1 2001-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
3 * src/support/snprintf.c (va_copy): only define va_copy if undefined
5 2001-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7 * src/lyxvc.C (showLog): give the tempfile a mask
9 * src/lyx_cb.C (AutoSave): five tempfile a mask, enter the failed
12 * src/support/filetools.C (IsDirWriteable): give the tempfile a
13 mask and unlink the tempfile after use.
15 2001-01-04 Juergen Vigna <jug@sad.it>
17 * src/insets/insettabular.C (resetPos): an extra scroll, but we
18 really should redo all this scrolling code!
19 (TabularFeatures): unlock the_locking_inset before add/del rows/colums.
21 * src/text.C (GetVisibleRow): check that y/h values are good otherwise
24 * src/insets/insettabular.C (LocalDispatch): fixes to PASTESELECTION.
25 (pasteSelection): pay attention to multicolumn cells.
26 (calculate_dimensions_of_cells): forgot to reset maxAsc/Desc.
28 2001-01-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
30 * src/mathed/math_panel.C (deco_cb): check the decoration index is
33 * src/frontends/xforms/FormPreferences.C (feedback): apply
34 formatting to the translated string, not to the original one.
35 (printWarning): ditto.
37 * src/gettext.C (_): translate empty string with empty string.
39 * src/frontends/xforms/FormCopyright.C (build): use _() instead of
44 * UPGRADING: mention that tabular format has been changed.
46 2001-01-03 Juergen Vigna <jug@sad.it>
48 * src/insets/insettabular.C (InsetButtonPress): look for button==2
49 and do Clipboard Paste!
51 * src/insets/insettext.C (SetText): added function.
53 * src/insets/insettabular.C (LocalDispatch): Fixed LFUN_PASTE and
54 new LFUN_PASTESELECTION.
56 * src/insets/insettext.C (draw): don't clear if top_x changes.
58 * src/insets/insettabular.C (draw): clear only if the inset didn't
59 change in the draw routine.
61 * src/insets/insettext.C (width): make the width dependant on the
64 * src/text.C (draw): comment out the UpdateInset call.
66 * src/screen.C (DrawOneRow):
67 (DrawFromTo): check for bv->text->status not text->status.
69 * src/insets/insettabular.C (calculate_dimensions_of_cells): calculate
70 dimensions of ascent-descent for the whole row.
72 * src/insets/insettext.C (draw): check also for need_update == INIT.
74 2001-01-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
76 * Makefile.am (EXTRA_DIST): add autogen.sh
78 2001-01-03 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
80 * development/OS2/quick_fix.patch:
81 * lib/configure.cmd: update OS/2 support files.
83 2001-01-02 Juergen Vigna <jug@sad.it>
85 * src/insets/insettabular.C (pasteSelection): rewritten correctly.
87 * src/tabular.C (TeXTopHLine):
88 (TeXBottomHLine): fixed Lars new code.
90 * src/insets/insettext.C (LocalDispatch): added support for math_greek.
92 * src/mathed/math_symbols.C (math_insert_greek): removed current_view
93 from this function and added a BufferView * parameter.
95 * src/mathed/math_symbols.C (math_insert_symbol): ditto
97 2000-12-31 Lars Gullik Bjønnes <larsbj@lyx.org>
99 * src/version.h: set to pre3
101 2000-12-31 Lars Gullik Bjønnes <larsbj@lyx.org>
103 * src/Makefile.am (lyx_SOURCES): added Floating.C
105 * src/Floating.h: moved all the inlines to Floating.C
107 * src/Floating.C: new file
109 2000-12-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
111 * src/frontends/xforms/FormPreferences.C (feedback): fix
112 description of RC_PRINTCOPIESFLAG and RC_PRINTCOLLCOPIESFLAG.
114 2000-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
116 * src/support/FileInfo.h: move unistd.h to after sys/types.h and
119 * src/support/FileInfo.C: don't include sys/types. and sys/stat.h
121 * src/mathed/math_inset.h: move LString.h to be included first
123 * src/insets/insetfloat.C: adjust for change in private variable names
125 * src/frontends/xforms/xform_helpers.h : don't include config.h
127 * src/frontends/xforms/xform_helpers.C: adjust the order of
128 includes, some whitespace changes.
130 * src/trans.C (Load): constify filename and res
132 * src/text2.C (SetCounter): call Floating::name()
134 * src/screen.C: change to not use owner from WorkArea, but from
137 * src/lyxfunc.C: adjust because of changes in Intl.
139 * src/intl.h: make trans a object instead of pointer, inlucd
140 trans_mgr.h in this file.
141 (getTrans): return a reference to TransManager
143 * src/intl.C: don't include trans_mgr.h here
144 modify calls to trans to work on object instead of on pointer
146 * src/WorkArea.h: add using for Signal1
147 comment out forward decl of BufferView.
149 remove class variable owner_ and getter method for this.
151 * src/WorkArea.C: don't include BufferView.h
152 (WorkArea): change to not take a BufferView.h, use signals
154 (scroll_cb): emit signal
156 * src/LaTeXFeatures.C: include Floatlist.h
157 (getPackages): only load float.sty when needed
158 (getMacros): prepare for outputting the correct code to preamble.
160 * src/Floating.h: make all variables private + rename to var_.
161 (Floating): default ctor
162 (Floating): complex ctor to set a complete Floating
168 * src/FloatList.C (FloatList): use Floating's constructor
171 (newFloat): call type()
172 (defaultPlacement): call placement()
173 (operator): new operator
175 * src/BufferView_pimpl.C (Pimpl): modify call to WorkArea
176 (scrollUp): call pimpl's scrollCB
178 (pasteClipboard): constify clip
180 * src/BufferView2.C (insertLyXFile): constify fname, fi and c.
181 (insertErrors): constify desctext, errortext, msgtxt and errorrow
182 (open_new_inset): delete some commented code.
184 * src/BufferView.[Ch] (enterView): comment out
187 (workAreaMotionNotify): ditto
188 (workAreaButtonPress): ditto
191 (workAreaButtonRelease): ditto
192 (workAreaExpose): ditto
194 * config/lyxinclude.m4 (cross_compiling): small stuff to be able
195 to compile with cvs gcc (2.97).
197 2000-12-28 Dekel Tsur <dekelts@tau.ac.il>
199 * lib/ui/default.ui: menu structure cleanup.
201 * lib/languages: add description of entries.
203 2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
205 * src/insets/ExternalTemplate.C (readTemplates): change debug
207 (readTemplate): use lyxlex.printError to report read errors.
210 * src/insets/insetexternal.C (Read): suppress debug message when
213 2000-12-21 Dekel Tsur <dekelts@tau.ac.il>
215 * src/insets/insetinclude.C (Ascii): New method. Currently
216 supports only verbatim input.
218 2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
220 * lib/bind/fi_menus.bind: update from Pauli Virtanen.
222 2000-12-22 Juergen Vigna <jug@sad.it>
224 * src/insets/insettabular.C (InsetButtonPress): do nothing if we
225 have a selection and button == 3.
226 (UpdateLocal): if what == INIT clear selection if existent!
227 (InsetButtonPress): don't activate the cell inset on button==3
229 (LocalDispatch): move curor up/down if exiting an inset which this
232 2000-12-20 Juergen Vigna <jug@sad.it>
234 * src/mathed/formula.C (LocalDispatch): return UNDISPATCHED when
235 calling for the math-panel (do not unlock the math-inset if locked)!
237 * src/text.C (GetVisibleRow): fixed drawing of depth lines inside
238 text-insets (with x-offset).
240 * src/tabular.C (TeXCellPreamble): fixed wrong output of special
241 alignment of multicolumn-cells.
243 2000-12-19 Juergen Vigna <jug@sad.it>
245 * src/lyxfunc.C (Dispatch):
246 * src/bufferview_funcs.C (changeDepth): implemented DEPTH functions
249 2000-12-19 Lars Gullik Bjønnes <larsbj@lyx.org>
251 * src/WorkArea.C (work_area_handler): simplify the key/keysym
252 handling for XForms 0.89, this might have rendered some cases
253 unusable. I have at least deadkeys, accent-xxx and KP_x working.
254 Please report proplems.
256 * src/lyxfunc.C (processKeySym): make the self-insert handling
259 2000-12-18 Baruch Even <baruch.even@writeme.com>
261 * src/LaTeX.C (deplog): fix spelling errors
262 * src/text2.C (CutSelection): ditto
263 * src/lyxfunc.C (Dispatch): ditto
265 2000-12-18 Lars Gullik Bjønnes <larsbj@lyx.org>
267 * lib/layouts/stdlayouts.inc: only allow align Center for Caption
269 * src/mathed/math_inset.C (MathMatrixInset): initialize v_align
270 and h_align in default init.
271 adjust calls to MathedRowSt
273 * src/mathed/math_iter.C: adjust calls to MathedRowSt
274 * src/mathed/math_iter.h (getAD): ditto
276 * src/mathed/math_defs.h (class MathedRowSt): remove friends, add
277 methods setBaseline, ascent, descent
278 (class MathMatrixInset): remove method GetAlign, change h_align
281 * src/lyxfunc.C (processKeySym): discover the correct argument if
282 the action is LFUN_SELFINSERT
284 2000-12-18 Dekel Tsur <dekelts@tau.ac.il>
286 * src/mathed/math_cursor.C (Interpret) Suppress a debug message
289 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
291 * src/support/copy.C: don't include filetools.h
293 * lib/images: revert to old banner, drop the cucumber.
295 2000-12-12 Dekel Tsur <dekelts@tau.ac.il>
297 * src/converter.C (Formats::View): Change the current directory to
298 the directory of the file.
300 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
302 * src/kbsequence.C (addkey): also clear sequence and modifiers if
305 * src/BufferView2.C (theLockingInset): return 0 if text is 0
307 2000-12-17 Dekel Tsur <dekelts@tau.ac.il>
309 * Many files: Fix RTL support for insettext.
311 2000-12-11 John Levon <moz@compsoc.man.ac.uk>
313 * README: add mention of broken ghostscript versions, remove
314 reference to non-existent BUGS file
316 2000-12-13 Angus Leeming <a.leeming@ic.ac.uk>
318 * src/support/lstrings.C (compare_no_case): small fix. When passed
319 length, should use it in the size comparison.
321 2000-12-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
323 * src/insets/insetexternal.C (getScreenLabel): Return a default
324 value if the template label is empty.
326 * src/lyxlookup.C: do not condition on FL_REVISION.
329 * src/sp_form.C: fix the font size of some text entries
331 * src/frontends/xforms/Menubar_pimpl.C (add_toc): honor separator
332 after TOC when there is no TOC.
334 * src/lyxrc.C (readBindFileIfNeeded): new method. Reads the main
335 bind file if it has not been done yet.
336 (read): remove local bindFile variable. Try to fix the handling of
337 RC_BIND and RC_BINDFILE.
339 * src/lyx_main.C (init): use readBindFileIfNeeded().
341 * lib/languages: Change description of german to "German (new
344 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
346 * src/frontends/xforms/FormInset.C (createInset): activate "Ok",
347 "Apply" buttons if arg is non-zero.
349 * src/lyxfunc.C (Dispatch): enable citation to be inserted without
350 launching the popup if sufficient info is passed to
351 LFUN_CITATION_CREATE.
353 2000-11-23 Dekel Tsur <dekelts@tau.ac.il>
355 * src/lyx_cb.C (MenuInsertLabel): Compute a default value for new
356 labels (disabled in 1.1.6).
358 * src/lyxrc.[Ch]: New variable label_init_length
360 * mathed/formula.C (LocalDispatch): Preserve the label when
361 changing from display math to eqnarray (however, the label
362 do not appear at the first line, as one might expects, but at the
364 (LocalDispatch): When inserting a label to a formula which already
365 have a label, the old label is used as default value.
366 Also, if the label is changed, then all references to the label
369 * src/mathed/math_iter.C (setLabel): Allow to set the label
370 even if it is empty. This is needed to allow deletion of a label
373 * src/BufferView2.C (ChangeRefsIfUnique): New method. Changes the
374 refernces only if the old label appears once in the document.
376 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
378 * lib/languages: added ngerman. Patch courtesy of Andreas Gehlert
379 <gehlert@Rcs1.urz.tu-dresden.de>
381 * src/frontends/xforms/FormBase.C: comment out debug.h
383 * src/frontends/xforms/FormGraphics.[Ch] (browseFile): removed. Reuse
384 code in xform_helpers instead.
385 (d-tor): comment out "delete dialog;" and so prevent a crash on exit.
387 * src/frontends/xforms/FormPreferences.C: use AddName() in more places.
388 Use N_(), rather than _() when creating strings to pass to browseFile()
389 because browseFile calls gettext() itself now.
391 * src/frontends/xforms/xform_helpers.C (browseFile): call gettext() and
392 display the filename correctly.
394 2000-12-09 Dekel Tsur <dekelts@tau.ac.il>
396 * src/converter.C (Move): New method. Used to move file or files
397 from temp dir to the output dir. (this fixes the bug that
398 exporting linuxdoc/docbook document to html would not move all
399 html file from temp directory).
401 * src/support/filetools.C (DirList): Fixed.
403 * src/lstrings.C (prefixIs): Fixed (how nobody noticed it before??).
405 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
407 * src/converter.C (Add): Remove $$i when setting latex_command.
409 * src/text.C (IsBoundary): Return false when pos = 0.
411 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
413 * lib/kbd/hebrew.kmap: Add Hebrew points (nikud).
415 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
417 * src/frontends/xforms/FormDocument.C (checkMarginValues): you don't
418 need to empty the fields to turn off use of the geometry package!
420 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
422 * src/lyxparagraph.h, src/paragraph.C (CopyIntoMinibuffer): pass a
423 (Buffer const &), not a (BufferParams const &) and so fix a crash
424 caused by using current_view before it had been initialised. Not
425 the best way to do this, but much easier than changing
426 Inset::Clone(Buffer const &) to Inset::Clone().
429 * src/tabular.C: changed call to CopyIntoMinibuffer().
431 2000-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
433 * lib/ui/default.ui: put TOC at the beginning of the TOC menu.
435 * src/lyxfunc.C (getStatus): disable insertion of floats in a
438 2000-12-06 Angus Leeming <a.leeming@ic.ac.uk>
440 * src/frontends/xforms/FormPreferences.C (ScreenFonts::build):
441 changed filter for screen fonts input filter from int to float
443 * src/frontends/xforms/input_validators.c: removed.
444 * src/frontends/xforms/input_validators.C: new file. Can now call C++
445 functions from within the filter functions.
447 * src/frontends/xforms/input_validators.[Ch]
448 (fl_unsigned_float_filter): new filter function.
450 * src/frontends/xforms/forms/fdfixc.sed: I defy gettext to get
451 confused now! And if you think I'm going to do this in
452 ./forms/fdfix.sh with its "sed -e" declarations, then think again!
454 2000-12-06 Lars Gullik Bjønnes <larsbj@lyx.org>
456 * src/buffer.C (asciiParagraph): small NEW_INSETS fix from Levon
458 * src/WorkArea.C (work_area_handler): don't handle button requests
459 if xbutton.button == 0
461 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
463 * lib/layouts/lyxmacros.inc: do not use \verbatim@font in lyxcode.
464 It creates a lot of interesting problems.
466 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
468 * src/frontends/xforms/Menubar_pimpl.C (openByName): check that
469 the menu exists in the current menubar before opening it.
471 * src/MenuBackend.C (hasSubmenu): new method.
473 * src/frontends/xforms/Menubar_pimpl.C: fix problem with bogus
474 action value by offsetting actions by a large constant (so that
475 bogs choice result will be less than this constant).
477 * lib/bind/fi_menus.bind: more cleanup to menus.
478 * lib/bind/sciword.bind: ditto.
479 * lib/bind/xemacs.bind: ditto.
480 * lib/bind/emacs.bind: ditto.
481 * lib/bind/pt_menus.bind: ditto.
482 * lib/bind/hu_menus.bind: ditto.
484 * src/gettext.h (locale_init): set locale LC_NUMERIC to "C".
486 * INSTALL: update PROBLEMS section.
488 * src/lyxlookup.h: remove condition on xforms version, since we
489 should not include it if not appropriate.
491 2000-12-05 John Levon <moz@compsoc.man.ac.uk>
493 * src/LColor.C: "latex text" -> "latex inset" (from
496 * src/lyxrc.C: "it's" -> "its" (from Angus Leeming)
498 * src/frontends/kde/FormTabularCreate.C:
499 * src/frontends/kde/citationdlg.C:
500 * src/frontends/kde/copyrightdlg.C:
501 * src/frontends/kde/paradlg.C:
502 * src/frontends/kde/paraextradlg.C:
503 * src/frontends/kde/parageneraldlg.C:
504 * src/frontends/kde/printdlg.C:
505 * src/frontends/kde/refdlg.C:
506 * src/frontends/kde/tabcreatedlg.C:
507 * src/frontends/kde/tocdlg.C:
508 * src/frontends/kde/urldlg.C: add necessary headers
511 * src/frontends/kde/dlg/emptytable.C:
512 * src/frontends/kde/dlg/tabstack.C: ctors shouldn't have
513 default parameters (from Angus Leeming)
515 * src/frontends/kde/dlg/moc/.cvsignore:
516 * src/frontends/kde/dlg/.cvsignore:
517 * src/frontends/kde/moc/.cvsignore: fix the library name
520 * src/frontends/kde/paradlg.C:
521 * src/frontends/kde/parageneraldlg.C:
522 * src/frontends/kde/dlg/para.dlg:
523 * src/frontends/kde/dlg/paradlgdata.C: added accelerators
525 * src/frontends/kde/dlg/README: clarified qtarch version
527 * src/frontends/kde/dlg/Makefile.am: removed the
528 dlg rules as they created spontaneous rebuilds
529 (not a good idea as it requires qtarch)
531 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
533 * config/lyxinclude.m4 (LYX_PATH_XFORMS): display also the
534 fixlevel along with xforms version.
536 * src/WorkArea.C (work_area_handler): use stuff in lyxlookup.h when
537 xforms version is strictly less than 0.89.5.
538 * src/lyx_gui.C (LyXGUI): ditto.
539 * src/LyXView.C (show): ditto.
541 2000-12-02 Dekel Tsur <dekelts@tau.ac.il>
543 * src/BufferView_pimpl.C (workAreaMotionNotify): Fixed mouse
544 movement in inset in RTL text.
545 (checkInsetHit): Fixed mouse movement in scrolled inset in RTL text.
546 (workAreaButtonRelease): Do not open a float when there is a selection.
548 * src/insets/insettext.C (cx): Fixed for insets in RTL text.
550 * src/spellchecker.C (RunSpellChecker): Open all floats before
553 * src/text.C (InsertChar): Consider "," as a part of a number
554 (for LTR numbers in RTL text code).
555 (IsBoundary): Fixed (and simplified).
556 (InsertChar): Recalculate cursor boundary.
559 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
561 * src/spellchecker.C: fix figures with pspell enabled
563 * src/insets/figinset.C: workaround for gs hang xforms bug
565 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
567 * lib/bind/??_menus.bind: comment out the entries corresponding to
568 real menus. They should be eventually removed, but I'll let the
569 language maintainers do that.
571 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
573 * src/frontends/kde/parageneraldlg.C:
574 * src/frontends/kde/parageneraldlg.h: don't use
575 a derived class for SpaceAbove/Below
577 * src/frontends/kde/dlg/README: add some info
579 * src/frontends/kde/dlg/*: update data files, update
582 * src/frontends/kde/dlg/moc/Makefile.am: add
585 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
587 * configure.in: add new KDE Makefiles
588 * src/vspace.h: return GlueLength not a normal one
589 * src/support/lstrings.h:
590 * src/support/lstrings.C: add isStrUnsignedInt(),
593 * src/frontends/kde/*: big reorganisation, update
594 FormParagraph, add FormTabCreate
596 2000-12-04 Angus Leeming <a.leeming@ic.ac.uk>
598 * lib/ui/default.ui: small grammatical change.
600 * src/frontends/xforms/xform_macros.h: removed.
602 * src/frontends/xforms/FormBase.C:
603 * src/frontends/xforms/FormPreferences.C:
604 * src/frontends/xforms/Makefile.am: changes associated with removing
605 xform_macros.h. Should make Lars' debugging a little easier.
607 * src/frontends/xforms/FormPreferences.C:
608 * src/frontends/xforms/FormPreferences.h:
609 * src/frontends/xforms/forms/form_preferences.fd (Colors tab): no
610 longer use X11 color name database. HSV and RGB dials/sliders.
611 Please let this be the end of this!
613 2000-11-30 Dekel Tsur <dekelts@tau.ac.il>
615 * Several files: Allow compilation when the compiler doesn't
618 2000-11-30 Angus Leeming <a.leeming@ic.ac.uk>
621 * src/lyx_main.C (commandLineHelp, easyParse): documented remaining
622 command line options.
624 2000-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
626 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use
627 FL_MENU_BUTTON for items in menu bar. Not sure what difference it
630 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
632 * src/frontends/xforms/FormRef.C (updateBrowser):
633 * src/frontends/xforms/forms/form_ref.fd: try clicking on
634 different insets with the sort key active. Now apply this patch!
636 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
638 * src/frontends/xforms/FormPrint.C: set to valid()
639 when we update from the passed parameters.
641 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
643 * src/LColor.C (getFromGUIName): internationalise the comparison.
645 * src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a
646 FormPreferences choice.
648 * src/frontends/xforms/FormPreferences.C: some additional Color safety.
651 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
653 * src/lyxrc.C: more detail for the printer program config
656 * src/LColor.C: ert->latex text. LColor needs a big revamp
657 but will have to wait till after 1.1.6
659 * src/buffer.C: bring up a dialog if we load a document
660 with an un-installed text class, rather than just complain
663 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
665 * src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
666 the browser form for a combox in a tabbed folder. Bug fix courtesy of
667 Steve Lamont <spl@ncmir.ucsd.edu>.
669 * src/frontends/xforms/FormDocument.C (build):
670 * src/frontends/xforms/FormPreferences.C (Language::build):
671 pass tabfolders to Combox::add() in order to use this work around.
673 * src/frontends/xforms/FormCitation.C (connect): remove max size
675 (update): sort list of bibliography keys.
677 * src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser,
679 No max size limitation. Same popup for new and existing insets. Fixes
680 bugs reported by Rob Lahaye.
682 * src/frontends/xforms/FormCitation.C (c-tor):
683 * src/frontends/xforms/FormCopyright.C (c-tor):
684 * src/frontends/xforms/FormError.C (c-tor):
685 * src/frontends/xforms/FormGraphics.C (c-tor):
686 * src/frontends/xforms/FormIndex.C (c-tor):
687 * src/frontends/xforms/FormRef.C (c-tor):
688 * src/frontends/xforms/FormToc.C (c-tor):
689 * src/frontends/xforms/FormUrl.C (c-tor):
690 use correct policy for ButtonController.
692 * src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more.
694 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr
697 * src/frontends/xforms/forms/form_citation.fd: some resizing changes.
699 * src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons.
700 Some resizing changes.
702 2000-11-28 Lars Gullik Bjønnes <larsbj@lyx.org>
704 * configure.in: fix typo
706 * lib/languages: add ukraninian and change no to no_NO
708 * src/lyxfont.[Ch] (setGUISize): comment out setGUISize
710 * src/bufferview_funcs.C (FontSize): use setLyXSize
712 2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
714 * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
715 to check for systems where mkstemp() is available but not declared
716 in headers. The new autoconf macro lyx_CHECK_DECL can be used
717 to check for declarations in headers.
719 2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
721 * forms/bibforms.fd: tiny fix to get it to run with fdesign.
723 * forms/makefile: added bibforms.fd, include_form.fd.
724 Removed lyx_sendfax.fd.
726 * src/LaTeXLog.C (ShowLatexLog):
727 * src/LyXAction.C (init):
728 * src/bufferparams.C (readLanguage): altered messages as suggested by
731 * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
734 * src/credits.C: made fd_form_credits non-static, so that it can be
735 redrawn should the xforms colors be re-mapped.
736 * src/spellchecker.C ditto fd_form_spell_options.
738 * src/filedlg.[Ch] (redraw):
739 * src/intl.[Ch] (redraw):
740 * src/lyxfr0.[Ch] (redraw):
741 * src/insets/figinset.[Ch] (redraw):
742 * src/insets/insetexternal.[Ch] (redraw):
743 new methods, connected to Dialogs::redrawGUI.
745 * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
746 to be connected to Dialogs::redrawGUI.
748 * src/frontends/xforms/FormCitation.C (build):
749 * src/frontends/xforms/FormCopyright.C (build):
750 * src/frontends/xforms/FormError.C (build):
751 * src/frontends/xforms/FormGraphics.C (build):
752 * src/frontends/xforms/FormIndex.C (build):
753 * src/frontends/xforms/FormTabularCreate.[Ch] (update):
754 * src/frontends/xforms/FormToc.C (build):
755 * src/frontends/xforms/FormUrl.C (build):
756 use the ButtonController correctly.
758 * src/frontends/xforms/FormCopyright.C (build):
759 * src/frontends/xforms/forms/form_copyright.fd: moved the text out of
760 the .fd file and into build().
762 * src/frontends/xforms/FormPreferences.C: tiny clean-up.
764 * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
766 * src/frontends/xforms/forms/form_citation.fd:
767 * src/frontends/xforms/forms/form_copyright.fd:
768 * src/frontends/xforms/forms/form_error.fd:
769 * src/frontends/xforms/forms/form_graphics.fd:
770 * src/frontends/xforms/forms/form_index.fd:
771 * src/frontends/xforms/forms/form_toc.fd:
772 * src/frontends/xforms/forms/form_url.fd:
773 renamed some of the objects. Named others explicitly for the first time.
774 Added Restore and Apply buttons where appropriate.
776 * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
779 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
781 * src/version.h: try the pre2 again
783 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
785 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
787 * src/frontends/kde/FormParagraph.C: added using directive.
789 * src/frontends/kde/paradlg.C: added config.h and using directive.
791 * src/frontends/kde/paradlg.h: added std::qualifier.
793 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
795 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
797 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
799 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
801 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
803 * src/version.h: set back to 1.1.6cvs
805 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
807 * src/version.h: set to 1.1.6pre2
809 2000-11-20 Marko Vendelin <markov@ioc.ee>
811 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
813 * src/frontends/gnome/Makefile.am: updated list of XForms object files
815 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
817 * src/LColor.C (init):
818 * src/lyxrc.C (getDescription): changed some comments as suggested by
821 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
822 disconnect the redrawGUI signal in best-practice fashion.
824 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
825 long_opts_tab to reflect the change in name of this tabfolder, as
826 suggested by John Levon.
827 (connect, disconnect): new methods. Don't do much at present other than
828 ensuring that we can't resize the dialog. This just makes xforms go
830 (lots of methods in Colors): made void rather than bool. The idea is
831 to have an isOk() function that keeps track of whether any input is
832 genuinely invalid and should therefore block Save, Apply.
833 Easier to manipulate the counters rapidly.
834 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
835 compiler will like this code. Much cleaner way of doing things.
837 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
839 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
840 rather than simple counters, following suggestion by John Levon.
842 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
843 than engraved frame + text.
845 * src/frontends/xforms/forms/makefile: removed spurious command.
847 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
849 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
851 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
854 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
856 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
857 see what Lars has changed and what is just white space!
858 Now used X directly to ascertain the RGB color associated with the
860 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
862 Added some sort capability.
863 The X11 color name database input is only displayed if the database
864 isn't found in the standard place.
865 Got rid of struct compare_converter; it wasn't used.
866 Probably some other stuff that I've forgotten.
868 * src/frontends/xforms/FormPreferences.h: changed the names of some
869 methods in the Colors struct. Added a couple of structs to help sort
870 colors by name and by RGBColor.
872 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
873 functions into a new class RWInfo.
875 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
876 The dialog is now almost navigable using the keyboard. Unfortunately,
877 the cursor has to be inside a browser for it to be activated. There is
878 no visual feedback for the key shortcuts to the arrow keys (use
879 Alt-appropriate arrow key, Alt-x).
881 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
884 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
885 xform_helpers.[Ch]. See above.
887 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
889 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
891 * src/screen.C (setCursorColor): new method. Sets the color of the
893 (ShowManualCursor): call it.
894 Constify some local variables.
896 * src/LColor.[Ch] (LColor): add entry for cursor
897 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
900 2000-11-19 Juergen Vigna <jug@sad.it>
902 * src/insets/insettabular.C (draw): fixed text border redraw problem.
903 (calculate_dimensions_of_cells): try to boost up when inserting chars.
905 2000-11-15 Rob Lahaye <lahaye@postech.edu>
907 * lib/ui/default.ui: OptItem used for Fax entry
909 2000-11-17 Matej Cepl <cepl@bigfoot.com>
911 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
913 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
915 * src/vspace.C (nextToken): fix so it can handle length phrases like
916 "10mm+-20mm", "40inplus16mmminus10cm" etc.
918 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
920 * src/frontends/xforms/FormPreferences.C: constify several variables
921 (BrowserLyX): rewrite to not need the choice variable
922 (Modify): rewrite to not need the choide variable
923 (compare_converter): make operator const
925 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
926 correct the writing of \set_color
927 (getDescription): return a const string
929 * src/kbsequence.[Ch] (addkey): remove dead code
931 * src/Painter.C (text): remove some commented code
933 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
935 * src/ColorHandler.[Ch]: removed some header files from .h file.
936 Included LColor.h in .C file.
938 * src/LColor.[Ch]: made class copyable so that I could create a
939 system_lcolor instance.
941 * src/Painter.h: removed LColor.h.
943 * src/lyx_gui.C (create_forms): used AddName.
945 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
946 of user preferences/lyxrc file.
948 * src/lyxrc.C (output): output changes to lcolor.
950 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
952 Moved class xformColor to files xform_helpers.[Ch]. These files,
953 Color.[Ch], could now be moved into src if they would be useful to
956 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
957 Also moved FormPreferences::browseFile here as it can be used by any
958 xform dialog with a "Browse" button. FormGraphics is a perfect example.
960 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
961 ReadableFile): changed the FormPreferences methods a little and moved
962 them here as they'll be useful elsewhere also.
964 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
965 Removed some header files and used forward declarations instead.
967 Removed some methods as they'll be useful elsewhere (see above).
969 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
970 Can also now modify the LyX LColors. However, for reasons that I don't
971 yet understand, it appears that we can use
972 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
973 present. The problem appears to lie in ColorHandler, because I can
974 change the color using LColor.SetColor(). Similarly, when reading in a
975 preferences file with some set_color instances, I'll get a warning
976 like: Color sea green is undefined or may not be redefined
977 Bad lyxrc set_color for sea green
979 Once the buffer is loaded, however, I can happily change to this color.
981 Finally, it appears that I have to set the color of "inset frame"
982 explicitly, or it oscillates from "black" to "indian red" with each
985 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
987 * ANNOUNCE: corrected a spelling mistake.
989 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
992 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
994 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
996 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
999 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
1000 match the requirements from the standard better. This is required
1001 to work with gnu libstdc++-v3
1003 * src/frontends/xforms/FormPreferences.C: add explict pair
1004 arguments to browse calls. include support/lyxmanip.h remvoe
1005 extern fmt. whitespace changes. reorder variables in
1006 FormPreferences.h, to match initalizaton order.
1008 * several files: constify more local variables.
1010 * src/buffer.C: remove some commented functions.
1012 * src/DepTable.C (remove_files_with_extension): temporary
1013 work around for gcc 2.97
1014 * src/filedlg.C (find): ditto
1015 * src/Variables.C (set): ditto
1016 * src/LyXAction.C (searchActionArg): ditto
1017 (retrieveActionArg): ditto
1019 * configure.in: check for mktemp too
1021 * UPGRADING: prepare for 1.1.6
1023 * Makefile.am (lgbtags): add backup tags for when etags are
1024 different than usual.
1026 * ANNOUNCE: prepare for 1.1.6
1028 * src/support/tempname.C (make_tempfile): new function, wrapper
1029 around mkstemp and mktemp. Only mkstemp has been tested.
1030 (tempName): call it.
1032 2000-11-14 Rob Lahaye <lahaye@postech.edu>
1034 * default.ui: capitalized some menu items to improve shortcuts.
1036 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1038 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
1040 * src/frontends/xforms/Dialogs.C: add "using" directive.
1042 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
1044 * src/filedlg.C (Select): highlight suggested file in browser, if
1047 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
1048 each tab folder is encapsulated in its own class.
1049 The Language keymaps are now chosen using a text input and a
1050 browser button, rather than a Combox.
1051 All the browser buttons are now functional, although LyXFileDlg
1052 still needs to be modified to make it straighhtforward to return a
1053 directory if that is what is desired.
1055 * src/frontends/xforms/forms/form_preferences.fd: use text input
1056 and browse button to input the Language keymaps. Add a few
1057 callbacks for the browse buttons.
1059 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1061 * src/support/tempname.C (tempName): small changes to make it
1062 safer. remove the '.' before XXXXXX
1064 * src/support/filetools.C (TmpFileName): remove func
1067 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
1068 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
1069 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
1070 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
1072 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
1073 (FormCommand): ditto
1075 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
1078 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
1079 for bp (this fixes a reproducible hard crash)
1081 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
1084 * src/frontends/xforms/FormBase.h: make bp_ private
1085 (FormBaseBI): remove default for bp
1088 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
1091 * src/frontends/xforms/Color.C (RGBColor): made several vars
1092 const, changed initialization of j to allow it to be const
1095 * several files: added const to local variables.
1097 * src/lyx_cb.C: removed several function prototypes and moved them
1101 (UpdateLayoutPreamble):
1103 (MenuInsertLabel): add BufferView as arguemnt
1104 (LayoutsCB): make tmp const
1106 * src/layout_forms.h: regenerated
1108 * src/debug.C: add Debug::FILES
1109 (showLevel) (showTags): translate the desc
1111 * src/debug.h: add FILES as debug target
1113 * src/bufferlist.C: use current_view as an interim measure becuase
1114 of added arguments to MenuWrite and MenuWriteAs
1116 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
1118 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
1120 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
1121 libstdc++ is compiled with.
1123 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
1125 * lib/layouts/docbook-book.layout
1126 * lib/layouts/docbook.layout
1127 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
1128 those paragraphs are expresse as SGML comments <!-- -->.
1130 * src/LaTeXFeatures.h
1131 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
1132 parameter, this allows to express all the include files as relative
1133 paths to the master buffer. The verbatim insert works as the other
1136 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
1138 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
1140 (MakeDocBookFile): top_element is always written. Some clean up, as
1141 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
1143 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
1144 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
1145 a reference is written instead of the name.
1146 (Validate): use the relative path for the filename.
1148 * src/insets/insetlabel.C (DocBook): write end tag, for XML
1151 * src/support/filetools.h
1152 * src/support/filetools.C (IsSGMLFilename): added.
1155 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
1157 * development/OS2/quick_fix.patch:
1158 * lib/configure.cmd:
1159 * README.OS2: quick update to the OS/2 port.
1161 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1163 * src/converter.C: add "using" directive.
1165 * src/frontends/xforms/FormPreferences.C: add "using" directive.
1166 (compare_converter): add "int" as return type.
1168 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
1171 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
1173 * src/lyx_gui.C (create_forms): map the xform colours, should a
1174 mapping exist. Ie, call XformColor::read().
1176 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
1177 and struct HSV as HSVColor.
1178 (XformColor::read, XformColor::write) : new methods that
1179 input/output any changes to the cform GUI colors.
1181 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
1184 * src/frontends/xforms/FormPreferences.C Lots of little changes
1185 associated with the changed name of the RGB and HSV structs. Can
1186 now save changes to xforms GUI to file. Commented out
1187 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
1188 used currently anyway.
1190 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
1192 * src/converter.C: A lot of changes:
1193 - It is no longer possible to choose between two or more ways to
1194 export to some format (the new code uses only the shortest path).
1195 However, it is still possible to choose between pdflatex/ps2pdf
1196 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
1197 - Added several methods that makes the FormPreferences code simpler.
1198 - Changed the tokens $$FName and $$OutName to $$i and $$o.
1200 * src/exporter.C (Export): lyxrc.use_pdf is set before
1201 makeLaTeXFile is called. This works but not very nice.
1203 * src/frontends/xforms/FormPreferences.C: The formats/converters
1204 tabs are now fully functional.
1206 * src/buffer.C (getTocList): Add numbers to the captions.
1208 * lib/lyxrc.example: Removed fax section
1210 * src/support/rename.C (rename): Delete the old file if lyx::copy
1213 2000-11-13 Rob Lahaye <lahaye@postech.edu>
1215 * lib/ui/default.ui: minor polishing.
1217 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1219 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
1222 * lib/Makefile.am (DOCINST): do not install everything in the
1223 documentation directory.
1225 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
1227 * src/bufferlist.C (newFile): set the filename to the constructed
1230 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
1231 constructed "newfileXX.lyx" name to the dialog
1233 * src/frontends/DialogBase.h: make update() non-abstract so
1234 KDE doesn't need to implement two update methods for every form
1236 * src/frontends/kde/Makefile.am: add missing xforms objects
1239 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
1241 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
1243 * src/frontends/xforms/Color.[Ch]: new files, defining the color
1244 structs RGB and HSV. May not be the best place for these files.
1245 Perhaps move them into src ?
1247 * src/frontends/xforms/Makefile.am: added new files.
1249 * src/frontends/xforms/forms/form_preferences.fd:
1250 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
1251 replaced all instances of "colour" with "color"!
1253 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
1256 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
1257 tab. Can now alter the colors of the xform's GUI on the fly. With
1258 the aid of a single static Signal (see below), can "Apply" these
1259 changes to all currently open dialogs. (Well, to all of the NEW
1260 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
1261 subsequently opened dialogs will, of course, also have the new
1262 color scheme. Cannot yet save (or load) the choices to file, so
1263 they are lost when exiting LyX.
1265 * src/frontends/Dialogs.h:
1266 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
1267 Used to trigger a redraw of any dialogs connected to it because,
1268 for example, the GUI colours have been re-mapped.
1270 * src/frontends/xforms/FormBase.[Ch]:
1271 * src/frontends/xforms/FormDocument.[Ch]:
1272 * src/frontends/xforms/FormParagraph.[Ch]:
1273 * src/frontends/xforms/FormPreferences.[Ch]:
1274 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
1275 method, to be connected to Dialogs::redrawGUI. Method must be
1276 virtual, because dialogs with tabbed folders need to redraw the
1277 forms of each tab folder.
1279 * src/LyXView.C (d-tor):
1280 * src/frontends/xforms/FormBase.C (d-tor): connected
1281 Dialogs::redrawGUI signal to redraw().
1283 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
1284 removed Assert, because it is identical to that in FormBase.
1286 2000-11-10 Rob Lahaye <lahaye@postech.edu>
1288 * lib/ui/default.ui: minor polishing.
1290 2000-11-10 Juergen Vigna <jug@sad.it>
1292 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
1293 (deleteLyXText): ditto
1295 * src/insets/insettabular.C (InsetButtonPress): don't clear the
1296 selection on mouse-button-3.
1298 * src/insets/insettabular.h: new function clearSelection(), use this
1299 functions inside insettabular.C.
1301 * src/insets/insettabular.C (TabularFeatures): clear the selection
1302 on remove_row/column.
1304 * src/insets/inset.C (scroll): fixed some scroll stuff.
1306 * src/insets/insettabular.C (draw): fixed another minor draw problem.
1308 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1310 * lib/CREDITS: add Yves Bastide
1312 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
1314 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
1315 check whether C library functions are in the global namespace.
1317 * configure.in: calls it.
1319 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
1320 #ifndef __GLIBCPP__.
1322 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
1324 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
1325 iterators to prevent crash.
1327 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
1329 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
1331 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
1332 shortcut for xforms CB to the preemptive or post-handler function.
1334 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
1335 removed the HIDDEN_TIMER as it's no longer used.
1336 Various other small changes.
1338 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
1339 preemptive handler to obtain feedback, rather than the post-handler.
1340 (ColoursLoadBrowser): find "black" and "white" based on RGB values
1342 Formats tab is now complete. Converters tab is nearly so.
1344 2000-11-09 Juergen Vigna <jug@sad.it>
1346 * src/insets/insettext.C (~InsetText):
1349 (SetParagraphData): set cache.second to 0 after deleting it!
1350 (getLyXText): check if cache.second is not 0 if finding it.
1352 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1354 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
1355 lyxlex to parse the rgb.txt file.
1358 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
1359 replace the default '#' comment character.
1361 * src/support/tempname.C: add "using" directive
1362 * src/frontends/ButtonPolicies.C: ditto.
1364 * src/support/filetools.C (DirList): add an explicit cast to avoid
1365 a compile error (probably not the right fix)
1367 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
1369 * src/support/filetools.C (DirList): implement using system functions
1371 * src/support/tempname.C: new file
1373 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
1375 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
1377 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
1380 * src/frontends/xforms/ButtonController.C: new file
1382 * src/os2_defines.h: remove getcwd define
1384 * src/lyxvc.C: include support/lyxlib.h
1385 (showLog): use lyx::tempName
1387 * src/lyx_cb.C: comment out includes that we don't need
1388 (AutoSave): use lyx::tempName
1390 * src/filedlg.C: include support/lyxlib.h
1391 (Reread): use lyx::getcwd
1393 * src/converter.C: include support/filetools.h
1394 (add_options): change to static inline, make tail const
1395 (Add): make old_viewer const
1396 (GetAllFormats): make it a const method, use const_iterator
1397 (enable): make static inline
1398 (SplitFormat): make using_format const
1400 * src/LaTeX.C (run): use lyx::getcwd
1402 * configure.in: check for mkstemp as well
1404 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1406 * src/converter.[Ch] (GetAllCommands): new method.
1408 * src/support/filetools.[Ch] (DirList): new method.
1410 * src/frontends/xforms/FormPreferences.C: started (just!) adding
1411 functionality to the converters tab.
1412 The formats tab is now nearly complete.
1413 The kbmap choices in Languages tab now display the contents of
1414 system_lyxdir/kbd/*.kmap in readable form.
1416 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
1417 Moved some variables into the class.
1419 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
1420 inactive tab folder to FL_COL1. Haven't yet worked out how to change
1421 colour of active folder to lighter grey instead. Any takers?
1422 (form_colours): added an "Apply" button.
1423 (form_converters): added a "Flags" input field.
1424 (form_formats): added a "Shortcut" input field. Note that we can't use
1425 names such as "input_shortcut" as this buggers up the sed script stuff.
1427 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1435 * src/lyx_sendfax_main.C:
1438 * src/spellchecker.C:
1439 * src/insets/figinset.C:
1440 * src/insets/insetbib.C:
1441 * src/insets/insetexternal.C:
1442 * src/insets/insetinclude.C:
1443 * src/insets/insetinfo.C:
1444 * src/mathed/math_panel.C:
1445 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
1446 all "daughter" dialogs now have identical "feel".
1448 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1450 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
1451 used (and was only used in one place prior to this patch. Incorrectly!)
1453 * src/frontends/xforms/FormDocument.C: changed some instances of
1454 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
1455 sense. Also added fl_set_input_return() for class_->input_doc_extra and
1456 for options_->input_float_placement. This fixes a bug reported by
1459 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
1460 functionality into d-tor.
1462 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
1463 input of numerals also.
1465 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
1466 fl_set_form_atclose(). Can now close dialog from window manager,
1467 fixing a bug reported by Rob Lahaye.
1469 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
1471 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
1472 are no longer dark. Haven't yet worked out how to lighten the colour of
1473 the active tabfolder. Any ideas anybody?
1474 Adjusted Colours tab a little.
1475 Added Shortcut field to converters tab. Note that we can't create an
1476 fdesign label like "input_shortcut" as this buggers up the sed-script
1479 * src/frontends/xforms/FormPreferences.[Ch]:
1480 (feedback): fixed crash due to to ob=0.
1481 (LanguagesXXX): the kbmap choices now contain the files
1482 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
1483 be replaced by an input with a file browse button, but since the browse
1484 buttons don'y yet work, this'll do for the moment.
1485 (FormatsXXX): think that this is now nearly fully functional.
1486 Some points/questions though:
1487 1. Does "Apply" remove formats if no longer present?
1488 2. I think that the browser should list the GUI names rather than the
1490 3. Must ensure that we can't delete Formats used by an existing
1493 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
1494 if this is the best way to do this.
1496 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1498 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
1500 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
1501 for variable assignment.
1503 2000-11-07 Rob Lahaye <lahaye@postech.edu>
1505 * src/lib/ui/default.ui: added sub/superscripts to menu as
1506 Insert->Special characters and cleaned-up the file a bit
1508 2000-11-07 Allan Rae <rae@lyx.org>
1510 * src/frontends/xforms/FormPreferences.C (feedback): make sure
1511 ob isn't 0 before using it. See comments in function.
1513 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
1515 * src/frontends/xforms/form_*.C: regenerated
1517 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1519 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
1521 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
1522 compiling with gcc-2.96
1524 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1526 * src/support/lyxstring.C: add a couple "using" directives.
