1 2000-09-22 Juergen Vigna <jug@sad.it>
3 * src/frontends/kde/Dialogs.C: added credits forms.
5 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
7 * src/frontends/gnome/Dialogs.C: added some forms.
9 * src/spellchecker.C (init_spell_checker): set language in pspell code
10 (RunSpellChecker): some modifications for setting language string.
12 * src/language.[Ch]: added language_country code.
14 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
16 * src/frontends/Dialogs.h: added new signal showError.
17 Rearranged existing signals in some sort of alphabetical order.
19 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
20 FormError.[Ch], form_error.[Ch]
21 * src/frontends/xforms/forms/makefile: added new file form_error.fd
22 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
24 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
25 dialogs. I think that this can be used as the base to all these
28 * src/frontends/xforms/FormError.[Ch]
29 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
30 implementation of InsetError dialog.
32 * src/insets/inseterror.[Ch]: rendered GUI-independent.
34 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
35 * src/frontends/kde/Makefile.am: ditto
37 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
39 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
40 macrobf. This fixes a bug of invisible text.
42 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
44 * lib/doc/LaTeXConfig.lyx.in: updated.
46 * src/language.C (initL): remove language "francais" and change a
47 bit the names of the two other french variations.
49 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
50 string that may not be 0-terminated.
52 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
54 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
56 2000-09-20 Marko Vendelin <markov@ioc.ee>
58 * src/frontends/gnome/FormCitation.C
59 * src/frontends/gnome/FormIndex.C
60 * src/frontends/gnome/FormToc.C
61 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
62 the variable initialization to shut up the warnings
64 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
66 * src/table.[Ch]: deleted files
68 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
71 2000-09-18 Juergen Vigna <jug@sad.it>
73 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
74 problems with selection. Inserted new LFUN_PASTESELECTION.
75 (InsetButtonPress): inserted handling of middle mouse-button paste.
77 * src/spellchecker.C: changed word to word.c_str().
79 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
81 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
82 included in the ``make dist'' tarball.
84 2000-09-15 Juergen Vigna <jug@sad.it>
86 * src/CutAndPaste.C (cutSelection): small fix return the right
87 end position after cut inside one paragraph only.
89 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
90 we are locked as otherwise we don't have a valid cursor position!
92 * src/insets/figinset.C (draw): small bugfix but why is this needed???
94 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
96 * src/frontends/kde/FormRef.C: added using directive.
97 * src/frontends/kde/FormToc.C: ditto
99 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
101 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
104 2000-09-19 Marko Vendelin <markov@ioc.ee>
106 * src/frontends/gnome/Menubar_pimpl.C
107 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
108 Toc, ViewFormats, UpdateFormats, and ExportFormats.
110 * src/frontends/gnome/mainapp.C
111 * src/frontends/gnome/mainapp.h: support for menu update used
114 * src/frontends/gnome/mainapp.C
115 * src/frontends/gnome/mainapp.h: support for "action" area in the
116 main window. This area is used by small simple dialogs, such as
119 * src/frontends/gnome/FormIndex.C
120 * src/frontends/gnome/FormIndex.h
121 * src/frontends/gnome/FormUrl.C
122 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
125 * src/frontends/gnome/FormCitation.C
126 * src/frontends/gnome/FormCitation.h: rewrite to use main window
127 action area. Only "Insert new citation" is implemented.
131 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
133 * src/buffer.C (Dispatch): fix call to Dispatch
134 * src/insets/insetref.C (Edit): likewise
135 * src/insets/insetparent.C (Edit): likewise
136 * src/insets/insetinclude.C (include_cb): likewise
137 * src/frontends/xforms/FormUrl.C (apply): likewise
138 * src/frontends/xforms/FormToc.C (apply): likewise
139 * src/frontends/xforms/FormRef.C (apply): likewise
140 * src/frontends/xforms/FormIndex.C (apply): likewise
141 * src/frontends/xforms/FormCitation.C (apply): likewise
142 * src/lyxserver.C (callback): likewise
143 * src/lyxfunc.C (processKeySym): likewise
146 * src/lyx_cb.C (LayoutsCB): likewise
148 * Makefile.am (sourcedoc): small change
150 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
152 * src/main.C (main): Don't make an empty GUIRunTime object. all
153 methods are static. constify a bit remove unneded using + headers.
155 * src/tabular.C: some more const to local vars move some loop vars
157 * src/spellchecker.C: added some c_str after some word for pspell
159 * src/frontends/GUIRunTime.h: add new static method setDefaults
160 * src/frontends/xforms/GUIRunTime.C (setDefaults):
161 * src/frontends/kde/GUIRunTime.C (setDefaults):
162 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
164 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
165 with strnew in arg, use correct emptystring when calling SetName.
167 * several files: remove all commented code with relation to
168 HAVE_SSTREAM beeing false. We now only support stringstream and
171 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
173 * src/lyxfunc.C: construct correctly the automatic new file
176 * src/text2.C (IsStringInText): change type of variable i to shut
179 * src/support/sstream.h: do not use namespaces if the compiler
180 does not support them.
182 2000-09-15 Marko Vendelin <markov@ioc.ee>
183 * src/frontends/gnome/FormCitation.C
184 * src/frontends/gnome/FormCitation.h
185 * src/frontends/gnome/diainsertcitation_interface.c
186 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
187 regexp support to FormCitation [Gnome].
189 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
192 * configure.in: remove unused KDE/GTKGUI define
194 * src/frontends/kde/FormRef.C
195 * src/frontends/kde/FormRef.h
196 * src/frontends/kde/formrefdialog.C
197 * src/frontends/kde/formrefdialog.h: double click will
198 go to reference, now it is possible to change a cross-ref
201 * src/frontends/kde/FormToc.C
202 * src/frontends/kde/FormToc.h
203 * src/frontends/kde/formtocdialog.C
204 * src/frontends/kde/formtocdialog.h: add a depth
207 * src/frontends/kde/Makefile.am: add QtLyXView.h
210 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
212 * src/frontends/kde/FormCitation.h: added some using directives.
214 * src/frontends/kde/FormToc.h: corrected definition of doTree.
216 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
219 * src/mathed/math_defs.h: redefine SetAlign to use string rather
222 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
224 * src/buffer.C (pop_tag): revert for the second time a change by
225 Lars, who seems to really hate having non-local loop variables :)
227 * src/Lsstream.h: add "using" statements.
229 * src/support/copy.C (copy): add a bunch of std:: qualifiers
230 * src/buffer.C (writeFile): ditto
232 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
234 * src/buffer.C (writeFile): try to fix the locale modified format
235 number to always be as we want it.
237 * src/WorkArea.C (work_area_handler): try to workaround the bugs
238 in XForms 0.89. C-space is now working again.
240 * src/Lsstream.h src/support/sstream.h: new files.
242 * also commented out all cases where strstream were used.
244 * src/Bullet.h (c_str): remove method.
246 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
248 * a lot of files: get rid of "char const *" and "char *" is as
249 many places as possible. We only want to use them in interaction
250 with system of other libraries, not inside lyx.
252 * a lot of files: return const object is not of pod type. This
253 helps ensure that temporary objects is not modified. And fits well
254 with "programming by contract".
256 * configure.in: check for the locale header too
258 * Makefile.am (sourcedoc): new tag for generation of doc++
261 2000-09-14 Juergen Vigna <jug@sad.it>
263 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
264 callback to check which combo called it and do the right action.
266 * src/combox.C (combo_cb): added combo * to the callbacks.
267 (Hide): moved call of callback after Ungrab of the pointer.
269 * src/intl.h: removed LCombo2 function.
271 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
272 function as this can now be handled in one function.
274 * src/combox.h: added Combox * to callback prototype.
276 * src/frontends/xforms/Toolbar_pimpl.C:
277 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
279 2000-09-14 Garst Reese <reese@isn.net>
281 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
282 moved usepackage{xxx}'s to beginning of file. Changed left margin
283 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
284 underlining from title. Thanks to John Culleton for useful suggestions.
286 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
288 * src/lyxlex_pimpl.C (setFile): change error message to debug
291 2000-09-13 Juergen Vigna <jug@sad.it>
293 * src/frontends/xforms/FormDocument.C: implemented choice_class
294 as combox and give callback to combo_language so OK/Apply is activated
297 * src/bufferlist.C (newFile): small fix so already named files
298 (via an open call) are not requested to be named again on the
301 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
303 * src/frontends/kde/Makefile.am
304 * src/frontends/kde/FormRef.C
305 * src/frontends/kde/FormRef.h
306 * src/frontends/kde/formrefdialog.C
307 * src/frontends/kde/formrefdialog.h: implement
310 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
312 * src/frontends/kde/formtocdialog.C
313 * src/frontends/kde/formtocdialog.h
314 * src/frontends/kde/FormToc.C
315 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
317 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
319 * src/frontends/kde/FormCitation.C: fix thinko
320 where we didn't always display the reference text
323 * src/frontends/kde/formurldialog.C
324 * src/frontends/kde/formurldialog.h
325 * src/frontends/kde/FormUrl.C
326 * src/frontends/kde/FormUrl.h: minor cleanups
328 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
330 * src/frontends/kde/Makefile.am
331 * src/frontends/kde/FormToc.C
332 * src/frontends/kde/FormToc.h
333 * src/frontends/kde/FormCitation.C
334 * src/frontends/kde/FormCitation.h
335 * src/frontends/kde/FormIndex.C
336 * src/frontends/kde/FormIndex.h
337 * src/frontends/kde/formtocdialog.C
338 * src/frontends/kde/formtocdialog.h
339 * src/frontends/kde/formcitationdialog.C
340 * src/frontends/kde/formcitationdialog.h
341 * src/frontends/kde/formindexdialog.C
342 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
344 2000-09-12 Juergen Vigna <jug@sad.it>
346 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
349 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
351 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
354 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
356 * src/converter.C (Add, Convert): Added support for converter flags:
357 needaux, resultdir, resultfile.
358 (Convert): Added new parameter view_file.
359 (dvips_options): Fixed letter paper option.
361 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
362 (Export, GetExportableFormats, GetViewableFormats): Added support
365 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
367 (easyParse): Fixed to work with new export code.
369 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
372 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
374 * lib/bind/*.bind: Replaced
375 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
376 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
378 2000-09-11 Juergen Vigna <jug@sad.it>
380 * src/lyx_gui.C (runTime): uses global guiruntime variable.
382 * src/main.C (main): now GUII defines global guiruntime!
384 * src/frontends/gnome/GUIRunTime.C (initApplication):
385 * src/frontends/kde/GUIRunTime.C (initApplication):
386 * src/frontends/xforms/GUIRunTime.C (initApplication):
387 * src/frontends/GUIRunTime.h: added new function initApplication.
389 * src/spellchecker.C (sc_accept_word): change to add_to_session.
391 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
393 2000-09-08 Juergen Vigna <jug@sad.it>
395 * src/lyx_gui.C (create_forms): don't display the "default" entry as
396 we have already "Reset".
398 * src/language.C (initL): inserted "default" language and made this
399 THE default language (and not american!)
401 * src/paragraph.C: inserted handling of "default" language!
403 * src/lyxfont.C: ditto
407 * src/paragraph.C: output the \\par only if we have a following
408 paragraph otherwise it's not needed.
410 2000-09-05 Juergen Vigna <jug@sad.it>
412 * config/pspell.m4: added entry to lyx-flags
414 * src/spellchecker.C: modified version from Kevin for using pspell
416 2000-09-01 Marko Vendelin <markov@ioc.ee>
417 * src/frontends/gnome/Makefile.am
418 * src/frontends/gnome/FormCitation.C
419 * src/frontends/gnome/FormCitation.h
420 * src/frontends/gnome/diainsertcitation_callbacks.c
421 * src/frontends/gnome/diainsertcitation_callbacks.h
422 * src/frontends/gnome/diainsertcitation_interface.c
423 * src/frontends/gnome/diainsertcitation_interface.h
424 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
425 dialog for Gnome frontend
427 * src/main.C: Gnome libraries require keeping application name
428 and its version as strings
430 * src/frontends/gnome/mainapp.C: Change the name of the main window
431 from GnomeLyX to PACKAGE
433 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
435 * src/frontends/Liason.C: add "using: declaration.
437 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
439 * src/mathed/math_macro.C (Metrics): Set the size of the template
441 * src/mathed/formulamacro.C (Latex): Fixed the returned value
443 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
445 * src/converter.C (add_options): New function.
446 (SetViewer): Change $$FName into '$$FName'.
447 (View): Add options when running xdvi
448 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
449 (Convert): The 3rd parameter is now the desired filename. Converts
450 calls to lyx::rename if necessary.
451 Add options when running dvips.
452 (dvi_papersize,dvips_options): New methods.
454 * src/exporter.C (Export): Use getLatexName() instead of fileName().
456 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
457 using a call to Converter::dvips_options.
458 Fixed to work with nex export code.
461 * src/support/rename.C: New files
463 * src/support/syscall.h
464 * src/support/syscall.C: Added Starttype SystemDontWait.
466 * lib/ui/default.ui: Changed to work with new export code
468 * lib/configure.m4: Changed to work with new export code
470 * src/encoding.C: Changed latex name for iso8859_7 encoding.
472 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
474 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
475 so that code compiles with DEC cxx.
477 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
478 to work correctly! Also now supports the additional elements
481 2000-09-01 Allan Rae <rae@lyx.org>
483 * src/frontends/ButtonPolicies.C: renamed all the references to
484 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
486 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
487 since it's a const not a type.
489 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
491 2000-08-31 Juergen Vigna <jug@sad.it>
493 * src/insets/figinset.C: Various changes to look if the filename has
494 an extension and if not add it for inline previewing.
496 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
498 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
499 make buttonStatus and isReadOnly be const methods. (also reflect
500 this in derived classes.)
502 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
503 (nextState): change to be static inline, pass the StateMachine as
505 (PreferencesPolicy): remove casts
506 (OkCancelPolicy): remvoe casts
507 (OkCancelReadOnlyPolicy): remove casts
508 (NoRepeatedApplyReadOnlyPolicy): remove casts
509 (OkApplyCancelReadOnlyPolicy): remove casts
510 (OkApplyCancelPolicy): remove casts
511 (NoRepeatedApplyPolicy): remove casts
513 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
515 * src/converter.C: added some using directives
517 * src/frontends/ButtonPolicies.C: changes to overcome
518 "need lvalue" error with DEC c++
520 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
521 to WMHideCB for DEC c++
523 * src/frontends/xforms/Menubar_pimpl.C: added using directive
525 * src/frontends/xforms/forms/form_document.C.patch: use C callback
526 to BulletBMTableCB for DEC c++
528 2000-08-31 Allan Rae <rae@lyx.org>
530 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
531 character dialog separately from old document dialogs combo_language.
534 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
536 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
537 Removed LFUN_REF_CREATE.
539 * src/MenuBackend.C: Added new tags: toc and references
541 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
542 (add_lastfiles, add_documents, add_formats): Removed the unused smn
544 (add_toc, add_references): New methods.
545 (create_submenu): Handle correctly the case when there is a
546 seperator after optional menu items.
548 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
549 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
550 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
552 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
554 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
556 * src/converter.[Ch]: New file for converting between different
559 * src/export.[Ch]: New file for exporting a LyX file to different
562 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
563 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
564 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
565 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
566 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
567 RunDocBook, MenuExport.
569 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
570 Exporter::Preview methods if NEW_EXPORT is defined.
572 * src/buffer.C (Dispatch): Use Exporter::Export.
574 * src/lyxrc.C: Added new tags: \converter and \viewer.
577 * src/LyXAction.C: Define new lyx-function: buffer-update.
578 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
579 when NEW_EXPORT is defined.
581 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
583 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
585 * lib/ui/default.ui: Added submenus "view" and "update" to the
588 * src/filetools.C (GetExtension): New function.
590 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
592 2000-08-29 Allan Rae <rae@lyx.org>
594 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
596 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
597 (EnableDocumentLayout): removed
598 (DisableDocumentLayout): removed
599 (build): make use of ButtonController's read-only handling to
600 de/activate various objects. Replaces both of the above functions.
602 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
603 (readOnly): was read_only
604 (refresh): fixed dumb mistakes with read_only_ handling
606 * src/frontends/xforms/forms/form_document.fd:
607 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
608 tabbed dialogs so the tabs look more like tabs and so its easier to
609 work out which is the current tab.
611 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
612 segfault with form_table
614 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
616 2000-08-28 Juergen Vigna <jug@sad.it>
618 * acconfig.h: added USE_PSPELL.
620 * src/config.h.in: added USE_PSPELL.
622 * autogen.sh: added pspell.m4
624 * config/pspell.m4: new file.
626 * src/spellchecker.C: implemented support for pspell libary.
628 2000-08-25 Juergen Vigna <jug@sad.it>
630 * src/LyXAction.C (init): renamed LFUN_TABLE to
631 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
633 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
635 * src/lyxscreen.h: add force_clear variable and fuction to force
636 a clear area when redrawing in LyXText.
638 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
640 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
642 * some whitespace and comment changes.
644 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
646 * src/buffer.C: up te LYX_FORMAT to 2.17
648 2000-08-23 Juergen Vigna <jug@sad.it>
650 * src/BufferView_pimpl.C (tripleClick): disable this when in a
653 * src/insets/insettabular.C (pasteSelection): delete the insets
654 LyXText as it is not valid anymore.
655 (copySelection): new function.
656 (pasteSelection): new function.
657 (cutSelection): new function.
658 (LocalDispatch): implemented cut/copy/paste of cell selections.
660 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
661 don't have a LyXText.
663 * src/LyXAction.C (init): a NEW_TABULAR define too much.
665 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
668 2000-08-22 Juergen Vigna <jug@sad.it>
670 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
671 ifdef form_table out if NEW_TABULAR.
673 2000-08-21 Juergen Vigna <jug@sad.it>
675 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
676 (draw): fixed draw position so that the cursor is positioned in the
678 (InsetMotionNotify): hide/show cursor so the position is updated.
679 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
680 using cellstart() function where it should be used.
682 * src/insets/insettext.C (draw): ditto.
684 * src/tabular.C: fixed initialization of some missing variables and
685 made BoxType into an enum.
687 2000-08-22 Marko Vendelin <markov@ioc.ee>
688 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
689 stock menu item using action numerical value, not its string
693 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
695 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
696 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
698 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
700 * src/frontends/xforms/GUIRunTime.C: new file
702 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
703 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
705 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
707 * src/frontends/kde/GUIRunTime.C: new file
709 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
710 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
712 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
714 * src/frontends/gnome/GUIRunTime.C: new file
716 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
719 * src/frontends/GUIRunTime.h: removed constructor and destructor,
720 small change to documetentation.
722 * src/frontends/GUIRunTime.C: removed file
724 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
726 * src/lyxparagraph.h: enable NEW_TABULAR as default
728 * src/lyxfunc.C (processKeySym): remove some commented code
730 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
731 NEW_TABULAR around the fd_form_table_options.
733 * src/lyx_gui.C (runTime): call the static member function as
734 GUIRunTime::runTime().
736 2000-08-21 Allan Rae <rae@lyx.org>
738 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
741 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
743 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
745 2000-08-21 Allan Rae <rae@lyx.org>
747 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
749 * src/frontends/xforms/FormPreferences.C (build): use setOK
750 * src/frontends/xforms/FormDocument.C (build): use setOK
751 (FormDocument): use the appropriate policy.
753 2000-08-21 Allan Rae <rae@lyx.org>
755 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
756 automatic [de]activation of arbitrary objects when in a read-only state.
758 * src/frontends/ButtonPolicies.h: More documentation
759 (isReadOnly): added to support the above.
761 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
763 2000-08-18 Juergen Vigna <jug@sad.it>
765 * src/insets/insettabular.C (getStatus): changed to return func_status.
767 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
768 display toggle menu entries if they are.
770 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
771 new document layout now.
773 * src/lyxfunc.C: ditto
775 * src/lyx_gui_misc.C: ditto
777 * src/lyx_gui.C: ditto
779 * lib/ui/default.ui: removed paper and quotes layout as they are now
780 all in the document layout tabbed folder.
782 * src/frontends/xforms/forms/form_document.fd: added Restore
783 button and callbacks for all inputs for Allan's ButtonPolicy.
785 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
786 (CheckChoiceClass): added missing params setting on class change.
787 (UpdateLayoutDocument): added for updating the layout on params.
788 (build): forgot to RETURN_ALWAYS input_doc_spacing.
789 (FormDocument): Implemented Allan's ButtonPolicy with the
792 2000-08-17 Allan Rae <rae@lyx.org>
794 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
795 so we can at least see the credits again.
797 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
798 controller calls for the appropriate callbacks. Note that since Ok
799 calls apply followed by cancel, and apply isn't a valid input for the
800 APPLIED state, the bc_ calls have to be made in the static callback not
801 within each of the real callbacks.
803 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
804 (setOk): renamed from setOkay()
806 2000-08-17 Juergen Vigna <jug@sad.it>
808 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
809 in the implementation part.
810 (composeUIInfo): don't show optional menu-items.
812 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
814 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
816 * src/bufferview_funcs.C (CurrentState): fixed to show also the
817 text-state when in a text-inset.
819 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
821 2000-08-17 Marko Vendelin <markov@ioc.ee>
822 * src/frontends/gnome/FormIndex.C
823 * src/frontends/gnome/FormIndex.h
824 * src/frontends/gnome/FormToc.C
825 * src/frontends/gnome/FormToc.h
826 * src/frontends/gnome/dialogs
827 * src/frontends/gnome/diatoc_callbacks.c
828 * src/frontends/gnome/diatoc_callbacks.h
829 * src/frontends/gnome/diainsertindex_callbacks.h
830 * src/frontends/gnome/diainsertindex_callbacks.c
831 * src/frontends/gnome/diainsertindex_interface.c
832 * src/frontends/gnome/diainsertindex_interface.h
833 * src/frontends/gnome/diatoc_interface.h
834 * src/frontends/gnome/diatoc_interface.c
835 * src/frontends/gnome/Makefile.am: Table of Contents and
836 Insert Index dialogs implementation for Gnome frontend
838 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
840 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
842 * src/frontends/gnome/diainserturl_interface.c: make the dialog
845 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
847 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
848 destructor. Don't definde if you don't need it
849 (processEvents): made static, non-blocking events processing for
851 (runTime): static method. event loop for xforms
852 * similar as above for kde and gnome.
854 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
856 (runTime): new method calss the real frontends runtime func.
858 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
860 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
862 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
864 2000-08-16 Juergen Vigna <jug@sad.it>
866 * src/lyx_gui.C (runTime): added GUII RunTime support.
868 * src/frontends/Makefile.am:
869 * src/frontends/GUIRunTime.[Ch]:
870 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
871 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
872 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
874 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
876 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
877 as this is already set in ${FRONTEND_INCLUDE} if needed.
879 * configure.in (CPPFLAGS): setting the include dir for the frontend
880 directory and don't set FRONTEND=xforms for now as this is executed
883 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
885 * src/frontends/kde/Makefile.am:
886 * src/frontends/kde/FormUrl.C:
887 * src/frontends/kde/FormUrl.h:
888 * src/frontends/kde/formurldialog.h:
889 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
891 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
893 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
895 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
897 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
900 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
902 * src/WorkArea.C (work_area_handler): more work to get te
903 FL_KEYBOARD to work with xforms 0.88 too, please test.
905 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
907 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
909 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
912 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
914 * src/Timeout.h: remove Qt::emit hack.
916 * several files: changes to allo doc++ compilation
918 * src/lyxfunc.C (processKeySym): new method
919 (processKeyEvent): comment out if FL_REVISION < 89
921 * src/WorkArea.C: change some debugging levels.
922 (WorkArea): set wantkey to FL_KEY_ALL
923 (work_area_handler): enable the FL_KEYBOARD clause, this enables
924 clearer code and the use of compose with XForms 0.89. Change to
925 use signals instead of calling methods in bufferview directly.
927 * src/Painter.C: change some debugging levels.
929 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
932 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
933 (workAreaKeyPress): new method
935 2000-08-14 Juergen Vigna <jug@sad.it>
937 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
939 * config/kde.m4: addes some features
941 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
942 include missing xforms dialogs.
944 * src/Timeout.h: a hack to be able to compile with qt/kde.
946 * sigc++/.cvsignore: added acinclude.m4
948 * lib/.cvsignore: added listerros
950 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
951 xforms tree as objects are needed for other frontends.
953 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
954 linking with not yet implemented xforms objects.
956 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
958 2000-08-14 Baruch Even <baruch.even@writeme.com>
960 * src/frontends/xforms/FormGraphics.h:
961 * src/frontends/xforms/FormGraphics.C:
962 * src/frontends/xforms/RadioButtonGroup.h:
963 * src/frontends/xforms/RadioButtonGroup.C:
964 * src/insets/insetgraphics.h:
965 * src/insets/insetgraphics.C:
966 * src/insets/insetgraphicsParams.h:
967 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
968 instead of spaces, and various other indentation issues to make the
969 sources more consistent.
971 2000-08-14 Marko Vendelin <markov@ioc.ee>
973 * src/frontends/gnome/dialogs/diaprint.glade
974 * src/frontends/gnome/FormPrint.C
975 * src/frontends/gnome/FormPrint.h
976 * src/frontends/gnome/diaprint_callbacks.c
977 * src/frontends/gnome/diaprint_callbacks.h
978 * src/frontends/gnome/diaprint_interface.c
979 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
982 * src/frontends/gnome/dialogs/diainserturl.glade
983 * src/frontends/gnome/FormUrl.C
984 * src/frontends/gnome/FormUrl.h
985 * src/frontends/gnome/diainserturl_callbacks.c
986 * src/frontends/gnome/diainserturl_callbacks.h
987 * src/frontends/gnome/diainserturl_interface.c
988 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
991 * src/frontends/gnome/Dialogs.C
992 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
993 all other dialogs. Copy all unimplemented dialogs from Xforms
996 * src/frontends/gnome/support.c
997 * src/frontends/gnome/support.h: support files generated by Glade
1001 * config/gnome.m4: Gnome configuration scripts
1003 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
1004 configure --help message
1006 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
1007 only if there are no events pendling in Gnome/Gtk. This enhances
1008 the performance of menus.
1011 2000-08-14 Allan Rae <rae@lyx.org>
1013 * lib/Makefile.am: listerrors cleaning
1015 * lib/listerrors: removed -- generated file
1016 * acinclude.m4: ditto
1017 * sigc++/acinclude.m4: ditto
1019 * src/frontends/xforms/forms/form_citation.fd:
1020 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
1023 * src/frontends/xforms/forms/makefile: I renamed the `install` target
1024 `updatesrc` and now we have a `test` target that does what `updatesrc`
1025 used to do. I didn't like having an install target that wasn't related
1028 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
1029 on all except FormGraphics. This may yet happen. Followed by a major
1030 cleanup including using FL_TRANSIENT for most of the dialogs. More
1031 changes to come when the ButtonController below is introduced.
1033 * src/frontends/xforms/ButtonController.h: New file for managing up to
1034 four buttons on a dialog according to an externally defined policy.
1035 * src/frontends/xforms/Makefile.am: added above
1037 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
1038 Apply and Cancel/Close buttons and everything in between and beyond.
1039 * src/frontends/Makefile.am: added above.
1041 * src/frontends/xforms/forms/form_preferences.fd:
1042 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
1043 and removed variable 'status' as a result. Fixed the set_minsize thing.
1044 Use the new screen-font-update after checking screen fonts were changed
1045 Added a "Restore" button to restore the original lyxrc values while
1046 editing. This restores everything not just the last input changed.
1047 That's still a tricky one. As is the "LyX: this shouldn't happen..."
1049 * src/LyXAction.C: screen-font-update added for updating buffers after
1050 screen font settings have been changed.
1051 * src/commandtags.h: ditto
1052 * src/lyxfunc.C: ditto
1054 * forms/lyx.fd: removed screen fonts dialog.
1055 * src/lyx_gui.C: ditto
1056 * src/menus.[Ch]: ditto
1057 * src/lyx.[Ch]: ditto
1058 * src/lyx_cb.C: ditto + code from here moved to make
1059 screen-font-update. And people wonder why progress on GUII is
1060 slow. Look at how scattered this stuff was! It takes forever
1063 * forms/fdfix.sh: Fixup the spacing after commas.
1064 * forms/makefile: Remove date from generated files. Fewer clashes now.
1065 * forms/bullet_forms.C.patch: included someones handwritten changes
1067 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
1068 once I've discovered why LyXRC was made noncopyable.
1069 * src/lyx_main.C: ditto
1071 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
1073 * src/frontends/xforms/forms/fdfix.sh:
1074 * src/frontends/xforms/forms/fdfixh.sed:
1075 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
1076 * src/frontends/xforms/Form*.[hC]:
1077 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
1078 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
1079 provide a destructor for the struct FD_form_xxxx. Another version of
1080 the set_[max|min]size workaround and a few other cleanups. Actually,
1081 Angus' patch from 20000809.
1083 2000-08-13 Baruch Even <baruch.even@writeme.com>
1085 * src/insets/insetgraphics.C (Clone): Added several fields that needed
1088 2000-08-11 Juergen Vigna <jug@sad.it>
1090 * src/insets/insetgraphics.C (InsetGraphics): changing init
1091 order because of warnings.
1093 * src/frontends/xforms/forms/makefile: adding patching .C with
1096 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
1097 from .C.patch to .c.patch
1099 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
1100 order because of warning.
1102 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
1104 * src/frontends/Liason.C (setMinibuffer): new helper function
1106 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
1108 * src/lyxfunc.C (Dispatch): calling new Document-Layout
1110 * lib/ui/default.ui: commented out PaperLayout entry
1112 * src/frontends/xforms/form_document.[Ch]: new added files
1114 * src/frontends/xforms/FormDocument.[Ch]: ditto
1116 * src/frontends/xforms/forms/form_document.fd: ditto
1118 * src/frontends/xforms/forms/form_document.C.patch: ditto
1120 2000-08-10 Juergen Vigna <jug@sad.it>
1122 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
1123 (InsetGraphics): initialized cacheHandle to 0.
1124 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
1126 2000-08-10 Baruch Even <baruch.even@writeme.com>
1128 * src/graphics/GraphicsCache.h:
1129 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
1130 correctly as a cache.
1132 * src/graphics/GraphicsCacheItem.h:
1133 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
1136 * src/graphics/GraphicsCacheItem_pimpl.h:
1137 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
1140 * src/insets/insetgraphics.h:
1141 * src/insets/insetgraphics.C: Changed from using a signal notification
1142 to polling when image is not loaded.
1144 2000-08-10 Allan Rae <rae@lyx.org>
1146 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
1147 that there are two functions that have to been taken out of line by
1148 hand and aren't taken care of in the script. (Just a reminder note)
1150 * sigc++/macros/*.h.m4: Updated as above.
1152 2000-08-09 Juergen Vigna <jug@sad.it>
1154 * src/insets/insettext.C (draw): small fix for clearing rectangle.
1156 * src/insets/insettabular.C: make drawing of single cell smarter.
