1 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
3 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
6 * src/frontends/xforms/FormError.C (disconnect): use erase() to
7 make the message_ empty.
8 (FormError): don't initialize message_ in initializer list.
10 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
12 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
14 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
16 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
18 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
20 * src/frontends/kde/*data.[Ch]: _("") is not
23 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
25 * src/buffer.C: removed redundant using directive.
27 * src/frontends/DialogBase.h: revert to original definition of
30 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
31 stuff into two classes, one for each dialog, requires a new
32 element in the dialogs vector, FormTabularCreate.
34 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
37 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
38 method. Continues Allan's idea, but means that derived classes
39 don't need to worry about "update or hide?".
41 * src/frontends/xforms/FormError.C (showInset): add connection
44 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
45 one for each dialog. FormTabular now contains main tabular dialog
48 * src/frontends/xforms/FormTabularCreate.[Ch]:
49 * src/frontends/xforms/forms/form_tabular_create.fd: the create
52 * src/frontends/xforms/FormGraphics.[Ch]:
53 * src/frontends/xforms/forms/form_graphics.fd
54 * src/frontends/xforms/FormTabular.[Ch]:
55 * src/frontends/xforms/forms/form_tabular.fd: made daughter
58 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
59 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
61 * src/frontends/xforms/Makefile.am:
62 * src/frontends/xforms/forms/makefile: added new files.
64 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
65 variable. added Signal0 hide signal, in keeping with other GUI-I
68 * src/support/lstrings.h: removed redundant std:: qualifier as
69 it's already declared in Lsstream.h.
71 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
73 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
77 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
79 * src/tabular.C (Ascii): minimize scope of cell.
81 * src/BufferView2.C (nextWord): return string() instead of 0;
83 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
85 * src/converter.h: add a std:: qualifier
87 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
89 * src/importer.[Ch]: New files. Used for importing files into LyX.
91 * src/lyxfunc.C (doImport): Use the new Importer class.
93 * src/converter.h: Add shortcut member to the Format class.
94 Used for holding the menu shortcut.
96 * src/converter.C and other files: Made a distinction between
97 format name and format extension. New formats can be defined using
98 the \format lyxrc tag.
99 Added two new converter flags: latex and disable.
101 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
103 * src/support/lyxlib.h: unify namespace/struct implementation.
104 Remove extra declarations.
106 * src/support/chdir.C (chdir): remove version taking char const *
108 * src/support/rename.C: ditto.
109 * src/support/lyxsum.C: ditto.
111 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
113 * src/frontends/xforms/FormBase.[Ch]:
114 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
115 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
116 work only for the next call to fl_show_form(). The correct place to set
117 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
118 done. FormBase also stores minw_, minh_ itself. All dialogs derived
119 from FormBase have the minimum size set; no more stupid crashes with
122 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
124 * lib/ui/default.ui: fix shortcut for Insert->Include File.
126 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
128 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
130 * src/support/lyxlib.h: changed second argument of mkdir to
131 unsigned long int (unsigned int would probably have been enough,
132 but...). Removed <sys/types.h> header.
133 * src/support/mkdir.C (mkdir): ditto.
137 2000-10-19 Juergen Vigna <jug@sad.it>
139 * src/lyxfunc.C (MenuNew): small fix (form John)
141 * src/screen.C (Update): removed unneeded code.
143 * src/tabular.C (Ascii): refixed int != uint bug!
145 * src/support/lyxlib.h: added sys/types.h include for now permits
146 compiling, but I don't like this!
148 2000-10-18 Juergen Vigna <jug@sad.it>
150 * src/text2.C (ClearSelection): if we clear the selection we need
151 more refresh so set the status apropriately
153 * src/insets/insettext.C (draw): hopefully finally fixed draw
156 2000-10-12 Juergen Vigna <jug@sad.it>
158 * src/insets/insettext.C (draw): another small fix and make a block
159 so that variables are localized.
161 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
163 * src/support/lstrings.C (lowercase, uppercase):
164 use explicit casts to remove compiler warnings.
166 * src/support/LRegex.C (Impl):
167 * src/support/StrPool.C (add):
168 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
169 (AddPath, MakeDisplayPath):
170 * src/support/lstrings.C (prefixIs, subst):
171 use correct type to remove compiler warnings.
173 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
175 * src/support/lyxlib.h:
176 * src/support/mkdir.C (mkdir): change parameter to mode_t for
177 portability and to remove compiler warning with DEC cxx.
179 * src/support/FileInfo.[Ch] (flagRWX): ditto.
181 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
183 * src/minibuffer.C (peek_event): retun 1 when there has been a
184 mouseclick in the minibuffer.
188 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
190 * src/frontends/xforms/FormParagraph.C: more space above/below
193 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
195 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
196 a char only if real_current_font was changed.
198 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
200 * NEWS: update somewhat for 1.1.6
202 * lib/ui/default.ui: clean up.
204 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
206 * lib/CREDITS: clean up
208 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
210 * src/combox.[Ch] (select): changed argument back to int
211 * src/combox.C (peek_event): removed num_bytes as it is declared but
214 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
215 modified calls to Combox::select() to remove warnings about type
218 * src/insets/insetbutton.C (width): explicit cast to remove warning
219 about type conversion.
221 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
224 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
225 sel_pos_end, refering to cursor position are changed to
226 LyXParagraph::size_type.
228 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
229 consistent with LyXCursor::pos().
230 (inset_pos): changed to LyXParagraph::size_type for same reason.
232 * src/insets/insettext.C (resizeLyXText): changed some temporary
233 variables refing to cursor position to LyXParagraph::size_type.
235 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
237 * src/frontends/kde/<various>: The Great Renaming,
240 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
242 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
244 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
246 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
247 0 when there are no arguments.
249 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
251 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
252 to segfaults when pressing Ok in InsetBibtex dialog.
254 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
256 * forms/layout_forms.fd:
257 * src/layout_forms.C (create_form_form_character): small change to use
258 labelframe rather than engraved frame + text
260 * src/lyx_gui.C (create_forms): initialise choice_language with some
261 arbitrary value to prevent segfault when dialog is shown.
263 2000-10-16 Baruch Even <baruch.even@writeme.com>
265 * src/converter.C (runLaTeX, scanLog): Added a warning when there
266 is no resulting file. This pertains only to LaTeX output.
268 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
270 * src/text.C (Backspace): Make sure that the row of the cursor is
273 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
276 * src/lyx_gui.C (init): Prevent a crash when only one font from
277 menu/popup fonts is not found.
279 * lib/lyxrc.example: Add an example for binding a key for language
282 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
284 * src/converter.C (GetReachable): Changed the returned type to
286 (IsReachable): New method
288 * src/MenuBackend.C (expand): Handle formats that appear more
291 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
293 * src/frontends/support/Makefile.am
294 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
297 * lib/CREDITS: add Garst Reese.
299 * src/support/snprintf.h: add extern "C" {} around the definitions.
301 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
303 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
306 * src/frontends/xforms/FormDocument.C:
307 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
308 compile without "conversion to integral type of smaller size"
311 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
313 * src/text.C (GetColumnNearX): Fixed disabled code.
315 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
317 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
320 * src/support/snprintf.[ch]: new files
322 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
324 * src/frontends/kde/formprintdialog.C: add
325 file browser for selecting postscript output
327 * src/frontends/kde/formprintdialogdata.C:
328 * src/frontends/kde/formprintdialogdata.h: re-generate
331 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
333 * src/frontends/gnome/Makefile.am:
334 * src/frontends/kde/Makefile.am: FormCommand.C
335 disappeared from xforms
337 * src/frontends/kde/FormCitation.C:
338 * src/frontends/kde/FormIndex.C: read-only
341 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
343 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
346 * src/bufferlist.C: add using directive.
348 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
350 * src/support/lyxfunctional.h: version of class_fun for void
351 returns added, const versions of back_inseter_fun and compare_fun
354 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
356 * src/frontends/xforms/FormInset.C (showInset): fix typo.
358 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
360 * ChangeLog: cleanup.
362 * lib/CREDITS: update to add all the contributors we've forgotten.
363 I have obviously missed some, so tell me whether there were
366 2000-10-13 Marko Vendelin <markov@ioc.ee>
368 * src/frontends/gnome/FormCitation.C
369 * src/frontends/gnome/FormCitation.h
370 * src/frontends/gnome/FormError.C
371 * src/frontends/gnome/FormIndex.C
372 * src/frontends/gnome/FormRef.C
373 * src/frontends/gnome/FormRef.h
374 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
376 * src/frontends/gnome/FormCitation.C
377 * src/frontends/gnome/FormCopyright.C
378 * src/frontends/gnome/FormError.C
379 * src/frontends/gnome/FormIndex.C
380 * src/frontends/gnome/FormRef.C
381 * src/frontends/gnome/FormToc.C
382 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
385 * src/frontends/gnome/Menubar_pimpl.C
386 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
389 2000-10-11 Baruch Even <baruch.even@writeme.com>
392 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
393 to convey its real action.
395 * src/minibuffer.C (peek_event): Added action when mouse clicks to
396 clear the minibuffer and prepare to enter a command.
398 * src/mathed/formula.C (LocalDispatch): Changed to conform with
399 the rename from ExecCommand to PrepareForCommand.
400 * src/lyxfunc.C (Dispatch): ditto.
402 2000-10-11 Baruch Even <baruch.even@writeme.com>
404 * src/buffer.C (writeFile): Added test for errors on writing, this
405 catches all errors and not only file system full errors as intended.
407 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
409 * src/lyx_gui.C (create_forms): better fix for crash with
410 translated interface.
412 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
414 * src/frontends/kde/Makefile.am:
415 * src/frontends/kde/FormCopyright.C:
416 * src/frontends/kde/formcopyrightdialog.C:
417 * src/frontends/kde/formcopyrightdialog.h:
418 * src/frontends/kde/formcopyrightdialogdata.C:
419 * src/frontends/kde/formcopyrightdialogdata.h:
420 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
421 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
422 copyright to use qtarch
424 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
426 * src/encoding.C (read): Fixed bug that caused an error message at
429 * po/Makefile.in.in: Fixed rule for ext_l10n.h
431 * lib/lyxrc.example: Fixed hebrew example.
433 2000-10-13 Allan Rae <rae@lyx.org>
435 * src/frontends/xforms/FormPreferences.C (input): reworking the
437 (build, update, apply): New inputs in various tabfolders
439 * src/frontends/xforms/FormToc.C: use new button policy.
440 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
441 dialogs that either can't use any existing policy or where it just
444 * src/frontends/xforms/FormTabular.h: removed copyright notice that
447 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
448 added a bool parameter which is ignored.
450 * src/buffer.C (setReadonly):
451 * src/BufferView_pimpl.C (buffer):
452 * src/frontends/kde/FormCopyright.h (update):
453 * src/frontends/kde/FormCitation.[Ch] (update):
454 * src/frontends/kde/FormIndex.[Ch] (update):
455 * src/frontends/kde/FormPrint.[Ch] (update):
456 * src/frontends/kde/FormRef.[Ch] (update):
457 * src/frontends/kde/FormToc.[Ch] (update):
458 * src/frontends/kde/FormUrl.[Ch] (update):
459 * src/frontends/gnome/FormCopyright.h (update):
460 * src/frontends/gnome/FormCitation.[Ch] (update):
461 * src/frontends/gnome/FormError.[Ch] (update):
462 * src/frontends/gnome/FormIndex.[Ch] (update):
463 * src/frontends/gnome/FormPrint.[Ch] (update):
464 * src/frontends/gnome/FormRef.h (update):
465 * src/frontends/gnome/FormToc.[Ch] (update):
466 * src/frontends/gnome/FormUrl.[Ch] (update):
467 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
468 to updateBufferDependent and DialogBase
470 * src/frontends/xforms/FormCitation.[hC]:
471 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
472 * src/frontends/xforms/FormError.[Ch]:
473 * src/frontends/xforms/FormGraphics.[Ch]:
474 * src/frontends/xforms/FormIndex.[Ch]:
475 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
476 and fixed readOnly handling.
477 * src/frontends/xforms/FormPrint.[Ch]:
478 * src/frontends/xforms/FormRef.[Ch]:
479 * src/frontends/xforms/FormTabular.[Ch]:
480 * src/frontends/xforms/FormToc.[Ch]:
481 * src/frontends/xforms/FormUrl.[Ch]:
482 * src/frontends/xforms/FormInset.[Ch]:
483 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
484 form of updateBufferDependent.
486 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
487 if form()->visible just in case someone does stuff to the form in a
490 * src/frontends/DialogBase.h (enum): removed enum since we can now use
491 the buttoncontroller for everything the enum used to be used for.
492 (update) It would seem we need to force all dialogs to use a bool
493 parameter or have two update functions. I chose to go with one.
494 I did try removing update() from here and FormBase and defining the
495 appropriate update signatures in FormBaseB[DI] but then ran into the
496 problem of the update() call in FormBase::show(). Whatever I did
497 to get around that would require another function and that just
498 got more confusing. Hence the decision to make everyone have an
499 update(bool). An alternative might have been to override show() in
500 FormBaseB[DI] and that would allow the different and appropriate
503 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
504 true == buffer change occurred. I decided against using a default
505 template parameter since not all compilers support that at present.
507 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
509 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
510 army knife" by removing functionality.
511 (clearStore): removed. All such housekeeping on hide()ing the dialog
512 is to be carried out by overloaded disconnect() methods.
513 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
514 superceded by Baruch's neat test (FormGraphics) to update an existing
515 dialog if a new signal is recieved rather than block all new signals
517 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
518 only to Inset dialogs.
519 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
520 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
522 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
524 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
525 as a base class to all inset dialogs. Used solely to connect/disconnect
526 the Inset::hide signal and to define what action to take on receipt of
527 a UpdateBufferDependent signal.
528 (FormCommand): now derived from FormInset.
530 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
533 * src/frontends/xforms/FormCopyright.[Ch]:
534 * src/frontends/xforms/FormPreferences.[Ch]:
535 now derived from FormBaseBI.
537 * src/frontends/xforms/FormDocument.[Ch]:
538 * src/frontends/xforms/FormParagraph.[Ch]:
539 * src/frontends/xforms/FormPrint.[Ch]:
540 now derived from FormBaseBD.
542 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
544 * src/frontends/xforms/FormCitation.[Ch]:
545 * src/frontends/xforms/FormError.[Ch]:
546 * src/frontends/xforms/FormRef.[Ch]:
547 * src/frontends/xforms/FormToc.[Ch]:
548 (clearStore): reworked as disconnect().
550 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
553 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
555 * src/converter.C (runLaTeX): constify buffer argument
558 * src/frontends/support/Makefile.am (INCLUDES): fix.
560 * src/buffer.h: add std:: qualifier
561 * src/insets/figinset.C (addpidwait): ditto
562 * src/MenuBackend.C: ditto
563 * src/buffer.C: ditto
564 * src/bufferlist.C: ditto
565 * src/layout.C: ditto
566 * src/lyxfunc.C: ditto
568 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
570 * src/lyxtext.h (bidi_level): change return type to
571 LyXParagraph::size_type.
573 * src/lyxparagraph.h: change size_type to
574 TextContainer::difference_type. This should really be
575 TextContainer::size_type, but we need currently to support signed
578 2000-10-11 Marko Vendelin <markov@ioc.ee>
579 * src/frontends/gnome/FormError.h
580 * src/frontends/gnome/FormRef.C
581 * src/frontends/gnome/FormRef.h
582 * src/frontends/gnome/FormError.C
583 * src/frontends/gnome/Makefile.am
584 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
585 to Gnome frontend. Both dialogs use "action" area.
587 2000-10-12 Baruch Even <baruch.even@writeme.com>
589 * src/graphics/GraphicsCacheItem_pimpl.C:
590 * src/graphics/Renderer.C:
591 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
594 2000-10-12 Juergen Vigna <jug@sad.it>
596 * src/insets/insettext.C (draw): fixed drawing bug (specifically
597 visible when selecting).
599 * development/Code_rules/Rules: fixed some typos.
601 2000-10-09 Baruch Even <baruch.even@writeme.com>
603 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
604 compiling on egcs 1.1.2 possible.
606 * src/filedlg.C (comp_direntry::operator() ): ditto.
608 2000-08-31 Baruch Even <baruch.even@writeme.com>
610 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
613 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
614 transient it now only gets freed when the object is destructed.
616 2000-08-24 Baruch Even <baruch.even@writeme.com>
618 * src/frontends/FormGraphics.h:
619 * src/frontends/FormGraphics.C: Changed to use ButtonController and
622 2000-08-20 Baruch Even <baruch.even@writeme.com>
624 * src/insets/insetgraphics.C:
625 (draw): Added messages to the drawn rectangle to report status.
626 (updateInset): Disabled the use of the inline graphics,
629 2000-08-17 Baruch Even <baruch.even@writeme.com>
631 * src/frontends/support: Directory added for the support of GUII LyX.
633 * src/frontends/support/LyXImage.h:
634 * src/frontends/support/LyXImage.C: Base class for GUII holding of
637 * src/frontends/support/LyXImage_X.h:
638 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
639 version of LyXImage, this uses the Xlib Pixmap.
644 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
645 replacement to Pixmap.
647 * src/insets/insetgraphics.h:
648 * src/insets/insetgraphics.C:
649 * src/graphics/GraphicsCacheItem.h:
650 * src/graphics/GraphicsCacheItem.C:
651 * src/graphics/GraphicsCacheItem_pimpl.h:
652 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
655 * src/graphics/GraphicsCacheItem.h:
656 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
657 another copy of the object.
659 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
660 of cacheHandle, this fixed a bug that sent LyX crashing.
662 * src/graphics/XPM_Renderer.h:
663 * src/graphics/XPM_Renderer.C:
664 * src/graphics/EPS_Renderer.h:
665 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
667 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
669 * src/lyxfunc.C (processKeySym): only handle the
670 lockinginset/inset stuff if we have a buffer and text loaded...
672 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
674 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
676 * src/support/lyxfunctional.h: add operator= that takes a reference
678 * src/lyxserver.C (mkfifo): make first arg const
680 * src/layout.h: renamed name(...) to setName(...) to work around
683 * src/buffer.C (setFileName): had to change name of function to
684 work around bugs in egcs. (renamed from fileName)
686 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
688 * src/support/translator.h: move helper template classes to
689 lyxfunctional.h, include "support/lyxfunctional.h"
691 * src/support/lyxmanip.h: add delaration of fmt
693 * src/support/lyxfunctional.h: new file
694 (class_fun_t): new template class
695 (class_fun): helper template function
696 (back_insert_fun_iterator): new template class
697 (back_inserter_fun): helper template function
698 (compare_memfun_t): new template class
699 (compare_memfun): helper template function
700 (equal_1st_in_pair): moved here from translator
701 (equal_2nd_in_pair): moved here from translator
703 * src/support/fmt.C: new file
704 (fmt): new func, can be used for a printf substitute when still
705 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
707 * src/support/StrPool.C: add some comments
709 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
712 * src/insets/figinset.C (addpidwait): use std::copy with
713 ostream_iterator to fill the pidwaitlist
715 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
717 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
720 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
723 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
725 * src/frontends/xforms/FormDocument.C (build): remove c_str()
726 (class_update): ditto
728 (CheckChoiceClass): move initialization of tc and tct
730 * src/tabular.C: remove current_view
731 (OldFormatRead): similar to right below [istream::ignore]
733 * src/lyxlex_pimpl.C (next): add code for faster skipping of
734 chars, unfortunately this is buggy on gcc 2.95.2, so currently
735 unused [istream::ignore]
737 * src/lyxfunc.C: include "support/lyxfunctional.h"
738 (getInsetByCode): use std::find_if and compare_memfun
740 * src/lyxfont.C (stateText): remove c_str()
742 * src/lyx_main.C (setDebuggingLevel): make static
743 (commandLineHelp): make static
745 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
746 Screen* together with fl_get_display() and fl_screen
748 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
749 togheter with fl_get_display() and fl_screen
750 (create_forms): remove c_str()
752 * src/layout.C: include "support/lyxfunctional.h"
753 (hasLayout): use std::find_if and compare_memfun
754 (GetLayout): use std::find_if and comapre_memfun
755 (delete_layout): use std::remove_if and compare_memfun
756 (NumberOfClass): use std:.find_if and compare_memfun
758 * src/gettext.h: change for the new functions
760 * src/gettext.C: new file, make _(char const * str) and _(string
761 const & str) real functions.
763 * src/font.C (width): rewrite slightly to avoid one extra variable
765 * src/debug.C: initialize Debug::ANY here
767 * src/commandtags.h: update number comments
769 * src/combox.h (get): make const func
771 (getline): make const
773 * src/combox.C (input_cb): handle case where fl_get_input can
776 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
777 "support/lyxfunctional.h", remove current_view variable.
778 (resize): use std::for_each with std::mem_fun
779 (getFileNames): use std::copy with back_inserter_fun
780 (getBuffer): change arg type to unsigned int
781 (emergencyWriteAll): call emergencyWrite with std::for_each and
783 (emergencyWrite): new method, the for loop in emergencyWriteAll
785 (exists): use std::find_if with compare_memfun
786 (getBuffer): use std::find_if and compare_memfun
788 * src/buffer.h: add typedefs for iterator_category, value_type
789 difference_type, pointer and reference for inset_iterator
790 add postfix ++ for inset_iterator
791 make inset_iterator::getPos() const
793 * src/buffer.C: added support/lyxmanip.h
794 (readFile): use lyxerr << fmt instead of printf
795 (makeLaTeXFile): use std::copy to write out encodings
797 * src/Painter.C (text): rewrite slightly to avoid extra font variable
799 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
800 free and the char * temp.
801 (hasMenu): use std::find_if and compare_memfun
804 * src/Makefile.am (lyx_SOURCES): added gettext.C
806 * src/LyXAction.C (retrieveActionArg): clear the arg, use
807 string::insert small change to avoid temporary
809 * src/LColor.C (getGUIName): remove c_str()
811 * several files: change all occurrences of fl_display to
814 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
815 that -pedantic is not used for gcc 2.97 (cvs gcc)
817 * boost/Makefile.am: begin slowly to prepare for a real boost lib
819 2000-10-11 Allan Rae <rae@lyx.org>
821 * src/frontends/xforms/FormPreferences.C (input): template path must be
822 a readable directory. It doesn't need to be writeable.
823 (build, delete, update, apply): New inputs in the various tabfolders
825 * src/frontends/xforms/forms/form_preferences.fd:
826 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
827 several new entries to existing folders. Shuffled some existing stuff
830 * src/frontends/xforms/forms/form_print.fd:
831 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
832 Should probably rework PrinterParams as well. Note that the switch to
833 collated is effectively the same as !unsorted so changing PrinterParams
834 will require a lot of fiddly changes to reverse the existing logic.
836 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
838 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
840 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
842 2000-10-10 Allan Rae <rae@lyx.org>
845 * src/lyxfunc.C (Dispatch):
847 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
850 * src/lyxrc.C (output): Only write the differences between system lyxrc
851 and the users settings.
854 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
856 I'll rewrite this later, after 1.1.6 probably, to keep a single
857 LyXRC but two instances of a LyXRCStruct.
859 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
861 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
863 * src/tabular.h: add a few std:: qualifiers.
865 * src/encoding.C: add using directive.
866 * src/language.C: ditto.
868 * src/insets/insetquotes.C (Validate): use languages->lang()
869 instead of only language.
871 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
873 * lib/languages: New file.
875 * lib/encodings: New file.
877 * src/language.C (Languages): New class.
878 (read): New method. Reads the languages from the 'languages' file.
880 * src/encoding.C (Encodings): New class.
881 (read): New method. Reads the encodings from the 'encodings' file.
883 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
886 * src/bufferparams.h and a lot of files: Deleted the member language,
887 and renamed language_info to language
889 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
890 * src/lyxfont.C (latexWriteStartChanges): ditto.
891 * src/paragraph.C (validate,TeXOnePar): ditto.
893 * src/lyxfont.C (update): Restored deleted code.
895 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
897 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
899 * src/BufferView_pimpl.C (buffer): cleaned up a little.
901 * src/insets/figinset.[Ch]:
902 * src/insets/insetinclude.[Ch]:
903 * src/insets/insetinclude.[Ch]:
904 * src/insets/insetparent.[Ch]:
905 * src/insets/insetref.[Ch]:
906 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
909 * src/mathed/formula.[Ch]:
910 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
912 * src/buffer.C (parseSingleLyXformat2Token, readInset):
913 * src/lyx_cb.C (FigureApplyCB):
914 * src/lyxfunc.C (getStatus, Dispatch):
915 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
918 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
920 * src/converter.[Ch] (Formats::View):
921 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
923 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
924 *current_view->buffer(). This will change later, but this patch is way
927 2000-10-09 Juergen Vigna <jug@sad.it>
929 * src/text.C (GetRow): small fix.
931 * src/BufferView_pimpl.C (cursorPrevious):
932 (cursorNext): added LyXText parameter to function.
934 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
935 keypress depending on cursor position.
937 2000-10-06 Juergen Vigna <jug@sad.it>
939 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
940 (copySelection): redone this function and also copy ascii representa-
943 * src/tabular.C (Ascii):
947 (print_n_chars): new functions to realize the ascii export of tabulars.
949 2000-10-05 Juergen Vigna <jug@sad.it>
951 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
952 if we don't have a buffer.
954 2000-10-10 Allan Rae <rae@lyx.org>
956 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
957 with closing dialog. It seems that nested tabfolders require hiding
958 of inner tabfolders before hiding the dialog itself. Actually all I
959 did was hide the active outer folder.
961 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
962 unless there really is a buffer. hideBufferDependent is called
965 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
966 POTFILES.in stays in $(srcdir).
968 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
970 * lib/lyxrc.example: Few changes.
972 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
974 * src/BufferView_pimpl.C (buffer): only need one the
975 updateBufferDependent signal to be emitted once! Moved to the end of
976 the method to allow bv_->text to be updated first.
978 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
979 and hSignal_ with Dialogs * and BufferDependency variables.
980 New Buffer * parent_, initialised when the dialog is launched. Used to
981 check whether to update() or hide() dialog in the new, private
982 updateOrHide() method that is connected to the updateBufferDependent
983 signal. Daughter classes dictate what to do using the
984 ChangedBufferAction enum, passed to the c-tor.
986 * src/frontends/xforms/FormCitation.C:
987 * src/frontends/xforms/FormCommand.C:
988 * src/frontends/xforms/FormCopyright.C:
989 * src/frontends/xforms/FormDocument.C:
990 * src/frontends/xforms/FormError.C:
991 * src/frontends/xforms/FormIndex.C:
992 * src/frontends/xforms/FormPreferences.C:
993 * src/frontends/xforms/FormPrint.C:
994 * src/frontends/xforms/FormRef.C:
995 * src/frontends/xforms/FormToc.C:
996 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
999 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
1000 ChangedBufferAction enum.
1002 * src/frontends/xforms/FormParagraph.[Ch]
1003 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
1006 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1008 * lib/bind/cua.bind: fix a bit.
1009 * lib/bind/emacs.bind: ditto.
1011 * lib/bind/menus.bind: remove real menu entries from there.
1013 * src/spellchecker.C: make sure we only include strings.h when
1016 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1018 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
1019 function. It enlarges the maximum number of pup when needed.
1020 (add_toc2): Open a new menu if maximum number of items per menu has
1023 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
1025 * src/frontends/kde/FormPrint.C: fix error reporting
1027 * src/frontends/xforms/FormDocument.C: fix compiler
1030 * lib/.cvsignore: add Literate.nw
1032 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1035 * bufferview_funcs.[Ch]
1038 * text2.C: Add support for numbers in RTL text.
1040 2000-10-06 Allan Rae <rae@lyx.org>
1042 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
1043 to be gettext.m4 friendly again. ext_l10n.h is now
1044 generated into $top_srcdir instead of $top_builddir
1045 so that lyx.pot will be built correctly -- without
1046 duplicate parsing of ext_l10n.h.
1048 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1050 * src/frontends/kde/FormCitation.C: make the dialog
1051 behave more sensibly
1053 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
1055 * config/kde.m4: fix consecutive ./configure runs,
1056 look for qtarch, fix library order
1058 * src/frontends/kde/Makefile.am: tidy up,
1059 add Print dialog, add .dlg dependencies
1061 * src/frontends/kde/FormPrint.C:
1062 * src/frontends/kde/FormPrint.h:
1063 * src/frontends/kde/formprintdialog.C:
1064 * src/frontends/kde/formprintdialog.h:
1065 * src/frontends/kde/formprintdialogdata.C:
1066 * src/frontends/kde/formprintdialogdata.h:
1067 * src/frontends/kde/dlg/formprintdialog.dlg: add
1070 * src/frontends/kde/dlg/README: Added explanatory readme
1072 * src/frontends/kde/dlg/checkinitorder.pl: small perl
1073 script to double-check qtarch's output
1075 * src/frontends/kde/formindexdialog.C:
1076 * src/frontends/kde/formindexdialogdata.C:
1077 * src/frontends/kde/formindexdialogdata.h:
1078 * src/frontends/kde/dlg/formindexdialog.dlg: update
1079 for qtarch, minor fixes
1081 2000-10-05 Allan Rae <rae@lyx.org>
1083 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
1084 dialogs when switching buffers update them instead. It's up to each
1085 dialog to decide if it should still be visible or not.
1086 update() should return a bool to control visiblity within show().
1087 Or perhaps better to set a member variable and use that to control
1090 * lib/build-listerrors: create an empty "listerrors" file just to stop
1091 make trying to regenerate it all the time if you don't have noweb
1094 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
1096 * po/Makefile.in.in (ext_l10n.h): added a rule to build
1097 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
1098 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
1099 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
1100 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
1102 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
1104 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
1106 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
1107 deleting buffer. Closes all buffer-dependent dialogs.
1109 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
1111 * src/frontends/xforms/FormCitation.[Ch]:
1112 * src/frontends/xforms/FormPreferences.[Ch]:
1113 * src/frontends/xforms/FormPrint.[Ch]:
1114 * src/frontends/xforms/FormRef.[Ch]:
1115 * src/frontends/xforms/FormUrl.[Ch]: ditto
1117 * src/frontends/xforms/FormDocument.[Ch]:
1118 * src/frontends/xforms/forms/form_document.C.patch:
1119 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
1120 pass through a single input() function.
1122 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1124 * lib/build-listerrors: return status as OK
1126 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
1128 * lib/lyxrc.example: Updated to new export code
1130 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1132 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
1135 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
1138 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
1139 LyX-Code is defined.
1140 * lib/layouts/amsbook.layout: ditto.
1142 * boost/Makefile.am: fix typo.
1144 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
1146 (add_lastfiles): removed.
1147 (add_documents): removed.
1148 (add_formats): removed.
1150 * src/frontends/Menubar.C: remove useless "using" directive.
1152 * src/MenuBackend.h: add a new MenuItem constructor.
1154 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
1157 2000-10-04 Allan Rae <rae@lyx.org>
1159 * lib/Makefile.am (listerrors):
1160 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
1161 I haven't got notangle installed so Kayvan please test. The output
1162 should end up in $builddir. This also allows people who don't have
1163 noweb installed to complete the make process without error.
1165 * src/frontends/xforms/FormCommand.[Ch] (showInset):
1166 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
1167 by JMarc's picky compiler.
1169 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1172 * src/insets/insettabular.C (setPos): change for loop to not use
1173 sequencing operator. Please check this Jürgen.
1175 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
1177 * src/insets/insetcite.C (getScreenLabel): ditto
1178 * src/support/filetools.C (QuoteName): ditto
1179 (ChangeExtension): ditto
1181 * src/BufferView_pimpl.C (scrollCB): make heigt int
1183 * src/BufferView2.C (insertInset): comment out unused arg
1185 * boost/Makefile.am (EXTRADIST): new variable
1187 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1189 * src/exporter.C (IsExportable): Fixed
1191 * lib/configure.m4: Small fix
1193 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1195 * src/insets/insetbutton.C (width): Changed to work with no GUI.
1196 * src/insets/insetbib.C (bibitemWidest): ditto.
1197 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
1199 2000-10-03 Juergen Vigna <jug@sad.it>
1201 * src/BufferView2.C (theLockingInset): removed const because of
1202 Agnus's compile problems.
1204 * src/insets/insettext.C (LocalDispatch): set the language of the
1205 surronding paragraph on inserting the first character.
1207 * various files: changed use of BufferView::the_locking_inset.
1209 * src/BufferView2.C (theLockingInset):
1210 (theLockingInset): new functions.
1212 * src/BufferView.h: removed the_locking_inset.
1214 * src/lyxtext.h: added the_locking_inset
1216 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
1218 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
1220 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1222 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
1223 * src/mathed/math_cursor.C (IsAlpha): ditto.
1224 * src/mathed/math_inset.C (strnew): ditto.
1225 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
1226 (IMetrics): cxp set but never used; removed.
1227 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
1228 that the variable in question has been removed also!
1231 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
1232 using the Buffer * passed to Latex(), using the BufferView * passed to
1233 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
1235 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
1236 Linuxdoc() and DocBook() rather than the stored Buffer * master.
1238 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
1239 * src/buffer.C (readInset): used new InsetBibtex c-tor
1240 * (getBibkeyList): used new InsetBibtex::getKeys
1242 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1245 * lib/build-listerrors
1247 * src/exporter.C: Add literate programming support to the export code
1250 * src/lyx_cb.C: Remove old literate code.
1252 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
1255 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
1256 * src/converter.C (View, Convert): Use QuoteName.
1258 * src/insets/figinset.C (Preview): Use Formats::View.
1260 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
1262 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1264 * src/lyxfunc.C (Dispatch): move declaration of text variable at
1265 the top of the function, because compaq cxx complains that the
1266 "goto exit_with_message" when the function is disabled bypasses
1268 (MenuNew): try a better fix for the generation of new file names.
1269 This time, I used AddName() instead of AddPath(), hoping Juergen
1272 2000-10-03 Allan Rae <rae@lyx.org>
1274 * src/frontends/xforms/forms/form_preferences.fd:
1275 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
1276 nested tabfolders has begun. The old "Miscellaneous" was renamed as
1277 "Look and Feel"->"General" but will need to be split up further into
1278 general output and general input tabs. Current plan is for four outer
1279 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
1280 stuff; "Inputs" for input and import configuration; "Outputs" for
1281 output and export configuration; and one more whatever is left over
1282 called "General". The leftovers at present look like being which
1283 viewers to use, spellchecker, language support and might be better
1284 named "Support". I've put "Paths" in "Inputs" for the moment as this
1285 seems reasonable for now at least.
1286 One problem remains: X error kills LyX when you close Preferences.
1288 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1290 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
1291 qualifier from form()
1292 * src/frontends/xforms/FormCitation.[Ch]:
1293 * src/frontends/xforms/FormCopyright.[Ch]:
1294 * src/frontends/xforms/FormDocument.[Ch]:
1295 * src/frontends/xforms/FormError.[Ch]:
1296 * src/frontends/xforms/FormIndex.[Ch]:
1297 * src/frontends/xforms/FormPreferences.[Ch]:
1298 * src/frontends/xforms/FormPrint.[Ch]:
1299 * src/frontends/xforms/FormRef.[Ch]:
1300 * src/frontends/xforms/FormToc.[Ch]:
1301 * src/frontends/xforms/FormUrl.[Ch]: ditto.
1303 * src/frontends/xforms/FormCitation.[Ch]:
1304 * src/frontends/xforms/FormIndex.[Ch]:
1305 * src/frontends/xforms/FormRef.[Ch]:
1306 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
1307 with Allan's naming policy
1309 * src/frontends/xforms/FormCitation.C: some static casts to remove
1312 2000-10-02 Juergen Vigna <jug@sad.it>
1314 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
1315 now you can type or do stuff inside the table-cell also when in dummy
1316 position, fixed visible cursor.
1318 * src/insets/insettext.C (Edit): fixing cursor-view position.
1320 * src/lyxfunc.C (Dispatch): use * text variable so that it can
1321 be used for equal functions in lyxfunc and insettext.
1323 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
1325 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
1327 * src/frontends/gnome/FormCitation.h:
1328 * src/frontends/gnome/FormCopyright.h:
1329 * src/frontends/gnome/FormIndex.h:
1330 * src/frontends/gnome/FormPrint.h:
1331 * src/frontends/gnome/FormToc.h:
1332 * src/frontends/gnome/FormUrl.h:
1333 * src/frontends/kde/FormCitation.h:
1334 * src/frontends/kde/FormCopyright.h:
1335 * src/frontends/kde/FormIndex.h:
1336 * src/frontends/kde/FormRef.h:
1337 * src/frontends/kde/FormToc.h:
1338 * src/frontends/kde/FormUrl.h: fix remaining users of
1341 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1343 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
1344 from depth argument.
1345 (DocBookHandleCaption): ditto.
1346 (DocBookHandleFootnote): ditto.
1347 (SimpleDocBookOnePar): ditto.
1349 * src/frontends/xforms/FormDocument.h (form): remove extra
1350 FormDocument:: qualifier.
1352 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
1354 * sigc++/handle.h: ditto.
1356 * src/lyx_gui_misc.C: add "using" directive.
1358 * src/cheaders/cstddef: new file, needed by the boost library (for
1361 2000-10-02 Juergen Vigna <jug@sad.it>
1363 * src/insets/insettext.C (SetFont): better support.
1365 * src/insets/insettabular.C (draw): fixed drawing of single cell.
1367 * src/screen.C (DrawOneRow): some uint refixes!
1369 2000-10-02 Allan Rae <rae@lyx.org>
1371 * boost/.cvsignore: ignore Makefile as well
1373 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
1374 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
1376 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
1377 Left this one out by accident.
1379 * src/frontends/xforms/FormBase.h (restore): default to calling
1380 update() since that will restore the original/currently-applied values.