1528 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
1529 a .c_str() here too for good measure.
1530 * src/Spacing.C (set): ditto.
1531 * src/lyxfunc.C (Dispatch): ditto.
1533 * src/insets/insettabular.C (copySelection): change .str() to
1534 .str().c_str() to fix problems with lyxstring.
1535 * src/support/filetools.C (GetFileContents): ditto.
1536 * src/buffer.C (asciiParagraph): ditto.
1537 * src/paragraph.C (String): ditto.
1539 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
1540 * lib/bind/sciword.bind: ditto.
1542 * src/LyXAction.C (init): remove "symbol-insert" function, which
1543 shared LFUN_INSERT_MATH with "math-insert".
1545 * lib/configure.m4: == is not a valid operator for command test.
1547 * src/lyxrc.C: add using directive.
1549 * src/converter.h: add std:: qualifier.
1551 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
1553 * src/converter.[Ch] and other files: Change the Format class to a
1554 real class, and create two instances: formats and system_format.
1556 * src/lyxrc.C (output): Output the difference between formats and
1559 * src/frontends/xforms/FormPreferences.C (input): Simplify.
1560 (buildFormats): Insert formats into browser.
1561 (inputFormats): Made the browser and add button functional.
1562 (applyFormats): Update formats from format_vec.
1564 * src/converter.C: Changed all (*it). to it->
1565 (Format::dummy): New method.
1566 (Format::importer): New format flag.
1567 (Formats::GetAllFormats): New method.
1568 (Formats::Add): Delete format from the map if prettyname is empty.
1569 (Converter::Convert): Print an error message if moving the file fails.
1570 (Converter::GetReachableTo): New method
1572 * src/MenuBackend.[Ch]: Add support for importformats tag.
1574 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
1576 * lib/configure.m4: Add word->tex and ps->fax converters.
1578 * lib/ui/default.ui: Use ImportFormats on file->import menu.
1579 Return fax to file menu.
1583 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
1585 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
1588 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
1591 * src/lyxfunc.C (processKeyEvent): removed
1593 * src/bufferlist.C (emergencyWrite): removed the out commented
1594 emergency write code.
1596 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
1598 * src/LyXView.[Ch]: remove the outcommented raw_callback code
1600 * many files: change formatting to be a bit more uniform for
1601 if,while,for,switch statements, remove some parantesis not needed.
1604 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
1606 * config/kde.m4: make config more robust when KDEDIR is set
1608 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1610 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
1611 not returned a pixmap for "math-insert".
1613 * src/LyXAction.C (init): sort the entries a bit.
1615 2000-11-03 Juergen Vigna <jug@sad.it>
1617 * src/insets/insettabular.h: added fixed number to update codes so
1618 that update is only in one direction.
1620 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
1623 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
1624 before call to edit because of redraw.
1626 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
1628 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1630 * lib/ui/default.ui: Populate "edit_float" menu
1632 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
1634 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
1635 "floats-operate". The name is ugly (and the func also), but this
1636 is just a band-aid until we switch to new insets.
1638 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1640 * lib/ui/default.ui: update again the menu layout (fix some
1643 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1645 * src/MenuBackend.h (fulllabel): new method.
1647 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
1648 the menu shortcuts of a menu are unique and whether they
1649 correspond to a letter of the label.
1650 (expand): call checkShortcuts when debugging.
1652 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
1654 * src/insets/insettext.C (InsetButtonPress): shut off warning.
1656 2000-11-02 Lior Silberman <lior@Princeton.EDU>
1658 * lib/examples/*.lyx : '\language default' => '\language english'
1660 * lib/examples/it_splash.lyx : except where it should be italian
1662 * lib/templates/*.lyx : the same
1664 * doc/*.lyx* : the same
1666 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1668 * lib/bind/menus.bind: remove the Layout menu entries, which I
1669 somehow forgot earlier.
1671 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1673 * lib/ui/old-default.ui: keep the old one here for reference (to
1676 * lib/ui/default.ui: update the menu layout
1678 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
1680 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
1681 Can now Apply to different insets without closing the dialog.
1683 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
1684 Can't actually DO anything with them yet, but I'd like a little
1687 * src/frontends/xforms/input_validators.[ch]
1688 (fl_lowercase_filter): new.
1690 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
1692 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
1693 of MATH_CODE. This fixes a bug with math-macros in RTL text.
1695 * src/text.C (PrepareToPrint): Show math-macros block aligned.
1697 2000-11-02 Juergen Vigna <jug@sad.it>
1699 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
1700 on char insertion as it has already be updated by bv->updateInset().
1702 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
1703 if an inset inside was updated.
1705 * lib/configure.cmd: commented out fax-search code
1707 2000-11-01 Yves Bastide <stid@acm.org>
1709 * src/tabular.C (OldFormatRead): set tabular language to the
1712 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1714 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
1715 class names with non-letter characters (from Yves Bastide).
1717 * lib/ui/default.ui: change Item to OptItem in import menu.
1718 Comment out fax stuff.
1720 * lib/configure.m4: comment out fax-related stuff.
1722 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
1724 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
1725 useful xforms helper functions. At present contains only formatted().
1726 Input a string and it returns it with line breaks so that in fits
1729 * src/frontends/xforms/Makefile.am: add new files.
1731 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
1732 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
1735 * src/frontends/xforms/FormPreferences.[Ch]:
1736 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
1737 but lots of little clean ups. Removed enum State. Make use of
1738 formatted(). Constify lots of methods. Perhaps best of all: removed
1739 requirement for that horrible reinterpret_cast from pointer to long in
1742 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1744 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
1745 conditionalize build on xforms < 0.89
1747 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
1749 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
1751 * src/LyXAction.C (init): comment out fax
1753 * src/lyxrc.h: comment out the fax enums
1754 comment out the fax variables
1756 * src/commandtags.h: comment out LFUN_FAX
1758 * src/lyxrc.C: disable fax variables.
1759 (read): disable parsing of fax variables
1760 (output): disable writing of fax variables
1761 (getFeedback): now description for fax variables
1763 * src/lyxfunc.C: comment out MenuFax
1764 (Dispatch): disable LFUN_FAX
1766 * src/lyx_cb.C (MenuFax): comment out
1768 * src/WorkArea.C: add <cctype>
1769 (work_area_handler): better key handling, should be ok now.
1770 for accented chars + etc
1772 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
1773 lyx_sendfax.h and lyx_sendfax_man.C
1775 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
1776 (show): don't call InitLyXLookup when using xforms 0.89
1778 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1780 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1782 * src/support/filetools.C (GetFileContents): close to dummy change
1784 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1786 * src/trans.C (AddDeadkey): workaround stupid compilers.
1788 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1790 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1791 of two-sided document.
1793 2000-10-31 Juergen Vigna <jug@sad.it>
1795 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1797 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1798 xposition to the Edit call.
1800 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1802 * src/trans.C (AddDeadkey): cast explicitly to char.
1804 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1806 * src/tabular.C (AsciiBottomHLine): simplify?
1807 (AsciiTopHLine): simplify?
1808 (print_n_chars): simplify
1809 (DocBook): remove most of the << endl; we should flush the stream
1810 as seldom as possible.
1812 (TeXBottomHLine): ditto
1813 (TeXTopHLine): ditto
1815 (write_attribute): try a templified version.
1816 (set_row_column_number_info): lesson scope of variables
1818 * src/support/lstrings.h (tostr): new specialization of tostr
1820 * src/trans.C (AddDeadkey): slightly cleaner fix.
1822 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1824 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1825 '%%' in Toc menu labels.
1828 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1829 font_norm is iso10646-1.
1831 * src/font.C (ascent): Fixed for 16bit fonts
1832 (descent,lbearing,rbearing): ditto
1834 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1836 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1837 (getFeedback): new static method.
1839 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1840 Now use combox rather than choice to display languages.
1841 Feedback is now output using a new timer callback mechanism, identical
1842 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1844 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1846 * src/minibuffer.C: fix for older compilers
1848 2000-10-30 Juergen Vigna <jug@sad.it>
1850 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1851 has to be Left of the inset otherwise LyXText won't find it!
1853 * src/BufferView2.C (open_new_inset): delete the inset if it can
1856 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1858 * lyx.man: fix typo.
1860 2000-10-29 Marko Vendelin <markov@ioc.ee>
1861 * src/frontends/gnome/FormCitation.C
1862 * src/frontends/gnome/FormCitation.h
1863 * src/frontends/gnome/FormCopyright.C
1864 * src/frontends/gnome/FormCopyright.h
1865 * src/frontends/gnome/FormError.C
1866 * src/frontends/gnome/FormError.h
1867 * src/frontends/gnome/FormIndex.C
1868 * src/frontends/gnome/FormIndex.h
1869 * src/frontends/gnome/FormPrint.C
1870 * src/frontends/gnome/FormPrint.h
1871 * src/frontends/gnome/FormRef.C
1872 * src/frontends/gnome/FormRef.h
1873 * src/frontends/gnome/FormToc.C
1874 * src/frontends/gnome/FormToc.h
1875 * src/frontends/gnome/FormUrl.C
1876 * src/frontends/gnome/FormUrl.h
1877 * src/frontends/gnome/Menubar_pimpl.C
1878 * src/frontends/gnome/mainapp.C
1879 * src/frontends/gnome/mainapp.h
1880 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1881 changing update() to updateSlot() where appropriate
1883 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1885 * src/frontends/xforms/FormPreferences.[Ch]:
1886 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1889 2000-10-28 Juergen Vigna <jug@sad.it>
1891 * src/insets/insettabular.C (draw): fixed drawing bug.
1893 * src/insets/insettext.C (clear):
1895 (SetParagraphData): clearing the TEXT buffers when deleting the
1896 paragraphs used by it.
1898 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
1900 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
1902 2000-10-27 Juergen Vigna <jug@sad.it>
1904 * src/tabular.C (~LyXTabular): removed not needed anymore.
1906 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
1909 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1911 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
1914 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
1917 * src/frontends/xforms/FormPreferences.[Ch]:
1918 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
1919 Reorganised as modules based on tabs. Much easier to follow the
1920 flow and to add new tabs. Added warning and feedback messages.
1923 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1925 * src/tabular.h (DocBook): add std:: qualifier.
1927 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
1929 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
1930 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
1933 * insettabular.C (DocBook): uses the tabular methods to export
1936 * src/insets/insettext.h
1937 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
1939 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1941 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
1944 * src/lyxfunc.C (MenuNew): lessen the scope of fname
1945 moved misplaced AllowInput two lines up.
1947 * src/buffer.C (readFile): compare float with float, not with int
1949 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1951 * src/minibuffer.C: add "using SigC::slot" statement.
1953 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
1955 * src/frontends/xforms/forms/README: updated section about make.
1957 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
1958 Tidied some forms up, made two of form_tabular's tabs more
1959 self-consistent, fixed Jean-Marc's size problem in form_preferences,
1960 fixed translation problem with "Column".
1962 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1964 * src/minibuffer.h: use Timeout instead of the xforms timer
1966 (setTimer) rewrite for the Timeout, change to unsigned arg
1967 (set): change to unsigned timer arg
1970 * src/minibuffer.C (TimerCB): removed func
1971 (C_MiniBuffer_TimerCB): removed func
1972 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
1973 (peek_event): use a switch statement
1974 (add): don't use fl_add_timer.
1975 (Set): rewrite to use the Timeout
1978 * src/Timeout.[Ch] (setType): return a Timeout &
1979 (setTimeout): ditto, change to unsigned arg for timeout
1981 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
1983 * src/mathed/formula.C (mathed_string_width): Use string instead
1984 of a constant size char array.
1986 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1988 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
1989 the two recently added operator<< for SMInput and State.
1991 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
1993 (OkCancelPolicy): ditto
1994 (OkCancelReadOnlyPolicy): ditto
1995 (NoRepeatedApplyReadOnlyPolicy): ditto
1996 (OkApplyCancelReadOnlyPolicy): ditto
1997 (OkApplyCancelPolicy): ditto
1998 (NoRepeatedApplyPolicy): ditto
2000 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2002 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
2003 add the usual std:: qualifiers.
2005 2000-10-25 Juergen Vigna <jug@sad.it>
2007 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
2009 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2011 * src/support/filetools.C (MakeRelPath): change some types to
2014 * src/frontends/ButtonPolicies.h (operator<<): new operator for
2015 ButtonPolicy::SMInput and ButtonPolicy::State.
2017 * src/FontLoader.C (reset): small cleanup
2018 (unload): small cleanup
2020 * src/FontInfo.C (getFontname): initialize error to 10000.0
2022 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
2024 * src/frontends/xforms/FormPreferences.[Ch]:
2025 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
2026 TeX encoding and default paper size sections.
2028 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
2030 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
2033 * src/frontends/xforms/FormError.C (disconnect): use erase() to
2034 make the message_ empty.
2035 (FormError): don't initialize message_ in initializer list.
2037 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
2039 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
2041 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2043 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
2045 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
2047 * src/frontends/kde/*data.[Ch]: _("") is not
2050 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
2052 * src/buffer.C: removed redundant using directive.
2054 * src/frontends/DialogBase.h: revert to original definition of
2057 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
2058 stuff into two classes, one for each dialog, requires a new
2059 element in the dialogs vector, FormTabularCreate.
2061 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
2064 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
2065 method. Continues Allan's idea, but means that derived classes
2066 don't need to worry about "update or hide?".
2068 * src/frontends/xforms/FormError.C (showInset): add connection
2071 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
2072 one for each dialog. FormTabular now contains main tabular dialog
2075 * src/frontends/xforms/FormTabularCreate.[Ch]:
2076 * src/frontends/xforms/forms/form_tabular_create.fd: the create
2079 * src/frontends/xforms/FormGraphics.[Ch]:
2080 * src/frontends/xforms/forms/form_graphics.fd
2081 * src/frontends/xforms/FormTabular.[Ch]:
2082 * src/frontends/xforms/forms/form_tabular.fd: made daughter
2083 classes of FormInset.
2085 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
2086 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
2088 * src/frontends/xforms/Makefile.am:
2089 * src/frontends/xforms/forms/makefile: added new files.
2091 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
2092 variable. added Signal0 hide signal, in keeping with other GUI-I
2095 * src/support/lstrings.h: removed redundant std:: qualifier as
2096 it's already declared in Lsstream.h.
2098 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2100 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
2104 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
2106 * src/tabular.C (Ascii): minimize scope of cell.
2108 * src/BufferView2.C (nextWord): return string() instead of 0;
2110 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2112 * src/converter.h: add a std:: qualifier
2114 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
2116 * src/importer.[Ch]: New files. Used for importing files into LyX.
2118 * src/lyxfunc.C (doImport): Use the new Importer class.
2120 * src/converter.h: Add shortcut member to the Format class.
2121 Used for holding the menu shortcut.
2123 * src/converter.C and other files: Made a distinction between
2124 format name and format extension. New formats can be defined using
2125 the \format lyxrc tag.
2126 Added two new converter flags: latex and disable.
2128 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2130 * src/support/lyxlib.h: unify namespace/struct implementation.
2131 Remove extra declarations.
2133 * src/support/chdir.C (chdir): remove version taking char const *
2135 * src/support/rename.C: ditto.
2136 * src/support/lyxsum.C: ditto.
2138 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
2140 * src/frontends/xforms/FormBase.[Ch]:
2141 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
2142 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
2143 work only for the next call to fl_show_form(). The correct place to set
2144 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
2145 done. FormBase also stores minw_, minh_ itself. All dialogs derived
2146 from FormBase have the minimum size set; no more stupid crashes with
2149 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2151 * lib/ui/default.ui: fix shortcut for Insert->Include File.
2153 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2155 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
2157 * src/support/lyxlib.h: changed second argument of mkdir to
2158 unsigned long int (unsigned int would probably have been enough,
2159 but...). Removed <sys/types.h> header.
2160 * src/support/mkdir.C (mkdir): ditto.
2164 2000-10-19 Juergen Vigna <jug@sad.it>
2166 * src/lyxfunc.C (MenuNew): small fix (form John)
2168 * src/screen.C (Update): removed unneeded code.
2170 * src/tabular.C (Ascii): refixed int != uint bug!
2172 * src/support/lyxlib.h: added sys/types.h include for now permits
2173 compiling, but I don't like this!
2175 2000-10-18 Juergen Vigna <jug@sad.it>
2177 * src/text2.C (ClearSelection): if we clear the selection we need
2178 more refresh so set the status apropriately
2180 * src/insets/insettext.C (draw): hopefully finally fixed draw
2183 2000-10-12 Juergen Vigna <jug@sad.it>
2185 * src/insets/insettext.C (draw): another small fix and make a block
2186 so that variables are localized.
2188 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
2190 * src/support/lstrings.C (lowercase, uppercase):
2191 use explicit casts to remove compiler warnings.
2193 * src/support/LRegex.C (Impl):
2194 * src/support/StrPool.C (add):
2195 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
2196 (AddPath, MakeDisplayPath):
2197 * src/support/lstrings.C (prefixIs, subst):
2198 use correct type to remove compiler warnings.
2200 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
2202 * src/support/lyxlib.h:
2203 * src/support/mkdir.C (mkdir): change parameter to mode_t for
2204 portability and to remove compiler warning with DEC cxx.
2206 * src/support/FileInfo.[Ch] (flagRWX): ditto.
2208 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2210 * src/minibuffer.C (peek_event): retun 1 when there has been a
2211 mouseclick in the minibuffer.
2215 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
2217 * src/frontends/xforms/FormParagraph.C: more space above/below
2220 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
2222 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
2223 a char only if real_current_font was changed.
2225 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2227 * NEWS: update somewhat for 1.1.6
2229 * lib/ui/default.ui: clean up.
2231 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
2233 * lib/CREDITS: clean up
2235 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2237 * src/combox.[Ch] (select): changed argument back to int
2238 * src/combox.C (peek_event): removed num_bytes as it is declared but
2241 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
2242 modified calls to Combox::select() to remove warnings about type
2245 * src/insets/insetbutton.C (width): explicit cast to remove warning
2246 about type conversion.
2248 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
2251 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
2252 sel_pos_end, refering to cursor position are changed to
2253 LyXParagraph::size_type.
2255 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
2256 consistent with LyXCursor::pos().
2257 (inset_pos): changed to LyXParagraph::size_type for same reason.
2259 * src/insets/insettext.C (resizeLyXText): changed some temporary
2260 variables refing to cursor position to LyXParagraph::size_type.
2262 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
2264 * src/frontends/kde/<various>: The Great Renaming,
2267 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2269 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
2271 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2273 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
2274 0 when there are no arguments.
2276 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2278 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
2279 to segfaults when pressing Ok in InsetBibtex dialog.
2281 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2283 * forms/layout_forms.fd:
2284 * src/layout_forms.C (create_form_form_character): small change to use
2285 labelframe rather than engraved frame + text
2287 * src/lyx_gui.C (create_forms): initialise choice_language with some
2288 arbitrary value to prevent segfault when dialog is shown.
2290 2000-10-16 Baruch Even <baruch.even@writeme.com>
2292 * src/converter.C (runLaTeX, scanLog): Added a warning when there
2293 is no resulting file. This pertains only to LaTeX output.
2295 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
2297 * src/text.C (Backspace): Make sure that the row of the cursor is
2300 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
2303 * src/lyx_gui.C (init): Prevent a crash when only one font from
2304 menu/popup fonts is not found.
2306 * lib/lyxrc.example: Add an example for binding a key for language
2309 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
2311 * src/converter.C (GetReachable): Changed the returned type to
2313 (IsReachable): New method
2315 * src/MenuBackend.C (expand): Handle formats that appear more
2318 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2320 * src/frontends/support/Makefile.am
2321 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
2324 * lib/CREDITS: add Garst Reese.
2326 * src/support/snprintf.h: add extern "C" {} around the definitions.
2328 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
2330 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2333 * src/frontends/xforms/FormDocument.C:
2334 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
2335 compile without "conversion to integral type of smaller size"
2338 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2340 * src/text.C (GetColumnNearX): Fixed disabled code.
2342 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2344 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
2347 * src/support/snprintf.[ch]: new files
2349 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2351 * src/frontends/kde/formprintdialog.C: add
2352 file browser for selecting postscript output
2354 * src/frontends/kde/formprintdialogdata.C:
2355 * src/frontends/kde/formprintdialogdata.h: re-generate
2358 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2360 * src/frontends/gnome/Makefile.am:
2361 * src/frontends/kde/Makefile.am: FormCommand.C
2362 disappeared from xforms
2364 * src/frontends/kde/FormCitation.C:
2365 * src/frontends/kde/FormIndex.C: read-only
2368 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2370 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
2373 * src/bufferlist.C: add using directive.
2375 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2377 * src/support/lyxfunctional.h: version of class_fun for void
2378 returns added, const versions of back_inseter_fun and compare_fun
2381 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2383 * src/frontends/xforms/FormInset.C (showInset): fix typo.
2385 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2387 * ChangeLog: cleanup.
2389 * lib/CREDITS: update to add all the contributors we've forgotten.
2390 I have obviously missed some, so tell me whether there were
2393 2000-10-13 Marko Vendelin <markov@ioc.ee>
2395 * src/frontends/gnome/FormCitation.C
2396 * src/frontends/gnome/FormCitation.h
2397 * src/frontends/gnome/FormError.C
2398 * src/frontends/gnome/FormIndex.C
2399 * src/frontends/gnome/FormRef.C
2400 * src/frontends/gnome/FormRef.h
2401 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
2403 * src/frontends/gnome/FormCitation.C
2404 * src/frontends/gnome/FormCopyright.C
2405 * src/frontends/gnome/FormError.C
2406 * src/frontends/gnome/FormIndex.C
2407 * src/frontends/gnome/FormRef.C
2408 * src/frontends/gnome/FormToc.C
2409 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
2412 * src/frontends/gnome/Menubar_pimpl.C
2413 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
2416 2000-10-11 Baruch Even <baruch.even@writeme.com>
2419 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
2420 to convey its real action.
2422 * src/minibuffer.C (peek_event): Added action when mouse clicks to
2423 clear the minibuffer and prepare to enter a command.
2425 * src/mathed/formula.C (LocalDispatch): Changed to conform with
2426 the rename from ExecCommand to PrepareForCommand.
2427 * src/lyxfunc.C (Dispatch): ditto.
2429 2000-10-11 Baruch Even <baruch.even@writeme.com>
2431 * src/buffer.C (writeFile): Added test for errors on writing, this
2432 catches all errors and not only file system full errors as intended.
2434 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2436 * src/lyx_gui.C (create_forms): better fix for crash with
2437 translated interface.
2439 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
2441 * src/frontends/kde/Makefile.am:
2442 * src/frontends/kde/FormCopyright.C:
2443 * src/frontends/kde/formcopyrightdialog.C:
2444 * src/frontends/kde/formcopyrightdialog.h:
2445 * src/frontends/kde/formcopyrightdialogdata.C:
2446 * src/frontends/kde/formcopyrightdialogdata.h:
2447 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
2448 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
2449 copyright to use qtarch
2451 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
2453 * src/encoding.C (read): Fixed bug that caused an error message at
2454 the end of the file.
2456 * po/Makefile.in.in: Fixed rule for ext_l10n.h
2458 * lib/lyxrc.example: Fixed hebrew example.
2460 2000-10-13 Allan Rae <rae@lyx.org>
2462 * src/frontends/xforms/FormPreferences.C (input): reworking the
2464 (build, update, apply): New inputs in various tabfolders
2466 * src/frontends/xforms/FormToc.C: use new button policy.
2467 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
2468 dialogs that either can't use any existing policy or where it just
2471 * src/frontends/xforms/FormTabular.h: removed copyright notice that
2474 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
2475 added a bool parameter which is ignored.
2477 * src/buffer.C (setReadonly):
2478 * src/BufferView_pimpl.C (buffer):
2479 * src/frontends/kde/FormCopyright.h (update):
2480 * src/frontends/kde/FormCitation.[Ch] (update):
2481 * src/frontends/kde/FormIndex.[Ch] (update):
2482 * src/frontends/kde/FormPrint.[Ch] (update):
2483 * src/frontends/kde/FormRef.[Ch] (update):
2484 * src/frontends/kde/FormToc.[Ch] (update):
2485 * src/frontends/kde/FormUrl.[Ch] (update):
2486 * src/frontends/gnome/FormCopyright.h (update):
2487 * src/frontends/gnome/FormCitation.[Ch] (update):
2488 * src/frontends/gnome/FormError.[Ch] (update):
2489 * src/frontends/gnome/FormIndex.[Ch] (update):
2490 * src/frontends/gnome/FormPrint.[Ch] (update):
2491 * src/frontends/gnome/FormRef.h (update):
2492 * src/frontends/gnome/FormToc.[Ch] (update):
2493 * src/frontends/gnome/FormUrl.[Ch] (update):
2494 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
2495 to updateBufferDependent and DialogBase
2497 * src/frontends/xforms/FormCitation.[hC]:
2498 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
2499 * src/frontends/xforms/FormError.[Ch]:
2500 * src/frontends/xforms/FormGraphics.[Ch]:
2501 * src/frontends/xforms/FormIndex.[Ch]:
2502 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
2503 and fixed readOnly handling.
2504 * src/frontends/xforms/FormPrint.[Ch]:
2505 * src/frontends/xforms/FormRef.[Ch]:
2506 * src/frontends/xforms/FormTabular.[Ch]:
2507 * src/frontends/xforms/FormToc.[Ch]:
2508 * src/frontends/xforms/FormUrl.[Ch]:
2509 * src/frontends/xforms/FormInset.[Ch]:
2510 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
2511 form of updateBufferDependent.
2513 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
2514 if form()->visible just in case someone does stuff to the form in a
2517 * src/frontends/DialogBase.h (enum): removed enum since we can now use
2518 the buttoncontroller for everything the enum used to be used for.
2519 (update) It would seem we need to force all dialogs to use a bool
2520 parameter or have two update functions. I chose to go with one.
2521 I did try removing update() from here and FormBase and defining the
2522 appropriate update signatures in FormBaseB[DI] but then ran into the
2523 problem of the update() call in FormBase::show(). Whatever I did
2524 to get around that would require another function and that just
2525 got more confusing. Hence the decision to make everyone have an
2526 update(bool). An alternative might have been to override show() in
2527 FormBaseB[DI] and that would allow the different and appropriate
2530 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
2531 true == buffer change occurred. I decided against using a default
2532 template parameter since not all compilers support that at present.
2534 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
2536 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
2537 army knife" by removing functionality.
2538 (clearStore): removed. All such housekeeping on hide()ing the dialog
2539 is to be carried out by overloaded disconnect() methods.
2540 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
2541 superceded by Baruch's neat test (FormGraphics) to update an existing
2542 dialog if a new signal is recieved rather than block all new signals
2544 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
2545 only to Inset dialogs.
2546 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
2547 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
2549 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
2551 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
2552 as a base class to all inset dialogs. Used solely to connect/disconnect
2553 the Inset::hide signal and to define what action to take on receipt of
2554 a UpdateBufferDependent signal.
2555 (FormCommand): now derived from FormInset.
2557 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
2560 * src/frontends/xforms/FormCopyright.[Ch]:
2561 * src/frontends/xforms/FormPreferences.[Ch]:
2562 now derived from FormBaseBI.
2564 * src/frontends/xforms/FormDocument.[Ch]:
2565 * src/frontends/xforms/FormParagraph.[Ch]:
2566 * src/frontends/xforms/FormPrint.[Ch]:
2567 now derived from FormBaseBD.
2569 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
2571 * src/frontends/xforms/FormCitation.[Ch]:
2572 * src/frontends/xforms/FormError.[Ch]:
2573 * src/frontends/xforms/FormRef.[Ch]:
2574 * src/frontends/xforms/FormToc.[Ch]:
2575 (clearStore): reworked as disconnect().
2577 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
2580 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2582 * src/converter.C (runLaTeX): constify buffer argument
2585 * src/frontends/support/Makefile.am (INCLUDES): fix.
2587 * src/buffer.h: add std:: qualifier
2588 * src/insets/figinset.C (addpidwait): ditto
2589 * src/MenuBackend.C: ditto
2590 * src/buffer.C: ditto
2591 * src/bufferlist.C: ditto
2592 * src/layout.C: ditto
2593 * src/lyxfunc.C: ditto
2595 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2597 * src/lyxtext.h (bidi_level): change return type to
2598 LyXParagraph::size_type.
2600 * src/lyxparagraph.h: change size_type to
2601 TextContainer::difference_type. This should really be
2602 TextContainer::size_type, but we need currently to support signed
2605 2000-10-11 Marko Vendelin <markov@ioc.ee>
2606 * src/frontends/gnome/FormError.h
2607 * src/frontends/gnome/FormRef.C
2608 * src/frontends/gnome/FormRef.h
2609 * src/frontends/gnome/FormError.C
2610 * src/frontends/gnome/Makefile.am
2611 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
2612 to Gnome frontend. Both dialogs use "action" area.
2614 2000-10-12 Baruch Even <baruch.even@writeme.com>
2616 * src/graphics/GraphicsCacheItem_pimpl.C:
2617 * src/graphics/Renderer.C:
2618 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
2621 2000-10-12 Juergen Vigna <jug@sad.it>
2623 * src/insets/insettext.C (draw): fixed drawing bug (specifically
2624 visible when selecting).
2626 * development/Code_rules/Rules: fixed some typos.
2628 2000-10-09 Baruch Even <baruch.even@writeme.com>
2630 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
2631 compiling on egcs 1.1.2 possible.
2633 * src/filedlg.C (comp_direntry::operator() ): ditto.
2635 2000-08-31 Baruch Even <baruch.even@writeme.com>
2637 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
2640 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
2641 transient it now only gets freed when the object is destructed.
2643 2000-08-24 Baruch Even <baruch.even@writeme.com>
2645 * src/frontends/FormGraphics.h:
2646 * src/frontends/FormGraphics.C: Changed to use ButtonController and
2649 2000-08-20 Baruch Even <baruch.even@writeme.com>
2651 * src/insets/insetgraphics.C:
2652 (draw): Added messages to the drawn rectangle to report status.
2653 (updateInset): Disabled the use of the inline graphics,
2656 2000-08-17 Baruch Even <baruch.even@writeme.com>
2658 * src/frontends/support: Directory added for the support of GUII LyX.
2660 * src/frontends/support/LyXImage.h:
2661 * src/frontends/support/LyXImage.C: Base class for GUII holding of
2664 * src/frontends/support/LyXImage_X.h:
2665 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
2666 version of LyXImage, this uses the Xlib Pixmap.
2668 * src/PainterBase.h:
2669 * src/PainterBase.C:
2671 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
2672 replacement to Pixmap.
2674 * src/insets/insetgraphics.h:
2675 * src/insets/insetgraphics.C:
2676 * src/graphics/GraphicsCacheItem.h:
2677 * src/graphics/GraphicsCacheItem.C:
2678 * src/graphics/GraphicsCacheItem_pimpl.h:
2679 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
2682 * src/graphics/GraphicsCacheItem.h:
2683 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
2684 another copy of the object.
2686 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
2687 of cacheHandle, this fixed a bug that sent LyX crashing.
2689 * src/graphics/XPM_Renderer.h:
2690 * src/graphics/XPM_Renderer.C:
2691 * src/graphics/EPS_Renderer.h:
2692 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
2694 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2696 * src/lyxfunc.C (processKeySym): only handle the
2697 lockinginset/inset stuff if we have a buffer and text loaded...
2699 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
2701 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2703 * src/support/lyxfunctional.h: add operator= that takes a reference
2705 * src/lyxserver.C (mkfifo): make first arg const
2707 * src/layout.h: renamed name(...) to setName(...) to work around
2710 * src/buffer.C (setFileName): had to change name of function to
2711 work around bugs in egcs. (renamed from fileName)
2713 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
2715 * src/support/translator.h: move helper template classes to
2716 lyxfunctional.h, include "support/lyxfunctional.h"
2718 * src/support/lyxmanip.h: add delaration of fmt
2720 * src/support/lyxfunctional.h: new file
2721 (class_fun_t): new template class
2722 (class_fun): helper template function
2723 (back_insert_fun_iterator): new template class
2724 (back_inserter_fun): helper template function
2725 (compare_memfun_t): new template class
2726 (compare_memfun): helper template function
2727 (equal_1st_in_pair): moved here from translator
2728 (equal_2nd_in_pair): moved here from translator
2730 * src/support/fmt.C: new file
2731 (fmt): new func, can be used for a printf substitute when still
2732 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
2734 * src/support/StrPool.C: add some comments
2736 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
2739 * src/insets/figinset.C (addpidwait): use std::copy with
2740 ostream_iterator to fill the pidwaitlist
2742 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
2744 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
2747 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
2750 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
2752 * src/frontends/xforms/FormDocument.C (build): remove c_str()
2753 (class_update): ditto
2754 (BulletPanel): ditto
2755 (CheckChoiceClass): move initialization of tc and tct
2757 * src/tabular.C: remove current_view
2758 (OldFormatRead): similar to right below [istream::ignore]
2760 * src/lyxlex_pimpl.C (next): add code for faster skipping of
2761 chars, unfortunately this is buggy on gcc 2.95.2, so currently
2762 unused [istream::ignore]
2764 * src/lyxfunc.C: include "support/lyxfunctional.h"
2765 (getInsetByCode): use std::find_if and compare_memfun
2767 * src/lyxfont.C (stateText): remove c_str()
2769 * src/lyx_main.C (setDebuggingLevel): make static
2770 (commandLineHelp): make static
2772 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
2773 Screen* together with fl_get_display() and fl_screen
2775 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
2776 togheter with fl_get_display() and fl_screen
2777 (create_forms): remove c_str()
2779 * src/layout.C: include "support/lyxfunctional.h"
2780 (hasLayout): use std::find_if and compare_memfun
2781 (GetLayout): use std::find_if and comapre_memfun
2782 (delete_layout): use std::remove_if and compare_memfun
2783 (NumberOfClass): use std:.find_if and compare_memfun
2785 * src/gettext.h: change for the new functions
2787 * src/gettext.C: new file, make _(char const * str) and _(string
2788 const & str) real functions.
2790 * src/font.C (width): rewrite slightly to avoid one extra variable
2792 * src/debug.C: initialize Debug::ANY here
2794 * src/commandtags.h: update number comments
2796 * src/combox.h (get): make const func
2798 (getline): make const
2800 * src/combox.C (input_cb): handle case where fl_get_input can
2803 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2804 "support/lyxfunctional.h", remove current_view variable.
2805 (resize): use std::for_each with std::mem_fun
2806 (getFileNames): use std::copy with back_inserter_fun
2807 (getBuffer): change arg type to unsigned int
2808 (emergencyWriteAll): call emergencyWrite with std::for_each and
2810 (emergencyWrite): new method, the for loop in emergencyWriteAll
2812 (exists): use std::find_if with compare_memfun
2813 (getBuffer): use std::find_if and compare_memfun
2815 * src/buffer.h: add typedefs for iterator_category, value_type
2816 difference_type, pointer and reference for inset_iterator
2817 add postfix ++ for inset_iterator
2818 make inset_iterator::getPos() const
2820 * src/buffer.C: added support/lyxmanip.h
2821 (readFile): use lyxerr << fmt instead of printf
2822 (makeLaTeXFile): use std::copy to write out encodings
2824 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2826 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2827 free and the char * temp.
2828 (hasMenu): use std::find_if and compare_memfun
2831 * src/Makefile.am (lyx_SOURCES): added gettext.C
2833 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2834 string::insert small change to avoid temporary
2836 * src/LColor.C (getGUIName): remove c_str()
2838 * several files: change all occurrences of fl_display to
2841 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2842 that -pedantic is not used for gcc 2.97 (cvs gcc)
2844 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2846 2000-10-11 Allan Rae <rae@lyx.org>
2848 * src/frontends/xforms/FormPreferences.C (input): template path must be
2849 a readable directory. It doesn't need to be writeable.
2850 (build, delete, update, apply): New inputs in the various tabfolders
2852 * src/frontends/xforms/forms/form_preferences.fd:
2853 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2854 several new entries to existing folders. Shuffled some existing stuff
2857 * src/frontends/xforms/forms/form_print.fd:
2858 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2859 Should probably rework PrinterParams as well. Note that the switch to
2860 collated is effectively the same as !unsorted so changing PrinterParams
2861 will require a lot of fiddly changes to reverse the existing logic.
2863 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2865 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2867 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2869 2000-10-10 Allan Rae <rae@lyx.org>
2872 * src/lyxfunc.C (Dispatch):
2874 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2877 * src/lyxrc.C (output): Only write the differences between system lyxrc
2878 and the users settings.
2881 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2883 I'll rewrite this later, after 1.1.6 probably, to keep a single
2884 LyXRC but two instances of a LyXRCStruct.
2886 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2888 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2890 * src/tabular.h: add a few std:: qualifiers.
2892 * src/encoding.C: add using directive.
2893 * src/language.C: ditto.
2895 * src/insets/insetquotes.C (Validate): use languages->lang()
2896 instead of only language.
2898 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
2900 * lib/languages: New file.
2902 * lib/encodings: New file.
2904 * src/language.C (Languages): New class.
2905 (read): New method. Reads the languages from the 'languages' file.
2907 * src/encoding.C (Encodings): New class.
2908 (read): New method. Reads the encodings from the 'encodings' file.
2910 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
2913 * src/bufferparams.h and a lot of files: Deleted the member language,
2914 and renamed language_info to language
2916 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
2917 * src/lyxfont.C (latexWriteStartChanges): ditto.
2918 * src/paragraph.C (validate,TeXOnePar): ditto.
2920 * src/lyxfont.C (update): Restored deleted code.
2922 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
2924 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2926 * src/BufferView_pimpl.C (buffer): cleaned up a little.
2928 * src/insets/figinset.[Ch]:
2929 * src/insets/insetinclude.[Ch]:
2930 * src/insets/insetinclude.[Ch]:
2931 * src/insets/insetparent.[Ch]:
2932 * src/insets/insetref.[Ch]:
2933 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
2935 * src/insets/*.[Ch]:
2936 * src/mathed/formula.[Ch]:
2937 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
2939 * src/buffer.C (parseSingleLyXformat2Token, readInset):
2940 * src/lyx_cb.C (FigureApplyCB):
2941 * src/lyxfunc.C (getStatus, Dispatch):
2942 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
2945 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
2947 * src/converter.[Ch] (Formats::View):
2948 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
2950 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
2951 *current_view->buffer(). This will change later, but this patch is way
2954 2000-10-09 Juergen Vigna <jug@sad.it>
2956 * src/text.C (GetRow): small fix.
2958 * src/BufferView_pimpl.C (cursorPrevious):
2959 (cursorNext): added LyXText parameter to function.
2961 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
2962 keypress depending on cursor position.
2964 2000-10-06 Juergen Vigna <jug@sad.it>
2966 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
2967 (copySelection): redone this function and also copy ascii representa-
2970 * src/tabular.C (Ascii):
2974 (print_n_chars): new functions to realize the ascii export of tabulars.
2976 2000-10-05 Juergen Vigna <jug@sad.it>
2978 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
2979 if we don't have a buffer.
2981 2000-10-10 Allan Rae <rae@lyx.org>
2983 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
2984 with closing dialog. It seems that nested tabfolders require hiding
2985 of inner tabfolders before hiding the dialog itself. Actually all I
2986 did was hide the active outer folder.
2988 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
2989 unless there really is a buffer. hideBufferDependent is called
2992 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
2993 POTFILES.in stays in $(srcdir).
2995 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
2997 * lib/lyxrc.example: Few changes.
2999 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
3001 * src/BufferView_pimpl.C (buffer): only need one the
3002 updateBufferDependent signal to be emitted once! Moved to the end of
3003 the method to allow bv_->text to be updated first.
3005 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
3006 and hSignal_ with Dialogs * and BufferDependency variables.
3007 New Buffer * parent_, initialised when the dialog is launched. Used to
3008 check whether to update() or hide() dialog in the new, private
3009 updateOrHide() method that is connected to the updateBufferDependent
3010 signal. Daughter classes dictate what to do using the
3011 ChangedBufferAction enum, passed to the c-tor.
3013 * src/frontends/xforms/FormCitation.C:
3014 * src/frontends/xforms/FormCommand.C:
3015 * src/frontends/xforms/FormCopyright.C:
3016 * src/frontends/xforms/FormDocument.C:
3017 * src/frontends/xforms/FormError.C:
3018 * src/frontends/xforms/FormIndex.C:
3019 * src/frontends/xforms/FormPreferences.C:
3020 * src/frontends/xforms/FormPrint.C:
3021 * src/frontends/xforms/FormRef.C:
3022 * src/frontends/xforms/FormToc.C:
3023 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
3026 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
3027 ChangedBufferAction enum.
3029 * src/frontends/xforms/FormParagraph.[Ch]
3030 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
3033 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3035 * lib/bind/cua.bind: fix a bit.
3036 * lib/bind/emacs.bind: ditto.
3038 * lib/bind/menus.bind: remove real menu entries from there.
3040 * src/spellchecker.C: make sure we only include strings.h when
3043 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
3045 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
3046 function. It enlarges the maximum number of pup when needed.
3047 (add_toc2): Open a new menu if maximum number of items per menu has
3050 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
3052 * src/frontends/kde/FormPrint.C: fix error reporting
3054 * src/frontends/xforms/FormDocument.C: fix compiler
3057 * lib/.cvsignore: add Literate.nw
3059 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
3062 * bufferview_funcs.[Ch]
3065 * text2.C: Add support for numbers in RTL text.
3067 2000-10-06 Allan Rae <rae@lyx.org>
3069 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
3070 to be gettext.m4 friendly again. ext_l10n.h is now
3071 generated into $top_srcdir instead of $top_builddir
3072 so that lyx.pot will be built correctly -- without
3073 duplicate parsing of ext_l10n.h.
3075 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
3077 * src/frontends/kde/FormCitation.C: make the dialog
3078 behave more sensibly
3080 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
3082 * config/kde.m4: fix consecutive ./configure runs,
3083 look for qtarch, fix library order
3085 * src/frontends/kde/Makefile.am: tidy up,
3086 add Print dialog, add .dlg dependencies
3088 * src/frontends/kde/FormPrint.C:
3089 * src/frontends/kde/FormPrint.h:
3090 * src/frontends/kde/formprintdialog.C:
3091 * src/frontends/kde/formprintdialog.h:
3092 * src/frontends/kde/formprintdialogdata.C:
3093 * src/frontends/kde/formprintdialogdata.h:
3094 * src/frontends/kde/dlg/formprintdialog.dlg: add
3097 * src/frontends/kde/dlg/README: Added explanatory readme
3099 * src/frontends/kde/dlg/checkinitorder.pl: small perl
3100 script to double-check qtarch's output
3102 * src/frontends/kde/formindexdialog.C:
3103 * src/frontends/kde/formindexdialogdata.C:
3104 * src/frontends/kde/formindexdialogdata.h:
3105 * src/frontends/kde/dlg/formindexdialog.dlg: update
3106 for qtarch, minor fixes
3108 2000-10-05 Allan Rae <rae@lyx.org>
3110 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
3111 dialogs when switching buffers update them instead. It's up to each
3112 dialog to decide if it should still be visible or not.
3113 update() should return a bool to control visiblity within show().
3114 Or perhaps better to set a member variable and use that to control
3117 * lib/build-listerrors: create an empty "listerrors" file just to stop
3118 make trying to regenerate it all the time if you don't have noweb
3121 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
3123 * po/Makefile.in.in (ext_l10n.h): added a rule to build
3124 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
3125 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
3126 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
3127 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
3129 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
3131 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
3133 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
3134 deleting buffer. Closes all buffer-dependent dialogs.
3136 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
3138 * src/frontends/xforms/FormCitation.[Ch]:
3139 * src/frontends/xforms/FormPreferences.[Ch]:
3140 * src/frontends/xforms/FormPrint.[Ch]:
3141 * src/frontends/xforms/FormRef.[Ch]:
3142 * src/frontends/xforms/FormUrl.[Ch]: ditto
3144 * src/frontends/xforms/FormDocument.[Ch]:
3145 * src/frontends/xforms/forms/form_document.C.patch:
3146 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
3147 pass through a single input() function.
3149 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
3151 * lib/build-listerrors: return status as OK
3153 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
3155 * lib/lyxrc.example: Updated to new export code
3157 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3159 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
3162 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
3165 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
3166 LyX-Code is defined.
3167 * lib/layouts/amsbook.layout: ditto.
3169 * boost/Makefile.am: fix typo.
3171 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
3173 (add_lastfiles): removed.
3174 (add_documents): removed.
3175 (add_formats): removed.
3177 * src/frontends/Menubar.C: remove useless "using" directive.
3179 * src/MenuBackend.h: add a new MenuItem constructor.
3181 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
3184 2000-10-04 Allan Rae <rae@lyx.org>
3186 * lib/Makefile.am (listerrors):
3187 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
3188 I haven't got notangle installed so Kayvan please test. The output
3189 should end up in $builddir. This also allows people who don't have
3190 noweb installed to complete the make process without error.