1158 2000-08-09 Marko Vendelin <markov@ioc.ee>
1159 * src/frontends/gnome/Menubar_pimpl.C
1160 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
1161 implementation: new files
1163 * src/frontends/gnome/mainapp.C
1164 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
1167 * src/main.C: create Gnome main window
1169 * src/frontends/xforms/Menubar_pimpl.h
1170 * src/frontends/Menubar.C
1171 * src/frontends/Menubar.h: added method Menubar::update that calls
1172 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
1174 * src/LyXView.C: calls Menubar::update to update the state
1177 * src/frontends/gnome/Makefile.am: added new files
1179 * src/frontends/Makefile.am: added frontend compiler options
1181 2000-08-08 Juergen Vigna <jug@sad.it>
1183 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
1185 * src/bufferlist.C (close):
1186 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
1187 documents if exiting without saving.
1189 * src/buffer.C (save): use removeAutosaveFile()
1191 * src/support/filetools.C (removeAutosaveFile): new function.
1193 * src/lyx_cb.C (MenuWrite): returns a bool now.
1194 (MenuWriteAs): check if file could really be saved and revert to the
1196 (MenuWriteAs): removing old autosavefile if existant.
1198 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
1199 before Goto toggle declaration, because of compiler warning.
1201 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
1203 * src/lyxfunc.C (MenuNew): small fix.
1205 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
1207 * src/bufferlist.C (newFile):
1208 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
1210 * src/lyxrc.C: added new_ask_filename tag
1212 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
1214 * src/lyx.fd: removed code pertaining to form_ref
1215 * src/lyx.[Ch]: ditto
1216 * src/lyx_cb.C: ditto
1217 * src/lyx_gui.C: ditto
1218 * src/lyx_gui_misc.C: ditto
1220 * src/BufferView_pimpl.C (restorePosition): update buffer only
1223 * src/commandtags.h (LFUN_REFTOGGLE): removed
1224 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
1225 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
1226 (LFUN_REFBACK): renamed LFUN_REF_BACK
1228 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
1229 * src/menus.C: ditto
1230 * src/lyxfunc.C (Dispatch): ditto.
1231 InsertRef dialog is now GUI-independent.
1233 * src/texrow.C: added using std::endl;
1235 * src/insets/insetref.[Ch]: strip out large amounts of code.
1236 The inset is now a container and this functionality is now
1237 managed by a new FormRef dialog
1239 * src/frontends/Dialogs.h (showRef, createRef): new signals
1241 * src/frontends/xforms/FormIndex.[Ch],
1242 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
1243 when setting dialog's min/max size
1244 * src/frontends/xforms/FormIndex.[Ch]: ditto
1246 * src/frontends/xforms/FormRef.[Ch],
1247 src/frontends/xforms/forms/form_ref.fd: new xforms
1248 implementation of an InsetRef dialog
1250 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
1253 * src/graphics/XPM_Renderer.C (isImageFormatOK):
1254 ios::nocreate is not part of the standard. Removed.
1256 2000-08-07 Baruch Even <baruch.even@writeme.com>
1258 * src/graphics/Renderer.h:
1259 * src/graphics/Renderer.C: Added base class for rendering of different
1260 image formats into Pixmaps.
1262 * src/graphics/XPM_Renderer.h:
1263 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
1264 in a different class.
1266 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
1267 easily add support for other formats.
1269 * src/insets/figinset.C: plugged a leak of an X resource.
1271 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1273 * src/CutAndPaste.[Ch]: make all metods static.
1275 * development/Code_rules/Rules: more work, added section on
1276 Exceptions, and a References section.
1278 * a lot of header files: work to make doc++ able to generate the
1279 source documentation, some workarounds of doc++ problems. Doc++ is
1280 now able to generate the documentation.
1282 2000-08-07 Juergen Vigna <jug@sad.it>
1284 * src/insets/insettabular.C (recomputeTextInsets): removed function
1286 * src/tabular.C (SetWidthOfMulticolCell):
1288 (calculate_width_of_column_NMC): fixed return value so that it really
1289 only returns true if the column-width has changed (there where
1290 problems with muliticolumn-cells in this column).
1292 2000-08-04 Juergen Vigna <jug@sad.it>
1294 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
1295 also on the scrollstatus of the inset.
1296 (workAreaMotionNotify): ditto.
1298 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
1300 2000-08-01 Juergen Vigna <jug@sad.it>
1302 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
1304 * src/commandtags.h:
1305 * src/LyXAction.C (init):
1306 * src/insets/inset.C (LocalDispatch): added support for
1309 * src/insets/inset.C (scroll): new functions.
1311 * src/insets/insettext.C (removeNewlines): new function.
1312 (SetAutoBreakRows): removes forced newlines in the text of the
1313 paragraph if autoBreakRows is set to false.
1315 * src/tabular.C (Latex): generates a parbox around the cell contents
1318 * src/frontends/xforms/FormTabular.C (local_update): removed
1319 the radio_useparbox button.
1321 * src/tabular.C (UseParbox): new function
1323 2000-08-06 Baruch Even <baruch.even@writeme.com>
1325 * src/graphics/GraphicsCache.h:
1326 * src/graphics/GraphicsCache.C:
1327 * src/graphics/GraphicsCacheItem.h:
1328 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
1331 * src/insets/insetgraphics.h:
1332 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
1333 drawing of the inline image.
1335 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
1336 into the wrong position.
1338 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
1341 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
1343 * src/support/translator.h: move all typedefs to public section
1345 * src/support/filetools.C (MakeLatexName): return string const
1347 (TmpFileName): ditto
1348 (FileOpenSearch): ditto
1350 (LibFileSearch): ditto
1351 (i18nLibFileSearch): ditto
1354 (CreateTmpDir): ditto
1355 (CreateBufferTmpDir): ditto
1356 (CreateLyXTmpDir): ditto
1359 (MakeAbsPath): ditto
1361 (OnlyFilename): ditto
1363 (NormalizePath): ditto
1364 (CleanupPath): ditto
1365 (GetFileContents): ditto
1366 (ReplaceEnvironmentPath): ditto
1367 (MakeRelPath): ditto
1369 (ChangeExtension): ditto
1370 (MakeDisplayPath): ditto
1371 (do_popen): return cmdret const
1372 (findtexfile): return string const
1374 * src/support/DebugStream.h: add some /// to please doc++
1376 * src/frontends/DialogBase.h (endif): add some /// to please doc++
1378 * src/texrow.C (same_rownumber): functor to use with find_if
1379 (getIdFromRow): rewritten to use find_if and to not update the
1380 positions. return true if row is found
1381 (increasePos): new method, use to update positions
1383 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
1385 * src/lyxlex_pimpl.C (verifyTable): new method
1388 (GetString): return string const
1389 (pushTable): rewrite to use std::stack
1391 (setFile): better check
1394 * src/lyxlex.h: make LyXLex noncopyable
1396 * src/lyxlex.C (text): return char const * const
1397 (GetString): return string const
1398 (getLongString): return string const
1400 * src/lyx_gui_misc.C (askForText): return pair<...> const
1402 * src/lastfiles.[Ch] (operator): return string const
1404 * src/buffer.C (parseSingleLyXformat2Token): pass string to
1405 istringstream not char const *.
1406 move token.end() out of loop.
1407 (readFile): move initializaton of token
1409 * src/BufferView2.C (insertErrors): run texrow.increasePos if
1410 getIdFromRow is successful.
1412 * lib/bind/emacs.bind: don't include menus bind
1414 * development/Code_rules/Rules: the beginnings of making this
1415 better and covering more of the unwritten rules that we have.
1417 * development/Code_rules/Recommendations: a couple of wording
1420 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1422 * src/support/strerror.c: remove C++ comment.
1424 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
1426 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
1427 LFUN_INDEX_INSERT_LAST
1429 * src/texrow.C (getIdFromRow): changed from const_iterator to
1430 iterator, allowing code to compile with DEC cxx
1432 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
1433 stores part of the class, as suggested by Allan. Will allow
1435 (apply): test to apply uses InsetCommandParams operator!=
1437 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
1438 (apply): test to apply uses InsetCommandParams operator!=
1440 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
1441 stores part of the class.
1442 (update): removed limits on min/max size.
1444 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
1445 (apply): test to apply uses InsetCommandParams operator!=
1447 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
1448 (Read, Write, scanCommand, getCommand): moved functionality
1449 into InsetCommandParams.
1451 (getScreenLabel): made pure virtual
1452 new InsetCommandParams operators== and !=
1454 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
1455 c-tors based on InsetCommandParams. Removed others.
1456 * src/insets/insetinclude.[Ch]: ditto
1457 * src/insets/insetlabel.[Ch]: ditto
1458 * src/insets/insetparent.[Ch]: ditto
1459 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
1461 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
1462 insets derived from InsetCommand created using similar c-tors
1463 based on InsetCommandParams
1464 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
1465 * src/menus.C (ShowRefsMenu): ditto
1466 * src/paragraph.C (Clone): ditto
1467 * src/text2.C (SetCounter): ditto
1468 * src/lyxfunc.C (Dispatch) ditto
1469 Also recreated old InsetIndex behaviour exactly. Can now
1470 index-insert at the start of a paragraph and index-insert-last
1471 without launching the pop-up.
1473 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1475 * lib/lyxrc.example: mark te pdf options as non functional.
1477 * src/support/lstrings.C (strToInt): move initalization of tmpstr
1478 (isStrDbl): move tmpstr.end() out of loop.
1479 (strToDbl): move intialization of tmpstr
1480 (lowercase): return string const and move tmp.end() out of loop.
1481 (uppercase): return string const and move tmp.edn() out of loop.
1482 (prefixIs): add assertion
1487 (containsOnly): ditto
1488 (containsOnly): ditto
1489 (containsOnly): ditto
1490 (countChar): make last arg char not char const
1491 (token): return string const
1492 (subst): return string const, move tmp.end() out of loop.
1493 (subst): return string const, add assertion
1494 (strip): return string const
1495 (frontStrip): return string const, add assertion
1496 (frontStrip): return string const
1501 * src/support/lstrings.C: add inclde "LAssert.h"
1502 (isStrInt): move tmpstr.end() out of loop.
1504 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
1505 toollist.end() out of loop.
1506 (deactivate): move toollist.end() out of loop.
1507 (update): move toollist.end() out of loop.
1508 (updateLayoutList): move tc.end() out of loop.
1509 (add): move toollist.end() out of loop.
1511 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
1512 md.end() out of loop.
1514 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
1516 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
1519 * src/paragraph.C (Erase): move fontlist.end() out of loop.
1520 (Erase): move insetlist.end() out of loop.
1522 * src/lyx_sendfax_main.C: make show_logfile static and to take a
1523 ref to const string as first arg. Move initialization of some
1524 variables, whitespace changes.
1526 * src/kbmap.C (defkey): move table.end() out of loop.
1527 (kb_keymap): move table.end() out of loop.
1528 (findbinding): move table.end() out of loop.
1530 * src/MenuBackend.C (hasMenu): move end() out of loop.
1531 (getMenu): move end() out of loop.
1532 (getMenu): move menulist_.end() out of loop.
1534 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
1536 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
1539 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
1540 (getFromLyXName): move infotab.end() out of loop.
1542 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
1543 -fvtable-thunks -ffunction-sections -fdata-sections
1545 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
1547 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
1550 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1552 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
1554 * src/frontends/xforms/FormCitation.[Ch],
1555 src/frontends/xforms/FormIndex.[Ch],
1556 src/frontends/xforms/FormToc.[Ch],
1557 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
1559 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1561 * src/commandtags.h: renamed, created some flags for citation
1564 * src/lyx_gui_misc.C: stripped out old FD_index_form code
1566 * src/lyxfunc.C (dispatch): use signals to insert index entry
1568 * src/frontends/Dialogs.h: new signal createIndex
1570 * src/frontends/xforms/FormCommand.[Ch],
1571 src/frontends/xforms/FormCitation.[Ch],
1572 src/frontends/xforms/FormToc.[Ch],
1573 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
1575 * src/insets/insetindex.[Ch]: GUI-independent
1577 * src/frontends/xforms/FormIndex.[Ch],
1578 * src/frontends/xforms/forms/form_index.fd: xforms implementation
1581 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
1583 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
1584 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
1586 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1588 * src/insets/insetref.C (Latex): rewrite so that there is now
1589 question that a initialization is requested.
1591 * src/insets/insetcommand.h: reenable the hide signal
1593 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1595 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
1596 fix handling of shortcuts (many bugs :)
1597 (add_lastfiles): ditto.
1599 * lib/ui/default.ui: fix a few shortcuts.
1601 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
1603 * Makefile.am: Fix ``rpmdist'' target to return the exit
1604 status of the ``rpm'' command, instead of the last command in
1605 the chain (the ``rm lyx.xpm'' command, which always returns
1608 2000-08-02 Allan Rae <rae@lyx.org>
1610 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
1611 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
1612 * src/frontends/xforms/FormToc.C (FormToc): ditto
1614 * src/frontends/xforms/Makefile.am: A few forgotten files
1616 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
1617 Signals-not-copyable-problem Lars' started commenting out.
1619 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
1621 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1623 * src/insets/insetcommand.h: Signals is not copyable so anoter
1624 scheme for automatic hiding of forms must be used.
1626 * src/frontends/xforms/FormCitation.h: don't inerit from
1627 noncopyable, FormCommand already does that.
1628 * src/frontends/xforms/FormToc.h: ditto
1629 * src/frontends/xforms/FormUrl.h: ditto
1631 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1633 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
1635 * src/insets/insetcommand.h (hide): new SigC::Signal0
1636 (d-tor) new virtual destructor emits hide signal
1638 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
1639 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
1641 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
1642 LOF and LOT. Inset is now GUI-independent
1644 * src/insets/insetloa.[Ch]: redundant
1645 * src/insets/insetlof.[Ch]: ditto
1646 * src/insets/insetlot.[Ch]: ditto
1648 * src/frontends/xforms/forms/form_url.fd: tweaked!
1649 * src/frontends/xforms/forms/form_citation.fd: ditto
1651 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
1652 dialogs dealing with InsetCommand insets
1654 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
1655 FormCommand base class
1656 * src/frontends/xforms/FormUrl.[Ch]: ditto
1658 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
1660 * src/frontends/xforms/FormToc.[Ch]: ditto
1662 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
1663 passed a generic InsetCommand pointer
1664 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
1666 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
1667 and modified InsetTOC class
1668 * src/buffer.C: ditto
1670 * forms/lyx.fd: strip out old FD_form_toc code
1671 * src/lyx_gui_misc.C: ditto
1672 * src/lyx_gui.C: ditto
1673 * src/lyx_cb.C: ditto
1674 * src/lyx.[Ch]: ditto
1676 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1678 * src/support/utility.hpp: tr -d '\r'
1680 2000-08-01 Juergen Vigna <jug@sad.it>
1682 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
1684 * src/commandtags.h:
1685 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
1686 LFUN_TABULAR_FEATURES.
1688 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
1689 LFUN_LAYOUT_TABULAR.
1691 * src/insets/insettabular.C (getStatus): implemented helper function.
1693 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
1695 2000-07-31 Juergen Vigna <jug@sad.it>
1697 * src/text.C (draw): fixed screen update problem for text-insets.
1699 * src/text2.C (SetParagrpah): call an update of the inset-owner when
1700 something changed probably this has to be added in various other
1703 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
1705 2000-07-31 Baruch Even <baruch.even@writeme.com>
1707 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
1708 templates to satisfy compaq cxx.
1711 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1713 * src/support/translator.h (equal_1st_in_pair::operator()): take
1714 const ref pair_type as arg.
1715 (equal_2nd_in_pair::operator()): ditto
1716 (Translator::~Translator): remove empty d-tor.
1718 * src/graphics/GraphicsCache.C: move include config.h to top, also
1719 put initialization of GraphicsCache::singleton here.
1720 (~GraphicsCache): move here
1721 (addFile): take const ref as arg
1724 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
1726 * src/BufferView2.C (insertLyXFile): change te with/without header
1729 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1731 * src/frontends/xforms/FormGraphics.C (apply): add some
1732 static_cast. Not very nice, but required by compaq cxx.
1734 * src/frontends/xforms/RadioButtonGroup.h: include header
1735 <utility> instead of <pair.h>
1737 * src/insets/insetgraphicsParams.C: add using directive.
1738 (readResize): change return type to void.
1739 (readOrigin): ditto.
1741 * src/lyxfunc.C (getStatus): add missing break for build-program
1742 function; add test for Literate for export functions.
1744 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
1745 entries in Options menu.
1747 2000-07-31 Baruch Even <baruch.even@writeme.com>
1749 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
1750 protect against auto-allocation; release icon when needed.
1752 2000-07-31 Matej Cepl <CeplM@seznam.cz>
1754 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
1755 on usual typewriter.
1757 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
1758 earlier czech.kmap), useful only for programming.
1760 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1762 * src/frontends/xforms/FormCitation.h: fix conditioning around
1765 2000-07-31 Juergen Vigna <jug@sad.it>
1767 * src/frontends/xforms/FormTabular.C (local_update): changed
1768 radio_linebreaks to radio_useparbox and added radio_useminipage.
1770 * src/tabular.C: made support for using minipages/parboxes.
1772 * src/bufferlist.C (QwriteAll): small fix for asking for save.
1774 * src/insets/insetgraphics.C (draw): just draw the inset so that the
1776 (descent): so the cursor is in the middle.
1777 (width): bit smaller box.
1779 * src/insets/insetgraphics.h: added display() function.
1781 2000-07-31 Baruch Even <baruch.even@writeme.com>
1783 * src/frontends/Dialogs.h: Added showGraphics signals.
1785 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
1786 xforms form definition of the graphics dialog.
1788 * src/frontends/xforms/FormGraphics.h:
1789 * src/frontends/xforms/FormGraphics.C: Added files, the
1790 GUIndependent code of InsetGraphics
1792 * src/insets/insetgraphics.h:
1793 * src/insets/insetgraphics.C: Major writing to make it work.
1795 * src/insets/insetgraphicsParams.h:
1796 * src/insets/insetgraphicsParams.C: Added files, parameter passing
1797 struct between InsetGraphics and GUI.
1799 * src/LaTeXFeatures.h:
1800 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
1801 support for graphicx package.
1803 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
1804 for the graphics inset.
1806 * src/support/translator.h: Added file, used in
1807 InsetGraphicsParams. this is a template to translate between two
1810 * src/frontends/xforms/RadioButtonGroup.h:
1811 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
1812 way to easily control a radio button group.
1814 2000-07-28 Juergen Vigna <jug@sad.it>
1816 * src/insets/insettabular.C (LocalDispatch):
1817 (TabularFeatures): added support for lyx-functions of tabular features.
1818 (cellstart): refixed this function after someone wrongly changed it.
1820 * src/commandtags.h:
1821 * src/LyXAction.C (init): added support for tabular-features
1823 2000-07-28 Allan Rae <rae@lyx.org>
1825 * src/frontends/xforms/FormPreferences.C (build): Setup input return
1826 checking. NOTE: It seems that pressing ESC to cancel the dialog also
1827 triggers the callback for input checking. As a result we sometimes get
1828 "LyX: This shouldn't happen..." printed to cerr.
1829 (input): Started using status variable since I only free() on
1830 destruction. Some input checking for paths and font sizes.
1832 * src/frontends/xforms/FormPreferences.h: Use status to control
1833 activation of Ok and Apply
1835 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
1836 callback. Also resized to stop segfaults with 0.88. The problem is
1837 that xforms-0.88 requires the folder to be wide enough to fit all the
1838 tabs. If it isn't it causes all sorts of problems.
1840 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
1842 * src/frontends/xforms/forms/README: Reflect reality.
1844 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
1845 * src/frontends/xforms/forms/makefile: ditto.
1847 * src/commandtags.h: Get access to new Preferences dialog
1848 * src/LyXAction.C: ditto
1849 * src/lyxfunc.C: ditto
1850 * lib/ui/default.ui: ditto
1852 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1854 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
1856 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
1859 * src/frontends/xforms/form_url.[Ch]: added.
1861 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1863 * src/insets/insetbib.h: fixed bug in previous commit
1865 * src/frontends/xforms/FormUrl.h: ditto
1867 * src/frontends/xforms/FormPrint.h: ditto
1869 * src/frontends/xforms/FormPreferences.h: ditto
1871 * src/frontends/xforms/FormCopyright.h: ditto
1873 * src/frontends/xforms/FormCitation.C: ditto
1875 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
1876 private copyconstructor and private default contructor
1878 * src/support/Makefile.am: add utility.hpp
1880 * src/support/utility.hpp: new file from boost
1882 * src/insets/insetbib.h: set owner in clone
1884 * src/frontends/xforms/FormCitation.C: added missing include
1887 * src/insets/form_url.[Ch]: removed
1889 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
1891 * development/lyx.spec.in
1892 * Makefile.am: Fix buglet for LyX RPM generation resulting from
1893 file/directory re-organization.
1895 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
1897 * src/insets/insetcommand.[Ch]: moved the string data and
1898 associated manipulation methods into a new stand-alone class
1899 InsetCommandParams. This class has two additional methods
1900 getAsString() and setFromString() allowing the contents to be
1901 moved around as a single string.
1902 (addContents) method removed.
1903 (setContents) method no longer virtual.
1905 * src/buffer.C (readInset): made use of new InsetCitation,
1906 InsetUrl constructors based on InsetCommandParams.
1908 * src/commandtags.h: add LFUN_INSERT_URL
1910 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
1911 independent InsetUrl and use InsetCommandParams to extract
1912 string info and create new Insets.
1914 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
1916 * src/frontends/xforms/FormCitation.C (apply): uses
1919 * src/frontends/xforms/form_url.C
1920 * src/frontends/xforms/form_url.h
1921 * src/frontends/xforms/FormUrl.h
1922 * src/frontends/xforms/FormUrl.C
1923 * src/frontends/xforms/forms/form_url.fd: new files
1925 * src/insets/insetcite.[Ch]: removed unused constructors.
1927 * src/insets/insetinclude.[Ch]: no longer store filename
1929 * src/insets/inseturl.[Ch]: GUI-independent.
1931 2000-07-26 Juergen Vigna <jug@sad.it>
1932 * renamed frontend from gtk to gnome as it is that what is realized
1933 and did the necessary changes in the files.
1935 2000-07-26 Marko Vendelin <markov@ioc.ee>
1937 * configure.in: cleaning up gnome configuration scripts
1939 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1941 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
1942 shortcuts syndrom by redrawing them explicitely (a better solution
1943 would be appreciated).
1945 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
1947 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
1950 * src/lyx_cb.C (MenuExport): change html export to do the right
1951 thing depending of the document type (instead of having
1952 html-linuxdoc and html-docbook).
1953 * src/lyxfunc.C (getStatus): update for html
1954 * lib/ui/default.ui: simplify due to the above change.
1955 * src/menus.C (ShowFileMenu): update too (in case we need it).
1957 * src/MenuBackend.C (read): if a menu is defined twice, add the
1958 new entries to the exiting one.
1960 2000-07-26 Juergen Vigna <jug@sad.it>
1962 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
1964 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
1965 and return a bool if it did actual save the file.
1966 (AutoSave): don't autosave a unnamed doc.
1968 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
1969 check if this is an UNNAMED new file and react to it.
1970 (newFile): set buffer to unnamed and change to not mark a new
1971 buffer dirty if I didn't do anything with it.
1973 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
1975 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1977 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
1978 friend as per Angus's patch posted to lyx-devel.
1980 * src/ext_l10n.h: updated
1982 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
1983 gettext on the style string right before inserting them into the
1986 * autogen.sh: add code to extract style strings form layout files,
1987 not good enough yet.
1989 * src/frontends/gtk/.cvsignore: add MAKEFILE
1991 * src/MenuBackend.C (read): run the label strings through gettext
1992 before storing them in the containers.
1994 * src/ext_l10n.h: new file
1996 * autogen.sh : generate the ext_l10n.h file here
1998 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2000 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
2003 * lib/ui/default.ui: fix a couple of typos.
2005 * config/gnome/gtk.m4: added (and added to the list of files in
2008 * src/insets/insetinclude.C (unique_id): fix when we are using
2009 lyxstring instead of basic_string<>.
2010 * src/insets/insettext.C (LocalDispatch): ditto.
2011 * src/support/filetools.C: ditto.
2013 * lib/configure.m4: create the ui/ directory if necessary.
2015 * src/LyXView.[Ch] (updateToolbar): new method.
2017 * src/BufferView_pimpl.C (buffer): update the toolbar when
2018 opening/closing buffer.
2020 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2022 * src/LyXAction.C (getActionName): enhance to return also the name
2023 and options of pseudo-actions.
2024 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
2026 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
2027 as an example of what is possible). Used in File->Build too (more
2028 useful) and in the import/export menus (to mimick the complicated
2029 handling of linuxdoc and friends). Try to update all the entries.
2031 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
2034 * src/MenuBackend.C (read): Parse the new OptItem tag.
2036 * src/MenuBackend.h: Add a new optional_ data member (used if the
2037 entry should be omitted when the lyxfunc is disabled).
2039 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
2040 function, used as a shortcut.
2041 (create_submenu): align correctly the shortcuts on the widest
2044 * src/MenuBackend.h: MenuItem.label() only returns the label of
2045 the menu without shortcut; new method shortcut().
2047 2000-07-14 Marko Vendelin <markov@ioc.ee>
2049 * src/frontends/gtk/Dialogs.C:
2050 * src/frontends/gtk/FormCopyright.C:
2051 * src/frontends/gtk/FormCopyright.h:
2052 * src/frontends/gtk/Makefile.am: added these source-files for the
2053 Gtk/Gnome support of the Copyright-Dialog.
2055 * src/main.C: added Gnome::Main initialization if using
2056 Gtk/Gnome frontend-GUI.
2058 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
2060 * config/gnome/aclocal-include.m4
2061 * config/gnome/compiler-flags.m4
2062 * config/gnome/curses.m4
2063 * config/gnome/gnome--.m4
2064 * config/gnome/gnome-bonobo-check.m4
2065 * config/gnome/gnome-common.m4
2066 * config/gnome/gnome-fileutils.m4
2067 * config/gnome/gnome-ghttp-check.m4
2068 * config/gnome/gnome-gnorba-check.m4
2069 * config/gnome/gnome-guile-checks.m4
2070 * config/gnome/gnome-libgtop-check.m4
2071 * config/gnome/gnome-objc-checks.m4
2072 * config/gnome/gnome-orbit-check.m4
2073 * config/gnome/gnome-print-check.m4
2074 * config/gnome/gnome-pthread-check.m4
2075 * config/gnome/gnome-support.m4
2076 * config/gnome/gnome-undelfs.m4
2077 * config/gnome/gnome-vfs.m4
2078 * config/gnome/gnome-x-checks.m4
2079 * config/gnome/gnome-xml-check.m4
2080 * config/gnome/gnome.m4
2081 * config/gnome/gperf-check.m4
2082 * config/gnome/gtk--.m4
2083 * config/gnome/linger.m4
2084 * config/gnome/need-declaration.m4: added configuration scripts
2085 for Gtk/Gnome frontend-GUI
2087 * configure.in: added support for the --with-frontend=gtk option
2089 * autogen.sh: added config/gnome/* to list of config-files
2091 * acconfig.h: added define for GTKGUI-support
2093 * config/lyxinclude.m4: added --with-frontend[=value] option value
2094 for Gtk/Gnome frontend-GUI support.
2096 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2098 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
2102 * src/paragraph.C (GetChar): remove non-const version
2104 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
2105 (search_kw): use it.
2107 * src/lyx_main.C (init): if "preferences" exist, read that instead
2109 (ReadRcFile): return bool if the file could be read ok.
2110 (ReadUIFile): add a check to see if lex file is set ok.
2112 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
2113 bastring can be used instead of lyxstring (still uses the old code
2114 if std::string is good enough or if lyxstring is used.)
2116 * src/encoding.C: make the arrays static, move ininle functions
2118 * src/encoding.h: from here.
2120 * src/buffer.C: have last_isnet_read as a file scope variable for now.
2121 (parseSingleLyXformat2Token): move inset parsing to separate method
2122 (readInset): new private method
2124 * src/Variables.h: remove virtual from get().
2126 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
2127 access to NEW_INSETS and NEW_TABULAR
2129 * src/MenuBackend.h: remove superfluous forward declaration of
2130 MenuItem. Add documentations tags "///", remove empty MenuItem
2131 destructor, remove private default contructor.
2133 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
2135 (read): more string mlabel and mname to where they are used
2136 (read): remove unused variables mlabel and mname
2137 (defaults): unconditional clear, make menusetup take advantage of
2138 add returning Menu &.
2140 * src/LyXView.h: define NEW_MENUBAR as default
2142 * src/LyXAction.C: include lyxparagraph.h temporary to get access
2143 to NEW_INSETS and NEW_TABULAR.
2144 (init): commetn out some funcs that is obsolete when NEW_INSETS is
2145 defined. Change some of the "xxxx-inset-insert" functions names to
2148 * several files: more enahncements to NEW_INSETS and the resulting
2151 * lib/lyxrc.example (\date_insert_format): move to misc section
2153 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
2154 bastring and use AC_CACHE_CHECK.
2155 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
2156 the system have the newest methods. uses AC_CACHE_CHECK
2157 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
2158 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
2159 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
2161 * configure.in: add LYX_CXX_GOOD_STD_STRING
2163 * acinclude.m4: recreated
2165 2000-07-24 Amir Karger
2167 * README: add Hebrew, Arabic kmaps
2170 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2172 * src/buffer.C (writeFileAscii): Define actcell as an int instead
2175 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2177 * Lot of files: add pragma interface/implementation.
2179 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
2181 * lib/ui/default.ui: new file (ans new directory). Contains the
2182 default menu and toolbar.
2184 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
2185 global space. Toolbars are now read (as menus) in ui files.
2187 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
2189 * src/lyxfunc.C (getStatus): do not exit immediately if a command
2190 is disabled because the document is read-only. We want to have the
2191 toggle state of the function anyway.
2192 (getStatus): add code for LFUN_VC* functions (mimicking what is
2193 done in old-style menus)
2195 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
2196 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
2198 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
2199 * src/BufferView_pimpl.C: ditto.
2200 * src/lyxfunc.C: ditto.
2202 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
2203 default). This replaces old-style menus by new ones.
2205 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
2206 MenuItem. Contain the data structure of a menu.
2208 * src/insets/insettext.C: use LyXView::setLayout instead of
2209 accessing directly the toolbar combox.
2210 * src/lyxfunc.C (Dispatch): ditto.
2212 * src/LyXView.C (setLayout): new method, which just calls
2213 Toolbar::setLayout().
2214 (updateLayoutChoice): move part of this method in Toolbar.
2216 * src/toolbar.[Ch]: removed.
2218 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
2219 implementation the toolbar.
2221 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
2222 the toolbar. It might make sense to merge it with ToolbarDefaults
2224 (setLayout): new function.
2225 (updateLayoutList): ditto.
2226 (openLayoutList): ditto.
2228 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
2229 xforms implementation of the toolbar.
2230 (get_toolbar_func): comment out, since I do not
2231 know what it is good for.
2233 * src/ToolbarDefaults.h: Add the ItemType enum.
2235 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
2236 for a list of allocated C strings. Used in Menubar xforms
2237 implementation to avoid memory leaks.
