath): ditto
3644 (ChangeExtension): ditto
3645 (MakeDisplayPath): ditto
3646 (do_popen): return cmdret const
3647 (findtexfile): return string const
3649 * src/support/DebugStream.h: add some /// to please doc++
3651 * src/frontends/DialogBase.h (endif): add some /// to please doc++
3653 * src/texrow.C (same_rownumber): functor to use with find_if
3654 (getIdFromRow): rewritten to use find_if and to not update the
3655 positions. return true if row is found
3656 (increasePos): new method, use to update positions
3658 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
3660 * src/lyxlex_pimpl.C (verifyTable): new method
3663 (GetString): return string const
3664 (pushTable): rewrite to use std::stack
3666 (setFile): better check
3669 * src/lyxlex.h: make LyXLex noncopyable
3671 * src/lyxlex.C (text): return char const * const
3672 (GetString): return string const
3673 (getLongString): return string const
3675 * src/lyx_gui_misc.C (askForText): return pair<...> const
3677 * src/lastfiles.[Ch] (operator): return string const
3679 * src/buffer.C (parseSingleLyXformat2Token): pass string to
3680 istringstream not char const *.
3681 move token.end() out of loop.
3682 (readFile): move initializaton of token
3684 * src/BufferView2.C (insertErrors): run texrow.increasePos if
3685 getIdFromRow is successful.
3687 * lib/bind/emacs.bind: don't include menus bind
3689 * development/Code_rules/Rules: the beginnings of making this
3690 better and covering more of the unwritten rules that we have.
3692 * development/Code_rules/Recommendations: a couple of wording
3695 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3697 * src/support/strerror.c: remove C++ comment.
3699 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
3701 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
3702 LFUN_INDEX_INSERT_LAST
3704 * src/texrow.C (getIdFromRow): changed from const_iterator to
3705 iterator, allowing code to compile with DEC cxx
3707 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
3708 stores part of the class, as suggested by Allan. Will allow
3710 (apply): test to apply uses InsetCommandParams operator!=
3712 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
3713 (apply): test to apply uses InsetCommandParams operator!=
3715 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
3716 stores part of the class.
3717 (update): removed limits on min/max size.
3719 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
3720 (apply): test to apply uses InsetCommandParams operator!=
3722 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
3723 (Read, Write, scanCommand, getCommand): moved functionality
3724 into InsetCommandParams.
3726 (getScreenLabel): made pure virtual
3727 new InsetCommandParams operators== and !=
3729 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
3730 c-tors based on InsetCommandParams. Removed others.
3731 * src/insets/insetinclude.[Ch]: ditto
3732 * src/insets/insetlabel.[Ch]: ditto
3733 * src/insets/insetparent.[Ch]: ditto
3734 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
3736 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
3737 insets derived from InsetCommand created using similar c-tors
3738 based on InsetCommandParams
3739 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
3740 * src/menus.C (ShowRefsMenu): ditto
3741 * src/paragraph.C (Clone): ditto
3742 * src/text2.C (SetCounter): ditto
3743 * src/lyxfunc.C (Dispatch) ditto
3744 Also recreated old InsetIndex behaviour exactly. Can now
3745 index-insert at the start of a paragraph and index-insert-last
3746 without launching the pop-up.
3748 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3750 * lib/lyxrc.example: mark te pdf options as non functional.
3752 * src/support/lstrings.C (strToInt): move initalization of tmpstr
3753 (isStrDbl): move tmpstr.end() out of loop.
3754 (strToDbl): move intialization of tmpstr
3755 (lowercase): return string const and move tmp.end() out of loop.
3756 (uppercase): return string const and move tmp.edn() out of loop.
3757 (prefixIs): add assertion
3762 (containsOnly): ditto
3763 (containsOnly): ditto
3764 (containsOnly): ditto
3765 (countChar): make last arg char not char const
3766 (token): return string const
3767 (subst): return string const, move tmp.end() out of loop.
3768 (subst): return string const, add assertion
3769 (strip): return string const
3770 (frontStrip): return string const, add assertion
3771 (frontStrip): return string const
3776 * src/support/lstrings.C: add inclde "LAssert.h"
3777 (isStrInt): move tmpstr.end() out of loop.
3779 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
3780 toollist.end() out of loop.
3781 (deactivate): move toollist.end() out of loop.
3782 (update): move toollist.end() out of loop.
3783 (updateLayoutList): move tc.end() out of loop.
3784 (add): move toollist.end() out of loop.
3786 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
3787 md.end() out of loop.
3789 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
3791 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
3794 * src/paragraph.C (Erase): move fontlist.end() out of loop.
3795 (Erase): move insetlist.end() out of loop.
3797 * src/lyx_sendfax_main.C: make show_logfile static and to take a
3798 ref to const string as first arg. Move initialization of some
3799 variables, whitespace changes.
3801 * src/kbmap.C (defkey): move table.end() out of loop.
3802 (kb_keymap): move table.end() out of loop.
3803 (findbinding): move table.end() out of loop.
3805 * src/MenuBackend.C (hasMenu): move end() out of loop.
3806 (getMenu): move end() out of loop.
3807 (getMenu): move menulist_.end() out of loop.
3809 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
3811 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
3814 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
3815 (getFromLyXName): move infotab.end() out of loop.
3817 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
3818 -fvtable-thunks -ffunction-sections -fdata-sections
3820 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
3822 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
3825 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3827 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
3829 * src/frontends/xforms/FormCitation.[Ch],
3830 src/frontends/xforms/FormIndex.[Ch],
3831 src/frontends/xforms/FormToc.[Ch],
3832 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
3834 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3836 * src/commandtags.h: renamed, created some flags for citation
3839 * src/lyx_gui_misc.C: stripped out old FD_index_form code
3841 * src/lyxfunc.C (dispatch): use signals to insert index entry
3843 * src/frontends/Dialogs.h: new signal createIndex
3845 * src/frontends/xforms/FormCommand.[Ch],
3846 src/frontends/xforms/FormCitation.[Ch],
3847 src/frontends/xforms/FormToc.[Ch],
3848 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
3850 * src/insets/insetindex.[Ch]: GUI-independent
3852 * src/frontends/xforms/FormIndex.[Ch],
3853 * src/frontends/xforms/forms/form_index.fd: xforms implementation
3856 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
3858 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
3859 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
3861 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3863 * src/insets/insetref.C (Latex): rewrite so that there is now
3864 question that a initialization is requested.
3866 * src/insets/insetcommand.h: reenable the hide signal
3868 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3870 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
3871 fix handling of shortcuts (many bugs :)
3872 (add_lastfiles): ditto.
3874 * lib/ui/default.ui: fix a few shortcuts.
3876 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
3878 * Makefile.am: Fix ``rpmdist'' target to return the exit
3879 status of the ``rpm'' command, instead of the last command in
3880 the chain (the ``rm lyx.xpm'' command, which always returns
3883 2000-08-02 Allan Rae <rae@lyx.org>
3885 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
3886 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
3887 * src/frontends/xforms/FormToc.C (FormToc): ditto
3889 * src/frontends/xforms/Makefile.am: A few forgotten files
3891 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
3892 Signals-not-copyable-problem Lars' started commenting out.
3894 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
3896 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3898 * src/insets/insetcommand.h: Signals is not copyable so anoter
3899 scheme for automatic hiding of forms must be used.
3901 * src/frontends/xforms/FormCitation.h: don't inerit from
3902 noncopyable, FormCommand already does that.
3903 * src/frontends/xforms/FormToc.h: ditto
3904 * src/frontends/xforms/FormUrl.h: ditto
3906 * src/frontends/xforms/FormCitation.C: add include <algorithm>
3908 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
3910 * src/insets/insetcommand.h (hide): new SigC::Signal0
3911 (d-tor) new virtual destructor emits hide signal
3913 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
3914 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
3916 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
3917 LOF and LOT. Inset is now GUI-independent
3919 * src/insets/insetloa.[Ch]: redundant
3920 * src/insets/insetlof.[Ch]: ditto
3921 * src/insets/insetlot.[Ch]: ditto
3923 * src/frontends/xforms/forms/form_url.fd: tweaked!
3924 * src/frontends/xforms/forms/form_citation.fd: ditto
3926 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
3927 dialogs dealing with InsetCommand insets
3929 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
3930 FormCommand base class
3931 * src/frontends/xforms/FormUrl.[Ch]: ditto
3933 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
3935 * src/frontends/xforms/FormToc.[Ch]: ditto
3937 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
3938 passed a generic InsetCommand pointer
3939 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
3941 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
3942 and modified InsetTOC class
3943 * src/buffer.C: ditto
3945 * forms/lyx.fd: strip out old FD_form_toc code
3946 * src/lyx_gui_misc.C: ditto
3947 * src/lyx_gui.C: ditto
3948 * src/lyx_cb.C: ditto
3949 * src/lyx.[Ch]: ditto
3951 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3953 * src/support/utility.hpp: tr -d '\r'
3955 2000-08-01 Juergen Vigna <jug@sad.it>
3957 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
3959 * src/commandtags.h:
3960 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
3961 LFUN_TABULAR_FEATURES.
3963 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
3964 LFUN_LAYOUT_TABULAR.
3966 * src/insets/insettabular.C (getStatus): implemented helper function.
3968 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
3970 2000-07-31 Juergen Vigna <jug@sad.it>
3972 * src/text.C (draw): fixed screen update problem for text-insets.
3974 * src/text2.C (SetParagrpah): call an update of the inset-owner when
3975 something changed probably this has to be added in various other
3978 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
3980 2000-07-31 Baruch Even <baruch.even@writeme.com>
3982 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
3983 templates to satisfy compaq cxx.
3986 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3988 * src/support/translator.h (equal_1st_in_pair::operator()): take
3989 const ref pair_type as arg.
3990 (equal_2nd_in_pair::operator()): ditto
3991 (Translator::~Translator): remove empty d-tor.
3993 * src/graphics/GraphicsCache.C: move include config.h to top, also
3994 put initialization of GraphicsCache::singleton here.
3995 (~GraphicsCache): move here
3996 (addFile): take const ref as arg
3999 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
4001 * src/BufferView2.C (insertLyXFile): change te with/without header
4004 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4006 * src/frontends/xforms/FormGraphics.C (apply): add some
4007 static_cast. Not very nice, but required by compaq cxx.
4009 * src/frontends/xforms/RadioButtonGroup.h: include header
4010 <utility> instead of <pair.h>
4012 * src/insets/insetgraphicsParams.C: add using directive.
4013 (readResize): change return type to void.
4014 (readOrigin): ditto.
4016 * src/lyxfunc.C (getStatus): add missing break for build-program
4017 function; add test for Literate for export functions.
4019 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
4020 entries in Options menu.
4022 2000-07-31 Baruch Even <baruch.even@writeme.com>
4024 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
4025 protect against auto-allocation; release icon when needed.
4027 2000-07-31 Matej Cepl <CeplM@seznam.cz>
4029 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
4030 on usual typewriter.
4032 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
4033 earlier czech.kmap), useful only for programming.
4035 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4037 * src/frontends/xforms/FormCitation.h: fix conditioning around
4040 2000-07-31 Juergen Vigna <jug@sad.it>
4042 * src/frontends/xforms/FormTabular.C (local_update): changed
4043 radio_linebreaks to radio_useparbox and added radio_useminipage.
4045 * src/tabular.C: made support for using minipages/parboxes.
4047 * src/bufferlist.C (QwriteAll): small fix for asking for save.
4049 * src/insets/insetgraphics.C (draw): just draw the inset so that the
4051 (descent): so the cursor is in the middle.
4052 (width): bit smaller box.
4054 * src/insets/insetgraphics.h: added display() function.
4056 2000-07-31 Baruch Even <baruch.even@writeme.com>
4058 * src/frontends/Dialogs.h: Added showGraphics signals.
4060 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
4061 xforms form definition of the graphics dialog.
4063 * src/frontends/xforms/FormGraphics.h:
4064 * src/frontends/xforms/FormGraphics.C: Added files, the
4065 GUIndependent code of InsetGraphics
4067 * src/insets/insetgraphics.h:
4068 * src/insets/insetgraphics.C: Major writing to make it work.
4070 * src/insets/insetgraphicsParams.h:
4071 * src/insets/insetgraphicsParams.C: Added files, parameter passing
4072 struct between InsetGraphics and GUI.
4074 * src/LaTeXFeatures.h:
4075 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
4076 support for graphicx package.
4078 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
4079 for the graphics inset.
4081 * src/support/translator.h: Added file, used in
4082 InsetGraphicsParams. this is a template to translate between two
4085 * src/frontends/xforms/RadioButtonGroup.h:
4086 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
4087 way to easily control a radio button group.
4089 2000-07-28 Juergen Vigna <jug@sad.it>
4091 * src/insets/insettabular.C (LocalDispatch):
4092 (TabularFeatures): added support for lyx-functions of tabular features.
4093 (cellstart): refixed this function after someone wrongly changed it.
4095 * src/commandtags.h:
4096 * src/LyXAction.C (init): added support for tabular-features
4098 2000-07-28 Allan Rae <rae@lyx.org>
4100 * src/frontends/xforms/FormPreferences.C (build): Setup input return
4101 checking. NOTE: It seems that pressing ESC to cancel the dialog also
4102 triggers the callback for input checking. As a result we sometimes get
4103 "LyX: This shouldn't happen..." printed to cerr.
4104 (input): Started using status variable since I only free() on
4105 destruction. Some input checking for paths and font sizes.
4107 * src/frontends/xforms/FormPreferences.h: Use status to control
4108 activation of Ok and Apply
4110 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
4111 callback. Also resized to stop segfaults with 0.88. The problem is
4112 that xforms-0.88 requires the folder to be wide enough to fit all the
4113 tabs. If it isn't it causes all sorts of problems.
4115 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
4117 * src/frontends/xforms/forms/README: Reflect reality.
4119 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
4120 * src/frontends/xforms/forms/makefile: ditto.
4122 * src/commandtags.h: Get access to new Preferences dialog
4123 * src/LyXAction.C: ditto
4124 * src/lyxfunc.C: ditto
4125 * lib/ui/default.ui: ditto
4127 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4129 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
4131 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
4134 * src/frontends/xforms/form_url.[Ch]: added.
4136 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4138 * src/insets/insetbib.h: fixed bug in previous commit
4140 * src/frontends/xforms/FormUrl.h: ditto
4142 * src/frontends/xforms/FormPrint.h: ditto
4144 * src/frontends/xforms/FormPreferences.h: ditto
4146 * src/frontends/xforms/FormCopyright.h: ditto
4148 * src/frontends/xforms/FormCitation.C: ditto
4150 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
4151 private copyconstructor and private default contructor
4153 * src/support/Makefile.am: add utility.hpp
4155 * src/support/utility.hpp: new file from boost
4157 * src/insets/insetbib.h: set owner in clone
4159 * src/frontends/xforms/FormCitation.C: added missing include
4162 * src/insets/form_url.[Ch]: removed
4164 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
4166 * development/lyx.spec.in
4167 * Makefile.am: Fix buglet for LyX RPM generation resulting from
4168 file/directory re-organization.
4170 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
4172 * src/insets/insetcommand.[Ch]: moved the string data and
4173 associated manipulation methods into a new stand-alone class
4174 InsetCommandParams. This class has two additional methods
4175 getAsString() and setFromString() allowing the contents to be
4176 moved around as a single string.
4177 (addContents) method removed.
4178 (setContents) method no longer virtual.
4180 * src/buffer.C (readInset): made use of new InsetCitation,
4181 InsetUrl constructors based on InsetCommandParams.
4183 * src/commandtags.h: add LFUN_INSERT_URL
4185 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
4186 independent InsetUrl and use InsetCommandParams to extract
4187 string info and create new Insets.
4189 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
4191 * src/frontends/xforms/FormCitation.C (apply): uses
4194 * src/frontends/xforms/form_url.C
4195 * src/frontends/xforms/form_url.h
4196 * src/frontends/xforms/FormUrl.h
4197 * src/frontends/xforms/FormUrl.C
4198 * src/frontends/xforms/forms/form_url.fd: new files
4200 * src/insets/insetcite.[Ch]: removed unused constructors.
4202 * src/insets/insetinclude.[Ch]: no longer store filename
4204 * src/insets/inseturl.[Ch]: GUI-independent.
4206 2000-07-26 Juergen Vigna <jug@sad.it>
4207 * renamed frontend from gtk to gnome as it is that what is realized
4208 and did the necessary changes in the files.
4210 2000-07-26 Marko Vendelin <markov@ioc.ee>
4212 * configure.in: cleaning up gnome configuration scripts
4214 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4216 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
4217 shortcuts syndrom by redrawing them explicitely (a better solution
4218 would be appreciated).
4220 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
4222 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
4225 * src/lyx_cb.C (MenuExport): change html export to do the right
4226 thing depending of the document type (instead of having
4227 html-linuxdoc and html-docbook).
4228 * src/lyxfunc.C (getStatus): update for html
4229 * lib/ui/default.ui: simplify due to the above change.
4230 * src/menus.C (ShowFileMenu): update too (in case we need it).
4232 * src/MenuBackend.C (read): if a menu is defined twice, add the
4233 new entries to the exiting one.
4235 2000-07-26 Juergen Vigna <jug@sad.it>
4237 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
4239 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
4240 and return a bool if it did actual save the file.
4241 (AutoSave): don't autosave a unnamed doc.
4243 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
4244 check if this is an UNNAMED new file and react to it.
4245 (newFile): set buffer to unnamed and change to not mark a new
4246 buffer dirty if I didn't do anything with it.
4248 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
4250 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4252 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
4253 friend as per Angus's patch posted to lyx-devel.
4255 * src/ext_l10n.h: updated
4257 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
4258 gettext on the style string right before inserting them into the
4261 * autogen.sh: add code to extract style strings form layout files,
4262 not good enough yet.
4264 * src/frontends/gtk/.cvsignore: add MAKEFILE
4266 * src/MenuBackend.C (read): run the label strings through gettext
4267 before storing them in the containers.
4269 * src/ext_l10n.h: new file
4271 * autogen.sh : generate the ext_l10n.h file here
4273 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4275 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
4278 * lib/ui/default.ui: fix a couple of typos.
4280 * config/gnome/gtk.m4: added (and added to the list of files in
4283 * src/insets/insetinclude.C (unique_id): fix when we are using
4284 lyxstring instead of basic_string<>.
4285 * src/insets/insettext.C (LocalDispatch): ditto.
4286 * src/support/filetools.C: ditto.
4288 * lib/configure.m4: create the ui/ directory if necessary.
4290 * src/LyXView.[Ch] (updateToolbar): new method.
4292 * src/BufferView_pimpl.C (buffer): update the toolbar when
4293 opening/closing buffer.
4295 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4297 * src/LyXAction.C (getActionName): enhance to return also the name
4298 and options of pseudo-actions.
4299 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
4301 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
4302 as an example of what is possible). Used in File->Build too (more
4303 useful) and in the import/export menus (to mimick the complicated
4304 handling of linuxdoc and friends). Try to update all the entries.
4306 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
4309 * src/MenuBackend.C (read): Parse the new OptItem tag.
4311 * src/MenuBackend.h: Add a new optional_ data member (used if the
4312 entry should be omitted when the lyxfunc is disabled).
4314 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
4315 function, used as a shortcut.
4316 (create_submenu): align correctly the shortcuts on the widest
4319 * src/MenuBackend.h: MenuItem.label() only returns the label of
4320 the menu without shortcut; new method shortcut().
4322 2000-07-14 Marko Vendelin <markov@ioc.ee>
4324 * src/frontends/gtk/Dialogs.C:
4325 * src/frontends/gtk/FormCopyright.C:
4326 * src/frontends/gtk/FormCopyright.h:
4327 * src/frontends/gtk/Makefile.am: added these source-files for the
4328 Gtk/Gnome support of the Copyright-Dialog.
4330 * src/main.C: added Gnome::Main initialization if using
4331 Gtk/Gnome frontend-GUI.
4333 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
4335 * config/gnome/aclocal-include.m4
4336 * config/gnome/compiler-flags.m4
4337 * config/gnome/curses.m4
4338 * config/gnome/gnome--.m4
4339 * config/gnome/gnome-bonobo-check.m4
4340 * config/gnome/gnome-common.m4
4341 * config/gnome/gnome-fileutils.m4
4342 * config/gnome/gnome-ghttp-check.m4
4343 * config/gnome/gnome-gnorba-check.m4
4344 * config/gnome/gnome-guile-checks.m4
4345 * config/gnome/gnome-libgtop-check.m4
4346 * config/gnome/gnome-objc-checks.m4
4347 * config/gnome/gnome-orbit-check.m4
4348 * config/gnome/gnome-print-check.m4
4349 * config/gnome/gnome-pthread-check.m4
4350 * config/gnome/gnome-support.m4
4351 * config/gnome/gnome-undelfs.m4
4352 * config/gnome/gnome-vfs.m4
4353 * config/gnome/gnome-x-checks.m4
4354 * config/gnome/gnome-xml-check.m4
4355 * config/gnome/gnome.m4
4356 * config/gnome/gperf-check.m4
4357 * config/gnome/gtk--.m4
4358 * config/gnome/linger.m4
4359 * config/gnome/need-declaration.m4: added configuration scripts
4360 for Gtk/Gnome frontend-GUI
4362 * configure.in: added support for the --with-frontend=gtk option
4364 * autogen.sh: added config/gnome/* to list of config-files
4366 * acconfig.h: added define for GTKGUI-support
4368 * config/lyxinclude.m4: added --with-frontend[=value] option value
4369 for Gtk/Gnome frontend-GUI support.
4371 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4373 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
4377 * src/paragraph.C (GetChar): remove non-const version
4379 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
4380 (search_kw): use it.
4382 * src/lyx_main.C (init): if "preferences" exist, read that instead
4384 (ReadRcFile): return bool if the file could be read ok.
4385 (ReadUIFile): add a check to see if lex file is set ok.
4387 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
4388 bastring can be used instead of lyxstring (still uses the old code
4389 if std::string is good enough or if lyxstring is used.)
4391 * src/encoding.C: make the arrays static, move ininle functions
4393 * src/encoding.h: from here.
4395 * src/buffer.C: have last_isnet_read as a file scope variable for now.
4396 (parseSingleLyXformat2Token): move inset parsing to separate method
4397 (readInset): new private method
4399 * src/Variables.h: remove virtual from get().
4401 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
4402 access to NEW_INSETS and NEW_TABULAR
4404 * src/MenuBackend.h: remove superfluous forward declaration of
4405 MenuItem. Add documentations tags "///", remove empty MenuItem
4406 destructor, remove private default contructor.
4408 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
4410 (read): more string mlabel and mname to where they are used
4411 (read): remove unused variables mlabel and mname
4412 (defaults): unconditional clear, make menusetup take advantage of
4413 add returning Menu &.
4415 * src/LyXView.h: define NEW_MENUBAR as default
4417 * src/LyXAction.C: include lyxparagraph.h temporary to get access
4418 to NEW_INSETS and NEW_TABULAR.
4419 (init): commetn out some funcs that is obsolete when NEW_INSETS is
4420 defined. Change some of the "xxxx-inset-insert" functions names to
4423 * several files: more enahncements to NEW_INSETS and the resulting
4426 * lib/lyxrc.example (\date_insert_format): move to misc section
4428 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
4429 bastring and use AC_CACHE_CHECK.
4430 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
4431 the system have the newest methods. uses AC_CACHE_CHECK
4432 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
4433 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
4434 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
4436 * configure.in: add LYX_CXX_GOOD_STD_STRING
4438 * acinclude.m4: recreated
4440 2000-07-24 Amir Karger <karger@lyx.org>
4442 * README: add Hebrew, Arabic kmaps
4445 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4447 * src/buffer.C (writeFileAscii): Define actcell as an int instead
4450 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4452 * Lot of files: add pragma interface/implementation.
4454 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
4456 * lib/ui/default.ui: new file (ans new directory). Contains the
4457 default menu and toolbar.
4459 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
4460 global space. Toolbars are now read (as menus) in ui files.
4462 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
4464 * src/lyxfunc.C (getStatus): do not exit immediately if a command
4465 is disabled because the document is read-only. We want to have the
4466 toggle state of the function anyway.
4467 (getStatus): add code for LFUN_VC* functions (mimicking what is
4468 done in old-style menus)
4470 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
4471 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
4473 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
4474 * src/BufferView_pimpl.C: ditto.
4475 * src/lyxfunc.C: ditto.
4477 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
4478 default). This replaces old-style menus by new ones.
4480 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
4481 MenuItem. Contain the data structure of a menu.
4483 * src/insets/insettext.C: use LyXView::setLayout instead of
4484 accessing directly the toolbar combox.
4485 * src/lyxfunc.C (Dispatch): ditto.
4487 * src/LyXView.C (setLayout): new method, which just calls
4488 Toolbar::setLayout().
4489 (updateLayoutChoice): move part of this method in Toolbar.
4491 * src/toolbar.[Ch]: removed.
4493 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
4494 implementation the toolbar.
4496 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
4497 the toolbar. It might make sense to merge it with ToolbarDefaults
4499 (setLayout): new function.
4500 (updateLayoutList): ditto.
4501 (openLayoutList): ditto.
4503 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
4504 xforms implementation of the toolbar.
4505 (get_toolbar_func): comment out, since I do not
4506 know what it is good for.
4508 * src/ToolbarDefaults.h: Add the ItemType enum.
4510 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
4511 for a list of allocated C strings. Used in Menubar xforms
4512 implementation to avoid memory leaks.
4514 * src/support/lstrings.[Ch] (uppercase): new version taking and
4518 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
4519 * lib/bind/emacs.bind: ditto.
4521 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4523 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
4524 forward decl of LyXView.
4526 * src/toolbar.C (toolbarItem): moved from toolbar.h
4527 (toolbarItem::clean): ditto
4528 (toolbarItem::~toolbarItem): ditto
4529 (toolbarItem::operator): ditto
4531 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
4533 * src/paragraph.h: control the NEW_TABULAR define from here
4535 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
4536 USE_TABULAR_INSETS to NEW_TABULAR
4538 * src/ToolbarDefaults.C: add include "lyxlex.h"
4540 * files using the old table/tabular: use NEW_TABULAR to control
4541 compilation of old tabular stuff.
4543 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
4546 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
4547 planemet in reading of old style floats, fix the \end_deeper
4548 problem when reading old style floats.
4550 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4552 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
4554 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
4556 * lib/bind/sciword.bind: updated.