3192 * src/frontends/xforms/FormCommand.[Ch] (showInset):
3193 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
3194 by JMarc's picky compiler.
3196 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3199 * src/insets/insettabular.C (setPos): change for loop to not use
3200 sequencing operator. Please check this Jürgen.
3202 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
3204 * src/insets/insetcite.C (getScreenLabel): ditto
3205 * src/support/filetools.C (QuoteName): ditto
3206 (ChangeExtension): ditto
3208 * src/BufferView_pimpl.C (scrollCB): make heigt int
3210 * src/BufferView2.C (insertInset): comment out unused arg
3212 * boost/Makefile.am (EXTRADIST): new variable
3214 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
3216 * src/exporter.C (IsExportable): Fixed
3218 * lib/configure.m4: Small fix
3220 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
3222 * src/insets/insetbutton.C (width): Changed to work with no GUI.
3223 * src/insets/insetbib.C (bibitemWidest): ditto.
3224 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
3226 2000-10-03 Juergen Vigna <jug@sad.it>
3228 * src/BufferView2.C (theLockingInset): removed const because of
3229 Agnus's compile problems.
3231 * src/insets/insettext.C (LocalDispatch): set the language of the
3232 surronding paragraph on inserting the first character.
3234 * various files: changed use of BufferView::the_locking_inset.
3236 * src/BufferView2.C (theLockingInset):
3237 (theLockingInset): new functions.
3239 * src/BufferView.h: removed the_locking_inset.
3241 * src/lyxtext.h: added the_locking_inset
3243 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
3245 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
3247 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3249 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
3250 * src/mathed/math_cursor.C (IsAlpha): ditto.
3251 * src/mathed/math_inset.C (strnew): ditto.
3252 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
3253 (IMetrics): cxp set but never used; removed.
3254 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
3255 that the variable in question has been removed also!
3258 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
3259 using the Buffer * passed to Latex(), using the BufferView * passed to
3260 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
3262 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
3263 Linuxdoc() and DocBook() rather than the stored Buffer * master.
3265 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
3266 * src/buffer.C (readInset): used new InsetBibtex c-tor
3267 * (getBibkeyList): used new InsetBibtex::getKeys
3269 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3272 * lib/build-listerrors
3274 * src/exporter.C: Add literate programming support to the export code
3277 * src/lyx_cb.C: Remove old literate code.
3279 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
3282 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
3283 * src/converter.C (View, Convert): Use QuoteName.
3285 * src/insets/figinset.C (Preview): Use Formats::View.
3287 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
3289 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3291 * src/lyxfunc.C (Dispatch): move declaration of text variable at
3292 the top of the function, because compaq cxx complains that the
3293 "goto exit_with_message" when the function is disabled bypasses
3295 (MenuNew): try a better fix for the generation of new file names.
3296 This time, I used AddName() instead of AddPath(), hoping Juergen
3299 2000-10-03 Allan Rae <rae@lyx.org>
3301 * src/frontends/xforms/forms/form_preferences.fd:
3302 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
3303 nested tabfolders has begun. The old "Miscellaneous" was renamed as
3304 "Look and Feel"->"General" but will need to be split up further into
3305 general output and general input tabs. Current plan is for four outer
3306 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
3307 stuff; "Inputs" for input and import configuration; "Outputs" for
3308 output and export configuration; and one more whatever is left over
3309 called "General". The leftovers at present look like being which
3310 viewers to use, spellchecker, language support and might be better
3311 named "Support". I've put "Paths" in "Inputs" for the moment as this
3312 seems reasonable for now at least.
3313 One problem remains: X error kills LyX when you close Preferences.
3315 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3317 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
3318 qualifier from form()
3319 * src/frontends/xforms/FormCitation.[Ch]:
3320 * src/frontends/xforms/FormCopyright.[Ch]:
3321 * src/frontends/xforms/FormDocument.[Ch]:
3322 * src/frontends/xforms/FormError.[Ch]:
3323 * src/frontends/xforms/FormIndex.[Ch]:
3324 * src/frontends/xforms/FormPreferences.[Ch]:
3325 * src/frontends/xforms/FormPrint.[Ch]:
3326 * src/frontends/xforms/FormRef.[Ch]:
3327 * src/frontends/xforms/FormToc.[Ch]:
3328 * src/frontends/xforms/FormUrl.[Ch]: ditto.
3330 * src/frontends/xforms/FormCitation.[Ch]:
3331 * src/frontends/xforms/FormIndex.[Ch]:
3332 * src/frontends/xforms/FormRef.[Ch]:
3333 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
3334 with Allan's naming policy
3336 * src/frontends/xforms/FormCitation.C: some static casts to remove
3339 2000-10-02 Juergen Vigna <jug@sad.it>
3341 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
3342 now you can type or do stuff inside the table-cell also when in dummy
3343 position, fixed visible cursor.
3345 * src/insets/insettext.C (Edit): fixing cursor-view position.
3347 * src/lyxfunc.C (Dispatch): use * text variable so that it can
3348 be used for equal functions in lyxfunc and insettext.
3350 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
3352 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
3354 * src/frontends/gnome/FormCitation.h:
3355 * src/frontends/gnome/FormCopyright.h:
3356 * src/frontends/gnome/FormIndex.h:
3357 * src/frontends/gnome/FormPrint.h:
3358 * src/frontends/gnome/FormToc.h:
3359 * src/frontends/gnome/FormUrl.h:
3360 * src/frontends/kde/FormCitation.h:
3361 * src/frontends/kde/FormCopyright.h:
3362 * src/frontends/kde/FormIndex.h:
3363 * src/frontends/kde/FormRef.h:
3364 * src/frontends/kde/FormToc.h:
3365 * src/frontends/kde/FormUrl.h: fix remaining users of
3368 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3370 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
3371 from depth argument.
3372 (DocBookHandleCaption): ditto.
3373 (DocBookHandleFootnote): ditto.
3374 (SimpleDocBookOnePar): ditto.
3376 * src/frontends/xforms/FormDocument.h (form): remove extra
3377 FormDocument:: qualifier.
3379 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
3381 * sigc++/handle.h: ditto.
3383 * src/lyx_gui_misc.C: add "using" directive.
3385 * src/cheaders/cstddef: new file, needed by the boost library (for
3388 2000-10-02 Juergen Vigna <jug@sad.it>
3390 * src/insets/insettext.C (SetFont): better support.
3392 * src/insets/insettabular.C (draw): fixed drawing of single cell.
3394 * src/screen.C (DrawOneRow): some uint refixes!
3396 2000-10-02 Allan Rae <rae@lyx.org>
3398 * boost/.cvsignore: ignore Makefile as well
3400 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
3401 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
3403 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
3404 Left this one out by accident.
3406 * src/frontends/xforms/FormBase.h (restore): default to calling
3407 update() since that will restore the original/currently-applied values.
3408 Any input() triggered error messages will require the derived classes
3409 to redefine restore().
3411 * src/frontends/xforms/FormDocument.C: initialize a few variables to
3412 avoid a segfault. combo_doc_class is the main concern.
3414 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
3416 * Simplify build-listerrors in view of GUI-less export ability!
3418 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3420 * src/lyx_main.C (easyParse): Disable gui when exporting
3422 * src/insets/figinset.C:
3425 * src/lyx_gui_misc.C
3426 * src/tabular.C: Changes to allow no-gui.
3428 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3430 * src/support/utility.hpp: removed file
3431 * src/support/block.h: removed file
3433 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
3436 * src/mathed/formula.C: add support/lyxlib.h
3437 * src/mathed/formulamacro.C: ditto
3439 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
3440 * src/lyxparagraph.h: ditto
3442 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
3443 * src/frontends/Makefile.am (INCLUDES): ditto
3444 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
3445 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
3446 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
3447 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
3448 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
3449 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
3451 * src/BufferView.h: use boost/utility.hpp
3452 * src/LColor.h: ditto
3453 * src/LaTeX.h: ditto
3454 * src/LyXAction.h: ditto
3455 * src/LyXView.h: ditto
3456 * src/bufferlist.h: ditto
3457 * src/lastfiles.h: ditto
3458 * src/layout.h: ditto
3459 * src/lyx_gui.h: ditto
3460 * src/lyx_main.h: ditto
3461 * src/lyxlex.h: ditto
3462 * src/lyxrc.h: ditto
3463 * src/frontends/ButtonPolicies.h: ditto
3464 * src/frontends/Dialogs.h: ditto
3465 * src/frontends/xforms/FormBase.h: ditto
3466 * src/frontends/xforms/FormGraphics.h: ditto
3467 * src/frontends/xforms/FormParagraph.h: ditto
3468 * src/frontends/xforms/FormTabular.h: ditto
3469 * src/graphics/GraphicsCache.h: ditto
3470 * src/graphics/Renderer.h: ditto
3471 * src/insets/ExternalTemplate.h: ditto
3472 * src/insets/insetcommand.h: ditto
3473 * src/support/path.h: ditto
3475 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
3476 and introduce clause for 2.97.
3478 * boost/libs/README: new file
3480 * boost/boost/utility.hpp: new file
3482 * boost/boost/config.hpp: new file
3484 * boost/boost/array.hpp: new file
3486 * boost/Makefile.am: new file
3488 * boost/.cvsignore: new file
3490 * configure.in (AC_OUTPUT): add boost/Makefile
3492 * Makefile.am (SUBDIRS): add boost
3494 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3496 * src/support/lstrings.C (suffixIs): Fixed.
3498 2000-10-01 Allan Rae <rae@lyx.org>
3500 * src/PrinterParams.h: moved things around to avoid the "can't
3501 inline call" warning.
3503 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
3504 into doc++ documentation.
3506 * src/frontends/xforms/FormCommand.[Ch]: support button policy
3508 * src/frontends/xforms/FormRef.C: make use of button controller
3509 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
3510 cleaned up button controller usage.
3511 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
3512 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
3513 use the button controller
3515 * src/frontends/xforms/forms/*.fd: and associated generated files
3516 updated to reflect changes to FormBase. Some other FormXxxx files
3517 also got minor updates to reflect changes to FormBase.
3519 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
3520 (hide): made virtual.
3521 (input): return a bool. true == valid input
3522 (RestoreCB, restore): new
3523 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
3524 Changes to allow derived dialogs to use a ButtonController and
3525 make sense when doing so: OK button calls ok() and so on.
3527 * src/frontends/xforms/ButtonController.h (class ButtonController):
3528 Switch from template implementation to taking Policy parameter.
3529 Allows FormBase to provide a ButtonController for any dialog.
3531 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
3532 Probably should rename connect and disconnect.
3533 (apply): use the radio button groups
3534 (form): needed by FormBase
3535 (build): setup the radio button groups
3537 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
3539 * several files: type changes to reduce the number of warnings and
3540 to unify type hangling a bit. Still much to do.
3542 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3544 * lib/images/*: rename a bunch of icons to match Dekel converter
3547 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
3550 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
3552 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
3554 * sigc++/handle.h: ditto for class Handle.
3556 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
3558 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
3560 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
3562 * src/intl.C (InitKeyMapper): Correct the value of n due to the
3563 removal of the "default" language.
3565 * src/combox.h (getline): Check that sel > 0
3567 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
3569 * lib/examples/docbook_example.lyx
3570 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
3572 * lib/layouts/docbook-book.layout: new docbook book layout.
3574 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
3576 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
3578 * src/insets/figinset.C (DocBook):fixed small typo.
3580 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
3582 * src/insets/insetinclude.h: string include_label doesn't need to be
3585 2000-09-29 Allan Rae <rae@lyx.org>
3587 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
3588 Allow derived type to control connection and disconnection from signals
3589 of its choice if desired.
3591 2000-09-28 Juergen Vigna <jug@sad.it>
3593 * src/insets/insettabular.C (update): fixed cursor setting when
3594 the_locking_inset changed.
3595 (draw): made this a bit cleaner.
3596 (InsetButtonPress): fixed!
3598 * various files: added LyXText Parameter to fitCursor call.
3600 * src/BufferView.C (fitCursor): added LyXText parameter.
3602 * src/insets/insettabular.C (draw): small draw fix.
3604 * src/tabular.C: right setting of left/right celllines.
3606 * src/tabular.[Ch]: fixed various types in funcions and structures.
3607 * src/insets/insettabular.C: ditto
3608 * src/frontends/xforms/FormTabular.C: ditto
3610 2000-09-28 Allan Rae <rae@lyx.org>
3612 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
3613 that the #ifdef's had been applied to part of what should have been
3614 a complete condition. It's possible there are other tests that
3615 were specific to tables that are also wrong now that InsetTabular is
3616 being used. Now we need to fix the output of '\n' after a table in a
3617 float for the same reason as the original condition:
3618 "don't insert this if we would be adding it before or after a table
3619 in a float. This little trick is needed in order to allow use of
3620 tables in \subfigures or \subtables."
3621 Juergen can you check this?
3623 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3625 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
3626 output to the ostream.
3628 * several files: fixed types based on warnings from cxx
3630 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
3632 * src/frontends/kde/Makefile.am: fix rule for
3633 formindexdialogdata_moc.C
3635 * src/.cvsignore: add ext_l10n.h to ignore
3637 * acconfig.h: stop messing with __STRICT_ANSI__
3638 * config/gnome.m4: remove option to set -ansi
3639 * config/kde.m4: remove option to set -ansi
3640 * config/lyxinclude.m4: don't set -ansi
3642 2000-09-27 Juergen Vigna <jug@sad.it>
3644 * various files: remove "default" language check.
3646 * src/insets/insetquotes.C: removed use of current_view.
3648 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
3649 the one should have red ears by now!
3651 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
3652 in more then one paragraph. Fixed cursor-movement/selection.
3654 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
3655 paragraphs inside a text inset.
3657 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
3658 text-inset if this owner is an inset.
3660 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3662 * src/Bullet.h: changed type of font, character and size to int
3664 * src/buffer.C (asciiParagraph): remove actcell and fname1.
3666 * src/insets/inseturl.[Ch]:
3667 * src/insets/insetref.[Ch]:
3668 * src/insets/insetlabel.[Ch]: add linelen to Ascii
3670 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
3672 * src/buffer.C (readFile): block-if statement rearranged to minimise
3673 bloat. Patch does not reverse Jean-Marc's change ;-)
3675 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
3676 Class rewritten to store pointers to hide/update signals directly,
3677 rather than Dialogs *. Also defined an enum to ease use. All xforms
3678 forms can now be derived from this class.
3680 * src/frontends/xforms/FormCommand.[Ch]
3681 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
3683 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
3686 * src/frontends/xforms/forms/form_citation.fd
3687 * src/frontends/xforms/forms/form_copyright.fd
3688 * src/frontends/xforms/forms/form_error.fd
3689 * src/frontends/xforms/forms/form_index.fd
3690 * src/frontends/xforms/forms/form_ref.fd
3691 * src/frontends/xforms/forms/form_toc.fd
3692 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
3694 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
3696 * src/insets/insetfoot.C: removed redundent using directive.
3698 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3700 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
3701 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
3703 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
3704 created in the constructors in different groups. Then set() just
3705 have to show the groups as needed. This fixes the redraw problems
3706 (and is how the old menu code worked).
3708 * src/support/lyxlib.h: declare the methods as static when we do
3709 not have namespaces.
3711 2000-09-26 Juergen Vigna <jug@sad.it>
3713 * src/buffer.C (asciiParagraph): new function.
3714 (writeFileAscii): new function with parameter ostream.
3715 (writeFileAscii): use now asciiParagraph.
3717 * various inset files: added the linelen parameter to the Ascii-func.
3719 * src/tabular.C (Write): fixed error in writing file introduced by
3720 the last changes from Lars.
3722 * lib/bind/menus.bind: removed not supported functions.
3724 * src/insets/insettext.C (Ascii): implemented this function.
3726 * src/insets/lyxinset.h (Ascii): added linelen parameter.
3728 * src/tabular.C (write_attribute[int,string,bool]): new functions.
3729 (Write): use of the write_attribute functions.
3731 * src/bufferlist.C (close): fixed reasking question!
3733 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3735 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
3736 new files use the everwhere possible.
3739 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
3740 src/log_form.C src/lyx.C:
3743 * src/buffer.C (runLaTeX): remove func
3745 * src/PaperLayout.C: removed file
3746 * src/ParagraphExtra.C: likewise
3747 * src/bullet_forms.C: likewise
3748 * src/bullet_forms.h: likewise
3749 * src/bullet_forms_cb.C: likewise
3751 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
3752 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
3755 * several files: remove all traces of the old fd_form_paragraph,
3756 and functions belonging to that.
3758 * several files: remove all traces of the old fd_form_document,
3759 and functions belonging to that.
3761 * several files: constify local variables were possible.
3763 * several files: remove all code that was dead when NEW_EXPORT was
3766 * several files: removed string::c_str in as many places as
3769 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
3770 (e): be a bit more outspoken when patching
3771 (updatesrc): only move files if changed.
3773 * forms/layout_forms.h.patch: regenerated
3775 * forms/layout_forms.fd: remove form_document and form_paragraph
3776 and form_quotes and form_paper and form_table_options and
3777 form_paragraph_extra
3779 * forms/form1.fd: remove form_table
3781 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3782 the fdui->... rewrite. Update some comments to xforms 0.88
3784 * forms/bullet_forms.C.patch: removed file
3785 * forms/bullet_forms.fd: likewise
3786 * forms/bullet_forms.h.patch: likewise
3788 * development/Code_rules/Rules: added a section on switch
3789 statements. Updated some comment to xforms 0.88.
3791 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3793 * src/buffer.C (readFile): make sure that the whole version number
3794 is read after \lyxformat (even when it contains a comma)
3796 * lib/ui/default.ui: change shortcut of math menu to M-a.
3798 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3800 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3803 * src/LyXView.C (updateWindowTitle): show the full files name in
3804 window title, limited to 30 characters.
3806 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3807 When a number of characters has been given, we should not assume
3808 that the string is 0-terminated.
3810 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3811 calls (fixes some memory leaks)
3813 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3814 trans member on exit.
3816 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3818 * src/converter.C (GetReachable): fix typo.
3820 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3821 understand ',' instead of '.'.
3822 (GetInteger): rewrite to use strToInt().
3824 2000-09-26 Juergen Vigna <jug@sad.it>
3826 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3827 better visibility and error-message on wrong VSpace input.
3829 * src/language.C (initL): added english again.
3831 2000-09-25 Juergen Vigna <jug@sad.it>
3833 * src/frontends/kde/Dialogs.C (Dialogs):
3834 * src/frontends/gnome/Dialogs.C (Dialogs):
3835 * src/frontends/kde/Makefile.am:
3836 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3838 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3840 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3842 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3844 * src/frontends/xforms/FormParagraph.C:
3845 * src/frontends/xforms/FormParagraph.h:
3846 * src/frontends/xforms/form_paragraph.C:
3847 * src/frontends/xforms/form_paragraph.h:
3848 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3851 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3853 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3854 Paragraph-Data after use.
3856 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3857 non breakable paragraphs.
3859 2000-09-25 Garst R. Reese <reese@isn.net>
3861 * src/language.C (initL): added missing language_country codes.
3863 2000-09-25 Juergen Vigna <jug@sad.it>
3865 * src/insets/insettext.C (InsetText):
3866 (deleteLyXText): remove the not released LyXText structure!
3868 2000-09-24 Marko Vendelin <markov@ioc.ee>
3870 * src/frontends/gnome/mainapp.C
3871 * src/frontends/gnome/mainapp.h: added support for keyboard
3874 * src/frontends/gnome/FormCitation.C
3875 * src/frontends/gnome/FormCitation.h
3876 * src/frontends/gnome/Makefile.am
3877 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3878 FormCitation to use "action area" in mainapp window
3880 * src/frontends/gnome/Menubar_pimpl.C
3881 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3884 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3886 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3887 width/descent/ascent values if name is empty.
3888 (mathed_string_height): Use std::max.
3890 2000-09-25 Allan Rae <rae@lyx.org>
3892 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
3893 segfault. This will be completely redesigned soon.
3895 * sigc++: updated libsigc++. Fixes struct timespec bug.
3897 * development/tools/makeLyXsigc.sh: .cvsignore addition
3899 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3901 * several files: removed almost all traces of the old table
3904 * src/TableLayout.C: removed file
3906 2000-09-22 Juergen Vigna <jug@sad.it>
3908 * src/frontends/kde/Dialogs.C: added credits forms.
3910 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
3912 * src/frontends/gnome/Dialogs.C: added some forms.
3914 * src/spellchecker.C (init_spell_checker): set language in pspell code
3915 (RunSpellChecker): some modifications for setting language string.
3917 * src/language.[Ch]: added language_country code.
3919 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
3921 * src/frontends/Dialogs.h: added new signal showError.
3922 Rearranged existing signals in some sort of alphabetical order.
3924 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
3925 FormError.[Ch], form_error.[Ch]
3926 * src/frontends/xforms/forms/makefile: added new file form_error.fd
3927 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
3929 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
3930 dialogs. I think that this can be used as the base to all these
3933 * src/frontends/xforms/FormError.[Ch]
3934 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
3935 implementation of InsetError dialog.
3937 * src/insets/inseterror.[Ch]: rendered GUI-independent.
3939 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
3940 * src/frontends/kde/Makefile.am: ditto
3942 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
3944 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
3945 macrobf. This fixes a bug of invisible text.
3947 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3949 * lib/doc/LaTeXConfig.lyx.in: updated.
3951 * src/language.C (initL): remove language "francais" and change a
3952 bit the names of the two other french variations.
3954 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
3955 string that may not be 0-terminated.
3957 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3959 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
3961 2000-09-20 Marko Vendelin <markov@ioc.ee>
3963 * src/frontends/gnome/FormCitation.C
3964 * src/frontends/gnome/FormIndex.C
3965 * src/frontends/gnome/FormToc.C
3966 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
3967 the variable initialization to shut up the warnings
3969 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3971 * src/table.[Ch]: deleted files
3973 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
3976 2000-09-18 Juergen Vigna <jug@sad.it>
3978 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
3979 problems with selection. Inserted new LFUN_PASTESELECTION.
3980 (InsetButtonPress): inserted handling of middle mouse-button paste.
3982 * src/spellchecker.C: changed word to word.c_str().
3984 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
3986 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
3987 included in the ``make dist'' tarball.
3989 2000-09-15 Juergen Vigna <jug@sad.it>
3991 * src/CutAndPaste.C (cutSelection): small fix return the right
3992 end position after cut inside one paragraph only.
3994 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
3995 we are locked as otherwise we don't have a valid cursor position!
3997 * src/insets/figinset.C (draw): small bugfix but why is this needed???
3999 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
4001 * src/frontends/kde/FormRef.C: added using directive.
4002 * src/frontends/kde/FormToc.C: ditto
4004 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
4006 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
4008 2000-09-19 Marko Vendelin <markov@ioc.ee>
4010 * src/frontends/gnome/Menubar_pimpl.C
4011 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
4012 Toc, ViewFormats, UpdateFormats, and ExportFormats.
4014 * src/frontends/gnome/mainapp.C
4015 * src/frontends/gnome/mainapp.h: support for menu update used
4018 * src/frontends/gnome/mainapp.C
4019 * src/frontends/gnome/mainapp.h: support for "action" area in the
4020 main window. This area is used by small simple dialogs, such as
4023 * src/frontends/gnome/FormIndex.C
4024 * src/frontends/gnome/FormIndex.h
4025 * src/frontends/gnome/FormUrl.C
4026 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
4029 * src/frontends/gnome/FormCitation.C
4030 * src/frontends/gnome/FormCitation.h: rewrite to use main window
4031 action area. Only "Insert new citation" is implemented.
4033 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4035 * src/buffer.C (Dispatch): fix call to Dispatch
4036 * src/insets/insetref.C (Edit): likewise
4037 * src/insets/insetparent.C (Edit): likewise
4038 * src/insets/insetinclude.C (include_cb): likewise
4039 * src/frontends/xforms/FormUrl.C (apply): likewise
4040 * src/frontends/xforms/FormToc.C (apply): likewise
4041 * src/frontends/xforms/FormRef.C (apply): likewise
4042 * src/frontends/xforms/FormIndex.C (apply): likewise
4043 * src/frontends/xforms/FormCitation.C (apply): likewise
4044 * src/lyxserver.C (callback): likewise
4045 * src/lyxfunc.C (processKeySym): likewise
4046 (Dispatch): likewise
4047 (Dispatch): likewise
4048 * src/lyx_cb.C (LayoutsCB): likewise
4050 * Makefile.am (sourcedoc): small change
4052 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4054 * src/main.C (main): Don't make an empty GUIRunTime object. all
4055 methods are static. constify a bit remove unneded using + headers.
4057 * src/tabular.C: some more const to local vars move some loop vars
4059 * src/spellchecker.C: added some c_str after some word for pspell
4061 * src/frontends/GUIRunTime.h: add new static method setDefaults
4062 * src/frontends/xforms/GUIRunTime.C (setDefaults):
4063 * src/frontends/kde/GUIRunTime.C (setDefaults):
4064 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
4066 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
4067 with strnew in arg, use correct emptystring when calling SetName.
4069 * several files: remove all commented code with relation to
4070 HAVE_SSTREAM beeing false. We now only support stringstream and
4073 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4075 * src/lyxfunc.C: construct correctly the automatic new file
4078 * src/text2.C (IsStringInText): change type of variable i to shut
4081 * src/support/sstream.h: do not use namespaces if the compiler
4082 does not support them.
4084 2000-09-15 Marko Vendelin <markov@ioc.ee>
4085 * src/frontends/gnome/FormCitation.C
4086 * src/frontends/gnome/FormCitation.h
4087 * src/frontends/gnome/diainsertcitation_interface.c
4088 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
4089 regexp support to FormCitation [Gnome].
4091 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
4094 * configure.in: remove unused KDE/GTKGUI define
4096 * src/frontends/kde/FormRef.C
4097 * src/frontends/kde/FormRef.h
4098 * src/frontends/kde/formrefdialog.C
4099 * src/frontends/kde/formrefdialog.h: double click will
4100 go to reference, now it is possible to change a cross-ref
4103 * src/frontends/kde/FormToc.C
4104 * src/frontends/kde/FormToc.h
4105 * src/frontends/kde/formtocdialog.C
4106 * src/frontends/kde/formtocdialog.h: add a depth
4109 * src/frontends/kde/Makefile.am: add QtLyXView.h
4112 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
4114 * src/frontends/kde/FormCitation.h: added some using directives.
4116 * src/frontends/kde/FormToc.h: corrected definition of doTree.
4118 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
4121 * src/mathed/math_defs.h: redefine SetAlign to use string rather
4124 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4126 * src/buffer.C (pop_tag): revert for the second time a change by
4127 Lars, who seems to really hate having non-local loop variables :)
4129 * src/Lsstream.h: add "using" statements.
4131 * src/support/copy.C (copy): add a bunch of std:: qualifiers
4132 * src/buffer.C (writeFile): ditto
4134 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4136 * src/buffer.C (writeFile): try to fix the locale modified format
4137 number to always be as we want it.
4139 * src/WorkArea.C (work_area_handler): try to workaround the bugs
4140 in XForms 0.89. C-space is now working again.
4142 * src/Lsstream.h src/support/sstream.h: new files.
4144 * also commented out all cases where strstream were used.
4146 * src/Bullet.h (c_str): remove method.
4148 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
4150 * a lot of files: get rid of "char const *" and "char *" is as
4151 many places as possible. We only want to use them in interaction
4152 with system of other libraries, not inside lyx.
4154 * a lot of files: return const object is not of pod type. This
4155 helps ensure that temporary objects is not modified. And fits well
4156 with "programming by contract".
4158 * configure.in: check for the locale header too
4160 * Makefile.am (sourcedoc): new tag for generation of doc++
4163 2000-09-14 Juergen Vigna <jug@sad.it>
4165 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
4166 callback to check which combo called it and do the right action.
4168 * src/combox.C (combo_cb): added combo * to the callbacks.
4169 (Hide): moved call of callback after Ungrab of the pointer.
4171 * src/intl.h: removed LCombo2 function.
4173 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
4174 function as this can now be handled in one function.
4176 * src/combox.h: added Combox * to callback prototype.
4178 * src/frontends/xforms/Toolbar_pimpl.C:
4179 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
4181 2000-09-14 Garst Reese <reese@isn.net>
4183 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
4184 moved usepackage{xxx}'s to beginning of file. Changed left margin
4185 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
4186 underlining from title. Thanks to John Culleton for useful suggestions.
4188 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4190 * src/lyxlex_pimpl.C (setFile): change error message to debug
4193 2000-09-13 Juergen Vigna <jug@sad.it>
4195 * src/frontends/xforms/FormDocument.C: implemented choice_class
4196 as combox and give callback to combo_language so OK/Apply is activated
4199 * src/bufferlist.C (newFile): small fix so already named files
4200 (via an open call) are not requested to be named again on the
4203 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
4205 * src/frontends/kde/Makefile.am
4206 * src/frontends/kde/FormRef.C
4207 * src/frontends/kde/FormRef.h
4208 * src/frontends/kde/formrefdialog.C
4209 * src/frontends/kde/formrefdialog.h: implement
4212 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
4214 * src/frontends/kde/formtocdialog.C
4215 * src/frontends/kde/formtocdialog.h
4216 * src/frontends/kde/FormToc.C
4217 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
4219 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
4221 * src/frontends/kde/FormCitation.C: fix thinko
4222 where we didn't always display the reference text
4225 * src/frontends/kde/formurldialog.C
4226 * src/frontends/kde/formurldialog.h
4227 * src/frontends/kde/FormUrl.C
4228 * src/frontends/kde/FormUrl.h: minor cleanups
4230 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
4232 * src/frontends/kde/Makefile.am
4233 * src/frontends/kde/FormToc.C
4234 * src/frontends/kde/FormToc.h
4235 * src/frontends/kde/FormCitation.C
4236 * src/frontends/kde/FormCitation.h
4237 * src/frontends/kde/FormIndex.C
4238 * src/frontends/kde/FormIndex.h
4239 * src/frontends/kde/formtocdialog.C
4240 * src/frontends/kde/formtocdialog.h
4241 * src/frontends/kde/formcitationdialog.C
4242 * src/frontends/kde/formcitationdialog.h
4243 * src/frontends/kde/formindexdialog.C
4244 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
4246 2000-09-12 Juergen Vigna <jug@sad.it>
4248 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
4251 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4253 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
4256 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
4258 * src/converter.C (Add, Convert): Added support for converter flags:
4259 needaux, resultdir, resultfile.
4260 (Convert): Added new parameter view_file.
4261 (dvips_options): Fixed letter paper option.
4263 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
4264 (Export, GetExportableFormats, GetViewableFormats): Added support
4267 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
4269 (easyParse): Fixed to work with new export code.
4271 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
4274 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
4276 * lib/bind/*.bind: Replaced
4277 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
4278 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
4280 2000-09-11 Juergen Vigna <jug@sad.it>
4282 * src/lyx_gui.C (runTime): uses global guiruntime variable.
4284 * src/main.C (main): now GUII defines global guiruntime!
4286 * src/frontends/gnome/GUIRunTime.C (initApplication):
4287 * src/frontends/kde/GUIRunTime.C (initApplication):
4288 * src/frontends/xforms/GUIRunTime.C (initApplication):
4289 * src/frontends/GUIRunTime.h: added new function initApplication.
4291 * src/spellchecker.C (sc_accept_word): change to add_to_session.
4293 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
4295 2000-09-08 Juergen Vigna <jug@sad.it>
4297 * src/lyx_gui.C (create_forms): don't display the "default" entry as
4298 we have already "Reset".
4300 * src/language.C (initL): inserted "default" language and made this
4301 THE default language (and not american!)
4303 * src/paragraph.C: inserted handling of "default" language!
4305 * src/lyxfont.C: ditto
4309 * src/paragraph.C: output the \\par only if we have a following
4310 paragraph otherwise it's not needed.
4312 2000-09-05 Juergen Vigna <jug@sad.it>
4314 * config/pspell.m4: added entry to lyx-flags
4316 * src/spellchecker.C: modified version from Kevin for using pspell
4318 2000-09-01 Marko Vendelin <markov@ioc.ee>
4319 * src/frontends/gnome/Makefile.am
4320 * src/frontends/gnome/FormCitation.C
4321 * src/frontends/gnome/FormCitation.h
4322 * src/frontends/gnome/diainsertcitation_callbacks.c
4323 * src/frontends/gnome/diainsertcitation_callbacks.h
4324 * src/frontends/gnome/diainsertcitation_interface.c
4325 * src/frontends/gnome/diainsertcitation_interface.h
4326 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
4327 dialog for Gnome frontend
4329 * src/main.C: Gnome libraries require keeping application name
4330 and its version as strings
4332 * src/frontends/gnome/mainapp.C: Change the name of the main window
4333 from GnomeLyX to PACKAGE
4335 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4337 * src/frontends/Liason.C: add "using: declaration.
4339 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
4341 * src/mathed/math_macro.C (Metrics): Set the size of the template
4343 * src/mathed/formulamacro.C (Latex): Fixed the returned value
4345 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
4347 * src/converter.C (add_options): New function.
4348 (SetViewer): Change $$FName into '$$FName'.
4349 (View): Add options when running xdvi
4350 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
4351 (Convert): The 3rd parameter is now the desired filename. Converts
4352 calls to lyx::rename if necessary.
4353 Add options when running dvips.
4354 (dvi_papersize,dvips_options): New methods.
4356 * src/exporter.C (Export): Use getLatexName() instead of fileName().
4358 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
4359 using a call to Converter::dvips_options.
4360 Fixed to work with nex export code.
4362 * src/support/copy.C
4363 * src/support/rename.C: New files
4365 * src/support/syscall.h
4366 * src/support/syscall.C: Added Starttype SystemDontWait.
4368 * lib/ui/default.ui: Changed to work with new export code
4370 * lib/configure.m4: Changed to work with new export code
4372 * src/encoding.C: Changed latex name for iso8859_7 encoding.
4374 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
4376 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
4377 so that code compiles with DEC cxx.
4379 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
4380 to work correctly! Also now supports the additional elements
4383 2000-09-01 Allan Rae <rae@lyx.org>
4385 * src/frontends/ButtonPolicies.C: renamed all the references to
4386 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
4388 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
4389 since it's a const not a type.
4391 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
4393 2000-08-31 Juergen Vigna <jug@sad.it>
4395 * src/insets/figinset.C: Various changes to look if the filename has
4396 an extension and if not add it for inline previewing.
4398 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4400 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
4401 make buttonStatus and isReadOnly be const methods. (also reflect
4402 this in derived classes.)
4404 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
4405 (nextState): change to be static inline, pass the StateMachine as
4407 (PreferencesPolicy): remove casts
4408 (OkCancelPolicy): remvoe casts
4409 (OkCancelReadOnlyPolicy): remove casts
4410 (NoRepeatedApplyReadOnlyPolicy): remove casts
4411 (OkApplyCancelReadOnlyPolicy): remove casts
4412 (OkApplyCancelPolicy): remove casts
4413 (NoRepeatedApplyPolicy): remove casts
4415 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
4417 * src/converter.C: added some using directives
4419 * src/frontends/ButtonPolicies.C: changes to overcome
4420 "need lvalue" error with DEC c++
4422 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
4423 to WMHideCB for DEC c++
4425 * src/frontends/xforms/Menubar_pimpl.C: added using directive
4427 * src/frontends/xforms/forms/form_document.C.patch: use C callback
4428 to BulletBMTableCB for DEC c++
4430 2000-08-31 Allan Rae <rae@lyx.org>
4432 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
4433 character dialog separately from old document dialogs combo_language.
4436 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4438 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
4439 Removed LFUN_REF_CREATE.
4441 * src/MenuBackend.C: Added new tags: toc and references
4443 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
4444 (add_lastfiles, add_documents, add_formats): Removed the unused smn
4446 (add_toc, add_references): New methods.
4447 (create_submenu): Handle correctly the case when there is a
4448 seperator after optional menu items.
4450 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
4451 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
4452 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
4454 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
4456 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4458 * src/converter.[Ch]: New file for converting between different
4461 * src/export.[Ch]: New file for exporting a LyX file to different
4464 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
4465 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
4466 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
4467 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
4468 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
4469 RunDocBook, MenuExport.
4471 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
4472 Exporter::Preview methods if NEW_EXPORT is defined.
4474 * src/buffer.C (Dispatch): Use Exporter::Export.
4476 * src/lyxrc.C: Added new tags: \converter and \viewer.
4479 * src/LyXAction.C: Define new lyx-function: buffer-update.
4480 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
4481 when NEW_EXPORT is defined.
4483 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
4485 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
4487 * lib/ui/default.ui: Added submenus "view" and "update" to the
4490 * src/filetools.C (GetExtension): New function.
4492 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
4494 2000-08-29 Allan Rae <rae@lyx.org>
4496 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
4498 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
4499 (EnableDocumentLayout): removed
4500 (DisableDocumentLayout): removed
4501 (build): make use of ButtonController's read-only handling to
4502 de/activate various objects. Replaces both of the above functions.
4504 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
4505 (readOnly): was read_only
4506 (refresh): fixed dumb mistakes with read_only_ handling
4508 * src/frontends/xforms/forms/form_document.fd:
4509 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
4510 tabbed dialogs so the tabs look more like tabs and so its easier to
4511 work out which is the current tab.
4513 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
4514 segfault with form_table
4516 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
4518 2000-08-28 Juergen Vigna <jug@sad.it>
4520 * acconfig.h: added USE_PSPELL.
4522 * src/config.h.in: added USE_PSPELL.
4524 * autogen.sh: added pspell.m4
4526 * config/pspell.m4: new file.
4528 * src/spellchecker.C: implemented support for pspell libary.
4530 2000-08-25 Juergen Vigna <jug@sad.it>
4532 * src/LyXAction.C (init): renamed LFUN_TABLE to
4533 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
4535 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
4537 * src/lyxscreen.h: add force_clear variable and fuction to force
4538 a clear area when redrawing in LyXText.
4540 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
4542 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4544 * some whitespace and comment changes.
4546 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
4548 * src/buffer.C: up te LYX_FORMAT to 2.17
4550 2000-08-23 Juergen Vigna <jug@sad.it>
4552 * src/BufferView_pimpl.C (tripleClick): disable this when in a
4555 * src/insets/insettabular.C (pasteSelection): delete the insets
4556 LyXText as it is not valid anymore.
4557 (copySelection): new function.
4558 (pasteSelection): new function.
4559 (cutSelection): new function.
4560 (LocalDispatch): implemented cut/copy/paste of cell selections.
4562 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
4563 don't have a LyXText.
4565 * src/LyXAction.C (init): a NEW_TABULAR define too much.
4567 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
4570 2000-08-22 Juergen Vigna <jug@sad.it>
4572 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
4573 ifdef form_table out if NEW_TABULAR.
4575 2000-08-21 Juergen Vigna <jug@sad.it>
4577 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
4578 (draw): fixed draw position so that the cursor is positioned in the
4580 (InsetMotionNotify): hide/show cursor so the position is updated.
4581 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
4582 using cellstart() function where it should be used.
4584 * src/insets/insettext.C (draw): ditto.
4586 * src/tabular.C: fixed initialization of some missing variables and
4587 made BoxType into an enum.
4589 2000-08-22 Marko Vendelin <markov@ioc.ee>
4590 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
4591 stock menu item using action numerical value, not its string
4595 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4597 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
4598 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
4600 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
4602 * src/frontends/xforms/GUIRunTime.C: new file
4604 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
4605 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4607 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
4609 * src/frontends/kde/GUIRunTime.C: new file
4611 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
4612 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4614 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
4616 * src/frontends/gnome/GUIRunTime.C: new file
4618 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
4621 * src/frontends/GUIRunTime.h: removed constructor and destructor,
4622 small change to documetentation.
4624 * src/frontends/GUIRunTime.C: removed file
4626 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
4628 * src/lyxparagraph.h: enable NEW_TABULAR as default
4630 * src/lyxfunc.C (processKeySym): remove some commented code
4632 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
4633 NEW_TABULAR around the fd_form_table_options.
4635 * src/lyx_gui.C (runTime): call the static member function as
4636 GUIRunTime::runTime().
4638 2000-08-21 Allan Rae <rae@lyx.org>
4640 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
4643 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
4645 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
4647 2000-08-21 Allan Rae <rae@lyx.org>
4649 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
4650 keep Garst happy ;-)
4651 * src/frontends/xforms/FormPreferences.C (build): use setOK
4652 * src/frontends/xforms/FormDocument.C (build): use setOK
4653 (FormDocument): use the appropriate policy.
4655 2000-08-21 Allan Rae <rae@lyx.org>
4657 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
4658 automatic [de]activation of arbitrary objects when in a read-only state.
4660 * src/frontends/ButtonPolicies.h: More documentation
4661 (isReadOnly): added to support the above.
4663 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
4665 2000-08-18 Juergen Vigna <jug@sad.it>
4667 * src/insets/insettabular.C (getStatus): changed to return func_status.
4669 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
4670 display toggle menu entries if they are.
4672 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
4673 new document layout now.
4675 * src/lyxfunc.C: ditto
4677 * src/lyx_gui_misc.C: ditto
4679 * src/lyx_gui.C: ditto
4681 * lib/ui/default.ui: removed paper and quotes layout as they are now
4682 all in the document layout tabbed folder.
4684 * src/frontends/xforms/forms/form_document.fd: added Restore
4685 button and callbacks for all inputs for Allan's ButtonPolicy.
4687 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
4688 (CheckChoiceClass): added missing params setting on class change.
4689 (UpdateLayoutDocument): added for updating the layout on params.
4690 (build): forgot to RETURN_ALWAYS input_doc_spacing.
4691 (FormDocument): Implemented Allan's ButtonPolicy with the
4694 2000-08-17 Allan Rae <rae@lyx.org>
4696 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
4697 so we can at least see the credits again.
4699 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
4700 controller calls for the appropriate callbacks. Note that since Ok
4701 calls apply followed by cancel, and apply isn't a valid input for the
4702 APPLIED state, the bc_ calls have to be made in the static callback not
4703 within each of the real callbacks.
4705 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
4706 (setOk): renamed from setOkay()
4708 2000-08-17 Juergen Vigna <jug@sad.it>
4710 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
4711 in the implementation part.
4712 (composeUIInfo): don't show optional menu-items.
4714 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
4716 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
4718 * src/bufferview_funcs.C (CurrentState): fixed to show also the
4719 text-state when in a text-inset.
4721 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
4723 2000-08-17 Marko Vendelin <markov@ioc.ee>
4724 * src/frontends/gnome/FormIndex.C
4725 * src/frontends/gnome/FormIndex.h
4726 * src/frontends/gnome/FormToc.C
4727 * src/frontends/gnome/FormToc.h
4728 * src/frontends/gnome/dialogs
4729 * src/frontends/gnome/diatoc_callbacks.c
4730 * src/frontends/gnome/diatoc_callbacks.h
4731 * src/frontends/gnome/diainsertindex_callbacks.h
4732 * src/frontends/gnome/diainsertindex_callbacks.c
4733 * src/frontends/gnome/diainsertindex_interface.c
4734 * src/frontends/gnome/diainsertindex_interface.h
4735 * src/frontends/gnome/diatoc_interface.h
4736 * src/frontends/gnome/diatoc_interface.c
4737 * src/frontends/gnome/Makefile.am: Table of Contents and
4738 Insert Index dialogs implementation for Gnome frontend
4740 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
4742 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
4744 * src/frontends/gnome/diainserturl_interface.c: make the dialog
4747 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4749 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
4750 destructor. Don't definde if you don't need it
4751 (processEvents): made static, non-blocking events processing for
4753 (runTime): static method. event loop for xforms
4754 * similar as above for kde and gnome.
4756 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
4757 new Pimpl is correct
4758 (runTime): new method calss the real frontends runtime func.
4760 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
4762 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4764 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
4766 2000-08-16 Juergen Vigna <jug@sad.it>
4768 * src/lyx_gui.C (runTime): added GUII RunTime support.
4770 * src/frontends/Makefile.am:
4771 * src/frontends/GUIRunTime.[Ch]:
4772 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
4773 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
4774 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
4776 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
4778 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
4779 as this is already set in ${FRONTEND_INCLUDE} if needed.
4781 * configure.in (CPPFLAGS): setting the include dir for the frontend
4782 directory and don't set FRONTEND=xforms for now as this is executed
4785 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4787 * src/frontends/kde/Makefile.am:
4788 * src/frontends/kde/FormUrl.C:
4789 * src/frontends/kde/FormUrl.h:
4790 * src/frontends/kde/formurldialog.h:
4791 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4793 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4795 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4797 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4799 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4802 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4804 * src/WorkArea.C (work_area_handler): more work to get te
4805 FL_KEYBOARD to work with xforms 0.88 too, please test.
4807 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4809 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4811 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4814 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4816 * src/Timeout.h: remove Qt::emit hack.