2239 * src/support/lstrings.[Ch] (uppercase): new version taking and
2243 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
2244 * lib/bind/emacs.bind: ditto.
2246 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2248 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
2249 forward decl of LyXView.
2251 * src/toolbar.C (toolbarItem): moved from toolbar.h
2252 (toolbarItem::clean): ditto
2253 (toolbarItem::~toolbarItem): ditto
2254 (toolbarItem::operator): ditto
2256 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
2258 * src/paragraph.h: control the NEW_TABULAR define from here
2260 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
2261 USE_TABULAR_INSETS to NEW_TABULAR
2263 * src/ToolbarDefaults.C: add include "lyxlex.h"
2265 * files using the old table/tabular: use NEW_TABULAR to control
2266 compilation of old tabular stuff.
2268 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
2271 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
2272 planemet in reading of old style floats, fix the \end_deeper
2273 problem when reading old style floats.
2275 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2277 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
2279 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
2281 * lib/bind/sciword.bind: updated.
2283 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2285 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
2286 layout write problem
2288 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2290 * src/Makefile.am (INCLUDES): remove image directory from include
2293 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
2294 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
2296 * src/LyXView.C (create_form_form_main): read the application icon
2299 * lib/images/*.xpm: change the icons to use transparent color for
2302 * src/toolbar.C (update): change the color of the button when it
2305 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2307 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
2308 setting explicitely the minibuffer.
2309 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
2311 * src/LyXView.C (showState): new function. Shows font information
2312 in minibuffer and update toolbar state.
2313 (LyXView): call Toolbar::update after creating the
2316 * src/toolbar.C: change toollist to be a vector instead of a
2318 (BubbleTimerCB): get help string directly from the callback
2319 argument of the corresponding icon (which is the action)
2320 (set): remove unnecessary ugliness.
2321 (update): new function. update the icons (depressed, disabled)
2322 depending of the status of the corresponding action.
2324 * src/toolbar.h: remove help in toolbarItem
2326 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
2328 * src/Painter.C (text): Added code for using symbol glyphs from
2329 iso10646 fonts. Currently diabled.
2331 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
2334 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
2335 magyar,turkish and usorbian.
2337 * src/paragraph.C (isMultiLingual): Made more efficient.
2339 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
2342 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
2343 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
2344 Also changed the prototype to "bool math_insert_greek(char)".
2346 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2348 * lots of files: apply the NEW_INSETS on all code that will not be
2349 needed when we move to use the new insets. Enable the define in
2350 lyxparagrah.h to try it.
2352 * src/insets/insettabular.C (cellstart): change to be a static
2354 (InsetTabular): initialize buffer in the initializer list.
2356 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
2358 * src/frontends/xforms/FormPrint.[Ch] : moved #include
2359 form_print.h out of the header file. Replaced with forward
2360 declarations of the relevant struct.
2362 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
2365 * src/commandtags.h: do not include "debug.h" which does not
2366 belong there. #include it in some other places because of this
2369 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2371 * src/insets/insetcaption.C: add a couple "using" directives.
2373 * src/toolbar.C (add): get the help text directly from lyxaction.
2375 (setPixmap): new function. Loads from disk and sets a pixmap on a
2376 botton; the name of the pixmap file is derived from the command
2379 * src/toolbar.h: remove members isBitmap and pixmap from
2382 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
2383 * lib/images/: move many files from images/banner.xpm.
2385 * src/lyx_gui.C (create_forms): read banner pixmap from file.
2387 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
2388 * src/toolbar.C: ditto.
2389 * configure.in: ditto.
2390 * INSTALL: document.
2392 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
2393 the spellchecker popup is closed from the WM.
2395 2000-07-19 Juergen Vigna <jug@sad.it>
2397 * src/insets/insetfloat.C (Write): small fix because we use the
2398 insetname for the type now!
2400 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
2402 * src/frontends/xforms/forms/form_citation.fd: object sizes are
2405 * src/frontends/Dialogs.h: removed hideCitation signal
2407 * src/insets/insetcite.h: added hide signal
2409 * src/insets/insetcite.C (~InsetCitation): emits new signal
2410 (getScreenLabel): "intelligent" label should now fit on the screen!
2412 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
2414 * src/frontends/xforms/FormCitation.C (showInset): connects
2415 hide() to the inset's hide signal
2416 (show): modified to use fl_set_object_position rather than
2417 fl_set_object_geometry wherever possible
2419 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2421 * src/insets/lyxinset.h: add caption code
2423 * src/insets/insetfloat.C (type): new method
2425 * src/insets/insetcaption.C (Write): new method
2427 (LyxCode): new method
2429 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
2430 to get it right together with using the FloatList.
2432 * src/commandtags.h: add LFUN_INSET_CAPTION
2433 * src/lyxfunc.C (Dispatch): handle it
2435 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
2438 * src/Variables.[Ch]: make expand take a const reference, remove
2439 the destructor, some whitespace changes.
2441 * src/LyXAction.C (init): add caption-inset-insert
2443 * src/FloatList.C (FloatList): update the default floats a bit.
2445 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2447 * src/Variables.[Ch]: new files. Intended to be used for language
2448 specific strings (like \chaptername) and filename substitution in
2451 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
2453 * lib/kbd/american.kmap: update
2455 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
2457 * src/bufferparams.[Ch]: remove member allowAccents.
2459 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
2461 * src/LaTeXLog.C: use the log_form.h header.
2462 * src/lyx_gui.C: ditto.
2463 * src/lyx_gui_misc.C: ditto.
2464 * src/lyxvc.h: ditto.
2466 * forms/log_form.fd: new file, created from latexoptions.fd. I
2467 kept the log popup and nuked the options form.
2469 * src/{la,}texoptions.[Ch]: removed.
2470 * src/lyx_cb.C (LaTeXOptions): ditto
2472 * src/lyx_gui.C (create_forms): do not handle the
2473 fd_latex_options form.
2475 2000-07-18 Juergen Vigna <jug@sad.it>
2477 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
2478 name of the inset so that it can be requested outside (text2.C).
2480 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
2483 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2485 * src/mathed/formula.h (ConvertFont): constify
2487 * src/mathed/formula.C (Read): add warning if \end_inset is not
2488 found on expected place.
2490 * src/insets/lyxinset.h (ConvertFont): consify
2492 * src/insets/insetquotes.C (ConvertFont): constify
2493 * src/insets/insetquotes.h: ditto
2495 * src/insets/insetinfo.h: add labelfont
2497 * src/insets/insetinfo.C (InsetInfo): set the labelfont
2498 (ascent): use labelfont
2502 (Write): make .lyx file a bit nicer
2504 * src/insets/insetfloat.C (Write): simplify somewhat...
2505 (Read): add warning if arg is not found
2507 * src/insets/insetcollapsable.C: add using std::max
2508 (Read): move string token and add warning in arg is not found
2509 (draw): use std::max to get the right ty
2510 (getMaxWidth): simplify by using std::max
2512 * src/insets/insetsection.h: new file
2513 * src/insets/insetsection.C: new file
2514 * src/insets/insetcaption.h: new file
2515 * src/insets/insetcaption.C: new file
2517 * src/insets/inset.C (ConvertFont): constify signature
2519 * src/insets/Makefile.am (libinsets_la_SOURCES): add
2520 insetcaption.[Ch] and insetsection.[Ch]
2522 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
2523 uses to use LABEL_COUNTER_CHAPTER instead.
2524 * src/text2.C (SetCounter): here
2526 * src/counters.h: new file
2527 * src/counters.C: new file
2528 * src/Sectioning.h: new file
2529 * src/Sectioning.C: new file
2531 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
2533 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2535 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
2538 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
2541 2000-07-17 Juergen Vigna <jug@sad.it>
2543 * src/tabular.C (Validate): check if array-package is needed.
2544 (SetVAlignment): added support for vertical alignment.
2545 (SetLTFoot): better support for longtable header/footers
2546 (Latex): modified to support added features.
2548 * src/LaTeXFeatures.[Ch]: added array-package.
2550 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
2552 * src/lyx_gui.C (LyXGUI): make sure that the height is large
2555 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
2557 * configure.in: do not forget to put a space after -isystem.
2559 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
2561 * lib/kbd/arabic.kmap: a few fixes.
2563 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2565 * some whitespace chagnes to a number of files.
2567 * src/support/DebugStream.h: change to make it easier for
2568 doc++ to parse correctly.
2569 * src/support/lyxstring.h: ditto
2571 * src/mathed/math_utils.C (compara): change to have only one
2573 (MathedLookupBOP): change because of the above.
2575 * src/mathed/math_delim.C (math_deco_compare): change to have only
2577 (search_deco): change becasue of the above.
2579 * src/insets/insettabular.C (DrawCellSelection): use std::swap
2580 instead of manually coded one.
2582 * src/insets/insetquotes.C (Read): read the \end_inset too
2584 * src/insets/insetlatex.h: remove file
2585 * src/insets/insetlatex.C: remove file
2587 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
2589 (InsetPrintIndex): remove destructor
2591 * src/insets/insetinclude.h: remove default constructor
2593 * src/insets/insetfloat.C: work to make it work better
2595 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
2597 * src/insets/insetcite.h (InsetCitation): remove default constructor
2599 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
2601 * src/text.C (GetColumnNearX): comment out some currently unused code.
2603 * src/paragraph.C (writeFile): move some initializations closer to
2605 (CutIntoMinibuffer): small change to use new matchIT operator
2609 (InsertInset): ditto
2612 (InsetIterator): ditto
2613 (Erase): small change to use new matchFT operator
2615 (GetFontSettings): ditto
2616 (HighestFontInRange): ditto
2619 * src/lyxparagraph.h: some chars changed to value_type
2620 (matchIT): because of some stronger checking (perhaps too strong)
2621 in SGI STL, the two operator() unified to one.
2624 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
2626 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
2627 the last inset read added
2628 (parseSingleLyXformat2Token): some more (future) compability code added
2629 (parseSingleLyXformat2Token): warning about solitary \end_inset added
2630 (parseSingleLyXformat2Token): set last_inset_read
2631 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2632 (parseSingleLyXformat2Token): don't double intializw string next_token
2634 * src/TextCache.C (text_fits::operator()): add const's to the signature
2635 (has_buffer::operator()): ditto
2637 * src/Floating.h: add some comments on the class
2639 * src/FloatList.[Ch] (typeExist): new method
2642 * src/BackStack.h: added default constructor, wanted by Gcc.
2644 2000-07-14 Juergen Vigna <jug@sad.it>
2646 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
2648 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
2650 * src/insets/insettabular.C (resizeLyXText): need this to be able to
2651 do a redraw when the window is resized!
2652 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
2654 * src/insets/insettext.C (resizeLyXText): added function to correctly
2655 being able to resize the LyXWindow.
2657 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
2659 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
2661 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
2662 crashes when closing dialog to a deleted inset.
2664 * src/insets/insetcite.[Ch] (Edit) : the return of this former
2665 method! Now similar to other insets.
2667 2000-07-13 Juergen Vigna <jug@sad.it>
2669 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
2671 * lib/examples/Literate.lyx: small patch!
2673 * src/insets/insetbib.C (Read): added this function because of wrong
2674 Write (without [begin|end]_inset).
2676 2000-07-11 Juergen Vigna <jug@sad.it>
2678 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
2679 as the insertInset could not be good!
2681 * src/screen.C (ToggleSelection): fixed toggle selection bug as
2682 the bool param should not be last.
2684 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2686 * sigc++/configure.in: fix bug in threading-related code (Yes, I
2687 did submit that to Karl).
2689 * configure.in: use -isystem instead of -I for X headers. This
2690 fixes a problem on solaris with a recent gcc;
2691 put the front-end code after the X detection code;
2692 configure in sigc++ before lib/
2694 * src/lyx_main.C (commandLineHelp): remove -display from command
2697 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
2699 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
2700 Also put in Makefile rules for building the ``listerrors''
2701 program for parsing errors from literate programs written in LyX.
2703 * lib/build-listerrors: Added small shell script as part of compile
2704 process. This builds a working ``listerrors'' binary if noweb is
2705 installed and either 1) the VNC X server is installed on the machine,
2706 or 2) the user is compiling from within a GUI. The existence of a GUI
2707 is necessary to use the ``lyx --export'' feature for now. This
2708 hack can be removed once ``lyx --export'' no longer requires a GUI to
2711 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
2713 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
2714 now passed back correctly from gcc and placed "under" error
2715 buttons in a Literate LyX source.
2717 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2719 * src/text.C (GetColumnNearX): Better behavior when a RTL
2720 paragraph is ended by LTR text.
2722 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
2725 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2727 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
2728 true when clipboard is empty.
2730 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2732 * text.C (Backspace): Prevent rebreaking of a row if it is the last
2733 row of the paragraph.
2734 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
2735 to prevent calculation of bidi tables
2737 2000-07-07 Juergen Vigna <jug@sad.it>
2739 * src/screen.C (ToggleSelection): added y_offset and x_offset
2742 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
2745 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
2747 * src/insets/insettext.C: fixed Layout-Display!
2749 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2751 * configure.in: add check for strings.h header.
2753 * src/spellchecker.C: include <strings.h> in order to have a
2754 definition for bzero().
2756 2000-07-07 Juergen Vigna <jug@sad.it>
2758 * src/insets/insettext.C (draw): set the status of the bv->text to
2759 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
2761 * src/screen.C (DrawOneRow):
2762 (DrawFromTo): redraw the actual row if something has changed in it
2765 * src/text.C (draw): call an update of the toplevel-inset if something
2766 has changed inside while drawing.
2768 * src/lyxtext.h: added CHANGED_IN_DRAW status.
2770 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
2772 * src/insets/insetbib.[Ch] (callback) new method, moving callback
2773 processing inside class.
2775 * src/insets/insetindex.[Ch] (callback) new method, moving callback
2776 processing inside class.
2778 * src/insets/insetindex.h new struct Holder, consistent with other
2781 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
2782 citation dialog from main code and placed it in src/frontends/xforms.
2783 Dialog launched through signals instead of callbacks
2785 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
2787 * lyx.man: update the options description.
2789 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
2791 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
2792 handle neg values, set min width to 590, add doc about -display
2794 2000-07-05 Juergen Vigna <jug@sad.it>
2796 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
2797 calls to BufferView *.
2799 * src/insets/insettext.C (checkAndActivateInset): small fix non
2800 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
2802 * src/insets/insetcommand.C (Read): Fixed as insets should read till
2803 their \end_inset token!
2805 2000-07-04 edscott <edscott@imp.mx>
2807 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
2808 lib/lyxrc.example: added option \wheel_jump
2810 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
2812 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
2813 remove support for -width,-height,-xpos and -ypos.
2815 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
2817 * src/encoding.[Ch]: New files.
2819 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
2820 (text): Call to the underline() method only when needed.
2822 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
2824 * src/buffer.C (makeLaTeXFile): Compute automatically the input
2825 encoding(s) for the document.
2827 * src/bufferparams.C (BufferParams): Changed default value of
2830 * src/language.C (newLang): Removed.
2831 (items[]): Added encoding information for all defined languages.
2833 * src/lyx_gui.C (create_forms): Added "auto" option to the input
2834 encoding choice button.
2836 * src/lyxrc.h (font_norm_type): New member variable.
2837 (set_font_norm_type): New method.
2839 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
2840 paragraphs with different encodings.
2842 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
2843 (TransformChar): Changed to work correctly with Arabic points.
2844 (draw): Added support for drawing Arabic points.
2845 (draw): Removed code for drawing underbars (this is done by
2848 * src/support/textutils.h (IsPrintableNonspace): New function.
2850 * src/BufferView_pimpl.h: Added "using SigC::Object".
2851 * src/LyXView.h: ditto.
2853 * src/insets/insetinclude.h (include_label): Changed to mutable.
2855 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
2857 * src/mathed/math_iter.h: remove empty destructor
2859 * src/mathed/math_cursor.h: remove empty destructor
2861 * src/insets/lyxinset.h: add THEOREM_CODE
2863 * src/insets/insettheorem.[Ch]: new files
2865 * src/insets/insetminipage.C: (InsertInset): remove
2867 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
2869 (InsertInset): remove
2871 * src/insets/insetlist.C: (InsertList): remove
2873 * src/insets/insetfootlike.[Ch]: new files
2875 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
2878 (InsertInset): ditto
2880 * src/insets/insetert.C: remove include Painter.h, reindent
2881 (InsertInset): move to header
2883 * src/insets/insetcollapsable.h: remove explicit from default
2884 contructor, remove empty destructor, add InsertInset
2886 * src/insets/insetcollapsable.C (InsertInset): new func
2888 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2890 * src/vspace.h: add explicit to constructor
2892 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
2893 \textcompwordmark, please test this.
2895 * src/lyxrc.C: set ascii_linelen to 65 by default
2897 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
2899 * src/commandtags.h: add LFUN_INSET_THEOREM
2901 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
2902 (makeLinuxDocFile): remove _some_ of the nice logic
2903 (makeDocBookFile): ditto
2905 * src/Painter.[Ch]: (~Painter): removed
2907 * src/LyXAction.C (init): entry for insettheorem added
2909 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
2911 (deplog): code to detect files generated by LaTeX, needs testing
2914 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2916 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
2918 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2920 * src/LaTeX.C (deplog): Add a check for files that are going to be
2921 created by the first latex run, part of the project to remove the
2924 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
2925 contents to the extension list.
2927 2000-07-04 Juergen Vigna <jug@sad.it>
2929 * src/text.C (NextBreakPoint): added support for needFullRow()
2931 * src/insets/lyxinset.h: added needFullRow()
2933 * src/insets/insetcollapsable.C: redone now this uses a text-inset
2936 * src/insets/insettext.C: lots of changes for update!
2938 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
2940 * src/LaTeXFeatures.h: add a missing std:: qualifier.
2942 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
2944 * src/insets/insetinclude.C (InsetInclude): fixed
2945 initialization of include_label.
2946 (unique_id): now returns a string.
2948 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
2950 * src/LaTeXFeatures.h: new member IncludedFiles, for
2951 a map of key, included file name.
2953 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
2954 with the included files for inclusion in SGML preamble,
2955 i. e., linuxdoc and docbook.
2958 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
2959 nice (is the generated linuxdoc code to be exported?), that
2960 allows to remove column, and only_body that will be true for
2961 slave documents. Insets are allowed inside SGML font type.
2962 New handling of the SGML preamble for included files.
2963 (makeDocBookFile): the same for docbook.
2965 * src/insets/insetinclude.h:
2966 * src/insets/insetinclude.C (Validate): keeps a list of included files.
2968 (DocBook): new export methods.
2970 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
2971 and makeDocBookFile.
2973 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
2974 formats to export with command line argument -x.
2976 2000-06-29 Juergen Vigna <jug@sad.it>
2978 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
2979 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
2981 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
2982 region could already been cleared by an inset!
2984 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2986 * src/BufferView_pimpl.h: remove member variables lyx_focus and
2989 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
2991 (cursorToggle): remove special handling of lyx focus.
2993 2000-06-28 Juergen Vigna <jug@sad.it>
2995 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
2998 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3000 * src/insets/insetindex.C (Edit): add a callback when popup is
3003 * src/insets/insettext.C (LocalDispatch):
3004 * src/insets/insetmarginal.h:
3005 * src/insets/insetlist.h:
3006 * src/insets/insetfoot.h:
3007 * src/insets/insetfloat.h:
3008 * src/insets/insetert.h: add a missing std:: qualifier.
3010 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3012 * src/support/lyxsum.C (sum): '\0' teminate file read when using
3015 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
3017 * src/insets/insettext.C (Read): remove tmptok unused variable
3018 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
3019 (InsertInset): change for new InsetInset code
3021 * src/insets/insettext.h: add TEXT inline method
3023 * src/insets/insettext.C: remove TEXT macro
3025 * src/insets/insetmarginal.C (Write): new method
3026 (Latex): change output slightly
3028 * src/insets/insetfoot.C (Write): new method
3029 (Latex): change output slightly (don't use endl when no need)
3031 * src/insets/insetert.C (Write): new method
3033 * src/insets/insetcollapsable.h: make button_length, button_top_y
3034 and button_bottm_y protected.
3036 * src/insets/insetcollapsable.C (Write): simplify code by using
3037 tostr. Also do not output the float name, the children class
3038 should to that to get control over own arguments
3040 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
3041 src/insets/insetminipage.[Ch]:
3044 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3046 * src/lyxfunc.C (Dispatch): cases for new insets/commands
3048 * src/Makefile.am (lyx_SOURCES): add the new files
3050 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
3051 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
3052 * src/commandtags.h: ditto
3054 * src/LaTeXFeatures.h: add a std::set of used floattypes
3056 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
3058 * src/FloatList.[Ch] src/Floating.h: new files
3060 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
3062 * src/lyx_cb.C (TableApplyCB): ditto
3064 * src/text2.C: ditto
3065 * src/buffer.C (SimpleLinuxDocOnePar): ditto
3066 (parseSingleLyXformat2Token): ditto + add code for
3067 backwards compability for old float styles + add code for new insets
3069 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
3071 (InsertInset(size_type, Inset *, LyXFont)): new method
3072 (InsetChar(size_type, char)): changed to use the other InsetChar
3073 with a LyXFont(ALL_INHERIT).
3074 (InsetInset(size_type, Inset*)): changed to use InsetChar to
3075 insert the META_INSET.
3077 * sigc++/thread.cc (Privete<int>::operator int&): move definition
3079 * sigc++/thread.h (Threads): from here
3081 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
3082 definition out of line
3083 * sigc++/scope.h: from here
3085 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3087 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
3088 is specified (adapted from a patch from edscott <edscott@imp.mx>).
3090 * Makefile.am (bindist): new target.
3092 * INSTALL: add instructions for doing a binary distribution.
3094 * development/tools/README.bin.example: update a bit.
3096 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
3099 * lib/lyxrc.example: new lyxrc tag \set_color.
3101 * src/lyxfunc.C (Dispatch):
3102 * src/commandtags.h:
3103 * src/LyXAction.C: new lyxfunc "set-color".
3105 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
3106 and an x11name given as strings.
3108 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
3109 cache when a color is changed.
3111 2000-06-26 Juergen Vigna <jug@sad.it>
3113 * src/lyxrow.C (width): added this functions and variable.
3115 * src/insets/insetcite.C (create_form_citation_form): some Gravity
3118 * src/text.C (SetHeightOfRow): fixed calcualting of width.
3120 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3122 * images/undo_bw.xpm: new icon.
3123 * images/redo_bw.xpm: ditto.
3125 * configure.in (INSTALL_SCRIPT): change value to
3126 ${INSTALL} to avoid failures of install-script target.
3127 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
3129 * src/BufferView.h: add a magic "friend" declaration to please
3132 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
3134 * forms/cite.fd: modified to allow resizing without messing
3137 * src/insetcite.C: Uses code from cite.fd almost without
3139 User can now resize dialog in the x-direction.
3140 Resizing the dialog in the y-direction is prevented, as the
3141 code does this intelligently already.
3143 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3145 * INSTALL: remove obsolete entry in "problems" section.
3147 * lib/examples/sl_*.lyx: update of the slovenian examples.
3149 * src/support/FileInfo.[Ch] (getBlockSize): remove.
3151 2000-06-23 Juergen Vigna <jug@sad.it>
3153 * src/lyxtext.h: added a 'cleared' flag to draw() function.
3155 * src/buffer.C (resize): delete the LyXText of textinsets.
3157 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
3159 * src/insets/lyxinset.h: added another parameter 'cleared' to
3160 the draw() function.
3162 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
3163 unlocking inset in inset.
3165 2000-06-22 Juergen Vigna <jug@sad.it>
3167 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
3168 of insets and moved first to LyXText.
3170 * src/mathed/formulamacro.[Ch]:
3171 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
3173 2000-06-21 Juergen Vigna <jug@sad.it>
3175 * src/text.C (GetVisibleRow): look if I should clear the area or not
3176 using Inset::doClearArea() function.
3178 * src/insets/lyxinset.h: added doClearArea() function and
3179 modified draw(Painter &, ...) to draw(BufferView *, ...)
3181 * src/text2.C (UpdateInset): return bool insted of int
3183 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
3185 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
3186 combox in the character popup
3188 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
3189 BufferParams const & params
3191 2000-06-20 Juergen Vigna <jug@sad.it>
3193 * src/insets/insettext.C (SetParagraphData): set insetowner on
3196 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3198 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
3199 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
3201 (form_main_): remove
3203 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
3204 (create_form_form_main): remove FD_form_main stuff, connect to
3205 autosave_timeout signal
3207 * src/LyXView.[Ch] (getMainForm): remove
3208 (UpdateTimerCB): remove
3209 * src/BufferView_pimpl.h: inherit from SigC::Object
3211 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
3212 signal instead of callback
3214 * src/BufferView.[Ch] (cursorToggleCB): remove
3216 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3218 * src/BufferView_pimpl.C: changes because of the one below
3220 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
3221 instead of storing a pointer to a LyXText.
3223 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
3225 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
3227 * src/lyxparagraph.h
3229 * src/paragraph.C: Changed fontlist to a sorted vector.
3231 2000-06-19 Juergen Vigna <jug@sad.it>
3233 * src/BufferView.h: added screen() function.
3235 * src/insets/insettext.C (LocalDispatch): some selection code
3238 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
3240 * src/insets/insettext.C (SetParagraphData):
3242 (InsetText): fixes for multiple paragraphs.
3244 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
3246 * development/lyx.spec.in: Call configure with ``--without-warnings''
3247 to work around a bug with the Makefiles when doing ``make lyxrpm''.
3248 This should be fine, however, since we generally don't want to be
3249 verbose when making an RPM.
3251 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
3253 * lib/scripts/fig2pstex.py: New file
3255 2000-06-16 Juergen Vigna <jug@sad.it>
3257 * src/insets/insettabular.C (UpdateLocal):
3258 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
3259 (LocalDispatch): Changed all functions to use LyXText.
3261 2000-06-15 Juergen Vigna <jug@sad.it>
3263 * src/text.C (SetHeightOfRow): call inset::update before requesting
3266 * src/insets/insettext.C (update):
3267 * src/insets/insettabular.C (update): added implementation
3269 * src/insets/lyxinset.h: added update function
3271 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3273 * src/text.C (SelectNextWord): protect against null pointers with
3274 old-style string streams. (fix from Paul Theo Gonciari
3277 * src/cite.[Ch]: remove erroneous files.
3279 * lib/configure.m4: update the list of created directories.
3281 * src/lyxrow.C: include <config.h>
3282 * src/lyxcursor.C: ditto.
3284 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3286 * lib/examples/decimal.lyx: new example file from Mike.
3288 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
3289 to find template definitions (from Dekel)
3291 * src/frontends/.cvsignore: add a few things.
3293 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
3295 * src/Timeout.C (TimeOut): remove default argument.
3297 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
3300 * src/insets/ExternalTemplate.C: add a "using" directive.
3302 * src/lyx_main.h: remove the act_ struct, which seems unused
3305 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
3307 * LyX Developers Meeting: All files changed, due to random C++ (by
3308 coincidence) code generator script.
3310 - external inset (cool!)
3311 - initial online editing of preferences
3312 - insettabular breaks insettext(s contents)
3314 - some DocBook fixes
3315 - example files update
3316 - other cool stuff, create a diff and look for yourself.
3318 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
3320 * src/insets/insettext.C (computeTextRows): if the maxWidth is
3321 -1 this is a non-line-breaking textinset.
3323 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
3324 if there is no width set.
3326 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
3328 * Lots of files: Merged the dialogbase branch.
3330 2000-06-09 Allan Rae <rae@lyx.org>
3332 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
3333 and the Dispatch methods that used it.
3335 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
3336 access to functions formerly kept in Dispatch.
3338 2000-05-19 Allan Rae <rae@lyx.org>
3340 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
3341 made to_page and count_copies integers again. from_page remains a
3342 string however because I want to allow entry of a print range like
3343 "1,4,22-25" using this field.
3345 * src/LyXAction.C: added action info and commands for buffer-print-xtl
3346 and printer-params-get. These aren't useful from the minibuffer but
3347 could be used by a script/LyXServer app provided it passes a suitable
3348 auto_mem_buffer. I guess I should take a look at how the LyXServer
3349 works and make it support xtl buffers.
3351 * sigc++/: updated to libsigc++-1.0.1
3353 * src/xtl/: updated to xtl-1.3.pl.11
3355 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
3356 those changes done to the files in src/ are actually recreated when
3357 they get regenerated. Please don't ever accept a patch that changes a
3358 dialog unless that patch includes the changes to the corresponding *.fd
3361 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
3362 stringOnlyContains, renamed it and generalised it.
3364 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
3365 branch. Removed the remaining old form_print code.
3367 2000-04-26 Allan Rae <rae@lyx.org>
3369 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
3370 trap I was trying to fix with the ID: fields in src/xtl/ :-)
3372 2000-04-25 Allan Rae <rae@lyx.org>
3374 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
3375 against a base of xtl-1.3.pl.4
3377 * development/tools/lxtl.sh: fixed a couple of silly typos and now
3378 filter the Id: entries so they still show the xtl version number
3381 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
3382 into the src/xtl code. Patch still pending with José (XTL)
3384 2000-04-24 Allan Rae <rae@lyx.org>
3386 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
3387 both more generic and much safer. Use the new template functions.
3388 * src/buffer.[Ch] (Dispatch): ditto.
3390 * src/frontends/xforms/FormPrint.C (update): Use new template functions
3391 and mem buffer more intelligently. Also a little general cleanup.
3394 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
3395 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
3396 * src/xtl/Makefile.am: ditto.
3397 * src/xtl/.cvsignore: ditto.
3398 * src/Makefile.am: ditto.
3400 * src/PrinterParams.h: Removed the macros member functions. Added a
3401 testInvariant member function. A bit of tidying up and commenting.
3402 Included Angus's idea for fixing operation with egcs-1.1.2.
3404 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
3405 cool expansion of XTL's mem_buffer to support automatic memory
3406 management within the buffer itself. Removed the various macros and
3407 replaced them with template functions that use either auto_mem_buffer
3408 or mem_buffer depending on a #define. The mem_buffer support will
3409 disappear as soon as the auto_mem_buffer is confirmed to be good on
3410 other platforms/compilers. That is, it's there so you've got something
3413 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
3414 effectively forked XTL. However I expect José will include my code
3415 into the next major release. Also fixed a memory leak.
3416 * src/xtl/text.h: ditto.
3417 * src/xtl/xdr.h: ditto.
3418 * src/xtl/giop.h: ditto.
3420 2000-04-16 Allan Rae <rae@lyx.org>
3422 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
3423 by autogen.sh and removed by maintainer-clean anyway.
3424 * .cvsignore, sigc++/.cvsignore: Support the above.
3426 * sigc++/.cvsignore: Forgot that retbind.h was generated.
3428 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
3430 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
3431 macros, renamed static callback-target member functions to suit new
3432 scheme and made them public.
3433 * src/frontends/xforms/forms/form_print.fd: ditto.
3434 * src/frontends/xforms/forms/form_copyright.fd: ditto.
