1 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
3 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
5 * src/frontends/kde/FormParagraph.C: added using directive.
7 * src/frontends/kde/paradlg.C: added config.h and using directive.
9 * src/frontends/kde/paradlg.h: added std::qualifier.
11 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
13 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
15 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
17 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
19 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
21 * src/version.h: set back to 1.1.6cvs
23 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
25 * src/version.h: set to 1.1.6pre2
27 2000-11-20 Marko Vendelin <markov@ioc.ee>
29 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
31 * src/frontends/gnome/Makefile.am: updated list of XForms object files
33 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
35 * src/LColor.C (init):
36 * src/lyxrc.C (getDescription): changed some comments as suggested by
39 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
40 disconnect the redrawGUI signal in best-practice fashion.
42 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
43 long_opts_tab to reflect the change in name of this tabfolder, as
44 suggested by Rob Lahaye.
45 (connect, disconnect): new methods. Don't do much at present other than
46 ensuring that we can't resize the dialog. This just makes xforms go
48 (lots of methods in Colors): made void rather than bool. The idea is
49 to have an isOk() function that keeps track of whether any input is
50 genuinely invalid and should therefore block Save, Apply.
51 Easier to manipulate the counters rapidly.
52 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
53 compiler will like this code. Much cleaner way of doing things.
55 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
57 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
58 rather than simple counters, following suggestion by Rob Lahaye.
60 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
61 than engraved frame + text.
63 * src/frontends/xforms/forms/makefile: removed spurious command.
65 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
67 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
69 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
72 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
74 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
75 see what Lars has changed and what is just white space!
76 Now used X directly to ascertain the RGB color associated with the
78 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
80 Added some sort capability.
81 The X11 color name database input is only displayed if the database
82 isn't found in the standard place.
83 Got rid of struct compare_converter; it wasn't used.
84 Probably some other stuff that I've forgotten.
86 * src/frontends/xforms/FormPreferences.h: changed the names of some
87 methods in the Colors struct. Added a couple of structs to help sort
88 colors by name and by RGBColor.
90 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
91 functions into a new class RWInfo.
93 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
94 The dialog is now almost navigable using the keyboard. Unfortunately,
95 the cursor has to be inside a browser for it to be activated. There is
96 no visual feedback for the key shortcuts to the arrow keys (use
97 Alt-appropriate arrow key, Alt-x).
99 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
102 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
103 xform_helpers.[Ch]. See above.
105 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
107 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
109 * src/screen.C (setCursorColor): new method. Sets the color of the
111 (ShowManualCursor): call it.
112 Constify some local variables.
114 * src/LColor.[Ch] (LColor): add entry for cursor
115 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
118 2000-11-19 Juergen Vigna <jug@sad.it>
120 * src/insets/insettabular.C (draw): fixed text border redraw problem.
121 (calculate_dimensions_of_cells): try to boost up when inserting chars.
123 2000-11-15 Rob Lahaye <lahaye@postech.edu>
125 * lib/ui/default.ui: OptItem used for Fax entry
127 2000-11-17 Matej Cepl <cepl@bigfoot.com>
129 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
131 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
133 * src/vspace.C (nextToken): fix so it can handle length phrases like
134 "10mm+-20mm", "40inplus16mmminus10cm" etc.
136 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
138 * src/frontends/xforms/FormPreferences.C: constify several variables
139 (BrowserLyX): rewrite to not need the choice variable
140 (Modify): rewrite to not need the choide variable
141 (compare_converter): make operator const
143 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
144 correct the writing of \set_color
145 (getDescription): return a const string
147 * src/kbsequence.[Ch] (addkey): remove dead code
149 * src/Painter.C (text): remove some commented code
151 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
153 * src/ColorHandler.[Ch]: removed some header files from .h file.
154 Included LColor.h in .C file.
156 * src/LColor.[Ch]: made class copyable so that I could create a
157 system_lcolor instance.
159 * src/Painter.h: removed LColor.h.