1381 Any input() triggered error messages will require the derived classes
1382 to redefine restore().
1384 * src/frontends/xforms/FormDocument.C: initialize a few variables to
1385 avoid a segfault. combo_doc_class is the main concern.
1387 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
1389 * Simplify build-listerrors in view of GUI-less export ability!
1391 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1393 * src/lyx_main.C (easyParse): Disable gui when exporting
1395 * src/insets/figinset.C:
1398 * src/lyx_gui_misc.C
1399 * src/tabular.C: Changes to allow no-gui.
1401 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1403 * src/support/utility.hpp: removed file
1404 * src/support/block.h: removed file
1406 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
1409 * src/mathed/formula.C: add support/lyxlib.h
1410 * src/mathed/formulamacro.C: ditto
1412 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
1413 * src/lyxparagraph.h: ditto
1415 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
1416 * src/frontends/Makefile.am (INCLUDES): ditto
1417 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
1418 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
1419 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
1420 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
1421 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
1422 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
1424 * src/BufferView.h: use boost/utility.hpp
1425 * src/LColor.h: ditto
1426 * src/LaTeX.h: ditto
1427 * src/LyXAction.h: ditto
1428 * src/LyXView.h: ditto
1429 * src/bufferlist.h: ditto
1430 * src/lastfiles.h: ditto
1431 * src/layout.h: ditto
1432 * src/lyx_gui.h: ditto
1433 * src/lyx_main.h: ditto
1434 * src/lyxlex.h: ditto
1435 * src/lyxrc.h: ditto
1436 * src/frontends/ButtonPolicies.h: ditto
1437 * src/frontends/Dialogs.h: ditto
1438 * src/frontends/xforms/FormBase.h: ditto
1439 * src/frontends/xforms/FormGraphics.h: ditto
1440 * src/frontends/xforms/FormParagraph.h: ditto
1441 * src/frontends/xforms/FormTabular.h: ditto
1442 * src/graphics/GraphicsCache.h: ditto
1443 * src/graphics/Renderer.h: ditto
1444 * src/insets/ExternalTemplate.h: ditto
1445 * src/insets/insetcommand.h: ditto
1446 * src/support/path.h: ditto
1448 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
1449 and introduce clause for 2.97.
1451 * boost/libs/README: new file
1453 * boost/boost/utility.hpp: new file
1455 * boost/boost/config.hpp: new file
1457 * boost/boost/array.hpp: new file
1459 * boost/Makefile.am: new file
1461 * boost/.cvsignore: new file
1463 * configure.in (AC_OUTPUT): add boost/Makefile
1465 * Makefile.am (SUBDIRS): add boost
1467 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1469 * src/support/lstrings.C (suffixIs): Fixed.
1471 2000-10-01 Allan Rae <rae@lyx.org>
1473 * src/PrinterParams.h: moved things around to avoid the "can't
1474 inline call" warning.
1476 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
1477 into doc++ documentation.
1479 * src/frontends/xforms/FormCommand.[Ch]: support button policy
1481 * src/frontends/xforms/FormRef.C: make use of button controller
1482 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
1483 cleaned up button controller usage.
1484 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
1485 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
1486 use the button controller
1488 * src/frontends/xforms/forms/*.fd: and associated generated files
1489 updated to reflect changes to FormBase. Some other FormXxxx files
1490 also got minor updates to reflect changes to FormBase.
1492 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
1493 (hide): made virtual.
1494 (input): return a bool. true == valid input
1495 (RestoreCB, restore): new
1496 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
1497 Changes to allow derived dialogs to use a ButtonController and
1498 make sense when doing so: OK button calls ok() and so on.
1500 * src/frontends/xforms/ButtonController.h (class ButtonController):
1501 Switch from template implementation to taking Policy parameter.
1502 Allows FormBase to provide a ButtonController for any dialog.
1504 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
1505 Probably should rename connect and disconnect.
1506 (apply): use the radio button groups
1507 (form): needed by FormBase
1508 (build): setup the radio button groups
1510 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
1512 * several files: type changes to reduce the number of warnings and
1513 to unify type hangling a bit. Still much to do.
1515 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1517 * lib/images/*: rename a bunch of icons to match Dekel converter
1520 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
1523 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
1525 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
1527 * sigc++/handle.h: ditto for class Handle.
1529 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
1531 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
1533 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
1535 * src/intl.C (InitKeyMapper): Correct the value of n due to the
1536 removal of the "default" language.
1538 * src/combox.h (getline): Check that sel > 0
1540 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
1542 * lib/examples/docbook_example.lyx
1543 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
1545 * lib/layouts/docbook-book.layout: new docbook book layout.
1547 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
1549 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
1551 * src/insets/figinset.C (DocBook):fixed small typo.
1553 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
1555 * src/insets/insetinclude.h: string include_label doesn't need to be
1558 2000-09-29 Allan Rae <rae@lyx.org>
1560 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
1561 Allow derived type to control connection and disconnection from signals
1562 of its choice if desired.
1564 2000-09-28 Juergen Vigna <jug@sad.it>
1566 * src/insets/insettabular.C (update): fixed cursor setting when
1567 the_locking_inset changed.
1568 (draw): made this a bit cleaner.
1569 (InsetButtonPress): fixed!
1571 * various files: added LyXText Parameter to fitCursor call.
1573 * src/BufferView.C (fitCursor): added LyXText parameter.
1575 * src/insets/insettabular.C (draw): small draw fix.
1577 * src/tabular.C: right setting of left/right celllines.
1579 * src/tabular.[Ch]: fixed various types in funcions and structures.
1580 * src/insets/insettabular.C: ditto
1581 * src/frontends/xforms/FormTabular.C: ditto
1583 2000-09-28 Allan Rae <rae@lyx.org>
1585 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
1586 that the #ifdef's had been applied to part of what should have been
1587 a complete condition. It's possible there are other tests that
1588 were specific to tables that are also wrong now that InsetTabular is
1589 being used. Now we need to fix the output of '\n' after a table in a
1590 float for the same reason as the original condition:
1591 "don't insert this if we would be adding it before or after a table
1592 in a float. This little trick is needed in order to allow use of
1593 tables in \subfigures or \subtables."
1594 Juergen can you check this?
1596 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1598 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
1599 output to the ostream.
1601 * several files: fixed types based on warnings from cxx
1603 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
1605 * src/frontends/kde/Makefile.am: fix rule for
1606 formindexdialogdata_moc.C
1608 * src/.cvsignore: add ext_l10n.h to ignore
1610 * acconfig.h: stop messing with __STRICT_ANSI__
1611 * config/gnome.m4: remove option to set -ansi
1612 * config/kde.m4: remove option to set -ansi
1613 * config/lyxinclude.m4: don't set -ansi
1615 2000-09-27 Juergen Vigna <jug@sad.it>
1617 * various files: remove "default" language check.
1619 * src/insets/insetquotes.C: removed use of current_view.
1621 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
1622 the one should have red ears by now!
1624 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
1625 in more then one paragraph. Fixed cursor-movement/selection.
1627 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
1628 paragraphs inside a text inset.
1630 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
1631 text-inset if this owner is an inset.
1633 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1635 * src/Bullet.h: changed type of font, character and size to int
1637 * src/buffer.C (asciiParagraph): remove actcell and fname1.
1639 * src/insets/inseturl.[Ch]:
1640 * src/insets/insetref.[Ch]:
1641 * src/insets/insetlabel.[Ch]: add linelen to Ascii
1643 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
1645 * src/buffer.C (readFile): block-if statement rearranged to minimise
1646 bloat. Patch does not reverse Jean-Marc's change ;-)
1648 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
1649 Class rewritten to store pointers to hide/update signals directly,
1650 rather than Dialogs *. Also defined an enum to ease use. All xforms
1651 forms can now be derived from this class.
1653 * src/frontends/xforms/FormCommand.[Ch]
1654 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
1656 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
1659 * src/frontends/xforms/forms/form_citation.fd
1660 * src/frontends/xforms/forms/form_copyright.fd
1661 * src/frontends/xforms/forms/form_error.fd
1662 * src/frontends/xforms/forms/form_index.fd
1663 * src/frontends/xforms/forms/form_ref.fd
1664 * src/frontends/xforms/forms/form_toc.fd
1665 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
1667 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
1669 * src/insets/insetfoot.C: removed redundent using directive.
1671 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1673 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
1674 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
1676 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
1677 created in the constructors in different groups. Then set() just
1678 have to show the groups as needed. This fixes the redraw problems
1679 (and is how the old menu code worked).
1681 * src/support/lyxlib.h: declare the methods as static when we do
1682 not have namespaces.
1684 2000-09-26 Juergen Vigna <jug@sad.it>
1686 * src/buffer.C (asciiParagraph): new function.
1687 (writeFileAscii): new function with parameter ostream.
1688 (writeFileAscii): use now asciiParagraph.
1690 * various inset files: added the linelen parameter to the Ascii-func.
1692 * src/tabular.C (Write): fixed error in writing file introduced by
1693 the last changes from Lars.
1695 * lib/bind/menus.bind: removed not supported functions.
1697 * src/insets/insettext.C (Ascii): implemented this function.
1699 * src/insets/lyxinset.h (Ascii): added linelen parameter.
1701 * src/tabular.C (write_attribute[int,string,bool]): new functions.
1702 (Write): use of the write_attribute functions.
1704 * src/bufferlist.C (close): fixed reasking question!
1706 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1708 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
1709 new files use the everwhere possible.
1712 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
1713 src/log_form.C src/lyx.C:
1716 * src/buffer.C (runLaTeX): remove func
1718 * src/PaperLayout.C: removed file
1719 * src/ParagraphExtra.C: likewise
1720 * src/bullet_forms.C: likewise
1721 * src/bullet_forms.h: likewise
1722 * src/bullet_forms_cb.C: likewise
1724 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
1725 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
1728 * several files: remove all traces of the old fd_form_paragraph,
1729 and functions belonging to that.
1731 * several files: remove all traces of the old fd_form_document,
1732 and functions belonging to that.
1734 * several files: constify local variables were possible.
1736 * several files: remove all code that was dead when NEW_EXPORT was
1739 * several files: removed string::c_str in as many places as
1742 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
1743 (e): be a bit more outspoken when patching
1744 (updatesrc): only move files if changed.
1746 * forms/layout_forms.h.patch: regenerated
1748 * forms/layout_forms.fd: remove form_document and form_paragraph
1749 and form_quotes and form_paper and form_table_options and
1750 form_paragraph_extra
1752 * forms/form1.fd: remove form_table
1754 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
1755 the fdui->... rewrite. Update some comments to xforms 0.88
1757 * forms/bullet_forms.C.patch: removed file
1758 * forms/bullet_forms.fd: likewise
1759 * forms/bullet_forms.h.patch: likewise
1761 * development/Code_rules/Rules: added a section on switch
1762 statements. Updated some comment to xforms 0.88.
1764 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1766 * src/buffer.C (readFile): make sure that the whole version number
1767 is read after \lyxformat (even when it contains a comma)
1769 * lib/ui/default.ui: change shortcut of math menu to M-a.
1771 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1773 * src/vspace.C (nextToken): use isStrDbl() to check for proper
1776 * src/LyXView.C (updateWindowTitle): show the full files name in
1777 window title, limited to 30 characters.
1779 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
1780 When a number of characters has been given, we should not assume
1781 that the string is 0-terminated.
1783 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
1784 calls (fixes some memory leaks)
1786 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
1787 trans member on exit.
1789 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1791 * src/converter.C (GetReachable): fix typo.
1793 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
1794 understand ',' instead of '.'.
1795 (GetInteger): rewrite to use strToInt().
1797 2000-09-26 Juergen Vigna <jug@sad.it>
1799 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
1800 better visibility and error-message on wrong VSpace input.
1802 * src/language.C (initL): added english again.
1804 2000-09-25 Juergen Vigna <jug@sad.it>
1806 * src/frontends/kde/Dialogs.C (Dialogs):
1807 * src/frontends/gnome/Dialogs.C (Dialogs):
1808 * src/frontends/kde/Makefile.am:
1809 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
1811 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
1813 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
1815 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
1817 * src/frontends/xforms/FormParagraph.C:
1818 * src/frontends/xforms/FormParagraph.h:
1819 * src/frontends/xforms/form_paragraph.C:
1820 * src/frontends/xforms/form_paragraph.h:
1821 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
1824 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
1826 * src/tabular.C (OldFormatRead): forgot to delete the temporary
1827 Paragraph-Data after use.
1829 * src/insets/insettext.C (LocalDispatch): don't set the layout on
1830 non breakable paragraphs.
1832 2000-09-25 Garst R. Reese <reese@isn.net>
1834 * src/language.C (initL): added missing language_country codes.
1836 2000-09-25 Juergen Vigna <jug@sad.it>
1838 * src/insets/insettext.C (InsetText):
1839 (deleteLyXText): remove the not released LyXText structure!
1841 2000-09-24 Marko Vendelin <markov@ioc.ee>
1843 * src/frontends/gnome/mainapp.C
1844 * src/frontends/gnome/mainapp.h: added support for keyboard
1847 * src/frontends/gnome/FormCitation.C
1848 * src/frontends/gnome/FormCitation.h
1849 * src/frontends/gnome/Makefile.am
1850 * src/frontends/gnome/pixbutton.h: completed the rewrite of
1851 FormCitation to use "action area" in mainapp window
1853 * src/frontends/gnome/Menubar_pimpl.C
1854 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
1857 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
1859 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
1860 width/descent/ascent values if name is empty.
1861 (mathed_string_height): Use std::max.
1863 2000-09-25 Allan Rae <rae@lyx.org>
1865 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
1866 segfault. This will be completely redesigned soon.
1868 * sigc++: updated libsigc++. Fixes struct timespec bug.
1870 * development/tools/makeLyXsigc.sh: .cvsignore addition
1872 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
1874 * several files: removed almost all traces of the old table
1877 * src/TableLayout.C: removed file
1879 2000-09-22 Juergen Vigna <jug@sad.it>
1881 * src/frontends/kde/Dialogs.C: added credits forms.
1883 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
1885 * src/frontends/gnome/Dialogs.C: added some forms.
1887 * src/spellchecker.C (init_spell_checker): set language in pspell code
1888 (RunSpellChecker): some modifications for setting language string.
1890 * src/language.[Ch]: added language_country code.
1892 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
1894 * src/frontends/Dialogs.h: added new signal showError.
1895 Rearranged existing signals in some sort of alphabetical order.
1897 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
1898 FormError.[Ch], form_error.[Ch]
1899 * src/frontends/xforms/forms/makefile: added new file form_error.fd
1900 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
1902 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
1903 dialogs. I think that this can be used as the base to all these
1906 * src/frontends/xforms/FormError.[Ch]
1907 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
1908 implementation of InsetError dialog.
1910 * src/insets/inseterror.[Ch]: rendered GUI-independent.
1912 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
1913 * src/frontends/kde/Makefile.am: ditto
1915 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
1917 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
1918 macrobf. This fixes a bug of invisible text.
1920 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1922 * lib/doc/LaTeXConfig.lyx.in: updated.
1924 * src/language.C (initL): remove language "francais" and change a
1925 bit the names of the two other french variations.
1927 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
1928 string that may not be 0-terminated.
1930 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1932 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
1934 2000-09-20 Marko Vendelin <markov@ioc.ee>
1936 * src/frontends/gnome/FormCitation.C
1937 * src/frontends/gnome/FormIndex.C
1938 * src/frontends/gnome/FormToc.C
1939 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
1940 the variable initialization to shut up the warnings
1942 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1944 * src/table.[Ch]: deleted files
1946 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
1949 2000-09-18 Juergen Vigna <jug@sad.it>
1951 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
1952 problems with selection. Inserted new LFUN_PASTESELECTION.
1953 (InsetButtonPress): inserted handling of middle mouse-button paste.
1955 * src/spellchecker.C: changed word to word.c_str().
1957 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
1959 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
1960 included in the ``make dist'' tarball.
1962 2000-09-15 Juergen Vigna <jug@sad.it>
1964 * src/CutAndPaste.C (cutSelection): small fix return the right
1965 end position after cut inside one paragraph only.
1967 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
1968 we are locked as otherwise we don't have a valid cursor position!
1970 * src/insets/figinset.C (draw): small bugfix but why is this needed???
1972 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
1974 * src/frontends/kde/FormRef.C: added using directive.
1975 * src/frontends/kde/FormToc.C: ditto
1977 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
1979 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
1981 2000-09-19 Marko Vendelin <markov@ioc.ee>
1983 * src/frontends/gnome/Menubar_pimpl.C
1984 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
1985 Toc, ViewFormats, UpdateFormats, and ExportFormats.
1987 * src/frontends/gnome/mainapp.C
1988 * src/frontends/gnome/mainapp.h: support for menu update used
1991 * src/frontends/gnome/mainapp.C
1992 * src/frontends/gnome/mainapp.h: support for "action" area in the
1993 main window. This area is used by small simple dialogs, such as
1996 * src/frontends/gnome/FormIndex.C
1997 * src/frontends/gnome/FormIndex.h
1998 * src/frontends/gnome/FormUrl.C
1999 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
2002 * src/frontends/gnome/FormCitation.C
2003 * src/frontends/gnome/FormCitation.h: rewrite to use main window
2004 action area. Only "Insert new citation" is implemented.
2006 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2008 * src/buffer.C (Dispatch): fix call to Dispatch
2009 * src/insets/insetref.C (Edit): likewise
2010 * src/insets/insetparent.C (Edit): likewise
2011 * src/insets/insetinclude.C (include_cb): likewise
2012 * src/frontends/xforms/FormUrl.C (apply): likewise
2013 * src/frontends/xforms/FormToc.C (apply): likewise
2014 * src/frontends/xforms/FormRef.C (apply): likewise
2015 * src/frontends/xforms/FormIndex.C (apply): likewise
2016 * src/frontends/xforms/FormCitation.C (apply): likewise
2017 * src/lyxserver.C (callback): likewise
2018 * src/lyxfunc.C (processKeySym): likewise
2019 (Dispatch): likewise
2020 (Dispatch): likewise
2021 * src/lyx_cb.C (LayoutsCB): likewise
2023 * Makefile.am (sourcedoc): small change
2025 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2027 * src/main.C (main): Don't make an empty GUIRunTime object. all
2028 methods are static. constify a bit remove unneded using + headers.
2030 * src/tabular.C: some more const to local vars move some loop vars
2032 * src/spellchecker.C: added some c_str after some word for pspell
2034 * src/frontends/GUIRunTime.h: add new static method setDefaults
2035 * src/frontends/xforms/GUIRunTime.C (setDefaults):
2036 * src/frontends/kde/GUIRunTime.C (setDefaults):
2037 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
2039 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
2040 with strnew in arg, use correct emptystring when calling SetName.
2042 * several files: remove all commented code with relation to
2043 HAVE_SSTREAM beeing false. We now only support stringstream and
2046 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2048 * src/lyxfunc.C: construct correctly the automatic new file
2051 * src/text2.C (IsStringInText): change type of variable i to shut
2054 * src/support/sstream.h: do not use namespaces if the compiler
2055 does not support them.
2057 2000-09-15 Marko Vendelin <markov@ioc.ee>
2058 * src/frontends/gnome/FormCitation.C
2059 * src/frontends/gnome/FormCitation.h
2060 * src/frontends/gnome/diainsertcitation_interface.c
2061 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
2062 regexp support to FormCitation [Gnome].
2064 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
2067 * configure.in: remove unused KDE/GTKGUI define
2069 * src/frontends/kde/FormRef.C
2070 * src/frontends/kde/FormRef.h
2071 * src/frontends/kde/formrefdialog.C
2072 * src/frontends/kde/formrefdialog.h: double click will
2073 go to reference, now it is possible to change a cross-ref
2076 * src/frontends/kde/FormToc.C
2077 * src/frontends/kde/FormToc.h
2078 * src/frontends/kde/formtocdialog.C
2079 * src/frontends/kde/formtocdialog.h: add a depth
2082 * src/frontends/kde/Makefile.am: add QtLyXView.h
2085 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
2087 * src/frontends/kde/FormCitation.h: added some using directives.
2089 * src/frontends/kde/FormToc.h: corrected definition of doTree.
2091 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
2094 * src/mathed/math_defs.h: redefine SetAlign to use string rather
2097 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2099 * src/buffer.C (pop_tag): revert for the second time a change by
2100 Lars, who seems to really hate having non-local loop variables :)
2102 * src/Lsstream.h: add "using" statements.
2104 * src/support/copy.C (copy): add a bunch of std:: qualifiers
2105 * src/buffer.C (writeFile): ditto
2107 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2109 * src/buffer.C (writeFile): try to fix the locale modified format
2110 number to always be as we want it.
2112 * src/WorkArea.C (work_area_handler): try to workaround the bugs
2113 in XForms 0.89. C-space is now working again.
2115 * src/Lsstream.h src/support/sstream.h: new files.
2117 * also commented out all cases where strstream were used.
2119 * src/Bullet.h (c_str): remove method.
2121 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
2123 * a lot of files: get rid of "char const *" and "char *" is as
2124 many places as possible. We only want to use them in interaction
2125 with system of other libraries, not inside lyx.
2127 * a lot of files: return const object is not of pod type. This
2128 helps ensure that temporary objects is not modified. And fits well
2129 with "programming by contract".
2131 * configure.in: check for the locale header too
2133 * Makefile.am (sourcedoc): new tag for generation of doc++
2136 2000-09-14 Juergen Vigna <jug@sad.it>
2138 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
2139 callback to check which combo called it and do the right action.
2141 * src/combox.C (combo_cb): added combo * to the callbacks.
2142 (Hide): moved call of callback after Ungrab of the pointer.
2144 * src/intl.h: removed LCombo2 function.
2146 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
2147 function as this can now be handled in one function.
2149 * src/combox.h: added Combox * to callback prototype.
2151 * src/frontends/xforms/Toolbar_pimpl.C:
2152 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
2154 2000-09-14 Garst Reese <reese@isn.net>
2156 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
2157 moved usepackage{xxx}'s to beginning of file. Changed left margin
2158 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
2159 underlining from title. Thanks to John Culleton for useful suggestions.
2161 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2163 * src/lyxlex_pimpl.C (setFile): change error message to debug
2166 2000-09-13 Juergen Vigna <jug@sad.it>
2168 * src/frontends/xforms/FormDocument.C: implemented choice_class
2169 as combox and give callback to combo_language so OK/Apply is activated
2172 * src/bufferlist.C (newFile): small fix so already named files
2173 (via an open call) are not requested to be named again on the
2176 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2178 * src/frontends/kde/Makefile.am
2179 * src/frontends/kde/FormRef.C
2180 * src/frontends/kde/FormRef.h
2181 * src/frontends/kde/formrefdialog.C
2182 * src/frontends/kde/formrefdialog.h: implement
2185 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2187 * src/frontends/kde/formtocdialog.C
2188 * src/frontends/kde/formtocdialog.h
2189 * src/frontends/kde/FormToc.C
2190 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
2192 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
2194 * src/frontends/kde/FormCitation.C: fix thinko
2195 where we didn't always display the reference text
2198 * src/frontends/kde/formurldialog.C
2199 * src/frontends/kde/formurldialog.h
2200 * src/frontends/kde/FormUrl.C
2201 * src/frontends/kde/FormUrl.h: minor cleanups
2203 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
2205 * src/frontends/kde/Makefile.am
2206 * src/frontends/kde/FormToc.C
2207 * src/frontends/kde/FormToc.h
2208 * src/frontends/kde/FormCitation.C
2209 * src/frontends/kde/FormCitation.h
2210 * src/frontends/kde/FormIndex.C
2211 * src/frontends/kde/FormIndex.h
2212 * src/frontends/kde/formtocdialog.C
2213 * src/frontends/kde/formtocdialog.h
2214 * src/frontends/kde/formcitationdialog.C
2215 * src/frontends/kde/formcitationdialog.h
2216 * src/frontends/kde/formindexdialog.C
2217 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
2219 2000-09-12 Juergen Vigna <jug@sad.it>
2221 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
2224 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2226 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
2229 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
2231 * src/converter.C (Add, Convert): Added support for converter flags:
2232 needaux, resultdir, resultfile.
2233 (Convert): Added new parameter view_file.
2234 (dvips_options): Fixed letter paper option.
2236 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
2237 (Export, GetExportableFormats, GetViewableFormats): Added support
2240 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
2242 (easyParse): Fixed to work with new export code.
2244 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
2247 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
2249 * lib/bind/*.bind: Replaced
2250 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
2251 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
2253 2000-09-11 Juergen Vigna <jug@sad.it>
2255 * src/lyx_gui.C (runTime): uses global guiruntime variable.
2257 * src/main.C (main): now GUII defines global guiruntime!
2259 * src/frontends/gnome/GUIRunTime.C (initApplication):
2260 * src/frontends/kde/GUIRunTime.C (initApplication):
2261 * src/frontends/xforms/GUIRunTime.C (initApplication):
2262 * src/frontends/GUIRunTime.h: added new function initApplication.
2264 * src/spellchecker.C (sc_accept_word): change to add_to_session.
2266 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
2268 2000-09-08 Juergen Vigna <jug@sad.it>
2270 * src/lyx_gui.C (create_forms): don't display the "default" entry as
2271 we have already "Reset".
2273 * src/language.C (initL): inserted "default" language and made this
2274 THE default language (and not american!)
2276 * src/paragraph.C: inserted handling of "default" language!
2278 * src/lyxfont.C: ditto
2282 * src/paragraph.C: output the \\par only if we have a following
2283 paragraph otherwise it's not needed.
2285 2000-09-05 Juergen Vigna <jug@sad.it>
2287 * config/pspell.m4: added entry to lyx-flags
2289 * src/spellchecker.C: modified version from Kevin for using pspell
2291 2000-09-01 Marko Vendelin <markov@ioc.ee>
2292 * src/frontends/gnome/Makefile.am
2293 * src/frontends/gnome/FormCitation.C
2294 * src/frontends/gnome/FormCitation.h
2295 * src/frontends/gnome/diainsertcitation_callbacks.c
2296 * src/frontends/gnome/diainsertcitation_callbacks.h
2297 * src/frontends/gnome/diainsertcitation_interface.c
2298 * src/frontends/gnome/diainsertcitation_interface.h
2299 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
2300 dialog for Gnome frontend
2302 * src/main.C: Gnome libraries require keeping application name
2303 and its version as strings
2305 * src/frontends/gnome/mainapp.C: Change the name of the main window
2306 from GnomeLyX to PACKAGE
2308 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2310 * src/frontends/Liason.C: add "using: declaration.
2312 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
2314 * src/mathed/math_macro.C (Metrics): Set the size of the template
2316 * src/mathed/formulamacro.C (Latex): Fixed the returned value
2318 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
2320 * src/converter.C (add_options): New function.
2321 (SetViewer): Change $$FName into '$$FName'.
2322 (View): Add options when running xdvi
2323 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
2324 (Convert): The 3rd parameter is now the desired filename. Converts
2325 calls to lyx::rename if necessary.
2326 Add options when running dvips.
2327 (dvi_papersize,dvips_options): New methods.
2329 * src/exporter.C (Export): Use getLatexName() instead of fileName().
2331 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
2332 using a call to Converter::dvips_options.
2333 Fixed to work with nex export code.
2335 * src/support/copy.C
2336 * src/support/rename.C: New files
2338 * src/support/syscall.h
2339 * src/support/syscall.C: Added Starttype SystemDontWait.
2341 * lib/ui/default.ui: Changed to work with new export code
2343 * lib/configure.m4: Changed to work with new export code
2345 * src/encoding.C: Changed latex name for iso8859_7 encoding.
2347 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
2349 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
2350 so that code compiles with DEC cxx.
2352 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
2353 to work correctly! Also now supports the additional elements
2356 2000-09-01 Allan Rae <rae@lyx.org>
2358 * src/frontends/ButtonPolicies.C: renamed all the references to
2359 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
2361 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
2362 since it's a const not a type.
2364 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
2366 2000-08-31 Juergen Vigna <jug@sad.it>
2368 * src/insets/figinset.C: Various changes to look if the filename has
2369 an extension and if not add it for inline previewing.
2371 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2373 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
2374 make buttonStatus and isReadOnly be const methods. (also reflect
2375 this in derived classes.)
2377 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
2378 (nextState): change to be static inline, pass the StateMachine as
2380 (PreferencesPolicy): remove casts
2381 (OkCancelPolicy): remvoe casts
2382 (OkCancelReadOnlyPolicy): remove casts
2383 (NoRepeatedApplyReadOnlyPolicy): remove casts
2384 (OkApplyCancelReadOnlyPolicy): remove casts
2385 (OkApplyCancelPolicy): remove casts
2386 (NoRepeatedApplyPolicy): remove casts
2388 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
2390 * src/converter.C: added some using directives
2392 * src/frontends/ButtonPolicies.C: changes to overcome
2393 "need lvalue" error with DEC c++
2395 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
2396 to WMHideCB for DEC c++
2398 * src/frontends/xforms/Menubar_pimpl.C: added using directive
2400 * src/frontends/xforms/forms/form_document.C.patch: use C callback
2401 to BulletBMTableCB for DEC c++
2403 2000-08-31 Allan Rae <rae@lyx.org>
2405 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
2406 character dialog separately from old document dialogs combo_language.
2409 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2411 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
2412 Removed LFUN_REF_CREATE.
2414 * src/MenuBackend.C: Added new tags: toc and references
2416 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
2417 (add_lastfiles, add_documents, add_formats): Removed the unused smn
2419 (add_toc, add_references): New methods.
2420 (create_submenu): Handle correctly the case when there is a
2421 seperator after optional menu items.
2423 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
2424 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
2425 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
2427 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
2429 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2431 * src/converter.[Ch]: New file for converting between different
2434 * src/export.[Ch]: New file for exporting a LyX file to different
2437 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
2438 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
2439 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
2440 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
2441 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
2442 RunDocBook, MenuExport.
2444 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
2445 Exporter::Preview methods if NEW_EXPORT is defined.
2447 * src/buffer.C (Dispatch): Use Exporter::Export.
2449 * src/lyxrc.C: Added new tags: \converter and \viewer.
2452 * src/LyXAction.C: Define new lyx-function: buffer-update.
2453 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
2454 when NEW_EXPORT is defined.
2456 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
2458 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
2460 * lib/ui/default.ui: Added submenus "view" and "update" to the
2463 * src/filetools.C (GetExtension): New function.
2465 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
2467 2000-08-29 Allan Rae <rae@lyx.org>
2469 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
2471 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
2472 (EnableDocumentLayout): removed
2473 (DisableDocumentLayout): removed
2474 (build): make use of ButtonController's read-only handling to
2475 de/activate various objects. Replaces both of the above functions.
2477 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
2478 (readOnly): was read_only
2479 (refresh): fixed dumb mistakes with read_only_ handling
2481 * src/frontends/xforms/forms/form_document.fd:
2482 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
2483 tabbed dialogs so the tabs look more like tabs and so its easier to
2484 work out which is the current tab.
2486 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
2487 segfault with form_table
2489 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
2491 2000-08-28 Juergen Vigna <jug@sad.it>
2493 * acconfig.h: added USE_PSPELL.
2495 * src/config.h.in: added USE_PSPELL.
2497 * autogen.sh: added pspell.m4
2499 * config/pspell.m4: new file.
2501 * src/spellchecker.C: implemented support for pspell libary.
2503 2000-08-25 Juergen Vigna <jug@sad.it>
2505 * src/LyXAction.C (init): renamed LFUN_TABLE to
2506 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
2508 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
2510 * src/lyxscreen.h: add force_clear variable and fuction to force
2511 a clear area when redrawing in LyXText.
2513 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
2515 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2517 * some whitespace and comment changes.
2519 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
2521 * src/buffer.C: up te LYX_FORMAT to 2.17
2523 2000-08-23 Juergen Vigna <jug@sad.it>
2525 * src/BufferView_pimpl.C (tripleClick): disable this when in a
2528 * src/insets/insettabular.C (pasteSelection): delete the insets
2529 LyXText as it is not valid anymore.
2530 (copySelection): new function.
2531 (pasteSelection): new function.
2532 (cutSelection): new function.
2533 (LocalDispatch): implemented cut/copy/paste of cell selections.
2535 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
2536 don't have a LyXText.
2538 * src/LyXAction.C (init): a NEW_TABULAR define too much.
2540 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
2543 2000-08-22 Juergen Vigna <jug@sad.it>
2545 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
2546 ifdef form_table out if NEW_TABULAR.
2548 2000-08-21 Juergen Vigna <jug@sad.it>
2550 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
2551 (draw): fixed draw position so that the cursor is positioned in the
2553 (InsetMotionNotify): hide/show cursor so the position is updated.
2554 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
2555 using cellstart() function where it should be used.
2557 * src/insets/insettext.C (draw): ditto.
2559 * src/tabular.C: fixed initialization of some missing variables and
2560 made BoxType into an enum.
2562 2000-08-22 Marko Vendelin <markov@ioc.ee>
2563 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
2564 stock menu item using action numerical value, not its string
2568 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
2570 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
2571 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
2573 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
2575 * src/frontends/xforms/GUIRunTime.C: new file
2577 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
2578 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2580 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
2582 * src/frontends/kde/GUIRunTime.C: new file
2584 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
2585 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2587 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
2589 * src/frontends/gnome/GUIRunTime.C: new file
2591 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
2594 * src/frontends/GUIRunTime.h: removed constructor and destructor,
2595 small change to documetentation.
2597 * src/frontends/GUIRunTime.C: removed file
2599 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
2601 * src/lyxparagraph.h: enable NEW_TABULAR as default
2603 * src/lyxfunc.C (processKeySym): remove some commented code
2605 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
2606 NEW_TABULAR around the fd_form_table_options.
2608 * src/lyx_gui.C (runTime): call the static member function as
2609 GUIRunTime::runTime().
2611 2000-08-21 Allan Rae <rae@lyx.org>
2613 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
2616 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
2618 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
2620 2000-08-21 Allan Rae <rae@lyx.org>
2622 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
2623 keep Garst happy ;-)
2624 * src/frontends/xforms/FormPreferences.C (build): use setOK
2625 * src/frontends/xforms/FormDocument.C (build): use setOK
2626 (FormDocument): use the appropriate policy.
2628 2000-08-21 Allan Rae <rae@lyx.org>
2630 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
2631 automatic [de]activation of arbitrary objects when in a read-only state.
2633 * src/frontends/ButtonPolicies.h: More documentation
2634 (isReadOnly): added to support the above.
2636 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
2638 2000-08-18 Juergen Vigna <jug@sad.it>
2640 * src/insets/insettabular.C (getStatus): changed to return func_status.
2642 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
2643 display toggle menu entries if they are.
2645 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
2646 new document layout now.
2648 * src/lyxfunc.C: ditto
2650 * src/lyx_gui_misc.C: ditto
2652 * src/lyx_gui.C: ditto
2654 * lib/ui/default.ui: removed paper and quotes layout as they are now
2655 all in the document layout tabbed folder.
2657 * src/frontends/xforms/forms/form_document.fd: added Restore
2658 button and callbacks for all inputs for Allan's ButtonPolicy.
2660 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
2661 (CheckChoiceClass): added missing params setting on class change.
2662 (UpdateLayoutDocument): added for updating the layout on params.
2663 (build): forgot to RETURN_ALWAYS input_doc_spacing.
2664 (FormDocument): Implemented Allan's ButtonPolicy with the
2667 2000-08-17 Allan Rae <rae@lyx.org>
2669 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
2670 so we can at least see the credits again.
2672 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
2673 controller calls for the appropriate callbacks. Note that since Ok
2674 calls apply followed by cancel, and apply isn't a valid input for the
2675 APPLIED state, the bc_ calls have to be made in the static callback not
2676 within each of the real callbacks.
2678 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
2679 (setOk): renamed from setOkay()
2681 2000-08-17 Juergen Vigna <jug@sad.it>
2683 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
2684 in the implementation part.
2685 (composeUIInfo): don't show optional menu-items.
2687 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
2689 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
2691 * src/bufferview_funcs.C (CurrentState): fixed to show also the
2692 text-state when in a text-inset.
2694 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
2696 2000-08-17 Marko Vendelin <markov@ioc.ee>
2697 * src/frontends/gnome/FormIndex.C
2698 * src/frontends/gnome/FormIndex.h
2699 * src/frontends/gnome/FormToc.C
2700 * src/frontends/gnome/FormToc.h
2701 * src/frontends/gnome/dialogs
2702 * src/frontends/gnome/diatoc_callbacks.c
2703 * src/frontends/gnome/diatoc_callbacks.h
2704 * src/frontends/gnome/diainsertindex_callbacks.h
2705 * src/frontends/gnome/diainsertindex_callbacks.c
2706 * src/frontends/gnome/diainsertindex_interface.c
2707 * src/frontends/gnome/diainsertindex_interface.h
2708 * src/frontends/gnome/diatoc_interface.h
2709 * src/frontends/gnome/diatoc_interface.c
2710 * src/frontends/gnome/Makefile.am: Table of Contents and
2711 Insert Index dialogs implementation for Gnome frontend
2713 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
2715 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
2717 * src/frontends/gnome/diainserturl_interface.c: make the dialog
2720 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2722 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
2723 destructor. Don't definde if you don't need it
2724 (processEvents): made static, non-blocking events processing for
2726 (runTime): static method. event loop for xforms
2727 * similar as above for kde and gnome.
2729 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
2730 new Pimpl is correct
2731 (runTime): new method calss the real frontends runtime func.
2733 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
2735 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2737 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
2739 2000-08-16 Juergen Vigna <jug@sad.it>
2741 * src/lyx_gui.C (runTime): added GUII RunTime support.
2743 * src/frontends/Makefile.am:
2744 * src/frontends/GUIRunTime.[Ch]:
2745 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
2746 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
2747 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
2749 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
2751 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
2752 as this is already set in ${FRONTEND_INCLUDE} if needed.
