1 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3 * src/converter.[Ch]: New file for converting between different
6 * src/export.[Ch]: New file for exporting a LyX file to different
9 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
10 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
11 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
12 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
13 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
14 RunDocBook, MenuExport.
16 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
17 Exporter::Preview methods if NEW_EXPORT is defined.
19 * src/buffer.C (Dispatch): Use Exporter::Export.
21 * src/lyxrc.C: Added new tags: \converter and \viewer.
24 * src/LyXAction.C: Define new lyx-function: buffer-update.
25 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
26 when NEW_EXPORT is defined.
28 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
30 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
32 * lib/ui/default.ui: Added submenus "view" and "update" to the
35 * src/filetools.C (GetExtension): New function.
37 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
39 2000-08-29 Allan Rae <rae@lyx.org>
41 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
43 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
44 (EnableDocumentLayout): removed
45 (DisableDocumentLayout): removed
46 (build): make use of ButtonController's read-only handling to
47 de/activate various objects. Replaces both of the above functions.
49 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
50 (readOnly): was read_only
51 (refresh): fixed dumb mistakes with read_only_ handling
53 * src/frontends/xforms/forms/form_document.fd:
54 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
55 tabbed dialogs so the tabs look more like tabs and so its easier to
56 work out which is the current tab.
58 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
59 segfault with form_table
61 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
63 2000-08-28 Juergen Vigna <jug@sad.it>
65 * acconfig.h: added USE_PSPELL.
67 * src/config.h.in: added USE_PSPELL.
69 * autogen.sh: added pspell.m4
71 * config/pspell.m4: new file.
73 * src/spellchecker.C: implemented support for pspell libary.
75 2000-08-25 Juergen Vigna <jug@sad.it>
77 * src/LyXAction.C (init): renamed LFUN_TABLE to
78 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
80 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
82 * src/lyxscreen.h: add force_clear variable and fuction to force
83 a clear area when redrawing in LyXText.
85 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
87 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
89 * some whitespace and comment changes.
91 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
93 * src/buffer.C: up te LYX_FORMAT to 2.17
95 2000-08-23 Juergen Vigna <jug@sad.it>
97 * src/BufferView_pimpl.C (tripleClick): disable this when in a
100 * src/insets/insettabular.C (pasteSelection): delete the insets
101 LyXText as it is not valid anymore.
102 (copySelection): new function.
103 (pasteSelection): new function.
104 (cutSelection): new function.
105 (LocalDispatch): implemented cut/copy/paste of cell selections.
107 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
108 don't have a LyXText.
110 * src/LyXAction.C (init): a NEW_TABULAR define too much.
112 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
115 2000-08-22 Juergen Vigna <jug@sad.it>
117 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
118 ifdef form_table out if NEW_TABULAR.
120 2000-08-21 Juergen Vigna <jug@sad.it>
122 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
123 (draw): fixed draw position so that the cursor is positioned in the
125 (InsetMotionNotify): hide/show cursor so the position is updated.
126 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
127 using cellstart() function where it should be used.
129 * src/insets/insettext.C (draw): ditto.
131 * src/tabular.C: fixed initialization of some missing variables and
132 made BoxType into an enum.
134 2000-08-22 Marko Vendelin <markov@ioc.ee>
135 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
136 stock menu item using action numerical value, not its string
140 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
142 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
143 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
145 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
147 * src/frontends/xforms/GUIRunTime.C: new file
149 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
150 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
152 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
154 * src/frontends/kde/GUIRunTime.C: new file
156 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
157 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
159 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
161 * src/frontends/gnome/GUIRunTime.C: new file
163 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
166 * src/frontends/GUIRunTime.h: removed constructor and destructor,
167 small change to documetentation.
169 * src/frontends/GUIRunTime.C: removed file
171 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
173 * src/lyxparagraph.h: enable NEW_TABULAR as default
175 * src/lyxfunc.C (processKeySym): remove some commented code
177 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
178 NEW_TABULAR around the fd_form_table_options.
180 * src/lyx_gui.C (runTime): call the static member function as
181 GUIRunTime::runTime().
183 2000-08-21 Allan Rae <rae@lyx.org>
185 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
188 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
190 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
192 2000-08-21 Allan Rae <rae@lyx.org>
194 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
196 * src/frontends/xforms/FormPreferences.C (build): use setOK
197 * src/frontends/xforms/FormDocument.C (build): use setOK
198 (FormDocument): use the appropriate policy.
200 2000-08-21 Allan Rae <rae@lyx.org>
202 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
203 automatic [de]activation of arbitrary objects when in a read-only state.
205 * src/frontends/ButtonPolicies.h: More documentation
206 (isReadOnly): added to support the above.
208 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
210 2000-08-18 Juergen Vigna <jug@sad.it>
212 * src/insets/insettabular.C (getStatus): changed to return func_status.
214 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
215 display toggle menu entries if they are.
217 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
218 new document layout now.
220 * src/lyxfunc.C: ditto
222 * src/lyx_gui_misc.C: ditto
224 * src/lyx_gui.C: ditto
226 * lib/ui/default.ui: removed paper and quotes layout as they are now
227 all in the document layout tabbed folder.
229 * src/frontends/xforms/forms/form_document.fd: added Restore
230 button and callbacks for all inputs for Allan's ButtonPolicy.
232 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
233 (CheckChoiceClass): added missing params setting on class change.
234 (UpdateLayoutDocument): added for updating the layout on params.
235 (build): forgot to RETURN_ALWAYS input_doc_spacing.
236 (FormDocument): Implemented Allan's ButtonPolicy with the
239 2000-08-17 Allan Rae <rae@lyx.org>
241 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
242 so we can at least see the credits again.
244 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
245 controller calls for the appropriate callbacks. Note that since Ok
246 calls apply followed by cancel, and apply isn't a valid input for the
247 APPLIED state, the bc_ calls have to be made in the static callback not
248 within each of the real callbacks.
250 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
251 (setOk): renamed from setOkay()
253 2000-08-17 Juergen Vigna <jug@sad.it>
255 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
256 in the implementation part.
257 (composeUIInfo): don't show optional menu-items.
259 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
261 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
263 * src/bufferview_funcs.C (CurrentState): fixed to show also the
264 text-state when in a text-inset.
266 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
268 2000-08-17 Marko Vendelin <markov@ioc.ee>
269 * src/frontends/gnome/FormIndex.C
270 * src/frontends/gnome/FormIndex.h
271 * src/frontends/gnome/FormToc.C
272 * src/frontends/gnome/FormToc.h
273 * src/frontends/gnome/dialogs
274 * src/frontends/gnome/diatoc_callbacks.c
275 * src/frontends/gnome/diatoc_callbacks.h
276 * src/frontends/gnome/diainsertindex_callbacks.h
277 * src/frontends/gnome/diainsertindex_callbacks.c
278 * src/frontends/gnome/diainsertindex_interface.c
279 * src/frontends/gnome/diainsertindex_interface.h
280 * src/frontends/gnome/diatoc_interface.h
281 * src/frontends/gnome/diatoc_interface.c
282 * src/frontends/gnome/Makefile.am: Table of Contents and
283 Insert Index dialogs implementation for Gnome frontend
285 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
287 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
289 * src/frontends/gnome/diainserturl_interface.c: make the dialog
292 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
294 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
295 destructor. Don't definde if you don't need it
296 (processEvents): made static, non-blocking events processing for
298 (runTime): static method. event loop for xforms
299 * similar as above for kde and gnome.
301 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
303 (runTime): new method calss the real frontends runtime func.
305 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
307 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
309 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
311 2000-08-16 Juergen Vigna <jug@sad.it>
313 * src/lyx_gui.C (runTime): added GUII RunTime support.
315 * src/frontends/Makefile.am:
316 * src/frontends/GUIRunTime.[Ch]:
317 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
318 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
319 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
321 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
323 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
324 as this is already set in ${FRONTEND_INCLUDE} if needed.
326 * configure.in (CPPFLAGS): setting the include dir for the frontend
327 directory and don't set FRONTEND=xforms for now as this is executed
330 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
332 * src/frontends/kde/Makefile.am:
333 * src/frontends/kde/FormUrl.C:
334 * src/frontends/kde/FormUrl.h:
335 * src/frontends/kde/formurldialog.h:
336 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
338 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
340 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
342 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
344 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
347 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
349 * src/WorkArea.C (work_area_handler): more work to get te
350 FL_KEYBOARD to work with xforms 0.88 too, please test.
352 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
354 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
356 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
359 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
361 * src/Timeout.h: remove Qt::emit hack.
363 * several files: changes to allo doc++ compilation
365 * src/lyxfunc.C (processKeySym): new method
366 (processKeyEvent): comment out if FL_REVISION < 89
368 * src/WorkArea.C: change some debugging levels.
369 (WorkArea): set wantkey to FL_KEY_ALL
370 (work_area_handler): enable the FL_KEYBOARD clause, this enables
371 clearer code and the use of compose with XForms 0.89. Change to
372 use signals instead of calling methods in bufferview directly.
374 * src/Painter.C: change some debugging levels.
376 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
379 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
380 (workAreaKeyPress): new method
382 2000-08-14 Juergen Vigna <jug@sad.it>
384 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
386 * config/kde.m4: addes some features
388 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
389 include missing xforms dialogs.
391 * src/Timeout.h: a hack to be able to compile with qt/kde.
393 * sigc++/.cvsignore: added acinclude.m4
395 * lib/.cvsignore: added listerros
397 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
398 xforms tree as objects are needed for other frontends.
400 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
401 linking with not yet implemented xforms objects.
403 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
405 2000-08-14 Baruch Even <baruch.even@writeme.com>
407 * src/frontends/xforms/FormGraphics.h:
408 * src/frontends/xforms/FormGraphics.C:
409 * src/frontends/xforms/RadioButtonGroup.h:
410 * src/frontends/xforms/RadioButtonGroup.C:
411 * src/insets/insetgraphics.h:
412 * src/insets/insetgraphics.C:
413 * src/insets/insetgraphicsParams.h:
414 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
415 instead of spaces, and various other indentation issues to make the
416 sources more consistent.
418 2000-08-14 Marko Vendelin <markov@ioc.ee>
420 * src/frontends/gnome/dialogs/diaprint.glade
421 * src/frontends/gnome/FormPrint.C
422 * src/frontends/gnome/FormPrint.h
423 * src/frontends/gnome/diaprint_callbacks.c
424 * src/frontends/gnome/diaprint_callbacks.h
425 * src/frontends/gnome/diaprint_interface.c
426 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
429 * src/frontends/gnome/dialogs/diainserturl.glade
430 * src/frontends/gnome/FormUrl.C
431 * src/frontends/gnome/FormUrl.h
432 * src/frontends/gnome/diainserturl_callbacks.c
433 * src/frontends/gnome/diainserturl_callbacks.h
434 * src/frontends/gnome/diainserturl_interface.c
435 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
438 * src/frontends/gnome/Dialogs.C
439 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
440 all other dialogs. Copy all unimplemented dialogs from Xforms
443 * src/frontends/gnome/support.c
444 * src/frontends/gnome/support.h: support files generated by Glade
448 * config/gnome.m4: Gnome configuration scripts
450 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
451 configure --help message
453 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
454 only if there are no events pendling in Gnome/Gtk. This enhances
455 the performance of menus.
458 2000-08-14 Allan Rae <rae@lyx.org>
460 * lib/Makefile.am: listerrors cleaning
462 * lib/listerrors: removed -- generated file
463 * acinclude.m4: ditto
464 * sigc++/acinclude.m4: ditto
466 * src/frontends/xforms/forms/form_citation.fd:
467 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
470 * src/frontends/xforms/forms/makefile: I renamed the `install` target
471 `updatesrc` and now we have a `test` target that does what `updatesrc`
472 used to do. I didn't like having an install target that wasn't related
475 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
476 on all except FormGraphics. This may yet happen. Followed by a major
477 cleanup including using FL_TRANSIENT for most of the dialogs. More
478 changes to come when the ButtonController below is introduced.
480 * src/frontends/xforms/ButtonController.h: New file for managing up to
481 four buttons on a dialog according to an externally defined policy.
482 * src/frontends/xforms/Makefile.am: added above
484 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
485 Apply and Cancel/Close buttons and everything in between and beyond.
486 * src/frontends/Makefile.am: added above.
488 * src/frontends/xforms/forms/form_preferences.fd:
489 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
490 and removed variable 'status' as a result. Fixed the set_minsize thing.
491 Use the new screen-font-update after checking screen fonts were changed
492 Added a "Restore" button to restore the original lyxrc values while
493 editing. This restores everything not just the last input changed.
494 That's still a tricky one. As is the "LyX: this shouldn't happen..."
496 * src/LyXAction.C: screen-font-update added for updating buffers after
497 screen font settings have been changed.
498 * src/commandtags.h: ditto
499 * src/lyxfunc.C: ditto
501 * forms/lyx.fd: removed screen fonts dialog.
502 * src/lyx_gui.C: ditto
503 * src/menus.[Ch]: ditto
504 * src/lyx.[Ch]: ditto
505 * src/lyx_cb.C: ditto + code from here moved to make
506 screen-font-update. And people wonder why progress on GUII is
507 slow. Look at how scattered this stuff was! It takes forever
510 * forms/fdfix.sh: Fixup the spacing after commas.
511 * forms/makefile: Remove date from generated files. Fewer clashes now.
512 * forms/bullet_forms.C.patch: included someones handwritten changes
514 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
515 once I've discovered why LyXRC was made noncopyable.
516 * src/lyx_main.C: ditto
518 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
520 * src/frontends/xforms/forms/fdfix.sh:
521 * src/frontends/xforms/forms/fdfixh.sed:
522 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
523 * src/frontends/xforms/Form*.[hC]:
524 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
525 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
526 provide a destructor for the struct FD_form_xxxx. Another version of
527 the set_[max|min]size workaround and a few other cleanups. Actually,
528 Angus' patch from 20000809.
530 2000-08-13 Baruch Even <baruch.even@writeme.com>
532 * src/insets/insetgraphics.C (Clone): Added several fields that needed
535 2000-08-11 Juergen Vigna <jug@sad.it>
537 * src/insets/insetgraphics.C (InsetGraphics): changing init
538 order because of warnings.
540 * src/frontends/xforms/forms/makefile: adding patching .C with
543 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
544 from .C.patch to .c.patch
546 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
547 order because of warning.
549 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
551 * src/frontends/Liason.C (setMinibuffer): new helper function
553 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
555 * src/lyxfunc.C (Dispatch): calling new Document-Layout
557 * lib/ui/default.ui: commented out PaperLayout entry
559 * src/frontends/xforms/form_document.[Ch]: new added files
561 * src/frontends/xforms/FormDocument.[Ch]: ditto
563 * src/frontends/xforms/forms/form_document.fd: ditto
565 * src/frontends/xforms/forms/form_document.C.patch: ditto
567 2000-08-10 Juergen Vigna <jug@sad.it>
569 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
570 (InsetGraphics): initialized cacheHandle to 0.
571 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
573 2000-08-10 Baruch Even <baruch.even@writeme.com>
575 * src/graphics/GraphicsCache.h:
576 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
577 correctly as a cache.
579 * src/graphics/GraphicsCacheItem.h:
580 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
583 * src/graphics/GraphicsCacheItem_pimpl.h:
584 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
587 * src/insets/insetgraphics.h:
588 * src/insets/insetgraphics.C: Changed from using a signal notification
589 to polling when image is not loaded.
591 2000-08-10 Allan Rae <rae@lyx.org>
593 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
594 that there are two functions that have to been taken out of line by
595 hand and aren't taken care of in the script. (Just a reminder note)
597 * sigc++/macros/*.h.m4: Updated as above.
599 2000-08-09 Juergen Vigna <jug@sad.it>
601 * src/insets/insettext.C (draw): small fix for clearing rectangle.
603 * src/insets/insettabular.C: make drawing of single cell smarter.
605 2000-08-09 Marko Vendelin <markov@ioc.ee>
606 * src/frontends/gnome/Menubar_pimpl.C
607 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
608 implementation: new files
610 * src/frontends/gnome/mainapp.C
611 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
614 * src/main.C: create Gnome main window
616 * src/frontends/xforms/Menubar_pimpl.h
617 * src/frontends/Menubar.C
618 * src/frontends/Menubar.h: added method Menubar::update that calls
619 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
621 * src/LyXView.C: calls Menubar::update to update the state
624 * src/frontends/gnome/Makefile.am: added new files
626 * src/frontends/Makefile.am: added frontend compiler options
628 2000-08-08 Juergen Vigna <jug@sad.it>
630 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
632 * src/bufferlist.C (close):
633 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
634 documents if exiting without saving.
636 * src/buffer.C (save): use removeAutosaveFile()
638 * src/support/filetools.C (removeAutosaveFile): new function.
640 * src/lyx_cb.C (MenuWrite): returns a bool now.
641 (MenuWriteAs): check if file could really be saved and revert to the
643 (MenuWriteAs): removing old autosavefile if existant.
645 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
646 before Goto toggle declaration, because of compiler warning.
648 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
650 * src/lyxfunc.C (MenuNew): small fix.
652 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
654 * src/bufferlist.C (newFile):
655 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
657 * src/lyxrc.C: added new_ask_filename tag
659 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
661 * src/lyx.fd: removed code pertaining to form_ref
662 * src/lyx.[Ch]: ditto
663 * src/lyx_cb.C: ditto
664 * src/lyx_gui.C: ditto
665 * src/lyx_gui_misc.C: ditto
667 * src/BufferView_pimpl.C (restorePosition): update buffer only
670 * src/commandtags.h (LFUN_REFTOGGLE): removed
671 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
672 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
673 (LFUN_REFBACK): renamed LFUN_REF_BACK
675 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
677 * src/lyxfunc.C (Dispatch): ditto.
678 InsertRef dialog is now GUI-independent.
680 * src/texrow.C: added using std::endl;
682 * src/insets/insetref.[Ch]: strip out large amounts of code.
683 The inset is now a container and this functionality is now
684 managed by a new FormRef dialog
686 * src/frontends/Dialogs.h (showRef, createRef): new signals
688 * src/frontends/xforms/FormIndex.[Ch],
689 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
690 when setting dialog's min/max size
691 * src/frontends/xforms/FormIndex.[Ch]: ditto
693 * src/frontends/xforms/FormRef.[Ch],
694 src/frontends/xforms/forms/form_ref.fd: new xforms
695 implementation of an InsetRef dialog
697 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
700 * src/graphics/XPM_Renderer.C (isImageFormatOK):
701 ios::nocreate is not part of the standard. Removed.
703 2000-08-07 Baruch Even <baruch.even@writeme.com>
705 * src/graphics/Renderer.h:
706 * src/graphics/Renderer.C: Added base class for rendering of different
707 image formats into Pixmaps.
709 * src/graphics/XPM_Renderer.h:
710 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
711 in a different class.
713 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
714 easily add support for other formats.
716 * src/insets/figinset.C: plugged a leak of an X resource.
718 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
720 * src/CutAndPaste.[Ch]: make all metods static.
722 * development/Code_rules/Rules: more work, added section on
723 Exceptions, and a References section.
725 * a lot of header files: work to make doc++ able to generate the
726 source documentation, some workarounds of doc++ problems. Doc++ is
727 now able to generate the documentation.
729 2000-08-07 Juergen Vigna <jug@sad.it>
731 * src/insets/insettabular.C (recomputeTextInsets): removed function
733 * src/tabular.C (SetWidthOfMulticolCell):
735 (calculate_width_of_column_NMC): fixed return value so that it really
736 only returns true if the column-width has changed (there where
737 problems with muliticolumn-cells in this column).
739 2000-08-04 Juergen Vigna <jug@sad.it>
741 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
742 also on the scrollstatus of the inset.
743 (workAreaMotionNotify): ditto.
745 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
747 2000-08-01 Juergen Vigna <jug@sad.it>
749 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
752 * src/LyXAction.C (init):
753 * src/insets/inset.C (LocalDispatch): added support for
756 * src/insets/inset.C (scroll): new functions.
758 * src/insets/insettext.C (removeNewlines): new function.
759 (SetAutoBreakRows): removes forced newlines in the text of the
760 paragraph if autoBreakRows is set to false.
762 * src/tabular.C (Latex): generates a parbox around the cell contents
765 * src/frontends/xforms/FormTabular.C (local_update): removed
766 the radio_useparbox button.
768 * src/tabular.C (UseParbox): new function
770 2000-08-06 Baruch Even <baruch.even@writeme.com>
772 * src/graphics/GraphicsCache.h:
773 * src/graphics/GraphicsCache.C:
774 * src/graphics/GraphicsCacheItem.h:
775 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
778 * src/insets/insetgraphics.h:
779 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
780 drawing of the inline image.
782 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
783 into the wrong position.
785 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
788 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
790 * src/support/translator.h: move all typedefs to public section
792 * src/support/filetools.C (MakeLatexName): return string const
795 (FileOpenSearch): ditto
797 (LibFileSearch): ditto
798 (i18nLibFileSearch): ditto
801 (CreateTmpDir): ditto
802 (CreateBufferTmpDir): ditto
803 (CreateLyXTmpDir): ditto
808 (OnlyFilename): ditto
810 (NormalizePath): ditto
812 (GetFileContents): ditto
813 (ReplaceEnvironmentPath): ditto
816 (ChangeExtension): ditto
817 (MakeDisplayPath): ditto
818 (do_popen): return cmdret const
819 (findtexfile): return string const
821 * src/support/DebugStream.h: add some /// to please doc++
823 * src/frontends/DialogBase.h (endif): add some /// to please doc++
825 * src/texrow.C (same_rownumber): functor to use with find_if
826 (getIdFromRow): rewritten to use find_if and to not update the
827 positions. return true if row is found
828 (increasePos): new method, use to update positions
830 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
832 * src/lyxlex_pimpl.C (verifyTable): new method
835 (GetString): return string const
836 (pushTable): rewrite to use std::stack
838 (setFile): better check
841 * src/lyxlex.h: make LyXLex noncopyable
843 * src/lyxlex.C (text): return char const * const
844 (GetString): return string const
845 (getLongString): return string const
847 * src/lyx_gui_misc.C (askForText): return pair<...> const
849 * src/lastfiles.[Ch] (operator): return string const
851 * src/buffer.C (parseSingleLyXformat2Token): pass string to
852 istringstream not char const *.
853 move token.end() out of loop.
854 (readFile): move initializaton of token
856 * src/BufferView2.C (insertErrors): run texrow.increasePos if
857 getIdFromRow is successful.
859 * lib/bind/emacs.bind: don't include menus bind
861 * development/Code_rules/Rules: the beginnings of making this
862 better and covering more of the unwritten rules that we have.
864 * development/Code_rules/Recommendations: a couple of wording
867 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
869 * src/support/strerror.c: remove C++ comment.
871 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
873 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
874 LFUN_INDEX_INSERT_LAST
876 * src/texrow.C (getIdFromRow): changed from const_iterator to
877 iterator, allowing code to compile with DEC cxx
879 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
880 stores part of the class, as suggested by Allan. Will allow
882 (apply): test to apply uses InsetCommandParams operator!=
884 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
885 (apply): test to apply uses InsetCommandParams operator!=
887 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
888 stores part of the class.
889 (update): removed limits on min/max size.
891 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
892 (apply): test to apply uses InsetCommandParams operator!=
894 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
895 (Read, Write, scanCommand, getCommand): moved functionality
896 into InsetCommandParams.
898 (getScreenLabel): made pure virtual
899 new InsetCommandParams operators== and !=
901 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
902 c-tors based on InsetCommandParams. Removed others.
903 * src/insets/insetinclude.[Ch]: ditto
904 * src/insets/insetlabel.[Ch]: ditto
905 * src/insets/insetparent.[Ch]: ditto
906 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
908 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
909 insets derived from InsetCommand created using similar c-tors
910 based on InsetCommandParams
911 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
912 * src/menus.C (ShowRefsMenu): ditto
913 * src/paragraph.C (Clone): ditto
914 * src/text2.C (SetCounter): ditto
915 * src/lyxfunc.C (Dispatch) ditto
916 Also recreated old InsetIndex behaviour exactly. Can now
917 index-insert at the start of a paragraph and index-insert-last
918 without launching the pop-up.
920 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
922 * lib/lyxrc.example: mark te pdf options as non functional.
924 * src/support/lstrings.C (strToInt): move initalization of tmpstr
925 (isStrDbl): move tmpstr.end() out of loop.
926 (strToDbl): move intialization of tmpstr
927 (lowercase): return string const and move tmp.end() out of loop.
928 (uppercase): return string const and move tmp.edn() out of loop.
929 (prefixIs): add assertion
934 (containsOnly): ditto
935 (containsOnly): ditto
936 (containsOnly): ditto
937 (countChar): make last arg char not char const
938 (token): return string const
939 (subst): return string const, move tmp.end() out of loop.
940 (subst): return string const, add assertion
941 (strip): return string const
942 (frontStrip): return string const, add assertion
943 (frontStrip): return string const
948 * src/support/lstrings.C: add inclde "LAssert.h"
949 (isStrInt): move tmpstr.end() out of loop.
951 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
952 toollist.end() out of loop.
953 (deactivate): move toollist.end() out of loop.
954 (update): move toollist.end() out of loop.
955 (updateLayoutList): move tc.end() out of loop.
956 (add): move toollist.end() out of loop.
958 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
959 md.end() out of loop.
961 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
963 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
966 * src/paragraph.C (Erase): move fontlist.end() out of loop.
967 (Erase): move insetlist.end() out of loop.
969 * src/lyx_sendfax_main.C: make show_logfile static and to take a
970 ref to const string as first arg. Move initialization of some
971 variables, whitespace changes.
973 * src/kbmap.C (defkey): move table.end() out of loop.
974 (kb_keymap): move table.end() out of loop.
975 (findbinding): move table.end() out of loop.
977 * src/MenuBackend.C (hasMenu): move end() out of loop.
978 (getMenu): move end() out of loop.
979 (getMenu): move menulist_.end() out of loop.
981 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
983 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
986 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
987 (getFromLyXName): move infotab.end() out of loop.
989 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
990 -fvtable-thunks -ffunction-sections -fdata-sections
992 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
994 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
997 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
999 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
1001 * src/frontends/xforms/FormCitation.[Ch],
1002 src/frontends/xforms/FormIndex.[Ch],
1003 src/frontends/xforms/FormToc.[Ch],
1004 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
1006 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1008 * src/commandtags.h: renamed, created some flags for citation
1011 * src/lyx_gui_misc.C: stripped out old FD_index_form code
1013 * src/lyxfunc.C (dispatch): use signals to insert index entry
1015 * src/frontends/Dialogs.h: new signal createIndex
1017 * src/frontends/xforms/FormCommand.[Ch],
1018 src/frontends/xforms/FormCitation.[Ch],
1019 src/frontends/xforms/FormToc.[Ch],
1020 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
1022 * src/insets/insetindex.[Ch]: GUI-independent
1024 * src/frontends/xforms/FormIndex.[Ch],
1025 * src/frontends/xforms/forms/form_index.fd: xforms implementation
1028 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
1030 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
1031 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
1033 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1035 * src/insets/insetref.C (Latex): rewrite so that there is now
1036 question that a initialization is requested.
1038 * src/insets/insetcommand.h: reenable the hide signal
1040 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1042 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
1043 fix handling of shortcuts (many bugs :)
1044 (add_lastfiles): ditto.
1046 * lib/ui/default.ui: fix a few shortcuts.
1048 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
1050 * Makefile.am: Fix ``rpmdist'' target to return the exit
1051 status of the ``rpm'' command, instead of the last command in
1052 the chain (the ``rm lyx.xpm'' command, which always returns
1055 2000-08-02 Allan Rae <rae@lyx.org>
1057 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
1058 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
1059 * src/frontends/xforms/FormToc.C (FormToc): ditto
1061 * src/frontends/xforms/Makefile.am: A few forgotten files
1063 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
1064 Signals-not-copyable-problem Lars' started commenting out.
1066 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
1068 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1070 * src/insets/insetcommand.h: Signals is not copyable so anoter
1071 scheme for automatic hiding of forms must be used.
1073 * src/frontends/xforms/FormCitation.h: don't inerit from
1074 noncopyable, FormCommand already does that.
1075 * src/frontends/xforms/FormToc.h: ditto
1076 * src/frontends/xforms/FormUrl.h: ditto
1078 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1080 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
1082 * src/insets/insetcommand.h (hide): new SigC::Signal0
1083 (d-tor) new virtual destructor emits hide signal
1085 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
1086 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
1088 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
1089 LOF and LOT. Inset is now GUI-independent
1091 * src/insets/insetloa.[Ch]: redundant
1092 * src/insets/insetlof.[Ch]: ditto
1093 * src/insets/insetlot.[Ch]: ditto
1095 * src/frontends/xforms/forms/form_url.fd: tweaked!