161 * src/lyx_gui.C (create_forms): used AddName.
163 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
164 of user preferences/lyxrc file.
166 * src/lyxrc.C (output): output changes to lcolor.
168 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
170 Moved class xformColor to files xform_helpers.[Ch]. These files,
171 Color.[Ch], could now be moved into src if they would be useful to
174 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
175 Also moved FormPreferences::browseFile here as it can be used by any
176 xform dialog with a "Browse" button. FormGraphics is a perfect example.
178 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
179 ReadableFile): changed the FormPreferences methods a little and moved
180 them here as they'll be useful elsewhere also.
182 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
183 Removed some header files and used forward declarations instead.
185 Removed some methods as they'll be useful elsewhere (see above).
187 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
188 Can also now modify the LyX LColors. However, for reasons that I don't
189 yet understand, it appears that we can use
190 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
191 present. The problem appears to lie in ColorHandler, because I can
192 change the color using LColor.SetColor(). Similarly, when reading in a
193 preferences file with some set_color instances, I'll get a warning
194 like: Color sea green is undefined or may not be redefined
195 Bad lyxrc set_color for sea green
197 Once the buffer is loaded, however, I can happily change to this color.
199 Finally, it appears that I have to set the color of "inset frame"
200 explicitly, or it oscillates from "black" to "indian red" with each
203 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
205 * ANNOUNCE: corrected a spelling mistake.
207 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
210 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
212 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
214 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
217 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
218 match the requirements from the standard better. This is required
219 to work with gnu libstdc++-v3
221 * src/frontends/xforms/FormPreferences.C: add explict pair
222 arguments to browse calls. include support/lyxmanip.h remvoe
223 extern fmt. whitespace changes. reorder variables in
224 FormPreferences.h, to match initalizaton order.
226 * several files: constify more local variables.
228 * src/buffer.C: remove some commented functions.
230 * src/DepTable.C (remove_files_with_extension): temporary
231 work around for gcc 2.97
232 * src/filedlg.C (find): ditto
233 * src/Variables.C (set): ditto
234 * src/LyXAction.C (searchActionArg): ditto
235 (retrieveActionArg): ditto
237 * configure.in: check for mktemp too
239 * UPGRADING: prepare for 1.1.6
241 * Makefile.am (lgbtags): add backup tags for when etags are
242 different than usual.
244 * ANNOUNCE: prepare for 1.1.6
246 * src/support/tempname.C (make_tempfile): new function, wrapper
247 around mkstemp and mktemp. Only mkstemp has been tested.
250 2000-11-14 Rob Lahaye <lahaye@postech.edu>
252 * default.ui: capitalized some menu items to improve shortcuts.
254 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
256 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
258 * src/frontends/xforms/Dialogs.C: add "using" directive.
260 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
262 * src/filedlg.C (Select): highlight suggested file in browser, if
265 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
266 each tab folder is encapsulated in its own class.
267 The Language keymaps are now chosen using a text input and a
268 browser button, rather than a Combox.
269 All the browser buttons are now functional, although LyXFileDlg
270 still needs to be modified to make it straighhtforward to return a
271 directory if that is what is desired.
273 * src/frontends/xforms/forms/form_preferences.fd: use text input
274 and browse button to input the Language keymaps. Add a few
275 callbacks for the browse buttons.
277 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
279 * src/support/tempname.C (tempName): small changes to make it
280 safer. remove the '.' before XXXXXX
282 * src/support/filetools.C (TmpFileName): remove func
285 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
286 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
287 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
288 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
290 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
293 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
296 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
297 for bp (this fixes a reproducible hard crash)
299 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
302 * src/frontends/xforms/FormBase.h: make bp_ private
303 (FormBaseBI): remove default for bp
306 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
309 * src/frontends/xforms/Color.C (RGBColor): made several vars
310 const, changed initialization of j to allow it to be const
313 * several files: added const to local variables.