3436 * src/support/lxtl.h: small cleanup to use typedef instead of #define
3439 * src/xtl/: New directory containing a minimal distribution of XTL.
3440 This is XTL-1.3.pl.4.
3442 * development/tools/lxtl.sh: A script to generate the above mini-dist.
3444 2000-04-15 Allan Rae <rae@lyx.org>
3446 * development/tools/makeLyXsigc.sh: Remove the library version numbers
3448 * sigc++/: Updated to libsigc++-1.0.0
3450 2000-04-14 Allan Rae <rae@lyx.org>
3452 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
3453 use the generic ones in future. I'll modify my conversion script.
3455 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
3457 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
3458 (CloseAllBufferRelatedDialogs): Renamed.
3459 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
3461 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
3462 of the generic ones. These are the same ones my conversion script
3465 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
3466 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
3467 * src/buffer.C (Dispatch): ditto
3469 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
3470 functions for updating and hiding buffer dependent dialogs.
3471 * src/BufferView.C (buffer): ditto
3472 * src/buffer.C (setReadonly): ditto
3473 * src/lyxfunc.C (CloseBuffer): ditto
3475 * src/buffer.h: Take setReadonly() out of line so I don't have to include
3476 Dialogs.h, and hence all the SigC stuff, into every file that includes
3477 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
3479 * src/BufferView2.C: reduce the number of headers included by buffer.h
3481 2000-04-11 Allan Rae <rae@lyx.org>
3483 * src/frontends/xforms/xform_macros.h: A small collection of macros
3484 for building C callbacks.
3486 * src/frontends/xforms/Makefile.am: Added above file.
3488 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
3489 scheme again. This time it should work for JMarc. If this is
3490 successful I'll revise my conversion script to automate some of this.
3491 The static member functions in the class also have to be public for
3492 this scheme will work. If the scheme works (it's almost identical to
3493 the way BufferView::cursorToggleCB is handled so it should work) then
3494 FormCopyright and FormPrint will be ready for inclusion into the main
3495 trunk immediately after 1.1.5 is released -- provided we're prepared
3496 for complaints about lame compilers not handling XTL.
3498 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
3500 2000-04-07 Allan Rae <rae@lyx.org>
3502 * config/lyxinclude.m4: A bit more tidying up (Angus)
3504 * src/LString.h: JMarc's <string> header fix
3506 * src/PrinterParams.h: Used string for most data to remove some
3507 ugly code in the Print dialog and avoid even uglier code when
3508 appending the ints to a string for output.
3510 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
3511 and moved "default:" back to the end of switch statement. Cleaned
3512 up the printing so it uses the right function calls and so the
3513 "print to file" option actually puts the file in the right directory.
3515 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
3517 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
3518 and Ok+Apply button control into a separate method: input (Angus).
3519 (input) Cleaned it up and improved it to be very thorough now.
3520 (All CB) static_cast used instead of C style cast (Angus). This will
3521 probably change again once we've worked out how to keep gcc-2.8.1 happy
3522 with real C callbacks.
3523 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
3524 ignore some of the bool settings and has random numbers instead. Needs
3525 some more investigation. Added other input length checks and checking
3526 of file and printer names.
3528 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
3529 would link (Angus). Seems the old code doesn't compile with the pragma
3530 statement either. Separated callback entries from internal methods.
3532 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
3534 2000-03-17 Allan Rae <rae@lyx.org>
3536 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
3537 need it? Maybe it could go in Dialogs instead? I could make it a
3538 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
3539 values to get the bool return value.
3540 (Dispatch): New overloaded method for xtl support.
3542 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
3543 extern "C" callback instead of static member functions. Hopefully,
3544 JMarc will be able to compile this. I haven't changed
3545 forms/form_copyright.fd yet. Breaking one of my own rules already.
3547 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
3548 because they aren't useful from the minibuffer. Maybe a LyXServer
3549 might want a help message though?
3551 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
3553 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
3554 xtl which needs both rtti and exceptions.
3556 * src/support/Makefile.am:
3557 * src/support/lxtl.h: New file. Some helper macros for using XTL.
3559 * src/frontends/xforms/input_validators.[ch]: input filters and
3560 validators. These conrol what keys are valid in input boxes.
3561 Use them and write some more. Much better idea than waiting till
3562 after the user has pressed Ok to say that the input fields don't make
3565 * src/frontends/xforms/Makefile.am:
3566 * src/frontends/xforms/forms/form_print.fd:
3567 * src/frontends/xforms/forms/makefile:
3568 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
3569 new scheme. Still have to make sure I haven't missed anything from
3570 the current implementation.
3572 * src/Makefile.am, src/PrinterParams.h: New data store.
3574 * other files: Added a couple of copyright notices.
3576 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3578 * src/insets/insetbib.h: move Holder struct in public space.
3580 * src/frontends/include/DialogBase.h: use SigC:: only when
3581 SIGC_CXX_NAMESPACES is defined.
3582 * src/frontends/include/Dialogs.h: ditto.
3584 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
3586 * src/frontends/xforms/FormCopyright.[Ch]: do not
3587 mention SigC:: explicitely.
3589 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3591 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
3592 deals with testing KDE in main configure.in
3593 * configure.in: ditto.
3595 2000-02-22 Allan Rae <rae@lyx.org>
3597 * Lots of files: Merged from HEAD
3599 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
3600 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
3602 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
3604 * sigc++/: new minidist.
3606 2000-02-14 Allan Rae <rae@lyx.org>
3608 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
3610 2000-02-08 Juergen Vigna <jug@sad.it>
3612 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
3613 file for the buildin GUI builder of KDevelop of the copyright-dialog.
3615 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
3616 for this port and so it is much easier for other people to port
3617 dialogs in a common development environment.
3619 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
3620 the QT/KDE implementation.
3622 * src/frontends/kde/Dialogs.C:
3623 * src/frontends/kde/FormCopyright.C:
3624 * src/frontends/kde/FormCopyright.h:
3625 * src/frontends/kde/Makefile.am:
3626 * src/frontends/kde/formcopyrightdialog.C:
3627 * src/frontends/kde/formcopyrightdialog.h:
3628 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
3629 for the kde support of the Copyright-Dialog.
3631 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3632 subdir-substitution instead of hardcoded 'xforms' as we now have also
3635 * src/frontends/include/DialogBase.h (Object): just commented the
3636 label after #endif (nasty warning and I don't like warnings ;)
3638 * src/main.C (main): added KApplication initialization if using
3641 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
3642 For now only the KDE event-loop is added if frontend==kde.
3644 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
3646 * configure.in: added support for the --with-frontend[=value] option
3648 * autogen.sh: added kde.m4 file to list of config-files
3650 * acconfig.h: added define for KDEGUI-support
3652 * config/kde.m4: added configuration functions for KDE-port
3654 * config/lyxinclude.m4: added --with-frontend[=value] option with
3655 support for xforms and KDE.
3657 2000-02-08 Allan Rae <rae@lyx.org>
3659 * all Makefile.am: Fixed up so the make targets dist, distclean,
3660 install and uninstall all work even if builddir != srcdir. Still
3661 have a new sigc++ minidist update to come.
3663 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
3665 2000-02-01 Allan Rae <rae@lyx.org>
3667 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
3668 Many mods to get builddir != srcdir working.
3670 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
3671 for building on NT and so we can do the builddir != srcdir stuff.
3673 2000-01-30 Allan Rae <rae@lyx.org>
3675 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
3676 This will stay in "rae" branch. We probably don't really need it in
3677 the main trunk as anyone who wants to help programming it should get
3678 a full library installed also. So they can check both included and
3679 system supplied library compilation.
3681 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
3682 Added a 'mini' distribution of libsigc++. If you feel the urge to
3683 change something in these directories - Resist it. If you can't
3684 resist the urge then you should modify the following script and rebuild
3685 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
3686 all happen. Still uses a hacked version of libsigc++'s configure.in.
3687 I'm quite happy with the results. I'm not sure the extra work to turn
3688 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
3689 worth the trouble and would probably lead to extra maintenance
3691 I haven't tested the following important make targets: install, dist.
3692 Not ready for prime time but very close. Maybe 1.1.5.
3694 * development/tools/makeLyXsigc.sh: A shell script to automatically
3695 generate our mini-dist of libsigc++. It can only be used with a CVS
3696 checkout of libsigc++ not a tarball distribution. It's well commented.
3697 This will end up as part of the libsigc++ distribution so other apps
3698 can easily have an included mini-dist. If someone makes mods to the
3699 sigc++ subpackage without modifying this script to generate those
3700 changes I'll be very upset!
3702 * src/frontends/: Started the gui/system indep structure.
3704 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
3705 to access the gui-indep dialogs are in this class. Much improved
3706 design compared to previous revision. Lars, please refrain from
3707 moving this header into src/ like you did with Popups.h last time.
3709 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
3711 * src/frontends/xforms/: Started the gui-indep system with a single
3712 dialog: FormCopyright. Initial testing of use of libsigc++ was very
3715 * src/frontends/xforms/forms: Repository for the xforms .fd files.
3716 Here you'll find a very useful makefile and automated fdfix.sh that
3717 makes updating dailogs a no-brainer -- provided you follow the rules
3718 set out in the README. I'm thinking about adding another script to
3719 automatically generate skeleton code for a new dialog given just the
3722 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
3723 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
3724 Made FormCopyright gui-indep and added a lyxfunc to get to it.
3726 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
3728 * src/support/LSubstring.C (operator): simplify
3730 * src/lyxtext.h: removed bparams, use buffer_->params instead
3732 * src/lyxrow.h: make Row a real class, move all variables to
3733 private and use accessors.
3735 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
3737 (isRightToLeftPar): ditto
3738 (ChangeLanguage): ditto
3739 (isMultiLingual): ditto
3742 (SimpleTeXOnePar): ditto
3743 (TeXEnvironment): ditto
3744 (GetEndLabel): ditto
3746 (SetOnlyLayout): ditto
3747 (BreakParagraph): ditto
3748 (BreakParagraphConservative): ditto
3749 (GetFontSettings): ditto
3751 (CopyIntoMinibuffer): ditto
3752 (CutIntoMinibuffer): ditto
3753 (PasteParagraph): ditto
3754 (SetPExtraType): ditto
3755 (UnsetPExtraType): ditto
3756 (DocBookContTableRows): ditto
3757 (SimpleDocBookOneTablePar): ditto
3759 (TeXFootnote): ditto
3760 (SimpleTeXOneTablePar): ditto
3761 (TeXContTableRows): ditto
3762 (SimpleTeXSpecialChars): ditto
3765 * src/lyxcursor.h: make LyXCursor a real class, move all variables
3766 to private and use accessors.
3768 * src/lyx_cb.C: remove char updatetimer, and all code that uses
3769 this, we did not use it anymore and has not been for ages. Just a
3770 waste of cpu cycles.
3772 * src/language.h: make Language a real class, move all variables
3773 to private and use accessors.
3775 * src/BufferView_pimpl.C (Pimpl): use new timer code.
3776 (create_view): remove
3777 (update): some changes for new timer
3778 (cursorToggle): use new timer
3779 (beforeChange): change for new timer
3781 * src/BufferView.h (cursorToggleCB): removed last paramter because
3784 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
3785 (cursorToggleCB): change because of new timer code
3787 * lib/CREDITS: updated own mailaddress
3789 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3791 * src/support/filetools.C (PutEnv): fix the code in case neither
3792 putenv() nor setenv() have been found.
3794 * INSTALL: mention the install-strip Makefile target.
3796 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
3797 read-only documents.
3799 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3801 * lib/reLyX/configure.in (VERSION): avoid using a previously
3802 generated reLyX wrapper to find out $prefix.
3804 * lib/examples/eu_adibide_lyx-atua.lyx:
3805 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
3806 translation of the Tutorial (Dooteo)
3808 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
3810 * forms/cite.fd: new citation dialog
3812 * src/insetcite.[Ch]: the new citation dialog is moved into
3815 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
3818 * src/insets/insetcommand.h: data members made private.
3820 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3822 * LyX 1.1.5 released
3824 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3826 * src/version.h (LYX_RELEASE): to 1.1.5
3828 * src/spellchecker.C (RunSpellChecker): return false if the
3829 spellchecker dies upon creation.
3831 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3833 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
3834 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
3838 * lib/CREDITS: update entry for Martin Vermeer.
3840 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
3842 * src/text.C (draw): Draw foreign language bars at the bottom of
3843 the row instead of at the baseline.
3845 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
3847 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3849 * lib/bind/de_menus.bind: updated
3851 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3853 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
3855 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3857 * src/menus.C (Limit_string_length): New function
3858 (ShowTocMenu): Limit the number of items/length of items in the
3861 * src/paragraph.C (String): Correct result for a paragraph inside
3864 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3866 * src/bufferlist.C (close): test of buf->getuser() == NULL
3868 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
3870 * src/BufferView2.C (removeAutoInsets): Fix a bug:
3871 Do not call to SetCursor when the paragraph is a closed footnote!
3873 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
3875 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
3878 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
3880 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3883 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
3884 reference popup, that activates the reference-back action
3886 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
3888 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
3889 the menus. Also fixed a bug.
3891 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
3892 the math panels when switching buffers (unless new buffer is readonly).
3894 * src/BufferView.C (NoSavedPositions)
3895 * src/BufferView_pimpl.C (NoSavedPositions): New methods
3897 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3899 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
3900 less of dvi dirty or not.
3902 * src/trans_mgr.[Ch] (insert): change first parameter to string
3905 * src/chset.[Ch] (encodeString): add const to first parameter
3907 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3909 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
3913 * src/LaTeX.C (deplog): better searching for dependency files in
3914 the latex log. Uses now regexps.
3916 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
3917 instead of the box hack or \hfill.
3919 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3921 * src/lyxfunc.C (doImportHelper): do not create the file before
3922 doing the actual import.
3923 (doImportASCIIasLines): create a new file before doing the insert.
3924 (doImportASCIIasParagraphs): ditto.
3926 * lib/lyxrc.example: remove mention of non-existing commands
3928 * lyx.man: remove mention of color-related switches.
3930 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
3932 * src/lyx_gui.C: remove all the color-related ressources, which
3933 are not used anymore.
3935 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
3938 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3940 * src/lyxrc.C (read): Add a missing break in the switch
3942 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
3944 * src/text2.C (InsertStringA): Fix a bug with insertion into table
3946 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
3949 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3951 * src/text.C (draw): draw bars under foreign language words.
3953 * src/LColor.[Ch]: add LColor::language
3955 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3957 * src/lyxcursor.h (boundary): New member variable
3959 * src/text.C (IsBoundary): New methods
3961 * src/text.C: Use the above for currect cursor movement when there
3962 is both RTL & LTR text.
3964 * src/text2.C: ditto
3966 * src/bufferview_funcs.C (ToggleAndShow): ditto
3968 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3970 * src/text.C (DeleteLineForward): set selection to true to avoid
3971 that DeleteEmptyParagraphMechanism does some magic. This is how it
3972 is done in all other functions, and seems reasonable.
3973 (DeleteWordForward): do not jump over non-word stuff, since
3974 CursorRightOneWord() already does it.
3976 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
3977 DeleteWordBackward, since they seem safe to me (since selection is
3978 set to "true") DeleteEmptyParagraphMechanism does nothing.
3980 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3982 * src/lyx_main.C (easyParse): simplify the code by factoring the
3983 part that removes parameters from the command line.
3984 (LyX): check wether wrong command line options have been given.
3986 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
3988 * src/lyx_main.C : add support for specifying user LyX
3989 directory via command line option -userdir.
3991 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
3993 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
3994 the number of items per popup.
3995 (Add_to_refs_menu): Ditto.
3997 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3999 * src/lyxparagraph.h: renamed ClearParagraph() to
4000 StripLeadingSpaces() and moved it to paragraph.C. We pass the
4001 textclass as parameter, and do nothing if free_spacing is
4002 true. This fixes part of the line-delete-forward problems.
4004 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
4005 (pasteSelection): ditto.
4006 (SwitchLayoutsBetweenClasses): more translatable strings.
4008 * src/text2.C (CutSelection): use StripLeadingSpaces.
4009 (PasteSelection): ditto.
4010 (DeleteEmptyParagraphMechanism): ditto.
4012 2000-05-26 Juergen Vigna <jug@sad.it>
4014 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
4015 is not needed in tabular insets.
4017 * src/insets/insettabular.C (TabularFeatures): added missing features.
4019 * src/tabular.C (DeleteColumn):
4021 (AppendRow): implemented this functions
4022 (cellsturct::operator=): clone the inset too;
4024 2000-05-23 Juergen Vigna <jug@sad.it>
4026 * src/insets/insettabular.C (LocalDispatch): better selection support
4027 when having multicolumn-cells.
4029 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4031 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
4033 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4035 * src/ColorHandler.C (getGCForeground): put more test into _()
4037 * lib/examples/eu_splash.lyx: new file (Basque translation) from
4040 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
4043 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
4045 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
4046 there are no labels, or when buffer is readonly.
4048 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
4049 there are no labels, buffer is SGML, or when buffer is readonly.
4051 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4053 * src/LColor.C (LColor): change a couple of grey40 to grey60
4054 (LColor): rewore initalization to make compiles go some magnitude
4056 (getGUIName): don't use gettext until we need the string.
4058 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
4060 * src/Bullet.[Ch]: Fixed a small bug.
4062 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
4064 * src/paragraph.C (String): Several fixes/improvements
4066 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
4068 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4070 * src/paragraph.C (String): give more correct output.
4072 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
4074 * src/lyxfont.C (stateText) Do not output the language if it is
4075 eqaul to the language of the document.
4077 * src/paragraph.C (TeXOnePar): Do not put language switch commands
4078 between two paragraphs with the same language.
4080 * src/paragraph.C (getParLanguage) Return a correct answer for an
4081 empty dummy paragraph.
4083 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
4086 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
4089 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
4090 the menus/popup, if requested fonts are unavailable.
4092 2000-05-22 Juergen Vigna <jug@sad.it>
4094 * src/insets/insettabular.C (LocalDispatch): added some more cursor
4095 movement support (Up/Down/Tab/Shift-Tab).
4096 (LocalDispatch): added also preliminari cursor-selection.
4098 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
4100 * src/paragraph.C (PasteParagraph): Hopefully now right!
4102 2000-05-22 Garst R. Reese <reese@isn.net>
4104 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
4105 of list, change all references to Environment to Command
4106 * tex/hollywood.cls : rewrite environments as commands, add
4107 \uppercase to interiorshot and exteriorshot to force uppecase.
4108 * tex/broadway.cls : rewrite environments as commands. Tweak
4111 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4113 * src/menus.C (Add_to_toc_menu): fix the code which limits the
4114 size of items: use a constant intead of the hardcoded 40, and more
4115 importantly do not remove the %m and %x tags added at the end.
4116 (Add_to_refs_menu): use vector::size_type instead of
4117 unsigned int as basic types for the variables. _Please_ do not
4118 assume that size_t is equal to unsigned int. On an alpha, this is
4119 unsigned long, which is _not_ the same.
4121 * src/language.C (initL): remove language "hungarian", since it
4122 seems that "magyar" is better.
4124 2000-05-22 Juergen Vigna <jug@sad.it>
4126 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
4128 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
4131 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
4132 next was deleted but not set to 0.
4134 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4136 * src/language.C (initL): change the initialization of languages
4137 so that compiles goes _fast_.
4139 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
4142 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
4144 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4148 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4150 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
4152 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
4156 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
4159 * src/insets/insetlo*.[Ch]: Made editable
4161 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4163 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
4164 the current selection.
4166 * src/BufferView_pimpl.C (stuffClipboard): new method
4168 * src/BufferView.C (stuffClipboard): new method
4170 * src/paragraph.C (String): new method
4172 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
4173 LColor::ignore when lyxname is not found.
4175 * src/BufferView.C (pasteSelection): new method
4177 * src/BufferView_pimpl.C (pasteSelection): new method
4179 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
4181 * src/WorkArea.C (request_clipboard_cb): new static function
4182 (getClipboard): new method
4183 (putClipboard): new method
4185 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4187 * LyX 1.1.5pre2 released
4189 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4191 * src/vspace.C (operator=): removed
4192 (operator=): removed
4194 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
4196 * src/layout.C (NumberOfClass): manually set the type in make_pair
4197 (NumberOfLayout): ditto
4199 * src/language.C: use the Language constructor for ignore_lang
4201 * src/language.h: add constructors to struct Language
4203 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
4205 * src/text2.C (SetCursorIntern): comment out #warning
4207 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
4209 * src/mathed/math_iter.h: initialize sx and sw to 0
4211 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4213 * forms/lyx.fd: Redesign of form_ref
4215 * src/LaTeXFeatures.[Ch]
4219 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
4222 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
4223 and Buffer::inset_iterator.
4225 * src/menus.C: Added new menus: TOC and Refs.
4227 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
4229 * src/buffer.C (getTocList): New method.
4231 * src/BufferView2.C (ChangeRefs): New method.
4233 * src/buffer.C (getLabelList): New method. It replaces the old
4234 getReferenceList. The return type is vector<string> instead of
4237 * src/insets/insetinclude.C (getLabelList): New method. Replaces
4238 the old getLabel() and GetNumberOfLabels() methods.
4239 * src/insets/insetlabel.C (getLabelList): ditto
4240 * src/mathed/formula.C (getLabelList): ditto
4242 * src/paragraph.C (String): New method.
4244 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
4245 Uses the new getTocList() method.
4246 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
4247 which automatically updates the contents of the browser.
4248 (RefUpdateCB): Use the new getLabelList method.
4250 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
4252 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
4254 * src/spellchecker.C: Added using std::reverse;
4256 2000-05-19 Juergen Vigna <jug@sad.it>
4258 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
4260 * src/insets/insettext.C (computeTextRows): small fix for display of
4261 1 character after a newline.
4263 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
4266 2000-05-18 Juergen Vigna <jug@sad.it>
4268 * src/insets/insettabular.C (TabularFeatures): fixed update of display
4269 when changing width of column.
4271 * src/tabular.C (set_row_column_number_info): setting of
4272 autobreak rows if necessary.
4274 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4276 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
4278 * src/vc-backend.*: renamed stat() to status() and vcstat to
4279 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
4280 compilation broke. The new name seems more relevant, anyway.
4282 2000-05-17 Juergen Vigna <jug@sad.it>
4284 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
4285 which was wrong if the removing caused removing of rows!
4287 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
4288 (pushToken): new function.
4290 * src/text2.C (CutSelection): fix problem discovered with purify
4292 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4294 * src/debug.C (showTags): enlarge the first column, now that we
4295 have 6-digits debug codes.
4297 * lib/layouts/hollywood.layout:
4298 * lib/tex/hollywood.cls:
4299 * lib/tex/brodway.cls:
4300 * lib/layouts/brodway.layout: more commands and fewer
4301 environments. Preambles moved in the .cls files. Broadway now has
4302 more options on scene numbering and less whitespace (from Garst)
4304 * src/insets/insetbib.C (getKeys): make sure that we are in the
4305 document directory, in case the bib file is there.
4307 * src/insets/insetbib.C (Latex): revert bogus change.
4309 2000-05-16 Juergen Vigna <jug@sad.it>
4311 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
4312 the TabularLayout on cursor move.
4314 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
4316 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
4319 (draw): fixed cursor position and drawing so that the cursor is
4320 visible when before the tabular-inset.
4322 * src/insets/insettext.C (init): drawLockedFrame was not initialized
4323 when creating from old insettext.
4325 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
4327 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4329 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
4330 * lib/tex/brodway.cls: ditto
4332 * lib/layouts/brodway.layout: change alignment of parenthical
4335 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4337 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
4338 versions 0.88 and 0.89 are supported.
4340 2000-05-15 Juergen Vigna <jug@sad.it>
4342 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
4345 * src/insets/insettext.C (computeTextRows): redone completely this
4346 function in a much cleaner way, because of problems when having a
4348 (draw): added a frame border when the inset is locked.
4349 (SetDrawLockedFrame): this sets if we draw the border or not.
4350 (SetFrameColor): this sets the frame color (default=insetframe).
4352 * src/insets/lyxinset.h: added x() and y() functions which return
4353 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
4354 function which is needed to see if we have a locking inset of some
4355 type in this inset (needed for now in insettabular).
4357 * src/vspace.C (inPixels): the same function also without a BufferView
4358 parameter as so it is easier to use it in some ocasions.
4360 * src/lyxfunc.C: changed all places where insertInset was used so
4361 that now if it couldn't be inserted it is deleted!
4363 * src/TabularLayout.C:
4364 * src/TableLayout.C: added support for new tabular-inset!
4366 * src/BufferView2.C (insertInset): this now returns a bool if the
4367 inset was really inserted!!!
4369 * src/tabular.C (GetLastCellInRow):
4370 (GetFirstCellInRow): new helper functions.
4371 (Latex): implemented for new tabular class.
4375 (TeXTopHLine): new Latex() helper functions.
4377 2000-05-12 Juergen Vigna <jug@sad.it>
4379 * src/mathed/formulamacro.C (Read):
4380 * src/mathed/formula.C (Read): read also the \end_inset here!
4382 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4384 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
4385 crush when saving formulae with unbalanced parenthesis.
4387 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
4389 * src/layout.C: Add new keyword "endlabelstring" to layout file
4391 * src/text.C (GetVisibleRow): Draw endlabel string.
4393 * lib/layouts/broadway.layout
4394 * lib/layouts/hollywood.layout: Added endlabel for the
4395 Parenthetical layout.
4397 * lib/layouts/heb-article.layout: Do not use slanted font shape
4398 for Theorem like environments.
4400 * src/buffer.C (makeLaTeXFile): Always add "american" to
4401 the UsedLanguages list if document language is RTL.
4403 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4405 * add addendum to README.OS2 and small patch (from SMiyata)
4407 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4409 * many files: correct the calls to ChangeExtension().
4411 * src/support/filetools.C (ChangeExtension): remove the no_path
4412 argument, which does not belong there. Use OnlyFileName() instead.
4414 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
4415 files when LaTeXing a non-nice latex file.
4417 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
4418 a chain of "if". Return false when deadkeys are not handled.
4420 * src/lyx_main.C (LyX): adapted the code for default bindings.
4422 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
4423 bindings for basic functionality (except deadkeys).
4424 (deadKeyBindings): new method. Performs the bindings of deadkeys.
4426 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
4427 several methods: handle override_x_deadkeys.
4429 * src/lyxrc.h: remove the "bindings" map, which did not make much
4430 sense anyway. New variable override_x_deadkeys, defaulting to "true".
4432 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4434 * src/lyxfont.C (stateText): use a saner method to determine
4435 whether the font is "default". Seems to fix the crash with DEC
4438 * src/Bullet.[Ch] (Bullet): remove const on parameters.
4440 2000-05-08 Juergen Vigna <jug@sad.it>
4442 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
4443 TabularLayoutMenu with mouse-button-3
4444 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
4446 * src/TabularLayout.C: added this file for having a Layout for
4449 2000-05-05 Juergen Vigna <jug@sad.it>
4451 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
4452 recalculating inset-widths.
4453 (TabularFeatures): activated this function so that I can change
4454 tabular-features via menu.
4456 * src/menus.C (ShowEditMenu): inserted support for insettabular so
4457 that I can test some functions with the Table menu.
4459 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4461 * src/lyxfont.C (stateText): guard against stupid c++libs.
4463 * src/tabular.C: add using std::vector
4464 some whitespace changes, + removed som autogenerated code.
4466 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
4468 2000-05-05 Juergen Vigna <jug@sad.it>
4470 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
4471 row, columns and cellstructures.
4473 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4475 * lib/lyxrc.example: remove obsolete entries.
4477 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
4478 reading of protected_separator for free_spacing.
4480 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4482 * src/text.C (draw): do not display an exclamation mark in the
4483 margin for margin notes. This is confusing, ugly and
4486 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
4487 AMS math' is checked.
4489 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
4490 name to see whether including the amsmath package is needed.
4492 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
4494 * src/paragraph.C (validate): Compute UsedLanguages correctly
4495 (don't insert the american language if it doesn't appear in the
4498 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
4499 The argument of \thanks{} command is considered moving argument
4501 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
4504 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
4506 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
4507 for appendix/minipage/depth. The lines can be now both in the footnote
4508 frame, and outside the frame.
4510 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
4513 2000-05-05 Juergen Vigna <jug@sad.it>
4515 * src/table.[Ch]: removed the inset and buffer stuff as this is now
4516 neede only in tabular.[Ch].
4518 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4520 * src/insets/insetspecialchar.C (Read): allow command == '~' for
4522 (Write): write '~' for PROTECTED_SEPARATOR
4524 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4526 * src/lyxparagraph.h: add a friend struct matchIT after the struct
4529 * src/mathed/formula.C (drawStr): rename size to siz.
4531 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
4532 possibly fix a bug by not changing the pflags = flags to piflags =
4535 2000-05-05 Juergen Vigna <jug@sad.it>
4537 * src/insets/insetbib.C: moved using directive
4539 * src/ImportNoweb.C: small fix for being able to compile (missing
4542 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4544 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
4545 to use clear, since we don't depend on this in the code. Add test
4548 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4550 * (various *.C files): add using std::foo directives to please dec
4553 * replace calls to string::clear() to string::erase() (Angus)
4555 * src/cheaders/cmath: modified to provide std::abs.
4557 2000-05-04 Juergen Vigna <jug@sad.it>
4559 * src/insets/insettext.C: Prepared all for inserting of multiple
4560 paragraphs. Still display stuff to do (alignment and other things),
4561 but I would like to use LyXText to do this when we cleaned out the
4562 table-support stuff.
4564 * src/insets/insettabular.C: Changed lot of stuff and added lots
4565 of functionality still a lot to do.
4567 * src/tabular.C: Various functions changed name and moved to be
4568 const functions. Added new Read and Write functions and changed
4569 lots of things so it works good with tabular-insets (also removed
4570 some stuff which is not needed anymore * hacks *).
4572 * src/lyxcursor.h: added operators == and != which just look if
4573 par and pos are (not) equal.
4575 * src/buffer.C (latexParagraphs): inserted this function to latex
4576 all paragraphs form par to endpar as then I can use this too for
4579 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
4580 so that I can call this to from text insets with their own cursor.
4582 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
4583 output off all paragraphs (because of the fix below)!
4585 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
4586 the very last paragraph (this could be also the last paragraph of an
4589 * src/texrow.h: added rows() call which returns the count-variable.
4591 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4593 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
4595 * lib/configure.m4: better autodetection of DocBook tools.
4597 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4599 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
4601 * src/lyx_cb.C: add using std::reverse;
4603 * src/LaTeX.C (run): on error always run deleteFilesOnError before
4606 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
4607 selected files. Should fix repeated errors from generated files.
4609 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
4611 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
4613 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
4614 the spellchecker popup.
4616 * lib/lyxrc.example: Removed the \number_inset section
4618 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4620 * src/insets/figinset.C (various): Use IsFileReadable() to make
4621 sure that the file actually exist. Relying on ghostscripts errors
4622 is a bad idea since they can lead to X server crashes.