4558 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4560 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
4561 layout write problem
4563 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4565 * src/Makefile.am (INCLUDES): remove image directory from include
4568 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
4569 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
4571 * src/LyXView.C (create_form_form_main): read the application icon
4574 * lib/images/*.xpm: change the icons to use transparent color for
4577 * src/toolbar.C (update): change the color of the button when it
4580 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4582 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
4583 setting explicitely the minibuffer.
4584 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
4586 * src/LyXView.C (showState): new function. Shows font information
4587 in minibuffer and update toolbar state.
4588 (LyXView): call Toolbar::update after creating the
4591 * src/toolbar.C: change toollist to be a vector instead of a
4593 (BubbleTimerCB): get help string directly from the callback
4594 argument of the corresponding icon (which is the action)
4595 (set): remove unnecessary ugliness.
4596 (update): new function. update the icons (depressed, disabled)
4597 depending of the status of the corresponding action.
4599 * src/toolbar.h: remove help in toolbarItem
4601 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
4603 * src/Painter.C (text): Added code for using symbol glyphs from
4604 iso10646 fonts. Currently diabled.
4606 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
4609 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
4610 magyar,turkish and usorbian.
4612 * src/paragraph.C (isMultiLingual): Made more efficient.
4614 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
4617 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
4618 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
4619 Also changed the prototype to "bool math_insert_greek(char)".
4621 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4623 * lots of files: apply the NEW_INSETS on all code that will not be
4624 needed when we move to use the new insets. Enable the define in
4625 lyxparagrah.h to try it.
4627 * src/insets/insettabular.C (cellstart): change to be a static
4629 (InsetTabular): initialize buffer in the initializer list.
4631 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
4633 * src/frontends/xforms/FormPrint.[Ch] : moved #include
4634 form_print.h out of the header file. Replaced with forward
4635 declarations of the relevant struct.
4637 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
4640 * src/commandtags.h: do not include "debug.h" which does not
4641 belong there. #include it in some other places because of this
4644 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4646 * src/insets/insetcaption.C: add a couple "using" directives.
4648 * src/toolbar.C (add): get the help text directly from lyxaction.
4650 (setPixmap): new function. Loads from disk and sets a pixmap on a
4651 botton; the name of the pixmap file is derived from the command
4654 * src/toolbar.h: remove members isBitmap and pixmap from
4657 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
4658 * lib/images/: move many files from images/banner.xpm.
4660 * src/lyx_gui.C (create_forms): read banner pixmap from file.
4662 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
4663 * src/toolbar.C: ditto.
4664 * configure.in: ditto.
4665 * INSTALL: document.
4667 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
4668 the spellchecker popup is closed from the WM.
4670 2000-07-19 Juergen Vigna <jug@sad.it>
4672 * src/insets/insetfloat.C (Write): small fix because we use the
4673 insetname for the type now!
4675 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
4677 * src/frontends/xforms/forms/form_citation.fd: object sizes are
4680 * src/frontends/Dialogs.h: removed hideCitation signal
4682 * src/insets/insetcite.h: added hide signal
4684 * src/insets/insetcite.C (~InsetCitation): emits new signal
4685 (getScreenLabel): "intelligent" label should now fit on the screen!
4687 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
4689 * src/frontends/xforms/FormCitation.C (showInset): connects
4690 hide() to the inset's hide signal
4691 (show): modified to use fl_set_object_position rather than
4692 fl_set_object_geometry wherever possible
4694 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4696 * src/insets/lyxinset.h: add caption code
4698 * src/insets/insetfloat.C (type): new method
4700 * src/insets/insetcaption.C (Write): new method
4702 (LyxCode): new method
4704 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
4705 to get it right together with using the FloatList.
4707 * src/commandtags.h: add LFUN_INSET_CAPTION
4708 * src/lyxfunc.C (Dispatch): handle it
4710 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
4713 * src/Variables.[Ch]: make expand take a const reference, remove
4714 the destructor, some whitespace changes.
4716 * src/LyXAction.C (init): add caption-inset-insert
4718 * src/FloatList.C (FloatList): update the default floats a bit.
4720 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4722 * src/Variables.[Ch]: new files. Intended to be used for language
4723 specific strings (like \chaptername) and filename substitution in
4726 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
4728 * lib/kbd/american.kmap: update
4730 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
4732 * src/bufferparams.[Ch]: remove member allowAccents.
4734 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
4736 * src/LaTeXLog.C: use the log_form.h header.
4737 * src/lyx_gui.C: ditto.
4738 * src/lyx_gui_misc.C: ditto.
4739 * src/lyxvc.h: ditto.
4741 * forms/log_form.fd: new file, created from latexoptions.fd. I
4742 kept the log popup and nuked the options form.
4744 * src/{la,}texoptions.[Ch]: removed.
4745 * src/lyx_cb.C (LaTeXOptions): ditto
4747 * src/lyx_gui.C (create_forms): do not handle the
4748 fd_latex_options form.
4750 2000-07-18 Juergen Vigna <jug@sad.it>
4752 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
4753 name of the inset so that it can be requested outside (text2.C).
4755 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
4758 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4760 * src/mathed/formula.h (ConvertFont): constify
4762 * src/mathed/formula.C (Read): add warning if \end_inset is not
4763 found on expected place.
4765 * src/insets/lyxinset.h (ConvertFont): consify
4767 * src/insets/insetquotes.C (ConvertFont): constify
4768 * src/insets/insetquotes.h: ditto
4770 * src/insets/insetinfo.h: add labelfont
4772 * src/insets/insetinfo.C (InsetInfo): set the labelfont
4773 (ascent): use labelfont
4777 (Write): make .lyx file a bit nicer
4779 * src/insets/insetfloat.C (Write): simplify somewhat...
4780 (Read): add warning if arg is not found
4782 * src/insets/insetcollapsable.C: add using std::max
4783 (Read): move string token and add warning in arg is not found
4784 (draw): use std::max to get the right ty
4785 (getMaxWidth): simplify by using std::max
4787 * src/insets/insetsection.h: new file
4788 * src/insets/insetsection.C: new file
4789 * src/insets/insetcaption.h: new file
4790 * src/insets/insetcaption.C: new file
4792 * src/insets/inset.C (ConvertFont): constify signature
4794 * src/insets/Makefile.am (libinsets_la_SOURCES): add
4795 insetcaption.[Ch] and insetsection.[Ch]
4797 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
4798 uses to use LABEL_COUNTER_CHAPTER instead.
4799 * src/text2.C (SetCounter): here
4801 * src/counters.h: new file
4802 * src/counters.C: new file
4803 * src/Sectioning.h: new file
4804 * src/Sectioning.C: new file
4806 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
4808 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4810 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
4813 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
4816 2000-07-17 Juergen Vigna <jug@sad.it>
4818 * src/tabular.C (Validate): check if array-package is needed.
4819 (SetVAlignment): added support for vertical alignment.
4820 (SetLTFoot): better support for longtable header/footers
4821 (Latex): modified to support added features.
4823 * src/LaTeXFeatures.[Ch]: added array-package.
4825 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
4827 * src/lyx_gui.C (LyXGUI): make sure that the height is large
4830 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
4832 * configure.in: do not forget to put a space after -isystem.
4834 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
4836 * lib/kbd/arabic.kmap: a few fixes.
4838 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4840 * some whitespace chagnes to a number of files.
4842 * src/support/DebugStream.h: change to make it easier for
4843 doc++ to parse correctly.
4844 * src/support/lyxstring.h: ditto
4846 * src/mathed/math_utils.C (compara): change to have only one
4848 (MathedLookupBOP): change because of the above.
4850 * src/mathed/math_delim.C (math_deco_compare): change to have only
4852 (search_deco): change becasue of the above.
4854 * src/insets/insettabular.C (DrawCellSelection): use std::swap
4855 instead of manually coded one.
4857 * src/insets/insetquotes.C (Read): read the \end_inset too
4859 * src/insets/insetlatex.h: remove file
4860 * src/insets/insetlatex.C: remove file
4862 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
4864 (InsetPrintIndex): remove destructor
4866 * src/insets/insetinclude.h: remove default constructor
4868 * src/insets/insetfloat.C: work to make it work better
4870 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
4872 * src/insets/insetcite.h (InsetCitation): remove default constructor
4874 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
4876 * src/text.C (GetColumnNearX): comment out some currently unused code.
4878 * src/paragraph.C (writeFile): move some initializations closer to
4880 (CutIntoMinibuffer): small change to use new matchIT operator
4884 (InsertInset): ditto
4887 (InsetIterator): ditto
4888 (Erase): small change to use new matchFT operator
4890 (GetFontSettings): ditto
4891 (HighestFontInRange): ditto
4894 * src/lyxparagraph.h: some chars changed to value_type
4895 (matchIT): because of some stronger checking (perhaps too strong)
4896 in SGI STL, the two operator() unified to one.
4899 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
4901 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
4902 the last inset read added
4903 (parseSingleLyXformat2Token): some more (future) compability code added
4904 (parseSingleLyXformat2Token): warning about solitary \end_inset added
4905 (parseSingleLyXformat2Token): set last_inset_read
4906 (parseSingleLyXformat2Token): more code to read new "Float" correctly
4907 (parseSingleLyXformat2Token): don't double intializw string next_token
4909 * src/TextCache.C (text_fits::operator()): add const's to the signature
4910 (has_buffer::operator()): ditto
4912 * src/Floating.h: add some comments on the class
4914 * src/FloatList.[Ch] (typeExist): new method
4917 * src/BackStack.h: added default constructor, wanted by Gcc.
4919 2000-07-14 Juergen Vigna <jug@sad.it>
4921 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
4923 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
4925 * src/insets/insettabular.C (resizeLyXText): need this to be able to
4926 do a redraw when the window is resized!
4927 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
4929 * src/insets/insettext.C (resizeLyXText): added function to correctly
4930 being able to resize the LyXWindow.
4932 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
4934 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
4936 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
4937 crashes when closing dialog to a deleted inset.
4939 * src/insets/insetcite.[Ch] (Edit) : the return of this former
4940 method! Now similar to other insets.
4942 2000-07-13 Juergen Vigna <jug@sad.it>
4944 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
4946 * lib/examples/Literate.lyx: small patch!
4948 * src/insets/insetbib.C (Read): added this function because of wrong
4949 Write (without [begin|end]_inset).
4951 2000-07-11 Juergen Vigna <jug@sad.it>
4953 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
4954 as the insertInset could not be good!
4956 * src/screen.C (ToggleSelection): fixed toggle selection bug as
4957 the bool param should not be last.
4959 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4961 * sigc++/configure.in: fix bug in threading-related code (Yes, I
4962 did submit that to Karl).
4964 * configure.in: use -isystem instead of -I for X headers. This
4965 fixes a problem on solaris with a recent gcc;
4966 put the front-end code after the X detection code;
4967 configure in sigc++ before lib/
4969 * src/lyx_main.C (commandLineHelp): remove -display from command
4972 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
4974 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
4975 Also put in Makefile rules for building the ``listerrors''
4976 program for parsing errors from literate programs written in LyX.
4978 * lib/build-listerrors: Added small shell script as part of compile
4979 process. This builds a working ``listerrors'' binary if noweb is
4980 installed and either 1) the VNC X server is installed on the machine,
4981 or 2) the user is compiling from within a GUI. The existence of a GUI
4982 is necessary to use the ``lyx --export'' feature for now. This
4983 hack can be removed once ``lyx --export'' no longer requires a GUI to
4986 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
4988 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
4989 now passed back correctly from gcc and placed "under" error
4990 buttons in a Literate LyX source.
4992 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4994 * src/text.C (GetColumnNearX): Better behavior when a RTL
4995 paragraph is ended by LTR text.
4997 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
5000 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5002 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
5003 true when clipboard is empty.
5005 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5007 * text.C (Backspace): Prevent rebreaking of a row if it is the last
5008 row of the paragraph.
5009 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
5010 to prevent calculation of bidi tables
5012 2000-07-07 Juergen Vigna <jug@sad.it>
5014 * src/screen.C (ToggleSelection): added y_offset and x_offset
5017 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
5020 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
5022 * src/insets/insettext.C: fixed Layout-Display!
5024 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5026 * configure.in: add check for strings.h header.
5028 * src/spellchecker.C: include <strings.h> in order to have a
5029 definition for bzero().
5031 2000-07-07 Juergen Vigna <jug@sad.it>
5033 * src/insets/insettext.C (draw): set the status of the bv->text to
5034 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
5036 * src/screen.C (DrawOneRow):
5037 (DrawFromTo): redraw the actual row if something has changed in it
5040 * src/text.C (draw): call an update of the toplevel-inset if something
5041 has changed inside while drawing.
5043 * src/lyxtext.h: added CHANGED_IN_DRAW status.
5045 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
5047 * src/insets/insetbib.[Ch] (callback) new method, moving callback
5048 processing inside class.
5050 * src/insets/insetindex.[Ch] (callback) new method, moving callback
5051 processing inside class.
5053 * src/insets/insetindex.h new struct Holder, consistent with other
5056 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
5057 citation dialog from main code and placed it in src/frontends/xforms.
5058 Dialog launched through signals instead of callbacks
5060 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
5062 * lyx.man: update the options description.
5064 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
5066 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
5067 handle neg values, set min width to 590, add doc about -display
5069 2000-07-05 Juergen Vigna <jug@sad.it>
5071 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
5072 calls to BufferView *.
5074 * src/insets/insettext.C (checkAndActivateInset): small fix non
5075 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
5077 * src/insets/insetcommand.C (Read): Fixed as insets should read till
5078 their \end_inset token!
5080 2000-07-04 edscott <edscott@imp.mx>
5082 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
5083 lib/lyxrc.example: added option \wheel_jump
5085 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
5087 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
5088 remove support for -width,-height,-xpos and -ypos.
5090 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
5092 * src/encoding.[Ch]: New files.
5094 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
5095 (text): Call to the underline() method only when needed.
5097 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
5099 * src/buffer.C (makeLaTeXFile): Compute automatically the input
5100 encoding(s) for the document.
5102 * src/bufferparams.C (BufferParams): Changed default value of
5105 * src/language.C (newLang): Removed.
5106 (items[]): Added encoding information for all defined languages.
5108 * src/lyx_gui.C (create_forms): Added "auto" option to the input
5109 encoding choice button.
5111 * src/lyxrc.h (font_norm_type): New member variable.
5112 (set_font_norm_type): New method.
5114 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
5115 paragraphs with different encodings.
5117 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
5118 (TransformChar): Changed to work correctly with Arabic points.
5119 (draw): Added support for drawing Arabic points.
5120 (draw): Removed code for drawing underbars (this is done by
5123 * src/support/textutils.h (IsPrintableNonspace): New function.
5125 * src/BufferView_pimpl.h: Added "using SigC::Object".
5126 * src/LyXView.h: ditto.
5128 * src/insets/insetinclude.h (include_label): Changed to mutable.
5130 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5132 * src/mathed/math_iter.h: remove empty destructor
5134 * src/mathed/math_cursor.h: remove empty destructor
5136 * src/insets/lyxinset.h: add THEOREM_CODE
5138 * src/insets/insettheorem.[Ch]: new files
5140 * src/insets/insetminipage.C: (InsertInset): remove
5142 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
5144 (InsertInset): remove
5146 * src/insets/insetlist.C: (InsertList): remove
5148 * src/insets/insetfootlike.[Ch]: new files
5150 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
5153 (InsertInset): ditto
5155 * src/insets/insetert.C: remove include Painter.h, reindent
5156 (InsertInset): move to header
5158 * src/insets/insetcollapsable.h: remove explicit from default
5159 contructor, remove empty destructor, add InsertInset
5161 * src/insets/insetcollapsable.C (InsertInset): new func
5163 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5165 * src/vspace.h: add explicit to constructor
5167 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
5168 \textcompwordmark, please test this.
5170 * src/lyxrc.C: set ascii_linelen to 65 by default
5172 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
5174 * src/commandtags.h: add LFUN_INSET_THEOREM
5176 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
5177 (makeLinuxDocFile): remove _some_ of the nice logic
5178 (makeDocBookFile): ditto
5180 * src/Painter.[Ch]: (~Painter): removed
5182 * src/LyXAction.C (init): entry for insettheorem added
5184 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
5186 (deplog): code to detect files generated by LaTeX, needs testing
5189 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5191 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
5193 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5195 * src/LaTeX.C (deplog): Add a check for files that are going to be
5196 created by the first latex run, part of the project to remove the
5199 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
5200 contents to the extension list.
5202 2000-07-04 Juergen Vigna <jug@sad.it>
5204 * src/text.C (NextBreakPoint): added support for needFullRow()
5206 * src/insets/lyxinset.h: added needFullRow()
5208 * src/insets/insetcollapsable.C: redone now this uses a text-inset
5211 * src/insets/insettext.C: lots of changes for update!
5213 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
5215 * src/LaTeXFeatures.h: add a missing std:: qualifier.
5217 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
5219 * src/insets/insetinclude.C (InsetInclude): fixed
5220 initialization of include_label.
5221 (unique_id): now returns a string.
5223 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
5225 * src/LaTeXFeatures.h: new member IncludedFiles, for
5226 a map of key, included file name.
5228 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
5229 with the included files for inclusion in SGML preamble,
5230 i. e., linuxdoc and docbook.
5233 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
5234 nice (is the generated linuxdoc code to be exported?), that
5235 allows to remove column, and only_body that will be true for
5236 slave documents. Insets are allowed inside SGML font type.
5237 New handling of the SGML preamble for included files.
5238 (makeDocBookFile): the same for docbook.
5240 * src/insets/insetinclude.h:
5241 * src/insets/insetinclude.C (Validate): keeps a list of included files.
5243 (DocBook): new export methods.
5245 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
5246 and makeDocBookFile.
5248 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
5249 formats to export with command line argument -x.
5251 2000-06-29 Juergen Vigna <jug@sad.it>
5253 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
5254 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
5256 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
5257 region could already been cleared by an inset!
5259 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5261 * src/BufferView_pimpl.h: remove member variables lyx_focus and
5264 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
5266 (cursorToggle): remove special handling of lyx focus.
5268 2000-06-28 Juergen Vigna <jug@sad.it>
5270 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
5273 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5275 * src/insets/insetindex.C (Edit): add a callback when popup is
5278 * src/insets/insettext.C (LocalDispatch):
5279 * src/insets/insetmarginal.h:
5280 * src/insets/insetlist.h:
5281 * src/insets/insetfoot.h:
5282 * src/insets/insetfloat.h:
5283 * src/insets/insetert.h: add a missing std:: qualifier.
5285 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5287 * src/support/lyxsum.C (sum): '\0' teminate file read when using
5290 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
5292 * src/insets/insettext.C (Read): remove tmptok unused variable
5293 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
5294 (InsertInset): change for new InsetInset code
5296 * src/insets/insettext.h: add TEXT inline method
5298 * src/insets/insettext.C: remove TEXT macro
5300 * src/insets/insetmarginal.C (Write): new method
5301 (Latex): change output slightly
5303 * src/insets/insetfoot.C (Write): new method
5304 (Latex): change output slightly (don't use endl when no need)
5306 * src/insets/insetert.C (Write): new method
5308 * src/insets/insetcollapsable.h: make button_length, button_top_y
5309 and button_bottm_y protected.
5311 * src/insets/insetcollapsable.C (Write): simplify code by using
5312 tostr. Also do not output the float name, the children class
5313 should to that to get control over own arguments
5315 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
5316 src/insets/insetminipage.[Ch]:
5319 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5321 * src/lyxfunc.C (Dispatch): cases for new insets/commands
5323 * src/Makefile.am (lyx_SOURCES): add the new files
5325 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
5326 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
5327 * src/commandtags.h: ditto
5329 * src/LaTeXFeatures.h: add a std::set of used floattypes
5331 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
5333 * src/FloatList.[Ch] src/Floating.h: new files
5335 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
5337 * src/lyx_cb.C (TableApplyCB): ditto
5339 * src/text2.C: ditto
5340 * src/buffer.C (SimpleLinuxDocOnePar): ditto
5341 (parseSingleLyXformat2Token): ditto + add code for
5342 backwards compability for old float styles + add code for new insets
5344 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
5346 (InsertInset(size_type, Inset *, LyXFont)): new method
5347 (InsetChar(size_type, char)): changed to use the other InsetChar
5348 with a LyXFont(ALL_INHERIT).
5349 (InsetInset(size_type, Inset*)): changed to use InsetChar to
5350 insert the META_INSET.
5352 * sigc++/thread.cc (Privete<int>::operator int&): move definition
5354 * sigc++/thread.h (Threads): from here
5356 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
5357 definition out of line
5358 * sigc++/scope.h: from here
5360 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5362 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
5363 is specified (adapted from a patch from edscott <edscott@imp.mx>).
5365 * Makefile.am (bindist): new target.
5367 * INSTALL: add instructions for doing a binary distribution.
5369 * development/tools/README.bin.example: update a bit.
5371 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
5374 * lib/lyxrc.example: new lyxrc tag \set_color.
5376 * src/lyxfunc.C (Dispatch):
5377 * src/commandtags.h:
5378 * src/LyXAction.C: new lyxfunc "set-color".
5380 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
5381 and an x11name given as strings.
5383 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
5384 cache when a color is changed.
5386 2000-06-26 Juergen Vigna <jug@sad.it>
5388 * src/lyxrow.C (width): added this functions and variable.
5390 * src/insets/insetcite.C (create_form_citation_form): some Gravity
5393 * src/text.C (SetHeightOfRow): fixed calcualting of width.
5395 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5397 * images/undo_bw.xpm: new icon.
5398 * images/redo_bw.xpm: ditto.
5400 * configure.in (INSTALL_SCRIPT): change value to
5401 ${INSTALL} to avoid failures of install-script target.
5402 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
5404 * src/BufferView.h: add a magic "friend" declaration to please
5407 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
5409 * forms/cite.fd: modified to allow resizing without messing
5412 * src/insetcite.C: Uses code from cite.fd almost without
5414 User can now resize dialog in the x-direction.
5415 Resizing the dialog in the y-direction is prevented, as the
5416 code does this intelligently already.
5418 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5420 * INSTALL: remove obsolete entry in "problems" section.
5422 * lib/examples/sl_*.lyx: update of the slovenian examples.
5424 * src/support/FileInfo.[Ch] (getBlockSize): remove.
5426 2000-06-23 Juergen Vigna <jug@sad.it>
5428 * src/lyxtext.h: added a 'cleared' flag to draw() function.
5430 * src/buffer.C (resize): delete the LyXText of textinsets.
5432 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
5434 * src/insets/lyxinset.h: added another parameter 'cleared' to
5435 the draw() function.
5437 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
5438 unlocking inset in inset.
5440 2000-06-22 Juergen Vigna <jug@sad.it>
5442 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
5443 of insets and moved first to LyXText.
5445 * src/mathed/formulamacro.[Ch]:
5446 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
5448 2000-06-21 Juergen Vigna <jug@sad.it>
5450 * src/text.C (GetVisibleRow): look if I should clear the area or not
5451 using Inset::doClearArea() function.
5453 * src/insets/lyxinset.h: added doClearArea() function and
5454 modified draw(Painter &, ...) to draw(BufferView *, ...)
5456 * src/text2.C (UpdateInset): return bool insted of int
5458 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
5460 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
5461 combox in the character popup
5463 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
5464 BufferParams const & params
5466 2000-06-20 Juergen Vigna <jug@sad.it>
5468 * src/insets/insettext.C (SetParagraphData): set insetowner on
5471 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5473 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
5474 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
5476 (form_main_): remove
5478 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
5479 (create_form_form_main): remove FD_form_main stuff, connect to
5480 autosave_timeout signal
5482 * src/LyXView.[Ch] (getMainForm): remove
5483 (UpdateTimerCB): remove
5484 * src/BufferView_pimpl.h: inherit from SigC::Object
5486 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
5487 signal instead of callback
5489 * src/BufferView.[Ch] (cursorToggleCB): remove
5491 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5493 * src/BufferView_pimpl.C: changes because of the one below
5495 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
5496 instead of storing a pointer to a LyXText.
5498 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
5500 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
5502 * src/lyxparagraph.h
5504 * src/paragraph.C: Changed fontlist to a sorted vector.
5506 2000-06-19 Juergen Vigna <jug@sad.it>
5508 * src/BufferView.h: added screen() function.
5510 * src/insets/insettext.C (LocalDispatch): some selection code
5513 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
5515 * src/insets/insettext.C (SetParagraphData):
5517 (InsetText): fixes for multiple paragraphs.
5519 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
5521 * development/lyx.spec.in: Call configure with ``--without-warnings''
5522 to work around a bug with the Makefiles when doing ``make lyxrpm''.
5523 This should be fine, however, since we generally don't want to be
5524 verbose when making an RPM.
5526 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
5528 * lib/scripts/fig2pstex.py: New file
5530 2000-06-16 Juergen Vigna <jug@sad.it>
5532 * src/insets/insettabular.C (UpdateLocal):
5533 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
5534 (LocalDispatch): Changed all functions to use LyXText.
5536 2000-06-15 Juergen Vigna <jug@sad.it>
5538 * src/text.C (SetHeightOfRow): call inset::update before requesting
5541 * src/insets/insettext.C (update):
5542 * src/insets/insettabular.C (update): added implementation
5544 * src/insets/lyxinset.h: added update function
5546 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5548 * src/text.C (SelectNextWord): protect against null pointers with
5549 old-style string streams. (fix from Paul Theo Gonciari
5552 * src/cite.[Ch]: remove erroneous files.
5554 * lib/configure.m4: update the list of created directories.
5556 * src/lyxrow.C: include <config.h>
5557 * src/lyxcursor.C: ditto.
5559 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5561 * lib/examples/decimal.lyx: new example file from Mike.
5563 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
5564 to find template definitions (from Dekel)
5566 * src/frontends/.cvsignore: add a few things.
5568 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
5570 * src/Timeout.C (TimeOut): remove default argument.
5572 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
5575 * src/insets/ExternalTemplate.C: add a "using" directive.
5577 * src/lyx_main.h: remove the act_ struct, which seems unused
5580 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5582 * LyX Developers Meeting: All files changed, due to random C++ (by
5583 coincidence) code generator script.
5585 - external inset (cool!)
5586 - initial online editing of preferences
5587 - insettabular breaks insettext(s contents)
5589 - some DocBook fixes
5590 - example files update
5591 - other cool stuff, create a diff and look for yourself.
5593 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
5595 * src/insets/insettext.C (computeTextRows): if the maxWidth is
5596 -1 this is a non-line-breaking textinset.
5598 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
5599 if there is no width set.
5601 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5603 * Lots of files: Merged the dialogbase branch.
5605 2000-06-09 Allan Rae <rae@lyx.org>
5607 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
5608 and the Dispatch methods that used it.
5610 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
5611 access to functions formerly kept in Dispatch.
