1 2000-09-15 Marko Vendelin <markov@ioc.ee>
2 * src/frontends/gnome/FormCitation.C
3 * src/frontends/gnome/FormCitation.h
4 * src/frontends/gnome/diainsertcitation_interface.c
5 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
6 regexp support to FormCitation [Gnome].
8 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
11 * configure.in: remove unused KDE/GTKGUI define
13 * src/frontends/kde/FormRef.C
14 * src/frontends/kde/FormRef.h
15 * src/frontends/kde/formrefdialog.C
16 * src/frontends/kde/formrefdialog.h: double click will
17 go to reference, now it is possible to change a cross-ref
20 * src/frontends/kde/FormToc.C
21 * src/frontends/kde/FormToc.h
22 * src/frontends/kde/formtocdialog.C
23 * src/frontends/kde/formtocdialog.h: add a depth
26 * src/frontends/kde/Makefile.am: add QtLyXView.h
29 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
31 * src/frontends/kde/FormCitation.h: added some using directives.
33 * src/frontends/kde/FormToc.h: corrected definition of doTree.
35 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
38 * src/mathed/math_defs.h: redefine SetAlign to use string rather
41 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
43 * src/buffer.C (pop_tag): revert for the second time a change by
44 Lars, who seems to really hate having non-local loop variables :)
46 * src/Lsstream.h: add "using" statements.
48 * src/support/copy.C (copy): add a bunch of std:: qualifiers
49 * src/buffer.C (writeFile): ditto
51 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
53 * src/buffer.C (writeFile): try to fix the locale modified format
54 number to always be as we want it.
56 * src/WorkArea.C (work_area_handler): try to workaround the bugs
57 in XForms 0.89. C-space is now working again.
59 * src/Lsstream.h src/support/sstream.h: new files.
61 * also commented out all cases where strstream were used.
63 * src/Bullet.h (c_str): remove method.
65 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
67 * a lot of files: get rid of "char const *" and "char *" is as
68 many places as possible. We only want to use them in interaction
69 with system of other libraries, not inside lyx.
71 * a lot of files: return const object is not of pod type. This
72 helps ensure that temporary objects is not modified. And fits well
73 with "programming by contract".
75 * configure.in: check for the locale header too
77 * Makefile.am (sourcedoc): new tag for generation of doc++
80 2000-09-14 Juergen Vigna <jug@sad.it>
82 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
83 callback to check which combo called it and do the right action.
85 * src/combox.C (combo_cb): added combo * to the callbacks.
86 (Hide): moved call of callback after Ungrab of the pointer.
88 * src/intl.h: removed LCombo2 function.
90 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
91 function as this can now be handled in one function.
93 * src/combox.h: added Combox * to callback prototype.
95 * src/frontends/xforms/Toolbar_pimpl.C:
96 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
98 2000-09-14 Garst Reese <reese@isn.net>
100 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
101 moved usepackage{xxx}'s to beginning of file. Changed left margin
102 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
103 underlining from title. Thanks to John Culleton for useful suggestions.
105 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
107 * src/lyxlex_pimpl.C (setFile): change error message to debug
110 2000-09-13 Juergen Vigna <jug@sad.it>
112 * src/frontends/xforms/FormDocument.C: implemented choice_class
113 as combox and give callback to combo_language so OK/Apply is activated
116 * src/bufferlist.C (newFile): small fix so already named files
117 (via an open call) are not requested to be named again on the
120 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
122 * src/frontends/kde/Makefile.am
123 * src/frontends/kde/FormRef.C
124 * src/frontends/kde/FormRef.h
125 * src/frontends/kde/formrefdialog.C
126 * src/frontends/kde/formrefdialog.h: implement
129 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
131 * src/frontends/kde/formtocdialog.C
132 * src/frontends/kde/formtocdialog.h
133 * src/frontends/kde/FormToc.C
134 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
136 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
138 * src/frontends/kde/FormCitation.C: fix thinko
139 where we didn't always display the reference text
142 * src/frontends/kde/formurldialog.C
143 * src/frontends/kde/formurldialog.h
144 * src/frontends/kde/FormUrl.C
145 * src/frontends/kde/FormUrl.h: minor cleanups
147 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
149 * src/frontends/kde/Makefile.am
150 * src/frontends/kde/FormToc.C
151 * src/frontends/kde/FormToc.h
152 * src/frontends/kde/FormCitation.C
153 * src/frontends/kde/FormCitation.h
154 * src/frontends/kde/FormIndex.C
155 * src/frontends/kde/FormIndex.h
156 * src/frontends/kde/formtocdialog.C
157 * src/frontends/kde/formtocdialog.h
158 * src/frontends/kde/formcitationdialog.C
159 * src/frontends/kde/formcitationdialog.h
160 * src/frontends/kde/formindexdialog.C
161 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
163 2000-09-12 Juergen Vigna <jug@sad.it>
165 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
168 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
170 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
173 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
175 * src/converter.C (Add, Convert): Added support for converter flags:
176 needaux, resultdir, resultfile.
177 (Convert): Added new parameter view_file.
178 (dvips_options): Fixed letter paper option.
180 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
181 (Export, GetExportableFormats, GetViewableFormats): Added support
184 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
186 (easyParse): Fixed to work with new export code.
188 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
191 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
193 * lib/bind/*.bind: Replaced
194 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
195 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
197 2000-09-11 Juergen Vigna <jug@sad.it>
199 * src/lyx_gui.C (runTime): uses global guiruntime variable.
201 * src/main.C (main): now GUII defines global guiruntime!
203 * src/frontends/gnome/GUIRunTime.C (initApplication):
204 * src/frontends/kde/GUIRunTime.C (initApplication):
205 * src/frontends/xforms/GUIRunTime.C (initApplication):
206 * src/frontends/GUIRunTime.h: added new function initApplication.
208 * src/spellchecker.C (sc_accept_word): change to add_to_session.
210 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
212 2000-09-08 Juergen Vigna <jug@sad.it>
214 * src/lyx_gui.C (create_forms): don't display the "default" entry as
215 we have already "Reset".
217 * src/language.C (initL): inserted "default" language and made this
218 THE default language (and not american!)
220 * src/paragraph.C: inserted handling of "default" language!
222 * src/lyxfont.C: ditto
226 * src/paragraph.C: output the \\par only if we have a following
227 paragraph otherwise it's not needed.
229 2000-09-05 Juergen Vigna <jug@sad.it>
231 * config/pspell.m4: added entry to lyx-flags
233 * src/spellchecker.C: modified version from Kevin for using pspell
235 2000-09-01 Marko Vendelin <markov@ioc.ee>
236 * src/frontends/gnome/Makefile.am
237 * src/frontends/gnome/FormCitation.C
238 * src/frontends/gnome/FormCitation.h
239 * src/frontends/gnome/diainsertcitation_callbacks.c
240 * src/frontends/gnome/diainsertcitation_callbacks.h
241 * src/frontends/gnome/diainsertcitation_interface.c
242 * src/frontends/gnome/diainsertcitation_interface.h
243 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
244 dialog for Gnome frontend
246 * src/main.C: Gnome libraries require keeping application name
247 and its version as strings
249 * src/frontends/gnome/mainapp.C: Change the name of the main window
250 from GnomeLyX to PACKAGE
252 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
254 * src/frontends/Liason.C: add "using: declaration.
256 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
258 * src/mathed/math_macro.C (Metrics): Set the size of the template
260 * src/mathed/formulamacro.C (Latex): Fixed the returned value
262 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
264 * src/converter.C (add_options): New function.
265 (SetViewer): Change $$FName into '$$FName'.
266 (View): Add options when running xdvi
267 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
268 (Convert): The 3rd parameter is now the desired filename. Converts
269 calls to lyx::rename if necessary.
270 Add options when running dvips.
271 (dvi_papersize,dvips_options): New methods.
273 * src/exporter.C (Export): Use getLatexName() instead of fileName().
275 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
276 using a call to Converter::dvips_options.
277 Fixed to work with nex export code.
280 * src/support/rename.C: New files
282 * src/support/syscall.h
283 * src/support/syscall.C: Added Starttype SystemDontWait.
285 * lib/ui/default.ui: Changed to work with new export code
287 * lib/configure.m4: Changed to work with new export code
289 * src/encoding.C: Changed latex name for iso8859_7 encoding.
291 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
293 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
294 so that code compiles with DEC cxx.
296 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
297 to work correctly! Also now supports the additional elements
300 2000-09-01 Allan Rae <rae@lyx.org>
302 * src/frontends/ButtonPolicies.C: renamed all the references to
303 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
305 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
306 since it's a const not a type.
308 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
310 2000-08-31 Juergen Vigna <jug@sad.it>
312 * src/insets/figinset.C: Various changes to look if the filename has
313 an extension and if not add it for inline previewing.
315 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
317 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
318 make buttonStatus and isReadOnly be const methods. (also reflect
319 this in derived classes.)
321 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
322 (nextState): change to be static inline, pass the StateMachine as
324 (PreferencesPolicy): remove casts
325 (OkCancelPolicy): remvoe casts
326 (OkCancelReadOnlyPolicy): remove casts
327 (NoRepeatedApplyReadOnlyPolicy): remove casts
328 (OkApplyCancelReadOnlyPolicy): remove casts
329 (OkApplyCancelPolicy): remove casts
330 (NoRepeatedApplyPolicy): remove casts
332 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
334 * src/converter.C: added some using directives
336 * src/frontends/ButtonPolicies.C: changes to overcome
337 "need lvalue" error with DEC c++
339 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
340 to WMHideCB for DEC c++
342 * src/frontends/xforms/Menubar_pimpl.C: added using directive
344 * src/frontends/xforms/forms/form_document.C.patch: use C callback
345 to BulletBMTableCB for DEC c++
347 2000-08-31 Allan Rae <rae@lyx.org>
349 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
350 character dialog separately from old document dialogs combo_language.
353 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
355 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
356 Removed LFUN_REF_CREATE.
358 * src/MenuBackend.C: Added new tags: toc and references
360 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
361 (add_lastfiles, add_documents, add_formats): Removed the unused smn
363 (add_toc, add_references): New methods.
364 (create_submenu): Handle correctly the case when there is a
365 seperator after optional menu items.
367 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
368 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
369 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
371 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
373 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
375 * src/converter.[Ch]: New file for converting between different
378 * src/export.[Ch]: New file for exporting a LyX file to different
381 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
382 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
383 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
384 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
385 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
386 RunDocBook, MenuExport.
388 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
389 Exporter::Preview methods if NEW_EXPORT is defined.
391 * src/buffer.C (Dispatch): Use Exporter::Export.
393 * src/lyxrc.C: Added new tags: \converter and \viewer.
396 * src/LyXAction.C: Define new lyx-function: buffer-update.
397 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
398 when NEW_EXPORT is defined.
400 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
402 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
404 * lib/ui/default.ui: Added submenus "view" and "update" to the
407 * src/filetools.C (GetExtension): New function.
409 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
411 2000-08-29 Allan Rae <rae@lyx.org>
413 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
415 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
416 (EnableDocumentLayout): removed
417 (DisableDocumentLayout): removed
418 (build): make use of ButtonController's read-only handling to
419 de/activate various objects. Replaces both of the above functions.
421 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
422 (readOnly): was read_only
423 (refresh): fixed dumb mistakes with read_only_ handling
425 * src/frontends/xforms/forms/form_document.fd:
426 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
427 tabbed dialogs so the tabs look more like tabs and so its easier to
428 work out which is the current tab.
430 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
431 segfault with form_table
433 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
435 2000-08-28 Juergen Vigna <jug@sad.it>
437 * acconfig.h: added USE_PSPELL.
439 * src/config.h.in: added USE_PSPELL.
441 * autogen.sh: added pspell.m4
443 * config/pspell.m4: new file.
445 * src/spellchecker.C: implemented support for pspell libary.
447 2000-08-25 Juergen Vigna <jug@sad.it>
449 * src/LyXAction.C (init): renamed LFUN_TABLE to
450 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
452 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
454 * src/lyxscreen.h: add force_clear variable and fuction to force
455 a clear area when redrawing in LyXText.
457 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
459 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
461 * some whitespace and comment changes.
463 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
465 * src/buffer.C: up te LYX_FORMAT to 2.17
467 2000-08-23 Juergen Vigna <jug@sad.it>
469 * src/BufferView_pimpl.C (tripleClick): disable this when in a
472 * src/insets/insettabular.C (pasteSelection): delete the insets
473 LyXText as it is not valid anymore.
474 (copySelection): new function.
475 (pasteSelection): new function.
476 (cutSelection): new function.
477 (LocalDispatch): implemented cut/copy/paste of cell selections.
479 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
480 don't have a LyXText.
482 * src/LyXAction.C (init): a NEW_TABULAR define too much.
484 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
487 2000-08-22 Juergen Vigna <jug@sad.it>
489 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
490 ifdef form_table out if NEW_TABULAR.
492 2000-08-21 Juergen Vigna <jug@sad.it>
494 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
495 (draw): fixed draw position so that the cursor is positioned in the
497 (InsetMotionNotify): hide/show cursor so the position is updated.
498 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
499 using cellstart() function where it should be used.
501 * src/insets/insettext.C (draw): ditto.
503 * src/tabular.C: fixed initialization of some missing variables and
504 made BoxType into an enum.
506 2000-08-22 Marko Vendelin <markov@ioc.ee>
507 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
508 stock menu item using action numerical value, not its string
512 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
514 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
515 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
517 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
519 * src/frontends/xforms/GUIRunTime.C: new file
521 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
522 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
524 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
526 * src/frontends/kde/GUIRunTime.C: new file
528 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
529 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
531 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
533 * src/frontends/gnome/GUIRunTime.C: new file
535 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
538 * src/frontends/GUIRunTime.h: removed constructor and destructor,
539 small change to documetentation.
541 * src/frontends/GUIRunTime.C: removed file
543 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
545 * src/lyxparagraph.h: enable NEW_TABULAR as default
547 * src/lyxfunc.C (processKeySym): remove some commented code
549 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
550 NEW_TABULAR around the fd_form_table_options.
552 * src/lyx_gui.C (runTime): call the static member function as
553 GUIRunTime::runTime().
555 2000-08-21 Allan Rae <rae@lyx.org>
557 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
560 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
562 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
564 2000-08-21 Allan Rae <rae@lyx.org>
566 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
568 * src/frontends/xforms/FormPreferences.C (build): use setOK
569 * src/frontends/xforms/FormDocument.C (build): use setOK
570 (FormDocument): use the appropriate policy.
572 2000-08-21 Allan Rae <rae@lyx.org>
574 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
575 automatic [de]activation of arbitrary objects when in a read-only state.
577 * src/frontends/ButtonPolicies.h: More documentation
578 (isReadOnly): added to support the above.
580 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
582 2000-08-18 Juergen Vigna <jug@sad.it>
584 * src/insets/insettabular.C (getStatus): changed to return func_status.
586 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
587 display toggle menu entries if they are.
589 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
590 new document layout now.
592 * src/lyxfunc.C: ditto
594 * src/lyx_gui_misc.C: ditto
596 * src/lyx_gui.C: ditto
598 * lib/ui/default.ui: removed paper and quotes layout as they are now
599 all in the document layout tabbed folder.
601 * src/frontends/xforms/forms/form_document.fd: added Restore
602 button and callbacks for all inputs for Allan's ButtonPolicy.
604 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
605 (CheckChoiceClass): added missing params setting on class change.
606 (UpdateLayoutDocument): added for updating the layout on params.
607 (build): forgot to RETURN_ALWAYS input_doc_spacing.
608 (FormDocument): Implemented Allan's ButtonPolicy with the
611 2000-08-17 Allan Rae <rae@lyx.org>
613 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
614 so we can at least see the credits again.
616 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
617 controller calls for the appropriate callbacks. Note that since Ok
618 calls apply followed by cancel, and apply isn't a valid input for the
619 APPLIED state, the bc_ calls have to be made in the static callback not
620 within each of the real callbacks.
622 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
623 (setOk): renamed from setOkay()
625 2000-08-17 Juergen Vigna <jug@sad.it>
627 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
628 in the implementation part.
629 (composeUIInfo): don't show optional menu-items.
631 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
633 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
635 * src/bufferview_funcs.C (CurrentState): fixed to show also the
636 text-state when in a text-inset.
638 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
640 2000-08-17 Marko Vendelin <markov@ioc.ee>
641 * src/frontends/gnome/FormIndex.C
642 * src/frontends/gnome/FormIndex.h
643 * src/frontends/gnome/FormToc.C
644 * src/frontends/gnome/FormToc.h
645 * src/frontends/gnome/dialogs
646 * src/frontends/gnome/diatoc_callbacks.c
647 * src/frontends/gnome/diatoc_callbacks.h
648 * src/frontends/gnome/diainsertindex_callbacks.h
649 * src/frontends/gnome/diainsertindex_callbacks.c
650 * src/frontends/gnome/diainsertindex_interface.c
651 * src/frontends/gnome/diainsertindex_interface.h
652 * src/frontends/gnome/diatoc_interface.h
653 * src/frontends/gnome/diatoc_interface.c
654 * src/frontends/gnome/Makefile.am: Table of Contents and
655 Insert Index dialogs implementation for Gnome frontend
657 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
659 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
661 * src/frontends/gnome/diainserturl_interface.c: make the dialog
664 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
666 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
667 destructor. Don't definde if you don't need it
668 (processEvents): made static, non-blocking events processing for
670 (runTime): static method. event loop for xforms
671 * similar as above for kde and gnome.
673 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
675 (runTime): new method calss the real frontends runtime func.
677 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
679 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
681 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
683 2000-08-16 Juergen Vigna <jug@sad.it>
685 * src/lyx_gui.C (runTime): added GUII RunTime support.
687 * src/frontends/Makefile.am:
688 * src/frontends/GUIRunTime.[Ch]:
689 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
690 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
691 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
693 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
695 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
696 as this is already set in ${FRONTEND_INCLUDE} if needed.
698 * configure.in (CPPFLAGS): setting the include dir for the frontend
699 directory and don't set FRONTEND=xforms for now as this is executed
702 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
704 * src/frontends/kde/Makefile.am:
705 * src/frontends/kde/FormUrl.C:
706 * src/frontends/kde/FormUrl.h:
707 * src/frontends/kde/formurldialog.h:
708 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
710 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
712 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
714 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
716 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
719 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
721 * src/WorkArea.C (work_area_handler): more work to get te
722 FL_KEYBOARD to work with xforms 0.88 too, please test.
724 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
726 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
728 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
731 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
733 * src/Timeout.h: remove Qt::emit hack.
735 * several files: changes to allo doc++ compilation
737 * src/lyxfunc.C (processKeySym): new method
738 (processKeyEvent): comment out if FL_REVISION < 89
740 * src/WorkArea.C: change some debugging levels.
741 (WorkArea): set wantkey to FL_KEY_ALL
742 (work_area_handler): enable the FL_KEYBOARD clause, this enables
743 clearer code and the use of compose with XForms 0.89. Change to
744 use signals instead of calling methods in bufferview directly.
746 * src/Painter.C: change some debugging levels.
748 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
751 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
752 (workAreaKeyPress): new method
754 2000-08-14 Juergen Vigna <jug@sad.it>
756 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
758 * config/kde.m4: addes some features
760 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
761 include missing xforms dialogs.
763 * src/Timeout.h: a hack to be able to compile with qt/kde.
765 * sigc++/.cvsignore: added acinclude.m4
767 * lib/.cvsignore: added listerros
769 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
770 xforms tree as objects are needed for other frontends.
772 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
773 linking with not yet implemented xforms objects.
775 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
777 2000-08-14 Baruch Even <baruch.even@writeme.com>
779 * src/frontends/xforms/FormGraphics.h:
780 * src/frontends/xforms/FormGraphics.C:
781 * src/frontends/xforms/RadioButtonGroup.h:
782 * src/frontends/xforms/RadioButtonGroup.C:
783 * src/insets/insetgraphics.h:
784 * src/insets/insetgraphics.C:
785 * src/insets/insetgraphicsParams.h:
786 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
787 instead of spaces, and various other indentation issues to make the
788 sources more consistent.
790 2000-08-14 Marko Vendelin <markov@ioc.ee>
792 * src/frontends/gnome/dialogs/diaprint.glade
793 * src/frontends/gnome/FormPrint.C
794 * src/frontends/gnome/FormPrint.h
795 * src/frontends/gnome/diaprint_callbacks.c
796 * src/frontends/gnome/diaprint_callbacks.h
797 * src/frontends/gnome/diaprint_interface.c
798 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
801 * src/frontends/gnome/dialogs/diainserturl.glade
802 * src/frontends/gnome/FormUrl.C
803 * src/frontends/gnome/FormUrl.h
804 * src/frontends/gnome/diainserturl_callbacks.c
805 * src/frontends/gnome/diainserturl_callbacks.h
806 * src/frontends/gnome/diainserturl_interface.c
807 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
810 * src/frontends/gnome/Dialogs.C
811 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
812 all other dialogs. Copy all unimplemented dialogs from Xforms
815 * src/frontends/gnome/support.c
816 * src/frontends/gnome/support.h: support files generated by Glade
820 * config/gnome.m4: Gnome configuration scripts
822 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
823 configure --help message
825 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
826 only if there are no events pendling in Gnome/Gtk. This enhances
827 the performance of menus.
830 2000-08-14 Allan Rae <rae@lyx.org>
832 * lib/Makefile.am: listerrors cleaning
834 * lib/listerrors: removed -- generated file
835 * acinclude.m4: ditto
836 * sigc++/acinclude.m4: ditto
838 * src/frontends/xforms/forms/form_citation.fd:
839 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
842 * src/frontends/xforms/forms/makefile: I renamed the `install` target
843 `updatesrc` and now we have a `test` target that does what `updatesrc`
844 used to do. I didn't like having an install target that wasn't related
847 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
848 on all except FormGraphics. This may yet happen. Followed by a major
849 cleanup including using FL_TRANSIENT for most of the dialogs. More
850 changes to come when the ButtonController below is introduced.
852 * src/frontends/xforms/ButtonController.h: New file for managing up to
853 four buttons on a dialog according to an externally defined policy.
854 * src/frontends/xforms/Makefile.am: added above
856 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
857 Apply and Cancel/Close buttons and everything in between and beyond.
858 * src/frontends/Makefile.am: added above.
860 * src/frontends/xforms/forms/form_preferences.fd:
861 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
862 and removed variable 'status' as a result. Fixed the set_minsize thing.
863 Use the new screen-font-update after checking screen fonts were changed
864 Added a "Restore" button to restore the original lyxrc values while
865 editing. This restores everything not just the last input changed.
866 That's still a tricky one. As is the "LyX: this shouldn't happen..."
868 * src/LyXAction.C: screen-font-update added for updating buffers after
869 screen font settings have been changed.
870 * src/commandtags.h: ditto
871 * src/lyxfunc.C: ditto
873 * forms/lyx.fd: removed screen fonts dialog.
874 * src/lyx_gui.C: ditto
875 * src/menus.[Ch]: ditto
876 * src/lyx.[Ch]: ditto
877 * src/lyx_cb.C: ditto + code from here moved to make
878 screen-font-update. And people wonder why progress on GUII is
879 slow. Look at how scattered this stuff was! It takes forever
882 * forms/fdfix.sh: Fixup the spacing after commas.
883 * forms/makefile: Remove date from generated files. Fewer clashes now.
884 * forms/bullet_forms.C.patch: included someones handwritten changes
886 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
887 once I've discovered why LyXRC was made noncopyable.
888 * src/lyx_main.C: ditto
890 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
892 * src/frontends/xforms/forms/fdfix.sh:
893 * src/frontends/xforms/forms/fdfixh.sed:
894 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
895 * src/frontends/xforms/Form*.[hC]:
896 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
897 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
898 provide a destructor for the struct FD_form_xxxx. Another version of
899 the set_[max|min]size workaround and a few other cleanups. Actually,
900 Angus' patch from 20000809.
902 2000-08-13 Baruch Even <baruch.even@writeme.com>
904 * src/insets/insetgraphics.C (Clone): Added several fields that needed
907 2000-08-11 Juergen Vigna <jug@sad.it>
909 * src/insets/insetgraphics.C (InsetGraphics): changing init
910 order because of warnings.
912 * src/frontends/xforms/forms/makefile: adding patching .C with
915 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
916 from .C.patch to .c.patch
918 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
919 order because of warning.
921 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
923 * src/frontends/Liason.C (setMinibuffer): new helper function
925 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
927 * src/lyxfunc.C (Dispatch): calling new Document-Layout
929 * lib/ui/default.ui: commented out PaperLayout entry
931 * src/frontends/xforms/form_document.[Ch]: new added files
933 * src/frontends/xforms/FormDocument.[Ch]: ditto
935 * src/frontends/xforms/forms/form_document.fd: ditto
937 * src/frontends/xforms/forms/form_document.C.patch: ditto
939 2000-08-10 Juergen Vigna <jug@sad.it>
941 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
942 (InsetGraphics): initialized cacheHandle to 0.
943 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
945 2000-08-10 Baruch Even <baruch.even@writeme.com>
947 * src/graphics/GraphicsCache.h:
948 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
949 correctly as a cache.
951 * src/graphics/GraphicsCacheItem.h:
952 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
955 * src/graphics/GraphicsCacheItem_pimpl.h:
956 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
959 * src/insets/insetgraphics.h:
960 * src/insets/insetgraphics.C: Changed from using a signal notification
961 to polling when image is not loaded.
963 2000-08-10 Allan Rae <rae@lyx.org>
965 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
966 that there are two functions that have to been taken out of line by
967 hand and aren't taken care of in the script. (Just a reminder note)
969 * sigc++/macros/*.h.m4: Updated as above.
971 2000-08-09 Juergen Vigna <jug@sad.it>
973 * src/insets/insettext.C (draw): small fix for clearing rectangle.
975 * src/insets/insettabular.C: make drawing of single cell smarter.
977 2000-08-09 Marko Vendelin <markov@ioc.ee>
978 * src/frontends/gnome/Menubar_pimpl.C
979 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
980 implementation: new files
982 * src/frontends/gnome/mainapp.C
983 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
986 * src/main.C: create Gnome main window
988 * src/frontends/xforms/Menubar_pimpl.h
989 * src/frontends/Menubar.C
990 * src/frontends/Menubar.h: added method Menubar::update that calls
991 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
993 * src/LyXView.C: calls Menubar::update to update the state
996 * src/frontends/gnome/Makefile.am: added new files
998 * src/frontends/Makefile.am: added frontend compiler options
1000 2000-08-08 Juergen Vigna <jug@sad.it>
1002 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
1004 * src/bufferlist.C (close):
1005 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
1006 documents if exiting without saving.
1008 * src/buffer.C (save): use removeAutosaveFile()
1010 * src/support/filetools.C (removeAutosaveFile): new function.
1012 * src/lyx_cb.C (MenuWrite): returns a bool now.
1013 (MenuWriteAs): check if file could really be saved and revert to the
1015 (MenuWriteAs): removing old autosavefile if existant.
1017 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
1018 before Goto toggle declaration, because of compiler warning.
1020 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
1022 * src/lyxfunc.C (MenuNew): small fix.
1024 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
1026 * src/bufferlist.C (newFile):
1027 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
1029 * src/lyxrc.C: added new_ask_filename tag
1031 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
1033 * src/lyx.fd: removed code pertaining to form_ref
1034 * src/lyx.[Ch]: ditto
1035 * src/lyx_cb.C: ditto
1036 * src/lyx_gui.C: ditto
1037 * src/lyx_gui_misc.C: ditto
1039 * src/BufferView_pimpl.C (restorePosition): update buffer only
1042 * src/commandtags.h (LFUN_REFTOGGLE): removed
1043 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
1044 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
1045 (LFUN_REFBACK): renamed LFUN_REF_BACK
1047 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
1048 * src/menus.C: ditto
1049 * src/lyxfunc.C (Dispatch): ditto.
1050 InsertRef dialog is now GUI-independent.
1052 * src/texrow.C: added using std::endl;
1054 * src/insets/insetref.[Ch]: strip out large amounts of code.
1055 The inset is now a container and this functionality is now
1056 managed by a new FormRef dialog
1058 * src/frontends/Dialogs.h (showRef, createRef): new signals
1060 * src/frontends/xforms/FormIndex.[Ch],
1061 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
1062 when setting dialog's min/max size
1063 * src/frontends/xforms/FormIndex.[Ch]: ditto
1065 * src/frontends/xforms/FormRef.[Ch],
1066 src/frontends/xforms/forms/form_ref.fd: new xforms
1067 implementation of an InsetRef dialog
1069 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
1072 * src/graphics/XPM_Renderer.C (isImageFormatOK):
1073 ios::nocreate is not part of the standard. Removed.
1075 2000-08-07 Baruch Even <baruch.even@writeme.com>
1077 * src/graphics/Renderer.h:
1078 * src/graphics/Renderer.C: Added base class for rendering of different
1079 image formats into Pixmaps.
1081 * src/graphics/XPM_Renderer.h:
1082 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
1083 in a different class.
1085 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
1086 easily add support for other formats.
1088 * src/insets/figinset.C: plugged a leak of an X resource.
1090 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1092 * src/CutAndPaste.[Ch]: make all metods static.
1094 * development/Code_rules/Rules: more work, added section on
1095 Exceptions, and a References section.
1097 * a lot of header files: work to make doc++ able to generate the
1098 source documentation, some workarounds of doc++ problems. Doc++ is
1099 now able to generate the documentation.
1101 2000-08-07 Juergen Vigna <jug@sad.it>
1103 * src/insets/insettabular.C (recomputeTextInsets): removed function
1105 * src/tabular.C (SetWidthOfMulticolCell):
1107 (calculate_width_of_column_NMC): fixed return value so that it really
1108 only returns true if the column-width has changed (there where
1109 problems with muliticolumn-cells in this column).
1111 2000-08-04 Juergen Vigna <jug@sad.it>
1113 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
1114 also on the scrollstatus of the inset.
1115 (workAreaMotionNotify): ditto.
1117 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
1119 2000-08-01 Juergen Vigna <jug@sad.it>
1121 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
1123 * src/commandtags.h:
1124 * src/LyXAction.C (init):
1125 * src/insets/inset.C (LocalDispatch): added support for
1128 * src/insets/inset.C (scroll): new functions.
1130 * src/insets/insettext.C (removeNewlines): new function.
1131 (SetAutoBreakRows): removes forced newlines in the text of the
1132 paragraph if autoBreakRows is set to false.