1096 * src/frontends/xforms/forms/form_citation.fd: ditto
1098 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
1099 dialogs dealing with InsetCommand insets
1101 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
1102 FormCommand base class
1103 * src/frontends/xforms/FormUrl.[Ch]: ditto
1105 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
1107 * src/frontends/xforms/FormToc.[Ch]: ditto
1109 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
1110 passed a generic InsetCommand pointer
1111 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
1113 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
1114 and modified InsetTOC class
1115 * src/buffer.C: ditto
1117 * forms/lyx.fd: strip out old FD_form_toc code
1118 * src/lyx_gui_misc.C: ditto
1119 * src/lyx_gui.C: ditto
1120 * src/lyx_cb.C: ditto
1121 * src/lyx.[Ch]: ditto
1123 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1125 * src/support/utility.hpp: tr -d '\r'
1127 2000-08-01 Juergen Vigna <jug@sad.it>
1129 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
1131 * src/commandtags.h:
1132 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
1133 LFUN_TABULAR_FEATURES.
1135 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
1136 LFUN_LAYOUT_TABULAR.
1138 * src/insets/insettabular.C (getStatus): implemented helper function.
1140 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
1142 2000-07-31 Juergen Vigna <jug@sad.it>
1144 * src/text.C (draw): fixed screen update problem for text-insets.
1146 * src/text2.C (SetParagrpah): call an update of the inset-owner when
1147 something changed probably this has to be added in various other
1150 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
1152 2000-07-31 Baruch Even <baruch.even@writeme.com>
1154 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
1155 templates to satisfy compaq cxx.
1158 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1160 * src/support/translator.h (equal_1st_in_pair::operator()): take
1161 const ref pair_type as arg.
1162 (equal_2nd_in_pair::operator()): ditto
1163 (Translator::~Translator): remove empty d-tor.
1165 * src/graphics/GraphicsCache.C: move include config.h to top, also
1166 put initialization of GraphicsCache::singleton here.
1167 (~GraphicsCache): move here
1168 (addFile): take const ref as arg
1171 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
1173 * src/BufferView2.C (insertLyXFile): change te with/without header
1176 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1178 * src/frontends/xforms/FormGraphics.C (apply): add some
1179 static_cast. Not very nice, but required by compaq cxx.
1181 * src/frontends/xforms/RadioButtonGroup.h: include header
1182 <utility> instead of <pair.h>
1184 * src/insets/insetgraphicsParams.C: add using directive.
1185 (readResize): change return type to void.
1186 (readOrigin): ditto.
1188 * src/lyxfunc.C (getStatus): add missing break for build-program
1189 function; add test for Literate for export functions.
1191 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
1192 entries in Options menu.
1194 2000-07-31 Baruch Even <baruch.even@writeme.com>
1196 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
1197 protect against auto-allocation; release icon when needed.
1199 2000-07-31 Matej Cepl <CeplM@seznam.cz>
1201 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
1202 on usual typewriter.
1204 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
1205 earlier czech.kmap), useful only for programming.
1207 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1209 * src/frontends/xforms/FormCitation.h: fix conditioning around
1212 2000-07-31 Juergen Vigna <jug@sad.it>
1214 * src/frontends/xforms/FormTabular.C (local_update): changed
1215 radio_linebreaks to radio_useparbox and added radio_useminipage.
1217 * src/tabular.C: made support for using minipages/parboxes.
1219 * src/bufferlist.C (QwriteAll): small fix for asking for save.
1221 * src/insets/insetgraphics.C (draw): just draw the inset so that the
1223 (descent): so the cursor is in the middle.
1224 (width): bit smaller box.
1226 * src/insets/insetgraphics.h: added display() function.
1228 2000-07-31 Baruch Even <baruch.even@writeme.com>
1230 * src/frontends/Dialogs.h: Added showGraphics signals.
1232 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
1233 xforms form definition of the graphics dialog.
1235 * src/frontends/xforms/FormGraphics.h:
1236 * src/frontends/xforms/FormGraphics.C: Added files, the
1237 GUIndependent code of InsetGraphics
1239 * src/insets/insetgraphics.h:
1240 * src/insets/insetgraphics.C: Major writing to make it work.
1242 * src/insets/insetgraphicsParams.h:
1243 * src/insets/insetgraphicsParams.C: Added files, parameter passing
1244 struct between InsetGraphics and GUI.
1246 * src/LaTeXFeatures.h:
1247 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
1248 support for graphicx package.
1250 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
1251 for the graphics inset.
1253 * src/support/translator.h: Added file, used in
1254 InsetGraphicsParams. this is a template to translate between two
1257 * src/frontends/xforms/RadioButtonGroup.h:
1258 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
1259 way to easily control a radio button group.
1261 2000-07-28 Juergen Vigna <jug@sad.it>
1263 * src/insets/insettabular.C (LocalDispatch):
1264 (TabularFeatures): added support for lyx-functions of tabular features.
1265 (cellstart): refixed this function after someone wrongly changed it.
1267 * src/commandtags.h:
1268 * src/LyXAction.C (init): added support for tabular-features
1270 2000-07-28 Allan Rae <rae@lyx.org>
1272 * src/frontends/xforms/FormPreferences.C (build): Setup input return
1273 checking. NOTE: It seems that pressing ESC to cancel the dialog also
1274 triggers the callback for input checking. As a result we sometimes get
1275 "LyX: This shouldn't happen..." printed to cerr.
1276 (input): Started using status variable since I only free() on
1277 destruction. Some input checking for paths and font sizes.
1279 * src/frontends/xforms/FormPreferences.h: Use status to control
1280 activation of Ok and Apply
1282 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
1283 callback. Also resized to stop segfaults with 0.88. The problem is
1284 that xforms-0.88 requires the folder to be wide enough to fit all the
1285 tabs. If it isn't it causes all sorts of problems.
1287 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
1289 * src/frontends/xforms/forms/README: Reflect reality.
1291 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
1292 * src/frontends/xforms/forms/makefile: ditto.
1294 * src/commandtags.h: Get access to new Preferences dialog
1295 * src/LyXAction.C: ditto
1296 * src/lyxfunc.C: ditto
1297 * lib/ui/default.ui: ditto
1299 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1301 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
1303 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
1306 * src/frontends/xforms/form_url.[Ch]: added.
1308 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1310 * src/insets/insetbib.h: fixed bug in previous commit
1312 * src/frontends/xforms/FormUrl.h: ditto
1314 * src/frontends/xforms/FormPrint.h: ditto
1316 * src/frontends/xforms/FormPreferences.h: ditto
1318 * src/frontends/xforms/FormCopyright.h: ditto
1320 * src/frontends/xforms/FormCitation.C: ditto
1322 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
1323 private copyconstructor and private default contructor
1325 * src/support/Makefile.am: add utility.hpp
1327 * src/support/utility.hpp: new file from boost
1329 * src/insets/insetbib.h: set owner in clone
1331 * src/frontends/xforms/FormCitation.C: added missing include
1334 * src/insets/form_url.[Ch]: removed
1336 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
1338 * development/lyx.spec.in
1339 * Makefile.am: Fix buglet for LyX RPM generation resulting from
1340 file/directory re-organization.
1342 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
1344 * src/insets/insetcommand.[Ch]: moved the string data and
1345 associated manipulation methods into a new stand-alone class
1346 InsetCommandParams. This class has two additional methods
1347 getAsString() and setFromString() allowing the contents to be
1348 moved around as a single string.
1349 (addContents) method removed.
1350 (setContents) method no longer virtual.
1352 * src/buffer.C (readInset): made use of new InsetCitation,
1353 InsetUrl constructors based on InsetCommandParams.
1355 * src/commandtags.h: add LFUN_INSERT_URL
1357 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
1358 independent InsetUrl and use InsetCommandParams to extract
1359 string info and create new Insets.
1361 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
1363 * src/frontends/xforms/FormCitation.C (apply): uses
1366 * src/frontends/xforms/form_url.C
1367 * src/frontends/xforms/form_url.h
1368 * src/frontends/xforms/FormUrl.h
1369 * src/frontends/xforms/FormUrl.C
1370 * src/frontends/xforms/forms/form_url.fd: new files
1372 * src/insets/insetcite.[Ch]: removed unused constructors.
1374 * src/insets/insetinclude.[Ch]: no longer store filename
1376 * src/insets/inseturl.[Ch]: GUI-independent.
1378 2000-07-26 Juergen Vigna <jug@sad.it>
1379 * renamed frontend from gtk to gnome as it is that what is realized
1380 and did the necessary changes in the files.
1382 2000-07-26 Marko Vendelin <markov@ioc.ee>
1384 * configure.in: cleaning up gnome configuration scripts
1386 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1388 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
1389 shortcuts syndrom by redrawing them explicitely (a better solution
1390 would be appreciated).
1392 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
1394 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
1397 * src/lyx_cb.C (MenuExport): change html export to do the right
1398 thing depending of the document type (instead of having
1399 html-linuxdoc and html-docbook).
1400 * src/lyxfunc.C (getStatus): update for html
1401 * lib/ui/default.ui: simplify due to the above change.
1402 * src/menus.C (ShowFileMenu): update too (in case we need it).
1404 * src/MenuBackend.C (read): if a menu is defined twice, add the
1405 new entries to the exiting one.
1407 2000-07-26 Juergen Vigna <jug@sad.it>
1409 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
1411 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
1412 and return a bool if it did actual save the file.
1413 (AutoSave): don't autosave a unnamed doc.
1415 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
1416 check if this is an UNNAMED new file and react to it.
1417 (newFile): set buffer to unnamed and change to not mark a new
1418 buffer dirty if I didn't do anything with it.
1420 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
1422 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1424 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
1425 friend as per Angus's patch posted to lyx-devel.
1427 * src/ext_l10n.h: updated
1429 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
1430 gettext on the style string right before inserting them into the
1433 * autogen.sh: add code to extract style strings form layout files,
1434 not good enough yet.
1436 * src/frontends/gtk/.cvsignore: add MAKEFILE
1438 * src/MenuBackend.C (read): run the label strings through gettext
1439 before storing them in the containers.
1441 * src/ext_l10n.h: new file
1443 * autogen.sh : generate the ext_l10n.h file here
1445 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1447 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
1450 * lib/ui/default.ui: fix a couple of typos.
1452 * config/gnome/gtk.m4: added (and added to the list of files in
1455 * src/insets/insetinclude.C (unique_id): fix when we are using
1456 lyxstring instead of basic_string<>.
1457 * src/insets/insettext.C (LocalDispatch): ditto.
1458 * src/support/filetools.C: ditto.
1460 * lib/configure.m4: create the ui/ directory if necessary.
1462 * src/LyXView.[Ch] (updateToolbar): new method.
1464 * src/BufferView_pimpl.C (buffer): update the toolbar when
1465 opening/closing buffer.
1467 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1469 * src/LyXAction.C (getActionName): enhance to return also the name
1470 and options of pseudo-actions.
1471 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
1473 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
1474 as an example of what is possible). Used in File->Build too (more
1475 useful) and in the import/export menus (to mimick the complicated
1476 handling of linuxdoc and friends). Try to update all the entries.
1478 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
1481 * src/MenuBackend.C (read): Parse the new OptItem tag.
1483 * src/MenuBackend.h: Add a new optional_ data member (used if the
1484 entry should be omitted when the lyxfunc is disabled).
1486 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
1487 function, used as a shortcut.
1488 (create_submenu): align correctly the shortcuts on the widest
1491 * src/MenuBackend.h: MenuItem.label() only returns the label of
1492 the menu without shortcut; new method shortcut().
1494 2000-07-14 Marko Vendelin <markov@ioc.ee>
1496 * src/frontends/gtk/Dialogs.C:
1497 * src/frontends/gtk/FormCopyright.C:
1498 * src/frontends/gtk/FormCopyright.h:
1499 * src/frontends/gtk/Makefile.am: added these source-files for the
1500 Gtk/Gnome support of the Copyright-Dialog.
1502 * src/main.C: added Gnome::Main initialization if using
1503 Gtk/Gnome frontend-GUI.
1505 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
1507 * config/gnome/aclocal-include.m4
1508 * config/gnome/compiler-flags.m4
1509 * config/gnome/curses.m4
1510 * config/gnome/gnome--.m4
1511 * config/gnome/gnome-bonobo-check.m4
1512 * config/gnome/gnome-common.m4
1513 * config/gnome/gnome-fileutils.m4
1514 * config/gnome/gnome-ghttp-check.m4
1515 * config/gnome/gnome-gnorba-check.m4
1516 * config/gnome/gnome-guile-checks.m4
1517 * config/gnome/gnome-libgtop-check.m4
1518 * config/gnome/gnome-objc-checks.m4
1519 * config/gnome/gnome-orbit-check.m4
1520 * config/gnome/gnome-print-check.m4
1521 * config/gnome/gnome-pthread-check.m4
1522 * config/gnome/gnome-support.m4
1523 * config/gnome/gnome-undelfs.m4
1524 * config/gnome/gnome-vfs.m4
1525 * config/gnome/gnome-x-checks.m4
1526 * config/gnome/gnome-xml-check.m4
1527 * config/gnome/gnome.m4
1528 * config/gnome/gperf-check.m4
1529 * config/gnome/gtk--.m4
1530 * config/gnome/linger.m4
1531 * config/gnome/need-declaration.m4: added configuration scripts
1532 for Gtk/Gnome frontend-GUI
1534 * configure.in: added support for the --with-frontend=gtk option
1536 * autogen.sh: added config/gnome/* to list of config-files
1538 * acconfig.h: added define for GTKGUI-support
1540 * config/lyxinclude.m4: added --with-frontend[=value] option value
1541 for Gtk/Gnome frontend-GUI support.
1543 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1545 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
1549 * src/paragraph.C (GetChar): remove non-const version
1551 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
1552 (search_kw): use it.
1554 * src/lyx_main.C (init): if "preferences" exist, read that instead
1556 (ReadRcFile): return bool if the file could be read ok.
1557 (ReadUIFile): add a check to see if lex file is set ok.
1559 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
1560 bastring can be used instead of lyxstring (still uses the old code
1561 if std::string is good enough or if lyxstring is used.)
1563 * src/encoding.C: make the arrays static, move ininle functions
1565 * src/encoding.h: from here.
1567 * src/buffer.C: have last_isnet_read as a file scope variable for now.
1568 (parseSingleLyXformat2Token): move inset parsing to separate method
1569 (readInset): new private method
1571 * src/Variables.h: remove virtual from get().
1573 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
1574 access to NEW_INSETS and NEW_TABULAR
1576 * src/MenuBackend.h: remove superfluous forward declaration of
1577 MenuItem. Add documentations tags "///", remove empty MenuItem
1578 destructor, remove private default contructor.
1580 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
1582 (read): more string mlabel and mname to where they are used
1583 (read): remove unused variables mlabel and mname
1584 (defaults): unconditional clear, make menusetup take advantage of
1585 add returning Menu &.
1587 * src/LyXView.h: define NEW_MENUBAR as default
1589 * src/LyXAction.C: include lyxparagraph.h temporary to get access
1590 to NEW_INSETS and NEW_TABULAR.
1591 (init): commetn out some funcs that is obsolete when NEW_INSETS is
1592 defined. Change some of the "xxxx-inset-insert" functions names to
1595 * several files: more enahncements to NEW_INSETS and the resulting
1598 * lib/lyxrc.example (\date_insert_format): move to misc section
1600 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
1601 bastring and use AC_CACHE_CHECK.
1602 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
1603 the system have the newest methods. uses AC_CACHE_CHECK
1604 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
1605 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
1606 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
1608 * configure.in: add LYX_CXX_GOOD_STD_STRING
1610 * acinclude.m4: recreated
1612 2000-07-24 Amir Karger
1614 * README: add Hebrew, Arabic kmaps
1617 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1619 * src/buffer.C (writeFileAscii): Define actcell as an int instead
1622 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1624 * Lot of files: add pragma interface/implementation.
1626 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
1628 * lib/ui/default.ui: new file (ans new directory). Contains the
1629 default menu and toolbar.
1631 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
1632 global space. Toolbars are now read (as menus) in ui files.
1634 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
1636 * src/lyxfunc.C (getStatus): do not exit immediately if a command
1637 is disabled because the document is read-only. We want to have the
1638 toggle state of the function anyway.
1639 (getStatus): add code for LFUN_VC* functions (mimicking what is
1640 done in old-style menus)
1642 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
1643 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
1645 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
1646 * src/BufferView_pimpl.C: ditto.
1647 * src/lyxfunc.C: ditto.
1649 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
1650 default). This replaces old-style menus by new ones.
1652 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
1653 MenuItem. Contain the data structure of a menu.
1655 * src/insets/insettext.C: use LyXView::setLayout instead of
1656 accessing directly the toolbar combox.
1657 * src/lyxfunc.C (Dispatch): ditto.
1659 * src/LyXView.C (setLayout): new method, which just calls
1660 Toolbar::setLayout().
1661 (updateLayoutChoice): move part of this method in Toolbar.
1663 * src/toolbar.[Ch]: removed.
1665 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
1666 implementation the toolbar.
1668 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
1669 the toolbar. It might make sense to merge it with ToolbarDefaults
1671 (setLayout): new function.
1672 (updateLayoutList): ditto.
1673 (openLayoutList): ditto.
1675 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
1676 xforms implementation of the toolbar.
1677 (get_toolbar_func): comment out, since I do not
1678 know what it is good for.
1680 * src/ToolbarDefaults.h: Add the ItemType enum.
1682 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
1683 for a list of allocated C strings. Used in Menubar xforms
1684 implementation to avoid memory leaks.
1686 * src/support/lstrings.[Ch] (uppercase): new version taking and
1690 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
1691 * lib/bind/emacs.bind: ditto.
1693 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
1695 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
1696 forward decl of LyXView.
1698 * src/toolbar.C (toolbarItem): moved from toolbar.h
1699 (toolbarItem::clean): ditto
1700 (toolbarItem::~toolbarItem): ditto
1701 (toolbarItem::operator): ditto
1703 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
1705 * src/paragraph.h: control the NEW_TABULAR define from here
1707 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
1708 USE_TABULAR_INSETS to NEW_TABULAR
1710 * src/ToolbarDefaults.C: add include "lyxlex.h"
1712 * files using the old table/tabular: use NEW_TABULAR to control
1713 compilation of old tabular stuff.
1715 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
1718 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
1719 planemet in reading of old style floats, fix the \end_deeper
1720 problem when reading old style floats.
1722 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1724 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
1726 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
1728 * lib/bind/sciword.bind: updated.
1730 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1732 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
1733 layout write problem
1735 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1737 * src/Makefile.am (INCLUDES): remove image directory from include
1740 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
1741 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
1743 * src/LyXView.C (create_form_form_main): read the application icon
1746 * lib/images/*.xpm: change the icons to use transparent color for
1749 * src/toolbar.C (update): change the color of the button when it
1752 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1754 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
1755 setting explicitely the minibuffer.
1756 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
1758 * src/LyXView.C (showState): new function. Shows font information
1759 in minibuffer and update toolbar state.
1760 (LyXView): call Toolbar::update after creating the
1763 * src/toolbar.C: change toollist to be a vector instead of a
1765 (BubbleTimerCB): get help string directly from the callback
1766 argument of the corresponding icon (which is the action)
1767 (set): remove unnecessary ugliness.
1768 (update): new function. update the icons (depressed, disabled)
1769 depending of the status of the corresponding action.
1771 * src/toolbar.h: remove help in toolbarItem
1773 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
1775 * src/Painter.C (text): Added code for using symbol glyphs from
1776 iso10646 fonts. Currently diabled.
1778 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
1781 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
1782 magyar,turkish and usorbian.
1784 * src/paragraph.C (isMultiLingual): Made more efficient.
1786 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
1789 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
1790 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
1791 Also changed the prototype to "bool math_insert_greek(char)".
1793 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1795 * lots of files: apply the NEW_INSETS on all code that will not be
1796 needed when we move to use the new insets. Enable the define in
1797 lyxparagrah.h to try it.
1799 * src/insets/insettabular.C (cellstart): change to be a static
1801 (InsetTabular): initialize buffer in the initializer list.
1803 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
1805 * src/frontends/xforms/FormPrint.[Ch] : moved #include
1806 form_print.h out of the header file. Replaced with forward
1807 declarations of the relevant struct.
1809 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
1812 * src/commandtags.h: do not include "debug.h" which does not
1813 belong there. #include it in some other places because of this
1816 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1818 * src/insets/insetcaption.C: add a couple "using" directives.
1820 * src/toolbar.C (add): get the help text directly from lyxaction.
1822 (setPixmap): new function. Loads from disk and sets a pixmap on a
1823 botton; the name of the pixmap file is derived from the command
1826 * src/toolbar.h: remove members isBitmap and pixmap from
1829 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
1830 * lib/images/: move many files from images/banner.xpm.
1832 * src/lyx_gui.C (create_forms): read banner pixmap from file.
1834 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
1835 * src/toolbar.C: ditto.
1836 * configure.in: ditto.
1837 * INSTALL: document.
1839 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
1840 the spellchecker popup is closed from the WM.
1842 2000-07-19 Juergen Vigna <jug@sad.it>
1844 * src/insets/insetfloat.C (Write): small fix because we use the
1845 insetname for the type now!
1847 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
1849 * src/frontends/xforms/forms/form_citation.fd: object sizes are
1852 * src/frontends/Dialogs.h: removed hideCitation signal
1854 * src/insets/insetcite.h: added hide signal
1856 * src/insets/insetcite.C (~InsetCitation): emits new signal
1857 (getScreenLabel): "intelligent" label should now fit on the screen!
1859 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
1861 * src/frontends/xforms/FormCitation.C (showInset): connects
1862 hide() to the inset's hide signal
1863 (show): modified to use fl_set_object_position rather than
1864 fl_set_object_geometry wherever possible
1866 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1868 * src/insets/lyxinset.h: add caption code
1870 * src/insets/insetfloat.C (type): new method
1872 * src/insets/insetcaption.C (Write): new method
1874 (LyxCode): new method
1876 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
1877 to get it right together with using the FloatList.
1879 * src/commandtags.h: add LFUN_INSET_CAPTION
1880 * src/lyxfunc.C (Dispatch): handle it
1882 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
1885 * src/Variables.[Ch]: make expand take a const reference, remove
1886 the destructor, some whitespace changes.
1888 * src/LyXAction.C (init): add caption-inset-insert
1890 * src/FloatList.C (FloatList): update the default floats a bit.
1892 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1894 * src/Variables.[Ch]: new files. Intended to be used for language
1895 specific strings (like \chaptername) and filename substitution in
1898 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
1900 * lib/kbd/american.kmap: update
1902 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
1904 * src/bufferparams.[Ch]: remove member allowAccents.
1906 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
1908 * src/LaTeXLog.C: use the log_form.h header.
1909 * src/lyx_gui.C: ditto.
1910 * src/lyx_gui_misc.C: ditto.
1911 * src/lyxvc.h: ditto.
1913 * forms/log_form.fd: new file, created from latexoptions.fd. I
1914 kept the log popup and nuked the options form.
1916 * src/{la,}texoptions.[Ch]: removed.
1917 * src/lyx_cb.C (LaTeXOptions): ditto
1919 * src/lyx_gui.C (create_forms): do not handle the
1920 fd_latex_options form.
1922 2000-07-18 Juergen Vigna <jug@sad.it>
1924 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
1925 name of the inset so that it can be requested outside (text2.C).
1927 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
1930 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1932 * src/mathed/formula.h (ConvertFont): constify
1934 * src/mathed/formula.C (Read): add warning if \end_inset is not
1935 found on expected place.
1937 * src/insets/lyxinset.h (ConvertFont): consify
1939 * src/insets/insetquotes.C (ConvertFont): constify
1940 * src/insets/insetquotes.h: ditto
1942 * src/insets/insetinfo.h: add labelfont
1944 * src/insets/insetinfo.C (InsetInfo): set the labelfont
1945 (ascent): use labelfont
1949 (Write): make .lyx file a bit nicer
1951 * src/insets/insetfloat.C (Write): simplify somewhat...
1952 (Read): add warning if arg is not found
1954 * src/insets/insetcollapsable.C: add using std::max
1955 (Read): move string token and add warning in arg is not found
1956 (draw): use std::max to get the right ty
1957 (getMaxWidth): simplify by using std::max
1959 * src/insets/insetsection.h: new file
1960 * src/insets/insetsection.C: new file
1961 * src/insets/insetcaption.h: new file
1962 * src/insets/insetcaption.C: new file
1964 * src/insets/inset.C (ConvertFont): constify signature
1966 * src/insets/Makefile.am (libinsets_la_SOURCES): add
1967 insetcaption.[Ch] and insetsection.[Ch]
1969 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
1970 uses to use LABEL_COUNTER_CHAPTER instead.
1971 * src/text2.C (SetCounter): here
1973 * src/counters.h: new file
1974 * src/counters.C: new file
1975 * src/Sectioning.h: new file
1976 * src/Sectioning.C: new file
1978 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
1980 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1982 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
1985 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
1988 2000-07-17 Juergen Vigna <jug@sad.it>
1990 * src/tabular.C (Validate): check if array-package is needed.
1991 (SetVAlignment): added support for vertical alignment.
1992 (SetLTFoot): better support for longtable header/footers
1993 (Latex): modified to support added features.
1995 * src/LaTeXFeatures.[Ch]: added array-package.
1997 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
1999 * src/lyx_gui.C (LyXGUI): make sure that the height is large
2002 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
2004 * configure.in: do not forget to put a space after -isystem.
2006 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
2008 * lib/kbd/arabic.kmap: a few fixes.
2010 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2012 * some whitespace chagnes to a number of files.
2014 * src/support/DebugStream.h: change to make it easier for
2015 doc++ to parse correctly.
2016 * src/support/lyxstring.h: ditto
2018 * src/mathed/math_utils.C (compara): change to have only one
2020 (MathedLookupBOP): change because of the above.
2022 * src/mathed/math_delim.C (math_deco_compare): change to have only
2024 (search_deco): change becasue of the above.
2026 * src/insets/insettabular.C (DrawCellSelection): use std::swap
2027 instead of manually coded one.
2029 * src/insets/insetquotes.C (Read): read the \end_inset too
2031 * src/insets/insetlatex.h: remove file
2032 * src/insets/insetlatex.C: remove file
2034 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
2036 (InsetPrintIndex): remove destructor
2038 * src/insets/insetinclude.h: remove default constructor
2040 * src/insets/insetfloat.C: work to make it work better
2042 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
2044 * src/insets/insetcite.h (InsetCitation): remove default constructor
2046 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
2048 * src/text.C (GetColumnNearX): comment out some currently unused code.
2050 * src/paragraph.C (writeFile): move some initializations closer to
2052 (CutIntoMinibuffer): small change to use new matchIT operator
2056 (InsertInset): ditto
2059 (InsetIterator): ditto
2060 (Erase): small change to use new matchFT operator
2062 (GetFontSettings): ditto
2063 (HighestFontInRange): ditto
2066 * src/lyxparagraph.h: some chars changed to value_type
2067 (matchIT): because of some stronger checking (perhaps too strong)
2068 in SGI STL, the two operator() unified to one.
2071 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
2073 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
2074 the last inset read added
2075 (parseSingleLyXformat2Token): some more (future) compability code added
2076 (parseSingleLyXformat2Token): warning about solitary \end_inset added
2077 (parseSingleLyXformat2Token): set last_inset_read
2078 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2079 (parseSingleLyXformat2Token): don't double intializw string next_token
2081 * src/TextCache.C (text_fits::operator()): add const's to the signature
2082 (has_buffer::operator()): ditto
2084 * src/Floating.h: add some comments on the class
2086 * src/FloatList.[Ch] (typeExist): new method
2089 * src/BackStack.h: added default constructor, wanted by Gcc.
2091 2000-07-14 Juergen Vigna <jug@sad.it>
2093 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
2095 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
2097 * src/insets/insettabular.C (resizeLyXText): need this to be able to
2098 do a redraw when the window is resized!
2099 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
2101 * src/insets/insettext.C (resizeLyXText): added function to correctly
2102 being able to resize the LyXWindow.
2104 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
2106 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
2108 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
2109 crashes when closing dialog to a deleted inset.
2111 * src/insets/insetcite.[Ch] (Edit) : the return of this former
2112 method! Now similar to other insets.
2114 2000-07-13 Juergen Vigna <jug@sad.it>
2116 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
2118 * lib/examples/Literate.lyx: small patch!
2120 * src/insets/insetbib.C (Read): added this function because of wrong
2121 Write (without [begin|end]_inset).
2123 2000-07-11 Juergen Vigna <jug@sad.it>
2125 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
2126 as the insertInset could not be good!
2128 * src/screen.C (ToggleSelection): fixed toggle selection bug as
2129 the bool param should not be last.
2131 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2133 * sigc++/configure.in: fix bug in threading-related code (Yes, I
2134 did submit that to Karl).
2136 * configure.in: use -isystem instead of -I for X headers. This
2137 fixes a problem on solaris with a recent gcc;
2138 put the front-end code after the X detection code;
2139 configure in sigc++ before lib/
2141 * src/lyx_main.C (commandLineHelp): remove -display from command
2144 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
2146 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
2147 Also put in Makefile rules for building the ``listerrors''
2148 program for parsing errors from literate programs written in LyX.