4624 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
4626 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
4629 * lib/lyxrc.example: smallish typo in description of
4630 \view_dvi_paper_option
4632 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4635 * src/lyxfunc.C: doImportHelper to factor out common code of the
4636 various import methods. New functions doImportASCIIasLines,
4637 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
4638 doImportLinuxDoc for the format specific parts.
4641 * buffer.C: Dispatch returns now a bool to indicate success
4644 * lyx_gui.C: Add getLyXView() for member access
4646 * lyx_main.C: Change logic for batch commands: First try
4647 Buffer::Dispatch (possibly without GUI), if that fails, use
4650 * lyx_main.C: Add support for --import command line switch.
4651 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
4652 Available Formats: Everything accepted by 'buffer-import <format>'
4654 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4656 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
4659 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
4660 documents will be reformatted upon reentry.
4662 2000-04-27 Juergen Vigna <jug@sad.it>
4664 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
4665 correctly only last pos this was a bug.
4667 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4669 * release of lyx-1.1.5pre1
4671 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4673 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
4675 * src/menus.C: revert the change of naming (Figure->Graphic...)
4676 from 2000-04-11. It was incomplete and bad.
4678 * src/LColor.[Ch]: add LColor::depthbar.
4679 * src/text.C (GetVisibleRow): use it.
4681 * README: update the languages list.
4683 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4685 * src/text.C (GetVisibleRow): show the depth of paragraphs using
4688 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4690 * README: remove sections that were just wrong.
4692 * src/text2.C (GetRowNearY): remove currentrow code
4694 * src/text.C (GetRow): remove currentrow code
4696 * src/screen.C (Update): rewritten a bit.
4697 (SmallUpdate): removed func
4699 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
4701 (FullRebreak): return bool
4702 (currentrow): remove var
4703 (currentrow_y): ditto
4705 * src/lyxscreen.h (Draw): change arg to unsigned long
4706 (FitCursor): return bool
4707 (FitManualCursor): ditto
4708 (Smallpdate): remove func
4709 (first): change to unsigned long
4710 (DrawOneRow): change second arg to long (from long &)
4711 (screen_refresh_y): remove var
4712 (scree_refresh_row): ditto
4714 * src/lyxrow.h: change baseline to usigned int from unsigned
4715 short, this brings some implicit/unsigned issues out in the open.
4717 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
4719 (Dispatch): don't call updateScrollbar after fitCursor. Use update
4720 instead of smallUpdate.
4722 * src/lyxcursor.h: change y to unsigned long
4724 * src/buffer.h: don't call updateScrollbar after fitcursor
4726 * src/buffer.C (parseSingleLyXformat2Token): move variables to
4727 where they are used. Removed "\\direction", this was not present
4728 in 1.1.4 and is already obsolete. Commented out some code that I
4729 believe to never be called.
4730 (runLiterate): don't call updateScrollbar after fitCursor
4732 (buildProgram): ditto
4735 * src/WorkArea.h (workWidth): change return val to unsigned
4738 (redraw): remove the button redraws
4739 (setScrollbarValue): change for scrollbar
4740 (getScrollbarValue): change for scrollbar
4741 (getScrollbarBounds): change for scrollbar
4743 * src/WorkArea.C (C_WorkArea_up_cb): removed func
4744 (C_WorkArea_down_cb): removed func
4745 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
4746 (resize): change for scrollbar
4747 (setScrollbar): ditto
4748 (setScrollbarBounds): ditto
4749 (setScrollbarIncrements): ditto
4750 (up_cb): removed func
4751 (down_cb): removed func
4752 (scroll_cb): change for scrollbar
4753 (work_area_handler): ditto
4755 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
4756 when FitCursor did something.
4757 (updateScrollbar): some unsigned changes
4758 (downCB): removed func
4759 (scrollUpOnePage): removed func
4760 (scrollDownOnePage): remvoed func
4761 (workAreaMotionNotify): don't call screen->FitCursor but use
4762 fitCursor instead. and bool return val
4763 (workAreaButtonPress): ditto
4764 (workAreaButtonRelease): some unsigned changes
4765 (checkInsetHit): ditto
4766 (workAreaExpose): ditto
4767 (update): parts rewritten, comments about the signed char arg added
4768 (smallUpdate): removed func
4769 (cursorPrevious): call needed updateScrollbar
4772 * src/BufferView2.C (allFloats): don't call updateScrollbar after
4775 * src/BufferView.[Ch] (upCB): removed func
4776 (downCB): removed func
4777 (smallUpdate): removed func
4779 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4781 * src/lyxtext.h src/text.C src/text2.C: removed support for the
4782 currentrow, currentrow_y optimization. This did not help a lot and
4783 if we want to do this kind of optimization we should rather use
4784 cursor.row instead of the currentrow.
4786 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
4787 buffer spacing and klyx spacing support.
4789 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4791 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
4794 2000-04-26 Juergen Vigna <jug@sad.it>
4796 * src/insets/figinset.C: fixes to Lars sstream changes!
4798 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
4800 * A lot of files: Added Ascii(ostream &) methods to all inset
4801 classes. Used when exporting to ASCII.
4803 * src/buffer.C (writeFileAscii,RoffAsciiTable)
4804 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
4807 * src/text2.C (ToggleFree): Disabled implicit word selection when
4808 there is a change in the language
4810 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
4811 no output was generated for end-of-sentence inset.
4813 * src/insets/lyxinset.h
4816 * src/paragraph.C: Removed the insetnumber code
4818 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
4820 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4822 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
4823 no_babel and no_epsfig completely from the file.
4824 (parseSingleLyXformat2Token): add handling for per-paragraph
4825 spacing as written by klyx.
4827 * src/insets/figinset.C: applied patch by Andre. Made it work with
4830 2000-04-20 Juergen Vigna <jug@sad.it>
4832 * src/insets/insettext.C (cutSelection):
4833 (copySelection): Fixed with selection from right to left.
4834 (draw): now the rows are not recalculated at every draw.
4835 (computeTextRows): for now reset the inset-owner here (this is
4836 important for an undo or copy where the inset-owner is not set
4839 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
4840 motion to the_locking_inset screen->first was forgotten, this was
4841 not important till we got multiline insets.
4843 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4845 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
4846 code seems to be alright (it is code changed by Dekel, and the
4847 intent is indeed that all macros should be defined \protect'ed)
4849 * NEWS: a bit of reorganisation of the new user-visible features.
4851 2000-04-19 Juergen Vigna <jug@sad.it>
4853 * src/insets/insettext.C (init): using a LyXCursor now for cursor
4854 position. Set the inset_owner of the used paragraph so that it knows
4855 that it is inside an inset. Fixed cursor handling with mouse and
4856 cursor keys. Fixed wrong timed inset redraws and lots of other changes
4857 and cleanups to make TextInsets work better.
4859 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
4860 Changed parameters of various functions and added LockInsetInInset().
4862 * src/insets/insettext.C:
4864 * src/insets/insetcollapsable.h:
4865 * src/insets/insetcollapsable.C:
4866 * src/insets/insetfoot.h:
4867 * src/insets/insetfoot.C:
4868 * src/insets/insetert.h:
4869 * src/insets/insetert.C: cleaned up the code so that it works now
4870 correctly with insettext.
4872 * src/insets/inset.C:
4873 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
4874 that insets in insets are supported right.
4877 * src/table.C: lots of changes for use with inset tabular (and cleanup)
4879 * src/paragraph.C: some small fixes
4881 * src/debug.h: inserted INSETS debug info
4883 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
4884 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
4886 * src/commandtags.h:
4887 * src/LyXAction.C: insert code for InsetTabular.
4889 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
4890 not Button1MotionMask.
4891 (workAreaButtonRelease): send always a InsetButtonRelease event to
4893 (checkInsetHit): some setCursor fixes (always with insets).
4895 * src/BufferView2.C (lockInset): returns a bool now and extended for
4896 locking insets inside insets.
4897 (showLockedInsetCursor): it is important to have the cursor always
4898 before the locked inset.
4899 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
4901 * src/BufferView.h: made lockInset return a bool.
4903 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
4905 * src/text2.C (SetCursor): This now has a version with a LyXCursor
4906 that is used also internally but can be called as public to have back
4907 a cursor pos which is not set internally.
4908 (SetCursorIntern): Changed to use above function.
4910 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
4912 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4917 * NEWS: updated for prerelease of 1.1.5. Please comment and send
4918 patches for things that should be in or should be changed.
4920 * src/* [insetfiles]: change "usigned char fragile" to bool
4921 fragile. There was only one point that could that be questioned
4922 and that is commented in formulamacro.C. Grep for "CHECK".
4924 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
4925 (DeleteBuffer): take it out of CutAndPaste and make it static.
4927 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4929 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
4930 output the spacing envir commands. Also the new commands used in
4931 the LaTeX output makes the result better.
4933 * src/Spacing.C (writeEnvirBegin): new method
4934 (writeEnvirEnd): new method
4936 2000-04-18 Juergen Vigna <jug@sad.it>
4938 * src/CutAndPaste.C: made textclass a static member of the class
4939 as otherwise it is not accesed right!!!
4941 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
4943 * forms/layout_forms.fd
4944 * src/layout_forms.h
4945 * src/layout_forms.C (create_form_form_character)
4946 * src/lyx_cb.C (UserFreeFont)
4947 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
4948 documents (in the layout->character popup).
4950 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4952 * src/spellchecker.C (create_ispell_pipe): fix a bug where
4953 \spell_command was in fact not honored (from Kevin Atkinson).
4955 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
4958 * src/lyx_gui.h: make lyxViews private (Angus)
4960 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
4962 * src/mathed/math_write.C
4963 (MathMatrixInset::Write) Put \protect before \begin{array} and
4964 \end{array} if fragile
4965 (MathParInset::Write): Put \protect before \\ if fragile
4967 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4969 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
4970 initialization if the LyXColorHandler must be done after the
4971 connections to the XServer has been established.
4973 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
4974 get the background pixel from the lyxColorhandler so that the
4975 figures are rendered with the correct background color.
4976 (NextToken): removed functions.
4977 (GetPSSizes): use ifs >> string instead of NextToken.
4979 * src/Painter.[Ch]: the color cache moved out of this file.
4981 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
4984 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4986 * src/WorkArea.C (work_area_handler): call BufferView::enterView
4987 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
4989 * src/BufferView.C (enterView): new func
4990 (leaveView): new func
4992 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
4994 (leaveView): new func, undefines xterm cursor when approp.
4996 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
4997 (AllowInput): delete the Workarea cursor handling from this func.
4999 * src/Painter.C (underline): draw a slimer underline in most cases.
5001 * src/lyx_main.C (error_handler): use extern "C"
5003 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5005 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
5006 sent directly to me.
5008 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
5009 to the list by Dekel.
5011 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
5014 * src/bufferview_funcs.[Ch]: two new files, moved several of the
5015 methods from lyx_cb.here.
5017 * src/lyx_cb.C: in addition to the above; removed input_prohibited
5020 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5022 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
5023 instead of using current_view directly.
5025 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
5027 * src/LyXAction.C (init): add the paragraph-spacing command.
5029 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
5031 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
5033 * src/lyx_cb.C (CurrentState): output a string when the spacing is
5034 different from the documents.
5036 * src/text.C (SetHeightOfRow): take paragraph spacing into
5037 account, paragraph spacing takes precedence over buffer spacing
5038 (GetVisibleRow): ditto
5040 * src/paragraph.C (writeFile): output the spacing parameter too.
5041 (validate): set the correct features if spacing is used in the
5043 (Clear): set spacing to default
5044 (MakeSameLayout): spacing too
5045 (HasSameLayout): spacing too
5046 (SetLayout): spacing too
5047 (TeXOnePar): output the spacing commands
5049 * src/lyxparagraph.h: added a spacing variable for use with
5050 per-paragraph spacing.
5052 * src/Spacing.h: add a Default spacing and a method to check if
5053 the current spacing is default. also added an operator==
5055 * src/text2.C (DeleteEmptyParagraphMechanism): added a
5058 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5060 * src/lyxserver.C (callback): fix dispatch of functions
5062 * src/insets/insetlatexaccent.C (checkContents): turn bogus
5063 printf() into lyxerr call.
5065 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
5068 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
5069 "Table" to "Table Box", "Float" to "Floating Material"; deletes
5070 the "Float" from each of the subitems.
5071 (ShowHelpMenu): add entry for "FAQ" and "TOC".
5073 * src/support/DebugStream.h: add an #ifdef to work around a gcc
5074 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
5075 documented the change so that the workaround can be nuked later.
5077 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
5080 * src/lyxlex_pimpl.C (next): do not re-declare the default value
5082 * src/buffer.C (getLatexName): ditto
5083 (setReadonly): ditto
5085 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5087 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
5088 avoid some uses of current_view. Added also a bufferParams()
5089 method to get at this.
5091 * src/lyxtext.h: changed params->buffer and paramters->bparams.
5093 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5095 * src/lyxparagraph.[Ch]: removed
5096 operator<(LyXParagraph::InsetTable..., added a struct matchIT
5097 with operators used by lower_bound and
5098 upper_bound in InsetTable's
5099 Make struct InsetTable private again. Used matchpos.
5101 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
5103 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
5104 document, the language of existing text is changed (unless the
5105 document is multi-lingual)
5107 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
5109 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
5111 * A lot of files: A rewrite of the Right-to-Left support.
5113 2000-04-10 Juergen Vigna <jug@sad.it>
5115 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
5116 misplaced cursor when inset in inset is locked.
5118 * src/insets/insettext.C (LocalDispatch): small fix so that a
5119 BREAKLINE is not inserted if we don't permit it with autBreakRows.
5121 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
5122 footnote font should be decreased in size twice when displaying.
5124 * src/insets/insettext.C (GetDrawFont): inserted this function as
5125 the drawing-font may differ from the real paragraph font.
5127 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
5128 insets (inset in inset!).
5130 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
5131 function here because we don't want footnotes inside footnotes.
5133 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
5135 (init): now set the inset_owner in paragraph.C
5136 (LocalDispatch): added some resetPos() in the right position
5139 (pasteSelection): changed to use the new CutAndPaste-Class.
5141 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
5142 which tells if it is allowed to insert another inset inside this one.
5144 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
5145 SwitchLayoutsBetweenClasses.
5147 * src/text2.C (InsertInset): checking of the new paragraph-function
5149 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
5150 is not needed anymore here!
5153 (PasteSelection): redone (also with #ifdef) so that now this uses
5154 the CutAndPaste-Class.
5155 (SwitchLayoutsBetweenClasses): removed here and implemented in the
5158 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
5159 from/to text/insets.
5161 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
5162 so that the paragraph knows if it is inside an (text)-inset.
5163 (InsertFromMinibuffer): changed return-value to bool as now it
5164 may happen that an inset is not inserted in the paragraph.
5165 (InsertInsetAllowed): this checks if it is allowed to insert an
5166 inset in this paragraph.
5168 (BreakParagraphConservative):
5169 (BreakParagraph) : small change for the above change of the return
5170 value of InsertFromMinibuffer.
5172 * src/lyxparagraph.h: added inset_owner and the functions to handle
5173 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
5175 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5177 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
5178 functions from BufferView to BufferView::Pimpl to ease maintence.
5180 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
5181 correctly. Also use SetCursorIntern instead of SetCursor.
5183 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
5186 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5188 * src/WorkArea.C (belowMouse): manually implement below mouse.
5190 * src/*: Add "explicit" on several constructors, I added probably
5191 some unneeded ones. A couple of changes to code because of this.
5193 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
5194 implementation and private parts from the users of BufferView. Not
5197 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
5198 implementation and private parts from the users of LyXLex. Not
5201 * src/BufferView_pimpl.[Ch]: new files
5203 * src/lyxlex_pimpl.[Ch]: new files
5205 * src/LyXView.[Ch]: some inline functions move out-of-line
5207 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5209 * src/lyxparagraph.h: make struct InsetTable public.
5211 * src/support/lyxstring.h: change lyxstring::difference_type to be
5212 ptrdiff_t. Add std:: modifiers to streams.
5214 * src/font.C: include the <cctype> header, for islower() and
5217 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5219 * src/font.[Ch]: new files. Contains the metric functions for
5220 fonts, takes a LyXFont as parameter. Better separation of concepts.
5222 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
5223 changes because of this.
5225 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
5227 * src/*: compile with -Winline and move functions that don't
5230 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
5233 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5235 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
5236 (various files changed because of this)
5238 * src/Painter.C (text): fixed the drawing of smallcaps.
5240 * src/lyxfont.[Ch] (drawText): removed unused member func.
5243 * src/*.C: added needed "using" statements and "std::" qualifiers.
5245 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5247 * src/*.h: removed all use of "using" from header files use
5248 qualifier std:: instead.
5250 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5252 * src/text.C (Backspace): some additional cleanups (we already
5253 know whether cursor.pos is 0 or not).
5255 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
5256 automake does not provide one).
5258 * src/bmtable.h: replace C++ comments with C comments.
5260 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
5262 * src/screen.C (ShowCursor): Change the shape of the cursor if
5263 the current language is not equal to the language of the document.
5264 (If the cursor change its shape unexpectedly, then you've found a bug)
5266 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
5269 * src/insets/insetnumber.[Ch]: New files.
5271 * src/LyXAction.C (init)
5272 * src/lyxfunc.C (dispatch): Add command number-inset-insert
5275 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
5277 * src/lyxparagraph.h
5278 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
5279 (the vector is kept sorted).
5281 * src/text.C (GetVisibleRow): Draw selection correctly when there
5282 is both LTR and RTL text.
5284 * src/paragraph.C (Clone): Use the assignment operator for cloning,
5285 which is much faster.
5287 * src/text.C (GetVisibleRow and other): Do not draw the last space
5288 in a row if the direction of the last letter is not equal to the
5289 direction of the paragraph.
5291 * src/lyxfont.C (latexWriteStartChanges):
5292 Check that font language is not equal to basefont language.
5293 (latexWriteEndChanges): ditto
5295 * src/lyx_cb.C (StyleReset): Don't change the language while using
5296 the font-default command.
5298 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
5299 empty paragraph before a footnote.
5301 * src/insets/insetcommand.C (draw): Increase x correctly.
5303 * src/screen.C (ShowCursor): Change cursor shape if
5304 current language != document language.
5306 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
5308 2000-03-31 Juergen Vigna <jug@sad.it>
5310 * src/paragraph.C (GetInset): commented out text[pos] = ' '
5311 (Clone): changed mode how the paragraph-data is copied to the
5312 new clone-paragraph.
5314 * src/lyxfunc.C (Dispatch): fixed small problem when calling
5315 GetInset(pos) with no inset anymore there (in inset UNDO)
5317 * src/insets/insetcommand.C (draw): small fix as here x is
5318 incremented not as much as width() returns (2 before, 2 behind = 4)
5320 2000-03-30 Juergen Vigna <jug@sad.it>
5322 * src/insets/insettext.C (InsetText): small fix in initialize
5323 widthOffset (should not be done in the init() function)
5325 2000-03-29 Amir Karger <karger@lyx.org>
5327 * lib/examples/it_ItemizeBullets.lyx: translation by
5330 * Implemented \textasciitilde and fixed a tiny bug in reLyX
5332 2000-03-29 Juergen Vigna <jug@sad.it>
5334 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
5336 * src/insets/insetfoot.C (Clone): small change as for the below
5337 new init function in the text-inset
5339 * src/insets/insettext.C (init): new function as I've seen that
5340 clone did not copy the Paragraph-Data!
5341 (LocalDispatch): Added code so that now we have some sort of Undo
5342 functionality (well actually we HAVE Undo ;)
5344 * src/text.C (Backspace): Small fix for the a | a Backspace problem
5346 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
5348 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
5351 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5353 * src/main.C: added a runtime check that verifies that the xforms
5354 header used when building LyX and the library used when running
5355 LyX match. Exit with a message if they don't match. This is a
5356 version number check only.
5358 * src/buffer.C (save): Don't allocate memory on the heap for
5359 struct utimbuf times.
5361 * *: some using changes, use iosfwd instead of the real headers.
5363 * src/lyxfont.C use char const * instead of string for the static
5364 strings. Rewrite some functions to use sstream.
5366 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5368 * src/text.C (Backspace): hopefully fix the dreaded backaspace
5371 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5373 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
5374 of Geodesy (from Martin Vermeer)
5376 * lib/layouts/svjour.inc: include file for the Springer svjour
5377 class. It can be used to support journals other than JoG.
5379 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
5380 Miskiewicz <misiek@pld.org.pl>)
5381 * lib/reLyX/Makefile.am: ditto.
5383 2000-03-27 Juergen Vigna <jug@sad.it>
5385 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
5386 also some modifications with operations on selected text.
5388 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
5389 problems with clicking on insets (last famous words ;)
5391 * src/insets/insetcommand.C (draw):
5392 (width): Changed to have a bit of space before and after the inset so
5393 that the blinking cursor can be seen (otherwise it was hidden)
5395 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5397 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
5398 would not be added to the link list when an installed gettext (not
5399 part of libc) is found.
5401 2000-03-24 Juergen Vigna <jug@sad.it>
5403 * src/insets/insetcollapsable.C (Edit):
5404 * src/mathed/formula.C (InsetButtonRelease):
5405 (InsetButtonPress): fixed for new handling of ButtonPress/Release
5408 * src/BufferView.C (workAreaButtonPress):
5409 (workAreaButtonRelease):
5410 (checkInsetHit): Finally fixed the clicking on insets be handled
5413 * src/insets/insetert.C (Edit): inserted this call so that ERT
5414 insets work always with LaTeX-font
5416 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5418 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
5419 caused lyx to startup with no GUI in place, causing in a crash
5420 upon startup when called with arguments.
5422 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5424 * src/FontLoader.C: better initialization of dummyXFontStruct.
5426 2000-03-20 José Abílio Matos <jamatos@lyx.org>
5428 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
5429 for linuxdoc and docbook import and export format options.
5431 * lib/lyxrc.example Example of default values for the previous flags.
5433 * src/lyx_cb.C Use those flags instead of the hardwired values for
5434 linuxdoc and docbook export.
5436 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
5439 * src/menus.C Added menus entries for the new import/exports formats.
5441 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5443 * src/lyxrc.*: Added support for running without Gui
5446 * src/FontLoader.C: sensible defaults if no fonts are needed
5448 * src/lyx_cb.C: New function ShowMessage (writes either to the
5449 minibuffer or cout in case of no gui
5450 New function AskOverwrite for common stuff
5451 Consequently various changes to call these functions
5453 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
5454 wild guess at sensible screen resolution when having no gui
5456 * src/lyxfont.C: no gui, no fonts... set some defaults
5458 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5460 * src/LColor.C: made the command inset background a bit lighter.
5462 2000-03-20 Hartmut Goebel <goebel@noris.net>
5464 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
5465 stdstruct.inc. Koma-Script added some title elements which
5466 otherwise have been listed below "bibliography". This split allows
5467 adding title elements to where they belong.
5469 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
5470 define the additional tilte elements and then include
5473 * many other layout files: changed to include stdtitle.inc just
5474 before stdstruct.inc.
5476 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
5478 * src/buffer.C: (save) Added the option to store all backup files
5479 in a single directory
5481 * src/lyxrc.[Ch]: Added variable \backupdir_path
5483 * lib/lyxrc.example: Added descriptions of recently added variables
5485 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
5486 bibtex inset, not closing the bibtex popup when deleting the inset)
5488 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5490 * src/lyx_cb.C: add a couple using directives.
5492 2000-03-17 José Abílio Matos <jamatos@lyx.org>
5493 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
5494 import based on the filename.
5496 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
5497 file would be imported at start, if the filename where of a sgml file.
5499 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
5501 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
5503 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
5504 * src/lyxfont.h Replaced the member variable bits.direction by the
5505 member variable lang. Made many changes in other files.
5506 This allows having a multi-lingual document
5508 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
5509 that change the current language to <l>.
5510 Removed the command "font-rtl"
5512 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
5513 format for Hebrew documents)
5515 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
5516 When auto_mathmode is "true", pressing a digit key in normal mode
5517 will cause entering into mathmode.
5518 If auto_mathmode is "rtl" then this behavior will be active only
5519 when writing right-to-left text.
5521 * src/text2.C (InsertStringA) The string is inserted using the
5524 * src/paragraph.C (GetEndLabel) Gives a correct result for
5525 footnote paragraphs.
5527 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
5529 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5531 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
5532 front of PasteParagraph. Never insert a ' '. This should at least
5533 fix some cause for the segfaults that we have been experiencing,
5534 it also fixes backspace behaviour slightly. (Phu!)
5536 * src/support/lstrings.C (compare_no_case): some change to make it
5537 compile with gcc 2.95.2 and stdlibc++-v3
5539 * src/text2.C (MeltFootnoteEnvironment): change type o
5540 first_footnote_par_is_not_empty to bool.
5542 * src/lyxparagraph.h: make text private. Changes in other files
5544 (fitToSize): new function
5545 (setContentsFromPar): new function
5546 (clearContents): new function
5547 (SetChar): new function
5549 * src/paragraph.C (readSimpleWholeFile): deleted.
5551 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
5552 the file, just use a simple string instead. Also read the file in
5553 a more maintainable manner.
5555 * src/text2.C (InsertStringA): deleted.
5556 (InsertStringB): deleted.
5558 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5560 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
5561 RedoParagraphs from the doublespace handling part, just set status
5562 to NEED_MORE_REFRESH. Also don't update cursor position (should be
5563 done, but perhaps not like this.)
5565 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5567 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
5568 character when inserting an inset.
5570 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5572 * src/bufferparams.C (readLanguage): now takes "default" into
5575 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
5576 also initialize the toplevel_keymap with the default bindings from
5579 * src/buffer.C (Buffer): remove lyxrc from the parameters.
5581 * all files using lyxrc: have lyxrc as a real variable and not a
5582 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
5585 * src/lyxrc.C: remove double call to defaultKeyBindings
5587 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
5588 toolbar defauls using lyxlex. Remove enums, structs, functions
5591 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
5592 toolbar defaults. Also store default keybindings in a map.
5594 * src/ToolbarDefaults.[Ch]: New file. This class is used for
5595 storing the toolbar defaults without any xforms dependencies.
5597 * src/insets/figinset.C: patch posted to list by Andre Poenitz
5598 applied. Changed to use iterators.
5600 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
5602 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
5603 systems that don't have LINGUAS set to begin with.
5605 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5607 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
5608 the list by Dekel Tsur.
5610 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5612 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
5613 * src/insets/form_graphics.C: ditto.
5615 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
5617 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5619 * src/bufferparams.C (readLanguage): use the new language map
5621 * src/intl.C (InitKeyMapper): use the new language map
5623 * src/lyx_gui.C (create_forms): use the new language map
5625 * src/language.[Ch]: New files. Used for holding the information
5626 about each language. Now! Use this new language map enhance it and
5627 make it really usable for our needs.
5629 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
5631 * screen.C (ShowCursor): Removed duplicate code.
5632 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5633 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
5635 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
5638 * src/text.C Added TransformChar method. Used for rendering Arabic
5639 text correctly (change the glyphs of the letter according to the
5640 position in the word)
5645 * src/lyxrc.C Added lyxrc command {language_command_begin,
5646 language_command_end,language_command_ltr,language_command_rtl,
5647 language_package} which allows the use of either arabtex or Omega
5650 * src/lyx_gui.C (init)
5652 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
5653 to use encoding for menu fonts which is different than the encoding
5656 * src/buffer.C (makeLaTeXFile): If params.language = "default",
5657 do not load the babel package.
5658 To write an English document with Hebrew/Arabic, change the document
5659 language to "english".
5661 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
5662 (alphaCounter): changed to return char
5663 (loweralphaCounter, hebrewCounter, romanCounter): New functions
5665 * lib/lyxrc.example Added examples for Hebrew/Arabic
5668 * src/layout.C Added layout command endlabeltype
5670 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
5672 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
5674 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5676 * src/mathed/math_delim.C (search_deco): return a
5677 math_deco_struct* instead of index.
5679 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5681 * All files with a USE_OSTREAM_ONLY within: removed all code that
5682 was unused when USE_OSTREAM_ONLY is defined.
5684 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
5685 of any less. Removed header and using.
5687 * src/text.C (GetVisibleRow): draw the string "Page Break
5688 (top/bottom)" on screen when drawing a pagebreak line.
5690 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5692 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
5694 * src/mathed/math_macro.C (draw): do some cast magic.
5697 * src/mathed/math_defs.h: change byte* argument to byte const*.
5699 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
5701 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
5702 know it is right to return InsetFoot* too, but cxx does not like
5705 * src/insets/insetcollapsable.[Ch] (Clone): make const.
5707 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
5709 * src/mathed/math_delim.C: change == to proper assignment.
5711 2000-03-09 Juergen Vigna <jug@sad.it>
5713 * src/insets/insettext.C (setPos): fixed various cursor positioning
5714 problems (via mouse and cursor-keys)
5715 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
5716 inset (still a small display problem but it works ;)
5718 * src/insets/insetcollapsable.C (draw): added button_top_y and
5719 button_bottom_y to have correct values for clicking on the inset.
5721 * src/support/lyxalgo.h: commented out 'using std::less'
5723 2000-03-08 Juergen Vigna <jug@sad.it>
5725 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
5726 Button-Release event closes as it is alos the Release-Event
5729 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
5731 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5733 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
5734 can add multiple spaces in Scrap (literate programming) styles...
5735 which, by the way, is how I got hooked on LyX to begin with.
5737 * src/mathed/formula.C (Write): Added dummy variable to an
5738 inset::Latex() call.
5739 (Latex): Add free_spacing boolean to inset::Latex()
5741 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
5743 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
5744 virtual function to include the free_spacing boolean from
5745 the containing paragraph's style.
5747 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
5748 Added free_spacing boolean arg to match inset.h
5750 * src/insets/insettext.C, src/insets/insettext.h (Latex):
5751 Added free_spacing boolean arg to match inset.h
5753 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
5754 Added free_spacing boolean and made sure that if in a free_spacing
5755 paragraph, that we output normal space if there is a protected space.
5757 * src/insets/insetref.C, src/insets/insetref.h (Latex):
5758 Added free_spacing boolean arg to match inset.h
5760 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
5761 Added free_spacing boolean arg to match inset.h
5763 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
5764 Added free_spacing boolean arg to match inset.h
5766 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
5767 Added free_spacing boolean arg to match inset.h
5769 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
5770 Added free_spacing boolean arg to match inset.h
5772 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
5773 free_spacing boolean arg to match inset.h
5775 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
5776 Added free_spacing boolean arg to match inset.h
5778 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
5779 Added free_spacing boolean arg to match inset.h
5781 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
5782 Added free_spacing boolean arg to match inset.h
5784 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
5785 Added free_spacing boolean arg to match inset.h
5787 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
5788 Added free_spacing boolean arg to match inset.h
5790 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
5791 free_spacing boolean arg to match inset.h
5793 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
5794 free_spacing boolean arg to match inset.h
5796 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
5797 ignore free_spacing paragraphs. The user's spaces are left
5800 * src/text.C (InsertChar): Fixed the free_spacing layout
5801 attribute behavior. Now, if free_spacing is set, you can
5802 add multiple spaces in a paragraph with impunity (and they
5803 get output verbatim).