1134 * src/tabular.C (Latex): generates a parbox around the cell contents
1137 * src/frontends/xforms/FormTabular.C (local_update): removed
1138 the radio_useparbox button.
1140 * src/tabular.C (UseParbox): new function
1142 2000-08-06 Baruch Even <baruch.even@writeme.com>
1144 * src/graphics/GraphicsCache.h:
1145 * src/graphics/GraphicsCache.C:
1146 * src/graphics/GraphicsCacheItem.h:
1147 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
1150 * src/insets/insetgraphics.h:
1151 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
1152 drawing of the inline image.
1154 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
1155 into the wrong position.
1157 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
1160 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
1162 * src/support/translator.h: move all typedefs to public section
1164 * src/support/filetools.C (MakeLatexName): return string const
1166 (TmpFileName): ditto
1167 (FileOpenSearch): ditto
1169 (LibFileSearch): ditto
1170 (i18nLibFileSearch): ditto
1173 (CreateTmpDir): ditto
1174 (CreateBufferTmpDir): ditto
1175 (CreateLyXTmpDir): ditto
1178 (MakeAbsPath): ditto
1180 (OnlyFilename): ditto
1182 (NormalizePath): ditto
1183 (CleanupPath): ditto
1184 (GetFileContents): ditto
1185 (ReplaceEnvironmentPath): ditto
1186 (MakeRelPath): ditto
1188 (ChangeExtension): ditto
1189 (MakeDisplayPath): ditto
1190 (do_popen): return cmdret const
1191 (findtexfile): return string const
1193 * src/support/DebugStream.h: add some /// to please doc++
1195 * src/frontends/DialogBase.h (endif): add some /// to please doc++
1197 * src/texrow.C (same_rownumber): functor to use with find_if
1198 (getIdFromRow): rewritten to use find_if and to not update the
1199 positions. return true if row is found
1200 (increasePos): new method, use to update positions
1202 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
1204 * src/lyxlex_pimpl.C (verifyTable): new method
1207 (GetString): return string const
1208 (pushTable): rewrite to use std::stack
1210 (setFile): better check
1213 * src/lyxlex.h: make LyXLex noncopyable
1215 * src/lyxlex.C (text): return char const * const
1216 (GetString): return string const
1217 (getLongString): return string const
1219 * src/lyx_gui_misc.C (askForText): return pair<...> const
1221 * src/lastfiles.[Ch] (operator): return string const
1223 * src/buffer.C (parseSingleLyXformat2Token): pass string to
1224 istringstream not char const *.
1225 move token.end() out of loop.
1226 (readFile): move initializaton of token
1228 * src/BufferView2.C (insertErrors): run texrow.increasePos if
1229 getIdFromRow is successful.
1231 * lib/bind/emacs.bind: don't include menus bind
1233 * development/Code_rules/Rules: the beginnings of making this
1234 better and covering more of the unwritten rules that we have.
1236 * development/Code_rules/Recommendations: a couple of wording
1239 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1241 * src/support/strerror.c: remove C++ comment.
1243 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
1245 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
1246 LFUN_INDEX_INSERT_LAST
1248 * src/texrow.C (getIdFromRow): changed from const_iterator to
1249 iterator, allowing code to compile with DEC cxx
1251 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
1252 stores part of the class, as suggested by Allan. Will allow
1254 (apply): test to apply uses InsetCommandParams operator!=
1256 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
1257 (apply): test to apply uses InsetCommandParams operator!=
1259 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
1260 stores part of the class.
1261 (update): removed limits on min/max size.
1263 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
1264 (apply): test to apply uses InsetCommandParams operator!=
1266 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
1267 (Read, Write, scanCommand, getCommand): moved functionality
1268 into InsetCommandParams.
1270 (getScreenLabel): made pure virtual
1271 new InsetCommandParams operators== and !=
1273 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
1274 c-tors based on InsetCommandParams. Removed others.
1275 * src/insets/insetinclude.[Ch]: ditto
1276 * src/insets/insetlabel.[Ch]: ditto
1277 * src/insets/insetparent.[Ch]: ditto
1278 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
1280 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
1281 insets derived from InsetCommand created using similar c-tors
1282 based on InsetCommandParams
1283 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
1284 * src/menus.C (ShowRefsMenu): ditto
1285 * src/paragraph.C (Clone): ditto
1286 * src/text2.C (SetCounter): ditto
1287 * src/lyxfunc.C (Dispatch) ditto
1288 Also recreated old InsetIndex behaviour exactly. Can now
1289 index-insert at the start of a paragraph and index-insert-last
1290 without launching the pop-up.
1292 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1294 * lib/lyxrc.example: mark te pdf options as non functional.
1296 * src/support/lstrings.C (strToInt): move initalization of tmpstr
1297 (isStrDbl): move tmpstr.end() out of loop.
1298 (strToDbl): move intialization of tmpstr
1299 (lowercase): return string const and move tmp.end() out of loop.
1300 (uppercase): return string const and move tmp.edn() out of loop.
1301 (prefixIs): add assertion
1306 (containsOnly): ditto
1307 (containsOnly): ditto
1308 (containsOnly): ditto
1309 (countChar): make last arg char not char const
1310 (token): return string const
1311 (subst): return string const, move tmp.end() out of loop.
1312 (subst): return string const, add assertion
1313 (strip): return string const
1314 (frontStrip): return string const, add assertion
1315 (frontStrip): return string const
1320 * src/support/lstrings.C: add inclde "LAssert.h"
1321 (isStrInt): move tmpstr.end() out of loop.
1323 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
1324 toollist.end() out of loop.
1325 (deactivate): move toollist.end() out of loop.
1326 (update): move toollist.end() out of loop.
1327 (updateLayoutList): move tc.end() out of loop.
1328 (add): move toollist.end() out of loop.
1330 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
1331 md.end() out of loop.
1333 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
1335 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
1338 * src/paragraph.C (Erase): move fontlist.end() out of loop.
1339 (Erase): move insetlist.end() out of loop.
1341 * src/lyx_sendfax_main.C: make show_logfile static and to take a
1342 ref to const string as first arg. Move initialization of some
1343 variables, whitespace changes.
1345 * src/kbmap.C (defkey): move table.end() out of loop.
1346 (kb_keymap): move table.end() out of loop.
1347 (findbinding): move table.end() out of loop.
1349 * src/MenuBackend.C (hasMenu): move end() out of loop.
1350 (getMenu): move end() out of loop.
1351 (getMenu): move menulist_.end() out of loop.
1353 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
1355 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
1358 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
1359 (getFromLyXName): move infotab.end() out of loop.
1361 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
1362 -fvtable-thunks -ffunction-sections -fdata-sections
1364 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
1366 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
1369 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1371 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
1373 * src/frontends/xforms/FormCitation.[Ch],
1374 src/frontends/xforms/FormIndex.[Ch],
1375 src/frontends/xforms/FormToc.[Ch],
1376 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
1378 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1380 * src/commandtags.h: renamed, created some flags for citation
1383 * src/lyx_gui_misc.C: stripped out old FD_index_form code
1385 * src/lyxfunc.C (dispatch): use signals to insert index entry
1387 * src/frontends/Dialogs.h: new signal createIndex
1389 * src/frontends/xforms/FormCommand.[Ch],
1390 src/frontends/xforms/FormCitation.[Ch],
1391 src/frontends/xforms/FormToc.[Ch],
1392 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
1394 * src/insets/insetindex.[Ch]: GUI-independent
1396 * src/frontends/xforms/FormIndex.[Ch],
1397 * src/frontends/xforms/forms/form_index.fd: xforms implementation
1400 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
1402 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
1403 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
1405 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1407 * src/insets/insetref.C (Latex): rewrite so that there is now
1408 question that a initialization is requested.
1410 * src/insets/insetcommand.h: reenable the hide signal
1412 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1414 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
1415 fix handling of shortcuts (many bugs :)
1416 (add_lastfiles): ditto.
1418 * lib/ui/default.ui: fix a few shortcuts.
1420 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
1422 * Makefile.am: Fix ``rpmdist'' target to return the exit
1423 status of the ``rpm'' command, instead of the last command in
1424 the chain (the ``rm lyx.xpm'' command, which always returns
1427 2000-08-02 Allan Rae <rae@lyx.org>
1429 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
1430 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
1431 * src/frontends/xforms/FormToc.C (FormToc): ditto
1433 * src/frontends/xforms/Makefile.am: A few forgotten files
1435 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
1436 Signals-not-copyable-problem Lars' started commenting out.
1438 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
1440 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1442 * src/insets/insetcommand.h: Signals is not copyable so anoter
1443 scheme for automatic hiding of forms must be used.
1445 * src/frontends/xforms/FormCitation.h: don't inerit from
1446 noncopyable, FormCommand already does that.
1447 * src/frontends/xforms/FormToc.h: ditto
1448 * src/frontends/xforms/FormUrl.h: ditto
1450 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1452 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
1454 * src/insets/insetcommand.h (hide): new SigC::Signal0
1455 (d-tor) new virtual destructor emits hide signal
1457 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
1458 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
1460 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
1461 LOF and LOT. Inset is now GUI-independent
1463 * src/insets/insetloa.[Ch]: redundant
1464 * src/insets/insetlof.[Ch]: ditto
1465 * src/insets/insetlot.[Ch]: ditto
1467 * src/frontends/xforms/forms/form_url.fd: tweaked!
1468 * src/frontends/xforms/forms/form_citation.fd: ditto
1470 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
1471 dialogs dealing with InsetCommand insets
1473 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
1474 FormCommand base class
1475 * src/frontends/xforms/FormUrl.[Ch]: ditto
1477 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
1479 * src/frontends/xforms/FormToc.[Ch]: ditto
1481 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
1482 passed a generic InsetCommand pointer
1483 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
1485 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
1486 and modified InsetTOC class
1487 * src/buffer.C: ditto
1489 * forms/lyx.fd: strip out old FD_form_toc code
1490 * src/lyx_gui_misc.C: ditto
1491 * src/lyx_gui.C: ditto
1492 * src/lyx_cb.C: ditto
1493 * src/lyx.[Ch]: ditto
1495 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1497 * src/support/utility.hpp: tr -d '\r'
1499 2000-08-01 Juergen Vigna <jug@sad.it>
1501 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
1503 * src/commandtags.h:
1504 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
1505 LFUN_TABULAR_FEATURES.
1507 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
1508 LFUN_LAYOUT_TABULAR.
1510 * src/insets/insettabular.C (getStatus): implemented helper function.
1512 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
1514 2000-07-31 Juergen Vigna <jug@sad.it>
1516 * src/text.C (draw): fixed screen update problem for text-insets.
1518 * src/text2.C (SetParagrpah): call an update of the inset-owner when
1519 something changed probably this has to be added in various other
1522 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
1524 2000-07-31 Baruch Even <baruch.even@writeme.com>
1526 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
1527 templates to satisfy compaq cxx.
1530 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1532 * src/support/translator.h (equal_1st_in_pair::operator()): take
1533 const ref pair_type as arg.
1534 (equal_2nd_in_pair::operator()): ditto
1535 (Translator::~Translator): remove empty d-tor.
1537 * src/graphics/GraphicsCache.C: move include config.h to top, also
1538 put initialization of GraphicsCache::singleton here.
1539 (~GraphicsCache): move here
1540 (addFile): take const ref as arg
1543 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
1545 * src/BufferView2.C (insertLyXFile): change te with/without header
1548 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1550 * src/frontends/xforms/FormGraphics.C (apply): add some
1551 static_cast. Not very nice, but required by compaq cxx.
1553 * src/frontends/xforms/RadioButtonGroup.h: include header
1554 <utility> instead of <pair.h>
1556 * src/insets/insetgraphicsParams.C: add using directive.
1557 (readResize): change return type to void.
1558 (readOrigin): ditto.
1560 * src/lyxfunc.C (getStatus): add missing break for build-program
1561 function; add test for Literate for export functions.
1563 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
1564 entries in Options menu.
1566 2000-07-31 Baruch Even <baruch.even@writeme.com>
1568 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
1569 protect against auto-allocation; release icon when needed.
1571 2000-07-31 Matej Cepl <CeplM@seznam.cz>
1573 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
1574 on usual typewriter.
1576 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
1577 earlier czech.kmap), useful only for programming.
1579 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1581 * src/frontends/xforms/FormCitation.h: fix conditioning around
1584 2000-07-31 Juergen Vigna <jug@sad.it>
1586 * src/frontends/xforms/FormTabular.C (local_update): changed
1587 radio_linebreaks to radio_useparbox and added radio_useminipage.
1589 * src/tabular.C: made support for using minipages/parboxes.
1591 * src/bufferlist.C (QwriteAll): small fix for asking for save.
1593 * src/insets/insetgraphics.C (draw): just draw the inset so that the
1595 (descent): so the cursor is in the middle.
1596 (width): bit smaller box.
1598 * src/insets/insetgraphics.h: added display() function.
1600 2000-07-31 Baruch Even <baruch.even@writeme.com>
1602 * src/frontends/Dialogs.h: Added showGraphics signals.
1604 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
1605 xforms form definition of the graphics dialog.
1607 * src/frontends/xforms/FormGraphics.h:
1608 * src/frontends/xforms/FormGraphics.C: Added files, the
1609 GUIndependent code of InsetGraphics
1611 * src/insets/insetgraphics.h:
1612 * src/insets/insetgraphics.C: Major writing to make it work.
1614 * src/insets/insetgraphicsParams.h:
1615 * src/insets/insetgraphicsParams.C: Added files, parameter passing
1616 struct between InsetGraphics and GUI.
1618 * src/LaTeXFeatures.h:
1619 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
1620 support for graphicx package.
1622 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
1623 for the graphics inset.
1625 * src/support/translator.h: Added file, used in
1626 InsetGraphicsParams. this is a template to translate between two
1629 * src/frontends/xforms/RadioButtonGroup.h:
1630 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
1631 way to easily control a radio button group.
1633 2000-07-28 Juergen Vigna <jug@sad.it>
1635 * src/insets/insettabular.C (LocalDispatch):
1636 (TabularFeatures): added support for lyx-functions of tabular features.
1637 (cellstart): refixed this function after someone wrongly changed it.
1639 * src/commandtags.h:
1640 * src/LyXAction.C (init): added support for tabular-features
1642 2000-07-28 Allan Rae <rae@lyx.org>
1644 * src/frontends/xforms/FormPreferences.C (build): Setup input return
1645 checking. NOTE: It seems that pressing ESC to cancel the dialog also
1646 triggers the callback for input checking. As a result we sometimes get
1647 "LyX: This shouldn't happen..." printed to cerr.
1648 (input): Started using status variable since I only free() on
1649 destruction. Some input checking for paths and font sizes.
1651 * src/frontends/xforms/FormPreferences.h: Use status to control
1652 activation of Ok and Apply
1654 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
1655 callback. Also resized to stop segfaults with 0.88. The problem is
1656 that xforms-0.88 requires the folder to be wide enough to fit all the
1657 tabs. If it isn't it causes all sorts of problems.
1659 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
1661 * src/frontends/xforms/forms/README: Reflect reality.
1663 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
1664 * src/frontends/xforms/forms/makefile: ditto.
1666 * src/commandtags.h: Get access to new Preferences dialog
1667 * src/LyXAction.C: ditto
1668 * src/lyxfunc.C: ditto
1669 * lib/ui/default.ui: ditto
1671 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1673 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
1675 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
1678 * src/frontends/xforms/form_url.[Ch]: added.
1680 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1682 * src/insets/insetbib.h: fixed bug in previous commit
1684 * src/frontends/xforms/FormUrl.h: ditto
1686 * src/frontends/xforms/FormPrint.h: ditto
1688 * src/frontends/xforms/FormPreferences.h: ditto
1690 * src/frontends/xforms/FormCopyright.h: ditto
1692 * src/frontends/xforms/FormCitation.C: ditto
1694 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
1695 private copyconstructor and private default contructor
1697 * src/support/Makefile.am: add utility.hpp
1699 * src/support/utility.hpp: new file from boost
1701 * src/insets/insetbib.h: set owner in clone
1703 * src/frontends/xforms/FormCitation.C: added missing include
1706 * src/insets/form_url.[Ch]: removed
1708 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
1710 * development/lyx.spec.in
1711 * Makefile.am: Fix buglet for LyX RPM generation resulting from
1712 file/directory re-organization.
1714 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
1716 * src/insets/insetcommand.[Ch]: moved the string data and
1717 associated manipulation methods into a new stand-alone class
1718 InsetCommandParams. This class has two additional methods
1719 getAsString() and setFromString() allowing the contents to be
1720 moved around as a single string.
1721 (addContents) method removed.
1722 (setContents) method no longer virtual.
1724 * src/buffer.C (readInset): made use of new InsetCitation,
1725 InsetUrl constructors based on InsetCommandParams.
1727 * src/commandtags.h: add LFUN_INSERT_URL
1729 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
1730 independent InsetUrl and use InsetCommandParams to extract
1731 string info and create new Insets.
1733 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
1735 * src/frontends/xforms/FormCitation.C (apply): uses
1738 * src/frontends/xforms/form_url.C
1739 * src/frontends/xforms/form_url.h
1740 * src/frontends/xforms/FormUrl.h
1741 * src/frontends/xforms/FormUrl.C
1742 * src/frontends/xforms/forms/form_url.fd: new files
1744 * src/insets/insetcite.[Ch]: removed unused constructors.
1746 * src/insets/insetinclude.[Ch]: no longer store filename
1748 * src/insets/inseturl.[Ch]: GUI-independent.
1750 2000-07-26 Juergen Vigna <jug@sad.it>
1751 * renamed frontend from gtk to gnome as it is that what is realized
1752 and did the necessary changes in the files.
1754 2000-07-26 Marko Vendelin <markov@ioc.ee>
1756 * configure.in: cleaning up gnome configuration scripts
1758 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1760 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
1761 shortcuts syndrom by redrawing them explicitely (a better solution
1762 would be appreciated).
1764 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
1766 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
1769 * src/lyx_cb.C (MenuExport): change html export to do the right
1770 thing depending of the document type (instead of having
1771 html-linuxdoc and html-docbook).
1772 * src/lyxfunc.C (getStatus): update for html
1773 * lib/ui/default.ui: simplify due to the above change.
1774 * src/menus.C (ShowFileMenu): update too (in case we need it).
1776 * src/MenuBackend.C (read): if a menu is defined twice, add the
1777 new entries to the exiting one.
1779 2000-07-26 Juergen Vigna <jug@sad.it>
1781 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
1783 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
1784 and return a bool if it did actual save the file.
1785 (AutoSave): don't autosave a unnamed doc.
1787 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
1788 check if this is an UNNAMED new file and react to it.
1789 (newFile): set buffer to unnamed and change to not mark a new
1790 buffer dirty if I didn't do anything with it.
1792 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
1794 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1796 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
1797 friend as per Angus's patch posted to lyx-devel.
1799 * src/ext_l10n.h: updated
1801 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
1802 gettext on the style string right before inserting them into the
1805 * autogen.sh: add code to extract style strings form layout files,
1806 not good enough yet.
1808 * src/frontends/gtk/.cvsignore: add MAKEFILE
1810 * src/MenuBackend.C (read): run the label strings through gettext
1811 before storing them in the containers.
1813 * src/ext_l10n.h: new file
1815 * autogen.sh : generate the ext_l10n.h file here
1817 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1819 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
1822 * lib/ui/default.ui: fix a couple of typos.
1824 * config/gnome/gtk.m4: added (and added to the list of files in
1827 * src/insets/insetinclude.C (unique_id): fix when we are using
1828 lyxstring instead of basic_string<>.
1829 * src/insets/insettext.C (LocalDispatch): ditto.
1830 * src/support/filetools.C: ditto.
1832 * lib/configure.m4: create the ui/ directory if necessary.
1834 * src/LyXView.[Ch] (updateToolbar): new method.
1836 * src/BufferView_pimpl.C (buffer): update the toolbar when
1837 opening/closing buffer.
1839 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1841 * src/LyXAction.C (getActionName): enhance to return also the name
1842 and options of pseudo-actions.
1843 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
1845 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
1846 as an example of what is possible). Used in File->Build too (more
1847 useful) and in the import/export menus (to mimick the complicated
1848 handling of linuxdoc and friends). Try to update all the entries.
1850 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
1853 * src/MenuBackend.C (read): Parse the new OptItem tag.
1855 * src/MenuBackend.h: Add a new optional_ data member (used if the
1856 entry should be omitted when the lyxfunc is disabled).
1858 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
1859 function, used as a shortcut.
1860 (create_submenu): align correctly the shortcuts on the widest
1863 * src/MenuBackend.h: MenuItem.label() only returns the label of
1864 the menu without shortcut; new method shortcut().
1866 2000-07-14 Marko Vendelin <markov@ioc.ee>
1868 * src/frontends/gtk/Dialogs.C:
1869 * src/frontends/gtk/FormCopyright.C:
1870 * src/frontends/gtk/FormCopyright.h:
1871 * src/frontends/gtk/Makefile.am: added these source-files for the
1872 Gtk/Gnome support of the Copyright-Dialog.
1874 * src/main.C: added Gnome::Main initialization if using
1875 Gtk/Gnome frontend-GUI.
1877 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
1879 * config/gnome/aclocal-include.m4
1880 * config/gnome/compiler-flags.m4
1881 * config/gnome/curses.m4
1882 * config/gnome/gnome--.m4
1883 * config/gnome/gnome-bonobo-check.m4
1884 * config/gnome/gnome-common.m4
1885 * config/gnome/gnome-fileutils.m4
1886 * config/gnome/gnome-ghttp-check.m4
1887 * config/gnome/gnome-gnorba-check.m4
1888 * config/gnome/gnome-guile-checks.m4
1889 * config/gnome/gnome-libgtop-check.m4
1890 * config/gnome/gnome-objc-checks.m4
1891 * config/gnome/gnome-orbit-check.m4
1892 * config/gnome/gnome-print-check.m4
1893 * config/gnome/gnome-pthread-check.m4
1894 * config/gnome/gnome-support.m4
1895 * config/gnome/gnome-undelfs.m4
1896 * config/gnome/gnome-vfs.m4
1897 * config/gnome/gnome-x-checks.m4
1898 * config/gnome/gnome-xml-check.m4
1899 * config/gnome/gnome.m4
1900 * config/gnome/gperf-check.m4
1901 * config/gnome/gtk--.m4
1902 * config/gnome/linger.m4
1903 * config/gnome/need-declaration.m4: added configuration scripts
1904 for Gtk/Gnome frontend-GUI
1906 * configure.in: added support for the --with-frontend=gtk option
1908 * autogen.sh: added config/gnome/* to list of config-files
1910 * acconfig.h: added define for GTKGUI-support
1912 * config/lyxinclude.m4: added --with-frontend[=value] option value
1913 for Gtk/Gnome frontend-GUI support.
1915 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1917 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
1921 * src/paragraph.C (GetChar): remove non-const version
1923 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
1924 (search_kw): use it.
1926 * src/lyx_main.C (init): if "preferences" exist, read that instead
1928 (ReadRcFile): return bool if the file could be read ok.
1929 (ReadUIFile): add a check to see if lex file is set ok.
1931 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
1932 bastring can be used instead of lyxstring (still uses the old code
1933 if std::string is good enough or if lyxstring is used.)
1935 * src/encoding.C: make the arrays static, move ininle functions
1937 * src/encoding.h: from here.
1939 * src/buffer.C: have last_isnet_read as a file scope variable for now.
1940 (parseSingleLyXformat2Token): move inset parsing to separate method
1941 (readInset): new private method
1943 * src/Variables.h: remove virtual from get().
1945 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
1946 access to NEW_INSETS and NEW_TABULAR
1948 * src/MenuBackend.h: remove superfluous forward declaration of
1949 MenuItem. Add documentations tags "///", remove empty MenuItem
1950 destructor, remove private default contructor.
1952 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
1954 (read): more string mlabel and mname to where they are used
1955 (read): remove unused variables mlabel and mname
1956 (defaults): unconditional clear, make menusetup take advantage of
1957 add returning Menu &.
1959 * src/LyXView.h: define NEW_MENUBAR as default
1961 * src/LyXAction.C: include lyxparagraph.h temporary to get access
1962 to NEW_INSETS and NEW_TABULAR.
1963 (init): commetn out some funcs that is obsolete when NEW_INSETS is
1964 defined. Change some of the "xxxx-inset-insert" functions names to
1967 * several files: more enahncements to NEW_INSETS and the resulting
1970 * lib/lyxrc.example (\date_insert_format): move to misc section
1972 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
1973 bastring and use AC_CACHE_CHECK.
1974 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
1975 the system have the newest methods. uses AC_CACHE_CHECK
1976 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
1977 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
1978 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
1980 * configure.in: add LYX_CXX_GOOD_STD_STRING
1982 * acinclude.m4: recreated
1984 2000-07-24 Amir Karger
1986 * README: add Hebrew, Arabic kmaps
1989 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1991 * src/buffer.C (writeFileAscii): Define actcell as an int instead
1994 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1996 * Lot of files: add pragma interface/implementation.
1998 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
2000 * lib/ui/default.ui: new file (ans new directory). Contains the
2001 default menu and toolbar.
2003 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
2004 global space. Toolbars are now read (as menus) in ui files.
2006 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
2008 * src/lyxfunc.C (getStatus): do not exit immediately if a command
2009 is disabled because the document is read-only. We want to have the
2010 toggle state of the function anyway.
2011 (getStatus): add code for LFUN_VC* functions (mimicking what is
2012 done in old-style menus)
2014 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
2015 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
2017 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
2018 * src/BufferView_pimpl.C: ditto.
2019 * src/lyxfunc.C: ditto.
2021 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
2022 default). This replaces old-style menus by new ones.
2024 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
2025 MenuItem. Contain the data structure of a menu.
2027 * src/insets/insettext.C: use LyXView::setLayout instead of
2028 accessing directly the toolbar combox.
2029 * src/lyxfunc.C (Dispatch): ditto.
2031 * src/LyXView.C (setLayout): new method, which just calls
2032 Toolbar::setLayout().
2033 (updateLayoutChoice): move part of this method in Toolbar.
2035 * src/toolbar.[Ch]: removed.
2037 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
2038 implementation the toolbar.
2040 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
2041 the toolbar. It might make sense to merge it with ToolbarDefaults
2043 (setLayout): new function.
2044 (updateLayoutList): ditto.
2045 (openLayoutList): ditto.
2047 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
2048 xforms implementation of the toolbar.
2049 (get_toolbar_func): comment out, since I do not
2050 know what it is good for.
2052 * src/ToolbarDefaults.h: Add the ItemType enum.
2054 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
2055 for a list of allocated C strings. Used in Menubar xforms
2056 implementation to avoid memory leaks.
2058 * src/support/lstrings.[Ch] (uppercase): new version taking and
2062 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
2063 * lib/bind/emacs.bind: ditto.
2065 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2067 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
2068 forward decl of LyXView.
2070 * src/toolbar.C (toolbarItem): moved from toolbar.h
2071 (toolbarItem::clean): ditto
2072 (toolbarItem::~toolbarItem): ditto
2073 (toolbarItem::operator): ditto
2075 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
2077 * src/paragraph.h: control the NEW_TABULAR define from here
2079 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
2080 USE_TABULAR_INSETS to NEW_TABULAR
2082 * src/ToolbarDefaults.C: add include "lyxlex.h"
2084 * files using the old table/tabular: use NEW_TABULAR to control
2085 compilation of old tabular stuff.
2087 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
2090 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
2091 planemet in reading of old style floats, fix the \end_deeper
2092 problem when reading old style floats.
2094 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2096 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
2098 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
2100 * lib/bind/sciword.bind: updated.
2102 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2104 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
2105 layout write problem
2107 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2109 * src/Makefile.am (INCLUDES): remove image directory from include
2112 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
2113 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
2115 * src/LyXView.C (create_form_form_main): read the application icon
2118 * lib/images/*.xpm: change the icons to use transparent color for
2121 * src/toolbar.C (update): change the color of the button when it
2124 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2126 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
2127 setting explicitely the minibuffer.
2128 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
2130 * src/LyXView.C (showState): new function. Shows font information
2131 in minibuffer and update toolbar state.
2132 (LyXView): call Toolbar::update after creating the
2135 * src/toolbar.C: change toollist to be a vector instead of a
2137 (BubbleTimerCB): get help string directly from the callback
2138 argument of the corresponding icon (which is the action)
2139 (set): remove unnecessary ugliness.
2140 (update): new function. update the icons (depressed, disabled)
2141 depending of the status of the corresponding action.
2143 * src/toolbar.h: remove help in toolbarItem
2145 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
2147 * src/Painter.C (text): Added code for using symbol glyphs from
2148 iso10646 fonts. Currently diabled.
2150 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
2153 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
2154 magyar,turkish and usorbian.
2156 * src/paragraph.C (isMultiLingual): Made more efficient.
2158 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
2161 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
2162 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
2163 Also changed the prototype to "bool math_insert_greek(char)".
2165 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2167 * lots of files: apply the NEW_INSETS on all code that will not be
2168 needed when we move to use the new insets. Enable the define in
2169 lyxparagrah.h to try it.
2171 * src/insets/insettabular.C (cellstart): change to be a static
2173 (InsetTabular): initialize buffer in the initializer list.
2175 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
2177 * src/frontends/xforms/FormPrint.[Ch] : moved #include
2178 form_print.h out of the header file. Replaced with forward
2179 declarations of the relevant struct.
2181 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
2184 * src/commandtags.h: do not include "debug.h" which does not
2185 belong there. #include it in some other places because of this
2188 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2190 * src/insets/insetcaption.C: add a couple "using" directives.
2192 * src/toolbar.C (add): get the help text directly from lyxaction.
2194 (setPixmap): new function. Loads from disk and sets a pixmap on a
2195 botton; the name of the pixmap file is derived from the command
2198 * src/toolbar.h: remove members isBitmap and pixmap from
2201 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
2202 * lib/images/: move many files from images/banner.xpm.
2204 * src/lyx_gui.C (create_forms): read banner pixmap from file.
2206 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
2207 * src/toolbar.C: ditto.
2208 * configure.in: ditto.
2209 * INSTALL: document.
2211 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
2212 the spellchecker popup is closed from the WM.
2214 2000-07-19 Juergen Vigna <jug@sad.it>
2216 * src/insets/insetfloat.C (Write): small fix because we use the
2217 insetname for the type now!