2150 * lib/build-listerrors: Added small shell script as part of compile
2151 process. This builds a working ``listerrors'' binary if noweb is
2152 installed and either 1) the VNC X server is installed on the machine,
2153 or 2) the user is compiling from within a GUI. The existence of a GUI
2154 is necessary to use the ``lyx --export'' feature for now. This
2155 hack can be removed once ``lyx --export'' no longer requires a GUI to
2158 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
2160 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
2161 now passed back correctly from gcc and placed "under" error
2162 buttons in a Literate LyX source.
2164 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2166 * src/text.C (GetColumnNearX): Better behavior when a RTL
2167 paragraph is ended by LTR text.
2169 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
2172 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2174 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
2175 true when clipboard is empty.
2177 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2179 * text.C (Backspace): Prevent rebreaking of a row if it is the last
2180 row of the paragraph.
2181 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
2182 to prevent calculation of bidi tables
2184 2000-07-07 Juergen Vigna <jug@sad.it>
2186 * src/screen.C (ToggleSelection): added y_offset and x_offset
2189 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
2192 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
2194 * src/insets/insettext.C: fixed Layout-Display!
2196 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2198 * configure.in: add check for strings.h header.
2200 * src/spellchecker.C: include <strings.h> in order to have a
2201 definition for bzero().
2203 2000-07-07 Juergen Vigna <jug@sad.it>
2205 * src/insets/insettext.C (draw): set the status of the bv->text to
2206 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
2208 * src/screen.C (DrawOneRow):
2209 (DrawFromTo): redraw the actual row if something has changed in it
2212 * src/text.C (draw): call an update of the toplevel-inset if something
2213 has changed inside while drawing.
2215 * src/lyxtext.h: added CHANGED_IN_DRAW status.
2217 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
2219 * src/insets/insetbib.[Ch] (callback) new method, moving callback
2220 processing inside class.
2222 * src/insets/insetindex.[Ch] (callback) new method, moving callback
2223 processing inside class.
2225 * src/insets/insetindex.h new struct Holder, consistent with other
2228 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
2229 citation dialog from main code and placed it in src/frontends/xforms.
2230 Dialog launched through signals instead of callbacks
2232 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
2234 * lyx.man: update the options description.
2236 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
2238 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
2239 handle neg values, set min width to 590, add doc about -display
2241 2000-07-05 Juergen Vigna <jug@sad.it>
2243 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
2244 calls to BufferView *.
2246 * src/insets/insettext.C (checkAndActivateInset): small fix non
2247 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
2249 * src/insets/insetcommand.C (Read): Fixed as insets should read till
2250 their \end_inset token!
2252 2000-07-04 edscott <edscott@imp.mx>
2254 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
2255 lib/lyxrc.example: added option \wheel_jump
2257 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
2259 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
2260 remove support for -width,-height,-xpos and -ypos.
2262 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
2264 * src/encoding.[Ch]: New files.
2266 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
2267 (text): Call to the underline() method only when needed.
2269 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
2271 * src/buffer.C (makeLaTeXFile): Compute automatically the input
2272 encoding(s) for the document.
2274 * src/bufferparams.C (BufferParams): Changed default value of
2277 * src/language.C (newLang): Removed.
2278 (items[]): Added encoding information for all defined languages.
2280 * src/lyx_gui.C (create_forms): Added "auto" option to the input
2281 encoding choice button.
2283 * src/lyxrc.h (font_norm_type): New member variable.
2284 (set_font_norm_type): New method.
2286 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
2287 paragraphs with different encodings.
2289 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
2290 (TransformChar): Changed to work correctly with Arabic points.
2291 (draw): Added support for drawing Arabic points.
2292 (draw): Removed code for drawing underbars (this is done by
2295 * src/support/textutils.h (IsPrintableNonspace): New function.
2297 * src/BufferView_pimpl.h: Added "using SigC::Object".
2298 * src/LyXView.h: ditto.
2300 * src/insets/insetinclude.h (include_label): Changed to mutable.
2302 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
2304 * src/mathed/math_iter.h: remove empty destructor
2306 * src/mathed/math_cursor.h: remove empty destructor
2308 * src/insets/lyxinset.h: add THEOREM_CODE
2310 * src/insets/insettheorem.[Ch]: new files
2312 * src/insets/insetminipage.C: (InsertInset): remove
2314 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
2316 (InsertInset): remove
2318 * src/insets/insetlist.C: (InsertList): remove
2320 * src/insets/insetfootlike.[Ch]: new files
2322 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
2325 (InsertInset): ditto
2327 * src/insets/insetert.C: remove include Painter.h, reindent
2328 (InsertInset): move to header
2330 * src/insets/insetcollapsable.h: remove explicit from default
2331 contructor, remove empty destructor, add InsertInset
2333 * src/insets/insetcollapsable.C (InsertInset): new func
2335 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2337 * src/vspace.h: add explicit to constructor
2339 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
2340 \textcompwordmark, please test this.
2342 * src/lyxrc.C: set ascii_linelen to 65 by default
2344 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
2346 * src/commandtags.h: add LFUN_INSET_THEOREM
2348 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
2349 (makeLinuxDocFile): remove _some_ of the nice logic
2350 (makeDocBookFile): ditto
2352 * src/Painter.[Ch]: (~Painter): removed
2354 * src/LyXAction.C (init): entry for insettheorem added
2356 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
2358 (deplog): code to detect files generated by LaTeX, needs testing
2361 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2363 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
2365 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2367 * src/LaTeX.C (deplog): Add a check for files that are going to be
2368 created by the first latex run, part of the project to remove the
2371 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
2372 contents to the extension list.
2374 2000-07-04 Juergen Vigna <jug@sad.it>
2376 * src/text.C (NextBreakPoint): added support for needFullRow()
2378 * src/insets/lyxinset.h: added needFullRow()
2380 * src/insets/insetcollapsable.C: redone now this uses a text-inset
2383 * src/insets/insettext.C: lots of changes for update!
2385 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
2387 * src/LaTeXFeatures.h: add a missing std:: qualifier.
2389 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
2391 * src/insets/insetinclude.C (InsetInclude): fixed
2392 initialization of include_label.
2393 (unique_id): now returns a string.
2395 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
2397 * src/LaTeXFeatures.h: new member IncludedFiles, for
2398 a map of key, included file name.
2400 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
2401 with the included files for inclusion in SGML preamble,
2402 i. e., linuxdoc and docbook.
2405 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
2406 nice (is the generated linuxdoc code to be exported?), that
2407 allows to remove column, and only_body that will be true for
2408 slave documents. Insets are allowed inside SGML font type.
2409 New handling of the SGML preamble for included files.
2410 (makeDocBookFile): the same for docbook.
2412 * src/insets/insetinclude.h:
2413 * src/insets/insetinclude.C (Validate): keeps a list of included files.
2415 (DocBook): new export methods.
2417 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
2418 and makeDocBookFile.
2420 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
2421 formats to export with command line argument -x.
2423 2000-06-29 Juergen Vigna <jug@sad.it>
2425 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
2426 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
2428 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
2429 region could already been cleared by an inset!
2431 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2433 * src/BufferView_pimpl.h: remove member variables lyx_focus and
2436 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
2438 (cursorToggle): remove special handling of lyx focus.
2440 2000-06-28 Juergen Vigna <jug@sad.it>
2442 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
2445 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2447 * src/insets/insetindex.C (Edit): add a callback when popup is
2450 * src/insets/insettext.C (LocalDispatch):
2451 * src/insets/insetmarginal.h:
2452 * src/insets/insetlist.h:
2453 * src/insets/insetfoot.h:
2454 * src/insets/insetfloat.h:
2455 * src/insets/insetert.h: add a missing std:: qualifier.
2457 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2459 * src/support/lyxsum.C (sum): '\0' teminate file read when using
2462 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
2464 * src/insets/insettext.C (Read): remove tmptok unused variable
2465 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
2466 (InsertInset): change for new InsetInset code
2468 * src/insets/insettext.h: add TEXT inline method
2470 * src/insets/insettext.C: remove TEXT macro
2472 * src/insets/insetmarginal.C (Write): new method
2473 (Latex): change output slightly
2475 * src/insets/insetfoot.C (Write): new method
2476 (Latex): change output slightly (don't use endl when no need)
2478 * src/insets/insetert.C (Write): new method
2480 * src/insets/insetcollapsable.h: make button_length, button_top_y
2481 and button_bottm_y protected.
2483 * src/insets/insetcollapsable.C (Write): simplify code by using
2484 tostr. Also do not output the float name, the children class
2485 should to that to get control over own arguments
2487 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
2488 src/insets/insetminipage.[Ch]:
2491 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2493 * src/lyxfunc.C (Dispatch): cases for new insets/commands
2495 * src/Makefile.am (lyx_SOURCES): add the new files
2497 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
2498 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
2499 * src/commandtags.h: ditto
2501 * src/LaTeXFeatures.h: add a std::set of used floattypes
2503 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
2505 * src/FloatList.[Ch] src/Floating.h: new files
2507 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
2509 * src/lyx_cb.C (TableApplyCB): ditto
2511 * src/text2.C: ditto
2512 * src/buffer.C (SimpleLinuxDocOnePar): ditto
2513 (parseSingleLyXformat2Token): ditto + add code for
2514 backwards compability for old float styles + add code for new insets
2516 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
2518 (InsertInset(size_type, Inset *, LyXFont)): new method
2519 (InsetChar(size_type, char)): changed to use the other InsetChar
2520 with a LyXFont(ALL_INHERIT).
2521 (InsetInset(size_type, Inset*)): changed to use InsetChar to
2522 insert the META_INSET.
2524 * sigc++/thread.cc (Privete<int>::operator int&): move definition
2526 * sigc++/thread.h (Threads): from here
2528 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
2529 definition out of line
2530 * sigc++/scope.h: from here
2532 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2534 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
2535 is specified (adapted from a patch from edscott <edscott@imp.mx>).
2537 * Makefile.am (bindist): new target.
2539 * INSTALL: add instructions for doing a binary distribution.
2541 * development/tools/README.bin.example: update a bit.
2543 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
2546 * lib/lyxrc.example: new lyxrc tag \set_color.
2548 * src/lyxfunc.C (Dispatch):
2549 * src/commandtags.h:
2550 * src/LyXAction.C: new lyxfunc "set-color".
2552 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
2553 and an x11name given as strings.
2555 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
2556 cache when a color is changed.
2558 2000-06-26 Juergen Vigna <jug@sad.it>
2560 * src/lyxrow.C (width): added this functions and variable.
2562 * src/insets/insetcite.C (create_form_citation_form): some Gravity
2565 * src/text.C (SetHeightOfRow): fixed calcualting of width.
2567 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2569 * images/undo_bw.xpm: new icon.
2570 * images/redo_bw.xpm: ditto.
2572 * configure.in (INSTALL_SCRIPT): change value to
2573 ${INSTALL} to avoid failures of install-script target.
2574 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
2576 * src/BufferView.h: add a magic "friend" declaration to please
2579 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
2581 * forms/cite.fd: modified to allow resizing without messing
2584 * src/insetcite.C: Uses code from cite.fd almost without
2586 User can now resize dialog in the x-direction.
2587 Resizing the dialog in the y-direction is prevented, as the
2588 code does this intelligently already.
2590 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2592 * INSTALL: remove obsolete entry in "problems" section.
2594 * lib/examples/sl_*.lyx: update of the slovenian examples.
2596 * src/support/FileInfo.[Ch] (getBlockSize): remove.
2598 2000-06-23 Juergen Vigna <jug@sad.it>
2600 * src/lyxtext.h: added a 'cleared' flag to draw() function.
2602 * src/buffer.C (resize): delete the LyXText of textinsets.
2604 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
2606 * src/insets/lyxinset.h: added another parameter 'cleared' to
2607 the draw() function.
2609 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
2610 unlocking inset in inset.
2612 2000-06-22 Juergen Vigna <jug@sad.it>
2614 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
2615 of insets and moved first to LyXText.
2617 * src/mathed/formulamacro.[Ch]:
2618 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
2620 2000-06-21 Juergen Vigna <jug@sad.it>
2622 * src/text.C (GetVisibleRow): look if I should clear the area or not
2623 using Inset::doClearArea() function.
2625 * src/insets/lyxinset.h: added doClearArea() function and
2626 modified draw(Painter &, ...) to draw(BufferView *, ...)
2628 * src/text2.C (UpdateInset): return bool insted of int
2630 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
2632 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
2633 combox in the character popup
2635 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
2636 BufferParams const & params
2638 2000-06-20 Juergen Vigna <jug@sad.it>
2640 * src/insets/insettext.C (SetParagraphData): set insetowner on
2643 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2645 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
2646 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
2648 (form_main_): remove
2650 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
2651 (create_form_form_main): remove FD_form_main stuff, connect to
2652 autosave_timeout signal
2654 * src/LyXView.[Ch] (getMainForm): remove
2655 (UpdateTimerCB): remove
2656 * src/BufferView_pimpl.h: inherit from SigC::Object
2658 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
2659 signal instead of callback
2661 * src/BufferView.[Ch] (cursorToggleCB): remove
2663 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2665 * src/BufferView_pimpl.C: changes because of the one below
2667 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
2668 instead of storing a pointer to a LyXText.
2670 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
2672 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
2674 * src/lyxparagraph.h
2676 * src/paragraph.C: Changed fontlist to a sorted vector.
2678 2000-06-19 Juergen Vigna <jug@sad.it>
2680 * src/BufferView.h: added screen() function.
2682 * src/insets/insettext.C (LocalDispatch): some selection code
2685 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
2687 * src/insets/insettext.C (SetParagraphData):
2689 (InsetText): fixes for multiple paragraphs.
2691 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
2693 * development/lyx.spec.in: Call configure with ``--without-warnings''
2694 to work around a bug with the Makefiles when doing ``make lyxrpm''.
2695 This should be fine, however, since we generally don't want to be
2696 verbose when making an RPM.
2698 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
2700 * lib/scripts/fig2pstex.py: New file
2702 2000-06-16 Juergen Vigna <jug@sad.it>
2704 * src/insets/insettabular.C (UpdateLocal):
2705 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
2706 (LocalDispatch): Changed all functions to use LyXText.
2708 2000-06-15 Juergen Vigna <jug@sad.it>
2710 * src/text.C (SetHeightOfRow): call inset::update before requesting
2713 * src/insets/insettext.C (update):
2714 * src/insets/insettabular.C (update): added implementation
2716 * src/insets/lyxinset.h: added update function
2718 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2720 * src/text.C (SelectNextWord): protect against null pointers with
2721 old-style string streams. (fix from Paul Theo Gonciari
2724 * src/cite.[Ch]: remove erroneous files.
2726 * lib/configure.m4: update the list of created directories.
2728 * src/lyxrow.C: include <config.h>
2729 * src/lyxcursor.C: ditto.
2731 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2733 * lib/examples/decimal.lyx: new example file from Mike.
2735 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
2736 to find template definitions (from Dekel)
2738 * src/frontends/.cvsignore: add a few things.
2740 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
2742 * src/Timeout.C (TimeOut): remove default argument.
2744 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
2747 * src/insets/ExternalTemplate.C: add a "using" directive.
2749 * src/lyx_main.h: remove the act_ struct, which seems unused
2752 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2754 * LyX Developers Meeting: All files changed, due to random C++ (by
2755 coincidence) code generator script.
2757 - external inset (cool!)
2758 - initial online editing of preferences
2759 - insettabular breaks insettext(s contents)
2761 - some DocBook fixes
2762 - example files update
2763 - other cool stuff, create a diff and look for yourself.
2765 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
2767 * src/insets/insettext.C (computeTextRows): if the maxWidth is
2768 -1 this is a non-line-breaking textinset.
2770 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
2771 if there is no width set.
2773 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
2775 * Lots of files: Merged the dialogbase branch.
2777 2000-06-09 Allan Rae <rae@lyx.org>
2779 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
2780 and the Dispatch methods that used it.
2782 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
2783 access to functions formerly kept in Dispatch.
2785 2000-05-19 Allan Rae <rae@lyx.org>
2787 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
2788 made to_page and count_copies integers again. from_page remains a
2789 string however because I want to allow entry of a print range like
2790 "1,4,22-25" using this field.
2792 * src/LyXAction.C: added action info and commands for buffer-print-xtl
2793 and printer-params-get. These aren't useful from the minibuffer but
2794 could be used by a script/LyXServer app provided it passes a suitable
2795 auto_mem_buffer. I guess I should take a look at how the LyXServer
2796 works and make it support xtl buffers.
2798 * sigc++/: updated to libsigc++-1.0.1
2800 * src/xtl/: updated to xtl-1.3.pl.11
2802 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
2803 those changes done to the files in src/ are actually recreated when
2804 they get regenerated. Please don't ever accept a patch that changes a
2805 dialog unless that patch includes the changes to the corresponding *.fd
2808 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
2809 stringOnlyContains, renamed it and generalised it.
2811 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
2812 branch. Removed the remaining old form_print code.
2814 2000-04-26 Allan Rae <rae@lyx.org>
2816 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
2817 trap I was trying to fix with the ID: fields in src/xtl/ :-)
2819 2000-04-25 Allan Rae <rae@lyx.org>
2821 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
2822 against a base of xtl-1.3.pl.4
2824 * development/tools/lxtl.sh: fixed a couple of silly typos and now
2825 filter the Id: entries so they still show the xtl version number
2828 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
2829 into the src/xtl code. Patch still pending with José (XTL)
2831 2000-04-24 Allan Rae <rae@lyx.org>
2833 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
2834 both more generic and much safer. Use the new template functions.
2835 * src/buffer.[Ch] (Dispatch): ditto.
2837 * src/frontends/xforms/FormPrint.C (update): Use new template functions
2838 and mem buffer more intelligently. Also a little general cleanup.
2841 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
2842 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
2843 * src/xtl/Makefile.am: ditto.
2844 * src/xtl/.cvsignore: ditto.
2845 * src/Makefile.am: ditto.
2847 * src/PrinterParams.h: Removed the macros member functions. Added a
2848 testInvariant member function. A bit of tidying up and commenting.
2849 Included Angus's idea for fixing operation with egcs-1.1.2.
2851 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
2852 cool expansion of XTL's mem_buffer to support automatic memory
2853 management within the buffer itself. Removed the various macros and
2854 replaced them with template functions that use either auto_mem_buffer
2855 or mem_buffer depending on a #define. The mem_buffer support will
2856 disappear as soon as the auto_mem_buffer is confirmed to be good on
2857 other platforms/compilers. That is, it's there so you've got something
2860 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
2861 effectively forked XTL. However I expect José will include my code
2862 into the next major release. Also fixed a memory leak.
2863 * src/xtl/text.h: ditto.
2864 * src/xtl/xdr.h: ditto.
2865 * src/xtl/giop.h: ditto.
2867 2000-04-16 Allan Rae <rae@lyx.org>
2869 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
2870 by autogen.sh and removed by maintainer-clean anyway.
2871 * .cvsignore, sigc++/.cvsignore: Support the above.
2873 * sigc++/.cvsignore: Forgot that retbind.h was generated.
2875 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
2877 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
2878 macros, renamed static callback-target member functions to suit new
2879 scheme and made them public.
2880 * src/frontends/xforms/forms/form_print.fd: ditto.
2881 * src/frontends/xforms/forms/form_copyright.fd: ditto.
2883 * src/support/lxtl.h: small cleanup to use typedef instead of #define
2886 * src/xtl/: New directory containing a minimal distribution of XTL.
2887 This is XTL-1.3.pl.4.
2889 * development/tools/lxtl.sh: A script to generate the above mini-dist.
2891 2000-04-15 Allan Rae <rae@lyx.org>
2893 * development/tools/makeLyXsigc.sh: Remove the library version numbers
2895 * sigc++/: Updated to libsigc++-1.0.0
2897 2000-04-14 Allan Rae <rae@lyx.org>
2899 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
2900 use the generic ones in future. I'll modify my conversion script.
2902 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
2904 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
2905 (CloseAllBufferRelatedDialogs): Renamed.
2906 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
2908 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
2909 of the generic ones. These are the same ones my conversion script
2912 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
2913 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
2914 * src/buffer.C (Dispatch): ditto
2916 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
2917 functions for updating and hiding buffer dependent dialogs.
2918 * src/BufferView.C (buffer): ditto
2919 * src/buffer.C (setReadonly): ditto
2920 * src/lyxfunc.C (CloseBuffer): ditto
2922 * src/buffer.h: Take setReadonly() out of line so I don't have to include
2923 Dialogs.h, and hence all the SigC stuff, into every file that includes
2924 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
2926 * src/BufferView2.C: reduce the number of headers included by buffer.h
2928 2000-04-11 Allan Rae <rae@lyx.org>
2930 * src/frontends/xforms/xform_macros.h: A small collection of macros
2931 for building C callbacks.
2933 * src/frontends/xforms/Makefile.am: Added above file.
2935 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
2936 scheme again. This time it should work for JMarc. If this is
2937 successful I'll revise my conversion script to automate some of this.
2938 The static member functions in the class also have to be public for
2939 this scheme will work. If the scheme works (it's almost identical to
2940 the way BufferView::cursorToggleCB is handled so it should work) then
2941 FormCopyright and FormPrint will be ready for inclusion into the main
2942 trunk immediately after 1.1.5 is released -- provided we're prepared
2943 for complaints about lame compilers not handling XTL.
2945 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
2947 2000-04-07 Allan Rae <rae@lyx.org>
2949 * config/lyxinclude.m4: A bit more tidying up (Angus)
2951 * src/LString.h: JMarc's <string> header fix
2953 * src/PrinterParams.h: Used string for most data to remove some
2954 ugly code in the Print dialog and avoid even uglier code when
2955 appending the ints to a string for output.
2957 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
2958 and moved "default:" back to the end of switch statement. Cleaned
2959 up the printing so it uses the right function calls and so the
2960 "print to file" option actually puts the file in the right directory.
2962 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
2964 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
2965 and Ok+Apply button control into a separate method: input (Angus).
2966 (input) Cleaned it up and improved it to be very thorough now.
2967 (All CB) static_cast used instead of C style cast (Angus). This will
2968 probably change again once we've worked out how to keep gcc-2.8.1 happy
2969 with real C callbacks.
2970 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
2971 ignore some of the bool settings and has random numbers instead. Needs
2972 some more investigation. Added other input length checks and checking
2973 of file and printer names.
2975 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
2976 would link (Angus). Seems the old code doesn't compile with the pragma
2977 statement either. Separated callback entries from internal methods.
2979 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
2981 2000-03-17 Allan Rae <rae@lyx.org>
2983 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
2984 need it? Maybe it could go in Dialogs instead? I could make it a
2985 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
2986 values to get the bool return value.
2987 (Dispatch): New overloaded method for xtl support.
2989 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
2990 extern "C" callback instead of static member functions. Hopefully,
2991 JMarc will be able to compile this. I haven't changed
2992 forms/form_copyright.fd yet. Breaking one of my own rules already.
2994 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
2995 because they aren't useful from the minibuffer. Maybe a LyXServer
2996 might want a help message though?
2998 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
3000 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
3001 xtl which needs both rtti and exceptions.
3003 * src/support/Makefile.am:
3004 * src/support/lxtl.h: New file. Some helper macros for using XTL.
3006 * src/frontends/xforms/input_validators.[ch]: input filters and
3007 validators. These conrol what keys are valid in input boxes.
3008 Use them and write some more. Much better idea than waiting till
3009 after the user has pressed Ok to say that the input fields don't make
3012 * src/frontends/xforms/Makefile.am:
3013 * src/frontends/xforms/forms/form_print.fd:
3014 * src/frontends/xforms/forms/makefile:
3015 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
3016 new scheme. Still have to make sure I haven't missed anything from
3017 the current implementation.
3019 * src/Makefile.am, src/PrinterParams.h: New data store.
3021 * other files: Added a couple of copyright notices.
3023 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3025 * src/insets/insetbib.h: move Holder struct in public space.
3027 * src/frontends/include/DialogBase.h: use SigC:: only when
3028 SIGC_CXX_NAMESPACES is defined.
3029 * src/frontends/include/Dialogs.h: ditto.
3031 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
3033 * src/frontends/xforms/FormCopyright.[Ch]: do not
3034 mention SigC:: explicitely.
3036 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3038 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
3039 deals with testing KDE in main configure.in
3040 * configure.in: ditto.
3042 2000-02-22 Allan Rae <rae@lyx.org>
3044 * Lots of files: Merged from HEAD
3046 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
3047 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
3049 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
3051 * sigc++/: new minidist.
3053 2000-02-14 Allan Rae <rae@lyx.org>
3055 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
3057 2000-02-08 Juergen Vigna <jug@sad.it>
3059 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
3060 file for the buildin GUI builder of KDevelop of the copyright-dialog.
3062 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
3063 for this port and so it is much easier for other people to port
3064 dialogs in a common development environment.
3066 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
3067 the QT/KDE implementation.
3069 * src/frontends/kde/Dialogs.C:
3070 * src/frontends/kde/FormCopyright.C:
3071 * src/frontends/kde/FormCopyright.h:
3072 * src/frontends/kde/Makefile.am:
3073 * src/frontends/kde/formcopyrightdialog.C:
3074 * src/frontends/kde/formcopyrightdialog.h:
3075 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
3076 for the kde support of the Copyright-Dialog.
3078 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3079 subdir-substitution instead of hardcoded 'xforms' as we now have also
3082 * src/frontends/include/DialogBase.h (Object): just commented the
3083 label after #endif (nasty warning and I don't like warnings ;)
3085 * src/main.C (main): added KApplication initialization if using
3088 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
3089 For now only the KDE event-loop is added if frontend==kde.
3091 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
3093 * configure.in: added support for the --with-frontend[=value] option
3095 * autogen.sh: added kde.m4 file to list of config-files
3097 * acconfig.h: added define for KDEGUI-support
3099 * config/kde.m4: added configuration functions for KDE-port
3101 * config/lyxinclude.m4: added --with-frontend[=value] option with
3102 support for xforms and KDE.
3104 2000-02-08 Allan Rae <rae@lyx.org>
3106 * all Makefile.am: Fixed up so the make targets dist, distclean,
3107 install and uninstall all work even if builddir != srcdir. Still
3108 have a new sigc++ minidist update to come.
3110 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
3112 2000-02-01 Allan Rae <rae@lyx.org>
3114 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
3115 Many mods to get builddir != srcdir working.
3117 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
3118 for building on NT and so we can do the builddir != srcdir stuff.
3120 2000-01-30 Allan Rae <rae@lyx.org>
3122 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
3123 This will stay in "rae" branch. We probably don't really need it in
3124 the main trunk as anyone who wants to help programming it should get
3125 a full library installed also. So they can check both included and
3126 system supplied library compilation.
3128 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
3129 Added a 'mini' distribution of libsigc++. If you feel the urge to
3130 change something in these directories - Resist it. If you can't
3131 resist the urge then you should modify the following script and rebuild
3132 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
3133 all happen. Still uses a hacked version of libsigc++'s configure.in.
3134 I'm quite happy with the results. I'm not sure the extra work to turn
3135 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
3136 worth the trouble and would probably lead to extra maintenance
3138 I haven't tested the following important make targets: install, dist.
3139 Not ready for prime time but very close. Maybe 1.1.5.
3141 * development/tools/makeLyXsigc.sh: A shell script to automatically
3142 generate our mini-dist of libsigc++. It can only be used with a CVS
3143 checkout of libsigc++ not a tarball distribution. It's well commented.
3144 This will end up as part of the libsigc++ distribution so other apps
3145 can easily have an included mini-dist. If someone makes mods to the
3146 sigc++ subpackage without modifying this script to generate those
3147 changes I'll be very upset!
3149 * src/frontends/: Started the gui/system indep structure.
3151 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
3152 to access the gui-indep dialogs are in this class. Much improved
3153 design compared to previous revision. Lars, please refrain from
3154 moving this header into src/ like you did with Popups.h last time.
3156 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
3158 * src/frontends/xforms/: Started the gui-indep system with a single
3159 dialog: FormCopyright. Initial testing of use of libsigc++ was very
3162 * src/frontends/xforms/forms: Repository for the xforms .fd files.
3163 Here you'll find a very useful makefile and automated fdfix.sh that
3164 makes updating dailogs a no-brainer -- provided you follow the rules
3165 set out in the README. I'm thinking about adding another script to
3166 automatically generate skeleton code for a new dialog given just the
3169 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
3170 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
3171 Made FormCopyright gui-indep and added a lyxfunc to get to it.
3173 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
3175 * src/support/LSubstring.C (operator): simplify
3177 * src/lyxtext.h: removed bparams, use buffer_->params instead
3179 * src/lyxrow.h: make Row a real class, move all variables to
3180 private and use accessors.
3182 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
3184 (isRightToLeftPar): ditto
3185 (ChangeLanguage): ditto
3186 (isMultiLingual): ditto
3189 (SimpleTeXOnePar): ditto
3190 (TeXEnvironment): ditto
3191 (GetEndLabel): ditto
3193 (SetOnlyLayout): ditto
3194 (BreakParagraph): ditto
3195 (BreakParagraphConservative): ditto
3196 (GetFontSettings): ditto
3198 (CopyIntoMinibuffer): ditto
3199 (CutIntoMinibuffer): ditto
3200 (PasteParagraph): ditto
3201 (SetPExtraType): ditto
3202 (UnsetPExtraType): ditto
3203 (DocBookContTableRows): ditto
3204 (SimpleDocBookOneTablePar): ditto
3206 (TeXFootnote): ditto
3207 (SimpleTeXOneTablePar): ditto
3208 (TeXContTableRows): ditto
3209 (SimpleTeXSpecialChars): ditto
3212 * src/lyxcursor.h: make LyXCursor a real class, move all variables
3213 to private and use accessors.