5613 2000-05-19 Allan Rae <rae@lyx.org>
5615 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
5616 made to_page and count_copies integers again. from_page remains a
5617 string however because I want to allow entry of a print range like
5618 "1,4,22-25" using this field.
5620 * src/LyXAction.C: added action info and commands for buffer-print-xtl
5621 and printer-params-get. These aren't useful from the minibuffer but
5622 could be used by a script/LyXServer app provided it passes a suitable
5623 auto_mem_buffer. I guess I should take a look at how the LyXServer
5624 works and make it support xtl buffers.
5626 * sigc++/: updated to libsigc++-1.0.1
5628 * src/xtl/: updated to xtl-1.3.pl.11
5630 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
5631 those changes done to the files in src/ are actually recreated when
5632 they get regenerated. Please don't ever accept a patch that changes a
5633 dialog unless that patch includes the changes to the corresponding *.fd
5636 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
5637 stringOnlyContains, renamed it and generalised it.
5639 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
5640 branch. Removed the remaining old form_print code.
5642 2000-04-26 Allan Rae <rae@lyx.org>
5644 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
5645 trap I was trying to fix with the ID: fields in src/xtl/ :-)
5647 2000-04-25 Allan Rae <rae@lyx.org>
5649 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
5650 against a base of xtl-1.3.pl.4
5652 * development/tools/lxtl.sh: fixed a couple of silly typos and now
5653 filter the Id: entries so they still show the xtl version number
5656 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
5657 into the src/xtl code. Patch still pending with José (XTL)
5659 2000-04-24 Allan Rae <rae@lyx.org>
5661 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
5662 both more generic and much safer. Use the new template functions.
5663 * src/buffer.[Ch] (Dispatch): ditto.
5665 * src/frontends/xforms/FormPrint.C (update): Use new template functions
5666 and mem buffer more intelligently. Also a little general cleanup.
5669 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
5670 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
5671 * src/xtl/Makefile.am: ditto.
5672 * src/xtl/.cvsignore: ditto.
5673 * src/Makefile.am: ditto.
5675 * src/PrinterParams.h: Removed the macros member functions. Added a
5676 testInvariant member function. A bit of tidying up and commenting.
5677 Included Angus's idea for fixing operation with egcs-1.1.2.
5679 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
5680 cool expansion of XTL's mem_buffer to support automatic memory
5681 management within the buffer itself. Removed the various macros and
5682 replaced them with template functions that use either auto_mem_buffer
5683 or mem_buffer depending on a #define. The mem_buffer support will
5684 disappear as soon as the auto_mem_buffer is confirmed to be good on
5685 other platforms/compilers. That is, it's there so you've got something
5688 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
5689 effectively forked XTL. However I expect José will include my code
5690 into the next major release. Also fixed a memory leak.
5691 * src/xtl/text.h: ditto.
5692 * src/xtl/xdr.h: ditto.
5693 * src/xtl/giop.h: ditto.
5695 2000-04-16 Allan Rae <rae@lyx.org>
5697 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
5698 by autogen.sh and removed by maintainer-clean anyway.
5699 * .cvsignore, sigc++/.cvsignore: Support the above.
5701 * sigc++/.cvsignore: Forgot that retbind.h was generated.
5703 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
5705 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
5706 macros, renamed static callback-target member functions to suit new
5707 scheme and made them public.
5708 * src/frontends/xforms/forms/form_print.fd: ditto.
5709 * src/frontends/xforms/forms/form_copyright.fd: ditto.
5711 * src/support/lxtl.h: small cleanup to use typedef instead of #define
5714 * src/xtl/: New directory containing a minimal distribution of XTL.
5715 This is XTL-1.3.pl.4.
5717 * development/tools/lxtl.sh: A script to generate the above mini-dist.
5719 2000-04-15 Allan Rae <rae@lyx.org>
5721 * development/tools/makeLyXsigc.sh: Remove the library version numbers
5723 * sigc++/: Updated to libsigc++-1.0.0
5725 2000-04-14 Allan Rae <rae@lyx.org>
5727 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
5728 use the generic ones in future. I'll modify my conversion script.
5730 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
5732 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
5733 (CloseAllBufferRelatedDialogs): Renamed.
5734 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
5736 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
5737 of the generic ones. These are the same ones my conversion script
5740 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
5741 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
5742 * src/buffer.C (Dispatch): ditto
5744 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
5745 functions for updating and hiding buffer dependent dialogs.
5746 * src/BufferView.C (buffer): ditto
5747 * src/buffer.C (setReadonly): ditto
5748 * src/lyxfunc.C (CloseBuffer): ditto
5750 * src/buffer.h: Take setReadonly() out of line so I don't have to include
5751 Dialogs.h, and hence all the SigC stuff, into every file that includes
5752 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
5754 * src/BufferView2.C: reduce the number of headers included by buffer.h
5756 2000-04-11 Allan Rae <rae@lyx.org>
5758 * src/frontends/xforms/xform_macros.h: A small collection of macros
5759 for building C callbacks.
5761 * src/frontends/xforms/Makefile.am: Added above file.
5763 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
5764 scheme again. This time it should work for JMarc. If this is
5765 successful I'll revise my conversion script to automate some of this.
5766 The static member functions in the class also have to be public for
5767 this scheme will work. If the scheme works (it's almost identical to
5768 the way BufferView::cursorToggleCB is handled so it should work) then
5769 FormCopyright and FormPrint will be ready for inclusion into the main
5770 trunk immediately after 1.1.5 is released -- provided we're prepared
5771 for complaints about lame compilers not handling XTL.
5773 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
5775 2000-04-07 Allan Rae <rae@lyx.org>
5777 * config/lyxinclude.m4: A bit more tidying up (Angus)
5779 * src/LString.h: JMarc's <string> header fix
5781 * src/PrinterParams.h: Used string for most data to remove some
5782 ugly code in the Print dialog and avoid even uglier code when
5783 appending the ints to a string for output.
5785 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
5786 and moved "default:" back to the end of switch statement. Cleaned
5787 up the printing so it uses the right function calls and so the
5788 "print to file" option actually puts the file in the right directory.
5790 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
5792 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
5793 and Ok+Apply button control into a separate method: input (Angus).
5794 (input) Cleaned it up and improved it to be very thorough now.
5795 (All CB) static_cast used instead of C style cast (Angus). This will
5796 probably change again once we've worked out how to keep gcc-2.8.1 happy
5797 with real C callbacks.
5798 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
5799 ignore some of the bool settings and has random numbers instead. Needs
5800 some more investigation. Added other input length checks and checking
5801 of file and printer names.
5803 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
5804 would link (Angus). Seems the old code doesn't compile with the pragma
5805 statement either. Separated callback entries from internal methods.
5807 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
5809 2000-03-17 Allan Rae <rae@lyx.org>
5811 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
5812 need it? Maybe it could go in Dialogs instead? I could make it a
5813 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
5814 values to get the bool return value.
5815 (Dispatch): New overloaded method for xtl support.
5817 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
5818 extern "C" callback instead of static member functions. Hopefully,
5819 JMarc will be able to compile this. I haven't changed
5820 forms/form_copyright.fd yet. Breaking one of my own rules already.
5822 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
5823 because they aren't useful from the minibuffer. Maybe a LyXServer
5824 might want a help message though?
5826 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
5828 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
5829 xtl which needs both rtti and exceptions.
5831 * src/support/Makefile.am:
5832 * src/support/lxtl.h: New file. Some helper macros for using XTL.
5834 * src/frontends/xforms/input_validators.[ch]: input filters and
5835 validators. These conrol what keys are valid in input boxes.
5836 Use them and write some more. Much better idea than waiting till
5837 after the user has pressed Ok to say that the input fields don't make
5840 * src/frontends/xforms/Makefile.am:
5841 * src/frontends/xforms/forms/form_print.fd:
5842 * src/frontends/xforms/forms/makefile:
5843 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
5844 new scheme. Still have to make sure I haven't missed anything from
5845 the current implementation.
5847 * src/Makefile.am, src/PrinterParams.h: New data store.
5849 * other files: Added a couple of copyright notices.
5851 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5853 * src/insets/insetbib.h: move Holder struct in public space.
5855 * src/frontends/include/DialogBase.h: use SigC:: only when
5856 SIGC_CXX_NAMESPACES is defined.
5857 * src/frontends/include/Dialogs.h: ditto.
5859 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
5861 * src/frontends/xforms/FormCopyright.[Ch]: do not
5862 mention SigC:: explicitely.
5864 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5866 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
5867 deals with testing KDE in main configure.in
5868 * configure.in: ditto.
5870 2000-02-22 Allan Rae <rae@lyx.org>
5872 * Lots of files: Merged from HEAD
5874 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
5875 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
5877 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
5879 * sigc++/: new minidist.
5881 2000-02-14 Allan Rae <rae@lyx.org>
5883 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
5885 2000-02-08 Juergen Vigna <jug@sad.it>
5887 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
5888 file for the buildin GUI builder of KDevelop of the copyright-dialog.
5890 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
5891 for this port and so it is much easier for other people to port
5892 dialogs in a common development environment.
5894 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
5895 the QT/KDE implementation.
5897 * src/frontends/kde/Dialogs.C:
5898 * src/frontends/kde/FormCopyright.C:
5899 * src/frontends/kde/FormCopyright.h:
5900 * src/frontends/kde/Makefile.am:
5901 * src/frontends/kde/formcopyrightdialog.C:
5902 * src/frontends/kde/formcopyrightdialog.h:
5903 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
5904 for the kde support of the Copyright-Dialog.
5906 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
5907 subdir-substitution instead of hardcoded 'xforms' as we now have also
5910 * src/frontends/include/DialogBase.h (Object): just commented the
5911 label after #endif (nasty warning and I don't like warnings ;)
5913 * src/main.C (main): added KApplication initialization if using
5916 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
5917 For now only the KDE event-loop is added if frontend==kde.
5919 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
5921 * configure.in: added support for the --with-frontend[=value] option
5923 * autogen.sh: added kde.m4 file to list of config-files
5925 * acconfig.h: added define for KDEGUI-support
5927 * config/kde.m4: added configuration functions for KDE-port
5929 * config/lyxinclude.m4: added --with-frontend[=value] option with
5930 support for xforms and KDE.
5932 2000-02-08 Allan Rae <rae@lyx.org>
5934 * all Makefile.am: Fixed up so the make targets dist, distclean,
5935 install and uninstall all work even if builddir != srcdir. Still
5936 have a new sigc++ minidist update to come.
5938 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
5940 2000-02-01 Allan Rae <rae@lyx.org>
5942 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
5943 Many mods to get builddir != srcdir working.
5945 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
5946 for building on NT and so we can do the builddir != srcdir stuff.
5948 2000-01-30 Allan Rae <rae@lyx.org>
5950 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
5951 This will stay in "rae" branch. We probably don't really need it in
5952 the main trunk as anyone who wants to help programming it should get
5953 a full library installed also. So they can check both included and
5954 system supplied library compilation.
5956 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
5957 Added a 'mini' distribution of libsigc++. If you feel the urge to
5958 change something in these directories - Resist it. If you can't
5959 resist the urge then you should modify the following script and rebuild
5960 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
5961 all happen. Still uses a hacked version of libsigc++'s configure.in.
5962 I'm quite happy with the results. I'm not sure the extra work to turn
5963 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
5964 worth the trouble and would probably lead to extra maintenance
5966 I haven't tested the following important make targets: install, dist.
5967 Not ready for prime time but very close. Maybe 1.1.5.
5969 * development/tools/makeLyXsigc.sh: A shell script to automatically
5970 generate our mini-dist of libsigc++. It can only be used with a CVS
5971 checkout of libsigc++ not a tarball distribution. It's well commented.
5972 This will end up as part of the libsigc++ distribution so other apps
5973 can easily have an included mini-dist. If someone makes mods to the
5974 sigc++ subpackage without modifying this script to generate those
5975 changes I'll be very upset!
5977 * src/frontends/: Started the gui/system indep structure.
5979 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
5980 to access the gui-indep dialogs are in this class. Much improved
5981 design compared to previous revision. Lars, please refrain from
5982 moving this header into src/ like you did with Popups.h last time.
5984 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
5986 * src/frontends/xforms/: Started the gui-indep system with a single
5987 dialog: FormCopyright. Initial testing of use of libsigc++ was very
5990 * src/frontends/xforms/forms: Repository for the xforms .fd files.
5991 Here you'll find a very useful makefile and automated fdfix.sh that
5992 makes updating dailogs a no-brainer -- provided you follow the rules
5993 set out in the README. I'm thinking about adding another script to
5994 automatically generate skeleton code for a new dialog given just the
5997 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
5998 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
5999 Made FormCopyright gui-indep and added a lyxfunc to get to it.
6001 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6003 * src/support/LSubstring.C (operator): simplify
6005 * src/lyxtext.h: removed bparams, use buffer_->params instead
6007 * src/lyxrow.h: make Row a real class, move all variables to
6008 private and use accessors.
6010 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
6012 (isRightToLeftPar): ditto
6013 (ChangeLanguage): ditto
6014 (isMultiLingual): ditto
6017 (SimpleTeXOnePar): ditto
6018 (TeXEnvironment): ditto
6019 (GetEndLabel): ditto
6021 (SetOnlyLayout): ditto
6022 (BreakParagraph): ditto
6023 (BreakParagraphConservative): ditto
6024 (GetFontSettings): ditto
6026 (CopyIntoMinibuffer): ditto
6027 (CutIntoMinibuffer): ditto
6028 (PasteParagraph): ditto
6029 (SetPExtraType): ditto
6030 (UnsetPExtraType): ditto
6031 (DocBookContTableRows): ditto
6032 (SimpleDocBookOneTablePar): ditto
6034 (TeXFootnote): ditto
6035 (SimpleTeXOneTablePar): ditto
6036 (TeXContTableRows): ditto
6037 (SimpleTeXSpecialChars): ditto
6040 * src/lyxcursor.h: make LyXCursor a real class, move all variables
6041 to private and use accessors.
6043 * src/lyx_cb.C: remove char updatetimer, and all code that uses
6044 this, we did not use it anymore and has not been for ages. Just a
6045 waste of cpu cycles.
6047 * src/language.h: make Language a real class, move all variables
6048 to private and use accessors.
6050 * src/BufferView_pimpl.C (Pimpl): use new timer code.
6051 (create_view): remove
6052 (update): some changes for new timer
6053 (cursorToggle): use new timer
6054 (beforeChange): change for new timer
6056 * src/BufferView.h (cursorToggleCB): removed last paramter because
6059 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
6060 (cursorToggleCB): change because of new timer code
6062 * lib/CREDITS: updated own mailaddress
6064 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6066 * src/support/filetools.C (PutEnv): fix the code in case neither
6067 putenv() nor setenv() have been found.
6069 * INSTALL: mention the install-strip Makefile target.
6071 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
6072 read-only documents.
6074 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6076 * lib/reLyX/configure.in (VERSION): avoid using a previously
6077 generated reLyX wrapper to find out $prefix.
6079 * lib/examples/eu_adibide_lyx-atua.lyx:
6080 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
6081 translation of the Tutorial (Dooteo)
6083 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
6085 * forms/cite.fd: new citation dialog
6087 * src/insetcite.[Ch]: the new citation dialog is moved into
6090 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
6093 * src/insets/insetcommand.h: data members made private.
6095 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6097 * LyX 1.1.5 released
6099 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6101 * src/version.h (LYX_RELEASE): to 1.1.5
6103 * src/spellchecker.C (RunSpellChecker): return false if the
6104 spellchecker dies upon creation.
6106 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6108 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
6109 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
6113 * lib/CREDITS: update entry for Martin Vermeer.
6115 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
6117 * src/text.C (draw): Draw foreign language bars at the bottom of
6118 the row instead of at the baseline.
6120 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
6122 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6124 * lib/bind/de_menus.bind: updated
6126 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6128 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
6130 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6132 * src/menus.C (Limit_string_length): New function
6133 (ShowTocMenu): Limit the number of items/length of items in the
6136 * src/paragraph.C (String): Correct result for a paragraph inside
6139 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6141 * src/bufferlist.C (close): test of buf->getuser() == NULL
6143 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
6145 * src/BufferView2.C (removeAutoInsets): Fix a bug:
6146 Do not call to SetCursor when the paragraph is a closed footnote!
6148 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
6150 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
6153 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
6155 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6158 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
6159 reference popup, that activates the reference-back action
6161 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
6163 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
6164 the menus. Also fixed a bug.
6166 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
6167 the math panels when switching buffers (unless new buffer is readonly).
6169 * src/BufferView.C (NoSavedPositions)
6170 * src/BufferView_pimpl.C (NoSavedPositions): New methods
6172 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6174 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
6175 less of dvi dirty or not.
6177 * src/trans_mgr.[Ch] (insert): change first parameter to string
6180 * src/chset.[Ch] (encodeString): add const to first parameter
6182 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6184 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
6188 * src/LaTeX.C (deplog): better searching for dependency files in
6189 the latex log. Uses now regexps.
6191 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
6192 instead of the box hack or \hfill.
6194 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6196 * src/lyxfunc.C (doImportHelper): do not create the file before
6197 doing the actual import.
6198 (doImportASCIIasLines): create a new file before doing the insert.
6199 (doImportASCIIasParagraphs): ditto.
6201 * lib/lyxrc.example: remove mention of non-existing commands
6203 * lyx.man: remove mention of color-related switches.
6205 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
6207 * src/lyx_gui.C: remove all the color-related ressources, which
6208 are not used anymore.
6210 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
6213 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6215 * src/lyxrc.C (read): Add a missing break in the switch
6217 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
6219 * src/text2.C (InsertStringA): Fix a bug with insertion into table
6221 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
6224 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6226 * src/text.C (draw): draw bars under foreign language words.
6228 * src/LColor.[Ch]: add LColor::language
6230 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6232 * src/lyxcursor.h (boundary): New member variable
6234 * src/text.C (IsBoundary): New methods
6236 * src/text.C: Use the above for currect cursor movement when there
6237 is both RTL & LTR text.
6239 * src/text2.C: ditto
6241 * src/bufferview_funcs.C (ToggleAndShow): ditto
6243 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6245 * src/text.C (DeleteLineForward): set selection to true to avoid
6246 that DeleteEmptyParagraphMechanism does some magic. This is how it
6247 is done in all other functions, and seems reasonable.
6248 (DeleteWordForward): do not jump over non-word stuff, since
6249 CursorRightOneWord() already does it.
6251 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
6252 DeleteWordBackward, since they seem safe to me (since selection is
6253 set to "true") DeleteEmptyParagraphMechanism does nothing.
6255 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6257 * src/lyx_main.C (easyParse): simplify the code by factoring the
6258 part that removes parameters from the command line.
6259 (LyX): check wether wrong command line options have been given.
6261 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
6263 * src/lyx_main.C : add support for specifying user LyX
6264 directory via command line option -userdir.
6266 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
6268 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
6269 the number of items per popup.
6270 (Add_to_refs_menu): Ditto.
6272 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6274 * src/lyxparagraph.h: renamed ClearParagraph() to
6275 StripLeadingSpaces() and moved it to paragraph.C. We pass the
6276 textclass as parameter, and do nothing if free_spacing is
6277 true. This fixes part of the line-delete-forward problems.
6279 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
6280 (pasteSelection): ditto.
6281 (SwitchLayoutsBetweenClasses): more translatable strings.
6283 * src/text2.C (CutSelection): use StripLeadingSpaces.
6284 (PasteSelection): ditto.
6285 (DeleteEmptyParagraphMechanism): ditto.
6287 2000-05-26 Juergen Vigna <jug@sad.it>
6289 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
6290 is not needed in tabular insets.
6292 * src/insets/insettabular.C (TabularFeatures): added missing features.
6294 * src/tabular.C (DeleteColumn):
6296 (AppendRow): implemented this functions
6297 (cellsturct::operator=): clone the inset too;
6299 2000-05-23 Juergen Vigna <jug@sad.it>
6301 * src/insets/insettabular.C (LocalDispatch): better selection support
6302 when having multicolumn-cells.
6304 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6306 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
6308 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6310 * src/ColorHandler.C (getGCForeground): put more test into _()
6312 * lib/examples/eu_splash.lyx: new file (Basque translation) from
6315 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
6318 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
6320 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
6321 there are no labels, or when buffer is readonly.
6323 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
6324 there are no labels, buffer is SGML, or when buffer is readonly.
6326 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6328 * src/LColor.C (LColor): change a couple of grey40 to grey60
6329 (LColor): rewore initalization to make compiles go some magnitude
6331 (getGUIName): don't use gettext until we need the string.
6333 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
6335 * src/Bullet.[Ch]: Fixed a small bug.
6337 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
6339 * src/paragraph.C (String): Several fixes/improvements
6341 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
6343 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6345 * src/paragraph.C (String): give more correct output.
6347 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
6349 * src/lyxfont.C (stateText) Do not output the language if it is
6350 eqaul to the language of the document.
6352 * src/paragraph.C (TeXOnePar): Do not put language switch commands
6353 between two paragraphs with the same language.
6355 * src/paragraph.C (getParLanguage) Return a correct answer for an
6356 empty dummy paragraph.
6358 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
6361 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
6364 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
6365 the menus/popup, if requested fonts are unavailable.
6367 2000-05-22 Juergen Vigna <jug@sad.it>
6369 * src/insets/insettabular.C (LocalDispatch): added some more cursor
6370 movement support (Up/Down/Tab/Shift-Tab).
6371 (LocalDispatch): added also preliminari cursor-selection.
6373 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
6375 * src/paragraph.C (PasteParagraph): Hopefully now right!
6377 2000-05-22 Garst R. Reese <reese@isn.net>
6379 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
6380 of list, change all references to Environment to Command
6381 * tex/hollywood.cls : rewrite environments as commands, add
6382 \uppercase to interiorshot and exteriorshot to force uppecase.
6383 * tex/broadway.cls : rewrite environments as commands. Tweak
6386 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6388 * src/menus.C (Add_to_toc_menu): fix the code which limits the
6389 size of items: use a constant intead of the hardcoded 40, and more
6390 importantly do not remove the %m and %x tags added at the end.
6391 (Add_to_refs_menu): use vector::size_type instead of
6392 unsigned int as basic types for the variables. _Please_ do not
6393 assume that size_t is equal to unsigned int. On an alpha, this is
6394 unsigned long, which is _not_ the same.
6396 * src/language.C (initL): remove language "hungarian", since it
6397 seems that "magyar" is better.
6399 2000-05-22 Juergen Vigna <jug@sad.it>
6401 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
6403 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
6406 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
6407 next was deleted but not set to 0.
6409 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6411 * src/language.C (initL): change the initialization of languages
6412 so that compiles goes _fast_.
6414 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
6417 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
6419 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6423 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6425 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
6427 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
6431 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
6434 * src/insets/insetlo*.[Ch]: Made editable
6436 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6438 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
6439 the current selection.
6441 * src/BufferView_pimpl.C (stuffClipboard): new method
6443 * src/BufferView.C (stuffClipboard): new method
6445 * src/paragraph.C (String): new method
6447 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
6448 LColor::ignore when lyxname is not found.
6450 * src/BufferView.C (pasteSelection): new method
6452 * src/BufferView_pimpl.C (pasteSelection): new method
6454 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
6456 * src/WorkArea.C (request_clipboard_cb): new static function
6457 (getClipboard): new method
6458 (putClipboard): new method
6460 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6462 * LyX 1.1.5pre2 released
6464 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6466 * src/vspace.C (operator=): removed
6467 (operator=): removed
6469 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
6471 * src/layout.C (NumberOfClass): manually set the type in make_pair
6472 (NumberOfLayout): ditto
6474 * src/language.C: use the Language constructor for ignore_lang
6476 * src/language.h: add constructors to struct Language
6478 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
6480 * src/text2.C (SetCursorIntern): comment out #warning
6482 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
6484 * src/mathed/math_iter.h: initialize sx and sw to 0
6486 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6488 * forms/lyx.fd: Redesign of form_ref
6490 * src/LaTeXFeatures.[Ch]
6494 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
6497 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
6498 and Buffer::inset_iterator.
6500 * src/menus.C: Added new menus: TOC and Refs.
6502 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
6504 * src/buffer.C (getTocList): New method.
6506 * src/BufferView2.C (ChangeRefs): New method.
6508 * src/buffer.C (getLabelList): New method. It replaces the old
6509 getReferenceList. The return type is vector<string> instead of
6512 * src/insets/insetinclude.C (getLabelList): New method. Replaces
6513 the old getLabel() and GetNumberOfLabels() methods.
6514 * src/insets/insetlabel.C (getLabelList): ditto
6515 * src/mathed/formula.C (getLabelList): ditto
6517 * src/paragraph.C (String): New method.
6519 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
6520 Uses the new getTocList() method.
6521 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
6522 which automatically updates the contents of the browser.
6523 (RefUpdateCB): Use the new getLabelList method.
6525 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
6527 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
6529 * src/spellchecker.C: Added using std::reverse;
6531 2000-05-19 Juergen Vigna <jug@sad.it>
6533 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
6535 * src/insets/insettext.C (computeTextRows): small fix for display of
6536 1 character after a newline.
6538 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
6541 2000-05-18 Juergen Vigna <jug@sad.it>
6543 * src/insets/insettabular.C (TabularFeatures): fixed update of display
6544 when changing width of column.
6546 * src/tabular.C (set_row_column_number_info): setting of
6547 autobreak rows if necessary.
6549 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6551 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
6553 * src/vc-backend.*: renamed stat() to status() and vcstat to
6554 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
6555 compilation broke. The new name seems more relevant, anyway.
6557 2000-05-17 Juergen Vigna <jug@sad.it>
6559 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
6560 which was wrong if the removing caused removing of rows!
6562 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
6563 (pushToken): new function.
6565 * src/text2.C (CutSelection): fix problem discovered with purify
6567 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6569 * src/debug.C (showTags): enlarge the first column, now that we
6570 have 6-digits debug codes.
6572 * lib/layouts/hollywood.layout:
6573 * lib/tex/hollywood.cls:
6574 * lib/tex/brodway.cls:
6575 * lib/layouts/brodway.layout: more commands and fewer
6576 environments. Preambles moved in the .cls files. Broadway now has
6577 more options on scene numbering and less whitespace (from Garst)
6579 * src/insets/insetbib.C (getKeys): make sure that we are in the
6580 document directory, in case the bib file is there.
6582 * src/insets/insetbib.C (Latex): revert bogus change.
6584 2000-05-16 Juergen Vigna <jug@sad.it>
6586 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
6587 the TabularLayout on cursor move.