315 * src/lyx_cb.C: removed several function prototypes and moved them
319 (UpdateLayoutPreamble):
321 (MenuInsertLabel): add BufferView as arguemnt
322 (LayoutsCB): make tmp const
324 * src/layout_forms.h: regenerated
326 * src/debug.C: add Debug::FILES
327 (showLevel) (showTags): translate the desc
329 * src/debug.h: add FILES as debug target
331 * src/bufferlist.C: use current_view as an interim measure becuase
332 of added arguments to MenuWrite and MenuWriteAs
334 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
336 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
338 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
339 libstdc++ is compiled with.
341 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
343 * lib/layouts/docbook-book.layout
344 * lib/layouts/docbook.layout
345 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
346 those paragraphs are expresse as SGML comments <!-- -->.
348 * src/LaTeXFeatures.h
349 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
350 parameter, this allows to express all the include files as relative
351 paths to the master buffer. The verbatim insert works as the other
354 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
356 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
358 (MakeDocBookFile): top_element is always written. Some clean up, as
359 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
361 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
362 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
363 a reference is written instead of the name.
364 (Validate): use the relative path for the filename.
366 * src/insets/insetlabel.C (DocBook): write end tag, for XML
369 * src/support/filetools.h
370 * src/support/filetools.C (IsSGMLFilename): added.
373 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
375 * development/OS2/quick_fix.patch:
377 * README.OS2: quick update to the OS/2 port.
379 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
381 * src/converter.C: add "using" directive.
383 * src/frontends/xforms/FormPreferences.C: add "using" directive.
384 (compare_converter): add "int" as return type.
386 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
389 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
391 * src/lyx_gui.C (create_forms): map the xform colours, should a
392 mapping exist. Ie, call XformColor::read().
394 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
395 and struct HSV as HSVColor.
396 (XformColor::read, XformColor::write) : new methods that
397 input/output any changes to the cform GUI colors.
399 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
402 * src/frontends/xforms/FormPreferences.C Lots of little changes
403 associated with the changed name of the RGB and HSV structs. Can
404 now save changes to xforms GUI to file. Commented out
405 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
406 used currently anyway.
408 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
410 * src/converter.C: A lot of changes:
411 - It is no longer possible to choose between two or more ways to
412 export to some format (the new code uses only the shortest path).
413 However, it is still possible to choose between pdflatex/ps2pdf
414 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
415 - Added several methods that makes the FormPreferences code simpler.
416 - Changed the tokens $$FName and $$OutName to $$i and $$o.
418 * src/exporter.C (Export): lyxrc.use_pdf is set before
419 makeLaTeXFile is called. This works but not very nice.
421 * src/frontends/xforms/FormPreferences.C: The formats/converters
422 tabs are now fully functional.
424 * src/buffer.C (getTocList): Add numbers to the captions.
426 * lib/lyxrc.example: Removed fax section
428 * src/support/rename.C (rename): Delete the old file if lyx::copy
431 2000-11-13 Rob Lahaye <lahaye@postech.edu>
433 * lib/ui/default.ui: minor polishing.
435 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
437 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
440 * lib/Makefile.am (DOCINST): do not install everything in the
441 documentation directory.
443 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
445 * src/bufferlist.C (newFile): set the filename to the constructed
448 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
449 constructed "newfileXX.lyx" name to the dialog
451 * src/frontends/DialogBase.h: make update() non-abstract so
452 KDE doesn't need to implement two update methods for every form
454 * src/frontends/kde/Makefile.am: add missing xforms objects
457 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
459 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
461 * src/frontends/xforms/Color.[Ch]: new files, defining the color
462 structs RGB and HSV. May not be the best place for these files.
463 Perhaps move them into src ?
465 * src/frontends/xforms/Makefile.am: added new files.
467 * src/frontends/xforms/forms/form_preferences.fd:
468 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
469 replaced all instances of "colour" with "color"!