2754 * configure.in (CPPFLAGS): setting the include dir for the frontend
2755 directory and don't set FRONTEND=xforms for now as this is executed
2758 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
2760 * src/frontends/kde/Makefile.am:
2761 * src/frontends/kde/FormUrl.C:
2762 * src/frontends/kde/FormUrl.h:
2763 * src/frontends/kde/formurldialog.h:
2764 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
2766 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
2768 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
2770 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2772 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
2775 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
2777 * src/WorkArea.C (work_area_handler): more work to get te
2778 FL_KEYBOARD to work with xforms 0.88 too, please test.
2780 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
2782 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
2784 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
2787 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2789 * src/Timeout.h: remove Qt::emit hack.
2791 * several files: changes to allo doc++ compilation
2793 * src/lyxfunc.C (processKeySym): new method
2794 (processKeyEvent): comment out if FL_REVISION < 89
2796 * src/WorkArea.C: change some debugging levels.
2797 (WorkArea): set wantkey to FL_KEY_ALL
2798 (work_area_handler): enable the FL_KEYBOARD clause, this enables
2799 clearer code and the use of compose with XForms 0.89. Change to
2800 use signals instead of calling methods in bufferview directly.
2802 * src/Painter.C: change some debugging levels.
2804 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
2807 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
2808 (workAreaKeyPress): new method
2810 2000-08-14 Juergen Vigna <jug@sad.it>
2812 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
2814 * config/kde.m4: addes some features
2816 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
2817 include missing xforms dialogs.
2819 * src/Timeout.h: a hack to be able to compile with qt/kde.
2821 * sigc++/.cvsignore: added acinclude.m4
2823 * lib/.cvsignore: added listerros
2825 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
2826 xforms tree as objects are needed for other frontends.
2828 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
2829 linking with not yet implemented xforms objects.
2831 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
2833 2000-08-14 Baruch Even <baruch.even@writeme.com>
2835 * src/frontends/xforms/FormGraphics.h:
2836 * src/frontends/xforms/FormGraphics.C:
2837 * src/frontends/xforms/RadioButtonGroup.h:
2838 * src/frontends/xforms/RadioButtonGroup.C:
2839 * src/insets/insetgraphics.h:
2840 * src/insets/insetgraphics.C:
2841 * src/insets/insetgraphicsParams.h:
2842 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
2843 instead of spaces, and various other indentation issues to make the
2844 sources more consistent.
2846 2000-08-14 Marko Vendelin <markov@ioc.ee>
2848 * src/frontends/gnome/dialogs/diaprint.glade
2849 * src/frontends/gnome/FormPrint.C
2850 * src/frontends/gnome/FormPrint.h
2851 * src/frontends/gnome/diaprint_callbacks.c
2852 * src/frontends/gnome/diaprint_callbacks.h
2853 * src/frontends/gnome/diaprint_interface.c
2854 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
2857 * src/frontends/gnome/dialogs/diainserturl.glade
2858 * src/frontends/gnome/FormUrl.C
2859 * src/frontends/gnome/FormUrl.h
2860 * src/frontends/gnome/diainserturl_callbacks.c
2861 * src/frontends/gnome/diainserturl_callbacks.h
2862 * src/frontends/gnome/diainserturl_interface.c
2863 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
2864 Gnome implementation
2866 * src/frontends/gnome/Dialogs.C
2867 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
2868 all other dialogs. Copy all unimplemented dialogs from Xforms
2871 * src/frontends/gnome/support.c
2872 * src/frontends/gnome/support.h: support files generated by Glade
2876 * config/gnome.m4: Gnome configuration scripts
2878 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
2879 configure --help message
2881 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
2882 only if there are no events pendling in Gnome/Gtk. This enhances
2883 the performance of menus.
2886 2000-08-14 Allan Rae <rae@lyx.org>
2888 * lib/Makefile.am: listerrors cleaning
2890 * lib/listerrors: removed -- generated file
2891 * acinclude.m4: ditto
2892 * sigc++/acinclude.m4: ditto
2894 * src/frontends/xforms/forms/form_citation.fd:
2895 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
2898 * src/frontends/xforms/forms/makefile: I renamed the `install` target
2899 `updatesrc` and now we have a `test` target that does what `updatesrc`
2900 used to do. I didn't like having an install target that wasn't related
2903 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
2904 on all except FormGraphics. This may yet happen. Followed by a major
2905 cleanup including using FL_TRANSIENT for most of the dialogs. More
2906 changes to come when the ButtonController below is introduced.
2908 * src/frontends/xforms/ButtonController.h: New file for managing up to
2909 four buttons on a dialog according to an externally defined policy.
2910 * src/frontends/xforms/Makefile.am: added above
2912 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
2913 Apply and Cancel/Close buttons and everything in between and beyond.
2914 * src/frontends/Makefile.am: added above.
2916 * src/frontends/xforms/forms/form_preferences.fd:
2917 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
2918 and removed variable 'status' as a result. Fixed the set_minsize thing.
2919 Use the new screen-font-update after checking screen fonts were changed
2920 Added a "Restore" button to restore the original lyxrc values while
2921 editing. This restores everything not just the last input changed.
2922 That's still a tricky one. As is the "LyX: this shouldn't happen..."
2924 * src/LyXAction.C: screen-font-update added for updating buffers after
2925 screen font settings have been changed.
2926 * src/commandtags.h: ditto
2927 * src/lyxfunc.C: ditto
2929 * forms/lyx.fd: removed screen fonts dialog.
2930 * src/lyx_gui.C: ditto
2931 * src/menus.[Ch]: ditto
2932 * src/lyx.[Ch]: ditto
2933 * src/lyx_cb.C: ditto + code from here moved to make
2934 screen-font-update. And people wonder why progress on GUII is
2935 slow. Look at how scattered this stuff was! It takes forever
2938 * forms/fdfix.sh: Fixup the spacing after commas.
2939 * forms/makefile: Remove date from generated files. Fewer clashes now.
2940 * forms/bullet_forms.C.patch: included someones handwritten changes
2942 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
2943 once I've discovered why LyXRC was made noncopyable.
2944 * src/lyx_main.C: ditto
2946 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
2948 * src/frontends/xforms/forms/fdfix.sh:
2949 * src/frontends/xforms/forms/fdfixh.sed:
2950 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
2951 * src/frontends/xforms/Form*.[hC]:
2952 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
2953 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
2954 provide a destructor for the struct FD_form_xxxx. Another version of
2955 the set_[max|min]size workaround and a few other cleanups. Actually,
2956 Angus' patch from 20000809.
2958 2000-08-13 Baruch Even <baruch.even@writeme.com>
2960 * src/insets/insetgraphics.C (Clone): Added several fields that needed
2963 2000-08-11 Juergen Vigna <jug@sad.it>
2965 * src/insets/insetgraphics.C (InsetGraphics): changing init
2966 order because of warnings.
2968 * src/frontends/xforms/forms/makefile: adding patching .C with
2971 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
2972 from .C.patch to .c.patch
2974 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
2975 order because of warning.
2977 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
2979 * src/frontends/Liason.C (setMinibuffer): new helper function
2981 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
2983 * src/lyxfunc.C (Dispatch): calling new Document-Layout
2985 * lib/ui/default.ui: commented out PaperLayout entry
2987 * src/frontends/xforms/form_document.[Ch]: new added files
2989 * src/frontends/xforms/FormDocument.[Ch]: ditto
2991 * src/frontends/xforms/forms/form_document.fd: ditto
2993 * src/frontends/xforms/forms/form_document.C.patch: ditto
2995 2000-08-10 Juergen Vigna <jug@sad.it>
2997 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
2998 (InsetGraphics): initialized cacheHandle to 0.
2999 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
3001 2000-08-10 Baruch Even <baruch.even@writeme.com>
3003 * src/graphics/GraphicsCache.h:
3004 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
3005 correctly as a cache.
3007 * src/graphics/GraphicsCacheItem.h:
3008 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
3011 * src/graphics/GraphicsCacheItem_pimpl.h:
3012 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
3015 * src/insets/insetgraphics.h:
3016 * src/insets/insetgraphics.C: Changed from using a signal notification
3017 to polling when image is not loaded.
3019 2000-08-10 Allan Rae <rae@lyx.org>
3021 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
3022 that there are two functions that have to been taken out of line by
3023 hand and aren't taken care of in the script. (Just a reminder note)
3025 * sigc++/macros/*.h.m4: Updated as above.
3027 2000-08-09 Juergen Vigna <jug@sad.it>
3029 * src/insets/insettext.C (draw): small fix for clearing rectangle.
3031 * src/insets/insettabular.C: make drawing of single cell smarter.
3033 2000-08-09 Marko Vendelin <markov@ioc.ee>
3034 * src/frontends/gnome/Menubar_pimpl.C
3035 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
3036 implementation: new files
3038 * src/frontends/gnome/mainapp.C
3039 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
3042 * src/main.C: create Gnome main window
3044 * src/frontends/xforms/Menubar_pimpl.h
3045 * src/frontends/Menubar.C
3046 * src/frontends/Menubar.h: added method Menubar::update that calls
3047 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
3049 * src/LyXView.C: calls Menubar::update to update the state
3052 * src/frontends/gnome/Makefile.am: added new files
3054 * src/frontends/Makefile.am: added frontend compiler options
3056 2000-08-08 Juergen Vigna <jug@sad.it>
3058 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
3060 * src/bufferlist.C (close):
3061 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
3062 documents if exiting without saving.
3064 * src/buffer.C (save): use removeAutosaveFile()
3066 * src/support/filetools.C (removeAutosaveFile): new function.
3068 * src/lyx_cb.C (MenuWrite): returns a bool now.
3069 (MenuWriteAs): check if file could really be saved and revert to the
3071 (MenuWriteAs): removing old autosavefile if existant.
3073 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
3074 before Goto toggle declaration, because of compiler warning.
3076 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
3078 * src/lyxfunc.C (MenuNew): small fix.
3080 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
3082 * src/bufferlist.C (newFile):
3083 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
3085 * src/lyxrc.C: added new_ask_filename tag
3087 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
3089 * src/lyx.fd: removed code pertaining to form_ref
3090 * src/lyx.[Ch]: ditto
3091 * src/lyx_cb.C: ditto
3092 * src/lyx_gui.C: ditto
3093 * src/lyx_gui_misc.C: ditto
3095 * src/BufferView_pimpl.C (restorePosition): update buffer only
3098 * src/commandtags.h (LFUN_REFTOGGLE): removed
3099 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
3100 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
3101 (LFUN_REFBACK): renamed LFUN_REF_BACK
3103 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
3104 * src/menus.C: ditto
3105 * src/lyxfunc.C (Dispatch): ditto.
3106 InsertRef dialog is now GUI-independent.
3108 * src/texrow.C: added using std::endl;
3110 * src/insets/insetref.[Ch]: strip out large amounts of code.
3111 The inset is now a container and this functionality is now
3112 managed by a new FormRef dialog
3114 * src/frontends/Dialogs.h (showRef, createRef): new signals
3116 * src/frontends/xforms/FormIndex.[Ch],
3117 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
3118 when setting dialog's min/max size
3119 * src/frontends/xforms/FormIndex.[Ch]: ditto
3121 * src/frontends/xforms/FormRef.[Ch],
3122 src/frontends/xforms/forms/form_ref.fd: new xforms
3123 implementation of an InsetRef dialog
3125 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
3128 * src/graphics/XPM_Renderer.C (isImageFormatOK):
3129 ios::nocreate is not part of the standard. Removed.
3131 2000-08-07 Baruch Even <baruch.even@writeme.com>
3133 * src/graphics/Renderer.h:
3134 * src/graphics/Renderer.C: Added base class for rendering of different
3135 image formats into Pixmaps.
3137 * src/graphics/XPM_Renderer.h:
3138 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
3139 in a different class.
3141 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
3142 easily add support for other formats.
3144 * src/insets/figinset.C: plugged a leak of an X resource.
3146 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
3148 * src/CutAndPaste.[Ch]: make all metods static.
3150 * development/Code_rules/Rules: more work, added section on
3151 Exceptions, and a References section.
3153 * a lot of header files: work to make doc++ able to generate the
3154 source documentation, some workarounds of doc++ problems. Doc++ is
3155 now able to generate the documentation.
3157 2000-08-07 Juergen Vigna <jug@sad.it>
3159 * src/insets/insettabular.C (recomputeTextInsets): removed function
3161 * src/tabular.C (SetWidthOfMulticolCell):
3163 (calculate_width_of_column_NMC): fixed return value so that it really
3164 only returns true if the column-width has changed (there where
3165 problems with muliticolumn-cells in this column).
3167 2000-08-04 Juergen Vigna <jug@sad.it>
3169 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
3170 also on the scrollstatus of the inset.
3171 (workAreaMotionNotify): ditto.
3173 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
3175 2000-08-01 Juergen Vigna <jug@sad.it>
3177 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
3179 * src/commandtags.h:
3180 * src/LyXAction.C (init):
3181 * src/insets/inset.C (LocalDispatch): added support for
3184 * src/insets/inset.C (scroll): new functions.
3186 * src/insets/insettext.C (removeNewlines): new function.
3187 (SetAutoBreakRows): removes forced newlines in the text of the
3188 paragraph if autoBreakRows is set to false.
3190 * src/tabular.C (Latex): generates a parbox around the cell contents
3193 * src/frontends/xforms/FormTabular.C (local_update): removed
3194 the radio_useparbox button.
3196 * src/tabular.C (UseParbox): new function
3198 2000-08-06 Baruch Even <baruch.even@writeme.com>
3200 * src/graphics/GraphicsCache.h:
3201 * src/graphics/GraphicsCache.C:
3202 * src/graphics/GraphicsCacheItem.h:
3203 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
3206 * src/insets/insetgraphics.h:
3207 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
3208 and the drawing of the inline image.
3210 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
3211 loaded into the wrong position.
3213 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
3216 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3218 * src/support/translator.h: move all typedefs to public section
3220 * src/support/filetools.C (MakeLatexName): return string const
3222 (TmpFileName): ditto
3223 (FileOpenSearch): ditto
3225 (LibFileSearch): ditto
3226 (i18nLibFileSearch): ditto
3229 (CreateTmpDir): ditto
3230 (CreateBufferTmpDir): ditto
3231 (CreateLyXTmpDir): ditto
3234 (MakeAbsPath): ditto
3236 (OnlyFilename): ditto
3238 (NormalizePath): ditto
3239 (CleanupPath): ditto
3240 (GetFileContents): ditto
3241 (ReplaceEnvironmentPath): ditto
3242 (MakeRelPath): ditto
3244 (ChangeExtension): ditto
3245 (MakeDisplayPath): ditto
3246 (do_popen): return cmdret const
3247 (findtexfile): return string const
3249 * src/support/DebugStream.h: add some /// to please doc++
3251 * src/frontends/DialogBase.h (endif): add some /// to please doc++
3253 * src/texrow.C (same_rownumber): functor to use with find_if
3254 (getIdFromRow): rewritten to use find_if and to not update the
3255 positions. return true if row is found
3256 (increasePos): new method, use to update positions
3258 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
3260 * src/lyxlex_pimpl.C (verifyTable): new method
3263 (GetString): return string const
3264 (pushTable): rewrite to use std::stack
3266 (setFile): better check
3269 * src/lyxlex.h: make LyXLex noncopyable
3271 * src/lyxlex.C (text): return char const * const
3272 (GetString): return string const
3273 (getLongString): return string const
3275 * src/lyx_gui_misc.C (askForText): return pair<...> const
3277 * src/lastfiles.[Ch] (operator): return string const
3279 * src/buffer.C (parseSingleLyXformat2Token): pass string to
3280 istringstream not char const *.
3281 move token.end() out of loop.
3282 (readFile): move initializaton of token
3284 * src/BufferView2.C (insertErrors): run texrow.increasePos if
3285 getIdFromRow is successful.
3287 * lib/bind/emacs.bind: don't include menus bind
3289 * development/Code_rules/Rules: the beginnings of making this
3290 better and covering more of the unwritten rules that we have.
3292 * development/Code_rules/Recommendations: a couple of wording
3295 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3297 * src/support/strerror.c: remove C++ comment.
3299 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
3301 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
3302 LFUN_INDEX_INSERT_LAST
3304 * src/texrow.C (getIdFromRow): changed from const_iterator to
3305 iterator, allowing code to compile with DEC cxx
3307 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
3308 stores part of the class, as suggested by Allan. Will allow
3310 (apply): test to apply uses InsetCommandParams operator!=
3312 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
3313 (apply): test to apply uses InsetCommandParams operator!=
3315 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
3316 stores part of the class.
3317 (update): removed limits on min/max size.
3319 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
3320 (apply): test to apply uses InsetCommandParams operator!=
3322 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
3323 (Read, Write, scanCommand, getCommand): moved functionality
3324 into InsetCommandParams.
3326 (getScreenLabel): made pure virtual
3327 new InsetCommandParams operators== and !=
3329 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
3330 c-tors based on InsetCommandParams. Removed others.
3331 * src/insets/insetinclude.[Ch]: ditto
3332 * src/insets/insetlabel.[Ch]: ditto
3333 * src/insets/insetparent.[Ch]: ditto
3334 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
3336 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
3337 insets derived from InsetCommand created using similar c-tors
3338 based on InsetCommandParams
3339 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
3340 * src/menus.C (ShowRefsMenu): ditto
3341 * src/paragraph.C (Clone): ditto
3342 * src/text2.C (SetCounter): ditto
3343 * src/lyxfunc.C (Dispatch) ditto
3344 Also recreated old InsetIndex behaviour exactly. Can now
3345 index-insert at the start of a paragraph and index-insert-last
3346 without launching the pop-up.
3348 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3350 * lib/lyxrc.example: mark te pdf options as non functional.
3352 * src/support/lstrings.C (strToInt): move initalization of tmpstr
3353 (isStrDbl): move tmpstr.end() out of loop.
3354 (strToDbl): move intialization of tmpstr
3355 (lowercase): return string const and move tmp.end() out of loop.
3356 (uppercase): return string const and move tmp.edn() out of loop.
3357 (prefixIs): add assertion
3362 (containsOnly): ditto
3363 (containsOnly): ditto
3364 (containsOnly): ditto
3365 (countChar): make last arg char not char const
3366 (token): return string const
3367 (subst): return string const, move tmp.end() out of loop.
3368 (subst): return string const, add assertion
3369 (strip): return string const
3370 (frontStrip): return string const, add assertion
3371 (frontStrip): return string const
3376 * src/support/lstrings.C: add inclde "LAssert.h"
3377 (isStrInt): move tmpstr.end() out of loop.
3379 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
3380 toollist.end() out of loop.
3381 (deactivate): move toollist.end() out of loop.
3382 (update): move toollist.end() out of loop.
3383 (updateLayoutList): move tc.end() out of loop.
3384 (add): move toollist.end() out of loop.
3386 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
3387 md.end() out of loop.
3389 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
3391 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
3394 * src/paragraph.C (Erase): move fontlist.end() out of loop.
3395 (Erase): move insetlist.end() out of loop.
3397 * src/lyx_sendfax_main.C: make show_logfile static and to take a
3398 ref to const string as first arg. Move initialization of some
3399 variables, whitespace changes.
3401 * src/kbmap.C (defkey): move table.end() out of loop.
3402 (kb_keymap): move table.end() out of loop.
3403 (findbinding): move table.end() out of loop.
3405 * src/MenuBackend.C (hasMenu): move end() out of loop.
3406 (getMenu): move end() out of loop.
3407 (getMenu): move menulist_.end() out of loop.
3409 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
3411 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
3414 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
3415 (getFromLyXName): move infotab.end() out of loop.
3417 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
3418 -fvtable-thunks -ffunction-sections -fdata-sections
3420 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
3422 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
3425 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3427 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
3429 * src/frontends/xforms/FormCitation.[Ch],
3430 src/frontends/xforms/FormIndex.[Ch],
3431 src/frontends/xforms/FormToc.[Ch],
3432 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
3434 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3436 * src/commandtags.h: renamed, created some flags for citation
3439 * src/lyx_gui_misc.C: stripped out old FD_index_form code
3441 * src/lyxfunc.C (dispatch): use signals to insert index entry
3443 * src/frontends/Dialogs.h: new signal createIndex
3445 * src/frontends/xforms/FormCommand.[Ch],
3446 src/frontends/xforms/FormCitation.[Ch],
3447 src/frontends/xforms/FormToc.[Ch],
3448 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
3450 * src/insets/insetindex.[Ch]: GUI-independent
3452 * src/frontends/xforms/FormIndex.[Ch],
3453 * src/frontends/xforms/forms/form_index.fd: xforms implementation
3456 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
3458 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
3459 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
3461 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3463 * src/insets/insetref.C (Latex): rewrite so that there is now
3464 question that a initialization is requested.
3466 * src/insets/insetcommand.h: reenable the hide signal
3468 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3470 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
3471 fix handling of shortcuts (many bugs :)
3472 (add_lastfiles): ditto.
3474 * lib/ui/default.ui: fix a few shortcuts.
3476 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
3478 * Makefile.am: Fix ``rpmdist'' target to return the exit
3479 status of the ``rpm'' command, instead of the last command in
3480 the chain (the ``rm lyx.xpm'' command, which always returns
3483 2000-08-02 Allan Rae <rae@lyx.org>
3485 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
3486 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
3487 * src/frontends/xforms/FormToc.C (FormToc): ditto
3489 * src/frontends/xforms/Makefile.am: A few forgotten files
3491 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
3492 Signals-not-copyable-problem Lars' started commenting out.
3494 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
3496 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3498 * src/insets/insetcommand.h: Signals is not copyable so anoter
3499 scheme for automatic hiding of forms must be used.
3501 * src/frontends/xforms/FormCitation.h: don't inerit from
3502 noncopyable, FormCommand already does that.
3503 * src/frontends/xforms/FormToc.h: ditto
3504 * src/frontends/xforms/FormUrl.h: ditto
3506 * src/frontends/xforms/FormCitation.C: add include <algorithm>
3508 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
3510 * src/insets/insetcommand.h (hide): new SigC::Signal0
3511 (d-tor) new virtual destructor emits hide signal
3513 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
3514 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
3516 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
3517 LOF and LOT. Inset is now GUI-independent
3519 * src/insets/insetloa.[Ch]: redundant
3520 * src/insets/insetlof.[Ch]: ditto
3521 * src/insets/insetlot.[Ch]: ditto
3523 * src/frontends/xforms/forms/form_url.fd: tweaked!
3524 * src/frontends/xforms/forms/form_citation.fd: ditto
3526 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
3527 dialogs dealing with InsetCommand insets
3529 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
3530 FormCommand base class
3531 * src/frontends/xforms/FormUrl.[Ch]: ditto
3533 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
3535 * src/frontends/xforms/FormToc.[Ch]: ditto
3537 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
3538 passed a generic InsetCommand pointer
3539 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
3541 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
3542 and modified InsetTOC class
3543 * src/buffer.C: ditto
3545 * forms/lyx.fd: strip out old FD_form_toc code
3546 * src/lyx_gui_misc.C: ditto
3547 * src/lyx_gui.C: ditto
3548 * src/lyx_cb.C: ditto
3549 * src/lyx.[Ch]: ditto
3551 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3553 * src/support/utility.hpp: tr -d '\r'
3555 2000-08-01 Juergen Vigna <jug@sad.it>
3557 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
3559 * src/commandtags.h:
3560 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
3561 LFUN_TABULAR_FEATURES.
3563 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
3564 LFUN_LAYOUT_TABULAR.
3566 * src/insets/insettabular.C (getStatus): implemented helper function.
3568 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
3570 2000-07-31 Juergen Vigna <jug@sad.it>
3572 * src/text.C (draw): fixed screen update problem for text-insets.
3574 * src/text2.C (SetParagrpah): call an update of the inset-owner when
3575 something changed probably this has to be added in various other
3578 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
3580 2000-07-31 Baruch Even <baruch.even@writeme.com>
3582 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
3583 templates to satisfy compaq cxx.
3586 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3588 * src/support/translator.h (equal_1st_in_pair::operator()): take
3589 const ref pair_type as arg.
3590 (equal_2nd_in_pair::operator()): ditto
3591 (Translator::~Translator): remove empty d-tor.
3593 * src/graphics/GraphicsCache.C: move include config.h to top, also
3594 put initialization of GraphicsCache::singleton here.
3595 (~GraphicsCache): move here
3596 (addFile): take const ref as arg
3599 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
3601 * src/BufferView2.C (insertLyXFile): change te with/without header
3604 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3606 * src/frontends/xforms/FormGraphics.C (apply): add some
3607 static_cast. Not very nice, but required by compaq cxx.
3609 * src/frontends/xforms/RadioButtonGroup.h: include header
3610 <utility> instead of <pair.h>
3612 * src/insets/insetgraphicsParams.C: add using directive.
3613 (readResize): change return type to void.
3614 (readOrigin): ditto.
3616 * src/lyxfunc.C (getStatus): add missing break for build-program
3617 function; add test for Literate for export functions.
3619 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
3620 entries in Options menu.
3622 2000-07-31 Baruch Even <baruch.even@writeme.com>
3624 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
3625 protect against auto-allocation; release icon when needed.
3627 2000-07-31 Matej Cepl <CeplM@seznam.cz>
3629 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
3630 on usual typewriter.
3632 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
3633 earlier czech.kmap), useful only for programming.
3635 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3637 * src/frontends/xforms/FormCitation.h: fix conditioning around
3640 2000-07-31 Juergen Vigna <jug@sad.it>
3642 * src/frontends/xforms/FormTabular.C (local_update): changed
3643 radio_linebreaks to radio_useparbox and added radio_useminipage.
3645 * src/tabular.C: made support for using minipages/parboxes.
3647 * src/bufferlist.C (QwriteAll): small fix for asking for save.
3649 * src/insets/insetgraphics.C (draw): just draw the inset so that the
3651 (descent): so the cursor is in the middle.
3652 (width): bit smaller box.
3654 * src/insets/insetgraphics.h: added display() function.
3656 2000-07-31 Baruch Even <baruch.even@writeme.com>
3658 * src/frontends/Dialogs.h: Added showGraphics signals.
3660 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
3661 xforms form definition of the graphics dialog.
3663 * src/frontends/xforms/FormGraphics.h:
3664 * src/frontends/xforms/FormGraphics.C: Added files, the
3665 GUIndependent code of InsetGraphics
3667 * src/insets/insetgraphics.h:
3668 * src/insets/insetgraphics.C: Major writing to make it work.
3670 * src/insets/insetgraphicsParams.h:
3671 * src/insets/insetgraphicsParams.C: Added files, parameter passing
3672 struct between InsetGraphics and GUI.
3674 * src/LaTeXFeatures.h:
3675 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
3676 support for graphicx package.
3678 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
3679 for the graphics inset.
3681 * src/support/translator.h: Added file, used in
3682 InsetGraphicsParams. this is a template to translate between two
3685 * src/frontends/xforms/RadioButtonGroup.h:
3686 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
3687 way to easily control a radio button group.
3689 2000-07-28 Juergen Vigna <jug@sad.it>
3691 * src/insets/insettabular.C (LocalDispatch):
3692 (TabularFeatures): added support for lyx-functions of tabular features.
3693 (cellstart): refixed this function after someone wrongly changed it.
3695 * src/commandtags.h:
3696 * src/LyXAction.C (init): added support for tabular-features
3698 2000-07-28 Allan Rae <rae@lyx.org>
3700 * src/frontends/xforms/FormPreferences.C (build): Setup input return
3701 checking. NOTE: It seems that pressing ESC to cancel the dialog also
3702 triggers the callback for input checking. As a result we sometimes get
3703 "LyX: This shouldn't happen..." printed to cerr.
3704 (input): Started using status variable since I only free() on
3705 destruction. Some input checking for paths and font sizes.
3707 * src/frontends/xforms/FormPreferences.h: Use status to control
3708 activation of Ok and Apply
3710 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
3711 callback. Also resized to stop segfaults with 0.88. The problem is
3712 that xforms-0.88 requires the folder to be wide enough to fit all the
3713 tabs. If it isn't it causes all sorts of problems.
3715 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
3717 * src/frontends/xforms/forms/README: Reflect reality.
3719 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
3720 * src/frontends/xforms/forms/makefile: ditto.
3722 * src/commandtags.h: Get access to new Preferences dialog
3723 * src/LyXAction.C: ditto
3724 * src/lyxfunc.C: ditto
3725 * lib/ui/default.ui: ditto
3727 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3729 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
3731 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
3734 * src/frontends/xforms/form_url.[Ch]: added.
3736 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3738 * src/insets/insetbib.h: fixed bug in previous commit
3740 * src/frontends/xforms/FormUrl.h: ditto
3742 * src/frontends/xforms/FormPrint.h: ditto
3744 * src/frontends/xforms/FormPreferences.h: ditto
3746 * src/frontends/xforms/FormCopyright.h: ditto
3748 * src/frontends/xforms/FormCitation.C: ditto
3750 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
3751 private copyconstructor and private default contructor
3753 * src/support/Makefile.am: add utility.hpp
3755 * src/support/utility.hpp: new file from boost
3757 * src/insets/insetbib.h: set owner in clone
3759 * src/frontends/xforms/FormCitation.C: added missing include
3762 * src/insets/form_url.[Ch]: removed
3764 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
3766 * development/lyx.spec.in
3767 * Makefile.am: Fix buglet for LyX RPM generation resulting from
3768 file/directory re-organization.
3770 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
3772 * src/insets/insetcommand.[Ch]: moved the string data and
3773 associated manipulation methods into a new stand-alone class
3774 InsetCommandParams. This class has two additional methods
3775 getAsString() and setFromString() allowing the contents to be
3776 moved around as a single string.
3777 (addContents) method removed.
3778 (setContents) method no longer virtual.
3780 * src/buffer.C (readInset): made use of new InsetCitation,
3781 InsetUrl constructors based on InsetCommandParams.
3783 * src/commandtags.h: add LFUN_INSERT_URL
3785 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
3786 independent InsetUrl and use InsetCommandParams to extract
3787 string info and create new Insets.
3789 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
3791 * src/frontends/xforms/FormCitation.C (apply): uses
3794 * src/frontends/xforms/form_url.C
3795 * src/frontends/xforms/form_url.h
3796 * src/frontends/xforms/FormUrl.h
3797 * src/frontends/xforms/FormUrl.C
3798 * src/frontends/xforms/forms/form_url.fd: new files
3800 * src/insets/insetcite.[Ch]: removed unused constructors.
3802 * src/insets/insetinclude.[Ch]: no longer store filename
3804 * src/insets/inseturl.[Ch]: GUI-independent.
3806 2000-07-26 Juergen Vigna <jug@sad.it>
3807 * renamed frontend from gtk to gnome as it is that what is realized
3808 and did the necessary changes in the files.
3810 2000-07-26 Marko Vendelin <markov@ioc.ee>
3812 * configure.in: cleaning up gnome configuration scripts
3814 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3816 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
3817 shortcuts syndrom by redrawing them explicitely (a better solution
3818 would be appreciated).
3820 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
3822 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
3825 * src/lyx_cb.C (MenuExport): change html export to do the right
3826 thing depending of the document type (instead of having
3827 html-linuxdoc and html-docbook).
3828 * src/lyxfunc.C (getStatus): update for html
3829 * lib/ui/default.ui: simplify due to the above change.
3830 * src/menus.C (ShowFileMenu): update too (in case we need it).
3832 * src/MenuBackend.C (read): if a menu is defined twice, add the
3833 new entries to the exiting one.
3835 2000-07-26 Juergen Vigna <jug@sad.it>
3837 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
3839 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
3840 and return a bool if it did actual save the file.
3841 (AutoSave): don't autosave a unnamed doc.
3843 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
3844 check if this is an UNNAMED new file and react to it.
3845 (newFile): set buffer to unnamed and change to not mark a new
3846 buffer dirty if I didn't do anything with it.
3848 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
3850 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3852 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
3853 friend as per Angus's patch posted to lyx-devel.
3855 * src/ext_l10n.h: updated
3857 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
3858 gettext on the style string right before inserting them into the
3861 * autogen.sh: add code to extract style strings form layout files,
3862 not good enough yet.
3864 * src/frontends/gtk/.cvsignore: add MAKEFILE
3866 * src/MenuBackend.C (read): run the label strings through gettext
3867 before storing them in the containers.
3869 * src/ext_l10n.h: new file
3871 * autogen.sh : generate the ext_l10n.h file here
3873 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3875 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
3878 * lib/ui/default.ui: fix a couple of typos.
3880 * config/gnome/gtk.m4: added (and added to the list of files in
3883 * src/insets/insetinclude.C (unique_id): fix when we are using
3884 lyxstring instead of basic_string<>.
3885 * src/insets/insettext.C (LocalDispatch): ditto.
3886 * src/support/filetools.C: ditto.
3888 * lib/configure.m4: create the ui/ directory if necessary.
3890 * src/LyXView.[Ch] (updateToolbar): new method.
3892 * src/BufferView_pimpl.C (buffer): update the toolbar when
3893 opening/closing buffer.
3895 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3897 * src/LyXAction.C (getActionName): enhance to return also the name
3898 and options of pseudo-actions.
3899 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
3901 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
3902 as an example of what is possible). Used in File->Build too (more
3903 useful) and in the import/export menus (to mimick the complicated
3904 handling of linuxdoc and friends). Try to update all the entries.
3906 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
3909 * src/MenuBackend.C (read): Parse the new OptItem tag.
3911 * src/MenuBackend.h: Add a new optional_ data member (used if the
3912 entry should be omitted when the lyxfunc is disabled).
3914 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
3915 function, used as a shortcut.
3916 (create_submenu): align correctly the shortcuts on the widest
3919 * src/MenuBackend.h: MenuItem.label() only returns the label of
3920 the menu without shortcut; new method shortcut().
3922 2000-07-14 Marko Vendelin <markov@ioc.ee>
3924 * src/frontends/gtk/Dialogs.C:
3925 * src/frontends/gtk/FormCopyright.C:
3926 * src/frontends/gtk/FormCopyright.h:
3927 * src/frontends/gtk/Makefile.am: added these source-files for the
3928 Gtk/Gnome support of the Copyright-Dialog.
3930 * src/main.C: added Gnome::Main initialization if using
3931 Gtk/Gnome frontend-GUI.
3933 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
3935 * config/gnome/aclocal-include.m4
3936 * config/gnome/compiler-flags.m4
3937 * config/gnome/curses.m4
3938 * config/gnome/gnome--.m4
3939 * config/gnome/gnome-bonobo-check.m4
3940 * config/gnome/gnome-common.m4
3941 * config/gnome/gnome-fileutils.m4
3942 * config/gnome/gnome-ghttp-check.m4
3943 * config/gnome/gnome-gnorba-check.m4
3944 * config/gnome/gnome-guile-checks.m4
3945 * config/gnome/gnome-libgtop-check.m4
3946 * config/gnome/gnome-objc-checks.m4
3947 * config/gnome/gnome-orbit-check.m4
3948 * config/gnome/gnome-print-check.m4
3949 * config/gnome/gnome-pthread-check.m4
3950 * config/gnome/gnome-support.m4
3951 * config/gnome/gnome-undelfs.m4
3952 * config/gnome/gnome-vfs.m4
3953 * config/gnome/gnome-x-checks.m4
3954 * config/gnome/gnome-xml-check.m4
3955 * config/gnome/gnome.m4
3956 * config/gnome/gperf-check.m4
3957 * config/gnome/gtk--.m4
3958 * config/gnome/linger.m4
3959 * config/gnome/need-declaration.m4: added configuration scripts
3960 for Gtk/Gnome frontend-GUI
3962 * configure.in: added support for the --with-frontend=gtk option
3964 * autogen.sh: added config/gnome/* to list of config-files
3966 * acconfig.h: added define for GTKGUI-support
3968 * config/lyxinclude.m4: added --with-frontend[=value] option value
3969 for Gtk/Gnome frontend-GUI support.
3971 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3973 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
3977 * src/paragraph.C (GetChar): remove non-const version
3979 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
3980 (search_kw): use it.
3982 * src/lyx_main.C (init): if "preferences" exist, read that instead
3984 (ReadRcFile): return bool if the file could be read ok.
3985 (ReadUIFile): add a check to see if lex file is set ok.
3987 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
3988 bastring can be used instead of lyxstring (still uses the old code
3989 if std::string is good enough or if lyxstring is used.)
3991 * src/encoding.C: make the arrays static, move ininle functions
3993 * src/encoding.h: from here.
3995 * src/buffer.C: have last_isnet_read as a file scope variable for now.
3996 (parseSingleLyXformat2Token): move inset parsing to separate method
3997 (readInset): new private method
3999 * src/Variables.h: remove virtual from get().
4001 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
4002 access to NEW_INSETS and NEW_TABULAR
4004 * src/MenuBackend.h: remove superfluous forward declaration of
4005 MenuItem. Add documentations tags "///", remove empty MenuItem
4006 destructor, remove private default contructor.
4008 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
4010 (read): more string mlabel and mname to where they are used
4011 (read): remove unused variables mlabel and mname
4012 (defaults): unconditional clear, make menusetup take advantage of
4013 add returning Menu &.
4015 * src/LyXView.h: define NEW_MENUBAR as default
4017 * src/LyXAction.C: include lyxparagraph.h temporary to get access
4018 to NEW_INSETS and NEW_TABULAR.
4019 (init): commetn out some funcs that is obsolete when NEW_INSETS is
4020 defined. Change some of the "xxxx-inset-insert" functions names to
4023 * several files: more enahncements to NEW_INSETS and the resulting
4026 * lib/lyxrc.example (\date_insert_format): move to misc section
4028 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
4029 bastring and use AC_CACHE_CHECK.