2219 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
2221 * src/frontends/xforms/forms/form_citation.fd: object sizes are
2224 * src/frontends/Dialogs.h: removed hideCitation signal
2226 * src/insets/insetcite.h: added hide signal
2228 * src/insets/insetcite.C (~InsetCitation): emits new signal
2229 (getScreenLabel): "intelligent" label should now fit on the screen!
2231 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
2233 * src/frontends/xforms/FormCitation.C (showInset): connects
2234 hide() to the inset's hide signal
2235 (show): modified to use fl_set_object_position rather than
2236 fl_set_object_geometry wherever possible
2238 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2240 * src/insets/lyxinset.h: add caption code
2242 * src/insets/insetfloat.C (type): new method
2244 * src/insets/insetcaption.C (Write): new method
2246 (LyxCode): new method
2248 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
2249 to get it right together with using the FloatList.
2251 * src/commandtags.h: add LFUN_INSET_CAPTION
2252 * src/lyxfunc.C (Dispatch): handle it
2254 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
2257 * src/Variables.[Ch]: make expand take a const reference, remove
2258 the destructor, some whitespace changes.
2260 * src/LyXAction.C (init): add caption-inset-insert
2262 * src/FloatList.C (FloatList): update the default floats a bit.
2264 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2266 * src/Variables.[Ch]: new files. Intended to be used for language
2267 specific strings (like \chaptername) and filename substitution in
2270 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
2272 * lib/kbd/american.kmap: update
2274 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
2276 * src/bufferparams.[Ch]: remove member allowAccents.
2278 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
2280 * src/LaTeXLog.C: use the log_form.h header.
2281 * src/lyx_gui.C: ditto.
2282 * src/lyx_gui_misc.C: ditto.
2283 * src/lyxvc.h: ditto.
2285 * forms/log_form.fd: new file, created from latexoptions.fd. I
2286 kept the log popup and nuked the options form.
2288 * src/{la,}texoptions.[Ch]: removed.
2289 * src/lyx_cb.C (LaTeXOptions): ditto
2291 * src/lyx_gui.C (create_forms): do not handle the
2292 fd_latex_options form.
2294 2000-07-18 Juergen Vigna <jug@sad.it>
2296 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
2297 name of the inset so that it can be requested outside (text2.C).
2299 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
2302 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2304 * src/mathed/formula.h (ConvertFont): constify
2306 * src/mathed/formula.C (Read): add warning if \end_inset is not
2307 found on expected place.
2309 * src/insets/lyxinset.h (ConvertFont): consify
2311 * src/insets/insetquotes.C (ConvertFont): constify
2312 * src/insets/insetquotes.h: ditto
2314 * src/insets/insetinfo.h: add labelfont
2316 * src/insets/insetinfo.C (InsetInfo): set the labelfont
2317 (ascent): use labelfont
2321 (Write): make .lyx file a bit nicer
2323 * src/insets/insetfloat.C (Write): simplify somewhat...
2324 (Read): add warning if arg is not found
2326 * src/insets/insetcollapsable.C: add using std::max
2327 (Read): move string token and add warning in arg is not found
2328 (draw): use std::max to get the right ty
2329 (getMaxWidth): simplify by using std::max
2331 * src/insets/insetsection.h: new file
2332 * src/insets/insetsection.C: new file
2333 * src/insets/insetcaption.h: new file
2334 * src/insets/insetcaption.C: new file
2336 * src/insets/inset.C (ConvertFont): constify signature
2338 * src/insets/Makefile.am (libinsets_la_SOURCES): add
2339 insetcaption.[Ch] and insetsection.[Ch]
2341 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
2342 uses to use LABEL_COUNTER_CHAPTER instead.
2343 * src/text2.C (SetCounter): here
2345 * src/counters.h: new file
2346 * src/counters.C: new file
2347 * src/Sectioning.h: new file
2348 * src/Sectioning.C: new file
2350 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
2352 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2354 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
2357 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
2360 2000-07-17 Juergen Vigna <jug@sad.it>
2362 * src/tabular.C (Validate): check if array-package is needed.
2363 (SetVAlignment): added support for vertical alignment.
2364 (SetLTFoot): better support for longtable header/footers
2365 (Latex): modified to support added features.
2367 * src/LaTeXFeatures.[Ch]: added array-package.
2369 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
2371 * src/lyx_gui.C (LyXGUI): make sure that the height is large
2374 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
2376 * configure.in: do not forget to put a space after -isystem.
2378 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
2380 * lib/kbd/arabic.kmap: a few fixes.
2382 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2384 * some whitespace chagnes to a number of files.
2386 * src/support/DebugStream.h: change to make it easier for
2387 doc++ to parse correctly.
2388 * src/support/lyxstring.h: ditto
2390 * src/mathed/math_utils.C (compara): change to have only one
2392 (MathedLookupBOP): change because of the above.
2394 * src/mathed/math_delim.C (math_deco_compare): change to have only
2396 (search_deco): change becasue of the above.
2398 * src/insets/insettabular.C (DrawCellSelection): use std::swap
2399 instead of manually coded one.
2401 * src/insets/insetquotes.C (Read): read the \end_inset too
2403 * src/insets/insetlatex.h: remove file
2404 * src/insets/insetlatex.C: remove file
2406 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
2408 (InsetPrintIndex): remove destructor
2410 * src/insets/insetinclude.h: remove default constructor
2412 * src/insets/insetfloat.C: work to make it work better
2414 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
2416 * src/insets/insetcite.h (InsetCitation): remove default constructor
2418 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
2420 * src/text.C (GetColumnNearX): comment out some currently unused code.
2422 * src/paragraph.C (writeFile): move some initializations closer to
2424 (CutIntoMinibuffer): small change to use new matchIT operator
2428 (InsertInset): ditto
2431 (InsetIterator): ditto
2432 (Erase): small change to use new matchFT operator
2434 (GetFontSettings): ditto
2435 (HighestFontInRange): ditto
2438 * src/lyxparagraph.h: some chars changed to value_type
2439 (matchIT): because of some stronger checking (perhaps too strong)
2440 in SGI STL, the two operator() unified to one.
2443 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
2445 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
2446 the last inset read added
2447 (parseSingleLyXformat2Token): some more (future) compability code added
2448 (parseSingleLyXformat2Token): warning about solitary \end_inset added
2449 (parseSingleLyXformat2Token): set last_inset_read
2450 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2451 (parseSingleLyXformat2Token): don't double intializw string next_token
2453 * src/TextCache.C (text_fits::operator()): add const's to the signature
2454 (has_buffer::operator()): ditto
2456 * src/Floating.h: add some comments on the class
2458 * src/FloatList.[Ch] (typeExist): new method
2461 * src/BackStack.h: added default constructor, wanted by Gcc.
2463 2000-07-14 Juergen Vigna <jug@sad.it>
2465 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
2467 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
2469 * src/insets/insettabular.C (resizeLyXText): need this to be able to
2470 do a redraw when the window is resized!
2471 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
2473 * src/insets/insettext.C (resizeLyXText): added function to correctly
2474 being able to resize the LyXWindow.
2476 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
2478 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
2480 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
2481 crashes when closing dialog to a deleted inset.
2483 * src/insets/insetcite.[Ch] (Edit) : the return of this former
2484 method! Now similar to other insets.
2486 2000-07-13 Juergen Vigna <jug@sad.it>
2488 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
2490 * lib/examples/Literate.lyx: small patch!
2492 * src/insets/insetbib.C (Read): added this function because of wrong
2493 Write (without [begin|end]_inset).
2495 2000-07-11 Juergen Vigna <jug@sad.it>
2497 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
2498 as the insertInset could not be good!
2500 * src/screen.C (ToggleSelection): fixed toggle selection bug as
2501 the bool param should not be last.
2503 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2505 * sigc++/configure.in: fix bug in threading-related code (Yes, I
2506 did submit that to Karl).
2508 * configure.in: use -isystem instead of -I for X headers. This
2509 fixes a problem on solaris with a recent gcc;
2510 put the front-end code after the X detection code;
2511 configure in sigc++ before lib/
2513 * src/lyx_main.C (commandLineHelp): remove -display from command
2516 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
2518 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
2519 Also put in Makefile rules for building the ``listerrors''
2520 program for parsing errors from literate programs written in LyX.
2522 * lib/build-listerrors: Added small shell script as part of compile
2523 process. This builds a working ``listerrors'' binary if noweb is
2524 installed and either 1) the VNC X server is installed on the machine,
2525 or 2) the user is compiling from within a GUI. The existence of a GUI
2526 is necessary to use the ``lyx --export'' feature for now. This
2527 hack can be removed once ``lyx --export'' no longer requires a GUI to
2530 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
2532 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
2533 now passed back correctly from gcc and placed "under" error
2534 buttons in a Literate LyX source.
2536 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2538 * src/text.C (GetColumnNearX): Better behavior when a RTL
2539 paragraph is ended by LTR text.
2541 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
2544 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2546 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
2547 true when clipboard is empty.
2549 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2551 * text.C (Backspace): Prevent rebreaking of a row if it is the last
2552 row of the paragraph.
2553 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
2554 to prevent calculation of bidi tables
2556 2000-07-07 Juergen Vigna <jug@sad.it>
2558 * src/screen.C (ToggleSelection): added y_offset and x_offset
2561 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
2564 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
2566 * src/insets/insettext.C: fixed Layout-Display!
2568 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2570 * configure.in: add check for strings.h header.
2572 * src/spellchecker.C: include <strings.h> in order to have a
2573 definition for bzero().
2575 2000-07-07 Juergen Vigna <jug@sad.it>
2577 * src/insets/insettext.C (draw): set the status of the bv->text to
2578 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
2580 * src/screen.C (DrawOneRow):
2581 (DrawFromTo): redraw the actual row if something has changed in it
2584 * src/text.C (draw): call an update of the toplevel-inset if something
2585 has changed inside while drawing.
2587 * src/lyxtext.h: added CHANGED_IN_DRAW status.
2589 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
2591 * src/insets/insetbib.[Ch] (callback) new method, moving callback
2592 processing inside class.
2594 * src/insets/insetindex.[Ch] (callback) new method, moving callback
2595 processing inside class.
2597 * src/insets/insetindex.h new struct Holder, consistent with other
2600 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
2601 citation dialog from main code and placed it in src/frontends/xforms.
2602 Dialog launched through signals instead of callbacks
2604 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
2606 * lyx.man: update the options description.
2608 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
2610 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
2611 handle neg values, set min width to 590, add doc about -display
2613 2000-07-05 Juergen Vigna <jug@sad.it>
2615 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
2616 calls to BufferView *.
2618 * src/insets/insettext.C (checkAndActivateInset): small fix non
2619 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
2621 * src/insets/insetcommand.C (Read): Fixed as insets should read till
2622 their \end_inset token!
2624 2000-07-04 edscott <edscott@imp.mx>
2626 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
2627 lib/lyxrc.example: added option \wheel_jump
2629 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
2631 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
2632 remove support for -width,-height,-xpos and -ypos.
2634 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
2636 * src/encoding.[Ch]: New files.
2638 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
2639 (text): Call to the underline() method only when needed.
2641 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
2643 * src/buffer.C (makeLaTeXFile): Compute automatically the input
2644 encoding(s) for the document.
2646 * src/bufferparams.C (BufferParams): Changed default value of
2649 * src/language.C (newLang): Removed.
2650 (items[]): Added encoding information for all defined languages.
2652 * src/lyx_gui.C (create_forms): Added "auto" option to the input
2653 encoding choice button.
2655 * src/lyxrc.h (font_norm_type): New member variable.
2656 (set_font_norm_type): New method.
2658 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
2659 paragraphs with different encodings.
2661 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
2662 (TransformChar): Changed to work correctly with Arabic points.
2663 (draw): Added support for drawing Arabic points.
2664 (draw): Removed code for drawing underbars (this is done by
2667 * src/support/textutils.h (IsPrintableNonspace): New function.
2669 * src/BufferView_pimpl.h: Added "using SigC::Object".
2670 * src/LyXView.h: ditto.
2672 * src/insets/insetinclude.h (include_label): Changed to mutable.
2674 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
2676 * src/mathed/math_iter.h: remove empty destructor
2678 * src/mathed/math_cursor.h: remove empty destructor
2680 * src/insets/lyxinset.h: add THEOREM_CODE
2682 * src/insets/insettheorem.[Ch]: new files
2684 * src/insets/insetminipage.C: (InsertInset): remove
2686 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
2688 (InsertInset): remove
2690 * src/insets/insetlist.C: (InsertList): remove
2692 * src/insets/insetfootlike.[Ch]: new files
2694 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
2697 (InsertInset): ditto
2699 * src/insets/insetert.C: remove include Painter.h, reindent
2700 (InsertInset): move to header
2702 * src/insets/insetcollapsable.h: remove explicit from default
2703 contructor, remove empty destructor, add InsertInset
2705 * src/insets/insetcollapsable.C (InsertInset): new func
2707 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2709 * src/vspace.h: add explicit to constructor
2711 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
2712 \textcompwordmark, please test this.
2714 * src/lyxrc.C: set ascii_linelen to 65 by default
2716 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
2718 * src/commandtags.h: add LFUN_INSET_THEOREM
2720 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
2721 (makeLinuxDocFile): remove _some_ of the nice logic
2722 (makeDocBookFile): ditto
2724 * src/Painter.[Ch]: (~Painter): removed
2726 * src/LyXAction.C (init): entry for insettheorem added
2728 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
2730 (deplog): code to detect files generated by LaTeX, needs testing
2733 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2735 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
2737 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2739 * src/LaTeX.C (deplog): Add a check for files that are going to be
2740 created by the first latex run, part of the project to remove the
2743 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
2744 contents to the extension list.
2746 2000-07-04 Juergen Vigna <jug@sad.it>
2748 * src/text.C (NextBreakPoint): added support for needFullRow()
2750 * src/insets/lyxinset.h: added needFullRow()
2752 * src/insets/insetcollapsable.C: redone now this uses a text-inset
2755 * src/insets/insettext.C: lots of changes for update!
2757 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
2759 * src/LaTeXFeatures.h: add a missing std:: qualifier.
2761 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
2763 * src/insets/insetinclude.C (InsetInclude): fixed
2764 initialization of include_label.
2765 (unique_id): now returns a string.
2767 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
2769 * src/LaTeXFeatures.h: new member IncludedFiles, for
2770 a map of key, included file name.
2772 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
2773 with the included files for inclusion in SGML preamble,
2774 i. e., linuxdoc and docbook.
2777 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
2778 nice (is the generated linuxdoc code to be exported?), that
2779 allows to remove column, and only_body that will be true for
2780 slave documents. Insets are allowed inside SGML font type.
2781 New handling of the SGML preamble for included files.
2782 (makeDocBookFile): the same for docbook.
2784 * src/insets/insetinclude.h:
2785 * src/insets/insetinclude.C (Validate): keeps a list of included files.
2787 (DocBook): new export methods.
2789 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
2790 and makeDocBookFile.
2792 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
2793 formats to export with command line argument -x.
2795 2000-06-29 Juergen Vigna <jug@sad.it>
2797 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
2798 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
2800 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
2801 region could already been cleared by an inset!
2803 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2805 * src/BufferView_pimpl.h: remove member variables lyx_focus and
2808 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
2810 (cursorToggle): remove special handling of lyx focus.
2812 2000-06-28 Juergen Vigna <jug@sad.it>
2814 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
2817 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2819 * src/insets/insetindex.C (Edit): add a callback when popup is
2822 * src/insets/insettext.C (LocalDispatch):
2823 * src/insets/insetmarginal.h:
2824 * src/insets/insetlist.h:
2825 * src/insets/insetfoot.h:
2826 * src/insets/insetfloat.h:
2827 * src/insets/insetert.h: add a missing std:: qualifier.
2829 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2831 * src/support/lyxsum.C (sum): '\0' teminate file read when using
2834 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
2836 * src/insets/insettext.C (Read): remove tmptok unused variable
2837 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
2838 (InsertInset): change for new InsetInset code
2840 * src/insets/insettext.h: add TEXT inline method
2842 * src/insets/insettext.C: remove TEXT macro
2844 * src/insets/insetmarginal.C (Write): new method
2845 (Latex): change output slightly
2847 * src/insets/insetfoot.C (Write): new method
2848 (Latex): change output slightly (don't use endl when no need)
2850 * src/insets/insetert.C (Write): new method
2852 * src/insets/insetcollapsable.h: make button_length, button_top_y
2853 and button_bottm_y protected.
2855 * src/insets/insetcollapsable.C (Write): simplify code by using
2856 tostr. Also do not output the float name, the children class
2857 should to that to get control over own arguments
2859 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
2860 src/insets/insetminipage.[Ch]:
2863 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2865 * src/lyxfunc.C (Dispatch): cases for new insets/commands
2867 * src/Makefile.am (lyx_SOURCES): add the new files
2869 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
2870 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
2871 * src/commandtags.h: ditto
2873 * src/LaTeXFeatures.h: add a std::set of used floattypes
2875 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
2877 * src/FloatList.[Ch] src/Floating.h: new files
2879 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
2881 * src/lyx_cb.C (TableApplyCB): ditto
2883 * src/text2.C: ditto
2884 * src/buffer.C (SimpleLinuxDocOnePar): ditto
2885 (parseSingleLyXformat2Token): ditto + add code for
2886 backwards compability for old float styles + add code for new insets
2888 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
2890 (InsertInset(size_type, Inset *, LyXFont)): new method
2891 (InsetChar(size_type, char)): changed to use the other InsetChar
2892 with a LyXFont(ALL_INHERIT).
2893 (InsetInset(size_type, Inset*)): changed to use InsetChar to
2894 insert the META_INSET.
2896 * sigc++/thread.cc (Privete<int>::operator int&): move definition
2898 * sigc++/thread.h (Threads): from here
2900 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
2901 definition out of line
2902 * sigc++/scope.h: from here
2904 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2906 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
2907 is specified (adapted from a patch from edscott <edscott@imp.mx>).
2909 * Makefile.am (bindist): new target.
2911 * INSTALL: add instructions for doing a binary distribution.
2913 * development/tools/README.bin.example: update a bit.
2915 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
2918 * lib/lyxrc.example: new lyxrc tag \set_color.
2920 * src/lyxfunc.C (Dispatch):
2921 * src/commandtags.h:
2922 * src/LyXAction.C: new lyxfunc "set-color".
2924 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
2925 and an x11name given as strings.
2927 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
2928 cache when a color is changed.
2930 2000-06-26 Juergen Vigna <jug@sad.it>
2932 * src/lyxrow.C (width): added this functions and variable.
2934 * src/insets/insetcite.C (create_form_citation_form): some Gravity
2937 * src/text.C (SetHeightOfRow): fixed calcualting of width.
2939 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2941 * images/undo_bw.xpm: new icon.
2942 * images/redo_bw.xpm: ditto.
2944 * configure.in (INSTALL_SCRIPT): change value to
2945 ${INSTALL} to avoid failures of install-script target.
2946 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
2948 * src/BufferView.h: add a magic "friend" declaration to please
2951 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
2953 * forms/cite.fd: modified to allow resizing without messing
2956 * src/insetcite.C: Uses code from cite.fd almost without
2958 User can now resize dialog in the x-direction.
2959 Resizing the dialog in the y-direction is prevented, as the
2960 code does this intelligently already.
2962 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2964 * INSTALL: remove obsolete entry in "problems" section.
2966 * lib/examples/sl_*.lyx: update of the slovenian examples.
2968 * src/support/FileInfo.[Ch] (getBlockSize): remove.
2970 2000-06-23 Juergen Vigna <jug@sad.it>
2972 * src/lyxtext.h: added a 'cleared' flag to draw() function.
2974 * src/buffer.C (resize): delete the LyXText of textinsets.
2976 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
2978 * src/insets/lyxinset.h: added another parameter 'cleared' to
2979 the draw() function.
2981 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
2982 unlocking inset in inset.
2984 2000-06-22 Juergen Vigna <jug@sad.it>
2986 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
2987 of insets and moved first to LyXText.
2989 * src/mathed/formulamacro.[Ch]:
2990 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
2992 2000-06-21 Juergen Vigna <jug@sad.it>
2994 * src/text.C (GetVisibleRow): look if I should clear the area or not
2995 using Inset::doClearArea() function.
2997 * src/insets/lyxinset.h: added doClearArea() function and
2998 modified draw(Painter &, ...) to draw(BufferView *, ...)
3000 * src/text2.C (UpdateInset): return bool insted of int
3002 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
3004 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
3005 combox in the character popup
3007 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
3008 BufferParams const & params
3010 2000-06-20 Juergen Vigna <jug@sad.it>
3012 * src/insets/insettext.C (SetParagraphData): set insetowner on
3015 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3017 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
3018 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
3020 (form_main_): remove
3022 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
3023 (create_form_form_main): remove FD_form_main stuff, connect to
3024 autosave_timeout signal
3026 * src/LyXView.[Ch] (getMainForm): remove
3027 (UpdateTimerCB): remove
3028 * src/BufferView_pimpl.h: inherit from SigC::Object
3030 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
3031 signal instead of callback
3033 * src/BufferView.[Ch] (cursorToggleCB): remove
3035 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3037 * src/BufferView_pimpl.C: changes because of the one below
3039 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
3040 instead of storing a pointer to a LyXText.
3042 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
3044 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
3046 * src/lyxparagraph.h
3048 * src/paragraph.C: Changed fontlist to a sorted vector.
3050 2000-06-19 Juergen Vigna <jug@sad.it>
3052 * src/BufferView.h: added screen() function.
3054 * src/insets/insettext.C (LocalDispatch): some selection code
3057 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
3059 * src/insets/insettext.C (SetParagraphData):
3061 (InsetText): fixes for multiple paragraphs.
3063 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
3065 * development/lyx.spec.in: Call configure with ``--without-warnings''
3066 to work around a bug with the Makefiles when doing ``make lyxrpm''.
3067 This should be fine, however, since we generally don't want to be
3068 verbose when making an RPM.
3070 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
3072 * lib/scripts/fig2pstex.py: New file
3074 2000-06-16 Juergen Vigna <jug@sad.it>
3076 * src/insets/insettabular.C (UpdateLocal):
3077 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
3078 (LocalDispatch): Changed all functions to use LyXText.
3080 2000-06-15 Juergen Vigna <jug@sad.it>
3082 * src/text.C (SetHeightOfRow): call inset::update before requesting
3085 * src/insets/insettext.C (update):
3086 * src/insets/insettabular.C (update): added implementation
3088 * src/insets/lyxinset.h: added update function
3090 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3092 * src/text.C (SelectNextWord): protect against null pointers with
3093 old-style string streams. (fix from Paul Theo Gonciari
3096 * src/cite.[Ch]: remove erroneous files.
3098 * lib/configure.m4: update the list of created directories.
3100 * src/lyxrow.C: include <config.h>
3101 * src/lyxcursor.C: ditto.
3103 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3105 * lib/examples/decimal.lyx: new example file from Mike.
3107 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
3108 to find template definitions (from Dekel)
3110 * src/frontends/.cvsignore: add a few things.
3112 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
3114 * src/Timeout.C (TimeOut): remove default argument.
3116 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
3119 * src/insets/ExternalTemplate.C: add a "using" directive.
3121 * src/lyx_main.h: remove the act_ struct, which seems unused
3124 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
3126 * LyX Developers Meeting: All files changed, due to random C++ (by
3127 coincidence) code generator script.
3129 - external inset (cool!)
3130 - initial online editing of preferences
3131 - insettabular breaks insettext(s contents)
3133 - some DocBook fixes
3134 - example files update
3135 - other cool stuff, create a diff and look for yourself.
3137 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
3139 * src/insets/insettext.C (computeTextRows): if the maxWidth is
3140 -1 this is a non-line-breaking textinset.
3142 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
3143 if there is no width set.
3145 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
3147 * Lots of files: Merged the dialogbase branch.
3149 2000-06-09 Allan Rae <rae@lyx.org>
3151 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
3152 and the Dispatch methods that used it.
3154 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
3155 access to functions formerly kept in Dispatch.
3157 2000-05-19 Allan Rae <rae@lyx.org>
3159 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
3160 made to_page and count_copies integers again. from_page remains a
3161 string however because I want to allow entry of a print range like
3162 "1,4,22-25" using this field.
3164 * src/LyXAction.C: added action info and commands for buffer-print-xtl
3165 and printer-params-get. These aren't useful from the minibuffer but
3166 could be used by a script/LyXServer app provided it passes a suitable
3167 auto_mem_buffer. I guess I should take a look at how the LyXServer
3168 works and make it support xtl buffers.
3170 * sigc++/: updated to libsigc++-1.0.1
3172 * src/xtl/: updated to xtl-1.3.pl.11
3174 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
3175 those changes done to the files in src/ are actually recreated when
3176 they get regenerated. Please don't ever accept a patch that changes a
3177 dialog unless that patch includes the changes to the corresponding *.fd
3180 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
3181 stringOnlyContains, renamed it and generalised it.
3183 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
3184 branch. Removed the remaining old form_print code.
3186 2000-04-26 Allan Rae <rae@lyx.org>
3188 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
3189 trap I was trying to fix with the ID: fields in src/xtl/ :-)
3191 2000-04-25 Allan Rae <rae@lyx.org>
3193 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
3194 against a base of xtl-1.3.pl.4
3196 * development/tools/lxtl.sh: fixed a couple of silly typos and now
3197 filter the Id: entries so they still show the xtl version number
3200 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
3201 into the src/xtl code. Patch still pending with José (XTL)
3203 2000-04-24 Allan Rae <rae@lyx.org>
3205 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
3206 both more generic and much safer. Use the new template functions.
3207 * src/buffer.[Ch] (Dispatch): ditto.
3209 * src/frontends/xforms/FormPrint.C (update): Use new template functions
3210 and mem buffer more intelligently. Also a little general cleanup.
3213 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
3214 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
3215 * src/xtl/Makefile.am: ditto.
3216 * src/xtl/.cvsignore: ditto.
3217 * src/Makefile.am: ditto.
3219 * src/PrinterParams.h: Removed the macros member functions. Added a
3220 testInvariant member function. A bit of tidying up and commenting.
3221 Included Angus's idea for fixing operation with egcs-1.1.2.
3223 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
3224 cool expansion of XTL's mem_buffer to support automatic memory
3225 management within the buffer itself. Removed the various macros and
3226 replaced them with template functions that use either auto_mem_buffer
3227 or mem_buffer depending on a #define. The mem_buffer support will
3228 disappear as soon as the auto_mem_buffer is confirmed to be good on
3229 other platforms/compilers. That is, it's there so you've got something
3232 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
3233 effectively forked XTL. However I expect José will include my code
3234 into the next major release. Also fixed a memory leak.
3235 * src/xtl/text.h: ditto.
3236 * src/xtl/xdr.h: ditto.
3237 * src/xtl/giop.h: ditto.
3239 2000-04-16 Allan Rae <rae@lyx.org>
3241 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
3242 by autogen.sh and removed by maintainer-clean anyway.
3243 * .cvsignore, sigc++/.cvsignore: Support the above.
3245 * sigc++/.cvsignore: Forgot that retbind.h was generated.
3247 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
3249 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
3250 macros, renamed static callback-target member functions to suit new
3251 scheme and made them public.
3252 * src/frontends/xforms/forms/form_print.fd: ditto.
3253 * src/frontends/xforms/forms/form_copyright.fd: ditto.
3255 * src/support/lxtl.h: small cleanup to use typedef instead of #define
3258 * src/xtl/: New directory containing a minimal distribution of XTL.
3259 This is XTL-1.3.pl.4.
3261 * development/tools/lxtl.sh: A script to generate the above mini-dist.
3263 2000-04-15 Allan Rae <rae@lyx.org>
3265 * development/tools/makeLyXsigc.sh: Remove the library version numbers
3267 * sigc++/: Updated to libsigc++-1.0.0
3269 2000-04-14 Allan Rae <rae@lyx.org>
3271 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
3272 use the generic ones in future. I'll modify my conversion script.
3274 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
3276 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
3277 (CloseAllBufferRelatedDialogs): Renamed.
3278 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
3280 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
3281 of the generic ones. These are the same ones my conversion script
3284 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
3285 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
3286 * src/buffer.C (Dispatch): ditto
3288 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
3289 functions for updating and hiding buffer dependent dialogs.
3290 * src/BufferView.C (buffer): ditto
3291 * src/buffer.C (setReadonly): ditto
3292 * src/lyxfunc.C (CloseBuffer): ditto
3294 * src/buffer.h: Take setReadonly() out of line so I don't have to include
3295 Dialogs.h, and hence all the SigC stuff, into every file that includes
3296 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
3298 * src/BufferView2.C: reduce the number of headers included by buffer.h
3300 2000-04-11 Allan Rae <rae@lyx.org>
3302 * src/frontends/xforms/xform_macros.h: A small collection of macros
3303 for building C callbacks.
3305 * src/frontends/xforms/Makefile.am: Added above file.
3307 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
3308 scheme again. This time it should work for JMarc. If this is
3309 successful I'll revise my conversion script to automate some of this.
3310 The static member functions in the class also have to be public for
3311 this scheme will work. If the scheme works (it's almost identical to
3312 the way BufferView::cursorToggleCB is handled so it should work) then
3313 FormCopyright and FormPrint will be ready for inclusion into the main
3314 trunk immediately after 1.1.5 is released -- provided we're prepared
3315 for complaints about lame compilers not handling XTL.
3317 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
3319 2000-04-07 Allan Rae <rae@lyx.org>
3321 * config/lyxinclude.m4: A bit more tidying up (Angus)
3323 * src/LString.h: JMarc's <string> header fix
3325 * src/PrinterParams.h: Used string for most data to remove some
3326 ugly code in the Print dialog and avoid even uglier code when
3327 appending the ints to a string for output.
3329 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
3330 and moved "default:" back to the end of switch statement. Cleaned
3331 up the printing so it uses the right function calls and so the
3332 "print to file" option actually puts the file in the right directory.
3334 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
3336 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
3337 and Ok+Apply button control into a separate method: input (Angus).
3338 (input) Cleaned it up and improved it to be very thorough now.
3339 (All CB) static_cast used instead of C style cast (Angus). This will
3340 probably change again once we've worked out how to keep gcc-2.8.1 happy
3341 with real C callbacks.
3342 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
3343 ignore some of the bool settings and has random numbers instead. Needs
3344 some more investigation. Added other input length checks and checking
3345 of file and printer names.
3347 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
3348 would link (Angus). Seems the old code doesn't compile with the pragma
3349 statement either. Separated callback entries from internal methods.
3351 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
3353 2000-03-17 Allan Rae <rae@lyx.org>
3355 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
3356 need it? Maybe it could go in Dialogs instead? I could make it a
3357 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
3358 values to get the bool return value.