4818 * several files: changes to allo doc++ compilation
4820 * src/lyxfunc.C (processKeySym): new method
4821 (processKeyEvent): comment out if FL_REVISION < 89
4823 * src/WorkArea.C: change some debugging levels.
4824 (WorkArea): set wantkey to FL_KEY_ALL
4825 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4826 clearer code and the use of compose with XForms 0.89. Change to
4827 use signals instead of calling methods in bufferview directly.
4829 * src/Painter.C: change some debugging levels.
4831 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4834 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4835 (workAreaKeyPress): new method
4837 2000-08-14 Juergen Vigna <jug@sad.it>
4839 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4841 * config/kde.m4: addes some features
4843 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4844 include missing xforms dialogs.
4846 * src/Timeout.h: a hack to be able to compile with qt/kde.
4848 * sigc++/.cvsignore: added acinclude.m4
4850 * lib/.cvsignore: added listerros
4852 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4853 xforms tree as objects are needed for other frontends.
4855 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4856 linking with not yet implemented xforms objects.
4858 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4860 2000-08-14 Baruch Even <baruch.even@writeme.com>
4862 * src/frontends/xforms/FormGraphics.h:
4863 * src/frontends/xforms/FormGraphics.C:
4864 * src/frontends/xforms/RadioButtonGroup.h:
4865 * src/frontends/xforms/RadioButtonGroup.C:
4866 * src/insets/insetgraphics.h:
4867 * src/insets/insetgraphics.C:
4868 * src/insets/insetgraphicsParams.h:
4869 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4870 instead of spaces, and various other indentation issues to make the
4871 sources more consistent.
4873 2000-08-14 Marko Vendelin <markov@ioc.ee>
4875 * src/frontends/gnome/dialogs/diaprint.glade
4876 * src/frontends/gnome/FormPrint.C
4877 * src/frontends/gnome/FormPrint.h
4878 * src/frontends/gnome/diaprint_callbacks.c
4879 * src/frontends/gnome/diaprint_callbacks.h
4880 * src/frontends/gnome/diaprint_interface.c
4881 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4884 * src/frontends/gnome/dialogs/diainserturl.glade
4885 * src/frontends/gnome/FormUrl.C
4886 * src/frontends/gnome/FormUrl.h
4887 * src/frontends/gnome/diainserturl_callbacks.c
4888 * src/frontends/gnome/diainserturl_callbacks.h
4889 * src/frontends/gnome/diainserturl_interface.c
4890 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
4891 Gnome implementation
4893 * src/frontends/gnome/Dialogs.C
4894 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
4895 all other dialogs. Copy all unimplemented dialogs from Xforms
4898 * src/frontends/gnome/support.c
4899 * src/frontends/gnome/support.h: support files generated by Glade
4903 * config/gnome.m4: Gnome configuration scripts
4905 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4906 configure --help message
4908 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
4909 only if there are no events pendling in Gnome/Gtk. This enhances
4910 the performance of menus.
4913 2000-08-14 Allan Rae <rae@lyx.org>
4915 * lib/Makefile.am: listerrors cleaning
4917 * lib/listerrors: removed -- generated file
4918 * acinclude.m4: ditto
4919 * sigc++/acinclude.m4: ditto
4921 * src/frontends/xforms/forms/form_citation.fd:
4922 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
4925 * src/frontends/xforms/forms/makefile: I renamed the `install` target
4926 `updatesrc` and now we have a `test` target that does what `updatesrc`
4927 used to do. I didn't like having an install target that wasn't related
4930 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
4931 on all except FormGraphics. This may yet happen. Followed by a major
4932 cleanup including using FL_TRANSIENT for most of the dialogs. More
4933 changes to come when the ButtonController below is introduced.
4935 * src/frontends/xforms/ButtonController.h: New file for managing up to
4936 four buttons on a dialog according to an externally defined policy.
4937 * src/frontends/xforms/Makefile.am: added above
4939 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
4940 Apply and Cancel/Close buttons and everything in between and beyond.
4941 * src/frontends/Makefile.am: added above.
4943 * src/frontends/xforms/forms/form_preferences.fd:
4944 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
4945 and removed variable 'status' as a result. Fixed the set_minsize thing.
4946 Use the new screen-font-update after checking screen fonts were changed
4947 Added a "Restore" button to restore the original lyxrc values while
4948 editing. This restores everything not just the last input changed.
4949 That's still a tricky one. As is the "LyX: this shouldn't happen..."
4951 * src/LyXAction.C: screen-font-update added for updating buffers after
4952 screen font settings have been changed.
4953 * src/commandtags.h: ditto
4954 * src/lyxfunc.C: ditto
4956 * forms/lyx.fd: removed screen fonts dialog.
4957 * src/lyx_gui.C: ditto
4958 * src/menus.[Ch]: ditto
4959 * src/lyx.[Ch]: ditto
4960 * src/lyx_cb.C: ditto + code from here moved to make
4961 screen-font-update. And people wonder why progress on GUII is
4962 slow. Look at how scattered this stuff was! It takes forever
4965 * forms/fdfix.sh: Fixup the spacing after commas.
4966 * forms/makefile: Remove date from generated files. Fewer clashes now.
4967 * forms/bullet_forms.C.patch: included someones handwritten changes
4969 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
4970 once I've discovered why LyXRC was made noncopyable.
4971 * src/lyx_main.C: ditto
4973 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
4975 * src/frontends/xforms/forms/fdfix.sh:
4976 * src/frontends/xforms/forms/fdfixh.sed:
4977 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
4978 * src/frontends/xforms/Form*.[hC]:
4979 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
4980 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
4981 provide a destructor for the struct FD_form_xxxx. Another version of
4982 the set_[max|min]size workaround and a few other cleanups. Actually,
4983 Angus' patch from 20000809.
4985 2000-08-13 Baruch Even <baruch.even@writeme.com>
4987 * src/insets/insetgraphics.C (Clone): Added several fields that needed
4990 2000-08-11 Juergen Vigna <jug@sad.it>
4992 * src/insets/insetgraphics.C (InsetGraphics): changing init
4993 order because of warnings.
4995 * src/frontends/xforms/forms/makefile: adding patching .C with
4998 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
4999 from .C.patch to .c.patch
5001 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
5002 order because of warning.
5004 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
5006 * src/frontends/Liason.C (setMinibuffer): new helper function
5008 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
5010 * src/lyxfunc.C (Dispatch): calling new Document-Layout
5012 * lib/ui/default.ui: commented out PaperLayout entry
5014 * src/frontends/xforms/form_document.[Ch]: new added files
5016 * src/frontends/xforms/FormDocument.[Ch]: ditto
5018 * src/frontends/xforms/forms/form_document.fd: ditto
5020 * src/frontends/xforms/forms/form_document.C.patch: ditto
5022 2000-08-10 Juergen Vigna <jug@sad.it>
5024 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
5025 (InsetGraphics): initialized cacheHandle to 0.
5026 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
5028 2000-08-10 Baruch Even <baruch.even@writeme.com>
5030 * src/graphics/GraphicsCache.h:
5031 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
5032 correctly as a cache.
5034 * src/graphics/GraphicsCacheItem.h:
5035 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
5038 * src/graphics/GraphicsCacheItem_pimpl.h:
5039 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
5042 * src/insets/insetgraphics.h:
5043 * src/insets/insetgraphics.C: Changed from using a signal notification
5044 to polling when image is not loaded.
5046 2000-08-10 Allan Rae <rae@lyx.org>
5048 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
5049 that there are two functions that have to been taken out of line by
5050 hand and aren't taken care of in the script. (Just a reminder note)
5052 * sigc++/macros/*.h.m4: Updated as above.
5054 2000-08-09 Juergen Vigna <jug@sad.it>
5056 * src/insets/insettext.C (draw): small fix for clearing rectangle.
5058 * src/insets/insettabular.C: make drawing of single cell smarter.
5060 2000-08-09 Marko Vendelin <markov@ioc.ee>
5061 * src/frontends/gnome/Menubar_pimpl.C
5062 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
5063 implementation: new files
5065 * src/frontends/gnome/mainapp.C
5066 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
5069 * src/main.C: create Gnome main window
5071 * src/frontends/xforms/Menubar_pimpl.h
5072 * src/frontends/Menubar.C
5073 * src/frontends/Menubar.h: added method Menubar::update that calls
5074 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
5076 * src/LyXView.C: calls Menubar::update to update the state
5079 * src/frontends/gnome/Makefile.am: added new files
5081 * src/frontends/Makefile.am: added frontend compiler options
5083 2000-08-08 Juergen Vigna <jug@sad.it>
5085 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
5087 * src/bufferlist.C (close):
5088 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
5089 documents if exiting without saving.
5091 * src/buffer.C (save): use removeAutosaveFile()
5093 * src/support/filetools.C (removeAutosaveFile): new function.
5095 * src/lyx_cb.C (MenuWrite): returns a bool now.
5096 (MenuWriteAs): check if file could really be saved and revert to the
5098 (MenuWriteAs): removing old autosavefile if existant.
5100 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
5101 before Goto toggle declaration, because of compiler warning.
5103 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
5105 * src/lyxfunc.C (MenuNew): small fix.
5107 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
5109 * src/bufferlist.C (newFile):
5110 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
5112 * src/lyxrc.C: added new_ask_filename tag
5114 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
5116 * src/lyx.fd: removed code pertaining to form_ref
5117 * src/lyx.[Ch]: ditto
5118 * src/lyx_cb.C: ditto
5119 * src/lyx_gui.C: ditto
5120 * src/lyx_gui_misc.C: ditto
5122 * src/BufferView_pimpl.C (restorePosition): update buffer only
5125 * src/commandtags.h (LFUN_REFTOGGLE): removed
5126 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
5127 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
5128 (LFUN_REFBACK): renamed LFUN_REF_BACK
5130 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
5131 * src/menus.C: ditto
5132 * src/lyxfunc.C (Dispatch): ditto.
5133 InsertRef dialog is now GUI-independent.
5135 * src/texrow.C: added using std::endl;
5137 * src/insets/insetref.[Ch]: strip out large amounts of code.
5138 The inset is now a container and this functionality is now
5139 managed by a new FormRef dialog
5141 * src/frontends/Dialogs.h (showRef, createRef): new signals
5143 * src/frontends/xforms/FormIndex.[Ch],
5144 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
5145 when setting dialog's min/max size
5146 * src/frontends/xforms/FormIndex.[Ch]: ditto
5148 * src/frontends/xforms/FormRef.[Ch],
5149 src/frontends/xforms/forms/form_ref.fd: new xforms
5150 implementation of an InsetRef dialog
5152 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
5155 * src/graphics/XPM_Renderer.C (isImageFormatOK):
5156 ios::nocreate is not part of the standard. Removed.
5158 2000-08-07 Baruch Even <baruch.even@writeme.com>
5160 * src/graphics/Renderer.h:
5161 * src/graphics/Renderer.C: Added base class for rendering of different
5162 image formats into Pixmaps.
5164 * src/graphics/XPM_Renderer.h:
5165 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
5166 in a different class.
5168 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
5169 easily add support for other formats.
5171 * src/insets/figinset.C: plugged a leak of an X resource.
5173 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5175 * src/CutAndPaste.[Ch]: make all metods static.
5177 * development/Code_rules/Rules: more work, added section on
5178 Exceptions, and a References section.
5180 * a lot of header files: work to make doc++ able to generate the
5181 source documentation, some workarounds of doc++ problems. Doc++ is
5182 now able to generate the documentation.
5184 2000-08-07 Juergen Vigna <jug@sad.it>
5186 * src/insets/insettabular.C (recomputeTextInsets): removed function
5188 * src/tabular.C (SetWidthOfMulticolCell):
5190 (calculate_width_of_column_NMC): fixed return value so that it really
5191 only returns true if the column-width has changed (there where
5192 problems with muliticolumn-cells in this column).
5194 2000-08-04 Juergen Vigna <jug@sad.it>
5196 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
5197 also on the scrollstatus of the inset.
5198 (workAreaMotionNotify): ditto.
5200 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
5202 2000-08-01 Juergen Vigna <jug@sad.it>
5204 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
5206 * src/commandtags.h:
5207 * src/LyXAction.C (init):
5208 * src/insets/inset.C (LocalDispatch): added support for
5211 * src/insets/inset.C (scroll): new functions.
5213 * src/insets/insettext.C (removeNewlines): new function.
5214 (SetAutoBreakRows): removes forced newlines in the text of the
5215 paragraph if autoBreakRows is set to false.
5217 * src/tabular.C (Latex): generates a parbox around the cell contents
5220 * src/frontends/xforms/FormTabular.C (local_update): removed
5221 the radio_useparbox button.
5223 * src/tabular.C (UseParbox): new function
5225 2000-08-06 Baruch Even <baruch.even@writeme.com>
5227 * src/graphics/GraphicsCache.h:
5228 * src/graphics/GraphicsCache.C:
5229 * src/graphics/GraphicsCacheItem.h:
5230 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
5233 * src/insets/insetgraphics.h:
5234 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
5235 and the drawing of the inline image.
5237 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
5238 loaded into the wrong position.
5240 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
5243 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5245 * src/support/translator.h: move all typedefs to public section
5247 * src/support/filetools.C (MakeLatexName): return string const
5249 (TmpFileName): ditto
5250 (FileOpenSearch): ditto
5252 (LibFileSearch): ditto
5253 (i18nLibFileSearch): ditto
5256 (CreateTmpDir): ditto
5257 (CreateBufferTmpDir): ditto
5258 (CreateLyXTmpDir): ditto
5261 (MakeAbsPath): ditto
5263 (OnlyFilename): ditto
5265 (NormalizePath): ditto
5266 (CleanupPath): ditto
5267 (GetFileContents): ditto
5268 (ReplaceEnvironmentPath): ditto
5269 (MakeRelPath): ditto
5271 (ChangeExtension): ditto
5272 (MakeDisplayPath): ditto
5273 (do_popen): return cmdret const
5274 (findtexfile): return string const
5276 * src/support/DebugStream.h: add some /// to please doc++
5278 * src/frontends/DialogBase.h (endif): add some /// to please doc++
5280 * src/texrow.C (same_rownumber): functor to use with find_if
5281 (getIdFromRow): rewritten to use find_if and to not update the
5282 positions. return true if row is found
5283 (increasePos): new method, use to update positions
5285 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
5287 * src/lyxlex_pimpl.C (verifyTable): new method
5290 (GetString): return string const
5291 (pushTable): rewrite to use std::stack
5293 (setFile): better check
5296 * src/lyxlex.h: make LyXLex noncopyable
5298 * src/lyxlex.C (text): return char const * const
5299 (GetString): return string const
5300 (getLongString): return string const
5302 * src/lyx_gui_misc.C (askForText): return pair<...> const
5304 * src/lastfiles.[Ch] (operator): return string const
5306 * src/buffer.C (parseSingleLyXformat2Token): pass string to
5307 istringstream not char const *.
5308 move token.end() out of loop.
5309 (readFile): move initializaton of token
5311 * src/BufferView2.C (insertErrors): run texrow.increasePos if
5312 getIdFromRow is successful.
5314 * lib/bind/emacs.bind: don't include menus bind
5316 * development/Code_rules/Rules: the beginnings of making this
5317 better and covering more of the unwritten rules that we have.
5319 * development/Code_rules/Recommendations: a couple of wording
5322 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5324 * src/support/strerror.c: remove C++ comment.
5326 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
5328 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
5329 LFUN_INDEX_INSERT_LAST
5331 * src/texrow.C (getIdFromRow): changed from const_iterator to
5332 iterator, allowing code to compile with DEC cxx
5334 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
5335 stores part of the class, as suggested by Allan. Will allow
5337 (apply): test to apply uses InsetCommandParams operator!=
5339 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
5340 (apply): test to apply uses InsetCommandParams operator!=
5342 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
5343 stores part of the class.
5344 (update): removed limits on min/max size.
5346 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
5347 (apply): test to apply uses InsetCommandParams operator!=
5349 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
5350 (Read, Write, scanCommand, getCommand): moved functionality
5351 into InsetCommandParams.
5353 (getScreenLabel): made pure virtual
5354 new InsetCommandParams operators== and !=
5356 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
5357 c-tors based on InsetCommandParams. Removed others.
5358 * src/insets/insetinclude.[Ch]: ditto
5359 * src/insets/insetlabel.[Ch]: ditto
5360 * src/insets/insetparent.[Ch]: ditto
5361 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
5363 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
5364 insets derived from InsetCommand created using similar c-tors
5365 based on InsetCommandParams
5366 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
5367 * src/menus.C (ShowRefsMenu): ditto
5368 * src/paragraph.C (Clone): ditto
5369 * src/text2.C (SetCounter): ditto
5370 * src/lyxfunc.C (Dispatch) ditto
5371 Also recreated old InsetIndex behaviour exactly. Can now
5372 index-insert at the start of a paragraph and index-insert-last
5373 without launching the pop-up.
5375 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5377 * lib/lyxrc.example: mark te pdf options as non functional.
5379 * src/support/lstrings.C (strToInt): move initalization of tmpstr
5380 (isStrDbl): move tmpstr.end() out of loop.
5381 (strToDbl): move intialization of tmpstr
5382 (lowercase): return string const and move tmp.end() out of loop.
5383 (uppercase): return string const and move tmp.edn() out of loop.
5384 (prefixIs): add assertion
5389 (containsOnly): ditto
5390 (containsOnly): ditto
5391 (containsOnly): ditto
5392 (countChar): make last arg char not char const
5393 (token): return string const
5394 (subst): return string const, move tmp.end() out of loop.
5395 (subst): return string const, add assertion
5396 (strip): return string const
5397 (frontStrip): return string const, add assertion
5398 (frontStrip): return string const
5403 * src/support/lstrings.C: add inclde "LAssert.h"
5404 (isStrInt): move tmpstr.end() out of loop.
5406 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
5407 toollist.end() out of loop.
5408 (deactivate): move toollist.end() out of loop.
5409 (update): move toollist.end() out of loop.
5410 (updateLayoutList): move tc.end() out of loop.
5411 (add): move toollist.end() out of loop.
5413 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
5414 md.end() out of loop.
5416 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
5418 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
5421 * src/paragraph.C (Erase): move fontlist.end() out of loop.
5422 (Erase): move insetlist.end() out of loop.
5424 * src/lyx_sendfax_main.C: make show_logfile static and to take a
5425 ref to const string as first arg. Move initialization of some
5426 variables, whitespace changes.
5428 * src/kbmap.C (defkey): move table.end() out of loop.
5429 (kb_keymap): move table.end() out of loop.
5430 (findbinding): move table.end() out of loop.
5432 * src/MenuBackend.C (hasMenu): move end() out of loop.
5433 (getMenu): move end() out of loop.
5434 (getMenu): move menulist_.end() out of loop.
5436 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
5438 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
5441 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
5442 (getFromLyXName): move infotab.end() out of loop.
5444 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
5445 -fvtable-thunks -ffunction-sections -fdata-sections
5447 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
5449 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
5452 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5454 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
5456 * src/frontends/xforms/FormCitation.[Ch],
5457 src/frontends/xforms/FormIndex.[Ch],
5458 src/frontends/xforms/FormToc.[Ch],
5459 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
5461 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5463 * src/commandtags.h: renamed, created some flags for citation
5466 * src/lyx_gui_misc.C: stripped out old FD_index_form code
5468 * src/lyxfunc.C (dispatch): use signals to insert index entry
5470 * src/frontends/Dialogs.h: new signal createIndex
5472 * src/frontends/xforms/FormCommand.[Ch],
5473 src/frontends/xforms/FormCitation.[Ch],
5474 src/frontends/xforms/FormToc.[Ch],
5475 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
5477 * src/insets/insetindex.[Ch]: GUI-independent
5479 * src/frontends/xforms/FormIndex.[Ch],
5480 * src/frontends/xforms/forms/form_index.fd: xforms implementation
5483 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
5485 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
5486 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
5488 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5490 * src/insets/insetref.C (Latex): rewrite so that there is now
5491 question that a initialization is requested.
5493 * src/insets/insetcommand.h: reenable the hide signal
5495 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5497 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
5498 fix handling of shortcuts (many bugs :)
5499 (add_lastfiles): ditto.
5501 * lib/ui/default.ui: fix a few shortcuts.
5503 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
5505 * Makefile.am: Fix ``rpmdist'' target to return the exit
5506 status of the ``rpm'' command, instead of the last command in
5507 the chain (the ``rm lyx.xpm'' command, which always returns
5510 2000-08-02 Allan Rae <rae@lyx.org>
5512 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
5513 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
5514 * src/frontends/xforms/FormToc.C (FormToc): ditto
5516 * src/frontends/xforms/Makefile.am: A few forgotten files
5518 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
5519 Signals-not-copyable-problem Lars' started commenting out.
5521 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
5523 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5525 * src/insets/insetcommand.h: Signals is not copyable so anoter
5526 scheme for automatic hiding of forms must be used.
5528 * src/frontends/xforms/FormCitation.h: don't inerit from
5529 noncopyable, FormCommand already does that.
5530 * src/frontends/xforms/FormToc.h: ditto
5531 * src/frontends/xforms/FormUrl.h: ditto
5533 * src/frontends/xforms/FormCitation.C: add include <algorithm>
5535 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
5537 * src/insets/insetcommand.h (hide): new SigC::Signal0
5538 (d-tor) new virtual destructor emits hide signal
5540 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
5541 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
5543 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
5544 LOF and LOT. Inset is now GUI-independent
5546 * src/insets/insetloa.[Ch]: redundant
5547 * src/insets/insetlof.[Ch]: ditto
5548 * src/insets/insetlot.[Ch]: ditto
5550 * src/frontends/xforms/forms/form_url.fd: tweaked!
5551 * src/frontends/xforms/forms/form_citation.fd: ditto
5553 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
5554 dialogs dealing with InsetCommand insets
5556 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
5557 FormCommand base class
5558 * src/frontends/xforms/FormUrl.[Ch]: ditto
5560 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
5562 * src/frontends/xforms/FormToc.[Ch]: ditto
5564 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
5565 passed a generic InsetCommand pointer
5566 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
5568 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
5569 and modified InsetTOC class
5570 * src/buffer.C: ditto
5572 * forms/lyx.fd: strip out old FD_form_toc code
5573 * src/lyx_gui_misc.C: ditto
5574 * src/lyx_gui.C: ditto
5575 * src/lyx_cb.C: ditto
5576 * src/lyx.[Ch]: ditto
5578 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5580 * src/support/utility.hpp: tr -d '\r'
5582 2000-08-01 Juergen Vigna <jug@sad.it>
5584 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
5586 * src/commandtags.h:
5587 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
5588 LFUN_TABULAR_FEATURES.
5590 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
5591 LFUN_LAYOUT_TABULAR.
5593 * src/insets/insettabular.C (getStatus): implemented helper function.
5595 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
5597 2000-07-31 Juergen Vigna <jug@sad.it>
5599 * src/text.C (draw): fixed screen update problem for text-insets.
5601 * src/text2.C (SetParagrpah): call an update of the inset-owner when
5602 something changed probably this has to be added in various other
5605 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
5607 2000-07-31 Baruch Even <baruch.even@writeme.com>
5609 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
5610 templates to satisfy compaq cxx.
5613 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5615 * src/support/translator.h (equal_1st_in_pair::operator()): take
5616 const ref pair_type as arg.
5617 (equal_2nd_in_pair::operator()): ditto
5618 (Translator::~Translator): remove empty d-tor.
5620 * src/graphics/GraphicsCache.C: move include config.h to top, also
5621 put initialization of GraphicsCache::singleton here.
5622 (~GraphicsCache): move here
5623 (addFile): take const ref as arg
5626 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
5628 * src/BufferView2.C (insertLyXFile): change te with/without header
5631 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5633 * src/frontends/xforms/FormGraphics.C (apply): add some
5634 static_cast. Not very nice, but required by compaq cxx.
5636 * src/frontends/xforms/RadioButtonGroup.h: include header
5637 <utility> instead of <pair.h>
5639 * src/insets/insetgraphicsParams.C: add using directive.
5640 (readResize): change return type to void.
5641 (readOrigin): ditto.
5643 * src/lyxfunc.C (getStatus): add missing break for build-program
5644 function; add test for Literate for export functions.
5646 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
5647 entries in Options menu.
5649 2000-07-31 Baruch Even <baruch.even@writeme.com>
5651 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
5652 protect against auto-allocation; release icon when needed.
5654 2000-07-31 Matej Cepl <CeplM@seznam.cz>
5656 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
5657 on usual typewriter.
5659 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
5660 earlier czech.kmap), useful only for programming.
5662 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5664 * src/frontends/xforms/FormCitation.h: fix conditioning around
5667 2000-07-31 Juergen Vigna <jug@sad.it>
5669 * src/frontends/xforms/FormTabular.C (local_update): changed
5670 radio_linebreaks to radio_useparbox and added radio_useminipage.
5672 * src/tabular.C: made support for using minipages/parboxes.
5674 * src/bufferlist.C (QwriteAll): small fix for asking for save.
5676 * src/insets/insetgraphics.C (draw): just draw the inset so that the
5678 (descent): so the cursor is in the middle.
5679 (width): bit smaller box.
5681 * src/insets/insetgraphics.h: added display() function.
5683 2000-07-31 Baruch Even <baruch.even@writeme.com>
5685 * src/frontends/Dialogs.h: Added showGraphics signals.
5687 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
5688 xforms form definition of the graphics dialog.
5690 * src/frontends/xforms/FormGraphics.h:
5691 * src/frontends/xforms/FormGraphics.C: Added files, the
5692 GUIndependent code of InsetGraphics
5694 * src/insets/insetgraphics.h:
5695 * src/insets/insetgraphics.C: Major writing to make it work.
5697 * src/insets/insetgraphicsParams.h:
5698 * src/insets/insetgraphicsParams.C: Added files, parameter passing
5699 struct between InsetGraphics and GUI.
5701 * src/LaTeXFeatures.h:
5702 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
5703 support for graphicx package.
5705 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
5706 for the graphics inset.
5708 * src/support/translator.h: Added file, used in
5709 InsetGraphicsParams. this is a template to translate between two
5712 * src/frontends/xforms/RadioButtonGroup.h:
5713 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
5714 way to easily control a radio button group.
5716 2000-07-28 Juergen Vigna <jug@sad.it>
5718 * src/insets/insettabular.C (LocalDispatch):
5719 (TabularFeatures): added support for lyx-functions of tabular features.
5720 (cellstart): refixed this function after someone wrongly changed it.
5722 * src/commandtags.h:
5723 * src/LyXAction.C (init): added support for tabular-features
5725 2000-07-28 Allan Rae <rae@lyx.org>
5727 * src/frontends/xforms/FormPreferences.C (build): Setup input return
5728 checking. NOTE: It seems that pressing ESC to cancel the dialog also
5729 triggers the callback for input checking. As a result we sometimes get
5730 "LyX: This shouldn't happen..." printed to cerr.
5731 (input): Started using status variable since I only free() on
5732 destruction. Some input checking for paths and font sizes.
5734 * src/frontends/xforms/FormPreferences.h: Use status to control
5735 activation of Ok and Apply
5737 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
5738 callback. Also resized to stop segfaults with 0.88. The problem is
5739 that xforms-0.88 requires the folder to be wide enough to fit all the
5740 tabs. If it isn't it causes all sorts of problems.
5742 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
5744 * src/frontends/xforms/forms/README: Reflect reality.
5746 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
5747 * src/frontends/xforms/forms/makefile: ditto.
5749 * src/commandtags.h: Get access to new Preferences dialog
5750 * src/LyXAction.C: ditto
5751 * src/lyxfunc.C: ditto
5752 * lib/ui/default.ui: ditto
5754 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5756 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
5758 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
5761 * src/frontends/xforms/form_url.[Ch]: added.
5763 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5765 * src/insets/insetbib.h: fixed bug in previous commit
5767 * src/frontends/xforms/FormUrl.h: ditto
5769 * src/frontends/xforms/FormPrint.h: ditto
5771 * src/frontends/xforms/FormPreferences.h: ditto
5773 * src/frontends/xforms/FormCopyright.h: ditto
5775 * src/frontends/xforms/FormCitation.C: ditto
5777 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
5778 private copyconstructor and private default contructor
5780 * src/support/Makefile.am: add utility.hpp
5782 * src/support/utility.hpp: new file from boost
5784 * src/insets/insetbib.h: set owner in clone
5786 * src/frontends/xforms/FormCitation.C: added missing include
5789 * src/insets/form_url.[Ch]: removed
5791 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5793 * development/lyx.spec.in
5794 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5795 file/directory re-organization.
5797 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5799 * src/insets/insetcommand.[Ch]: moved the string data and
5800 associated manipulation methods into a new stand-alone class
5801 InsetCommandParams. This class has two additional methods
5802 getAsString() and setFromString() allowing the contents to be
5803 moved around as a single string.
5804 (addContents) method removed.
5805 (setContents) method no longer virtual.
5807 * src/buffer.C (readInset): made use of new InsetCitation,
5808 InsetUrl constructors based on InsetCommandParams.
5810 * src/commandtags.h: add LFUN_INSERT_URL
5812 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5813 independent InsetUrl and use InsetCommandParams to extract
5814 string info and create new Insets.
5816 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5818 * src/frontends/xforms/FormCitation.C (apply): uses
5821 * src/frontends/xforms/form_url.C
5822 * src/frontends/xforms/form_url.h
5823 * src/frontends/xforms/FormUrl.h
5824 * src/frontends/xforms/FormUrl.C
5825 * src/frontends/xforms/forms/form_url.fd: new files
5827 * src/insets/insetcite.[Ch]: removed unused constructors.
5829 * src/insets/insetinclude.[Ch]: no longer store filename
5831 * src/insets/inseturl.[Ch]: GUI-independent.
5833 2000-07-26 Juergen Vigna <jug@sad.it>
5834 * renamed frontend from gtk to gnome as it is that what is realized
5835 and did the necessary changes in the files.
5837 2000-07-26 Marko Vendelin <markov@ioc.ee>
5839 * configure.in: cleaning up gnome configuration scripts
5841 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5843 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5844 shortcuts syndrom by redrawing them explicitely (a better solution
5845 would be appreciated).
5847 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5849 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5852 * src/lyx_cb.C (MenuExport): change html export to do the right
5853 thing depending of the document type (instead of having
5854 html-linuxdoc and html-docbook).
5855 * src/lyxfunc.C (getStatus): update for html
5856 * lib/ui/default.ui: simplify due to the above change.
5857 * src/menus.C (ShowFileMenu): update too (in case we need it).
5859 * src/MenuBackend.C (read): if a menu is defined twice, add the
5860 new entries to the exiting one.
5862 2000-07-26 Juergen Vigna <jug@sad.it>
5864 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5866 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5867 and return a bool if it did actual save the file.
5868 (AutoSave): don't autosave a unnamed doc.
5870 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5871 check if this is an UNNAMED new file and react to it.
5872 (newFile): set buffer to unnamed and change to not mark a new
5873 buffer dirty if I didn't do anything with it.
5875 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5877 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5879 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5880 friend as per Angus's patch posted to lyx-devel.
5882 * src/ext_l10n.h: updated
5884 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5885 gettext on the style string right before inserting them into the
5888 * autogen.sh: add code to extract style strings form layout files,
5889 not good enough yet.
5891 * src/frontends/gtk/.cvsignore: add MAKEFILE
5893 * src/MenuBackend.C (read): run the label strings through gettext
5894 before storing them in the containers.
5896 * src/ext_l10n.h: new file
5898 * autogen.sh : generate the ext_l10n.h file here
5900 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5902 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5905 * lib/ui/default.ui: fix a couple of typos.
5907 * config/gnome/gtk.m4: added (and added to the list of files in
5910 * src/insets/insetinclude.C (unique_id): fix when we are using
5911 lyxstring instead of basic_string<>.
5912 * src/insets/insettext.C (LocalDispatch): ditto.
5913 * src/support/filetools.C: ditto.
5915 * lib/configure.m4: create the ui/ directory if necessary.
5917 * src/LyXView.[Ch] (updateToolbar): new method.
5919 * src/BufferView_pimpl.C (buffer): update the toolbar when
5920 opening/closing buffer.
5922 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5924 * src/LyXAction.C (getActionName): enhance to return also the name
5925 and options of pseudo-actions.
5926 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
5928 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
5929 as an example of what is possible). Used in File->Build too (more
5930 useful) and in the import/export menus (to mimick the complicated
5931 handling of linuxdoc and friends). Try to update all the entries.
5933 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
5936 * src/MenuBackend.C (read): Parse the new OptItem tag.
5938 * src/MenuBackend.h: Add a new optional_ data member (used if the
5939 entry should be omitted when the lyxfunc is disabled).
5941 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
5942 function, used as a shortcut.
5943 (create_submenu): align correctly the shortcuts on the widest
5946 * src/MenuBackend.h: MenuItem.label() only returns the label of
5947 the menu without shortcut; new method shortcut().
5949 2000-07-14 Marko Vendelin <markov@ioc.ee>
5951 * src/frontends/gtk/Dialogs.C:
5952 * src/frontends/gtk/FormCopyright.C:
5953 * src/frontends/gtk/FormCopyright.h:
5954 * src/frontends/gtk/Makefile.am: added these source-files for the
5955 Gtk/Gnome support of the Copyright-Dialog.
5957 * src/main.C: added Gnome::Main initialization if using
5958 Gtk/Gnome frontend-GUI.
5960 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
5962 * config/gnome/aclocal-include.m4
5963 * config/gnome/compiler-flags.m4
5964 * config/gnome/curses.m4
5965 * config/gnome/gnome--.m4
5966 * config/gnome/gnome-bonobo-check.m4
5967 * config/gnome/gnome-common.m4
5968 * config/gnome/gnome-fileutils.m4
5969 * config/gnome/gnome-ghttp-check.m4
5970 * config/gnome/gnome-gnorba-check.m4
5971 * config/gnome/gnome-guile-checks.m4
5972 * config/gnome/gnome-libgtop-check.m4
5973 * config/gnome/gnome-objc-checks.m4
5974 * config/gnome/gnome-orbit-check.m4
5975 * config/gnome/gnome-print-check.m4
5976 * config/gnome/gnome-pthread-check.m4
5977 * config/gnome/gnome-support.m4
5978 * config/gnome/gnome-undelfs.m4
5979 * config/gnome/gnome-vfs.m4
5980 * config/gnome/gnome-x-checks.m4
5981 * config/gnome/gnome-xml-check.m4
5982 * config/gnome/gnome.m4
5983 * config/gnome/gperf-check.m4
5984 * config/gnome/gtk--.m4
5985 * config/gnome/linger.m4
5986 * config/gnome/need-declaration.m4: added configuration scripts
5987 for Gtk/Gnome frontend-GUI
5989 * configure.in: added support for the --with-frontend=gtk option
5991 * autogen.sh: added config/gnome/* to list of config-files
5993 * acconfig.h: added define for GTKGUI-support
5995 * config/lyxinclude.m4: added --with-frontend[=value] option value
5996 for Gtk/Gnome frontend-GUI support.
5998 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6000 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
6004 * src/paragraph.C (GetChar): remove non-const version
6006 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
6007 (search_kw): use it.
6009 * src/lyx_main.C (init): if "preferences" exist, read that instead
6011 (ReadRcFile): return bool if the file could be read ok.
6012 (ReadUIFile): add a check to see if lex file is set ok.
6014 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
6015 bastring can be used instead of lyxstring (still uses the old code
6016 if std::string is good enough or if lyxstring is used.)
6018 * src/encoding.C: make the arrays static, move ininle functions
6020 * src/encoding.h: from here.
6022 * src/buffer.C: have last_isnet_read as a file scope variable for now.
6023 (parseSingleLyXformat2Token): move inset parsing to separate method
6024 (readInset): new private method
6026 * src/Variables.h: remove virtual from get().
6028 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
6029 access to NEW_INSETS and NEW_TABULAR
6031 * src/MenuBackend.h: remove superfluous forward declaration of
6032 MenuItem. Add documentations tags "///", remove empty MenuItem
6033 destructor, remove private default contructor.
6035 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
6037 (read): more string mlabel and mname to where they are used
6038 (read): remove unused variables mlabel and mname
6039 (defaults): unconditional clear, make menusetup take advantage of
6040 add returning Menu &.
6042 * src/LyXView.h: define NEW_MENUBAR as default
6044 * src/LyXAction.C: include lyxparagraph.h temporary to get access
6045 to NEW_INSETS and NEW_TABULAR.
6046 (init): commetn out some funcs that is obsolete when NEW_INSETS is
6047 defined. Change some of the "xxxx-inset-insert" functions names to
6050 * several files: more enahncements to NEW_INSETS and the resulting
6053 * lib/lyxrc.example (\date_insert_format): move to misc section
6055 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
6056 bastring and use AC_CACHE_CHECK.
6057 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
6058 the system have the newest methods. uses AC_CACHE_CHECK
6059 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
6060 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
6061 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
6063 * configure.in: add LYX_CXX_GOOD_STD_STRING
6065 * acinclude.m4: recreated
6067 2000-07-24 Amir Karger <karger@lyx.org>
6069 * README: add Hebrew, Arabic kmaps
6072 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6074 * src/buffer.C (writeFileAscii): Define actcell as an int instead
6077 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6079 * Lot of files: add pragma interface/implementation.
6081 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
6083 * lib/ui/default.ui: new file (ans new directory). Contains the
6084 default menu and toolbar.
6086 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
6087 global space. Toolbars are now read (as menus) in ui files.
6089 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
6091 * src/lyxfunc.C (getStatus): do not exit immediately if a command
6092 is disabled because the document is read-only. We want to have the
6093 toggle state of the function anyway.
6094 (getStatus): add code for LFUN_VC* functions (mimicking what is
6095 done in old-style menus)
6097 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
6098 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
6100 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
6101 * src/BufferView_pimpl.C: ditto.
6102 * src/lyxfunc.C: ditto.
6104 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
6105 default). This replaces old-style menus by new ones.
6107 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
6108 MenuItem. Contain the data structure of a menu.
6110 * src/insets/insettext.C: use LyXView::setLayout instead of
6111 accessing directly the toolbar combox.
6112 * src/lyxfunc.C (Dispatch): ditto.
6114 * src/LyXView.C (setLayout): new method, which just calls
6115 Toolbar::setLayout().
6116 (updateLayoutChoice): move part of this method in Toolbar.
6118 * src/toolbar.[Ch]: removed.
6120 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
6121 implementation the toolbar.
6123 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
6124 the toolbar. It might make sense to merge it with ToolbarDefaults
6126 (setLayout): new function.
6127 (updateLayoutList): ditto.
6128 (openLayoutList): ditto.
6130 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
6131 xforms implementation of the toolbar.
6132 (get_toolbar_func): comment out, since I do not
6133 know what it is good for.
6135 * src/ToolbarDefaults.h: Add the ItemType enum.
6137 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
6138 for a list of allocated C strings. Used in Menubar xforms
6139 implementation to avoid memory leaks.
6141 * src/support/lstrings.[Ch] (uppercase): new version taking and
6145 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
6146 * lib/bind/emacs.bind: ditto.
6148 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6150 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
6151 forward decl of LyXView.
6153 * src/toolbar.C (toolbarItem): moved from toolbar.h
6154 (toolbarItem::clean): ditto
6155 (toolbarItem::~toolbarItem): ditto
6156 (toolbarItem::operator): ditto
6158 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
6160 * src/paragraph.h: control the NEW_TABULAR define from here
6162 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
6163 USE_TABULAR_INSETS to NEW_TABULAR
6165 * src/ToolbarDefaults.C: add include "lyxlex.h"
6167 * files using the old table/tabular: use NEW_TABULAR to control
6168 compilation of old tabular stuff.
6170 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
6173 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
6174 planemet in reading of old style floats, fix the \end_deeper
6175 problem when reading old style floats.
6177 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6179 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
6181 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
6183 * lib/bind/sciword.bind: updated.
6185 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6187 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
6188 layout write problem
6190 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6192 * src/Makefile.am (INCLUDES): remove image directory from include
6195 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
6196 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
6198 * src/LyXView.C (create_form_form_main): read the application icon
6201 * lib/images/*.xpm: change the icons to use transparent color for
6204 * src/toolbar.C (update): change the color of the button when it
6207 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6209 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
6210 setting explicitely the minibuffer.
6211 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
6213 * src/LyXView.C (showState): new function. Shows font information
6214 in minibuffer and update toolbar state.
6215 (LyXView): call Toolbar::update after creating the
6218 * src/toolbar.C: change toollist to be a vector instead of a
6220 (BubbleTimerCB): get help string directly from the callback
6221 argument of the corresponding icon (which is the action)
6222 (set): remove unnecessary ugliness.
6223 (update): new function. update the icons (depressed, disabled)
6224 depending of the status of the corresponding action.
6226 * src/toolbar.h: remove help in toolbarItem
6228 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
6230 * src/Painter.C (text): Added code for using symbol glyphs from
6231 iso10646 fonts. Currently diabled.
6233 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
6236 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
6237 magyar,turkish and usorbian.
6239 * src/paragraph.C (isMultiLingual): Made more efficient.
6241 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
6244 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
6245 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
6246 Also changed the prototype to "bool math_insert_greek(char)".
6248 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6250 * lots of files: apply the NEW_INSETS on all code that will not be
6251 needed when we move to use the new insets. Enable the define in
6252 lyxparagrah.h to try it.
6254 * src/insets/insettabular.C (cellstart): change to be a static
6256 (InsetTabular): initialize buffer in the initializer list.
6258 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
6260 * src/frontends/xforms/FormPrint.[Ch] : moved #include
6261 form_print.h out of the header file. Replaced with forward
6262 declarations of the relevant struct.
6264 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
6267 * src/commandtags.h: do not include "debug.h" which does not
6268 belong there. #include it in some other places because of this
6271 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6273 * src/insets/insetcaption.C: add a couple "using" directives.
6275 * src/toolbar.C (add): get the help text directly from lyxaction.
6277 (setPixmap): new function. Loads from disk and sets a pixmap on a
6278 botton; the name of the pixmap file is derived from the command
6281 * src/toolbar.h: remove members isBitmap and pixmap from
6284 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
6285 * lib/images/: move many files from images/banner.xpm.
6287 * src/lyx_gui.C (create_forms): read banner pixmap from file.
6289 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
6290 * src/toolbar.C: ditto.
6291 * configure.in: ditto.
6292 * INSTALL: document.
6294 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
6295 the spellchecker popup is closed from the WM.
6297 2000-07-19 Juergen Vigna <jug@sad.it>
6299 * src/insets/insetfloat.C (Write): small fix because we use the
6300 insetname for the type now!
6302 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
6304 * src/frontends/xforms/forms/form_citation.fd: object sizes are
6307 * src/frontends/Dialogs.h: removed hideCitation signal
6309 * src/insets/insetcite.h: added hide signal
6311 * src/insets/insetcite.C (~InsetCitation): emits new signal
6312 (getScreenLabel): "intelligent" label should now fit on the screen!
6314 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
6316 * src/frontends/xforms/FormCitation.C (showInset): connects
6317 hide() to the inset's hide signal
6318 (show): modified to use fl_set_object_position rather than
6319 fl_set_object_geometry wherever possible
6321 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6323 * src/insets/lyxinset.h: add caption code
6325 * src/insets/insetfloat.C (type): new method
6327 * src/insets/insetcaption.C (Write): new method
6329 (LyxCode): new method
6331 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
6332 to get it right together with using the FloatList.
6334 * src/commandtags.h: add LFUN_INSET_CAPTION
6335 * src/lyxfunc.C (Dispatch): handle it
6337 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
6340 * src/Variables.[Ch]: make expand take a const reference, remove
6341 the destructor, some whitespace changes.
6343 * src/LyXAction.C (init): add caption-inset-insert
6345 * src/FloatList.C (FloatList): update the default floats a bit.
6347 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6349 * src/Variables.[Ch]: new files. Intended to be used for language
6350 specific strings (like \chaptername) and filename substitution in
6353 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
6355 * lib/kbd/american.kmap: update
6357 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
6359 * src/bufferparams.[Ch]: remove member allowAccents.
6361 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
6363 * src/LaTeXLog.C: use the log_form.h header.
6364 * src/lyx_gui.C: ditto.
6365 * src/lyx_gui_misc.C: ditto.
6366 * src/lyxvc.h: ditto.
6368 * forms/log_form.fd: new file, created from latexoptions.fd. I
6369 kept the log popup and nuked the options form.
6371 * src/{la,}texoptions.[Ch]: removed.
6372 * src/lyx_cb.C (LaTeXOptions): ditto
6374 * src/lyx_gui.C (create_forms): do not handle the
6375 fd_latex_options form.
6377 2000-07-18 Juergen Vigna <jug@sad.it>
6379 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
6380 name of the inset so that it can be requested outside (text2.C).
6382 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
6385 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6387 * src/mathed/formula.h (ConvertFont): constify
6389 * src/mathed/formula.C (Read): add warning if \end_inset is not
6390 found on expected place.