6589 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
6591 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
6594 (draw): fixed cursor position and drawing so that the cursor is
6595 visible when before the tabular-inset.
6597 * src/insets/insettext.C (init): drawLockedFrame was not initialized
6598 when creating from old insettext.
6600 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
6602 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6604 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
6605 * lib/tex/brodway.cls: ditto
6607 * lib/layouts/brodway.layout: change alignment of parenthical
6610 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6612 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
6613 versions 0.88 and 0.89 are supported.
6615 2000-05-15 Juergen Vigna <jug@sad.it>
6617 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
6620 * src/insets/insettext.C (computeTextRows): redone completely this
6621 function in a much cleaner way, because of problems when having a
6623 (draw): added a frame border when the inset is locked.
6624 (SetDrawLockedFrame): this sets if we draw the border or not.
6625 (SetFrameColor): this sets the frame color (default=insetframe).
6627 * src/insets/lyxinset.h: added x() and y() functions which return
6628 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
6629 function which is needed to see if we have a locking inset of some
6630 type in this inset (needed for now in insettabular).
6632 * src/vspace.C (inPixels): the same function also without a BufferView
6633 parameter as so it is easier to use it in some ocasions.
6635 * src/lyxfunc.C: changed all places where insertInset was used so
6636 that now if it couldn't be inserted it is deleted!
6638 * src/TabularLayout.C:
6639 * src/TableLayout.C: added support for new tabular-inset!
6641 * src/BufferView2.C (insertInset): this now returns a bool if the
6642 inset was really inserted!!!
6644 * src/tabular.C (GetLastCellInRow):
6645 (GetFirstCellInRow): new helper functions.
6646 (Latex): implemented for new tabular class.
6650 (TeXTopHLine): new Latex() helper functions.
6652 2000-05-12 Juergen Vigna <jug@sad.it>
6654 * src/mathed/formulamacro.C (Read):
6655 * src/mathed/formula.C (Read): read also the \end_inset here!
6657 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6659 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
6660 crush when saving formulae with unbalanced parenthesis.
6662 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
6664 * src/layout.C: Add new keyword "endlabelstring" to layout file
6666 * src/text.C (GetVisibleRow): Draw endlabel string.
6668 * lib/layouts/broadway.layout
6669 * lib/layouts/hollywood.layout: Added endlabel for the
6670 Parenthetical layout.
6672 * lib/layouts/heb-article.layout: Do not use slanted font shape
6673 for Theorem like environments.
6675 * src/buffer.C (makeLaTeXFile): Always add "american" to
6676 the UsedLanguages list if document language is RTL.
6678 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6680 * add addendum to README.OS2 and small patch (from SMiyata)
6682 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6684 * many files: correct the calls to ChangeExtension().
6686 * src/support/filetools.C (ChangeExtension): remove the no_path
6687 argument, which does not belong there. Use OnlyFileName() instead.
6689 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
6690 files when LaTeXing a non-nice latex file.
6692 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
6693 a chain of "if". Return false when deadkeys are not handled.
6695 * src/lyx_main.C (LyX): adapted the code for default bindings.
6697 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
6698 bindings for basic functionality (except deadkeys).
6699 (deadKeyBindings): new method. Performs the bindings of deadkeys.
6701 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
6702 several methods: handle override_x_deadkeys.
6704 * src/lyxrc.h: remove the "bindings" map, which did not make much
6705 sense anyway. New variable override_x_deadkeys, defaulting to "true".
6707 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6709 * src/lyxfont.C (stateText): use a saner method to determine
6710 whether the font is "default". Seems to fix the crash with DEC
6713 * src/Bullet.[Ch] (Bullet): remove const on parameters.
6715 2000-05-08 Juergen Vigna <jug@sad.it>
6717 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
6718 TabularLayoutMenu with mouse-button-3
6719 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
6721 * src/TabularLayout.C: added this file for having a Layout for
6724 2000-05-05 Juergen Vigna <jug@sad.it>
6726 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
6727 recalculating inset-widths.
6728 (TabularFeatures): activated this function so that I can change
6729 tabular-features via menu.
6731 * src/menus.C (ShowEditMenu): inserted support for insettabular so
6732 that I can test some functions with the Table menu.
6734 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6736 * src/lyxfont.C (stateText): guard against stupid c++libs.
6738 * src/tabular.C: add using std::vector
6739 some whitespace changes, + removed som autogenerated code.
6741 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
6743 2000-05-05 Juergen Vigna <jug@sad.it>
6745 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
6746 row, columns and cellstructures.
6748 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6750 * lib/lyxrc.example: remove obsolete entries.
6752 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
6753 reading of protected_separator for free_spacing.
6755 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6757 * src/text.C (draw): do not display an exclamation mark in the
6758 margin for margin notes. This is confusing, ugly and
6761 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
6762 AMS math' is checked.
6764 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
6765 name to see whether including the amsmath package is needed.
6767 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
6769 * src/paragraph.C (validate): Compute UsedLanguages correctly
6770 (don't insert the american language if it doesn't appear in the
6773 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
6774 The argument of \thanks{} command is considered moving argument
6776 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
6779 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
6781 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
6782 for appendix/minipage/depth. The lines can be now both in the footnote
6783 frame, and outside the frame.
6785 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
6788 2000-05-05 Juergen Vigna <jug@sad.it>
6790 * src/table.[Ch]: removed the inset and buffer stuff as this is now
6791 neede only in tabular.[Ch].
6793 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6795 * src/insets/insetspecialchar.C (Read): allow command == '~' for
6797 (Write): write '~' for PROTECTED_SEPARATOR
6799 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6801 * src/lyxparagraph.h: add a friend struct matchIT after the struct
6804 * src/mathed/formula.C (drawStr): rename size to siz.
6806 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
6807 possibly fix a bug by not changing the pflags = flags to piflags =
6810 2000-05-05 Juergen Vigna <jug@sad.it>
6812 * src/insets/insetbib.C: moved using directive
6814 * src/ImportNoweb.C: small fix for being able to compile (missing
6817 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6819 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
6820 to use clear, since we don't depend on this in the code. Add test
6823 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6825 * (various *.C files): add using std::foo directives to please dec
6828 * replace calls to string::clear() to string::erase() (Angus)
6830 * src/cheaders/cmath: modified to provide std::abs.
6832 2000-05-04 Juergen Vigna <jug@sad.it>
6834 * src/insets/insettext.C: Prepared all for inserting of multiple
6835 paragraphs. Still display stuff to do (alignment and other things),
6836 but I would like to use LyXText to do this when we cleaned out the
6837 table-support stuff.
6839 * src/insets/insettabular.C: Changed lot of stuff and added lots
6840 of functionality still a lot to do.
6842 * src/tabular.C: Various functions changed name and moved to be
6843 const functions. Added new Read and Write functions and changed
6844 lots of things so it works good with tabular-insets (also removed
6845 some stuff which is not needed anymore * hacks *).
6847 * src/lyxcursor.h: added operators == and != which just look if
6848 par and pos are (not) equal.
6850 * src/buffer.C (latexParagraphs): inserted this function to latex
6851 all paragraphs form par to endpar as then I can use this too for
6854 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
6855 so that I can call this to from text insets with their own cursor.
6857 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
6858 output off all paragraphs (because of the fix below)!
6860 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
6861 the very last paragraph (this could be also the last paragraph of an
6864 * src/texrow.h: added rows() call which returns the count-variable.
6866 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6868 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
6870 * lib/configure.m4: better autodetection of DocBook tools.
6872 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6874 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
6876 * src/lyx_cb.C: add using std::reverse;
6878 * src/LaTeX.C (run): on error always run deleteFilesOnError before
6881 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
6882 selected files. Should fix repeated errors from generated files.
6884 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
6886 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
6888 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
6889 the spellchecker popup.
6891 * lib/lyxrc.example: Removed the \number_inset section
6893 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6895 * src/insets/figinset.C (various): Use IsFileReadable() to make
6896 sure that the file actually exist. Relying on ghostscripts errors
6897 is a bad idea since they can lead to X server crashes.
6899 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
6901 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
6904 * lib/lyxrc.example: smallish typo in description of
6905 \view_dvi_paper_option
6907 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6910 * src/lyxfunc.C: doImportHelper to factor out common code of the
6911 various import methods. New functions doImportASCIIasLines,
6912 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
6913 doImportLinuxDoc for the format specific parts.
6916 * buffer.C: Dispatch returns now a bool to indicate success
6919 * lyx_gui.C: Add getLyXView() for member access
6921 * lyx_main.C: Change logic for batch commands: First try
6922 Buffer::Dispatch (possibly without GUI), if that fails, use
6925 * lyx_main.C: Add support for --import command line switch.
6926 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
6927 Available Formats: Everything accepted by 'buffer-import <format>'
6929 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6931 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
6934 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
6935 documents will be reformatted upon reentry.
6937 2000-04-27 Juergen Vigna <jug@sad.it>
6939 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
6940 correctly only last pos this was a bug.
6942 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6944 * release of lyx-1.1.5pre1
6946 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6948 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
6950 * src/menus.C: revert the change of naming (Figure->Graphic...)
6951 from 2000-04-11. It was incomplete and bad.
6953 * src/LColor.[Ch]: add LColor::depthbar.
6954 * src/text.C (GetVisibleRow): use it.
6956 * README: update the languages list.
6958 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6960 * src/text.C (GetVisibleRow): show the depth of paragraphs using
6963 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6965 * README: remove sections that were just wrong.
6967 * src/text2.C (GetRowNearY): remove currentrow code
6969 * src/text.C (GetRow): remove currentrow code
6971 * src/screen.C (Update): rewritten a bit.
6972 (SmallUpdate): removed func
6974 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
6976 (FullRebreak): return bool
6977 (currentrow): remove var
6978 (currentrow_y): ditto
6980 * src/lyxscreen.h (Draw): change arg to unsigned long
6981 (FitCursor): return bool
6982 (FitManualCursor): ditto
6983 (Smallpdate): remove func
6984 (first): change to unsigned long
6985 (DrawOneRow): change second arg to long (from long &)
6986 (screen_refresh_y): remove var
6987 (scree_refresh_row): ditto
6989 * src/lyxrow.h: change baseline to usigned int from unsigned
6990 short, this brings some implicit/unsigned issues out in the open.
6992 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
6994 (Dispatch): don't call updateScrollbar after fitCursor. Use update
6995 instead of smallUpdate.
6997 * src/lyxcursor.h: change y to unsigned long
6999 * src/buffer.h: don't call updateScrollbar after fitcursor
7001 * src/buffer.C (parseSingleLyXformat2Token): move variables to
7002 where they are used. Removed "\\direction", this was not present
7003 in 1.1.4 and is already obsolete. Commented out some code that I
7004 believe to never be called.
7005 (runLiterate): don't call updateScrollbar after fitCursor
7007 (buildProgram): ditto
7010 * src/WorkArea.h (workWidth): change return val to unsigned
7013 (redraw): remove the button redraws
7014 (setScrollbarValue): change for scrollbar
7015 (getScrollbarValue): change for scrollbar
7016 (getScrollbarBounds): change for scrollbar
7018 * src/WorkArea.C (C_WorkArea_up_cb): removed func
7019 (C_WorkArea_down_cb): removed func
7020 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
7021 (resize): change for scrollbar
7022 (setScrollbar): ditto
7023 (setScrollbarBounds): ditto
7024 (setScrollbarIncrements): ditto
7025 (up_cb): removed func
7026 (down_cb): removed func
7027 (scroll_cb): change for scrollbar
7028 (work_area_handler): ditto
7030 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
7031 when FitCursor did something.
7032 (updateScrollbar): some unsigned changes
7033 (downCB): removed func
7034 (scrollUpOnePage): removed func
7035 (scrollDownOnePage): remvoed func
7036 (workAreaMotionNotify): don't call screen->FitCursor but use
7037 fitCursor instead. and bool return val
7038 (workAreaButtonPress): ditto
7039 (workAreaButtonRelease): some unsigned changes
7040 (checkInsetHit): ditto
7041 (workAreaExpose): ditto
7042 (update): parts rewritten, comments about the signed char arg added
7043 (smallUpdate): removed func
7044 (cursorPrevious): call needed updateScrollbar
7047 * src/BufferView2.C (allFloats): don't call updateScrollbar after
7050 * src/BufferView.[Ch] (upCB): removed func
7051 (downCB): removed func
7052 (smallUpdate): removed func
7054 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7056 * src/lyxtext.h src/text.C src/text2.C: removed support for the
7057 currentrow, currentrow_y optimization. This did not help a lot and
7058 if we want to do this kind of optimization we should rather use
7059 cursor.row instead of the currentrow.
7061 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
7062 buffer spacing and klyx spacing support.
7064 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7066 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
7069 2000-04-26 Juergen Vigna <jug@sad.it>
7071 * src/insets/figinset.C: fixes to Lars sstream changes!
7073 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
7075 * A lot of files: Added Ascii(ostream &) methods to all inset
7076 classes. Used when exporting to ASCII.
7078 * src/buffer.C (writeFileAscii,RoffAsciiTable)
7079 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
7082 * src/text2.C (ToggleFree): Disabled implicit word selection when
7083 there is a change in the language
7085 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
7086 no output was generated for end-of-sentence inset.
7088 * src/insets/lyxinset.h
7091 * src/paragraph.C: Removed the insetnumber code
7093 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
7095 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7097 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
7098 no_babel and no_epsfig completely from the file.
7099 (parseSingleLyXformat2Token): add handling for per-paragraph
7100 spacing as written by klyx.
7102 * src/insets/figinset.C: applied patch by Andre. Made it work with
7105 2000-04-20 Juergen Vigna <jug@sad.it>
7107 * src/insets/insettext.C (cutSelection):
7108 (copySelection): Fixed with selection from right to left.
7109 (draw): now the rows are not recalculated at every draw.
7110 (computeTextRows): for now reset the inset-owner here (this is
7111 important for an undo or copy where the inset-owner is not set
7114 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
7115 motion to the_locking_inset screen->first was forgotten, this was
7116 not important till we got multiline insets.
7118 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7120 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
7121 code seems to be alright (it is code changed by Dekel, and the
7122 intent is indeed that all macros should be defined \protect'ed)
7124 * NEWS: a bit of reorganisation of the new user-visible features.
7126 2000-04-19 Juergen Vigna <jug@sad.it>
7128 * src/insets/insettext.C (init): using a LyXCursor now for cursor
7129 position. Set the inset_owner of the used paragraph so that it knows
7130 that it is inside an inset. Fixed cursor handling with mouse and
7131 cursor keys. Fixed wrong timed inset redraws and lots of other changes
7132 and cleanups to make TextInsets work better.
7134 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
7135 Changed parameters of various functions and added LockInsetInInset().
7137 * src/insets/insettext.C:
7139 * src/insets/insetcollapsable.h:
7140 * src/insets/insetcollapsable.C:
7141 * src/insets/insetfoot.h:
7142 * src/insets/insetfoot.C:
7143 * src/insets/insetert.h:
7144 * src/insets/insetert.C: cleaned up the code so that it works now
7145 correctly with insettext.
7147 * src/insets/inset.C:
7148 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
7149 that insets in insets are supported right.
7152 * src/table.C: lots of changes for use with inset tabular (and cleanup)
7154 * src/paragraph.C: some small fixes
7156 * src/debug.h: inserted INSETS debug info
7158 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
7159 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
7161 * src/commandtags.h:
7162 * src/LyXAction.C: insert code for InsetTabular.
7164 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
7165 not Button1MotionMask.
7166 (workAreaButtonRelease): send always a InsetButtonRelease event to
7168 (checkInsetHit): some setCursor fixes (always with insets).
7170 * src/BufferView2.C (lockInset): returns a bool now and extended for
7171 locking insets inside insets.
7172 (showLockedInsetCursor): it is important to have the cursor always
7173 before the locked inset.
7174 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
7176 * src/BufferView.h: made lockInset return a bool.
7178 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
7180 * src/text2.C (SetCursor): This now has a version with a LyXCursor
7181 that is used also internally but can be called as public to have back
7182 a cursor pos which is not set internally.
7183 (SetCursorIntern): Changed to use above function.
7185 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
7187 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7192 * NEWS: updated for prerelease of 1.1.5. Please comment and send
7193 patches for things that should be in or should be changed.
7195 * src/* [insetfiles]: change "usigned char fragile" to bool
7196 fragile. There was only one point that could that be questioned
7197 and that is commented in formulamacro.C. Grep for "CHECK".
7199 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
7200 (DeleteBuffer): take it out of CutAndPaste and make it static.
7202 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7204 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
7205 output the spacing envir commands. Also the new commands used in
7206 the LaTeX output makes the result better.
7208 * src/Spacing.C (writeEnvirBegin): new method
7209 (writeEnvirEnd): new method
7211 2000-04-18 Juergen Vigna <jug@sad.it>
7213 * src/CutAndPaste.C: made textclass a static member of the class
7214 as otherwise it is not accesed right!!!
7216 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
7218 * forms/layout_forms.fd
7219 * src/layout_forms.h
7220 * src/layout_forms.C (create_form_form_character)
7221 * src/lyx_cb.C (UserFreeFont)
7222 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
7223 documents (in the layout->character popup).
7225 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7227 * src/spellchecker.C (create_ispell_pipe): fix a bug where
7228 \spell_command was in fact not honored (from Kevin Atkinson).
7230 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
7233 * src/lyx_gui.h: make lyxViews private (Angus)
7235 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
7237 * src/mathed/math_write.C
7238 (MathMatrixInset::Write) Put \protect before \begin{array} and
7239 \end{array} if fragile
7240 (MathParInset::Write): Put \protect before \\ if fragile
7242 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7244 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
7245 initialization if the LyXColorHandler must be done after the
7246 connections to the XServer has been established.
7248 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
7249 get the background pixel from the lyxColorhandler so that the
7250 figures are rendered with the correct background color.
7251 (NextToken): removed functions.
7252 (GetPSSizes): use ifs >> string instead of NextToken.
7254 * src/Painter.[Ch]: the color cache moved out of this file.
7256 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
7259 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7261 * src/WorkArea.C (work_area_handler): call BufferView::enterView
7262 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
7264 * src/BufferView.C (enterView): new func
7265 (leaveView): new func
7267 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
7269 (leaveView): new func, undefines xterm cursor when approp.
7271 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
7272 (AllowInput): delete the Workarea cursor handling from this func.
7274 * src/Painter.C (underline): draw a slimer underline in most cases.
7276 * src/lyx_main.C (error_handler): use extern "C"
7278 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7280 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
7281 sent directly to me.
7283 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
7284 to the list by Dekel.
7286 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
7289 * src/bufferview_funcs.[Ch]: two new files, moved several of the
7290 methods from lyx_cb.here.
7292 * src/lyx_cb.C: in addition to the above; removed input_prohibited
7295 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7297 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
7298 instead of using current_view directly.
7300 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
7302 * src/LyXAction.C (init): add the paragraph-spacing command.
7304 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
7306 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
7308 * src/lyx_cb.C (CurrentState): output a string when the spacing is
7309 different from the documents.
7311 * src/text.C (SetHeightOfRow): take paragraph spacing into
7312 account, paragraph spacing takes precedence over buffer spacing
7313 (GetVisibleRow): ditto
7315 * src/paragraph.C (writeFile): output the spacing parameter too.
7316 (validate): set the correct features if spacing is used in the
7318 (Clear): set spacing to default
7319 (MakeSameLayout): spacing too
7320 (HasSameLayout): spacing too
7321 (SetLayout): spacing too
7322 (TeXOnePar): output the spacing commands
7324 * src/lyxparagraph.h: added a spacing variable for use with
7325 per-paragraph spacing.
7327 * src/Spacing.h: add a Default spacing and a method to check if
7328 the current spacing is default. also added an operator==
7330 * src/text2.C (DeleteEmptyParagraphMechanism): added a
7333 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7335 * src/lyxserver.C (callback): fix dispatch of functions
7337 * src/insets/insetlatexaccent.C (checkContents): turn bogus
7338 printf() into lyxerr call.
7340 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
7343 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
7344 "Table" to "Table Box", "Float" to "Floating Material"; deletes
7345 the "Float" from each of the subitems.
7346 (ShowHelpMenu): add entry for "FAQ" and "TOC".
7348 * src/support/DebugStream.h: add an #ifdef to work around a gcc
7349 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
7350 documented the change so that the workaround can be nuked later.
7352 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
7355 * src/lyxlex_pimpl.C (next): do not re-declare the default value
7357 * src/buffer.C (getLatexName): ditto
7358 (setReadonly): ditto
7360 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7362 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
7363 avoid some uses of current_view. Added also a bufferParams()
7364 method to get at this.
7366 * src/lyxtext.h: changed params->buffer and paramters->bparams.
7368 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7370 * src/lyxparagraph.[Ch]: removed
7371 operator<(LyXParagraph::InsetTable..., added a struct matchIT
7372 with operators used by lower_bound and
7373 upper_bound in InsetTable's
7374 Make struct InsetTable private again. Used matchpos.
7376 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
7378 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
7379 document, the language of existing text is changed (unless the
7380 document is multi-lingual)
7382 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
7384 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
7386 * A lot of files: A rewrite of the Right-to-Left support.
7388 2000-04-10 Juergen Vigna <jug@sad.it>
7390 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
7391 misplaced cursor when inset in inset is locked.
7393 * src/insets/insettext.C (LocalDispatch): small fix so that a
7394 BREAKLINE is not inserted if we don't permit it with autBreakRows.
7396 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
7397 footnote font should be decreased in size twice when displaying.
7399 * src/insets/insettext.C (GetDrawFont): inserted this function as
7400 the drawing-font may differ from the real paragraph font.
7402 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
7403 insets (inset in inset!).
7405 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
7406 function here because we don't want footnotes inside footnotes.
7408 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
7410 (init): now set the inset_owner in paragraph.C
7411 (LocalDispatch): added some resetPos() in the right position
7414 (pasteSelection): changed to use the new CutAndPaste-Class.
7416 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
7417 which tells if it is allowed to insert another inset inside this one.
7419 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
7420 SwitchLayoutsBetweenClasses.
7422 * src/text2.C (InsertInset): checking of the new paragraph-function
7424 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
7425 is not needed anymore here!
7428 (PasteSelection): redone (also with #ifdef) so that now this uses
7429 the CutAndPaste-Class.
7430 (SwitchLayoutsBetweenClasses): removed here and implemented in the
7433 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
7434 from/to text/insets.
7436 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
7437 so that the paragraph knows if it is inside an (text)-inset.
7438 (InsertFromMinibuffer): changed return-value to bool as now it
7439 may happen that an inset is not inserted in the paragraph.
7440 (InsertInsetAllowed): this checks if it is allowed to insert an
7441 inset in this paragraph.
7443 (BreakParagraphConservative):
7444 (BreakParagraph) : small change for the above change of the return
7445 value of InsertFromMinibuffer.
7447 * src/lyxparagraph.h: added inset_owner and the functions to handle
7448 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
7450 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7452 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
7453 functions from BufferView to BufferView::Pimpl to ease maintence.
7455 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
7456 correctly. Also use SetCursorIntern instead of SetCursor.
7458 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
7461 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7463 * src/WorkArea.C (belowMouse): manually implement below mouse.
7465 * src/*: Add "explicit" on several constructors, I added probably
7466 some unneeded ones. A couple of changes to code because of this.
7468 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
7469 implementation and private parts from the users of BufferView. Not
7472 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
7473 implementation and private parts from the users of LyXLex. Not
7476 * src/BufferView_pimpl.[Ch]: new files
7478 * src/lyxlex_pimpl.[Ch]: new files
7480 * src/LyXView.[Ch]: some inline functions move out-of-line
7482 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7484 * src/lyxparagraph.h: make struct InsetTable public.
7486 * src/support/lyxstring.h: change lyxstring::difference_type to be
7487 ptrdiff_t. Add std:: modifiers to streams.
7489 * src/font.C: include the <cctype> header, for islower() and
7492 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7494 * src/font.[Ch]: new files. Contains the metric functions for
7495 fonts, takes a LyXFont as parameter. Better separation of concepts.
7497 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
7498 changes because of this.
7500 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
7502 * src/*: compile with -Winline and move functions that don't
7505 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
7508 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7510 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
7511 (various files changed because of this)
7513 * src/Painter.C (text): fixed the drawing of smallcaps.
7515 * src/lyxfont.[Ch] (drawText): removed unused member func.
7518 * src/*.C: added needed "using" statements and "std::" qualifiers.
7520 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7522 * src/*.h: removed all use of "using" from header files use
7523 qualifier std:: instead.
7525 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7527 * src/text.C (Backspace): some additional cleanups (we already
7528 know whether cursor.pos is 0 or not).
7530 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
7531 automake does not provide one).
7533 * src/bmtable.h: replace C++ comments with C comments.
7535 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
7537 * src/screen.C (ShowCursor): Change the shape of the cursor if
7538 the current language is not equal to the language of the document.
7539 (If the cursor change its shape unexpectedly, then you've found a bug)
7541 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
7544 * src/insets/insetnumber.[Ch]: New files.
7546 * src/LyXAction.C (init)
7547 * src/lyxfunc.C (dispatch): Add command number-inset-insert
7550 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
7552 * src/lyxparagraph.h
7553 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
7554 (the vector is kept sorted).
7556 * src/text.C (GetVisibleRow): Draw selection correctly when there
7557 is both LTR and RTL text.
7559 * src/paragraph.C (Clone): Use the assignment operator for cloning,
7560 which is much faster.
7562 * src/text.C (GetVisibleRow and other): Do not draw the last space
7563 in a row if the direction of the last letter is not equal to the
7564 direction of the paragraph.
7566 * src/lyxfont.C (latexWriteStartChanges):
7567 Check that font language is not equal to basefont language.
7568 (latexWriteEndChanges): ditto
7570 * src/lyx_cb.C (StyleReset): Don't change the language while using
7571 the font-default command.
7573 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
7574 empty paragraph before a footnote.
7576 * src/insets/insetcommand.C (draw): Increase x correctly.
7578 * src/screen.C (ShowCursor): Change cursor shape if
7579 current language != document language.
7581 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
7583 2000-03-31 Juergen Vigna <jug@sad.it>
7585 * src/paragraph.C (GetInset): commented out text[pos] = ' '
7586 (Clone): changed mode how the paragraph-data is copied to the
7587 new clone-paragraph.