4030 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
4031 the system have the newest methods. uses AC_CACHE_CHECK
4032 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
4033 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
4034 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
4036 * configure.in: add LYX_CXX_GOOD_STD_STRING
4038 * acinclude.m4: recreated
4040 2000-07-24 Amir Karger <karger@lyx.org>
4042 * README: add Hebrew, Arabic kmaps
4045 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4047 * src/buffer.C (writeFileAscii): Define actcell as an int instead
4050 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4052 * Lot of files: add pragma interface/implementation.
4054 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
4056 * lib/ui/default.ui: new file (ans new directory). Contains the
4057 default menu and toolbar.
4059 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
4060 global space. Toolbars are now read (as menus) in ui files.
4062 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
4064 * src/lyxfunc.C (getStatus): do not exit immediately if a command
4065 is disabled because the document is read-only. We want to have the
4066 toggle state of the function anyway.
4067 (getStatus): add code for LFUN_VC* functions (mimicking what is
4068 done in old-style menus)
4070 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
4071 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
4073 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
4074 * src/BufferView_pimpl.C: ditto.
4075 * src/lyxfunc.C: ditto.
4077 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
4078 default). This replaces old-style menus by new ones.
4080 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
4081 MenuItem. Contain the data structure of a menu.
4083 * src/insets/insettext.C: use LyXView::setLayout instead of
4084 accessing directly the toolbar combox.
4085 * src/lyxfunc.C (Dispatch): ditto.
4087 * src/LyXView.C (setLayout): new method, which just calls
4088 Toolbar::setLayout().
4089 (updateLayoutChoice): move part of this method in Toolbar.
4091 * src/toolbar.[Ch]: removed.
4093 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
4094 implementation the toolbar.
4096 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
4097 the toolbar. It might make sense to merge it with ToolbarDefaults
4099 (setLayout): new function.
4100 (updateLayoutList): ditto.
4101 (openLayoutList): ditto.
4103 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
4104 xforms implementation of the toolbar.
4105 (get_toolbar_func): comment out, since I do not
4106 know what it is good for.
4108 * src/ToolbarDefaults.h: Add the ItemType enum.
4110 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
4111 for a list of allocated C strings. Used in Menubar xforms
4112 implementation to avoid memory leaks.
4114 * src/support/lstrings.[Ch] (uppercase): new version taking and
4118 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
4119 * lib/bind/emacs.bind: ditto.
4121 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4123 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
4124 forward decl of LyXView.
4126 * src/toolbar.C (toolbarItem): moved from toolbar.h
4127 (toolbarItem::clean): ditto
4128 (toolbarItem::~toolbarItem): ditto
4129 (toolbarItem::operator): ditto
4131 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
4133 * src/paragraph.h: control the NEW_TABULAR define from here
4135 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
4136 USE_TABULAR_INSETS to NEW_TABULAR
4138 * src/ToolbarDefaults.C: add include "lyxlex.h"
4140 * files using the old table/tabular: use NEW_TABULAR to control
4141 compilation of old tabular stuff.
4143 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
4146 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
4147 planemet in reading of old style floats, fix the \end_deeper
4148 problem when reading old style floats.
4150 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4152 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
4154 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
4156 * lib/bind/sciword.bind: updated.
4158 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4160 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
4161 layout write problem
4163 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4165 * src/Makefile.am (INCLUDES): remove image directory from include
4168 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
4169 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
4171 * src/LyXView.C (create_form_form_main): read the application icon
4174 * lib/images/*.xpm: change the icons to use transparent color for
4177 * src/toolbar.C (update): change the color of the button when it
4180 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4182 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
4183 setting explicitely the minibuffer.
4184 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
4186 * src/LyXView.C (showState): new function. Shows font information
4187 in minibuffer and update toolbar state.
4188 (LyXView): call Toolbar::update after creating the
4191 * src/toolbar.C: change toollist to be a vector instead of a
4193 (BubbleTimerCB): get help string directly from the callback
4194 argument of the corresponding icon (which is the action)
4195 (set): remove unnecessary ugliness.
4196 (update): new function. update the icons (depressed, disabled)
4197 depending of the status of the corresponding action.
4199 * src/toolbar.h: remove help in toolbarItem
4201 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
4203 * src/Painter.C (text): Added code for using symbol glyphs from
4204 iso10646 fonts. Currently diabled.
4206 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
4209 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
4210 magyar,turkish and usorbian.
4212 * src/paragraph.C (isMultiLingual): Made more efficient.
4214 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
4217 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
4218 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
4219 Also changed the prototype to "bool math_insert_greek(char)".
4221 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4223 * lots of files: apply the NEW_INSETS on all code that will not be
4224 needed when we move to use the new insets. Enable the define in
4225 lyxparagrah.h to try it.
4227 * src/insets/insettabular.C (cellstart): change to be a static
4229 (InsetTabular): initialize buffer in the initializer list.
4231 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
4233 * src/frontends/xforms/FormPrint.[Ch] : moved #include
4234 form_print.h out of the header file. Replaced with forward
4235 declarations of the relevant struct.
4237 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
4240 * src/commandtags.h: do not include "debug.h" which does not
4241 belong there. #include it in some other places because of this
4244 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4246 * src/insets/insetcaption.C: add a couple "using" directives.
4248 * src/toolbar.C (add): get the help text directly from lyxaction.
4250 (setPixmap): new function. Loads from disk and sets a pixmap on a
4251 botton; the name of the pixmap file is derived from the command
4254 * src/toolbar.h: remove members isBitmap and pixmap from
4257 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
4258 * lib/images/: move many files from images/banner.xpm.
4260 * src/lyx_gui.C (create_forms): read banner pixmap from file.
4262 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
4263 * src/toolbar.C: ditto.
4264 * configure.in: ditto.
4265 * INSTALL: document.
4267 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
4268 the spellchecker popup is closed from the WM.
4270 2000-07-19 Juergen Vigna <jug@sad.it>
4272 * src/insets/insetfloat.C (Write): small fix because we use the
4273 insetname for the type now!
4275 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
4277 * src/frontends/xforms/forms/form_citation.fd: object sizes are
4280 * src/frontends/Dialogs.h: removed hideCitation signal
4282 * src/insets/insetcite.h: added hide signal
4284 * src/insets/insetcite.C (~InsetCitation): emits new signal
4285 (getScreenLabel): "intelligent" label should now fit on the screen!
4287 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
4289 * src/frontends/xforms/FormCitation.C (showInset): connects
4290 hide() to the inset's hide signal
4291 (show): modified to use fl_set_object_position rather than
4292 fl_set_object_geometry wherever possible
4294 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4296 * src/insets/lyxinset.h: add caption code
4298 * src/insets/insetfloat.C (type): new method
4300 * src/insets/insetcaption.C (Write): new method
4302 (LyxCode): new method
4304 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
4305 to get it right together with using the FloatList.
4307 * src/commandtags.h: add LFUN_INSET_CAPTION
4308 * src/lyxfunc.C (Dispatch): handle it
4310 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
4313 * src/Variables.[Ch]: make expand take a const reference, remove
4314 the destructor, some whitespace changes.
4316 * src/LyXAction.C (init): add caption-inset-insert
4318 * src/FloatList.C (FloatList): update the default floats a bit.
4320 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4322 * src/Variables.[Ch]: new files. Intended to be used for language
4323 specific strings (like \chaptername) and filename substitution in
4326 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
4328 * lib/kbd/american.kmap: update
4330 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
4332 * src/bufferparams.[Ch]: remove member allowAccents.
4334 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
4336 * src/LaTeXLog.C: use the log_form.h header.
4337 * src/lyx_gui.C: ditto.
4338 * src/lyx_gui_misc.C: ditto.
4339 * src/lyxvc.h: ditto.
4341 * forms/log_form.fd: new file, created from latexoptions.fd. I
4342 kept the log popup and nuked the options form.
4344 * src/{la,}texoptions.[Ch]: removed.
4345 * src/lyx_cb.C (LaTeXOptions): ditto
4347 * src/lyx_gui.C (create_forms): do not handle the
4348 fd_latex_options form.
4350 2000-07-18 Juergen Vigna <jug@sad.it>
4352 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
4353 name of the inset so that it can be requested outside (text2.C).
4355 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
4358 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4360 * src/mathed/formula.h (ConvertFont): constify
4362 * src/mathed/formula.C (Read): add warning if \end_inset is not
4363 found on expected place.
4365 * src/insets/lyxinset.h (ConvertFont): consify
4367 * src/insets/insetquotes.C (ConvertFont): constify
4368 * src/insets/insetquotes.h: ditto
4370 * src/insets/insetinfo.h: add labelfont
4372 * src/insets/insetinfo.C (InsetInfo): set the labelfont
4373 (ascent): use labelfont
4377 (Write): make .lyx file a bit nicer
4379 * src/insets/insetfloat.C (Write): simplify somewhat...
4380 (Read): add warning if arg is not found
4382 * src/insets/insetcollapsable.C: add using std::max
4383 (Read): move string token and add warning in arg is not found
4384 (draw): use std::max to get the right ty
4385 (getMaxWidth): simplify by using std::max
4387 * src/insets/insetsection.h: new file
4388 * src/insets/insetsection.C: new file
4389 * src/insets/insetcaption.h: new file
4390 * src/insets/insetcaption.C: new file
4392 * src/insets/inset.C (ConvertFont): constify signature
4394 * src/insets/Makefile.am (libinsets_la_SOURCES): add
4395 insetcaption.[Ch] and insetsection.[Ch]
4397 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
4398 uses to use LABEL_COUNTER_CHAPTER instead.
4399 * src/text2.C (SetCounter): here
4401 * src/counters.h: new file
4402 * src/counters.C: new file
4403 * src/Sectioning.h: new file
4404 * src/Sectioning.C: new file
4406 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
4408 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4410 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
4413 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
4416 2000-07-17 Juergen Vigna <jug@sad.it>
4418 * src/tabular.C (Validate): check if array-package is needed.
4419 (SetVAlignment): added support for vertical alignment.
4420 (SetLTFoot): better support for longtable header/footers
4421 (Latex): modified to support added features.
4423 * src/LaTeXFeatures.[Ch]: added array-package.
4425 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
4427 * src/lyx_gui.C (LyXGUI): make sure that the height is large
4430 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
4432 * configure.in: do not forget to put a space after -isystem.
4434 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
4436 * lib/kbd/arabic.kmap: a few fixes.
4438 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4440 * some whitespace chagnes to a number of files.
4442 * src/support/DebugStream.h: change to make it easier for
4443 doc++ to parse correctly.
4444 * src/support/lyxstring.h: ditto
4446 * src/mathed/math_utils.C (compara): change to have only one
4448 (MathedLookupBOP): change because of the above.
4450 * src/mathed/math_delim.C (math_deco_compare): change to have only
4452 (search_deco): change becasue of the above.
4454 * src/insets/insettabular.C (DrawCellSelection): use std::swap
4455 instead of manually coded one.
4457 * src/insets/insetquotes.C (Read): read the \end_inset too
4459 * src/insets/insetlatex.h: remove file
4460 * src/insets/insetlatex.C: remove file
4462 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
4464 (InsetPrintIndex): remove destructor
4466 * src/insets/insetinclude.h: remove default constructor
4468 * src/insets/insetfloat.C: work to make it work better
4470 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
4472 * src/insets/insetcite.h (InsetCitation): remove default constructor
4474 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
4476 * src/text.C (GetColumnNearX): comment out some currently unused code.
4478 * src/paragraph.C (writeFile): move some initializations closer to
4480 (CutIntoMinibuffer): small change to use new matchIT operator
4484 (InsertInset): ditto
4487 (InsetIterator): ditto
4488 (Erase): small change to use new matchFT operator
4490 (GetFontSettings): ditto
4491 (HighestFontInRange): ditto
4494 * src/lyxparagraph.h: some chars changed to value_type
4495 (matchIT): because of some stronger checking (perhaps too strong)
4496 in SGI STL, the two operator() unified to one.
4499 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
4501 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
4502 the last inset read added
4503 (parseSingleLyXformat2Token): some more (future) compability code added
4504 (parseSingleLyXformat2Token): warning about solitary \end_inset added
4505 (parseSingleLyXformat2Token): set last_inset_read
4506 (parseSingleLyXformat2Token): more code to read new "Float" correctly
4507 (parseSingleLyXformat2Token): don't double intializw string next_token
4509 * src/TextCache.C (text_fits::operator()): add const's to the signature
4510 (has_buffer::operator()): ditto
4512 * src/Floating.h: add some comments on the class
4514 * src/FloatList.[Ch] (typeExist): new method
4517 * src/BackStack.h: added default constructor, wanted by Gcc.
4519 2000-07-14 Juergen Vigna <jug@sad.it>
4521 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
4523 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
4525 * src/insets/insettabular.C (resizeLyXText): need this to be able to
4526 do a redraw when the window is resized!
4527 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
4529 * src/insets/insettext.C (resizeLyXText): added function to correctly
4530 being able to resize the LyXWindow.
4532 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
4534 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
4536 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
4537 crashes when closing dialog to a deleted inset.
4539 * src/insets/insetcite.[Ch] (Edit) : the return of this former
4540 method! Now similar to other insets.
4542 2000-07-13 Juergen Vigna <jug@sad.it>
4544 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
4546 * lib/examples/Literate.lyx: small patch!
4548 * src/insets/insetbib.C (Read): added this function because of wrong
4549 Write (without [begin|end]_inset).
4551 2000-07-11 Juergen Vigna <jug@sad.it>
4553 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
4554 as the insertInset could not be good!
4556 * src/screen.C (ToggleSelection): fixed toggle selection bug as
4557 the bool param should not be last.
4559 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4561 * sigc++/configure.in: fix bug in threading-related code (Yes, I
4562 did submit that to Karl).
4564 * configure.in: use -isystem instead of -I for X headers. This
4565 fixes a problem on solaris with a recent gcc;
4566 put the front-end code after the X detection code;
4567 configure in sigc++ before lib/
4569 * src/lyx_main.C (commandLineHelp): remove -display from command
4572 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
4574 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
4575 Also put in Makefile rules for building the ``listerrors''
4576 program for parsing errors from literate programs written in LyX.
4578 * lib/build-listerrors: Added small shell script as part of compile
4579 process. This builds a working ``listerrors'' binary if noweb is
4580 installed and either 1) the VNC X server is installed on the machine,
4581 or 2) the user is compiling from within a GUI. The existence of a GUI
4582 is necessary to use the ``lyx --export'' feature for now. This
4583 hack can be removed once ``lyx --export'' no longer requires a GUI to
4586 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
4588 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
4589 now passed back correctly from gcc and placed "under" error
4590 buttons in a Literate LyX source.
4592 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4594 * src/text.C (GetColumnNearX): Better behavior when a RTL
4595 paragraph is ended by LTR text.
4597 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
4600 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4602 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
4603 true when clipboard is empty.
4605 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4607 * text.C (Backspace): Prevent rebreaking of a row if it is the last
4608 row of the paragraph.
4609 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
4610 to prevent calculation of bidi tables
4612 2000-07-07 Juergen Vigna <jug@sad.it>
4614 * src/screen.C (ToggleSelection): added y_offset and x_offset
4617 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
4620 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
4622 * src/insets/insettext.C: fixed Layout-Display!
4624 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4626 * configure.in: add check for strings.h header.
4628 * src/spellchecker.C: include <strings.h> in order to have a
4629 definition for bzero().
4631 2000-07-07 Juergen Vigna <jug@sad.it>
4633 * src/insets/insettext.C (draw): set the status of the bv->text to
4634 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
4636 * src/screen.C (DrawOneRow):
4637 (DrawFromTo): redraw the actual row if something has changed in it
4640 * src/text.C (draw): call an update of the toplevel-inset if something
4641 has changed inside while drawing.
4643 * src/lyxtext.h: added CHANGED_IN_DRAW status.
4645 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
4647 * src/insets/insetbib.[Ch] (callback) new method, moving callback
4648 processing inside class.
4650 * src/insets/insetindex.[Ch] (callback) new method, moving callback
4651 processing inside class.
4653 * src/insets/insetindex.h new struct Holder, consistent with other
4656 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
4657 citation dialog from main code and placed it in src/frontends/xforms.
4658 Dialog launched through signals instead of callbacks
4660 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
4662 * lyx.man: update the options description.
4664 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
4666 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
4667 handle neg values, set min width to 590, add doc about -display
4669 2000-07-05 Juergen Vigna <jug@sad.it>
4671 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
4672 calls to BufferView *.
4674 * src/insets/insettext.C (checkAndActivateInset): small fix non
4675 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
4677 * src/insets/insetcommand.C (Read): Fixed as insets should read till
4678 their \end_inset token!
4680 2000-07-04 edscott <edscott@imp.mx>
4682 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
4683 lib/lyxrc.example: added option \wheel_jump
4685 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
4687 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
4688 remove support for -width,-height,-xpos and -ypos.
4690 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
4692 * src/encoding.[Ch]: New files.
4694 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
4695 (text): Call to the underline() method only when needed.
4697 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
4699 * src/buffer.C (makeLaTeXFile): Compute automatically the input
4700 encoding(s) for the document.
4702 * src/bufferparams.C (BufferParams): Changed default value of
4705 * src/language.C (newLang): Removed.
4706 (items[]): Added encoding information for all defined languages.
4708 * src/lyx_gui.C (create_forms): Added "auto" option to the input
4709 encoding choice button.
4711 * src/lyxrc.h (font_norm_type): New member variable.
4712 (set_font_norm_type): New method.
4714 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
4715 paragraphs with different encodings.
4717 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
4718 (TransformChar): Changed to work correctly with Arabic points.
4719 (draw): Added support for drawing Arabic points.
4720 (draw): Removed code for drawing underbars (this is done by
4723 * src/support/textutils.h (IsPrintableNonspace): New function.
4725 * src/BufferView_pimpl.h: Added "using SigC::Object".
4726 * src/LyXView.h: ditto.
4728 * src/insets/insetinclude.h (include_label): Changed to mutable.
4730 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4732 * src/mathed/math_iter.h: remove empty destructor
4734 * src/mathed/math_cursor.h: remove empty destructor
4736 * src/insets/lyxinset.h: add THEOREM_CODE
4738 * src/insets/insettheorem.[Ch]: new files
4740 * src/insets/insetminipage.C: (InsertInset): remove
4742 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
4744 (InsertInset): remove
4746 * src/insets/insetlist.C: (InsertList): remove
4748 * src/insets/insetfootlike.[Ch]: new files
4750 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
4753 (InsertInset): ditto
4755 * src/insets/insetert.C: remove include Painter.h, reindent
4756 (InsertInset): move to header
4758 * src/insets/insetcollapsable.h: remove explicit from default
4759 contructor, remove empty destructor, add InsertInset
4761 * src/insets/insetcollapsable.C (InsertInset): new func
4763 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
4765 * src/vspace.h: add explicit to constructor
4767 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
4768 \textcompwordmark, please test this.
4770 * src/lyxrc.C: set ascii_linelen to 65 by default
4772 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
4774 * src/commandtags.h: add LFUN_INSET_THEOREM
4776 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
4777 (makeLinuxDocFile): remove _some_ of the nice logic
4778 (makeDocBookFile): ditto
4780 * src/Painter.[Ch]: (~Painter): removed
4782 * src/LyXAction.C (init): entry for insettheorem added
4784 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
4786 (deplog): code to detect files generated by LaTeX, needs testing
4789 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4791 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
4793 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4795 * src/LaTeX.C (deplog): Add a check for files that are going to be
4796 created by the first latex run, part of the project to remove the
4799 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
4800 contents to the extension list.
4802 2000-07-04 Juergen Vigna <jug@sad.it>
4804 * src/text.C (NextBreakPoint): added support for needFullRow()
4806 * src/insets/lyxinset.h: added needFullRow()
4808 * src/insets/insetcollapsable.C: redone now this uses a text-inset
4811 * src/insets/insettext.C: lots of changes for update!
4813 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
4815 * src/LaTeXFeatures.h: add a missing std:: qualifier.
4817 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
4819 * src/insets/insetinclude.C (InsetInclude): fixed
4820 initialization of include_label.
4821 (unique_id): now returns a string.
4823 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
4825 * src/LaTeXFeatures.h: new member IncludedFiles, for
4826 a map of key, included file name.
4828 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
4829 with the included files for inclusion in SGML preamble,
4830 i. e., linuxdoc and docbook.
4833 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
4834 nice (is the generated linuxdoc code to be exported?), that
4835 allows to remove column, and only_body that will be true for
4836 slave documents. Insets are allowed inside SGML font type.
4837 New handling of the SGML preamble for included files.
4838 (makeDocBookFile): the same for docbook.
4840 * src/insets/insetinclude.h:
4841 * src/insets/insetinclude.C (Validate): keeps a list of included files.
4843 (DocBook): new export methods.
4845 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
4846 and makeDocBookFile.
4848 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
4849 formats to export with command line argument -x.
4851 2000-06-29 Juergen Vigna <jug@sad.it>
4853 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
4854 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
4856 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
4857 region could already been cleared by an inset!
4859 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4861 * src/BufferView_pimpl.h: remove member variables lyx_focus and
4864 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
4866 (cursorToggle): remove special handling of lyx focus.
4868 2000-06-28 Juergen Vigna <jug@sad.it>
4870 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
4873 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4875 * src/insets/insetindex.C (Edit): add a callback when popup is
4878 * src/insets/insettext.C (LocalDispatch):
4879 * src/insets/insetmarginal.h:
4880 * src/insets/insetlist.h:
4881 * src/insets/insetfoot.h:
4882 * src/insets/insetfloat.h:
4883 * src/insets/insetert.h: add a missing std:: qualifier.
4885 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4887 * src/support/lyxsum.C (sum): '\0' teminate file read when using
4890 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
4892 * src/insets/insettext.C (Read): remove tmptok unused variable
4893 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
4894 (InsertInset): change for new InsetInset code
4896 * src/insets/insettext.h: add TEXT inline method
4898 * src/insets/insettext.C: remove TEXT macro
4900 * src/insets/insetmarginal.C (Write): new method
4901 (Latex): change output slightly
4903 * src/insets/insetfoot.C (Write): new method
4904 (Latex): change output slightly (don't use endl when no need)
4906 * src/insets/insetert.C (Write): new method
4908 * src/insets/insetcollapsable.h: make button_length, button_top_y
4909 and button_bottm_y protected.
4911 * src/insets/insetcollapsable.C (Write): simplify code by using
4912 tostr. Also do not output the float name, the children class
4913 should to that to get control over own arguments
4915 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
4916 src/insets/insetminipage.[Ch]:
4919 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
4921 * src/lyxfunc.C (Dispatch): cases for new insets/commands
4923 * src/Makefile.am (lyx_SOURCES): add the new files
4925 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
4926 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
4927 * src/commandtags.h: ditto
4929 * src/LaTeXFeatures.h: add a std::set of used floattypes
4931 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
4933 * src/FloatList.[Ch] src/Floating.h: new files
4935 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
4937 * src/lyx_cb.C (TableApplyCB): ditto
4939 * src/text2.C: ditto
4940 * src/buffer.C (SimpleLinuxDocOnePar): ditto
4941 (parseSingleLyXformat2Token): ditto + add code for
4942 backwards compability for old float styles + add code for new insets
4944 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
4946 (InsertInset(size_type, Inset *, LyXFont)): new method
4947 (InsetChar(size_type, char)): changed to use the other InsetChar
4948 with a LyXFont(ALL_INHERIT).
4949 (InsetInset(size_type, Inset*)): changed to use InsetChar to
4950 insert the META_INSET.
4952 * sigc++/thread.cc (Privete<int>::operator int&): move definition
4954 * sigc++/thread.h (Threads): from here
4956 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
4957 definition out of line
4958 * sigc++/scope.h: from here
4960 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4962 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
4963 is specified (adapted from a patch from edscott <edscott@imp.mx>).
4965 * Makefile.am (bindist): new target.
4967 * INSTALL: add instructions for doing a binary distribution.
4969 * development/tools/README.bin.example: update a bit.
4971 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
4974 * lib/lyxrc.example: new lyxrc tag \set_color.
4976 * src/lyxfunc.C (Dispatch):
4977 * src/commandtags.h:
4978 * src/LyXAction.C: new lyxfunc "set-color".
4980 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
4981 and an x11name given as strings.
4983 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
4984 cache when a color is changed.
4986 2000-06-26 Juergen Vigna <jug@sad.it>
4988 * src/lyxrow.C (width): added this functions and variable.
4990 * src/insets/insetcite.C (create_form_citation_form): some Gravity
4993 * src/text.C (SetHeightOfRow): fixed calcualting of width.
4995 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4997 * images/undo_bw.xpm: new icon.
4998 * images/redo_bw.xpm: ditto.
5000 * configure.in (INSTALL_SCRIPT): change value to
5001 ${INSTALL} to avoid failures of install-script target.
5002 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
5004 * src/BufferView.h: add a magic "friend" declaration to please
5007 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
5009 * forms/cite.fd: modified to allow resizing without messing
5012 * src/insetcite.C: Uses code from cite.fd almost without
5014 User can now resize dialog in the x-direction.
5015 Resizing the dialog in the y-direction is prevented, as the
5016 code does this intelligently already.
5018 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5020 * INSTALL: remove obsolete entry in "problems" section.
5022 * lib/examples/sl_*.lyx: update of the slovenian examples.
5024 * src/support/FileInfo.[Ch] (getBlockSize): remove.
5026 2000-06-23 Juergen Vigna <jug@sad.it>
5028 * src/lyxtext.h: added a 'cleared' flag to draw() function.
5030 * src/buffer.C (resize): delete the LyXText of textinsets.
5032 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
5034 * src/insets/lyxinset.h: added another parameter 'cleared' to
5035 the draw() function.
5037 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
5038 unlocking inset in inset.
5040 2000-06-22 Juergen Vigna <jug@sad.it>
5042 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
5043 of insets and moved first to LyXText.
5045 * src/mathed/formulamacro.[Ch]:
5046 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
5048 2000-06-21 Juergen Vigna <jug@sad.it>
5050 * src/text.C (GetVisibleRow): look if I should clear the area or not
5051 using Inset::doClearArea() function.
5053 * src/insets/lyxinset.h: added doClearArea() function and
5054 modified draw(Painter &, ...) to draw(BufferView *, ...)
5056 * src/text2.C (UpdateInset): return bool insted of int
5058 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
5060 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
5061 combox in the character popup
5063 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
5064 BufferParams const & params
5066 2000-06-20 Juergen Vigna <jug@sad.it>
5068 * src/insets/insettext.C (SetParagraphData): set insetowner on
5071 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5073 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
5074 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
5076 (form_main_): remove
5078 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
5079 (create_form_form_main): remove FD_form_main stuff, connect to
5080 autosave_timeout signal
5082 * src/LyXView.[Ch] (getMainForm): remove
5083 (UpdateTimerCB): remove
5084 * src/BufferView_pimpl.h: inherit from SigC::Object
5086 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
5087 signal instead of callback
5089 * src/BufferView.[Ch] (cursorToggleCB): remove
5091 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5093 * src/BufferView_pimpl.C: changes because of the one below
5095 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
5096 instead of storing a pointer to a LyXText.
5098 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
5100 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
5102 * src/lyxparagraph.h
5104 * src/paragraph.C: Changed fontlist to a sorted vector.
5106 2000-06-19 Juergen Vigna <jug@sad.it>
5108 * src/BufferView.h: added screen() function.
5110 * src/insets/insettext.C (LocalDispatch): some selection code
5113 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
5115 * src/insets/insettext.C (SetParagraphData):
5117 (InsetText): fixes for multiple paragraphs.
5119 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
5121 * development/lyx.spec.in: Call configure with ``--without-warnings''
5122 to work around a bug with the Makefiles when doing ``make lyxrpm''.
5123 This should be fine, however, since we generally don't want to be
5124 verbose when making an RPM.
5126 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
5128 * lib/scripts/fig2pstex.py: New file
5130 2000-06-16 Juergen Vigna <jug@sad.it>
5132 * src/insets/insettabular.C (UpdateLocal):
5133 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
5134 (LocalDispatch): Changed all functions to use LyXText.
5136 2000-06-15 Juergen Vigna <jug@sad.it>
5138 * src/text.C (SetHeightOfRow): call inset::update before requesting
5141 * src/insets/insettext.C (update):
5142 * src/insets/insettabular.C (update): added implementation
5144 * src/insets/lyxinset.h: added update function
5146 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5148 * src/text.C (SelectNextWord): protect against null pointers with
5149 old-style string streams. (fix from Paul Theo Gonciari
5152 * src/cite.[Ch]: remove erroneous files.
5154 * lib/configure.m4: update the list of created directories.
5156 * src/lyxrow.C: include <config.h>
5157 * src/lyxcursor.C: ditto.
5159 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5161 * lib/examples/decimal.lyx: new example file from Mike.
5163 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
5164 to find template definitions (from Dekel)
5166 * src/frontends/.cvsignore: add a few things.
5168 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
5170 * src/Timeout.C (TimeOut): remove default argument.
5172 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
5175 * src/insets/ExternalTemplate.C: add a "using" directive.
5177 * src/lyx_main.h: remove the act_ struct, which seems unused
5180 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5182 * LyX Developers Meeting: All files changed, due to random C++ (by
5183 coincidence) code generator script.
5185 - external inset (cool!)
5186 - initial online editing of preferences
5187 - insettabular breaks insettext(s contents)
5189 - some DocBook fixes
5190 - example files update
5191 - other cool stuff, create a diff and look for yourself.
5193 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
5195 * src/insets/insettext.C (computeTextRows): if the maxWidth is
5196 -1 this is a non-line-breaking textinset.
5198 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
5199 if there is no width set.
5201 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5203 * Lots of files: Merged the dialogbase branch.
5205 2000-06-09 Allan Rae <rae@lyx.org>
5207 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
5208 and the Dispatch methods that used it.
5210 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
5211 access to functions formerly kept in Dispatch.
5213 2000-05-19 Allan Rae <rae@lyx.org>
5215 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
5216 made to_page and count_copies integers again. from_page remains a
5217 string however because I want to allow entry of a print range like
5218 "1,4,22-25" using this field.
5220 * src/LyXAction.C: added action info and commands for buffer-print-xtl
5221 and printer-params-get. These aren't useful from the minibuffer but
5222 could be used by a script/LyXServer app provided it passes a suitable
5223 auto_mem_buffer. I guess I should take a look at how the LyXServer
5224 works and make it support xtl buffers.
5226 * sigc++/: updated to libsigc++-1.0.1
5228 * src/xtl/: updated to xtl-1.3.pl.11
5230 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
5231 those changes done to the files in src/ are actually recreated when
5232 they get regenerated. Please don't ever accept a patch that changes a
5233 dialog unless that patch includes the changes to the corresponding *.fd
5236 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
5237 stringOnlyContains, renamed it and generalised it.
5239 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
5240 branch. Removed the remaining old form_print code.
5242 2000-04-26 Allan Rae <rae@lyx.org>
5244 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
5245 trap I was trying to fix with the ID: fields in src/xtl/ :-)
5247 2000-04-25 Allan Rae <rae@lyx.org>
5249 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
5250 against a base of xtl-1.3.pl.4
5252 * development/tools/lxtl.sh: fixed a couple of silly typos and now
5253 filter the Id: entries so they still show the xtl version number
5256 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
5257 into the src/xtl code. Patch still pending with José (XTL)
5259 2000-04-24 Allan Rae <rae@lyx.org>
5261 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
5262 both more generic and much safer. Use the new template functions.
5263 * src/buffer.[Ch] (Dispatch): ditto.
5265 * src/frontends/xforms/FormPrint.C (update): Use new template functions
5266 and mem buffer more intelligently. Also a little general cleanup.
5269 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
5270 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
5271 * src/xtl/Makefile.am: ditto.
5272 * src/xtl/.cvsignore: ditto.
5273 * src/Makefile.am: ditto.
5275 * src/PrinterParams.h: Removed the macros member functions. Added a
5276 testInvariant member function. A bit of tidying up and commenting.
5277 Included Angus's idea for fixing operation with egcs-1.1.2.
5279 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
5280 cool expansion of XTL's mem_buffer to support automatic memory
5281 management within the buffer itself. Removed the various macros and
5282 replaced them with template functions that use either auto_mem_buffer
5283 or mem_buffer depending on a #define. The mem_buffer support will
5284 disappear as soon as the auto_mem_buffer is confirmed to be good on
5285 other platforms/compilers. That is, it's there so you've got something
5288 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
5289 effectively forked XTL. However I expect José will include my code
5290 into the next major release. Also fixed a memory leak.
5291 * src/xtl/text.h: ditto.
5292 * src/xtl/xdr.h: ditto.
5293 * src/xtl/giop.h: ditto.
5295 2000-04-16 Allan Rae <rae@lyx.org>
5297 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
5298 by autogen.sh and removed by maintainer-clean anyway.
5299 * .cvsignore, sigc++/.cvsignore: Support the above.
5301 * sigc++/.cvsignore: Forgot that retbind.h was generated.
5303 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
5305 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
5306 macros, renamed static callback-target member functions to suit new
5307 scheme and made them public.
5308 * src/frontends/xforms/forms/form_print.fd: ditto.
5309 * src/frontends/xforms/forms/form_copyright.fd: ditto.
5311 * src/support/lxtl.h: small cleanup to use typedef instead of #define
5314 * src/xtl/: New directory containing a minimal distribution of XTL.
5315 This is XTL-1.3.pl.4.
5317 * development/tools/lxtl.sh: A script to generate the above mini-dist.
5319 2000-04-15 Allan Rae <rae@lyx.org>
5321 * development/tools/makeLyXsigc.sh: Remove the library version numbers
5323 * sigc++/: Updated to libsigc++-1.0.0
5325 2000-04-14 Allan Rae <rae@lyx.org>
5327 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
5328 use the generic ones in future. I'll modify my conversion script.
5330 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
5332 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
5333 (CloseAllBufferRelatedDialogs): Renamed.
5334 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
5336 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
5337 of the generic ones. These are the same ones my conversion script
5340 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
5341 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
5342 * src/buffer.C (Dispatch): ditto
5344 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
5345 functions for updating and hiding buffer dependent dialogs.
5346 * src/BufferView.C (buffer): ditto
5347 * src/buffer.C (setReadonly): ditto
5348 * src/lyxfunc.C (CloseBuffer): ditto
5350 * src/buffer.h: Take setReadonly() out of line so I don't have to include
5351 Dialogs.h, and hence all the SigC stuff, into every file that includes
5352 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
5354 * src/BufferView2.C: reduce the number of headers included by buffer.h
5356 2000-04-11 Allan Rae <rae@lyx.org>
5358 * src/frontends/xforms/xform_macros.h: A small collection of macros
5359 for building C callbacks.
5361 * src/frontends/xforms/Makefile.am: Added above file.
5363 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
5364 scheme again. This time it should work for JMarc. If this is
5365 successful I'll revise my conversion script to automate some of this.
5366 The static member functions in the class also have to be public for
5367 this scheme will work. If the scheme works (it's almost identical to
5368 the way BufferView::cursorToggleCB is handled so it should work) then
5369 FormCopyright and FormPrint will be ready for inclusion into the main
5370 trunk immediately after 1.1.5 is released -- provided we're prepared
5371 for complaints about lame compilers not handling XTL.
5373 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
5375 2000-04-07 Allan Rae <rae@lyx.org>
5377 * config/lyxinclude.m4: A bit more tidying up (Angus)
5379 * src/LString.h: JMarc's <string> header fix
5381 * src/PrinterParams.h: Used string for most data to remove some
5382 ugly code in the Print dialog and avoid even uglier code when
5383 appending the ints to a string for output.
5385 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
5386 and moved "default:" back to the end of switch statement. Cleaned
5387 up the printing so it uses the right function calls and so the
5388 "print to file" option actually puts the file in the right directory.
5390 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
5392 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
5393 and Ok+Apply button control into a separate method: input (Angus).
5394 (input) Cleaned it up and improved it to be very thorough now.
5395 (All CB) static_cast used instead of C style cast (Angus). This will
5396 probably change again once we've worked out how to keep gcc-2.8.1 happy
5397 with real C callbacks.
5398 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
5399 ignore some of the bool settings and has random numbers instead. Needs
5400 some more investigation. Added other input length checks and checking
5401 of file and printer names.
5403 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
5404 would link (Angus). Seems the old code doesn't compile with the pragma
5405 statement either. Separated callback entries from internal methods.
5407 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
5409 2000-03-17 Allan Rae <rae@lyx.org>
5411 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
5412 need it? Maybe it could go in Dialogs instead? I could make it a
5413 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
5414 values to get the bool return value.
5415 (Dispatch): New overloaded method for xtl support.
5417 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
5418 extern "C" callback instead of static member functions. Hopefully,
5419 JMarc will be able to compile this. I haven't changed
5420 forms/form_copyright.fd yet. Breaking one of my own rules already.
5422 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
5423 because they aren't useful from the minibuffer. Maybe a LyXServer
5424 might want a help message though?
5426 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
5428 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
5429 xtl which needs both rtti and exceptions.
5431 * src/support/Makefile.am:
5432 * src/support/lxtl.h: New file. Some helper macros for using XTL.
5434 * src/frontends/xforms/input_validators.[ch]: input filters and
5435 validators. These conrol what keys are valid in input boxes.
5436 Use them and write some more. Much better idea than waiting till
5437 after the user has pressed Ok to say that the input fields don't make
5440 * src/frontends/xforms/Makefile.am:
5441 * src/frontends/xforms/forms/form_print.fd:
5442 * src/frontends/xforms/forms/makefile:
5443 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
5444 new scheme. Still have to make sure I haven't missed anything from
5445 the current implementation.
5447 * src/Makefile.am, src/PrinterParams.h: New data store.
5449 * other files: Added a couple of copyright notices.
5451 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5453 * src/insets/insetbib.h: move Holder struct in public space.