5804 (SelectSelectedWord): Added dummy argument to inset::Latex()
5807 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
5810 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
5811 paragraph layouts now only input a simple space instead.
5812 Special character insets don't make any sense in free-spacing
5815 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
5816 hard-spaces in the *input* file to simple spaces if the layout
5817 is free-spacing. This converts old files which had to have
5818 hard-spaces in free-spacing layouts where a simple space was
5820 (writeFileAscii): Added free_spacing check to pass to the newly
5821 reworked inset::Latex(...) methods. The inset::Latex() code
5822 ensures that hard-spaces in free-spacing paragraphs get output
5823 as spaces (rather than "~").
5825 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5827 * src/mathed/math_delim.C (draw): draw the empty placeholder
5828 delims with a onoffdash line.
5829 (struct math_deco_compare): struct that holds the "functors" used
5830 for the sort and the binary search in math_deco_table.
5831 (class init_deco_table): class used for initial sort of the
5833 (search_deco): use lower_bound to do a binary search in the
5836 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5838 * src/lyxrc.C: a small secret thingie...
5840 * src/lyxlex.C (printTable): changed to take a ostream as paramter
5841 and to not flush the stream as often as it used to.
5843 * src/support/lyxalgo.h: new file
5844 (sorted): template function used for checking if a sequence is
5845 sorted or not. Two versions with and without user supplied
5846 compare. Uses same compare as std::sort.
5848 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
5849 it and give warning on lyxerr.
5851 (struct compare_tags): struct with function operators used for
5852 checking if sorted, sorting and lower_bound.
5853 (search_kw): use lower_bound instead of manually implemented
5856 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5858 * src/insets/insetcollapsable.h: fix Clone() declaration.
5859 * src/insets/insetfoot.h: ditto.
5861 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
5863 2000-03-08 Juergen Vigna <jug@sad.it>
5865 * src/insets/lyxinset.h: added owner call which tells us if
5866 this inset is inside another inset. Changed also the return-type
5867 of Editable to an enum so it tells clearer what the return-value is.
5869 * src/insets/insettext.C (computeTextRows): fixed computing of
5870 textinsets which split automatically on more rows.
5872 * src/insets/insetert.[Ch]: changed this to be of BaseType
5875 * src/insets/insetfoot.[Ch]: added footnote inset
5877 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
5878 collapsable insets (like footnote, ert, ...)
5880 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5882 * src/lyxdraw.h: remvoe file
5884 * src/lyxdraw.C: remove file
5886 * src/insets/insettext.C: added <algorithm>.
5888 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5890 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
5891 (matrix_cb): case MM_OK use string stream
5893 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
5896 * src/mathed/math_macro.C (draw): use string stream
5897 (Metrics): use string stream
5899 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
5900 directly to the ostream.
5902 * src/vspace.C (asString): use string stream.
5903 (asString): use string stream
5904 (asLatexString): use string stream
5906 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
5907 setting Spacing::Other.
5909 * src/LaTeXFeatures.C (getPackages): use string stream instead of
5910 sprintf when creating the stretch vale.
5912 * src/text2.C (alphaCounter): changed to return a string and to
5913 not use a static variable internally. Also fixed a one-off bug.
5914 (SetCounter): changed the drawing of the labels to use string
5915 streams instead of sprintf.
5917 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
5918 manipulator to use a scheme that does not require library support.
5919 This is also the way it is done in the new GNU libstdc++. Should
5920 work with DEC cxx now.
5922 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5924 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
5925 end. This fixes a bug.
5927 * src/mathed (all files concerned with file writing): apply the
5928 USE_OSTREAM_ONLY changes to mathed too.
5930 * src/support/DebugStream.h: make the constructor explicit.
5932 * src/lyxfont.C (latexWriteStartChanges): small bug related to
5933 count and ostream squashed.
5935 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5937 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
5939 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
5940 ostringstream uses STL strings, and we might not.
5942 * src/insets/insetspecialchar.C: add using directive.
5943 * src/insets/insettext.C: ditto.
5945 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5947 * lib/layouts/seminar.layout: feeble attempt at a layout for
5948 seminar.cls, far from completet and could really use some looking
5949 at from people used to write layout files.
5951 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
5952 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
5953 a lot nicer and works nicely with ostreams.
5955 * src/mathed/formula.C (draw): a slightly different solution that
5956 the one posted to the list, but I think this one works too. (font
5957 size wrong in headers.)
5959 * src/insets/insettext.C (computeTextRows): some fiddling on
5960 Jürgens turf, added some comments that he should read.
5962 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
5963 used and it gave compiler warnings.
5964 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
5967 * src/lyx_gui.C (create_forms): do the right thing when
5968 show_banner is true/false.
5970 * src/lyx_cb.C (TimerCB): no need to close or do anything if
5971 show_banner is false.
5973 * most file writing files: Now use iostreams to do almost all of
5974 the writing. Also instead of passing string &, we now use
5975 stringstreams. mathed output is still not adapted to iostreams.
5976 This change can be turned off by commenting out all the occurences
5977 of the "#define USE_OSTREAM_ONLY 1" lines.
5979 * src/WorkArea.C (createPixmap): don't output debug messages.
5980 (WorkArea): don't output debug messages.
5982 * lib/lyxrc.example: added a comment about the new variable
5985 * development/Code_rules/Rules: Added some more commente about how
5986 to build class interfaces and on how better encapsulation can be
5989 2000-03-03 Juergen Vigna <jug@sad.it>
5991 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
5992 automatically with the width of the LyX-Window
5994 * src/insets/insettext.C (computeTextRows): fixed update bug in
5995 displaying text-insets (scrollvalues where not initialized!)
5997 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5999 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
6000 id in the check of the result from lower_bound is not enough since
6001 lower_bound can return last too, and then res->id will not be a
6004 * all insets and some code that use them: I have conditionalized
6005 removed the Latex(string & out, ...) this means that only the
6006 Latex(ostream &, ...) will be used. This is a work in progress to
6007 move towards using streams for all output of files.
6009 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
6012 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6014 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
6015 routine (this fixes bug where greek letters were surrounded by too
6018 * src/support/filetools.C (findtexfile): change a bit the search
6019 algorithm, to fix bug introduced in 1.1.4. Note that --format is
6020 no longer passed to kpsewhich, we may have to change that later.
6022 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
6023 warning options to avoid problems with X header files (from Angus
6025 * acinclude.m4: regenerated.
6027 2000-03-02 Juergen Vigna <jug@sad.it>
6029 * src/insets/insettext.C (WriteParagraphData): Using the
6030 par->writeFile() function for writing paragraph-data.
6031 (Read): Using buffer->parseSingleLyXformat2Token()-function
6032 for parsing paragraph data!
6034 * src/buffer.C (readLyXformat2): removed all parse data and using
6035 the new parseSingleLyXformat2Token()-function.
6036 (parseSingleLyXformat2Token): added this function to parse (read)
6037 lyx-file-format (this is called also from text-insets now!)
6039 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6041 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
6044 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
6045 directly instead of going through a func. One very bad thing: a
6046 static LyXFindReplace, but I don't know where to place it.
6048 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
6049 string instead of char[]. Also changed to static.
6050 (GetSelectionOrWordAtCursor): changed to static inline
6051 (SetSelectionOverLenChars): ditto.
6053 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
6054 current_view and global variables. both classes has changed names
6055 and LyXFindReplace is not inherited from SearchForm.
6057 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
6058 fl_form_search form.
6060 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
6062 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6064 * lib/bind/*.bind: make sure 'buffer-previous' function is not
6065 bound (from Kayvan).
6067 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
6069 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
6071 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6073 * some things that I should comment but the local pub says head to
6076 * comment out all code that belongs to the Roff code for Ascii
6077 export of tables. (this is unused)
6079 * src/LyXView.C: use correct type for global variable
6080 current_layout. (LyXTextClass::size_type)
6082 * some code to get the new insetgraphics closer to working I'd be
6083 grateful for any help.
6085 * src/BufferView2.C (insertInset): use the return type of
6086 NumberOfLayout properly. (also changes in other files)
6088 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
6089 this as a test. I want to know what breaks because of this.
6091 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
6093 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6095 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
6096 to use a \makebox in the label, this allows proper justification
6097 with out using protected spaces or multiple hfills. Now it is
6098 "label" for left justified, "\hfill label\hfill" for center, and
6099 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
6100 should be changed accordingly.
6102 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6104 * src/lyxtext.h: change SetLayout() to take a
6105 LyXTextClass::size_type instead of a char (when there is more than
6106 127 layouts in a class); also change type of copylayouttype.
6107 * src/text2.C (SetLayout): ditto.
6108 * src/LyXView.C (updateLayoutChoice): ditto.
6110 * src/LaTeX.C (scanLogFile): errors where the line number was not
6111 given just after the '!'-line were ignored (from Dekel Tsur).
6113 * lib/lyxrc.example: fix description of \date_insert_format
6115 * lib/layouts/llncs.layout: new layout, contributed by Martin
6118 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6120 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
6121 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
6122 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
6123 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
6124 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
6125 paragraph.C, text.C, text2.C)
6127 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6129 * src/insets/insettext.C (LocalDispatch): remove extra break
6132 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
6133 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
6135 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
6136 * src/insets/insettext.[Ch] (GetCursorPos): ditto
6138 * src/insets/insetbib.h: move InsetBibkey::Holder and
6139 InsetCitation::Holder in public space.
6141 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6143 * src/insets/insettext.h: small change to get the new files from
6144 Juergen to compile (use "string", not "class string").
6146 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
6147 const & as parameter to LocalDispatch, use LyXFont const & as
6148 paramter to some other func. This also had impacto on lyxinsets.h
6149 and the two mathed insets.
6151 2000-02-24 Juergen Vigna <jug@sad.it>
6154 * src/commandtags.h:
6156 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
6160 * src/BufferView2.C: added/updated code for various inset-functions
6162 * src/insets/insetert.[Ch]: added implementation of InsetERT
6164 * src/insets/insettext.[Ch]: added implementation of InsetText
6166 * src/insets/inset.C (Edit): added "unsigned int button" parameter
6167 (draw): added preliminary code for inset scrolling not finshed yet
6169 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
6170 as it is in lyxfunc.C now
6172 * src/insets/lyxinset.h: Added functions for text-insets
6174 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6176 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
6177 BufferView and reimplement the list as a queue put inside its own
6180 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
6182 * several files: use the new interface to the "updateinsetlist"
6184 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
6186 (work_area_handler): call BufferView::trippleClick on trippleclick.
6188 * src/BufferView.C (doubleClick): new function, selects word on
6190 (trippleClick): new function, selects line on trippleclick.
6192 2000-02-22 Allan Rae <rae@lyx.org>
6194 * lib/bind/xemacs.bind: buffer-previous not supported
6196 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6198 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
6201 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6203 * src/bufferlist.C: get rid of current_view from this file
6205 * src/spellchecker.C: get rid of current_view from this file
6207 * src/vspace.C: get rid of current_view from this file
6208 (inPixels): added BufferView parameter for this func
6209 (asLatexCommand): added a BufferParams for this func
6211 * src/text.C src/text2.C: get rid of current_view from these
6214 * src/lyxfont.C (getFontDirection): move this function here from
6217 * src/bufferparams.C (getDocumentDirection): move this function
6220 * src/paragraph.C (getParDirection): move this function here from
6222 (getLetterDirection): ditto
6224 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6226 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
6227 resize due to wrong pixmap beeing used. Also took the opurtunity
6228 to make the LyXScreen stateless on regard to WorkArea and some
6229 general cleanup in the same files.
6231 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6233 * src/Makefile.am: add missing direction.h
6235 * src/PainterBase.h: made the width functions const.
6237 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
6240 * src/insets/insetcommand.C (draw): draw Editable as buttons.
6242 * src/insets/insetlatexaccent.C (draw): make the accents draw
6243 better, at present this will only work well with iso8859-1.
6245 * several files: remove the old drawing code, now we use the new
6248 * several files: remove support for mono_video, reverse_video and
6251 2000-02-17 Juergen Vigna <jug@sad.it>
6253 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
6254 int ** as we have to return the pointer, otherwise we have only
6255 NULL pointers in the returning function.
6257 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6259 * src/LaTeX.C (operator()): quote file name when running latex.
6261 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6263 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
6264 (bubble tip), this removes our special handling of this.
6266 * Remove all code that is unused now that we have the new
6267 workarea. (Code that are not active when NEW_WA is defined.)
6269 * Make the uses of XSync not conditionalized on define USE_XSYNC.
6271 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6273 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
6274 nonexisting layout; correctly redirect obsoleted layouts.
6276 * lib/lyxrc.example: document \view_dvi_paper_option
6278 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
6281 * src/lyx_cb.C (RunScript): handle $$FName for command names.
6282 (PreviewDVI): handle the view_dvi_paper_option variable.
6283 [Both from Roland Krause]
6285 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6287 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
6288 char const *, int, LyXFont)
6289 (text(int, int, string, LyXFont)): ditto
6291 * src/text.C (InsertCharInTable): attempt to fix the double-space
6292 feature in tables too.
6293 (BackspaceInTable): ditto.
6294 (GetVisibleRow): make bottom pagebreak line be a onoff line.
6296 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6298 * src/text2.C (owner): only complain if owner_ is set and bv != 0
6300 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
6301 newly found text in textcache to this.
6302 (buffer): set the owner of the text put into the textcache to 0
6304 * src/insets/figinset.C (draw): fixed the drawing of figures with
6307 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
6308 drawing of mathframe, hfills, protected space, table lines. I have
6309 now no outstanding drawing problems with the new Painter code.
6311 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6313 * src/PainterBase.C (ellipse, circle): do not specify the default
6316 * src/LColor.h: add using directive.
6318 * src/Painter.[Ch]: change return type of methods from Painter& to
6319 PainterBase&. Add a using directive.
6321 * src/WorkArea.C: wrap xforms callbacks in C functions
6324 * lib/layouts/foils.layout: font fix and simplifications from Carl
6327 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6329 * a lot of files: The Painter, LColor and WorkArea from the old
6330 devel branch has been ported to lyx-devel. Some new files and a
6331 lot of #ifdeffed code. The new workarea is enabled by default, but
6332 if you want to test the new Painter and LColor you have to compile
6333 with USE_PAINTER defined (do this in config.h f.ex.) There are
6334 still some rought edges, and I'd like some help to clear those
6335 out. It looks stable (loads and displays the Userguide very well).
6338 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6340 * src/buffer.C (pop_tag): revert to the previous implementation
6341 (use a global variable for both loops).
6343 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
6345 * src/lyxrc.C (LyXRC): change slightly default date format.
6347 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
6348 there is an English text with a footnote that starts with a Hebrew
6349 paragraph, or vice versa.
6350 (TeXFootnote): ditto.
6352 * src/text.C (LeftMargin): allow for negative values for
6353 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
6356 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
6357 for input encoding (cyrillic)
6359 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6361 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
6364 * src/toolbar.C (set): ditto
6365 * src/insets/insetbib.C (create_form_citation_form): ditto
6367 * lib/CREDITS: added Dekel Tsur.
6369 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
6370 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
6371 hebrew supports files from Dekel Tsur.
6373 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
6374 <tzafrir@technion.ac.il>
6376 * src/lyxrc.C: put \date_insert_format at the right place.
6378 * src/buffer.C (makeLaTeXFile): fix the handling of
6379 BufferParams::sides when writing out latex files.
6381 * src/BufferView2.C: add a "using" directive.
6383 * src/support/lyxsum.C (sum): when we use lyxstring,
6384 ostringstream::str needs an additional .c_str().
6386 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6388 * src/support/filetools.C (ChangeExtension): patch from Etienne
6391 * src/TextCache.C (show): remove const_cast and make second
6392 parameter non-const LyXText *.
6394 * src/TextCache.h: use non const LyXText in show.
6396 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
6399 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6401 * src/support/lyxsum.C: rework to be more flexible.
6403 * several places: don't check if a pointer is 0 if you are going
6406 * src/text.C: remove some dead code.
6408 * src/insets/figinset.C: remove some dead code
6410 * src/buffer.C: move the BufferView funcs to BufferView2.C
6411 remove all support for insetlatexdel
6412 remove support for oldpapersize stuff
6413 made some member funcs const
6415 * src/kbmap.C: use a std::list to store the bindings in.
6417 * src/BufferView2.C: new file
6419 * src/kbsequence.[Ch]: new files
6421 * src/LyXAction.C + others: remove all trace of buffer-previous
6423 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
6424 only have one copy in the binary of this table.
6426 * hebrew patch: moved some functions from LyXText to more
6427 appropriate places. (LyXParagraph, BufferParams, LyXFont)
6429 * several files: remove support for XForms older than 0.88
6431 remove some #if 0 #endif code
6433 * src/TextCache.[Ch]: new file. Holds the textcache.
6435 * src/BufferView.C: changes to use the new TextCache interface.
6436 (waitForX): remove the now unused code.
6438 * src/BackStack.h: remove some commented code
6440 * lib/bind/emacs.bind: remove binding for buffer-previous
6442 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6444 * applied the hebrew patch.
6446 * src/lyxrow.h: make sure that all Row variables are initialized.
6448 * src/text2.C (TextHandleUndo): comment out a delete, this might
6449 introduce a memory leak, but should also help us to not try to
6450 read freed memory. We need to look at this one.
6452 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
6453 (LyXParagraph): initalize footnotekind.
6455 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
6456 forgot this when applying the patch. Please heed the warnings.
6458 * src/BufferView.C (buffer): a fix for the buffer-reload problem
6459 (aka. reformat problem)
6461 * src/bufferlist.C (exists): made const, and use const_iterator
6462 (isLoaded): new func.
6463 (release): use std::find to find the correct buffer.
6465 * src/bufferlist.h: made getState a const func.
6466 made empty a const func.
6467 made exists a const func.
6470 2000-02-01 Juergen Vigna <jug@sad.it>
6472 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
6474 * po/it.po: updated a bit the italian po file and also changed the
6475 'file nuovo' for newfile to 'filenuovo' without a space, this did
6478 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
6479 for the new insert_date command.
6481 * src/lyxfunc.C (Dispatch): added support for a insert_date function
6482 from jdblair, to insert a date into the current text conforming to
6483 a strftime format (for now only considering the locale-set and not
6484 the document-language).
6486 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6488 * src/lyxfont.C (textWidth): hopefully better fix for the Array
6489 Bounds Read error seen by purify. The problem was that islower is
6490 a macros which takes an unsigned char and uses it as an index for
6491 in array of characters properties (and is thus subject to the
6495 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
6496 correctly the paper sides radio buttons.
6497 (UpdateDocumentButtons): ditto.
6499 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6501 * src/kbmap.C (getsym + others): change to return unsigned int,
6502 returning a long can give problems on 64 bit systems. (I assume
6503 that int is 32bit on 64bit systems)
6505 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6507 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
6508 LyXLookupString to be zero-terminated. Really fixes problems seen
6511 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6513 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
6514 write a (char*)0 to the lyxerr stream.
6516 * src/lastfiles.C: move algorithm before the using statemets.
6518 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6520 * src/lastfiles.C: move using directives in global scope (egcs 1.x
6521 complains otherwise).
6522 * src/table.C: ditto
6524 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
6527 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
6528 that I removed earlier... It is really needed.
6530 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
6532 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6534 * INSTALL: update xforms home page URL.
6536 * lib/configure.m4: fix a bug with unreadable layout files.
6538 * src/table.C (calculate_width_of_column): add "using std::max"
6541 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6543 * several files: marked several lines with "DEL LINE", this is
6544 lines that can be deleted without changing anything.
6545 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
6546 checks this anyway */
6549 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
6551 * src/DepTable.C (update): add a "+" at the end when the checksum
6552 is different. (debugging string only)
6554 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
6555 the next inset to not be displayed. This should also fix the list
6556 of labels in the "Insert Crossreference" dialog.
6558 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6560 * src/support/LSubstring.C (LSubstring): set pos to string::npos
6561 when regex was not found.
6563 * src/support/lstrings.C (lowercase): use handcoded transform always.
6566 * src/text.C (Delete): fixed the crash. cursor.par->prev and
6567 old_cursor.par->prev could be 0.
6569 * several files: changed post inc/dec to pre inc/dec
6571 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
6572 write the lastfiles to file.
6574 * src/BufferView.C (buffer): only show TextCache info when debugging
6576 (resizeCurrentBuffer): ditto
6577 (workAreaExpose): ditto
6579 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
6581 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
6583 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
6584 a bit better by removing the special case for \i and \j.
6586 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6588 * src/lyx_main.C (easyParse): remove test for bad comand line
6589 options, since this broke all xforms-related parsing.
6591 * src/kbmap.C (getsym): set return type to unsigned long, as
6592 declared in header. On an alpha, long is _not_ the same as int.
6594 * src/support/LOstream.h: add a "using std::flush;"
6596 * src/insets/figinset.C: ditto.
6598 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6600 * src/bufferlist.C (write): use blinding fast file copy instead of
6601 "a char at a time", now we are doing it the C++ way.
6603 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
6604 std::list<int> instead.
6605 (addpidwait): reflect move to std::list<int>
6606 (sigchldchecker): ditto
6608 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
6611 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
6612 that obviously was wrong...
6614 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
6615 c, this avoids warnings with purify and islower.
6617 * src/insets/figinset.C: rename struct queue to struct
6618 queue_element and rewrite to use a std::queue. gsqueue is now a
6619 std::queue<queue_element>
6620 (runqueue): reflect move to std::queue
6623 * src/support/lstrings.h (tostr): specialize for bool, otherwise
6624 we would get "1" "0" instead of "true" "false. Also make the tostr
6627 2000-01-21 Juergen Vigna <jug@sad.it>
6629 * src/buffer.C (writeFileAscii): Disabled code for special groff
6630 handling of tabulars till I fix this in table.C
6632 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6634 * src/support/mkdir.C (mkdir): change second argument of mkdir to
6636 * src/support/lyxlib.h: ditto.
6638 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6640 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
6641 and 'j' look better. This might fix the "macron" bug that has been
6644 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
6645 functions as one template function. Delete the old versions.
6647 * src/support/lyxsum.C: move using std::ifstream inside
6650 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
6653 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
6655 * src/mathed/formula.C: delete #include "bufferlist.h" never used
6657 * src/insets/figinset.C (InitFigures): use new instead of malloc
6658 to allocate memory for figures and bitmaps.
6659 (DoneFigures): use delete[] instead of free to deallocate memory
6660 for figures and bitmaps.
6661 (runqueue): use new to allocate
6662 (getfigdata): use new/delete[] instead of malloc/free
6663 (RegisterFigure): ditto
6665 * some files: moved some declarations closer to first use, small
6666 whitespace changes use preincrement instead of postincrement where
6667 it does not make a difference.
6669 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
6670 step on the way to use stl::containers for key maps.
6672 * src/bufferlist.h: add a typedef for const_iterator and const
6673 versions of begin and end.
6675 * src/bufferlist.[Ch]: change name of member variable _state to
6676 state_. (avoid reserved names)
6678 (getFileNames): returns the filenames of the buffers in a vector.
6680 * configure.in (ALL_LINGUAS): added ro
6682 * src/support/putenv.C: new file
6684 * src/support/mkdir.C: new file
6686 2000-01-20 Allan Rae <rae@lyx.org>
6688 * lib/layouts/IEEEtran.layout: Added several theorem environments
6690 * lib/templates/IEEEtran.lyx: Example theorem environments and a
6691 couple of minor additions.
6693 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
6694 (except for those in footnotes of course)
6696 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6698 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
6700 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
6701 std::sort and std::lower_bound instead of qsort and handwritten
6703 (struct compara): struct that holds the functors used by std::sort
6704 and std::lower_bound in MathedLookupBOP.
6706 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6708 * src/support/LAssert.h: do not do partial specialization. We do
6711 * src/support/lyxlib.h: note that lyx::getUserName() and
6712 lyx::date() are not in use right now. Should these be suppressed?
6714 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
6715 (makeLinuxDocFile): do not put date and user name in linuxdoc
6718 * src/support/lyxlib.h (kill): change first argument to long int,
6719 since that's what solaris uses.
6721 * src/support/kill.C (kill): fix declaration to match prototype.
6723 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
6724 actually check whether namespaces are supported. This is not what
6727 * src/support/lyxsum.C: add a using directive.
6729 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6731 * src/support/kill.C: if we have namespace support we don't have
6732 to include lyxlib.h.
6734 * src/support/lyxlib.h: use namespace lyx if supported.
6736 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6738 * src/support/date.C: new file
6740 * src/support/chdir.C: new file
6742 * src/support/getUserName.C: new file
6744 * src/support/getcwd.C: new file
6746 * src/support/abort.C: new file
6748 * src/support/kill.C: new file
6750 * src/support/lyxlib.h: moved all the functions in this file
6751 insede struct lyx. Added also kill and abort to this struct. This
6752 is a way to avoid the "kill is not defined in <csignal>", we make
6753 C++ wrappers for functions that are not ANSI C or ANSI C++.
6755 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
6756 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
6757 lyx it has been renamed to sum.
6759 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6761 * src/text.C: add using directives for std::min and std::max.
6763 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6765 * src/texrow.C (getIdFromRow): actually return something useful in
6766 id and pos. Hopefully fixes the bug with positionning of errorbox
6769 * src/lyx_main.C (easyParse): output an error and exit if an
6770 incorrect command line option has been given.
6772 * src/spellchecker.C (ispell_check_word): document a memory leak.
6774 * src/bufferlist.C (write): fix mismatched allocation/deletion,
6775 where a "struct utimbuf" is allocated with "new" and deleted with
6778 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
6780 * src/text2.C (CutSelection): don't delete double spaces.
6781 (PasteSelection): ditto
6782 (CopySelection): ditto
6784 * src/text.C (Backspace): don't delete double spaces.
6786 * src/lyxlex.C (next): fix a bug that were only present with
6787 conformant std::istream::get to read comment lines, use
6788 std::istream::getline instead. This seems to fix the problem.
6790 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6792 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
6793 allowed to insert space before space" editing problem. Please read
6794 commends at the beginning of the function. Comments about usage
6797 * src/text.C (InsertChar): fix for the "not allowed to insert
6798 space before space" editing problem.
6800 * src/text2.C (DeleteEmptyParagraphMechanism): when
6801 IsEmptyTableRow can only return false this last "else if" will
6802 always be a no-op. Commented out.
6804 * src/text.C (RedoParagraph): As far as I can understand tmp
6805 cursor is not really needed.
6807 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
6808 present it could only return false anyway.
6809 (several functions): Did something not so smart...added a const
6810 specifier on a lot of methods.
6812 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
6813 and add a tmp->text.resize. The LyXParagraph constructor does the
6815 (BreakParagraphConservative): ditto
6817 * src/support/path.h (Path): add a define so that the wrong usage
6818 "Path("/tmp") will be flagged as a compilation error:
6819 "`unnamed_Path' undeclared (first use this function)"
6821 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6823 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
6824 which was bogus for several reasons.
6826 * src/LaTeX.C (scanAux): fix the regular expression used to scan
6830 * autogen.sh: do not use "type -path" (what's that anyway?).
6832 * src/support/filetools.C (findtexfile): remove extraneous space
6833 which caused a kpsewhich warning (at least with kpathsea version
6836 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6838 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
6840 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
6842 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
6844 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6846 * src/paragraph.C (BreakParagraph): do not reserve space on text
6847 if we don't need to (otherwise, if pos_end < pos, we end up
6848 reserving huge amounts of memory due to bad unsigned karma).
6849 (BreakParagraphConservative): ditto, although I have not seen
6850 evidence the bug can happen here.
6852 * src/lyxparagraph.h: add a using std::list.
6854 2000-01-11 Juergen Vigna <jug@sad.it>
6856 * src/menus.C (MenuDocu): output an Alert if the documentation-file
6859 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6861 * src/vc-backend.C (doVCCommand): change to be static and take one
6862 more parameter: the path to chdir too be fore executing the command.
6863 (retrive): new function equiv to "co -r"
6865 * src/bufferlist.C (loadLyXFile): implement the missing parts if
6866 file_not_found_hook is true.
6868 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
6870 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
6871 if a file is readwrite,readonly...anything else.
6873 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6875 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
6876 (CreatePostscript): name change from MenuRunDVIPS (or something)
6877 (PreviewPostscript): name change from MenuPreviewPS
6878 (PreviewDVI): name change from MenuPreviewDVI
6880 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
6881 \view_pdf_command., \pdf_to_ps_command
6883 * lib/configure.m4: added search for PDF viewer, and search for
6884 PDF to PS converter.
6885 (lyxrc.defaults output): add \pdflatex_command,
6886 \view_pdf_command and \pdf_to_ps_command.
6888 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
6890 * src/bufferlist.C (write): we don't use blocksize for anything so
6893 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6895 * src/support/block.h: disable operator T* (), since it causes
6896 problems with both compilers I tried. See comments in the file.
6898 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
6901 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
6902 variable LYX_DIR_10x to LYX_DIR_11x.
6904 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
6906 * INSTALL: document --with-lyxname.
6909 * configure.in: new configure flag --with-lyxname which allows to
6910 choose the name under which lyx is installed. Default is "lyx", of
6911 course. It used to be possible to do this with --program-suffix,
6912 but the later has in fact a different meaning for autoconf.
6914 * src/support/lstrings.h (lstrchr): reformat a bit.
6916 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
6917 * src/mathed/math_defs.h: ditto.
6919 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6921 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
6922 true, decides if we create a backup file or not when saving. New
6923 tag and variable \pdf_mode, defaults to false. New tag and
6924 variable \pdflatex_command, defaults to pdflatex. New tag and
6925 variable \view_pdf_command, defaults to xpdf. New tag and variable
6926 \pdf_to_ps_command, defaults to pdf2ps.
6928 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6930 * src/bufferlist.C (close): don't call insetUnlock if the buffer
6931 does not have a BufferView.
6932 (unlockInset): ditto + don't access the_locking_inset if the
6933 buffer does not have a BufferView.
6935 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
6936 certain circumstances so that we don't continue a keyboard
6937 operation long after the key was released. Try f.ex. to load a
6938 large document, press PageDown for some seconds and then release
6939 it. Before this change the document would contine to scroll for
6940 some time, with this change it stops imidiatly.
6942 * src/support/block.h: don't allocate more space than needed. As
6943 long as we don't try to write to the arr[x] in a array_type arr[x]
6944 it is perfectly ok. (if you write to it you might segfault).
6945 added operator value_type*() so that is possible to pass the array
6946 to functions expecting a C-pointer.
6948 * lib/Makefile.am (dist-hook): don't fail completely if unable to
6951 * intl/*: updated to gettext 0.10.35, tried to add our own
6952 required modifications. Please verify.
6954 * po/*: updated to gettext 0.10.35, tried to add our own required
6955 modifications. Please verify.
6957 * src/support/lstrings.C (tostr): go at fixing the problem with
6958 cxx and stringstream. When stringstream is used return
6959 oss.str().c_str() so that problems with lyxstring and basic_string
6960 are avoided. Note that the best solution would be for cxx to use
6961 basic_string all the way, but it is not conformant yet. (it seems)
6963 * src/lyx_cb.C + other files: moved several global functions to
6964 class BufferView, some have been moved to BufferView.[Ch] others
6965 are still located in lyx_cb.C. Code changes because of this. (part
6966 of "get rid of current_view project".)