6392 * src/insets/lyxinset.h (ConvertFont): consify
6394 * src/insets/insetquotes.C (ConvertFont): constify
6395 * src/insets/insetquotes.h: ditto
6397 * src/insets/insetinfo.h: add labelfont
6399 * src/insets/insetinfo.C (InsetInfo): set the labelfont
6400 (ascent): use labelfont
6404 (Write): make .lyx file a bit nicer
6406 * src/insets/insetfloat.C (Write): simplify somewhat...
6407 (Read): add warning if arg is not found
6409 * src/insets/insetcollapsable.C: add using std::max
6410 (Read): move string token and add warning in arg is not found
6411 (draw): use std::max to get the right ty
6412 (getMaxWidth): simplify by using std::max
6414 * src/insets/insetsection.h: new file
6415 * src/insets/insetsection.C: new file
6416 * src/insets/insetcaption.h: new file
6417 * src/insets/insetcaption.C: new file
6419 * src/insets/inset.C (ConvertFont): constify signature
6421 * src/insets/Makefile.am (libinsets_la_SOURCES): add
6422 insetcaption.[Ch] and insetsection.[Ch]
6424 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
6425 uses to use LABEL_COUNTER_CHAPTER instead.
6426 * src/text2.C (SetCounter): here
6428 * src/counters.h: new file
6429 * src/counters.C: new file
6430 * src/Sectioning.h: new file
6431 * src/Sectioning.C: new file
6433 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
6435 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6437 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
6440 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
6443 2000-07-17 Juergen Vigna <jug@sad.it>
6445 * src/tabular.C (Validate): check if array-package is needed.
6446 (SetVAlignment): added support for vertical alignment.
6447 (SetLTFoot): better support for longtable header/footers
6448 (Latex): modified to support added features.
6450 * src/LaTeXFeatures.[Ch]: added array-package.
6452 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
6454 * src/lyx_gui.C (LyXGUI): make sure that the height is large
6457 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
6459 * configure.in: do not forget to put a space after -isystem.
6461 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
6463 * lib/kbd/arabic.kmap: a few fixes.
6465 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6467 * some whitespace chagnes to a number of files.
6469 * src/support/DebugStream.h: change to make it easier for
6470 doc++ to parse correctly.
6471 * src/support/lyxstring.h: ditto
6473 * src/mathed/math_utils.C (compara): change to have only one
6475 (MathedLookupBOP): change because of the above.
6477 * src/mathed/math_delim.C (math_deco_compare): change to have only
6479 (search_deco): change becasue of the above.
6481 * src/insets/insettabular.C (DrawCellSelection): use std::swap
6482 instead of manually coded one.
6484 * src/insets/insetquotes.C (Read): read the \end_inset too
6486 * src/insets/insetlatex.h: remove file
6487 * src/insets/insetlatex.C: remove file
6489 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
6491 (InsetPrintIndex): remove destructor
6493 * src/insets/insetinclude.h: remove default constructor
6495 * src/insets/insetfloat.C: work to make it work better
6497 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
6499 * src/insets/insetcite.h (InsetCitation): remove default constructor
6501 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
6503 * src/text.C (GetColumnNearX): comment out some currently unused code.
6505 * src/paragraph.C (writeFile): move some initializations closer to
6507 (CutIntoMinibuffer): small change to use new matchIT operator
6511 (InsertInset): ditto
6514 (InsetIterator): ditto
6515 (Erase): small change to use new matchFT operator
6517 (GetFontSettings): ditto
6518 (HighestFontInRange): ditto
6521 * src/lyxparagraph.h: some chars changed to value_type
6522 (matchIT): because of some stronger checking (perhaps too strong)
6523 in SGI STL, the two operator() unified to one.
6526 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
6528 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
6529 the last inset read added
6530 (parseSingleLyXformat2Token): some more (future) compability code added
6531 (parseSingleLyXformat2Token): warning about solitary \end_inset added
6532 (parseSingleLyXformat2Token): set last_inset_read
6533 (parseSingleLyXformat2Token): more code to read new "Float" correctly
6534 (parseSingleLyXformat2Token): don't double intializw string next_token
6536 * src/TextCache.C (text_fits::operator()): add const's to the signature
6537 (has_buffer::operator()): ditto
6539 * src/Floating.h: add some comments on the class
6541 * src/FloatList.[Ch] (typeExist): new method
6544 * src/BackStack.h: added default constructor, wanted by Gcc.
6546 2000-07-14 Juergen Vigna <jug@sad.it>
6548 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
6550 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
6552 * src/insets/insettabular.C (resizeLyXText): need this to be able to
6553 do a redraw when the window is resized!
6554 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
6556 * src/insets/insettext.C (resizeLyXText): added function to correctly
6557 being able to resize the LyXWindow.
6559 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
6561 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
6563 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
6564 crashes when closing dialog to a deleted inset.
6566 * src/insets/insetcite.[Ch] (Edit) : the return of this former
6567 method! Now similar to other insets.
6569 2000-07-13 Juergen Vigna <jug@sad.it>
6571 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
6573 * lib/examples/Literate.lyx: small patch!
6575 * src/insets/insetbib.C (Read): added this function because of wrong
6576 Write (without [begin|end]_inset).
6578 2000-07-11 Juergen Vigna <jug@sad.it>
6580 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
6581 as the insertInset could not be good!
6583 * src/screen.C (ToggleSelection): fixed toggle selection bug as
6584 the bool param should not be last.
6586 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6588 * sigc++/configure.in: fix bug in threading-related code (Yes, I
6589 did submit that to Karl).
6591 * configure.in: use -isystem instead of -I for X headers. This
6592 fixes a problem on solaris with a recent gcc;
6593 put the front-end code after the X detection code;
6594 configure in sigc++ before lib/
6596 * src/lyx_main.C (commandLineHelp): remove -display from command
6599 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
6601 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
6602 Also put in Makefile rules for building the ``listerrors''
6603 program for parsing errors from literate programs written in LyX.
6605 * lib/build-listerrors: Added small shell script as part of compile
6606 process. This builds a working ``listerrors'' binary if noweb is
6607 installed and either 1) the VNC X server is installed on the machine,
6608 or 2) the user is compiling from within a GUI. The existence of a GUI
6609 is necessary to use the ``lyx --export'' feature for now. This
6610 hack can be removed once ``lyx --export'' no longer requires a GUI to
6613 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
6615 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
6616 now passed back correctly from gcc and placed "under" error
6617 buttons in a Literate LyX source.
6619 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6621 * src/text.C (GetColumnNearX): Better behavior when a RTL
6622 paragraph is ended by LTR text.
6624 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
6627 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6629 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
6630 true when clipboard is empty.
6632 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6634 * text.C (Backspace): Prevent rebreaking of a row if it is the last
6635 row of the paragraph.
6636 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
6637 to prevent calculation of bidi tables
6639 2000-07-07 Juergen Vigna <jug@sad.it>
6641 * src/screen.C (ToggleSelection): added y_offset and x_offset
6644 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
6647 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
6649 * src/insets/insettext.C: fixed Layout-Display!
6651 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6653 * configure.in: add check for strings.h header.
6655 * src/spellchecker.C: include <strings.h> in order to have a
6656 definition for bzero().
6658 2000-07-07 Juergen Vigna <jug@sad.it>
6660 * src/insets/insettext.C (draw): set the status of the bv->text to
6661 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
6663 * src/screen.C (DrawOneRow):
6664 (DrawFromTo): redraw the actual row if something has changed in it
6667 * src/text.C (draw): call an update of the toplevel-inset if something
6668 has changed inside while drawing.
6670 * src/lyxtext.h: added CHANGED_IN_DRAW status.
6672 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
6674 * src/insets/insetbib.[Ch] (callback) new method, moving callback
6675 processing inside class.
6677 * src/insets/insetindex.[Ch] (callback) new method, moving callback
6678 processing inside class.
6680 * src/insets/insetindex.h new struct Holder, consistent with other
6683 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
6684 citation dialog from main code and placed it in src/frontends/xforms.
6685 Dialog launched through signals instead of callbacks
6687 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
6689 * lyx.man: update the options description.
6691 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
6693 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
6694 handle neg values, set min width to 590, add doc about -display
6696 2000-07-05 Juergen Vigna <jug@sad.it>
6698 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
6699 calls to BufferView *.
6701 * src/insets/insettext.C (checkAndActivateInset): small fix non
6702 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
6704 * src/insets/insetcommand.C (Read): Fixed as insets should read till
6705 their \end_inset token!
6707 2000-07-04 edscott <edscott@imp.mx>
6709 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
6710 lib/lyxrc.example: added option \wheel_jump
6712 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
6714 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
6715 remove support for -width,-height,-xpos and -ypos.
6717 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
6719 * src/encoding.[Ch]: New files.
6721 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
6722 (text): Call to the underline() method only when needed.
6724 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
6726 * src/buffer.C (makeLaTeXFile): Compute automatically the input
6727 encoding(s) for the document.
6729 * src/bufferparams.C (BufferParams): Changed default value of
6732 * src/language.C (newLang): Removed.
6733 (items[]): Added encoding information for all defined languages.
6735 * src/lyx_gui.C (create_forms): Added "auto" option to the input
6736 encoding choice button.
6738 * src/lyxrc.h (font_norm_type): New member variable.
6739 (set_font_norm_type): New method.
6741 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
6742 paragraphs with different encodings.
6744 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
6745 (TransformChar): Changed to work correctly with Arabic points.
6746 (draw): Added support for drawing Arabic points.
6747 (draw): Removed code for drawing underbars (this is done by
6750 * src/support/textutils.h (IsPrintableNonspace): New function.
6752 * src/BufferView_pimpl.h: Added "using SigC::Object".
6753 * src/LyXView.h: ditto.
6755 * src/insets/insetinclude.h (include_label): Changed to mutable.
6757 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6759 * src/mathed/math_iter.h: remove empty destructor
6761 * src/mathed/math_cursor.h: remove empty destructor
6763 * src/insets/lyxinset.h: add THEOREM_CODE
6765 * src/insets/insettheorem.[Ch]: new files
6767 * src/insets/insetminipage.C: (InsertInset): remove
6769 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
6771 (InsertInset): remove
6773 * src/insets/insetlist.C: (InsertList): remove
6775 * src/insets/insetfootlike.[Ch]: new files
6777 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
6780 (InsertInset): ditto
6782 * src/insets/insetert.C: remove include Painter.h, reindent
6783 (InsertInset): move to header
6785 * src/insets/insetcollapsable.h: remove explicit from default
6786 contructor, remove empty destructor, add InsertInset
6788 * src/insets/insetcollapsable.C (InsertInset): new func
6790 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6792 * src/vspace.h: add explicit to constructor
6794 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6795 \textcompwordmark, please test this.
6797 * src/lyxrc.C: set ascii_linelen to 65 by default
6799 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6801 * src/commandtags.h: add LFUN_INSET_THEOREM
6803 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6804 (makeLinuxDocFile): remove _some_ of the nice logic
6805 (makeDocBookFile): ditto
6807 * src/Painter.[Ch]: (~Painter): removed
6809 * src/LyXAction.C (init): entry for insettheorem added
6811 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6813 (deplog): code to detect files generated by LaTeX, needs testing
6816 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6818 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6820 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6822 * src/LaTeX.C (deplog): Add a check for files that are going to be
6823 created by the first latex run, part of the project to remove the
6826 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6827 contents to the extension list.
6829 2000-07-04 Juergen Vigna <jug@sad.it>
6831 * src/text.C (NextBreakPoint): added support for needFullRow()
6833 * src/insets/lyxinset.h: added needFullRow()
6835 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6838 * src/insets/insettext.C: lots of changes for update!
6840 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6842 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6844 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6846 * src/insets/insetinclude.C (InsetInclude): fixed
6847 initialization of include_label.
6848 (unique_id): now returns a string.
6850 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6852 * src/LaTeXFeatures.h: new member IncludedFiles, for
6853 a map of key, included file name.
6855 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6856 with the included files for inclusion in SGML preamble,
6857 i. e., linuxdoc and docbook.
6860 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6861 nice (is the generated linuxdoc code to be exported?), that
6862 allows to remove column, and only_body that will be true for
6863 slave documents. Insets are allowed inside SGML font type.
6864 New handling of the SGML preamble for included files.
6865 (makeDocBookFile): the same for docbook.
6867 * src/insets/insetinclude.h:
6868 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6870 (DocBook): new export methods.
6872 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6873 and makeDocBookFile.
6875 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6876 formats to export with command line argument -x.
6878 2000-06-29 Juergen Vigna <jug@sad.it>
6880 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6881 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6883 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6884 region could already been cleared by an inset!
6886 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6888 * src/BufferView_pimpl.h: remove member variables lyx_focus and
6891 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
6893 (cursorToggle): remove special handling of lyx focus.
6895 2000-06-28 Juergen Vigna <jug@sad.it>
6897 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
6900 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6902 * src/insets/insetindex.C (Edit): add a callback when popup is
6905 * src/insets/insettext.C (LocalDispatch):
6906 * src/insets/insetmarginal.h:
6907 * src/insets/insetlist.h:
6908 * src/insets/insetfoot.h:
6909 * src/insets/insetfloat.h:
6910 * src/insets/insetert.h: add a missing std:: qualifier.
6912 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6914 * src/support/lyxsum.C (sum): '\0' teminate file read when using
6917 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
6919 * src/insets/insettext.C (Read): remove tmptok unused variable
6920 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
6921 (InsertInset): change for new InsetInset code
6923 * src/insets/insettext.h: add TEXT inline method
6925 * src/insets/insettext.C: remove TEXT macro
6927 * src/insets/insetmarginal.C (Write): new method
6928 (Latex): change output slightly
6930 * src/insets/insetfoot.C (Write): new method
6931 (Latex): change output slightly (don't use endl when no need)
6933 * src/insets/insetert.C (Write): new method
6935 * src/insets/insetcollapsable.h: make button_length, button_top_y
6936 and button_bottm_y protected.
6938 * src/insets/insetcollapsable.C (Write): simplify code by using
6939 tostr. Also do not output the float name, the children class
6940 should to that to get control over own arguments
6942 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
6943 src/insets/insetminipage.[Ch]:
6946 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6948 * src/lyxfunc.C (Dispatch): cases for new insets/commands
6950 * src/Makefile.am (lyx_SOURCES): add the new files
6952 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
6953 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
6954 * src/commandtags.h: ditto
6956 * src/LaTeXFeatures.h: add a std::set of used floattypes
6958 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
6960 * src/FloatList.[Ch] src/Floating.h: new files
6962 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
6964 * src/lyx_cb.C (TableApplyCB): ditto
6966 * src/text2.C: ditto
6967 * src/buffer.C (SimpleLinuxDocOnePar): ditto
6968 (parseSingleLyXformat2Token): ditto + add code for
6969 backwards compability for old float styles + add code for new insets
6971 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
6973 (InsertInset(size_type, Inset *, LyXFont)): new method
6974 (InsetChar(size_type, char)): changed to use the other InsetChar
6975 with a LyXFont(ALL_INHERIT).
6976 (InsetInset(size_type, Inset*)): changed to use InsetChar to
6977 insert the META_INSET.
6979 * sigc++/thread.cc (Privete<int>::operator int&): move definition
6981 * sigc++/thread.h (Threads): from here
6983 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
6984 definition out of line
6985 * sigc++/scope.h: from here
6987 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6989 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
6990 is specified (adapted from a patch from edscott <edscott@imp.mx>).
6992 * Makefile.am (bindist): new target.
6994 * INSTALL: add instructions for doing a binary distribution.
6996 * development/tools/README.bin.example: update a bit.
6998 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
7001 * lib/lyxrc.example: new lyxrc tag \set_color.
7003 * src/lyxfunc.C (Dispatch):
7004 * src/commandtags.h:
7005 * src/LyXAction.C: new lyxfunc "set-color".
7007 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
7008 and an x11name given as strings.
7010 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
7011 cache when a color is changed.
7013 2000-06-26 Juergen Vigna <jug@sad.it>
7015 * src/lyxrow.C (width): added this functions and variable.
7017 * src/insets/insetcite.C (create_form_citation_form): some Gravity
7020 * src/text.C (SetHeightOfRow): fixed calcualting of width.
7022 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7024 * images/undo_bw.xpm: new icon.
7025 * images/redo_bw.xpm: ditto.
7027 * configure.in (INSTALL_SCRIPT): change value to
7028 ${INSTALL} to avoid failures of install-script target.
7029 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
7031 * src/BufferView.h: add a magic "friend" declaration to please
7034 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
7036 * forms/cite.fd: modified to allow resizing without messing
7039 * src/insetcite.C: Uses code from cite.fd almost without
7041 User can now resize dialog in the x-direction.
7042 Resizing the dialog in the y-direction is prevented, as the
7043 code does this intelligently already.
7045 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7047 * INSTALL: remove obsolete entry in "problems" section.
7049 * lib/examples/sl_*.lyx: update of the slovenian examples.
7051 * src/support/FileInfo.[Ch] (getBlockSize): remove.
7053 2000-06-23 Juergen Vigna <jug@sad.it>
7055 * src/lyxtext.h: added a 'cleared' flag to draw() function.
7057 * src/buffer.C (resize): delete the LyXText of textinsets.
7059 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
7061 * src/insets/lyxinset.h: added another parameter 'cleared' to
7062 the draw() function.
7064 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
7065 unlocking inset in inset.
7067 2000-06-22 Juergen Vigna <jug@sad.it>
7069 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
7070 of insets and moved first to LyXText.
7072 * src/mathed/formulamacro.[Ch]:
7073 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
7075 2000-06-21 Juergen Vigna <jug@sad.it>
7077 * src/text.C (GetVisibleRow): look if I should clear the area or not
7078 using Inset::doClearArea() function.
7080 * src/insets/lyxinset.h: added doClearArea() function and
7081 modified draw(Painter &, ...) to draw(BufferView *, ...)
7083 * src/text2.C (UpdateInset): return bool insted of int
7085 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
7087 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
7088 combox in the character popup
7090 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
7091 BufferParams const & params
7093 2000-06-20 Juergen Vigna <jug@sad.it>
7095 * src/insets/insettext.C (SetParagraphData): set insetowner on
7098 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7100 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
7101 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
7103 (form_main_): remove
7105 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
7106 (create_form_form_main): remove FD_form_main stuff, connect to
7107 autosave_timeout signal
7109 * src/LyXView.[Ch] (getMainForm): remove
7110 (UpdateTimerCB): remove
7111 * src/BufferView_pimpl.h: inherit from SigC::Object
7113 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
7114 signal instead of callback
7116 * src/BufferView.[Ch] (cursorToggleCB): remove
7118 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7120 * src/BufferView_pimpl.C: changes because of the one below
7122 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
7123 instead of storing a pointer to a LyXText.
7125 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
7127 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
7129 * src/lyxparagraph.h
7131 * src/paragraph.C: Changed fontlist to a sorted vector.
7133 2000-06-19 Juergen Vigna <jug@sad.it>
7135 * src/BufferView.h: added screen() function.
7137 * src/insets/insettext.C (LocalDispatch): some selection code
7140 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
7142 * src/insets/insettext.C (SetParagraphData):
7144 (InsetText): fixes for multiple paragraphs.
7146 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
7148 * development/lyx.spec.in: Call configure with ``--without-warnings''
7149 to work around a bug with the Makefiles when doing ``make lyxrpm''.
7150 This should be fine, however, since we generally don't want to be
7151 verbose when making an RPM.
7153 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
7155 * lib/scripts/fig2pstex.py: New file
7157 2000-06-16 Juergen Vigna <jug@sad.it>
7159 * src/insets/insettabular.C (UpdateLocal):
7160 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
7161 (LocalDispatch): Changed all functions to use LyXText.
7163 2000-06-15 Juergen Vigna <jug@sad.it>
7165 * src/text.C (SetHeightOfRow): call inset::update before requesting
7168 * src/insets/insettext.C (update):
7169 * src/insets/insettabular.C (update): added implementation
7171 * src/insets/lyxinset.h: added update function
7173 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7175 * src/text.C (SelectNextWord): protect against null pointers with
7176 old-style string streams. (fix from Paul Theo Gonciari
7179 * src/cite.[Ch]: remove erroneous files.
7181 * lib/configure.m4: update the list of created directories.
7183 * src/lyxrow.C: include <config.h>
7184 * src/lyxcursor.C: ditto.
7186 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7188 * lib/examples/decimal.lyx: new example file from Mike.
7190 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
7191 to find template definitions (from Dekel)
7193 * src/frontends/.cvsignore: add a few things.
7195 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
7197 * src/Timeout.C (TimeOut): remove default argument.
7199 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
7202 * src/insets/ExternalTemplate.C: add a "using" directive.
7204 * src/lyx_main.h: remove the act_ struct, which seems unused
7207 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7209 * LyX Developers Meeting: All files changed, due to random C++ (by
7210 coincidence) code generator script.
7212 - external inset (cool!)
7213 - initial online editing of preferences
7214 - insettabular breaks insettext(s contents)
7216 - some DocBook fixes
7217 - example files update
7218 - other cool stuff, create a diff and look for yourself.
7220 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
7222 * src/insets/insettext.C (computeTextRows): if the maxWidth is
7223 -1 this is a non-line-breaking textinset.
7225 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
7226 if there is no width set.
7228 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7230 * Lots of files: Merged the dialogbase branch.
7232 2000-06-09 Allan Rae <rae@lyx.org>
7234 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
7235 and the Dispatch methods that used it.
7237 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
7238 access to functions formerly kept in Dispatch.
7240 2000-05-19 Allan Rae <rae@lyx.org>
7242 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
7243 made to_page and count_copies integers again. from_page remains a
7244 string however because I want to allow entry of a print range like
7245 "1,4,22-25" using this field.
7247 * src/LyXAction.C: added action info and commands for buffer-print-xtl
7248 and printer-params-get. These aren't useful from the minibuffer but
7249 could be used by a script/LyXServer app provided it passes a suitable
7250 auto_mem_buffer. I guess I should take a look at how the LyXServer
7251 works and make it support xtl buffers.
7253 * sigc++/: updated to libsigc++-1.0.1
7255 * src/xtl/: updated to xtl-1.3.pl.11
7257 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
7258 those changes done to the files in src/ are actually recreated when
7259 they get regenerated. Please don't ever accept a patch that changes a
7260 dialog unless that patch includes the changes to the corresponding *.fd
7263 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
7264 stringOnlyContains, renamed it and generalised it.
7266 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
7267 branch. Removed the remaining old form_print code.
7269 2000-04-26 Allan Rae <rae@lyx.org>
7271 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
7272 trap I was trying to fix with the ID: fields in src/xtl/ :-)
7274 2000-04-25 Allan Rae <rae@lyx.org>
7276 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
7277 against a base of xtl-1.3.pl.4
7279 * development/tools/lxtl.sh: fixed a couple of silly typos and now
7280 filter the Id: entries so they still show the xtl version number
7283 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
7284 into the src/xtl code. Patch still pending with José (XTL)
7286 2000-04-24 Allan Rae <rae@lyx.org>
7288 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
7289 both more generic and much safer. Use the new template functions.
7290 * src/buffer.[Ch] (Dispatch): ditto.
7292 * src/frontends/xforms/FormPrint.C (update): Use new template functions
7293 and mem buffer more intelligently. Also a little general cleanup.
7296 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
7297 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
7298 * src/xtl/Makefile.am: ditto.
7299 * src/xtl/.cvsignore: ditto.
7300 * src/Makefile.am: ditto.
7302 * src/PrinterParams.h: Removed the macros member functions. Added a
7303 testInvariant member function. A bit of tidying up and commenting.
7304 Included Angus's idea for fixing operation with egcs-1.1.2.
7306 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
7307 cool expansion of XTL's mem_buffer to support automatic memory
7308 management within the buffer itself. Removed the various macros and
7309 replaced them with template functions that use either auto_mem_buffer
7310 or mem_buffer depending on a #define. The mem_buffer support will
7311 disappear as soon as the auto_mem_buffer is confirmed to be good on
7312 other platforms/compilers. That is, it's there so you've got something
7315 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
7316 effectively forked XTL. However I expect José will include my code
7317 into the next major release. Also fixed a memory leak.
7318 * src/xtl/text.h: ditto.
7319 * src/xtl/xdr.h: ditto.
7320 * src/xtl/giop.h: ditto.
7322 2000-04-16 Allan Rae <rae@lyx.org>
7324 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
7325 by autogen.sh and removed by maintainer-clean anyway.
7326 * .cvsignore, sigc++/.cvsignore: Support the above.
7328 * sigc++/.cvsignore: Forgot that retbind.h was generated.
7330 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
7332 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
7333 macros, renamed static callback-target member functions to suit new
7334 scheme and made them public.
7335 * src/frontends/xforms/forms/form_print.fd: ditto.
7336 * src/frontends/xforms/forms/form_copyright.fd: ditto.
7338 * src/support/lxtl.h: small cleanup to use typedef instead of #define
7341 * src/xtl/: New directory containing a minimal distribution of XTL.
7342 This is XTL-1.3.pl.4.
7344 * development/tools/lxtl.sh: A script to generate the above mini-dist.
7346 2000-04-15 Allan Rae <rae@lyx.org>
7348 * development/tools/makeLyXsigc.sh: Remove the library version numbers
7350 * sigc++/: Updated to libsigc++-1.0.0
7352 2000-04-14 Allan Rae <rae@lyx.org>
7354 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
7355 use the generic ones in future. I'll modify my conversion script.
7357 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
7359 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
7360 (CloseAllBufferRelatedDialogs): Renamed.
7361 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
7363 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
7364 of the generic ones. These are the same ones my conversion script
7367 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
7368 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
7369 * src/buffer.C (Dispatch): ditto
7371 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
7372 functions for updating and hiding buffer dependent dialogs.
7373 * src/BufferView.C (buffer): ditto
7374 * src/buffer.C (setReadonly): ditto
7375 * src/lyxfunc.C (CloseBuffer): ditto
7377 * src/buffer.h: Take setReadonly() out of line so I don't have to include
7378 Dialogs.h, and hence all the SigC stuff, into every file that includes
7379 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
7381 * src/BufferView2.C: reduce the number of headers included by buffer.h
7383 2000-04-11 Allan Rae <rae@lyx.org>
7385 * src/frontends/xforms/xform_macros.h: A small collection of macros
7386 for building C callbacks.
7388 * src/frontends/xforms/Makefile.am: Added above file.
7390 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
7391 scheme again. This time it should work for JMarc. If this is
7392 successful I'll revise my conversion script to automate some of this.
7393 The static member functions in the class also have to be public for
7394 this scheme will work. If the scheme works (it's almost identical to
7395 the way BufferView::cursorToggleCB is handled so it should work) then
7396 FormCopyright and FormPrint will be ready for inclusion into the main
7397 trunk immediately after 1.1.5 is released -- provided we're prepared
7398 for complaints about lame compilers not handling XTL.
7400 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
7402 2000-04-07 Allan Rae <rae@lyx.org>
7404 * config/lyxinclude.m4: A bit more tidying up (Angus)
7406 * src/LString.h: JMarc's <string> header fix
7408 * src/PrinterParams.h: Used string for most data to remove some
7409 ugly code in the Print dialog and avoid even uglier code when
7410 appending the ints to a string for output.
7412 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
7413 and moved "default:" back to the end of switch statement. Cleaned
7414 up the printing so it uses the right function calls and so the
7415 "print to file" option actually puts the file in the right directory.
7417 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
7419 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
7420 and Ok+Apply button control into a separate method: input (Angus).
7421 (input) Cleaned it up and improved it to be very thorough now.
7422 (All CB) static_cast used instead of C style cast (Angus). This will
7423 probably change again once we've worked out how to keep gcc-2.8.1 happy
7424 with real C callbacks.
7425 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
7426 ignore some of the bool settings and has random numbers instead. Needs
7427 some more investigation. Added other input length checks and checking
7428 of file and printer names.
7430 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
7431 would link (Angus). Seems the old code doesn't compile with the pragma
7432 statement either. Separated callback entries from internal methods.
7434 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
7436 2000-03-17 Allan Rae <rae@lyx.org>
7438 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
7439 need it? Maybe it could go in Dialogs instead? I could make it a
7440 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
7441 values to get the bool return value.
7442 (Dispatch): New overloaded method for xtl support.
7444 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
7445 extern "C" callback instead of static member functions. Hopefully,
7446 JMarc will be able to compile this. I haven't changed
7447 forms/form_copyright.fd yet. Breaking one of my own rules already.
7449 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
7450 because they aren't useful from the minibuffer. Maybe a LyXServer
7451 might want a help message though?
7453 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
7455 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
7456 xtl which needs both rtti and exceptions.
7458 * src/support/Makefile.am:
7459 * src/support/lxtl.h: New file. Some helper macros for using XTL.
7461 * src/frontends/xforms/input_validators.[ch]: input filters and
7462 validators. These conrol what keys are valid in input boxes.
7463 Use them and write some more. Much better idea than waiting till
7464 after the user has pressed Ok to say that the input fields don't make
7467 * src/frontends/xforms/Makefile.am:
7468 * src/frontends/xforms/forms/form_print.fd:
7469 * src/frontends/xforms/forms/makefile:
7470 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
7471 new scheme. Still have to make sure I haven't missed anything from
7472 the current implementation.
7474 * src/Makefile.am, src/PrinterParams.h: New data store.
7476 * other files: Added a couple of copyright notices.
7478 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7480 * src/insets/insetbib.h: move Holder struct in public space.
7482 * src/frontends/include/DialogBase.h: use SigC:: only when
7483 SIGC_CXX_NAMESPACES is defined.
7484 * src/frontends/include/Dialogs.h: ditto.
7486 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
7488 * src/frontends/xforms/FormCopyright.[Ch]: do not
7489 mention SigC:: explicitely.
7491 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7493 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
7494 deals with testing KDE in main configure.in
7495 * configure.in: ditto.
7497 2000-02-22 Allan Rae <rae@lyx.org>
7499 * Lots of files: Merged from HEAD
7501 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
7502 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
7504 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
7506 * sigc++/: new minidist.
7508 2000-02-14 Allan Rae <rae@lyx.org>
7510 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
7512 2000-02-08 Juergen Vigna <jug@sad.it>
7514 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
7515 file for the buildin GUI builder of KDevelop of the copyright-dialog.
7517 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
7518 for this port and so it is much easier for other people to port
7519 dialogs in a common development environment.
7521 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
7522 the QT/KDE implementation.
7524 * src/frontends/kde/Dialogs.C:
7525 * src/frontends/kde/FormCopyright.C:
7526 * src/frontends/kde/FormCopyright.h:
7527 * src/frontends/kde/Makefile.am:
7528 * src/frontends/kde/formcopyrightdialog.C:
7529 * src/frontends/kde/formcopyrightdialog.h:
7530 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
7531 for the kde support of the Copyright-Dialog.
7533 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
7534 subdir-substitution instead of hardcoded 'xforms' as we now have also
7537 * src/frontends/include/DialogBase.h (Object): just commented the
7538 label after #endif (nasty warning and I don't like warnings ;)
7540 * src/main.C (main): added KApplication initialization if using
7543 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
7544 For now only the KDE event-loop is added if frontend==kde.
7546 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
7548 * configure.in: added support for the --with-frontend[=value] option
7550 * autogen.sh: added kde.m4 file to list of config-files
7552 * acconfig.h: added define for KDEGUI-support
7554 * config/kde.m4: added configuration functions for KDE-port
7556 * config/lyxinclude.m4: added --with-frontend[=value] option with
7557 support for xforms and KDE.
7559 2000-02-08 Allan Rae <rae@lyx.org>
7561 * all Makefile.am: Fixed up so the make targets dist, distclean,
7562 install and uninstall all work even if builddir != srcdir. Still
7563 have a new sigc++ minidist update to come.
7565 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
7567 2000-02-01 Allan Rae <rae@lyx.org>
7569 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
7570 Many mods to get builddir != srcdir working.
7572 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
7573 for building on NT and so we can do the builddir != srcdir stuff.
7575 2000-01-30 Allan Rae <rae@lyx.org>
7577 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
7578 This will stay in "rae" branch. We probably don't really need it in
7579 the main trunk as anyone who wants to help programming it should get
7580 a full library installed also. So they can check both included and
7581 system supplied library compilation.
7583 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
7584 Added a 'mini' distribution of libsigc++. If you feel the urge to
7585 change something in these directories - Resist it. If you can't
7586 resist the urge then you should modify the following script and rebuild
7587 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
7588 all happen. Still uses a hacked version of libsigc++'s configure.in.
7589 I'm quite happy with the results. I'm not sure the extra work to turn
7590 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
7591 worth the trouble and would probably lead to extra maintenance
7593 I haven't tested the following important make targets: install, dist.
7594 Not ready for prime time but very close. Maybe 1.1.5.
7596 * development/tools/makeLyXsigc.sh: A shell script to automatically
7597 generate our mini-dist of libsigc++. It can only be used with a CVS
7598 checkout of libsigc++ not a tarball distribution. It's well commented.
7599 This will end up as part of the libsigc++ distribution so other apps
7600 can easily have an included mini-dist. If someone makes mods to the
7601 sigc++ subpackage without modifying this script to generate those
7602 changes I'll be very upset!
7604 * src/frontends/: Started the gui/system indep structure.
7606 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
7607 to access the gui-indep dialogs are in this class. Much improved
7608 design compared to previous revision. Lars, please refrain from
7609 moving this header into src/ like you did with Popups.h last time.
7611 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
7613 * src/frontends/xforms/: Started the gui-indep system with a single
7614 dialog: FormCopyright. Initial testing of use of libsigc++ was very
7617 * src/frontends/xforms/forms: Repository for the xforms .fd files.
7618 Here you'll find a very useful makefile and automated fdfix.sh that
7619 makes updating dailogs a no-brainer -- provided you follow the rules
7620 set out in the README. I'm thinking about adding another script to
7621 automatically generate skeleton code for a new dialog given just the
7624 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
7625 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
7626 Made FormCopyright gui-indep and added a lyxfunc to get to it.
7628 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7630 * src/support/LSubstring.C (operator): simplify
7632 * src/lyxtext.h: removed bparams, use buffer_->params instead
7634 * src/lyxrow.h: make Row a real class, move all variables to
7635 private and use accessors.
7637 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
7639 (isRightToLeftPar): ditto
7640 (ChangeLanguage): ditto
7641 (isMultiLingual): ditto
7644 (SimpleTeXOnePar): ditto
7645 (TeXEnvironment): ditto
7646 (GetEndLabel): ditto
7648 (SetOnlyLayout): ditto
7649 (BreakParagraph): ditto
7650 (BreakParagraphConservative): ditto
7651 (GetFontSettings): ditto
7653 (CopyIntoMinibuffer): ditto
7654 (CutIntoMinibuffer): ditto
7655 (PasteParagraph): ditto
7656 (SetPExtraType): ditto
7657 (UnsetPExtraType): ditto
7658 (DocBookContTableRows): ditto
7659 (SimpleDocBookOneTablePar): ditto
7661 (TeXFootnote): ditto
7662 (SimpleTeXOneTablePar): ditto
7663 (TeXContTableRows): ditto
7664 (SimpleTeXSpecialChars): ditto
7667 * src/lyxcursor.h: make LyXCursor a real class, move all variables
7668 to private and use accessors.
7670 * src/lyx_cb.C: remove char updatetimer, and all code that uses
7671 this, we did not use it anymore and has not been for ages. Just a
7672 waste of cpu cycles.
7674 * src/language.h: make Language a real class, move all variables
7675 to private and use accessors.
7677 * src/BufferView_pimpl.C (Pimpl): use new timer code.
7678 (create_view): remove
7679 (update): some changes for new timer
7680 (cursorToggle): use new timer
7681 (beforeChange): change for new timer
7683 * src/BufferView.h (cursorToggleCB): removed last paramter because
7686 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
7687 (cursorToggleCB): change because of new timer code
7689 * lib/CREDITS: updated own mailaddress
7691 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7693 * src/support/filetools.C (PutEnv): fix the code in case neither
7694 putenv() nor setenv() have been found.
7696 * INSTALL: mention the install-strip Makefile target.
7698 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
7699 read-only documents.
7701 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7703 * lib/reLyX/configure.in (VERSION): avoid using a previously
7704 generated reLyX wrapper to find out $prefix.
7706 * lib/examples/eu_adibide_lyx-atua.lyx:
7707 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
7708 translation of the Tutorial (Dooteo)
7710 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
7712 * forms/cite.fd: new citation dialog
7714 * src/insetcite.[Ch]: the new citation dialog is moved into
7717 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
7720 * src/insets/insetcommand.h: data members made private.
7722 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7724 * LyX 1.1.5 released
7726 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7728 * src/version.h (LYX_RELEASE): to 1.1.5
7730 * src/spellchecker.C (RunSpellChecker): return false if the
7731 spellchecker dies upon creation.
7733 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7735 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
7736 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
7740 * lib/CREDITS: update entry for Martin Vermeer.
7742 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
7744 * src/text.C (draw): Draw foreign language bars at the bottom of
7745 the row instead of at the baseline.
7747 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
7749 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7751 * lib/bind/de_menus.bind: updated
7753 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7755 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
7757 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7759 * src/menus.C (Limit_string_length): New function
7760 (ShowTocMenu): Limit the number of items/length of items in the
7763 * src/paragraph.C (String): Correct result for a paragraph inside
7766 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7768 * src/bufferlist.C (close): test of buf->getuser() == NULL
7770 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
7772 * src/BufferView2.C (removeAutoInsets): Fix a bug:
7773 Do not call to SetCursor when the paragraph is a closed footnote!
7775 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
7777 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
7780 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7782 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7785 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7786 reference popup, that activates the reference-back action
7788 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7790 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7791 the menus. Also fixed a bug.
7793 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7794 the math panels when switching buffers (unless new buffer is readonly).
7796 * src/BufferView.C (NoSavedPositions)
7797 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7799 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7801 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7802 less of dvi dirty or not.
7804 * src/trans_mgr.[Ch] (insert): change first parameter to string
7807 * src/chset.[Ch] (encodeString): add const to first parameter
7809 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7811 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7815 * src/LaTeX.C (deplog): better searching for dependency files in
7816 the latex log. Uses now regexps.
7818 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7819 instead of the box hack or \hfill.
7821 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7823 * src/lyxfunc.C (doImportHelper): do not create the file before
7824 doing the actual import.
7825 (doImportASCIIasLines): create a new file before doing the insert.
7826 (doImportASCIIasParagraphs): ditto.
7828 * lib/lyxrc.example: remove mention of non-existing commands
7830 * lyx.man: remove mention of color-related switches.
7832 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7834 * src/lyx_gui.C: remove all the color-related ressources, which
7835 are not used anymore.
7837 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7840 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7842 * src/lyxrc.C (read): Add a missing break in the switch
7844 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7846 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7848 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7851 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7853 * src/text.C (draw): draw bars under foreign language words.
7855 * src/LColor.[Ch]: add LColor::language
7857 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7859 * src/lyxcursor.h (boundary): New member variable
7861 * src/text.C (IsBoundary): New methods
7863 * src/text.C: Use the above for currect cursor movement when there
7864 is both RTL & LTR text.
7866 * src/text2.C: ditto
7868 * src/bufferview_funcs.C (ToggleAndShow): ditto
7870 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7872 * src/text.C (DeleteLineForward): set selection to true to avoid
7873 that DeleteEmptyParagraphMechanism does some magic. This is how it
7874 is done in all other functions, and seems reasonable.
7875 (DeleteWordForward): do not jump over non-word stuff, since
7876 CursorRightOneWord() already does it.
7878 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7879 DeleteWordBackward, since they seem safe to me (since selection is
7880 set to "true") DeleteEmptyParagraphMechanism does nothing.
7882 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7884 * src/lyx_main.C (easyParse): simplify the code by factoring the
7885 part that removes parameters from the command line.
7886 (LyX): check wether wrong command line options have been given.
7888 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7890 * src/lyx_main.C : add support for specifying user LyX
7891 directory via command line option -userdir.
7893 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
7895 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
7896 the number of items per popup.
7897 (Add_to_refs_menu): Ditto.
7899 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7901 * src/lyxparagraph.h: renamed ClearParagraph() to
7902 StripLeadingSpaces() and moved it to paragraph.C. We pass the
7903 textclass as parameter, and do nothing if free_spacing is
7904 true. This fixes part of the line-delete-forward problems.
7906 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
7907 (pasteSelection): ditto.
7908 (SwitchLayoutsBetweenClasses): more translatable strings.
7910 * src/text2.C (CutSelection): use StripLeadingSpaces.
7911 (PasteSelection): ditto.
7912 (DeleteEmptyParagraphMechanism): ditto.
7914 2000-05-26 Juergen Vigna <jug@sad.it>
7916 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
7917 is not needed in tabular insets.
7919 * src/insets/insettabular.C (TabularFeatures): added missing features.
7921 * src/tabular.C (DeleteColumn):
7923 (AppendRow): implemented this functions
7924 (cellsturct::operator=): clone the inset too;
7926 2000-05-23 Juergen Vigna <jug@sad.it>
7928 * src/insets/insettabular.C (LocalDispatch): better selection support
7929 when having multicolumn-cells.
7931 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7933 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
7935 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7937 * src/ColorHandler.C (getGCForeground): put more test into _()
7939 * lib/examples/eu_splash.lyx: new file (Basque translation) from
7942 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
7945 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
7947 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
7948 there are no labels, or when buffer is readonly.
7950 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
7951 there are no labels, buffer is SGML, or when buffer is readonly.
7953 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7955 * src/LColor.C (LColor): change a couple of grey40 to grey60
7956 (LColor): rewore initalization to make compiles go some magnitude
7958 (getGUIName): don't use gettext until we need the string.
7960 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
7962 * src/Bullet.[Ch]: Fixed a small bug.
7964 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
7966 * src/paragraph.C (String): Several fixes/improvements
7968 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
7970 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7972 * src/paragraph.C (String): give more correct output.
7974 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
7976 * src/lyxfont.C (stateText) Do not output the language if it is
7977 eqaul to the language of the document.
7979 * src/paragraph.C (TeXOnePar): Do not put language switch commands
7980 between two paragraphs with the same language.
7982 * src/paragraph.C (getParLanguage) Return a correct answer for an
7983 empty dummy paragraph.
7985 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
7988 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
7991 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
7992 the menus/popup, if requested fonts are unavailable.
7994 2000-05-22 Juergen Vigna <jug@sad.it>
7996 * src/insets/insettabular.C (LocalDispatch): added some more cursor
7997 movement support (Up/Down/Tab/Shift-Tab).
7998 (LocalDispatch): added also preliminari cursor-selection.
8000 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
8002 * src/paragraph.C (PasteParagraph): Hopefully now right!
8004 2000-05-22 Garst R. Reese <reese@isn.net>
8006 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
8007 of list, change all references to Environment to Command
8008 * tex/hollywood.cls : rewrite environments as commands, add
8009 \uppercase to interiorshot and exteriorshot to force uppecase.
8010 * tex/broadway.cls : rewrite environments as commands. Tweak
8013 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8015 * src/menus.C (Add_to_toc_menu): fix the code which limits the
8016 size of items: use a constant intead of the hardcoded 40, and more
8017 importantly do not remove the %m and %x tags added at the end.
8018 (Add_to_refs_menu): use vector::size_type instead of
8019 unsigned int as basic types for the variables. _Please_ do not
8020 assume that size_t is equal to unsigned int. On an alpha, this is
8021 unsigned long, which is _not_ the same.
8023 * src/language.C (initL): remove language "hungarian", since it
8024 seems that "magyar" is better.
8026 2000-05-22 Juergen Vigna <jug@sad.it>
8028 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
8030 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
8033 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
8034 next was deleted but not set to 0.
8036 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8038 * src/language.C (initL): change the initialization of languages
8039 so that compiles goes _fast_.
8041 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
8044 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
8046 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8050 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8052 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
8054 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
8058 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
8061 * src/insets/insetlo*.[Ch]: Made editable
8063 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8065 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
8066 the current selection.
8068 * src/BufferView_pimpl.C (stuffClipboard): new method
8070 * src/BufferView.C (stuffClipboard): new method
8072 * src/paragraph.C (String): new method
8074 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
8075 LColor::ignore when lyxname is not found.
8077 * src/BufferView.C (pasteSelection): new method
8079 * src/BufferView_pimpl.C (pasteSelection): new method
8081 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
8083 * src/WorkArea.C (request_clipboard_cb): new static function
8084 (getClipboard): new method
8085 (putClipboard): new method
8087 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8089 * LyX 1.1.5pre2 released
8091 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8093 * src/vspace.C (operator=): removed
8094 (operator=): removed
8096 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
8098 * src/layout.C (NumberOfClass): manually set the type in make_pair
8099 (NumberOfLayout): ditto
8101 * src/language.C: use the Language constructor for ignore_lang
8103 * src/language.h: add constructors to struct Language
8105 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
8107 * src/text2.C (SetCursorIntern): comment out #warning
8109 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
8111 * src/mathed/math_iter.h: initialize sx and sw to 0
8113 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
8115 * forms/lyx.fd: Redesign of form_ref
8117 * src/LaTeXFeatures.[Ch]
8121 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
8124 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
8125 and Buffer::inset_iterator.