5455 * src/frontends/include/DialogBase.h: use SigC:: only when
5456 SIGC_CXX_NAMESPACES is defined.
5457 * src/frontends/include/Dialogs.h: ditto.
5459 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
5461 * src/frontends/xforms/FormCopyright.[Ch]: do not
5462 mention SigC:: explicitely.
5464 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5466 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
5467 deals with testing KDE in main configure.in
5468 * configure.in: ditto.
5470 2000-02-22 Allan Rae <rae@lyx.org>
5472 * Lots of files: Merged from HEAD
5474 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
5475 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
5477 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
5479 * sigc++/: new minidist.
5481 2000-02-14 Allan Rae <rae@lyx.org>
5483 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
5485 2000-02-08 Juergen Vigna <jug@sad.it>
5487 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
5488 file for the buildin GUI builder of KDevelop of the copyright-dialog.
5490 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
5491 for this port and so it is much easier for other people to port
5492 dialogs in a common development environment.
5494 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
5495 the QT/KDE implementation.
5497 * src/frontends/kde/Dialogs.C:
5498 * src/frontends/kde/FormCopyright.C:
5499 * src/frontends/kde/FormCopyright.h:
5500 * src/frontends/kde/Makefile.am:
5501 * src/frontends/kde/formcopyrightdialog.C:
5502 * src/frontends/kde/formcopyrightdialog.h:
5503 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
5504 for the kde support of the Copyright-Dialog.
5506 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
5507 subdir-substitution instead of hardcoded 'xforms' as we now have also
5510 * src/frontends/include/DialogBase.h (Object): just commented the
5511 label after #endif (nasty warning and I don't like warnings ;)
5513 * src/main.C (main): added KApplication initialization if using
5516 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
5517 For now only the KDE event-loop is added if frontend==kde.
5519 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
5521 * configure.in: added support for the --with-frontend[=value] option
5523 * autogen.sh: added kde.m4 file to list of config-files
5525 * acconfig.h: added define for KDEGUI-support
5527 * config/kde.m4: added configuration functions for KDE-port
5529 * config/lyxinclude.m4: added --with-frontend[=value] option with
5530 support for xforms and KDE.
5532 2000-02-08 Allan Rae <rae@lyx.org>
5534 * all Makefile.am: Fixed up so the make targets dist, distclean,
5535 install and uninstall all work even if builddir != srcdir. Still
5536 have a new sigc++ minidist update to come.
5538 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
5540 2000-02-01 Allan Rae <rae@lyx.org>
5542 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
5543 Many mods to get builddir != srcdir working.
5545 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
5546 for building on NT and so we can do the builddir != srcdir stuff.
5548 2000-01-30 Allan Rae <rae@lyx.org>
5550 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
5551 This will stay in "rae" branch. We probably don't really need it in
5552 the main trunk as anyone who wants to help programming it should get
5553 a full library installed also. So they can check both included and
5554 system supplied library compilation.
5556 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
5557 Added a 'mini' distribution of libsigc++. If you feel the urge to
5558 change something in these directories - Resist it. If you can't
5559 resist the urge then you should modify the following script and rebuild
5560 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
5561 all happen. Still uses a hacked version of libsigc++'s configure.in.
5562 I'm quite happy with the results. I'm not sure the extra work to turn
5563 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
5564 worth the trouble and would probably lead to extra maintenance
5566 I haven't tested the following important make targets: install, dist.
5567 Not ready for prime time but very close. Maybe 1.1.5.
5569 * development/tools/makeLyXsigc.sh: A shell script to automatically
5570 generate our mini-dist of libsigc++. It can only be used with a CVS
5571 checkout of libsigc++ not a tarball distribution. It's well commented.
5572 This will end up as part of the libsigc++ distribution so other apps
5573 can easily have an included mini-dist. If someone makes mods to the
5574 sigc++ subpackage without modifying this script to generate those
5575 changes I'll be very upset!
5577 * src/frontends/: Started the gui/system indep structure.
5579 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
5580 to access the gui-indep dialogs are in this class. Much improved
5581 design compared to previous revision. Lars, please refrain from
5582 moving this header into src/ like you did with Popups.h last time.
5584 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
5586 * src/frontends/xforms/: Started the gui-indep system with a single
5587 dialog: FormCopyright. Initial testing of use of libsigc++ was very
5590 * src/frontends/xforms/forms: Repository for the xforms .fd files.
5591 Here you'll find a very useful makefile and automated fdfix.sh that
5592 makes updating dailogs a no-brainer -- provided you follow the rules
5593 set out in the README. I'm thinking about adding another script to
5594 automatically generate skeleton code for a new dialog given just the
5597 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
5598 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
5599 Made FormCopyright gui-indep and added a lyxfunc to get to it.
5601 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5603 * src/support/LSubstring.C (operator): simplify
5605 * src/lyxtext.h: removed bparams, use buffer_->params instead
5607 * src/lyxrow.h: make Row a real class, move all variables to
5608 private and use accessors.
5610 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
5612 (isRightToLeftPar): ditto
5613 (ChangeLanguage): ditto
5614 (isMultiLingual): ditto
5617 (SimpleTeXOnePar): ditto
5618 (TeXEnvironment): ditto
5619 (GetEndLabel): ditto
5621 (SetOnlyLayout): ditto
5622 (BreakParagraph): ditto
5623 (BreakParagraphConservative): ditto
5624 (GetFontSettings): ditto
5626 (CopyIntoMinibuffer): ditto
5627 (CutIntoMinibuffer): ditto
5628 (PasteParagraph): ditto
5629 (SetPExtraType): ditto
5630 (UnsetPExtraType): ditto
5631 (DocBookContTableRows): ditto
5632 (SimpleDocBookOneTablePar): ditto
5634 (TeXFootnote): ditto
5635 (SimpleTeXOneTablePar): ditto
5636 (TeXContTableRows): ditto
5637 (SimpleTeXSpecialChars): ditto
5640 * src/lyxcursor.h: make LyXCursor a real class, move all variables
5641 to private and use accessors.
5643 * src/lyx_cb.C: remove char updatetimer, and all code that uses
5644 this, we did not use it anymore and has not been for ages. Just a
5645 waste of cpu cycles.
5647 * src/language.h: make Language a real class, move all variables
5648 to private and use accessors.
5650 * src/BufferView_pimpl.C (Pimpl): use new timer code.
5651 (create_view): remove
5652 (update): some changes for new timer
5653 (cursorToggle): use new timer
5654 (beforeChange): change for new timer
5656 * src/BufferView.h (cursorToggleCB): removed last paramter because
5659 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
5660 (cursorToggleCB): change because of new timer code
5662 * lib/CREDITS: updated own mailaddress
5664 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5666 * src/support/filetools.C (PutEnv): fix the code in case neither
5667 putenv() nor setenv() have been found.
5669 * INSTALL: mention the install-strip Makefile target.
5671 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
5672 read-only documents.
5674 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5676 * lib/reLyX/configure.in (VERSION): avoid using a previously
5677 generated reLyX wrapper to find out $prefix.
5679 * lib/examples/eu_adibide_lyx-atua.lyx:
5680 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
5681 translation of the Tutorial (Dooteo)
5683 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
5685 * forms/cite.fd: new citation dialog
5687 * src/insetcite.[Ch]: the new citation dialog is moved into
5690 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
5693 * src/insets/insetcommand.h: data members made private.
5695 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5697 * LyX 1.1.5 released
5699 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5701 * src/version.h (LYX_RELEASE): to 1.1.5
5703 * src/spellchecker.C (RunSpellChecker): return false if the
5704 spellchecker dies upon creation.
5706 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5708 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
5709 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
5713 * lib/CREDITS: update entry for Martin Vermeer.
5715 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
5717 * src/text.C (draw): Draw foreign language bars at the bottom of
5718 the row instead of at the baseline.
5720 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
5722 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5724 * lib/bind/de_menus.bind: updated
5726 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5728 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
5730 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5732 * src/menus.C (Limit_string_length): New function
5733 (ShowTocMenu): Limit the number of items/length of items in the
5736 * src/paragraph.C (String): Correct result for a paragraph inside
5739 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5741 * src/bufferlist.C (close): test of buf->getuser() == NULL
5743 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
5745 * src/BufferView2.C (removeAutoInsets): Fix a bug:
5746 Do not call to SetCursor when the paragraph is a closed footnote!
5748 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
5750 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
5753 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
5755 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5758 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
5759 reference popup, that activates the reference-back action
5761 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
5763 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
5764 the menus. Also fixed a bug.
5766 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
5767 the math panels when switching buffers (unless new buffer is readonly).
5769 * src/BufferView.C (NoSavedPositions)
5770 * src/BufferView_pimpl.C (NoSavedPositions): New methods
5772 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5774 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
5775 less of dvi dirty or not.
5777 * src/trans_mgr.[Ch] (insert): change first parameter to string
5780 * src/chset.[Ch] (encodeString): add const to first parameter
5782 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5784 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
5788 * src/LaTeX.C (deplog): better searching for dependency files in
5789 the latex log. Uses now regexps.
5791 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
5792 instead of the box hack or \hfill.
5794 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5796 * src/lyxfunc.C (doImportHelper): do not create the file before
5797 doing the actual import.
5798 (doImportASCIIasLines): create a new file before doing the insert.
5799 (doImportASCIIasParagraphs): ditto.
5801 * lib/lyxrc.example: remove mention of non-existing commands
5803 * lyx.man: remove mention of color-related switches.
5805 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
5807 * src/lyx_gui.C: remove all the color-related ressources, which
5808 are not used anymore.
5810 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
5813 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5815 * src/lyxrc.C (read): Add a missing break in the switch
5817 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
5819 * src/text2.C (InsertStringA): Fix a bug with insertion into table
5821 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
5824 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
5826 * src/text.C (draw): draw bars under foreign language words.
5828 * src/LColor.[Ch]: add LColor::language
5830 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
5832 * src/lyxcursor.h (boundary): New member variable
5834 * src/text.C (IsBoundary): New methods
5836 * src/text.C: Use the above for currect cursor movement when there
5837 is both RTL & LTR text.
5839 * src/text2.C: ditto
5841 * src/bufferview_funcs.C (ToggleAndShow): ditto
5843 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5845 * src/text.C (DeleteLineForward): set selection to true to avoid
5846 that DeleteEmptyParagraphMechanism does some magic. This is how it
5847 is done in all other functions, and seems reasonable.
5848 (DeleteWordForward): do not jump over non-word stuff, since
5849 CursorRightOneWord() already does it.
5851 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
5852 DeleteWordBackward, since they seem safe to me (since selection is
5853 set to "true") DeleteEmptyParagraphMechanism does nothing.
5855 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5857 * src/lyx_main.C (easyParse): simplify the code by factoring the
5858 part that removes parameters from the command line.
5859 (LyX): check wether wrong command line options have been given.
5861 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
5863 * src/lyx_main.C : add support for specifying user LyX
5864 directory via command line option -userdir.
5866 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
5868 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
5869 the number of items per popup.
5870 (Add_to_refs_menu): Ditto.
5872 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5874 * src/lyxparagraph.h: renamed ClearParagraph() to
5875 StripLeadingSpaces() and moved it to paragraph.C. We pass the
5876 textclass as parameter, and do nothing if free_spacing is
5877 true. This fixes part of the line-delete-forward problems.
5879 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
5880 (pasteSelection): ditto.
5881 (SwitchLayoutsBetweenClasses): more translatable strings.
5883 * src/text2.C (CutSelection): use StripLeadingSpaces.
5884 (PasteSelection): ditto.
5885 (DeleteEmptyParagraphMechanism): ditto.
5887 2000-05-26 Juergen Vigna <jug@sad.it>
5889 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
5890 is not needed in tabular insets.
5892 * src/insets/insettabular.C (TabularFeatures): added missing features.
5894 * src/tabular.C (DeleteColumn):
5896 (AppendRow): implemented this functions
5897 (cellsturct::operator=): clone the inset too;
5899 2000-05-23 Juergen Vigna <jug@sad.it>
5901 * src/insets/insettabular.C (LocalDispatch): better selection support
5902 when having multicolumn-cells.
5904 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
5906 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
5908 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5910 * src/ColorHandler.C (getGCForeground): put more test into _()
5912 * lib/examples/eu_splash.lyx: new file (Basque translation) from
5915 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
5918 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
5920 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
5921 there are no labels, or when buffer is readonly.
5923 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
5924 there are no labels, buffer is SGML, or when buffer is readonly.
5926 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5928 * src/LColor.C (LColor): change a couple of grey40 to grey60
5929 (LColor): rewore initalization to make compiles go some magnitude
5931 (getGUIName): don't use gettext until we need the string.
5933 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
5935 * src/Bullet.[Ch]: Fixed a small bug.
5937 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
5939 * src/paragraph.C (String): Several fixes/improvements
5941 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
5943 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5945 * src/paragraph.C (String): give more correct output.
5947 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
5949 * src/lyxfont.C (stateText) Do not output the language if it is
5950 eqaul to the language of the document.
5952 * src/paragraph.C (TeXOnePar): Do not put language switch commands
5953 between two paragraphs with the same language.
5955 * src/paragraph.C (getParLanguage) Return a correct answer for an
5956 empty dummy paragraph.
5958 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
5961 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
5964 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
5965 the menus/popup, if requested fonts are unavailable.
5967 2000-05-22 Juergen Vigna <jug@sad.it>
5969 * src/insets/insettabular.C (LocalDispatch): added some more cursor
5970 movement support (Up/Down/Tab/Shift-Tab).
5971 (LocalDispatch): added also preliminari cursor-selection.
5973 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
5975 * src/paragraph.C (PasteParagraph): Hopefully now right!
5977 2000-05-22 Garst R. Reese <reese@isn.net>
5979 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
5980 of list, change all references to Environment to Command
5981 * tex/hollywood.cls : rewrite environments as commands, add
5982 \uppercase to interiorshot and exteriorshot to force uppecase.
5983 * tex/broadway.cls : rewrite environments as commands. Tweak
5986 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5988 * src/menus.C (Add_to_toc_menu): fix the code which limits the
5989 size of items: use a constant intead of the hardcoded 40, and more
5990 importantly do not remove the %m and %x tags added at the end.
5991 (Add_to_refs_menu): use vector::size_type instead of
5992 unsigned int as basic types for the variables. _Please_ do not
5993 assume that size_t is equal to unsigned int. On an alpha, this is
5994 unsigned long, which is _not_ the same.
5996 * src/language.C (initL): remove language "hungarian", since it
5997 seems that "magyar" is better.
5999 2000-05-22 Juergen Vigna <jug@sad.it>
6001 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
6003 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
6006 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
6007 next was deleted but not set to 0.
6009 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6011 * src/language.C (initL): change the initialization of languages
6012 so that compiles goes _fast_.
6014 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
6017 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
6019 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6023 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6025 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
6027 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
6031 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
6034 * src/insets/insetlo*.[Ch]: Made editable
6036 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6038 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
6039 the current selection.
6041 * src/BufferView_pimpl.C (stuffClipboard): new method
6043 * src/BufferView.C (stuffClipboard): new method
6045 * src/paragraph.C (String): new method
6047 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
6048 LColor::ignore when lyxname is not found.
6050 * src/BufferView.C (pasteSelection): new method
6052 * src/BufferView_pimpl.C (pasteSelection): new method
6054 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
6056 * src/WorkArea.C (request_clipboard_cb): new static function
6057 (getClipboard): new method
6058 (putClipboard): new method
6060 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6062 * LyX 1.1.5pre2 released
6064 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6066 * src/vspace.C (operator=): removed
6067 (operator=): removed
6069 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
6071 * src/layout.C (NumberOfClass): manually set the type in make_pair
6072 (NumberOfLayout): ditto
6074 * src/language.C: use the Language constructor for ignore_lang
6076 * src/language.h: add constructors to struct Language
6078 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
6080 * src/text2.C (SetCursorIntern): comment out #warning
6082 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
6084 * src/mathed/math_iter.h: initialize sx and sw to 0
6086 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6088 * forms/lyx.fd: Redesign of form_ref
6090 * src/LaTeXFeatures.[Ch]
6094 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
6097 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
6098 and Buffer::inset_iterator.
6100 * src/menus.C: Added new menus: TOC and Refs.
6102 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
6104 * src/buffer.C (getTocList): New method.
6106 * src/BufferView2.C (ChangeRefs): New method.
6108 * src/buffer.C (getLabelList): New method. It replaces the old
6109 getReferenceList. The return type is vector<string> instead of
6112 * src/insets/insetinclude.C (getLabelList): New method. Replaces
6113 the old getLabel() and GetNumberOfLabels() methods.
6114 * src/insets/insetlabel.C (getLabelList): ditto
6115 * src/mathed/formula.C (getLabelList): ditto
6117 * src/paragraph.C (String): New method.
6119 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
6120 Uses the new getTocList() method.
6121 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
6122 which automatically updates the contents of the browser.
6123 (RefUpdateCB): Use the new getLabelList method.
6125 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
6127 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
6129 * src/spellchecker.C: Added using std::reverse;
6131 2000-05-19 Juergen Vigna <jug@sad.it>
6133 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
6135 * src/insets/insettext.C (computeTextRows): small fix for display of
6136 1 character after a newline.
6138 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
6141 2000-05-18 Juergen Vigna <jug@sad.it>
6143 * src/insets/insettabular.C (TabularFeatures): fixed update of display
6144 when changing width of column.
6146 * src/tabular.C (set_row_column_number_info): setting of
6147 autobreak rows if necessary.
6149 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6151 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
6153 * src/vc-backend.*: renamed stat() to status() and vcstat to
6154 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
6155 compilation broke. The new name seems more relevant, anyway.
6157 2000-05-17 Juergen Vigna <jug@sad.it>
6159 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
6160 which was wrong if the removing caused removing of rows!
6162 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
6163 (pushToken): new function.
6165 * src/text2.C (CutSelection): fix problem discovered with purify
6167 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6169 * src/debug.C (showTags): enlarge the first column, now that we
6170 have 6-digits debug codes.
6172 * lib/layouts/hollywood.layout:
6173 * lib/tex/hollywood.cls:
6174 * lib/tex/brodway.cls:
6175 * lib/layouts/brodway.layout: more commands and fewer
6176 environments. Preambles moved in the .cls files. Broadway now has
6177 more options on scene numbering and less whitespace (from Garst)
6179 * src/insets/insetbib.C (getKeys): make sure that we are in the
6180 document directory, in case the bib file is there.
6182 * src/insets/insetbib.C (Latex): revert bogus change.
6184 2000-05-16 Juergen Vigna <jug@sad.it>
6186 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
6187 the TabularLayout on cursor move.
6189 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
6191 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
6194 (draw): fixed cursor position and drawing so that the cursor is
6195 visible when before the tabular-inset.
6197 * src/insets/insettext.C (init): drawLockedFrame was not initialized
6198 when creating from old insettext.
6200 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
6202 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6204 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
6205 * lib/tex/brodway.cls: ditto
6207 * lib/layouts/brodway.layout: change alignment of parenthical
6210 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6212 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
6213 versions 0.88 and 0.89 are supported.
6215 2000-05-15 Juergen Vigna <jug@sad.it>
6217 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
6220 * src/insets/insettext.C (computeTextRows): redone completely this
6221 function in a much cleaner way, because of problems when having a
6223 (draw): added a frame border when the inset is locked.
6224 (SetDrawLockedFrame): this sets if we draw the border or not.
6225 (SetFrameColor): this sets the frame color (default=insetframe).
6227 * src/insets/lyxinset.h: added x() and y() functions which return
6228 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
6229 function which is needed to see if we have a locking inset of some
6230 type in this inset (needed for now in insettabular).
6232 * src/vspace.C (inPixels): the same function also without a BufferView
6233 parameter as so it is easier to use it in some ocasions.
6235 * src/lyxfunc.C: changed all places where insertInset was used so
6236 that now if it couldn't be inserted it is deleted!
6238 * src/TabularLayout.C:
6239 * src/TableLayout.C: added support for new tabular-inset!
6241 * src/BufferView2.C (insertInset): this now returns a bool if the
6242 inset was really inserted!!!
6244 * src/tabular.C (GetLastCellInRow):
6245 (GetFirstCellInRow): new helper functions.
6246 (Latex): implemented for new tabular class.
6250 (TeXTopHLine): new Latex() helper functions.
6252 2000-05-12 Juergen Vigna <jug@sad.it>
6254 * src/mathed/formulamacro.C (Read):
6255 * src/mathed/formula.C (Read): read also the \end_inset here!
6257 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6259 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
6260 crush when saving formulae with unbalanced parenthesis.
6262 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
6264 * src/layout.C: Add new keyword "endlabelstring" to layout file
6266 * src/text.C (GetVisibleRow): Draw endlabel string.
6268 * lib/layouts/broadway.layout
6269 * lib/layouts/hollywood.layout: Added endlabel for the
6270 Parenthetical layout.
6272 * lib/layouts/heb-article.layout: Do not use slanted font shape
6273 for Theorem like environments.
6275 * src/buffer.C (makeLaTeXFile): Always add "american" to
6276 the UsedLanguages list if document language is RTL.
6278 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6280 * add addendum to README.OS2 and small patch (from SMiyata)
6282 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6284 * many files: correct the calls to ChangeExtension().
6286 * src/support/filetools.C (ChangeExtension): remove the no_path
6287 argument, which does not belong there. Use OnlyFileName() instead.
6289 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
6290 files when LaTeXing a non-nice latex file.
6292 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
6293 a chain of "if". Return false when deadkeys are not handled.
6295 * src/lyx_main.C (LyX): adapted the code for default bindings.
6297 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
6298 bindings for basic functionality (except deadkeys).
6299 (deadKeyBindings): new method. Performs the bindings of deadkeys.
6301 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
6302 several methods: handle override_x_deadkeys.
6304 * src/lyxrc.h: remove the "bindings" map, which did not make much
6305 sense anyway. New variable override_x_deadkeys, defaulting to "true".
6307 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6309 * src/lyxfont.C (stateText): use a saner method to determine
6310 whether the font is "default". Seems to fix the crash with DEC
6313 * src/Bullet.[Ch] (Bullet): remove const on parameters.
6315 2000-05-08 Juergen Vigna <jug@sad.it>
6317 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
6318 TabularLayoutMenu with mouse-button-3
6319 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
6321 * src/TabularLayout.C: added this file for having a Layout for
6324 2000-05-05 Juergen Vigna <jug@sad.it>
6326 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
6327 recalculating inset-widths.
6328 (TabularFeatures): activated this function so that I can change
6329 tabular-features via menu.
6331 * src/menus.C (ShowEditMenu): inserted support for insettabular so
6332 that I can test some functions with the Table menu.
6334 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6336 * src/lyxfont.C (stateText): guard against stupid c++libs.
6338 * src/tabular.C: add using std::vector
6339 some whitespace changes, + removed som autogenerated code.
6341 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
6343 2000-05-05 Juergen Vigna <jug@sad.it>
6345 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
6346 row, columns and cellstructures.
6348 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6350 * lib/lyxrc.example: remove obsolete entries.
6352 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
6353 reading of protected_separator for free_spacing.
6355 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6357 * src/text.C (draw): do not display an exclamation mark in the
6358 margin for margin notes. This is confusing, ugly and
6361 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
6362 AMS math' is checked.
6364 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
6365 name to see whether including the amsmath package is needed.
6367 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
6369 * src/paragraph.C (validate): Compute UsedLanguages correctly
6370 (don't insert the american language if it doesn't appear in the
6373 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
6374 The argument of \thanks{} command is considered moving argument
6376 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
6379 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
6381 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
6382 for appendix/minipage/depth. The lines can be now both in the footnote
6383 frame, and outside the frame.
6385 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
6388 2000-05-05 Juergen Vigna <jug@sad.it>
6390 * src/table.[Ch]: removed the inset and buffer stuff as this is now
6391 neede only in tabular.[Ch].
6393 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6395 * src/insets/insetspecialchar.C (Read): allow command == '~' for
6397 (Write): write '~' for PROTECTED_SEPARATOR
6399 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6401 * src/lyxparagraph.h: add a friend struct matchIT after the struct
6404 * src/mathed/formula.C (drawStr): rename size to siz.
6406 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
6407 possibly fix a bug by not changing the pflags = flags to piflags =
6410 2000-05-05 Juergen Vigna <jug@sad.it>
6412 * src/insets/insetbib.C: moved using directive
6414 * src/ImportNoweb.C: small fix for being able to compile (missing
6417 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6419 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
6420 to use clear, since we don't depend on this in the code. Add test
6423 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6425 * (various *.C files): add using std::foo directives to please dec
6428 * replace calls to string::clear() to string::erase() (Angus)
6430 * src/cheaders/cmath: modified to provide std::abs.
6432 2000-05-04 Juergen Vigna <jug@sad.it>
6434 * src/insets/insettext.C: Prepared all for inserting of multiple
6435 paragraphs. Still display stuff to do (alignment and other things),
6436 but I would like to use LyXText to do this when we cleaned out the
6437 table-support stuff.
6439 * src/insets/insettabular.C: Changed lot of stuff and added lots
6440 of functionality still a lot to do.
6442 * src/tabular.C: Various functions changed name and moved to be
6443 const functions. Added new Read and Write functions and changed
6444 lots of things so it works good with tabular-insets (also removed
6445 some stuff which is not needed anymore * hacks *).
6447 * src/lyxcursor.h: added operators == and != which just look if
6448 par and pos are (not) equal.
6450 * src/buffer.C (latexParagraphs): inserted this function to latex
6451 all paragraphs form par to endpar as then I can use this too for
6454 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
6455 so that I can call this to from text insets with their own cursor.
6457 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
6458 output off all paragraphs (because of the fix below)!
6460 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
6461 the very last paragraph (this could be also the last paragraph of an
6464 * src/texrow.h: added rows() call which returns the count-variable.
6466 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6468 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
6470 * lib/configure.m4: better autodetection of DocBook tools.
6472 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6474 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
6476 * src/lyx_cb.C: add using std::reverse;
6478 * src/LaTeX.C (run): on error always run deleteFilesOnError before
6481 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
6482 selected files. Should fix repeated errors from generated files.
6484 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
6486 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
6488 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
6489 the spellchecker popup.
6491 * lib/lyxrc.example: Removed the \number_inset section
6493 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6495 * src/insets/figinset.C (various): Use IsFileReadable() to make
6496 sure that the file actually exist. Relying on ghostscripts errors
6497 is a bad idea since they can lead to X server crashes.
6499 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
6501 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
6504 * lib/lyxrc.example: smallish typo in description of
6505 \view_dvi_paper_option
6507 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6510 * src/lyxfunc.C: doImportHelper to factor out common code of the
6511 various import methods. New functions doImportASCIIasLines,
6512 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
6513 doImportLinuxDoc for the format specific parts.
6516 * buffer.C: Dispatch returns now a bool to indicate success
6519 * lyx_gui.C: Add getLyXView() for member access
6521 * lyx_main.C: Change logic for batch commands: First try
6522 Buffer::Dispatch (possibly without GUI), if that fails, use
6525 * lyx_main.C: Add support for --import command line switch.
6526 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
6527 Available Formats: Everything accepted by 'buffer-import <format>'
6529 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6531 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
6534 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
6535 documents will be reformatted upon reentry.
6537 2000-04-27 Juergen Vigna <jug@sad.it>
6539 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
6540 correctly only last pos this was a bug.
6542 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6544 * release of lyx-1.1.5pre1
6546 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6548 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
6550 * src/menus.C: revert the change of naming (Figure->Graphic...)
6551 from 2000-04-11. It was incomplete and bad.
6553 * src/LColor.[Ch]: add LColor::depthbar.
6554 * src/text.C (GetVisibleRow): use it.
6556 * README: update the languages list.
6558 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6560 * src/text.C (GetVisibleRow): show the depth of paragraphs using
6563 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6565 * README: remove sections that were just wrong.
6567 * src/text2.C (GetRowNearY): remove currentrow code
6569 * src/text.C (GetRow): remove currentrow code
6571 * src/screen.C (Update): rewritten a bit.
6572 (SmallUpdate): removed func
6574 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
6576 (FullRebreak): return bool
6577 (currentrow): remove var
6578 (currentrow_y): ditto
6580 * src/lyxscreen.h (Draw): change arg to unsigned long
6581 (FitCursor): return bool
6582 (FitManualCursor): ditto
6583 (Smallpdate): remove func
6584 (first): change to unsigned long
6585 (DrawOneRow): change second arg to long (from long &)
6586 (screen_refresh_y): remove var
6587 (scree_refresh_row): ditto
6589 * src/lyxrow.h: change baseline to usigned int from unsigned
6590 short, this brings some implicit/unsigned issues out in the open.
6592 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
6594 (Dispatch): don't call updateScrollbar after fitCursor. Use update
6595 instead of smallUpdate.
6597 * src/lyxcursor.h: change y to unsigned long
6599 * src/buffer.h: don't call updateScrollbar after fitcursor
6601 * src/buffer.C (parseSingleLyXformat2Token): move variables to
6602 where they are used. Removed "\\direction", this was not present
6603 in 1.1.4 and is already obsolete. Commented out some code that I
6604 believe to never be called.
6605 (runLiterate): don't call updateScrollbar after fitCursor
6607 (buildProgram): ditto
6610 * src/WorkArea.h (workWidth): change return val to unsigned
6613 (redraw): remove the button redraws
6614 (setScrollbarValue): change for scrollbar
6615 (getScrollbarValue): change for scrollbar
6616 (getScrollbarBounds): change for scrollbar
6618 * src/WorkArea.C (C_WorkArea_up_cb): removed func
6619 (C_WorkArea_down_cb): removed func
6620 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
6621 (resize): change for scrollbar
6622 (setScrollbar): ditto
6623 (setScrollbarBounds): ditto
6624 (setScrollbarIncrements): ditto
6625 (up_cb): removed func
6626 (down_cb): removed func
6627 (scroll_cb): change for scrollbar
6628 (work_area_handler): ditto
6630 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
6631 when FitCursor did something.
6632 (updateScrollbar): some unsigned changes
6633 (downCB): removed func
6634 (scrollUpOnePage): removed func
6635 (scrollDownOnePage): remvoed func
6636 (workAreaMotionNotify): don't call screen->FitCursor but use
6637 fitCursor instead. and bool return val
6638 (workAreaButtonPress): ditto
6639 (workAreaButtonRelease): some unsigned changes
6640 (checkInsetHit): ditto
6641 (workAreaExpose): ditto
6642 (update): parts rewritten, comments about the signed char arg added
6643 (smallUpdate): removed func
6644 (cursorPrevious): call needed updateScrollbar
6647 * src/BufferView2.C (allFloats): don't call updateScrollbar after
6650 * src/BufferView.[Ch] (upCB): removed func
6651 (downCB): removed func
6652 (smallUpdate): removed func
6654 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6656 * src/lyxtext.h src/text.C src/text2.C: removed support for the
6657 currentrow, currentrow_y optimization. This did not help a lot and
6658 if we want to do this kind of optimization we should rather use
6659 cursor.row instead of the currentrow.
6661 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
6662 buffer spacing and klyx spacing support.
6664 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6666 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
6669 2000-04-26 Juergen Vigna <jug@sad.it>
6671 * src/insets/figinset.C: fixes to Lars sstream changes!
6673 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
6675 * A lot of files: Added Ascii(ostream &) methods to all inset
6676 classes. Used when exporting to ASCII.
6678 * src/buffer.C (writeFileAscii,RoffAsciiTable)
6679 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
6682 * src/text2.C (ToggleFree): Disabled implicit word selection when
6683 there is a change in the language
6685 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
6686 no output was generated for end-of-sentence inset.
6688 * src/insets/lyxinset.h
6691 * src/paragraph.C: Removed the insetnumber code
6693 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
6695 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6697 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
6698 no_babel and no_epsfig completely from the file.
6699 (parseSingleLyXformat2Token): add handling for per-paragraph
6700 spacing as written by klyx.
6702 * src/insets/figinset.C: applied patch by Andre. Made it work with
6705 2000-04-20 Juergen Vigna <jug@sad.it>
6707 * src/insets/insettext.C (cutSelection):
6708 (copySelection): Fixed with selection from right to left.
6709 (draw): now the rows are not recalculated at every draw.
6710 (computeTextRows): for now reset the inset-owner here (this is
6711 important for an undo or copy where the inset-owner is not set
6714 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
6715 motion to the_locking_inset screen->first was forgotten, this was
6716 not important till we got multiline insets.
6718 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6720 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
6721 code seems to be alright (it is code changed by Dekel, and the
6722 intent is indeed that all macros should be defined \protect'ed)
6724 * NEWS: a bit of reorganisation of the new user-visible features.
6726 2000-04-19 Juergen Vigna <jug@sad.it>
6728 * src/insets/insettext.C (init): using a LyXCursor now for cursor
6729 position. Set the inset_owner of the used paragraph so that it knows
6730 that it is inside an inset. Fixed cursor handling with mouse and
6731 cursor keys. Fixed wrong timed inset redraws and lots of other changes
6732 and cleanups to make TextInsets work better.
6734 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
6735 Changed parameters of various functions and added LockInsetInInset().
6737 * src/insets/insettext.C:
6739 * src/insets/insetcollapsable.h:
6740 * src/insets/insetcollapsable.C:
6741 * src/insets/insetfoot.h:
6742 * src/insets/insetfoot.C:
6743 * src/insets/insetert.h:
6744 * src/insets/insetert.C: cleaned up the code so that it works now
6745 correctly with insettext.
6747 * src/insets/inset.C:
6748 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
6749 that insets in insets are supported right.
6752 * src/table.C: lots of changes for use with inset tabular (and cleanup)
6754 * src/paragraph.C: some small fixes
6756 * src/debug.h: inserted INSETS debug info
6758 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
6759 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
6761 * src/commandtags.h:
6762 * src/LyXAction.C: insert code for InsetTabular.
6764 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
6765 not Button1MotionMask.
6766 (workAreaButtonRelease): send always a InsetButtonRelease event to
6768 (checkInsetHit): some setCursor fixes (always with insets).
6770 * src/BufferView2.C (lockInset): returns a bool now and extended for
6771 locking insets inside insets.
6772 (showLockedInsetCursor): it is important to have the cursor always
6773 before the locked inset.
6774 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
6776 * src/BufferView.h: made lockInset return a bool.
6778 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
6780 * src/text2.C (SetCursor): This now has a version with a LyXCursor
6781 that is used also internally but can be called as public to have back
6782 a cursor pos which is not set internally.
6783 (SetCursorIntern): Changed to use above function.
6785 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
6787 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6792 * NEWS: updated for prerelease of 1.1.5. Please comment and send
6793 patches for things that should be in or should be changed.
6795 * src/* [insetfiles]: change "usigned char fragile" to bool
6796 fragile. There was only one point that could that be questioned
6797 and that is commented in formulamacro.C. Grep for "CHECK".
6799 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
6800 (DeleteBuffer): take it out of CutAndPaste and make it static.
6802 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6804 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
6805 output the spacing envir commands. Also the new commands used in
6806 the LaTeX output makes the result better.
6808 * src/Spacing.C (writeEnvirBegin): new method
6809 (writeEnvirEnd): new method
6811 2000-04-18 Juergen Vigna <jug@sad.it>
6813 * src/CutAndPaste.C: made textclass a static member of the class
6814 as otherwise it is not accesed right!!!
6816 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
6818 * forms/layout_forms.fd
6819 * src/layout_forms.h
6820 * src/layout_forms.C (create_form_form_character)
6821 * src/lyx_cb.C (UserFreeFont)
6822 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
6823 documents (in the layout->character popup).
6825 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6827 * src/spellchecker.C (create_ispell_pipe): fix a bug where
6828 \spell_command was in fact not honored (from Kevin Atkinson).
6830 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
6833 * src/lyx_gui.h: make lyxViews private (Angus)
6835 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
6837 * src/mathed/math_write.C
6838 (MathMatrixInset::Write) Put \protect before \begin{array} and
6839 \end{array} if fragile
6840 (MathParInset::Write): Put \protect before \\ if fragile
6842 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6844 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
6845 initialization if the LyXColorHandler must be done after the
6846 connections to the XServer has been established.
6848 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
6849 get the background pixel from the lyxColorhandler so that the
6850 figures are rendered with the correct background color.
6851 (NextToken): removed functions.
6852 (GetPSSizes): use ifs >> string instead of NextToken.
6854 * src/Painter.[Ch]: the color cache moved out of this file.
6856 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
6859 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6861 * src/WorkArea.C (work_area_handler): call BufferView::enterView
6862 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
6864 * src/BufferView.C (enterView): new func
6865 (leaveView): new func
6867 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
6869 (leaveView): new func, undefines xterm cursor when approp.
6871 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
6872 (AllowInput): delete the Workarea cursor handling from this func.
6874 * src/Painter.C (underline): draw a slimer underline in most cases.
6876 * src/lyx_main.C (error_handler): use extern "C"
6878 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6880 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
6881 sent directly to me.
6883 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
6884 to the list by Dekel.
6886 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
6889 * src/bufferview_funcs.[Ch]: two new files, moved several of the
6890 methods from lyx_cb.here.
6892 * src/lyx_cb.C: in addition to the above; removed input_prohibited
6895 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6897 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
6898 instead of using current_view directly.
6900 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
6902 * src/LyXAction.C (init): add the paragraph-spacing command.
6904 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
6906 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
6908 * src/lyx_cb.C (CurrentState): output a string when the spacing is
6909 different from the documents.
6911 * src/text.C (SetHeightOfRow): take paragraph spacing into
6912 account, paragraph spacing takes precedence over buffer spacing
6913 (GetVisibleRow): ditto
6915 * src/paragraph.C (writeFile): output the spacing parameter too.