3359 (Dispatch): New overloaded method for xtl support.
3361 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
3362 extern "C" callback instead of static member functions. Hopefully,
3363 JMarc will be able to compile this. I haven't changed
3364 forms/form_copyright.fd yet. Breaking one of my own rules already.
3366 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
3367 because they aren't useful from the minibuffer. Maybe a LyXServer
3368 might want a help message though?
3370 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
3372 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
3373 xtl which needs both rtti and exceptions.
3375 * src/support/Makefile.am:
3376 * src/support/lxtl.h: New file. Some helper macros for using XTL.
3378 * src/frontends/xforms/input_validators.[ch]: input filters and
3379 validators. These conrol what keys are valid in input boxes.
3380 Use them and write some more. Much better idea than waiting till
3381 after the user has pressed Ok to say that the input fields don't make
3384 * src/frontends/xforms/Makefile.am:
3385 * src/frontends/xforms/forms/form_print.fd:
3386 * src/frontends/xforms/forms/makefile:
3387 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
3388 new scheme. Still have to make sure I haven't missed anything from
3389 the current implementation.
3391 * src/Makefile.am, src/PrinterParams.h: New data store.
3393 * other files: Added a couple of copyright notices.
3395 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3397 * src/insets/insetbib.h: move Holder struct in public space.
3399 * src/frontends/include/DialogBase.h: use SigC:: only when
3400 SIGC_CXX_NAMESPACES is defined.
3401 * src/frontends/include/Dialogs.h: ditto.
3403 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
3405 * src/frontends/xforms/FormCopyright.[Ch]: do not
3406 mention SigC:: explicitely.
3408 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3410 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
3411 deals with testing KDE in main configure.in
3412 * configure.in: ditto.
3414 2000-02-22 Allan Rae <rae@lyx.org>
3416 * Lots of files: Merged from HEAD
3418 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
3419 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
3421 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
3423 * sigc++/: new minidist.
3425 2000-02-14 Allan Rae <rae@lyx.org>
3427 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
3429 2000-02-08 Juergen Vigna <jug@sad.it>
3431 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
3432 file for the buildin GUI builder of KDevelop of the copyright-dialog.
3434 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
3435 for this port and so it is much easier for other people to port
3436 dialogs in a common development environment.
3438 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
3439 the QT/KDE implementation.
3441 * src/frontends/kde/Dialogs.C:
3442 * src/frontends/kde/FormCopyright.C:
3443 * src/frontends/kde/FormCopyright.h:
3444 * src/frontends/kde/Makefile.am:
3445 * src/frontends/kde/formcopyrightdialog.C:
3446 * src/frontends/kde/formcopyrightdialog.h:
3447 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
3448 for the kde support of the Copyright-Dialog.
3450 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3451 subdir-substitution instead of hardcoded 'xforms' as we now have also
3454 * src/frontends/include/DialogBase.h (Object): just commented the
3455 label after #endif (nasty warning and I don't like warnings ;)
3457 * src/main.C (main): added KApplication initialization if using
3460 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
3461 For now only the KDE event-loop is added if frontend==kde.
3463 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
3465 * configure.in: added support for the --with-frontend[=value] option
3467 * autogen.sh: added kde.m4 file to list of config-files
3469 * acconfig.h: added define for KDEGUI-support
3471 * config/kde.m4: added configuration functions for KDE-port
3473 * config/lyxinclude.m4: added --with-frontend[=value] option with
3474 support for xforms and KDE.
3476 2000-02-08 Allan Rae <rae@lyx.org>
3478 * all Makefile.am: Fixed up so the make targets dist, distclean,
3479 install and uninstall all work even if builddir != srcdir. Still
3480 have a new sigc++ minidist update to come.
3482 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
3484 2000-02-01 Allan Rae <rae@lyx.org>
3486 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
3487 Many mods to get builddir != srcdir working.
3489 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
3490 for building on NT and so we can do the builddir != srcdir stuff.
3492 2000-01-30 Allan Rae <rae@lyx.org>
3494 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
3495 This will stay in "rae" branch. We probably don't really need it in
3496 the main trunk as anyone who wants to help programming it should get
3497 a full library installed also. So they can check both included and
3498 system supplied library compilation.
3500 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
3501 Added a 'mini' distribution of libsigc++. If you feel the urge to
3502 change something in these directories - Resist it. If you can't
3503 resist the urge then you should modify the following script and rebuild
3504 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
3505 all happen. Still uses a hacked version of libsigc++'s configure.in.
3506 I'm quite happy with the results. I'm not sure the extra work to turn
3507 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
3508 worth the trouble and would probably lead to extra maintenance
3510 I haven't tested the following important make targets: install, dist.
3511 Not ready for prime time but very close. Maybe 1.1.5.
3513 * development/tools/makeLyXsigc.sh: A shell script to automatically
3514 generate our mini-dist of libsigc++. It can only be used with a CVS
3515 checkout of libsigc++ not a tarball distribution. It's well commented.
3516 This will end up as part of the libsigc++ distribution so other apps
3517 can easily have an included mini-dist. If someone makes mods to the
3518 sigc++ subpackage without modifying this script to generate those
3519 changes I'll be very upset!
3521 * src/frontends/: Started the gui/system indep structure.
3523 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
3524 to access the gui-indep dialogs are in this class. Much improved
3525 design compared to previous revision. Lars, please refrain from
3526 moving this header into src/ like you did with Popups.h last time.
3528 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
3530 * src/frontends/xforms/: Started the gui-indep system with a single
3531 dialog: FormCopyright. Initial testing of use of libsigc++ was very
3534 * src/frontends/xforms/forms: Repository for the xforms .fd files.
3535 Here you'll find a very useful makefile and automated fdfix.sh that
3536 makes updating dailogs a no-brainer -- provided you follow the rules
3537 set out in the README. I'm thinking about adding another script to
3538 automatically generate skeleton code for a new dialog given just the
3541 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
3542 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
3543 Made FormCopyright gui-indep and added a lyxfunc to get to it.
3545 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
3547 * src/support/LSubstring.C (operator): simplify
3549 * src/lyxtext.h: removed bparams, use buffer_->params instead
3551 * src/lyxrow.h: make Row a real class, move all variables to
3552 private and use accessors.
3554 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
3556 (isRightToLeftPar): ditto
3557 (ChangeLanguage): ditto
3558 (isMultiLingual): ditto
3561 (SimpleTeXOnePar): ditto
3562 (TeXEnvironment): ditto
3563 (GetEndLabel): ditto
3565 (SetOnlyLayout): ditto
3566 (BreakParagraph): ditto
3567 (BreakParagraphConservative): ditto
3568 (GetFontSettings): ditto
3570 (CopyIntoMinibuffer): ditto
3571 (CutIntoMinibuffer): ditto
3572 (PasteParagraph): ditto
3573 (SetPExtraType): ditto
3574 (UnsetPExtraType): ditto
3575 (DocBookContTableRows): ditto
3576 (SimpleDocBookOneTablePar): ditto
3578 (TeXFootnote): ditto
3579 (SimpleTeXOneTablePar): ditto
3580 (TeXContTableRows): ditto
3581 (SimpleTeXSpecialChars): ditto
3584 * src/lyxcursor.h: make LyXCursor a real class, move all variables
3585 to private and use accessors.
3587 * src/lyx_cb.C: remove char updatetimer, and all code that uses
3588 this, we did not use it anymore and has not been for ages. Just a
3589 waste of cpu cycles.
3591 * src/language.h: make Language a real class, move all variables
3592 to private and use accessors.
3594 * src/BufferView_pimpl.C (Pimpl): use new timer code.
3595 (create_view): remove
3596 (update): some changes for new timer
3597 (cursorToggle): use new timer
3598 (beforeChange): change for new timer
3600 * src/BufferView.h (cursorToggleCB): removed last paramter because
3603 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
3604 (cursorToggleCB): change because of new timer code
3606 * lib/CREDITS: updated own mailaddress
3608 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3610 * src/support/filetools.C (PutEnv): fix the code in case neither
3611 putenv() nor setenv() have been found.
3613 * INSTALL: mention the install-strip Makefile target.
3615 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
3616 read-only documents.
3618 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3620 * lib/reLyX/configure.in (VERSION): avoid using a previously
3621 generated reLyX wrapper to find out $prefix.
3623 * lib/examples/eu_adibide_lyx-atua.lyx:
3624 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
3625 translation of the Tutorial (Dooteo)
3627 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
3629 * forms/cite.fd: new citation dialog
3631 * src/insetcite.[Ch]: the new citation dialog is moved into
3634 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
3637 * src/insets/insetcommand.h: data members made private.
3639 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3641 * LyX 1.1.5 released
3643 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3645 * src/version.h (LYX_RELEASE): to 1.1.5
3647 * src/spellchecker.C (RunSpellChecker): return false if the
3648 spellchecker dies upon creation.
3650 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3652 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
3653 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
3657 * lib/CREDITS: update entry for Martin Vermeer.
3659 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
3661 * src/text.C (draw): Draw foreign language bars at the bottom of
3662 the row instead of at the baseline.
3664 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
3666 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3668 * lib/bind/de_menus.bind: updated
3670 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3672 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
3674 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3676 * src/menus.C (Limit_string_length): New function
3677 (ShowTocMenu): Limit the number of items/length of items in the
3680 * src/paragraph.C (String): Correct result for a paragraph inside
3683 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3685 * src/bufferlist.C (close): test of buf->getuser() == NULL
3687 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
3689 * src/BufferView2.C (removeAutoInsets): Fix a bug:
3690 Do not call to SetCursor when the paragraph is a closed footnote!
3692 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
3694 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
3697 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
3699 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3702 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
3703 reference popup, that activates the reference-back action
3705 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
3707 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
3708 the menus. Also fixed a bug.
3710 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
3711 the math panels when switching buffers (unless new buffer is readonly).
3713 * src/BufferView.C (NoSavedPositions)
3714 * src/BufferView_pimpl.C (NoSavedPositions): New methods
3716 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3718 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
3719 less of dvi dirty or not.
3721 * src/trans_mgr.[Ch] (insert): change first parameter to string
3724 * src/chset.[Ch] (encodeString): add const to first parameter
3726 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3728 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
3732 * src/LaTeX.C (deplog): better searching for dependency files in
3733 the latex log. Uses now regexps.
3735 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
3736 instead of the box hack or \hfill.
3738 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3740 * src/lyxfunc.C (doImportHelper): do not create the file before
3741 doing the actual import.
3742 (doImportASCIIasLines): create a new file before doing the insert.
3743 (doImportASCIIasParagraphs): ditto.
3745 * lib/lyxrc.example: remove mention of non-existing commands
3747 * lyx.man: remove mention of color-related switches.
3749 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
3751 * src/lyx_gui.C: remove all the color-related ressources, which
3752 are not used anymore.
3754 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
3757 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3759 * src/lyxrc.C (read): Add a missing break in the switch
3761 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
3763 * src/text2.C (InsertStringA): Fix a bug with insertion into table
3765 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
3768 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3770 * src/text.C (draw): draw bars under foreign language words.
3772 * src/LColor.[Ch]: add LColor::language
3774 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3776 * src/lyxcursor.h (boundary): New member variable
3778 * src/text.C (IsBoundary): New methods
3780 * src/text.C: Use the above for currect cursor movement when there
3781 is both RTL & LTR text.
3783 * src/text2.C: ditto
3785 * src/bufferview_funcs.C (ToggleAndShow): ditto
3787 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3789 * src/text.C (DeleteLineForward): set selection to true to avoid
3790 that DeleteEmptyParagraphMechanism does some magic. This is how it
3791 is done in all other functions, and seems reasonable.
3792 (DeleteWordForward): do not jump over non-word stuff, since
3793 CursorRightOneWord() already does it.
3795 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
3796 DeleteWordBackward, since they seem safe to me (since selection is
3797 set to "true") DeleteEmptyParagraphMechanism does nothing.
3799 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3801 * src/lyx_main.C (easyParse): simplify the code by factoring the
3802 part that removes parameters from the command line.
3803 (LyX): check wether wrong command line options have been given.
3805 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
3807 * src/lyx_main.C : add support for specifying user LyX
3808 directory via command line option -userdir.
3810 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
3812 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
3813 the number of items per popup.
3814 (Add_to_refs_menu): Ditto.
3816 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3818 * src/lyxparagraph.h: renamed ClearParagraph() to
3819 StripLeadingSpaces() and moved it to paragraph.C. We pass the
3820 textclass as parameter, and do nothing if free_spacing is
3821 true. This fixes part of the line-delete-forward problems.
3823 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
3824 (pasteSelection): ditto.
3825 (SwitchLayoutsBetweenClasses): more translatable strings.
3827 * src/text2.C (CutSelection): use StripLeadingSpaces.
3828 (PasteSelection): ditto.
3829 (DeleteEmptyParagraphMechanism): ditto.
3831 2000-05-26 Juergen Vigna <jug@sad.it>
3833 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
3834 is not needed in tabular insets.
3836 * src/insets/insettabular.C (TabularFeatures): added missing features.
3838 * src/tabular.C (DeleteColumn):
3840 (AppendRow): implemented this functions
3841 (cellsturct::operator=): clone the inset too;
3843 2000-05-23 Juergen Vigna <jug@sad.it>
3845 * src/insets/insettabular.C (LocalDispatch): better selection support
3846 when having multicolumn-cells.
3848 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3850 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
3852 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3854 * src/ColorHandler.C (getGCForeground): put more test into _()
3856 * lib/examples/eu_splash.lyx: new file (Basque translation) from
3859 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
3862 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
3864 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
3865 there are no labels, or when buffer is readonly.
3867 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
3868 there are no labels, buffer is SGML, or when buffer is readonly.
3870 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3872 * src/LColor.C (LColor): change a couple of grey40 to grey60
3873 (LColor): rewore initalization to make compiles go some magnitude
3875 (getGUIName): don't use gettext until we need the string.
3877 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
3879 * src/Bullet.[Ch]: Fixed a small bug.
3881 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
3883 * src/paragraph.C (String): Several fixes/improvements
3885 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
3887 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3889 * src/paragraph.C (String): give more correct output.
3891 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
3893 * src/lyxfont.C (stateText) Do not output the language if it is
3894 eqaul to the language of the document.
3896 * src/paragraph.C (TeXOnePar): Do not put language switch commands
3897 between two paragraphs with the same language.
3899 * src/paragraph.C (getParLanguage) Return a correct answer for an
3900 empty dummy paragraph.
3902 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
3905 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
3908 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
3909 the menus/popup, if requested fonts are unavailable.
3911 2000-05-22 Juergen Vigna <jug@sad.it>
3913 * src/insets/insettabular.C (LocalDispatch): added some more cursor
3914 movement support (Up/Down/Tab/Shift-Tab).
3915 (LocalDispatch): added also preliminari cursor-selection.
3917 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
3919 * src/paragraph.C (PasteParagraph): Hopefully now right!
3921 2000-05-22 Garst R. Reese <reese@isn.net>
3923 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
3924 of list, change all references to Environment to Command
3925 * tex/hollywood.cls : rewrite environments as commands, add
3926 \uppercase to interiorshot and exteriorshot to force uppecase.
3927 * tex/broadway.cls : rewrite environments as commands. Tweak
3930 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3932 * src/menus.C (Add_to_toc_menu): fix the code which limits the
3933 size of items: use a constant intead of the hardcoded 40, and more
3934 importantly do not remove the %m and %x tags added at the end.
3935 (Add_to_refs_menu): use vector::size_type instead of
3936 unsigned int as basic types for the variables. _Please_ do not
3937 assume that size_t is equal to unsigned int. On an alpha, this is
3938 unsigned long, which is _not_ the same.
3940 * src/language.C (initL): remove language "hungarian", since it
3941 seems that "magyar" is better.
3943 2000-05-22 Juergen Vigna <jug@sad.it>
3945 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
3947 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
3950 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
3951 next was deleted but not set to 0.
3953 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3955 * src/language.C (initL): change the initialization of languages
3956 so that compiles goes _fast_.
3958 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
3961 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
3963 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3967 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3969 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
3971 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
3975 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
3978 * src/insets/insetlo*.[Ch]: Made editable
3980 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3982 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
3983 the current selection.
3985 * src/BufferView_pimpl.C (stuffClipboard): new method
3987 * src/BufferView.C (stuffClipboard): new method
3989 * src/paragraph.C (String): new method
3991 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
3992 LColor::ignore when lyxname is not found.
3994 * src/BufferView.C (pasteSelection): new method
3996 * src/BufferView_pimpl.C (pasteSelection): new method
3998 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
4000 * src/WorkArea.C (request_clipboard_cb): new static function
4001 (getClipboard): new method
4002 (putClipboard): new method
4004 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4006 * LyX 1.1.5pre2 released
4008 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4010 * src/vspace.C (operator=): removed
4011 (operator=): removed
4013 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
4015 * src/layout.C (NumberOfClass): manually set the type in make_pair
4016 (NumberOfLayout): ditto
4018 * src/language.C: use the Language constructor for ignore_lang
4020 * src/language.h: add constructors to struct Language
4022 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
4024 * src/text2.C (SetCursorIntern): comment out #warning
4026 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
4028 * src/mathed/math_iter.h: initialize sx and sw to 0
4030 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4032 * forms/lyx.fd: Redesign of form_ref
4034 * src/LaTeXFeatures.[Ch]
4038 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
4041 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
4042 and Buffer::inset_iterator.
4044 * src/menus.C: Added new menus: TOC and Refs.
4046 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
4048 * src/buffer.C (getTocList): New method.
4050 * src/BufferView2.C (ChangeRefs): New method.
4052 * src/buffer.C (getLabelList): New method. It replaces the old
4053 getReferenceList. The return type is vector<string> instead of
4056 * src/insets/insetinclude.C (getLabelList): New method. Replaces
4057 the old getLabel() and GetNumberOfLabels() methods.
4058 * src/insets/insetlabel.C (getLabelList): ditto
4059 * src/mathed/formula.C (getLabelList): ditto
4061 * src/paragraph.C (String): New method.
4063 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
4064 Uses the new getTocList() method.
4065 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
4066 which automatically updates the contents of the browser.
4067 (RefUpdateCB): Use the new getLabelList method.
4069 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
4071 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
4073 * src/spellchecker.C: Added using std::reverse;
4075 2000-05-19 Juergen Vigna <jug@sad.it>
4077 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
4079 * src/insets/insettext.C (computeTextRows): small fix for display of
4080 1 character after a newline.
4082 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
4085 2000-05-18 Juergen Vigna <jug@sad.it>
4087 * src/insets/insettabular.C (TabularFeatures): fixed update of display
4088 when changing width of column.
4090 * src/tabular.C (set_row_column_number_info): setting of
4091 autobreak rows if necessary.
4093 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4095 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
4097 * src/vc-backend.*: renamed stat() to status() and vcstat to
4098 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
4099 compilation broke. The new name seems more relevant, anyway.
4101 2000-05-17 Juergen Vigna <jug@sad.it>
4103 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
4104 which was wrong if the removing caused removing of rows!
4106 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
4107 (pushToken): new function.
4109 * src/text2.C (CutSelection): fix problem discovered with purify
4111 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4113 * src/debug.C (showTags): enlarge the first column, now that we
4114 have 6-digits debug codes.
4116 * lib/layouts/hollywood.layout:
4117 * lib/tex/hollywood.cls:
4118 * lib/tex/brodway.cls:
4119 * lib/layouts/brodway.layout: more commands and fewer
4120 environments. Preambles moved in the .cls files. Broadway now has
4121 more options on scene numbering and less whitespace (from Garst)
4123 * src/insets/insetbib.C (getKeys): make sure that we are in the
4124 document directory, in case the bib file is there.
4126 * src/insets/insetbib.C (Latex): revert bogus change.
4128 2000-05-16 Juergen Vigna <jug@sad.it>
4130 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
4131 the TabularLayout on cursor move.
4133 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
4135 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
4138 (draw): fixed cursor position and drawing so that the cursor is
4139 visible when before the tabular-inset.
4141 * src/insets/insettext.C (init): drawLockedFrame was not initialized
4142 when creating from old insettext.
4144 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
4146 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4148 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
4149 * lib/tex/brodway.cls: ditto
4151 * lib/layouts/brodway.layout: change alignment of parenthical
4154 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4156 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
4157 versions 0.88 and 0.89 are supported.
4159 2000-05-15 Juergen Vigna <jug@sad.it>
4161 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
4164 * src/insets/insettext.C (computeTextRows): redone completely this
4165 function in a much cleaner way, because of problems when having a
4167 (draw): added a frame border when the inset is locked.
4168 (SetDrawLockedFrame): this sets if we draw the border or not.
4169 (SetFrameColor): this sets the frame color (default=insetframe).
4171 * src/insets/lyxinset.h: added x() and y() functions which return
4172 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
4173 function which is needed to see if we have a locking inset of some
4174 type in this inset (needed for now in insettabular).
4176 * src/vspace.C (inPixels): the same function also without a BufferView
4177 parameter as so it is easier to use it in some ocasions.
4179 * src/lyxfunc.C: changed all places where insertInset was used so
4180 that now if it couldn't be inserted it is deleted!
4182 * src/TabularLayout.C:
4183 * src/TableLayout.C: added support for new tabular-inset!
4185 * src/BufferView2.C (insertInset): this now returns a bool if the
4186 inset was really inserted!!!
4188 * src/tabular.C (GetLastCellInRow):
4189 (GetFirstCellInRow): new helper functions.
4190 (Latex): implemented for new tabular class.
4194 (TeXTopHLine): new Latex() helper functions.
4196 2000-05-12 Juergen Vigna <jug@sad.it>
4198 * src/mathed/formulamacro.C (Read):
4199 * src/mathed/formula.C (Read): read also the \end_inset here!
4201 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4203 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
4204 crush when saving formulae with unbalanced parenthesis.
4206 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
4208 * src/layout.C: Add new keyword "endlabelstring" to layout file
4210 * src/text.C (GetVisibleRow): Draw endlabel string.
4212 * lib/layouts/broadway.layout
4213 * lib/layouts/hollywood.layout: Added endlabel for the
4214 Parenthetical layout.
4216 * lib/layouts/heb-article.layout: Do not use slanted font shape
4217 for Theorem like environments.
4219 * src/buffer.C (makeLaTeXFile): Always add "american" to
4220 the UsedLanguages list if document language is RTL.
4222 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4224 * add addendum to README.OS2 and small patch (from SMiyata)
4226 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4228 * many files: correct the calls to ChangeExtension().
4230 * src/support/filetools.C (ChangeExtension): remove the no_path
4231 argument, which does not belong there. Use OnlyFileName() instead.
4233 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
4234 files when LaTeXing a non-nice latex file.
4236 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
4237 a chain of "if". Return false when deadkeys are not handled.
4239 * src/lyx_main.C (LyX): adapted the code for default bindings.
4241 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
4242 bindings for basic functionality (except deadkeys).
4243 (deadKeyBindings): new method. Performs the bindings of deadkeys.
4245 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
4246 several methods: handle override_x_deadkeys.
4248 * src/lyxrc.h: remove the "bindings" map, which did not make much
4249 sense anyway. New variable override_x_deadkeys, defaulting to "true".
4251 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4253 * src/lyxfont.C (stateText): use a saner method to determine
4254 whether the font is "default". Seems to fix the crash with DEC
4257 * src/Bullet.[Ch] (Bullet): remove const on parameters.
4259 2000-05-08 Juergen Vigna <jug@sad.it>
4261 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
4262 TabularLayoutMenu with mouse-button-3
4263 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
4265 * src/TabularLayout.C: added this file for having a Layout for
4268 2000-05-05 Juergen Vigna <jug@sad.it>
4270 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
4271 recalculating inset-widths.
4272 (TabularFeatures): activated this function so that I can change
4273 tabular-features via menu.
4275 * src/menus.C (ShowEditMenu): inserted support for insettabular so
4276 that I can test some functions with the Table menu.
4278 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4280 * src/lyxfont.C (stateText): guard against stupid c++libs.
4282 * src/tabular.C: add using std::vector
4283 some whitespace changes, + removed som autogenerated code.
4285 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
4287 2000-05-05 Juergen Vigna <jug@sad.it>
4289 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
4290 row, columns and cellstructures.
4292 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4294 * lib/lyxrc.example: remove obsolete entries.
4296 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
4297 reading of protected_separator for free_spacing.
4299 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4301 * src/text.C (draw): do not display an exclamation mark in the
4302 margin for margin notes. This is confusing, ugly and
4305 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
4306 AMS math' is checked.
4308 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
4309 name to see whether including the amsmath package is needed.
4311 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
4313 * src/paragraph.C (validate): Compute UsedLanguages correctly
4314 (don't insert the american language if it doesn't appear in the
4317 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
4318 The argument of \thanks{} command is considered moving argument
4320 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
4323 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
4325 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
4326 for appendix/minipage/depth. The lines can be now both in the footnote
4327 frame, and outside the frame.
4329 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
4332 2000-05-05 Juergen Vigna <jug@sad.it>
4334 * src/table.[Ch]: removed the inset and buffer stuff as this is now
4335 neede only in tabular.[Ch].
4337 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4339 * src/insets/insetspecialchar.C (Read): allow command == '~' for
4341 (Write): write '~' for PROTECTED_SEPARATOR
4343 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4345 * src/lyxparagraph.h: add a friend struct matchIT after the struct
4348 * src/mathed/formula.C (drawStr): rename size to siz.
4350 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
4351 possibly fix a bug by not changing the pflags = flags to piflags =
4354 2000-05-05 Juergen Vigna <jug@sad.it>
4356 * src/insets/insetbib.C: moved using directive
4358 * src/ImportNoweb.C: small fix for being able to compile (missing
4361 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4363 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
4364 to use clear, since we don't depend on this in the code. Add test
4367 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4369 * (various *.C files): add using std::foo directives to please dec
4372 * replace calls to string::clear() to string::erase() (Angus)
4374 * src/cheaders/cmath: modified to provide std::abs.
4376 2000-05-04 Juergen Vigna <jug@sad.it>
4378 * src/insets/insettext.C: Prepared all for inserting of multiple
4379 paragraphs. Still display stuff to do (alignment and other things),
4380 but I would like to use LyXText to do this when we cleaned out the
4381 table-support stuff.
4383 * src/insets/insettabular.C: Changed lot of stuff and added lots
4384 of functionality still a lot to do.
4386 * src/tabular.C: Various functions changed name and moved to be
4387 const functions. Added new Read and Write functions and changed
4388 lots of things so it works good with tabular-insets (also removed
4389 some stuff which is not needed anymore * hacks *).
4391 * src/lyxcursor.h: added operators == and != which just look if
4392 par and pos are (not) equal.
4394 * src/buffer.C (latexParagraphs): inserted this function to latex
4395 all paragraphs form par to endpar as then I can use this too for
4398 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
4399 so that I can call this to from text insets with their own cursor.
4401 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
4402 output off all paragraphs (because of the fix below)!
4404 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
4405 the very last paragraph (this could be also the last paragraph of an
4408 * src/texrow.h: added rows() call which returns the count-variable.
4410 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4412 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
4414 * lib/configure.m4: better autodetection of DocBook tools.
4416 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4418 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
4420 * src/lyx_cb.C: add using std::reverse;
4422 * src/LaTeX.C (run): on error always run deleteFilesOnError before
4425 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
4426 selected files. Should fix repeated errors from generated files.
4428 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
4430 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
4432 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
4433 the spellchecker popup.
4435 * lib/lyxrc.example: Removed the \number_inset section
4437 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4439 * src/insets/figinset.C (various): Use IsFileReadable() to make
4440 sure that the file actually exist. Relying on ghostscripts errors
4441 is a bad idea since they can lead to X server crashes.
4443 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
4445 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
4448 * lib/lyxrc.example: smallish typo in description of
4449 \view_dvi_paper_option
4451 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4454 * src/lyxfunc.C: doImportHelper to factor out common code of the
4455 various import methods. New functions doImportASCIIasLines,
4456 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
4457 doImportLinuxDoc for the format specific parts.
4460 * buffer.C: Dispatch returns now a bool to indicate success
4463 * lyx_gui.C: Add getLyXView() for member access
4465 * lyx_main.C: Change logic for batch commands: First try
4466 Buffer::Dispatch (possibly without GUI), if that fails, use
4469 * lyx_main.C: Add support for --import command line switch.
4470 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
4471 Available Formats: Everything accepted by 'buffer-import <format>'
4473 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4475 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
4478 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
4479 documents will be reformatted upon reentry.
4481 2000-04-27 Juergen Vigna <jug@sad.it>
4483 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
4484 correctly only last pos this was a bug.
4486 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4488 * release of lyx-1.1.5pre1
4490 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4492 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
4494 * src/menus.C: revert the change of naming (Figure->Graphic...)
4495 from 2000-04-11. It was incomplete and bad.
4497 * src/LColor.[Ch]: add LColor::depthbar.
4498 * src/text.C (GetVisibleRow): use it.
4500 * README: update the languages list.
4502 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4504 * src/text.C (GetVisibleRow): show the depth of paragraphs using
4507 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4509 * README: remove sections that were just wrong.
4511 * src/text2.C (GetRowNearY): remove currentrow code
4513 * src/text.C (GetRow): remove currentrow code
4515 * src/screen.C (Update): rewritten a bit.
4516 (SmallUpdate): removed func
4518 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
4520 (FullRebreak): return bool
4521 (currentrow): remove var
4522 (currentrow_y): ditto
4524 * src/lyxscreen.h (Draw): change arg to unsigned long
4525 (FitCursor): return bool
4526 (FitManualCursor): ditto
4527 (Smallpdate): remove func
4528 (first): change to unsigned long
4529 (DrawOneRow): change second arg to long (from long &)
4530 (screen_refresh_y): remove var
4531 (scree_refresh_row): ditto
4533 * src/lyxrow.h: change baseline to usigned int from unsigned
4534 short, this brings some implicit/unsigned issues out in the open.
4536 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
4538 (Dispatch): don't call updateScrollbar after fitCursor. Use update
4539 instead of smallUpdate.
4541 * src/lyxcursor.h: change y to unsigned long
4543 * src/buffer.h: don't call updateScrollbar after fitcursor
4545 * src/buffer.C (parseSingleLyXformat2Token): move variables to
4546 where they are used. Removed "\\direction", this was not present
4547 in 1.1.4 and is already obsolete. Commented out some code that I
4548 believe to never be called.