8127 * src/menus.C: Added new menus: TOC and Refs.
8129 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
8131 * src/buffer.C (getTocList): New method.
8133 * src/BufferView2.C (ChangeRefs): New method.
8135 * src/buffer.C (getLabelList): New method. It replaces the old
8136 getReferenceList. The return type is vector<string> instead of
8139 * src/insets/insetinclude.C (getLabelList): New method. Replaces
8140 the old getLabel() and GetNumberOfLabels() methods.
8141 * src/insets/insetlabel.C (getLabelList): ditto
8142 * src/mathed/formula.C (getLabelList): ditto
8144 * src/paragraph.C (String): New method.
8146 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
8147 Uses the new getTocList() method.
8148 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
8149 which automatically updates the contents of the browser.
8150 (RefUpdateCB): Use the new getLabelList method.
8152 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
8154 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
8156 * src/spellchecker.C: Added using std::reverse;
8158 2000-05-19 Juergen Vigna <jug@sad.it>
8160 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
8162 * src/insets/insettext.C (computeTextRows): small fix for display of
8163 1 character after a newline.
8165 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
8168 2000-05-18 Juergen Vigna <jug@sad.it>
8170 * src/insets/insettabular.C (TabularFeatures): fixed update of display
8171 when changing width of column.
8173 * src/tabular.C (set_row_column_number_info): setting of
8174 autobreak rows if necessary.
8176 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8178 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
8180 * src/vc-backend.*: renamed stat() to status() and vcstat to
8181 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
8182 compilation broke. The new name seems more relevant, anyway.
8184 2000-05-17 Juergen Vigna <jug@sad.it>
8186 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
8187 which was wrong if the removing caused removing of rows!
8189 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
8190 (pushToken): new function.
8192 * src/text2.C (CutSelection): fix problem discovered with purify
8194 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8196 * src/debug.C (showTags): enlarge the first column, now that we
8197 have 6-digits debug codes.
8199 * lib/layouts/hollywood.layout:
8200 * lib/tex/hollywood.cls:
8201 * lib/tex/brodway.cls:
8202 * lib/layouts/brodway.layout: more commands and fewer
8203 environments. Preambles moved in the .cls files. Broadway now has
8204 more options on scene numbering and less whitespace (from Garst)
8206 * src/insets/insetbib.C (getKeys): make sure that we are in the
8207 document directory, in case the bib file is there.
8209 * src/insets/insetbib.C (Latex): revert bogus change.
8211 2000-05-16 Juergen Vigna <jug@sad.it>
8213 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
8214 the TabularLayout on cursor move.
8216 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
8218 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
8221 (draw): fixed cursor position and drawing so that the cursor is
8222 visible when before the tabular-inset.
8224 * src/insets/insettext.C (init): drawLockedFrame was not initialized
8225 when creating from old insettext.
8227 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
8229 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8231 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
8232 * lib/tex/brodway.cls: ditto
8234 * lib/layouts/brodway.layout: change alignment of parenthical
8237 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8239 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
8240 versions 0.88 and 0.89 are supported.
8242 2000-05-15 Juergen Vigna <jug@sad.it>
8244 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
8247 * src/insets/insettext.C (computeTextRows): redone completely this
8248 function in a much cleaner way, because of problems when having a
8250 (draw): added a frame border when the inset is locked.
8251 (SetDrawLockedFrame): this sets if we draw the border or not.
8252 (SetFrameColor): this sets the frame color (default=insetframe).
8254 * src/insets/lyxinset.h: added x() and y() functions which return
8255 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
8256 function which is needed to see if we have a locking inset of some
8257 type in this inset (needed for now in insettabular).
8259 * src/vspace.C (inPixels): the same function also without a BufferView
8260 parameter as so it is easier to use it in some ocasions.
8262 * src/lyxfunc.C: changed all places where insertInset was used so
8263 that now if it couldn't be inserted it is deleted!
8265 * src/TabularLayout.C:
8266 * src/TableLayout.C: added support for new tabular-inset!
8268 * src/BufferView2.C (insertInset): this now returns a bool if the
8269 inset was really inserted!!!
8271 * src/tabular.C (GetLastCellInRow):
8272 (GetFirstCellInRow): new helper functions.
8273 (Latex): implemented for new tabular class.
8277 (TeXTopHLine): new Latex() helper functions.
8279 2000-05-12 Juergen Vigna <jug@sad.it>
8281 * src/mathed/formulamacro.C (Read):
8282 * src/mathed/formula.C (Read): read also the \end_inset here!
8284 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
8286 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
8287 crush when saving formulae with unbalanced parenthesis.
8289 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
8291 * src/layout.C: Add new keyword "endlabelstring" to layout file
8293 * src/text.C (GetVisibleRow): Draw endlabel string.
8295 * lib/layouts/broadway.layout
8296 * lib/layouts/hollywood.layout: Added endlabel for the
8297 Parenthetical layout.
8299 * lib/layouts/heb-article.layout: Do not use slanted font shape
8300 for Theorem like environments.
8302 * src/buffer.C (makeLaTeXFile): Always add "american" to
8303 the UsedLanguages list if document language is RTL.
8305 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8307 * add addendum to README.OS2 and small patch (from SMiyata)
8309 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8311 * many files: correct the calls to ChangeExtension().
8313 * src/support/filetools.C (ChangeExtension): remove the no_path
8314 argument, which does not belong there. Use OnlyFileName() instead.
8316 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
8317 files when LaTeXing a non-nice latex file.
8319 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
8320 a chain of "if". Return false when deadkeys are not handled.
8322 * src/lyx_main.C (LyX): adapted the code for default bindings.
8324 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
8325 bindings for basic functionality (except deadkeys).
8326 (deadKeyBindings): new method. Performs the bindings of deadkeys.
8328 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
8329 several methods: handle override_x_deadkeys.
8331 * src/lyxrc.h: remove the "bindings" map, which did not make much
8332 sense anyway. New variable override_x_deadkeys, defaulting to "true".
8334 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8336 * src/lyxfont.C (stateText): use a saner method to determine
8337 whether the font is "default". Seems to fix the crash with DEC
8340 * src/Bullet.[Ch] (Bullet): remove const on parameters.
8342 2000-05-08 Juergen Vigna <jug@sad.it>
8344 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
8345 TabularLayoutMenu with mouse-button-3
8346 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
8348 * src/TabularLayout.C: added this file for having a Layout for
8351 2000-05-05 Juergen Vigna <jug@sad.it>
8353 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
8354 recalculating inset-widths.
8355 (TabularFeatures): activated this function so that I can change
8356 tabular-features via menu.
8358 * src/menus.C (ShowEditMenu): inserted support for insettabular so
8359 that I can test some functions with the Table menu.
8361 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8363 * src/lyxfont.C (stateText): guard against stupid c++libs.
8365 * src/tabular.C: add using std::vector
8366 some whitespace changes, + removed som autogenerated code.
8368 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
8370 2000-05-05 Juergen Vigna <jug@sad.it>
8372 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
8373 row, columns and cellstructures.
8375 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8377 * lib/lyxrc.example: remove obsolete entries.
8379 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
8380 reading of protected_separator for free_spacing.
8382 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8384 * src/text.C (draw): do not display an exclamation mark in the
8385 margin for margin notes. This is confusing, ugly and
8388 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
8389 AMS math' is checked.
8391 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
8392 name to see whether including the amsmath package is needed.
8394 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
8396 * src/paragraph.C (validate): Compute UsedLanguages correctly
8397 (don't insert the american language if it doesn't appear in the
8400 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
8401 The argument of \thanks{} command is considered moving argument
8403 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
8406 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
8408 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
8409 for appendix/minipage/depth. The lines can be now both in the footnote
8410 frame, and outside the frame.
8412 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
8415 2000-05-05 Juergen Vigna <jug@sad.it>
8417 * src/table.[Ch]: removed the inset and buffer stuff as this is now
8418 neede only in tabular.[Ch].
8420 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8422 * src/insets/insetspecialchar.C (Read): allow command == '~' for
8424 (Write): write '~' for PROTECTED_SEPARATOR
8426 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8428 * src/lyxparagraph.h: add a friend struct matchIT after the struct
8431 * src/mathed/formula.C (drawStr): rename size to siz.
8433 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
8434 possibly fix a bug by not changing the pflags = flags to piflags =
8437 2000-05-05 Juergen Vigna <jug@sad.it>
8439 * src/insets/insetbib.C: moved using directive
8441 * src/ImportNoweb.C: small fix for being able to compile (missing
8444 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8446 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
8447 to use clear, since we don't depend on this in the code. Add test
8450 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8452 * (various *.C files): add using std::foo directives to please dec
8455 * replace calls to string::clear() to string::erase() (Angus)
8457 * src/cheaders/cmath: modified to provide std::abs.
8459 2000-05-04 Juergen Vigna <jug@sad.it>
8461 * src/insets/insettext.C: Prepared all for inserting of multiple
8462 paragraphs. Still display stuff to do (alignment and other things),
8463 but I would like to use LyXText to do this when we cleaned out the
8464 table-support stuff.
8466 * src/insets/insettabular.C: Changed lot of stuff and added lots
8467 of functionality still a lot to do.
8469 * src/tabular.C: Various functions changed name and moved to be
8470 const functions. Added new Read and Write functions and changed
8471 lots of things so it works good with tabular-insets (also removed
8472 some stuff which is not needed anymore * hacks *).
8474 * src/lyxcursor.h: added operators == and != which just look if
8475 par and pos are (not) equal.
8477 * src/buffer.C (latexParagraphs): inserted this function to latex
8478 all paragraphs form par to endpar as then I can use this too for
8481 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
8482 so that I can call this to from text insets with their own cursor.
8484 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
8485 output off all paragraphs (because of the fix below)!
8487 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
8488 the very last paragraph (this could be also the last paragraph of an
8491 * src/texrow.h: added rows() call which returns the count-variable.
8493 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
8495 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
8497 * lib/configure.m4: better autodetection of DocBook tools.
8499 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8501 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
8503 * src/lyx_cb.C: add using std::reverse;
8505 * src/LaTeX.C (run): on error always run deleteFilesOnError before
8508 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
8509 selected files. Should fix repeated errors from generated files.
8511 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
8513 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
8515 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
8516 the spellchecker popup.
8518 * lib/lyxrc.example: Removed the \number_inset section
8520 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8522 * src/insets/figinset.C (various): Use IsFileReadable() to make
8523 sure that the file actually exist. Relying on ghostscripts errors
8524 is a bad idea since they can lead to X server crashes.
8526 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
8528 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
8531 * lib/lyxrc.example: smallish typo in description of
8532 \view_dvi_paper_option
8534 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8537 * src/lyxfunc.C: doImportHelper to factor out common code of the
8538 various import methods. New functions doImportASCIIasLines,
8539 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
8540 doImportLinuxDoc for the format specific parts.
8543 * buffer.C: Dispatch returns now a bool to indicate success
8546 * lyx_gui.C: Add getLyXView() for member access
8548 * lyx_main.C: Change logic for batch commands: First try
8549 Buffer::Dispatch (possibly without GUI), if that fails, use
8552 * lyx_main.C: Add support for --import command line switch.
8553 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
8554 Available Formats: Everything accepted by 'buffer-import <format>'
8556 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8558 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
8561 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
8562 documents will be reformatted upon reentry.
8564 2000-04-27 Juergen Vigna <jug@sad.it>
8566 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
8567 correctly only last pos this was a bug.
8569 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8571 * release of lyx-1.1.5pre1
8573 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8575 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
8577 * src/menus.C: revert the change of naming (Figure->Graphic...)
8578 from 2000-04-11. It was incomplete and bad.
8580 * src/LColor.[Ch]: add LColor::depthbar.
8581 * src/text.C (GetVisibleRow): use it.
8583 * README: update the languages list.
8585 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8587 * src/text.C (GetVisibleRow): show the depth of paragraphs using
8590 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8592 * README: remove sections that were just wrong.
8594 * src/text2.C (GetRowNearY): remove currentrow code
8596 * src/text.C (GetRow): remove currentrow code
8598 * src/screen.C (Update): rewritten a bit.
8599 (SmallUpdate): removed func
8601 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
8603 (FullRebreak): return bool
8604 (currentrow): remove var
8605 (currentrow_y): ditto
8607 * src/lyxscreen.h (Draw): change arg to unsigned long
8608 (FitCursor): return bool
8609 (FitManualCursor): ditto
8610 (Smallpdate): remove func
8611 (first): change to unsigned long
8612 (DrawOneRow): change second arg to long (from long &)
8613 (screen_refresh_y): remove var
8614 (scree_refresh_row): ditto
8616 * src/lyxrow.h: change baseline to usigned int from unsigned
8617 short, this brings some implicit/unsigned issues out in the open.
8619 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
8621 (Dispatch): don't call updateScrollbar after fitCursor. Use update
8622 instead of smallUpdate.
8624 * src/lyxcursor.h: change y to unsigned long
8626 * src/buffer.h: don't call updateScrollbar after fitcursor
8628 * src/buffer.C (parseSingleLyXformat2Token): move variables to
8629 where they are used. Removed "\\direction", this was not present
8630 in 1.1.4 and is already obsolete. Commented out some code that I
8631 believe to never be called.
8632 (runLiterate): don't call updateScrollbar after fitCursor
8634 (buildProgram): ditto
8637 * src/WorkArea.h (workWidth): change return val to unsigned
8640 (redraw): remove the button redraws
8641 (setScrollbarValue): change for scrollbar
8642 (getScrollbarValue): change for scrollbar
8643 (getScrollbarBounds): change for scrollbar
8645 * src/WorkArea.C (C_WorkArea_up_cb): removed func
8646 (C_WorkArea_down_cb): removed func
8647 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
8648 (resize): change for scrollbar
8649 (setScrollbar): ditto
8650 (setScrollbarBounds): ditto
8651 (setScrollbarIncrements): ditto
8652 (up_cb): removed func
8653 (down_cb): removed func
8654 (scroll_cb): change for scrollbar
8655 (work_area_handler): ditto
8657 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
8658 when FitCursor did something.
8659 (updateScrollbar): some unsigned changes
8660 (downCB): removed func
8661 (scrollUpOnePage): removed func
8662 (scrollDownOnePage): remvoed func
8663 (workAreaMotionNotify): don't call screen->FitCursor but use
8664 fitCursor instead. and bool return val
8665 (workAreaButtonPress): ditto
8666 (workAreaButtonRelease): some unsigned changes
8667 (checkInsetHit): ditto
8668 (workAreaExpose): ditto
8669 (update): parts rewritten, comments about the signed char arg added
8670 (smallUpdate): removed func
8671 (cursorPrevious): call needed updateScrollbar
8674 * src/BufferView2.C (allFloats): don't call updateScrollbar after
8677 * src/BufferView.[Ch] (upCB): removed func
8678 (downCB): removed func
8679 (smallUpdate): removed func
8681 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8683 * src/lyxtext.h src/text.C src/text2.C: removed support for the
8684 currentrow, currentrow_y optimization. This did not help a lot and
8685 if we want to do this kind of optimization we should rather use
8686 cursor.row instead of the currentrow.
8688 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
8689 buffer spacing and klyx spacing support.
8691 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8693 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
8696 2000-04-26 Juergen Vigna <jug@sad.it>
8698 * src/insets/figinset.C: fixes to Lars sstream changes!
8700 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
8702 * A lot of files: Added Ascii(ostream &) methods to all inset
8703 classes. Used when exporting to ASCII.
8705 * src/buffer.C (writeFileAscii,RoffAsciiTable)
8706 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
8709 * src/text2.C (ToggleFree): Disabled implicit word selection when
8710 there is a change in the language
8712 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
8713 no output was generated for end-of-sentence inset.
8715 * src/insets/lyxinset.h
8718 * src/paragraph.C: Removed the insetnumber code
8720 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
8722 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8724 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
8725 no_babel and no_epsfig completely from the file.
8726 (parseSingleLyXformat2Token): add handling for per-paragraph
8727 spacing as written by klyx.
8729 * src/insets/figinset.C: applied patch by Andre. Made it work with
8732 2000-04-20 Juergen Vigna <jug@sad.it>
8734 * src/insets/insettext.C (cutSelection):
8735 (copySelection): Fixed with selection from right to left.
8736 (draw): now the rows are not recalculated at every draw.
8737 (computeTextRows): for now reset the inset-owner here (this is
8738 important for an undo or copy where the inset-owner is not set
8741 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
8742 motion to the_locking_inset screen->first was forgotten, this was
8743 not important till we got multiline insets.
8745 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8747 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
8748 code seems to be alright (it is code changed by Dekel, and the
8749 intent is indeed that all macros should be defined \protect'ed)
8751 * NEWS: a bit of reorganisation of the new user-visible features.
8753 2000-04-19 Juergen Vigna <jug@sad.it>
8755 * src/insets/insettext.C (init): using a LyXCursor now for cursor
8756 position. Set the inset_owner of the used paragraph so that it knows
8757 that it is inside an inset. Fixed cursor handling with mouse and
8758 cursor keys. Fixed wrong timed inset redraws and lots of other changes
8759 and cleanups to make TextInsets work better.
8761 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
8762 Changed parameters of various functions and added LockInsetInInset().
8764 * src/insets/insettext.C:
8766 * src/insets/insetcollapsable.h:
8767 * src/insets/insetcollapsable.C:
8768 * src/insets/insetfoot.h:
8769 * src/insets/insetfoot.C:
8770 * src/insets/insetert.h:
8771 * src/insets/insetert.C: cleaned up the code so that it works now
8772 correctly with insettext.
8774 * src/insets/inset.C:
8775 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
8776 that insets in insets are supported right.
8779 * src/table.C: lots of changes for use with inset tabular (and cleanup)
8781 * src/paragraph.C: some small fixes
8783 * src/debug.h: inserted INSETS debug info
8785 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8786 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8788 * src/commandtags.h:
8789 * src/LyXAction.C: insert code for InsetTabular.
8791 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8792 not Button1MotionMask.
8793 (workAreaButtonRelease): send always a InsetButtonRelease event to
8795 (checkInsetHit): some setCursor fixes (always with insets).
8797 * src/BufferView2.C (lockInset): returns a bool now and extended for
8798 locking insets inside insets.
8799 (showLockedInsetCursor): it is important to have the cursor always
8800 before the locked inset.
8801 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8803 * src/BufferView.h: made lockInset return a bool.
8805 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8807 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8808 that is used also internally but can be called as public to have back
8809 a cursor pos which is not set internally.
8810 (SetCursorIntern): Changed to use above function.
8812 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8814 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8819 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8820 patches for things that should be in or should be changed.
8822 * src/* [insetfiles]: change "usigned char fragile" to bool
8823 fragile. There was only one point that could that be questioned
8824 and that is commented in formulamacro.C. Grep for "CHECK".
8826 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8827 (DeleteBuffer): take it out of CutAndPaste and make it static.
8829 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8831 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8832 output the spacing envir commands. Also the new commands used in
8833 the LaTeX output makes the result better.
8835 * src/Spacing.C (writeEnvirBegin): new method
8836 (writeEnvirEnd): new method
8838 2000-04-18 Juergen Vigna <jug@sad.it>
8840 * src/CutAndPaste.C: made textclass a static member of the class
8841 as otherwise it is not accesed right!!!
8843 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8845 * forms/layout_forms.fd
8846 * src/layout_forms.h
8847 * src/layout_forms.C (create_form_form_character)
8848 * src/lyx_cb.C (UserFreeFont)
8849 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8850 documents (in the layout->character popup).
8852 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8854 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8855 \spell_command was in fact not honored (from Kevin Atkinson).
8857 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8860 * src/lyx_gui.h: make lyxViews private (Angus)
8862 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8864 * src/mathed/math_write.C
8865 (MathMatrixInset::Write) Put \protect before \begin{array} and
8866 \end{array} if fragile
8867 (MathParInset::Write): Put \protect before \\ if fragile
8869 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8871 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8872 initialization if the LyXColorHandler must be done after the
8873 connections to the XServer has been established.
8875 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8876 get the background pixel from the lyxColorhandler so that the
8877 figures are rendered with the correct background color.
8878 (NextToken): removed functions.
8879 (GetPSSizes): use ifs >> string instead of NextToken.
8881 * src/Painter.[Ch]: the color cache moved out of this file.
8883 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8886 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8888 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8889 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
8891 * src/BufferView.C (enterView): new func
8892 (leaveView): new func
8894 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
8896 (leaveView): new func, undefines xterm cursor when approp.
8898 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
8899 (AllowInput): delete the Workarea cursor handling from this func.
8901 * src/Painter.C (underline): draw a slimer underline in most cases.
8903 * src/lyx_main.C (error_handler): use extern "C"
8905 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8907 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
8908 sent directly to me.
8910 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
8911 to the list by Dekel.
8913 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
8916 * src/bufferview_funcs.[Ch]: two new files, moved several of the
8917 methods from lyx_cb.here.
8919 * src/lyx_cb.C: in addition to the above; removed input_prohibited
8922 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8924 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
8925 instead of using current_view directly.
8927 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
8929 * src/LyXAction.C (init): add the paragraph-spacing command.
8931 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
8933 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
8935 * src/lyx_cb.C (CurrentState): output a string when the spacing is
8936 different from the documents.
8938 * src/text.C (SetHeightOfRow): take paragraph spacing into
8939 account, paragraph spacing takes precedence over buffer spacing
8940 (GetVisibleRow): ditto
8942 * src/paragraph.C (writeFile): output the spacing parameter too.
8943 (validate): set the correct features if spacing is used in the
8945 (Clear): set spacing to default
8946 (MakeSameLayout): spacing too
8947 (HasSameLayout): spacing too
8948 (SetLayout): spacing too
8949 (TeXOnePar): output the spacing commands
8951 * src/lyxparagraph.h: added a spacing variable for use with
8952 per-paragraph spacing.
8954 * src/Spacing.h: add a Default spacing and a method to check if
8955 the current spacing is default. also added an operator==
8957 * src/text2.C (DeleteEmptyParagraphMechanism): added a
8960 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8962 * src/lyxserver.C (callback): fix dispatch of functions
8964 * src/insets/insetlatexaccent.C (checkContents): turn bogus
8965 printf() into lyxerr call.
8967 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
8970 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
8971 "Table" to "Table Box", "Float" to "Floating Material"; deletes
8972 the "Float" from each of the subitems.
8973 (ShowHelpMenu): add entry for "FAQ" and "TOC".
8975 * src/support/DebugStream.h: add an #ifdef to work around a gcc
8976 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
8977 documented the change so that the workaround can be nuked later.
8979 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
8982 * src/lyxlex_pimpl.C (next): do not re-declare the default value
8984 * src/buffer.C (getLatexName): ditto
8985 (setReadonly): ditto
8987 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8989 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
8990 avoid some uses of current_view. Added also a bufferParams()
8991 method to get at this.
8993 * src/lyxtext.h: changed params->buffer and paramters->bparams.
8995 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8997 * src/lyxparagraph.[Ch]: removed
8998 operator<(LyXParagraph::InsetTable..., added a struct matchIT
8999 with operators used by lower_bound and
9000 upper_bound in InsetTable's
9001 Make struct InsetTable private again. Used matchpos.
9003 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
9005 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
9006 document, the language of existing text is changed (unless the
9007 document is multi-lingual)
9009 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
9011 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
9013 * A lot of files: A rewrite of the Right-to-Left support.
9015 2000-04-10 Juergen Vigna <jug@sad.it>
9017 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
9018 misplaced cursor when inset in inset is locked.
9020 * src/insets/insettext.C (LocalDispatch): small fix so that a
9021 BREAKLINE is not inserted if we don't permit it with autBreakRows.
9023 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
9024 footnote font should be decreased in size twice when displaying.
9026 * src/insets/insettext.C (GetDrawFont): inserted this function as
9027 the drawing-font may differ from the real paragraph font.
9029 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
9030 insets (inset in inset!).
9032 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
9033 function here because we don't want footnotes inside footnotes.
9035 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
9037 (init): now set the inset_owner in paragraph.C
9038 (LocalDispatch): added some resetPos() in the right position
9041 (pasteSelection): changed to use the new CutAndPaste-Class.
9043 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
9044 which tells if it is allowed to insert another inset inside this one.
9046 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
9047 SwitchLayoutsBetweenClasses.
9049 * src/text2.C (InsertInset): checking of the new paragraph-function
9051 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
9052 is not needed anymore here!
9055 (PasteSelection): redone (also with #ifdef) so that now this uses
9056 the CutAndPaste-Class.
9057 (SwitchLayoutsBetweenClasses): removed here and implemented in the
9060 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
9061 from/to text/insets.
9063 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
9064 so that the paragraph knows if it is inside an (text)-inset.
9065 (InsertFromMinibuffer): changed return-value to bool as now it
9066 may happen that an inset is not inserted in the paragraph.
9067 (InsertInsetAllowed): this checks if it is allowed to insert an
9068 inset in this paragraph.
9070 (BreakParagraphConservative):
9071 (BreakParagraph) : small change for the above change of the return
9072 value of InsertFromMinibuffer.
9074 * src/lyxparagraph.h: added inset_owner and the functions to handle
9075 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
9077 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9079 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
9080 functions from BufferView to BufferView::Pimpl to ease maintence.
9082 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
9083 correctly. Also use SetCursorIntern instead of SetCursor.
9085 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
9088 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9090 * src/WorkArea.C (belowMouse): manually implement below mouse.
9092 * src/*: Add "explicit" on several constructors, I added probably
9093 some unneeded ones. A couple of changes to code because of this.
9095 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
9096 implementation and private parts from the users of BufferView. Not
9099 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
9100 implementation and private parts from the users of LyXLex. Not
9103 * src/BufferView_pimpl.[Ch]: new files
9105 * src/lyxlex_pimpl.[Ch]: new files
9107 * src/LyXView.[Ch]: some inline functions move out-of-line
9109 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9111 * src/lyxparagraph.h: make struct InsetTable public.
9113 * src/support/lyxstring.h: change lyxstring::difference_type to be
9114 ptrdiff_t. Add std:: modifiers to streams.
9116 * src/font.C: include the <cctype> header, for islower() and
9119 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9121 * src/font.[Ch]: new files. Contains the metric functions for
9122 fonts, takes a LyXFont as parameter. Better separation of concepts.
9124 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
9125 changes because of this.
9127 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
9129 * src/*: compile with -Winline and move functions that don't
9132 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
9135 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9137 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
9138 (various files changed because of this)
9140 * src/Painter.C (text): fixed the drawing of smallcaps.
9142 * src/lyxfont.[Ch] (drawText): removed unused member func.
9145 * src/*.C: added needed "using" statements and "std::" qualifiers.
9147 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
9149 * src/*.h: removed all use of "using" from header files use
9150 qualifier std:: instead.
9152 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9154 * src/text.C (Backspace): some additional cleanups (we already
9155 know whether cursor.pos is 0 or not).
9157 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
9158 automake does not provide one).
9160 * src/bmtable.h: replace C++ comments with C comments.
9162 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
9164 * src/screen.C (ShowCursor): Change the shape of the cursor if
9165 the current language is not equal to the language of the document.
9166 (If the cursor change its shape unexpectedly, then you've found a bug)
9168 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
9171 * src/insets/insetnumber.[Ch]: New files.
9173 * src/LyXAction.C (init)
9174 * src/lyxfunc.C (dispatch): Add command number-inset-insert
9177 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
9179 * src/lyxparagraph.h
9180 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
9181 (the vector is kept sorted).
9183 * src/text.C (GetVisibleRow): Draw selection correctly when there
9184 is both LTR and RTL text.
9186 * src/paragraph.C (Clone): Use the assignment operator for cloning,
9187 which is much faster.
9189 * src/text.C (GetVisibleRow and other): Do not draw the last space
9190 in a row if the direction of the last letter is not equal to the
9191 direction of the paragraph.
9193 * src/lyxfont.C (latexWriteStartChanges):
9194 Check that font language is not equal to basefont language.
9195 (latexWriteEndChanges): ditto
9197 * src/lyx_cb.C (StyleReset): Don't change the language while using
9198 the font-default command.
9200 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
9201 empty paragraph before a footnote.
9203 * src/insets/insetcommand.C (draw): Increase x correctly.
9205 * src/screen.C (ShowCursor): Change cursor shape if
9206 current language != document language.
9208 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
9210 2000-03-31 Juergen Vigna <jug@sad.it>
9212 * src/paragraph.C (GetInset): commented out text[pos] = ' '
9213 (Clone): changed mode how the paragraph-data is copied to the
9214 new clone-paragraph.
9216 * src/lyxfunc.C (Dispatch): fixed small problem when calling
9217 GetInset(pos) with no inset anymore there (in inset UNDO)
9219 * src/insets/insetcommand.C (draw): small fix as here x is
9220 incremented not as much as width() returns (2 before, 2 behind = 4)
9222 2000-03-30 Juergen Vigna <jug@sad.it>
9224 * src/insets/insettext.C (InsetText): small fix in initialize
9225 widthOffset (should not be done in the init() function)
9227 2000-03-29 Amir Karger <karger@lyx.org>
9229 * lib/examples/it_ItemizeBullets.lyx: translation by
9232 * Implemented \textasciitilde and fixed a tiny bug in reLyX
9234 2000-03-29 Juergen Vigna <jug@sad.it>
9236 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
9238 * src/insets/insetfoot.C (Clone): small change as for the below
9239 new init function in the text-inset
9241 * src/insets/insettext.C (init): new function as I've seen that
9242 clone did not copy the Paragraph-Data!
9243 (LocalDispatch): Added code so that now we have some sort of Undo
9244 functionality (well actually we HAVE Undo ;)
9246 * src/text.C (Backspace): Small fix for the a | a Backspace problem
9248 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
9250 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
9253 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9255 * src/main.C: added a runtime check that verifies that the xforms
9256 header used when building LyX and the library used when running
9257 LyX match. Exit with a message if they don't match. This is a
9258 version number check only.
9260 * src/buffer.C (save): Don't allocate memory on the heap for
9261 struct utimbuf times.
9263 * *: some using changes, use iosfwd instead of the real headers.
9265 * src/lyxfont.C use char const * instead of string for the static
9266 strings. Rewrite some functions to use sstream.
9268 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9270 * src/text.C (Backspace): hopefully fix the dreaded backaspace
9273 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9275 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
9276 of Geodesy (from Martin Vermeer)
9278 * lib/layouts/svjour.inc: include file for the Springer svjour
9279 class. It can be used to support journals other than JoG.
9281 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
9282 Miskiewicz <misiek@pld.org.pl>)
9283 * lib/reLyX/Makefile.am: ditto.
9285 2000-03-27 Juergen Vigna <jug@sad.it>
9287 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
9288 also some modifications with operations on selected text.
9290 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
9291 problems with clicking on insets (last famous words ;)
9293 * src/insets/insetcommand.C (draw):
9294 (width): Changed to have a bit of space before and after the inset so
9295 that the blinking cursor can be seen (otherwise it was hidden)
9297 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9299 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
9300 would not be added to the link list when an installed gettext (not
9301 part of libc) is found.
9303 2000-03-24 Juergen Vigna <jug@sad.it>
9305 * src/insets/insetcollapsable.C (Edit):
9306 * src/mathed/formula.C (InsetButtonRelease):
9307 (InsetButtonPress): fixed for new handling of ButtonPress/Release
9310 * src/BufferView.C (workAreaButtonPress):
9311 (workAreaButtonRelease):
9312 (checkInsetHit): Finally fixed the clicking on insets be handled
9315 * src/insets/insetert.C (Edit): inserted this call so that ERT
9316 insets work always with LaTeX-font
9318 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9320 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
9321 caused lyx to startup with no GUI in place, causing in a crash
9322 upon startup when called with arguments.
9324 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9326 * src/FontLoader.C: better initialization of dummyXFontStruct.
9328 2000-03-20 José Abílio Matos <jamatos@lyx.org>
9330 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
9331 for linuxdoc and docbook import and export format options.
9333 * lib/lyxrc.example Example of default values for the previous flags.
9335 * src/lyx_cb.C Use those flags instead of the hardwired values for
9336 linuxdoc and docbook export.
9338 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
9341 * src/menus.C Added menus entries for the new import/exports formats.
9343 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9345 * src/lyxrc.*: Added support for running without Gui
9348 * src/FontLoader.C: sensible defaults if no fonts are needed
9350 * src/lyx_cb.C: New function ShowMessage (writes either to the
9351 minibuffer or cout in case of no gui
9352 New function AskOverwrite for common stuff
9353 Consequently various changes to call these functions
9355 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
9356 wild guess at sensible screen resolution when having no gui
9358 * src/lyxfont.C: no gui, no fonts... set some defaults
9360 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9362 * src/LColor.C: made the command inset background a bit lighter.
9364 2000-03-20 Hartmut Goebel <goebel@noris.net>
9366 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
9367 stdstruct.inc. Koma-Script added some title elements which
9368 otherwise have been listed below "bibliography". This split allows
9369 adding title elements to where they belong.
9371 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
9372 define the additional title elements and then include
9375 * many other layout files: changed to include stdtitle.inc just
9376 before stdstruct.inc.
9378 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
9380 * src/buffer.C: (save) Added the option to store all backup files
9381 in a single directory
9383 * src/lyxrc.[Ch]: Added variable \backupdir_path
9385 * lib/lyxrc.example: Added descriptions of recently added variables
9387 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
9388 bibtex inset, not closing the bibtex popup when deleting the inset)
9390 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9392 * src/lyx_cb.C: add a couple using directives.
9394 2000-03-17 José Abílio Matos <jamatos@lyx.org>
9395 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
9396 import based on the filename.
9398 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
9399 file would be imported at start, if the filename where of a sgml file.
9401 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
9403 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
9405 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
9406 * src/lyxfont.h Replaced the member variable bits.direction by the
9407 member variable lang. Made many changes in other files.
9408 This allows having a multi-lingual document
9410 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
9411 that change the current language to <l>.
9412 Removed the command "font-rtl"
9414 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
9415 format for Hebrew documents)
9417 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
9418 When auto_mathmode is "true", pressing a digit key in normal mode
9419 will cause entering into mathmode.
9420 If auto_mathmode is "rtl" then this behavior will be active only
9421 when writing right-to-left text.
9423 * src/text2.C (InsertStringA) The string is inserted using the
9426 * src/paragraph.C (GetEndLabel) Gives a correct result for
9427 footnote paragraphs.
9429 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
9431 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9433 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
9434 front of PasteParagraph. Never insert a ' '. This should at least
9435 fix some cause for the segfaults that we have been experiencing,
9436 it also fixes backspace behaviour slightly. (Phu!)
9438 * src/support/lstrings.C (compare_no_case): some change to make it
9439 compile with gcc 2.95.2 and stdlibc++-v3
9441 * src/text2.C (MeltFootnoteEnvironment): change type o
9442 first_footnote_par_is_not_empty to bool.
9444 * src/lyxparagraph.h: make text private. Changes in other files
9446 (fitToSize): new function
9447 (setContentsFromPar): new function
9448 (clearContents): new function
9449 (SetChar): new function
9451 * src/paragraph.C (readSimpleWholeFile): deleted.
9453 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
9454 the file, just use a simple string instead. Also read the file in
9455 a more maintainable manner.
9457 * src/text2.C (InsertStringA): deleted.
9458 (InsertStringB): deleted.
9460 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9462 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
9463 RedoParagraphs from the doublespace handling part, just set status
9464 to NEED_MORE_REFRESH. Also don't update cursor position (should be
9465 done, but perhaps not like this.)
9467 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9469 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
9470 character when inserting an inset.
9472 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9474 * src/bufferparams.C (readLanguage): now takes "default" into
9477 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
9478 also initialize the toplevel_keymap with the default bindings from
9481 * src/buffer.C (Buffer): remove lyxrc from the parameters.
9483 * all files using lyxrc: have lyxrc as a real variable and not a
9484 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
9487 * src/lyxrc.C: remove double call to defaultKeyBindings
9489 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
9490 toolbar defauls using lyxlex. Remove enums, structs, functions
9493 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
9494 toolbar defaults. Also store default keybindings in a map.
9496 * src/ToolbarDefaults.[Ch]: New file. This class is used for
9497 storing the toolbar defaults without any xforms dependencies.
9499 * src/insets/figinset.C: patch posted to list by Andre Poenitz
9500 applied. Changed to use iterators.
9502 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9504 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
9505 systems that don't have LINGUAS set to begin with.
9507 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9509 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
9510 the list by Dekel Tsur.
9512 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9514 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
9515 * src/insets/form_graphics.C: ditto.
9517 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
9519 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9521 * src/bufferparams.C (readLanguage): use the new language map
9523 * src/intl.C (InitKeyMapper): use the new language map
9525 * src/lyx_gui.C (create_forms): use the new language map
9527 * src/language.[Ch]: New files. Used for holding the information
9528 about each language. Now! Use this new language map enhance it and
9529 make it really usable for our needs.
9531 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
9533 * screen.C (ShowCursor): Removed duplicate code.
9534 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
9535 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
9537 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
9540 * src/text.C Added TransformChar method. Used for rendering Arabic
9541 text correctly (change the glyphs of the letter according to the
9542 position in the word)
9547 * src/lyxrc.C Added lyxrc command {language_command_begin,
9548 language_command_end,language_command_ltr,language_command_rtl,
9549 language_package} which allows the use of either arabtex or Omega
9552 * src/lyx_gui.C (init)
9554 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
9555 to use encoding for menu fonts which is different than the encoding
9558 * src/buffer.C (makeLaTeXFile): If params.language = "default",
9559 do not load the babel package.
9560 To write an English document with Hebrew/Arabic, change the document
9561 language to "english".
9563 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
9564 (alphaCounter): changed to return char
9565 (loweralphaCounter, hebrewCounter, romanCounter): New functions
9567 * lib/lyxrc.example Added examples for Hebrew/Arabic
9570 * src/layout.C Added layout command endlabeltype
9572 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
9574 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
9576 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9578 * src/mathed/math_delim.C (search_deco): return a
9579 math_deco_struct* instead of index.
9581 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9583 * All files with a USE_OSTREAM_ONLY within: removed all code that
9584 was unused when USE_OSTREAM_ONLY is defined.
9586 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
9587 of any less. Removed header and using.
9589 * src/text.C (GetVisibleRow): draw the string "Page Break
9590 (top/bottom)" on screen when drawing a pagebreak line.
9592 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9594 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
9596 * src/mathed/math_macro.C (draw): do some cast magic.
9599 * src/mathed/math_defs.h: change byte* argument to byte const*.
9601 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
9603 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
9604 know it is right to return InsetFoot* too, but cxx does not like
9607 * src/insets/insetcollapsable.[Ch] (Clone): make const.
9609 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
9611 * src/mathed/math_delim.C: change == to proper assignment.
9613 2000-03-09 Juergen Vigna <jug@sad.it>
9615 * src/insets/insettext.C (setPos): fixed various cursor positioning
9616 problems (via mouse and cursor-keys)
9617 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
9618 inset (still a small display problem but it works ;)
9620 * src/insets/insetcollapsable.C (draw): added button_top_y and
9621 button_bottom_y to have correct values for clicking on the inset.
9623 * src/support/lyxalgo.h: commented out 'using std::less'
9625 2000-03-08 Juergen Vigna <jug@sad.it>
9627 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
9628 Button-Release event closes as it is alos the Release-Event
9631 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
9633 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9635 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
9636 can add multiple spaces in Scrap (literate programming) styles...
9637 which, by the way, is how I got hooked on LyX to begin with.
9639 * src/mathed/formula.C (Write): Added dummy variable to an
9640 inset::Latex() call.
9641 (Latex): Add free_spacing boolean to inset::Latex()
9643 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
9645 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
9646 virtual function to include the free_spacing boolean from
9647 the containing paragraph's style.
9649 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
9650 Added free_spacing boolean arg to match inset.h
9652 * src/insets/insettext.C, src/insets/insettext.h (Latex):
9653 Added free_spacing boolean arg to match inset.h
9655 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
9656 Added free_spacing boolean and made sure that if in a free_spacing
9657 paragraph, that we output normal space if there is a protected space.
9659 * src/insets/insetref.C, src/insets/insetref.h (Latex):
9660 Added free_spacing boolean arg to match inset.h
9662 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
9663 Added free_spacing boolean arg to match inset.h
9665 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
9666 Added free_spacing boolean arg to match inset.h
9668 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
9669 Added free_spacing boolean arg to match inset.h
9671 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
9672 Added free_spacing boolean arg to match inset.h
9674 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
9675 free_spacing boolean arg to match inset.h
9677 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
9678 Added free_spacing boolean arg to match inset.h
9680 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
9681 Added free_spacing boolean arg to match inset.h
9683 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
9684 Added free_spacing boolean arg to match inset.h
9686 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
9687 Added free_spacing boolean arg to match inset.h
9689 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
9690 Added free_spacing boolean arg to match inset.h
9692 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
9693 free_spacing boolean arg to match inset.h
9695 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
9696 free_spacing boolean arg to match inset.h
9698 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
9699 ignore free_spacing paragraphs. The user's spaces are left
9702 * src/text.C (InsertChar): Fixed the free_spacing layout
9703 attribute behavior. Now, if free_spacing is set, you can
9704 add multiple spaces in a paragraph with impunity (and they
9705 get output verbatim).
9706 (SelectSelectedWord): Added dummy argument to inset::Latex()
9709 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
9712 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
9713 paragraph layouts now only input a simple space instead.
9714 Special character insets don't make any sense in free-spacing
9717 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
9718 hard-spaces in the *input* file to simple spaces if the layout
9719 is free-spacing. This converts old files which had to have
9720 hard-spaces in free-spacing layouts where a simple space was
9722 (writeFileAscii): Added free_spacing check to pass to the newly
9723 reworked inset::Latex(...) methods. The inset::Latex() code
9724 ensures that hard-spaces in free-spacing paragraphs get output
9725 as spaces (rather than "~").
9727 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9729 * src/mathed/math_delim.C (draw): draw the empty placeholder
9730 delims with a onoffdash line.
9731 (struct math_deco_compare): struct that holds the "functors" used
9732 for the sort and the binary search in math_deco_table.
9733 (class init_deco_table): class used for initial sort of the
9735 (search_deco): use lower_bound to do a binary search in the
9738 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9740 * src/lyxrc.C: a small secret thingie...
9742 * src/lyxlex.C (printTable): changed to take a ostream as paramter
9743 and to not flush the stream as often as it used to.
9745 * src/support/lyxalgo.h: new file
9746 (sorted): template function used for checking if a sequence is
9747 sorted or not. Two versions with and without user supplied
9748 compare. Uses same compare as std::sort.
9750 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
9751 it and give warning on lyxerr.
9753 (struct compare_tags): struct with function operators used for
9754 checking if sorted, sorting and lower_bound.
9755 (search_kw): use lower_bound instead of manually implemented
9758 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9760 * src/insets/insetcollapsable.h: fix Clone() declaration.
9761 * src/insets/insetfoot.h: ditto.
9763 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
9765 2000-03-08 Juergen Vigna <jug@sad.it>
9767 * src/insets/lyxinset.h: added owner call which tells us if
9768 this inset is inside another inset. Changed also the return-type
9769 of Editable to an enum so it tells clearer what the return-value is.
9771 * src/insets/insettext.C (computeTextRows): fixed computing of
9772 textinsets which split automatically on more rows.
9774 * src/insets/insetert.[Ch]: changed this to be of BaseType
9777 * src/insets/insetfoot.[Ch]: added footnote inset
9779 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
9780 collapsable insets (like footnote, ert, ...)
9782 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9784 * src/lyxdraw.h: remvoe file
9786 * src/lyxdraw.C: remove file
9788 * src/insets/insettext.C: added <algorithm>.
9790 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9792 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9793 (matrix_cb): case MM_OK use string stream
9795 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9798 * src/mathed/math_macro.C (draw): use string stream
9799 (Metrics): use string stream
9801 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9802 directly to the ostream.
9804 * src/vspace.C (asString): use string stream.
9805 (asString): use string stream
9806 (asLatexString): use string stream
9808 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9809 setting Spacing::Other.
9811 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9812 sprintf when creating the stretch vale.
9814 * src/text2.C (alphaCounter): changed to return a string and to
9815 not use a static variable internally. Also fixed a one-off bug.
9816 (SetCounter): changed the drawing of the labels to use string
9817 streams instead of sprintf.
9819 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9820 manipulator to use a scheme that does not require library support.
9821 This is also the way it is done in the new GNU libstdc++. Should
9822 work with DEC cxx now.
9824 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9826 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9827 end. This fixes a bug.
9829 * src/mathed (all files concerned with file writing): apply the
9830 USE_OSTREAM_ONLY changes to mathed too.
9832 * src/support/DebugStream.h: make the constructor explicit.