7589 * src/lyxfunc.C (Dispatch): fixed small problem when calling
7590 GetInset(pos) with no inset anymore there (in inset UNDO)
7592 * src/insets/insetcommand.C (draw): small fix as here x is
7593 incremented not as much as width() returns (2 before, 2 behind = 4)
7595 2000-03-30 Juergen Vigna <jug@sad.it>
7597 * src/insets/insettext.C (InsetText): small fix in initialize
7598 widthOffset (should not be done in the init() function)
7600 2000-03-29 Amir Karger <karger@lyx.org>
7602 * lib/examples/it_ItemizeBullets.lyx: translation by
7605 * Implemented \textasciitilde and fixed a tiny bug in reLyX
7607 2000-03-29 Juergen Vigna <jug@sad.it>
7609 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
7611 * src/insets/insetfoot.C (Clone): small change as for the below
7612 new init function in the text-inset
7614 * src/insets/insettext.C (init): new function as I've seen that
7615 clone did not copy the Paragraph-Data!
7616 (LocalDispatch): Added code so that now we have some sort of Undo
7617 functionality (well actually we HAVE Undo ;)
7619 * src/text.C (Backspace): Small fix for the a | a Backspace problem
7621 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
7623 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
7626 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7628 * src/main.C: added a runtime check that verifies that the xforms
7629 header used when building LyX and the library used when running
7630 LyX match. Exit with a message if they don't match. This is a
7631 version number check only.
7633 * src/buffer.C (save): Don't allocate memory on the heap for
7634 struct utimbuf times.
7636 * *: some using changes, use iosfwd instead of the real headers.
7638 * src/lyxfont.C use char const * instead of string for the static
7639 strings. Rewrite some functions to use sstream.
7641 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7643 * src/text.C (Backspace): hopefully fix the dreaded backaspace
7646 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7648 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
7649 of Geodesy (from Martin Vermeer)
7651 * lib/layouts/svjour.inc: include file for the Springer svjour
7652 class. It can be used to support journals other than JoG.
7654 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
7655 Miskiewicz <misiek@pld.org.pl>)
7656 * lib/reLyX/Makefile.am: ditto.
7658 2000-03-27 Juergen Vigna <jug@sad.it>
7660 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
7661 also some modifications with operations on selected text.
7663 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
7664 problems with clicking on insets (last famous words ;)
7666 * src/insets/insetcommand.C (draw):
7667 (width): Changed to have a bit of space before and after the inset so
7668 that the blinking cursor can be seen (otherwise it was hidden)
7670 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7672 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
7673 would not be added to the link list when an installed gettext (not
7674 part of libc) is found.
7676 2000-03-24 Juergen Vigna <jug@sad.it>
7678 * src/insets/insetcollapsable.C (Edit):
7679 * src/mathed/formula.C (InsetButtonRelease):
7680 (InsetButtonPress): fixed for new handling of ButtonPress/Release
7683 * src/BufferView.C (workAreaButtonPress):
7684 (workAreaButtonRelease):
7685 (checkInsetHit): Finally fixed the clicking on insets be handled
7688 * src/insets/insetert.C (Edit): inserted this call so that ERT
7689 insets work always with LaTeX-font
7691 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7693 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
7694 caused lyx to startup with no GUI in place, causing in a crash
7695 upon startup when called with arguments.
7697 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7699 * src/FontLoader.C: better initialization of dummyXFontStruct.
7701 2000-03-20 José Abílio Matos <jamatos@lyx.org>
7703 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
7704 for linuxdoc and docbook import and export format options.
7706 * lib/lyxrc.example Example of default values for the previous flags.
7708 * src/lyx_cb.C Use those flags instead of the hardwired values for
7709 linuxdoc and docbook export.
7711 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
7714 * src/menus.C Added menus entries for the new import/exports formats.
7716 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7718 * src/lyxrc.*: Added support for running without Gui
7721 * src/FontLoader.C: sensible defaults if no fonts are needed
7723 * src/lyx_cb.C: New function ShowMessage (writes either to the
7724 minibuffer or cout in case of no gui
7725 New function AskOverwrite for common stuff
7726 Consequently various changes to call these functions
7728 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
7729 wild guess at sensible screen resolution when having no gui
7731 * src/lyxfont.C: no gui, no fonts... set some defaults
7733 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7735 * src/LColor.C: made the command inset background a bit lighter.
7737 2000-03-20 Hartmut Goebel <goebel@noris.net>
7739 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
7740 stdstruct.inc. Koma-Script added some title elements which
7741 otherwise have been listed below "bibliography". This split allows
7742 adding title elements to where they belong.
7744 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
7745 define the additional title elements and then include
7748 * many other layout files: changed to include stdtitle.inc just
7749 before stdstruct.inc.
7751 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
7753 * src/buffer.C: (save) Added the option to store all backup files
7754 in a single directory
7756 * src/lyxrc.[Ch]: Added variable \backupdir_path
7758 * lib/lyxrc.example: Added descriptions of recently added variables
7760 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
7761 bibtex inset, not closing the bibtex popup when deleting the inset)
7763 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7765 * src/lyx_cb.C: add a couple using directives.
7767 2000-03-17 José Abílio Matos <jamatos@lyx.org>
7768 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
7769 import based on the filename.
7771 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
7772 file would be imported at start, if the filename where of a sgml file.
7774 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
7776 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
7778 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
7779 * src/lyxfont.h Replaced the member variable bits.direction by the
7780 member variable lang. Made many changes in other files.
7781 This allows having a multi-lingual document
7783 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
7784 that change the current language to <l>.
7785 Removed the command "font-rtl"
7787 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
7788 format for Hebrew documents)
7790 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
7791 When auto_mathmode is "true", pressing a digit key in normal mode
7792 will cause entering into mathmode.
7793 If auto_mathmode is "rtl" then this behavior will be active only
7794 when writing right-to-left text.
7796 * src/text2.C (InsertStringA) The string is inserted using the
7799 * src/paragraph.C (GetEndLabel) Gives a correct result for
7800 footnote paragraphs.
7802 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
7804 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7806 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
7807 front of PasteParagraph. Never insert a ' '. This should at least
7808 fix some cause for the segfaults that we have been experiencing,
7809 it also fixes backspace behaviour slightly. (Phu!)
7811 * src/support/lstrings.C (compare_no_case): some change to make it
7812 compile with gcc 2.95.2 and stdlibc++-v3
7814 * src/text2.C (MeltFootnoteEnvironment): change type o
7815 first_footnote_par_is_not_empty to bool.
7817 * src/lyxparagraph.h: make text private. Changes in other files
7819 (fitToSize): new function
7820 (setContentsFromPar): new function
7821 (clearContents): new function
7822 (SetChar): new function
7824 * src/paragraph.C (readSimpleWholeFile): deleted.
7826 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
7827 the file, just use a simple string instead. Also read the file in
7828 a more maintainable manner.
7830 * src/text2.C (InsertStringA): deleted.
7831 (InsertStringB): deleted.
7833 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7835 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
7836 RedoParagraphs from the doublespace handling part, just set status
7837 to NEED_MORE_REFRESH. Also don't update cursor position (should be
7838 done, but perhaps not like this.)
7840 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7842 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
7843 character when inserting an inset.
7845 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7847 * src/bufferparams.C (readLanguage): now takes "default" into
7850 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
7851 also initialize the toplevel_keymap with the default bindings from
7854 * src/buffer.C (Buffer): remove lyxrc from the parameters.
7856 * all files using lyxrc: have lyxrc as a real variable and not a
7857 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
7860 * src/lyxrc.C: remove double call to defaultKeyBindings
7862 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
7863 toolbar defauls using lyxlex. Remove enums, structs, functions
7866 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
7867 toolbar defaults. Also store default keybindings in a map.
7869 * src/ToolbarDefaults.[Ch]: New file. This class is used for
7870 storing the toolbar defaults without any xforms dependencies.
7872 * src/insets/figinset.C: patch posted to list by Andre Poenitz
7873 applied. Changed to use iterators.
7875 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7877 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
7878 systems that don't have LINGUAS set to begin with.
7880 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7882 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
7883 the list by Dekel Tsur.
7885 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7887 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
7888 * src/insets/form_graphics.C: ditto.
7890 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
7892 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7894 * src/bufferparams.C (readLanguage): use the new language map
7896 * src/intl.C (InitKeyMapper): use the new language map
7898 * src/lyx_gui.C (create_forms): use the new language map
7900 * src/language.[Ch]: New files. Used for holding the information
7901 about each language. Now! Use this new language map enhance it and
7902 make it really usable for our needs.
7904 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
7906 * screen.C (ShowCursor): Removed duplicate code.
7907 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
7908 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
7910 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
7913 * src/text.C Added TransformChar method. Used for rendering Arabic
7914 text correctly (change the glyphs of the letter according to the
7915 position in the word)
7920 * src/lyxrc.C Added lyxrc command {language_command_begin,
7921 language_command_end,language_command_ltr,language_command_rtl,
7922 language_package} which allows the use of either arabtex or Omega
7925 * src/lyx_gui.C (init)
7927 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
7928 to use encoding for menu fonts which is different than the encoding
7931 * src/buffer.C (makeLaTeXFile): If params.language = "default",
7932 do not load the babel package.
7933 To write an English document with Hebrew/Arabic, change the document
7934 language to "english".
7936 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
7937 (alphaCounter): changed to return char
7938 (loweralphaCounter, hebrewCounter, romanCounter): New functions
7940 * lib/lyxrc.example Added examples for Hebrew/Arabic
7943 * src/layout.C Added layout command endlabeltype
7945 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
7947 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
7949 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7951 * src/mathed/math_delim.C (search_deco): return a
7952 math_deco_struct* instead of index.
7954 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7956 * All files with a USE_OSTREAM_ONLY within: removed all code that
7957 was unused when USE_OSTREAM_ONLY is defined.
7959 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
7960 of any less. Removed header and using.
7962 * src/text.C (GetVisibleRow): draw the string "Page Break
7963 (top/bottom)" on screen when drawing a pagebreak line.
7965 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7967 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
7969 * src/mathed/math_macro.C (draw): do some cast magic.
7972 * src/mathed/math_defs.h: change byte* argument to byte const*.
7974 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
7976 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
7977 know it is right to return InsetFoot* too, but cxx does not like
7980 * src/insets/insetcollapsable.[Ch] (Clone): make const.
7982 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
7984 * src/mathed/math_delim.C: change == to proper assignment.
7986 2000-03-09 Juergen Vigna <jug@sad.it>
7988 * src/insets/insettext.C (setPos): fixed various cursor positioning
7989 problems (via mouse and cursor-keys)
7990 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
7991 inset (still a small display problem but it works ;)
7993 * src/insets/insetcollapsable.C (draw): added button_top_y and
7994 button_bottom_y to have correct values for clicking on the inset.
7996 * src/support/lyxalgo.h: commented out 'using std::less'
7998 2000-03-08 Juergen Vigna <jug@sad.it>
8000 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
8001 Button-Release event closes as it is alos the Release-Event
8004 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
8006 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8008 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
8009 can add multiple spaces in Scrap (literate programming) styles...
8010 which, by the way, is how I got hooked on LyX to begin with.
8012 * src/mathed/formula.C (Write): Added dummy variable to an
8013 inset::Latex() call.
8014 (Latex): Add free_spacing boolean to inset::Latex()
8016 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
8018 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
8019 virtual function to include the free_spacing boolean from
8020 the containing paragraph's style.
8022 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
8023 Added free_spacing boolean arg to match inset.h
8025 * src/insets/insettext.C, src/insets/insettext.h (Latex):
8026 Added free_spacing boolean arg to match inset.h
8028 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
8029 Added free_spacing boolean and made sure that if in a free_spacing
8030 paragraph, that we output normal space if there is a protected space.
8032 * src/insets/insetref.C, src/insets/insetref.h (Latex):
8033 Added free_spacing boolean arg to match inset.h
8035 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
8036 Added free_spacing boolean arg to match inset.h
8038 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
8039 Added free_spacing boolean arg to match inset.h
8041 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
8042 Added free_spacing boolean arg to match inset.h
8044 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
8045 Added free_spacing boolean arg to match inset.h
8047 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
8048 free_spacing boolean arg to match inset.h
8050 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
8051 Added free_spacing boolean arg to match inset.h
8053 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
8054 Added free_spacing boolean arg to match inset.h
8056 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
8057 Added free_spacing boolean arg to match inset.h
8059 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
8060 Added free_spacing boolean arg to match inset.h
8062 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
8063 Added free_spacing boolean arg to match inset.h
8065 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
8066 free_spacing boolean arg to match inset.h
8068 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
8069 free_spacing boolean arg to match inset.h
8071 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
8072 ignore free_spacing paragraphs. The user's spaces are left
8075 * src/text.C (InsertChar): Fixed the free_spacing layout
8076 attribute behavior. Now, if free_spacing is set, you can
8077 add multiple spaces in a paragraph with impunity (and they
8078 get output verbatim).
8079 (SelectSelectedWord): Added dummy argument to inset::Latex()
8082 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
8085 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
8086 paragraph layouts now only input a simple space instead.
8087 Special character insets don't make any sense in free-spacing
8090 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
8091 hard-spaces in the *input* file to simple spaces if the layout
8092 is free-spacing. This converts old files which had to have
8093 hard-spaces in free-spacing layouts where a simple space was
8095 (writeFileAscii): Added free_spacing check to pass to the newly
8096 reworked inset::Latex(...) methods. The inset::Latex() code
8097 ensures that hard-spaces in free-spacing paragraphs get output
8098 as spaces (rather than "~").
8100 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8102 * src/mathed/math_delim.C (draw): draw the empty placeholder
8103 delims with a onoffdash line.
8104 (struct math_deco_compare): struct that holds the "functors" used
8105 for the sort and the binary search in math_deco_table.
8106 (class init_deco_table): class used for initial sort of the
8108 (search_deco): use lower_bound to do a binary search in the
8111 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8113 * src/lyxrc.C: a small secret thingie...
8115 * src/lyxlex.C (printTable): changed to take a ostream as paramter
8116 and to not flush the stream as often as it used to.
8118 * src/support/lyxalgo.h: new file
8119 (sorted): template function used for checking if a sequence is
8120 sorted or not. Two versions with and without user supplied
8121 compare. Uses same compare as std::sort.
8123 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
8124 it and give warning on lyxerr.
8126 (struct compare_tags): struct with function operators used for
8127 checking if sorted, sorting and lower_bound.
8128 (search_kw): use lower_bound instead of manually implemented
8131 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8133 * src/insets/insetcollapsable.h: fix Clone() declaration.
8134 * src/insets/insetfoot.h: ditto.
8136 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
8138 2000-03-08 Juergen Vigna <jug@sad.it>
8140 * src/insets/lyxinset.h: added owner call which tells us if
8141 this inset is inside another inset. Changed also the return-type
8142 of Editable to an enum so it tells clearer what the return-value is.
8144 * src/insets/insettext.C (computeTextRows): fixed computing of
8145 textinsets which split automatically on more rows.
8147 * src/insets/insetert.[Ch]: changed this to be of BaseType
8150 * src/insets/insetfoot.[Ch]: added footnote inset
8152 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
8153 collapsable insets (like footnote, ert, ...)
8155 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8157 * src/lyxdraw.h: remvoe file
8159 * src/lyxdraw.C: remove file
8161 * src/insets/insettext.C: added <algorithm>.
8163 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8165 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
8166 (matrix_cb): case MM_OK use string stream
8168 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
8171 * src/mathed/math_macro.C (draw): use string stream
8172 (Metrics): use string stream
8174 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
8175 directly to the ostream.
8177 * src/vspace.C (asString): use string stream.
8178 (asString): use string stream
8179 (asLatexString): use string stream
8181 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
8182 setting Spacing::Other.
8184 * src/LaTeXFeatures.C (getPackages): use string stream instead of
8185 sprintf when creating the stretch vale.
8187 * src/text2.C (alphaCounter): changed to return a string and to
8188 not use a static variable internally. Also fixed a one-off bug.
8189 (SetCounter): changed the drawing of the labels to use string
8190 streams instead of sprintf.
8192 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
8193 manipulator to use a scheme that does not require library support.
8194 This is also the way it is done in the new GNU libstdc++. Should
8195 work with DEC cxx now.
8197 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8199 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
8200 end. This fixes a bug.
8202 * src/mathed (all files concerned with file writing): apply the
8203 USE_OSTREAM_ONLY changes to mathed too.
8205 * src/support/DebugStream.h: make the constructor explicit.
8207 * src/lyxfont.C (latexWriteStartChanges): small bug related to
8208 count and ostream squashed.
8210 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8212 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
8214 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
8215 ostringstream uses STL strings, and we might not.
8217 * src/insets/insetspecialchar.C: add using directive.
8218 * src/insets/insettext.C: ditto.
8220 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8222 * lib/layouts/seminar.layout: feeble attempt at a layout for
8223 seminar.cls, far from completet and could really use some looking
8224 at from people used to write layout files.
8226 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
8227 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
8228 a lot nicer and works nicely with ostreams.
8230 * src/mathed/formula.C (draw): a slightly different solution that
8231 the one posted to the list, but I think this one works too. (font
8232 size wrong in headers.)
8234 * src/insets/insettext.C (computeTextRows): some fiddling on
8235 Jürgens turf, added some comments that he should read.
8237 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
8238 used and it gave compiler warnings.
8239 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
8242 * src/lyx_gui.C (create_forms): do the right thing when
8243 show_banner is true/false.
8245 * src/lyx_cb.C (TimerCB): no need to close or do anything if
8246 show_banner is false.
8248 * most file writing files: Now use iostreams to do almost all of
8249 the writing. Also instead of passing string &, we now use
8250 stringstreams. mathed output is still not adapted to iostreams.
8251 This change can be turned off by commenting out all the occurences
8252 of the "#define USE_OSTREAM_ONLY 1" lines.
8254 * src/WorkArea.C (createPixmap): don't output debug messages.
8255 (WorkArea): don't output debug messages.
8257 * lib/lyxrc.example: added a comment about the new variable
8260 * development/Code_rules/Rules: Added some more commente about how
8261 to build class interfaces and on how better encapsulation can be
8264 2000-03-03 Juergen Vigna <jug@sad.it>
8266 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
8267 automatically with the width of the LyX-Window
8269 * src/insets/insettext.C (computeTextRows): fixed update bug in
8270 displaying text-insets (scrollvalues where not initialized!)
8272 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8274 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
8275 id in the check of the result from lower_bound is not enough since
8276 lower_bound can return last too, and then res->id will not be a
8279 * all insets and some code that use them: I have conditionalized
8280 removed the Latex(string & out, ...) this means that only the
8281 Latex(ostream &, ...) will be used. This is a work in progress to
8282 move towards using streams for all output of files.
8284 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
8287 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8289 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
8290 routine (this fixes bug where greek letters were surrounded by too
8293 * src/support/filetools.C (findtexfile): change a bit the search
8294 algorithm, to fix bug introduced in 1.1.4. Note that --format is
8295 no longer passed to kpsewhich, we may have to change that later.
8297 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
8298 warning options to avoid problems with X header files (from Angus
8300 * acinclude.m4: regenerated.
8302 2000-03-02 Juergen Vigna <jug@sad.it>
8304 * src/insets/insettext.C (WriteParagraphData): Using the
8305 par->writeFile() function for writing paragraph-data.
8306 (Read): Using buffer->parseSingleLyXformat2Token()-function
8307 for parsing paragraph data!
8309 * src/buffer.C (readLyXformat2): removed all parse data and using
8310 the new parseSingleLyXformat2Token()-function.
8311 (parseSingleLyXformat2Token): added this function to parse (read)
8312 lyx-file-format (this is called also from text-insets now!)
8314 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8316 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
8319 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
8320 directly instead of going through a func. One very bad thing: a
8321 static LyXFindReplace, but I don't know where to place it.
8323 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
8324 string instead of char[]. Also changed to static.
8325 (GetSelectionOrWordAtCursor): changed to static inline
8326 (SetSelectionOverLenChars): ditto.
8328 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
8329 current_view and global variables. both classes has changed names
8330 and LyXFindReplace is not inherited from SearchForm.
8332 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
8333 fl_form_search form.
8335 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
8337 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8339 * lib/bind/*.bind: make sure 'buffer-previous' function is not
8340 bound (from Kayvan).
8342 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
8344 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
8346 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8348 * some things that I should comment but the local pub says head to
8351 * comment out all code that belongs to the Roff code for Ascii
8352 export of tables. (this is unused)
8354 * src/LyXView.C: use correct type for global variable
8355 current_layout. (LyXTextClass::size_type)
8357 * some code to get the new insetgraphics closer to working I'd be
8358 grateful for any help.
8360 * src/BufferView2.C (insertInset): use the return type of
8361 NumberOfLayout properly. (also changes in other files)
8363 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
8364 this as a test. I want to know what breaks because of this.
8366 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
8368 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8370 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
8371 to use a \makebox in the label, this allows proper justification
8372 with out using protected spaces or multiple hfills. Now it is
8373 "label" for left justified, "\hfill label\hfill" for center, and
8374 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
8375 should be changed accordingly.
8377 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8379 * src/lyxtext.h: change SetLayout() to take a
8380 LyXTextClass::size_type instead of a char (when there is more than
8381 127 layouts in a class); also change type of copylayouttype.
8382 * src/text2.C (SetLayout): ditto.
8383 * src/LyXView.C (updateLayoutChoice): ditto.
8385 * src/LaTeX.C (scanLogFile): errors where the line number was not
8386 given just after the '!'-line were ignored (from Dekel Tsur).
8388 * lib/lyxrc.example: fix description of \date_insert_format
8390 * lib/layouts/llncs.layout: new layout, contributed by Martin
8393 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8395 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
8396 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
8397 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
8398 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
8399 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
8400 paragraph.C, text.C, text2.C)
8402 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8404 * src/insets/insettext.C (LocalDispatch): remove extra break
8407 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
8408 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
8410 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
8411 * src/insets/insettext.[Ch] (GetCursorPos): ditto
8413 * src/insets/insetbib.h: move InsetBibkey::Holder and
8414 InsetCitation::Holder in public space.
8416 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8418 * src/insets/insettext.h: small change to get the new files from
8419 Juergen to compile (use "string", not "class string").
8421 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
8422 const & as parameter to LocalDispatch, use LyXFont const & as
8423 paramter to some other func. This also had impacto on lyxinsets.h
8424 and the two mathed insets.
8426 2000-02-24 Juergen Vigna <jug@sad.it>
8429 * src/commandtags.h:
8431 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
8435 * src/BufferView2.C: added/updated code for various inset-functions
8437 * src/insets/insetert.[Ch]: added implementation of InsetERT
8439 * src/insets/insettext.[Ch]: added implementation of InsetText
8441 * src/insets/inset.C (Edit): added "unsigned int button" parameter
8442 (draw): added preliminary code for inset scrolling not finshed yet
8444 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
8445 as it is in lyxfunc.C now
8447 * src/insets/lyxinset.h: Added functions for text-insets
8449 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8451 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
8452 BufferView and reimplement the list as a queue put inside its own
8455 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
8457 * several files: use the new interface to the "updateinsetlist"
8459 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
8461 (work_area_handler): call BufferView::trippleClick on trippleclick.
8463 * src/BufferView.C (doubleClick): new function, selects word on
8465 (trippleClick): new function, selects line on trippleclick.
8467 2000-02-22 Allan Rae <rae@lyx.org>
8469 * lib/bind/xemacs.bind: buffer-previous not supported
8471 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8473 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
8476 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8478 * src/bufferlist.C: get rid of current_view from this file
8480 * src/spellchecker.C: get rid of current_view from this file
8482 * src/vspace.C: get rid of current_view from this file
8483 (inPixels): added BufferView parameter for this func
8484 (asLatexCommand): added a BufferParams for this func
8486 * src/text.C src/text2.C: get rid of current_view from these
8489 * src/lyxfont.C (getFontDirection): move this function here from
8492 * src/bufferparams.C (getDocumentDirection): move this function
8495 * src/paragraph.C (getParDirection): move this function here from
8497 (getLetterDirection): ditto
8499 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
8501 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
8502 resize due to wrong pixmap beeing used. Also took the opurtunity
8503 to make the LyXScreen stateless on regard to WorkArea and some
8504 general cleanup in the same files.
8506 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8508 * src/Makefile.am: add missing direction.h
8510 * src/PainterBase.h: made the width functions const.
8512 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
8515 * src/insets/insetcommand.C (draw): draw Editable as buttons.
8517 * src/insets/insetlatexaccent.C (draw): make the accents draw
8518 better, at present this will only work well with iso8859-1.
8520 * several files: remove the old drawing code, now we use the new
8523 * several files: remove support for mono_video, reverse_video and
8526 2000-02-17 Juergen Vigna <jug@sad.it>
8528 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
8529 int ** as we have to return the pointer, otherwise we have only
8530 NULL pointers in the returning function.
8532 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8534 * src/LaTeX.C (operator()): quote file name when running latex.
8536 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8538 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
8539 (bubble tip), this removes our special handling of this.
8541 * Remove all code that is unused now that we have the new
8542 workarea. (Code that are not active when NEW_WA is defined.)
8544 * Make the uses of XSync not conditionalized on define USE_XSYNC.
8546 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8548 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
8549 nonexisting layout; correctly redirect obsoleted layouts.
8551 * lib/lyxrc.example: document \view_dvi_paper_option
8553 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
8556 * src/lyx_cb.C (RunScript): handle $$FName for command names.
8557 (PreviewDVI): handle the view_dvi_paper_option variable.
8558 [Both from Roland Krause]
8560 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8562 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
8563 char const *, int, LyXFont)
8564 (text(int, int, string, LyXFont)): ditto
8566 * src/text.C (InsertCharInTable): attempt to fix the double-space
8567 feature in tables too.
8568 (BackspaceInTable): ditto.
8569 (GetVisibleRow): make bottom pagebreak line be a onoff line.
8571 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8573 * src/text2.C (owner): only complain if owner_ is set and bv != 0
8575 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
8576 newly found text in textcache to this.
8577 (buffer): set the owner of the text put into the textcache to 0
8579 * src/insets/figinset.C (draw): fixed the drawing of figures with
8582 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
8583 drawing of mathframe, hfills, protected space, table lines. I have
8584 now no outstanding drawing problems with the new Painter code.
8586 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8588 * src/PainterBase.C (ellipse, circle): do not specify the default
8591 * src/LColor.h: add using directive.
8593 * src/Painter.[Ch]: change return type of methods from Painter& to
8594 PainterBase&. Add a using directive.
8596 * src/WorkArea.C: wrap xforms callbacks in C functions
8599 * lib/layouts/foils.layout: font fix and simplifications from Carl
8602 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8604 * a lot of files: The Painter, LColor and WorkArea from the old
8605 devel branch has been ported to lyx-devel. Some new files and a
8606 lot of #ifdeffed code. The new workarea is enabled by default, but
8607 if you want to test the new Painter and LColor you have to compile
8608 with USE_PAINTER defined (do this in config.h f.ex.) There are
8609 still some rought edges, and I'd like some help to clear those
8610 out. It looks stable (loads and displays the Userguide very well).