4549 (runLiterate): don't call updateScrollbar after fitCursor
4551 (buildProgram): ditto
4554 * src/WorkArea.h (workWidth): change return val to unsigned
4557 (redraw): remove the button redraws
4558 (setScrollbarValue): change for scrollbar
4559 (getScrollbarValue): change for scrollbar
4560 (getScrollbarBounds): change for scrollbar
4562 * src/WorkArea.C (C_WorkArea_up_cb): removed func
4563 (C_WorkArea_down_cb): removed func
4564 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
4565 (resize): change for scrollbar
4566 (setScrollbar): ditto
4567 (setScrollbarBounds): ditto
4568 (setScrollbarIncrements): ditto
4569 (up_cb): removed func
4570 (down_cb): removed func
4571 (scroll_cb): change for scrollbar
4572 (work_area_handler): ditto
4574 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
4575 when FitCursor did something.
4576 (updateScrollbar): some unsigned changes
4577 (downCB): removed func
4578 (scrollUpOnePage): removed func
4579 (scrollDownOnePage): remvoed func
4580 (workAreaMotionNotify): don't call screen->FitCursor but use
4581 fitCursor instead. and bool return val
4582 (workAreaButtonPress): ditto
4583 (workAreaButtonRelease): some unsigned changes
4584 (checkInsetHit): ditto
4585 (workAreaExpose): ditto
4586 (update): parts rewritten, comments about the signed char arg added
4587 (smallUpdate): removed func
4588 (cursorPrevious): call needed updateScrollbar
4591 * src/BufferView2.C (allFloats): don't call updateScrollbar after
4594 * src/BufferView.[Ch] (upCB): removed func
4595 (downCB): removed func
4596 (smallUpdate): removed func
4598 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4600 * src/lyxtext.h src/text.C src/text2.C: removed support for the
4601 currentrow, currentrow_y optimization. This did not help a lot and
4602 if we want to do this kind of optimization we should rather use
4603 cursor.row instead of the currentrow.
4605 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
4606 buffer spacing and klyx spacing support.
4608 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4610 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
4613 2000-04-26 Juergen Vigna <jug@sad.it>
4615 * src/insets/figinset.C: fixes to Lars sstream changes!
4617 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
4619 * A lot of files: Added Ascii(ostream &) methods to all inset
4620 classes. Used when exporting to ASCII.
4622 * src/buffer.C (writeFileAscii,RoffAsciiTable)
4623 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
4626 * src/text2.C (ToggleFree): Disabled implicit word selection when
4627 there is a change in the language
4629 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
4630 no output was generated for end-of-sentence inset.
4632 * src/insets/lyxinset.h
4635 * src/paragraph.C: Removed the insetnumber code
4637 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
4639 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4641 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
4642 no_babel and no_epsfig completely from the file.
4643 (parseSingleLyXformat2Token): add handling for per-paragraph
4644 spacing as written by klyx.
4646 * src/insets/figinset.C: applied patch by Andre. Made it work with
4649 2000-04-20 Juergen Vigna <jug@sad.it>
4651 * src/insets/insettext.C (cutSelection):
4652 (copySelection): Fixed with selection from right to left.
4653 (draw): now the rows are not recalculated at every draw.
4654 (computeTextRows): for now reset the inset-owner here (this is
4655 important for an undo or copy where the inset-owner is not set
4658 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
4659 motion to the_locking_inset screen->first was forgotten, this was
4660 not important till we got multiline insets.
4662 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4664 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
4665 code seems to be alright (it is code changed by Dekel, and the
4666 intent is indeed that all macros should be defined \protect'ed)
4668 * NEWS: a bit of reorganisation of the new user-visible features.
4670 2000-04-19 Juergen Vigna <jug@sad.it>
4672 * src/insets/insettext.C (init): using a LyXCursor now for cursor
4673 position. Set the inset_owner of the used paragraph so that it knows
4674 that it is inside an inset. Fixed cursor handling with mouse and
4675 cursor keys. Fixed wrong timed inset redraws and lots of other changes
4676 and cleanups to make TextInsets work better.
4678 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
4679 Changed parameters of various functions and added LockInsetInInset().
4681 * src/insets/insettext.C:
4683 * src/insets/insetcollapsable.h:
4684 * src/insets/insetcollapsable.C:
4685 * src/insets/insetfoot.h:
4686 * src/insets/insetfoot.C:
4687 * src/insets/insetert.h:
4688 * src/insets/insetert.C: cleaned up the code so that it works now
4689 correctly with insettext.
4691 * src/insets/inset.C:
4692 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
4693 that insets in insets are supported right.
4696 * src/table.C: lots of changes for use with inset tabular (and cleanup)
4698 * src/paragraph.C: some small fixes
4700 * src/debug.h: inserted INSETS debug info
4702 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
4703 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
4705 * src/commandtags.h:
4706 * src/LyXAction.C: insert code for InsetTabular.
4708 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
4709 not Button1MotionMask.
4710 (workAreaButtonRelease): send always a InsetButtonRelease event to
4712 (checkInsetHit): some setCursor fixes (always with insets).
4714 * src/BufferView2.C (lockInset): returns a bool now and extended for
4715 locking insets inside insets.
4716 (showLockedInsetCursor): it is important to have the cursor always
4717 before the locked inset.
4718 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
4720 * src/BufferView.h: made lockInset return a bool.
4722 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
4724 * src/text2.C (SetCursor): This now has a version with a LyXCursor
4725 that is used also internally but can be called as public to have back
4726 a cursor pos which is not set internally.
4727 (SetCursorIntern): Changed to use above function.
4729 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
4731 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4736 * NEWS: updated for prerelease of 1.1.5. Please comment and send
4737 patches for things that should be in or should be changed.
4739 * src/* [insetfiles]: change "usigned char fragile" to bool
4740 fragile. There was only one point that could that be questioned
4741 and that is commented in formulamacro.C. Grep for "CHECK".
4743 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
4744 (DeleteBuffer): take it out of CutAndPaste and make it static.
4746 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4748 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
4749 output the spacing envir commands. Also the new commands used in
4750 the LaTeX output makes the result better.
4752 * src/Spacing.C (writeEnvirBegin): new method
4753 (writeEnvirEnd): new method
4755 2000-04-18 Juergen Vigna <jug@sad.it>
4757 * src/CutAndPaste.C: made textclass a static member of the class
4758 as otherwise it is not accesed right!!!
4760 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
4762 * forms/layout_forms.fd
4763 * src/layout_forms.h
4764 * src/layout_forms.C (create_form_form_character)
4765 * src/lyx_cb.C (UserFreeFont)
4766 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
4767 documents (in the layout->character popup).
4769 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4771 * src/spellchecker.C (create_ispell_pipe): fix a bug where
4772 \spell_command was in fact not honored (from Kevin Atkinson).
4774 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
4777 * src/lyx_gui.h: make lyxViews private (Angus)
4779 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
4781 * src/mathed/math_write.C
4782 (MathMatrixInset::Write) Put \protect before \begin{array} and
4783 \end{array} if fragile
4784 (MathParInset::Write): Put \protect before \\ if fragile
4786 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4788 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
4789 initialization if the LyXColorHandler must be done after the
4790 connections to the XServer has been established.
4792 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
4793 get the background pixel from the lyxColorhandler so that the
4794 figures are rendered with the correct background color.
4795 (NextToken): removed functions.
4796 (GetPSSizes): use ifs >> string instead of NextToken.
4798 * src/Painter.[Ch]: the color cache moved out of this file.
4800 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
4803 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4805 * src/WorkArea.C (work_area_handler): call BufferView::enterView
4806 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
4808 * src/BufferView.C (enterView): new func
4809 (leaveView): new func
4811 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
4813 (leaveView): new func, undefines xterm cursor when approp.
4815 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
4816 (AllowInput): delete the Workarea cursor handling from this func.
4818 * src/Painter.C (underline): draw a slimer underline in most cases.
4820 * src/lyx_main.C (error_handler): use extern "C"
4822 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4824 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
4825 sent directly to me.
4827 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
4828 to the list by Dekel.
4830 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
4833 * src/bufferview_funcs.[Ch]: two new files, moved several of the
4834 methods from lyx_cb.here.
4836 * src/lyx_cb.C: in addition to the above; removed input_prohibited
4839 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4841 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
4842 instead of using current_view directly.
4844 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
4846 * src/LyXAction.C (init): add the paragraph-spacing command.
4848 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
4850 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
4852 * src/lyx_cb.C (CurrentState): output a string when the spacing is
4853 different from the documents.
4855 * src/text.C (SetHeightOfRow): take paragraph spacing into
4856 account, paragraph spacing takes precedence over buffer spacing
4857 (GetVisibleRow): ditto
4859 * src/paragraph.C (writeFile): output the spacing parameter too.
4860 (validate): set the correct features if spacing is used in the
4862 (Clear): set spacing to default
4863 (MakeSameLayout): spacing too
4864 (HasSameLayout): spacing too
4865 (SetLayout): spacing too
4866 (TeXOnePar): output the spacing commands
4868 * src/lyxparagraph.h: added a spacing variable for use with
4869 per-paragraph spacing.
4871 * src/Spacing.h: add a Default spacing and a method to check if
4872 the current spacing is default. also added an operator==
4874 * src/text2.C (DeleteEmptyParagraphMechanism): added a
4877 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4879 * src/lyxserver.C (callback): fix dispatch of functions
4881 * src/insets/insetlatexaccent.C (checkContents): turn bogus
4882 printf() into lyxerr call.
4884 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
4887 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
4888 "Table" to "Table Box", "Float" to "Floating Material"; deletes
4889 the "Float" from each of the subitems.
4890 (ShowHelpMenu): add entry for "FAQ" and "TOC".
4892 * src/support/DebugStream.h: add an #ifdef to work around a gcc
4893 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
4894 documented the change so that the workaround can be nuked later.
4896 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
4899 * src/lyxlex_pimpl.C (next): do not re-declare the default value
4901 * src/buffer.C (getLatexName): ditto
4902 (setReadonly): ditto
4904 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4906 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
4907 avoid some uses of current_view. Added also a bufferParams()
4908 method to get at this.
4910 * src/lyxtext.h: changed params->buffer and paramters->bparams.
4912 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4914 * src/lyxparagraph.[Ch]: removed
4915 operator<(LyXParagraph::InsetTable..., added a struct matchIT
4916 with operators used by lower_bound and
4917 upper_bound in InsetTable's
4918 Make struct InsetTable private again. Used matchpos.
4920 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
4922 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
4923 document, the language of existing text is changed (unless the
4924 document is multi-lingual)
4926 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
4928 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
4930 * A lot of files: A rewrite of the Right-to-Left support.
4932 2000-04-10 Juergen Vigna <jug@sad.it>
4934 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
4935 misplaced cursor when inset in inset is locked.
4937 * src/insets/insettext.C (LocalDispatch): small fix so that a
4938 BREAKLINE is not inserted if we don't permit it with autBreakRows.
4940 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
4941 footnote font should be decreased in size twice when displaying.
4943 * src/insets/insettext.C (GetDrawFont): inserted this function as
4944 the drawing-font may differ from the real paragraph font.
4946 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
4947 insets (inset in inset!).
4949 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
4950 function here because we don't want footnotes inside footnotes.
4952 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
4954 (init): now set the inset_owner in paragraph.C
4955 (LocalDispatch): added some resetPos() in the right position
4958 (pasteSelection): changed to use the new CutAndPaste-Class.
4960 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
4961 which tells if it is allowed to insert another inset inside this one.
4963 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
4964 SwitchLayoutsBetweenClasses.
4966 * src/text2.C (InsertInset): checking of the new paragraph-function
4968 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
4969 is not needed anymore here!
4972 (PasteSelection): redone (also with #ifdef) so that now this uses
4973 the CutAndPaste-Class.
4974 (SwitchLayoutsBetweenClasses): removed here and implemented in the
4977 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
4978 from/to text/insets.
4980 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
4981 so that the paragraph knows if it is inside an (text)-inset.
4982 (InsertFromMinibuffer): changed return-value to bool as now it
4983 may happen that an inset is not inserted in the paragraph.
4984 (InsertInsetAllowed): this checks if it is allowed to insert an
4985 inset in this paragraph.
4987 (BreakParagraphConservative):
4988 (BreakParagraph) : small change for the above change of the return
4989 value of InsertFromMinibuffer.
4991 * src/lyxparagraph.h: added inset_owner and the functions to handle
4992 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
4994 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4996 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
4997 functions from BufferView to BufferView::Pimpl to ease maintence.
4999 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
5000 correctly. Also use SetCursorIntern instead of SetCursor.
5002 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
5005 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5007 * src/WorkArea.C (belowMouse): manually implement below mouse.
5009 * src/*: Add "explicit" on several constructors, I added probably
5010 some unneeded ones. A couple of changes to code because of this.
5012 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
5013 implementation and private parts from the users of BufferView. Not
5016 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
5017 implementation and private parts from the users of LyXLex. Not
5020 * src/BufferView_pimpl.[Ch]: new files
5022 * src/lyxlex_pimpl.[Ch]: new files
5024 * src/LyXView.[Ch]: some inline functions move out-of-line
5026 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5028 * src/lyxparagraph.h: make struct InsetTable public.
5030 * src/support/lyxstring.h: change lyxstring::difference_type to be
5031 ptrdiff_t. Add std:: modifiers to streams.
5033 * src/font.C: include the <cctype> header, for islower() and
5036 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5038 * src/font.[Ch]: new files. Contains the metric functions for
5039 fonts, takes a LyXFont as parameter. Better separation of concepts.
5041 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
5042 changes because of this.
5044 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
5046 * src/*: compile with -Winline and move functions that don't
5049 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
5052 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5054 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
5055 (various files changed because of this)
5057 * src/Painter.C (text): fixed the drawing of smallcaps.
5059 * src/lyxfont.[Ch] (drawText): removed unused member func.
5062 * src/*.C: added needed "using" statements and "std::" qualifiers.
5064 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5066 * src/*.h: removed all use of "using" from header files use
5067 qualifier std:: instead.
5069 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5071 * src/text.C (Backspace): some additional cleanups (we already
5072 know whether cursor.pos is 0 or not).
5074 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
5075 automake does not provide one).
5077 * src/bmtable.h: replace C++ comments with C comments.
5079 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
5081 * src/screen.C (ShowCursor): Change the shape of the cursor if
5082 the current language is not equal to the language of the document.
5083 (If the cursor change its shape unexpectedly, then you've found a bug)
5085 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
5088 * src/insets/insetnumber.[Ch]: New files.
5090 * src/LyXAction.C (init)
5091 * src/lyxfunc.C (dispatch): Add command number-inset-insert
5094 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
5096 * src/lyxparagraph.h
5097 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
5098 (the vector is kept sorted).
5100 * src/text.C (GetVisibleRow): Draw selection correctly when there
5101 is both LTR and RTL text.
5103 * src/paragraph.C (Clone): Use the assignment operator for cloning,
5104 which is much faster.
5106 * src/text.C (GetVisibleRow and other): Do not draw the last space
5107 in a row if the direction of the last letter is not equal to the
5108 direction of the paragraph.
5110 * src/lyxfont.C (latexWriteStartChanges):
5111 Check that font language is not equal to basefont language.
5112 (latexWriteEndChanges): ditto
5114 * src/lyx_cb.C (StyleReset): Don't change the language while using
5115 the font-default command.
5117 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
5118 empty paragraph before a footnote.
5120 * src/insets/insetcommand.C (draw): Increase x correctly.
5122 * src/screen.C (ShowCursor): Change cursor shape if
5123 current language != document language.
5125 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
5127 2000-03-31 Juergen Vigna <jug@sad.it>
5129 * src/paragraph.C (GetInset): commented out text[pos] = ' '
5130 (Clone): changed mode how the paragraph-data is copied to the
5131 new clone-paragraph.
5133 * src/lyxfunc.C (Dispatch): fixed small problem when calling
5134 GetInset(pos) with no inset anymore there (in inset UNDO)
5136 * src/insets/insetcommand.C (draw): small fix as here x is
5137 incremented not as much as width() returns (2 before, 2 behind = 4)
5139 2000-03-30 Juergen Vigna <jug@sad.it>
5141 * src/insets/insettext.C (InsetText): small fix in initialize
5142 widthOffset (should not be done in the init() function)
5144 2000-03-29 Amir Karger <karger@lyx.org>
5146 * lib/examples/it_ItemizeBullets.lyx: translation by
5149 * Implemented \textasciitilde and fixed a tiny bug in reLyX
5151 2000-03-29 Juergen Vigna <jug@sad.it>
5153 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
5155 * src/insets/insetfoot.C (Clone): small change as for the below
5156 new init function in the text-inset
5158 * src/insets/insettext.C (init): new function as I've seen that
5159 clone did not copy the Paragraph-Data!
5160 (LocalDispatch): Added code so that now we have some sort of Undo
5161 functionality (well actually we HAVE Undo ;)
5163 * src/text.C (Backspace): Small fix for the a | a Backspace problem
5165 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
5167 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
5170 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5172 * src/main.C: added a runtime check that verifies that the xforms
5173 header used when building LyX and the library used when running
5174 LyX match. Exit with a message if they don't match. This is a
5175 version number check only.
5177 * src/buffer.C (save): Don't allocate memory on the heap for
5178 struct utimbuf times.
5180 * *: some using changes, use iosfwd instead of the real headers.
5182 * src/lyxfont.C use char const * instead of string for the static
5183 strings. Rewrite some functions to use sstream.
5185 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5187 * src/text.C (Backspace): hopefully fix the dreaded backaspace
5190 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5192 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
5193 of Geodesy (from Martin Vermeer)
5195 * lib/layouts/svjour.inc: include file for the Springer svjour
5196 class. It can be used to support journals other than JoG.
5198 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
5199 Miskiewicz <misiek@pld.org.pl>)
5200 * lib/reLyX/Makefile.am: ditto.
5202 2000-03-27 Juergen Vigna <jug@sad.it>
5204 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
5205 also some modifications with operations on selected text.
5207 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
5208 problems with clicking on insets (last famous words ;)
5210 * src/insets/insetcommand.C (draw):
5211 (width): Changed to have a bit of space before and after the inset so
5212 that the blinking cursor can be seen (otherwise it was hidden)
5214 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5216 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
5217 would not be added to the link list when an installed gettext (not
5218 part of libc) is found.
5220 2000-03-24 Juergen Vigna <jug@sad.it>
5222 * src/insets/insetcollapsable.C (Edit):
5223 * src/mathed/formula.C (InsetButtonRelease):
5224 (InsetButtonPress): fixed for new handling of ButtonPress/Release
5227 * src/BufferView.C (workAreaButtonPress):
5228 (workAreaButtonRelease):
5229 (checkInsetHit): Finally fixed the clicking on insets be handled
5232 * src/insets/insetert.C (Edit): inserted this call so that ERT
5233 insets work always with LaTeX-font
5235 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5237 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
5238 caused lyx to startup with no GUI in place, causing in a crash
5239 upon startup when called with arguments.
5241 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5243 * src/FontLoader.C: better initialization of dummyXFontStruct.
5245 2000-03-20 José Abílio Matos <jamatos@lyx.org>
5247 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
5248 for linuxdoc and docbook import and export format options.
5250 * lib/lyxrc.example Example of default values for the previous flags.
5252 * src/lyx_cb.C Use those flags instead of the hardwired values for
5253 linuxdoc and docbook export.
5255 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
5258 * src/menus.C Added menus entries for the new import/exports formats.
5260 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5262 * src/lyxrc.*: Added support for running without Gui
5265 * src/FontLoader.C: sensible defaults if no fonts are needed
5267 * src/lyx_cb.C: New function ShowMessage (writes either to the
5268 minibuffer or cout in case of no gui
5269 New function AskOverwrite for common stuff
5270 Consequently various changes to call these functions
5272 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
5273 wild guess at sensible screen resolution when having no gui
5275 * src/lyxfont.C: no gui, no fonts... set some defaults
5277 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5279 * src/LColor.C: made the command inset background a bit lighter.
5281 2000-03-20 Hartmut Goebel <goebel@noris.net>
5283 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
5284 stdstruct.inc. Koma-Script added some title elements which
5285 otherwise have been listed below "bibliography". This split allows
5286 adding title elements to where they belong.
5288 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
5289 define the additional tilte elements and then include
5292 * many other layout files: changed to include stdtitle.inc just
5293 before stdstruct.inc.
5295 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
5297 * src/buffer.C: (save) Added the option to store all backup files
5298 in a single directory
5300 * src/lyxrc.[Ch]: Added variable \backupdir_path
5302 * lib/lyxrc.example: Added descriptions of recently added variables
5304 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
5305 bibtex inset, not closing the bibtex popup when deleting the inset)
5307 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5309 * src/lyx_cb.C: add a couple using directives.
5311 2000-03-17 José Abílio Matos <jamatos@lyx.org>
5312 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
5313 import based on the filename.
5315 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
5316 file would be imported at start, if the filename where of a sgml file.
5318 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
5320 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
5322 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
5323 * src/lyxfont.h Replaced the member variable bits.direction by the
5324 member variable lang. Made many changes in other files.
5325 This allows having a multi-lingual document
5327 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
5328 that change the current language to <l>.
5329 Removed the command "font-rtl"
5331 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
5332 format for Hebrew documents)
5334 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
5335 When auto_mathmode is "true", pressing a digit key in normal mode
5336 will cause entering into mathmode.
5337 If auto_mathmode is "rtl" then this behavior will be active only
5338 when writing right-to-left text.
5340 * src/text2.C (InsertStringA) The string is inserted using the
5343 * src/paragraph.C (GetEndLabel) Gives a correct result for
5344 footnote paragraphs.
5346 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
5348 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5350 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
5351 front of PasteParagraph. Never insert a ' '. This should at least
5352 fix some cause for the segfaults that we have been experiencing,
5353 it also fixes backspace behaviour slightly. (Phu!)
5355 * src/support/lstrings.C (compare_no_case): some change to make it
5356 compile with gcc 2.95.2 and stdlibc++-v3
5358 * src/text2.C (MeltFootnoteEnvironment): change type o
5359 first_footnote_par_is_not_empty to bool.
5361 * src/lyxparagraph.h: make text private. Changes in other files
5363 (fitToSize): new function
5364 (setContentsFromPar): new function
5365 (clearContents): new function
5366 (SetChar): new function
5368 * src/paragraph.C (readSimpleWholeFile): deleted.
5370 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
5371 the file, just use a simple string instead. Also read the file in
5372 a more maintainable manner.
5374 * src/text2.C (InsertStringA): deleted.
5375 (InsertStringB): deleted.
5377 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5379 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
5380 RedoParagraphs from the doublespace handling part, just set status
5381 to NEED_MORE_REFRESH. Also don't update cursor position (should be
5382 done, but perhaps not like this.)
5384 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5386 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
5387 character when inserting an inset.
5389 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5391 * src/bufferparams.C (readLanguage): now takes "default" into
5394 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
5395 also initialize the toplevel_keymap with the default bindings from
5398 * src/buffer.C (Buffer): remove lyxrc from the parameters.
5400 * all files using lyxrc: have lyxrc as a real variable and not a
5401 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
5404 * src/lyxrc.C: remove double call to defaultKeyBindings
5406 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
5407 toolbar defauls using lyxlex. Remove enums, structs, functions
5410 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
5411 toolbar defaults. Also store default keybindings in a map.
5413 * src/ToolbarDefaults.[Ch]: New file. This class is used for
5414 storing the toolbar defaults without any xforms dependencies.
5416 * src/insets/figinset.C: patch posted to list by Andre Poenitz
5417 applied. Changed to use iterators.
5419 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
5421 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
5422 systems that don't have LINGUAS set to begin with.
5424 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5426 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
5427 the list by Dekel Tsur.
5429 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5431 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
5432 * src/insets/form_graphics.C: ditto.
5434 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
5436 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5438 * src/bufferparams.C (readLanguage): use the new language map
5440 * src/intl.C (InitKeyMapper): use the new language map
5442 * src/lyx_gui.C (create_forms): use the new language map
5444 * src/language.[Ch]: New files. Used for holding the information
5445 about each language. Now! Use this new language map enhance it and
5446 make it really usable for our needs.
5448 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
5450 * screen.C (ShowCursor): Removed duplicate code.
5451 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5452 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
5454 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
5457 * src/text.C Added TransformChar method. Used for rendering Arabic
5458 text correctly (change the glyphs of the letter according to the
5459 position in the word)
5464 * src/lyxrc.C Added lyxrc command {language_command_begin,
5465 language_command_end,language_command_ltr,language_command_rtl,
5466 language_package} which allows the use of either arabtex or Omega
5469 * src/lyx_gui.C (init)
5471 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
5472 to use encoding for menu fonts which is different than the encoding
5475 * src/buffer.C (makeLaTeXFile): If params.language = "default",
5476 do not load the babel package.
5477 To write an English document with Hebrew/Arabic, change the document
5478 language to "english".
5480 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
5481 (alphaCounter): changed to return char
5482 (loweralphaCounter, hebrewCounter, romanCounter): New functions
5484 * lib/lyxrc.example Added examples for Hebrew/Arabic
5487 * src/layout.C Added layout command endlabeltype
5489 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
5491 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
5493 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5495 * src/mathed/math_delim.C (search_deco): return a
5496 math_deco_struct* instead of index.
5498 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5500 * All files with a USE_OSTREAM_ONLY within: removed all code that
5501 was unused when USE_OSTREAM_ONLY is defined.
5503 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
5504 of any less. Removed header and using.
5506 * src/text.C (GetVisibleRow): draw the string "Page Break
5507 (top/bottom)" on screen when drawing a pagebreak line.
5509 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5511 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
5513 * src/mathed/math_macro.C (draw): do some cast magic.
5516 * src/mathed/math_defs.h: change byte* argument to byte const*.
5518 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
5520 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
5521 know it is right to return InsetFoot* too, but cxx does not like
5524 * src/insets/insetcollapsable.[Ch] (Clone): make const.
5526 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
5528 * src/mathed/math_delim.C: change == to proper assignment.
5530 2000-03-09 Juergen Vigna <jug@sad.it>
5532 * src/insets/insettext.C (setPos): fixed various cursor positioning
5533 problems (via mouse and cursor-keys)
5534 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
5535 inset (still a small display problem but it works ;)
5537 * src/insets/insetcollapsable.C (draw): added button_top_y and
5538 button_bottom_y to have correct values for clicking on the inset.
5540 * src/support/lyxalgo.h: commented out 'using std::less'
5542 2000-03-08 Juergen Vigna <jug@sad.it>
5544 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
5545 Button-Release event closes as it is alos the Release-Event
5548 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
5550 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5552 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
5553 can add multiple spaces in Scrap (literate programming) styles...
5554 which, by the way, is how I got hooked on LyX to begin with.
5556 * src/mathed/formula.C (Write): Added dummy variable to an
5557 inset::Latex() call.
5558 (Latex): Add free_spacing boolean to inset::Latex()
5560 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
5562 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
5563 virtual function to include the free_spacing boolean from
5564 the containing paragraph's style.
5566 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
5567 Added free_spacing boolean arg to match inset.h
5569 * src/insets/insettext.C, src/insets/insettext.h (Latex):
5570 Added free_spacing boolean arg to match inset.h
5572 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
5573 Added free_spacing boolean and made sure that if in a free_spacing
5574 paragraph, that we output normal space if there is a protected space.
5576 * src/insets/insetref.C, src/insets/insetref.h (Latex):
5577 Added free_spacing boolean arg to match inset.h
5579 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
5580 Added free_spacing boolean arg to match inset.h
5582 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
5583 Added free_spacing boolean arg to match inset.h
5585 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
5586 Added free_spacing boolean arg to match inset.h
5588 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
5589 Added free_spacing boolean arg to match inset.h
5591 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
5592 free_spacing boolean arg to match inset.h
5594 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
5595 Added free_spacing boolean arg to match inset.h
5597 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
5598 Added free_spacing boolean arg to match inset.h
5600 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
5601 Added free_spacing boolean arg to match inset.h
5603 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
5604 Added free_spacing boolean arg to match inset.h
5606 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
5607 Added free_spacing boolean arg to match inset.h
5609 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
5610 free_spacing boolean arg to match inset.h
5612 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
5613 free_spacing boolean arg to match inset.h
5615 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
5616 ignore free_spacing paragraphs. The user's spaces are left
5619 * src/text.C (InsertChar): Fixed the free_spacing layout
5620 attribute behavior. Now, if free_spacing is set, you can
5621 add multiple spaces in a paragraph with impunity (and they
5622 get output verbatim).
5623 (SelectSelectedWord): Added dummy argument to inset::Latex()
5626 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
5629 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
5630 paragraph layouts now only input a simple space instead.
5631 Special character insets don't make any sense in free-spacing
5634 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
5635 hard-spaces in the *input* file to simple spaces if the layout
5636 is free-spacing. This converts old files which had to have
5637 hard-spaces in free-spacing layouts where a simple space was
5639 (writeFileAscii): Added free_spacing check to pass to the newly
5640 reworked inset::Latex(...) methods. The inset::Latex() code
5641 ensures that hard-spaces in free-spacing paragraphs get output
5642 as spaces (rather than "~").
5644 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5646 * src/mathed/math_delim.C (draw): draw the empty placeholder
5647 delims with a onoffdash line.
5648 (struct math_deco_compare): struct that holds the "functors" used
5649 for the sort and the binary search in math_deco_table.
5650 (class init_deco_table): class used for initial sort of the
5652 (search_deco): use lower_bound to do a binary search in the
5655 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5657 * src/lyxrc.C: a small secret thingie...
5659 * src/lyxlex.C (printTable): changed to take a ostream as paramter
5660 and to not flush the stream as often as it used to.
5662 * src/support/lyxalgo.h: new file
5663 (sorted): template function used for checking if a sequence is
5664 sorted or not. Two versions with and without user supplied
5665 compare. Uses same compare as std::sort.
5667 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
5668 it and give warning on lyxerr.
5670 (struct compare_tags): struct with function operators used for
5671 checking if sorted, sorting and lower_bound.
5672 (search_kw): use lower_bound instead of manually implemented
5675 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5677 * src/insets/insetcollapsable.h: fix Clone() declaration.
5678 * src/insets/insetfoot.h: ditto.
5680 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
5682 2000-03-08 Juergen Vigna <jug@sad.it>
5684 * src/insets/lyxinset.h: added owner call which tells us if
5685 this inset is inside another inset. Changed also the return-type
5686 of Editable to an enum so it tells clearer what the return-value is.
5688 * src/insets/insettext.C (computeTextRows): fixed computing of
5689 textinsets which split automatically on more rows.