3215 * src/lyx_cb.C: remove char updatetimer, and all code that uses
3216 this, we did not use it anymore and has not been for ages. Just a
3217 waste of cpu cycles.
3219 * src/language.h: make Language a real class, move all variables
3220 to private and use accessors.
3222 * src/BufferView_pimpl.C (Pimpl): use new timer code.
3223 (create_view): remove
3224 (update): some changes for new timer
3225 (cursorToggle): use new timer
3226 (beforeChange): change for new timer
3228 * src/BufferView.h (cursorToggleCB): removed last paramter because
3231 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
3232 (cursorToggleCB): change because of new timer code
3234 * lib/CREDITS: updated own mailaddress
3236 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3238 * src/support/filetools.C (PutEnv): fix the code in case neither
3239 putenv() nor setenv() have been found.
3241 * INSTALL: mention the install-strip Makefile target.
3243 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
3244 read-only documents.
3246 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3248 * lib/reLyX/configure.in (VERSION): avoid using a previously
3249 generated reLyX wrapper to find out $prefix.
3251 * lib/examples/eu_adibide_lyx-atua.lyx:
3252 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
3253 translation of the Tutorial (Dooteo)
3255 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
3257 * forms/cite.fd: new citation dialog
3259 * src/insetcite.[Ch]: the new citation dialog is moved into
3262 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
3265 * src/insets/insetcommand.h: data members made private.
3267 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3269 * LyX 1.1.5 released
3271 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3273 * src/version.h (LYX_RELEASE): to 1.1.5
3275 * src/spellchecker.C (RunSpellChecker): return false if the
3276 spellchecker dies upon creation.
3278 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3280 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
3281 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
3285 * lib/CREDITS: update entry for Martin Vermeer.
3287 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
3289 * src/text.C (draw): Draw foreign language bars at the bottom of
3290 the row instead of at the baseline.
3292 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
3294 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3296 * lib/bind/de_menus.bind: updated
3298 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3300 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
3302 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3304 * src/menus.C (Limit_string_length): New function
3305 (ShowTocMenu): Limit the number of items/length of items in the
3308 * src/paragraph.C (String): Correct result for a paragraph inside
3311 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3313 * src/bufferlist.C (close): test of buf->getuser() == NULL
3315 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
3317 * src/BufferView2.C (removeAutoInsets): Fix a bug:
3318 Do not call to SetCursor when the paragraph is a closed footnote!
3320 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
3322 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
3325 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
3327 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3330 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
3331 reference popup, that activates the reference-back action
3333 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
3335 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
3336 the menus. Also fixed a bug.
3338 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
3339 the math panels when switching buffers (unless new buffer is readonly).
3341 * src/BufferView.C (NoSavedPositions)
3342 * src/BufferView_pimpl.C (NoSavedPositions): New methods
3344 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3346 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
3347 less of dvi dirty or not.
3349 * src/trans_mgr.[Ch] (insert): change first parameter to string
3352 * src/chset.[Ch] (encodeString): add const to first parameter
3354 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3356 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
3360 * src/LaTeX.C (deplog): better searching for dependency files in
3361 the latex log. Uses now regexps.
3363 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
3364 instead of the box hack or \hfill.
3366 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3368 * src/lyxfunc.C (doImportHelper): do not create the file before
3369 doing the actual import.
3370 (doImportASCIIasLines): create a new file before doing the insert.
3371 (doImportASCIIasParagraphs): ditto.
3373 * lib/lyxrc.example: remove mention of non-existing commands
3375 * lyx.man: remove mention of color-related switches.
3377 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
3379 * src/lyx_gui.C: remove all the color-related ressources, which
3380 are not used anymore.
3382 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
3385 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3387 * src/lyxrc.C (read): Add a missing break in the switch
3389 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
3391 * src/text2.C (InsertStringA): Fix a bug with insertion into table
3393 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
3396 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3398 * src/text.C (draw): draw bars under foreign language words.
3400 * src/LColor.[Ch]: add LColor::language
3402 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3404 * src/lyxcursor.h (boundary): New member variable
3406 * src/text.C (IsBoundary): New methods
3408 * src/text.C: Use the above for currect cursor movement when there
3409 is both RTL & LTR text.
3411 * src/text2.C: ditto
3413 * src/bufferview_funcs.C (ToggleAndShow): ditto
3415 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3417 * src/text.C (DeleteLineForward): set selection to true to avoid
3418 that DeleteEmptyParagraphMechanism does some magic. This is how it
3419 is done in all other functions, and seems reasonable.
3420 (DeleteWordForward): do not jump over non-word stuff, since
3421 CursorRightOneWord() already does it.
3423 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
3424 DeleteWordBackward, since they seem safe to me (since selection is
3425 set to "true") DeleteEmptyParagraphMechanism does nothing.
3427 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3429 * src/lyx_main.C (easyParse): simplify the code by factoring the
3430 part that removes parameters from the command line.
3431 (LyX): check wether wrong command line options have been given.
3433 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
3435 * src/lyx_main.C : add support for specifying user LyX
3436 directory via command line option -userdir.
3438 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
3440 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
3441 the number of items per popup.
3442 (Add_to_refs_menu): Ditto.
3444 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3446 * src/lyxparagraph.h: renamed ClearParagraph() to
3447 StripLeadingSpaces() and moved it to paragraph.C. We pass the
3448 textclass as parameter, and do nothing if free_spacing is
3449 true. This fixes part of the line-delete-forward problems.
3451 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
3452 (pasteSelection): ditto.
3453 (SwitchLayoutsBetweenClasses): more translatable strings.
3455 * src/text2.C (CutSelection): use StripLeadingSpaces.
3456 (PasteSelection): ditto.
3457 (DeleteEmptyParagraphMechanism): ditto.
3459 2000-05-26 Juergen Vigna <jug@sad.it>
3461 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
3462 is not needed in tabular insets.
3464 * src/insets/insettabular.C (TabularFeatures): added missing features.
3466 * src/tabular.C (DeleteColumn):
3468 (AppendRow): implemented this functions
3469 (cellsturct::operator=): clone the inset too;
3471 2000-05-23 Juergen Vigna <jug@sad.it>
3473 * src/insets/insettabular.C (LocalDispatch): better selection support
3474 when having multicolumn-cells.
3476 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3478 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
3480 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3482 * src/ColorHandler.C (getGCForeground): put more test into _()
3484 * lib/examples/eu_splash.lyx: new file (Basque translation) from
3487 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
3490 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
3492 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
3493 there are no labels, or when buffer is readonly.
3495 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
3496 there are no labels, buffer is SGML, or when buffer is readonly.
3498 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3500 * src/LColor.C (LColor): change a couple of grey40 to grey60
3501 (LColor): rewore initalization to make compiles go some magnitude
3503 (getGUIName): don't use gettext until we need the string.
3505 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
3507 * src/Bullet.[Ch]: Fixed a small bug.
3509 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
3511 * src/paragraph.C (String): Several fixes/improvements
3513 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
3515 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3517 * src/paragraph.C (String): give more correct output.
3519 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
3521 * src/lyxfont.C (stateText) Do not output the language if it is
3522 eqaul to the language of the document.
3524 * src/paragraph.C (TeXOnePar): Do not put language switch commands
3525 between two paragraphs with the same language.
3527 * src/paragraph.C (getParLanguage) Return a correct answer for an
3528 empty dummy paragraph.
3530 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
3533 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
3536 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
3537 the menus/popup, if requested fonts are unavailable.
3539 2000-05-22 Juergen Vigna <jug@sad.it>
3541 * src/insets/insettabular.C (LocalDispatch): added some more cursor
3542 movement support (Up/Down/Tab/Shift-Tab).
3543 (LocalDispatch): added also preliminari cursor-selection.
3545 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
3547 * src/paragraph.C (PasteParagraph): Hopefully now right!
3549 2000-05-22 Garst R. Reese <reese@isn.net>
3551 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
3552 of list, change all references to Environment to Command
3553 * tex/hollywood.cls : rewrite environments as commands, add
3554 \uppercase to interiorshot and exteriorshot to force uppecase.
3555 * tex/broadway.cls : rewrite environments as commands. Tweak
3558 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3560 * src/menus.C (Add_to_toc_menu): fix the code which limits the
3561 size of items: use a constant intead of the hardcoded 40, and more
3562 importantly do not remove the %m and %x tags added at the end.
3563 (Add_to_refs_menu): use vector::size_type instead of
3564 unsigned int as basic types for the variables. _Please_ do not
3565 assume that size_t is equal to unsigned int. On an alpha, this is
3566 unsigned long, which is _not_ the same.
3568 * src/language.C (initL): remove language "hungarian", since it
3569 seems that "magyar" is better.
3571 2000-05-22 Juergen Vigna <jug@sad.it>
3573 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
3575 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
3578 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
3579 next was deleted but not set to 0.
3581 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3583 * src/language.C (initL): change the initialization of languages
3584 so that compiles goes _fast_.
3586 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
3589 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
3591 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3595 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3597 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
3599 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
3603 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
3606 * src/insets/insetlo*.[Ch]: Made editable
3608 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3610 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
3611 the current selection.
3613 * src/BufferView_pimpl.C (stuffClipboard): new method
3615 * src/BufferView.C (stuffClipboard): new method
3617 * src/paragraph.C (String): new method
3619 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
3620 LColor::ignore when lyxname is not found.
3622 * src/BufferView.C (pasteSelection): new method
3624 * src/BufferView_pimpl.C (pasteSelection): new method
3626 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
3628 * src/WorkArea.C (request_clipboard_cb): new static function
3629 (getClipboard): new method
3630 (putClipboard): new method
3632 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3634 * LyX 1.1.5pre2 released
3636 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3638 * src/vspace.C (operator=): removed
3639 (operator=): removed
3641 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
3643 * src/layout.C (NumberOfClass): manually set the type in make_pair
3644 (NumberOfLayout): ditto
3646 * src/language.C: use the Language constructor for ignore_lang
3648 * src/language.h: add constructors to struct Language
3650 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
3652 * src/text2.C (SetCursorIntern): comment out #warning
3654 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
3656 * src/mathed/math_iter.h: initialize sx and sw to 0
3658 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3660 * forms/lyx.fd: Redesign of form_ref
3662 * src/LaTeXFeatures.[Ch]
3666 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
3669 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
3670 and Buffer::inset_iterator.
3672 * src/menus.C: Added new menus: TOC and Refs.
3674 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
3676 * src/buffer.C (getTocList): New method.
3678 * src/BufferView2.C (ChangeRefs): New method.
3680 * src/buffer.C (getLabelList): New method. It replaces the old
3681 getReferenceList. The return type is vector<string> instead of
3684 * src/insets/insetinclude.C (getLabelList): New method. Replaces
3685 the old getLabel() and GetNumberOfLabels() methods.
3686 * src/insets/insetlabel.C (getLabelList): ditto
3687 * src/mathed/formula.C (getLabelList): ditto
3689 * src/paragraph.C (String): New method.
3691 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
3692 Uses the new getTocList() method.
3693 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
3694 which automatically updates the contents of the browser.
3695 (RefUpdateCB): Use the new getLabelList method.
3697 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
3699 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
3701 * src/spellchecker.C: Added using std::reverse;
3703 2000-05-19 Juergen Vigna <jug@sad.it>
3705 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
3707 * src/insets/insettext.C (computeTextRows): small fix for display of
3708 1 character after a newline.
3710 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
3713 2000-05-18 Juergen Vigna <jug@sad.it>
3715 * src/insets/insettabular.C (TabularFeatures): fixed update of display
3716 when changing width of column.
3718 * src/tabular.C (set_row_column_number_info): setting of
3719 autobreak rows if necessary.
3721 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3723 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
3725 * src/vc-backend.*: renamed stat() to status() and vcstat to
3726 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
3727 compilation broke. The new name seems more relevant, anyway.
3729 2000-05-17 Juergen Vigna <jug@sad.it>
3731 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
3732 which was wrong if the removing caused removing of rows!
3734 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
3735 (pushToken): new function.
3737 * src/text2.C (CutSelection): fix problem discovered with purify
3739 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3741 * src/debug.C (showTags): enlarge the first column, now that we
3742 have 6-digits debug codes.
3744 * lib/layouts/hollywood.layout:
3745 * lib/tex/hollywood.cls:
3746 * lib/tex/brodway.cls:
3747 * lib/layouts/brodway.layout: more commands and fewer
3748 environments. Preambles moved in the .cls files. Broadway now has
3749 more options on scene numbering and less whitespace (from Garst)
3751 * src/insets/insetbib.C (getKeys): make sure that we are in the
3752 document directory, in case the bib file is there.
3754 * src/insets/insetbib.C (Latex): revert bogus change.
3756 2000-05-16 Juergen Vigna <jug@sad.it>
3758 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
3759 the TabularLayout on cursor move.
3761 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
3763 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
3766 (draw): fixed cursor position and drawing so that the cursor is
3767 visible when before the tabular-inset.
3769 * src/insets/insettext.C (init): drawLockedFrame was not initialized
3770 when creating from old insettext.
3772 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
3774 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3776 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
3777 * lib/tex/brodway.cls: ditto
3779 * lib/layouts/brodway.layout: change alignment of parenthical
3782 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3784 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
3785 versions 0.88 and 0.89 are supported.
3787 2000-05-15 Juergen Vigna <jug@sad.it>
3789 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
3792 * src/insets/insettext.C (computeTextRows): redone completely this
3793 function in a much cleaner way, because of problems when having a
3795 (draw): added a frame border when the inset is locked.
3796 (SetDrawLockedFrame): this sets if we draw the border or not.
3797 (SetFrameColor): this sets the frame color (default=insetframe).
3799 * src/insets/lyxinset.h: added x() and y() functions which return
3800 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
3801 function which is needed to see if we have a locking inset of some
3802 type in this inset (needed for now in insettabular).
3804 * src/vspace.C (inPixels): the same function also without a BufferView
3805 parameter as so it is easier to use it in some ocasions.
3807 * src/lyxfunc.C: changed all places where insertInset was used so
3808 that now if it couldn't be inserted it is deleted!
3810 * src/TabularLayout.C:
3811 * src/TableLayout.C: added support for new tabular-inset!
3813 * src/BufferView2.C (insertInset): this now returns a bool if the
3814 inset was really inserted!!!
3816 * src/tabular.C (GetLastCellInRow):
3817 (GetFirstCellInRow): new helper functions.
3818 (Latex): implemented for new tabular class.
3822 (TeXTopHLine): new Latex() helper functions.
3824 2000-05-12 Juergen Vigna <jug@sad.it>
3826 * src/mathed/formulamacro.C (Read):
3827 * src/mathed/formula.C (Read): read also the \end_inset here!
3829 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3831 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
3832 crush when saving formulae with unbalanced parenthesis.
3834 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
3836 * src/layout.C: Add new keyword "endlabelstring" to layout file
3838 * src/text.C (GetVisibleRow): Draw endlabel string.
3840 * lib/layouts/broadway.layout
3841 * lib/layouts/hollywood.layout: Added endlabel for the
3842 Parenthetical layout.
3844 * lib/layouts/heb-article.layout: Do not use slanted font shape
3845 for Theorem like environments.
3847 * src/buffer.C (makeLaTeXFile): Always add "american" to
3848 the UsedLanguages list if document language is RTL.
3850 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3852 * add addendum to README.OS2 and small patch (from SMiyata)
3854 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3856 * many files: correct the calls to ChangeExtension().
3858 * src/support/filetools.C (ChangeExtension): remove the no_path
3859 argument, which does not belong there. Use OnlyFileName() instead.
3861 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
3862 files when LaTeXing a non-nice latex file.
3864 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
3865 a chain of "if". Return false when deadkeys are not handled.
3867 * src/lyx_main.C (LyX): adapted the code for default bindings.
3869 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
3870 bindings for basic functionality (except deadkeys).
3871 (deadKeyBindings): new method. Performs the bindings of deadkeys.
3873 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
3874 several methods: handle override_x_deadkeys.
3876 * src/lyxrc.h: remove the "bindings" map, which did not make much
3877 sense anyway. New variable override_x_deadkeys, defaulting to "true".
3879 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3881 * src/lyxfont.C (stateText): use a saner method to determine
3882 whether the font is "default". Seems to fix the crash with DEC
3885 * src/Bullet.[Ch] (Bullet): remove const on parameters.
3887 2000-05-08 Juergen Vigna <jug@sad.it>
3889 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
3890 TabularLayoutMenu with mouse-button-3
3891 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
3893 * src/TabularLayout.C: added this file for having a Layout for
3896 2000-05-05 Juergen Vigna <jug@sad.it>
3898 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
3899 recalculating inset-widths.
3900 (TabularFeatures): activated this function so that I can change
3901 tabular-features via menu.
3903 * src/menus.C (ShowEditMenu): inserted support for insettabular so
3904 that I can test some functions with the Table menu.
3906 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3908 * src/lyxfont.C (stateText): guard against stupid c++libs.
3910 * src/tabular.C: add using std::vector
3911 some whitespace changes, + removed som autogenerated code.
3913 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
3915 2000-05-05 Juergen Vigna <jug@sad.it>
3917 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
3918 row, columns and cellstructures.
3920 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3922 * lib/lyxrc.example: remove obsolete entries.
3924 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
3925 reading of protected_separator for free_spacing.
3927 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3929 * src/text.C (draw): do not display an exclamation mark in the
3930 margin for margin notes. This is confusing, ugly and
3933 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
3934 AMS math' is checked.
3936 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
3937 name to see whether including the amsmath package is needed.
3939 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
3941 * src/paragraph.C (validate): Compute UsedLanguages correctly
3942 (don't insert the american language if it doesn't appear in the
3945 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
3946 The argument of \thanks{} command is considered moving argument
3948 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
3951 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
3953 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
3954 for appendix/minipage/depth. The lines can be now both in the footnote
3955 frame, and outside the frame.
3957 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
3960 2000-05-05 Juergen Vigna <jug@sad.it>
3962 * src/table.[Ch]: removed the inset and buffer stuff as this is now
3963 neede only in tabular.[Ch].
3965 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3967 * src/insets/insetspecialchar.C (Read): allow command == '~' for
3969 (Write): write '~' for PROTECTED_SEPARATOR
3971 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3973 * src/lyxparagraph.h: add a friend struct matchIT after the struct
3976 * src/mathed/formula.C (drawStr): rename size to siz.
3978 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
3979 possibly fix a bug by not changing the pflags = flags to piflags =
3982 2000-05-05 Juergen Vigna <jug@sad.it>
3984 * src/insets/insetbib.C: moved using directive
3986 * src/ImportNoweb.C: small fix for being able to compile (missing
3989 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3991 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
3992 to use clear, since we don't depend on this in the code. Add test
3995 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3997 * (various *.C files): add using std::foo directives to please dec
4000 * replace calls to string::clear() to string::erase() (Angus)
4002 * src/cheaders/cmath: modified to provide std::abs.
4004 2000-05-04 Juergen Vigna <jug@sad.it>
4006 * src/insets/insettext.C: Prepared all for inserting of multiple
4007 paragraphs. Still display stuff to do (alignment and other things),
4008 but I would like to use LyXText to do this when we cleaned out the
4009 table-support stuff.
4011 * src/insets/insettabular.C: Changed lot of stuff and added lots
4012 of functionality still a lot to do.
4014 * src/tabular.C: Various functions changed name and moved to be
4015 const functions. Added new Read and Write functions and changed
4016 lots of things so it works good with tabular-insets (also removed
4017 some stuff which is not needed anymore * hacks *).
4019 * src/lyxcursor.h: added operators == and != which just look if
4020 par and pos are (not) equal.
4022 * src/buffer.C (latexParagraphs): inserted this function to latex
4023 all paragraphs form par to endpar as then I can use this too for
4026 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
4027 so that I can call this to from text insets with their own cursor.
4029 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
4030 output off all paragraphs (because of the fix below)!
4032 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
4033 the very last paragraph (this could be also the last paragraph of an
4036 * src/texrow.h: added rows() call which returns the count-variable.
4038 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4040 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
4042 * lib/configure.m4: better autodetection of DocBook tools.
4044 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4046 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
4048 * src/lyx_cb.C: add using std::reverse;
4050 * src/LaTeX.C (run): on error always run deleteFilesOnError before
4053 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
4054 selected files. Should fix repeated errors from generated files.
4056 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
4058 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
4060 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
4061 the spellchecker popup.
4063 * lib/lyxrc.example: Removed the \number_inset section
4065 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4067 * src/insets/figinset.C (various): Use IsFileReadable() to make
4068 sure that the file actually exist. Relying on ghostscripts errors
4069 is a bad idea since they can lead to X server crashes.
4071 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
4073 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
4076 * lib/lyxrc.example: smallish typo in description of
4077 \view_dvi_paper_option
4079 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4082 * src/lyxfunc.C: doImportHelper to factor out common code of the
4083 various import methods. New functions doImportASCIIasLines,
4084 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
4085 doImportLinuxDoc for the format specific parts.
4088 * buffer.C: Dispatch returns now a bool to indicate success
4091 * lyx_gui.C: Add getLyXView() for member access
4093 * lyx_main.C: Change logic for batch commands: First try
4094 Buffer::Dispatch (possibly without GUI), if that fails, use
4097 * lyx_main.C: Add support for --import command line switch.
4098 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
4099 Available Formats: Everything accepted by 'buffer-import <format>'
4101 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4103 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
4106 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
4107 documents will be reformatted upon reentry.
4109 2000-04-27 Juergen Vigna <jug@sad.it>
4111 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
4112 correctly only last pos this was a bug.
4114 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4116 * release of lyx-1.1.5pre1
4118 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4120 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
4122 * src/menus.C: revert the change of naming (Figure->Graphic...)
4123 from 2000-04-11. It was incomplete and bad.
4125 * src/LColor.[Ch]: add LColor::depthbar.
4126 * src/text.C (GetVisibleRow): use it.
4128 * README: update the languages list.
4130 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4132 * src/text.C (GetVisibleRow): show the depth of paragraphs using
4135 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4137 * README: remove sections that were just wrong.
4139 * src/text2.C (GetRowNearY): remove currentrow code
4141 * src/text.C (GetRow): remove currentrow code
4143 * src/screen.C (Update): rewritten a bit.
4144 (SmallUpdate): removed func
4146 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
4148 (FullRebreak): return bool
4149 (currentrow): remove var
4150 (currentrow_y): ditto
4152 * src/lyxscreen.h (Draw): change arg to unsigned long
4153 (FitCursor): return bool
4154 (FitManualCursor): ditto
4155 (Smallpdate): remove func
4156 (first): change to unsigned long
4157 (DrawOneRow): change second arg to long (from long &)
4158 (screen_refresh_y): remove var
4159 (scree_refresh_row): ditto
4161 * src/lyxrow.h: change baseline to usigned int from unsigned
4162 short, this brings some implicit/unsigned issues out in the open.
4164 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
4166 (Dispatch): don't call updateScrollbar after fitCursor. Use update
4167 instead of smallUpdate.
4169 * src/lyxcursor.h: change y to unsigned long
4171 * src/buffer.h: don't call updateScrollbar after fitcursor
4173 * src/buffer.C (parseSingleLyXformat2Token): move variables to
4174 where they are used. Removed "\\direction", this was not present
4175 in 1.1.4 and is already obsolete. Commented out some code that I
4176 believe to never be called.
4177 (runLiterate): don't call updateScrollbar after fitCursor
4179 (buildProgram): ditto
4182 * src/WorkArea.h (workWidth): change return val to unsigned
4185 (redraw): remove the button redraws
4186 (setScrollbarValue): change for scrollbar
4187 (getScrollbarValue): change for scrollbar
4188 (getScrollbarBounds): change for scrollbar
4190 * src/WorkArea.C (C_WorkArea_up_cb): removed func
4191 (C_WorkArea_down_cb): removed func
4192 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
4193 (resize): change for scrollbar
4194 (setScrollbar): ditto
4195 (setScrollbarBounds): ditto
4196 (setScrollbarIncrements): ditto
4197 (up_cb): removed func
4198 (down_cb): removed func
4199 (scroll_cb): change for scrollbar
4200 (work_area_handler): ditto
4202 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
4203 when FitCursor did something.
4204 (updateScrollbar): some unsigned changes
4205 (downCB): removed func
4206 (scrollUpOnePage): removed func
4207 (scrollDownOnePage): remvoed func
4208 (workAreaMotionNotify): don't call screen->FitCursor but use
4209 fitCursor instead. and bool return val
4210 (workAreaButtonPress): ditto
4211 (workAreaButtonRelease): some unsigned changes
4212 (checkInsetHit): ditto
4213 (workAreaExpose): ditto
4214 (update): parts rewritten, comments about the signed char arg added
4215 (smallUpdate): removed func
4216 (cursorPrevious): call needed updateScrollbar
4219 * src/BufferView2.C (allFloats): don't call updateScrollbar after
4222 * src/BufferView.[Ch] (upCB): removed func
4223 (downCB): removed func
4224 (smallUpdate): removed func
4226 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4228 * src/lyxtext.h src/text.C src/text2.C: removed support for the
4229 currentrow, currentrow_y optimization. This did not help a lot and
4230 if we want to do this kind of optimization we should rather use
4231 cursor.row instead of the currentrow.
4233 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
4234 buffer spacing and klyx spacing support.
4236 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4238 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
4241 2000-04-26 Juergen Vigna <jug@sad.it>
4243 * src/insets/figinset.C: fixes to Lars sstream changes!
4245 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
4247 * A lot of files: Added Ascii(ostream &) methods to all inset
4248 classes. Used when exporting to ASCII.
4250 * src/buffer.C (writeFileAscii,RoffAsciiTable)
4251 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
4254 * src/text2.C (ToggleFree): Disabled implicit word selection when
4255 there is a change in the language
4257 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
4258 no output was generated for end-of-sentence inset.
4260 * src/insets/lyxinset.h
4263 * src/paragraph.C: Removed the insetnumber code
4265 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
4267 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4269 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
4270 no_babel and no_epsfig completely from the file.
4271 (parseSingleLyXformat2Token): add handling for per-paragraph
4272 spacing as written by klyx.
4274 * src/insets/figinset.C: applied patch by Andre. Made it work with
4277 2000-04-20 Juergen Vigna <jug@sad.it>
4279 * src/insets/insettext.C (cutSelection):
4280 (copySelection): Fixed with selection from right to left.
4281 (draw): now the rows are not recalculated at every draw.
4282 (computeTextRows): for now reset the inset-owner here (this is
4283 important for an undo or copy where the inset-owner is not set
4286 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
4287 motion to the_locking_inset screen->first was forgotten, this was
4288 not important till we got multiline insets.
4290 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4292 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
4293 code seems to be alright (it is code changed by Dekel, and the
4294 intent is indeed that all macros should be defined \protect'ed)
4296 * NEWS: a bit of reorganisation of the new user-visible features.
4298 2000-04-19 Juergen Vigna <jug@sad.it>
4300 * src/insets/insettext.C (init): using a LyXCursor now for cursor
4301 position. Set the inset_owner of the used paragraph so that it knows
4302 that it is inside an inset. Fixed cursor handling with mouse and
4303 cursor keys. Fixed wrong timed inset redraws and lots of other changes
4304 and cleanups to make TextInsets work better.
4306 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
4307 Changed parameters of various functions and added LockInsetInInset().
4309 * src/insets/insettext.C:
4311 * src/insets/insetcollapsable.h:
4312 * src/insets/insetcollapsable.C:
4313 * src/insets/insetfoot.h:
4314 * src/insets/insetfoot.C:
4315 * src/insets/insetert.h:
4316 * src/insets/insetert.C: cleaned up the code so that it works now
4317 correctly with insettext.
4319 * src/insets/inset.C:
4320 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
4321 that insets in insets are supported right.
4324 * src/table.C: lots of changes for use with inset tabular (and cleanup)
4326 * src/paragraph.C: some small fixes
4328 * src/debug.h: inserted INSETS debug info
4330 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
4331 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
4333 * src/commandtags.h:
4334 * src/LyXAction.C: insert code for InsetTabular.
4336 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
4337 not Button1MotionMask.
4338 (workAreaButtonRelease): send always a InsetButtonRelease event to
4340 (checkInsetHit): some setCursor fixes (always with insets).
4342 * src/BufferView2.C (lockInset): returns a bool now and extended for
4343 locking insets inside insets.
4344 (showLockedInsetCursor): it is important to have the cursor always
4345 before the locked inset.
4346 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
4348 * src/BufferView.h: made lockInset return a bool.
4350 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
4352 * src/text2.C (SetCursor): This now has a version with a LyXCursor
4353 that is used also internally but can be called as public to have back
4354 a cursor pos which is not set internally.
4355 (SetCursorIntern): Changed to use above function.