6968 * src/buffer.C + other files: moved several Buffer functions to
6969 class BufferView, the functions are still present in buffer.C.
6970 Code changes because of this.
6972 * config/lcmessage.m4: updated to most recent. used when creating
6975 * config/progtest.m4: updated to most recent. used when creating
6978 * config/gettext.m4: updated to most recent. applied patch for
6981 * config/gettext.m4.patch: new file that shows what changes we
6982 have done to the local copy of gettext.m4.
6984 * config/libtool.m4: new file, used in creation of acinclude.m4
6986 * config/lyxinclude.m4: new file, this is the lyx created m4
6987 macros, used in making acinclude.m4.
6989 * autogen.sh: GNU m4 discovered as a separate task not as part of
6990 the lib/configure creation.
6991 Generate acinlucde from files in config. Actually cat
6992 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
6993 easier to upgrade .m4 files that really are external.
6995 * src/Spacing.h: moved using std::istringstream to right after
6996 <sstream>. This should fix the problem seen with some compilers.
6998 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7000 * src/lyx_cb.C: began some work to remove the dependency a lot of
7001 functions have on BufferView::text, even if not really needed.
7002 (GetCurrentTextClass): removed this func, it only hid the
7005 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
7006 forgot this in last commit.
7008 * src/Bullet.C (bulletEntry): use static char const *[] for the
7009 tables, becuase of this the return arg had to change to string.
7011 (~Bullet): removed unneeded destructor
7013 * src/BufferView.C (beforeChange): moved from lyx_cb.C
7014 (insetSleep): moved from Buffer
7015 (insetWakeup): moved from Buffer
7016 (insetUnlock): moved from Buffer
7018 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
7019 from Buffer to BufferView.
7021 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
7023 * config/ltmain.sh: updated to version 1.3.4 of libtool
7025 * config/ltconfig: updated to version 1.3.4 of libtool
7027 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7030 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
7031 Did I get that right?
7033 * src/lyxlex.h: add a "using" directive or two.
7034 * src/Spacing.h: ditto.
7035 * src/insets/figinset.C: ditto.
7036 * src/support/filetools.C: ditto.
7037 * src/support/lstrings.C: ditto.
7038 * src/BufferView.C: ditto.
7039 * src/bufferlist.C: ditto.
7040 * src/lyx_cb.C: ditto.
7041 * src/lyxlex.C: ditto.
7043 * NEWS: add some changes for 1.1.4.
7045 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7047 * src/BufferView.C: first go at a TextCache to speed up switching
7050 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7052 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
7053 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
7054 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
7055 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
7058 * src/mathed/math_defs.h (MathedRowSt): make sure that all
7059 members of the struct are correctly initialized to 0 (detected by
7061 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
7062 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
7064 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
7065 pidwait, since it was allocated with "new". This was potentially
7066 very bad. Thanks to Michael Schmitt for running purify for us.
7069 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7071 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
7073 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
7075 1999-12-30 Allan Rae <rae@lyx.org>
7077 * lib/templates/IEEEtran.lyx: minor change
7079 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
7080 src/mathed/formula.C (LocalDispatch): askForText changes
7082 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
7083 know when a user has cancelled input. Fixes annoying problems with
7084 inserting labels and version control.
7086 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7088 * src/support/lstrings.C (tostr): rewritten to use strstream and
7091 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7093 * src/support/filetools.C (IsFileWriteable): use fstream to check
7094 (IsDirWriteable): use fileinfo to check
7096 * src/support/filetools.h (FilePtr): whole class deleted
7098 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
7100 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
7102 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
7104 * src/bufferlist.C (write): use ifstream and ofstream instead of
7107 * src/Spacing.h: use istrstream instead of sscanf
7109 * src/mathed/math_defs.h: change first arg to istream from FILE*
7111 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
7113 * src/mathed/math_parser.C: have yyis to be an istream
7114 (LexGetArg): use istream (yyis)
7116 (mathed_parse): ditto
7117 (mathed_parser_file): first arg istream instead of FILE*, set yyis
7119 * src/mathed/formula.C (Read): rewritten to use istream
7121 * src/mathed/formulamacro.C (Read): rewritten to use istream
7123 * src/lyxlex.h (~LyXLex): deleted desturctor
7124 (getStream): new function, returns an istream
7125 (getFile): deleted funtion
7126 (IsOK): return is.good();
7128 * src/lyxlex.C (LyXLex): delete file and owns_file
7129 (setFile): open an filebuf and assign that to a istream instead of
7131 (setStream): new function, takes an istream as arg.
7132 (setFile): deleted function
7133 (EatLine): rewritten us use istream instead of FILE*
7137 * src/table.C (LyXTable): use istream instead of FILE*
7138 (Read): rewritten to take an istream instead of FILE*
7140 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7142 * src/buffer.C (Dispatch): remove an extraneous break statement.
7144 * src/support/filetools.C (QuoteName): change to do simple
7145 'quoting'. More work is necessary. Also changed to do nothing
7146 under emx (needs fix too).
7147 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
7149 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
7150 config.h.in to the AC_DEFINE_UNQUOTED() call.
7151 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
7152 needs char * as argument (because Solaris 7 declares it like
7155 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
7156 remove definition of BZERO.
7158 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7160 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
7161 defined, "lyxregex.h" if not.
7163 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
7165 (REGEX): new variable that is set to regex.c lyxregex.h when
7166 AM_CONDITIONAL USE_REGEX is set.
7167 (libsupport_la_SOURCES): add $(REGEX)
7169 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
7172 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
7175 * configure.in: add call to LYX_REGEX
7177 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
7178 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
7180 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7182 * lib/bind/fi_menus.bind: new file, from
7183 pauli.virtanen@saunalahti.fi.
7185 * src/buffer.C (getBibkeyList): pass the parameter delim to
7186 InsetInclude::getKeys and InsetBibtex::getKeys.
7188 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
7189 is passed to Buffer::getBibkeyList
7191 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
7192 instead of the hardcoded comma.
7194 * src/insets/insetbib.C (getKeys): make sure that there are not
7195 leading blanks in bibtex keys. Normal latex does not care, but
7196 harvard.sty seems to dislike blanks at the beginning of citation
7197 keys. In particular, the retturn value of the function is
7199 * INSTALL: make it clear that libstdc++ is needed and that gcc
7200 2.7.x probably does not work.
7202 * src/support/filetools.C (findtexfile): make debug message go to
7204 * src/insets/insetbib.C (getKeys): ditto
7206 * src/debug.C (showTags): make sure that the output is correctly
7209 * configure.in: add a comment for TWO_COLOR_ICON define.
7211 * acconfig.h: remove all the entries that already defined in
7212 configure.in or acinclude.m4.
7214 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
7215 to avoid user name, date and copyright.
7217 1999-12-21 Juergen Vigna <jug@sad.it>
7219 * src/table.C (Read): Now read bogus row format informations
7220 if the format is < 5 so that afterwards the table can
7221 be read by lyx but without any format-info. Fixed the
7222 crash we experienced when not doing this.
7224 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7226 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
7227 (RedoDrawingOfParagraph): ditto
7228 (RedoParagraphs): ditto
7229 (RemoveTableRow): ditto
7231 * src/text.C (Fill): rename arg paperwidth -> paper_width
7233 * src/buffer.C (insertLyXFile): rename var filename -> fname
7234 (writeFile): rename arg filename -> fname
7235 (writeFileAscii): ditto
7236 (makeLaTeXFile): ditto
7237 (makeLinuxDocFile): ditto
7238 (makeDocBookFile): ditto
7240 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
7243 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
7245 * src/bmtable.h: add extern "C" on this file when __cplusplus is
7248 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
7249 compiled by a C compiler not C++.
7251 * src/layout.h (LyXTextClass): added typedef for const_iterator
7252 (LyXTextClassList): added typedef for const_iterator + member
7253 functions begin and end.
7255 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
7256 iterators to fill the choice_class.
7257 (updateLayoutChoice): rewritten to use iterators to fill the
7258 layoutlist in the toolbar.
7260 * src/BufferView.h (BufferView::work_area_width): removed unused
7263 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
7265 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
7266 (sgmlCloseTag): ditto
7268 * src/support/lstrings.h: return type of countChar changed to
7271 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
7272 what version of this func to use. Also made to return unsigned int.
7274 * configure.in: call LYX_STD_COUNT
7276 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
7277 conforming std::count.
7279 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7281 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
7282 and a subscript would give bad display (patch from Dekel Tsur
7283 <dekel@math.tau.ac.il>).
7285 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
7287 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
7290 * src/chset.h: add a few 'using' directives
7292 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
7293 triggered when no buffer is active
7295 * src/layout.C: removed `break' after `return' in switch(), since
7298 * src/lyx_main.C (init): make sure LyX can be ran in place even
7299 when libtool has done its magic with shared libraries. Fix the
7300 test for the case when the system directory has not been found.
7302 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
7303 name for the latex file.
7304 (MenuMakeHTML): ditto
7306 * src/buffer.h: add an optional boolean argument, which is passed
7309 1999-12-20 Allan Rae <rae@lyx.org>
7311 * lib/templates/IEEEtran.lyx: small correction and update.
7313 * configure.in: Attempted to use LYX_PATH_HEADER
7315 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
7317 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
7318 input from JMarc. Now use preprocessor to find the header.
7319 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
7320 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
7321 LYX_STL_STRING_FWD. See comments in file.
7323 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
7325 * The global MiniBuffer * minibuffer variable is dead.
7327 * The global FD_form_main * fd_form_main variable is dead.
7329 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7331 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
7333 * src/table.h: add the LOstream.h header
7334 * src/debug.h: ditto
7336 * src/LyXAction.h: change the explaination of the ReadOnly
7337 attribute: is indicates that the function _can_ be used.
7339 * src/LyXAction.C (init): find-replace _can_ be used in read-only
7342 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7344 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
7350 * src/paragraph.C (GetWord): assert on pos>=0
7353 * src/support/lyxstring.C: condition the use of an invariant on
7355 * src/support/lyxstring.h: ditto
7357 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
7358 Use LAssert.h instead of plain assert().
7360 * src/support/lstrings.h: add LAssert.h, in case it is needed.
7362 * src/lyxfunc.C: do not include LAssert.h, it is not used.
7363 * src/support/filetools.C: ditto
7365 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
7368 * INSTALL: document the new configure flags
7370 * configure.in: suppress --with-debug; add --enable-assertions
7372 * acinclude.m4: various changes in alignment of help strings.
7374 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7376 * src/kbmap.C: commented out the use of the hash map in kb_map,
7377 beginning of movement to a stl::container.
7379 * several files: removed code that was not in effect when
7380 MOVE_TEXT was defined.
7382 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
7383 for escaping should not be used. We can discuss if the string
7384 should be enclosed in f.ex. [] instead of "".
7386 * src/trans_mgr.C (insert): use the new returned value from
7387 encodeString to get deadkeys and keymaps done correctly.
7389 * src/chset.C (encodeString): changed to return a pair, to tell
7390 what to use if we know the string.
7392 * src/lyxscreen.h (fillArc): new function.
7394 * src/FontInfo.C (resize): rewritten to use more std::string like
7395 structore, especially string::replace.
7397 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
7400 * configure.in (chmod +x some scripts): remove config/gcc-hack
7402 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7404 * src/buffer.C (writeFile): change once again the top comment in a
7405 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
7406 instead of an hardcoded version number.
7407 (makeDocBookFile): ditto
7409 * src/version.h: add new define LYX_DOCVERSION
7411 * po/de.po: update from Pit Sütterlin
7412 * lib/bind/de_menus.bind: ditto.
7414 * src/lyxfunc.C (Dispatch): call MenuExport()
7415 * src/buffer.C (Dispatch): ditto
7417 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
7418 LyXFunc::Dispatch().
7419 (MenuExport): new function, moved from
7420 LyXFunc::Dispatch().
7422 * src/trans_mgr.C (insert): small cleanup
7423 * src/chset.C (loadFile): ditto
7425 * lib/kbd/iso8859-1.cdef: add missing backslashes
7427 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7429 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
7430 help with placing the manually drawn accents better.
7432 (Draw): x2 and hg changed to float to minimize rounding errors and
7433 help place the accents better.
7435 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
7436 unsigned short to char is just wrong...cast the char to unsigned
7437 char instead so that the two values can compare sanely. This
7438 should also make the display of insetlatexaccents better and
7439 perhaps also some other insets.
7441 (lbearing): new function
7444 1999-12-15 Allan Rae <rae@lyx.org>
7446 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
7447 header that provides a wrapper around the very annoying SGI STL header
7450 * src/support/lyxstring.C, src/LString.h:
7451 removed old SGI-STL-compatability attempts.
7453 * configure.in: Use LYX_STL_STRING_FWD.
7455 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
7456 stl_string_fwd.h is around and try to determine it's location.
7457 Major improvement over previous SGI STL 3.2 compatability.
7458 Three small problems remain with this function due to my zero
7459 knowledge of autoconf. JMarc and lgb see the comments in the code.
7461 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7463 * src/broken_const.h, config/hack-gcc, config/README: removed
7465 * configure.in: remove --with-gcc-hack option; do not call
7468 * INSTALL: remove documentation of --with-broken-const and
7471 * acconfig.h: remove all trace of BROKEN_CONST define
7473 * src/buffer.C (makeDocBookFile): update version number in output
7475 (SimpleDocBookOnePar): fix an assert when trying to a character
7476 access beyond string length
7479 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7481 * po/de.po: fix the Export menu
7483 * lyx.man: update the description of -dbg
7485 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
7486 (commandLineHelp): updated
7487 (easyParse): show list of available debug levels if -dbg is passed
7490 * src/Makefile.am: add debug.C
7492 * src/debug.h: moved some code to debug.C
7494 * src/debug.C: new file. Contains code to set and show debug
7497 * src/layout.C: remove 'break' after 'continue' in switch
7498 statements, since these cannot be reached.
7500 1999-12-13 Allan Rae <rae@lyx.org>
7502 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
7503 (in_word_set): hash() -> math_hash()
7505 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
7507 * acconfig.h: Added a test for whether we are using exceptions in the
7508 current compilation run. If so USING_EXCEPTIONS is defined.
7510 * config.in: Check for existance of stl_string_fwd.h
7511 * src/LString.h: If compiling --with-included-string and SGI's
7512 STL version 3.2 is present (see above test) we need to block their
7513 forward declaration of string and supply a __get_c_string().
7514 However, it turns out this is only necessary if compiling with
7515 exceptions enabled so I've a bit more to add yet.
7517 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
7518 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
7519 src/support/LRegex.h, src/undo.h:
7520 Shuffle the order of the included files a little to ensure that
7521 LString.h gets included before anything that includes stl_string_fwd.h
7523 * src/support/lyxstring.C: We need to #include LString.h instead of
7524 lyxstring.h to get the necessary definition of __get_c_string.
7525 (__get_c_string): New function. This is defined static just like SGI's
7526 although why they need to do this I'm not sure. Perhaps it should be
7527 in lstrings.C instead.
7529 * lib/templates/IEEEtran.lyx: New template file.
7531 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7533 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
7534 * intl/Makefile.in (MKINSTALLDIRS): ditto
7536 * src/LyXAction.C (init): changed to hold the LFUN data in a
7537 automatic array in stead of in callso to newFunc, this speeds up
7538 compilation a lot. Also all the memory used by the array is
7539 returned when the init is completed.
7541 * a lot of files: compiled with -Wold-style-cast, changed most of
7542 the reported offenders to C++ style casts. Did not change the
7543 offenders in C files.
7545 * src/trans.h (Match): change argument type to unsigned int.
7547 * src/support/DebugStream.C: fix some types on the streambufs so
7548 that it works on a conforming implementation.
7550 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7552 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
7554 * src/support/lyxstring.C: remove the inline added earlier since
7555 they cause a bunch of unsatisfied symbols when linking with dec
7556 cxx. Cxx likes to have the body of inlines at the place where they
7559 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
7560 accessing negative bounds in array. This fixes the crash when
7561 inserting accented characters.
7562 * src/trans.h (Match): ditto
7564 * src/buffer.C (Dispatch): since this is a void, it should not try
7565 to return anything...
7567 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7569 * src/buffer.h: removed the two friends from Buffer. Some changes
7570 because of this. Buffer::getFileName and Buffer::setFileName
7571 renamed to Buffer::fileName() and Buffer::fileName(...).
7573 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7575 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
7576 and Buffer::update(short) to BufferView. This move is currently
7577 controlled by a define MOVE_TEXT, this will be removed when all
7578 shows to be ok. This move paves the way for better separation
7579 between buffer contents and buffer view. One side effect is that
7580 the BufferView needs a rebreak when swiching buffers, if we want
7581 to avoid this we can add a cache that holds pointers to LyXText's
7582 that is not currently in use.
7584 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
7587 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7589 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
7591 * lyx_main.C: new command line option -x (or --execute) and
7592 -e (or --export). Now direct conversion from .lyx to .tex
7593 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
7594 Unfortunately, X is still needed and the GUI pops up during the
7597 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7599 * src/Spacing.C: add a using directive to bring stream stuff into
7601 * src/paragraph.C: ditto
7602 * src/buffer.C: ditto
7604 * NEWS: updated a bit the new features of 1.1.3 (took a few things
7605 from Lars' announcement).
7607 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
7608 example files from Tino Meinen.
7610 1999-12-06 Allan Rae <rae@lyx.org>
7612 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
7614 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7616 * src/support/lyxstring.C: added a lot of inline for no good
7619 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
7620 latexWriteEndChanges, they were not used.
7622 * src/layout.h (operator<<): output operator for PageSides
7624 * src/mathed/math_iter.C (my_memcpy): slightly changed.
7626 * some example files: loaded in LyX 1.0.4 and saved again to update
7627 certain constructs (table format)
7629 * a lot of files: did the change to use fstream/iostream for all
7630 writing of files. Done with a close look at Andre Poenitz's patch.
7632 * some files: whitespace changes.
7634 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7636 * src/mathed/math_iter.C (my_memcpy): new function. Since the
7637 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
7638 architecture, we provide our own. It is used unconditionnally, but
7639 I do not think this is a performance problem. Thanks to Angus
7640 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
7641 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
7643 (GetInset): use my_memcpy.
7647 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
7648 it is easier to understand, but it uses less TeX-only constructs now.
7650 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
7651 elements contain spaces
7653 * lib/configure: regenerated
7655 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
7656 elements contain spaces; display the list of programs that are
7659 * autogen.sh: make sure lib/configure is executable
7661 * lib/examples/*: rename the tutorial examples to begin with the
7662 two-letters language code.
7664 * src/lyxfunc.C (getStatus): do not query current font if no
7667 * src/lyx_cb.C (RunScript): use QuoteName
7668 (MenuRunDvips): ditto
7669 (PrintApplyCB): ditto
7671 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
7672 around argument, so that it works well with the current shell.
7673 Does not work properly with OS/2 shells currently.
7675 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
7676 * src/LyXSendto.C (SendtoApplyCB): ditto
7677 * src/lyxfunc.C (Dispatch): ditto
7678 * src/buffer.C (runLaTeX): ditto
7679 (runLiterate): ditto
7680 (buildProgram): ditto
7682 * src/lyx_cb.C (RunScript): ditto
7683 (MenuMakeLaTeX): ditto
7685 * src/buffer.h (getLatexName): new method
7687 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
7689 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7691 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
7692 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
7693 (create_math_panel): ditto
7695 * src/lyxfunc.C (getStatus): re-activate the code which gets
7696 current font and cursor; add test for export to html.
7698 * src/lyxrc.C (read): remove unreachable break statements; add a
7701 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
7703 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7705 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
7706 introduced by faulty regex.
7707 * src/buffer.C: ditto
7708 * src/lastfiles.C: ditto
7709 * src/paragraph.C: ditto
7710 * src/table.C: ditto
7711 * src/vspace.C: ditto
7712 * src/insets/figinset.C: ditto
7713 Note: most of these is absolutely harmless, except the one in
7714 src/mathed formula.C.
7716 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7718 * src/ImportNoweb.C (documentclass): fixed bounds for substr
7719 operation, yielding correct results for the reLyX command.
7721 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7723 * src/support/filetools.C (ExpandPath): removed an over eager
7725 (ReplaceEnvironmentPath): ditto
7727 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
7728 shows that we are doing something fishy in our code...
7732 * src/lyxrc.C (read): use a double switch trick to get more help
7733 from the compiler. (the same trick is used in layout.C)
7734 (write): new function. opens a ofstream and pass that to output
7735 (output): new function, takes a ostream and writes the lyxrc
7736 elemts to it. uses a dummy switch to make sure no elements are
7739 * src/lyxlex.h: added a struct pushpophelper for use in functions
7740 with more than one exit point.
7742 * src/lyxlex.[Ch] (GetInteger): made it const
7746 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
7748 * src/layout.[hC] : LayoutTags splitted into several enums, new
7749 methods created, better error handling cleaner use of lyxlex. Read
7752 * src/bmtable.[Ch]: change some member prototypes because of the
7753 image const changes.
7755 * commandtags.h, src/LyXAction.C (init): new function:
7756 "preferences-save", saves the lyxrc entries into .lyx/preferences.
7757 This file is not read automatically but you can add \input
7758 preferences to your lyxrc if you want to. We need to discuss how
7761 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
7762 in .aux, also remove .bib and .bst files from dependencies when
7765 * src/BufferView.C, src/LyXView.C: add const_cast several places
7766 because of changes to images.
7768 * lib/images/*: same change as for images/*
7770 * lib/lyxrc.example: Default for accept_compound is false not no.
7772 * images/*: changed to be const, however I have som misgivings
7773 about this change so it might be changed back.
7775 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7777 * lib/configure, po/POTFILES.in: regenerated
7779 * autogen.sh: autogenerate lib/configure from lib/configure.m4
7781 * config/lib_configure.m4: removed
7783 * lib/configure.m4: new file (was config/lib_configure.m4)
7785 * configure.in: do not test for rtti, since we do not use it.
7787 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7789 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
7790 doubling of allocated space scheme. This makes it faster for large
7791 strings end to use less memory for small strings. xtra rememoved.
7793 * src/insets/figinset.C (waitalarm): commented out.
7794 (GhostscriptMsg): use static_cast
7795 (GhostscriptMsg): use new instead of malloc to allocate memory for
7796 cmap. also delete the memory after use.
7798 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
7800 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
7801 for changes in bibtex database or style.
7802 (runBibTeX): remove all .bib and .bst files from dep before we
7804 (run): use scanAuc in when dep file already exist.
7806 * src/DepTable.C (remove_files_with_extension): new method
7809 * src/DepTable.[Ch]: made many of the methods const.
7811 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7813 * src/bufferparams.C: make sure that the default textclass is
7814 "article". It used to be the first one by description order, but
7815 now the first one is "docbook".
7817 * src/lyx_main.C (setDebuggingLevel): change type of argument to
7818 string; call Debug::value.
7819 (easyParse): pass complete argument to setDebuggingLevel().
7821 * src/debug.h (value): fix the code that parses debug levels.
7823 * src/debug.h: add new debug type ACTION, reserved for LyXAction
7826 * src/LyXAction.C: use Debug::ACTION as debug channel.
7828 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
7830 * NEWS: updated for the future 1.1.3 release.
7832 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
7833 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
7834 it should. This is of course a controversial change (since many
7835 people will find that their lyx workscreen is suddenly full of
7836 red), but done for the sake of correctness.
7838 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
7839 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
7841 * src/insets/inseterror.h, src/insets/inseturl.h,
7842 src/insets/insetinfo.h, src/insets/figinset.h,
7843 src/mathed/formulamacro.h, src/mathed/math_macro.h
7844 (EditMessage): add a missing const and add _() to make sure that
7847 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
7848 src/insets/insetbib.C, src/support/filetools.C: add `using'
7851 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
7852 doing 'Insert index of last word' at the beginning of a paragraph.
7854 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7856 * several files: white-space changes.
7858 * src/mathed/formula.C: removed IsAlpha and IsDigit
7860 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
7861 .bib file. use a ifstream instead of FilePtr when parsing the .bib
7864 * src/insets/figinset.C (GetPSSizes): don't break when
7865 "EndComments" is seen. But break when a boundingbox is read.
7867 * all classes inherited from Inset: return value of Clone
7868 changed back to Inset *.
7870 * all classes inherited form MathInset: return value of Clone
7871 changed back to MathedInset *.
7873 * src/insets/figinset.C (runqueue): use a ofstream to output the
7874 gs/ps file. Might need some setpresicion or setw. However I can
7875 see no problem with the current code.
7876 (runqueue): use sleep instead of the alarm/signal code. I just
7877 can't see the difference.
7879 * src/paragraph.C (LyXParagraph): reserve space in the new
7880 paragraph and resize the inserted paragraph to just fit.
7882 * src/lyxfunc.h (operator|=): added operator for func_status.
7884 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
7885 check for readable file.
7887 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
7888 check for readable file.
7889 (MenuMakeLinuxDoc): ditto
7890 (MenuMakeDocBook): ditto
7891 (MenuMakeAscii): ditto
7892 (InsertAsciiFile): split the test for openable and readable
7894 * src/bmtable.C (draw_bitmaptable): use
7895 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
7897 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
7898 findtexfile from LaTeX to filetools.
7900 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
7901 instead of FilePtr. Needs to be verified by a literate user.
7903 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7905 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
7906 (EditMessage): likewise.
7908 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
7909 respectively as \textasciitilde and \textasciicircum.
7911 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7913 * src/support/lyxstring.h: made the methods that take iterators
7916 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
7917 (regexMatch): made is use the real regex class.
7919 * src/support/Makefile.am: changed to use libtool
7921 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
7923 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
7925 (MathIsInset ++): changed several macros to be inline functions
7928 * src/mathed/Makefile.am: changed to use libtool
7930 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
7932 * src/insets/inset* : Clone changed to const and return type is
7933 the true insettype not just Inset*.
7935 * src/insets/Makefile.am: changed to use libtool
7937 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
7939 * src/undo.[Ch] : added empty() and changed some of the method
7942 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
7944 * src/lyxparagraph.h: use id() and id(...) instead of getID and
7945 setID use block<> for the bullets array, added const several places.
7947 * src/lyxfunc.C (getStatus): new function
7949 * src/lyxfunc.[Ch] : small changes to take advantage of the new
7950 LyXAction, added const to several funtions.
7952 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
7953 a std::map, and to store the dir items in a vector.
7955 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
7958 * src/LyXView.[Ch] + other files : changed currentView to view.
7960 * src/LyXAction.[Ch] : ported from the old devel branch.
7962 * src/.cvsignore: added .libs and a.out
7964 * configure.in : changes to use libtool.
7966 * acinclude.m4 : inserted libtool.m4
7968 * .cvsignore: added libtool
7970 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7972 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
7973 file name in insets and mathed directories (otherwise the
7974 dependency is not taken in account under cygwin).
7976 * src/text2.C (InsertString[AB]): make sure that we do not try to
7977 read characters past the string length.
7979 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7981 * lib/doc/LaTeXConfig.lyx.in,
7982 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
7984 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
7985 file saying who created them and when this heppened; this is
7986 useless and annoys tools like cvs.
7988 * lib/layouts/g-brief-{en,de}.layout,
7989 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
7990 from Thomas Hartkens <thomas@hartkens.de>.
7992 * src/{insets,mathed}/Makefile.am: do not declare an empty
7993 LDFLAGS, so that it can be set at configure time (useful on Irix
7996 * lib/reLyX/configure.in: make sure that the prefix is set
7997 correctly in LYX_DIR.
7999 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8001 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
8002 be used by 'command-sequence' this allows to bind a key to a
8003 sequence of LyX-commands
8004 (Example: 'command-sequence math-insert alpha; math-insert beta;")
8006 * src/LyXAction.C: add "command-sequence"
8008 * src/LyXFunction.C: handling of "command-sequence"
8010 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
8011 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
8013 * src/lyxserver.C, src/minibuffer.C: Use this new interface
8015 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8017 * src/buffer.C (writeFile): Do not output a comment giving user
8018 and date at the beginning of a .lyx file. This is useless and
8019 annoys cvs anyway; update version number to 1.1.
8021 * src/Makefile.am (LYX_DIR): add this definition, so that a
8022 default path is hardcoded in LyX.
8024 * configure.in: Use LYX_GNU_GETTEXT.
8026 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
8027 AM_GNU_GETTEXT with a bug fixed.
8029 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
8031 * src/chset.C: add "using std::ifstream;" to please dec cxx.
8033 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
8034 which is used to point to LyX data is now LYX_DIR_11x.
8036 * lyx.man: convert to a unix text file; small updates.
8038 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8040 * src/support/LSubstring.[Ch]: made the second arg of most of the
8041 constructors be a const reference.
8043 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
8046 * src/support/lyxstring.[Ch] (swap): added missing member function
8047 and specialization of swap(str, str);
8049 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
8051 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
8052 trace of the old one.
8054 * src/undo.[Ch]: made the undostack use std::list to store undo's in
8055 put the member definitions in undo.C.
8057 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
8058 NEW_TEXT and have now only code that was included when this was
8061 * src/intl.C (LCombo): use static_cast
8063 (DispatchCallback): ditto
8065 * src/definitions.h: removed whole file
8067 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
8069 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
8070 parsing and stores in a std:map. a regex defines the file format.
8071 removed unneeded members.
8073 * src/bufferparams.h: added several enums from definitions.h here.
8074 Removed unsused destructor. Changed some types to use proper enum
8075 types. use block to have the temp_bullets and user_defined_bullets
8076 and to make the whole class assignable.
8078 * src/bufferparams.C (Copy): removed this functions, use a default
8081 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
8084 * src/buffer.C (readLyXformat2): commend out all that have with
8085 oldpapersize to do. also comment out all that hve to do with
8086 insetlatex and insetlatexdel.
8087 (setOldPaperStuff): commented out
8089 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
8091 * src/LyXAction.C: remove use of inset-latex-insert
8093 * src/mathed/math_panel.C (button_cb): use static_cast
8095 * src/insets/Makefile.am (insets_o_SOURCES): removed
8098 * src/support/lyxstring.C (helper): use the unsigned long
8099 specifier, UL, instead of a static_cast.
8101 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
8103 * src/support/block.h: new file. to be used as a c-style array in
8104 classes, so that the class can be assignable.
8106 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8108 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
8109 NULL, make sure to return an empty string (it is not possible to
8110 set a string to NULL).
8112 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8114 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
8116 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
8118 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
8119 link line, so that Irix users (for example) can set it explicitely to
8122 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
8123 it can be overidden at make time (static or dynamic link, for
8126 * src/vc-backend.C, src/LaTeXFeatures.h,
8127 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
8128 statements to bring templates to global namespace.
8130 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8132 * src/support/lyxstring.C (operator[] const): make it standard
8135 * src/minibuffer.C (Init): changed to reflect that more
8136 information is given from the lyxvc and need not be provided here.
8138 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
8140 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
8142 * src/LyXView.C (UpdateTimerCB): use static_cast
8143 (KeyPressMask_raw_callback): ditto
8145 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
8146 buffer_, a lot of changes because of this. currentBuffer() ->
8147 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
8148 also changes to other files because of this.