5691 * src/insets/insetert.[Ch]: changed this to be of BaseType
5694 * src/insets/insetfoot.[Ch]: added footnote inset
5696 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
5697 collapsable insets (like footnote, ert, ...)
5699 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5701 * src/lyxdraw.h: remvoe file
5703 * src/lyxdraw.C: remove file
5705 * src/insets/insettext.C: added <algorithm>.
5707 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5709 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
5710 (matrix_cb): case MM_OK use string stream
5712 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
5715 * src/mathed/math_macro.C (draw): use string stream
5716 (Metrics): use string stream
5718 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
5719 directly to the ostream.
5721 * src/vspace.C (asString): use string stream.
5722 (asString): use string stream
5723 (asLatexString): use string stream
5725 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
5726 setting Spacing::Other.
5728 * src/LaTeXFeatures.C (getPackages): use string stream instead of
5729 sprintf when creating the stretch vale.
5731 * src/text2.C (alphaCounter): changed to return a string and to
5732 not use a static variable internally. Also fixed a one-off bug.
5733 (SetCounter): changed the drawing of the labels to use string
5734 streams instead of sprintf.
5736 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
5737 manipulator to use a scheme that does not require library support.
5738 This is also the way it is done in the new GNU libstdc++. Should
5739 work with DEC cxx now.
5741 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5743 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
5744 end. This fixes a bug.
5746 * src/mathed (all files concerned with file writing): apply the
5747 USE_OSTREAM_ONLY changes to mathed too.
5749 * src/support/DebugStream.h: make the constructor explicit.
5751 * src/lyxfont.C (latexWriteStartChanges): small bug related to
5752 count and ostream squashed.
5754 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5756 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
5758 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
5759 ostringstream uses STL strings, and we might not.
5761 * src/insets/insetspecialchar.C: add using directive.
5762 * src/insets/insettext.C: ditto.
5764 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5766 * lib/layouts/seminar.layout: feeble attempt at a layout for
5767 seminar.cls, far from completet and could really use some looking
5768 at from people used to write layout files.
5770 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
5771 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
5772 a lot nicer and works nicely with ostreams.
5774 * src/mathed/formula.C (draw): a slightly different solution that
5775 the one posted to the list, but I think this one works too. (font
5776 size wrong in headers.)
5778 * src/insets/insettext.C (computeTextRows): some fiddling on
5779 Jürgens turf, added some comments that he should read.
5781 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
5782 used and it gave compiler warnings.
5783 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
5786 * src/lyx_gui.C (create_forms): do the right thing when
5787 show_banner is true/false.
5789 * src/lyx_cb.C (TimerCB): no need to close or do anything if
5790 show_banner is false.
5792 * most file writing files: Now use iostreams to do almost all of
5793 the writing. Also instead of passing string &, we now use
5794 stringstreams. mathed output is still not adapted to iostreams.
5795 This change can be turned off by commenting out all the occurences
5796 of the "#define USE_OSTREAM_ONLY 1" lines.
5798 * src/WorkArea.C (createPixmap): don't output debug messages.
5799 (WorkArea): don't output debug messages.
5801 * lib/lyxrc.example: added a comment about the new variable
5804 * development/Code_rules/Rules: Added some more commente about how
5805 to build class interfaces and on how better encapsulation can be
5808 2000-03-03 Juergen Vigna <jug@sad.it>
5810 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
5811 automatically with the width of the LyX-Window
5813 * src/insets/insettext.C (computeTextRows): fixed update bug in
5814 displaying text-insets (scrollvalues where not initialized!)
5816 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5818 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
5819 id in the check of the result from lower_bound is not enough since
5820 lower_bound can return last too, and then res->id will not be a
5823 * all insets and some code that use them: I have conditionalized
5824 removed the Latex(string & out, ...) this means that only the
5825 Latex(ostream &, ...) will be used. This is a work in progress to
5826 move towards using streams for all output of files.
5828 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
5831 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5833 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
5834 routine (this fixes bug where greek letters were surrounded by too
5837 * src/support/filetools.C (findtexfile): change a bit the search
5838 algorithm, to fix bug introduced in 1.1.4. Note that --format is
5839 no longer passed to kpsewhich, we may have to change that later.
5841 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
5842 warning options to avoid problems with X header files (from Angus
5844 * acinclude.m4: regenerated.
5846 2000-03-02 Juergen Vigna <jug@sad.it>
5848 * src/insets/insettext.C (WriteParagraphData): Using the
5849 par->writeFile() function for writing paragraph-data.
5850 (Read): Using buffer->parseSingleLyXformat2Token()-function
5851 for parsing paragraph data!
5853 * src/buffer.C (readLyXformat2): removed all parse data and using
5854 the new parseSingleLyXformat2Token()-function.
5855 (parseSingleLyXformat2Token): added this function to parse (read)
5856 lyx-file-format (this is called also from text-insets now!)
5858 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5860 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
5863 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
5864 directly instead of going through a func. One very bad thing: a
5865 static LyXFindReplace, but I don't know where to place it.
5867 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
5868 string instead of char[]. Also changed to static.
5869 (GetSelectionOrWordAtCursor): changed to static inline
5870 (SetSelectionOverLenChars): ditto.
5872 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
5873 current_view and global variables. both classes has changed names
5874 and LyXFindReplace is not inherited from SearchForm.
5876 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
5877 fl_form_search form.
5879 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
5881 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5883 * lib/bind/*.bind: make sure 'buffer-previous' function is not
5884 bound (from Kayvan).
5886 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
5888 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
5890 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5892 * some things that I should comment but the local pub says head to
5895 * comment out all code that belongs to the Roff code for Ascii
5896 export of tables. (this is unused)
5898 * src/LyXView.C: use correct type for global variable
5899 current_layout. (LyXTextClass::size_type)
5901 * some code to get the new insetgraphics closer to working I'd be
5902 grateful for any help.
5904 * src/BufferView2.C (insertInset): use the return type of
5905 NumberOfLayout properly. (also changes in other files)
5907 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
5908 this as a test. I want to know what breaks because of this.
5910 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
5912 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
5914 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
5915 to use a \makebox in the label, this allows proper justification
5916 with out using protected spaces or multiple hfills. Now it is
5917 "label" for left justified, "\hfill label\hfill" for center, and
5918 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
5919 should be changed accordingly.
5921 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5923 * src/lyxtext.h: change SetLayout() to take a
5924 LyXTextClass::size_type instead of a char (when there is more than
5925 127 layouts in a class); also change type of copylayouttype.
5926 * src/text2.C (SetLayout): ditto.
5927 * src/LyXView.C (updateLayoutChoice): ditto.
5929 * src/LaTeX.C (scanLogFile): errors where the line number was not
5930 given just after the '!'-line were ignored (from Dekel Tsur).
5932 * lib/lyxrc.example: fix description of \date_insert_format
5934 * lib/layouts/llncs.layout: new layout, contributed by Martin
5937 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5939 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
5940 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
5941 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
5942 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
5943 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
5944 paragraph.C, text.C, text2.C)
5946 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5948 * src/insets/insettext.C (LocalDispatch): remove extra break
5951 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
5952 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
5954 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
5955 * src/insets/insettext.[Ch] (GetCursorPos): ditto
5957 * src/insets/insetbib.h: move InsetBibkey::Holder and
5958 InsetCitation::Holder in public space.
5960 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5962 * src/insets/insettext.h: small change to get the new files from
5963 Juergen to compile (use "string", not "class string").
5965 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
5966 const & as parameter to LocalDispatch, use LyXFont const & as
5967 paramter to some other func. This also had impacto on lyxinsets.h
5968 and the two mathed insets.
5970 2000-02-24 Juergen Vigna <jug@sad.it>
5973 * src/commandtags.h:
5975 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
5979 * src/BufferView2.C: added/updated code for various inset-functions
5981 * src/insets/insetert.[Ch]: added implementation of InsetERT
5983 * src/insets/insettext.[Ch]: added implementation of InsetText
5985 * src/insets/inset.C (Edit): added "unsigned int button" parameter
5986 (draw): added preliminary code for inset scrolling not finshed yet
5988 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
5989 as it is in lyxfunc.C now
5991 * src/insets/lyxinset.h: Added functions for text-insets
5993 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5995 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
5996 BufferView and reimplement the list as a queue put inside its own
5999 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
6001 * several files: use the new interface to the "updateinsetlist"
6003 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
6005 (work_area_handler): call BufferView::trippleClick on trippleclick.
6007 * src/BufferView.C (doubleClick): new function, selects word on
6009 (trippleClick): new function, selects line on trippleclick.
6011 2000-02-22 Allan Rae <rae@lyx.org>
6013 * lib/bind/xemacs.bind: buffer-previous not supported
6015 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6017 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
6020 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6022 * src/bufferlist.C: get rid of current_view from this file
6024 * src/spellchecker.C: get rid of current_view from this file
6026 * src/vspace.C: get rid of current_view from this file
6027 (inPixels): added BufferView parameter for this func
6028 (asLatexCommand): added a BufferParams for this func
6030 * src/text.C src/text2.C: get rid of current_view from these
6033 * src/lyxfont.C (getFontDirection): move this function here from
6036 * src/bufferparams.C (getDocumentDirection): move this function
6039 * src/paragraph.C (getParDirection): move this function here from
6041 (getLetterDirection): ditto
6043 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6045 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
6046 resize due to wrong pixmap beeing used. Also took the opurtunity
6047 to make the LyXScreen stateless on regard to WorkArea and some
6048 general cleanup in the same files.
6050 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6052 * src/Makefile.am: add missing direction.h
6054 * src/PainterBase.h: made the width functions const.
6056 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
6059 * src/insets/insetcommand.C (draw): draw Editable as buttons.
6061 * src/insets/insetlatexaccent.C (draw): make the accents draw
6062 better, at present this will only work well with iso8859-1.
6064 * several files: remove the old drawing code, now we use the new
6067 * several files: remove support for mono_video, reverse_video and
6070 2000-02-17 Juergen Vigna <jug@sad.it>
6072 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
6073 int ** as we have to return the pointer, otherwise we have only
6074 NULL pointers in the returning function.
6076 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6078 * src/LaTeX.C (operator()): quote file name when running latex.
6080 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6082 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
6083 (bubble tip), this removes our special handling of this.
6085 * Remove all code that is unused now that we have the new
6086 workarea. (Code that are not active when NEW_WA is defined.)
6088 * Make the uses of XSync not conditionalized on define USE_XSYNC.
6090 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6092 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
6093 nonexisting layout; correctly redirect obsoleted layouts.
6095 * lib/lyxrc.example: document \view_dvi_paper_option
6097 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
6100 * src/lyx_cb.C (RunScript): handle $$FName for command names.
6101 (PreviewDVI): handle the view_dvi_paper_option variable.
6102 [Both from Roland Krause]
6104 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6106 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
6107 char const *, int, LyXFont)
6108 (text(int, int, string, LyXFont)): ditto
6110 * src/text.C (InsertCharInTable): attempt to fix the double-space
6111 feature in tables too.
6112 (BackspaceInTable): ditto.
6113 (GetVisibleRow): make bottom pagebreak line be a onoff line.
6115 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6117 * src/text2.C (owner): only complain if owner_ is set and bv != 0
6119 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
6120 newly found text in textcache to this.
6121 (buffer): set the owner of the text put into the textcache to 0
6123 * src/insets/figinset.C (draw): fixed the drawing of figures with
6126 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
6127 drawing of mathframe, hfills, protected space, table lines. I have
6128 now no outstanding drawing problems with the new Painter code.
6130 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6132 * src/PainterBase.C (ellipse, circle): do not specify the default
6135 * src/LColor.h: add using directive.
6137 * src/Painter.[Ch]: change return type of methods from Painter& to
6138 PainterBase&. Add a using directive.
6140 * src/WorkArea.C: wrap xforms callbacks in C functions
6143 * lib/layouts/foils.layout: font fix and simplifications from Carl
6146 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6148 * a lot of files: The Painter, LColor and WorkArea from the old
6149 devel branch has been ported to lyx-devel. Some new files and a
6150 lot of #ifdeffed code. The new workarea is enabled by default, but
6151 if you want to test the new Painter and LColor you have to compile
6152 with USE_PAINTER defined (do this in config.h f.ex.) There are
6153 still some rought edges, and I'd like some help to clear those
6154 out. It looks stable (loads and displays the Userguide very well).
6157 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6159 * src/buffer.C (pop_tag): revert to the previous implementation
6160 (use a global variable for both loops).
6162 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
6164 * src/lyxrc.C (LyXRC): change slightly default date format.
6166 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
6167 there is an English text with a footnote that starts with a Hebrew
6168 paragraph, or vice versa.
6169 (TeXFootnote): ditto.
6171 * src/text.C (LeftMargin): allow for negative values for
6172 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
6175 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
6176 for input encoding (cyrillic)
6178 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6180 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
6183 * src/toolbar.C (set): ditto
6184 * src/insets/insetbib.C (create_form_citation_form): ditto
6186 * lib/CREDITS: added Dekel Tsur.
6188 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
6189 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
6190 hebrew supports files from Dekel Tsur.
6192 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
6193 <tzafrir@technion.ac.il>
6195 * src/lyxrc.C: put \date_insert_format at the right place.
6197 * src/buffer.C (makeLaTeXFile): fix the handling of
6198 BufferParams::sides when writing out latex files.
6200 * src/BufferView2.C: add a "using" directive.
6202 * src/support/lyxsum.C (sum): when we use lyxstring,
6203 ostringstream::str needs an additional .c_str().
6205 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6207 * src/support/filetools.C (ChangeExtension): patch from Etienne
6210 * src/TextCache.C (show): remove const_cast and make second
6211 parameter non-const LyXText *.
6213 * src/TextCache.h: use non const LyXText in show.
6215 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
6218 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6220 * src/support/lyxsum.C: rework to be more flexible.
6222 * several places: don't check if a pointer is 0 if you are going
6225 * src/text.C: remove some dead code.
6227 * src/insets/figinset.C: remove some dead code
6229 * src/buffer.C: move the BufferView funcs to BufferView2.C
6230 remove all support for insetlatexdel
6231 remove support for oldpapersize stuff
6232 made some member funcs const
6234 * src/kbmap.C: use a std::list to store the bindings in.
6236 * src/BufferView2.C: new file
6238 * src/kbsequence.[Ch]: new files
6240 * src/LyXAction.C + others: remove all trace of buffer-previous
6242 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
6243 only have one copy in the binary of this table.
6245 * hebrew patch: moved some functions from LyXText to more
6246 appropriate places. (LyXParagraph, BufferParams, LyXFont)
6248 * several files: remove support for XForms older than 0.88
6250 remove some #if 0 #endif code
6252 * src/TextCache.[Ch]: new file. Holds the textcache.
6254 * src/BufferView.C: changes to use the new TextCache interface.
6255 (waitForX): remove the now unused code.
6257 * src/BackStack.h: remove some commented code
6259 * lib/bind/emacs.bind: remove binding for buffer-previous
6261 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6263 * applied the hebrew patch.
6265 * src/lyxrow.h: make sure that all Row variables are initialized.
6267 * src/text2.C (TextHandleUndo): comment out a delete, this might
6268 introduce a memory leak, but should also help us to not try to
6269 read freed memory. We need to look at this one.
6271 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
6272 (LyXParagraph): initalize footnotekind.
6274 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
6275 forgot this when applying the patch. Please heed the warnings.
6277 * src/BufferView.C (buffer): a fix for the buffer-reload problem
6278 (aka. reformat problem)
6280 * src/bufferlist.C (exists): made const, and use const_iterator
6281 (isLoaded): new func.
6282 (release): use std::find to find the correct buffer.
6284 * src/bufferlist.h: made getState a const func.
6285 made empty a const func.
6286 made exists a const func.
6289 2000-02-01 Juergen Vigna <jug@sad.it>
6291 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
6293 * po/it.po: updated a bit the italian po file and also changed the
6294 'file nuovo' for newfile to 'filenuovo' without a space, this did
6297 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
6298 for the new insert_date command.
6300 * src/lyxfunc.C (Dispatch): added support for a insert_date function
6301 from jdblair, to insert a date into the current text conforming to
6302 a strftime format (for now only considering the locale-set and not
6303 the document-language).
6305 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6307 * src/lyxfont.C (textWidth): hopefully better fix for the Array
6308 Bounds Read error seen by purify. The problem was that islower is
6309 a macros which takes an unsigned char and uses it as an index for
6310 in array of characters properties (and is thus subject to the
6314 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
6315 correctly the paper sides radio buttons.
6316 (UpdateDocumentButtons): ditto.
6318 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6320 * src/kbmap.C (getsym + others): change to return unsigned int,
6321 returning a long can give problems on 64 bit systems. (I assume
6322 that int is 32bit on 64bit systems)
6324 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6326 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
6327 LyXLookupString to be zero-terminated. Really fixes problems seen
6330 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6332 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
6333 write a (char*)0 to the lyxerr stream.
6335 * src/lastfiles.C: move algorithm before the using statemets.
6337 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6339 * src/lastfiles.C: move using directives in global scope (egcs 1.x
6340 complains otherwise).
6341 * src/table.C: ditto
6343 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
6346 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
6347 that I removed earlier... It is really needed.
6349 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
6351 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6353 * INSTALL: update xforms home page URL.
6355 * lib/configure.m4: fix a bug with unreadable layout files.
6357 * src/table.C (calculate_width_of_column): add "using std::max"
6360 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6362 * several files: marked several lines with "DEL LINE", this is
6363 lines that can be deleted without changing anything.
6364 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
6365 checks this anyway */
6368 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
6370 * src/DepTable.C (update): add a "+" at the end when the checksum
6371 is different. (debugging string only)
6373 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
6374 the next inset to not be displayed. This should also fix the list
6375 of labels in the "Insert Crossreference" dialog.
6377 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6379 * src/support/LSubstring.C (LSubstring): set pos to string::npos
6380 when regex was not found.
6382 * src/support/lstrings.C (lowercase): use handcoded transform always.
6385 * src/text.C (Delete): fixed the crash. cursor.par->prev and
6386 old_cursor.par->prev could be 0.
6388 * several files: changed post inc/dec to pre inc/dec
6390 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
6391 write the lastfiles to file.
6393 * src/BufferView.C (buffer): only show TextCache info when debugging
6395 (resizeCurrentBuffer): ditto
6396 (workAreaExpose): ditto
6398 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
6400 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
6402 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
6403 a bit better by removing the special case for \i and \j.
6405 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6407 * src/lyx_main.C (easyParse): remove test for bad comand line
6408 options, since this broke all xforms-related parsing.
6410 * src/kbmap.C (getsym): set return type to unsigned long, as
6411 declared in header. On an alpha, long is _not_ the same as int.
6413 * src/support/LOstream.h: add a "using std::flush;"
6415 * src/insets/figinset.C: ditto.
6417 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6419 * src/bufferlist.C (write): use blinding fast file copy instead of
6420 "a char at a time", now we are doing it the C++ way.
6422 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
6423 std::list<int> instead.
6424 (addpidwait): reflect move to std::list<int>
6425 (sigchldchecker): ditto
6427 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
6430 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
6431 that obviously was wrong...
6433 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
6434 c, this avoids warnings with purify and islower.
6436 * src/insets/figinset.C: rename struct queue to struct
6437 queue_element and rewrite to use a std::queue. gsqueue is now a
6438 std::queue<queue_element>
6439 (runqueue): reflect move to std::queue
6442 * src/support/lstrings.h (tostr): specialize for bool, otherwise
6443 we would get "1" "0" instead of "true" "false. Also make the tostr
6446 2000-01-21 Juergen Vigna <jug@sad.it>
6448 * src/buffer.C (writeFileAscii): Disabled code for special groff
6449 handling of tabulars till I fix this in table.C
6451 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6453 * src/support/mkdir.C (mkdir): change second argument of mkdir to
6455 * src/support/lyxlib.h: ditto.
6457 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6459 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
6460 and 'j' look better. This might fix the "macron" bug that has been
6463 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
6464 functions as one template function. Delete the old versions.
6466 * src/support/lyxsum.C: move using std::ifstream inside
6469 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
6472 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
6474 * src/mathed/formula.C: delete #include "bufferlist.h" never used
6476 * src/insets/figinset.C (InitFigures): use new instead of malloc
6477 to allocate memory for figures and bitmaps.
6478 (DoneFigures): use delete[] instead of free to deallocate memory
6479 for figures and bitmaps.
6480 (runqueue): use new to allocate
6481 (getfigdata): use new/delete[] instead of malloc/free
6482 (RegisterFigure): ditto
6484 * some files: moved some declarations closer to first use, small
6485 whitespace changes use preincrement instead of postincrement where
6486 it does not make a difference.
6488 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
6489 step on the way to use stl::containers for key maps.
6491 * src/bufferlist.h: add a typedef for const_iterator and const
6492 versions of begin and end.
6494 * src/bufferlist.[Ch]: change name of member variable _state to
6495 state_. (avoid reserved names)
6497 (getFileNames): returns the filenames of the buffers in a vector.
6499 * configure.in (ALL_LINGUAS): added ro
6501 * src/support/putenv.C: new file
6503 * src/support/mkdir.C: new file
6505 2000-01-20 Allan Rae <rae@lyx.org>
6507 * lib/layouts/IEEEtran.layout: Added several theorem environments
6509 * lib/templates/IEEEtran.lyx: Example theorem environments and a
6510 couple of minor additions.
6512 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
6513 (except for those in footnotes of course)
6515 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6517 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
6519 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
6520 std::sort and std::lower_bound instead of qsort and handwritten
6522 (struct compara): struct that holds the functors used by std::sort
6523 and std::lower_bound in MathedLookupBOP.
6525 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6527 * src/support/LAssert.h: do not do partial specialization. We do
6530 * src/support/lyxlib.h: note that lyx::getUserName() and
6531 lyx::date() are not in use right now. Should these be suppressed?
6533 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
6534 (makeLinuxDocFile): do not put date and user name in linuxdoc
6537 * src/support/lyxlib.h (kill): change first argument to long int,
6538 since that's what solaris uses.
6540 * src/support/kill.C (kill): fix declaration to match prototype.
6542 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
6543 actually check whether namespaces are supported. This is not what
6546 * src/support/lyxsum.C: add a using directive.
6548 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6550 * src/support/kill.C: if we have namespace support we don't have
6551 to include lyxlib.h.
6553 * src/support/lyxlib.h: use namespace lyx if supported.
6555 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6557 * src/support/date.C: new file
6559 * src/support/chdir.C: new file
6561 * src/support/getUserName.C: new file
6563 * src/support/getcwd.C: new file
6565 * src/support/abort.C: new file
6567 * src/support/kill.C: new file
6569 * src/support/lyxlib.h: moved all the functions in this file
6570 insede struct lyx. Added also kill and abort to this struct. This
6571 is a way to avoid the "kill is not defined in <csignal>", we make
6572 C++ wrappers for functions that are not ANSI C or ANSI C++.
6574 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
6575 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
6576 lyx it has been renamed to sum.
6578 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6580 * src/text.C: add using directives for std::min and std::max.
6582 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6584 * src/texrow.C (getIdFromRow): actually return something useful in
6585 id and pos. Hopefully fixes the bug with positionning of errorbox
6588 * src/lyx_main.C (easyParse): output an error and exit if an
6589 incorrect command line option has been given.
6591 * src/spellchecker.C (ispell_check_word): document a memory leak.
6593 * src/bufferlist.C (write): fix mismatched allocation/deletion,
6594 where a "struct utimbuf" is allocated with "new" and deleted with
6597 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
6599 * src/text2.C (CutSelection): don't delete double spaces.
6600 (PasteSelection): ditto
6601 (CopySelection): ditto
6603 * src/text.C (Backspace): don't delete double spaces.
6605 * src/lyxlex.C (next): fix a bug that were only present with
6606 conformant std::istream::get to read comment lines, use
6607 std::istream::getline instead. This seems to fix the problem.
6609 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6611 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
6612 allowed to insert space before space" editing problem. Please read
6613 commends at the beginning of the function. Comments about usage
6616 * src/text.C (InsertChar): fix for the "not allowed to insert
6617 space before space" editing problem.
6619 * src/text2.C (DeleteEmptyParagraphMechanism): when
6620 IsEmptyTableRow can only return false this last "else if" will
6621 always be a no-op. Commented out.
6623 * src/text.C (RedoParagraph): As far as I can understand tmp
6624 cursor is not really needed.
6626 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
6627 present it could only return false anyway.
6628 (several functions): Did something not so smart...added a const
6629 specifier on a lot of methods.
6631 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
6632 and add a tmp->text.resize. The LyXParagraph constructor does the
6634 (BreakParagraphConservative): ditto
6636 * src/support/path.h (Path): add a define so that the wrong usage
6637 "Path("/tmp") will be flagged as a compilation error:
6638 "`unnamed_Path' undeclared (first use this function)"
6640 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6642 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
6643 which was bogus for several reasons.
6645 * src/LaTeX.C (scanAux): fix the regular expression used to scan
6649 * autogen.sh: do not use "type -path" (what's that anyway?).
6651 * src/support/filetools.C (findtexfile): remove extraneous space
6652 which caused a kpsewhich warning (at least with kpathsea version
6655 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6657 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
6659 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
6661 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
6663 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6665 * src/paragraph.C (BreakParagraph): do not reserve space on text
6666 if we don't need to (otherwise, if pos_end < pos, we end up
6667 reserving huge amounts of memory due to bad unsigned karma).
6668 (BreakParagraphConservative): ditto, although I have not seen
6669 evidence the bug can happen here.
6671 * src/lyxparagraph.h: add a using std::list.
6673 2000-01-11 Juergen Vigna <jug@sad.it>
6675 * src/menus.C (MenuDocu): output an Alert if the documentation-file
6678 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6680 * src/vc-backend.C (doVCCommand): change to be static and take one
6681 more parameter: the path to chdir too be fore executing the command.
6682 (retrive): new function equiv to "co -r"
6684 * src/bufferlist.C (loadLyXFile): implement the missing parts if
6685 file_not_found_hook is true.
6687 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
6689 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
6690 if a file is readwrite,readonly...anything else.
6692 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6694 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
6695 (CreatePostscript): name change from MenuRunDVIPS (or something)
6696 (PreviewPostscript): name change from MenuPreviewPS
6697 (PreviewDVI): name change from MenuPreviewDVI
6699 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
6700 \view_pdf_command., \pdf_to_ps_command
6702 * lib/configure.m4: added search for PDF viewer, and search for
6703 PDF to PS converter.
6704 (lyxrc.defaults output): add \pdflatex_command,
6705 \view_pdf_command and \pdf_to_ps_command.
6707 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
6709 * src/bufferlist.C (write): we don't use blocksize for anything so
6712 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6714 * src/support/block.h: disable operator T* (), since it causes
6715 problems with both compilers I tried. See comments in the file.
6717 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
6720 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
6721 variable LYX_DIR_10x to LYX_DIR_11x.
6723 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
6725 * INSTALL: document --with-lyxname.
6728 * configure.in: new configure flag --with-lyxname which allows to
6729 choose the name under which lyx is installed. Default is "lyx", of
6730 course. It used to be possible to do this with --program-suffix,
6731 but the later has in fact a different meaning for autoconf.
6733 * src/support/lstrings.h (lstrchr): reformat a bit.
6735 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
6736 * src/mathed/math_defs.h: ditto.
6738 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6740 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
6741 true, decides if we create a backup file or not when saving. New
6742 tag and variable \pdf_mode, defaults to false. New tag and
6743 variable \pdflatex_command, defaults to pdflatex. New tag and
6744 variable \view_pdf_command, defaults to xpdf. New tag and variable
6745 \pdf_to_ps_command, defaults to pdf2ps.
6747 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6749 * src/bufferlist.C (close): don't call insetUnlock if the buffer
6750 does not have a BufferView.
6751 (unlockInset): ditto + don't access the_locking_inset if the
6752 buffer does not have a BufferView.
6754 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
6755 certain circumstances so that we don't continue a keyboard
6756 operation long after the key was released. Try f.ex. to load a
6757 large document, press PageDown for some seconds and then release
6758 it. Before this change the document would contine to scroll for
6759 some time, with this change it stops imidiatly.
6761 * src/support/block.h: don't allocate more space than needed. As
6762 long as we don't try to write to the arr[x] in a array_type arr[x]
6763 it is perfectly ok. (if you write to it you might segfault).
6764 added operator value_type*() so that is possible to pass the array
6765 to functions expecting a C-pointer.
6767 * lib/Makefile.am (dist-hook): don't fail completely if unable to
6770 * intl/*: updated to gettext 0.10.35, tried to add our own
6771 required modifications. Please verify.
6773 * po/*: updated to gettext 0.10.35, tried to add our own required
6774 modifications. Please verify.
6776 * src/support/lstrings.C (tostr): go at fixing the problem with
6777 cxx and stringstream. When stringstream is used return
6778 oss.str().c_str() so that problems with lyxstring and basic_string
6779 are avoided. Note that the best solution would be for cxx to use
6780 basic_string all the way, but it is not conformant yet. (it seems)
6782 * src/lyx_cb.C + other files: moved several global functions to
6783 class BufferView, some have been moved to BufferView.[Ch] others
6784 are still located in lyx_cb.C. Code changes because of this. (part
6785 of "get rid of current_view project".)
6787 * src/buffer.C + other files: moved several Buffer functions to
6788 class BufferView, the functions are still present in buffer.C.
6789 Code changes because of this.
6791 * config/lcmessage.m4: updated to most recent. used when creating
6794 * config/progtest.m4: updated to most recent. used when creating
6797 * config/gettext.m4: updated to most recent. applied patch for
6800 * config/gettext.m4.patch: new file that shows what changes we
6801 have done to the local copy of gettext.m4.
6803 * config/libtool.m4: new file, used in creation of acinclude.m4
6805 * config/lyxinclude.m4: new file, this is the lyx created m4
6806 macros, used in making acinclude.m4.
6808 * autogen.sh: GNU m4 discovered as a separate task not as part of
6809 the lib/configure creation.
6810 Generate acinlucde from files in config. Actually cat
6811 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
6812 easier to upgrade .m4 files that really are external.
6814 * src/Spacing.h: moved using std::istringstream to right after
6815 <sstream>. This should fix the problem seen with some compilers.
6817 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6819 * src/lyx_cb.C: began some work to remove the dependency a lot of
6820 functions have on BufferView::text, even if not really needed.
6821 (GetCurrentTextClass): removed this func, it only hid the
6824 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
6825 forgot this in last commit.