4357 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
4359 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4364 * NEWS: updated for prerelease of 1.1.5. Please comment and send
4365 patches for things that should be in or should be changed.
4367 * src/* [insetfiles]: change "usigned char fragile" to bool
4368 fragile. There was only one point that could that be questioned
4369 and that is commented in formulamacro.C. Grep for "CHECK".
4371 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
4372 (DeleteBuffer): take it out of CutAndPaste and make it static.
4374 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4376 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
4377 output the spacing envir commands. Also the new commands used in
4378 the LaTeX output makes the result better.
4380 * src/Spacing.C (writeEnvirBegin): new method
4381 (writeEnvirEnd): new method
4383 2000-04-18 Juergen Vigna <jug@sad.it>
4385 * src/CutAndPaste.C: made textclass a static member of the class
4386 as otherwise it is not accesed right!!!
4388 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
4390 * forms/layout_forms.fd
4391 * src/layout_forms.h
4392 * src/layout_forms.C (create_form_form_character)
4393 * src/lyx_cb.C (UserFreeFont)
4394 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
4395 documents (in the layout->character popup).
4397 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4399 * src/spellchecker.C (create_ispell_pipe): fix a bug where
4400 \spell_command was in fact not honored (from Kevin Atkinson).
4402 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
4405 * src/lyx_gui.h: make lyxViews private (Angus)
4407 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
4409 * src/mathed/math_write.C
4410 (MathMatrixInset::Write) Put \protect before \begin{array} and
4411 \end{array} if fragile
4412 (MathParInset::Write): Put \protect before \\ if fragile
4414 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4416 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
4417 initialization if the LyXColorHandler must be done after the
4418 connections to the XServer has been established.
4420 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
4421 get the background pixel from the lyxColorhandler so that the
4422 figures are rendered with the correct background color.
4423 (NextToken): removed functions.
4424 (GetPSSizes): use ifs >> string instead of NextToken.
4426 * src/Painter.[Ch]: the color cache moved out of this file.
4428 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
4431 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4433 * src/WorkArea.C (work_area_handler): call BufferView::enterView
4434 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
4436 * src/BufferView.C (enterView): new func
4437 (leaveView): new func
4439 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
4441 (leaveView): new func, undefines xterm cursor when approp.
4443 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
4444 (AllowInput): delete the Workarea cursor handling from this func.
4446 * src/Painter.C (underline): draw a slimer underline in most cases.
4448 * src/lyx_main.C (error_handler): use extern "C"
4450 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4452 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
4453 sent directly to me.
4455 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
4456 to the list by Dekel.
4458 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
4461 * src/bufferview_funcs.[Ch]: two new files, moved several of the
4462 methods from lyx_cb.here.
4464 * src/lyx_cb.C: in addition to the above; removed input_prohibited
4467 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4469 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
4470 instead of using current_view directly.
4472 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
4474 * src/LyXAction.C (init): add the paragraph-spacing command.
4476 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
4478 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
4480 * src/lyx_cb.C (CurrentState): output a string when the spacing is
4481 different from the documents.
4483 * src/text.C (SetHeightOfRow): take paragraph spacing into
4484 account, paragraph spacing takes precedence over buffer spacing
4485 (GetVisibleRow): ditto
4487 * src/paragraph.C (writeFile): output the spacing parameter too.
4488 (validate): set the correct features if spacing is used in the
4490 (Clear): set spacing to default
4491 (MakeSameLayout): spacing too
4492 (HasSameLayout): spacing too
4493 (SetLayout): spacing too
4494 (TeXOnePar): output the spacing commands
4496 * src/lyxparagraph.h: added a spacing variable for use with
4497 per-paragraph spacing.
4499 * src/Spacing.h: add a Default spacing and a method to check if
4500 the current spacing is default. also added an operator==
4502 * src/text2.C (DeleteEmptyParagraphMechanism): added a
4505 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4507 * src/lyxserver.C (callback): fix dispatch of functions
4509 * src/insets/insetlatexaccent.C (checkContents): turn bogus
4510 printf() into lyxerr call.
4512 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
4515 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
4516 "Table" to "Table Box", "Float" to "Floating Material"; deletes
4517 the "Float" from each of the subitems.
4518 (ShowHelpMenu): add entry for "FAQ" and "TOC".
4520 * src/support/DebugStream.h: add an #ifdef to work around a gcc
4521 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
4522 documented the change so that the workaround can be nuked later.
4524 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
4527 * src/lyxlex_pimpl.C (next): do not re-declare the default value
4529 * src/buffer.C (getLatexName): ditto
4530 (setReadonly): ditto
4532 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4534 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
4535 avoid some uses of current_view. Added also a bufferParams()
4536 method to get at this.
4538 * src/lyxtext.h: changed params->buffer and paramters->bparams.
4540 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4542 * src/lyxparagraph.[Ch]: removed
4543 operator<(LyXParagraph::InsetTable..., added a struct matchIT
4544 with operators used by lower_bound and
4545 upper_bound in InsetTable's
4546 Make struct InsetTable private again. Used matchpos.
4548 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
4550 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
4551 document, the language of existing text is changed (unless the
4552 document is multi-lingual)
4554 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
4556 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
4558 * A lot of files: A rewrite of the Right-to-Left support.
4560 2000-04-10 Juergen Vigna <jug@sad.it>
4562 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
4563 misplaced cursor when inset in inset is locked.
4565 * src/insets/insettext.C (LocalDispatch): small fix so that a
4566 BREAKLINE is not inserted if we don't permit it with autBreakRows.
4568 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
4569 footnote font should be decreased in size twice when displaying.
4571 * src/insets/insettext.C (GetDrawFont): inserted this function as
4572 the drawing-font may differ from the real paragraph font.
4574 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
4575 insets (inset in inset!).
4577 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
4578 function here because we don't want footnotes inside footnotes.
4580 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
4582 (init): now set the inset_owner in paragraph.C
4583 (LocalDispatch): added some resetPos() in the right position
4586 (pasteSelection): changed to use the new CutAndPaste-Class.
4588 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
4589 which tells if it is allowed to insert another inset inside this one.
4591 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
4592 SwitchLayoutsBetweenClasses.
4594 * src/text2.C (InsertInset): checking of the new paragraph-function
4596 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
4597 is not needed anymore here!
4600 (PasteSelection): redone (also with #ifdef) so that now this uses
4601 the CutAndPaste-Class.
4602 (SwitchLayoutsBetweenClasses): removed here and implemented in the
4605 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
4606 from/to text/insets.
4608 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
4609 so that the paragraph knows if it is inside an (text)-inset.
4610 (InsertFromMinibuffer): changed return-value to bool as now it
4611 may happen that an inset is not inserted in the paragraph.
4612 (InsertInsetAllowed): this checks if it is allowed to insert an
4613 inset in this paragraph.
4615 (BreakParagraphConservative):
4616 (BreakParagraph) : small change for the above change of the return
4617 value of InsertFromMinibuffer.
4619 * src/lyxparagraph.h: added inset_owner and the functions to handle
4620 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
4622 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4624 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
4625 functions from BufferView to BufferView::Pimpl to ease maintence.
4627 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
4628 correctly. Also use SetCursorIntern instead of SetCursor.
4630 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
4633 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4635 * src/WorkArea.C (belowMouse): manually implement below mouse.
4637 * src/*: Add "explicit" on several constructors, I added probably
4638 some unneeded ones. A couple of changes to code because of this.
4640 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
4641 implementation and private parts from the users of BufferView. Not
4644 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
4645 implementation and private parts from the users of LyXLex. Not
4648 * src/BufferView_pimpl.[Ch]: new files
4650 * src/lyxlex_pimpl.[Ch]: new files
4652 * src/LyXView.[Ch]: some inline functions move out-of-line
4654 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4656 * src/lyxparagraph.h: make struct InsetTable public.
4658 * src/support/lyxstring.h: change lyxstring::difference_type to be
4659 ptrdiff_t. Add std:: modifiers to streams.
4661 * src/font.C: include the <cctype> header, for islower() and
4664 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4666 * src/font.[Ch]: new files. Contains the metric functions for
4667 fonts, takes a LyXFont as parameter. Better separation of concepts.
4669 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
4670 changes because of this.
4672 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
4674 * src/*: compile with -Winline and move functions that don't
4677 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
4680 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4682 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
4683 (various files changed because of this)
4685 * src/Painter.C (text): fixed the drawing of smallcaps.
4687 * src/lyxfont.[Ch] (drawText): removed unused member func.
4690 * src/*.C: added needed "using" statements and "std::" qualifiers.
4692 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4694 * src/*.h: removed all use of "using" from header files use
4695 qualifier std:: instead.
4697 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4699 * src/text.C (Backspace): some additional cleanups (we already
4700 know whether cursor.pos is 0 or not).
4702 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
4703 automake does not provide one).
4705 * src/bmtable.h: replace C++ comments with C comments.
4707 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
4709 * src/screen.C (ShowCursor): Change the shape of the cursor if
4710 the current language is not equal to the language of the document.
4711 (If the cursor change its shape unexpectedly, then you've found a bug)
4713 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
4716 * src/insets/insetnumber.[Ch]: New files.
4718 * src/LyXAction.C (init)
4719 * src/lyxfunc.C (dispatch): Add command number-inset-insert
4722 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
4724 * src/lyxparagraph.h
4725 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
4726 (the vector is kept sorted).
4728 * src/text.C (GetVisibleRow): Draw selection correctly when there
4729 is both LTR and RTL text.
4731 * src/paragraph.C (Clone): Use the assignment operator for cloning,
4732 which is much faster.
4734 * src/text.C (GetVisibleRow and other): Do not draw the last space
4735 in a row if the direction of the last letter is not equal to the
4736 direction of the paragraph.
4738 * src/lyxfont.C (latexWriteStartChanges):
4739 Check that font language is not equal to basefont language.
4740 (latexWriteEndChanges): ditto
4742 * src/lyx_cb.C (StyleReset): Don't change the language while using
4743 the font-default command.
4745 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
4746 empty paragraph before a footnote.
4748 * src/insets/insetcommand.C (draw): Increase x correctly.
4750 * src/screen.C (ShowCursor): Change cursor shape if
4751 current language != document language.
4753 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
4755 2000-03-31 Juergen Vigna <jug@sad.it>
4757 * src/paragraph.C (GetInset): commented out text[pos] = ' '
4758 (Clone): changed mode how the paragraph-data is copied to the
4759 new clone-paragraph.
4761 * src/lyxfunc.C (Dispatch): fixed small problem when calling
4762 GetInset(pos) with no inset anymore there (in inset UNDO)
4764 * src/insets/insetcommand.C (draw): small fix as here x is
4765 incremented not as much as width() returns (2 before, 2 behind = 4)
4767 2000-03-30 Juergen Vigna <jug@sad.it>
4769 * src/insets/insettext.C (InsetText): small fix in initialize
4770 widthOffset (should not be done in the init() function)
4772 2000-03-29 Amir Karger <karger@lyx.org>
4774 * lib/examples/it_ItemizeBullets.lyx: translation by
4777 * Implemented \textasciitilde and fixed a tiny bug in reLyX
4779 2000-03-29 Juergen Vigna <jug@sad.it>
4781 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
4783 * src/insets/insetfoot.C (Clone): small change as for the below
4784 new init function in the text-inset
4786 * src/insets/insettext.C (init): new function as I've seen that
4787 clone did not copy the Paragraph-Data!
4788 (LocalDispatch): Added code so that now we have some sort of Undo
4789 functionality (well actually we HAVE Undo ;)
4791 * src/text.C (Backspace): Small fix for the a | a Backspace problem
4793 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
4795 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
4798 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4800 * src/main.C: added a runtime check that verifies that the xforms
4801 header used when building LyX and the library used when running
4802 LyX match. Exit with a message if they don't match. This is a
4803 version number check only.
4805 * src/buffer.C (save): Don't allocate memory on the heap for
4806 struct utimbuf times.
4808 * *: some using changes, use iosfwd instead of the real headers.
4810 * src/lyxfont.C use char const * instead of string for the static
4811 strings. Rewrite some functions to use sstream.
4813 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4815 * src/text.C (Backspace): hopefully fix the dreaded backaspace
4818 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4820 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
4821 of Geodesy (from Martin Vermeer)
4823 * lib/layouts/svjour.inc: include file for the Springer svjour
4824 class. It can be used to support journals other than JoG.
4826 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
4827 Miskiewicz <misiek@pld.org.pl>)
4828 * lib/reLyX/Makefile.am: ditto.
4830 2000-03-27 Juergen Vigna <jug@sad.it>
4832 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
4833 also some modifications with operations on selected text.
4835 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
4836 problems with clicking on insets (last famous words ;)
4838 * src/insets/insetcommand.C (draw):
4839 (width): Changed to have a bit of space before and after the inset so
4840 that the blinking cursor can be seen (otherwise it was hidden)
4842 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4844 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
4845 would not be added to the link list when an installed gettext (not
4846 part of libc) is found.
4848 2000-03-24 Juergen Vigna <jug@sad.it>
4850 * src/insets/insetcollapsable.C (Edit):
4851 * src/mathed/formula.C (InsetButtonRelease):
4852 (InsetButtonPress): fixed for new handling of ButtonPress/Release
4855 * src/BufferView.C (workAreaButtonPress):
4856 (workAreaButtonRelease):
4857 (checkInsetHit): Finally fixed the clicking on insets be handled
4860 * src/insets/insetert.C (Edit): inserted this call so that ERT
4861 insets work always with LaTeX-font
4863 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
4865 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
4866 caused lyx to startup with no GUI in place, causing in a crash
4867 upon startup when called with arguments.
4869 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4871 * src/FontLoader.C: better initialization of dummyXFontStruct.
4873 2000-03-20 José Abílio Matos <jamatos@lyx.org>
4875 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
4876 for linuxdoc and docbook import and export format options.
4878 * lib/lyxrc.example Example of default values for the previous flags.
4880 * src/lyx_cb.C Use those flags instead of the hardwired values for
4881 linuxdoc and docbook export.
4883 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
4886 * src/menus.C Added menus entries for the new import/exports formats.
4888 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4890 * src/lyxrc.*: Added support for running without Gui
4893 * src/FontLoader.C: sensible defaults if no fonts are needed
4895 * src/lyx_cb.C: New function ShowMessage (writes either to the
4896 minibuffer or cout in case of no gui
4897 New function AskOverwrite for common stuff
4898 Consequently various changes to call these functions
4900 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
4901 wild guess at sensible screen resolution when having no gui
4903 * src/lyxfont.C: no gui, no fonts... set some defaults
4905 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4907 * src/LColor.C: made the command inset background a bit lighter.
4909 2000-03-20 Hartmut Goebel <goebel@noris.net>
4911 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
4912 stdstruct.inc. Koma-Script added some title elements which
4913 otherwise have been listed below "bibliography". This split allows
4914 adding title elements to where they belong.
4916 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
4917 define the additional tilte elements and then include
4920 * many other layout files: changed to include stdtitle.inc just
4921 before stdstruct.inc.
4923 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
4925 * src/buffer.C: (save) Added the option to store all backup files
4926 in a single directory
4928 * src/lyxrc.[Ch]: Added variable \backupdir_path
4930 * lib/lyxrc.example: Added descriptions of recently added variables
4932 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
4933 bibtex inset, not closing the bibtex popup when deleting the inset)
4935 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4937 * src/lyx_cb.C: add a couple using directives.
4939 2000-03-17 José Abílio Matos <jamatos@lyx.org>
4940 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
4941 import based on the filename.
4943 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
4944 file would be imported at start, if the filename where of a sgml file.
4946 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
4948 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
4950 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
4951 * src/lyxfont.h Replaced the member variable bits.direction by the
4952 member variable lang. Made many changes in other files.
4953 This allows having a multi-lingual document
4955 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
4956 that change the current language to <l>.
4957 Removed the command "font-rtl"
4959 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
4960 format for Hebrew documents)
4962 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
4963 When auto_mathmode is "true", pressing a digit key in normal mode
4964 will cause entering into mathmode.
4965 If auto_mathmode is "rtl" then this behavior will be active only
4966 when writing right-to-left text.
4968 * src/text2.C (InsertStringA) The string is inserted using the
4971 * src/paragraph.C (GetEndLabel) Gives a correct result for
4972 footnote paragraphs.
4974 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
4976 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4978 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
4979 front of PasteParagraph. Never insert a ' '. This should at least
4980 fix some cause for the segfaults that we have been experiencing,
4981 it also fixes backspace behaviour slightly. (Phu!)
4983 * src/support/lstrings.C (compare_no_case): some change to make it
4984 compile with gcc 2.95.2 and stdlibc++-v3
4986 * src/text2.C (MeltFootnoteEnvironment): change type o
4987 first_footnote_par_is_not_empty to bool.
4989 * src/lyxparagraph.h: make text private. Changes in other files
4991 (fitToSize): new function
4992 (setContentsFromPar): new function
4993 (clearContents): new function
4994 (SetChar): new function
4996 * src/paragraph.C (readSimpleWholeFile): deleted.
4998 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
4999 the file, just use a simple string instead. Also read the file in
5000 a more maintainable manner.
5002 * src/text2.C (InsertStringA): deleted.
5003 (InsertStringB): deleted.
5005 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5007 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
5008 RedoParagraphs from the doublespace handling part, just set status
5009 to NEED_MORE_REFRESH. Also don't update cursor position (should be
5010 done, but perhaps not like this.)
5012 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5014 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
5015 character when inserting an inset.
5017 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5019 * src/bufferparams.C (readLanguage): now takes "default" into
5022 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
5023 also initialize the toplevel_keymap with the default bindings from
5026 * src/buffer.C (Buffer): remove lyxrc from the parameters.
5028 * all files using lyxrc: have lyxrc as a real variable and not a
5029 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
5032 * src/lyxrc.C: remove double call to defaultKeyBindings
5034 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
5035 toolbar defauls using lyxlex. Remove enums, structs, functions
5038 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
5039 toolbar defaults. Also store default keybindings in a map.
5041 * src/ToolbarDefaults.[Ch]: New file. This class is used for
5042 storing the toolbar defaults without any xforms dependencies.
5044 * src/insets/figinset.C: patch posted to list by Andre Poenitz
5045 applied. Changed to use iterators.
5047 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
5049 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
5050 systems that don't have LINGUAS set to begin with.
5052 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5054 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
5055 the list by Dekel Tsur.
5057 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5059 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
5060 * src/insets/form_graphics.C: ditto.
5062 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
5064 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5066 * src/bufferparams.C (readLanguage): use the new language map
5068 * src/intl.C (InitKeyMapper): use the new language map
5070 * src/lyx_gui.C (create_forms): use the new language map
5072 * src/language.[Ch]: New files. Used for holding the information
5073 about each language. Now! Use this new language map enhance it and
5074 make it really usable for our needs.
5076 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
5078 * screen.C (ShowCursor): Removed duplicate code.
5079 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5080 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
5082 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
5085 * src/text.C Added TransformChar method. Used for rendering Arabic
5086 text correctly (change the glyphs of the letter according to the
5087 position in the word)
5092 * src/lyxrc.C Added lyxrc command {language_command_begin,
5093 language_command_end,language_command_ltr,language_command_rtl,
5094 language_package} which allows the use of either arabtex or Omega
5097 * src/lyx_gui.C (init)
5099 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
5100 to use encoding for menu fonts which is different than the encoding
5103 * src/buffer.C (makeLaTeXFile): If params.language = "default",
5104 do not load the babel package.
5105 To write an English document with Hebrew/Arabic, change the document
5106 language to "english".
5108 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
5109 (alphaCounter): changed to return char
5110 (loweralphaCounter, hebrewCounter, romanCounter): New functions
5112 * lib/lyxrc.example Added examples for Hebrew/Arabic
5115 * src/layout.C Added layout command endlabeltype
5117 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
5119 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
5121 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5123 * src/mathed/math_delim.C (search_deco): return a
5124 math_deco_struct* instead of index.
5126 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5128 * All files with a USE_OSTREAM_ONLY within: removed all code that
5129 was unused when USE_OSTREAM_ONLY is defined.
5131 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
5132 of any less. Removed header and using.
5134 * src/text.C (GetVisibleRow): draw the string "Page Break
5135 (top/bottom)" on screen when drawing a pagebreak line.
5137 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5139 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
5141 * src/mathed/math_macro.C (draw): do some cast magic.
5144 * src/mathed/math_defs.h: change byte* argument to byte const*.
5146 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
5148 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
5149 know it is right to return InsetFoot* too, but cxx does not like
5152 * src/insets/insetcollapsable.[Ch] (Clone): make const.
5154 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
5156 * src/mathed/math_delim.C: change == to proper assignment.
5158 2000-03-09 Juergen Vigna <jug@sad.it>
5160 * src/insets/insettext.C (setPos): fixed various cursor positioning
5161 problems (via mouse and cursor-keys)
5162 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
5163 inset (still a small display problem but it works ;)
5165 * src/insets/insetcollapsable.C (draw): added button_top_y and
5166 button_bottom_y to have correct values for clicking on the inset.
5168 * src/support/lyxalgo.h: commented out 'using std::less'
5170 2000-03-08 Juergen Vigna <jug@sad.it>
5172 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
5173 Button-Release event closes as it is alos the Release-Event
5176 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
5178 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5180 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
5181 can add multiple spaces in Scrap (literate programming) styles...
5182 which, by the way, is how I got hooked on LyX to begin with.
5184 * src/mathed/formula.C (Write): Added dummy variable to an
5185 inset::Latex() call.
5186 (Latex): Add free_spacing boolean to inset::Latex()
5188 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
5190 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
5191 virtual function to include the free_spacing boolean from
5192 the containing paragraph's style.
5194 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
5195 Added free_spacing boolean arg to match inset.h
5197 * src/insets/insettext.C, src/insets/insettext.h (Latex):
5198 Added free_spacing boolean arg to match inset.h
5200 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
5201 Added free_spacing boolean and made sure that if in a free_spacing
5202 paragraph, that we output normal space if there is a protected space.
5204 * src/insets/insetref.C, src/insets/insetref.h (Latex):
5205 Added free_spacing boolean arg to match inset.h
5207 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
5208 Added free_spacing boolean arg to match inset.h
5210 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
5211 Added free_spacing boolean arg to match inset.h
5213 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
5214 Added free_spacing boolean arg to match inset.h
5216 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
5217 Added free_spacing boolean arg to match inset.h
5219 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
5220 free_spacing boolean arg to match inset.h
5222 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
5223 Added free_spacing boolean arg to match inset.h
5225 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
5226 Added free_spacing boolean arg to match inset.h
5228 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
5229 Added free_spacing boolean arg to match inset.h
5231 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
5232 Added free_spacing boolean arg to match inset.h
5234 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
5235 Added free_spacing boolean arg to match inset.h
5237 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
5238 free_spacing boolean arg to match inset.h
5240 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
5241 free_spacing boolean arg to match inset.h
5243 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
5244 ignore free_spacing paragraphs. The user's spaces are left
5247 * src/text.C (InsertChar): Fixed the free_spacing layout
5248 attribute behavior. Now, if free_spacing is set, you can
5249 add multiple spaces in a paragraph with impunity (and they
5250 get output verbatim).
5251 (SelectSelectedWord): Added dummy argument to inset::Latex()
5254 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
5257 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
5258 paragraph layouts now only input a simple space instead.
5259 Special character insets don't make any sense in free-spacing
5262 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
5263 hard-spaces in the *input* file to simple spaces if the layout
5264 is free-spacing. This converts old files which had to have
5265 hard-spaces in free-spacing layouts where a simple space was
5267 (writeFileAscii): Added free_spacing check to pass to the newly
5268 reworked inset::Latex(...) methods. The inset::Latex() code
5269 ensures that hard-spaces in free-spacing paragraphs get output
5270 as spaces (rather than "~").
5272 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5274 * src/mathed/math_delim.C (draw): draw the empty placeholder
5275 delims with a onoffdash line.
5276 (struct math_deco_compare): struct that holds the "functors" used
5277 for the sort and the binary search in math_deco_table.
5278 (class init_deco_table): class used for initial sort of the
5280 (search_deco): use lower_bound to do a binary search in the
5283 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5285 * src/lyxrc.C: a small secret thingie...
5287 * src/lyxlex.C (printTable): changed to take a ostream as paramter
5288 and to not flush the stream as often as it used to.
5290 * src/support/lyxalgo.h: new file
5291 (sorted): template function used for checking if a sequence is
5292 sorted or not. Two versions with and without user supplied
5293 compare. Uses same compare as std::sort.
5295 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
5296 it and give warning on lyxerr.
5298 (struct compare_tags): struct with function operators used for
5299 checking if sorted, sorting and lower_bound.
5300 (search_kw): use lower_bound instead of manually implemented
5303 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5305 * src/insets/insetcollapsable.h: fix Clone() declaration.
5306 * src/insets/insetfoot.h: ditto.
5308 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
5310 2000-03-08 Juergen Vigna <jug@sad.it>
5312 * src/insets/lyxinset.h: added owner call which tells us if
5313 this inset is inside another inset. Changed also the return-type
5314 of Editable to an enum so it tells clearer what the return-value is.
5316 * src/insets/insettext.C (computeTextRows): fixed computing of
5317 textinsets which split automatically on more rows.
5319 * src/insets/insetert.[Ch]: changed this to be of BaseType
5322 * src/insets/insetfoot.[Ch]: added footnote inset
5324 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
5325 collapsable insets (like footnote, ert, ...)
5327 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5329 * src/lyxdraw.h: remvoe file
5331 * src/lyxdraw.C: remove file
5333 * src/insets/insettext.C: added <algorithm>.
5335 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5337 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
5338 (matrix_cb): case MM_OK use string stream
5340 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
5343 * src/mathed/math_macro.C (draw): use string stream
5344 (Metrics): use string stream
5346 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
5347 directly to the ostream.
5349 * src/vspace.C (asString): use string stream.
5350 (asString): use string stream
5351 (asLatexString): use string stream
5353 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
5354 setting Spacing::Other.
5356 * src/LaTeXFeatures.C (getPackages): use string stream instead of
5357 sprintf when creating the stretch vale.
5359 * src/text2.C (alphaCounter): changed to return a string and to
5360 not use a static variable internally. Also fixed a one-off bug.
5361 (SetCounter): changed the drawing of the labels to use string
5362 streams instead of sprintf.
5364 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
5365 manipulator to use a scheme that does not require library support.
5366 This is also the way it is done in the new GNU libstdc++. Should
5367 work with DEC cxx now.
5369 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5371 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
5372 end. This fixes a bug.
5374 * src/mathed (all files concerned with file writing): apply the
5375 USE_OSTREAM_ONLY changes to mathed too.
5377 * src/support/DebugStream.h: make the constructor explicit.
5379 * src/lyxfont.C (latexWriteStartChanges): small bug related to
5380 count and ostream squashed.
5382 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5384 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
5386 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
5387 ostringstream uses STL strings, and we might not.
5389 * src/insets/insetspecialchar.C: add using directive.
5390 * src/insets/insettext.C: ditto.
5392 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5394 * lib/layouts/seminar.layout: feeble attempt at a layout for
5395 seminar.cls, far from completet and could really use some looking
5396 at from people used to write layout files.
5398 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
5399 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
5400 a lot nicer and works nicely with ostreams.
5402 * src/mathed/formula.C (draw): a slightly different solution that
5403 the one posted to the list, but I think this one works too. (font
5404 size wrong in headers.)
5406 * src/insets/insettext.C (computeTextRows): some fiddling on
5407 Jürgens turf, added some comments that he should read.
5409 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
5410 used and it gave compiler warnings.
5411 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
5414 * src/lyx_gui.C (create_forms): do the right thing when
5415 show_banner is true/false.
5417 * src/lyx_cb.C (TimerCB): no need to close or do anything if
5418 show_banner is false.
5420 * most file writing files: Now use iostreams to do almost all of
5421 the writing. Also instead of passing string &, we now use
5422 stringstreams. mathed output is still not adapted to iostreams.
5423 This change can be turned off by commenting out all the occurences
5424 of the "#define USE_OSTREAM_ONLY 1" lines.
5426 * src/WorkArea.C (createPixmap): don't output debug messages.
5427 (WorkArea): don't output debug messages.
5429 * lib/lyxrc.example: added a comment about the new variable
5432 * development/Code_rules/Rules: Added some more commente about how
5433 to build class interfaces and on how better encapsulation can be
5436 2000-03-03 Juergen Vigna <jug@sad.it>
5438 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
5439 automatically with the width of the LyX-Window
5441 * src/insets/insettext.C (computeTextRows): fixed update bug in
5442 displaying text-insets (scrollvalues where not initialized!)
5444 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5446 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
5447 id in the check of the result from lower_bound is not enough since
5448 lower_bound can return last too, and then res->id will not be a
5451 * all insets and some code that use them: I have conditionalized
5452 removed the Latex(string & out, ...) this means that only the
5453 Latex(ostream &, ...) will be used. This is a work in progress to
5454 move towards using streams for all output of files.
5456 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
5459 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5461 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
5462 routine (this fixes bug where greek letters were surrounded by too
5465 * src/support/filetools.C (findtexfile): change a bit the search
5466 algorithm, to fix bug introduced in 1.1.4. Note that --format is
5467 no longer passed to kpsewhich, we may have to change that later.