8150 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8152 * src/vc-backend.[Ch]: new files. The backends for vc handling,
8153 have no support for RCS and partial support for CVS, will be
8156 * src/insets/ several files: changes because of function name
8157 changes in Bufferview and LyXView.
8159 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
8161 * src/support/LSubstring.[Ch]: new files. These implement a
8162 Substring that can be very convenient to use. i.e. is this
8164 string a = "Mary had a little sheep";
8165 Substring(a, "sheep") = "lamb";
8166 a is now "Mary has a little lamb".
8168 * src/support/LRegex.[Ch]: a regex class that can be used to pick
8169 out patterns and subpatterns of strings. It is used by LSubstring
8170 and also by vc-backend.C
8172 * src/support/lyxstring.C: went over all the assertions used and
8173 tried to correct the wrong ones and flag which of them is required
8174 by the standard. some bugs found because of this. Also removed a
8175 couple of assertions.
8177 * src/support/Makefile.am (libsupport_a_SOURCES): added
8178 LSubstring.[Ch] and LRegex.[Ch]
8180 * src/support/FileInfo.h: have struct stat buf as an object and
8181 not a pointer to one, some changes because of this.
8183 * src/LaTeXFeatures.C (getTClassPreamble): also use the
8184 information in layout when adding the layouts preamble to the
8187 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
8190 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
8191 because of bug in OS/2.
8193 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8195 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
8196 \verbatim@font instead of \ttfamily, so that it can be redefined.
8198 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
8199 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
8200 src/layout.h, src/text2.C: add 'using' directive to bring the
8201 STL templates we need from the std:: namespace to the global one.
8202 Needed by DEC cxx in strict ansi mode.
8204 * src/support/LIstream.h,src/support/LOstream.h,
8205 src/support/lyxstring.h,src/table.h,
8206 src/lyxlookup.h: do not include <config.h> in header
8207 files. This should be done in the .C files only.
8209 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
8213 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8215 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
8216 from Kayvan to fix the tth invokation.
8218 * development/lyx.spec.in: updates from Kayvan to reflect the
8219 changes of file names.
8221 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8223 * src/text2.C (InsertStringB): use std::copy
8224 (InsertStringA): use std::copy
8226 * src/bufferlist.C: use a vector to store the buffers in. This is
8227 an internal change and should not affect any other thing.
8229 * src/BufferView.C (waitForX): use XSync instead of the lengthy
8232 * src/text.C (Fill): fix potential bug, one off bug.
8234 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8236 * src/Makefile.am (lyx_main.o): add more files it depends on.
8238 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
8240 * src/support/lyxstring.C: use size_t for the reference count,
8241 size, reserved memory and xtra.
8242 (internal_compare): new private member function. Now the compare
8243 functions should work for std::strings that have embedded '\0'
8245 (compare): all compare functions rewritten to use
8248 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8250 * src/support/lyxstring.C (compare): pass c_str()
8251 (compare): pass c_str
8252 (compare): pass c_str
8254 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8256 * src/support/DebugStream.C: <config.h> was not included correctly.
8258 * lib/configure: forgot to re-generate it :( I'll make this file
8259 auto generated soon.
8261 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8263 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
8266 * src/support/lyxstring.C: some changes from length() to rep->sz.
8267 avoids a function call.
8269 * src/support/filetools.C (SpaceLess): yet another version of the
8270 algorithm...now per Jean-Marc's suggestions.
8272 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8274 * src/layout.C (less_textclass_desc): functor for use in sorting
8276 (LyXTextClass::Read): sort the textclasses after reading.
8278 * src/support/filetools.C (SpaceLess): new version of the
8279 SpaceLess functions. What problems does this one give? Please
8282 * images/banner_bw.xbm: made the arrays unsigned char *
8284 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8286 * src/support/lyxstring.C (find): remove bogus assertion in the
8287 two versions of find where this has not been done yet.
8289 * src/support/lyxlib.h: add missing int return type to
8292 * src/menus.C (ShowFileMenu): disable exporting to html if no
8293 html export command is present.
8295 * config/lib_configure.m4: add a test for an HTML converter. The
8296 programs checked for are, in this order: tth, latex2html and
8299 * lib/configure: generated from config/lib_configure.m4.
8301 * src/lyxfunc.C (Dispatch): update and improve the execution of an
8302 html converter. The parameters are now passed through $$FName and
8303 $$OutName, instead of standard input/output.
8305 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
8307 * lib/lyxrc.example: update description of \html_command.
8308 add "quotes" around \screen_font_xxx font setting examples to help
8309 people who use fonts with spaces in their names.
8311 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8313 * Distribution files: updates for v1.1.2
8315 * src/support/lyxstring.C (find): remove bogus assert and return
8316 npos for the same condition.
8318 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8320 * added patch for OS/2 from SMiyata.
8322 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8324 * src/text2.C (CutSelection): make space_wrapped a bool
8325 (CutSelection): dont declare int i until we have to.
8326 (alphaCounter): return a char const *.
8328 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8330 * src/support/syscall.C (Systemcalls::kill):
8331 src/support/filetools.C (PutEnv, PutEnvPath):
8332 src/lyx_cb.C (addNewlineAndDepth):
8333 src/FontInfo.C (FontInfo::resize): condition some #warning
8334 directives with WITH_WARNINGS.
8337 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8339 * src/layout.[Ch] + several files: access to class variables
8340 limited and made accessor functions instead a lot of code changed
8341 becuase of this. Also instead of returning pointers often a const
8342 reference is returned instead.
8344 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
8346 * src/Makefile.am (dist-hook): added used to remove the CVS from
8347 cheaders upon creating a dist
8348 (EXTRA_DIST): added cheaders
8350 * src/support/lstrings.C (tostr(char)): fix it to handle param as
8351 a character not as a small integer.
8353 * src/support/lyxstring.C (find): removed Assert and added i >=
8354 rep->sz to the first if.
8356 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8358 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
8359 src/LyXView.C src/buffer.C src/bufferparams.C
8360 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
8361 src/text2.C src/insets/insetinclude.C:
8362 lyxlayout renamed to textclasslist.
8364 * src/layout.C: some lyxerr changes.
8366 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
8367 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
8368 (LyXLayoutList): removed all traces of this class.
8369 (LyXTextClass::Read): rewrote LT_STYLE
8370 (LyXTextClass::hasLayout): new function
8371 (LyXTextClass::GetLayout): rewritten to return an iterator + has
8372 both const and nonconst version.
8373 (LyXTextClass::delete_layout): new function.
8374 (LyXTextClassList::Style): bug fix. do the right thing if layout
8376 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
8377 (LyXTextClassList::NameOfLayout): ditto
8378 (LyXTextClassList::Load): ditto
8380 * src/buffer.C (makeLaTeXFile): new access to layoutlist
8382 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
8384 * src/LyXAction.C (LookupFunc): added a workaround for sun
8385 compiler, on the other hand...we don't know if the current code
8386 compiles on sun at all...
8388 * src/support/filetools.C (CleanupPath): subst fix
8390 * src/insets/insetbib.C (delDatabase): subst fix, this looks
8393 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
8394 complained about this one?
8396 * src/insets/insetinclude.C (Latex): subst fix
8398 * src/insets/insetbib.C (getKeys): subst fix
8400 * src/LyXSendto.C (SendtoApplyCB): subst fix
8402 * src/lyx_main.C (init): subst fix
8404 * src/layout.C (Read): subst fix
8406 * src/lyx_sendfax_main.C (button_send): subst fix
8408 * src/buffer.C (RoffAsciiTable): subst fix
8410 * src/lyx_cb.C (MenuFax): subst fix
8411 (PrintApplyCB): subst fix
8413 1999-10-26 Juergen Vigna <jug@sad.it>
8415 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
8417 (Read): Cleaned up this code so now we read only format vestion >= 5
8419 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8421 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
8422 come nobody has complained about this one?
8424 * src/insets/insetinclude.C (Latex): subst fix
8426 * src/insets/insetbib.C (getKeys): subst fix
8428 * src/lyx_main.C (init): subst fix
8430 * src/layout.C (Read): subst fix
8432 * src/buffer.C (RoffAsciiTable): subst fix
8434 * src/lyx_cb.C (MenuFax): subst fix.
8436 * src/layout.[hC] + some other files: rewrote to use
8437 std::container to store textclasses and layouts in.
8438 Simplified, removed a lot of code. Make all classes
8439 assignable. Further simplifications and review of type
8440 use still to be one.
8442 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
8443 lastfiles to create the lastfiles partr of the menu.
8445 * src/lastfiles.[Ch]: rewritten to use deque to store the
8446 lastfiles in. Uses fstream for reading and writing. Simplifies
8449 * src/support/syscall.C: remove explicit cast.
8451 * src/BufferView.C (CursorToggleCB): removed code snippets that
8453 use explicat C++ style casts instead of C style casts. also use
8454 u_vdata instea of passing pointers in longs.
8456 * src/PaperLayout.C: removed code snippets that were commented out.
8458 * src/lyx_gui_misc.C: removed code snippets that were commented out.
8460 * src/lyx_main.C: removed code snippets that wer commented out.
8462 * src/paragraph.C: removed code snippets that were commented out.
8464 * src/lyxvc.C (logClose): use static_cast
8466 (viewLog): remove explicit cast to void*
8467 (showLog): removed old commented code
8469 * src/menus.C: use static_cast instead of C style casts. use
8470 u_vdata instead of u_ldata. remove explicit cast to (long) for
8471 pointers. Removed old code that was commented out.
8473 * src/insets/inset.C: removed old commented func
8475 * src/insets/insetref.C (InsetRef): removed old code that had been
8476 commented out for a long time.
8478 (escape): removed C style cast
8480 * src/insets/insetlatexaccent.C (Draw): removed old commented code
8482 * src/insets/insetlatex.C (Draw): removed old commented code
8483 (Read): rewritten to use string
8485 * src/insets/insetlabel.C (escape): removed C style cast
8487 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
8489 * src/insets/insetindex.C: use static_cast and u_vdata, removed
8492 * src/insets/insetinclude.h: removed a couple of stupid bools
8494 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
8495 (Clone): remove C style cast
8496 (getKeys): changed list to lst because of std::list
8498 * src/insets/inseterror.C (Draw): removed som old commented code.
8500 * src/insets/insetcommand.C (Draw): removed some old commented code.
8502 * src/insets/insetbib.C (bibitem_cb): removed code that has been
8503 commented out forever.
8504 (bibitem_cb): use static_cast instead of C style cast
8505 use of vdata changed to u_vdata.
8507 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
8509 (CloseUrlCB): use static_cast instead of C style cast.
8510 (CloseUrlCB): added a fl_free form...it seemed to be missing.
8512 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
8513 (C_InsetInfo_CloseInfoCB): forward the ob parameter
8514 (CloseInfoCB): static_cast from ob->u_vdata instead.
8515 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
8518 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
8519 (C_InsetError_CloseErrorCB): forward the ob parameter
8520 (CloseErrorCB): static_cast from ob->u_vdata instead.
8522 * src/vspace.h: include LString.h since we use string in this class.
8524 * src/vspace.C (lyx_advance): changed name from advance because of
8525 nameclash with stl. And since we cannot use namespaces yet...I
8526 used a lyx_ prefix instead. Expect this to change when we begin
8529 * src/BufferView.[Ch] (BufferView::~BufferView): removed
8531 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
8532 and removed now defunct constructor and deconstructor.
8534 * src/BufferView.h: have backstack as a object not as a pointer.
8535 removed initialization from constructor. added include for BackStack
8537 * development/lyx.spec.in (%build): add CFLAGS also.
8539 * src/screen.C (drawFrame): removed another warning.
8541 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8543 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
8544 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
8545 README and ANNOUNCE a bit for the next release. More work is
8548 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
8549 unbreakable if we are in freespacing mode (LyX-Code), but not in
8552 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8554 * src/BackStack.h: fixed initialization order in constructor
8556 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
8558 * acinclude.m4 (VERSION): new rules for when a version is
8559 development, added also a variable for prerelease.
8560 (warnings): we set with_warnings=yes for prereleases
8561 (lyx_opt): prereleases compile with same optimization as development
8562 (CXXFLAGS): only use pedantic if we are a development version
8564 * src/BufferView.C (restorePosition): don't do anything if the
8567 * src/BackStack.h: added member empty, use this to test if there
8568 is anything to pop...
8570 1999-10-25 Juergen Vigna <jug@sad.it>
8573 * forms/layout_forms.fd +
8574 * forms/latexoptions.fd +
8575 * lyx.fd: changed for various form resize issues
8577 * src/mathed/math_panel.C +
8578 * src/insets/inseterror.C +
8579 * src/insets/insetinfo.C +
8580 * src/insets/inseturl.C +
8581 * src/insets/inseturl.h +
8584 * src/PaperLayout.C +
8585 * src/ParagraphExtra.C +
8586 * src/TableLayout.C +
8588 * src/layout_forms.C +
8595 * src/menus.C: fixed various resize issues. So now forms can be
8596 resized savely or not be resized at all.
8598 * forms/form_url.fd +
8599 * src/insets/form_url.[Ch]: added because it's cleaner and easier
8602 * src/insets/Makefile.am: added files form_url.[Ch]
8604 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8606 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
8607 (and presumably 6.2).
8609 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
8610 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
8611 remaining static member callbacks.
8613 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
8616 * src/support/lyxstring.h: declare struct Srep as friend of
8617 lyxstring, since DEC cxx complains otherwise.
8619 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8621 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8623 * src/LaTeX.C (run): made run_bibtex also depend on files with
8625 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
8626 are put into the dependency file.
8628 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
8629 the code has shown itself to work
8630 (create_ispell_pipe): removed another warning, added a comment
8633 * src/minibuffer.C (ExecutingCB): removed code that has been
8634 commented out a long time
8636 * src/lyxfunc.C (processKeyEvent): removed some very old commented
8637 out code + a warning.
8639 * src/support/lyxstring.h: comment out the three private
8640 operators, when compiling with string ansi conforming compilers
8643 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
8645 (pixmapFromBitmapData): change type of bdata to be unsigned char *
8646 (pixmapFromBitmapData): add a reinterpret_cast in the call to
8649 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
8652 * src/mathed/math_panel.C (create_math_panel): remove explicit
8655 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
8658 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
8659 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
8660 to XCreatePixmapFromBitmapData
8661 (fl_set_bmtable_data): change the last argument to be unsigned
8663 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
8664 and bh to be unsigned int, remove explicit casts in call to
8665 XReadBitmapFileData.
8667 * images/arrows.xbm: made the arrays unsigned char *
8668 * images/varsz.xbm: ditto
8669 * images/misc.xbm: ditto
8670 * images/greek.xbm: ditto
8671 * images/dots.xbm: ditto
8672 * images/brel.xbm: ditto
8673 * images/bop.xbm: ditto
8675 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
8677 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
8678 (LYX_PROG_CXX): added -pedantic to g++ compile options when
8679 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
8681 (LYX_CXX_CHEADERS): added <clocale> to the test.
8683 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
8685 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
8687 * src/support/lyxstring.C (append): fixed something that must be a
8688 bug, rep->assign was used instead of rep->append.
8690 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
8693 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
8694 lyx insert double chars. Fix spotted by Kayvan.
8696 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8698 * Fixed the tth support. I messed up with the Emacs patch apply feature
8699 and omitted the changes in lyxrc.C.
8701 1999-10-22 Juergen Vigna <jug@sad.it>
8703 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
8705 * src/lyx_cb.C (MenuInsertRef) +
8706 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
8707 the form cannot be resized under it limits (fixes a segfault)
8709 * src/lyx.C (create_form_form_ref) +
8710 * forms/lyx.fd: Changed Gravity on name input field so that it is
8713 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8715 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
8716 <ostream> and <istream>.
8718 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
8719 whether <fstream> provides the latest standard features, or if we
8720 have an oldstyle library (like in egcs).
8721 (LYX_CXX_STL_STRING): fix the test.
8723 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
8724 code on MODERN_STL_STREAM.
8726 * src/support/lyxstring.h: use L{I,O}stream.h.
8728 * src/support/L{I,O}stream.h: new files, designed to setup
8729 correctly streams for our use
8730 - includes the right header depending on STL capabilities
8731 - puts std::ostream and std::endl (for LOStream.h) or
8732 std::istream (LIStream.h) in toplevel namespace.
8734 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8736 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
8737 was a bib file that had been changed we ensure that bibtex is run.
8738 (runBibTeX): enhanced to extract the names of the bib files and
8739 getting their absolute path and enter them into the dep file.
8740 (findtexfile): static func that is used to look for tex-files,
8741 checks for absolute patchs and tries also with kpsewhich.
8742 Alternative ways of finding the correct files are wanted. Will
8744 (do_popen): function that runs a command using popen and returns
8745 the whole output of that command in a string. Should be moved to
8748 * src/DepTable.[Ch] (extchanged): new function that returns true if a
8749 file with extension ext has changed.
8751 * src/insets/figinset.C: added ifdef guards around the fl_free
8752 code that jug commented out. Now it is commented out when
8753 compiling with XForms == 0.89.
8755 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
8756 to lyxstring.C, and only keep a forward declaration in
8757 lyxstring.h. Simplifies the header file a bit and should help a
8758 bit on compile time too. Also changes to Srep will not mandate a
8759 recompile of code just using string.
8760 (~lyxstring): definition moved here since it uses srep.
8761 (size): definition moved here since it uses srep.
8763 * src/support/lyxstring.h: removed a couple of "inline" that should
8766 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8768 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
8771 1999-10-21 Juergen Vigna <jug@sad.it>
8773 * src/table.C (SetPWidth): Just a small fix so the alignment is not
8774 set to left if I just remove the width entry (or it is empty).
8776 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
8777 paragraph when having dummy paragraphs.
8779 1999-10-20 Juergen Vigna <jug@sad.it>
8781 * src/insets/figinset.C: just commented some fl_free_form calls
8782 and added warnings so that this calls should be activated later
8783 again. This avoids for now a segfault, but we have a memory leak!
8785 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
8786 'const char * argument' to 'string argument', this should
8787 fix some Asserts() in lyxstring.C.
8789 * src/lyxfunc.h: Removed the function argAsString(const char *)
8790 as it is not used anymore.
8792 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8794 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
8797 * src/Literate.h: some funcs moved from public to private to make
8798 interface clearer. Unneeded args removed.
8800 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
8802 (scanBuildLogFile): ditto
8804 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
8805 normal TeX Error. Still room for improvement.
8807 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
8809 * src/buffer.C (insertErrors): changes to make the error
8810 desctription show properly.
8812 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
8815 * src/support/lyxstring.C (helper): changed to use
8816 sizeof(object->rep->ref).
8817 (operator>>): changed to use a pointer instead.
8819 * src/support/lyxstring.h: changed const reference & to value_type
8820 const & lets see if that helps.
8822 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8824 * Makefile.am (rpmdist): fixed to have non static package and
8827 * src/support/lyxstring.C: removed the compilation guards
8829 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
8832 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
8833 conditional compile of lyxstring.Ch
8835 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
8836 stupid check, but it is a lot better than the bastring hack.
8837 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
8839 * several files: changed string::erase into string::clear. Not
8842 * src/chset.C (encodeString): use a char temporary instead
8844 * src/table.C (TexEndOfCell): added tostr around
8845 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
8846 (TexEndOfCell): ditto
8847 (TexEndOfCell): ditto
8848 (TexEndOfCell): ditto
8849 (DocBookEndOfCell): ditto
8850 (DocBookEndOfCell): ditto
8851 (DocBookEndOfCell): ditto
8852 (DocBookEndOfCell): ditto
8854 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
8856 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
8858 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
8859 (MenuBuildProg): added tostr around ret
8860 (MenuRunChktex): added tostr around ret
8861 (DocumentApplyCB): added tostr around ret
8863 * src/chset.C (encodeString): added tostr around t->ic
8865 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
8866 (makeLaTeXFile): added tostr around tocdepth
8867 (makeLaTeXFile): added tostr around ftcound - 1
8869 * src/insets/insetbib.C (setCounter): added tostr around counter.
8871 * src/support/lyxstring.h: added an operator+=(int) to catch more
8874 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
8875 (lyxstring): We DON'T allow NULL pointers.
8877 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8879 * src/mathed/math_macro.C (MathMacroArgument::Write,
8880 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
8881 when writing them out.
8883 * src/LString.C: remove, since it is not used anymore.
8885 * src/support/lyxstring.C: condition the content to
8886 USE_INCLUDED_STRING macro.
8888 * src/mathed/math_symbols.C, src/support/lstrings.C,
8889 src/support/lyxstring.C: add `using' directive to specify what
8890 we need in <algorithm>. I do not think that we need to
8891 conditionalize this, but any thought is appreciated.
8893 * many files: change all callback functions to "C" linkage
8894 functions to please strict C++ compilers like DEC cxx 6.1 in mode
8895 strict_ansi. Those who were static are now global.
8896 The case of callbacks which are static class members is
8897 trickier, since we have to make C wrappers around them (see
8898 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
8899 did not finish this yet, since it defeats the purpose of
8900 encapsulation, and I am not sure what the best route is.
8902 1999-10-19 Juergen Vigna <jug@sad.it>
8904 * src/support/lyxstring.C (lyxstring): we permit to have a null
8905 pointer as assignment value and just don't assign it.
8907 * src/vspace.C (nextToken): corrected this function substituting
8908 find_first(_not)_of with find_last_of.
8910 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
8911 (TableOptCloseCB) (TableSpeCloseCB):
8912 inserted fl_set_focus call for problem with fl_hide_form() in
8915 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8917 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
8920 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8922 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
8923 LyXLex::next() and not eatline() to get its argument.
8925 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8927 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
8928 instead, use fstreams for io of the depfile, removed unneeded
8929 functions and variables.
8931 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
8932 vector instead, removed all functions and variables that is not in
8935 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8937 * src/buffer.C (insertErrors): use new interface to TeXError
8939 * Makefile.am (rpmdist): added a rpmdist target
8941 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
8942 per Kayvan's instructions.
8944 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8946 * src/Makefile.am: add a definition for localedir, so that locales
8947 are found after installation (Kayvan)
8949 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8951 * development/.cvsignore: new file.
8953 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8955 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
8956 C++ compiler provides wrappers for C headers and use our alternate
8959 * configure.in: use LYX_CXX_CHEADERS.
8961 * src/cheader/: new directory, populated with cname headers from
8962 libstdc++-2.8.1. They are a bit old, but probably good enough for
8963 what we want (support compilers who lack them).
8965 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
8966 from includes. It turns out is was stupid.
8968 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8970 * lib/Makefile.am (install-data-local): forgot a ';'
8971 (install-data-local): forgot a '\'
8972 (libinstalldirs): needed after all. reintroduced.
8974 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8976 * configure.in (AC_OUTPUT): added lyx.spec
8978 * development/lyx.spec: removed file
8980 * development/lyx.spec.in: new file
8982 * po/*.po: merged with lyx.pot becuase of make distcheck
8984 * lib/Makefile.am (dist-hook): added dist-hook so that
8985 documentation files will be included when doing a make
8986 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
8987 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
8989 more: tried to make install do the right thing, exclude CVS dirs
8992 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
8993 Path would fit in more nicely.
8995 * all files that used to use pathstack: uses now Path instead.
8996 This change was a lot easier than expected.
8998 * src/support/path.h: new file
9000 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
9002 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
9004 * src/support/lyxstring.C (getline): Default arg was given for
9007 * Configure.cmd: removed file
9009 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9011 * src/support/DebugStream.[Ch]: remove the explicit std:: before
9012 streams classes and types, add the proper 'using' statements when
9013 MODERN_STL is defined.
9015 * src/debug.h: move the << operator definition after the inclusion
9018 * src/support/filetools.C: include "LAssert.h", which is needed
9021 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
9024 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
9025 include "debug.h" to define a proper ostream.
9027 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9029 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
9030 method to the SystemCall class which can kill a process, but it's
9031 not fully implemented yet.
9033 * src/*.C: Changed Systemcalls::Startscript() to startscript()
9035 * src/support/FileInfo.h: Better documentation
9037 * src/lyxfunc.C: Added support for buffer-export html
9039 * src/menus.C: Added Export->As HTML...
9041 * lib/bind/*.bind: Added short-cut for buffer-export html
9043 * src/lyxrc.*: Added support for new \tth_command
9045 * lib/lyxrc.example: Added stuff for new \tth_command
9047 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9049 * lib/Makefile.am (IMAGES): removed images/README
9050 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
9051 installes in correct place. Check permisions is installed
9054 * src/LaTeX.C: some no-op changes moved declaration of some
9057 * src/LaTeX.h (LATEX_H): changed include guard name
9059 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9061 * lib/reLyX/Makefile.am: install noweb2lyx.
9063 * lib/Makefile.am: install configure.
9065 * lib/reLyX/configure.in: declare a config aux dir; set package
9066 name to lyx (not sure what the best solution is); generate noweb2lyx.
9068 * lib/layouts/egs.layout: fix the bibliography layout.
9070 1999-10-08 Jürgen Vigna <jug@sad.it>
9072 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
9073 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
9074 it returned without continuing to search the path.
9076 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9078 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
9079 also fixes a bug. It is not allowed to do tricks with std::strings
9080 like: string a("hei"); &a[e]; this will not give what you
9081 think... Any reason for the complexity in this func?
9083 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
9085 * Updated README and INSTALL a bit, mostly to check that my
9086 CVS rights are correctly set up.
9088 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9090 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
9091 does not allow '\0' chars but lyxstring and std::string does.
9093 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9095 * autogen.sh (AUTOCONF): let the autogen script create the
9096 POTFILES.in file too. POTFILES.in should perhaps now not be
9097 included in the cvs module.
9099 * some more files changed to use C++ includes instead of C ones.
9101 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
9103 (Reread): added tostr to nlink. buggy output otherwise.
9104 (Reread): added a string() around szMode when assigning to Buffer,
9105 without this I got a log of garbled info strings.
9107 * acconfig.h: commented out the PTR_AS_INT macros. They should not
9110 * I have added several ostream & operator<<(ostream &, some_type)
9111 functions. This has been done to avoid casting and warnings when
9112 outputting enums to lyxerr. This as thus eliminated a lot of
9113 explicit casts and has made the code clearer. Among the enums
9114 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
9115 mathed enums, some font enum the Debug::type enum.
9117 * src/support/lyxstring.h (clear): missing method. equivalent of
9120 * all files that contained "stderr": rewrote constructs that used
9121 stderr to use lyxerr instead. (except bmtable)
9123 * src/support/DebugStream.h (level): and the passed t with
9124 Debug::ANY to avoid spurious bits set.
9126 * src/debug.h (Debug::type value): made it accept strings of the
9129 * configure.in (Check for programs): Added a check for kpsewhich,
9130 the latex generation will use this later to better the dicovery of
9133 * src/BufferView.C (create_view): we don't need to cast this to
9134 (void*) that is done automatically.
9135 (WorkAreaButtonPress): removed some dead code.
9137 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9139 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
9140 is not overwritten when translated (David Sua'rez de Lis).
9142 * lib/CREDITS: Added David Sua'rez de Lis
9144 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
9146 * src/bufferparams.C (BufferParams): default input encoding is now
9149 * acinclude.m4 (cross_compiling): comment out macro
9150 LYX_GXX_STRENGTH_REDUCE.
9152 * acconfig.h: make sure that const is not defined (to empty) when
9153 we are compiling C++. Remove commented out code using SIZEOF_xx
9156 * configure.in : move the test for const and inline as late as
9157 possible so that these C tests do not interefere with C++ ones.
9158 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
9159 has not been proven.
9161 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9163 * src/table.C (getDocBookAlign): remove bad default value for
9166 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
9168 (ShowFileMenu2): ditto.
9170 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
9173 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9175 * Most files: finished the change from the old error code to use
9176 DebugStream for all lyxerr debugging. Only minor changes remain
9177 (e.g. the setting of debug levels using strings instead of number)
9179 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9181 * src/layout.C (Add): Changed to use compare_no_case instead of
9184 * src/FontInfo.C: changed loop variable type too string::size_type.
9186 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9188 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
9189 set ETAGS_ARGS to --c++
9191 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
9193 * src/table.C (DocBookEndOfCell): commented out two unused variables
9195 * src/paragraph.C: commented out four unused variables.
9197 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
9198 insed a if clause with type string::size_type.
9200 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
9203 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
9205 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
9206 variable, also changed loop to go from 0 to lenght + 1, instead of
9207 -1 to length. This should be correct.
9209 * src/LaTeX.C (scanError): use string::size_type as loop variable
9212 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
9213 (l.896) since y_tmp and row was not used anyway.
9215 * src/insets/insetref.C (escape): use string::size_type as loop
9218 * src/insets/insetquotes.C (Width): use string::size_type as loop
9220 (Draw): use string::size_type as loop variable type.
9222 * src/insets/insetlatexaccent.C (checkContents): use
9223 string::size_type as loop variable type.
9225 * src/insets/insetlabel.C (escape): use string::size_type as loop
9228 * src/insets/insetinfo.C: added an extern for current_view.
9230 * src/insets/insetcommand.C (scanCommand): use string::size_type
9231 as loop variable type.
9233 * most files: removed the RCS tags. With them we had to recompile
9234 a lot of files after a simple cvs commit. Also we have never used
9235 them for anything meaningful.
9237 * most files: tags-query-replace NULL 0. As adviced several plases
9238 we now use "0" instead of "NULL" in our code.
9240 * src/support/filetools.C (SpaceLess): use string::size_type as
9243 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9245 * src/paragraph.C: fixed up some more string stuff.
9247 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9249 * src/support/filetools.h: make modestr a std::string.
9251 * src/filetools.C (GetEnv): made ch really const.
9253 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
9254 made code that used these use max/min from <algorithm> instead.
9256 * changed several c library include files to their equivalent c++
9257 library include files. All is not changed yet.
9259 * created a support subdir in src, put lyxstring and lstrings
9260 there + the extra files atexit, fileblock, strerror. Created
9261 Makefile.am. edited configure.in and src/Makefile.am to use this
9262 new subdir. More files moved to support.
9264 * imported som of the functions from repository lyx, filetools
9266 * ran tags-query-replace on LString -> string, corrected the bogus
9267 cases. Tried to make use of lstrings.[hC], debugged a lot. There
9268 is still some errors in there. This is errors where too much or
9269 too litle get deleted from strings (string::erase, string::substr,
9270 string::replace), there can also be some off by one errors, or
9271 just plain wrong use of functions from lstrings. Viewing of quotes
9274 * LyX is now running fairly well with string, but there are
9275 certainly some bugs yet (see above) also string is quite different
9276 from LString among others in that it does not allow null pointers
9277 passed in and will abort if it gets any.
9279 * Added the revtex4 files I forgot when setting up the repository.
9281 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9283 * All over: Tried to clean everything up so that only the files
9284 that we really need are included in the cvs repository.
9285 * Switched to use automake.
9286 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
9287 * Install has not been checked.
9289 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9291 * po/pt.po: Three errors:
9292 l.533 and l.538 format specification error
9293 l. 402 duplicate entry, I just deleted it.