6827 * src/Bullet.C (bulletEntry): use static char const *[] for the
6828 tables, becuase of this the return arg had to change to string.
6830 (~Bullet): removed unneeded destructor
6832 * src/BufferView.C (beforeChange): moved from lyx_cb.C
6833 (insetSleep): moved from Buffer
6834 (insetWakeup): moved from Buffer
6835 (insetUnlock): moved from Buffer
6837 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
6838 from Buffer to BufferView.
6840 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
6842 * config/ltmain.sh: updated to version 1.3.4 of libtool
6844 * config/ltconfig: updated to version 1.3.4 of libtool
6846 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6849 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
6850 Did I get that right?
6852 * src/lyxlex.h: add a "using" directive or two.
6853 * src/Spacing.h: ditto.
6854 * src/insets/figinset.C: ditto.
6855 * src/support/filetools.C: ditto.
6856 * src/support/lstrings.C: ditto.
6857 * src/BufferView.C: ditto.
6858 * src/bufferlist.C: ditto.
6859 * src/lyx_cb.C: ditto.
6860 * src/lyxlex.C: ditto.
6862 * NEWS: add some changes for 1.1.4.
6864 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6866 * src/BufferView.C: first go at a TextCache to speed up switching
6869 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6871 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
6872 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
6873 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
6874 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
6877 * src/mathed/math_defs.h (MathedRowSt): make sure that all
6878 members of the struct are correctly initialized to 0 (detected by
6880 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
6881 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
6883 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
6884 pidwait, since it was allocated with "new". This was potentially
6885 very bad. Thanks to Michael Schmitt for running purify for us.
6888 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6890 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
6892 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
6894 1999-12-30 Allan Rae <rae@lyx.org>
6896 * lib/templates/IEEEtran.lyx: minor change
6898 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
6899 src/mathed/formula.C (LocalDispatch): askForText changes
6901 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
6902 know when a user has cancelled input. Fixes annoying problems with
6903 inserting labels and version control.
6905 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6907 * src/support/lstrings.C (tostr): rewritten to use strstream and
6910 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6912 * src/support/filetools.C (IsFileWriteable): use fstream to check
6913 (IsDirWriteable): use fileinfo to check
6915 * src/support/filetools.h (FilePtr): whole class deleted
6917 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
6919 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
6921 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
6923 * src/bufferlist.C (write): use ifstream and ofstream instead of
6926 * src/Spacing.h: use istrstream instead of sscanf
6928 * src/mathed/math_defs.h: change first arg to istream from FILE*
6930 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
6932 * src/mathed/math_parser.C: have yyis to be an istream
6933 (LexGetArg): use istream (yyis)
6935 (mathed_parse): ditto
6936 (mathed_parser_file): first arg istream instead of FILE*, set yyis
6938 * src/mathed/formula.C (Read): rewritten to use istream
6940 * src/mathed/formulamacro.C (Read): rewritten to use istream
6942 * src/lyxlex.h (~LyXLex): deleted desturctor
6943 (getStream): new function, returns an istream
6944 (getFile): deleted funtion
6945 (IsOK): return is.good();
6947 * src/lyxlex.C (LyXLex): delete file and owns_file
6948 (setFile): open an filebuf and assign that to a istream instead of
6950 (setStream): new function, takes an istream as arg.
6951 (setFile): deleted function
6952 (EatLine): rewritten us use istream instead of FILE*
6956 * src/table.C (LyXTable): use istream instead of FILE*
6957 (Read): rewritten to take an istream instead of FILE*
6959 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6961 * src/buffer.C (Dispatch): remove an extraneous break statement.
6963 * src/support/filetools.C (QuoteName): change to do simple
6964 'quoting'. More work is necessary. Also changed to do nothing
6965 under emx (needs fix too).
6966 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
6968 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
6969 config.h.in to the AC_DEFINE_UNQUOTED() call.
6970 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
6971 needs char * as argument (because Solaris 7 declares it like
6974 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
6975 remove definition of BZERO.
6977 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6979 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
6980 defined, "lyxregex.h" if not.
6982 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
6984 (REGEX): new variable that is set to regex.c lyxregex.h when
6985 AM_CONDITIONAL USE_REGEX is set.
6986 (libsupport_la_SOURCES): add $(REGEX)
6988 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
6991 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
6994 * configure.in: add call to LYX_REGEX
6996 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
6997 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
6999 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7001 * lib/bind/fi_menus.bind: new file, from
7002 pauli.virtanen@saunalahti.fi.
7004 * src/buffer.C (getBibkeyList): pass the parameter delim to
7005 InsetInclude::getKeys and InsetBibtex::getKeys.
7007 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
7008 is passed to Buffer::getBibkeyList
7010 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
7011 instead of the hardcoded comma.
7013 * src/insets/insetbib.C (getKeys): make sure that there are not
7014 leading blanks in bibtex keys. Normal latex does not care, but
7015 harvard.sty seems to dislike blanks at the beginning of citation
7016 keys. In particular, the retturn value of the function is
7018 * INSTALL: make it clear that libstdc++ is needed and that gcc
7019 2.7.x probably does not work.
7021 * src/support/filetools.C (findtexfile): make debug message go to
7023 * src/insets/insetbib.C (getKeys): ditto
7025 * src/debug.C (showTags): make sure that the output is correctly
7028 * configure.in: add a comment for TWO_COLOR_ICON define.
7030 * acconfig.h: remove all the entries that already defined in
7031 configure.in or acinclude.m4.
7033 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
7034 to avoid user name, date and copyright.
7036 1999-12-21 Juergen Vigna <jug@sad.it>
7038 * src/table.C (Read): Now read bogus row format informations
7039 if the format is < 5 so that afterwards the table can
7040 be read by lyx but without any format-info. Fixed the
7041 crash we experienced when not doing this.
7043 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7045 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
7046 (RedoDrawingOfParagraph): ditto
7047 (RedoParagraphs): ditto
7048 (RemoveTableRow): ditto
7050 * src/text.C (Fill): rename arg paperwidth -> paper_width
7052 * src/buffer.C (insertLyXFile): rename var filename -> fname
7053 (writeFile): rename arg filename -> fname
7054 (writeFileAscii): ditto
7055 (makeLaTeXFile): ditto
7056 (makeLinuxDocFile): ditto
7057 (makeDocBookFile): ditto
7059 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
7062 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
7064 * src/bmtable.h: add extern "C" on this file when __cplusplus is
7067 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
7068 compiled by a C compiler not C++.
7070 * src/layout.h (LyXTextClass): added typedef for const_iterator
7071 (LyXTextClassList): added typedef for const_iterator + member
7072 functions begin and end.
7074 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
7075 iterators to fill the choice_class.
7076 (updateLayoutChoice): rewritten to use iterators to fill the
7077 layoutlist in the toolbar.
7079 * src/BufferView.h (BufferView::work_area_width): removed unused
7082 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
7084 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
7085 (sgmlCloseTag): ditto
7087 * src/support/lstrings.h: return type of countChar changed to
7090 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
7091 what version of this func to use. Also made to return unsigned int.
7093 * configure.in: call LYX_STD_COUNT
7095 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
7096 conforming std::count.
7098 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7100 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
7101 and a subscript would give bad display (patch from Dekel Tsur
7102 <dekel@math.tau.ac.il>).
7104 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
7106 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
7109 * src/chset.h: add a few 'using' directives
7111 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
7112 triggered when no buffer is active
7114 * src/layout.C: removed `break' after `return' in switch(), since
7117 * src/lyx_main.C (init): make sure LyX can be ran in place even
7118 when libtool has done its magic with shared libraries. Fix the
7119 test for the case when the system directory has not been found.
7121 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
7122 name for the latex file.
7123 (MenuMakeHTML): ditto
7125 * src/buffer.h: add an optional boolean argument, which is passed
7128 1999-12-20 Allan Rae <rae@lyx.org>
7130 * lib/templates/IEEEtran.lyx: small correction and update.
7132 * configure.in: Attempted to use LYX_PATH_HEADER
7134 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
7136 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
7137 input from JMarc. Now use preprocessor to find the header.
7138 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
7139 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
7140 LYX_STL_STRING_FWD. See comments in file.
7142 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
7144 * The global MiniBuffer * minibuffer variable is dead.
7146 * The global FD_form_main * fd_form_main variable is dead.
7148 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7150 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
7152 * src/table.h: add the LOstream.h header
7153 * src/debug.h: ditto
7155 * src/LyXAction.h: change the explaination of the ReadOnly
7156 attribute: is indicates that the function _can_ be used.
7158 * src/LyXAction.C (init): find-replace _can_ be used in read-only
7161 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7163 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
7169 * src/paragraph.C (GetWord): assert on pos>=0
7172 * src/support/lyxstring.C: condition the use of an invariant on
7174 * src/support/lyxstring.h: ditto
7176 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
7177 Use LAssert.h instead of plain assert().
7179 * src/support/lstrings.h: add LAssert.h, in case it is needed.
7181 * src/lyxfunc.C: do not include LAssert.h, it is not used.
7182 * src/support/filetools.C: ditto
7184 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
7187 * INSTALL: document the new configure flags
7189 * configure.in: suppress --with-debug; add --enable-assertions
7191 * acinclude.m4: various changes in alignment of help strings.
7193 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7195 * src/kbmap.C: commented out the use of the hash map in kb_map,
7196 beginning of movement to a stl::container.
7198 * several files: removed code that was not in effect when
7199 MOVE_TEXT was defined.
7201 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
7202 for escaping should not be used. We can discuss if the string
7203 should be enclosed in f.ex. [] instead of "".
7205 * src/trans_mgr.C (insert): use the new returned value from
7206 encodeString to get deadkeys and keymaps done correctly.
7208 * src/chset.C (encodeString): changed to return a pair, to tell
7209 what to use if we know the string.
7211 * src/lyxscreen.h (fillArc): new function.
7213 * src/FontInfo.C (resize): rewritten to use more std::string like
7214 structore, especially string::replace.
7216 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
7219 * configure.in (chmod +x some scripts): remove config/gcc-hack
7221 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7223 * src/buffer.C (writeFile): change once again the top comment in a
7224 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
7225 instead of an hardcoded version number.
7226 (makeDocBookFile): ditto
7228 * src/version.h: add new define LYX_DOCVERSION
7230 * po/de.po: update from Pit Sütterlin
7231 * lib/bind/de_menus.bind: ditto.
7233 * src/lyxfunc.C (Dispatch): call MenuExport()
7234 * src/buffer.C (Dispatch): ditto
7236 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
7237 LyXFunc::Dispatch().
7238 (MenuExport): new function, moved from
7239 LyXFunc::Dispatch().
7241 * src/trans_mgr.C (insert): small cleanup
7242 * src/chset.C (loadFile): ditto
7244 * lib/kbd/iso8859-1.cdef: add missing backslashes
7246 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7248 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
7249 help with placing the manually drawn accents better.
7251 (Draw): x2 and hg changed to float to minimize rounding errors and
7252 help place the accents better.
7254 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
7255 unsigned short to char is just wrong...cast the char to unsigned
7256 char instead so that the two values can compare sanely. This
7257 should also make the display of insetlatexaccents better and
7258 perhaps also some other insets.
7260 (lbearing): new function
7263 1999-12-15 Allan Rae <rae@lyx.org>
7265 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
7266 header that provides a wrapper around the very annoying SGI STL header
7269 * src/support/lyxstring.C, src/LString.h:
7270 removed old SGI-STL-compatability attempts.
7272 * configure.in: Use LYX_STL_STRING_FWD.
7274 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
7275 stl_string_fwd.h is around and try to determine it's location.
7276 Major improvement over previous SGI STL 3.2 compatability.
7277 Three small problems remain with this function due to my zero
7278 knowledge of autoconf. JMarc and lgb see the comments in the code.
7280 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7282 * src/broken_const.h, config/hack-gcc, config/README: removed
7284 * configure.in: remove --with-gcc-hack option; do not call
7287 * INSTALL: remove documentation of --with-broken-const and
7290 * acconfig.h: remove all trace of BROKEN_CONST define
7292 * src/buffer.C (makeDocBookFile): update version number in output
7294 (SimpleDocBookOnePar): fix an assert when trying to a character
7295 access beyond string length
7298 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7300 * po/de.po: fix the Export menu
7302 * lyx.man: update the description of -dbg
7304 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
7305 (commandLineHelp): updated
7306 (easyParse): show list of available debug levels if -dbg is passed
7309 * src/Makefile.am: add debug.C
7311 * src/debug.h: moved some code to debug.C
7313 * src/debug.C: new file. Contains code to set and show debug
7316 * src/layout.C: remove 'break' after 'continue' in switch
7317 statements, since these cannot be reached.
7319 1999-12-13 Allan Rae <rae@lyx.org>
7321 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
7322 (in_word_set): hash() -> math_hash()
7324 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
7326 * acconfig.h: Added a test for whether we are using exceptions in the
7327 current compilation run. If so USING_EXCEPTIONS is defined.
7329 * config.in: Check for existance of stl_string_fwd.h
7330 * src/LString.h: If compiling --with-included-string and SGI's
7331 STL version 3.2 is present (see above test) we need to block their
7332 forward declaration of string and supply a __get_c_string().
7333 However, it turns out this is only necessary if compiling with
7334 exceptions enabled so I've a bit more to add yet.
7336 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
7337 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
7338 src/support/LRegex.h, src/undo.h:
7339 Shuffle the order of the included files a little to ensure that
7340 LString.h gets included before anything that includes stl_string_fwd.h
7342 * src/support/lyxstring.C: We need to #include LString.h instead of
7343 lyxstring.h to get the necessary definition of __get_c_string.
7344 (__get_c_string): New function. This is defined static just like SGI's
7345 although why they need to do this I'm not sure. Perhaps it should be
7346 in lstrings.C instead.
7348 * lib/templates/IEEEtran.lyx: New template file.
7350 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7352 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
7353 * intl/Makefile.in (MKINSTALLDIRS): ditto
7355 * src/LyXAction.C (init): changed to hold the LFUN data in a
7356 automatic array in stead of in callso to newFunc, this speeds up
7357 compilation a lot. Also all the memory used by the array is
7358 returned when the init is completed.
7360 * a lot of files: compiled with -Wold-style-cast, changed most of
7361 the reported offenders to C++ style casts. Did not change the
7362 offenders in C files.
7364 * src/trans.h (Match): change argument type to unsigned int.
7366 * src/support/DebugStream.C: fix some types on the streambufs so
7367 that it works on a conforming implementation.
7369 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7371 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
7373 * src/support/lyxstring.C: remove the inline added earlier since
7374 they cause a bunch of unsatisfied symbols when linking with dec
7375 cxx. Cxx likes to have the body of inlines at the place where they
7378 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
7379 accessing negative bounds in array. This fixes the crash when
7380 inserting accented characters.
7381 * src/trans.h (Match): ditto
7383 * src/buffer.C (Dispatch): since this is a void, it should not try
7384 to return anything...
7386 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7388 * src/buffer.h: removed the two friends from Buffer. Some changes
7389 because of this. Buffer::getFileName and Buffer::setFileName
7390 renamed to Buffer::fileName() and Buffer::fileName(...).
7392 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7394 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
7395 and Buffer::update(short) to BufferView. This move is currently
7396 controlled by a define MOVE_TEXT, this will be removed when all
7397 shows to be ok. This move paves the way for better separation
7398 between buffer contents and buffer view. One side effect is that
7399 the BufferView needs a rebreak when swiching buffers, if we want
7400 to avoid this we can add a cache that holds pointers to LyXText's
7401 that is not currently in use.
7403 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
7406 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7408 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
7410 * lyx_main.C: new command line option -x (or --execute) and
7411 -e (or --export). Now direct conversion from .lyx to .tex
7412 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
7413 Unfortunately, X is still needed and the GUI pops up during the
7416 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7418 * src/Spacing.C: add a using directive to bring stream stuff into
7420 * src/paragraph.C: ditto
7421 * src/buffer.C: ditto
7423 * NEWS: updated a bit the new features of 1.1.3 (took a few things
7424 from Lars' announcement).
7426 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
7427 example files from Tino Meinen.
7429 1999-12-06 Allan Rae <rae@lyx.org>
7431 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
7433 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7435 * src/support/lyxstring.C: added a lot of inline for no good
7438 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
7439 latexWriteEndChanges, they were not used.
7441 * src/layout.h (operator<<): output operator for PageSides
7443 * src/mathed/math_iter.C (my_memcpy): slightly changed.
7445 * some example files: loaded in LyX 1.0.4 and saved again to update
7446 certain constructs (table format)
7448 * a lot of files: did the change to use fstream/iostream for all
7449 writing of files. Done with a close look at Andre Poenitz's patch.
7451 * some files: whitespace changes.
7453 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7455 * src/mathed/math_iter.C (my_memcpy): new function. Since the
7456 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
7457 architecture, we provide our own. It is used unconditionnally, but
7458 I do not think this is a performance problem. Thanks to Angus
7459 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
7460 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
7462 (GetInset): use my_memcpy.
7466 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
7467 it is easier to understand, but it uses less TeX-only constructs now.
7469 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
7470 elements contain spaces
7472 * lib/configure: regenerated
7474 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
7475 elements contain spaces; display the list of programs that are
7478 * autogen.sh: make sure lib/configure is executable
7480 * lib/examples/*: rename the tutorial examples to begin with the
7481 two-letters language code.
7483 * src/lyxfunc.C (getStatus): do not query current font if no
7486 * src/lyx_cb.C (RunScript): use QuoteName
7487 (MenuRunDvips): ditto
7488 (PrintApplyCB): ditto
7490 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
7491 around argument, so that it works well with the current shell.
7492 Does not work properly with OS/2 shells currently.
7494 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
7495 * src/LyXSendto.C (SendtoApplyCB): ditto
7496 * src/lyxfunc.C (Dispatch): ditto
7497 * src/buffer.C (runLaTeX): ditto
7498 (runLiterate): ditto
7499 (buildProgram): ditto
7501 * src/lyx_cb.C (RunScript): ditto
7502 (MenuMakeLaTeX): ditto
7504 * src/buffer.h (getLatexName): new method
7506 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
7508 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7510 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
7511 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
7512 (create_math_panel): ditto
7514 * src/lyxfunc.C (getStatus): re-activate the code which gets
7515 current font and cursor; add test for export to html.
7517 * src/lyxrc.C (read): remove unreachable break statements; add a
7520 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
7522 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7524 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
7525 introduced by faulty regex.
7526 * src/buffer.C: ditto
7527 * src/lastfiles.C: ditto
7528 * src/paragraph.C: ditto
7529 * src/table.C: ditto
7530 * src/vspace.C: ditto
7531 * src/insets/figinset.C: ditto
7532 Note: most of these is absolutely harmless, except the one in
7533 src/mathed formula.C.
7535 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7537 * src/ImportNoweb.C (documentclass): fixed bounds for substr
7538 operation, yielding correct results for the reLyX command.
7540 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7542 * src/support/filetools.C (ExpandPath): removed an over eager
7544 (ReplaceEnvironmentPath): ditto
7546 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
7547 shows that we are doing something fishy in our code...
7551 * src/lyxrc.C (read): use a double switch trick to get more help
7552 from the compiler. (the same trick is used in layout.C)
7553 (write): new function. opens a ofstream and pass that to output
7554 (output): new function, takes a ostream and writes the lyxrc
7555 elemts to it. uses a dummy switch to make sure no elements are
7558 * src/lyxlex.h: added a struct pushpophelper for use in functions
7559 with more than one exit point.
7561 * src/lyxlex.[Ch] (GetInteger): made it const
7565 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
7567 * src/layout.[hC] : LayoutTags splitted into several enums, new
7568 methods created, better error handling cleaner use of lyxlex. Read
7571 * src/bmtable.[Ch]: change some member prototypes because of the
7572 image const changes.
7574 * commandtags.h, src/LyXAction.C (init): new function:
7575 "preferences-save", saves the lyxrc entries into .lyx/preferences.
7576 This file is not read automatically but you can add \input
7577 preferences to your lyxrc if you want to. We need to discuss how
7580 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
7581 in .aux, also remove .bib and .bst files from dependencies when
7584 * src/BufferView.C, src/LyXView.C: add const_cast several places
7585 because of changes to images.
7587 * lib/images/*: same change as for images/*
7589 * lib/lyxrc.example: Default for accept_compound is false not no.
7591 * images/*: changed to be const, however I have som misgivings
7592 about this change so it might be changed back.
7594 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7596 * lib/configure, po/POTFILES.in: regenerated
7598 * autogen.sh: autogenerate lib/configure from lib/configure.m4
7600 * config/lib_configure.m4: removed
7602 * lib/configure.m4: new file (was config/lib_configure.m4)
7604 * configure.in: do not test for rtti, since we do not use it.
7606 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7608 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
7609 doubling of allocated space scheme. This makes it faster for large
7610 strings end to use less memory for small strings. xtra rememoved.
7612 * src/insets/figinset.C (waitalarm): commented out.
7613 (GhostscriptMsg): use static_cast
7614 (GhostscriptMsg): use new instead of malloc to allocate memory for
7615 cmap. also delete the memory after use.
7617 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
7619 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
7620 for changes in bibtex database or style.
7621 (runBibTeX): remove all .bib and .bst files from dep before we
7623 (run): use scanAuc in when dep file already exist.
7625 * src/DepTable.C (remove_files_with_extension): new method
7628 * src/DepTable.[Ch]: made many of the methods const.
7630 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7632 * src/bufferparams.C: make sure that the default textclass is
7633 "article". It used to be the first one by description order, but
7634 now the first one is "docbook".
7636 * src/lyx_main.C (setDebuggingLevel): change type of argument to
7637 string; call Debug::value.
7638 (easyParse): pass complete argument to setDebuggingLevel().
7640 * src/debug.h (value): fix the code that parses debug levels.
7642 * src/debug.h: add new debug type ACTION, reserved for LyXAction
7645 * src/LyXAction.C: use Debug::ACTION as debug channel.
7647 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
7649 * NEWS: updated for the future 1.1.3 release.
7651 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
7652 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
7653 it should. This is of course a controversial change (since many
7654 people will find that their lyx workscreen is suddenly full of
7655 red), but done for the sake of correctness.
7657 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
7658 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
7660 * src/insets/inseterror.h, src/insets/inseturl.h,
7661 src/insets/insetinfo.h, src/insets/figinset.h,
7662 src/mathed/formulamacro.h, src/mathed/math_macro.h
7663 (EditMessage): add a missing const and add _() to make sure that
7666 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
7667 src/insets/insetbib.C, src/support/filetools.C: add `using'
7670 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
7671 doing 'Insert index of last word' at the beginning of a paragraph.
7673 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7675 * several files: white-space changes.
7677 * src/mathed/formula.C: removed IsAlpha and IsDigit
7679 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
7680 .bib file. use a ifstream instead of FilePtr when parsing the .bib
7683 * src/insets/figinset.C (GetPSSizes): don't break when
7684 "EndComments" is seen. But break when a boundingbox is read.
7686 * all classes inherited from Inset: return value of Clone
7687 changed back to Inset *.
7689 * all classes inherited form MathInset: return value of Clone
7690 changed back to MathedInset *.
7692 * src/insets/figinset.C (runqueue): use a ofstream to output the
7693 gs/ps file. Might need some setpresicion or setw. However I can
7694 see no problem with the current code.
7695 (runqueue): use sleep instead of the alarm/signal code. I just
7696 can't see the difference.
7698 * src/paragraph.C (LyXParagraph): reserve space in the new
7699 paragraph and resize the inserted paragraph to just fit.
7701 * src/lyxfunc.h (operator|=): added operator for func_status.
7703 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
7704 check for readable file.
7706 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
7707 check for readable file.
7708 (MenuMakeLinuxDoc): ditto
7709 (MenuMakeDocBook): ditto
7710 (MenuMakeAscii): ditto
7711 (InsertAsciiFile): split the test for openable and readable
7713 * src/bmtable.C (draw_bitmaptable): use
7714 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
7716 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
7717 findtexfile from LaTeX to filetools.
7719 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
7720 instead of FilePtr. Needs to be verified by a literate user.
7722 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7724 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
7725 (EditMessage): likewise.
7727 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
7728 respectively as \textasciitilde and \textasciicircum.
7730 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7732 * src/support/lyxstring.h: made the methods that take iterators
7735 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
7736 (regexMatch): made is use the real regex class.
7738 * src/support/Makefile.am: changed to use libtool
7740 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
7742 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
7744 (MathIsInset ++): changed several macros to be inline functions
7747 * src/mathed/Makefile.am: changed to use libtool
7749 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
7751 * src/insets/inset* : Clone changed to const and return type is
7752 the true insettype not just Inset*.
7754 * src/insets/Makefile.am: changed to use libtool
7756 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
7758 * src/undo.[Ch] : added empty() and changed some of the method
7761 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
7763 * src/lyxparagraph.h: use id() and id(...) instead of getID and
7764 setID use block<> for the bullets array, added const several places.
7766 * src/lyxfunc.C (getStatus): new function
7768 * src/lyxfunc.[Ch] : small changes to take advantage of the new
7769 LyXAction, added const to several funtions.
7771 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
7772 a std::map, and to store the dir items in a vector.
7774 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
7777 * src/LyXView.[Ch] + other files : changed currentView to view.
7779 * src/LyXAction.[Ch] : ported from the old devel branch.
7781 * src/.cvsignore: added .libs and a.out
7783 * configure.in : changes to use libtool.
7785 * acinclude.m4 : inserted libtool.m4
7787 * .cvsignore: added libtool
7789 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7791 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
7792 file name in insets and mathed directories (otherwise the
7793 dependency is not taken in account under cygwin).
7795 * src/text2.C (InsertString[AB]): make sure that we do not try to
7796 read characters past the string length.
7798 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7800 * lib/doc/LaTeXConfig.lyx.in,
7801 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
7803 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
7804 file saying who created them and when this heppened; this is
7805 useless and annoys tools like cvs.
7807 * lib/layouts/g-brief-{en,de}.layout,
7808 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
7809 from Thomas Hartkens <thomas@hartkens.de>.
7811 * src/{insets,mathed}/Makefile.am: do not declare an empty
7812 LDFLAGS, so that it can be set at configure time (useful on Irix
7815 * lib/reLyX/configure.in: make sure that the prefix is set
7816 correctly in LYX_DIR.
7818 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7820 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
7821 be used by 'command-sequence' this allows to bind a key to a
7822 sequence of LyX-commands
7823 (Example: 'command-sequence math-insert alpha; math-insert beta;")
7825 * src/LyXAction.C: add "command-sequence"
7827 * src/LyXFunction.C: handling of "command-sequence"
7829 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
7830 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
7832 * src/lyxserver.C, src/minibuffer.C: Use this new interface
7834 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7836 * src/buffer.C (writeFile): Do not output a comment giving user
7837 and date at the beginning of a .lyx file. This is useless and
7838 annoys cvs anyway; update version number to 1.1.
7840 * src/Makefile.am (LYX_DIR): add this definition, so that a
7841 default path is hardcoded in LyX.
7843 * configure.in: Use LYX_GNU_GETTEXT.
7845 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
7846 AM_GNU_GETTEXT with a bug fixed.
7848 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
7850 * src/chset.C: add "using std::ifstream;" to please dec cxx.
7852 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
7853 which is used to point to LyX data is now LYX_DIR_11x.
7855 * lyx.man: convert to a unix text file; small updates.
7857 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7859 * src/support/LSubstring.[Ch]: made the second arg of most of the
7860 constructors be a const reference.
7862 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
7865 * src/support/lyxstring.[Ch] (swap): added missing member function
7866 and specialization of swap(str, str);
7868 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
7870 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
7871 trace of the old one.
7873 * src/undo.[Ch]: made the undostack use std::list to store undo's in
7874 put the member definitions in undo.C.
7876 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
7877 NEW_TEXT and have now only code that was included when this was
7880 * src/intl.C (LCombo): use static_cast
7882 (DispatchCallback): ditto
7884 * src/definitions.h: removed whole file
7886 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
7888 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
7889 parsing and stores in a std:map. a regex defines the file format.
7890 removed unneeded members.
7892 * src/bufferparams.h: added several enums from definitions.h here.
7893 Removed unsused destructor. Changed some types to use proper enum
7894 types. use block to have the temp_bullets and user_defined_bullets
7895 and to make the whole class assignable.
7897 * src/bufferparams.C (Copy): removed this functions, use a default
7900 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
7903 * src/buffer.C (readLyXformat2): commend out all that have with
7904 oldpapersize to do. also comment out all that hve to do with
7905 insetlatex and insetlatexdel.
7906 (setOldPaperStuff): commented out
7908 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
7910 * src/LyXAction.C: remove use of inset-latex-insert
7912 * src/mathed/math_panel.C (button_cb): use static_cast
7914 * src/insets/Makefile.am (insets_o_SOURCES): removed
7917 * src/support/lyxstring.C (helper): use the unsigned long
7918 specifier, UL, instead of a static_cast.
7920 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
7922 * src/support/block.h: new file. to be used as a c-style array in
7923 classes, so that the class can be assignable.
7925 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7927 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
7928 NULL, make sure to return an empty string (it is not possible to
7929 set a string to NULL).
7931 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7933 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
7935 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
7937 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
7938 link line, so that Irix users (for example) can set it explicitely to
7941 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
7942 it can be overidden at make time (static or dynamic link, for
7945 * src/vc-backend.C, src/LaTeXFeatures.h,
7946 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
7947 statements to bring templates to global namespace.
7949 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7951 * src/support/lyxstring.C (operator[] const): make it standard
7954 * src/minibuffer.C (Init): changed to reflect that more
7955 information is given from the lyxvc and need not be provided here.
7957 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
7959 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
7961 * src/LyXView.C (UpdateTimerCB): use static_cast
7962 (KeyPressMask_raw_callback): ditto
7964 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
7965 buffer_, a lot of changes because of this. currentBuffer() ->
7966 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
7967 also changes to other files because of this.
7969 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7971 * src/vc-backend.[Ch]: new files. The backends for vc handling,
7972 have no support for RCS and partial support for CVS, will be
7975 * src/insets/ several files: changes because of function name
7976 changes in Bufferview and LyXView.
7978 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
7980 * src/support/LSubstring.[Ch]: new files. These implement a
7981 Substring that can be very convenient to use. i.e. is this
7983 string a = "Mary had a little sheep";
7984 Substring(a, "sheep") = "lamb";
7985 a is now "Mary has a little lamb".