5469 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
5470 warning options to avoid problems with X header files (from Angus
5472 * acinclude.m4: regenerated.
5474 2000-03-02 Juergen Vigna <jug@sad.it>
5476 * src/insets/insettext.C (WriteParagraphData): Using the
5477 par->writeFile() function for writing paragraph-data.
5478 (Read): Using buffer->parseSingleLyXformat2Token()-function
5479 for parsing paragraph data!
5481 * src/buffer.C (readLyXformat2): removed all parse data and using
5482 the new parseSingleLyXformat2Token()-function.
5483 (parseSingleLyXformat2Token): added this function to parse (read)
5484 lyx-file-format (this is called also from text-insets now!)
5486 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5488 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
5491 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
5492 directly instead of going through a func. One very bad thing: a
5493 static LyXFindReplace, but I don't know where to place it.
5495 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
5496 string instead of char[]. Also changed to static.
5497 (GetSelectionOrWordAtCursor): changed to static inline
5498 (SetSelectionOverLenChars): ditto.
5500 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
5501 current_view and global variables. both classes has changed names
5502 and LyXFindReplace is not inherited from SearchForm.
5504 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
5505 fl_form_search form.
5507 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
5509 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5511 * lib/bind/*.bind: make sure 'buffer-previous' function is not
5512 bound (from Kayvan).
5514 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
5516 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
5518 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5520 * some things that I should comment but the local pub says head to
5523 * comment out all code that belongs to the Roff code for Ascii
5524 export of tables. (this is unused)
5526 * src/LyXView.C: use correct type for global variable
5527 current_layout. (LyXTextClass::size_type)
5529 * some code to get the new insetgraphics closer to working I'd be
5530 grateful for any help.
5532 * src/BufferView2.C (insertInset): use the return type of
5533 NumberOfLayout properly. (also changes in other files)
5535 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
5536 this as a test. I want to know what breaks because of this.
5538 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
5540 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
5542 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
5543 to use a \makebox in the label, this allows proper justification
5544 with out using protected spaces or multiple hfills. Now it is
5545 "label" for left justified, "\hfill label\hfill" for center, and
5546 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
5547 should be changed accordingly.
5549 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5551 * src/lyxtext.h: change SetLayout() to take a
5552 LyXTextClass::size_type instead of a char (when there is more than
5553 127 layouts in a class); also change type of copylayouttype.
5554 * src/text2.C (SetLayout): ditto.
5555 * src/LyXView.C (updateLayoutChoice): ditto.
5557 * src/LaTeX.C (scanLogFile): errors where the line number was not
5558 given just after the '!'-line were ignored (from Dekel Tsur).
5560 * lib/lyxrc.example: fix description of \date_insert_format
5562 * lib/layouts/llncs.layout: new layout, contributed by Martin
5565 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5567 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
5568 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
5569 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
5570 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
5571 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
5572 paragraph.C, text.C, text2.C)
5574 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5576 * src/insets/insettext.C (LocalDispatch): remove extra break
5579 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
5580 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
5582 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
5583 * src/insets/insettext.[Ch] (GetCursorPos): ditto
5585 * src/insets/insetbib.h: move InsetBibkey::Holder and
5586 InsetCitation::Holder in public space.
5588 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5590 * src/insets/insettext.h: small change to get the new files from
5591 Juergen to compile (use "string", not "class string").
5593 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
5594 const & as parameter to LocalDispatch, use LyXFont const & as
5595 paramter to some other func. This also had impacto on lyxinsets.h
5596 and the two mathed insets.
5598 2000-02-24 Juergen Vigna <jug@sad.it>
5601 * src/commandtags.h:
5603 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
5607 * src/BufferView2.C: added/updated code for various inset-functions
5609 * src/insets/insetert.[Ch]: added implementation of InsetERT
5611 * src/insets/insettext.[Ch]: added implementation of InsetText
5613 * src/insets/inset.C (Edit): added "unsigned int button" parameter
5614 (draw): added preliminary code for inset scrolling not finshed yet
5616 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
5617 as it is in lyxfunc.C now
5619 * src/insets/lyxinset.h: Added functions for text-insets
5621 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5623 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
5624 BufferView and reimplement the list as a queue put inside its own
5627 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
5629 * several files: use the new interface to the "updateinsetlist"
5631 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
5633 (work_area_handler): call BufferView::trippleClick on trippleclick.
5635 * src/BufferView.C (doubleClick): new function, selects word on
5637 (trippleClick): new function, selects line on trippleclick.
5639 2000-02-22 Allan Rae <rae@lyx.org>
5641 * lib/bind/xemacs.bind: buffer-previous not supported
5643 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5645 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
5648 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5650 * src/bufferlist.C: get rid of current_view from this file
5652 * src/spellchecker.C: get rid of current_view from this file
5654 * src/vspace.C: get rid of current_view from this file
5655 (inPixels): added BufferView parameter for this func
5656 (asLatexCommand): added a BufferParams for this func
5658 * src/text.C src/text2.C: get rid of current_view from these
5661 * src/lyxfont.C (getFontDirection): move this function here from
5664 * src/bufferparams.C (getDocumentDirection): move this function
5667 * src/paragraph.C (getParDirection): move this function here from
5669 (getLetterDirection): ditto
5671 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5673 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
5674 resize due to wrong pixmap beeing used. Also took the opurtunity
5675 to make the LyXScreen stateless on regard to WorkArea and some
5676 general cleanup in the same files.
5678 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5680 * src/Makefile.am: add missing direction.h
5682 * src/PainterBase.h: made the width functions const.
5684 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
5687 * src/insets/insetcommand.C (draw): draw Editable as buttons.
5689 * src/insets/insetlatexaccent.C (draw): make the accents draw
5690 better, at present this will only work well with iso8859-1.
5692 * several files: remove the old drawing code, now we use the new
5695 * several files: remove support for mono_video, reverse_video and
5698 2000-02-17 Juergen Vigna <jug@sad.it>
5700 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
5701 int ** as we have to return the pointer, otherwise we have only
5702 NULL pointers in the returning function.
5704 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5706 * src/LaTeX.C (operator()): quote file name when running latex.
5708 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5710 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
5711 (bubble tip), this removes our special handling of this.
5713 * Remove all code that is unused now that we have the new
5714 workarea. (Code that are not active when NEW_WA is defined.)
5716 * Make the uses of XSync not conditionalized on define USE_XSYNC.
5718 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5720 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
5721 nonexisting layout; correctly redirect obsoleted layouts.
5723 * lib/lyxrc.example: document \view_dvi_paper_option
5725 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
5728 * src/lyx_cb.C (RunScript): handle $$FName for command names.
5729 (PreviewDVI): handle the view_dvi_paper_option variable.
5730 [Both from Roland Krause]
5732 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5734 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
5735 char const *, int, LyXFont)
5736 (text(int, int, string, LyXFont)): ditto
5738 * src/text.C (InsertCharInTable): attempt to fix the double-space
5739 feature in tables too.
5740 (BackspaceInTable): ditto.
5741 (GetVisibleRow): make bottom pagebreak line be a onoff line.
5743 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5745 * src/text2.C (owner): only complain if owner_ is set and bv != 0
5747 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
5748 newly found text in textcache to this.
5749 (buffer): set the owner of the text put into the textcache to 0
5751 * src/insets/figinset.C (draw): fixed the drawing of figures with
5754 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
5755 drawing of mathframe, hfills, protected space, table lines. I have
5756 now no outstanding drawing problems with the new Painter code.
5758 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5760 * src/PainterBase.C (ellipse, circle): do not specify the default
5763 * src/LColor.h: add using directive.
5765 * src/Painter.[Ch]: change return type of methods from Painter& to
5766 PainterBase&. Add a using directive.
5768 * src/WorkArea.C: wrap xforms callbacks in C functions
5771 * lib/layouts/foils.layout: font fix and simplifications from Carl
5774 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5776 * a lot of files: The Painter, LColor and WorkArea from the old
5777 devel branch has been ported to lyx-devel. Some new files and a
5778 lot of #ifdeffed code. The new workarea is enabled by default, but
5779 if you want to test the new Painter and LColor you have to compile
5780 with USE_PAINTER defined (do this in config.h f.ex.) There are
5781 still some rought edges, and I'd like some help to clear those
5782 out. It looks stable (loads and displays the Userguide very well).
5785 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5787 * src/buffer.C (pop_tag): revert to the previous implementation
5788 (use a global variable for both loops).
5790 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
5792 * src/lyxrc.C (LyXRC): change slightly default date format.
5794 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
5795 there is an English text with a footnote that starts with a Hebrew
5796 paragraph, or vice versa.
5797 (TeXFootnote): ditto.
5799 * src/text.C (LeftMargin): allow for negative values for
5800 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
5803 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
5804 for input encoding (cyrillic)
5806 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5808 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
5811 * src/toolbar.C (set): ditto
5812 * src/insets/insetbib.C (create_form_citation_form): ditto
5814 * lib/CREDITS: added Dekel Tsur.
5816 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
5817 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
5818 hebrew supports files from Dekel Tsur.
5820 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
5821 <tzafrir@technion.ac.il>
5823 * src/lyxrc.C: put \date_insert_format at the right place.
5825 * src/buffer.C (makeLaTeXFile): fix the handling of
5826 BufferParams::sides when writing out latex files.
5828 * src/BufferView2.C: add a "using" directive.
5830 * src/support/lyxsum.C (sum): when we use lyxstring,
5831 ostringstream::str needs an additional .c_str().
5833 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5835 * src/support/filetools.C (ChangeExtension): patch from Etienne
5838 * src/TextCache.C (show): remove const_cast and make second
5839 parameter non-const LyXText *.
5841 * src/TextCache.h: use non const LyXText in show.
5843 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
5846 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5848 * src/support/lyxsum.C: rework to be more flexible.
5850 * several places: don't check if a pointer is 0 if you are going
5853 * src/text.C: remove some dead code.
5855 * src/insets/figinset.C: remove some dead code
5857 * src/buffer.C: move the BufferView funcs to BufferView2.C
5858 remove all support for insetlatexdel
5859 remove support for oldpapersize stuff
5860 made some member funcs const
5862 * src/kbmap.C: use a std::list to store the bindings in.
5864 * src/BufferView2.C: new file
5866 * src/kbsequence.[Ch]: new files
5868 * src/LyXAction.C + others: remove all trace of buffer-previous
5870 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
5871 only have one copy in the binary of this table.
5873 * hebrew patch: moved some functions from LyXText to more
5874 appropriate places. (LyXParagraph, BufferParams, LyXFont)
5876 * several files: remove support for XForms older than 0.88
5878 remove some #if 0 #endif code
5880 * src/TextCache.[Ch]: new file. Holds the textcache.
5882 * src/BufferView.C: changes to use the new TextCache interface.
5883 (waitForX): remove the now unused code.
5885 * src/BackStack.h: remove some commented code
5887 * lib/bind/emacs.bind: remove binding for buffer-previous
5889 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5891 * applied the hebrew patch.
5893 * src/lyxrow.h: make sure that all Row variables are initialized.
5895 * src/text2.C (TextHandleUndo): comment out a delete, this might
5896 introduce a memory leak, but should also help us to not try to
5897 read freed memory. We need to look at this one.
5899 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
5900 (LyXParagraph): initalize footnotekind.
5902 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
5903 forgot this when applying the patch. Please heed the warnings.
5905 * src/BufferView.C (buffer): a fix for the buffer-reload problem
5906 (aka. reformat problem)
5908 * src/bufferlist.C (exists): made const, and use const_iterator
5909 (isLoaded): new func.
5910 (release): use std::find to find the correct buffer.
5912 * src/bufferlist.h: made getState a const func.
5913 made empty a const func.
5914 made exists a const func.
5917 2000-02-01 Juergen Vigna <jug@sad.it>
5919 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
5921 * po/it.po: updated a bit the italian po file and also changed the
5922 'file nuovo' for newfile to 'filenuovo' without a space, this did
5925 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
5926 for the new insert_date command.
5928 * src/lyxfunc.C (Dispatch): added support for a insert_date function
5929 from jdblair, to insert a date into the current text conforming to
5930 a strftime format (for now only considering the locale-set and not
5931 the document-language).
5933 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5935 * src/lyxfont.C (textWidth): hopefully better fix for the Array
5936 Bounds Read error seen by purify. The problem was that islower is
5937 a macros which takes an unsigned char and uses it as an index for
5938 in array of characters properties (and is thus subject to the
5942 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
5943 correctly the paper sides radio buttons.
5944 (UpdateDocumentButtons): ditto.
5946 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5948 * src/kbmap.C (getsym + others): change to return unsigned int,
5949 returning a long can give problems on 64 bit systems. (I assume
5950 that int is 32bit on 64bit systems)
5952 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5954 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
5955 LyXLookupString to be zero-terminated. Really fixes problems seen
5958 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5960 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
5961 write a (char*)0 to the lyxerr stream.
5963 * src/lastfiles.C: move algorithm before the using statemets.
5965 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5967 * src/lastfiles.C: move using directives in global scope (egcs 1.x
5968 complains otherwise).
5969 * src/table.C: ditto
5971 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
5974 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
5975 that I removed earlier... It is really needed.
5977 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
5979 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5981 * INSTALL: update xforms home page URL.
5983 * lib/configure.m4: fix a bug with unreadable layout files.
5985 * src/table.C (calculate_width_of_column): add "using std::max"
5988 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5990 * several files: marked several lines with "DEL LINE", this is
5991 lines that can be deleted without changing anything.
5992 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
5993 checks this anyway */
5996 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
5998 * src/DepTable.C (update): add a "+" at the end when the checksum
5999 is different. (debugging string only)
6001 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
6002 the next inset to not be displayed. This should also fix the list
6003 of labels in the "Insert Crossreference" dialog.
6005 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6007 * src/support/LSubstring.C (LSubstring): set pos to string::npos
6008 when regex was not found.
6010 * src/support/lstrings.C (lowercase): use handcoded transform always.
6013 * src/text.C (Delete): fixed the crash. cursor.par->prev and
6014 old_cursor.par->prev could be 0.
6016 * several files: changed post inc/dec to pre inc/dec
6018 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
6019 write the lastfiles to file.
6021 * src/BufferView.C (buffer): only show TextCache info when debugging
6023 (resizeCurrentBuffer): ditto
6024 (workAreaExpose): ditto
6026 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
6028 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
6030 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
6031 a bit better by removing the special case for \i and \j.
6033 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6035 * src/lyx_main.C (easyParse): remove test for bad comand line
6036 options, since this broke all xforms-related parsing.
6038 * src/kbmap.C (getsym): set return type to unsigned long, as
6039 declared in header. On an alpha, long is _not_ the same as int.
6041 * src/support/LOstream.h: add a "using std::flush;"
6043 * src/insets/figinset.C: ditto.
6045 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6047 * src/bufferlist.C (write): use blinding fast file copy instead of
6048 "a char at a time", now we are doing it the C++ way.
6050 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
6051 std::list<int> instead.
6052 (addpidwait): reflect move to std::list<int>
6053 (sigchldchecker): ditto
6055 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
6058 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
6059 that obviously was wrong...
6061 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
6062 c, this avoids warnings with purify and islower.
6064 * src/insets/figinset.C: rename struct queue to struct
6065 queue_element and rewrite to use a std::queue. gsqueue is now a
6066 std::queue<queue_element>
6067 (runqueue): reflect move to std::queue
6070 * src/support/lstrings.h (tostr): specialize for bool, otherwise
6071 we would get "1" "0" instead of "true" "false. Also make the tostr
6074 2000-01-21 Juergen Vigna <jug@sad.it>
6076 * src/buffer.C (writeFileAscii): Disabled code for special groff
6077 handling of tabulars till I fix this in table.C
6079 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6081 * src/support/mkdir.C (mkdir): change second argument of mkdir to
6083 * src/support/lyxlib.h: ditto.
6085 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6087 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
6088 and 'j' look better. This might fix the "macron" bug that has been
6091 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
6092 functions as one template function. Delete the old versions.
6094 * src/support/lyxsum.C: move using std::ifstream inside
6097 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
6100 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
6102 * src/mathed/formula.C: delete #include "bufferlist.h" never used
6104 * src/insets/figinset.C (InitFigures): use new instead of malloc
6105 to allocate memory for figures and bitmaps.
6106 (DoneFigures): use delete[] instead of free to deallocate memory
6107 for figures and bitmaps.
6108 (runqueue): use new to allocate
6109 (getfigdata): use new/delete[] instead of malloc/free
6110 (RegisterFigure): ditto
6112 * some files: moved some declarations closer to first use, small
6113 whitespace changes use preincrement instead of postincrement where
6114 it does not make a difference.
6116 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
6117 step on the way to use stl::containers for key maps.
6119 * src/bufferlist.h: add a typedef for const_iterator and const
6120 versions of begin and end.
6122 * src/bufferlist.[Ch]: change name of member variable _state to
6123 state_. (avoid reserved names)
6125 (getFileNames): returns the filenames of the buffers in a vector.
6127 * configure.in (ALL_LINGUAS): added ro
6129 * src/support/putenv.C: new file
6131 * src/support/mkdir.C: new file
6133 2000-01-20 Allan Rae <rae@lyx.org>
6135 * lib/layouts/IEEEtran.layout: Added several theorem environments
6137 * lib/templates/IEEEtran.lyx: Example theorem environments and a
6138 couple of minor additions.
6140 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
6141 (except for those in footnotes of course)
6143 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6145 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
6147 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
6148 std::sort and std::lower_bound instead of qsort and handwritten
6150 (struct compara): struct that holds the functors used by std::sort
6151 and std::lower_bound in MathedLookupBOP.
6153 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6155 * src/support/LAssert.h: do not do partial specialization. We do
6158 * src/support/lyxlib.h: note that lyx::getUserName() and
6159 lyx::date() are not in use right now. Should these be suppressed?
6161 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
6162 (makeLinuxDocFile): do not put date and user name in linuxdoc
6165 * src/support/lyxlib.h (kill): change first argument to long int,
6166 since that's what solaris uses.
6168 * src/support/kill.C (kill): fix declaration to match prototype.
6170 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
6171 actually check whether namespaces are supported. This is not what
6174 * src/support/lyxsum.C: add a using directive.
6176 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6178 * src/support/kill.C: if we have namespace support we don't have
6179 to include lyxlib.h.
6181 * src/support/lyxlib.h: use namespace lyx if supported.
6183 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6185 * src/support/date.C: new file
6187 * src/support/chdir.C: new file
6189 * src/support/getUserName.C: new file
6191 * src/support/getcwd.C: new file
6193 * src/support/abort.C: new file
6195 * src/support/kill.C: new file
6197 * src/support/lyxlib.h: moved all the functions in this file
6198 insede struct lyx. Added also kill and abort to this struct. This
6199 is a way to avoid the "kill is not defined in <csignal>", we make
6200 C++ wrappers for functions that are not ANSI C or ANSI C++.
6202 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
6203 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
6204 lyx it has been renamed to sum.
6206 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6208 * src/text.C: add using directives for std::min and std::max.
6210 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6212 * src/texrow.C (getIdFromRow): actually return something useful in
6213 id and pos. Hopefully fixes the bug with positionning of errorbox
6216 * src/lyx_main.C (easyParse): output an error and exit if an
6217 incorrect command line option has been given.
6219 * src/spellchecker.C (ispell_check_word): document a memory leak.
6221 * src/bufferlist.C (write): fix mismatched allocation/deletion,
6222 where a "struct utimbuf" is allocated with "new" and deleted with
6225 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
6227 * src/text2.C (CutSelection): don't delete double spaces.
6228 (PasteSelection): ditto
6229 (CopySelection): ditto
6231 * src/text.C (Backspace): don't delete double spaces.
6233 * src/lyxlex.C (next): fix a bug that were only present with
6234 conformant std::istream::get to read comment lines, use
6235 std::istream::getline instead. This seems to fix the problem.
6237 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6239 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
6240 allowed to insert space before space" editing problem. Please read
6241 commends at the beginning of the function. Comments about usage
6244 * src/text.C (InsertChar): fix for the "not allowed to insert
6245 space before space" editing problem.
6247 * src/text2.C (DeleteEmptyParagraphMechanism): when
6248 IsEmptyTableRow can only return false this last "else if" will
6249 always be a no-op. Commented out.
6251 * src/text.C (RedoParagraph): As far as I can understand tmp
6252 cursor is not really needed.
6254 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
6255 present it could only return false anyway.
6256 (several functions): Did something not so smart...added a const
6257 specifier on a lot of methods.
6259 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
6260 and add a tmp->text.resize. The LyXParagraph constructor does the
6262 (BreakParagraphConservative): ditto
6264 * src/support/path.h (Path): add a define so that the wrong usage
6265 "Path("/tmp") will be flagged as a compilation error:
6266 "`unnamed_Path' undeclared (first use this function)"
6268 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6270 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
6271 which was bogus for several reasons.
6273 * src/LaTeX.C (scanAux): fix the regular expression used to scan
6277 * autogen.sh: do not use "type -path" (what's that anyway?).
6279 * src/support/filetools.C (findtexfile): remove extraneous space
6280 which caused a kpsewhich warning (at least with kpathsea version
6283 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6285 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
6287 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
6289 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
6291 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6293 * src/paragraph.C (BreakParagraph): do not reserve space on text
6294 if we don't need to (otherwise, if pos_end < pos, we end up
6295 reserving huge amounts of memory due to bad unsigned karma).
6296 (BreakParagraphConservative): ditto, although I have not seen
6297 evidence the bug can happen here.
6299 * src/lyxparagraph.h: add a using std::list.
6301 2000-01-11 Juergen Vigna <jug@sad.it>
6303 * src/menus.C (MenuDocu): output an Alert if the documentation-file
6306 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6308 * src/vc-backend.C (doVCCommand): change to be static and take one
6309 more parameter: the path to chdir too be fore executing the command.
6310 (retrive): new function equiv to "co -r"
6312 * src/bufferlist.C (loadLyXFile): implement the missing parts if
6313 file_not_found_hook is true.
6315 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
6317 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
6318 if a file is readwrite,readonly...anything else.
6320 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6322 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
6323 (CreatePostscript): name change from MenuRunDVIPS (or something)
6324 (PreviewPostscript): name change from MenuPreviewPS
6325 (PreviewDVI): name change from MenuPreviewDVI
6327 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
6328 \view_pdf_command., \pdf_to_ps_command
6330 * lib/configure.m4: added search for PDF viewer, and search for
6331 PDF to PS converter.
6332 (lyxrc.defaults output): add \pdflatex_command,
6333 \view_pdf_command and \pdf_to_ps_command.
6335 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
6337 * src/bufferlist.C (write): we don't use blocksize for anything so
6340 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6342 * src/support/block.h: disable operator T* (), since it causes
6343 problems with both compilers I tried. See comments in the file.
6345 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
6348 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
6349 variable LYX_DIR_10x to LYX_DIR_11x.
6351 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
6353 * INSTALL: document --with-lyxname.
6356 * configure.in: new configure flag --with-lyxname which allows to
6357 choose the name under which lyx is installed. Default is "lyx", of
6358 course. It used to be possible to do this with --program-suffix,
6359 but the later has in fact a different meaning for autoconf.
6361 * src/support/lstrings.h (lstrchr): reformat a bit.
6363 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
6364 * src/mathed/math_defs.h: ditto.
6366 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6368 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
6369 true, decides if we create a backup file or not when saving. New
6370 tag and variable \pdf_mode, defaults to false. New tag and
6371 variable \pdflatex_command, defaults to pdflatex. New tag and
6372 variable \view_pdf_command, defaults to xpdf. New tag and variable
6373 \pdf_to_ps_command, defaults to pdf2ps.
6375 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6377 * src/bufferlist.C (close): don't call insetUnlock if the buffer
6378 does not have a BufferView.
6379 (unlockInset): ditto + don't access the_locking_inset if the
6380 buffer does not have a BufferView.
6382 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
6383 certain circumstances so that we don't continue a keyboard
6384 operation long after the key was released. Try f.ex. to load a
6385 large document, press PageDown for some seconds and then release
6386 it. Before this change the document would contine to scroll for
6387 some time, with this change it stops imidiatly.
6389 * src/support/block.h: don't allocate more space than needed. As
6390 long as we don't try to write to the arr[x] in a array_type arr[x]
6391 it is perfectly ok. (if you write to it you might segfault).
6392 added operator value_type*() so that is possible to pass the array
6393 to functions expecting a C-pointer.
6395 * lib/Makefile.am (dist-hook): don't fail completely if unable to
6398 * intl/*: updated to gettext 0.10.35, tried to add our own
6399 required modifications. Please verify.
6401 * po/*: updated to gettext 0.10.35, tried to add our own required
6402 modifications. Please verify.
6404 * src/support/lstrings.C (tostr): go at fixing the problem with
6405 cxx and stringstream. When stringstream is used return
6406 oss.str().c_str() so that problems with lyxstring and basic_string
6407 are avoided. Note that the best solution would be for cxx to use
6408 basic_string all the way, but it is not conformant yet. (it seems)
6410 * src/lyx_cb.C + other files: moved several global functions to
6411 class BufferView, some have been moved to BufferView.[Ch] others
6412 are still located in lyx_cb.C. Code changes because of this. (part
6413 of "get rid of current_view project".)
6415 * src/buffer.C + other files: moved several Buffer functions to
6416 class BufferView, the functions are still present in buffer.C.
6417 Code changes because of this.
6419 * config/lcmessage.m4: updated to most recent. used when creating
6422 * config/progtest.m4: updated to most recent. used when creating
6425 * config/gettext.m4: updated to most recent. applied patch for
6428 * config/gettext.m4.patch: new file that shows what changes we
6429 have done to the local copy of gettext.m4.
6431 * config/libtool.m4: new file, used in creation of acinclude.m4
6433 * config/lyxinclude.m4: new file, this is the lyx created m4
6434 macros, used in making acinclude.m4.
6436 * autogen.sh: GNU m4 discovered as a separate task not as part of
6437 the lib/configure creation.
6438 Generate acinlucde from files in config. Actually cat
6439 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
6440 easier to upgrade .m4 files that really are external.
6442 * src/Spacing.h: moved using std::istringstream to right after
6443 <sstream>. This should fix the problem seen with some compilers.
6445 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6447 * src/lyx_cb.C: began some work to remove the dependency a lot of
6448 functions have on BufferView::text, even if not really needed.
6449 (GetCurrentTextClass): removed this func, it only hid the
6452 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
6453 forgot this in last commit.
6455 * src/Bullet.C (bulletEntry): use static char const *[] for the
6456 tables, becuase of this the return arg had to change to string.
6458 (~Bullet): removed unneeded destructor
6460 * src/BufferView.C (beforeChange): moved from lyx_cb.C
6461 (insetSleep): moved from Buffer
6462 (insetWakeup): moved from Buffer
6463 (insetUnlock): moved from Buffer
6465 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
6466 from Buffer to BufferView.
6468 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
6470 * config/ltmain.sh: updated to version 1.3.4 of libtool
6472 * config/ltconfig: updated to version 1.3.4 of libtool
6474 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6477 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
6478 Did I get that right?
6480 * src/lyxlex.h: add a "using" directive or two.
6481 * src/Spacing.h: ditto.
6482 * src/insets/figinset.C: ditto.
6483 * src/support/filetools.C: ditto.
6484 * src/support/lstrings.C: ditto.
6485 * src/BufferView.C: ditto.
6486 * src/bufferlist.C: ditto.
6487 * src/lyx_cb.C: ditto.
6488 * src/lyxlex.C: ditto.
6490 * NEWS: add some changes for 1.1.4.
6492 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6494 * src/BufferView.C: first go at a TextCache to speed up switching
6497 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6499 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
6500 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
6501 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
6502 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
6505 * src/mathed/math_defs.h (MathedRowSt): make sure that all
6506 members of the struct are correctly initialized to 0 (detected by
6508 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
6509 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
6511 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
6512 pidwait, since it was allocated with "new". This was potentially
6513 very bad. Thanks to Michael Schmitt for running purify for us.
6516 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6518 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
6520 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
6522 1999-12-30 Allan Rae <rae@lyx.org>
6524 * lib/templates/IEEEtran.lyx: minor change
6526 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
6527 src/mathed/formula.C (LocalDispatch): askForText changes
6529 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
6530 know when a user has cancelled input. Fixes annoying problems with
6531 inserting labels and version control.
6533 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6535 * src/support/lstrings.C (tostr): rewritten to use strstream and
6538 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6540 * src/support/filetools.C (IsFileWriteable): use fstream to check
6541 (IsDirWriteable): use fileinfo to check
6543 * src/support/filetools.h (FilePtr): whole class deleted
6545 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
6547 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
6549 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
6551 * src/bufferlist.C (write): use ifstream and ofstream instead of
6554 * src/Spacing.h: use istrstream instead of sscanf
6556 * src/mathed/math_defs.h: change first arg to istream from FILE*
6558 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
6560 * src/mathed/math_parser.C: have yyis to be an istream
6561 (LexGetArg): use istream (yyis)
6563 (mathed_parse): ditto
6564 (mathed_parser_file): first arg istream instead of FILE*, set yyis
6566 * src/mathed/formula.C (Read): rewritten to use istream
6568 * src/mathed/formulamacro.C (Read): rewritten to use istream
6570 * src/lyxlex.h (~LyXLex): deleted desturctor
6571 (getStream): new function, returns an istream
6572 (getFile): deleted funtion
6573 (IsOK): return is.good();
6575 * src/lyxlex.C (LyXLex): delete file and owns_file
6576 (setFile): open an filebuf and assign that to a istream instead of
6578 (setStream): new function, takes an istream as arg.