8613 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8615 * src/buffer.C (pop_tag): revert to the previous implementation
8616 (use a global variable for both loops).
8618 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
8620 * src/lyxrc.C (LyXRC): change slightly default date format.
8622 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
8623 there is an English text with a footnote that starts with a Hebrew
8624 paragraph, or vice versa.
8625 (TeXFootnote): ditto.
8627 * src/text.C (LeftMargin): allow for negative values for
8628 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
8631 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
8632 for input encoding (cyrillic)
8634 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8636 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
8639 * src/toolbar.C (set): ditto
8640 * src/insets/insetbib.C (create_form_citation_form): ditto
8642 * lib/CREDITS: added Dekel Tsur.
8644 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
8645 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
8646 hebrew supports files from Dekel Tsur.
8648 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
8649 <tzafrir@technion.ac.il>
8651 * src/lyxrc.C: put \date_insert_format at the right place.
8653 * src/buffer.C (makeLaTeXFile): fix the handling of
8654 BufferParams::sides when writing out latex files.
8656 * src/BufferView2.C: add a "using" directive.
8658 * src/support/lyxsum.C (sum): when we use lyxstring,
8659 ostringstream::str needs an additional .c_str().
8661 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8663 * src/support/filetools.C (ChangeExtension): patch from Etienne
8666 * src/TextCache.C (show): remove const_cast and make second
8667 parameter non-const LyXText *.
8669 * src/TextCache.h: use non const LyXText in show.
8671 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
8674 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8676 * src/support/lyxsum.C: rework to be more flexible.
8678 * several places: don't check if a pointer is 0 if you are going
8681 * src/text.C: remove some dead code.
8683 * src/insets/figinset.C: remove some dead code
8685 * src/buffer.C: move the BufferView funcs to BufferView2.C
8686 remove all support for insetlatexdel
8687 remove support for oldpapersize stuff
8688 made some member funcs const
8690 * src/kbmap.C: use a std::list to store the bindings in.
8692 * src/BufferView2.C: new file
8694 * src/kbsequence.[Ch]: new files
8696 * src/LyXAction.C + others: remove all trace of buffer-previous
8698 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
8699 only have one copy in the binary of this table.
8701 * hebrew patch: moved some functions from LyXText to more
8702 appropriate places. (LyXParagraph, BufferParams, LyXFont)
8704 * several files: remove support for XForms older than 0.88
8706 remove some #if 0 #endif code
8708 * src/TextCache.[Ch]: new file. Holds the textcache.
8710 * src/BufferView.C: changes to use the new TextCache interface.
8711 (waitForX): remove the now unused code.
8713 * src/BackStack.h: remove some commented code
8715 * lib/bind/emacs.bind: remove binding for buffer-previous
8717 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8719 * applied the hebrew patch.
8721 * src/lyxrow.h: make sure that all Row variables are initialized.
8723 * src/text2.C (TextHandleUndo): comment out a delete, this might
8724 introduce a memory leak, but should also help us to not try to
8725 read freed memory. We need to look at this one.
8727 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
8728 (LyXParagraph): initalize footnotekind.
8730 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
8731 forgot this when applying the patch. Please heed the warnings.
8733 * src/BufferView.C (buffer): a fix for the buffer-reload problem
8734 (aka. reformat problem)
8736 * src/bufferlist.C (exists): made const, and use const_iterator
8737 (isLoaded): new func.
8738 (release): use std::find to find the correct buffer.
8740 * src/bufferlist.h: made getState a const func.
8741 made empty a const func.
8742 made exists a const func.
8745 2000-02-01 Juergen Vigna <jug@sad.it>
8747 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
8749 * po/it.po: updated a bit the italian po file and also changed the
8750 'file nuovo' for newfile to 'filenuovo' without a space, this did
8753 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
8754 for the new insert_date command.
8756 * src/lyxfunc.C (Dispatch): added support for a insert_date function
8757 from jdblair, to insert a date into the current text conforming to
8758 a strftime format (for now only considering the locale-set and not
8759 the document-language).
8761 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8763 * src/lyxfont.C (textWidth): hopefully better fix for the Array
8764 Bounds Read error seen by purify. The problem was that islower is
8765 a macros which takes an unsigned char and uses it as an index for
8766 in array of characters properties (and is thus subject to the
8770 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
8771 correctly the paper sides radio buttons.
8772 (UpdateDocumentButtons): ditto.
8774 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8776 * src/kbmap.C (getsym + others): change to return unsigned int,
8777 returning a long can give problems on 64 bit systems. (I assume
8778 that int is 32bit on 64bit systems)
8780 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8782 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
8783 LyXLookupString to be zero-terminated. Really fixes problems seen
8786 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8788 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
8789 write a (char*)0 to the lyxerr stream.
8791 * src/lastfiles.C: move algorithm before the using statemets.
8793 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8795 * src/lastfiles.C: move using directives in global scope (egcs 1.x
8796 complains otherwise).
8797 * src/table.C: ditto
8799 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
8802 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
8803 that I removed earlier... It is really needed.
8805 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
8807 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8809 * INSTALL: update xforms home page URL.
8811 * lib/configure.m4: fix a bug with unreadable layout files.
8813 * src/table.C (calculate_width_of_column): add "using std::max"
8816 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8818 * several files: marked several lines with "DEL LINE", this is
8819 lines that can be deleted without changing anything.
8820 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
8821 checks this anyway */
8824 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
8826 * src/DepTable.C (update): add a "+" at the end when the checksum
8827 is different. (debugging string only)
8829 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
8830 the next inset to not be displayed. This should also fix the list
8831 of labels in the "Insert Crossreference" dialog.
8833 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8835 * src/support/LSubstring.C (LSubstring): set pos to string::npos
8836 when regex was not found.
8838 * src/support/lstrings.C (lowercase): use handcoded transform always.
8841 * src/text.C (Delete): fixed the crash. cursor.par->prev and
8842 old_cursor.par->prev could be 0.
8844 * several files: changed post inc/dec to pre inc/dec
8846 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
8847 write the lastfiles to file.
8849 * src/BufferView.C (buffer): only show TextCache info when debugging
8851 (resizeCurrentBuffer): ditto
8852 (workAreaExpose): ditto
8854 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
8856 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
8858 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
8859 a bit better by removing the special case for \i and \j.
8861 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8863 * src/lyx_main.C (easyParse): remove test for bad comand line
8864 options, since this broke all xforms-related parsing.
8866 * src/kbmap.C (getsym): set return type to unsigned long, as
8867 declared in header. On an alpha, long is _not_ the same as int.
8869 * src/support/LOstream.h: add a "using std::flush;"
8871 * src/insets/figinset.C: ditto.
8873 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8875 * src/bufferlist.C (write): use blinding fast file copy instead of
8876 "a char at a time", now we are doing it the C++ way.
8878 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
8879 std::list<int> instead.
8880 (addpidwait): reflect move to std::list<int>
8881 (sigchldchecker): ditto
8883 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
8886 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
8887 that obviously was wrong...
8889 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
8890 c, this avoids warnings with purify and islower.
8892 * src/insets/figinset.C: rename struct queue to struct
8893 queue_element and rewrite to use a std::queue. gsqueue is now a
8894 std::queue<queue_element>
8895 (runqueue): reflect move to std::queue
8898 * src/support/lstrings.h (tostr): specialize for bool, otherwise
8899 we would get "1" "0" instead of "true" "false. Also make the tostr
8902 2000-01-21 Juergen Vigna <jug@sad.it>
8904 * src/buffer.C (writeFileAscii): Disabled code for special groff
8905 handling of tabulars till I fix this in table.C
8907 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8909 * src/support/mkdir.C (mkdir): change second argument of mkdir to
8911 * src/support/lyxlib.h: ditto.
8913 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8915 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
8916 and 'j' look better. This might fix the "macron" bug that has been
8919 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
8920 functions as one template function. Delete the old versions.
8922 * src/support/lyxsum.C: move using std::ifstream inside
8925 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
8928 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
8930 * src/mathed/formula.C: delete #include "bufferlist.h" never used
8932 * src/insets/figinset.C (InitFigures): use new instead of malloc
8933 to allocate memory for figures and bitmaps.
8934 (DoneFigures): use delete[] instead of free to deallocate memory
8935 for figures and bitmaps.
8936 (runqueue): use new to allocate
8937 (getfigdata): use new/delete[] instead of malloc/free
8938 (RegisterFigure): ditto
8940 * some files: moved some declarations closer to first use, small
8941 whitespace changes use preincrement instead of postincrement where
8942 it does not make a difference.
8944 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
8945 step on the way to use stl::containers for key maps.
8947 * src/bufferlist.h: add a typedef for const_iterator and const
8948 versions of begin and end.
8950 * src/bufferlist.[Ch]: change name of member variable _state to
8951 state_. (avoid reserved names)
8953 (getFileNames): returns the filenames of the buffers in a vector.
8955 * configure.in (ALL_LINGUAS): added ro
8957 * src/support/putenv.C: new file
8959 * src/support/mkdir.C: new file
8961 2000-01-20 Allan Rae <rae@lyx.org>
8963 * lib/layouts/IEEEtran.layout: Added several theorem environments
8965 * lib/templates/IEEEtran.lyx: Example theorem environments and a
8966 couple of minor additions.
8968 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
8969 (except for those in footnotes of course)
8971 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8973 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
8975 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
8976 std::sort and std::lower_bound instead of qsort and handwritten
8978 (struct compara): struct that holds the functors used by std::sort
8979 and std::lower_bound in MathedLookupBOP.
8981 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8983 * src/support/LAssert.h: do not do partial specialization. We do
8986 * src/support/lyxlib.h: note that lyx::getUserName() and
8987 lyx::date() are not in use right now. Should these be suppressed?
8989 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
8990 (makeLinuxDocFile): do not put date and user name in linuxdoc
8993 * src/support/lyxlib.h (kill): change first argument to long int,
8994 since that's what solaris uses.
8996 * src/support/kill.C (kill): fix declaration to match prototype.
8998 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
8999 actually check whether namespaces are supported. This is not what
9002 * src/support/lyxsum.C: add a using directive.
9004 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9006 * src/support/kill.C: if we have namespace support we don't have
9007 to include lyxlib.h.
9009 * src/support/lyxlib.h: use namespace lyx if supported.
9011 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9013 * src/support/date.C: new file
9015 * src/support/chdir.C: new file
9017 * src/support/getUserName.C: new file
9019 * src/support/getcwd.C: new file
9021 * src/support/abort.C: new file
9023 * src/support/kill.C: new file
9025 * src/support/lyxlib.h: moved all the functions in this file
9026 insede struct lyx. Added also kill and abort to this struct. This
9027 is a way to avoid the "kill is not defined in <csignal>", we make
9028 C++ wrappers for functions that are not ANSI C or ANSI C++.
9030 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
9031 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
9032 lyx it has been renamed to sum.
9034 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9036 * src/text.C: add using directives for std::min and std::max.
9038 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9040 * src/texrow.C (getIdFromRow): actually return something useful in
9041 id and pos. Hopefully fixes the bug with positionning of errorbox
9044 * src/lyx_main.C (easyParse): output an error and exit if an
9045 incorrect command line option has been given.
9047 * src/spellchecker.C (ispell_check_word): document a memory leak.
9049 * src/bufferlist.C (write): fix mismatched allocation/deletion,
9050 where a "struct utimbuf" is allocated with "new" and deleted with
9053 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9055 * src/text2.C (CutSelection): don't delete double spaces.
9056 (PasteSelection): ditto
9057 (CopySelection): ditto
9059 * src/text.C (Backspace): don't delete double spaces.
9061 * src/lyxlex.C (next): fix a bug that were only present with
9062 conformant std::istream::get to read comment lines, use
9063 std::istream::getline instead. This seems to fix the problem.
9065 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9067 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
9068 allowed to insert space before space" editing problem. Please read
9069 commends at the beginning of the function. Comments about usage
9072 * src/text.C (InsertChar): fix for the "not allowed to insert
9073 space before space" editing problem.
9075 * src/text2.C (DeleteEmptyParagraphMechanism): when
9076 IsEmptyTableRow can only return false this last "else if" will
9077 always be a no-op. Commented out.
9079 * src/text.C (RedoParagraph): As far as I can understand tmp
9080 cursor is not really needed.
9082 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
9083 present it could only return false anyway.
9084 (several functions): Did something not so smart...added a const
9085 specifier on a lot of methods.
9087 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
9088 and add a tmp->text.resize. The LyXParagraph constructor does the
9090 (BreakParagraphConservative): ditto
9092 * src/support/path.h (Path): add a define so that the wrong usage
9093 "Path("/tmp") will be flagged as a compilation error:
9094 "`unnamed_Path' undeclared (first use this function)"
9096 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9098 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
9099 which was bogus for several reasons.
9101 * src/LaTeX.C (scanAux): fix the regular expression used to scan
9105 * autogen.sh: do not use "type -path" (what's that anyway?).
9107 * src/support/filetools.C (findtexfile): remove extraneous space
9108 which caused a kpsewhich warning (at least with kpathsea version
9111 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9113 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
9115 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
9117 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
9119 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9121 * src/paragraph.C (BreakParagraph): do not reserve space on text
9122 if we don't need to (otherwise, if pos_end < pos, we end up
9123 reserving huge amounts of memory due to bad unsigned karma).
9124 (BreakParagraphConservative): ditto, although I have not seen
9125 evidence the bug can happen here.
9127 * src/lyxparagraph.h: add a using std::list.
9129 2000-01-11 Juergen Vigna <jug@sad.it>
9131 * src/menus.C (MenuDocu): output an Alert if the documentation-file
9134 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9136 * src/vc-backend.C (doVCCommand): change to be static and take one
9137 more parameter: the path to chdir too be fore executing the command.
9138 (retrive): new function equiv to "co -r"
9140 * src/bufferlist.C (loadLyXFile): implement the missing parts if
9141 file_not_found_hook is true.
9143 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
9145 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
9146 if a file is readwrite,readonly...anything else.
9148 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9150 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
9151 (CreatePostscript): name change from MenuRunDVIPS (or something)
9152 (PreviewPostscript): name change from MenuPreviewPS
9153 (PreviewDVI): name change from MenuPreviewDVI
9155 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
9156 \view_pdf_command., \pdf_to_ps_command
9158 * lib/configure.m4: added search for PDF viewer, and search for
9159 PDF to PS converter.
9160 (lyxrc.defaults output): add \pdflatex_command,
9161 \view_pdf_command and \pdf_to_ps_command.
9163 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
9165 * src/bufferlist.C (write): we don't use blocksize for anything so
9168 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9170 * src/support/block.h: disable operator T* (), since it causes
9171 problems with both compilers I tried. See comments in the file.
9173 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
9176 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
9177 variable LYX_DIR_10x to LYX_DIR_11x.
9179 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
9181 * INSTALL: document --with-lyxname.
9184 * configure.in: new configure flag --with-lyxname which allows to
9185 choose the name under which lyx is installed. Default is "lyx", of
9186 course. It used to be possible to do this with --program-suffix,
9187 but the later has in fact a different meaning for autoconf.
9189 * src/support/lstrings.h (lstrchr): reformat a bit.
9191 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
9192 * src/mathed/math_defs.h: ditto.
9194 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9196 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
9197 true, decides if we create a backup file or not when saving. New
9198 tag and variable \pdf_mode, defaults to false. New tag and
9199 variable \pdflatex_command, defaults to pdflatex. New tag and
9200 variable \view_pdf_command, defaults to xpdf. New tag and variable
9201 \pdf_to_ps_command, defaults to pdf2ps.
9203 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9205 * src/bufferlist.C (close): don't call insetUnlock if the buffer
9206 does not have a BufferView.
9207 (unlockInset): ditto + don't access the_locking_inset if the
9208 buffer does not have a BufferView.
9210 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
9211 certain circumstances so that we don't continue a keyboard
9212 operation long after the key was released. Try f.ex. to load a
9213 large document, press PageDown for some seconds and then release
9214 it. Before this change the document would contine to scroll for
9215 some time, with this change it stops imidiatly.
9217 * src/support/block.h: don't allocate more space than needed. As
9218 long as we don't try to write to the arr[x] in a array_type arr[x]
9219 it is perfectly ok. (if you write to it you might segfault).
9220 added operator value_type*() so that is possible to pass the array
9221 to functions expecting a C-pointer.
9223 * lib/Makefile.am (dist-hook): don't fail completely if unable to
9226 * intl/*: updated to gettext 0.10.35, tried to add our own
9227 required modifications. Please verify.
9229 * po/*: updated to gettext 0.10.35, tried to add our own required
9230 modifications. Please verify.
9232 * src/support/lstrings.C (tostr): go at fixing the problem with
9233 cxx and stringstream. When stringstream is used return
9234 oss.str().c_str() so that problems with lyxstring and basic_string
9235 are avoided. Note that the best solution would be for cxx to use
9236 basic_string all the way, but it is not conformant yet. (it seems)
9238 * src/lyx_cb.C + other files: moved several global functions to
9239 class BufferView, some have been moved to BufferView.[Ch] others
9240 are still located in lyx_cb.C. Code changes because of this. (part
9241 of "get rid of current_view project".)
9243 * src/buffer.C + other files: moved several Buffer functions to
9244 class BufferView, the functions are still present in buffer.C.
9245 Code changes because of this.
9247 * config/lcmessage.m4: updated to most recent. used when creating
9250 * config/progtest.m4: updated to most recent. used when creating
9253 * config/gettext.m4: updated to most recent. applied patch for
9256 * config/gettext.m4.patch: new file that shows what changes we
9257 have done to the local copy of gettext.m4.
9259 * config/libtool.m4: new file, used in creation of acinclude.m4
9261 * config/lyxinclude.m4: new file, this is the lyx created m4
9262 macros, used in making acinclude.m4.
9264 * autogen.sh: GNU m4 discovered as a separate task not as part of
9265 the lib/configure creation.
9266 Generate acinlucde from files in config. Actually cat
9267 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
9268 easier to upgrade .m4 files that really are external.
9270 * src/Spacing.h: moved using std::istringstream to right after
9271 <sstream>. This should fix the problem seen with some compilers.
9273 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9275 * src/lyx_cb.C: began some work to remove the dependency a lot of
9276 functions have on BufferView::text, even if not really needed.
9277 (GetCurrentTextClass): removed this func, it only hid the
9280 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
9281 forgot this in last commit.
9283 * src/Bullet.C (bulletEntry): use static char const *[] for the
9284 tables, becuase of this the return arg had to change to string.
9286 (~Bullet): removed unneeded destructor
9288 * src/BufferView.C (beforeChange): moved from lyx_cb.C
9289 (insetSleep): moved from Buffer
9290 (insetWakeup): moved from Buffer
9291 (insetUnlock): moved from Buffer
9293 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
9294 from Buffer to BufferView.
9296 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
9298 * config/ltmain.sh: updated to version 1.3.4 of libtool
9300 * config/ltconfig: updated to version 1.3.4 of libtool
9302 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9305 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
9306 Did I get that right?
9308 * src/lyxlex.h: add a "using" directive or two.
9309 * src/Spacing.h: ditto.
9310 * src/insets/figinset.C: ditto.
9311 * src/support/filetools.C: ditto.
9312 * src/support/lstrings.C: ditto.
9313 * src/BufferView.C: ditto.
9314 * src/bufferlist.C: ditto.
9315 * src/lyx_cb.C: ditto.
9316 * src/lyxlex.C: ditto.
9318 * NEWS: add some changes for 1.1.4.
9320 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9322 * src/BufferView.C: first go at a TextCache to speed up switching
9325 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9327 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
9328 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
9329 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
9330 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
9333 * src/mathed/math_defs.h (MathedRowSt): make sure that all
9334 members of the struct are correctly initialized to 0 (detected by
9336 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
9337 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
9339 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
9340 pidwait, since it was allocated with "new". This was potentially
9341 very bad. Thanks to Michael Schmitt for running purify for us.
9344 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9346 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
9348 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
9350 1999-12-30 Allan Rae <rae@lyx.org>
9352 * lib/templates/IEEEtran.lyx: minor change
9354 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
9355 src/mathed/formula.C (LocalDispatch): askForText changes
9357 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
9358 know when a user has cancelled input. Fixes annoying problems with
9359 inserting labels and version control.
9361 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9363 * src/support/lstrings.C (tostr): rewritten to use strstream and
9366 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9368 * src/support/filetools.C (IsFileWriteable): use fstream to check
9369 (IsDirWriteable): use fileinfo to check
9371 * src/support/filetools.h (FilePtr): whole class deleted
9373 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
9375 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
9377 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
9379 * src/bufferlist.C (write): use ifstream and ofstream instead of
9382 * src/Spacing.h: use istrstream instead of sscanf
9384 * src/mathed/math_defs.h: change first arg to istream from FILE*
9386 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
9388 * src/mathed/math_parser.C: have yyis to be an istream
9389 (LexGetArg): use istream (yyis)
9391 (mathed_parse): ditto
9392 (mathed_parser_file): first arg istream instead of FILE*, set yyis
9394 * src/mathed/formula.C (Read): rewritten to use istream
9396 * src/mathed/formulamacro.C (Read): rewritten to use istream
9398 * src/lyxlex.h (~LyXLex): deleted desturctor
9399 (getStream): new function, returns an istream
9400 (getFile): deleted funtion
9401 (IsOK): return is.good();
9403 * src/lyxlex.C (LyXLex): delete file and owns_file
9404 (setFile): open an filebuf and assign that to a istream instead of
9406 (setStream): new function, takes an istream as arg.
9407 (setFile): deleted function
9408 (EatLine): rewritten us use istream instead of FILE*
9412 * src/table.C (LyXTable): use istream instead of FILE*
9413 (Read): rewritten to take an istream instead of FILE*
9415 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9417 * src/buffer.C (Dispatch): remove an extraneous break statement.
9419 * src/support/filetools.C (QuoteName): change to do simple
9420 'quoting'. More work is necessary. Also changed to do nothing
9421 under emx (needs fix too).
9422 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
9424 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
9425 config.h.in to the AC_DEFINE_UNQUOTED() call.
9426 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
9427 needs char * as argument (because Solaris 7 declares it like
9430 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
9431 remove definition of BZERO.
9433 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9435 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
9436 defined, "lyxregex.h" if not.
9438 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
9440 (REGEX): new variable that is set to regex.c lyxregex.h when
9441 AM_CONDITIONAL USE_REGEX is set.
9442 (libsupport_la_SOURCES): add $(REGEX)
9444 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
9447 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
9450 * configure.in: add call to LYX_REGEX
9452 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
9453 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
9455 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9457 * lib/bind/fi_menus.bind: new file, from
9458 pauli.virtanen@saunalahti.fi.
9460 * src/buffer.C (getBibkeyList): pass the parameter delim to
9461 InsetInclude::getKeys and InsetBibtex::getKeys.
9463 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
9464 is passed to Buffer::getBibkeyList
9466 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
9467 instead of the hardcoded comma.
9469 * src/insets/insetbib.C (getKeys): make sure that there are not
9470 leading blanks in bibtex keys. Normal latex does not care, but
9471 harvard.sty seems to dislike blanks at the beginning of citation
9472 keys. In particular, the retturn value of the function is
9474 * INSTALL: make it clear that libstdc++ is needed and that gcc
9475 2.7.x probably does not work.
9477 * src/support/filetools.C (findtexfile): make debug message go to
9479 * src/insets/insetbib.C (getKeys): ditto
9481 * src/debug.C (showTags): make sure that the output is correctly
9484 * configure.in: add a comment for TWO_COLOR_ICON define.
9486 * acconfig.h: remove all the entries that already defined in
9487 configure.in or acinclude.m4.
9489 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
9490 to avoid user name, date and copyright.
9492 1999-12-21 Juergen Vigna <jug@sad.it>
9494 * src/table.C (Read): Now read bogus row format informations
9495 if the format is < 5 so that afterwards the table can
9496 be read by lyx but without any format-info. Fixed the
9497 crash we experienced when not doing this.
9499 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9501 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
9502 (RedoDrawingOfParagraph): ditto
9503 (RedoParagraphs): ditto
9504 (RemoveTableRow): ditto
9506 * src/text.C (Fill): rename arg paperwidth -> paper_width
9508 * src/buffer.C (insertLyXFile): rename var filename -> fname
9509 (writeFile): rename arg filename -> fname
9510 (writeFileAscii): ditto
9511 (makeLaTeXFile): ditto
9512 (makeLinuxDocFile): ditto
9513 (makeDocBookFile): ditto
9515 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
9518 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
9520 * src/bmtable.h: add extern "C" on this file when __cplusplus is
9523 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
9524 compiled by a C compiler not C++.
9526 * src/layout.h (LyXTextClass): added typedef for const_iterator
9527 (LyXTextClassList): added typedef for const_iterator + member
9528 functions begin and end.
9530 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
9531 iterators to fill the choice_class.
9532 (updateLayoutChoice): rewritten to use iterators to fill the
9533 layoutlist in the toolbar.
9535 * src/BufferView.h (BufferView::work_area_width): removed unused
9538 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
9540 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
9541 (sgmlCloseTag): ditto
9543 * src/support/lstrings.h: return type of countChar changed to
9546 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
9547 what version of this func to use. Also made to return unsigned int.
9549 * configure.in: call LYX_STD_COUNT
9551 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
9552 conforming std::count.
9554 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9556 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
9557 and a subscript would give bad display (patch from Dekel Tsur
9558 <dekel@math.tau.ac.il>).
9560 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
9562 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
9565 * src/chset.h: add a few 'using' directives
9567 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
9568 triggered when no buffer is active
9570 * src/layout.C: removed `break' after `return' in switch(), since
9573 * src/lyx_main.C (init): make sure LyX can be ran in place even
9574 when libtool has done its magic with shared libraries. Fix the
9575 test for the case when the system directory has not been found.
9577 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
9578 name for the latex file.
9579 (MenuMakeHTML): ditto
9581 * src/buffer.h: add an optional boolean argument, which is passed
9584 1999-12-20 Allan Rae <rae@lyx.org>
9586 * lib/templates/IEEEtran.lyx: small correction and update.
9588 * configure.in: Attempted to use LYX_PATH_HEADER
9590 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
9592 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
9593 input from JMarc. Now use preprocessor to find the header.
9594 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
9595 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
9596 LYX_STL_STRING_FWD. See comments in file.
9598 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
9600 * The global MiniBuffer * minibuffer variable is dead.
9602 * The global FD_form_main * fd_form_main variable is dead.