7987 * src/support/LRegex.[Ch]: a regex class that can be used to pick
7988 out patterns and subpatterns of strings. It is used by LSubstring
7989 and also by vc-backend.C
7991 * src/support/lyxstring.C: went over all the assertions used and
7992 tried to correct the wrong ones and flag which of them is required
7993 by the standard. some bugs found because of this. Also removed a
7994 couple of assertions.
7996 * src/support/Makefile.am (libsupport_a_SOURCES): added
7997 LSubstring.[Ch] and LRegex.[Ch]
7999 * src/support/FileInfo.h: have struct stat buf as an object and
8000 not a pointer to one, some changes because of this.
8002 * src/LaTeXFeatures.C (getTClassPreamble): also use the
8003 information in layout when adding the layouts preamble to the
8006 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
8009 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
8010 because of bug in OS/2.
8012 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8014 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
8015 \verbatim@font instead of \ttfamily, so that it can be redefined.
8017 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
8018 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
8019 src/layout.h, src/text2.C: add 'using' directive to bring the
8020 STL templates we need from the std:: namespace to the global one.
8021 Needed by DEC cxx in strict ansi mode.
8023 * src/support/LIstream.h,src/support/LOstream.h,
8024 src/support/lyxstring.h,src/table.h,
8025 src/lyxlookup.h: do not include <config.h> in header
8026 files. This should be done in the .C files only.
8028 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
8032 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8034 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
8035 from Kayvan to fix the tth invokation.
8037 * development/lyx.spec.in: updates from Kayvan to reflect the
8038 changes of file names.
8040 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8042 * src/text2.C (InsertStringB): use std::copy
8043 (InsertStringA): use std::copy
8045 * src/bufferlist.C: use a vector to store the buffers in. This is
8046 an internal change and should not affect any other thing.
8048 * src/BufferView.C (waitForX): use XSync instead of the lengthy
8051 * src/text.C (Fill): fix potential bug, one off bug.
8053 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8055 * src/Makefile.am (lyx_main.o): add more files it depends on.
8057 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
8059 * src/support/lyxstring.C: use size_t for the reference count,
8060 size, reserved memory and xtra.
8061 (internal_compare): new private member function. Now the compare
8062 functions should work for std::strings that have embedded '\0'
8064 (compare): all compare functions rewritten to use
8067 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8069 * src/support/lyxstring.C (compare): pass c_str()
8070 (compare): pass c_str
8071 (compare): pass c_str
8073 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8075 * src/support/DebugStream.C: <config.h> was not included correctly.
8077 * lib/configure: forgot to re-generate it :( I'll make this file
8078 auto generated soon.
8080 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8082 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
8085 * src/support/lyxstring.C: some changes from length() to rep->sz.
8086 avoids a function call.
8088 * src/support/filetools.C (SpaceLess): yet another version of the
8089 algorithm...now per Jean-Marc's suggestions.
8091 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8093 * src/layout.C (less_textclass_desc): functor for use in sorting
8095 (LyXTextClass::Read): sort the textclasses after reading.
8097 * src/support/filetools.C (SpaceLess): new version of the
8098 SpaceLess functions. What problems does this one give? Please
8101 * images/banner_bw.xbm: made the arrays unsigned char *
8103 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8105 * src/support/lyxstring.C (find): remove bogus assertion in the
8106 two versions of find where this has not been done yet.
8108 * src/support/lyxlib.h: add missing int return type to
8111 * src/menus.C (ShowFileMenu): disable exporting to html if no
8112 html export command is present.
8114 * config/lib_configure.m4: add a test for an HTML converter. The
8115 programs checked for are, in this order: tth, latex2html and
8118 * lib/configure: generated from config/lib_configure.m4.
8120 * src/lyxfunc.C (Dispatch): update and improve the execution of an
8121 html converter. The parameters are now passed through $$FName and
8122 $$OutName, instead of standard input/output.
8124 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
8126 * lib/lyxrc.example: update description of \html_command.
8127 add "quotes" around \screen_font_xxx font setting examples to help
8128 people who use fonts with spaces in their names.
8130 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8132 * Distribution files: updates for v1.1.2
8134 * src/support/lyxstring.C (find): remove bogus assert and return
8135 npos for the same condition.
8137 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8139 * added patch for OS/2 from SMiyata.
8141 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8143 * src/text2.C (CutSelection): make space_wrapped a bool
8144 (CutSelection): dont declare int i until we have to.
8145 (alphaCounter): return a char const *.
8147 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8149 * src/support/syscall.C (Systemcalls::kill):
8150 src/support/filetools.C (PutEnv, PutEnvPath):
8151 src/lyx_cb.C (addNewlineAndDepth):
8152 src/FontInfo.C (FontInfo::resize): condition some #warning
8153 directives with WITH_WARNINGS.
8156 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8158 * src/layout.[Ch] + several files: access to class variables
8159 limited and made accessor functions instead a lot of code changed
8160 becuase of this. Also instead of returning pointers often a const
8161 reference is returned instead.
8163 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
8165 * src/Makefile.am (dist-hook): added used to remove the CVS from
8166 cheaders upon creating a dist
8167 (EXTRA_DIST): added cheaders
8169 * src/support/lstrings.C (tostr(char)): fix it to handle param as
8170 a character not as a small integer.
8172 * src/support/lyxstring.C (find): removed Assert and added i >=
8173 rep->sz to the first if.
8175 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8177 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
8178 src/LyXView.C src/buffer.C src/bufferparams.C
8179 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
8180 src/text2.C src/insets/insetinclude.C:
8181 lyxlayout renamed to textclasslist.
8183 * src/layout.C: some lyxerr changes.
8185 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
8186 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
8187 (LyXLayoutList): removed all traces of this class.
8188 (LyXTextClass::Read): rewrote LT_STYLE
8189 (LyXTextClass::hasLayout): new function
8190 (LyXTextClass::GetLayout): rewritten to return an iterator + has
8191 both const and nonconst version.
8192 (LyXTextClass::delete_layout): new function.
8193 (LyXTextClassList::Style): bug fix. do the right thing if layout
8195 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
8196 (LyXTextClassList::NameOfLayout): ditto
8197 (LyXTextClassList::Load): ditto
8199 * src/buffer.C (makeLaTeXFile): new access to layoutlist
8201 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
8203 * src/LyXAction.C (LookupFunc): added a workaround for sun
8204 compiler, on the other hand...we don't know if the current code
8205 compiles on sun at all...
8207 * src/support/filetools.C (CleanupPath): subst fix
8209 * src/insets/insetbib.C (delDatabase): subst fix, this looks
8212 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
8213 complained about this one?
8215 * src/insets/insetinclude.C (Latex): subst fix
8217 * src/insets/insetbib.C (getKeys): subst fix
8219 * src/LyXSendto.C (SendtoApplyCB): subst fix
8221 * src/lyx_main.C (init): subst fix
8223 * src/layout.C (Read): subst fix
8225 * src/lyx_sendfax_main.C (button_send): subst fix
8227 * src/buffer.C (RoffAsciiTable): subst fix
8229 * src/lyx_cb.C (MenuFax): subst fix
8230 (PrintApplyCB): subst fix
8232 1999-10-26 Juergen Vigna <jug@sad.it>
8234 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
8236 (Read): Cleaned up this code so now we read only format vestion >= 5
8238 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8240 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
8241 come nobody has complained about this one?
8243 * src/insets/insetinclude.C (Latex): subst fix
8245 * src/insets/insetbib.C (getKeys): subst fix
8247 * src/lyx_main.C (init): subst fix
8249 * src/layout.C (Read): subst fix
8251 * src/buffer.C (RoffAsciiTable): subst fix
8253 * src/lyx_cb.C (MenuFax): subst fix.
8255 * src/layout.[hC] + some other files: rewrote to use
8256 std::container to store textclasses and layouts in.
8257 Simplified, removed a lot of code. Make all classes
8258 assignable. Further simplifications and review of type
8259 use still to be one.
8261 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
8262 lastfiles to create the lastfiles partr of the menu.
8264 * src/lastfiles.[Ch]: rewritten to use deque to store the
8265 lastfiles in. Uses fstream for reading and writing. Simplifies
8268 * src/support/syscall.C: remove explicit cast.
8270 * src/BufferView.C (CursorToggleCB): removed code snippets that
8272 use explicat C++ style casts instead of C style casts. also use
8273 u_vdata instea of passing pointers in longs.
8275 * src/PaperLayout.C: removed code snippets that were commented out.
8277 * src/lyx_gui_misc.C: removed code snippets that were commented out.
8279 * src/lyx_main.C: removed code snippets that wer commented out.
8281 * src/paragraph.C: removed code snippets that were commented out.
8283 * src/lyxvc.C (logClose): use static_cast
8285 (viewLog): remove explicit cast to void*
8286 (showLog): removed old commented code
8288 * src/menus.C: use static_cast instead of C style casts. use
8289 u_vdata instead of u_ldata. remove explicit cast to (long) for
8290 pointers. Removed old code that was commented out.
8292 * src/insets/inset.C: removed old commented func
8294 * src/insets/insetref.C (InsetRef): removed old code that had been
8295 commented out for a long time.
8297 (escape): removed C style cast
8299 * src/insets/insetlatexaccent.C (Draw): removed old commented code
8301 * src/insets/insetlatex.C (Draw): removed old commented code
8302 (Read): rewritten to use string
8304 * src/insets/insetlabel.C (escape): removed C style cast
8306 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
8308 * src/insets/insetindex.C: use static_cast and u_vdata, removed
8311 * src/insets/insetinclude.h: removed a couple of stupid bools
8313 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
8314 (Clone): remove C style cast
8315 (getKeys): changed list to lst because of std::list
8317 * src/insets/inseterror.C (Draw): removed som old commented code.
8319 * src/insets/insetcommand.C (Draw): removed some old commented code.
8321 * src/insets/insetbib.C (bibitem_cb): removed code that has been
8322 commented out forever.
8323 (bibitem_cb): use static_cast instead of C style cast
8324 use of vdata changed to u_vdata.
8326 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
8328 (CloseUrlCB): use static_cast instead of C style cast.
8329 (CloseUrlCB): added a fl_free form...it seemed to be missing.
8331 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
8332 (C_InsetInfo_CloseInfoCB): forward the ob parameter
8333 (CloseInfoCB): static_cast from ob->u_vdata instead.
8334 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
8337 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
8338 (C_InsetError_CloseErrorCB): forward the ob parameter
8339 (CloseErrorCB): static_cast from ob->u_vdata instead.
8341 * src/vspace.h: include LString.h since we use string in this class.
8343 * src/vspace.C (lyx_advance): changed name from advance because of
8344 nameclash with stl. And since we cannot use namespaces yet...I
8345 used a lyx_ prefix instead. Expect this to change when we begin
8348 * src/BufferView.[Ch] (BufferView::~BufferView): removed
8350 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
8351 and removed now defunct constructor and deconstructor.
8353 * src/BufferView.h: have backstack as a object not as a pointer.
8354 removed initialization from constructor. added include for BackStack
8356 * development/lyx.spec.in (%build): add CFLAGS also.
8358 * src/screen.C (drawFrame): removed another warning.
8360 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8362 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
8363 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
8364 README and ANNOUNCE a bit for the next release. More work is
8367 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
8368 unbreakable if we are in freespacing mode (LyX-Code), but not in
8371 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8373 * src/BackStack.h: fixed initialization order in constructor
8375 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
8377 * acinclude.m4 (VERSION): new rules for when a version is
8378 development, added also a variable for prerelease.
8379 (warnings): we set with_warnings=yes for prereleases
8380 (lyx_opt): prereleases compile with same optimization as development
8381 (CXXFLAGS): only use pedantic if we are a development version
8383 * src/BufferView.C (restorePosition): don't do anything if the
8386 * src/BackStack.h: added member empty, use this to test if there
8387 is anything to pop...
8389 1999-10-25 Juergen Vigna <jug@sad.it>
8392 * forms/layout_forms.fd +
8393 * forms/latexoptions.fd +
8394 * lyx.fd: changed for various form resize issues
8396 * src/mathed/math_panel.C +
8397 * src/insets/inseterror.C +
8398 * src/insets/insetinfo.C +
8399 * src/insets/inseturl.C +
8400 * src/insets/inseturl.h +
8403 * src/PaperLayout.C +
8404 * src/ParagraphExtra.C +
8405 * src/TableLayout.C +
8407 * src/layout_forms.C +
8414 * src/menus.C: fixed various resize issues. So now forms can be
8415 resized savely or not be resized at all.
8417 * forms/form_url.fd +
8418 * src/insets/form_url.[Ch]: added because it's cleaner and easier
8421 * src/insets/Makefile.am: added files form_url.[Ch]
8423 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8425 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
8426 (and presumably 6.2).
8428 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
8429 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
8430 remaining static member callbacks.
8432 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
8435 * src/support/lyxstring.h: declare struct Srep as friend of
8436 lyxstring, since DEC cxx complains otherwise.
8438 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8440 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8442 * src/LaTeX.C (run): made run_bibtex also depend on files with
8444 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
8445 are put into the dependency file.
8447 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
8448 the code has shown itself to work
8449 (create_ispell_pipe): removed another warning, added a comment
8452 * src/minibuffer.C (ExecutingCB): removed code that has been
8453 commented out a long time
8455 * src/lyxfunc.C (processKeyEvent): removed some very old commented
8456 out code + a warning.
8458 * src/support/lyxstring.h: comment out the three private
8459 operators, when compiling with string ansi conforming compilers
8462 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
8464 (pixmapFromBitmapData): change type of bdata to be unsigned char *
8465 (pixmapFromBitmapData): add a reinterpret_cast in the call to
8468 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
8471 * src/mathed/math_panel.C (create_math_panel): remove explicit
8474 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
8477 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
8478 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
8479 to XCreatePixmapFromBitmapData
8480 (fl_set_bmtable_data): change the last argument to be unsigned
8482 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
8483 and bh to be unsigned int, remove explicit casts in call to
8484 XReadBitmapFileData.
8486 * images/arrows.xbm: made the arrays unsigned char *
8487 * images/varsz.xbm: ditto
8488 * images/misc.xbm: ditto
8489 * images/greek.xbm: ditto
8490 * images/dots.xbm: ditto
8491 * images/brel.xbm: ditto
8492 * images/bop.xbm: ditto
8494 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
8496 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
8497 (LYX_PROG_CXX): added -pedantic to g++ compile options when
8498 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
8500 (LYX_CXX_CHEADERS): added <clocale> to the test.
8502 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
8504 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
8506 * src/support/lyxstring.C (append): fixed something that must be a
8507 bug, rep->assign was used instead of rep->append.
8509 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
8512 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
8513 lyx insert double chars. Fix spotted by Kayvan.
8515 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8517 * Fixed the tth support. I messed up with the Emacs patch apply feature
8518 and omitted the changes in lyxrc.C.
8520 1999-10-22 Juergen Vigna <jug@sad.it>
8522 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
8524 * src/lyx_cb.C (MenuInsertRef) +
8525 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
8526 the form cannot be resized under it limits (fixes a segfault)
8528 * src/lyx.C (create_form_form_ref) +
8529 * forms/lyx.fd: Changed Gravity on name input field so that it is
8532 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8534 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
8535 <ostream> and <istream>.
8537 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
8538 whether <fstream> provides the latest standard features, or if we
8539 have an oldstyle library (like in egcs).
8540 (LYX_CXX_STL_STRING): fix the test.
8542 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
8543 code on MODERN_STL_STREAM.
8545 * src/support/lyxstring.h: use L{I,O}stream.h.
8547 * src/support/L{I,O}stream.h: new files, designed to setup
8548 correctly streams for our use
8549 - includes the right header depending on STL capabilities
8550 - puts std::ostream and std::endl (for LOStream.h) or
8551 std::istream (LIStream.h) in toplevel namespace.
8553 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8555 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
8556 was a bib file that had been changed we ensure that bibtex is run.
8557 (runBibTeX): enhanced to extract the names of the bib files and
8558 getting their absolute path and enter them into the dep file.
8559 (findtexfile): static func that is used to look for tex-files,
8560 checks for absolute patchs and tries also with kpsewhich.
8561 Alternative ways of finding the correct files are wanted. Will
8563 (do_popen): function that runs a command using popen and returns
8564 the whole output of that command in a string. Should be moved to
8567 * src/DepTable.[Ch] (extchanged): new function that returns true if a
8568 file with extension ext has changed.
8570 * src/insets/figinset.C: added ifdef guards around the fl_free
8571 code that jug commented out. Now it is commented out when
8572 compiling with XForms == 0.89.
8574 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
8575 to lyxstring.C, and only keep a forward declaration in
8576 lyxstring.h. Simplifies the header file a bit and should help a
8577 bit on compile time too. Also changes to Srep will not mandate a
8578 recompile of code just using string.
8579 (~lyxstring): definition moved here since it uses srep.
8580 (size): definition moved here since it uses srep.
8582 * src/support/lyxstring.h: removed a couple of "inline" that should
8585 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8587 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
8590 1999-10-21 Juergen Vigna <jug@sad.it>
8592 * src/table.C (SetPWidth): Just a small fix so the alignment is not
8593 set to left if I just remove the width entry (or it is empty).
8595 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
8596 paragraph when having dummy paragraphs.
8598 1999-10-20 Juergen Vigna <jug@sad.it>
8600 * src/insets/figinset.C: just commented some fl_free_form calls
8601 and added warnings so that this calls should be activated later
8602 again. This avoids for now a segfault, but we have a memory leak!
8604 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
8605 'const char * argument' to 'string argument', this should
8606 fix some Asserts() in lyxstring.C.
8608 * src/lyxfunc.h: Removed the function argAsString(const char *)
8609 as it is not used anymore.
8611 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8613 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
8616 * src/Literate.h: some funcs moved from public to private to make
8617 interface clearer. Unneeded args removed.
8619 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
8621 (scanBuildLogFile): ditto
8623 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
8624 normal TeX Error. Still room for improvement.
8626 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
8628 * src/buffer.C (insertErrors): changes to make the error
8629 desctription show properly.
8631 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
8634 * src/support/lyxstring.C (helper): changed to use
8635 sizeof(object->rep->ref).
8636 (operator>>): changed to use a pointer instead.
8638 * src/support/lyxstring.h: changed const reference & to value_type
8639 const & lets see if that helps.
8641 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8643 * Makefile.am (rpmdist): fixed to have non static package and
8646 * src/support/lyxstring.C: removed the compilation guards
8648 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
8651 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
8652 conditional compile of lyxstring.Ch
8654 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
8655 stupid check, but it is a lot better than the bastring hack.
8656 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
8658 * several files: changed string::erase into string::clear. Not
8661 * src/chset.C (encodeString): use a char temporary instead
8663 * src/table.C (TexEndOfCell): added tostr around
8664 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
8665 (TexEndOfCell): ditto
8666 (TexEndOfCell): ditto
8667 (TexEndOfCell): ditto
8668 (DocBookEndOfCell): ditto
8669 (DocBookEndOfCell): ditto
8670 (DocBookEndOfCell): ditto
8671 (DocBookEndOfCell): ditto
8673 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
8675 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
8677 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
8678 (MenuBuildProg): added tostr around ret
8679 (MenuRunChktex): added tostr around ret
8680 (DocumentApplyCB): added tostr around ret
8682 * src/chset.C (encodeString): added tostr around t->ic
8684 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
8685 (makeLaTeXFile): added tostr around tocdepth
8686 (makeLaTeXFile): added tostr around ftcound - 1
8688 * src/insets/insetbib.C (setCounter): added tostr around counter.
8690 * src/support/lyxstring.h: added an operator+=(int) to catch more
8693 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
8694 (lyxstring): We DON'T allow NULL pointers.
8696 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8698 * src/mathed/math_macro.C (MathMacroArgument::Write,
8699 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
8700 when writing them out.
8702 * src/LString.C: remove, since it is not used anymore.
8704 * src/support/lyxstring.C: condition the content to
8705 USE_INCLUDED_STRING macro.
8707 * src/mathed/math_symbols.C, src/support/lstrings.C,
8708 src/support/lyxstring.C: add `using' directive to specify what
8709 we need in <algorithm>. I do not think that we need to
8710 conditionalize this, but any thought is appreciated.
8712 * many files: change all callback functions to "C" linkage
8713 functions to please strict C++ compilers like DEC cxx 6.1 in mode
8714 strict_ansi. Those who were static are now global.
8715 The case of callbacks which are static class members is
8716 trickier, since we have to make C wrappers around them (see
8717 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
8718 did not finish this yet, since it defeats the purpose of
8719 encapsulation, and I am not sure what the best route is.
8721 1999-10-19 Juergen Vigna <jug@sad.it>
8723 * src/support/lyxstring.C (lyxstring): we permit to have a null
8724 pointer as assignment value and just don't assign it.
8726 * src/vspace.C (nextToken): corrected this function substituting
8727 find_first(_not)_of with find_last_of.
8729 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
8730 (TableOptCloseCB) (TableSpeCloseCB):
8731 inserted fl_set_focus call for problem with fl_hide_form() in
8734 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8736 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
8739 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8741 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
8742 LyXLex::next() and not eatline() to get its argument.
8744 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8746 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
8747 instead, use fstreams for io of the depfile, removed unneeded
8748 functions and variables.
8750 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
8751 vector instead, removed all functions and variables that is not in
8754 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8756 * src/buffer.C (insertErrors): use new interface to TeXError
8758 * Makefile.am (rpmdist): added a rpmdist target
8760 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
8761 per Kayvan's instructions.
8763 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8765 * src/Makefile.am: add a definition for localedir, so that locales
8766 are found after installation (Kayvan)
8768 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8770 * development/.cvsignore: new file.
8772 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8774 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
8775 C++ compiler provides wrappers for C headers and use our alternate
8778 * configure.in: use LYX_CXX_CHEADERS.
8780 * src/cheader/: new directory, populated with cname headers from
8781 libstdc++-2.8.1. They are a bit old, but probably good enough for
8782 what we want (support compilers who lack them).
8784 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
8785 from includes. It turns out is was stupid.
8787 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8789 * lib/Makefile.am (install-data-local): forgot a ';'
8790 (install-data-local): forgot a '\'
8791 (libinstalldirs): needed after all. reintroduced.
8793 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8795 * configure.in (AC_OUTPUT): added lyx.spec
8797 * development/lyx.spec: removed file
8799 * development/lyx.spec.in: new file
8801 * po/*.po: merged with lyx.pot becuase of make distcheck
8803 * lib/Makefile.am (dist-hook): added dist-hook so that
8804 documentation files will be included when doing a make
8805 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
8806 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
8808 more: tried to make install do the right thing, exclude CVS dirs
8811 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
8812 Path would fit in more nicely.
8814 * all files that used to use pathstack: uses now Path instead.
8815 This change was a lot easier than expected.
8817 * src/support/path.h: new file
8819 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
8821 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
8823 * src/support/lyxstring.C (getline): Default arg was given for
8826 * Configure.cmd: removed file
8828 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8830 * src/support/DebugStream.[Ch]: remove the explicit std:: before
8831 streams classes and types, add the proper 'using' statements when
8832 MODERN_STL is defined.
8834 * src/debug.h: move the << operator definition after the inclusion
8837 * src/support/filetools.C: include "LAssert.h", which is needed
8840 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
8843 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
8844 include "debug.h" to define a proper ostream.
8846 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8848 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
8849 method to the SystemCall class which can kill a process, but it's
8850 not fully implemented yet.
8852 * src/*.C: Changed Systemcalls::Startscript() to startscript()
8854 * src/support/FileInfo.h: Better documentation
8856 * src/lyxfunc.C: Added support for buffer-export html
8858 * src/menus.C: Added Export->As HTML...
8860 * lib/bind/*.bind: Added short-cut for buffer-export html
8862 * src/lyxrc.*: Added support for new \tth_command
8864 * lib/lyxrc.example: Added stuff for new \tth_command
8866 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8868 * lib/Makefile.am (IMAGES): removed images/README
8869 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
8870 installes in correct place. Check permisions is installed
8873 * src/LaTeX.C: some no-op changes moved declaration of some
8876 * src/LaTeX.h (LATEX_H): changed include guard name
8878 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8880 * lib/reLyX/Makefile.am: install noweb2lyx.
8882 * lib/Makefile.am: install configure.
8884 * lib/reLyX/configure.in: declare a config aux dir; set package
8885 name to lyx (not sure what the best solution is); generate noweb2lyx.
8887 * lib/layouts/egs.layout: fix the bibliography layout.
8889 1999-10-08 Jürgen Vigna <jug@sad.it>
8891 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
8892 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
8893 it returned without continuing to search the path.
8895 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8897 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
8898 also fixes a bug. It is not allowed to do tricks with std::strings
8899 like: string a("hei"); &a[e]; this will not give what you
8900 think... Any reason for the complexity in this func?
8902 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
8904 * Updated README and INSTALL a bit, mostly to check that my
8905 CVS rights are correctly set up.
8907 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8909 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
8910 does not allow '\0' chars but lyxstring and std::string does.
8912 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8914 * autogen.sh (AUTOCONF): let the autogen script create the
8915 POTFILES.in file too. POTFILES.in should perhaps now not be
8916 included in the cvs module.
8918 * some more files changed to use C++ includes instead of C ones.
8920 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
8922 (Reread): added tostr to nlink. buggy output otherwise.
8923 (Reread): added a string() around szMode when assigning to Buffer,
8924 without this I got a log of garbled info strings.
8926 * acconfig.h: commented out the PTR_AS_INT macros. They should not
8929 * I have added several ostream & operator<<(ostream &, some_type)
8930 functions. This has been done to avoid casting and warnings when
8931 outputting enums to lyxerr. This as thus eliminated a lot of
8932 explicit casts and has made the code clearer. Among the enums
8933 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
8934 mathed enums, some font enum the Debug::type enum.
8936 * src/support/lyxstring.h (clear): missing method. equivalent of
8939 * all files that contained "stderr": rewrote constructs that used
8940 stderr to use lyxerr instead. (except bmtable)
8942 * src/support/DebugStream.h (level): and the passed t with
8943 Debug::ANY to avoid spurious bits set.
8945 * src/debug.h (Debug::type value): made it accept strings of the
8948 * configure.in (Check for programs): Added a check for kpsewhich,
8949 the latex generation will use this later to better the dicovery of
8952 * src/BufferView.C (create_view): we don't need to cast this to
8953 (void*) that is done automatically.
8954 (WorkAreaButtonPress): removed some dead code.
8956 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8958 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
8959 is not overwritten when translated (David Sua'rez de Lis).
8961 * lib/CREDITS: Added David Sua'rez de Lis
8963 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
8965 * src/bufferparams.C (BufferParams): default input encoding is now
8968 * acinclude.m4 (cross_compiling): comment out macro
8969 LYX_GXX_STRENGTH_REDUCE.
8971 * acconfig.h: make sure that const is not defined (to empty) when
8972 we are compiling C++. Remove commented out code using SIZEOF_xx
8975 * configure.in : move the test for const and inline as late as
8976 possible so that these C tests do not interefere with C++ ones.
8977 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
8978 has not been proven.
8980 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8982 * src/table.C (getDocBookAlign): remove bad default value for
8985 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
8987 (ShowFileMenu2): ditto.
8989 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
8992 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8994 * Most files: finished the change from the old error code to use
8995 DebugStream for all lyxerr debugging. Only minor changes remain
8996 (e.g. the setting of debug levels using strings instead of number)
8998 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9000 * src/layout.C (Add): Changed to use compare_no_case instead of
9003 * src/FontInfo.C: changed loop variable type too string::size_type.
9005 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9007 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
9008 set ETAGS_ARGS to --c++
9010 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
9012 * src/table.C (DocBookEndOfCell): commented out two unused variables
9014 * src/paragraph.C: commented out four unused variables.
9016 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
9017 insed a if clause with type string::size_type.
9019 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
9022 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
9024 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
9025 variable, also changed loop to go from 0 to lenght + 1, instead of
9026 -1 to length. This should be correct.
9028 * src/LaTeX.C (scanError): use string::size_type as loop variable
9031 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
9032 (l.896) since y_tmp and row was not used anyway.
9034 * src/insets/insetref.C (escape): use string::size_type as loop
9037 * src/insets/insetquotes.C (Width): use string::size_type as loop
9039 (Draw): use string::size_type as loop variable type.
9041 * src/insets/insetlatexaccent.C (checkContents): use
9042 string::size_type as loop variable type.
9044 * src/insets/insetlabel.C (escape): use string::size_type as loop
9047 * src/insets/insetinfo.C: added an extern for current_view.
9049 * src/insets/insetcommand.C (scanCommand): use string::size_type
9050 as loop variable type.
9052 * most files: removed the RCS tags. With them we had to recompile
9053 a lot of files after a simple cvs commit. Also we have never used
9054 them for anything meaningful.
9056 * most files: tags-query-replace NULL 0. As adviced several plases
9057 we now use "0" instead of "NULL" in our code.
9059 * src/support/filetools.C (SpaceLess): use string::size_type as
9062 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9064 * src/paragraph.C: fixed up some more string stuff.
9066 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9068 * src/support/filetools.h: make modestr a std::string.
9070 * src/filetools.C (GetEnv): made ch really const.
9072 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
9073 made code that used these use max/min from <algorithm> instead.
9075 * changed several c library include files to their equivalent c++
9076 library include files. All is not changed yet.
9078 * created a support subdir in src, put lyxstring and lstrings
9079 there + the extra files atexit, fileblock, strerror. Created
9080 Makefile.am. edited configure.in and src/Makefile.am to use this
9081 new subdir. More files moved to support.
9083 * imported som of the functions from repository lyx, filetools
9085 * ran tags-query-replace on LString -> string, corrected the bogus
9086 cases. Tried to make use of lstrings.[hC], debugged a lot. There
9087 is still some errors in there. This is errors where too much or
9088 too litle get deleted from strings (string::erase, string::substr,
9089 string::replace), there can also be some off by one errors, or
9090 just plain wrong use of functions from lstrings. Viewing of quotes
9093 * LyX is now running fairly well with string, but there are
9094 certainly some bugs yet (see above) also string is quite different
9095 from LString among others in that it does not allow null pointers
9096 passed in and will abort if it gets any.
9098 * Added the revtex4 files I forgot when setting up the repository.
9100 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9102 * All over: Tried to clean everything up so that only the files
9103 that we really need are included in the cvs repository.
9104 * Switched to use automake.
9105 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
9106 * Install has not been checked.
9108 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9110 * po/pt.po: Three errors:
9111 l.533 and l.538 format specification error
9112 l. 402 duplicate entry, I just deleted it.