471 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
474 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
475 tab. Can now alter the colors of the xform's GUI on the fly. With
476 the aid of a single static Signal (see below), can "Apply" these
477 changes to all currently open dialogs. (Well, to all of the NEW
478 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
479 subsequently opened dialogs will, of course, also have the new
480 color scheme. Cannot yet save (or load) the choices to file, so
481 they are lost when exiting LyX.
483 * src/frontends/Dialogs.h:
484 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
485 Used to trigger a redraw of any dialogs connected to it because,
486 for example, the GUI colours have been re-mapped.
488 * src/frontends/xforms/FormBase.[Ch]:
489 * src/frontends/xforms/FormDocument.[Ch]:
490 * src/frontends/xforms/FormParagraph.[Ch]:
491 * src/frontends/xforms/FormPreferences.[Ch]:
492 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
493 method, to be connected to Dialogs::redrawGUI. Method must be
494 virtual, because dialogs with tabbed folders need to redraw the
495 forms of each tab folder.
497 * src/LyXView.C (d-tor):
498 * src/frontends/xforms/FormBase.C (d-tor): connected
499 Dialogs::redrawGUI signal to redraw().
501 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
502 removed Assert, because it is identical to that in FormBase.
504 2000-11-10 Rob Lahaye <lahaye@postech.edu>
506 * lib/ui/default.ui: minor polishing.
508 2000-11-10 Juergen Vigna <jug@sad.it>
510 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
511 (deleteLyXText): ditto
513 * src/insets/insettabular.C (InsetButtonPress): don't clear the
514 selection on mouse-button-3.
516 * src/insets/insettabular.h: new function clearSelection(), use this
517 functions inside insettabular.C.
519 * src/insets/insettabular.C (TabularFeatures): clear the selection
520 on remove_row/column.
522 * src/insets/inset.C (scroll): fixed some scroll stuff.
524 * src/insets/insettabular.C (draw): fixed another minor draw problem.
526 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
528 * lib/CREDITS: add Yves Bastide
530 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
532 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
533 check whether C library functions are in the global namespace.
535 * configure.in: calls it.
537 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
540 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
542 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
543 iterators to prevent crash.
545 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
547 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
549 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
550 shortcut for xforms CB to the preemptive or post-handler function.
552 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
553 removed the HIDDEN_TIMER as it's no longer used.
554 Various other small changes.
556 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
557 preemptive handler to obtain feedback, rather than the post-handler.
558 (ColoursLoadBrowser): find "black" and "white" based on RGB values
560 Formats tab is now complete. Converters tab is nearly so.
562 2000-11-09 Juergen Vigna <jug@sad.it>
564 * src/insets/insettext.C (~InsetText):
567 (SetParagraphData): set cache.second to 0 after deleting it!
568 (getLyXText): check if cache.second is not 0 if finding it.
570 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
572 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
573 lyxlex to parse the rgb.txt file.
576 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
577 replace the default '#' comment character.
579 * src/support/tempname.C: add "using" directive
580 * src/frontends/ButtonPolicies.C: ditto.
582 * src/support/filetools.C (DirList): add an explicit cast to avoid
583 a compile error (probably not the right fix)
585 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
587 * src/support/filetools.C (DirList): implement using system functions
589 * src/support/tempname.C: new file
591 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
593 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
595 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
598 * src/frontends/xforms/ButtonController.C: new file
600 * src/os2_defines.h: remove getcwd define
602 * src/lyxvc.C: include support/lyxlib.h
603 (showLog): use lyx::tempName
605 * src/lyx_cb.C: comment out includes that we don't need
606 (AutoSave): use lyx::tempName
608 * src/filedlg.C: include support/lyxlib.h
609 (Reread): use lyx::getcwd
611 * src/converter.C: include support/filetools.h
612 (add_options): change to static inline, make tail const
613 (Add): make old_viewer const
614 (GetAllFormats): make it a const method, use const_iterator
615 (enable): make static inline
616 (SplitFormat): make using_format const
618 * src/LaTeX.C (run): use lyx::getcwd
620 * configure.in: check for mkstemp as well
622 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
624 * src/converter.[Ch] (GetAllCommands): new method.