9604 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9606 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
9608 * src/table.h: add the LOstream.h header
9609 * src/debug.h: ditto
9611 * src/LyXAction.h: change the explaination of the ReadOnly
9612 attribute: is indicates that the function _can_ be used.
9614 * src/LyXAction.C (init): find-replace _can_ be used in read-only
9617 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9619 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
9625 * src/paragraph.C (GetWord): assert on pos>=0
9628 * src/support/lyxstring.C: condition the use of an invariant on
9630 * src/support/lyxstring.h: ditto
9632 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
9633 Use LAssert.h instead of plain assert().
9635 * src/support/lstrings.h: add LAssert.h, in case it is needed.
9637 * src/lyxfunc.C: do not include LAssert.h, it is not used.
9638 * src/support/filetools.C: ditto
9640 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
9643 * INSTALL: document the new configure flags
9645 * configure.in: suppress --with-debug; add --enable-assertions
9647 * acinclude.m4: various changes in alignment of help strings.
9649 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9651 * src/kbmap.C: commented out the use of the hash map in kb_map,
9652 beginning of movement to a stl::container.
9654 * several files: removed code that was not in effect when
9655 MOVE_TEXT was defined.
9657 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
9658 for escaping should not be used. We can discuss if the string
9659 should be enclosed in f.ex. [] instead of "".
9661 * src/trans_mgr.C (insert): use the new returned value from
9662 encodeString to get deadkeys and keymaps done correctly.
9664 * src/chset.C (encodeString): changed to return a pair, to tell
9665 what to use if we know the string.
9667 * src/lyxscreen.h (fillArc): new function.
9669 * src/FontInfo.C (resize): rewritten to use more std::string like
9670 structore, especially string::replace.
9672 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
9675 * configure.in (chmod +x some scripts): remove config/gcc-hack
9677 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9679 * src/buffer.C (writeFile): change once again the top comment in a
9680 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
9681 instead of an hardcoded version number.
9682 (makeDocBookFile): ditto
9684 * src/version.h: add new define LYX_DOCVERSION
9686 * po/de.po: update from Pit Sütterlin
9687 * lib/bind/de_menus.bind: ditto.
9689 * src/lyxfunc.C (Dispatch): call MenuExport()
9690 * src/buffer.C (Dispatch): ditto
9692 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
9693 LyXFunc::Dispatch().
9694 (MenuExport): new function, moved from
9695 LyXFunc::Dispatch().
9697 * src/trans_mgr.C (insert): small cleanup
9698 * src/chset.C (loadFile): ditto
9700 * lib/kbd/iso8859-1.cdef: add missing backslashes
9702 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9704 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
9705 help with placing the manually drawn accents better.
9707 (Draw): x2 and hg changed to float to minimize rounding errors and
9708 help place the accents better.
9710 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
9711 unsigned short to char is just wrong...cast the char to unsigned
9712 char instead so that the two values can compare sanely. This
9713 should also make the display of insetlatexaccents better and
9714 perhaps also some other insets.
9716 (lbearing): new function
9719 1999-12-15 Allan Rae <rae@lyx.org>
9721 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
9722 header that provides a wrapper around the very annoying SGI STL header
9725 * src/support/lyxstring.C, src/LString.h:
9726 removed old SGI-STL-compatability attempts.
9728 * configure.in: Use LYX_STL_STRING_FWD.
9730 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
9731 stl_string_fwd.h is around and try to determine it's location.
9732 Major improvement over previous SGI STL 3.2 compatability.
9733 Three small problems remain with this function due to my zero
9734 knowledge of autoconf. JMarc and lgb see the comments in the code.
9736 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9738 * src/broken_const.h, config/hack-gcc, config/README: removed
9740 * configure.in: remove --with-gcc-hack option; do not call
9743 * INSTALL: remove documentation of --with-broken-const and
9746 * acconfig.h: remove all trace of BROKEN_CONST define
9748 * src/buffer.C (makeDocBookFile): update version number in output
9750 (SimpleDocBookOnePar): fix an assert when trying to a character
9751 access beyond string length
9754 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9756 * po/de.po: fix the Export menu
9758 * lyx.man: update the description of -dbg
9760 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
9761 (commandLineHelp): updated
9762 (easyParse): show list of available debug levels if -dbg is passed
9765 * src/Makefile.am: add debug.C
9767 * src/debug.h: moved some code to debug.C
9769 * src/debug.C: new file. Contains code to set and show debug
9772 * src/layout.C: remove 'break' after 'continue' in switch
9773 statements, since these cannot be reached.
9775 1999-12-13 Allan Rae <rae@lyx.org>
9777 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
9778 (in_word_set): hash() -> math_hash()
9780 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
9782 * acconfig.h: Added a test for whether we are using exceptions in the
9783 current compilation run. If so USING_EXCEPTIONS is defined.
9785 * config.in: Check for existance of stl_string_fwd.h
9786 * src/LString.h: If compiling --with-included-string and SGI's
9787 STL version 3.2 is present (see above test) we need to block their
9788 forward declaration of string and supply a __get_c_string().
9789 However, it turns out this is only necessary if compiling with
9790 exceptions enabled so I've a bit more to add yet.
9792 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
9793 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
9794 src/support/LRegex.h, src/undo.h:
9795 Shuffle the order of the included files a little to ensure that
9796 LString.h gets included before anything that includes stl_string_fwd.h
9798 * src/support/lyxstring.C: We need to #include LString.h instead of
9799 lyxstring.h to get the necessary definition of __get_c_string.
9800 (__get_c_string): New function. This is defined static just like SGI's
9801 although why they need to do this I'm not sure. Perhaps it should be
9802 in lstrings.C instead.
9804 * lib/templates/IEEEtran.lyx: New template file.
9806 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9808 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
9809 * intl/Makefile.in (MKINSTALLDIRS): ditto
9811 * src/LyXAction.C (init): changed to hold the LFUN data in a
9812 automatic array in stead of in callso to newFunc, this speeds up
9813 compilation a lot. Also all the memory used by the array is
9814 returned when the init is completed.
9816 * a lot of files: compiled with -Wold-style-cast, changed most of
9817 the reported offenders to C++ style casts. Did not change the
9818 offenders in C files.
9820 * src/trans.h (Match): change argument type to unsigned int.
9822 * src/support/DebugStream.C: fix some types on the streambufs so
9823 that it works on a conforming implementation.
9825 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9827 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
9829 * src/support/lyxstring.C: remove the inline added earlier since
9830 they cause a bunch of unsatisfied symbols when linking with dec
9831 cxx. Cxx likes to have the body of inlines at the place where they
9834 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
9835 accessing negative bounds in array. This fixes the crash when
9836 inserting accented characters.
9837 * src/trans.h (Match): ditto
9839 * src/buffer.C (Dispatch): since this is a void, it should not try
9840 to return anything...
9842 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9844 * src/buffer.h: removed the two friends from Buffer. Some changes
9845 because of this. Buffer::getFileName and Buffer::setFileName
9846 renamed to Buffer::fileName() and Buffer::fileName(...).
9848 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9850 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
9851 and Buffer::update(short) to BufferView. This move is currently
9852 controlled by a define MOVE_TEXT, this will be removed when all
9853 shows to be ok. This move paves the way for better separation
9854 between buffer contents and buffer view. One side effect is that
9855 the BufferView needs a rebreak when swiching buffers, if we want
9856 to avoid this we can add a cache that holds pointers to LyXText's
9857 that is not currently in use.
9859 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
9862 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9864 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
9866 * lyx_main.C: new command line option -x (or --execute) and
9867 -e (or --export). Now direct conversion from .lyx to .tex
9868 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
9869 Unfortunately, X is still needed and the GUI pops up during the
9872 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9874 * src/Spacing.C: add a using directive to bring stream stuff into
9876 * src/paragraph.C: ditto
9877 * src/buffer.C: ditto
9879 * NEWS: updated a bit the new features of 1.1.3 (took a few things
9880 from Lars' announcement).
9882 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
9883 example files from Tino Meinen.
9885 1999-12-06 Allan Rae <rae@lyx.org>
9887 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
9889 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9891 * src/support/lyxstring.C: added a lot of inline for no good
9894 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
9895 latexWriteEndChanges, they were not used.
9897 * src/layout.h (operator<<): output operator for PageSides
9899 * src/mathed/math_iter.C (my_memcpy): slightly changed.
9901 * some example files: loaded in LyX 1.0.4 and saved again to update
9902 certain constructs (table format)
9904 * a lot of files: did the change to use fstream/iostream for all
9905 writing of files. Done with a close look at Andre Poenitz's patch.
9907 * some files: whitespace changes.
9909 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9911 * src/mathed/math_iter.C (my_memcpy): new function. Since the
9912 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
9913 architecture, we provide our own. It is used unconditionnally, but
9914 I do not think this is a performance problem. Thanks to Angus
9915 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
9916 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
9918 (GetInset): use my_memcpy.
9922 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
9923 it is easier to understand, but it uses less TeX-only constructs now.
9925 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
9926 elements contain spaces
9928 * lib/configure: regenerated
9930 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
9931 elements contain spaces; display the list of programs that are
9934 * autogen.sh: make sure lib/configure is executable
9936 * lib/examples/*: rename the tutorial examples to begin with the
9937 two-letters language code.
9939 * src/lyxfunc.C (getStatus): do not query current font if no
9942 * src/lyx_cb.C (RunScript): use QuoteName
9943 (MenuRunDvips): ditto
9944 (PrintApplyCB): ditto
9946 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
9947 around argument, so that it works well with the current shell.
9948 Does not work properly with OS/2 shells currently.
9950 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
9951 * src/LyXSendto.C (SendtoApplyCB): ditto
9952 * src/lyxfunc.C (Dispatch): ditto
9953 * src/buffer.C (runLaTeX): ditto
9954 (runLiterate): ditto
9955 (buildProgram): ditto
9957 * src/lyx_cb.C (RunScript): ditto
9958 (MenuMakeLaTeX): ditto
9960 * src/buffer.h (getLatexName): new method
9962 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
9964 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9966 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
9967 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
9968 (create_math_panel): ditto
9970 * src/lyxfunc.C (getStatus): re-activate the code which gets
9971 current font and cursor; add test for export to html.
9973 * src/lyxrc.C (read): remove unreachable break statements; add a
9976 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
9978 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9980 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
9981 introduced by faulty regex.
9982 * src/buffer.C: ditto
9983 * src/lastfiles.C: ditto
9984 * src/paragraph.C: ditto
9985 * src/table.C: ditto
9986 * src/vspace.C: ditto
9987 * src/insets/figinset.C: ditto
9988 Note: most of these is absolutely harmless, except the one in
9989 src/mathed formula.C.
9991 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9993 * src/ImportNoweb.C (documentclass): fixed bounds for substr
9994 operation, yielding correct results for the reLyX command.
9996 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9998 * src/support/filetools.C (ExpandPath): removed an over eager
10000 (ReplaceEnvironmentPath): ditto
10002 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
10003 shows that we are doing something fishy in our code...
10004 (BubblePost): ditto
10007 * src/lyxrc.C (read): use a double switch trick to get more help
10008 from the compiler. (the same trick is used in layout.C)
10009 (write): new function. opens a ofstream and pass that to output
10010 (output): new function, takes a ostream and writes the lyxrc
10011 elemts to it. uses a dummy switch to make sure no elements are
10014 * src/lyxlex.h: added a struct pushpophelper for use in functions
10015 with more than one exit point.
10017 * src/lyxlex.[Ch] (GetInteger): made it const
10021 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
10023 * src/layout.[hC] : LayoutTags splitted into several enums, new
10024 methods created, better error handling cleaner use of lyxlex. Read
10027 * src/bmtable.[Ch]: change some member prototypes because of the
10028 image const changes.
10030 * commandtags.h, src/LyXAction.C (init): new function:
10031 "preferences-save", saves the lyxrc entries into .lyx/preferences.
10032 This file is not read automatically but you can add \input
10033 preferences to your lyxrc if you want to. We need to discuss how
10036 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
10037 in .aux, also remove .bib and .bst files from dependencies when
10040 * src/BufferView.C, src/LyXView.C: add const_cast several places
10041 because of changes to images.
10043 * lib/images/*: same change as for images/*
10045 * lib/lyxrc.example: Default for accept_compound is false not no.
10047 * images/*: changed to be const, however I have som misgivings
10048 about this change so it might be changed back.
10050 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10052 * lib/configure, po/POTFILES.in: regenerated
10054 * autogen.sh: autogenerate lib/configure from lib/configure.m4
10056 * config/lib_configure.m4: removed
10058 * lib/configure.m4: new file (was config/lib_configure.m4)
10060 * configure.in: do not test for rtti, since we do not use it.
10062 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10064 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
10065 doubling of allocated space scheme. This makes it faster for large
10066 strings end to use less memory for small strings. xtra rememoved.
10068 * src/insets/figinset.C (waitalarm): commented out.
10069 (GhostscriptMsg): use static_cast
10070 (GhostscriptMsg): use new instead of malloc to allocate memory for
10071 cmap. also delete the memory after use.
10073 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
10075 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
10076 for changes in bibtex database or style.
10077 (runBibTeX): remove all .bib and .bst files from dep before we
10079 (run): use scanAuc in when dep file already exist.
10081 * src/DepTable.C (remove_files_with_extension): new method
10082 (exist): new method
10084 * src/DepTable.[Ch]: made many of the methods const.
10086 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10088 * src/bufferparams.C: make sure that the default textclass is
10089 "article". It used to be the first one by description order, but
10090 now the first one is "docbook".
10092 * src/lyx_main.C (setDebuggingLevel): change type of argument to
10093 string; call Debug::value.
10094 (easyParse): pass complete argument to setDebuggingLevel().
10096 * src/debug.h (value): fix the code that parses debug levels.
10098 * src/debug.h: add new debug type ACTION, reserved for LyXAction
10101 * src/LyXAction.C: use Debug::ACTION as debug channel.
10103 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
10105 * NEWS: updated for the future 1.1.3 release.
10107 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
10108 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
10109 it should. This is of course a controversial change (since many
10110 people will find that their lyx workscreen is suddenly full of
10111 red), but done for the sake of correctness.
10113 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
10114 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
10116 * src/insets/inseterror.h, src/insets/inseturl.h,
10117 src/insets/insetinfo.h, src/insets/figinset.h,
10118 src/mathed/formulamacro.h, src/mathed/math_macro.h
10119 (EditMessage): add a missing const and add _() to make sure that
10120 translation happens
10122 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
10123 src/insets/insetbib.C, src/support/filetools.C: add `using'
10124 directives for cxx.
10126 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
10127 doing 'Insert index of last word' at the beginning of a paragraph.
10129 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10131 * several files: white-space changes.
10133 * src/mathed/formula.C: removed IsAlpha and IsDigit
10135 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
10136 .bib file. use a ifstream instead of FilePtr when parsing the .bib
10139 * src/insets/figinset.C (GetPSSizes): don't break when
10140 "EndComments" is seen. But break when a boundingbox is read.
10142 * all classes inherited from Inset: return value of Clone
10143 changed back to Inset *.
10145 * all classes inherited form MathInset: return value of Clone
10146 changed back to MathedInset *.
10148 * src/insets/figinset.C (runqueue): use a ofstream to output the
10149 gs/ps file. Might need some setpresicion or setw. However I can
10150 see no problem with the current code.
10151 (runqueue): use sleep instead of the alarm/signal code. I just
10152 can't see the difference.
10154 * src/paragraph.C (LyXParagraph): reserve space in the new
10155 paragraph and resize the inserted paragraph to just fit.
10157 * src/lyxfunc.h (operator|=): added operator for func_status.
10159 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
10160 check for readable file.
10162 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
10163 check for readable file.
10164 (MenuMakeLinuxDoc): ditto
10165 (MenuMakeDocBook): ditto
10166 (MenuMakeAscii): ditto
10167 (InsertAsciiFile): split the test for openable and readable
10169 * src/bmtable.C (draw_bitmaptable): use
10170 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
10172 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
10173 findtexfile from LaTeX to filetools.
10175 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
10176 instead of FilePtr. Needs to be verified by a literate user.
10178 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10180 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
10181 (EditMessage): likewise.
10183 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
10184 respectively as \textasciitilde and \textasciicircum.
10186 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10188 * src/support/lyxstring.h: made the methods that take iterators
10189 use const_iterator.
10191 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
10192 (regexMatch): made is use the real regex class.
10194 * src/support/Makefile.am: changed to use libtool
10196 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
10198 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
10200 (MathIsInset ++): changed several macros to be inline functions
10203 * src/mathed/Makefile.am: changed to use libtool
10205 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
10207 * src/insets/inset* : Clone changed to const and return type is
10208 the true insettype not just Inset*.
10210 * src/insets/Makefile.am: changed to use libtool
10212 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
10214 * src/undo.[Ch] : added empty() and changed some of the method
10217 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
10219 * src/lyxparagraph.h: use id() and id(...) instead of getID and
10220 setID use block<> for the bullets array, added const several places.
10222 * src/lyxfunc.C (getStatus): new function
10224 * src/lyxfunc.[Ch] : small changes to take advantage of the new
10225 LyXAction, added const to several funtions.
10227 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
10228 a std::map, and to store the dir items in a vector.
10230 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
10233 * src/LyXView.[Ch] + other files : changed currentView to view.
10235 * src/LyXAction.[Ch] : ported from the old devel branch.
10237 * src/.cvsignore: added .libs and a.out
10239 * configure.in : changes to use libtool.
10241 * acinclude.m4 : inserted libtool.m4
10243 * .cvsignore: added libtool
10245 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10247 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
10248 file name in insets and mathed directories (otherwise the
10249 dependency is not taken in account under cygwin).
10251 * src/text2.C (InsertString[AB]): make sure that we do not try to
10252 read characters past the string length.
10254 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10256 * lib/doc/LaTeXConfig.lyx.in,
10257 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
10259 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
10260 file saying who created them and when this heppened; this is
10261 useless and annoys tools like cvs.
10263 * lib/layouts/g-brief-{en,de}.layout,
10264 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
10265 from Thomas Hartkens <thomas@hartkens.de>.
10267 * src/{insets,mathed}/Makefile.am: do not declare an empty
10268 LDFLAGS, so that it can be set at configure time (useful on Irix
10271 * lib/reLyX/configure.in: make sure that the prefix is set
10272 correctly in LYX_DIR.
10274 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10276 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
10277 be used by 'command-sequence' this allows to bind a key to a
10278 sequence of LyX-commands
10279 (Example: 'command-sequence math-insert alpha; math-insert beta;")
10281 * src/LyXAction.C: add "command-sequence"
10283 * src/LyXFunction.C: handling of "command-sequence"
10285 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
10286 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
10288 * src/lyxserver.C, src/minibuffer.C: Use this new interface
10290 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10292 * src/buffer.C (writeFile): Do not output a comment giving user
10293 and date at the beginning of a .lyx file. This is useless and
10294 annoys cvs anyway; update version number to 1.1.
10296 * src/Makefile.am (LYX_DIR): add this definition, so that a
10297 default path is hardcoded in LyX.
10299 * configure.in: Use LYX_GNU_GETTEXT.
10301 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
10302 AM_GNU_GETTEXT with a bug fixed.
10304 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
10306 * src/chset.C: add "using std::ifstream;" to please dec cxx.
10308 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
10309 which is used to point to LyX data is now LYX_DIR_11x.
10311 * lyx.man: convert to a unix text file; small updates.
10313 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10315 * src/support/LSubstring.[Ch]: made the second arg of most of the
10316 constructors be a const reference.
10318 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
10321 * src/support/lyxstring.[Ch] (swap): added missing member function
10322 and specialization of swap(str, str);
10324 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
10326 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
10327 trace of the old one.
10329 * src/undo.[Ch]: made the undostack use std::list to store undo's in
10330 put the member definitions in undo.C.
10332 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
10333 NEW_TEXT and have now only code that was included when this was
10336 * src/intl.C (LCombo): use static_cast
10338 (DispatchCallback): ditto
10340 * src/definitions.h: removed whole file
10342 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
10344 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
10345 parsing and stores in a std:map. a regex defines the file format.
10346 removed unneeded members.
10348 * src/bufferparams.h: added several enums from definitions.h here.
10349 Removed unsused destructor. Changed some types to use proper enum
10350 types. use block to have the temp_bullets and user_defined_bullets
10351 and to make the whole class assignable.
10353 * src/bufferparams.C (Copy): removed this functions, use a default
10354 assignment instead.
10356 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
10359 * src/buffer.C (readLyXformat2): commend out all that have with
10360 oldpapersize to do. also comment out all that hve to do with
10361 insetlatex and insetlatexdel.
10362 (setOldPaperStuff): commented out
10364 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
10366 * src/LyXAction.C: remove use of inset-latex-insert
10368 * src/mathed/math_panel.C (button_cb): use static_cast
10370 * src/insets/Makefile.am (insets_o_SOURCES): removed
10373 * src/support/lyxstring.C (helper): use the unsigned long
10374 specifier, UL, instead of a static_cast.
10376 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
10378 * src/support/block.h: new file. to be used as a c-style array in
10379 classes, so that the class can be assignable.
10381 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10383 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
10384 NULL, make sure to return an empty string (it is not possible to
10385 set a string to NULL).
10387 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10389 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
10391 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
10393 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
10394 link line, so that Irix users (for example) can set it explicitely to
10397 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
10398 it can be overidden at make time (static or dynamic link, for
10401 * src/vc-backend.C, src/LaTeXFeatures.h,
10402 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
10403 statements to bring templates to global namespace.
10405 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10407 * src/support/lyxstring.C (operator[] const): make it standard
10410 * src/minibuffer.C (Init): changed to reflect that more
10411 information is given from the lyxvc and need not be provided here.
10413 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
10415 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
10417 * src/LyXView.C (UpdateTimerCB): use static_cast
10418 (KeyPressMask_raw_callback): ditto
10420 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
10421 buffer_, a lot of changes because of this. currentBuffer() ->
10422 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
10423 also changes to other files because of this.
10425 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10427 * src/vc-backend.[Ch]: new files. The backends for vc handling,
10428 have no support for RCS and partial support for CVS, will be
10431 * src/insets/ several files: changes because of function name
10432 changes in Bufferview and LyXView.
10434 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
10436 * src/support/LSubstring.[Ch]: new files. These implement a
10437 Substring that can be very convenient to use. i.e. is this
10439 string a = "Mary had a little sheep";
10440 Substring(a, "sheep") = "lamb";
10441 a is now "Mary has a little lamb".
10443 * src/support/LRegex.[Ch]: a regex class that can be used to pick
10444 out patterns and subpatterns of strings. It is used by LSubstring
10445 and also by vc-backend.C
10447 * src/support/lyxstring.C: went over all the assertions used and
10448 tried to correct the wrong ones and flag which of them is required
10449 by the standard. some bugs found because of this. Also removed a
10450 couple of assertions.
10452 * src/support/Makefile.am (libsupport_a_SOURCES): added
10453 LSubstring.[Ch] and LRegex.[Ch]
10455 * src/support/FileInfo.h: have struct stat buf as an object and
10456 not a pointer to one, some changes because of this.
10458 * src/LaTeXFeatures.C (getTClassPreamble): also use the
10459 information in layout when adding the layouts preamble to the
10460 textclass preamble.
10462 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
10465 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
10466 because of bug in OS/2.
10468 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10470 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
10471 \verbatim@font instead of \ttfamily, so that it can be redefined.
10473 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
10474 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
10475 src/layout.h, src/text2.C: add 'using' directive to bring the
10476 STL templates we need from the std:: namespace to the global one.
10477 Needed by DEC cxx in strict ansi mode.
10479 * src/support/LIstream.h,src/support/LOstream.h,
10480 src/support/lyxstring.h,src/table.h,
10481 src/lyxlookup.h: do not include <config.h> in header
10482 files. This should be done in the .C files only.
10484 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
10488 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10490 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
10491 from Kayvan to fix the tth invokation.
10493 * development/lyx.spec.in: updates from Kayvan to reflect the
10494 changes of file names.
10496 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10498 * src/text2.C (InsertStringB): use std::copy
10499 (InsertStringA): use std::copy
10501 * src/bufferlist.C: use a vector to store the buffers in. This is
10502 an internal change and should not affect any other thing.
10504 * src/BufferView.C (waitForX): use XSync instead of the lengthy
10507 * src/text.C (Fill): fix potential bug, one off bug.
10509 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10511 * src/Makefile.am (lyx_main.o): add more files it depends on.
10513 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
10515 * src/support/lyxstring.C: use size_t for the reference count,
10516 size, reserved memory and xtra.
10517 (internal_compare): new private member function. Now the compare
10518 functions should work for std::strings that have embedded '\0'
10520 (compare): all compare functions rewritten to use
10523 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10525 * src/support/lyxstring.C (compare): pass c_str()
10526 (compare): pass c_str
10527 (compare): pass c_str
10529 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10531 * src/support/DebugStream.C: <config.h> was not included correctly.
10533 * lib/configure: forgot to re-generate it :( I'll make this file
10534 auto generated soon.
10536 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10538 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
10541 * src/support/lyxstring.C: some changes from length() to rep->sz.
10542 avoids a function call.
10544 * src/support/filetools.C (SpaceLess): yet another version of the
10545 algorithm...now per Jean-Marc's suggestions.
10547 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10549 * src/layout.C (less_textclass_desc): functor for use in sorting
10551 (LyXTextClass::Read): sort the textclasses after reading.
10553 * src/support/filetools.C (SpaceLess): new version of the
10554 SpaceLess functions. What problems does this one give? Please
10557 * images/banner_bw.xbm: made the arrays unsigned char *
10559 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10561 * src/support/lyxstring.C (find): remove bogus assertion in the
10562 two versions of find where this has not been done yet.
10564 * src/support/lyxlib.h: add missing int return type to
10567 * src/menus.C (ShowFileMenu): disable exporting to html if no
10568 html export command is present.
10570 * config/lib_configure.m4: add a test for an HTML converter. The
10571 programs checked for are, in this order: tth, latex2html and
10574 * lib/configure: generated from config/lib_configure.m4.
10576 * src/lyxfunc.C (Dispatch): update and improve the execution of an
10577 html converter. The parameters are now passed through $$FName and
10578 $$OutName, instead of standard input/output.
10580 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
10582 * lib/lyxrc.example: update description of \html_command.
10583 add "quotes" around \screen_font_xxx font setting examples to help
10584 people who use fonts with spaces in their names.
10586 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10588 * Distribution files: updates for v1.1.2
10590 * src/support/lyxstring.C (find): remove bogus assert and return
10591 npos for the same condition.
10593 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10595 * added patch for OS/2 from SMiyata.
10597 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10599 * src/text2.C (CutSelection): make space_wrapped a bool
10600 (CutSelection): dont declare int i until we have to.