9834 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9835 count and ostream squashed.
9837 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9839 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9841 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9842 ostringstream uses STL strings, and we might not.
9844 * src/insets/insetspecialchar.C: add using directive.
9845 * src/insets/insettext.C: ditto.
9847 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9849 * lib/layouts/seminar.layout: feeble attempt at a layout for
9850 seminar.cls, far from completet and could really use some looking
9851 at from people used to write layout files.
9853 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9854 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9855 a lot nicer and works nicely with ostreams.
9857 * src/mathed/formula.C (draw): a slightly different solution that
9858 the one posted to the list, but I think this one works too. (font
9859 size wrong in headers.)
9861 * src/insets/insettext.C (computeTextRows): some fiddling on
9862 Jürgens turf, added some comments that he should read.
9864 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9865 used and it gave compiler warnings.
9866 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9869 * src/lyx_gui.C (create_forms): do the right thing when
9870 show_banner is true/false.
9872 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9873 show_banner is false.
9875 * most file writing files: Now use iostreams to do almost all of
9876 the writing. Also instead of passing string &, we now use
9877 stringstreams. mathed output is still not adapted to iostreams.
9878 This change can be turned off by commenting out all the occurences
9879 of the "#define USE_OSTREAM_ONLY 1" lines.
9881 * src/WorkArea.C (createPixmap): don't output debug messages.
9882 (WorkArea): don't output debug messages.
9884 * lib/lyxrc.example: added a comment about the new variable
9887 * development/Code_rules/Rules: Added some more commente about how
9888 to build class interfaces and on how better encapsulation can be
9891 2000-03-03 Juergen Vigna <jug@sad.it>
9893 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
9894 automatically with the width of the LyX-Window
9896 * src/insets/insettext.C (computeTextRows): fixed update bug in
9897 displaying text-insets (scrollvalues where not initialized!)
9899 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9901 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
9902 id in the check of the result from lower_bound is not enough since
9903 lower_bound can return last too, and then res->id will not be a
9906 * all insets and some code that use them: I have conditionalized
9907 removed the Latex(string & out, ...) this means that only the
9908 Latex(ostream &, ...) will be used. This is a work in progress to
9909 move towards using streams for all output of files.
9911 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
9914 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9916 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
9917 routine (this fixes bug where greek letters were surrounded by too
9920 * src/support/filetools.C (findtexfile): change a bit the search
9921 algorithm, to fix bug introduced in 1.1.4. Note that --format is
9922 no longer passed to kpsewhich, we may have to change that later.
9924 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
9925 warning options to avoid problems with X header files (from Angus
9927 * acinclude.m4: regenerated.
9929 2000-03-02 Juergen Vigna <jug@sad.it>
9931 * src/insets/insettext.C (WriteParagraphData): Using the
9932 par->writeFile() function for writing paragraph-data.
9933 (Read): Using buffer->parseSingleLyXformat2Token()-function
9934 for parsing paragraph data!
9936 * src/buffer.C (readLyXformat2): removed all parse data and using
9937 the new parseSingleLyXformat2Token()-function.
9938 (parseSingleLyXformat2Token): added this function to parse (read)
9939 lyx-file-format (this is called also from text-insets now!)
9941 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9943 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
9946 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
9947 directly instead of going through a func. One very bad thing: a
9948 static LyXFindReplace, but I don't know where to place it.
9950 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
9951 string instead of char[]. Also changed to static.
9952 (GetSelectionOrWordAtCursor): changed to static inline
9953 (SetSelectionOverLenChars): ditto.
9955 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
9956 current_view and global variables. both classes has changed names
9957 and LyXFindReplace is not inherited from SearchForm.
9959 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
9960 fl_form_search form.
9962 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
9964 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9966 * lib/bind/*.bind: make sure 'buffer-previous' function is not
9967 bound (from Kayvan).
9969 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
9971 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
9973 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9975 * some things that I should comment but the local pub says head to
9978 * comment out all code that belongs to the Roff code for Ascii
9979 export of tables. (this is unused)
9981 * src/LyXView.C: use correct type for global variable
9982 current_layout. (LyXTextClass::size_type)
9984 * some code to get the new insetgraphics closer to working I'd be
9985 grateful for any help.
9987 * src/BufferView2.C (insertInset): use the return type of
9988 NumberOfLayout properly. (also changes in other files)
9990 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
9991 this as a test. I want to know what breaks because of this.
9993 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
9995 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9997 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
9998 to use a \makebox in the label, this allows proper justification
9999 with out using protected spaces or multiple hfills. Now it is
10000 "label" for left justified, "\hfill label\hfill" for center, and
10001 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
10002 should be changed accordingly.
10004 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10006 * src/lyxtext.h: change SetLayout() to take a
10007 LyXTextClass::size_type instead of a char (when there is more than
10008 127 layouts in a class); also change type of copylayouttype.
10009 * src/text2.C (SetLayout): ditto.
10010 * src/LyXView.C (updateLayoutChoice): ditto.
10012 * src/LaTeX.C (scanLogFile): errors where the line number was not
10013 given just after the '!'-line were ignored (from Dekel Tsur).
10015 * lib/lyxrc.example: fix description of \date_insert_format
10017 * lib/layouts/llncs.layout: new layout, contributed by Martin
10020 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10022 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
10023 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
10024 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
10025 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
10026 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
10027 paragraph.C, text.C, text2.C)
10029 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10031 * src/insets/insettext.C (LocalDispatch): remove extra break
10034 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
10035 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
10037 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
10038 * src/insets/insettext.[Ch] (GetCursorPos): ditto
10040 * src/insets/insetbib.h: move InsetBibkey::Holder and
10041 InsetCitation::Holder in public space.
10043 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10045 * src/insets/insettext.h: small change to get the new files from
10046 Juergen to compile (use "string", not "class string").
10048 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
10049 const & as parameter to LocalDispatch, use LyXFont const & as
10050 paramter to some other func. This also had impacto on lyxinsets.h
10051 and the two mathed insets.
10053 2000-02-24 Juergen Vigna <jug@sad.it>
10056 * src/commandtags.h:
10058 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
10062 * src/BufferView2.C: added/updated code for various inset-functions
10064 * src/insets/insetert.[Ch]: added implementation of InsetERT
10066 * src/insets/insettext.[Ch]: added implementation of InsetText
10068 * src/insets/inset.C (Edit): added "unsigned int button" parameter
10069 (draw): added preliminary code for inset scrolling not finshed yet
10071 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
10072 as it is in lyxfunc.C now
10074 * src/insets/lyxinset.h: Added functions for text-insets
10076 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10078 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
10079 BufferView and reimplement the list as a queue put inside its own
10082 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
10084 * several files: use the new interface to the "updateinsetlist"
10086 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
10088 (work_area_handler): call BufferView::trippleClick on trippleclick.
10090 * src/BufferView.C (doubleClick): new function, selects word on
10092 (trippleClick): new function, selects line on trippleclick.
10094 2000-02-22 Allan Rae <rae@lyx.org>
10096 * lib/bind/xemacs.bind: buffer-previous not supported
10098 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10100 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
10103 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10105 * src/bufferlist.C: get rid of current_view from this file
10107 * src/spellchecker.C: get rid of current_view from this file
10109 * src/vspace.C: get rid of current_view from this file
10110 (inPixels): added BufferView parameter for this func
10111 (asLatexCommand): added a BufferParams for this func
10113 * src/text.C src/text2.C: get rid of current_view from these
10116 * src/lyxfont.C (getFontDirection): move this function here from
10119 * src/bufferparams.C (getDocumentDirection): move this function
10122 * src/paragraph.C (getParDirection): move this function here from
10124 (getLetterDirection): ditto
10126 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
10128 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
10129 resize due to wrong pixmap beeing used. Also took the opurtunity
10130 to make the LyXScreen stateless on regard to WorkArea and some
10131 general cleanup in the same files.
10133 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10135 * src/Makefile.am: add missing direction.h
10137 * src/PainterBase.h: made the width functions const.
10139 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
10142 * src/insets/insetcommand.C (draw): draw Editable as buttons.
10144 * src/insets/insetlatexaccent.C (draw): make the accents draw
10145 better, at present this will only work well with iso8859-1.
10147 * several files: remove the old drawing code, now we use the new
10150 * several files: remove support for mono_video, reverse_video and
10153 2000-02-17 Juergen Vigna <jug@sad.it>
10155 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
10156 int ** as we have to return the pointer, otherwise we have only
10157 NULL pointers in the returning function.
10159 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10161 * src/LaTeX.C (operator()): quote file name when running latex.
10163 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10165 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
10166 (bubble tip), this removes our special handling of this.
10168 * Remove all code that is unused now that we have the new
10169 workarea. (Code that are not active when NEW_WA is defined.)
10171 * Make the uses of XSync not conditionalized on define USE_XSYNC.
10173 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10175 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
10176 nonexisting layout; correctly redirect obsoleted layouts.
10178 * lib/lyxrc.example: document \view_dvi_paper_option
10180 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
10183 * src/lyx_cb.C (RunScript): handle $$FName for command names.
10184 (PreviewDVI): handle the view_dvi_paper_option variable.
10185 [Both from Roland Krause]
10187 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10189 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
10190 char const *, int, LyXFont)
10191 (text(int, int, string, LyXFont)): ditto
10193 * src/text.C (InsertCharInTable): attempt to fix the double-space
10194 feature in tables too.
10195 (BackspaceInTable): ditto.
10196 (GetVisibleRow): make bottom pagebreak line be a onoff line.
10198 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10200 * src/text2.C (owner): only complain if owner_ is set and bv != 0
10202 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
10203 newly found text in textcache to this.
10204 (buffer): set the owner of the text put into the textcache to 0
10206 * src/insets/figinset.C (draw): fixed the drawing of figures with
10209 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
10210 drawing of mathframe, hfills, protected space, table lines. I have
10211 now no outstanding drawing problems with the new Painter code.
10213 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10215 * src/PainterBase.C (ellipse, circle): do not specify the default
10218 * src/LColor.h: add using directive.
10220 * src/Painter.[Ch]: change return type of methods from Painter& to
10221 PainterBase&. Add a using directive.
10223 * src/WorkArea.C: wrap xforms callbacks in C functions
10226 * lib/layouts/foils.layout: font fix and simplifications from Carl
10229 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10231 * a lot of files: The Painter, LColor and WorkArea from the old
10232 devel branch has been ported to lyx-devel. Some new files and a
10233 lot of #ifdeffed code. The new workarea is enabled by default, but
10234 if you want to test the new Painter and LColor you have to compile
10235 with USE_PAINTER defined (do this in config.h f.ex.) There are
10236 still some rought edges, and I'd like some help to clear those
10237 out. It looks stable (loads and displays the Userguide very well).
10240 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10242 * src/buffer.C (pop_tag): revert to the previous implementation
10243 (use a global variable for both loops).
10245 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
10247 * src/lyxrc.C (LyXRC): change slightly default date format.
10249 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
10250 there is an English text with a footnote that starts with a Hebrew
10251 paragraph, or vice versa.
10252 (TeXFootnote): ditto.
10254 * src/text.C (LeftMargin): allow for negative values for
10255 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
10258 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
10259 for input encoding (cyrillic)
10261 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10263 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
10266 * src/toolbar.C (set): ditto
10267 * src/insets/insetbib.C (create_form_citation_form): ditto
10269 * lib/CREDITS: added Dekel Tsur.
10271 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
10272 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
10273 hebrew supports files from Dekel Tsur.
10275 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
10276 <tzafrir@technion.ac.il>
10278 * src/lyxrc.C: put \date_insert_format at the right place.
10280 * src/buffer.C (makeLaTeXFile): fix the handling of
10281 BufferParams::sides when writing out latex files.
10283 * src/BufferView2.C: add a "using" directive.
10285 * src/support/lyxsum.C (sum): when we use lyxstring,
10286 ostringstream::str needs an additional .c_str().
10288 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10290 * src/support/filetools.C (ChangeExtension): patch from Etienne
10293 * src/TextCache.C (show): remove const_cast and make second
10294 parameter non-const LyXText *.
10296 * src/TextCache.h: use non const LyXText in show.
10298 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
10301 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10303 * src/support/lyxsum.C: rework to be more flexible.
10305 * several places: don't check if a pointer is 0 if you are going
10308 * src/text.C: remove some dead code.
10310 * src/insets/figinset.C: remove some dead code
10312 * src/buffer.C: move the BufferView funcs to BufferView2.C
10313 remove all support for insetlatexdel
10314 remove support for oldpapersize stuff
10315 made some member funcs const
10317 * src/kbmap.C: use a std::list to store the bindings in.
10319 * src/BufferView2.C: new file
10321 * src/kbsequence.[Ch]: new files
10323 * src/LyXAction.C + others: remove all trace of buffer-previous
10325 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
10326 only have one copy in the binary of this table.
10328 * hebrew patch: moved some functions from LyXText to more
10329 appropriate places. (LyXParagraph, BufferParams, LyXFont)
10331 * several files: remove support for XForms older than 0.88
10332 whitespace changes.
10333 remove some #if 0 #endif code
10335 * src/TextCache.[Ch]: new file. Holds the textcache.
10337 * src/BufferView.C: changes to use the new TextCache interface.
10338 (waitForX): remove the now unused code.
10340 * src/BackStack.h: remove some commented code
10342 * lib/bind/emacs.bind: remove binding for buffer-previous
10344 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10346 * applied the hebrew patch.
10348 * src/lyxrow.h: make sure that all Row variables are initialized.
10350 * src/text2.C (TextHandleUndo): comment out a delete, this might
10351 introduce a memory leak, but should also help us to not try to
10352 read freed memory. We need to look at this one.
10354 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
10355 (LyXParagraph): initalize footnotekind.
10357 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
10358 forgot this when applying the patch. Please heed the warnings.
10360 * src/BufferView.C (buffer): a fix for the buffer-reload problem
10361 (aka. reformat problem)
10363 * src/bufferlist.C (exists): made const, and use const_iterator
10364 (isLoaded): new func.
10365 (release): use std::find to find the correct buffer.
10367 * src/bufferlist.h: made getState a const func.
10368 made empty a const func.
10369 made exists a const func.
10372 2000-02-01 Juergen Vigna <jug@sad.it>
10374 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
10376 * po/it.po: updated a bit the italian po file and also changed the
10377 'file nuovo' for newfile to 'filenuovo' without a space, this did
10380 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
10381 for the new insert_date command.
10383 * src/lyxfunc.C (Dispatch): added support for a insert_date function
10384 from jdblair, to insert a date into the current text conforming to
10385 a strftime format (for now only considering the locale-set and not
10386 the document-language).
10388 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10390 * src/lyxfont.C (textWidth): hopefully better fix for the Array
10391 Bounds Read error seen by purify. The problem was that islower is
10392 a macros which takes an unsigned char and uses it as an index for
10393 in array of characters properties (and is thus subject to the
10397 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
10398 correctly the paper sides radio buttons.
10399 (UpdateDocumentButtons): ditto.
10401 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10403 * src/kbmap.C (getsym + others): change to return unsigned int,
10404 returning a long can give problems on 64 bit systems. (I assume
10405 that int is 32bit on 64bit systems)
10407 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10409 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
10410 LyXLookupString to be zero-terminated. Really fixes problems seen
10411 by purify, I think.
10413 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10415 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
10416 write a (char*)0 to the lyxerr stream.
10418 * src/lastfiles.C: move algorithm before the using statemets.
10420 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10422 * src/lastfiles.C: move using directives in global scope (egcs 1.x
10423 complains otherwise).
10424 * src/table.C: ditto
10426 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
10429 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
10430 that I removed earlier... It is really needed.
10432 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
10434 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10436 * INSTALL: update xforms home page URL.
10438 * lib/configure.m4: fix a bug with unreadable layout files.
10440 * src/table.C (calculate_width_of_column): add "using std::max"
10443 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10445 * several files: marked several lines with "DEL LINE", this is
10446 lines that can be deleted without changing anything.
10447 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
10448 checks this anyway */
10451 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
10453 * src/DepTable.C (update): add a "+" at the end when the checksum
10454 is different. (debugging string only)
10456 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
10457 the next inset to not be displayed. This should also fix the list
10458 of labels in the "Insert Crossreference" dialog.
10460 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10462 * src/support/LSubstring.C (LSubstring): set pos to string::npos
10463 when regex was not found.
10465 * src/support/lstrings.C (lowercase): use handcoded transform always.
10468 * src/text.C (Delete): fixed the crash. cursor.par->prev and
10469 old_cursor.par->prev could be 0.
10471 * several files: changed post inc/dec to pre inc/dec
10473 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
10474 write the lastfiles to file.
10476 * src/BufferView.C (buffer): only show TextCache info when debugging
10478 (resizeCurrentBuffer): ditto
10479 (workAreaExpose): ditto
10481 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
10483 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
10485 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
10486 a bit better by removing the special case for \i and \j.
10488 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10490 * src/lyx_main.C (easyParse): remove test for bad comand line
10491 options, since this broke all xforms-related parsing.
10493 * src/kbmap.C (getsym): set return type to unsigned long, as
10494 declared in header. On an alpha, long is _not_ the same as int.
10496 * src/support/LOstream.h: add a "using std::flush;"
10498 * src/insets/figinset.C: ditto.
10500 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10502 * src/bufferlist.C (write): use blinding fast file copy instead of
10503 "a char at a time", now we are doing it the C++ way.
10505 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
10506 std::list<int> instead.
10507 (addpidwait): reflect move to std::list<int>
10508 (sigchldchecker): ditto
10510 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
10513 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
10514 that obviously was wrong...
10516 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
10517 c, this avoids warnings with purify and islower.
10519 * src/insets/figinset.C: rename struct queue to struct
10520 queue_element and rewrite to use a std::queue. gsqueue is now a
10521 std::queue<queue_element>
10522 (runqueue): reflect move to std::queue
10525 * src/support/lstrings.h (tostr): specialize for bool, otherwise
10526 we would get "1" "0" instead of "true" "false. Also make the tostr
10529 2000-01-21 Juergen Vigna <jug@sad.it>
10531 * src/buffer.C (writeFileAscii): Disabled code for special groff
10532 handling of tabulars till I fix this in table.C
10534 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10536 * src/support/mkdir.C (mkdir): change second argument of mkdir to
10538 * src/support/lyxlib.h: ditto.
10540 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10542 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
10543 and 'j' look better. This might fix the "macron" bug that has been
10546 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
10547 functions as one template function. Delete the old versions.
10549 * src/support/lyxsum.C: move using std::ifstream inside
10552 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
10555 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
10557 * src/mathed/formula.C: delete #include "bufferlist.h" never used
10559 * src/insets/figinset.C (InitFigures): use new instead of malloc
10560 to allocate memory for figures and bitmaps.
10561 (DoneFigures): use delete[] instead of free to deallocate memory
10562 for figures and bitmaps.
10563 (runqueue): use new to allocate
10564 (getfigdata): use new/delete[] instead of malloc/free
10565 (RegisterFigure): ditto
10567 * some files: moved some declarations closer to first use, small
10568 whitespace changes use preincrement instead of postincrement where
10569 it does not make a difference.
10571 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
10572 step on the way to use stl::containers for key maps.
10574 * src/bufferlist.h: add a typedef for const_iterator and const
10575 versions of begin and end.
10577 * src/bufferlist.[Ch]: change name of member variable _state to
10578 state_. (avoid reserved names)
10580 (getFileNames): returns the filenames of the buffers in a vector.
10582 * configure.in (ALL_LINGUAS): added ro
10584 * src/support/putenv.C: new file
10586 * src/support/mkdir.C: new file
10588 2000-01-20 Allan Rae <rae@lyx.org>
10590 * lib/layouts/IEEEtran.layout: Added several theorem environments
10592 * lib/templates/IEEEtran.lyx: Example theorem environments and a
10593 couple of minor additions.
10595 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
10596 (except for those in footnotes of course)
10598 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10600 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
10602 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
10603 std::sort and std::lower_bound instead of qsort and handwritten
10605 (struct compara): struct that holds the functors used by std::sort
10606 and std::lower_bound in MathedLookupBOP.
10608 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10610 * src/support/LAssert.h: do not do partial specialization. We do
10611 not really need it.
10613 * src/support/lyxlib.h: note that lyx::getUserName() and
10614 lyx::date() are not in use right now. Should these be suppressed?
10616 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
10617 (makeLinuxDocFile): do not put date and user name in linuxdoc
10620 * src/support/lyxlib.h (kill): change first argument to long int,
10621 since that's what solaris uses.
10623 * src/support/kill.C (kill): fix declaration to match prototype.
10625 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
10626 actually check whether namespaces are supported. This is not what
10629 * src/support/lyxsum.C: add a using directive.
10631 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10633 * src/support/kill.C: if we have namespace support we don't have
10634 to include lyxlib.h.
10636 * src/support/lyxlib.h: use namespace lyx if supported.
10638 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10640 * src/support/date.C: new file
10642 * src/support/chdir.C: new file
10644 * src/support/getUserName.C: new file
10646 * src/support/getcwd.C: new file
10648 * src/support/abort.C: new file
10650 * src/support/kill.C: new file
10652 * src/support/lyxlib.h: moved all the functions in this file
10653 insede struct lyx. Added also kill and abort to this struct. This
10654 is a way to avoid the "kill is not defined in <csignal>", we make
10655 C++ wrappers for functions that are not ANSI C or ANSI C++.
10657 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
10658 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
10659 lyx it has been renamed to sum.
10661 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10663 * src/text.C: add using directives for std::min and std::max.
10665 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10667 * src/texrow.C (getIdFromRow): actually return something useful in
10668 id and pos. Hopefully fixes the bug with positionning of errorbox
10671 * src/lyx_main.C (easyParse): output an error and exit if an
10672 incorrect command line option has been given.
10674 * src/spellchecker.C (ispell_check_word): document a memory leak.
10676 * src/bufferlist.C (write): fix mismatched allocation/deletion,
10677 where a "struct utimbuf" is allocated with "new" and deleted with
10680 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10682 * src/text2.C (CutSelection): don't delete double spaces.
10683 (PasteSelection): ditto
10684 (CopySelection): ditto
10686 * src/text.C (Backspace): don't delete double spaces.
10688 * src/lyxlex.C (next): fix a bug that were only present with
10689 conformant std::istream::get to read comment lines, use
10690 std::istream::getline instead. This seems to fix the problem.
10692 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10694 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
10695 allowed to insert space before space" editing problem. Please read
10696 commends at the beginning of the function. Comments about usage
10699 * src/text.C (InsertChar): fix for the "not allowed to insert
10700 space before space" editing problem.
10702 * src/text2.C (DeleteEmptyParagraphMechanism): when
10703 IsEmptyTableRow can only return false this last "else if" will
10704 always be a no-op. Commented out.
10706 * src/text.C (RedoParagraph): As far as I can understand tmp
10707 cursor is not really needed.
10709 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
10710 present it could only return false anyway.
10711 (several functions): Did something not so smart...added a const
10712 specifier on a lot of methods.
10714 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
10715 and add a tmp->text.resize. The LyXParagraph constructor does the
10717 (BreakParagraphConservative): ditto
10719 * src/support/path.h (Path): add a define so that the wrong usage
10720 "Path("/tmp") will be flagged as a compilation error:
10721 "`unnamed_Path' undeclared (first use this function)"
10723 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10725 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
10726 which was bogus for several reasons.
10728 * src/LaTeX.C (scanAux): fix the regular expression used to scan
10730 (runBibTeX): ditto.
10732 * autogen.sh: do not use "type -path" (what's that anyway?).
10734 * src/support/filetools.C (findtexfile): remove extraneous space
10735 which caused a kpsewhich warning (at least with kpathsea version
10738 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10740 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
10742 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
10744 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
10746 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10748 * src/paragraph.C (BreakParagraph): do not reserve space on text
10749 if we don't need to (otherwise, if pos_end < pos, we end up
10750 reserving huge amounts of memory due to bad unsigned karma).
10751 (BreakParagraphConservative): ditto, although I have not seen
10752 evidence the bug can happen here.
10754 * src/lyxparagraph.h: add a using std::list.
10756 2000-01-11 Juergen Vigna <jug@sad.it>
10758 * src/menus.C (MenuDocu): output an Alert if the documentation-file
10759 could not be found.
10761 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10763 * src/vc-backend.C (doVCCommand): change to be static and take one
10764 more parameter: the path to chdir too be fore executing the command.
10765 (retrive): new function equiv to "co -r"
10767 * src/bufferlist.C (loadLyXFile): implement the missing parts if
10768 file_not_found_hook is true.
10770 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
10772 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
10773 if a file is readwrite,readonly...anything else.
10775 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10777 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
10778 (CreatePostscript): name change from MenuRunDVIPS (or something)
10779 (PreviewPostscript): name change from MenuPreviewPS
10780 (PreviewDVI): name change from MenuPreviewDVI
10782 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10783 \view_pdf_command., \pdf_to_ps_command
10785 * lib/configure.m4: added search for PDF viewer, and search for
10786 PDF to PS converter.
10787 (lyxrc.defaults output): add \pdflatex_command,
10788 \view_pdf_command and \pdf_to_ps_command.
10790 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10792 * src/bufferlist.C (write): we don't use blocksize for anything so
10795 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10797 * src/support/block.h: disable operator T* (), since it causes
10798 problems with both compilers I tried. See comments in the file.
10800 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10803 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10804 variable LYX_DIR_10x to LYX_DIR_11x.
10806 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10808 * INSTALL: document --with-lyxname.
10811 * configure.in: new configure flag --with-lyxname which allows to
10812 choose the name under which lyx is installed. Default is "lyx", of
10813 course. It used to be possible to do this with --program-suffix,
10814 but the later has in fact a different meaning for autoconf.
10816 * src/support/lstrings.h (lstrchr): reformat a bit.
10818 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10819 * src/mathed/math_defs.h: ditto.
10821 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10823 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10824 true, decides if we create a backup file or not when saving. New
10825 tag and variable \pdf_mode, defaults to false. New tag and
10826 variable \pdflatex_command, defaults to pdflatex. New tag and
10827 variable \view_pdf_command, defaults to xpdf. New tag and variable
10828 \pdf_to_ps_command, defaults to pdf2ps.
10830 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10832 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10833 does not have a BufferView.
10834 (unlockInset): ditto + don't access the_locking_inset if the
10835 buffer does not have a BufferView.
10837 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10838 certain circumstances so that we don't continue a keyboard
10839 operation long after the key was released. Try f.ex. to load a
10840 large document, press PageDown for some seconds and then release
10841 it. Before this change the document would contine to scroll for
10842 some time, with this change it stops imidiatly.
10844 * src/support/block.h: don't allocate more space than needed. As
10845 long as we don't try to write to the arr[x] in a array_type arr[x]
10846 it is perfectly ok. (if you write to it you might segfault).
10847 added operator value_type*() so that is possible to pass the array
10848 to functions expecting a C-pointer.
10850 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10853 * intl/*: updated to gettext 0.10.35, tried to add our own
10854 required modifications. Please verify.
10856 * po/*: updated to gettext 0.10.35, tried to add our own required
10857 modifications. Please verify.
10859 * src/support/lstrings.C (tostr): go at fixing the problem with
10860 cxx and stringstream. When stringstream is used return
10861 oss.str().c_str() so that problems with lyxstring and basic_string
10862 are avoided. Note that the best solution would be for cxx to use
10863 basic_string all the way, but it is not conformant yet. (it seems)
10865 * src/lyx_cb.C + other files: moved several global functions to
10866 class BufferView, some have been moved to BufferView.[Ch] others
10867 are still located in lyx_cb.C. Code changes because of this. (part
10868 of "get rid of current_view project".)
10870 * src/buffer.C + other files: moved several Buffer functions to
10871 class BufferView, the functions are still present in buffer.C.
10872 Code changes because of this.
10874 * config/lcmessage.m4: updated to most recent. used when creating
10877 * config/progtest.m4: updated to most recent. used when creating
10880 * config/gettext.m4: updated to most recent. applied patch for
10883 * config/gettext.m4.patch: new file that shows what changes we
10884 have done to the local copy of gettext.m4.
10886 * config/libtool.m4: new file, used in creation of acinclude.m4
10888 * config/lyxinclude.m4: new file, this is the lyx created m4
10889 macros, used in making acinclude.m4.
10891 * autogen.sh: GNU m4 discovered as a separate task not as part of
10892 the lib/configure creation.
10893 Generate acinlucde from files in config. Actually cat
10894 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
10895 easier to upgrade .m4 files that really are external.
10897 * src/Spacing.h: moved using std::istringstream to right after
10898 <sstream>. This should fix the problem seen with some compilers.
10900 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10902 * src/lyx_cb.C: began some work to remove the dependency a lot of
10903 functions have on BufferView::text, even if not really needed.
10904 (GetCurrentTextClass): removed this func, it only hid the
10907 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
10908 forgot this in last commit.
10910 * src/Bullet.C (bulletEntry): use static char const *[] for the
10911 tables, becuase of this the return arg had to change to string.
10912 (bulletSize): ditto
10913 (~Bullet): removed unneeded destructor
10915 * src/BufferView.C (beforeChange): moved from lyx_cb.C
10916 (insetSleep): moved from Buffer
10917 (insetWakeup): moved from Buffer
10918 (insetUnlock): moved from Buffer
10920 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
10921 from Buffer to BufferView.
10923 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
10925 * config/ltmain.sh: updated to version 1.3.4 of libtool
10927 * config/ltconfig: updated to version 1.3.4 of libtool
10929 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10932 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
10933 Did I get that right?
10935 * src/lyxlex.h: add a "using" directive or two.
10936 * src/Spacing.h: ditto.
10937 * src/insets/figinset.C: ditto.
10938 * src/support/filetools.C: ditto.
10939 * src/support/lstrings.C: ditto.
10940 * src/BufferView.C: ditto.
10941 * src/bufferlist.C: ditto.
10942 * src/lyx_cb.C: ditto.
10943 * src/lyxlex.C: ditto.
10945 * NEWS: add some changes for 1.1.4.
10947 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10949 * src/BufferView.C: first go at a TextCache to speed up switching
10952 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10954 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
10955 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
10956 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
10957 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
10960 * src/mathed/math_defs.h (MathedRowSt): make sure that all
10961 members of the struct are correctly initialized to 0 (detected by
10963 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
10964 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
10966 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
10967 pidwait, since it was allocated with "new". This was potentially
10968 very bad. Thanks to Michael Schmitt for running purify for us.
10971 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10973 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
10975 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
10977 1999-12-30 Allan Rae <rae@lyx.org>
10979 * lib/templates/IEEEtran.lyx: minor change
10981 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
10982 src/mathed/formula.C (LocalDispatch): askForText changes
10984 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
10985 know when a user has cancelled input. Fixes annoying problems with
10986 inserting labels and version control.
10988 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10990 * src/support/lstrings.C (tostr): rewritten to use strstream and
10993 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10995 * src/support/filetools.C (IsFileWriteable): use fstream to check
10996 (IsDirWriteable): use fileinfo to check
10998 * src/support/filetools.h (FilePtr): whole class deleted
11000 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
11002 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
11004 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
11006 * src/bufferlist.C (write): use ifstream and ofstream instead of
11009 * src/Spacing.h: use istrstream instead of sscanf
11011 * src/mathed/math_defs.h: change first arg to istream from FILE*
11013 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
11015 * src/mathed/math_parser.C: have yyis to be an istream
11016 (LexGetArg): use istream (yyis)
11018 (mathed_parse): ditto
11019 (mathed_parser_file): first arg istream instead of FILE*, set yyis
11021 * src/mathed/formula.C (Read): rewritten to use istream
11023 * src/mathed/formulamacro.C (Read): rewritten to use istream
11025 * src/lyxlex.h (~LyXLex): deleted desturctor
11026 (getStream): new function, returns an istream
11027 (getFile): deleted funtion
11028 (IsOK): return is.good();
11030 * src/lyxlex.C (LyXLex): delete file and owns_file
11031 (setFile): open an filebuf and assign that to a istream instead of
11033 (setStream): new function, takes an istream as arg.
11034 (setFile): deleted function
11035 (EatLine): rewritten us use istream instead of FILE*
11039 * src/table.C (LyXTable): use istream instead of FILE*
11040 (Read): rewritten to take an istream instead of FILE*
11042 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11044 * src/buffer.C (Dispatch): remove an extraneous break statement.
11046 * src/support/filetools.C (QuoteName): change to do simple
11047 'quoting'. More work is necessary. Also changed to do nothing
11048 under emx (needs fix too).
11049 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
11051 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
11052 config.h.in to the AC_DEFINE_UNQUOTED() call.
11053 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
11054 needs char * as argument (because Solaris 7 declares it like
11057 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
11058 remove definition of BZERO.
11060 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11062 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
11063 defined, "lyxregex.h" if not.
11065 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
11067 (REGEX): new variable that is set to regex.c lyxregex.h when
11068 AM_CONDITIONAL USE_REGEX is set.
11069 (libsupport_la_SOURCES): add $(REGEX)
11071 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
11074 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
11077 * configure.in: add call to LYX_REGEX
11079 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
11080 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
11082 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11084 * lib/bind/fi_menus.bind: new file, from
11085 pauli.virtanen@saunalahti.fi.
11087 * src/buffer.C (getBibkeyList): pass the parameter delim to
11088 InsetInclude::getKeys and InsetBibtex::getKeys.
11090 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
11091 is passed to Buffer::getBibkeyList
11093 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
11094 instead of the hardcoded comma.
11096 * src/insets/insetbib.C (getKeys): make sure that there are not
11097 leading blanks in bibtex keys. Normal latex does not care, but
11098 harvard.sty seems to dislike blanks at the beginning of citation
11099 keys. In particular, the retturn value of the function is
11101 * INSTALL: make it clear that libstdc++ is needed and that gcc
11102 2.7.x probably does not work.
11104 * src/support/filetools.C (findtexfile): make debug message go to
11106 * src/insets/insetbib.C (getKeys): ditto
11108 * src/debug.C (showTags): make sure that the output is correctly
11111 * configure.in: add a comment for TWO_COLOR_ICON define.
11113 * acconfig.h: remove all the entries that already defined in
11114 configure.in or acinclude.m4.
11116 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
11117 to avoid user name, date and copyright.
11119 1999-12-21 Juergen Vigna <jug@sad.it>
11121 * src/table.C (Read): Now read bogus row format informations
11122 if the format is < 5 so that afterwards the table can
11123 be read by lyx but without any format-info. Fixed the
11124 crash we experienced when not doing this.
11126 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
11128 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
11129 (RedoDrawingOfParagraph): ditto
11130 (RedoParagraphs): ditto
11131 (RemoveTableRow): ditto
11133 * src/text.C (Fill): rename arg paperwidth -> paper_width
11135 * src/buffer.C (insertLyXFile): rename var filename -> fname
11136 (writeFile): rename arg filename -> fname
11137 (writeFileAscii): ditto
11138 (makeLaTeXFile): ditto
11139 (makeLinuxDocFile): ditto
11140 (makeDocBookFile): ditto
11142 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
11145 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
11147 * src/bmtable.h: add extern "C" on this file when __cplusplus is
11150 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
11151 compiled by a C compiler not C++.
11153 * src/layout.h (LyXTextClass): added typedef for const_iterator
11154 (LyXTextClassList): added typedef for const_iterator + member
11155 functions begin and end.
11157 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
11158 iterators to fill the choice_class.
11159 (updateLayoutChoice): rewritten to use iterators to fill the
11160 layoutlist in the toolbar.
11162 * src/BufferView.h (BufferView::work_area_width): removed unused
11165 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
11167 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
11168 (sgmlCloseTag): ditto
11170 * src/support/lstrings.h: return type of countChar changed to
11173 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
11174 what version of this func to use. Also made to return unsigned int.
11176 * configure.in: call LYX_STD_COUNT
11178 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
11179 conforming std::count.
11181 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11183 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
11184 and a subscript would give bad display (patch from Dekel Tsur
11185 <dekel@math.tau.ac.il>).
11187 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
11189 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
11192 * src/chset.h: add a few 'using' directives
11194 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
11195 triggered when no buffer is active
11197 * src/layout.C: removed `break' after `return' in switch(), since
11200 * src/lyx_main.C (init): make sure LyX can be ran in place even
11201 when libtool has done its magic with shared libraries. Fix the
11202 test for the case when the system directory has not been found.
11204 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
11205 name for the latex file.
11206 (MenuMakeHTML): ditto
11208 * src/buffer.h: add an optional boolean argument, which is passed
11209 to ChangeExtension.
11211 1999-12-20 Allan Rae <rae@lyx.org>
11213 * lib/templates/IEEEtran.lyx: small correction and update.
11215 * configure.in: Attempted to use LYX_PATH_HEADER
11217 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
11219 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
11220 input from JMarc. Now use preprocessor to find the header.
11221 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
11222 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
11223 LYX_STL_STRING_FWD. See comments in file.
11225 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
11227 * The global MiniBuffer * minibuffer variable is dead.
11229 * The global FD_form_main * fd_form_main variable is dead.
11231 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11233 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
11235 * src/table.h: add the LOstream.h header
11236 * src/debug.h: ditto
11238 * src/LyXAction.h: change the explaination of the ReadOnly
11239 attribute: is indicates that the function _can_ be used.
11241 * src/LyXAction.C (init): find-replace _can_ be used in read-only
11244 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11246 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
11252 * src/paragraph.C (GetWord): assert on pos>=0
11255 * src/support/lyxstring.C: condition the use of an invariant on
11257 * src/support/lyxstring.h: ditto
11259 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
11260 Use LAssert.h instead of plain assert().
11262 * src/support/lstrings.h: add LAssert.h, in case it is needed.
11264 * src/lyxfunc.C: do not include LAssert.h, it is not used.
11265 * src/support/filetools.C: ditto
11267 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
11270 * INSTALL: document the new configure flags
11272 * configure.in: suppress --with-debug; add --enable-assertions
11274 * acinclude.m4: various changes in alignment of help strings.
11276 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11278 * src/kbmap.C: commented out the use of the hash map in kb_map,
11279 beginning of movement to a stl::container.
11281 * several files: removed code that was not in effect when
11282 MOVE_TEXT was defined.
11284 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
11285 for escaping should not be used. We can discuss if the string
11286 should be enclosed in f.ex. [] instead of "".
11288 * src/trans_mgr.C (insert): use the new returned value from
11289 encodeString to get deadkeys and keymaps done correctly.
11291 * src/chset.C (encodeString): changed to return a pair, to tell
11292 what to use if we know the string.
11294 * src/lyxscreen.h (fillArc): new function.
11296 * src/FontInfo.C (resize): rewritten to use more std::string like
11297 structore, especially string::replace.
11299 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
11302 * configure.in (chmod +x some scripts): remove config/gcc-hack
11304 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11306 * src/buffer.C (writeFile): change once again the top comment in a
11307 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
11308 instead of an hardcoded version number.
11309 (makeDocBookFile): ditto
11311 * src/version.h: add new define LYX_DOCVERSION
11313 * po/de.po: update from Pit Sütterlin
11314 * lib/bind/de_menus.bind: ditto.
11316 * src/lyxfunc.C (Dispatch): call MenuExport()
11317 * src/buffer.C (Dispatch): ditto
11319 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
11320 LyXFunc::Dispatch().
11321 (MenuExport): new function, moved from
11322 LyXFunc::Dispatch().
11324 * src/trans_mgr.C (insert): small cleanup
11325 * src/chset.C (loadFile): ditto
11327 * lib/kbd/iso8859-1.cdef: add missing backslashes
11329 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11331 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
11332 help with placing the manually drawn accents better.
11334 (Draw): x2 and hg changed to float to minimize rounding errors and
11335 help place the accents better.
11337 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
11338 unsigned short to char is just wrong...cast the char to unsigned
11339 char instead so that the two values can compare sanely. This
11340 should also make the display of insetlatexaccents better and
11341 perhaps also some other insets.
11343 (lbearing): new function
11346 1999-12-15 Allan Rae <rae@lyx.org>
11348 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
11349 header that provides a wrapper around the very annoying SGI STL header
11352 * src/support/lyxstring.C, src/LString.h:
11353 removed old SGI-STL-compatability attempts.
11355 * configure.in: Use LYX_STL_STRING_FWD.
11357 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
11358 stl_string_fwd.h is around and try to determine it's location.
11359 Major improvement over previous SGI STL 3.2 compatability.
11360 Three small problems remain with this function due to my zero
11361 knowledge of autoconf. JMarc and lgb see the comments in the code.
11363 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11365 * src/broken_const.h, config/hack-gcc, config/README: removed
11367 * configure.in: remove --with-gcc-hack option; do not call
11370 * INSTALL: remove documentation of --with-broken-const and
11373 * acconfig.h: remove all trace of BROKEN_CONST define
11375 * src/buffer.C (makeDocBookFile): update version number in output
11377 (SimpleDocBookOnePar): fix an assert when trying to a character
11378 access beyond string length
11381 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11383 * po/de.po: fix the Export menu
11385 * lyx.man: update the description of -dbg
11387 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
11388 (commandLineHelp): updated
11389 (easyParse): show list of available debug levels if -dbg is passed
11392 * src/Makefile.am: add debug.C
11394 * src/debug.h: moved some code to debug.C
11396 * src/debug.C: new file. Contains code to set and show debug
11399 * src/layout.C: remove 'break' after 'continue' in switch
11400 statements, since these cannot be reached.
11402 1999-12-13 Allan Rae <rae@lyx.org>
11404 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
11405 (in_word_set): hash() -> math_hash()
11407 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
11409 * acconfig.h: Added a test for whether we are using exceptions in the
11410 current compilation run. If so USING_EXCEPTIONS is defined.
11412 * config.in: Check for existance of stl_string_fwd.h
11413 * src/LString.h: If compiling --with-included-string and SGI's
11414 STL version 3.2 is present (see above test) we need to block their
11415 forward declaration of string and supply a __get_c_string().
11416 However, it turns out this is only necessary if compiling with
11417 exceptions enabled so I've a bit more to add yet.
11419 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
11420 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
11421 src/support/LRegex.h, src/undo.h:
11422 Shuffle the order of the included files a little to ensure that
11423 LString.h gets included before anything that includes stl_string_fwd.h
11425 * src/support/lyxstring.C: We need to #include LString.h instead of
11426 lyxstring.h to get the necessary definition of __get_c_string.
11427 (__get_c_string): New function. This is defined static just like SGI's
11428 although why they need to do this I'm not sure. Perhaps it should be
11429 in lstrings.C instead.
11431 * lib/templates/IEEEtran.lyx: New template file.
11433 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11435 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
11436 * intl/Makefile.in (MKINSTALLDIRS): ditto
11438 * src/LyXAction.C (init): changed to hold the LFUN data in a
11439 automatic array in stead of in callso to newFunc, this speeds up
11440 compilation a lot. Also all the memory used by the array is
11441 returned when the init is completed.
11443 * a lot of files: compiled with -Wold-style-cast, changed most of
11444 the reported offenders to C++ style casts. Did not change the
11445 offenders in C files.
11447 * src/trans.h (Match): change argument type to unsigned int.
11449 * src/support/DebugStream.C: fix some types on the streambufs so
11450 that it works on a conforming implementation.
11452 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11454 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
11456 * src/support/lyxstring.C: remove the inline added earlier since
11457 they cause a bunch of unsatisfied symbols when linking with dec
11458 cxx. Cxx likes to have the body of inlines at the place where they
11461 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
11462 accessing negative bounds in array. This fixes the crash when
11463 inserting accented characters.
11464 * src/trans.h (Match): ditto
11466 * src/buffer.C (Dispatch): since this is a void, it should not try
11467 to return anything...
11469 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11471 * src/buffer.h: removed the two friends from Buffer. Some changes
11472 because of this. Buffer::getFileName and Buffer::setFileName
11473 renamed to Buffer::fileName() and Buffer::fileName(...).
11475 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11477 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
11478 and Buffer::update(short) to BufferView. This move is currently
11479 controlled by a define MOVE_TEXT, this will be removed when all
11480 shows to be ok. This move paves the way for better separation
11481 between buffer contents and buffer view. One side effect is that
11482 the BufferView needs a rebreak when swiching buffers, if we want
11483 to avoid this we can add a cache that holds pointers to LyXText's
11484 that is not currently in use.
11486 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
11489 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11491 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
11493 * lyx_main.C: new command line option -x (or --execute) and
11494 -e (or --export). Now direct conversion from .lyx to .tex
11495 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
11496 Unfortunately, X is still needed and the GUI pops up during the
11499 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11501 * src/Spacing.C: add a using directive to bring stream stuff into
11503 * src/paragraph.C: ditto
11504 * src/buffer.C: ditto
11506 * NEWS: updated a bit the new features of 1.1.3 (took a few things
11507 from Lars' announcement).
11509 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
11510 example files from Tino Meinen.
11512 1999-12-06 Allan Rae <rae@lyx.org>
11514 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
11516 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11518 * src/support/lyxstring.C: added a lot of inline for no good
11521 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
11522 latexWriteEndChanges, they were not used.