6579 (setFile): deleted function
6580 (EatLine): rewritten us use istream instead of FILE*
6584 * src/table.C (LyXTable): use istream instead of FILE*
6585 (Read): rewritten to take an istream instead of FILE*
6587 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6589 * src/buffer.C (Dispatch): remove an extraneous break statement.
6591 * src/support/filetools.C (QuoteName): change to do simple
6592 'quoting'. More work is necessary. Also changed to do nothing
6593 under emx (needs fix too).
6594 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
6596 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
6597 config.h.in to the AC_DEFINE_UNQUOTED() call.
6598 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
6599 needs char * as argument (because Solaris 7 declares it like
6602 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
6603 remove definition of BZERO.
6605 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6607 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
6608 defined, "lyxregex.h" if not.
6610 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
6612 (REGEX): new variable that is set to regex.c lyxregex.h when
6613 AM_CONDITIONAL USE_REGEX is set.
6614 (libsupport_la_SOURCES): add $(REGEX)
6616 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
6619 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
6622 * configure.in: add call to LYX_REGEX
6624 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
6625 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
6627 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6629 * lib/bind/fi_menus.bind: new file, from
6630 pauli.virtanen@saunalahti.fi.
6632 * src/buffer.C (getBibkeyList): pass the parameter delim to
6633 InsetInclude::getKeys and InsetBibtex::getKeys.
6635 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
6636 is passed to Buffer::getBibkeyList
6638 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
6639 instead of the hardcoded comma.
6641 * src/insets/insetbib.C (getKeys): make sure that there are not
6642 leading blanks in bibtex keys. Normal latex does not care, but
6643 harvard.sty seems to dislike blanks at the beginning of citation
6644 keys. In particular, the retturn value of the function is
6646 * INSTALL: make it clear that libstdc++ is needed and that gcc
6647 2.7.x probably does not work.
6649 * src/support/filetools.C (findtexfile): make debug message go to
6651 * src/insets/insetbib.C (getKeys): ditto
6653 * src/debug.C (showTags): make sure that the output is correctly
6656 * configure.in: add a comment for TWO_COLOR_ICON define.
6658 * acconfig.h: remove all the entries that already defined in
6659 configure.in or acinclude.m4.
6661 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
6662 to avoid user name, date and copyright.
6664 1999-12-21 Juergen Vigna <jug@sad.it>
6666 * src/table.C (Read): Now read bogus row format informations
6667 if the format is < 5 so that afterwards the table can
6668 be read by lyx but without any format-info. Fixed the
6669 crash we experienced when not doing this.
6671 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6673 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
6674 (RedoDrawingOfParagraph): ditto
6675 (RedoParagraphs): ditto
6676 (RemoveTableRow): ditto
6678 * src/text.C (Fill): rename arg paperwidth -> paper_width
6680 * src/buffer.C (insertLyXFile): rename var filename -> fname
6681 (writeFile): rename arg filename -> fname
6682 (writeFileAscii): ditto
6683 (makeLaTeXFile): ditto
6684 (makeLinuxDocFile): ditto
6685 (makeDocBookFile): ditto
6687 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
6690 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
6692 * src/bmtable.h: add extern "C" on this file when __cplusplus is
6695 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
6696 compiled by a C compiler not C++.
6698 * src/layout.h (LyXTextClass): added typedef for const_iterator
6699 (LyXTextClassList): added typedef for const_iterator + member
6700 functions begin and end.
6702 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
6703 iterators to fill the choice_class.
6704 (updateLayoutChoice): rewritten to use iterators to fill the
6705 layoutlist in the toolbar.
6707 * src/BufferView.h (BufferView::work_area_width): removed unused
6710 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
6712 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
6713 (sgmlCloseTag): ditto
6715 * src/support/lstrings.h: return type of countChar changed to
6718 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
6719 what version of this func to use. Also made to return unsigned int.
6721 * configure.in: call LYX_STD_COUNT
6723 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
6724 conforming std::count.
6726 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6728 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
6729 and a subscript would give bad display (patch from Dekel Tsur
6730 <dekel@math.tau.ac.il>).
6732 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
6734 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
6737 * src/chset.h: add a few 'using' directives
6739 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
6740 triggered when no buffer is active
6742 * src/layout.C: removed `break' after `return' in switch(), since
6745 * src/lyx_main.C (init): make sure LyX can be ran in place even
6746 when libtool has done its magic with shared libraries. Fix the
6747 test for the case when the system directory has not been found.
6749 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
6750 name for the latex file.
6751 (MenuMakeHTML): ditto
6753 * src/buffer.h: add an optional boolean argument, which is passed
6756 1999-12-20 Allan Rae <rae@lyx.org>
6758 * lib/templates/IEEEtran.lyx: small correction and update.
6760 * configure.in: Attempted to use LYX_PATH_HEADER
6762 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
6764 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
6765 input from JMarc. Now use preprocessor to find the header.
6766 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
6767 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
6768 LYX_STL_STRING_FWD. See comments in file.
6770 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
6772 * The global MiniBuffer * minibuffer variable is dead.
6774 * The global FD_form_main * fd_form_main variable is dead.
6776 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6778 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
6780 * src/table.h: add the LOstream.h header
6781 * src/debug.h: ditto
6783 * src/LyXAction.h: change the explaination of the ReadOnly
6784 attribute: is indicates that the function _can_ be used.
6786 * src/LyXAction.C (init): find-replace _can_ be used in read-only
6789 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6791 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
6797 * src/paragraph.C (GetWord): assert on pos>=0
6800 * src/support/lyxstring.C: condition the use of an invariant on
6802 * src/support/lyxstring.h: ditto
6804 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
6805 Use LAssert.h instead of plain assert().
6807 * src/support/lstrings.h: add LAssert.h, in case it is needed.
6809 * src/lyxfunc.C: do not include LAssert.h, it is not used.
6810 * src/support/filetools.C: ditto
6812 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
6815 * INSTALL: document the new configure flags
6817 * configure.in: suppress --with-debug; add --enable-assertions
6819 * acinclude.m4: various changes in alignment of help strings.
6821 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6823 * src/kbmap.C: commented out the use of the hash map in kb_map,
6824 beginning of movement to a stl::container.
6826 * several files: removed code that was not in effect when
6827 MOVE_TEXT was defined.
6829 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
6830 for escaping should not be used. We can discuss if the string
6831 should be enclosed in f.ex. [] instead of "".
6833 * src/trans_mgr.C (insert): use the new returned value from
6834 encodeString to get deadkeys and keymaps done correctly.
6836 * src/chset.C (encodeString): changed to return a pair, to tell
6837 what to use if we know the string.
6839 * src/lyxscreen.h (fillArc): new function.
6841 * src/FontInfo.C (resize): rewritten to use more std::string like
6842 structore, especially string::replace.
6844 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
6847 * configure.in (chmod +x some scripts): remove config/gcc-hack
6849 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6851 * src/buffer.C (writeFile): change once again the top comment in a
6852 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
6853 instead of an hardcoded version number.
6854 (makeDocBookFile): ditto
6856 * src/version.h: add new define LYX_DOCVERSION
6858 * po/de.po: update from Pit Sütterlin
6859 * lib/bind/de_menus.bind: ditto.
6861 * src/lyxfunc.C (Dispatch): call MenuExport()
6862 * src/buffer.C (Dispatch): ditto
6864 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
6865 LyXFunc::Dispatch().
6866 (MenuExport): new function, moved from
6867 LyXFunc::Dispatch().
6869 * src/trans_mgr.C (insert): small cleanup
6870 * src/chset.C (loadFile): ditto
6872 * lib/kbd/iso8859-1.cdef: add missing backslashes
6874 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6876 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
6877 help with placing the manually drawn accents better.
6879 (Draw): x2 and hg changed to float to minimize rounding errors and
6880 help place the accents better.
6882 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
6883 unsigned short to char is just wrong...cast the char to unsigned
6884 char instead so that the two values can compare sanely. This
6885 should also make the display of insetlatexaccents better and
6886 perhaps also some other insets.
6888 (lbearing): new function
6891 1999-12-15 Allan Rae <rae@lyx.org>
6893 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
6894 header that provides a wrapper around the very annoying SGI STL header
6897 * src/support/lyxstring.C, src/LString.h:
6898 removed old SGI-STL-compatability attempts.
6900 * configure.in: Use LYX_STL_STRING_FWD.
6902 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
6903 stl_string_fwd.h is around and try to determine it's location.
6904 Major improvement over previous SGI STL 3.2 compatability.
6905 Three small problems remain with this function due to my zero
6906 knowledge of autoconf. JMarc and lgb see the comments in the code.
6908 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6910 * src/broken_const.h, config/hack-gcc, config/README: removed
6912 * configure.in: remove --with-gcc-hack option; do not call
6915 * INSTALL: remove documentation of --with-broken-const and
6918 * acconfig.h: remove all trace of BROKEN_CONST define
6920 * src/buffer.C (makeDocBookFile): update version number in output
6922 (SimpleDocBookOnePar): fix an assert when trying to a character
6923 access beyond string length
6926 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6928 * po/de.po: fix the Export menu
6930 * lyx.man: update the description of -dbg
6932 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
6933 (commandLineHelp): updated
6934 (easyParse): show list of available debug levels if -dbg is passed
6937 * src/Makefile.am: add debug.C
6939 * src/debug.h: moved some code to debug.C
6941 * src/debug.C: new file. Contains code to set and show debug
6944 * src/layout.C: remove 'break' after 'continue' in switch
6945 statements, since these cannot be reached.
6947 1999-12-13 Allan Rae <rae@lyx.org>
6949 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
6950 (in_word_set): hash() -> math_hash()
6952 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
6954 * acconfig.h: Added a test for whether we are using exceptions in the
6955 current compilation run. If so USING_EXCEPTIONS is defined.
6957 * config.in: Check for existance of stl_string_fwd.h
6958 * src/LString.h: If compiling --with-included-string and SGI's
6959 STL version 3.2 is present (see above test) we need to block their
6960 forward declaration of string and supply a __get_c_string().
6961 However, it turns out this is only necessary if compiling with
6962 exceptions enabled so I've a bit more to add yet.
6964 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
6965 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
6966 src/support/LRegex.h, src/undo.h:
6967 Shuffle the order of the included files a little to ensure that
6968 LString.h gets included before anything that includes stl_string_fwd.h
6970 * src/support/lyxstring.C: We need to #include LString.h instead of
6971 lyxstring.h to get the necessary definition of __get_c_string.
6972 (__get_c_string): New function. This is defined static just like SGI's
6973 although why they need to do this I'm not sure. Perhaps it should be
6974 in lstrings.C instead.
6976 * lib/templates/IEEEtran.lyx: New template file.
6978 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6980 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
6981 * intl/Makefile.in (MKINSTALLDIRS): ditto
6983 * src/LyXAction.C (init): changed to hold the LFUN data in a
6984 automatic array in stead of in callso to newFunc, this speeds up
6985 compilation a lot. Also all the memory used by the array is
6986 returned when the init is completed.
6988 * a lot of files: compiled with -Wold-style-cast, changed most of
6989 the reported offenders to C++ style casts. Did not change the
6990 offenders in C files.
6992 * src/trans.h (Match): change argument type to unsigned int.
6994 * src/support/DebugStream.C: fix some types on the streambufs so
6995 that it works on a conforming implementation.
6997 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6999 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
7001 * src/support/lyxstring.C: remove the inline added earlier since
7002 they cause a bunch of unsatisfied symbols when linking with dec
7003 cxx. Cxx likes to have the body of inlines at the place where they
7006 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
7007 accessing negative bounds in array. This fixes the crash when
7008 inserting accented characters.
7009 * src/trans.h (Match): ditto
7011 * src/buffer.C (Dispatch): since this is a void, it should not try
7012 to return anything...
7014 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7016 * src/buffer.h: removed the two friends from Buffer. Some changes
7017 because of this. Buffer::getFileName and Buffer::setFileName
7018 renamed to Buffer::fileName() and Buffer::fileName(...).
7020 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7022 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
7023 and Buffer::update(short) to BufferView. This move is currently
7024 controlled by a define MOVE_TEXT, this will be removed when all
7025 shows to be ok. This move paves the way for better separation
7026 between buffer contents and buffer view. One side effect is that
7027 the BufferView needs a rebreak when swiching buffers, if we want
7028 to avoid this we can add a cache that holds pointers to LyXText's
7029 that is not currently in use.
7031 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
7034 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7036 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
7038 * lyx_main.C: new command line option -x (or --execute) and
7039 -e (or --export). Now direct conversion from .lyx to .tex
7040 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
7041 Unfortunately, X is still needed and the GUI pops up during the
7044 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7046 * src/Spacing.C: add a using directive to bring stream stuff into
7048 * src/paragraph.C: ditto
7049 * src/buffer.C: ditto
7051 * NEWS: updated a bit the new features of 1.1.3 (took a few things
7052 from Lars' announcement).
7054 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
7055 example files from Tino Meinen.
7057 1999-12-06 Allan Rae <rae@lyx.org>
7059 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
7061 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7063 * src/support/lyxstring.C: added a lot of inline for no good
7066 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
7067 latexWriteEndChanges, they were not used.
7069 * src/layout.h (operator<<): output operator for PageSides
7071 * src/mathed/math_iter.C (my_memcpy): slightly changed.
7073 * some example files: loaded in LyX 1.0.4 and saved again to update
7074 certain constructs (table format)
7076 * a lot of files: did the change to use fstream/iostream for all
7077 writing of files. Done with a close look at Andre Poenitz's patch.
7079 * some files: whitespace changes.
7081 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7083 * src/mathed/math_iter.C (my_memcpy): new function. Since the
7084 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
7085 architecture, we provide our own. It is used unconditionnally, but
7086 I do not think this is a performance problem. Thanks to Angus
7087 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
7088 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
7090 (GetInset): use my_memcpy.
7094 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
7095 it is easier to understand, but it uses less TeX-only constructs now.
7097 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
7098 elements contain spaces
7100 * lib/configure: regenerated
7102 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
7103 elements contain spaces; display the list of programs that are
7106 * autogen.sh: make sure lib/configure is executable
7108 * lib/examples/*: rename the tutorial examples to begin with the
7109 two-letters language code.
7111 * src/lyxfunc.C (getStatus): do not query current font if no
7114 * src/lyx_cb.C (RunScript): use QuoteName
7115 (MenuRunDvips): ditto
7116 (PrintApplyCB): ditto
7118 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
7119 around argument, so that it works well with the current shell.
7120 Does not work properly with OS/2 shells currently.
7122 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
7123 * src/LyXSendto.C (SendtoApplyCB): ditto
7124 * src/lyxfunc.C (Dispatch): ditto
7125 * src/buffer.C (runLaTeX): ditto
7126 (runLiterate): ditto
7127 (buildProgram): ditto
7129 * src/lyx_cb.C (RunScript): ditto
7130 (MenuMakeLaTeX): ditto
7132 * src/buffer.h (getLatexName): new method
7134 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
7136 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7138 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
7139 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
7140 (create_math_panel): ditto
7142 * src/lyxfunc.C (getStatus): re-activate the code which gets
7143 current font and cursor; add test for export to html.
7145 * src/lyxrc.C (read): remove unreachable break statements; add a
7148 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
7150 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7152 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
7153 introduced by faulty regex.
7154 * src/buffer.C: ditto
7155 * src/lastfiles.C: ditto
7156 * src/paragraph.C: ditto
7157 * src/table.C: ditto
7158 * src/vspace.C: ditto
7159 * src/insets/figinset.C: ditto
7160 Note: most of these is absolutely harmless, except the one in
7161 src/mathed formula.C.
7163 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7165 * src/ImportNoweb.C (documentclass): fixed bounds for substr
7166 operation, yielding correct results for the reLyX command.
7168 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7170 * src/support/filetools.C (ExpandPath): removed an over eager
7172 (ReplaceEnvironmentPath): ditto
7174 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
7175 shows that we are doing something fishy in our code...
7179 * src/lyxrc.C (read): use a double switch trick to get more help
7180 from the compiler. (the same trick is used in layout.C)
7181 (write): new function. opens a ofstream and pass that to output
7182 (output): new function, takes a ostream and writes the lyxrc
7183 elemts to it. uses a dummy switch to make sure no elements are
7186 * src/lyxlex.h: added a struct pushpophelper for use in functions
7187 with more than one exit point.
7189 * src/lyxlex.[Ch] (GetInteger): made it const
7193 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
7195 * src/layout.[hC] : LayoutTags splitted into several enums, new
7196 methods created, better error handling cleaner use of lyxlex. Read
7199 * src/bmtable.[Ch]: change some member prototypes because of the
7200 image const changes.
7202 * commandtags.h, src/LyXAction.C (init): new function:
7203 "preferences-save", saves the lyxrc entries into .lyx/preferences.
7204 This file is not read automatically but you can add \input
7205 preferences to your lyxrc if you want to. We need to discuss how
7208 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
7209 in .aux, also remove .bib and .bst files from dependencies when
7212 * src/BufferView.C, src/LyXView.C: add const_cast several places
7213 because of changes to images.
7215 * lib/images/*: same change as for images/*
7217 * lib/lyxrc.example: Default for accept_compound is false not no.
7219 * images/*: changed to be const, however I have som misgivings
7220 about this change so it might be changed back.
7222 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7224 * lib/configure, po/POTFILES.in: regenerated
7226 * autogen.sh: autogenerate lib/configure from lib/configure.m4
7228 * config/lib_configure.m4: removed
7230 * lib/configure.m4: new file (was config/lib_configure.m4)
7232 * configure.in: do not test for rtti, since we do not use it.
7234 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7236 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
7237 doubling of allocated space scheme. This makes it faster for large
7238 strings end to use less memory for small strings. xtra rememoved.
7240 * src/insets/figinset.C (waitalarm): commented out.
7241 (GhostscriptMsg): use static_cast
7242 (GhostscriptMsg): use new instead of malloc to allocate memory for
7243 cmap. also delete the memory after use.
7245 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
7247 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
7248 for changes in bibtex database or style.
7249 (runBibTeX): remove all .bib and .bst files from dep before we
7251 (run): use scanAuc in when dep file already exist.
7253 * src/DepTable.C (remove_files_with_extension): new method
7256 * src/DepTable.[Ch]: made many of the methods const.
7258 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7260 * src/bufferparams.C: make sure that the default textclass is
7261 "article". It used to be the first one by description order, but
7262 now the first one is "docbook".
7264 * src/lyx_main.C (setDebuggingLevel): change type of argument to
7265 string; call Debug::value.
7266 (easyParse): pass complete argument to setDebuggingLevel().
7268 * src/debug.h (value): fix the code that parses debug levels.
7270 * src/debug.h: add new debug type ACTION, reserved for LyXAction
7273 * src/LyXAction.C: use Debug::ACTION as debug channel.
7275 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
7277 * NEWS: updated for the future 1.1.3 release.
7279 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
7280 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
7281 it should. This is of course a controversial change (since many
7282 people will find that their lyx workscreen is suddenly full of
7283 red), but done for the sake of correctness.
7285 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
7286 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
7288 * src/insets/inseterror.h, src/insets/inseturl.h,
7289 src/insets/insetinfo.h, src/insets/figinset.h,
7290 src/mathed/formulamacro.h, src/mathed/math_macro.h
7291 (EditMessage): add a missing const and add _() to make sure that
7294 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
7295 src/insets/insetbib.C, src/support/filetools.C: add `using'
7298 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
7299 doing 'Insert index of last word' at the beginning of a paragraph.
7301 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7303 * several files: white-space changes.
7305 * src/mathed/formula.C: removed IsAlpha and IsDigit
7307 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
7308 .bib file. use a ifstream instead of FilePtr when parsing the .bib
7311 * src/insets/figinset.C (GetPSSizes): don't break when
7312 "EndComments" is seen. But break when a boundingbox is read.
7314 * all classes inherited from Inset: return value of Clone
7315 changed back to Inset *.
7317 * all classes inherited form MathInset: return value of Clone
7318 changed back to MathedInset *.
7320 * src/insets/figinset.C (runqueue): use a ofstream to output the
7321 gs/ps file. Might need some setpresicion or setw. However I can
7322 see no problem with the current code.
7323 (runqueue): use sleep instead of the alarm/signal code. I just
7324 can't see the difference.
7326 * src/paragraph.C (LyXParagraph): reserve space in the new
7327 paragraph and resize the inserted paragraph to just fit.
7329 * src/lyxfunc.h (operator|=): added operator for func_status.
7331 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
7332 check for readable file.
7334 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
7335 check for readable file.
7336 (MenuMakeLinuxDoc): ditto
7337 (MenuMakeDocBook): ditto
7338 (MenuMakeAscii): ditto
7339 (InsertAsciiFile): split the test for openable and readable
7341 * src/bmtable.C (draw_bitmaptable): use
7342 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
7344 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
7345 findtexfile from LaTeX to filetools.
7347 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
7348 instead of FilePtr. Needs to be verified by a literate user.
7350 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7352 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
7353 (EditMessage): likewise.
7355 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
7356 respectively as \textasciitilde and \textasciicircum.
7358 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7360 * src/support/lyxstring.h: made the methods that take iterators
7363 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
7364 (regexMatch): made is use the real regex class.
7366 * src/support/Makefile.am: changed to use libtool
7368 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
7370 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
7372 (MathIsInset ++): changed several macros to be inline functions
7375 * src/mathed/Makefile.am: changed to use libtool
7377 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
7379 * src/insets/inset* : Clone changed to const and return type is
7380 the true insettype not just Inset*.
7382 * src/insets/Makefile.am: changed to use libtool
7384 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
7386 * src/undo.[Ch] : added empty() and changed some of the method
7389 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
7391 * src/lyxparagraph.h: use id() and id(...) instead of getID and
7392 setID use block<> for the bullets array, added const several places.
7394 * src/lyxfunc.C (getStatus): new function
7396 * src/lyxfunc.[Ch] : small changes to take advantage of the new
7397 LyXAction, added const to several funtions.
7399 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
7400 a std::map, and to store the dir items in a vector.
7402 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
7405 * src/LyXView.[Ch] + other files : changed currentView to view.
7407 * src/LyXAction.[Ch] : ported from the old devel branch.
7409 * src/.cvsignore: added .libs and a.out
7411 * configure.in : changes to use libtool.
7413 * acinclude.m4 : inserted libtool.m4
7415 * .cvsignore: added libtool
7417 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7419 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
7420 file name in insets and mathed directories (otherwise the
7421 dependency is not taken in account under cygwin).
7423 * src/text2.C (InsertString[AB]): make sure that we do not try to
7424 read characters past the string length.
7426 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7428 * lib/doc/LaTeXConfig.lyx.in,
7429 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
7431 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
7432 file saying who created them and when this heppened; this is
7433 useless and annoys tools like cvs.
7435 * lib/layouts/g-brief-{en,de}.layout,
7436 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
7437 from Thomas Hartkens <thomas@hartkens.de>.
7439 * src/{insets,mathed}/Makefile.am: do not declare an empty
7440 LDFLAGS, so that it can be set at configure time (useful on Irix
7443 * lib/reLyX/configure.in: make sure that the prefix is set
7444 correctly in LYX_DIR.
7446 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7448 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
7449 be used by 'command-sequence' this allows to bind a key to a
7450 sequence of LyX-commands
7451 (Example: 'command-sequence math-insert alpha; math-insert beta;")
7453 * src/LyXAction.C: add "command-sequence"
7455 * src/LyXFunction.C: handling of "command-sequence"
7457 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
7458 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
7460 * src/lyxserver.C, src/minibuffer.C: Use this new interface
7462 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7464 * src/buffer.C (writeFile): Do not output a comment giving user
7465 and date at the beginning of a .lyx file. This is useless and
7466 annoys cvs anyway; update version number to 1.1.
7468 * src/Makefile.am (LYX_DIR): add this definition, so that a
7469 default path is hardcoded in LyX.
7471 * configure.in: Use LYX_GNU_GETTEXT.
7473 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
7474 AM_GNU_GETTEXT with a bug fixed.
7476 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
7478 * src/chset.C: add "using std::ifstream;" to please dec cxx.
7480 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
7481 which is used to point to LyX data is now LYX_DIR_11x.
7483 * lyx.man: convert to a unix text file; small updates.
7485 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7487 * src/support/LSubstring.[Ch]: made the second arg of most of the
7488 constructors be a const reference.
7490 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
7493 * src/support/lyxstring.[Ch] (swap): added missing member function
7494 and specialization of swap(str, str);
7496 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
7498 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
7499 trace of the old one.
7501 * src/undo.[Ch]: made the undostack use std::list to store undo's in
7502 put the member definitions in undo.C.
7504 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
7505 NEW_TEXT and have now only code that was included when this was
7508 * src/intl.C (LCombo): use static_cast
7510 (DispatchCallback): ditto
7512 * src/definitions.h: removed whole file
7514 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
7516 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
7517 parsing and stores in a std:map. a regex defines the file format.
7518 removed unneeded members.
7520 * src/bufferparams.h: added several enums from definitions.h here.
7521 Removed unsused destructor. Changed some types to use proper enum
7522 types. use block to have the temp_bullets and user_defined_bullets
7523 and to make the whole class assignable.
7525 * src/bufferparams.C (Copy): removed this functions, use a default
7528 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
7531 * src/buffer.C (readLyXformat2): commend out all that have with
7532 oldpapersize to do. also comment out all that hve to do with
7533 insetlatex and insetlatexdel.
7534 (setOldPaperStuff): commented out
7536 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
7538 * src/LyXAction.C: remove use of inset-latex-insert
7540 * src/mathed/math_panel.C (button_cb): use static_cast
7542 * src/insets/Makefile.am (insets_o_SOURCES): removed
7545 * src/support/lyxstring.C (helper): use the unsigned long
7546 specifier, UL, instead of a static_cast.
7548 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
7550 * src/support/block.h: new file. to be used as a c-style array in
7551 classes, so that the class can be assignable.
7553 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7555 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
7556 NULL, make sure to return an empty string (it is not possible to
7557 set a string to NULL).
7559 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7561 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
7563 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
7565 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
7566 link line, so that Irix users (for example) can set it explicitely to
7569 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
7570 it can be overidden at make time (static or dynamic link, for
7573 * src/vc-backend.C, src/LaTeXFeatures.h,
7574 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
7575 statements to bring templates to global namespace.
7577 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7579 * src/support/lyxstring.C (operator[] const): make it standard
7582 * src/minibuffer.C (Init): changed to reflect that more
7583 information is given from the lyxvc and need not be provided here.
7585 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
7587 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
7589 * src/LyXView.C (UpdateTimerCB): use static_cast
7590 (KeyPressMask_raw_callback): ditto
7592 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
7593 buffer_, a lot of changes because of this. currentBuffer() ->
7594 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
7595 also changes to other files because of this.
7597 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7599 * src/vc-backend.[Ch]: new files. The backends for vc handling,
7600 have no support for RCS and partial support for CVS, will be
7603 * src/insets/ several files: changes because of function name
7604 changes in Bufferview and LyXView.
7606 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
7608 * src/support/LSubstring.[Ch]: new files. These implement a
7609 Substring that can be very convenient to use. i.e. is this
7611 string a = "Mary had a little sheep";
7612 Substring(a, "sheep") = "lamb";
7613 a is now "Mary has a little lamb".
7615 * src/support/LRegex.[Ch]: a regex class that can be used to pick
7616 out patterns and subpatterns of strings. It is used by LSubstring
7617 and also by vc-backend.C
7619 * src/support/lyxstring.C: went over all the assertions used and
7620 tried to correct the wrong ones and flag which of them is required
7621 by the standard. some bugs found because of this. Also removed a
7622 couple of assertions.
7624 * src/support/Makefile.am (libsupport_a_SOURCES): added
7625 LSubstring.[Ch] and LRegex.[Ch]
7627 * src/support/FileInfo.h: have struct stat buf as an object and
7628 not a pointer to one, some changes because of this.
7630 * src/LaTeXFeatures.C (getTClassPreamble): also use the
7631 information in layout when adding the layouts preamble to the
7634 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
7637 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
7638 because of bug in OS/2.
7640 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7642 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
7643 \verbatim@font instead of \ttfamily, so that it can be redefined.
7645 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
7646 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
7647 src/layout.h, src/text2.C: add 'using' directive to bring the
7648 STL templates we need from the std:: namespace to the global one.
7649 Needed by DEC cxx in strict ansi mode.
7651 * src/support/LIstream.h,src/support/LOstream.h,
7652 src/support/lyxstring.h,src/table.h,
7653 src/lyxlookup.h: do not include <config.h> in header
7654 files. This should be done in the .C files only.
7656 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
7660 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7662 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
7663 from Kayvan to fix the tth invokation.