10601 (alphaCounter): return a char const *.
10603 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10605 * src/support/syscall.C (Systemcalls::kill):
10606 src/support/filetools.C (PutEnv, PutEnvPath):
10607 src/lyx_cb.C (addNewlineAndDepth):
10608 src/FontInfo.C (FontInfo::resize): condition some #warning
10609 directives with WITH_WARNINGS.
10612 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10614 * src/layout.[Ch] + several files: access to class variables
10615 limited and made accessor functions instead a lot of code changed
10616 becuase of this. Also instead of returning pointers often a const
10617 reference is returned instead.
10619 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
10621 * src/Makefile.am (dist-hook): added used to remove the CVS from
10622 cheaders upon creating a dist
10623 (EXTRA_DIST): added cheaders
10625 * src/support/lstrings.C (tostr(char)): fix it to handle param as
10626 a character not as a small integer.
10628 * src/support/lyxstring.C (find): removed Assert and added i >=
10629 rep->sz to the first if.
10631 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10633 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
10634 src/LyXView.C src/buffer.C src/bufferparams.C
10635 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
10636 src/text2.C src/insets/insetinclude.C:
10637 lyxlayout renamed to textclasslist.
10639 * src/layout.C: some lyxerr changes.
10641 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
10642 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
10643 (LyXLayoutList): removed all traces of this class.
10644 (LyXTextClass::Read): rewrote LT_STYLE
10645 (LyXTextClass::hasLayout): new function
10646 (LyXTextClass::GetLayout): rewritten to return an iterator + has
10647 both const and nonconst version.
10648 (LyXTextClass::delete_layout): new function.
10649 (LyXTextClassList::Style): bug fix. do the right thing if layout
10651 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
10652 (LyXTextClassList::NameOfLayout): ditto
10653 (LyXTextClassList::Load): ditto
10655 * src/buffer.C (makeLaTeXFile): new access to layoutlist
10657 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
10659 * src/LyXAction.C (LookupFunc): added a workaround for sun
10660 compiler, on the other hand...we don't know if the current code
10661 compiles on sun at all...
10663 * src/support/filetools.C (CleanupPath): subst fix
10665 * src/insets/insetbib.C (delDatabase): subst fix, this looks
10668 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
10669 complained about this one?
10671 * src/insets/insetinclude.C (Latex): subst fix
10673 * src/insets/insetbib.C (getKeys): subst fix
10675 * src/LyXSendto.C (SendtoApplyCB): subst fix
10677 * src/lyx_main.C (init): subst fix
10679 * src/layout.C (Read): subst fix
10681 * src/lyx_sendfax_main.C (button_send): subst fix
10683 * src/buffer.C (RoffAsciiTable): subst fix
10685 * src/lyx_cb.C (MenuFax): subst fix
10686 (PrintApplyCB): subst fix
10688 1999-10-26 Juergen Vigna <jug@sad.it>
10690 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
10692 (Read): Cleaned up this code so now we read only format vestion >= 5
10694 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10696 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
10697 come nobody has complained about this one?
10699 * src/insets/insetinclude.C (Latex): subst fix
10701 * src/insets/insetbib.C (getKeys): subst fix
10703 * src/lyx_main.C (init): subst fix
10705 * src/layout.C (Read): subst fix
10707 * src/buffer.C (RoffAsciiTable): subst fix
10709 * src/lyx_cb.C (MenuFax): subst fix.
10711 * src/layout.[hC] + some other files: rewrote to use
10712 std::container to store textclasses and layouts in.
10713 Simplified, removed a lot of code. Make all classes
10714 assignable. Further simplifications and review of type
10715 use still to be one.
10717 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
10718 lastfiles to create the lastfiles partr of the menu.
10720 * src/lastfiles.[Ch]: rewritten to use deque to store the
10721 lastfiles in. Uses fstream for reading and writing. Simplifies
10724 * src/support/syscall.C: remove explicit cast.
10726 * src/BufferView.C (CursorToggleCB): removed code snippets that
10727 were commented out.
10728 use explicat C++ style casts instead of C style casts. also use
10729 u_vdata instea of passing pointers in longs.
10731 * src/PaperLayout.C: removed code snippets that were commented out.
10733 * src/lyx_gui_misc.C: removed code snippets that were commented out.
10735 * src/lyx_main.C: removed code snippets that wer commented out.
10737 * src/paragraph.C: removed code snippets that were commented out.
10739 * src/lyxvc.C (logClose): use static_cast
10741 (viewLog): remove explicit cast to void*
10742 (showLog): removed old commented code
10744 * src/menus.C: use static_cast instead of C style casts. use
10745 u_vdata instead of u_ldata. remove explicit cast to (long) for
10746 pointers. Removed old code that was commented out.
10748 * src/insets/inset.C: removed old commented func
10750 * src/insets/insetref.C (InsetRef): removed old code that had been
10751 commented out for a long time.
10753 (escape): removed C style cast
10755 * src/insets/insetlatexaccent.C (Draw): removed old commented code
10757 * src/insets/insetlatex.C (Draw): removed old commented code
10758 (Read): rewritten to use string
10760 * src/insets/insetlabel.C (escape): removed C style cast
10762 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
10764 * src/insets/insetindex.C: use static_cast and u_vdata, removed
10765 old commented code.
10767 * src/insets/insetinclude.h: removed a couple of stupid bools
10769 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
10770 (Clone): remove C style cast
10771 (getKeys): changed list to lst because of std::list
10773 * src/insets/inseterror.C (Draw): removed som old commented code.
10775 * src/insets/insetcommand.C (Draw): removed some old commented code.
10777 * src/insets/insetbib.C (bibitem_cb): removed code that has been
10778 commented out forever.
10779 (bibitem_cb): use static_cast instead of C style cast
10780 use of vdata changed to u_vdata.
10782 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
10784 (CloseUrlCB): use static_cast instead of C style cast.
10785 (CloseUrlCB): added a fl_free form...it seemed to be missing.
10787 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
10788 (C_InsetInfo_CloseInfoCB): forward the ob parameter
10789 (CloseInfoCB): static_cast from ob->u_vdata instead.
10790 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
10793 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
10794 (C_InsetError_CloseErrorCB): forward the ob parameter
10795 (CloseErrorCB): static_cast from ob->u_vdata instead.
10797 * src/vspace.h: include LString.h since we use string in this class.
10799 * src/vspace.C (lyx_advance): changed name from advance because of
10800 nameclash with stl. And since we cannot use namespaces yet...I
10801 used a lyx_ prefix instead. Expect this to change when we begin
10804 * src/BufferView.[Ch] (BufferView::~BufferView): removed
10806 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
10807 and removed now defunct constructor and deconstructor.
10809 * src/BufferView.h: have backstack as a object not as a pointer.
10810 removed initialization from constructor. added include for BackStack
10812 * development/lyx.spec.in (%build): add CFLAGS also.
10814 * src/screen.C (drawFrame): removed another warning.
10816 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10818 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
10819 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
10820 README and ANNOUNCE a bit for the next release. More work is
10823 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
10824 unbreakable if we are in freespacing mode (LyX-Code), but not in
10827 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10829 * src/BackStack.h: fixed initialization order in constructor
10831 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
10833 * acinclude.m4 (VERSION): new rules for when a version is
10834 development, added also a variable for prerelease.
10835 (warnings): we set with_warnings=yes for prereleases
10836 (lyx_opt): prereleases compile with same optimization as development
10837 (CXXFLAGS): only use pedantic if we are a development version
10839 * src/BufferView.C (restorePosition): don't do anything if the
10840 backstack is empty.
10842 * src/BackStack.h: added member empty, use this to test if there
10843 is anything to pop...
10845 1999-10-25 Juergen Vigna <jug@sad.it>
10848 * forms/layout_forms.fd +
10849 * forms/latexoptions.fd +
10850 * lyx.fd: changed for various form resize issues
10852 * src/mathed/math_panel.C +
10853 * src/insets/inseterror.C +
10854 * src/insets/insetinfo.C +
10855 * src/insets/inseturl.C +
10856 * src/insets/inseturl.h +
10858 * src/LyXSendto.C +
10859 * src/PaperLayout.C +
10860 * src/ParagraphExtra.C +
10861 * src/TableLayout.C +
10863 * src/layout_forms.C +
10870 * src/menus.C: fixed various resize issues. So now forms can be
10871 resized savely or not be resized at all.
10873 * forms/form_url.fd +
10874 * src/insets/form_url.[Ch]: added because it's cleaner and easier
10877 * src/insets/Makefile.am: added files form_url.[Ch]
10879 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10881 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
10882 (and presumably 6.2).
10884 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
10885 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
10886 remaining static member callbacks.
10888 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
10891 * src/support/lyxstring.h: declare struct Srep as friend of
10892 lyxstring, since DEC cxx complains otherwise.
10894 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10896 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10898 * src/LaTeX.C (run): made run_bibtex also depend on files with
10900 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
10901 are put into the dependency file.
10903 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
10904 the code has shown itself to work
10905 (create_ispell_pipe): removed another warning, added a comment
10908 * src/minibuffer.C (ExecutingCB): removed code that has been
10909 commented out a long time
10911 * src/lyxfunc.C (processKeyEvent): removed some very old commented
10912 out code + a warning.
10914 * src/support/lyxstring.h: comment out the three private
10915 operators, when compiling with string ansi conforming compilers
10916 they make problems.
10918 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
10920 (pixmapFromBitmapData): change type of bdata to be unsigned char *
10921 (pixmapFromBitmapData): add a reinterpret_cast in the call to
10924 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
10927 * src/mathed/math_panel.C (create_math_panel): remove explicit
10930 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
10933 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
10934 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
10935 to XCreatePixmapFromBitmapData
10936 (fl_set_bmtable_data): change the last argument to be unsigned
10938 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
10939 and bh to be unsigned int, remove explicit casts in call to
10940 XReadBitmapFileData.
10942 * images/arrows.xbm: made the arrays unsigned char *
10943 * images/varsz.xbm: ditto
10944 * images/misc.xbm: ditto
10945 * images/greek.xbm: ditto
10946 * images/dots.xbm: ditto
10947 * images/brel.xbm: ditto
10948 * images/bop.xbm: ditto
10950 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
10952 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
10953 (LYX_PROG_CXX): added -pedantic to g++ compile options when
10954 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
10956 (LYX_CXX_CHEADERS): added <clocale> to the test.
10958 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
10960 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
10962 * src/support/lyxstring.C (append): fixed something that must be a
10963 bug, rep->assign was used instead of rep->append.
10965 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
10968 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
10969 lyx insert double chars. Fix spotted by Kayvan.
10971 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10973 * Fixed the tth support. I messed up with the Emacs patch apply feature
10974 and omitted the changes in lyxrc.C.
10976 1999-10-22 Juergen Vigna <jug@sad.it>
10978 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
10980 * src/lyx_cb.C (MenuInsertRef) +
10981 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
10982 the form cannot be resized under it limits (fixes a segfault)
10984 * src/lyx.C (create_form_form_ref) +
10985 * forms/lyx.fd: Changed Gravity on name input field so that it is
10988 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10990 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
10991 <ostream> and <istream>.
10993 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
10994 whether <fstream> provides the latest standard features, or if we
10995 have an oldstyle library (like in egcs).
10996 (LYX_CXX_STL_STRING): fix the test.
10998 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
10999 code on MODERN_STL_STREAM.
11001 * src/support/lyxstring.h: use L{I,O}stream.h.
11003 * src/support/L{I,O}stream.h: new files, designed to setup
11004 correctly streams for our use
11005 - includes the right header depending on STL capabilities
11006 - puts std::ostream and std::endl (for LOStream.h) or
11007 std::istream (LIStream.h) in toplevel namespace.
11009 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11011 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
11012 was a bib file that had been changed we ensure that bibtex is run.
11013 (runBibTeX): enhanced to extract the names of the bib files and
11014 getting their absolute path and enter them into the dep file.
11015 (findtexfile): static func that is used to look for tex-files,
11016 checks for absolute patchs and tries also with kpsewhich.
11017 Alternative ways of finding the correct files are wanted. Will
11019 (do_popen): function that runs a command using popen and returns
11020 the whole output of that command in a string. Should be moved to
11023 * src/DepTable.[Ch] (extchanged): new function that returns true if a
11024 file with extension ext has changed.
11026 * src/insets/figinset.C: added ifdef guards around the fl_free
11027 code that jug commented out. Now it is commented out when
11028 compiling with XForms == 0.89.
11030 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
11031 to lyxstring.C, and only keep a forward declaration in
11032 lyxstring.h. Simplifies the header file a bit and should help a
11033 bit on compile time too. Also changes to Srep will not mandate a
11034 recompile of code just using string.
11035 (~lyxstring): definition moved here since it uses srep.
11036 (size): definition moved here since it uses srep.
11038 * src/support/lyxstring.h: removed a couple of "inline" that should
11041 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11043 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
11046 1999-10-21 Juergen Vigna <jug@sad.it>
11048 * src/table.C (SetPWidth): Just a small fix so the alignment is not
11049 set to left if I just remove the width entry (or it is empty).
11051 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
11052 paragraph when having dummy paragraphs.
11054 1999-10-20 Juergen Vigna <jug@sad.it>
11056 * src/insets/figinset.C: just commented some fl_free_form calls
11057 and added warnings so that this calls should be activated later
11058 again. This avoids for now a segfault, but we have a memory leak!
11060 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
11061 'const char * argument' to 'string argument', this should
11062 fix some Asserts() in lyxstring.C.
11064 * src/lyxfunc.h: Removed the function argAsString(const char *)
11065 as it is not used anymore.
11067 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
11069 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
11072 * src/Literate.h: some funcs moved from public to private to make
11073 interface clearer. Unneeded args removed.
11075 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
11077 (scanBuildLogFile): ditto
11079 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
11080 normal TeX Error. Still room for improvement.
11082 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
11084 * src/buffer.C (insertErrors): changes to make the error
11085 desctription show properly.
11087 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
11090 * src/support/lyxstring.C (helper): changed to use
11091 sizeof(object->rep->ref).
11092 (operator>>): changed to use a pointer instead.
11094 * src/support/lyxstring.h: changed const reference & to value_type
11095 const & lets see if that helps.
11097 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
11099 * Makefile.am (rpmdist): fixed to have non static package and
11102 * src/support/lyxstring.C: removed the compilation guards
11104 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
11107 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
11108 conditional compile of lyxstring.Ch
11110 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
11111 stupid check, but it is a lot better than the bastring hack.
11112 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
11114 * several files: changed string::erase into string::clear. Not
11117 * src/chset.C (encodeString): use a char temporary instead
11119 * src/table.C (TexEndOfCell): added tostr around
11120 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
11121 (TexEndOfCell): ditto
11122 (TexEndOfCell): ditto
11123 (TexEndOfCell): ditto
11124 (DocBookEndOfCell): ditto
11125 (DocBookEndOfCell): ditto
11126 (DocBookEndOfCell): ditto
11127 (DocBookEndOfCell): ditto
11129 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
11131 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
11133 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
11134 (MenuBuildProg): added tostr around ret
11135 (MenuRunChktex): added tostr around ret
11136 (DocumentApplyCB): added tostr around ret
11138 * src/chset.C (encodeString): added tostr around t->ic
11140 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
11141 (makeLaTeXFile): added tostr around tocdepth
11142 (makeLaTeXFile): added tostr around ftcound - 1
11144 * src/insets/insetbib.C (setCounter): added tostr around counter.
11146 * src/support/lyxstring.h: added an operator+=(int) to catch more
11149 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
11150 (lyxstring): We DON'T allow NULL pointers.
11152 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11154 * src/mathed/math_macro.C (MathMacroArgument::Write,
11155 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
11156 when writing them out.
11158 * src/LString.C: remove, since it is not used anymore.
11160 * src/support/lyxstring.C: condition the content to
11161 USE_INCLUDED_STRING macro.
11163 * src/mathed/math_symbols.C, src/support/lstrings.C,
11164 src/support/lyxstring.C: add `using' directive to specify what
11165 we need in <algorithm>. I do not think that we need to
11166 conditionalize this, but any thought is appreciated.
11168 * many files: change all callback functions to "C" linkage
11169 functions to please strict C++ compilers like DEC cxx 6.1 in mode
11170 strict_ansi. Those who were static are now global.
11171 The case of callbacks which are static class members is
11172 trickier, since we have to make C wrappers around them (see
11173 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
11174 did not finish this yet, since it defeats the purpose of
11175 encapsulation, and I am not sure what the best route is.
11177 1999-10-19 Juergen Vigna <jug@sad.it>
11179 * src/support/lyxstring.C (lyxstring): we permit to have a null
11180 pointer as assignment value and just don't assign it.
11182 * src/vspace.C (nextToken): corrected this function substituting
11183 find_first(_not)_of with find_last_of.
11185 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
11186 (TableOptCloseCB) (TableSpeCloseCB):
11187 inserted fl_set_focus call for problem with fl_hide_form() in
11190 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11192 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
11195 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11197 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
11198 LyXLex::next() and not eatline() to get its argument.
11200 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
11202 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
11203 instead, use fstreams for io of the depfile, removed unneeded
11204 functions and variables.
11206 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
11207 vector instead, removed all functions and variables that is not in
11210 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11212 * src/buffer.C (insertErrors): use new interface to TeXError
11214 * Makefile.am (rpmdist): added a rpmdist target
11216 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
11217 per Kayvan's instructions.
11219 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11221 * src/Makefile.am: add a definition for localedir, so that locales
11222 are found after installation (Kayvan)
11224 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11226 * development/.cvsignore: new file.
11228 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11230 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
11231 C++ compiler provides wrappers for C headers and use our alternate
11234 * configure.in: use LYX_CXX_CHEADERS.
11236 * src/cheader/: new directory, populated with cname headers from
11237 libstdc++-2.8.1. They are a bit old, but probably good enough for
11238 what we want (support compilers who lack them).
11240 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
11241 from includes. It turns out is was stupid.
11243 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11245 * lib/Makefile.am (install-data-local): forgot a ';'
11246 (install-data-local): forgot a '\'
11247 (libinstalldirs): needed after all. reintroduced.
11249 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
11251 * configure.in (AC_OUTPUT): added lyx.spec
11253 * development/lyx.spec: removed file
11255 * development/lyx.spec.in: new file
11257 * po/*.po: merged with lyx.pot becuase of make distcheck
11259 * lib/Makefile.am (dist-hook): added dist-hook so that
11260 documentation files will be included when doing a make
11261 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
11262 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
11264 more: tried to make install do the right thing, exclude CVS dirs
11267 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
11268 Path would fit in more nicely.
11270 * all files that used to use pathstack: uses now Path instead.
11271 This change was a lot easier than expected.
11273 * src/support/path.h: new file
11275 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
11277 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
11279 * src/support/lyxstring.C (getline): Default arg was given for
11282 * Configure.cmd: removed file
11284 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11286 * src/support/DebugStream.[Ch]: remove the explicit std:: before
11287 streams classes and types, add the proper 'using' statements when
11288 MODERN_STL is defined.
11290 * src/debug.h: move the << operator definition after the inclusion
11293 * src/support/filetools.C: include "LAssert.h", which is needed
11296 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
11299 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
11300 include "debug.h" to define a proper ostream.
11302 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11304 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
11305 method to the SystemCall class which can kill a process, but it's
11306 not fully implemented yet.
11308 * src/*.C: Changed Systemcalls::Startscript() to startscript()
11310 * src/support/FileInfo.h: Better documentation
11312 * src/lyxfunc.C: Added support for buffer-export html
11314 * src/menus.C: Added Export->As HTML...
11316 * lib/bind/*.bind: Added short-cut for buffer-export html
11318 * src/lyxrc.*: Added support for new \tth_command
11320 * lib/lyxrc.example: Added stuff for new \tth_command
11322 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11324 * lib/Makefile.am (IMAGES): removed images/README
11325 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
11326 installes in correct place. Check permisions is installed
11329 * src/LaTeX.C: some no-op changes moved declaration of some
11332 * src/LaTeX.h (LATEX_H): changed include guard name
11334 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11336 * lib/reLyX/Makefile.am: install noweb2lyx.
11338 * lib/Makefile.am: install configure.
11340 * lib/reLyX/configure.in: declare a config aux dir; set package
11341 name to lyx (not sure what the best solution is); generate noweb2lyx.
11343 * lib/layouts/egs.layout: fix the bibliography layout.
11345 1999-10-08 Jürgen Vigna <jug@sad.it>
11347 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
11348 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
11349 it returned without continuing to search the path.
11351 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11353 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
11354 also fixes a bug. It is not allowed to do tricks with std::strings
11355 like: string a("hei"); &a[e]; this will not give what you
11356 think... Any reason for the complexity in this func?
11358 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
11360 * Updated README and INSTALL a bit, mostly to check that my
11361 CVS rights are correctly set up.
11363 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
11365 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
11366 does not allow '\0' chars but lyxstring and std::string does.
11368 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11370 * autogen.sh (AUTOCONF): let the autogen script create the
11371 POTFILES.in file too. POTFILES.in should perhaps now not be
11372 included in the cvs module.
11374 * some more files changed to use C++ includes instead of C ones.
11376 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
11378 (Reread): added tostr to nlink. buggy output otherwise.
11379 (Reread): added a string() around szMode when assigning to Buffer,
11380 without this I got a log of garbled info strings.
11382 * acconfig.h: commented out the PTR_AS_INT macros. They should not
11385 * I have added several ostream & operator<<(ostream &, some_type)
11386 functions. This has been done to avoid casting and warnings when
11387 outputting enums to lyxerr. This as thus eliminated a lot of
11388 explicit casts and has made the code clearer. Among the enums
11389 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
11390 mathed enums, some font enum the Debug::type enum.
11392 * src/support/lyxstring.h (clear): missing method. equivalent of
11395 * all files that contained "stderr": rewrote constructs that used
11396 stderr to use lyxerr instead. (except bmtable)
11398 * src/support/DebugStream.h (level): and the passed t with
11399 Debug::ANY to avoid spurious bits set.
11401 * src/debug.h (Debug::type value): made it accept strings of the
11402 type INFO,INIT,KEY.
11404 * configure.in (Check for programs): Added a check for kpsewhich,
11405 the latex generation will use this later to better the dicovery of
11408 * src/BufferView.C (create_view): we don't need to cast this to
11409 (void*) that is done automatically.
11410 (WorkAreaButtonPress): removed some dead code.
11412 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11414 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
11415 is not overwritten when translated (David Sua'rez de Lis).
11417 * lib/CREDITS: Added David Sua'rez de Lis
11419 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
11421 * src/bufferparams.C (BufferParams): default input encoding is now
11424 * acinclude.m4 (cross_compiling): comment out macro
11425 LYX_GXX_STRENGTH_REDUCE.
11427 * acconfig.h: make sure that const is not defined (to empty) when
11428 we are compiling C++. Remove commented out code using SIZEOF_xx
11431 * configure.in : move the test for const and inline as late as
11432 possible so that these C tests do not interefere with C++ ones.
11433 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
11434 has not been proven.
11436 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11438 * src/table.C (getDocBookAlign): remove bad default value for
11439 isColumn parameter.
11441 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
11443 (ShowFileMenu2): ditto.
11445 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
11446 of files to ignore.
11448 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11450 * Most files: finished the change from the old error code to use
11451 DebugStream for all lyxerr debugging. Only minor changes remain
11452 (e.g. the setting of debug levels using strings instead of number)
11454 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11456 * src/layout.C (Add): Changed to use compare_no_case instead of
11459 * src/FontInfo.C: changed loop variable type too string::size_type.
11461 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11463 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
11464 set ETAGS_ARGS to --c++
11466 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
11468 * src/table.C (DocBookEndOfCell): commented out two unused variables
11470 * src/paragraph.C: commented out four unused variables.
11472 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
11473 insed a if clause with type string::size_type.
11475 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
11478 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
11480 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
11481 variable, also changed loop to go from 0 to lenght + 1, instead of
11482 -1 to length. This should be correct.
11484 * src/LaTeX.C (scanError): use string::size_type as loop variable
11487 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
11488 (l.896) since y_tmp and row was not used anyway.
11490 * src/insets/insetref.C (escape): use string::size_type as loop
11493 * src/insets/insetquotes.C (Width): use string::size_type as loop
11495 (Draw): use string::size_type as loop variable type.
11497 * src/insets/insetlatexaccent.C (checkContents): use
11498 string::size_type as loop variable type.
11500 * src/insets/insetlabel.C (escape): use string::size_type as loop
11503 * src/insets/insetinfo.C: added an extern for current_view.
11505 * src/insets/insetcommand.C (scanCommand): use string::size_type
11506 as loop variable type.
11508 * most files: removed the RCS tags. With them we had to recompile
11509 a lot of files after a simple cvs commit. Also we have never used
11510 them for anything meaningful.
11512 * most files: tags-query-replace NULL 0. As adviced several plases
11513 we now use "0" instead of "NULL" in our code.
11515 * src/support/filetools.C (SpaceLess): use string::size_type as
11516 loop variable type.
11518 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11520 * src/paragraph.C: fixed up some more string stuff.
11522 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11524 * src/support/filetools.h: make modestr a std::string.
11526 * src/filetools.C (GetEnv): made ch really const.
11528 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
11529 made code that used these use max/min from <algorithm> instead.
11531 * changed several c library include files to their equivalent c++
11532 library include files. All is not changed yet.
11534 * created a support subdir in src, put lyxstring and lstrings
11535 there + the extra files atexit, fileblock, strerror. Created
11536 Makefile.am. edited configure.in and src/Makefile.am to use this
11537 new subdir. More files moved to support.
11539 * imported som of the functions from repository lyx, filetools
11541 * ran tags-query-replace on LString -> string, corrected the bogus
11542 cases. Tried to make use of lstrings.[hC], debugged a lot. There
11543 is still some errors in there. This is errors where too much or
11544 too litle get deleted from strings (string::erase, string::substr,
11545 string::replace), there can also be some off by one errors, or
11546 just plain wrong use of functions from lstrings. Viewing of quotes
11549 * LyX is now running fairly well with string, but there are
11550 certainly some bugs yet (see above) also string is quite different
11551 from LString among others in that it does not allow null pointers
11552 passed in and will abort if it gets any.
11554 * Added the revtex4 files I forgot when setting up the repository.
11556 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11558 * All over: Tried to clean everything up so that only the files
11559 that we really need are included in the cvs repository.
11560 * Switched to use automake.
11561 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
11562 * Install has not been checked.
11564 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11566 * po/pt.po: Three errors:
11567 l.533 and l.538 format specification error
11568 l. 402 duplicate entry, I just deleted it.