11524 * src/layout.h (operator<<): output operator for PageSides
11526 * src/mathed/math_iter.C (my_memcpy): slightly changed.
11528 * some example files: loaded in LyX 1.0.4 and saved again to update
11529 certain constructs (table format)
11531 * a lot of files: did the change to use fstream/iostream for all
11532 writing of files. Done with a close look at Andre Poenitz's patch.
11534 * some files: whitespace changes.
11536 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11538 * src/mathed/math_iter.C (my_memcpy): new function. Since the
11539 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
11540 architecture, we provide our own. It is used unconditionnally, but
11541 I do not think this is a performance problem. Thanks to Angus
11542 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
11543 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
11545 (GetInset): use my_memcpy.
11549 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
11550 it is easier to understand, but it uses less TeX-only constructs now.
11552 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
11553 elements contain spaces
11555 * lib/configure: regenerated
11557 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
11558 elements contain spaces; display the list of programs that are
11561 * autogen.sh: make sure lib/configure is executable
11563 * lib/examples/*: rename the tutorial examples to begin with the
11564 two-letters language code.
11566 * src/lyxfunc.C (getStatus): do not query current font if no
11569 * src/lyx_cb.C (RunScript): use QuoteName
11570 (MenuRunDvips): ditto
11571 (PrintApplyCB): ditto
11573 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
11574 around argument, so that it works well with the current shell.
11575 Does not work properly with OS/2 shells currently.
11577 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
11578 * src/LyXSendto.C (SendtoApplyCB): ditto
11579 * src/lyxfunc.C (Dispatch): ditto
11580 * src/buffer.C (runLaTeX): ditto
11581 (runLiterate): ditto
11582 (buildProgram): ditto
11584 * src/lyx_cb.C (RunScript): ditto
11585 (MenuMakeLaTeX): ditto
11587 * src/buffer.h (getLatexName): new method
11589 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
11591 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11593 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
11594 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
11595 (create_math_panel): ditto
11597 * src/lyxfunc.C (getStatus): re-activate the code which gets
11598 current font and cursor; add test for export to html.
11600 * src/lyxrc.C (read): remove unreachable break statements; add a
11603 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
11605 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11607 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
11608 introduced by faulty regex.
11609 * src/buffer.C: ditto
11610 * src/lastfiles.C: ditto
11611 * src/paragraph.C: ditto
11612 * src/table.C: ditto
11613 * src/vspace.C: ditto
11614 * src/insets/figinset.C: ditto
11615 Note: most of these is absolutely harmless, except the one in
11616 src/mathed formula.C.
11618 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
11620 * src/ImportNoweb.C (documentclass): fixed bounds for substr
11621 operation, yielding correct results for the reLyX command.
11623 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11625 * src/support/filetools.C (ExpandPath): removed an over eager
11627 (ReplaceEnvironmentPath): ditto
11629 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
11630 shows that we are doing something fishy in our code...
11631 (BubblePost): ditto
11634 * src/lyxrc.C (read): use a double switch trick to get more help
11635 from the compiler. (the same trick is used in layout.C)
11636 (write): new function. opens a ofstream and pass that to output
11637 (output): new function, takes a ostream and writes the lyxrc
11638 elemts to it. uses a dummy switch to make sure no elements are
11641 * src/lyxlex.h: added a struct pushpophelper for use in functions
11642 with more than one exit point.
11644 * src/lyxlex.[Ch] (GetInteger): made it const
11648 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
11650 * src/layout.[hC] : LayoutTags splitted into several enums, new
11651 methods created, better error handling cleaner use of lyxlex. Read
11654 * src/bmtable.[Ch]: change some member prototypes because of the
11655 image const changes.
11657 * commandtags.h, src/LyXAction.C (init): new function:
11658 "preferences-save", saves the lyxrc entries into .lyx/preferences.
11659 This file is not read automatically but you can add \input
11660 preferences to your lyxrc if you want to. We need to discuss how
11663 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
11664 in .aux, also remove .bib and .bst files from dependencies when
11667 * src/BufferView.C, src/LyXView.C: add const_cast several places
11668 because of changes to images.
11670 * lib/images/*: same change as for images/*
11672 * lib/lyxrc.example: Default for accept_compound is false not no.
11674 * images/*: changed to be const, however I have som misgivings
11675 about this change so it might be changed back.
11677 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11679 * lib/configure, po/POTFILES.in: regenerated
11681 * autogen.sh: autogenerate lib/configure from lib/configure.m4
11683 * config/lib_configure.m4: removed
11685 * lib/configure.m4: new file (was config/lib_configure.m4)
11687 * configure.in: do not test for rtti, since we do not use it.
11689 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11691 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
11692 doubling of allocated space scheme. This makes it faster for large
11693 strings end to use less memory for small strings. xtra rememoved.
11695 * src/insets/figinset.C (waitalarm): commented out.
11696 (GhostscriptMsg): use static_cast
11697 (GhostscriptMsg): use new instead of malloc to allocate memory for
11698 cmap. also delete the memory after use.
11700 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
11702 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
11703 for changes in bibtex database or style.
11704 (runBibTeX): remove all .bib and .bst files from dep before we
11706 (run): use scanAuc in when dep file already exist.
11708 * src/DepTable.C (remove_files_with_extension): new method
11709 (exist): new method
11711 * src/DepTable.[Ch]: made many of the methods const.
11713 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11715 * src/bufferparams.C: make sure that the default textclass is
11716 "article". It used to be the first one by description order, but
11717 now the first one is "docbook".
11719 * src/lyx_main.C (setDebuggingLevel): change type of argument to
11720 string; call Debug::value.
11721 (easyParse): pass complete argument to setDebuggingLevel().
11723 * src/debug.h (value): fix the code that parses debug levels.
11725 * src/debug.h: add new debug type ACTION, reserved for LyXAction
11728 * src/LyXAction.C: use Debug::ACTION as debug channel.
11730 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
11732 * NEWS: updated for the future 1.1.3 release.
11734 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
11735 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
11736 it should. This is of course a controversial change (since many
11737 people will find that their lyx workscreen is suddenly full of
11738 red), but done for the sake of correctness.
11740 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
11741 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
11743 * src/insets/inseterror.h, src/insets/inseturl.h,
11744 src/insets/insetinfo.h, src/insets/figinset.h,
11745 src/mathed/formulamacro.h, src/mathed/math_macro.h
11746 (EditMessage): add a missing const and add _() to make sure that
11747 translation happens
11749 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
11750 src/insets/insetbib.C, src/support/filetools.C: add `using'
11751 directives for cxx.
11753 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
11754 doing 'Insert index of last word' at the beginning of a paragraph.
11756 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11758 * several files: white-space changes.
11760 * src/mathed/formula.C: removed IsAlpha and IsDigit
11762 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
11763 .bib file. use a ifstream instead of FilePtr when parsing the .bib
11766 * src/insets/figinset.C (GetPSSizes): don't break when
11767 "EndComments" is seen. But break when a boundingbox is read.
11769 * all classes inherited from Inset: return value of Clone
11770 changed back to Inset *.
11772 * all classes inherited form MathInset: return value of Clone
11773 changed back to MathedInset *.
11775 * src/insets/figinset.C (runqueue): use a ofstream to output the
11776 gs/ps file. Might need some setpresicion or setw. However I can
11777 see no problem with the current code.
11778 (runqueue): use sleep instead of the alarm/signal code. I just
11779 can't see the difference.
11781 * src/paragraph.C (LyXParagraph): reserve space in the new
11782 paragraph and resize the inserted paragraph to just fit.
11784 * src/lyxfunc.h (operator|=): added operator for func_status.
11786 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11787 check for readable file.
11789 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11790 check for readable file.
11791 (MenuMakeLinuxDoc): ditto
11792 (MenuMakeDocBook): ditto
11793 (MenuMakeAscii): ditto
11794 (InsertAsciiFile): split the test for openable and readable
11796 * src/bmtable.C (draw_bitmaptable): use
11797 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11799 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11800 findtexfile from LaTeX to filetools.
11802 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11803 instead of FilePtr. Needs to be verified by a literate user.
11805 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11807 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11808 (EditMessage): likewise.
11810 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11811 respectively as \textasciitilde and \textasciicircum.
11813 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11815 * src/support/lyxstring.h: made the methods that take iterators
11816 use const_iterator.
11818 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11819 (regexMatch): made is use the real regex class.
11821 * src/support/Makefile.am: changed to use libtool
11823 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11825 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11827 (MathIsInset ++): changed several macros to be inline functions
11830 * src/mathed/Makefile.am: changed to use libtool
11832 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11834 * src/insets/inset* : Clone changed to const and return type is
11835 the true insettype not just Inset*.
11837 * src/insets/Makefile.am: changed to use libtool
11839 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11841 * src/undo.[Ch] : added empty() and changed some of the method
11844 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11846 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11847 setID use block<> for the bullets array, added const several places.
11849 * src/lyxfunc.C (getStatus): new function
11851 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11852 LyXAction, added const to several funtions.
11854 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11855 a std::map, and to store the dir items in a vector.
11857 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11860 * src/LyXView.[Ch] + other files : changed currentView to view.
11862 * src/LyXAction.[Ch] : ported from the old devel branch.
11864 * src/.cvsignore: added .libs and a.out
11866 * configure.in : changes to use libtool.
11868 * acinclude.m4 : inserted libtool.m4
11870 * .cvsignore: added libtool
11872 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11874 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11875 file name in insets and mathed directories (otherwise the
11876 dependency is not taken in account under cygwin).
11878 * src/text2.C (InsertString[AB]): make sure that we do not try to
11879 read characters past the string length.
11881 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11883 * lib/doc/LaTeXConfig.lyx.in,
11884 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11886 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11887 file saying who created them and when this heppened; this is
11888 useless and annoys tools like cvs.
11890 * lib/layouts/g-brief-{en,de}.layout,
11891 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
11892 from Thomas Hartkens <thomas@hartkens.de>.
11894 * src/{insets,mathed}/Makefile.am: do not declare an empty
11895 LDFLAGS, so that it can be set at configure time (useful on Irix
11898 * lib/reLyX/configure.in: make sure that the prefix is set
11899 correctly in LYX_DIR.
11901 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11903 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11904 be used by 'command-sequence' this allows to bind a key to a
11905 sequence of LyX-commands
11906 (Example: 'command-sequence math-insert alpha; math-insert beta;")
11908 * src/LyXAction.C: add "command-sequence"
11910 * src/LyXFunction.C: handling of "command-sequence"
11912 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
11913 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
11915 * src/lyxserver.C, src/minibuffer.C: Use this new interface
11917 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11919 * src/buffer.C (writeFile): Do not output a comment giving user
11920 and date at the beginning of a .lyx file. This is useless and
11921 annoys cvs anyway; update version number to 1.1.
11923 * src/Makefile.am (LYX_DIR): add this definition, so that a
11924 default path is hardcoded in LyX.
11926 * configure.in: Use LYX_GNU_GETTEXT.
11928 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
11929 AM_GNU_GETTEXT with a bug fixed.
11931 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
11933 * src/chset.C: add "using std::ifstream;" to please dec cxx.
11935 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
11936 which is used to point to LyX data is now LYX_DIR_11x.
11938 * lyx.man: convert to a unix text file; small updates.
11940 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11942 * src/support/LSubstring.[Ch]: made the second arg of most of the
11943 constructors be a const reference.
11945 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
11948 * src/support/lyxstring.[Ch] (swap): added missing member function
11949 and specialization of swap(str, str);
11951 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
11953 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
11954 trace of the old one.
11956 * src/undo.[Ch]: made the undostack use std::list to store undo's in
11957 put the member definitions in undo.C.
11959 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
11960 NEW_TEXT and have now only code that was included when this was
11963 * src/intl.C (LCombo): use static_cast
11965 (DispatchCallback): ditto
11967 * src/definitions.h: removed whole file
11969 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
11971 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
11972 parsing and stores in a std:map. a regex defines the file format.
11973 removed unneeded members.
11975 * src/bufferparams.h: added several enums from definitions.h here.
11976 Removed unsused destructor. Changed some types to use proper enum
11977 types. use block to have the temp_bullets and user_defined_bullets
11978 and to make the whole class assignable.
11980 * src/bufferparams.C (Copy): removed this functions, use a default
11981 assignment instead.
11983 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
11986 * src/buffer.C (readLyXformat2): commend out all that have with
11987 oldpapersize to do. also comment out all that hve to do with
11988 insetlatex and insetlatexdel.
11989 (setOldPaperStuff): commented out
11991 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
11993 * src/LyXAction.C: remove use of inset-latex-insert
11995 * src/mathed/math_panel.C (button_cb): use static_cast
11997 * src/insets/Makefile.am (insets_o_SOURCES): removed
12000 * src/support/lyxstring.C (helper): use the unsigned long
12001 specifier, UL, instead of a static_cast.
12003 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
12005 * src/support/block.h: new file. to be used as a c-style array in
12006 classes, so that the class can be assignable.
12008 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12010 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
12011 NULL, make sure to return an empty string (it is not possible to
12012 set a string to NULL).
12014 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12016 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
12018 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
12020 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
12021 link line, so that Irix users (for example) can set it explicitely to
12024 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
12025 it can be overidden at make time (static or dynamic link, for
12028 * src/vc-backend.C, src/LaTeXFeatures.h,
12029 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
12030 statements to bring templates to global namespace.
12032 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
12034 * src/support/lyxstring.C (operator[] const): make it standard
12037 * src/minibuffer.C (Init): changed to reflect that more
12038 information is given from the lyxvc and need not be provided here.
12040 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
12042 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
12044 * src/LyXView.C (UpdateTimerCB): use static_cast
12045 (KeyPressMask_raw_callback): ditto
12047 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
12048 buffer_, a lot of changes because of this. currentBuffer() ->
12049 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
12050 also changes to other files because of this.
12052 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
12054 * src/vc-backend.[Ch]: new files. The backends for vc handling,
12055 have no support for RCS and partial support for CVS, will be
12058 * src/insets/ several files: changes because of function name
12059 changes in Bufferview and LyXView.
12061 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
12063 * src/support/LSubstring.[Ch]: new files. These implement a
12064 Substring that can be very convenient to use. i.e. is this
12066 string a = "Mary had a little sheep";
12067 Substring(a, "sheep") = "lamb";
12068 a is now "Mary has a little lamb".
12070 * src/support/LRegex.[Ch]: a regex class that can be used to pick
12071 out patterns and subpatterns of strings. It is used by LSubstring
12072 and also by vc-backend.C
12074 * src/support/lyxstring.C: went over all the assertions used and
12075 tried to correct the wrong ones and flag which of them is required
12076 by the standard. some bugs found because of this. Also removed a
12077 couple of assertions.
12079 * src/support/Makefile.am (libsupport_a_SOURCES): added
12080 LSubstring.[Ch] and LRegex.[Ch]
12082 * src/support/FileInfo.h: have struct stat buf as an object and
12083 not a pointer to one, some changes because of this.
12085 * src/LaTeXFeatures.C (getTClassPreamble): also use the
12086 information in layout when adding the layouts preamble to the
12087 textclass preamble.
12089 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
12092 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
12093 because of bug in OS/2.
12095 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12097 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
12098 \verbatim@font instead of \ttfamily, so that it can be redefined.
12100 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
12101 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
12102 src/layout.h, src/text2.C: add 'using' directive to bring the
12103 STL templates we need from the std:: namespace to the global one.
12104 Needed by DEC cxx in strict ansi mode.
12106 * src/support/LIstream.h,src/support/LOstream.h,
12107 src/support/lyxstring.h,src/table.h,
12108 src/lyxlookup.h: do not include <config.h> in header
12109 files. This should be done in the .C files only.
12111 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
12115 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12117 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
12118 from Kayvan to fix the tth invokation.
12120 * development/lyx.spec.in: updates from Kayvan to reflect the
12121 changes of file names.
12123 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12125 * src/text2.C (InsertStringB): use std::copy
12126 (InsertStringA): use std::copy
12128 * src/bufferlist.C: use a vector to store the buffers in. This is
12129 an internal change and should not affect any other thing.
12131 * src/BufferView.C (waitForX): use XSync instead of the lengthy
12134 * src/text.C (Fill): fix potential bug, one off bug.
12136 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12138 * src/Makefile.am (lyx_main.o): add more files it depends on.
12140 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
12142 * src/support/lyxstring.C: use size_t for the reference count,
12143 size, reserved memory and xtra.
12144 (internal_compare): new private member function. Now the compare
12145 functions should work for std::strings that have embedded '\0'
12147 (compare): all compare functions rewritten to use
12150 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
12152 * src/support/lyxstring.C (compare): pass c_str()
12153 (compare): pass c_str
12154 (compare): pass c_str
12156 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12158 * src/support/DebugStream.C: <config.h> was not included correctly.
12160 * lib/configure: forgot to re-generate it :( I'll make this file
12161 auto generated soon.
12163 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
12165 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
12168 * src/support/lyxstring.C: some changes from length() to rep->sz.
12169 avoids a function call.
12171 * src/support/filetools.C (SpaceLess): yet another version of the
12172 algorithm...now per Jean-Marc's suggestions.
12174 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12176 * src/layout.C (less_textclass_desc): functor for use in sorting
12178 (LyXTextClass::Read): sort the textclasses after reading.
12180 * src/support/filetools.C (SpaceLess): new version of the
12181 SpaceLess functions. What problems does this one give? Please
12184 * images/banner_bw.xbm: made the arrays unsigned char *
12186 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12188 * src/support/lyxstring.C (find): remove bogus assertion in the
12189 two versions of find where this has not been done yet.
12191 * src/support/lyxlib.h: add missing int return type to
12194 * src/menus.C (ShowFileMenu): disable exporting to html if no
12195 html export command is present.
12197 * config/lib_configure.m4: add a test for an HTML converter. The
12198 programs checked for are, in this order: tth, latex2html and
12201 * lib/configure: generated from config/lib_configure.m4.
12203 * src/lyxfunc.C (Dispatch): update and improve the execution of an
12204 html converter. The parameters are now passed through $$FName and
12205 $$OutName, instead of standard input/output.
12207 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
12209 * lib/lyxrc.example: update description of \html_command.
12210 add "quotes" around \screen_font_xxx font setting examples to help
12211 people who use fonts with spaces in their names.
12213 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12215 * Distribution files: updates for v1.1.2
12217 * src/support/lyxstring.C (find): remove bogus assert and return
12218 npos for the same condition.
12220 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12222 * added patch for OS/2 from SMiyata.
12224 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12226 * src/text2.C (CutSelection): make space_wrapped a bool
12227 (CutSelection): dont declare int i until we have to.
12228 (alphaCounter): return a char const *.
12230 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12232 * src/support/syscall.C (Systemcalls::kill):
12233 src/support/filetools.C (PutEnv, PutEnvPath):
12234 src/lyx_cb.C (addNewlineAndDepth):
12235 src/FontInfo.C (FontInfo::resize): condition some #warning
12236 directives with WITH_WARNINGS.
12239 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12241 * src/layout.[Ch] + several files: access to class variables
12242 limited and made accessor functions instead a lot of code changed
12243 becuase of this. Also instead of returning pointers often a const
12244 reference is returned instead.
12246 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
12248 * src/Makefile.am (dist-hook): added used to remove the CVS from
12249 cheaders upon creating a dist
12250 (EXTRA_DIST): added cheaders
12252 * src/support/lstrings.C (tostr(char)): fix it to handle param as
12253 a character not as a small integer.
12255 * src/support/lyxstring.C (find): removed Assert and added i >=
12256 rep->sz to the first if.
12258 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12260 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
12261 src/LyXView.C src/buffer.C src/bufferparams.C
12262 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
12263 src/text2.C src/insets/insetinclude.C:
12264 lyxlayout renamed to textclasslist.
12266 * src/layout.C: some lyxerr changes.
12268 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
12269 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
12270 (LyXLayoutList): removed all traces of this class.
12271 (LyXTextClass::Read): rewrote LT_STYLE
12272 (LyXTextClass::hasLayout): new function
12273 (LyXTextClass::GetLayout): rewritten to return an iterator + has
12274 both const and nonconst version.
12275 (LyXTextClass::delete_layout): new function.
12276 (LyXTextClassList::Style): bug fix. do the right thing if layout
12278 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
12279 (LyXTextClassList::NameOfLayout): ditto
12280 (LyXTextClassList::Load): ditto
12282 * src/buffer.C (makeLaTeXFile): new access to layoutlist
12284 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
12286 * src/LyXAction.C (LookupFunc): added a workaround for sun
12287 compiler, on the other hand...we don't know if the current code
12288 compiles on sun at all...
12290 * src/support/filetools.C (CleanupPath): subst fix
12292 * src/insets/insetbib.C (delDatabase): subst fix, this looks
12295 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
12296 complained about this one?
12298 * src/insets/insetinclude.C (Latex): subst fix
12300 * src/insets/insetbib.C (getKeys): subst fix
12302 * src/LyXSendto.C (SendtoApplyCB): subst fix
12304 * src/lyx_main.C (init): subst fix
12306 * src/layout.C (Read): subst fix
12308 * src/lyx_sendfax_main.C (button_send): subst fix
12310 * src/buffer.C (RoffAsciiTable): subst fix
12312 * src/lyx_cb.C (MenuFax): subst fix
12313 (PrintApplyCB): subst fix
12315 1999-10-26 Juergen Vigna <jug@sad.it>
12317 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
12319 (Read): Cleaned up this code so now we read only format vestion >= 5
12321 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
12323 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
12324 come nobody has complained about this one?
12326 * src/insets/insetinclude.C (Latex): subst fix
12328 * src/insets/insetbib.C (getKeys): subst fix
12330 * src/lyx_main.C (init): subst fix
12332 * src/layout.C (Read): subst fix
12334 * src/buffer.C (RoffAsciiTable): subst fix
12336 * src/lyx_cb.C (MenuFax): subst fix.
12338 * src/layout.[hC] + some other files: rewrote to use
12339 std::container to store textclasses and layouts in.
12340 Simplified, removed a lot of code. Make all classes
12341 assignable. Further simplifications and review of type
12342 use still to be one.
12344 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
12345 lastfiles to create the lastfiles partr of the menu.
12347 * src/lastfiles.[Ch]: rewritten to use deque to store the
12348 lastfiles in. Uses fstream for reading and writing. Simplifies
12351 * src/support/syscall.C: remove explicit cast.
12353 * src/BufferView.C (CursorToggleCB): removed code snippets that
12354 were commented out.
12355 use explicat C++ style casts instead of C style casts. also use
12356 u_vdata instea of passing pointers in longs.
12358 * src/PaperLayout.C: removed code snippets that were commented out.
12360 * src/lyx_gui_misc.C: removed code snippets that were commented out.
12362 * src/lyx_main.C: removed code snippets that wer commented out.
12364 * src/paragraph.C: removed code snippets that were commented out.
12366 * src/lyxvc.C (logClose): use static_cast
12368 (viewLog): remove explicit cast to void*
12369 (showLog): removed old commented code
12371 * src/menus.C: use static_cast instead of C style casts. use
12372 u_vdata instead of u_ldata. remove explicit cast to (long) for
12373 pointers. Removed old code that was commented out.
12375 * src/insets/inset.C: removed old commented func
12377 * src/insets/insetref.C (InsetRef): removed old code that had been
12378 commented out for a long time.
12380 (escape): removed C style cast
12382 * src/insets/insetlatexaccent.C (Draw): removed old commented code
12384 * src/insets/insetlatex.C (Draw): removed old commented code
12385 (Read): rewritten to use string
12387 * src/insets/insetlabel.C (escape): removed C style cast
12389 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
12391 * src/insets/insetindex.C: use static_cast and u_vdata, removed
12392 old commented code.
12394 * src/insets/insetinclude.h: removed a couple of stupid bools
12396 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
12397 (Clone): remove C style cast
12398 (getKeys): changed list to lst because of std::list
12400 * src/insets/inseterror.C (Draw): removed som old commented code.
12402 * src/insets/insetcommand.C (Draw): removed some old commented code.
12404 * src/insets/insetbib.C (bibitem_cb): removed code that has been
12405 commented out forever.
12406 (bibitem_cb): use static_cast instead of C style cast
12407 use of vdata changed to u_vdata.
12409 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
12411 (CloseUrlCB): use static_cast instead of C style cast.
12412 (CloseUrlCB): added a fl_free form...it seemed to be missing.
12414 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
12415 (C_InsetInfo_CloseInfoCB): forward the ob parameter
12416 (CloseInfoCB): static_cast from ob->u_vdata instead.
12417 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
12420 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
12421 (C_InsetError_CloseErrorCB): forward the ob parameter
12422 (CloseErrorCB): static_cast from ob->u_vdata instead.
12424 * src/vspace.h: include LString.h since we use string in this class.
12426 * src/vspace.C (lyx_advance): changed name from advance because of
12427 nameclash with stl. And since we cannot use namespaces yet...I
12428 used a lyx_ prefix instead. Expect this to change when we begin
12431 * src/BufferView.[Ch] (BufferView::~BufferView): removed
12433 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
12434 and removed now defunct constructor and deconstructor.
12436 * src/BufferView.h: have backstack as a object not as a pointer.
12437 removed initialization from constructor. added include for BackStack
12439 * development/lyx.spec.in (%build): add CFLAGS also.
12441 * src/screen.C (drawFrame): removed another warning.
12443 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12445 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
12446 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
12447 README and ANNOUNCE a bit for the next release. More work is
12450 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
12451 unbreakable if we are in freespacing mode (LyX-Code), but not in
12454 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
12456 * src/BackStack.h: fixed initialization order in constructor
12458 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
12460 * acinclude.m4 (VERSION): new rules for when a version is
12461 development, added also a variable for prerelease.
12462 (warnings): we set with_warnings=yes for prereleases
12463 (lyx_opt): prereleases compile with same optimization as development
12464 (CXXFLAGS): only use pedantic if we are a development version
12466 * src/BufferView.C (restorePosition): don't do anything if the
12467 backstack is empty.
12469 * src/BackStack.h: added member empty, use this to test if there
12470 is anything to pop...
12472 1999-10-25 Juergen Vigna <jug@sad.it>
12475 * forms/layout_forms.fd +
12476 * forms/latexoptions.fd +
12477 * lyx.fd: changed for various form resize issues
12479 * src/mathed/math_panel.C +
12480 * src/insets/inseterror.C +
12481 * src/insets/insetinfo.C +
12482 * src/insets/inseturl.C +
12483 * src/insets/inseturl.h +
12485 * src/LyXSendto.C +
12486 * src/PaperLayout.C +
12487 * src/ParagraphExtra.C +
12488 * src/TableLayout.C +
12490 * src/layout_forms.C +
12497 * src/menus.C: fixed various resize issues. So now forms can be
12498 resized savely or not be resized at all.
12500 * forms/form_url.fd +
12501 * src/insets/form_url.[Ch]: added because it's cleaner and easier
12504 * src/insets/Makefile.am: added files form_url.[Ch]
12506 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12508 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
12509 (and presumably 6.2).
12511 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
12512 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
12513 remaining static member callbacks.
12515 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
12518 * src/support/lyxstring.h: declare struct Srep as friend of
12519 lyxstring, since DEC cxx complains otherwise.
12521 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12523 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12525 * src/LaTeX.C (run): made run_bibtex also depend on files with
12527 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
12528 are put into the dependency file.
12530 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
12531 the code has shown itself to work
12532 (create_ispell_pipe): removed another warning, added a comment
12535 * src/minibuffer.C (ExecutingCB): removed code that has been
12536 commented out a long time
12538 * src/lyxfunc.C (processKeyEvent): removed some very old commented
12539 out code + a warning.
12541 * src/support/lyxstring.h: comment out the three private
12542 operators, when compiling with string ansi conforming compilers
12543 they make problems.
12545 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
12547 (pixmapFromBitmapData): change type of bdata to be unsigned char *
12548 (pixmapFromBitmapData): add a reinterpret_cast in the call to
12551 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
12554 * src/mathed/math_panel.C (create_math_panel): remove explicit
12557 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
12560 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
12561 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
12562 to XCreatePixmapFromBitmapData
12563 (fl_set_bmtable_data): change the last argument to be unsigned
12565 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
12566 and bh to be unsigned int, remove explicit casts in call to
12567 XReadBitmapFileData.
12569 * images/arrows.xbm: made the arrays unsigned char *
12570 * images/varsz.xbm: ditto
12571 * images/misc.xbm: ditto
12572 * images/greek.xbm: ditto
12573 * images/dots.xbm: ditto
12574 * images/brel.xbm: ditto
12575 * images/bop.xbm: ditto
12577 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
12579 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
12580 (LYX_PROG_CXX): added -pedantic to g++ compile options when
12581 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
12583 (LYX_CXX_CHEADERS): added <clocale> to the test.
12585 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
12587 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
12589 * src/support/lyxstring.C (append): fixed something that must be a
12590 bug, rep->assign was used instead of rep->append.
12592 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
12595 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
12596 lyx insert double chars. Fix spotted by Kayvan.
12598 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12600 * Fixed the tth support. I messed up with the Emacs patch apply feature
12601 and omitted the changes in lyxrc.C.
12603 1999-10-22 Juergen Vigna <jug@sad.it>
12605 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
12607 * src/lyx_cb.C (MenuInsertRef) +
12608 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
12609 the form cannot be resized under it limits (fixes a segfault)
12611 * src/lyx.C (create_form_form_ref) +
12612 * forms/lyx.fd: Changed Gravity on name input field so that it is
12615 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12617 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
12618 <ostream> and <istream>.
12620 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
12621 whether <fstream> provides the latest standard features, or if we
12622 have an oldstyle library (like in egcs).
12623 (LYX_CXX_STL_STRING): fix the test.
12625 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
12626 code on MODERN_STL_STREAM.
12628 * src/support/lyxstring.h: use L{I,O}stream.h.
12630 * src/support/L{I,O}stream.h: new files, designed to setup
12631 correctly streams for our use
12632 - includes the right header depending on STL capabilities
12633 - puts std::ostream and std::endl (for LOStream.h) or
12634 std::istream (LIStream.h) in toplevel namespace.
12636 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12638 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
12639 was a bib file that had been changed we ensure that bibtex is run.
12640 (runBibTeX): enhanced to extract the names of the bib files and
12641 getting their absolute path and enter them into the dep file.
12642 (findtexfile): static func that is used to look for tex-files,
12643 checks for absolute patchs and tries also with kpsewhich.
12644 Alternative ways of finding the correct files are wanted. Will
12646 (do_popen): function that runs a command using popen and returns
12647 the whole output of that command in a string. Should be moved to
12650 * src/DepTable.[Ch] (extchanged): new function that returns true if a
12651 file with extension ext has changed.
12653 * src/insets/figinset.C: added ifdef guards around the fl_free
12654 code that jug commented out. Now it is commented out when
12655 compiling with XForms == 0.89.
12657 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
12658 to lyxstring.C, and only keep a forward declaration in
12659 lyxstring.h. Simplifies the header file a bit and should help a
12660 bit on compile time too. Also changes to Srep will not mandate a
12661 recompile of code just using string.
12662 (~lyxstring): definition moved here since it uses srep.
12663 (size): definition moved here since it uses srep.
12665 * src/support/lyxstring.h: removed a couple of "inline" that should
12668 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12670 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
12673 1999-10-21 Juergen Vigna <jug@sad.it>
12675 * src/table.C (SetPWidth): Just a small fix so the alignment is not
12676 set to left if I just remove the width entry (or it is empty).
12678 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
12679 paragraph when having dummy paragraphs.
12681 1999-10-20 Juergen Vigna <jug@sad.it>
12683 * src/insets/figinset.C: just commented some fl_free_form calls
12684 and added warnings so that this calls should be activated later
12685 again. This avoids for now a segfault, but we have a memory leak!
12687 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
12688 'const char * argument' to 'string argument', this should
12689 fix some Asserts() in lyxstring.C.
12691 * src/lyxfunc.h: Removed the function argAsString(const char *)
12692 as it is not used anymore.
12694 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
12696 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
12699 * src/Literate.h: some funcs moved from public to private to make
12700 interface clearer. Unneeded args removed.
12702 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
12704 (scanBuildLogFile): ditto
12706 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
12707 normal TeX Error. Still room for improvement.
12709 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
12711 * src/buffer.C (insertErrors): changes to make the error
12712 desctription show properly.
12714 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
12717 * src/support/lyxstring.C (helper): changed to use
12718 sizeof(object->rep->ref).
12719 (operator>>): changed to use a pointer instead.
12721 * src/support/lyxstring.h: changed const reference & to value_type
12722 const & lets see if that helps.
12724 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
12726 * Makefile.am (rpmdist): fixed to have non static package and
12729 * src/support/lyxstring.C: removed the compilation guards
12731 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
12734 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
12735 conditional compile of lyxstring.Ch
12737 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
12738 stupid check, but it is a lot better than the bastring hack.
12739 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
12741 * several files: changed string::erase into string::clear. Not
12744 * src/chset.C (encodeString): use a char temporary instead
12746 * src/table.C (TexEndOfCell): added tostr around
12747 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
12748 (TexEndOfCell): ditto
12749 (TexEndOfCell): ditto
12750 (TexEndOfCell): ditto
12751 (DocBookEndOfCell): ditto
12752 (DocBookEndOfCell): ditto
12753 (DocBookEndOfCell): ditto
12754 (DocBookEndOfCell): ditto
12756 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
12758 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
12760 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
12761 (MenuBuildProg): added tostr around ret
12762 (MenuRunChktex): added tostr around ret
12763 (DocumentApplyCB): added tostr around ret
12765 * src/chset.C (encodeString): added tostr around t->ic
12767 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
12768 (makeLaTeXFile): added tostr around tocdepth
12769 (makeLaTeXFile): added tostr around ftcound - 1
12771 * src/insets/insetbib.C (setCounter): added tostr around counter.
12773 * src/support/lyxstring.h: added an operator+=(int) to catch more
12776 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
12777 (lyxstring): We DON'T allow NULL pointers.
12779 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12781 * src/mathed/math_macro.C (MathMacroArgument::Write,
12782 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12783 when writing them out.
12785 * src/LString.C: remove, since it is not used anymore.
12787 * src/support/lyxstring.C: condition the content to
12788 USE_INCLUDED_STRING macro.
12790 * src/mathed/math_symbols.C, src/support/lstrings.C,
12791 src/support/lyxstring.C: add `using' directive to specify what
12792 we need in <algorithm>. I do not think that we need to
12793 conditionalize this, but any thought is appreciated.
12795 * many files: change all callback functions to "C" linkage
12796 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12797 strict_ansi. Those who were static are now global.
12798 The case of callbacks which are static class members is
12799 trickier, since we have to make C wrappers around them (see
12800 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12801 did not finish this yet, since it defeats the purpose of
12802 encapsulation, and I am not sure what the best route is.
12804 1999-10-19 Juergen Vigna <jug@sad.it>
12806 * src/support/lyxstring.C (lyxstring): we permit to have a null
12807 pointer as assignment value and just don't assign it.
12809 * src/vspace.C (nextToken): corrected this function substituting
12810 find_first(_not)_of with find_last_of.
12812 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12813 (TableOptCloseCB) (TableSpeCloseCB):
12814 inserted fl_set_focus call for problem with fl_hide_form() in
12817 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12819 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12822 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12824 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12825 LyXLex::next() and not eatline() to get its argument.
12827 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12829 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12830 instead, use fstreams for io of the depfile, removed unneeded
12831 functions and variables.
12833 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12834 vector instead, removed all functions and variables that is not in
12837 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12839 * src/buffer.C (insertErrors): use new interface to TeXError
12841 * Makefile.am (rpmdist): added a rpmdist target
12843 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12844 per Kayvan's instructions.
12846 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12848 * src/Makefile.am: add a definition for localedir, so that locales
12849 are found after installation (Kayvan)
12851 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12853 * development/.cvsignore: new file.
12855 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12857 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12858 C++ compiler provides wrappers for C headers and use our alternate
12861 * configure.in: use LYX_CXX_CHEADERS.
12863 * src/cheader/: new directory, populated with cname headers from
12864 libstdc++-2.8.1. They are a bit old, but probably good enough for
12865 what we want (support compilers who lack them).
12867 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12868 from includes. It turns out is was stupid.
12870 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12872 * lib/Makefile.am (install-data-local): forgot a ';'
12873 (install-data-local): forgot a '\'
12874 (libinstalldirs): needed after all. reintroduced.
12876 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12878 * configure.in (AC_OUTPUT): added lyx.spec
12880 * development/lyx.spec: removed file
12882 * development/lyx.spec.in: new file
12884 * po/*.po: merged with lyx.pot becuase of make distcheck
12886 * lib/Makefile.am (dist-hook): added dist-hook so that
12887 documentation files will be included when doing a make
12888 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12889 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
12891 more: tried to make install do the right thing, exclude CVS dirs
12894 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
12895 Path would fit in more nicely.
12897 * all files that used to use pathstack: uses now Path instead.
12898 This change was a lot easier than expected.
12900 * src/support/path.h: new file
12902 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12904 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12906 * src/support/lyxstring.C (getline): Default arg was given for
12909 * Configure.cmd: removed file
12911 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12913 * src/support/DebugStream.[Ch]: remove the explicit std:: before
12914 streams classes and types, add the proper 'using' statements when
12915 MODERN_STL is defined.
12917 * src/debug.h: move the << operator definition after the inclusion
12920 * src/support/filetools.C: include "LAssert.h", which is needed
12923 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
12926 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
12927 include "debug.h" to define a proper ostream.
12929 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12931 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
12932 method to the SystemCall class which can kill a process, but it's
12933 not fully implemented yet.
12935 * src/*.C: Changed Systemcalls::Startscript() to startscript()
12937 * src/support/FileInfo.h: Better documentation
12939 * src/lyxfunc.C: Added support for buffer-export html
12941 * src/menus.C: Added Export->As HTML...
12943 * lib/bind/*.bind: Added short-cut for buffer-export html
12945 * src/lyxrc.*: Added support for new \tth_command
12947 * lib/lyxrc.example: Added stuff for new \tth_command
12949 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
12951 * lib/Makefile.am (IMAGES): removed images/README
12952 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
12953 installes in correct place. Check permisions is installed
12956 * src/LaTeX.C: some no-op changes moved declaration of some
12959 * src/LaTeX.h (LATEX_H): changed include guard name
12961 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12963 * lib/reLyX/Makefile.am: install noweb2lyx.
12965 * lib/Makefile.am: install configure.
12967 * lib/reLyX/configure.in: declare a config aux dir; set package
12968 name to lyx (not sure what the best solution is); generate noweb2lyx.
12970 * lib/layouts/egs.layout: fix the bibliography layout.
12972 1999-10-08 Jürgen Vigna <jug@sad.it>
12974 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
12975 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
12976 it returned without continuing to search the path.
12978 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
12980 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
12981 also fixes a bug. It is not allowed to do tricks with std::strings
12982 like: string a("hei"); &a[e]; this will not give what you
12983 think... Any reason for the complexity in this func?
12985 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
12987 * Updated README and INSTALL a bit, mostly to check that my
12988 CVS rights are correctly set up.
12990 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
12992 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
12993 does not allow '\0' chars but lyxstring and std::string does.
12995 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12997 * autogen.sh (AUTOCONF): let the autogen script create the
12998 POTFILES.in file too. POTFILES.in should perhaps now not be
12999 included in the cvs module.
13001 * some more files changed to use C++ includes instead of C ones.
13003 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
13005 (Reread): added tostr to nlink. buggy output otherwise.
13006 (Reread): added a string() around szMode when assigning to Buffer,
13007 without this I got a log of garbled info strings.
13009 * acconfig.h: commented out the PTR_AS_INT macros. They should not
13012 * I have added several ostream & operator<<(ostream &, some_type)
13013 functions. This has been done to avoid casting and warnings when
13014 outputting enums to lyxerr. This as thus eliminated a lot of
13015 explicit casts and has made the code clearer. Among the enums
13016 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
13017 mathed enums, some font enum the Debug::type enum.
13019 * src/support/lyxstring.h (clear): missing method. equivalent of
13022 * all files that contained "stderr": rewrote constructs that used
13023 stderr to use lyxerr instead. (except bmtable)
13025 * src/support/DebugStream.h (level): and the passed t with
13026 Debug::ANY to avoid spurious bits set.
13028 * src/debug.h (Debug::type value): made it accept strings of the
13029 type INFO,INIT,KEY.
13031 * configure.in (Check for programs): Added a check for kpsewhich,
13032 the latex generation will use this later to better the dicovery of
13035 * src/BufferView.C (create_view): we don't need to cast this to
13036 (void*) that is done automatically.
13037 (WorkAreaButtonPress): removed some dead code.
13039 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
13041 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
13042 is not overwritten when translated (David Sua'rez de Lis).
13044 * lib/CREDITS: Added David Sua'rez de Lis
13046 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
13048 * src/bufferparams.C (BufferParams): default input encoding is now
13051 * acinclude.m4 (cross_compiling): comment out macro
13052 LYX_GXX_STRENGTH_REDUCE.
13054 * acconfig.h: make sure that const is not defined (to empty) when
13055 we are compiling C++. Remove commented out code using SIZEOF_xx
13058 * configure.in : move the test for const and inline as late as
13059 possible so that these C tests do not interefere with C++ ones.
13060 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
13061 has not been proven.
13063 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
13065 * src/table.C (getDocBookAlign): remove bad default value for
13066 isColumn parameter.
13068 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
13070 (ShowFileMenu2): ditto.
13072 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
13073 of files to ignore.
13075 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
13077 * Most files: finished the change from the old error code to use
13078 DebugStream for all lyxerr debugging. Only minor changes remain
13079 (e.g. the setting of debug levels using strings instead of number)
13081 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
13083 * src/layout.C (Add): Changed to use compare_no_case instead of
13086 * src/FontInfo.C: changed loop variable type too string::size_type.
13088 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
13090 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
13091 set ETAGS_ARGS to --c++
13093 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
13095 * src/table.C (DocBookEndOfCell): commented out two unused variables
13097 * src/paragraph.C: commented out four unused variables.
13099 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
13100 insed a if clause with type string::size_type.
13102 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
13105 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
13107 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
13108 variable, also changed loop to go from 0 to lenght + 1, instead of
13109 -1 to length. This should be correct.
13111 * src/LaTeX.C (scanError): use string::size_type as loop variable
13114 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
13115 (l.896) since y_tmp and row was not used anyway.
13117 * src/insets/insetref.C (escape): use string::size_type as loop
13120 * src/insets/insetquotes.C (Width): use string::size_type as loop
13122 (Draw): use string::size_type as loop variable type.
13124 * src/insets/insetlatexaccent.C (checkContents): use
13125 string::size_type as loop variable type.
13127 * src/insets/insetlabel.C (escape): use string::size_type as loop
13130 * src/insets/insetinfo.C: added an extern for current_view.
13132 * src/insets/insetcommand.C (scanCommand): use string::size_type
13133 as loop variable type.
13135 * most files: removed the RCS tags. With them we had to recompile
13136 a lot of files after a simple cvs commit. Also we have never used
13137 them for anything meaningful.
13139 * most files: tags-query-replace NULL 0. As adviced several plases
13140 we now use "0" instead of "NULL" in our code.
13142 * src/support/filetools.C (SpaceLess): use string::size_type as
13143 loop variable type.
13145 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
13147 * src/paragraph.C: fixed up some more string stuff.
13149 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
13151 * src/support/filetools.h: make modestr a std::string.
13153 * src/filetools.C (GetEnv): made ch really const.
13155 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
13156 made code that used these use max/min from <algorithm> instead.
13158 * changed several c library include files to their equivalent c++
13159 library include files. All is not changed yet.
13161 * created a support subdir in src, put lyxstring and lstrings
13162 there + the extra files atexit, fileblock, strerror. Created
13163 Makefile.am. edited configure.in and src/Makefile.am to use this
13164 new subdir. More files moved to support.
13166 * imported som of the functions from repository lyx, filetools
13168 * ran tags-query-replace on LString -> string, corrected the bogus
13169 cases. Tried to make use of lstrings.[hC], debugged a lot. There
13170 is still some errors in there. This is errors where too much or
13171 too litle get deleted from strings (string::erase, string::substr,
13172 string::replace), there can also be some off by one errors, or
13173 just plain wrong use of functions from lstrings. Viewing of quotes
13176 * LyX is now running fairly well with string, but there are
13177 certainly some bugs yet (see above) also string is quite different
13178 from LString among others in that it does not allow null pointers
13179 passed in and will abort if it gets any.
13181 * Added the revtex4 files I forgot when setting up the repository.
13183 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
13185 * All over: Tried to clean everything up so that only the files
13186 that we really need are included in the cvs repository.
13187 * Switched to use automake.
13188 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
13189 * Install has not been checked.
13191 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
13193 * po/pt.po: Three errors:
13194 l.533 and l.538 format specification error
13195 l. 402 duplicate entry, I just deleted it.