7665 * development/lyx.spec.in: updates from Kayvan to reflect the
7666 changes of file names.
7668 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7670 * src/text2.C (InsertStringB): use std::copy
7671 (InsertStringA): use std::copy
7673 * src/bufferlist.C: use a vector to store the buffers in. This is
7674 an internal change and should not affect any other thing.
7676 * src/BufferView.C (waitForX): use XSync instead of the lengthy
7679 * src/text.C (Fill): fix potential bug, one off bug.
7681 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7683 * src/Makefile.am (lyx_main.o): add more files it depends on.
7685 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
7687 * src/support/lyxstring.C: use size_t for the reference count,
7688 size, reserved memory and xtra.
7689 (internal_compare): new private member function. Now the compare
7690 functions should work for std::strings that have embedded '\0'
7692 (compare): all compare functions rewritten to use
7695 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7697 * src/support/lyxstring.C (compare): pass c_str()
7698 (compare): pass c_str
7699 (compare): pass c_str
7701 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7703 * src/support/DebugStream.C: <config.h> was not included correctly.
7705 * lib/configure: forgot to re-generate it :( I'll make this file
7706 auto generated soon.
7708 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7710 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
7713 * src/support/lyxstring.C: some changes from length() to rep->sz.
7714 avoids a function call.
7716 * src/support/filetools.C (SpaceLess): yet another version of the
7717 algorithm...now per Jean-Marc's suggestions.
7719 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7721 * src/layout.C (less_textclass_desc): functor for use in sorting
7723 (LyXTextClass::Read): sort the textclasses after reading.
7725 * src/support/filetools.C (SpaceLess): new version of the
7726 SpaceLess functions. What problems does this one give? Please
7729 * images/banner_bw.xbm: made the arrays unsigned char *
7731 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7733 * src/support/lyxstring.C (find): remove bogus assertion in the
7734 two versions of find where this has not been done yet.
7736 * src/support/lyxlib.h: add missing int return type to
7739 * src/menus.C (ShowFileMenu): disable exporting to html if no
7740 html export command is present.
7742 * config/lib_configure.m4: add a test for an HTML converter. The
7743 programs checked for are, in this order: tth, latex2html and
7746 * lib/configure: generated from config/lib_configure.m4.
7748 * src/lyxfunc.C (Dispatch): update and improve the execution of an
7749 html converter. The parameters are now passed through $$FName and
7750 $$OutName, instead of standard input/output.
7752 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
7754 * lib/lyxrc.example: update description of \html_command.
7755 add "quotes" around \screen_font_xxx font setting examples to help
7756 people who use fonts with spaces in their names.
7758 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7760 * Distribution files: updates for v1.1.2
7762 * src/support/lyxstring.C (find): remove bogus assert and return
7763 npos for the same condition.
7765 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7767 * added patch for OS/2 from SMiyata.
7769 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7771 * src/text2.C (CutSelection): make space_wrapped a bool
7772 (CutSelection): dont declare int i until we have to.
7773 (alphaCounter): return a char const *.
7775 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7777 * src/support/syscall.C (Systemcalls::kill):
7778 src/support/filetools.C (PutEnv, PutEnvPath):
7779 src/lyx_cb.C (addNewlineAndDepth):
7780 src/FontInfo.C (FontInfo::resize): condition some #warning
7781 directives with WITH_WARNINGS.
7784 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7786 * src/layout.[Ch] + several files: access to class variables
7787 limited and made accessor functions instead a lot of code changed
7788 becuase of this. Also instead of returning pointers often a const
7789 reference is returned instead.
7791 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
7793 * src/Makefile.am (dist-hook): added used to remove the CVS from
7794 cheaders upon creating a dist
7795 (EXTRA_DIST): added cheaders
7797 * src/support/lstrings.C (tostr(char)): fix it to handle param as
7798 a character not as a small integer.
7800 * src/support/lyxstring.C (find): removed Assert and added i >=
7801 rep->sz to the first if.
7803 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7805 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
7806 src/LyXView.C src/buffer.C src/bufferparams.C
7807 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
7808 src/text2.C src/insets/insetinclude.C:
7809 lyxlayout renamed to textclasslist.
7811 * src/layout.C: some lyxerr changes.
7813 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
7814 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
7815 (LyXLayoutList): removed all traces of this class.
7816 (LyXTextClass::Read): rewrote LT_STYLE
7817 (LyXTextClass::hasLayout): new function
7818 (LyXTextClass::GetLayout): rewritten to return an iterator + has
7819 both const and nonconst version.
7820 (LyXTextClass::delete_layout): new function.
7821 (LyXTextClassList::Style): bug fix. do the right thing if layout
7823 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
7824 (LyXTextClassList::NameOfLayout): ditto
7825 (LyXTextClassList::Load): ditto
7827 * src/buffer.C (makeLaTeXFile): new access to layoutlist
7829 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
7831 * src/LyXAction.C (LookupFunc): added a workaround for sun
7832 compiler, on the other hand...we don't know if the current code
7833 compiles on sun at all...
7835 * src/support/filetools.C (CleanupPath): subst fix
7837 * src/insets/insetbib.C (delDatabase): subst fix, this looks
7840 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
7841 complained about this one?
7843 * src/insets/insetinclude.C (Latex): subst fix
7845 * src/insets/insetbib.C (getKeys): subst fix
7847 * src/LyXSendto.C (SendtoApplyCB): subst fix
7849 * src/lyx_main.C (init): subst fix
7851 * src/layout.C (Read): subst fix
7853 * src/lyx_sendfax_main.C (button_send): subst fix
7855 * src/buffer.C (RoffAsciiTable): subst fix
7857 * src/lyx_cb.C (MenuFax): subst fix
7858 (PrintApplyCB): subst fix
7860 1999-10-26 Juergen Vigna <jug@sad.it>
7862 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
7864 (Read): Cleaned up this code so now we read only format vestion >= 5
7866 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7868 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
7869 come nobody has complained about this one?
7871 * src/insets/insetinclude.C (Latex): subst fix
7873 * src/insets/insetbib.C (getKeys): subst fix
7875 * src/lyx_main.C (init): subst fix
7877 * src/layout.C (Read): subst fix
7879 * src/buffer.C (RoffAsciiTable): subst fix
7881 * src/lyx_cb.C (MenuFax): subst fix.
7883 * src/layout.[hC] + some other files: rewrote to use
7884 std::container to store textclasses and layouts in.
7885 Simplified, removed a lot of code. Make all classes
7886 assignable. Further simplifications and review of type
7887 use still to be one.
7889 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
7890 lastfiles to create the lastfiles partr of the menu.
7892 * src/lastfiles.[Ch]: rewritten to use deque to store the
7893 lastfiles in. Uses fstream for reading and writing. Simplifies
7896 * src/support/syscall.C: remove explicit cast.
7898 * src/BufferView.C (CursorToggleCB): removed code snippets that
7900 use explicat C++ style casts instead of C style casts. also use
7901 u_vdata instea of passing pointers in longs.
7903 * src/PaperLayout.C: removed code snippets that were commented out.
7905 * src/lyx_gui_misc.C: removed code snippets that were commented out.
7907 * src/lyx_main.C: removed code snippets that wer commented out.
7909 * src/paragraph.C: removed code snippets that were commented out.
7911 * src/lyxvc.C (logClose): use static_cast
7913 (viewLog): remove explicit cast to void*
7914 (showLog): removed old commented code
7916 * src/menus.C: use static_cast instead of C style casts. use
7917 u_vdata instead of u_ldata. remove explicit cast to (long) for
7918 pointers. Removed old code that was commented out.
7920 * src/insets/inset.C: removed old commented func
7922 * src/insets/insetref.C (InsetRef): removed old code that had been
7923 commented out for a long time.
7925 (escape): removed C style cast
7927 * src/insets/insetlatexaccent.C (Draw): removed old commented code
7929 * src/insets/insetlatex.C (Draw): removed old commented code
7930 (Read): rewritten to use string
7932 * src/insets/insetlabel.C (escape): removed C style cast
7934 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
7936 * src/insets/insetindex.C: use static_cast and u_vdata, removed
7939 * src/insets/insetinclude.h: removed a couple of stupid bools
7941 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
7942 (Clone): remove C style cast
7943 (getKeys): changed list to lst because of std::list
7945 * src/insets/inseterror.C (Draw): removed som old commented code.
7947 * src/insets/insetcommand.C (Draw): removed some old commented code.
7949 * src/insets/insetbib.C (bibitem_cb): removed code that has been
7950 commented out forever.
7951 (bibitem_cb): use static_cast instead of C style cast
7952 use of vdata changed to u_vdata.
7954 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
7956 (CloseUrlCB): use static_cast instead of C style cast.
7957 (CloseUrlCB): added a fl_free form...it seemed to be missing.
7959 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
7960 (C_InsetInfo_CloseInfoCB): forward the ob parameter
7961 (CloseInfoCB): static_cast from ob->u_vdata instead.
7962 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
7965 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
7966 (C_InsetError_CloseErrorCB): forward the ob parameter
7967 (CloseErrorCB): static_cast from ob->u_vdata instead.
7969 * src/vspace.h: include LString.h since we use string in this class.
7971 * src/vspace.C (lyx_advance): changed name from advance because of
7972 nameclash with stl. And since we cannot use namespaces yet...I
7973 used a lyx_ prefix instead. Expect this to change when we begin
7976 * src/BufferView.[Ch] (BufferView::~BufferView): removed
7978 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
7979 and removed now defunct constructor and deconstructor.
7981 * src/BufferView.h: have backstack as a object not as a pointer.
7982 removed initialization from constructor. added include for BackStack
7984 * development/lyx.spec.in (%build): add CFLAGS also.
7986 * src/screen.C (drawFrame): removed another warning.
7988 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7990 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
7991 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
7992 README and ANNOUNCE a bit for the next release. More work is
7995 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
7996 unbreakable if we are in freespacing mode (LyX-Code), but not in
7999 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8001 * src/BackStack.h: fixed initialization order in constructor
8003 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
8005 * acinclude.m4 (VERSION): new rules for when a version is
8006 development, added also a variable for prerelease.
8007 (warnings): we set with_warnings=yes for prereleases
8008 (lyx_opt): prereleases compile with same optimization as development
8009 (CXXFLAGS): only use pedantic if we are a development version
8011 * src/BufferView.C (restorePosition): don't do anything if the
8014 * src/BackStack.h: added member empty, use this to test if there
8015 is anything to pop...
8017 1999-10-25 Juergen Vigna <jug@sad.it>
8020 * forms/layout_forms.fd +
8021 * forms/latexoptions.fd +
8022 * lyx.fd: changed for various form resize issues
8024 * src/mathed/math_panel.C +
8025 * src/insets/inseterror.C +
8026 * src/insets/insetinfo.C +
8027 * src/insets/inseturl.C +
8028 * src/insets/inseturl.h +
8031 * src/PaperLayout.C +
8032 * src/ParagraphExtra.C +
8033 * src/TableLayout.C +
8035 * src/layout_forms.C +
8042 * src/menus.C: fixed various resize issues. So now forms can be
8043 resized savely or not be resized at all.
8045 * forms/form_url.fd +
8046 * src/insets/form_url.[Ch]: added because it's cleaner and easier
8049 * src/insets/Makefile.am: added files form_url.[Ch]
8051 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8053 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
8054 (and presumably 6.2).
8056 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
8057 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
8058 remaining static member callbacks.
8060 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
8063 * src/support/lyxstring.h: declare struct Srep as friend of
8064 lyxstring, since DEC cxx complains otherwise.
8066 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8068 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8070 * src/LaTeX.C (run): made run_bibtex also depend on files with
8072 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
8073 are put into the dependency file.
8075 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
8076 the code has shown itself to work
8077 (create_ispell_pipe): removed another warning, added a comment
8080 * src/minibuffer.C (ExecutingCB): removed code that has been
8081 commented out a long time
8083 * src/lyxfunc.C (processKeyEvent): removed some very old commented
8084 out code + a warning.
8086 * src/support/lyxstring.h: comment out the three private
8087 operators, when compiling with string ansi conforming compilers
8090 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
8092 (pixmapFromBitmapData): change type of bdata to be unsigned char *
8093 (pixmapFromBitmapData): add a reinterpret_cast in the call to
8096 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
8099 * src/mathed/math_panel.C (create_math_panel): remove explicit
8102 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
8105 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
8106 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
8107 to XCreatePixmapFromBitmapData
8108 (fl_set_bmtable_data): change the last argument to be unsigned
8110 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
8111 and bh to be unsigned int, remove explicit casts in call to
8112 XReadBitmapFileData.
8114 * images/arrows.xbm: made the arrays unsigned char *
8115 * images/varsz.xbm: ditto
8116 * images/misc.xbm: ditto
8117 * images/greek.xbm: ditto
8118 * images/dots.xbm: ditto
8119 * images/brel.xbm: ditto
8120 * images/bop.xbm: ditto
8122 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
8124 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
8125 (LYX_PROG_CXX): added -pedantic to g++ compile options when
8126 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
8128 (LYX_CXX_CHEADERS): added <clocale> to the test.
8130 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
8132 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
8134 * src/support/lyxstring.C (append): fixed something that must be a
8135 bug, rep->assign was used instead of rep->append.
8137 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
8140 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
8141 lyx insert double chars. Fix spotted by Kayvan.
8143 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8145 * Fixed the tth support. I messed up with the Emacs patch apply feature
8146 and omitted the changes in lyxrc.C.
8148 1999-10-22 Juergen Vigna <jug@sad.it>
8150 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
8152 * src/lyx_cb.C (MenuInsertRef) +
8153 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
8154 the form cannot be resized under it limits (fixes a segfault)
8156 * src/lyx.C (create_form_form_ref) +
8157 * forms/lyx.fd: Changed Gravity on name input field so that it is
8160 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8162 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
8163 <ostream> and <istream>.
8165 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
8166 whether <fstream> provides the latest standard features, or if we
8167 have an oldstyle library (like in egcs).
8168 (LYX_CXX_STL_STRING): fix the test.
8170 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
8171 code on MODERN_STL_STREAM.
8173 * src/support/lyxstring.h: use L{I,O}stream.h.
8175 * src/support/L{I,O}stream.h: new files, designed to setup
8176 correctly streams for our use
8177 - includes the right header depending on STL capabilities
8178 - puts std::ostream and std::endl (for LOStream.h) or
8179 std::istream (LIStream.h) in toplevel namespace.
8181 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8183 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
8184 was a bib file that had been changed we ensure that bibtex is run.
8185 (runBibTeX): enhanced to extract the names of the bib files and
8186 getting their absolute path and enter them into the dep file.
8187 (findtexfile): static func that is used to look for tex-files,
8188 checks for absolute patchs and tries also with kpsewhich.
8189 Alternative ways of finding the correct files are wanted. Will
8191 (do_popen): function that runs a command using popen and returns
8192 the whole output of that command in a string. Should be moved to
8195 * src/DepTable.[Ch] (extchanged): new function that returns true if a
8196 file with extension ext has changed.
8198 * src/insets/figinset.C: added ifdef guards around the fl_free
8199 code that jug commented out. Now it is commented out when
8200 compiling with XForms == 0.89.
8202 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
8203 to lyxstring.C, and only keep a forward declaration in
8204 lyxstring.h. Simplifies the header file a bit and should help a
8205 bit on compile time too. Also changes to Srep will not mandate a
8206 recompile of code just using string.
8207 (~lyxstring): definition moved here since it uses srep.
8208 (size): definition moved here since it uses srep.
8210 * src/support/lyxstring.h: removed a couple of "inline" that should
8213 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8215 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
8218 1999-10-21 Juergen Vigna <jug@sad.it>
8220 * src/table.C (SetPWidth): Just a small fix so the alignment is not
8221 set to left if I just remove the width entry (or it is empty).
8223 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
8224 paragraph when having dummy paragraphs.
8226 1999-10-20 Juergen Vigna <jug@sad.it>
8228 * src/insets/figinset.C: just commented some fl_free_form calls
8229 and added warnings so that this calls should be activated later
8230 again. This avoids for now a segfault, but we have a memory leak!
8232 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
8233 'const char * argument' to 'string argument', this should
8234 fix some Asserts() in lyxstring.C.
8236 * src/lyxfunc.h: Removed the function argAsString(const char *)
8237 as it is not used anymore.
8239 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8241 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
8244 * src/Literate.h: some funcs moved from public to private to make
8245 interface clearer. Unneeded args removed.
8247 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
8249 (scanBuildLogFile): ditto
8251 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
8252 normal TeX Error. Still room for improvement.
8254 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
8256 * src/buffer.C (insertErrors): changes to make the error
8257 desctription show properly.
8259 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
8262 * src/support/lyxstring.C (helper): changed to use
8263 sizeof(object->rep->ref).
8264 (operator>>): changed to use a pointer instead.
8266 * src/support/lyxstring.h: changed const reference & to value_type
8267 const & lets see if that helps.
8269 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8271 * Makefile.am (rpmdist): fixed to have non static package and
8274 * src/support/lyxstring.C: removed the compilation guards
8276 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
8279 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
8280 conditional compile of lyxstring.Ch
8282 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
8283 stupid check, but it is a lot better than the bastring hack.
8284 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
8286 * several files: changed string::erase into string::clear. Not
8289 * src/chset.C (encodeString): use a char temporary instead
8291 * src/table.C (TexEndOfCell): added tostr around
8292 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
8293 (TexEndOfCell): ditto
8294 (TexEndOfCell): ditto
8295 (TexEndOfCell): ditto
8296 (DocBookEndOfCell): ditto
8297 (DocBookEndOfCell): ditto
8298 (DocBookEndOfCell): ditto
8299 (DocBookEndOfCell): ditto
8301 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
8303 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
8305 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
8306 (MenuBuildProg): added tostr around ret
8307 (MenuRunChktex): added tostr around ret
8308 (DocumentApplyCB): added tostr around ret
8310 * src/chset.C (encodeString): added tostr around t->ic
8312 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
8313 (makeLaTeXFile): added tostr around tocdepth
8314 (makeLaTeXFile): added tostr around ftcound - 1
8316 * src/insets/insetbib.C (setCounter): added tostr around counter.
8318 * src/support/lyxstring.h: added an operator+=(int) to catch more
8321 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
8322 (lyxstring): We DON'T allow NULL pointers.
8324 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8326 * src/mathed/math_macro.C (MathMacroArgument::Write,
8327 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
8328 when writing them out.
8330 * src/LString.C: remove, since it is not used anymore.
8332 * src/support/lyxstring.C: condition the content to
8333 USE_INCLUDED_STRING macro.
8335 * src/mathed/math_symbols.C, src/support/lstrings.C,
8336 src/support/lyxstring.C: add `using' directive to specify what
8337 we need in <algorithm>. I do not think that we need to
8338 conditionalize this, but any thought is appreciated.
8340 * many files: change all callback functions to "C" linkage
8341 functions to please strict C++ compilers like DEC cxx 6.1 in mode
8342 strict_ansi. Those who were static are now global.
8343 The case of callbacks which are static class members is
8344 trickier, since we have to make C wrappers around them (see
8345 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
8346 did not finish this yet, since it defeats the purpose of
8347 encapsulation, and I am not sure what the best route is.
8349 1999-10-19 Juergen Vigna <jug@sad.it>
8351 * src/support/lyxstring.C (lyxstring): we permit to have a null
8352 pointer as assignment value and just don't assign it.
8354 * src/vspace.C (nextToken): corrected this function substituting
8355 find_first(_not)_of with find_last_of.
8357 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
8358 (TableOptCloseCB) (TableSpeCloseCB):
8359 inserted fl_set_focus call for problem with fl_hide_form() in
8362 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8364 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
8367 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8369 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
8370 LyXLex::next() and not eatline() to get its argument.
8372 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8374 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
8375 instead, use fstreams for io of the depfile, removed unneeded
8376 functions and variables.
8378 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
8379 vector instead, removed all functions and variables that is not in
8382 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8384 * src/buffer.C (insertErrors): use new interface to TeXError
8386 * Makefile.am (rpmdist): added a rpmdist target
8388 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
8389 per Kayvan's instructions.
8391 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8393 * src/Makefile.am: add a definition for localedir, so that locales
8394 are found after installation (Kayvan)
8396 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8398 * development/.cvsignore: new file.
8400 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8402 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
8403 C++ compiler provides wrappers for C headers and use our alternate
8406 * configure.in: use LYX_CXX_CHEADERS.
8408 * src/cheader/: new directory, populated with cname headers from
8409 libstdc++-2.8.1. They are a bit old, but probably good enough for
8410 what we want (support compilers who lack them).
8412 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
8413 from includes. It turns out is was stupid.
8415 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8417 * lib/Makefile.am (install-data-local): forgot a ';'
8418 (install-data-local): forgot a '\'
8419 (libinstalldirs): needed after all. reintroduced.
8421 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8423 * configure.in (AC_OUTPUT): added lyx.spec
8425 * development/lyx.spec: removed file
8427 * development/lyx.spec.in: new file
8429 * po/*.po: merged with lyx.pot becuase of make distcheck
8431 * lib/Makefile.am (dist-hook): added dist-hook so that
8432 documentation files will be included when doing a make
8433 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
8434 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
8436 more: tried to make install do the right thing, exclude CVS dirs
8439 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
8440 Path would fit in more nicely.
8442 * all files that used to use pathstack: uses now Path instead.
8443 This change was a lot easier than expected.
8445 * src/support/path.h: new file
8447 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
8449 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
8451 * src/support/lyxstring.C (getline): Default arg was given for
8454 * Configure.cmd: removed file
8456 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8458 * src/support/DebugStream.[Ch]: remove the explicit std:: before
8459 streams classes and types, add the proper 'using' statements when
8460 MODERN_STL is defined.
8462 * src/debug.h: move the << operator definition after the inclusion
8465 * src/support/filetools.C: include "LAssert.h", which is needed
8468 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
8471 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
8472 include "debug.h" to define a proper ostream.
8474 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8476 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
8477 method to the SystemCall class which can kill a process, but it's
8478 not fully implemented yet.
8480 * src/*.C: Changed Systemcalls::Startscript() to startscript()
8482 * src/support/FileInfo.h: Better documentation
8484 * src/lyxfunc.C: Added support for buffer-export html
8486 * src/menus.C: Added Export->As HTML...
8488 * lib/bind/*.bind: Added short-cut for buffer-export html
8490 * src/lyxrc.*: Added support for new \tth_command
8492 * lib/lyxrc.example: Added stuff for new \tth_command
8494 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8496 * lib/Makefile.am (IMAGES): removed images/README
8497 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
8498 installes in correct place. Check permisions is installed
8501 * src/LaTeX.C: some no-op changes moved declaration of some
8504 * src/LaTeX.h (LATEX_H): changed include guard name
8506 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8508 * lib/reLyX/Makefile.am: install noweb2lyx.
8510 * lib/Makefile.am: install configure.
8512 * lib/reLyX/configure.in: declare a config aux dir; set package
8513 name to lyx (not sure what the best solution is); generate noweb2lyx.
8515 * lib/layouts/egs.layout: fix the bibliography layout.
8517 1999-10-08 Jürgen Vigna <jug@sad.it>
8519 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
8520 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
8521 it returned without continuing to search the path.
8523 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8525 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
8526 also fixes a bug. It is not allowed to do tricks with std::strings
8527 like: string a("hei"); &a[e]; this will not give what you
8528 think... Any reason for the complexity in this func?
8530 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
8532 * Updated README and INSTALL a bit, mostly to check that my
8533 CVS rights are correctly set up.
8535 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8537 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
8538 does not allow '\0' chars but lyxstring and std::string does.
8540 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8542 * autogen.sh (AUTOCONF): let the autogen script create the
8543 POTFILES.in file too. POTFILES.in should perhaps now not be
8544 included in the cvs module.
8546 * some more files changed to use C++ includes instead of C ones.
8548 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
8550 (Reread): added tostr to nlink. buggy output otherwise.
8551 (Reread): added a string() around szMode when assigning to Buffer,
8552 without this I got a log of garbled info strings.
8554 * acconfig.h: commented out the PTR_AS_INT macros. They should not
8557 * I have added several ostream & operator<<(ostream &, some_type)
8558 functions. This has been done to avoid casting and warnings when
8559 outputting enums to lyxerr. This as thus eliminated a lot of
8560 explicit casts and has made the code clearer. Among the enums
8561 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
8562 mathed enums, some font enum the Debug::type enum.
8564 * src/support/lyxstring.h (clear): missing method. equivalent of
8567 * all files that contained "stderr": rewrote constructs that used
8568 stderr to use lyxerr instead. (except bmtable)
8570 * src/support/DebugStream.h (level): and the passed t with
8571 Debug::ANY to avoid spurious bits set.
8573 * src/debug.h (Debug::type value): made it accept strings of the
8576 * configure.in (Check for programs): Added a check for kpsewhich,
8577 the latex generation will use this later to better the dicovery of
8580 * src/BufferView.C (create_view): we don't need to cast this to
8581 (void*) that is done automatically.
8582 (WorkAreaButtonPress): removed some dead code.
8584 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8586 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
8587 is not overwritten when translated (David Sua'rez de Lis).
8589 * lib/CREDITS: Added David Sua'rez de Lis
8591 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
8593 * src/bufferparams.C (BufferParams): default input encoding is now
8596 * acinclude.m4 (cross_compiling): comment out macro
8597 LYX_GXX_STRENGTH_REDUCE.
8599 * acconfig.h: make sure that const is not defined (to empty) when
8600 we are compiling C++. Remove commented out code using SIZEOF_xx
8603 * configure.in : move the test for const and inline as late as
8604 possible so that these C tests do not interefere with C++ ones.
8605 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
8606 has not been proven.
8608 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8610 * src/table.C (getDocBookAlign): remove bad default value for
8613 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
8615 (ShowFileMenu2): ditto.
8617 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
8620 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8622 * Most files: finished the change from the old error code to use
8623 DebugStream for all lyxerr debugging. Only minor changes remain
8624 (e.g. the setting of debug levels using strings instead of number)
8626 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8628 * src/layout.C (Add): Changed to use compare_no_case instead of
8631 * src/FontInfo.C: changed loop variable type too string::size_type.
8633 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8635 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
8636 set ETAGS_ARGS to --c++
8638 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
8640 * src/table.C (DocBookEndOfCell): commented out two unused variables
8642 * src/paragraph.C: commented out four unused variables.
8644 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
8645 insed a if clause with type string::size_type.
8647 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
8650 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
8652 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
8653 variable, also changed loop to go from 0 to lenght + 1, instead of
8654 -1 to length. This should be correct.
8656 * src/LaTeX.C (scanError): use string::size_type as loop variable
8659 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
8660 (l.896) since y_tmp and row was not used anyway.
8662 * src/insets/insetref.C (escape): use string::size_type as loop
8665 * src/insets/insetquotes.C (Width): use string::size_type as loop
8667 (Draw): use string::size_type as loop variable type.
8669 * src/insets/insetlatexaccent.C (checkContents): use
8670 string::size_type as loop variable type.
8672 * src/insets/insetlabel.C (escape): use string::size_type as loop
8675 * src/insets/insetinfo.C: added an extern for current_view.
8677 * src/insets/insetcommand.C (scanCommand): use string::size_type
8678 as loop variable type.
8680 * most files: removed the RCS tags. With them we had to recompile
8681 a lot of files after a simple cvs commit. Also we have never used
8682 them for anything meaningful.
8684 * most files: tags-query-replace NULL 0. As adviced several plases
8685 we now use "0" instead of "NULL" in our code.
8687 * src/support/filetools.C (SpaceLess): use string::size_type as
8690 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8692 * src/paragraph.C: fixed up some more string stuff.
8694 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8696 * src/support/filetools.h: make modestr a std::string.
8698 * src/filetools.C (GetEnv): made ch really const.
8700 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
8701 made code that used these use max/min from <algorithm> instead.
8703 * changed several c library include files to their equivalent c++
8704 library include files. All is not changed yet.
8706 * created a support subdir in src, put lyxstring and lstrings
8707 there + the extra files atexit, fileblock, strerror. Created
8708 Makefile.am. edited configure.in and src/Makefile.am to use this
8709 new subdir. More files moved to support.
8711 * imported som of the functions from repository lyx, filetools
8713 * ran tags-query-replace on LString -> string, corrected the bogus
8714 cases. Tried to make use of lstrings.[hC], debugged a lot. There
8715 is still some errors in there. This is errors where too much or
8716 too litle get deleted from strings (string::erase, string::substr,
8717 string::replace), there can also be some off by one errors, or
8718 just plain wrong use of functions from lstrings. Viewing of quotes
8721 * LyX is now running fairly well with string, but there are
8722 certainly some bugs yet (see above) also string is quite different
8723 from LString among others in that it does not allow null pointers
8724 passed in and will abort if it gets any.
8726 * Added the revtex4 files I forgot when setting up the repository.
8728 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8730 * All over: Tried to clean everything up so that only the files
8731 that we really need are included in the cvs repository.
8732 * Switched to use automake.
8733 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
8734 * Install has not been checked.
8736 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8738 * po/pt.po: Three errors:
8739 l.533 and l.538 format specification error
8740 l. 402 duplicate entry, I just deleted it.