626 * src/support/filetools.[Ch] (DirList): new method.
628 * src/frontends/xforms/FormPreferences.C: started (just!) adding
629 functionality to the converters tab.
630 The formats tab is now nearly complete.
631 The kbmap choices in Languages tab now display the contents of
632 system_lyxdir/kbd/*.kmap in readable form.
634 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
635 Moved some variables into the class.
637 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
638 inactive tab folder to FL_COL1. Haven't yet worked out how to change
639 colour of active folder to lighter grey instead. Any takers?
640 (form_colours): added an "Apply" button.
641 (form_converters): added a "Flags" input field.
642 (form_formats): added a "Shortcut" input field. Note that we can't use
643 names such as "input_shortcut" as this buggers up the sed script stuff.
645 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
653 * src/lyx_sendfax_main.C:
656 * src/spellchecker.C:
657 * src/insets/figinset.C:
658 * src/insets/insetbib.C:
659 * src/insets/insetexternal.C:
660 * src/insets/insetinclude.C:
661 * src/insets/insetinfo.C:
662 * src/mathed/math_panel.C:
663 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
664 all "daughter" dialogs now have identical "feel".
666 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
668 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
669 used (and was only used in one place prior to this patch. Incorrectly!)
671 * src/frontends/xforms/FormDocument.C: changed some instances of
672 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
673 sense. Also added fl_set_input_return() for class_->input_doc_extra and
674 for options_->input_float_placement. This fixes a bug reported by
677 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
678 functionality into d-tor.
680 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
681 input of numerals also.
683 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
684 fl_set_form_atclose(). Can now close dialog from window manager,
685 fixing a bug reported by Rob Lahaye.
687 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
689 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
690 are no longer dark. Haven't yet worked out how to lighten the colour of
691 the active tabfolder. Any ideas anybody?
692 Adjusted Colours tab a little.
693 Added Shortcut field to converters tab. Note that we can't create an
694 fdesign label like "input_shortcut" as this buggers up the sed-script
697 * src/frontends/xforms/FormPreferences.[Ch]:
698 (feedback): fixed crash due to to ob=0.
699 (LanguagesXXX): the kbmap choices now contain the files
700 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
701 be replaced by an input with a file browse button, but since the browse
702 buttons don'y yet work, this'll do for the moment.
703 (FormatsXXX): think that this is now nearly fully functional.
704 Some points/questions though:
705 1. Does "Apply" remove formats if no longer present?
706 2. I think that the browser should list the GUI names rather than the
708 3. Must ensure that we can't delete Formats used by an existing
711 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
712 if this is the best way to do this.
714 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
716 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
718 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
719 for variable assignment.
721 2000-11-07 Rob Lahaye <lahaye@postech.edu>
723 * src/lib/ui/default.ui: added sub/superscripts to menu as
724 Insert->Special characters and cleaned-up the file a bit
726 2000-11-07 Allan Rae <rae@lyx.org>
728 * src/frontends/xforms/FormPreferences.C (feedback): make sure
729 ob isn't 0 before using it. See comments in function.
731 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
733 * src/frontends/xforms/form_*.C: regenerated
735 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
737 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
739 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
740 compiling with gcc-2.96
742 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
744 * src/support/lyxstring.C: add a couple "using" directives.
746 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
747 a .c_str() here too for good measure.
748 * src/Spacing.C (set): ditto.
749 * src/lyxfunc.C (Dispatch): ditto.
751 * src/insets/insettabular.C (copySelection): change .str() to
752 .str().c_str() to fix problems with lyxstring.
753 * src/support/filetools.C (GetFileContents): ditto.
754 * src/buffer.C (asciiParagraph): ditto.
755 * src/paragraph.C (String): ditto.
757 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
758 * lib/bind/sciword.bind: ditto.