6916 (validate): set the correct features if spacing is used in the
6918 (Clear): set spacing to default
6919 (MakeSameLayout): spacing too
6920 (HasSameLayout): spacing too
6921 (SetLayout): spacing too
6922 (TeXOnePar): output the spacing commands
6924 * src/lyxparagraph.h: added a spacing variable for use with
6925 per-paragraph spacing.
6927 * src/Spacing.h: add a Default spacing and a method to check if
6928 the current spacing is default. also added an operator==
6930 * src/text2.C (DeleteEmptyParagraphMechanism): added a
6933 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6935 * src/lyxserver.C (callback): fix dispatch of functions
6937 * src/insets/insetlatexaccent.C (checkContents): turn bogus
6938 printf() into lyxerr call.
6940 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
6943 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
6944 "Table" to "Table Box", "Float" to "Floating Material"; deletes
6945 the "Float" from each of the subitems.
6946 (ShowHelpMenu): add entry for "FAQ" and "TOC".
6948 * src/support/DebugStream.h: add an #ifdef to work around a gcc
6949 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
6950 documented the change so that the workaround can be nuked later.
6952 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
6955 * src/lyxlex_pimpl.C (next): do not re-declare the default value
6957 * src/buffer.C (getLatexName): ditto
6958 (setReadonly): ditto
6960 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6962 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
6963 avoid some uses of current_view. Added also a bufferParams()
6964 method to get at this.
6966 * src/lyxtext.h: changed params->buffer and paramters->bparams.
6968 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6970 * src/lyxparagraph.[Ch]: removed
6971 operator<(LyXParagraph::InsetTable..., added a struct matchIT
6972 with operators used by lower_bound and
6973 upper_bound in InsetTable's
6974 Make struct InsetTable private again. Used matchpos.
6976 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
6978 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
6979 document, the language of existing text is changed (unless the
6980 document is multi-lingual)
6982 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
6984 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
6986 * A lot of files: A rewrite of the Right-to-Left support.
6988 2000-04-10 Juergen Vigna <jug@sad.it>
6990 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
6991 misplaced cursor when inset in inset is locked.
6993 * src/insets/insettext.C (LocalDispatch): small fix so that a
6994 BREAKLINE is not inserted if we don't permit it with autBreakRows.
6996 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
6997 footnote font should be decreased in size twice when displaying.
6999 * src/insets/insettext.C (GetDrawFont): inserted this function as
7000 the drawing-font may differ from the real paragraph font.
7002 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
7003 insets (inset in inset!).
7005 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
7006 function here because we don't want footnotes inside footnotes.
7008 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
7010 (init): now set the inset_owner in paragraph.C
7011 (LocalDispatch): added some resetPos() in the right position
7014 (pasteSelection): changed to use the new CutAndPaste-Class.
7016 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
7017 which tells if it is allowed to insert another inset inside this one.
7019 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
7020 SwitchLayoutsBetweenClasses.
7022 * src/text2.C (InsertInset): checking of the new paragraph-function
7024 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
7025 is not needed anymore here!
7028 (PasteSelection): redone (also with #ifdef) so that now this uses
7029 the CutAndPaste-Class.
7030 (SwitchLayoutsBetweenClasses): removed here and implemented in the
7033 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
7034 from/to text/insets.
7036 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
7037 so that the paragraph knows if it is inside an (text)-inset.
7038 (InsertFromMinibuffer): changed return-value to bool as now it
7039 may happen that an inset is not inserted in the paragraph.
7040 (InsertInsetAllowed): this checks if it is allowed to insert an
7041 inset in this paragraph.
7043 (BreakParagraphConservative):
7044 (BreakParagraph) : small change for the above change of the return
7045 value of InsertFromMinibuffer.
7047 * src/lyxparagraph.h: added inset_owner and the functions to handle
7048 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
7050 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7052 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
7053 functions from BufferView to BufferView::Pimpl to ease maintence.
7055 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
7056 correctly. Also use SetCursorIntern instead of SetCursor.
7058 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
7061 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7063 * src/WorkArea.C (belowMouse): manually implement below mouse.
7065 * src/*: Add "explicit" on several constructors, I added probably
7066 some unneeded ones. A couple of changes to code because of this.
7068 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
7069 implementation and private parts from the users of BufferView. Not
7072 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
7073 implementation and private parts from the users of LyXLex. Not
7076 * src/BufferView_pimpl.[Ch]: new files
7078 * src/lyxlex_pimpl.[Ch]: new files
7080 * src/LyXView.[Ch]: some inline functions move out-of-line
7082 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7084 * src/lyxparagraph.h: make struct InsetTable public.
7086 * src/support/lyxstring.h: change lyxstring::difference_type to be
7087 ptrdiff_t. Add std:: modifiers to streams.
7089 * src/font.C: include the <cctype> header, for islower() and
7092 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7094 * src/font.[Ch]: new files. Contains the metric functions for
7095 fonts, takes a LyXFont as parameter. Better separation of concepts.
7097 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
7098 changes because of this.
7100 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
7102 * src/*: compile with -Winline and move functions that don't
7105 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
7108 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7110 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
7111 (various files changed because of this)
7113 * src/Painter.C (text): fixed the drawing of smallcaps.
7115 * src/lyxfont.[Ch] (drawText): removed unused member func.
7118 * src/*.C: added needed "using" statements and "std::" qualifiers.
7120 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7122 * src/*.h: removed all use of "using" from header files use
7123 qualifier std:: instead.
7125 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7127 * src/text.C (Backspace): some additional cleanups (we already
7128 know whether cursor.pos is 0 or not).
7130 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
7131 automake does not provide one).
7133 * src/bmtable.h: replace C++ comments with C comments.
7135 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
7137 * src/screen.C (ShowCursor): Change the shape of the cursor if
7138 the current language is not equal to the language of the document.
7139 (If the cursor change its shape unexpectedly, then you've found a bug)
7141 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
7144 * src/insets/insetnumber.[Ch]: New files.
7146 * src/LyXAction.C (init)
7147 * src/lyxfunc.C (dispatch): Add command number-inset-insert
7150 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
7152 * src/lyxparagraph.h
7153 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
7154 (the vector is kept sorted).
7156 * src/text.C (GetVisibleRow): Draw selection correctly when there
7157 is both LTR and RTL text.
7159 * src/paragraph.C (Clone): Use the assignment operator for cloning,
7160 which is much faster.
7162 * src/text.C (GetVisibleRow and other): Do not draw the last space
7163 in a row if the direction of the last letter is not equal to the
7164 direction of the paragraph.
7166 * src/lyxfont.C (latexWriteStartChanges):
7167 Check that font language is not equal to basefont language.
7168 (latexWriteEndChanges): ditto
7170 * src/lyx_cb.C (StyleReset): Don't change the language while using
7171 the font-default command.
7173 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
7174 empty paragraph before a footnote.
7176 * src/insets/insetcommand.C (draw): Increase x correctly.
7178 * src/screen.C (ShowCursor): Change cursor shape if
7179 current language != document language.
7181 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
7183 2000-03-31 Juergen Vigna <jug@sad.it>
7185 * src/paragraph.C (GetInset): commented out text[pos] = ' '
7186 (Clone): changed mode how the paragraph-data is copied to the
7187 new clone-paragraph.
7189 * src/lyxfunc.C (Dispatch): fixed small problem when calling
7190 GetInset(pos) with no inset anymore there (in inset UNDO)
7192 * src/insets/insetcommand.C (draw): small fix as here x is
7193 incremented not as much as width() returns (2 before, 2 behind = 4)
7195 2000-03-30 Juergen Vigna <jug@sad.it>
7197 * src/insets/insettext.C (InsetText): small fix in initialize
7198 widthOffset (should not be done in the init() function)
7200 2000-03-29 Amir Karger <karger@lyx.org>
7202 * lib/examples/it_ItemizeBullets.lyx: translation by
7205 * Implemented \textasciitilde and fixed a tiny bug in reLyX
7207 2000-03-29 Juergen Vigna <jug@sad.it>
7209 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
7211 * src/insets/insetfoot.C (Clone): small change as for the below
7212 new init function in the text-inset
7214 * src/insets/insettext.C (init): new function as I've seen that
7215 clone did not copy the Paragraph-Data!
7216 (LocalDispatch): Added code so that now we have some sort of Undo
7217 functionality (well actually we HAVE Undo ;)
7219 * src/text.C (Backspace): Small fix for the a | a Backspace problem
7221 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
7223 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
7226 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7228 * src/main.C: added a runtime check that verifies that the xforms
7229 header used when building LyX and the library used when running
7230 LyX match. Exit with a message if they don't match. This is a
7231 version number check only.
7233 * src/buffer.C (save): Don't allocate memory on the heap for
7234 struct utimbuf times.
7236 * *: some using changes, use iosfwd instead of the real headers.
7238 * src/lyxfont.C use char const * instead of string for the static
7239 strings. Rewrite some functions to use sstream.
7241 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7243 * src/text.C (Backspace): hopefully fix the dreaded backaspace
7246 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7248 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
7249 of Geodesy (from Martin Vermeer)
7251 * lib/layouts/svjour.inc: include file for the Springer svjour
7252 class. It can be used to support journals other than JoG.
7254 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
7255 Miskiewicz <misiek@pld.org.pl>)
7256 * lib/reLyX/Makefile.am: ditto.
7258 2000-03-27 Juergen Vigna <jug@sad.it>
7260 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
7261 also some modifications with operations on selected text.
7263 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
7264 problems with clicking on insets (last famous words ;)
7266 * src/insets/insetcommand.C (draw):
7267 (width): Changed to have a bit of space before and after the inset so
7268 that the blinking cursor can be seen (otherwise it was hidden)
7270 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7272 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
7273 would not be added to the link list when an installed gettext (not
7274 part of libc) is found.
7276 2000-03-24 Juergen Vigna <jug@sad.it>
7278 * src/insets/insetcollapsable.C (Edit):
7279 * src/mathed/formula.C (InsetButtonRelease):
7280 (InsetButtonPress): fixed for new handling of ButtonPress/Release
7283 * src/BufferView.C (workAreaButtonPress):
7284 (workAreaButtonRelease):
7285 (checkInsetHit): Finally fixed the clicking on insets be handled
7288 * src/insets/insetert.C (Edit): inserted this call so that ERT
7289 insets work always with LaTeX-font
7291 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7293 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
7294 caused lyx to startup with no GUI in place, causing in a crash
7295 upon startup when called with arguments.
7297 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7299 * src/FontLoader.C: better initialization of dummyXFontStruct.
7301 2000-03-20 José Abílio Matos <jamatos@lyx.org>
7303 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
7304 for linuxdoc and docbook import and export format options.
7306 * lib/lyxrc.example Example of default values for the previous flags.
7308 * src/lyx_cb.C Use those flags instead of the hardwired values for
7309 linuxdoc and docbook export.
7311 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
7314 * src/menus.C Added menus entries for the new import/exports formats.
7316 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7318 * src/lyxrc.*: Added support for running without Gui
7321 * src/FontLoader.C: sensible defaults if no fonts are needed
7323 * src/lyx_cb.C: New function ShowMessage (writes either to the
7324 minibuffer or cout in case of no gui
7325 New function AskOverwrite for common stuff
7326 Consequently various changes to call these functions
7328 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
7329 wild guess at sensible screen resolution when having no gui
7331 * src/lyxfont.C: no gui, no fonts... set some defaults
7333 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7335 * src/LColor.C: made the command inset background a bit lighter.
7337 2000-03-20 Hartmut Goebel <goebel@noris.net>
7339 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
7340 stdstruct.inc. Koma-Script added some title elements which
7341 otherwise have been listed below "bibliography". This split allows
7342 adding title elements to where they belong.
7344 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
7345 define the additional title elements and then include
7348 * many other layout files: changed to include stdtitle.inc just
7349 before stdstruct.inc.
7351 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
7353 * src/buffer.C: (save) Added the option to store all backup files
7354 in a single directory
7356 * src/lyxrc.[Ch]: Added variable \backupdir_path
7358 * lib/lyxrc.example: Added descriptions of recently added variables
7360 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
7361 bibtex inset, not closing the bibtex popup when deleting the inset)
7363 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7365 * src/lyx_cb.C: add a couple using directives.
7367 2000-03-17 José Abílio Matos <jamatos@lyx.org>
7368 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
7369 import based on the filename.
7371 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
7372 file would be imported at start, if the filename where of a sgml file.
7374 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
7376 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
7378 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
7379 * src/lyxfont.h Replaced the member variable bits.direction by the
7380 member variable lang. Made many changes in other files.
7381 This allows having a multi-lingual document
7383 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
7384 that change the current language to <l>.
7385 Removed the command "font-rtl"
7387 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
7388 format for Hebrew documents)
7390 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
7391 When auto_mathmode is "true", pressing a digit key in normal mode
7392 will cause entering into mathmode.
7393 If auto_mathmode is "rtl" then this behavior will be active only
7394 when writing right-to-left text.
7396 * src/text2.C (InsertStringA) The string is inserted using the
7399 * src/paragraph.C (GetEndLabel) Gives a correct result for
7400 footnote paragraphs.
7402 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
7404 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7406 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
7407 front of PasteParagraph. Never insert a ' '. This should at least
7408 fix some cause for the segfaults that we have been experiencing,
7409 it also fixes backspace behaviour slightly. (Phu!)
7411 * src/support/lstrings.C (compare_no_case): some change to make it
7412 compile with gcc 2.95.2 and stdlibc++-v3
7414 * src/text2.C (MeltFootnoteEnvironment): change type o
7415 first_footnote_par_is_not_empty to bool.
7417 * src/lyxparagraph.h: make text private. Changes in other files
7419 (fitToSize): new function
7420 (setContentsFromPar): new function
7421 (clearContents): new function
7422 (SetChar): new function
7424 * src/paragraph.C (readSimpleWholeFile): deleted.
7426 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
7427 the file, just use a simple string instead. Also read the file in
7428 a more maintainable manner.
7430 * src/text2.C (InsertStringA): deleted.
7431 (InsertStringB): deleted.
7433 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7435 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
7436 RedoParagraphs from the doublespace handling part, just set status
7437 to NEED_MORE_REFRESH. Also don't update cursor position (should be
7438 done, but perhaps not like this.)
7440 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7442 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
7443 character when inserting an inset.
7445 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7447 * src/bufferparams.C (readLanguage): now takes "default" into
7450 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
7451 also initialize the toplevel_keymap with the default bindings from
7454 * src/buffer.C (Buffer): remove lyxrc from the parameters.
7456 * all files using lyxrc: have lyxrc as a real variable and not a
7457 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
7460 * src/lyxrc.C: remove double call to defaultKeyBindings
7462 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
7463 toolbar defauls using lyxlex. Remove enums, structs, functions
7466 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
7467 toolbar defaults. Also store default keybindings in a map.
7469 * src/ToolbarDefaults.[Ch]: New file. This class is used for
7470 storing the toolbar defaults without any xforms dependencies.
7472 * src/insets/figinset.C: patch posted to list by Andre Poenitz
7473 applied. Changed to use iterators.
7475 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7477 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
7478 systems that don't have LINGUAS set to begin with.
7480 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7482 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
7483 the list by Dekel Tsur.
7485 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7487 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
7488 * src/insets/form_graphics.C: ditto.
7490 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
7492 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7494 * src/bufferparams.C (readLanguage): use the new language map
7496 * src/intl.C (InitKeyMapper): use the new language map
7498 * src/lyx_gui.C (create_forms): use the new language map
7500 * src/language.[Ch]: New files. Used for holding the information
7501 about each language. Now! Use this new language map enhance it and
7502 make it really usable for our needs.
7504 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
7506 * screen.C (ShowCursor): Removed duplicate code.
7507 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
7508 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
7510 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
7513 * src/text.C Added TransformChar method. Used for rendering Arabic
7514 text correctly (change the glyphs of the letter according to the
7515 position in the word)
7520 * src/lyxrc.C Added lyxrc command {language_command_begin,
7521 language_command_end,language_command_ltr,language_command_rtl,
7522 language_package} which allows the use of either arabtex or Omega
7525 * src/lyx_gui.C (init)
7527 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
7528 to use encoding for menu fonts which is different than the encoding
7531 * src/buffer.C (makeLaTeXFile): If params.language = "default",
7532 do not load the babel package.
7533 To write an English document with Hebrew/Arabic, change the document
7534 language to "english".
7536 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
7537 (alphaCounter): changed to return char
7538 (loweralphaCounter, hebrewCounter, romanCounter): New functions
7540 * lib/lyxrc.example Added examples for Hebrew/Arabic
7543 * src/layout.C Added layout command endlabeltype
7545 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
7547 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
7549 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7551 * src/mathed/math_delim.C (search_deco): return a
7552 math_deco_struct* instead of index.
7554 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7556 * All files with a USE_OSTREAM_ONLY within: removed all code that
7557 was unused when USE_OSTREAM_ONLY is defined.
7559 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
7560 of any less. Removed header and using.
7562 * src/text.C (GetVisibleRow): draw the string "Page Break
7563 (top/bottom)" on screen when drawing a pagebreak line.
7565 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7567 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
7569 * src/mathed/math_macro.C (draw): do some cast magic.
7572 * src/mathed/math_defs.h: change byte* argument to byte const*.
7574 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
7576 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
7577 know it is right to return InsetFoot* too, but cxx does not like
7580 * src/insets/insetcollapsable.[Ch] (Clone): make const.
7582 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
7584 * src/mathed/math_delim.C: change == to proper assignment.
7586 2000-03-09 Juergen Vigna <jug@sad.it>
7588 * src/insets/insettext.C (setPos): fixed various cursor positioning
7589 problems (via mouse and cursor-keys)
7590 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
7591 inset (still a small display problem but it works ;)
7593 * src/insets/insetcollapsable.C (draw): added button_top_y and
7594 button_bottom_y to have correct values for clicking on the inset.
7596 * src/support/lyxalgo.h: commented out 'using std::less'
7598 2000-03-08 Juergen Vigna <jug@sad.it>
7600 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
7601 Button-Release event closes as it is alos the Release-Event
7604 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
7606 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7608 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
7609 can add multiple spaces in Scrap (literate programming) styles...
7610 which, by the way, is how I got hooked on LyX to begin with.
7612 * src/mathed/formula.C (Write): Added dummy variable to an
7613 inset::Latex() call.
7614 (Latex): Add free_spacing boolean to inset::Latex()
7616 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
7618 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
7619 virtual function to include the free_spacing boolean from
7620 the containing paragraph's style.
7622 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
7623 Added free_spacing boolean arg to match inset.h
7625 * src/insets/insettext.C, src/insets/insettext.h (Latex):
7626 Added free_spacing boolean arg to match inset.h
7628 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
7629 Added free_spacing boolean and made sure that if in a free_spacing
7630 paragraph, that we output normal space if there is a protected space.
7632 * src/insets/insetref.C, src/insets/insetref.h (Latex):
7633 Added free_spacing boolean arg to match inset.h
7635 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
7636 Added free_spacing boolean arg to match inset.h
7638 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
7639 Added free_spacing boolean arg to match inset.h
7641 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
7642 Added free_spacing boolean arg to match inset.h
7644 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
7645 Added free_spacing boolean arg to match inset.h
7647 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
7648 free_spacing boolean arg to match inset.h
7650 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
7651 Added free_spacing boolean arg to match inset.h
7653 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
7654 Added free_spacing boolean arg to match inset.h
7656 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
7657 Added free_spacing boolean arg to match inset.h
7659 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
7660 Added free_spacing boolean arg to match inset.h
7662 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
7663 Added free_spacing boolean arg to match inset.h
7665 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
7666 free_spacing boolean arg to match inset.h
7668 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
7669 free_spacing boolean arg to match inset.h
7671 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
7672 ignore free_spacing paragraphs. The user's spaces are left
7675 * src/text.C (InsertChar): Fixed the free_spacing layout
7676 attribute behavior. Now, if free_spacing is set, you can
7677 add multiple spaces in a paragraph with impunity (and they
7678 get output verbatim).
7679 (SelectSelectedWord): Added dummy argument to inset::Latex()
7682 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
7685 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
7686 paragraph layouts now only input a simple space instead.
7687 Special character insets don't make any sense in free-spacing
7690 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
7691 hard-spaces in the *input* file to simple spaces if the layout
7692 is free-spacing. This converts old files which had to have
7693 hard-spaces in free-spacing layouts where a simple space was
7695 (writeFileAscii): Added free_spacing check to pass to the newly
7696 reworked inset::Latex(...) methods. The inset::Latex() code
7697 ensures that hard-spaces in free-spacing paragraphs get output
7698 as spaces (rather than "~").
7700 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7702 * src/mathed/math_delim.C (draw): draw the empty placeholder
7703 delims with a onoffdash line.
7704 (struct math_deco_compare): struct that holds the "functors" used
7705 for the sort and the binary search in math_deco_table.
7706 (class init_deco_table): class used for initial sort of the
7708 (search_deco): use lower_bound to do a binary search in the
7711 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7713 * src/lyxrc.C: a small secret thingie...
7715 * src/lyxlex.C (printTable): changed to take a ostream as paramter
7716 and to not flush the stream as often as it used to.
7718 * src/support/lyxalgo.h: new file
7719 (sorted): template function used for checking if a sequence is
7720 sorted or not. Two versions with and without user supplied
7721 compare. Uses same compare as std::sort.
7723 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
7724 it and give warning on lyxerr.
7726 (struct compare_tags): struct with function operators used for
7727 checking if sorted, sorting and lower_bound.
7728 (search_kw): use lower_bound instead of manually implemented
7731 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7733 * src/insets/insetcollapsable.h: fix Clone() declaration.
7734 * src/insets/insetfoot.h: ditto.
7736 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
7738 2000-03-08 Juergen Vigna <jug@sad.it>
7740 * src/insets/lyxinset.h: added owner call which tells us if
7741 this inset is inside another inset. Changed also the return-type
7742 of Editable to an enum so it tells clearer what the return-value is.
7744 * src/insets/insettext.C (computeTextRows): fixed computing of
7745 textinsets which split automatically on more rows.
7747 * src/insets/insetert.[Ch]: changed this to be of BaseType
7750 * src/insets/insetfoot.[Ch]: added footnote inset
7752 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
7753 collapsable insets (like footnote, ert, ...)
7755 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7757 * src/lyxdraw.h: remvoe file
7759 * src/lyxdraw.C: remove file
7761 * src/insets/insettext.C: added <algorithm>.
7763 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7765 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
7766 (matrix_cb): case MM_OK use string stream
7768 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
7771 * src/mathed/math_macro.C (draw): use string stream
7772 (Metrics): use string stream
7774 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
7775 directly to the ostream.
7777 * src/vspace.C (asString): use string stream.
7778 (asString): use string stream
7779 (asLatexString): use string stream
7781 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
7782 setting Spacing::Other.
7784 * src/LaTeXFeatures.C (getPackages): use string stream instead of
7785 sprintf when creating the stretch vale.
7787 * src/text2.C (alphaCounter): changed to return a string and to
7788 not use a static variable internally. Also fixed a one-off bug.
7789 (SetCounter): changed the drawing of the labels to use string
7790 streams instead of sprintf.
7792 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
7793 manipulator to use a scheme that does not require library support.
7794 This is also the way it is done in the new GNU libstdc++. Should
7795 work with DEC cxx now.
7797 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7799 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
7800 end. This fixes a bug.
7802 * src/mathed (all files concerned with file writing): apply the
7803 USE_OSTREAM_ONLY changes to mathed too.
7805 * src/support/DebugStream.h: make the constructor explicit.
7807 * src/lyxfont.C (latexWriteStartChanges): small bug related to
7808 count and ostream squashed.
7810 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7812 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
7814 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
7815 ostringstream uses STL strings, and we might not.
7817 * src/insets/insetspecialchar.C: add using directive.
7818 * src/insets/insettext.C: ditto.
7820 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7822 * lib/layouts/seminar.layout: feeble attempt at a layout for
7823 seminar.cls, far from completet and could really use some looking
7824 at from people used to write layout files.
7826 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
7827 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
7828 a lot nicer and works nicely with ostreams.
7830 * src/mathed/formula.C (draw): a slightly different solution that
7831 the one posted to the list, but I think this one works too. (font
7832 size wrong in headers.)
7834 * src/insets/insettext.C (computeTextRows): some fiddling on
7835 Jürgens turf, added some comments that he should read.
7837 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
7838 used and it gave compiler warnings.
7839 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
7842 * src/lyx_gui.C (create_forms): do the right thing when
7843 show_banner is true/false.
7845 * src/lyx_cb.C (TimerCB): no need to close or do anything if
7846 show_banner is false.
7848 * most file writing files: Now use iostreams to do almost all of
7849 the writing. Also instead of passing string &, we now use
7850 stringstreams. mathed output is still not adapted to iostreams.
7851 This change can be turned off by commenting out all the occurences
7852 of the "#define USE_OSTREAM_ONLY 1" lines.
7854 * src/WorkArea.C (createPixmap): don't output debug messages.
7855 (WorkArea): don't output debug messages.
7857 * lib/lyxrc.example: added a comment about the new variable
7860 * development/Code_rules/Rules: Added some more commente about how
7861 to build class interfaces and on how better encapsulation can be
7864 2000-03-03 Juergen Vigna <jug@sad.it>
7866 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
7867 automatically with the width of the LyX-Window
7869 * src/insets/insettext.C (computeTextRows): fixed update bug in
7870 displaying text-insets (scrollvalues where not initialized!)
7872 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7874 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
7875 id in the check of the result from lower_bound is not enough since
7876 lower_bound can return last too, and then res->id will not be a
7879 * all insets and some code that use them: I have conditionalized
7880 removed the Latex(string & out, ...) this means that only the
7881 Latex(ostream &, ...) will be used. This is a work in progress to
7882 move towards using streams for all output of files.
7884 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
7887 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7889 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
7890 routine (this fixes bug where greek letters were surrounded by too
7893 * src/support/filetools.C (findtexfile): change a bit the search
7894 algorithm, to fix bug introduced in 1.1.4. Note that --format is
7895 no longer passed to kpsewhich, we may have to change that later.
7897 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
7898 warning options to avoid problems with X header files (from Angus
7900 * acinclude.m4: regenerated.
7902 2000-03-02 Juergen Vigna <jug@sad.it>
7904 * src/insets/insettext.C (WriteParagraphData): Using the
7905 par->writeFile() function for writing paragraph-data.
7906 (Read): Using buffer->parseSingleLyXformat2Token()-function
7907 for parsing paragraph data!
7909 * src/buffer.C (readLyXformat2): removed all parse data and using
7910 the new parseSingleLyXformat2Token()-function.
7911 (parseSingleLyXformat2Token): added this function to parse (read)
7912 lyx-file-format (this is called also from text-insets now!)
7914 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7916 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
7919 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
7920 directly instead of going through a func. One very bad thing: a
7921 static LyXFindReplace, but I don't know where to place it.
7923 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
7924 string instead of char[]. Also changed to static.
7925 (GetSelectionOrWordAtCursor): changed to static inline
7926 (SetSelectionOverLenChars): ditto.
7928 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
7929 current_view and global variables. both classes has changed names
7930 and LyXFindReplace is not inherited from SearchForm.
7932 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
7933 fl_form_search form.
7935 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
7937 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7939 * lib/bind/*.bind: make sure 'buffer-previous' function is not
7940 bound (from Kayvan).
7942 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
7944 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
7946 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7948 * some things that I should comment but the local pub says head to
7951 * comment out all code that belongs to the Roff code for Ascii
7952 export of tables. (this is unused)
7954 * src/LyXView.C: use correct type for global variable
7955 current_layout. (LyXTextClass::size_type)
7957 * some code to get the new insetgraphics closer to working I'd be
7958 grateful for any help.
7960 * src/BufferView2.C (insertInset): use the return type of
7961 NumberOfLayout properly. (also changes in other files)
7963 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
7964 this as a test. I want to know what breaks because of this.
7966 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
7968 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7970 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
7971 to use a \makebox in the label, this allows proper justification
7972 with out using protected spaces or multiple hfills. Now it is
7973 "label" for left justified, "\hfill label\hfill" for center, and
7974 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
7975 should be changed accordingly.
7977 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7979 * src/lyxtext.h: change SetLayout() to take a
7980 LyXTextClass::size_type instead of a char (when there is more than
7981 127 layouts in a class); also change type of copylayouttype.
7982 * src/text2.C (SetLayout): ditto.
7983 * src/LyXView.C (updateLayoutChoice): ditto.
7985 * src/LaTeX.C (scanLogFile): errors where the line number was not
7986 given just after the '!'-line were ignored (from Dekel Tsur).
7988 * lib/lyxrc.example: fix description of \date_insert_format
7990 * lib/layouts/llncs.layout: new layout, contributed by Martin
7993 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7995 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
7996 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
7997 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
7998 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
7999 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
8000 paragraph.C, text.C, text2.C)
8002 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8004 * src/insets/insettext.C (LocalDispatch): remove extra break
8007 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
8008 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
8010 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
8011 * src/insets/insettext.[Ch] (GetCursorPos): ditto
8013 * src/insets/insetbib.h: move InsetBibkey::Holder and
8014 InsetCitation::Holder in public space.
8016 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8018 * src/insets/insettext.h: small change to get the new files from
8019 Juergen to compile (use "string", not "class string").
8021 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
8022 const & as parameter to LocalDispatch, use LyXFont const & as
8023 paramter to some other func. This also had impacto on lyxinsets.h
8024 and the two mathed insets.
8026 2000-02-24 Juergen Vigna <jug@sad.it>
8029 * src/commandtags.h:
8031 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
8035 * src/BufferView2.C: added/updated code for various inset-functions
8037 * src/insets/insetert.[Ch]: added implementation of InsetERT
8039 * src/insets/insettext.[Ch]: added implementation of InsetText
8041 * src/insets/inset.C (Edit): added "unsigned int button" parameter
8042 (draw): added preliminary code for inset scrolling not finshed yet
8044 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
8045 as it is in lyxfunc.C now
8047 * src/insets/lyxinset.h: Added functions for text-insets
8049 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8051 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
8052 BufferView and reimplement the list as a queue put inside its own
8055 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
8057 * several files: use the new interface to the "updateinsetlist"
8059 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
8061 (work_area_handler): call BufferView::trippleClick on trippleclick.
8063 * src/BufferView.C (doubleClick): new function, selects word on
8065 (trippleClick): new function, selects line on trippleclick.
8067 2000-02-22 Allan Rae <rae@lyx.org>
8069 * lib/bind/xemacs.bind: buffer-previous not supported
8071 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8073 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
8076 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8078 * src/bufferlist.C: get rid of current_view from this file
8080 * src/spellchecker.C: get rid of current_view from this file
8082 * src/vspace.C: get rid of current_view from this file
8083 (inPixels): added BufferView parameter for this func
8084 (asLatexCommand): added a BufferParams for this func
8086 * src/text.C src/text2.C: get rid of current_view from these
8089 * src/lyxfont.C (getFontDirection): move this function here from
8092 * src/bufferparams.C (getDocumentDirection): move this function
8095 * src/paragraph.C (getParDirection): move this function here from
8097 (getLetterDirection): ditto
8099 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
8101 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
8102 resize due to wrong pixmap beeing used. Also took the opurtunity
8103 to make the LyXScreen stateless on regard to WorkArea and some
8104 general cleanup in the same files.
8106 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8108 * src/Makefile.am: add missing direction.h
8110 * src/PainterBase.h: made the width functions const.
8112 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
8115 * src/insets/insetcommand.C (draw): draw Editable as buttons.
8117 * src/insets/insetlatexaccent.C (draw): make the accents draw
8118 better, at present this will only work well with iso8859-1.
8120 * several files: remove the old drawing code, now we use the new
8123 * several files: remove support for mono_video, reverse_video and
8126 2000-02-17 Juergen Vigna <jug@sad.it>
8128 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
8129 int ** as we have to return the pointer, otherwise we have only
8130 NULL pointers in the returning function.
8132 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8134 * src/LaTeX.C (operator()): quote file name when running latex.
8136 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8138 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
8139 (bubble tip), this removes our special handling of this.
8141 * Remove all code that is unused now that we have the new
8142 workarea. (Code that are not active when NEW_WA is defined.)
8144 * Make the uses of XSync not conditionalized on define USE_XSYNC.
8146 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8148 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
8149 nonexisting layout; correctly redirect obsoleted layouts.
8151 * lib/lyxrc.example: document \view_dvi_paper_option
8153 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
8156 * src/lyx_cb.C (RunScript): handle $$FName for command names.
8157 (PreviewDVI): handle the view_dvi_paper_option variable.
8158 [Both from Roland Krause]
8160 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8162 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
8163 char const *, int, LyXFont)
8164 (text(int, int, string, LyXFont)): ditto
8166 * src/text.C (InsertCharInTable): attempt to fix the double-space
8167 feature in tables too.
8168 (BackspaceInTable): ditto.
8169 (GetVisibleRow): make bottom pagebreak line be a onoff line.
8171 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8173 * src/text2.C (owner): only complain if owner_ is set and bv != 0
8175 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
8176 newly found text in textcache to this.
8177 (buffer): set the owner of the text put into the textcache to 0
8179 * src/insets/figinset.C (draw): fixed the drawing of figures with
8182 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
8183 drawing of mathframe, hfills, protected space, table lines. I have
8184 now no outstanding drawing problems with the new Painter code.
8186 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8188 * src/PainterBase.C (ellipse, circle): do not specify the default
8191 * src/LColor.h: add using directive.
8193 * src/Painter.[Ch]: change return type of methods from Painter& to
8194 PainterBase&. Add a using directive.
8196 * src/WorkArea.C: wrap xforms callbacks in C functions
8199 * lib/layouts/foils.layout: font fix and simplifications from Carl
8202 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8204 * a lot of files: The Painter, LColor and WorkArea from the old
8205 devel branch has been ported to lyx-devel. Some new files and a
8206 lot of #ifdeffed code. The new workarea is enabled by default, but
8207 if you want to test the new Painter and LColor you have to compile
8208 with USE_PAINTER defined (do this in config.h f.ex.) There are
8209 still some rought edges, and I'd like some help to clear those
8210 out. It looks stable (loads and displays the Userguide very well).
8213 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8215 * src/buffer.C (pop_tag): revert to the previous implementation
8216 (use a global variable for both loops).
8218 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
8220 * src/lyxrc.C (LyXRC): change slightly default date format.
8222 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
8223 there is an English text with a footnote that starts with a Hebrew
8224 paragraph, or vice versa.
8225 (TeXFootnote): ditto.
8227 * src/text.C (LeftMargin): allow for negative values for
8228 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
8231 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
8232 for input encoding (cyrillic)
8234 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8236 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
8239 * src/toolbar.C (set): ditto
8240 * src/insets/insetbib.C (create_form_citation_form): ditto
8242 * lib/CREDITS: added Dekel Tsur.
8244 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
8245 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
8246 hebrew supports files from Dekel Tsur.
8248 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
8249 <tzafrir@technion.ac.il>
8251 * src/lyxrc.C: put \date_insert_format at the right place.
8253 * src/buffer.C (makeLaTeXFile): fix the handling of
8254 BufferParams::sides when writing out latex files.
8256 * src/BufferView2.C: add a "using" directive.
8258 * src/support/lyxsum.C (sum): when we use lyxstring,
8259 ostringstream::str needs an additional .c_str().
8261 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8263 * src/support/filetools.C (ChangeExtension): patch from Etienne
8266 * src/TextCache.C (show): remove const_cast and make second
8267 parameter non-const LyXText *.
8269 * src/TextCache.h: use non const LyXText in show.
8271 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
8274 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8276 * src/support/lyxsum.C: rework to be more flexible.
8278 * several places: don't check if a pointer is 0 if you are going
8281 * src/text.C: remove some dead code.
8283 * src/insets/figinset.C: remove some dead code
8285 * src/buffer.C: move the BufferView funcs to BufferView2.C
8286 remove all support for insetlatexdel
8287 remove support for oldpapersize stuff
8288 made some member funcs const
8290 * src/kbmap.C: use a std::list to store the bindings in.
8292 * src/BufferView2.C: new file
8294 * src/kbsequence.[Ch]: new files
8296 * src/LyXAction.C + others: remove all trace of buffer-previous
8298 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
8299 only have one copy in the binary of this table.
8301 * hebrew patch: moved some functions from LyXText to more
8302 appropriate places. (LyXParagraph, BufferParams, LyXFont)
8304 * several files: remove support for XForms older than 0.88
8306 remove some #if 0 #endif code
8308 * src/TextCache.[Ch]: new file. Holds the textcache.
8310 * src/BufferView.C: changes to use the new TextCache interface.
8311 (waitForX): remove the now unused code.
8313 * src/BackStack.h: remove some commented code
8315 * lib/bind/emacs.bind: remove binding for buffer-previous
8317 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8319 * applied the hebrew patch.
8321 * src/lyxrow.h: make sure that all Row variables are initialized.
8323 * src/text2.C (TextHandleUndo): comment out a delete, this might
8324 introduce a memory leak, but should also help us to not try to
8325 read freed memory. We need to look at this one.
8327 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
8328 (LyXParagraph): initalize footnotekind.
8330 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
8331 forgot this when applying the patch. Please heed the warnings.
8333 * src/BufferView.C (buffer): a fix for the buffer-reload problem
8334 (aka. reformat problem)
8336 * src/bufferlist.C (exists): made const, and use const_iterator
8337 (isLoaded): new func.
8338 (release): use std::find to find the correct buffer.
8340 * src/bufferlist.h: made getState a const func.
8341 made empty a const func.
8342 made exists a const func.
8345 2000-02-01 Juergen Vigna <jug@sad.it>
8347 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
8349 * po/it.po: updated a bit the italian po file and also changed the
8350 'file nuovo' for newfile to 'filenuovo' without a space, this did
8353 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
8354 for the new insert_date command.
8356 * src/lyxfunc.C (Dispatch): added support for a insert_date function
8357 from jdblair, to insert a date into the current text conforming to
8358 a strftime format (for now only considering the locale-set and not
8359 the document-language).
8361 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8363 * src/lyxfont.C (textWidth): hopefully better fix for the Array
8364 Bounds Read error seen by purify. The problem was that islower is
8365 a macros which takes an unsigned char and uses it as an index for
8366 in array of characters properties (and is thus subject to the
8370 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
8371 correctly the paper sides radio buttons.
8372 (UpdateDocumentButtons): ditto.
8374 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8376 * src/kbmap.C (getsym + others): change to return unsigned int,
8377 returning a long can give problems on 64 bit systems. (I assume
8378 that int is 32bit on 64bit systems)
8380 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8382 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
8383 LyXLookupString to be zero-terminated. Really fixes problems seen
8386 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8388 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
8389 write a (char*)0 to the lyxerr stream.
8391 * src/lastfiles.C: move algorithm before the using statemets.
8393 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8395 * src/lastfiles.C: move using directives in global scope (egcs 1.x
8396 complains otherwise).
8397 * src/table.C: ditto
8399 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
8402 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
8403 that I removed earlier... It is really needed.
8405 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
8407 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8409 * INSTALL: update xforms home page URL.
8411 * lib/configure.m4: fix a bug with unreadable layout files.
8413 * src/table.C (calculate_width_of_column): add "using std::max"
8416 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8418 * several files: marked several lines with "DEL LINE", this is
8419 lines that can be deleted without changing anything.
8420 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
8421 checks this anyway */
8424 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
8426 * src/DepTable.C (update): add a "+" at the end when the checksum
8427 is different. (debugging string only)
8429 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
8430 the next inset to not be displayed. This should also fix the list
8431 of labels in the "Insert Crossreference" dialog.
8433 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8435 * src/support/LSubstring.C (LSubstring): set pos to string::npos
8436 when regex was not found.
8438 * src/support/lstrings.C (lowercase): use handcoded transform always.
8441 * src/text.C (Delete): fixed the crash. cursor.par->prev and
8442 old_cursor.par->prev could be 0.
8444 * several files: changed post inc/dec to pre inc/dec
8446 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
8447 write the lastfiles to file.
8449 * src/BufferView.C (buffer): only show TextCache info when debugging
8451 (resizeCurrentBuffer): ditto
8452 (workAreaExpose): ditto
8454 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
8456 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
8458 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
8459 a bit better by removing the special case for \i and \j.
8461 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8463 * src/lyx_main.C (easyParse): remove test for bad comand line
8464 options, since this broke all xforms-related parsing.
8466 * src/kbmap.C (getsym): set return type to unsigned long, as
8467 declared in header. On an alpha, long is _not_ the same as int.
8469 * src/support/LOstream.h: add a "using std::flush;"
8471 * src/insets/figinset.C: ditto.
8473 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8475 * src/bufferlist.C (write): use blinding fast file copy instead of
8476 "a char at a time", now we are doing it the C++ way.
8478 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
8479 std::list<int> instead.
8480 (addpidwait): reflect move to std::list<int>
8481 (sigchldchecker): ditto
8483 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
8486 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
8487 that obviously was wrong...
8489 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
8490 c, this avoids warnings with purify and islower.
8492 * src/insets/figinset.C: rename struct queue to struct
8493 queue_element and rewrite to use a std::queue. gsqueue is now a
8494 std::queue<queue_element>
8495 (runqueue): reflect move to std::queue
8498 * src/support/lstrings.h (tostr): specialize for bool, otherwise
8499 we would get "1" "0" instead of "true" "false. Also make the tostr
8502 2000-01-21 Juergen Vigna <jug@sad.it>
8504 * src/buffer.C (writeFileAscii): Disabled code for special groff
8505 handling of tabulars till I fix this in table.C
8507 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8509 * src/support/mkdir.C (mkdir): change second argument of mkdir to
8511 * src/support/lyxlib.h: ditto.
8513 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8515 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
8516 and 'j' look better. This might fix the "macron" bug that has been
8519 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
8520 functions as one template function. Delete the old versions.
8522 * src/support/lyxsum.C: move using std::ifstream inside
8525 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
8528 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
8530 * src/mathed/formula.C: delete #include "bufferlist.h" never used
8532 * src/insets/figinset.C (InitFigures): use new instead of malloc
8533 to allocate memory for figures and bitmaps.
8534 (DoneFigures): use delete[] instead of free to deallocate memory
8535 for figures and bitmaps.
8536 (runqueue): use new to allocate
8537 (getfigdata): use new/delete[] instead of malloc/free
8538 (RegisterFigure): ditto
8540 * some files: moved some declarations closer to first use, small
8541 whitespace changes use preincrement instead of postincrement where
8542 it does not make a difference.
8544 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
8545 step on the way to use stl::containers for key maps.
8547 * src/bufferlist.h: add a typedef for const_iterator and const
8548 versions of begin and end.
8550 * src/bufferlist.[Ch]: change name of member variable _state to
8551 state_. (avoid reserved names)
8553 (getFileNames): returns the filenames of the buffers in a vector.
8555 * configure.in (ALL_LINGUAS): added ro
8557 * src/support/putenv.C: new file
8559 * src/support/mkdir.C: new file
8561 2000-01-20 Allan Rae <rae@lyx.org>
8563 * lib/layouts/IEEEtran.layout: Added several theorem environments
8565 * lib/templates/IEEEtran.lyx: Example theorem environments and a
8566 couple of minor additions.
8568 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
8569 (except for those in footnotes of course)
8571 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8573 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
8575 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
8576 std::sort and std::lower_bound instead of qsort and handwritten
8578 (struct compara): struct that holds the functors used by std::sort
8579 and std::lower_bound in MathedLookupBOP.
8581 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8583 * src/support/LAssert.h: do not do partial specialization. We do
8586 * src/support/lyxlib.h: note that lyx::getUserName() and
8587 lyx::date() are not in use right now. Should these be suppressed?
8589 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
8590 (makeLinuxDocFile): do not put date and user name in linuxdoc
8593 * src/support/lyxlib.h (kill): change first argument to long int,
8594 since that's what solaris uses.
8596 * src/support/kill.C (kill): fix declaration to match prototype.
8598 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
8599 actually check whether namespaces are supported. This is not what
8602 * src/support/lyxsum.C: add a using directive.
8604 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8606 * src/support/kill.C: if we have namespace support we don't have
8607 to include lyxlib.h.
8609 * src/support/lyxlib.h: use namespace lyx if supported.
8611 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8613 * src/support/date.C: new file
8615 * src/support/chdir.C: new file
8617 * src/support/getUserName.C: new file
8619 * src/support/getcwd.C: new file
8621 * src/support/abort.C: new file
8623 * src/support/kill.C: new file
8625 * src/support/lyxlib.h: moved all the functions in this file
8626 insede struct lyx. Added also kill and abort to this struct. This
8627 is a way to avoid the "kill is not defined in <csignal>", we make
8628 C++ wrappers for functions that are not ANSI C or ANSI C++.
8630 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
8631 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
8632 lyx it has been renamed to sum.
8634 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8636 * src/text.C: add using directives for std::min and std::max.
8638 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8640 * src/texrow.C (getIdFromRow): actually return something useful in
8641 id and pos. Hopefully fixes the bug with positionning of errorbox
8644 * src/lyx_main.C (easyParse): output an error and exit if an
8645 incorrect command line option has been given.
8647 * src/spellchecker.C (ispell_check_word): document a memory leak.
8649 * src/bufferlist.C (write): fix mismatched allocation/deletion,
8650 where a "struct utimbuf" is allocated with "new" and deleted with
8653 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8655 * src/text2.C (CutSelection): don't delete double spaces.
8656 (PasteSelection): ditto
8657 (CopySelection): ditto
8659 * src/text.C (Backspace): don't delete double spaces.
8661 * src/lyxlex.C (next): fix a bug that were only present with
8662 conformant std::istream::get to read comment lines, use
8663 std::istream::getline instead. This seems to fix the problem.
8665 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8667 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
8668 allowed to insert space before space" editing problem. Please read
8669 commends at the beginning of the function. Comments about usage
8672 * src/text.C (InsertChar): fix for the "not allowed to insert
8673 space before space" editing problem.
8675 * src/text2.C (DeleteEmptyParagraphMechanism): when
8676 IsEmptyTableRow can only return false this last "else if" will
8677 always be a no-op. Commented out.
8679 * src/text.C (RedoParagraph): As far as I can understand tmp
8680 cursor is not really needed.
8682 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
8683 present it could only return false anyway.
8684 (several functions): Did something not so smart...added a const
8685 specifier on a lot of methods.
8687 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
8688 and add a tmp->text.resize. The LyXParagraph constructor does the
8690 (BreakParagraphConservative): ditto
8692 * src/support/path.h (Path): add a define so that the wrong usage
8693 "Path("/tmp") will be flagged as a compilation error:
8694 "`unnamed_Path' undeclared (first use this function)"
8696 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8698 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
8699 which was bogus for several reasons.
8701 * src/LaTeX.C (scanAux): fix the regular expression used to scan
8705 * autogen.sh: do not use "type -path" (what's that anyway?).
8707 * src/support/filetools.C (findtexfile): remove extraneous space
8708 which caused a kpsewhich warning (at least with kpathsea version
8711 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8713 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
8715 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
8717 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
8719 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8721 * src/paragraph.C (BreakParagraph): do not reserve space on text
8722 if we don't need to (otherwise, if pos_end < pos, we end up
8723 reserving huge amounts of memory due to bad unsigned karma).
8724 (BreakParagraphConservative): ditto, although I have not seen
8725 evidence the bug can happen here.
8727 * src/lyxparagraph.h: add a using std::list.
8729 2000-01-11 Juergen Vigna <jug@sad.it>
8731 * src/menus.C (MenuDocu): output an Alert if the documentation-file
8734 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8736 * src/vc-backend.C (doVCCommand): change to be static and take one
8737 more parameter: the path to chdir too be fore executing the command.
8738 (retrive): new function equiv to "co -r"
8740 * src/bufferlist.C (loadLyXFile): implement the missing parts if
8741 file_not_found_hook is true.
8743 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
8745 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
8746 if a file is readwrite,readonly...anything else.
8748 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8750 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
8751 (CreatePostscript): name change from MenuRunDVIPS (or something)
8752 (PreviewPostscript): name change from MenuPreviewPS
8753 (PreviewDVI): name change from MenuPreviewDVI
8755 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
8756 \view_pdf_command., \pdf_to_ps_command
8758 * lib/configure.m4: added search for PDF viewer, and search for
8759 PDF to PS converter.
8760 (lyxrc.defaults output): add \pdflatex_command,
8761 \view_pdf_command and \pdf_to_ps_command.
8763 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
8765 * src/bufferlist.C (write): we don't use blocksize for anything so
8768 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8770 * src/support/block.h: disable operator T* (), since it causes
8771 problems with both compilers I tried. See comments in the file.
8773 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
8776 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
8777 variable LYX_DIR_10x to LYX_DIR_11x.
8779 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
8781 * INSTALL: document --with-lyxname.
8784 * configure.in: new configure flag --with-lyxname which allows to
8785 choose the name under which lyx is installed. Default is "lyx", of
8786 course. It used to be possible to do this with --program-suffix,
8787 but the later has in fact a different meaning for autoconf.
8789 * src/support/lstrings.h (lstrchr): reformat a bit.
8791 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
8792 * src/mathed/math_defs.h: ditto.
8794 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8796 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
8797 true, decides if we create a backup file or not when saving. New
8798 tag and variable \pdf_mode, defaults to false. New tag and
8799 variable \pdflatex_command, defaults to pdflatex. New tag and
8800 variable \view_pdf_command, defaults to xpdf. New tag and variable
8801 \pdf_to_ps_command, defaults to pdf2ps.
8803 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8805 * src/bufferlist.C (close): don't call insetUnlock if the buffer
8806 does not have a BufferView.
8807 (unlockInset): ditto + don't access the_locking_inset if the
8808 buffer does not have a BufferView.
8810 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
8811 certain circumstances so that we don't continue a keyboard
8812 operation long after the key was released. Try f.ex. to load a
8813 large document, press PageDown for some seconds and then release
8814 it. Before this change the document would contine to scroll for
8815 some time, with this change it stops imidiatly.
8817 * src/support/block.h: don't allocate more space than needed. As
8818 long as we don't try to write to the arr[x] in a array_type arr[x]
8819 it is perfectly ok. (if you write to it you might segfault).
8820 added operator value_type*() so that is possible to pass the array
8821 to functions expecting a C-pointer.
8823 * lib/Makefile.am (dist-hook): don't fail completely if unable to
8826 * intl/*: updated to gettext 0.10.35, tried to add our own
8827 required modifications. Please verify.
8829 * po/*: updated to gettext 0.10.35, tried to add our own required
8830 modifications. Please verify.
8832 * src/support/lstrings.C (tostr): go at fixing the problem with
8833 cxx and stringstream. When stringstream is used return
8834 oss.str().c_str() so that problems with lyxstring and basic_string
8835 are avoided. Note that the best solution would be for cxx to use
8836 basic_string all the way, but it is not conformant yet. (it seems)
8838 * src/lyx_cb.C + other files: moved several global functions to
8839 class BufferView, some have been moved to BufferView.[Ch] others
8840 are still located in lyx_cb.C. Code changes because of this. (part
8841 of "get rid of current_view project".)
8843 * src/buffer.C + other files: moved several Buffer functions to
8844 class BufferView, the functions are still present in buffer.C.
8845 Code changes because of this.
8847 * config/lcmessage.m4: updated to most recent. used when creating
8850 * config/progtest.m4: updated to most recent. used when creating
8853 * config/gettext.m4: updated to most recent. applied patch for
8856 * config/gettext.m4.patch: new file that shows what changes we
8857 have done to the local copy of gettext.m4.
8859 * config/libtool.m4: new file, used in creation of acinclude.m4
8861 * config/lyxinclude.m4: new file, this is the lyx created m4
8862 macros, used in making acinclude.m4.
8864 * autogen.sh: GNU m4 discovered as a separate task not as part of
8865 the lib/configure creation.
8866 Generate acinlucde from files in config. Actually cat
8867 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
8868 easier to upgrade .m4 files that really are external.
8870 * src/Spacing.h: moved using std::istringstream to right after
8871 <sstream>. This should fix the problem seen with some compilers.
8873 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8875 * src/lyx_cb.C: began some work to remove the dependency a lot of
8876 functions have on BufferView::text, even if not really needed.
8877 (GetCurrentTextClass): removed this func, it only hid the
8880 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
8881 forgot this in last commit.
8883 * src/Bullet.C (bulletEntry): use static char const *[] for the
8884 tables, becuase of this the return arg had to change to string.
8886 (~Bullet): removed unneeded destructor
8888 * src/BufferView.C (beforeChange): moved from lyx_cb.C
8889 (insetSleep): moved from Buffer
8890 (insetWakeup): moved from Buffer
8891 (insetUnlock): moved from Buffer
8893 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
8894 from Buffer to BufferView.
8896 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
8898 * config/ltmain.sh: updated to version 1.3.4 of libtool
8900 * config/ltconfig: updated to version 1.3.4 of libtool
8902 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8905 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
8906 Did I get that right?
8908 * src/lyxlex.h: add a "using" directive or two.
8909 * src/Spacing.h: ditto.
8910 * src/insets/figinset.C: ditto.
8911 * src/support/filetools.C: ditto.
8912 * src/support/lstrings.C: ditto.
8913 * src/BufferView.C: ditto.
8914 * src/bufferlist.C: ditto.
8915 * src/lyx_cb.C: ditto.
8916 * src/lyxlex.C: ditto.
8918 * NEWS: add some changes for 1.1.4.
8920 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8922 * src/BufferView.C: first go at a TextCache to speed up switching
8925 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8927 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
8928 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
8929 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
8930 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
8933 * src/mathed/math_defs.h (MathedRowSt): make sure that all
8934 members of the struct are correctly initialized to 0 (detected by
8936 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
8937 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
8939 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
8940 pidwait, since it was allocated with "new". This was potentially
8941 very bad. Thanks to Michael Schmitt for running purify for us.
8944 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8946 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
8948 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
8950 1999-12-30 Allan Rae <rae@lyx.org>
8952 * lib/templates/IEEEtran.lyx: minor change
8954 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
8955 src/mathed/formula.C (LocalDispatch): askForText changes
8957 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
8958 know when a user has cancelled input. Fixes annoying problems with
8959 inserting labels and version control.
8961 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8963 * src/support/lstrings.C (tostr): rewritten to use strstream and
8966 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8968 * src/support/filetools.C (IsFileWriteable): use fstream to check
8969 (IsDirWriteable): use fileinfo to check
8971 * src/support/filetools.h (FilePtr): whole class deleted
8973 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
8975 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
8977 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
8979 * src/bufferlist.C (write): use ifstream and ofstream instead of
8982 * src/Spacing.h: use istrstream instead of sscanf
8984 * src/mathed/math_defs.h: change first arg to istream from FILE*
8986 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
8988 * src/mathed/math_parser.C: have yyis to be an istream
8989 (LexGetArg): use istream (yyis)
8991 (mathed_parse): ditto
8992 (mathed_parser_file): first arg istream instead of FILE*, set yyis
8994 * src/mathed/formula.C (Read): rewritten to use istream
8996 * src/mathed/formulamacro.C (Read): rewritten to use istream
8998 * src/lyxlex.h (~LyXLex): deleted desturctor
8999 (getStream): new function, returns an istream
9000 (getFile): deleted funtion
9001 (IsOK): return is.good();
9003 * src/lyxlex.C (LyXLex): delete file and owns_file
9004 (setFile): open an filebuf and assign that to a istream instead of
9006 (setStream): new function, takes an istream as arg.
9007 (setFile): deleted function
9008 (EatLine): rewritten us use istream instead of FILE*
9012 * src/table.C (LyXTable): use istream instead of FILE*
9013 (Read): rewritten to take an istream instead of FILE*
9015 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9017 * src/buffer.C (Dispatch): remove an extraneous break statement.
9019 * src/support/filetools.C (QuoteName): change to do simple
9020 'quoting'. More work is necessary. Also changed to do nothing
9021 under emx (needs fix too).
9022 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
9024 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
9025 config.h.in to the AC_DEFINE_UNQUOTED() call.
9026 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
9027 needs char * as argument (because Solaris 7 declares it like
9030 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
9031 remove definition of BZERO.
9033 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9035 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
9036 defined, "lyxregex.h" if not.
9038 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
9040 (REGEX): new variable that is set to regex.c lyxregex.h when
9041 AM_CONDITIONAL USE_REGEX is set.
9042 (libsupport_la_SOURCES): add $(REGEX)
9044 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
9047 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
9050 * configure.in: add call to LYX_REGEX
9052 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
9053 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
9055 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9057 * lib/bind/fi_menus.bind: new file, from
9058 pauli.virtanen@saunalahti.fi.
9060 * src/buffer.C (getBibkeyList): pass the parameter delim to
9061 InsetInclude::getKeys and InsetBibtex::getKeys.
9063 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
9064 is passed to Buffer::getBibkeyList
9066 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
9067 instead of the hardcoded comma.
9069 * src/insets/insetbib.C (getKeys): make sure that there are not
9070 leading blanks in bibtex keys. Normal latex does not care, but
9071 harvard.sty seems to dislike blanks at the beginning of citation
9072 keys. In particular, the retturn value of the function is
9074 * INSTALL: make it clear that libstdc++ is needed and that gcc
9075 2.7.x probably does not work.
9077 * src/support/filetools.C (findtexfile): make debug message go to
9079 * src/insets/insetbib.C (getKeys): ditto
9081 * src/debug.C (showTags): make sure that the output is correctly
9084 * configure.in: add a comment for TWO_COLOR_ICON define.
9086 * acconfig.h: remove all the entries that already defined in
9087 configure.in or acinclude.m4.
9089 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
9090 to avoid user name, date and copyright.
9092 1999-12-21 Juergen Vigna <jug@sad.it>
9094 * src/table.C (Read): Now read bogus row format informations
9095 if the format is < 5 so that afterwards the table can
9096 be read by lyx but without any format-info. Fixed the
9097 crash we experienced when not doing this.
9099 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9101 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
9102 (RedoDrawingOfParagraph): ditto
9103 (RedoParagraphs): ditto
9104 (RemoveTableRow): ditto
9106 * src/text.C (Fill): rename arg paperwidth -> paper_width
9108 * src/buffer.C (insertLyXFile): rename var filename -> fname
9109 (writeFile): rename arg filename -> fname
9110 (writeFileAscii): ditto
9111 (makeLaTeXFile): ditto
9112 (makeLinuxDocFile): ditto
9113 (makeDocBookFile): ditto
9115 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
9118 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
9120 * src/bmtable.h: add extern "C" on this file when __cplusplus is
9123 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
9124 compiled by a C compiler not C++.
9126 * src/layout.h (LyXTextClass): added typedef for const_iterator
9127 (LyXTextClassList): added typedef for const_iterator + member
9128 functions begin and end.
9130 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
9131 iterators to fill the choice_class.
9132 (updateLayoutChoice): rewritten to use iterators to fill the
9133 layoutlist in the toolbar.
9135 * src/BufferView.h (BufferView::work_area_width): removed unused
9138 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
9140 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
9141 (sgmlCloseTag): ditto
9143 * src/support/lstrings.h: return type of countChar changed to
9146 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
9147 what version of this func to use. Also made to return unsigned int.
9149 * configure.in: call LYX_STD_COUNT
9151 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
9152 conforming std::count.
9154 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9156 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
9157 and a subscript would give bad display (patch from Dekel Tsur
9158 <dekel@math.tau.ac.il>).
9160 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
9162 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
9165 * src/chset.h: add a few 'using' directives
9167 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
9168 triggered when no buffer is active
9170 * src/layout.C: removed `break' after `return' in switch(), since
9173 * src/lyx_main.C (init): make sure LyX can be ran in place even
9174 when libtool has done its magic with shared libraries. Fix the
9175 test for the case when the system directory has not been found.
9177 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
9178 name for the latex file.
9179 (MenuMakeHTML): ditto
9181 * src/buffer.h: add an optional boolean argument, which is passed
9184 1999-12-20 Allan Rae <rae@lyx.org>
9186 * lib/templates/IEEEtran.lyx: small correction and update.
9188 * configure.in: Attempted to use LYX_PATH_HEADER
9190 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
9192 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
9193 input from JMarc. Now use preprocessor to find the header.
9194 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
9195 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
9196 LYX_STL_STRING_FWD. See comments in file.
9198 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
9200 * The global MiniBuffer * minibuffer variable is dead.
9202 * The global FD_form_main * fd_form_main variable is dead.
9204 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9206 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
9208 * src/table.h: add the LOstream.h header
9209 * src/debug.h: ditto
9211 * src/LyXAction.h: change the explaination of the ReadOnly
9212 attribute: is indicates that the function _can_ be used.
9214 * src/LyXAction.C (init): find-replace _can_ be used in read-only
9217 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9219 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
9225 * src/paragraph.C (GetWord): assert on pos>=0
9228 * src/support/lyxstring.C: condition the use of an invariant on
9230 * src/support/lyxstring.h: ditto
9232 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
9233 Use LAssert.h instead of plain assert().
9235 * src/support/lstrings.h: add LAssert.h, in case it is needed.
9237 * src/lyxfunc.C: do not include LAssert.h, it is not used.
9238 * src/support/filetools.C: ditto
9240 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
9243 * INSTALL: document the new configure flags
9245 * configure.in: suppress --with-debug; add --enable-assertions
9247 * acinclude.m4: various changes in alignment of help strings.
9249 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9251 * src/kbmap.C: commented out the use of the hash map in kb_map,
9252 beginning of movement to a stl::container.
9254 * several files: removed code that was not in effect when
9255 MOVE_TEXT was defined.
9257 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
9258 for escaping should not be used. We can discuss if the string
9259 should be enclosed in f.ex. [] instead of "".
9261 * src/trans_mgr.C (insert): use the new returned value from
9262 encodeString to get deadkeys and keymaps done correctly.
9264 * src/chset.C (encodeString): changed to return a pair, to tell
9265 what to use if we know the string.
9267 * src/lyxscreen.h (fillArc): new function.
9269 * src/FontInfo.C (resize): rewritten to use more std::string like
9270 structore, especially string::replace.
9272 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
9275 * configure.in (chmod +x some scripts): remove config/gcc-hack
9277 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9279 * src/buffer.C (writeFile): change once again the top comment in a
9280 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
9281 instead of an hardcoded version number.
9282 (makeDocBookFile): ditto
9284 * src/version.h: add new define LYX_DOCVERSION
9286 * po/de.po: update from Pit Sütterlin
9287 * lib/bind/de_menus.bind: ditto.
9289 * src/lyxfunc.C (Dispatch): call MenuExport()
9290 * src/buffer.C (Dispatch): ditto
9292 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
9293 LyXFunc::Dispatch().
9294 (MenuExport): new function, moved from
9295 LyXFunc::Dispatch().
9297 * src/trans_mgr.C (insert): small cleanup
9298 * src/chset.C (loadFile): ditto
9300 * lib/kbd/iso8859-1.cdef: add missing backslashes
9302 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9304 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
9305 help with placing the manually drawn accents better.
9307 (Draw): x2 and hg changed to float to minimize rounding errors and
9308 help place the accents better.
9310 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
9311 unsigned short to char is just wrong...cast the char to unsigned
9312 char instead so that the two values can compare sanely. This
9313 should also make the display of insetlatexaccents better and
9314 perhaps also some other insets.
9316 (lbearing): new function
9319 1999-12-15 Allan Rae <rae@lyx.org>
9321 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
9322 header that provides a wrapper around the very annoying SGI STL header
9325 * src/support/lyxstring.C, src/LString.h:
9326 removed old SGI-STL-compatability attempts.
9328 * configure.in: Use LYX_STL_STRING_FWD.
9330 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
9331 stl_string_fwd.h is around and try to determine it's location.
9332 Major improvement over previous SGI STL 3.2 compatability.
9333 Three small problems remain with this function due to my zero
9334 knowledge of autoconf. JMarc and lgb see the comments in the code.
9336 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9338 * src/broken_const.h, config/hack-gcc, config/README: removed
9340 * configure.in: remove --with-gcc-hack option; do not call
9343 * INSTALL: remove documentation of --with-broken-const and
9346 * acconfig.h: remove all trace of BROKEN_CONST define
9348 * src/buffer.C (makeDocBookFile): update version number in output
9350 (SimpleDocBookOnePar): fix an assert when trying to a character
9351 access beyond string length
9354 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9356 * po/de.po: fix the Export menu
9358 * lyx.man: update the description of -dbg
9360 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
9361 (commandLineHelp): updated
9362 (easyParse): show list of available debug levels if -dbg is passed
9365 * src/Makefile.am: add debug.C
9367 * src/debug.h: moved some code to debug.C
9369 * src/debug.C: new file. Contains code to set and show debug
9372 * src/layout.C: remove 'break' after 'continue' in switch
9373 statements, since these cannot be reached.
9375 1999-12-13 Allan Rae <rae@lyx.org>
9377 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
9378 (in_word_set): hash() -> math_hash()
9380 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
9382 * acconfig.h: Added a test for whether we are using exceptions in the
9383 current compilation run. If so USING_EXCEPTIONS is defined.
9385 * config.in: Check for existance of stl_string_fwd.h
9386 * src/LString.h: If compiling --with-included-string and SGI's
9387 STL version 3.2 is present (see above test) we need to block their
9388 forward declaration of string and supply a __get_c_string().
9389 However, it turns out this is only necessary if compiling with
9390 exceptions enabled so I've a bit more to add yet.
9392 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
9393 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
9394 src/support/LRegex.h, src/undo.h:
9395 Shuffle the order of the included files a little to ensure that
9396 LString.h gets included before anything that includes stl_string_fwd.h
9398 * src/support/lyxstring.C: We need to #include LString.h instead of
9399 lyxstring.h to get the necessary definition of __get_c_string.
9400 (__get_c_string): New function. This is defined static just like SGI's
9401 although why they need to do this I'm not sure. Perhaps it should be
9402 in lstrings.C instead.
9404 * lib/templates/IEEEtran.lyx: New template file.
9406 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9408 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
9409 * intl/Makefile.in (MKINSTALLDIRS): ditto
9411 * src/LyXAction.C (init): changed to hold the LFUN data in a
9412 automatic array in stead of in callso to newFunc, this speeds up
9413 compilation a lot. Also all the memory used by the array is
9414 returned when the init is completed.
9416 * a lot of files: compiled with -Wold-style-cast, changed most of
9417 the reported offenders to C++ style casts. Did not change the
9418 offenders in C files.
9420 * src/trans.h (Match): change argument type to unsigned int.
9422 * src/support/DebugStream.C: fix some types on the streambufs so
9423 that it works on a conforming implementation.
9425 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9427 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
9429 * src/support/lyxstring.C: remove the inline added earlier since
9430 they cause a bunch of unsatisfied symbols when linking with dec
9431 cxx. Cxx likes to have the body of inlines at the place where they
9434 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
9435 accessing negative bounds in array. This fixes the crash when
9436 inserting accented characters.
9437 * src/trans.h (Match): ditto
9439 * src/buffer.C (Dispatch): since this is a void, it should not try
9440 to return anything...
9442 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9444 * src/buffer.h: removed the two friends from Buffer. Some changes
9445 because of this. Buffer::getFileName and Buffer::setFileName
9446 renamed to Buffer::fileName() and Buffer::fileName(...).
9448 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9450 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
9451 and Buffer::update(short) to BufferView. This move is currently
9452 controlled by a define MOVE_TEXT, this will be removed when all
9453 shows to be ok. This move paves the way for better separation
9454 between buffer contents and buffer view. One side effect is that
9455 the BufferView needs a rebreak when swiching buffers, if we want
9456 to avoid this we can add a cache that holds pointers to LyXText's
9457 that is not currently in use.
9459 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
9462 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9464 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
9466 * lyx_main.C: new command line option -x (or --execute) and
9467 -e (or --export). Now direct conversion from .lyx to .tex
9468 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
9469 Unfortunately, X is still needed and the GUI pops up during the
9472 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9474 * src/Spacing.C: add a using directive to bring stream stuff into
9476 * src/paragraph.C: ditto
9477 * src/buffer.C: ditto
9479 * NEWS: updated a bit the new features of 1.1.3 (took a few things
9480 from Lars' announcement).
9482 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
9483 example files from Tino Meinen.
9485 1999-12-06 Allan Rae <rae@lyx.org>
9487 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
9489 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9491 * src/support/lyxstring.C: added a lot of inline for no good
9494 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
9495 latexWriteEndChanges, they were not used.
9497 * src/layout.h (operator<<): output operator for PageSides
9499 * src/mathed/math_iter.C (my_memcpy): slightly changed.
9501 * some example files: loaded in LyX 1.0.4 and saved again to update
9502 certain constructs (table format)
9504 * a lot of files: did the change to use fstream/iostream for all
9505 writing of files. Done with a close look at Andre Poenitz's patch.
9507 * some files: whitespace changes.
9509 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9511 * src/mathed/math_iter.C (my_memcpy): new function. Since the
9512 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
9513 architecture, we provide our own. It is used unconditionnally, but
9514 I do not think this is a performance problem. Thanks to Angus
9515 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
9516 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
9518 (GetInset): use my_memcpy.
9522 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
9523 it is easier to understand, but it uses less TeX-only constructs now.
9525 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
9526 elements contain spaces
9528 * lib/configure: regenerated
9530 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
9531 elements contain spaces; display the list of programs that are
9534 * autogen.sh: make sure lib/configure is executable
9536 * lib/examples/*: rename the tutorial examples to begin with the
9537 two-letters language code.
9539 * src/lyxfunc.C (getStatus): do not query current font if no
9542 * src/lyx_cb.C (RunScript): use QuoteName
9543 (MenuRunDvips): ditto
9544 (PrintApplyCB): ditto
9546 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
9547 around argument, so that it works well with the current shell.
9548 Does not work properly with OS/2 shells currently.
9550 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
9551 * src/LyXSendto.C (SendtoApplyCB): ditto
9552 * src/lyxfunc.C (Dispatch): ditto
9553 * src/buffer.C (runLaTeX): ditto
9554 (runLiterate): ditto
9555 (buildProgram): ditto
9557 * src/lyx_cb.C (RunScript): ditto
9558 (MenuMakeLaTeX): ditto
9560 * src/buffer.h (getLatexName): new method
9562 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
9564 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9566 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
9567 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
9568 (create_math_panel): ditto
9570 * src/lyxfunc.C (getStatus): re-activate the code which gets
9571 current font and cursor; add test for export to html.
9573 * src/lyxrc.C (read): remove unreachable break statements; add a
9576 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
9578 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9580 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
9581 introduced by faulty regex.
9582 * src/buffer.C: ditto
9583 * src/lastfiles.C: ditto
9584 * src/paragraph.C: ditto
9585 * src/table.C: ditto
9586 * src/vspace.C: ditto
9587 * src/insets/figinset.C: ditto
9588 Note: most of these is absolutely harmless, except the one in
9589 src/mathed formula.C.
9591 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9593 * src/ImportNoweb.C (documentclass): fixed bounds for substr
9594 operation, yielding correct results for the reLyX command.
9596 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9598 * src/support/filetools.C (ExpandPath): removed an over eager
9600 (ReplaceEnvironmentPath): ditto
9602 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
9603 shows that we are doing something fishy in our code...
9607 * src/lyxrc.C (read): use a double switch trick to get more help
9608 from the compiler. (the same trick is used in layout.C)
9609 (write): new function. opens a ofstream and pass that to output
9610 (output): new function, takes a ostream and writes the lyxrc
9611 elemts to it. uses a dummy switch to make sure no elements are
9614 * src/lyxlex.h: added a struct pushpophelper for use in functions
9615 with more than one exit point.
9617 * src/lyxlex.[Ch] (GetInteger): made it const
9621 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
9623 * src/layout.[hC] : LayoutTags splitted into several enums, new
9624 methods created, better error handling cleaner use of lyxlex. Read
9627 * src/bmtable.[Ch]: change some member prototypes because of the
9628 image const changes.
9630 * commandtags.h, src/LyXAction.C (init): new function:
9631 "preferences-save", saves the lyxrc entries into .lyx/preferences.
9632 This file is not read automatically but you can add \input
9633 preferences to your lyxrc if you want to. We need to discuss how
9636 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
9637 in .aux, also remove .bib and .bst files from dependencies when
9640 * src/BufferView.C, src/LyXView.C: add const_cast several places
9641 because of changes to images.
9643 * lib/images/*: same change as for images/*
9645 * lib/lyxrc.example: Default for accept_compound is false not no.
9647 * images/*: changed to be const, however I have som misgivings
9648 about this change so it might be changed back.
9650 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9652 * lib/configure, po/POTFILES.in: regenerated
9654 * autogen.sh: autogenerate lib/configure from lib/configure.m4
9656 * config/lib_configure.m4: removed
9658 * lib/configure.m4: new file (was config/lib_configure.m4)
9660 * configure.in: do not test for rtti, since we do not use it.
9662 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9664 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
9665 doubling of allocated space scheme. This makes it faster for large
9666 strings end to use less memory for small strings. xtra rememoved.
9668 * src/insets/figinset.C (waitalarm): commented out.
9669 (GhostscriptMsg): use static_cast
9670 (GhostscriptMsg): use new instead of malloc to allocate memory for
9671 cmap. also delete the memory after use.
9673 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
9675 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
9676 for changes in bibtex database or style.
9677 (runBibTeX): remove all .bib and .bst files from dep before we
9679 (run): use scanAuc in when dep file already exist.
9681 * src/DepTable.C (remove_files_with_extension): new method
9684 * src/DepTable.[Ch]: made many of the methods const.
9686 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9688 * src/bufferparams.C: make sure that the default textclass is
9689 "article". It used to be the first one by description order, but
9690 now the first one is "docbook".
9692 * src/lyx_main.C (setDebuggingLevel): change type of argument to
9693 string; call Debug::value.
9694 (easyParse): pass complete argument to setDebuggingLevel().
9696 * src/debug.h (value): fix the code that parses debug levels.
9698 * src/debug.h: add new debug type ACTION, reserved for LyXAction
9701 * src/LyXAction.C: use Debug::ACTION as debug channel.
9703 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
9705 * NEWS: updated for the future 1.1.3 release.
9707 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
9708 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
9709 it should. This is of course a controversial change (since many
9710 people will find that their lyx workscreen is suddenly full of
9711 red), but done for the sake of correctness.
9713 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
9714 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
9716 * src/insets/inseterror.h, src/insets/inseturl.h,
9717 src/insets/insetinfo.h, src/insets/figinset.h,
9718 src/mathed/formulamacro.h, src/mathed/math_macro.h
9719 (EditMessage): add a missing const and add _() to make sure that
9722 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
9723 src/insets/insetbib.C, src/support/filetools.C: add `using'
9726 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
9727 doing 'Insert index of last word' at the beginning of a paragraph.
9729 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9731 * several files: white-space changes.
9733 * src/mathed/formula.C: removed IsAlpha and IsDigit
9735 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
9736 .bib file. use a ifstream instead of FilePtr when parsing the .bib
9739 * src/insets/figinset.C (GetPSSizes): don't break when
9740 "EndComments" is seen. But break when a boundingbox is read.
9742 * all classes inherited from Inset: return value of Clone
9743 changed back to Inset *.
9745 * all classes inherited form MathInset: return value of Clone
9746 changed back to MathedInset *.
9748 * src/insets/figinset.C (runqueue): use a ofstream to output the
9749 gs/ps file. Might need some setpresicion or setw. However I can
9750 see no problem with the current code.
9751 (runqueue): use sleep instead of the alarm/signal code. I just
9752 can't see the difference.
9754 * src/paragraph.C (LyXParagraph): reserve space in the new
9755 paragraph and resize the inserted paragraph to just fit.
9757 * src/lyxfunc.h (operator|=): added operator for func_status.
9759 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
9760 check for readable file.
9762 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
9763 check for readable file.
9764 (MenuMakeLinuxDoc): ditto
9765 (MenuMakeDocBook): ditto
9766 (MenuMakeAscii): ditto
9767 (InsertAsciiFile): split the test for openable and readable
9769 * src/bmtable.C (draw_bitmaptable): use
9770 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
9772 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
9773 findtexfile from LaTeX to filetools.
9775 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
9776 instead of FilePtr. Needs to be verified by a literate user.
9778 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9780 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
9781 (EditMessage): likewise.
9783 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
9784 respectively as \textasciitilde and \textasciicircum.
9786 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9788 * src/support/lyxstring.h: made the methods that take iterators
9791 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
9792 (regexMatch): made is use the real regex class.
9794 * src/support/Makefile.am: changed to use libtool
9796 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
9798 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
9800 (MathIsInset ++): changed several macros to be inline functions
9803 * src/mathed/Makefile.am: changed to use libtool
9805 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
9807 * src/insets/inset* : Clone changed to const and return type is
9808 the true insettype not just Inset*.
9810 * src/insets/Makefile.am: changed to use libtool
9812 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
9814 * src/undo.[Ch] : added empty() and changed some of the method
9817 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
9819 * src/lyxparagraph.h: use id() and id(...) instead of getID and
9820 setID use block<> for the bullets array, added const several places.
9822 * src/lyxfunc.C (getStatus): new function
9824 * src/lyxfunc.[Ch] : small changes to take advantage of the new
9825 LyXAction, added const to several funtions.
9827 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
9828 a std::map, and to store the dir items in a vector.
9830 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
9833 * src/LyXView.[Ch] + other files : changed currentView to view.
9835 * src/LyXAction.[Ch] : ported from the old devel branch.
9837 * src/.cvsignore: added .libs and a.out
9839 * configure.in : changes to use libtool.
9841 * acinclude.m4 : inserted libtool.m4
9843 * .cvsignore: added libtool
9845 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9847 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
9848 file name in insets and mathed directories (otherwise the
9849 dependency is not taken in account under cygwin).
9851 * src/text2.C (InsertString[AB]): make sure that we do not try to
9852 read characters past the string length.
9854 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9856 * lib/doc/LaTeXConfig.lyx.in,
9857 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
9859 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
9860 file saying who created them and when this heppened; this is
9861 useless and annoys tools like cvs.
9863 * lib/layouts/g-brief-{en,de}.layout,
9864 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
9865 from Thomas Hartkens <thomas@hartkens.de>.
9867 * src/{insets,mathed}/Makefile.am: do not declare an empty
9868 LDFLAGS, so that it can be set at configure time (useful on Irix
9871 * lib/reLyX/configure.in: make sure that the prefix is set
9872 correctly in LYX_DIR.
9874 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9876 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
9877 be used by 'command-sequence' this allows to bind a key to a
9878 sequence of LyX-commands
9879 (Example: 'command-sequence math-insert alpha; math-insert beta;")
9881 * src/LyXAction.C: add "command-sequence"
9883 * src/LyXFunction.C: handling of "command-sequence"
9885 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
9886 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
9888 * src/lyxserver.C, src/minibuffer.C: Use this new interface
9890 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9892 * src/buffer.C (writeFile): Do not output a comment giving user
9893 and date at the beginning of a .lyx file. This is useless and
9894 annoys cvs anyway; update version number to 1.1.
9896 * src/Makefile.am (LYX_DIR): add this definition, so that a
9897 default path is hardcoded in LyX.
9899 * configure.in: Use LYX_GNU_GETTEXT.
9901 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
9902 AM_GNU_GETTEXT with a bug fixed.
9904 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
9906 * src/chset.C: add "using std::ifstream;" to please dec cxx.
9908 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
9909 which is used to point to LyX data is now LYX_DIR_11x.
9911 * lyx.man: convert to a unix text file; small updates.
9913 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9915 * src/support/LSubstring.[Ch]: made the second arg of most of the
9916 constructors be a const reference.
9918 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
9921 * src/support/lyxstring.[Ch] (swap): added missing member function
9922 and specialization of swap(str, str);
9924 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
9926 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
9927 trace of the old one.
9929 * src/undo.[Ch]: made the undostack use std::list to store undo's in
9930 put the member definitions in undo.C.
9932 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
9933 NEW_TEXT and have now only code that was included when this was
9936 * src/intl.C (LCombo): use static_cast
9938 (DispatchCallback): ditto
9940 * src/definitions.h: removed whole file
9942 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
9944 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
9945 parsing and stores in a std:map. a regex defines the file format.
9946 removed unneeded members.
9948 * src/bufferparams.h: added several enums from definitions.h here.
9949 Removed unsused destructor. Changed some types to use proper enum
9950 types. use block to have the temp_bullets and user_defined_bullets
9951 and to make the whole class assignable.
9953 * src/bufferparams.C (Copy): removed this functions, use a default
9956 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
9959 * src/buffer.C (readLyXformat2): commend out all that have with
9960 oldpapersize to do. also comment out all that hve to do with
9961 insetlatex and insetlatexdel.
9962 (setOldPaperStuff): commented out
9964 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
9966 * src/LyXAction.C: remove use of inset-latex-insert
9968 * src/mathed/math_panel.C (button_cb): use static_cast
9970 * src/insets/Makefile.am (insets_o_SOURCES): removed
9973 * src/support/lyxstring.C (helper): use the unsigned long
9974 specifier, UL, instead of a static_cast.
9976 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
9978 * src/support/block.h: new file. to be used as a c-style array in
9979 classes, so that the class can be assignable.
9981 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9983 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
9984 NULL, make sure to return an empty string (it is not possible to
9985 set a string to NULL).
9987 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9989 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
9991 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
9993 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
9994 link line, so that Irix users (for example) can set it explicitely to
9997 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
9998 it can be overidden at make time (static or dynamic link, for
10001 * src/vc-backend.C, src/LaTeXFeatures.h,
10002 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
10003 statements to bring templates to global namespace.
10005 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10007 * src/support/lyxstring.C (operator[] const): make it standard
10010 * src/minibuffer.C (Init): changed to reflect that more
10011 information is given from the lyxvc and need not be provided here.
10013 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
10015 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
10017 * src/LyXView.C (UpdateTimerCB): use static_cast
10018 (KeyPressMask_raw_callback): ditto
10020 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
10021 buffer_, a lot of changes because of this. currentBuffer() ->
10022 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
10023 also changes to other files because of this.
10025 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10027 * src/vc-backend.[Ch]: new files. The backends for vc handling,
10028 have no support for RCS and partial support for CVS, will be
10031 * src/insets/ several files: changes because of function name
10032 changes in Bufferview and LyXView.
10034 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
10036 * src/support/LSubstring.[Ch]: new files. These implement a
10037 Substring that can be very convenient to use. i.e. is this
10039 string a = "Mary had a little sheep";
10040 Substring(a, "sheep") = "lamb";
10041 a is now "Mary has a little lamb".
10043 * src/support/LRegex.[Ch]: a regex class that can be used to pick
10044 out patterns and subpatterns of strings. It is used by LSubstring
10045 and also by vc-backend.C
10047 * src/support/lyxstring.C: went over all the assertions used and
10048 tried to correct the wrong ones and flag which of them is required
10049 by the standard. some bugs found because of this. Also removed a
10050 couple of assertions.
10052 * src/support/Makefile.am (libsupport_a_SOURCES): added
10053 LSubstring.[Ch] and LRegex.[Ch]
10055 * src/support/FileInfo.h: have struct stat buf as an object and
10056 not a pointer to one, some changes because of this.
10058 * src/LaTeXFeatures.C (getTClassPreamble): also use the
10059 information in layout when adding the layouts preamble to the
10060 textclass preamble.
10062 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
10065 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
10066 because of bug in OS/2.
10068 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10070 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
10071 \verbatim@font instead of \ttfamily, so that it can be redefined.
10073 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
10074 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
10075 src/layout.h, src/text2.C: add 'using' directive to bring the
10076 STL templates we need from the std:: namespace to the global one.
10077 Needed by DEC cxx in strict ansi mode.
10079 * src/support/LIstream.h,src/support/LOstream.h,
10080 src/support/lyxstring.h,src/table.h,
10081 src/lyxlookup.h: do not include <config.h> in header
10082 files. This should be done in the .C files only.
10084 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
10088 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10090 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
10091 from Kayvan to fix the tth invokation.
10093 * development/lyx.spec.in: updates from Kayvan to reflect the
10094 changes of file names.
10096 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10098 * src/text2.C (InsertStringB): use std::copy
10099 (InsertStringA): use std::copy
10101 * src/bufferlist.C: use a vector to store the buffers in. This is
10102 an internal change and should not affect any other thing.
10104 * src/BufferView.C (waitForX): use XSync instead of the lengthy
10107 * src/text.C (Fill): fix potential bug, one off bug.
10109 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10111 * src/Makefile.am (lyx_main.o): add more files it depends on.
10113 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
10115 * src/support/lyxstring.C: use size_t for the reference count,
10116 size, reserved memory and xtra.
10117 (internal_compare): new private member function. Now the compare
10118 functions should work for std::strings that have embedded '\0'
10120 (compare): all compare functions rewritten to use
10123 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10125 * src/support/lyxstring.C (compare): pass c_str()
10126 (compare): pass c_str
10127 (compare): pass c_str
10129 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10131 * src/support/DebugStream.C: <config.h> was not included correctly.
10133 * lib/configure: forgot to re-generate it :( I'll make this file
10134 auto generated soon.
10136 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10138 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
10141 * src/support/lyxstring.C: some changes from length() to rep->sz.
10142 avoids a function call.
10144 * src/support/filetools.C (SpaceLess): yet another version of the
10145 algorithm...now per Jean-Marc's suggestions.
10147 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10149 * src/layout.C (less_textclass_desc): functor for use in sorting
10151 (LyXTextClass::Read): sort the textclasses after reading.
10153 * src/support/filetools.C (SpaceLess): new version of the
10154 SpaceLess functions. What problems does this one give? Please
10157 * images/banner_bw.xbm: made the arrays unsigned char *
10159 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10161 * src/support/lyxstring.C (find): remove bogus assertion in the
10162 two versions of find where this has not been done yet.
10164 * src/support/lyxlib.h: add missing int return type to
10167 * src/menus.C (ShowFileMenu): disable exporting to html if no
10168 html export command is present.
10170 * config/lib_configure.m4: add a test for an HTML converter. The
10171 programs checked for are, in this order: tth, latex2html and
10174 * lib/configure: generated from config/lib_configure.m4.
10176 * src/lyxfunc.C (Dispatch): update and improve the execution of an
10177 html converter. The parameters are now passed through $$FName and
10178 $$OutName, instead of standard input/output.
10180 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
10182 * lib/lyxrc.example: update description of \html_command.
10183 add "quotes" around \screen_font_xxx font setting examples to help
10184 people who use fonts with spaces in their names.
10186 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10188 * Distribution files: updates for v1.1.2
10190 * src/support/lyxstring.C (find): remove bogus assert and return
10191 npos for the same condition.
10193 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10195 * added patch for OS/2 from SMiyata.
10197 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10199 * src/text2.C (CutSelection): make space_wrapped a bool
10200 (CutSelection): dont declare int i until we have to.
10201 (alphaCounter): return a char const *.
10203 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10205 * src/support/syscall.C (Systemcalls::kill):
10206 src/support/filetools.C (PutEnv, PutEnvPath):
10207 src/lyx_cb.C (addNewlineAndDepth):
10208 src/FontInfo.C (FontInfo::resize): condition some #warning
10209 directives with WITH_WARNINGS.
10212 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10214 * src/layout.[Ch] + several files: access to class variables
10215 limited and made accessor functions instead a lot of code changed
10216 becuase of this. Also instead of returning pointers often a const
10217 reference is returned instead.
10219 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
10221 * src/Makefile.am (dist-hook): added used to remove the CVS from
10222 cheaders upon creating a dist
10223 (EXTRA_DIST): added cheaders
10225 * src/support/lstrings.C (tostr(char)): fix it to handle param as
10226 a character not as a small integer.
10228 * src/support/lyxstring.C (find): removed Assert and added i >=
10229 rep->sz to the first if.
10231 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10233 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
10234 src/LyXView.C src/buffer.C src/bufferparams.C
10235 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
10236 src/text2.C src/insets/insetinclude.C:
10237 lyxlayout renamed to textclasslist.
10239 * src/layout.C: some lyxerr changes.
10241 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
10242 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
10243 (LyXLayoutList): removed all traces of this class.
10244 (LyXTextClass::Read): rewrote LT_STYLE
10245 (LyXTextClass::hasLayout): new function
10246 (LyXTextClass::GetLayout): rewritten to return an iterator + has
10247 both const and nonconst version.
10248 (LyXTextClass::delete_layout): new function.
10249 (LyXTextClassList::Style): bug fix. do the right thing if layout
10251 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
10252 (LyXTextClassList::NameOfLayout): ditto
10253 (LyXTextClassList::Load): ditto
10255 * src/buffer.C (makeLaTeXFile): new access to layoutlist
10257 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
10259 * src/LyXAction.C (LookupFunc): added a workaround for sun
10260 compiler, on the other hand...we don't know if the current code
10261 compiles on sun at all...
10263 * src/support/filetools.C (CleanupPath): subst fix
10265 * src/insets/insetbib.C (delDatabase): subst fix, this looks
10268 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
10269 complained about this one?
10271 * src/insets/insetinclude.C (Latex): subst fix
10273 * src/insets/insetbib.C (getKeys): subst fix
10275 * src/LyXSendto.C (SendtoApplyCB): subst fix
10277 * src/lyx_main.C (init): subst fix
10279 * src/layout.C (Read): subst fix
10281 * src/lyx_sendfax_main.C (button_send): subst fix
10283 * src/buffer.C (RoffAsciiTable): subst fix
10285 * src/lyx_cb.C (MenuFax): subst fix
10286 (PrintApplyCB): subst fix
10288 1999-10-26 Juergen Vigna <jug@sad.it>
10290 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
10292 (Read): Cleaned up this code so now we read only format vestion >= 5
10294 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10296 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
10297 come nobody has complained about this one?
10299 * src/insets/insetinclude.C (Latex): subst fix
10301 * src/insets/insetbib.C (getKeys): subst fix
10303 * src/lyx_main.C (init): subst fix
10305 * src/layout.C (Read): subst fix
10307 * src/buffer.C (RoffAsciiTable): subst fix
10309 * src/lyx_cb.C (MenuFax): subst fix.
10311 * src/layout.[hC] + some other files: rewrote to use
10312 std::container to store textclasses and layouts in.
10313 Simplified, removed a lot of code. Make all classes
10314 assignable. Further simplifications and review of type
10315 use still to be one.
10317 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
10318 lastfiles to create the lastfiles partr of the menu.
10320 * src/lastfiles.[Ch]: rewritten to use deque to store the
10321 lastfiles in. Uses fstream for reading and writing. Simplifies
10324 * src/support/syscall.C: remove explicit cast.
10326 * src/BufferView.C (CursorToggleCB): removed code snippets that
10327 were commented out.
10328 use explicat C++ style casts instead of C style casts. also use
10329 u_vdata instea of passing pointers in longs.
10331 * src/PaperLayout.C: removed code snippets that were commented out.
10333 * src/lyx_gui_misc.C: removed code snippets that were commented out.
10335 * src/lyx_main.C: removed code snippets that wer commented out.
10337 * src/paragraph.C: removed code snippets that were commented out.
10339 * src/lyxvc.C (logClose): use static_cast
10341 (viewLog): remove explicit cast to void*
10342 (showLog): removed old commented code
10344 * src/menus.C: use static_cast instead of C style casts. use
10345 u_vdata instead of u_ldata. remove explicit cast to (long) for
10346 pointers. Removed old code that was commented out.
10348 * src/insets/inset.C: removed old commented func
10350 * src/insets/insetref.C (InsetRef): removed old code that had been
10351 commented out for a long time.
10353 (escape): removed C style cast
10355 * src/insets/insetlatexaccent.C (Draw): removed old commented code
10357 * src/insets/insetlatex.C (Draw): removed old commented code
10358 (Read): rewritten to use string
10360 * src/insets/insetlabel.C (escape): removed C style cast
10362 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
10364 * src/insets/insetindex.C: use static_cast and u_vdata, removed
10365 old commented code.
10367 * src/insets/insetinclude.h: removed a couple of stupid bools
10369 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
10370 (Clone): remove C style cast
10371 (getKeys): changed list to lst because of std::list
10373 * src/insets/inseterror.C (Draw): removed som old commented code.
10375 * src/insets/insetcommand.C (Draw): removed some old commented code.
10377 * src/insets/insetbib.C (bibitem_cb): removed code that has been
10378 commented out forever.
10379 (bibitem_cb): use static_cast instead of C style cast
10380 use of vdata changed to u_vdata.
10382 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
10384 (CloseUrlCB): use static_cast instead of C style cast.
10385 (CloseUrlCB): added a fl_free form...it seemed to be missing.
10387 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
10388 (C_InsetInfo_CloseInfoCB): forward the ob parameter
10389 (CloseInfoCB): static_cast from ob->u_vdata instead.
10390 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
10393 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
10394 (C_InsetError_CloseErrorCB): forward the ob parameter
10395 (CloseErrorCB): static_cast from ob->u_vdata instead.
10397 * src/vspace.h: include LString.h since we use string in this class.
10399 * src/vspace.C (lyx_advance): changed name from advance because of
10400 nameclash with stl. And since we cannot use namespaces yet...I
10401 used a lyx_ prefix instead. Expect this to change when we begin
10404 * src/BufferView.[Ch] (BufferView::~BufferView): removed
10406 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
10407 and removed now defunct constructor and deconstructor.
10409 * src/BufferView.h: have backstack as a object not as a pointer.
10410 removed initialization from constructor. added include for BackStack
10412 * development/lyx.spec.in (%build): add CFLAGS also.
10414 * src/screen.C (drawFrame): removed another warning.
10416 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10418 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
10419 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
10420 README and ANNOUNCE a bit for the next release. More work is
10423 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
10424 unbreakable if we are in freespacing mode (LyX-Code), but not in
10427 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10429 * src/BackStack.h: fixed initialization order in constructor
10431 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
10433 * acinclude.m4 (VERSION): new rules for when a version is
10434 development, added also a variable for prerelease.
10435 (warnings): we set with_warnings=yes for prereleases
10436 (lyx_opt): prereleases compile with same optimization as development
10437 (CXXFLAGS): only use pedantic if we are a development version
10439 * src/BufferView.C (restorePosition): don't do anything if the
10440 backstack is empty.
10442 * src/BackStack.h: added member empty, use this to test if there
10443 is anything to pop...
10445 1999-10-25 Juergen Vigna <jug@sad.it>
10448 * forms/layout_forms.fd +
10449 * forms/latexoptions.fd +
10450 * lyx.fd: changed for various form resize issues
10452 * src/mathed/math_panel.C +
10453 * src/insets/inseterror.C +
10454 * src/insets/insetinfo.C +
10455 * src/insets/inseturl.C +
10456 * src/insets/inseturl.h +
10458 * src/LyXSendto.C +
10459 * src/PaperLayout.C +
10460 * src/ParagraphExtra.C +
10461 * src/TableLayout.C +
10463 * src/layout_forms.C +
10470 * src/menus.C: fixed various resize issues. So now forms can be
10471 resized savely or not be resized at all.
10473 * forms/form_url.fd +
10474 * src/insets/form_url.[Ch]: added because it's cleaner and easier
10477 * src/insets/Makefile.am: added files form_url.[Ch]
10479 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10481 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
10482 (and presumably 6.2).
10484 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
10485 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
10486 remaining static member callbacks.
10488 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
10491 * src/support/lyxstring.h: declare struct Srep as friend of
10492 lyxstring, since DEC cxx complains otherwise.
10494 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10496 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10498 * src/LaTeX.C (run): made run_bibtex also depend on files with
10500 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
10501 are put into the dependency file.
10503 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
10504 the code has shown itself to work
10505 (create_ispell_pipe): removed another warning, added a comment
10508 * src/minibuffer.C (ExecutingCB): removed code that has been
10509 commented out a long time
10511 * src/lyxfunc.C (processKeyEvent): removed some very old commented
10512 out code + a warning.
10514 * src/support/lyxstring.h: comment out the three private
10515 operators, when compiling with string ansi conforming compilers
10516 they make problems.
10518 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
10520 (pixmapFromBitmapData): change type of bdata to be unsigned char *
10521 (pixmapFromBitmapData): add a reinterpret_cast in the call to
10524 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
10527 * src/mathed/math_panel.C (create_math_panel): remove explicit
10530 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
10533 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
10534 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
10535 to XCreatePixmapFromBitmapData
10536 (fl_set_bmtable_data): change the last argument to be unsigned
10538 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
10539 and bh to be unsigned int, remove explicit casts in call to
10540 XReadBitmapFileData.
10542 * images/arrows.xbm: made the arrays unsigned char *
10543 * images/varsz.xbm: ditto
10544 * images/misc.xbm: ditto
10545 * images/greek.xbm: ditto
10546 * images/dots.xbm: ditto
10547 * images/brel.xbm: ditto
10548 * images/bop.xbm: ditto
10550 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
10552 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
10553 (LYX_PROG_CXX): added -pedantic to g++ compile options when
10554 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
10556 (LYX_CXX_CHEADERS): added <clocale> to the test.
10558 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
10560 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
10562 * src/support/lyxstring.C (append): fixed something that must be a
10563 bug, rep->assign was used instead of rep->append.
10565 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
10568 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
10569 lyx insert double chars. Fix spotted by Kayvan.
10571 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10573 * Fixed the tth support. I messed up with the Emacs patch apply feature
10574 and omitted the changes in lyxrc.C.
10576 1999-10-22 Juergen Vigna <jug@sad.it>
10578 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
10580 * src/lyx_cb.C (MenuInsertRef) +
10581 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
10582 the form cannot be resized under it limits (fixes a segfault)
10584 * src/lyx.C (create_form_form_ref) +
10585 * forms/lyx.fd: Changed Gravity on name input field so that it is
10588 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10590 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
10591 <ostream> and <istream>.
10593 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
10594 whether <fstream> provides the latest standard features, or if we
10595 have an oldstyle library (like in egcs).
10596 (LYX_CXX_STL_STRING): fix the test.
10598 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
10599 code on MODERN_STL_STREAM.
10601 * src/support/lyxstring.h: use L{I,O}stream.h.
10603 * src/support/L{I,O}stream.h: new files, designed to setup
10604 correctly streams for our use
10605 - includes the right header depending on STL capabilities
10606 - puts std::ostream and std::endl (for LOStream.h) or
10607 std::istream (LIStream.h) in toplevel namespace.
10609 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10611 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
10612 was a bib file that had been changed we ensure that bibtex is run.
10613 (runBibTeX): enhanced to extract the names of the bib files and
10614 getting their absolute path and enter them into the dep file.
10615 (findtexfile): static func that is used to look for tex-files,
10616 checks for absolute patchs and tries also with kpsewhich.
10617 Alternative ways of finding the correct files are wanted. Will
10619 (do_popen): function that runs a command using popen and returns
10620 the whole output of that command in a string. Should be moved to
10623 * src/DepTable.[Ch] (extchanged): new function that returns true if a
10624 file with extension ext has changed.
10626 * src/insets/figinset.C: added ifdef guards around the fl_free
10627 code that jug commented out. Now it is commented out when
10628 compiling with XForms == 0.89.
10630 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
10631 to lyxstring.C, and only keep a forward declaration in
10632 lyxstring.h. Simplifies the header file a bit and should help a
10633 bit on compile time too. Also changes to Srep will not mandate a
10634 recompile of code just using string.
10635 (~lyxstring): definition moved here since it uses srep.
10636 (size): definition moved here since it uses srep.
10638 * src/support/lyxstring.h: removed a couple of "inline" that should
10641 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10643 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
10646 1999-10-21 Juergen Vigna <jug@sad.it>
10648 * src/table.C (SetPWidth): Just a small fix so the alignment is not
10649 set to left if I just remove the width entry (or it is empty).
10651 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
10652 paragraph when having dummy paragraphs.
10654 1999-10-20 Juergen Vigna <jug@sad.it>
10656 * src/insets/figinset.C: just commented some fl_free_form calls
10657 and added warnings so that this calls should be activated later
10658 again. This avoids for now a segfault, but we have a memory leak!
10660 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
10661 'const char * argument' to 'string argument', this should
10662 fix some Asserts() in lyxstring.C.
10664 * src/lyxfunc.h: Removed the function argAsString(const char *)
10665 as it is not used anymore.
10667 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10669 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
10672 * src/Literate.h: some funcs moved from public to private to make
10673 interface clearer. Unneeded args removed.
10675 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
10677 (scanBuildLogFile): ditto
10679 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
10680 normal TeX Error. Still room for improvement.
10682 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
10684 * src/buffer.C (insertErrors): changes to make the error
10685 desctription show properly.
10687 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
10690 * src/support/lyxstring.C (helper): changed to use
10691 sizeof(object->rep->ref).
10692 (operator>>): changed to use a pointer instead.
10694 * src/support/lyxstring.h: changed const reference & to value_type
10695 const & lets see if that helps.
10697 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10699 * Makefile.am (rpmdist): fixed to have non static package and
10702 * src/support/lyxstring.C: removed the compilation guards
10704 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
10707 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
10708 conditional compile of lyxstring.Ch
10710 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
10711 stupid check, but it is a lot better than the bastring hack.
10712 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
10714 * several files: changed string::erase into string::clear. Not
10717 * src/chset.C (encodeString): use a char temporary instead
10719 * src/table.C (TexEndOfCell): added tostr around
10720 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
10721 (TexEndOfCell): ditto
10722 (TexEndOfCell): ditto
10723 (TexEndOfCell): ditto
10724 (DocBookEndOfCell): ditto
10725 (DocBookEndOfCell): ditto
10726 (DocBookEndOfCell): ditto
10727 (DocBookEndOfCell): ditto
10729 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
10731 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
10733 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
10734 (MenuBuildProg): added tostr around ret
10735 (MenuRunChktex): added tostr around ret
10736 (DocumentApplyCB): added tostr around ret
10738 * src/chset.C (encodeString): added tostr around t->ic
10740 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
10741 (makeLaTeXFile): added tostr around tocdepth
10742 (makeLaTeXFile): added tostr around ftcound - 1
10744 * src/insets/insetbib.C (setCounter): added tostr around counter.
10746 * src/support/lyxstring.h: added an operator+=(int) to catch more
10749 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
10750 (lyxstring): We DON'T allow NULL pointers.
10752 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10754 * src/mathed/math_macro.C (MathMacroArgument::Write,
10755 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
10756 when writing them out.
10758 * src/LString.C: remove, since it is not used anymore.
10760 * src/support/lyxstring.C: condition the content to
10761 USE_INCLUDED_STRING macro.
10763 * src/mathed/math_symbols.C, src/support/lstrings.C,
10764 src/support/lyxstring.C: add `using' directive to specify what
10765 we need in <algorithm>. I do not think that we need to
10766 conditionalize this, but any thought is appreciated.
10768 * many files: change all callback functions to "C" linkage
10769 functions to please strict C++ compilers like DEC cxx 6.1 in mode
10770 strict_ansi. Those who were static are now global.
10771 The case of callbacks which are static class members is
10772 trickier, since we have to make C wrappers around them (see
10773 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
10774 did not finish this yet, since it defeats the purpose of
10775 encapsulation, and I am not sure what the best route is.
10777 1999-10-19 Juergen Vigna <jug@sad.it>
10779 * src/support/lyxstring.C (lyxstring): we permit to have a null
10780 pointer as assignment value and just don't assign it.
10782 * src/vspace.C (nextToken): corrected this function substituting
10783 find_first(_not)_of with find_last_of.
10785 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
10786 (TableOptCloseCB) (TableSpeCloseCB):
10787 inserted fl_set_focus call for problem with fl_hide_form() in
10790 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10792 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
10795 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10797 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
10798 LyXLex::next() and not eatline() to get its argument.
10800 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10802 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
10803 instead, use fstreams for io of the depfile, removed unneeded
10804 functions and variables.
10806 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
10807 vector instead, removed all functions and variables that is not in
10810 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10812 * src/buffer.C (insertErrors): use new interface to TeXError
10814 * Makefile.am (rpmdist): added a rpmdist target
10816 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
10817 per Kayvan's instructions.
10819 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10821 * src/Makefile.am: add a definition for localedir, so that locales
10822 are found after installation (Kayvan)
10824 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10826 * development/.cvsignore: new file.
10828 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10830 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
10831 C++ compiler provides wrappers for C headers and use our alternate
10834 * configure.in: use LYX_CXX_CHEADERS.
10836 * src/cheader/: new directory, populated with cname headers from
10837 libstdc++-2.8.1. They are a bit old, but probably good enough for
10838 what we want (support compilers who lack them).
10840 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
10841 from includes. It turns out is was stupid.
10843 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10845 * lib/Makefile.am (install-data-local): forgot a ';'
10846 (install-data-local): forgot a '\'
10847 (libinstalldirs): needed after all. reintroduced.
10849 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10851 * configure.in (AC_OUTPUT): added lyx.spec
10853 * development/lyx.spec: removed file
10855 * development/lyx.spec.in: new file
10857 * po/*.po: merged with lyx.pot becuase of make distcheck
10859 * lib/Makefile.am (dist-hook): added dist-hook so that
10860 documentation files will be included when doing a make
10861 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
10862 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
10864 more: tried to make install do the right thing, exclude CVS dirs
10867 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
10868 Path would fit in more nicely.
10870 * all files that used to use pathstack: uses now Path instead.
10871 This change was a lot easier than expected.
10873 * src/support/path.h: new file
10875 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
10877 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
10879 * src/support/lyxstring.C (getline): Default arg was given for
10882 * Configure.cmd: removed file
10884 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10886 * src/support/DebugStream.[Ch]: remove the explicit std:: before
10887 streams classes and types, add the proper 'using' statements when
10888 MODERN_STL is defined.
10890 * src/debug.h: move the << operator definition after the inclusion
10893 * src/support/filetools.C: include "LAssert.h", which is needed
10896 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
10899 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
10900 include "debug.h" to define a proper ostream.
10902 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10904 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
10905 method to the SystemCall class which can kill a process, but it's
10906 not fully implemented yet.
10908 * src/*.C: Changed Systemcalls::Startscript() to startscript()
10910 * src/support/FileInfo.h: Better documentation
10912 * src/lyxfunc.C: Added support for buffer-export html
10914 * src/menus.C: Added Export->As HTML...
10916 * lib/bind/*.bind: Added short-cut for buffer-export html
10918 * src/lyxrc.*: Added support for new \tth_command
10920 * lib/lyxrc.example: Added stuff for new \tth_command
10922 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10924 * lib/Makefile.am (IMAGES): removed images/README
10925 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
10926 installes in correct place. Check permisions is installed
10929 * src/LaTeX.C: some no-op changes moved declaration of some
10932 * src/LaTeX.h (LATEX_H): changed include guard name
10934 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10936 * lib/reLyX/Makefile.am: install noweb2lyx.
10938 * lib/Makefile.am: install configure.
10940 * lib/reLyX/configure.in: declare a config aux dir; set package
10941 name to lyx (not sure what the best solution is); generate noweb2lyx.
10943 * lib/layouts/egs.layout: fix the bibliography layout.
10945 1999-10-08 Jürgen Vigna <jug@sad.it>
10947 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
10948 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
10949 it returned without continuing to search the path.
10951 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10953 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
10954 also fixes a bug. It is not allowed to do tricks with std::strings
10955 like: string a("hei"); &a[e]; this will not give what you
10956 think... Any reason for the complexity in this func?
10958 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
10960 * Updated README and INSTALL a bit, mostly to check that my
10961 CVS rights are correctly set up.
10963 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10965 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
10966 does not allow '\0' chars but lyxstring and std::string does.
10968 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10970 * autogen.sh (AUTOCONF): let the autogen script create the
10971 POTFILES.in file too. POTFILES.in should perhaps now not be
10972 included in the cvs module.
10974 * some more files changed to use C++ includes instead of C ones.
10976 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
10978 (Reread): added tostr to nlink. buggy output otherwise.
10979 (Reread): added a string() around szMode when assigning to Buffer,
10980 without this I got a log of garbled info strings.
10982 * acconfig.h: commented out the PTR_AS_INT macros. They should not
10985 * I have added several ostream & operator<<(ostream &, some_type)
10986 functions. This has been done to avoid casting and warnings when
10987 outputting enums to lyxerr. This as thus eliminated a lot of
10988 explicit casts and has made the code clearer. Among the enums
10989 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
10990 mathed enums, some font enum the Debug::type enum.
10992 * src/support/lyxstring.h (clear): missing method. equivalent of
10995 * all files that contained "stderr": rewrote constructs that used
10996 stderr to use lyxerr instead. (except bmtable)
10998 * src/support/DebugStream.h (level): and the passed t with
10999 Debug::ANY to avoid spurious bits set.
11001 * src/debug.h (Debug::type value): made it accept strings of the
11002 type INFO,INIT,KEY.
11004 * configure.in (Check for programs): Added a check for kpsewhich,
11005 the latex generation will use this later to better the dicovery of
11008 * src/BufferView.C (create_view): we don't need to cast this to
11009 (void*) that is done automatically.
11010 (WorkAreaButtonPress): removed some dead code.
11012 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11014 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
11015 is not overwritten when translated (David Sua'rez de Lis).
11017 * lib/CREDITS: Added David Sua'rez de Lis
11019 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
11021 * src/bufferparams.C (BufferParams): default input encoding is now
11024 * acinclude.m4 (cross_compiling): comment out macro
11025 LYX_GXX_STRENGTH_REDUCE.
11027 * acconfig.h: make sure that const is not defined (to empty) when
11028 we are compiling C++. Remove commented out code using SIZEOF_xx
11031 * configure.in : move the test for const and inline as late as
11032 possible so that these C tests do not interefere with C++ ones.
11033 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
11034 has not been proven.
11036 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11038 * src/table.C (getDocBookAlign): remove bad default value for
11039 isColumn parameter.
11041 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
11043 (ShowFileMenu2): ditto.
11045 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
11046 of files to ignore.
11048 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11050 * Most files: finished the change from the old error code to use
11051 DebugStream for all lyxerr debugging. Only minor changes remain
11052 (e.g. the setting of debug levels using strings instead of number)
11054 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11056 * src/layout.C (Add): Changed to use compare_no_case instead of
11059 * src/FontInfo.C: changed loop variable type too string::size_type.
11061 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11063 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
11064 set ETAGS_ARGS to --c++
11066 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
11068 * src/table.C (DocBookEndOfCell): commented out two unused variables
11070 * src/paragraph.C: commented out four unused variables.
11072 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
11073 insed a if clause with type string::size_type.
11075 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
11078 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
11080 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
11081 variable, also changed loop to go from 0 to lenght + 1, instead of
11082 -1 to length. This should be correct.
11084 * src/LaTeX.C (scanError): use string::size_type as loop variable
11087 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
11088 (l.896) since y_tmp and row was not used anyway.
11090 * src/insets/insetref.C (escape): use string::size_type as loop
11093 * src/insets/insetquotes.C (Width): use string::size_type as loop
11095 (Draw): use string::size_type as loop variable type.
11097 * src/insets/insetlatexaccent.C (checkContents): use
11098 string::size_type as loop variable type.
11100 * src/insets/insetlabel.C (escape): use string::size_type as loop
11103 * src/insets/insetinfo.C: added an extern for current_view.
11105 * src/insets/insetcommand.C (scanCommand): use string::size_type
11106 as loop variable type.
11108 * most files: removed the RCS tags. With them we had to recompile
11109 a lot of files after a simple cvs commit. Also we have never used
11110 them for anything meaningful.
11112 * most files: tags-query-replace NULL 0. As adviced several plases
11113 we now use "0" instead of "NULL" in our code.
11115 * src/support/filetools.C (SpaceLess): use string::size_type as
11116 loop variable type.
11118 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11120 * src/paragraph.C: fixed up some more string stuff.
11122 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11124 * src/support/filetools.h: make modestr a std::string.
11126 * src/filetools.C (GetEnv): made ch really const.
11128 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
11129 made code that used these use max/min from <algorithm> instead.
11131 * changed several c library include files to their equivalent c++
11132 library include files. All is not changed yet.
11134 * created a support subdir in src, put lyxstring and lstrings
11135 there + the extra files atexit, fileblock, strerror. Created
11136 Makefile.am. edited configure.in and src/Makefile.am to use this
11137 new subdir. More files moved to support.
11139 * imported som of the functions from repository lyx, filetools
11141 * ran tags-query-replace on LString -> string, corrected the bogus
11142 cases. Tried to make use of lstrings.[hC], debugged a lot. There
11143 is still some errors in there. This is errors where too much or
11144 too litle get deleted from strings (string::erase, string::substr,
11145 string::replace), there can also be some off by one errors, or
11146 just plain wrong use of functions from lstrings. Viewing of quotes
11149 * LyX is now running fairly well with string, but there are
11150 certainly some bugs yet (see above) also string is quite different
11151 from LString among others in that it does not allow null pointers
11152 passed in and will abort if it gets any.
11154 * Added the revtex4 files I forgot when setting up the repository.
11156 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11158 * All over: Tried to clean everything up so that only the files
11159 that we really need are included in the cvs repository.
11160 * Switched to use automake.
11161 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
11162 * Install has not been checked.
11164 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11166 * po/pt.po: Three errors:
11167 l.533 and l.538 format specification error
11168 l. 402 duplicate entry, I just deleted it.