760 * src/LyXAction.C (init): remove "symbol-insert" function, which
761 shared LFUN_INSERT_MATH with "math-insert".
763 * lib/configure.m4: == is not a valid operator for command test.
765 * src/lyxrc.C: add using directive.
767 * src/converter.h: add std:: qualifier.
769 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
771 * src/converter.[Ch] and other files: Change the Format class to a
772 real class, and create two instances: formats and system_format.
774 * src/lyxrc.C (output): Output the difference between formats and
777 * src/frontends/xforms/FormPreferences.C (input): Simplify.
778 (buildFormats): Insert formats into browser.
779 (inputFormats): Made the browser and add button functional.
780 (applyFormats): Update formats from format_vec.
782 * src/converter.C: Changed all (*it). to it->
783 (Format::dummy): New method.
784 (Format::importer): New format flag.
785 (Formats::GetAllFormats): New method.
786 (Formats::Add): Delete format from the map if prettyname is empty.
787 (Converter::Convert): Print an error message if moving the file fails.
788 (Converter::GetReachableTo): New method
790 * src/MenuBackend.[Ch]: Add support for importformats tag.
792 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
794 * lib/configure.m4: Add word->tex and ps->fax converters.
796 * lib/ui/default.ui: Use ImportFormats on file->import menu.
797 Return fax to file menu.
801 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
803 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
806 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
809 * src/lyxfunc.C (processKeyEvent): removed
811 * src/bufferlist.C (emergencyWrite): removed the out commented
812 emergency write code.
814 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
816 * src/LyXView.[Ch]: remove the outcommented raw_callback code
818 * many files: change formatting to be a bit more uniform for
819 if,while,for,switch statements, remove some parantesis not needed.
822 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
824 * config/kde.m4: make config more robust when KDEDIR is set
826 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
828 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
829 not returned a pixmap for "math-insert".
831 * src/LyXAction.C (init): sort the entries a bit.
833 2000-11-03 Juergen Vigna <jug@sad.it>
835 * src/insets/insettabular.h: added fixed number to update codes so
836 that update is only in one direction.
838 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
841 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
842 before call to edit because of redraw.
844 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
846 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
848 * lib/ui/default.ui: Populate "edit_float" menu
850 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
852 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
853 "floats-operate". The name is ugly (and the func also), but this
854 is just a band-aid until we switch to new insets.
856 2000-11-03 Rob Lahaye <lahaye@postech.edu>
858 * lib/ui/default.ui: update again the menu layout (fix some
861 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
863 * src/MenuBackend.h (fulllabel): new method.
865 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
866 the menu shortcuts of a menu are unique and whether they
867 correspond to a letter of the label.
868 (expand): call checkShortcuts when debugging.
870 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
872 * src/insets/insettext.C (InsetButtonPress): shut off warning.
874 2000-11-02 Lior Silberman <lior@Princeton.EDU>
876 * lib/examples/*.lyx : '\language default' => '\language english'
878 * lib/examples/it_splash.lyx : except where it should be italian
880 * lib/templates/*.lyx : the same
882 * doc/*.lyx* : the same
884 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
886 * lib/bind/menus.bind: remove the Layout menu entries, which I
887 somehow forgot earlier.
889 2000-11-03 Rob Lahaye <lahaye@postech.edu>
891 * lib/ui/old-default.ui: keep the old one here for reference (to
894 * lib/ui/default.ui: update the menu layout
896 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
898 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
899 Can now Apply to different insets without closing the dialog.
901 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
902 Can't actually DO anything with them yet, but I'd like a little
905 * src/frontends/xforms/input_validators.[ch]
906 (fl_lowercase_filter): new.
908 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
910 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
911 of MATH_CODE. This fixes a bug with math-macros in RTL text.
913 * src/text.C (PrepareToPrint): Show math-macros block aligned.
915 2000-11-02 Juergen Vigna <jug@sad.it>
917 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
918 on char insertion as it has already be updated by bv->updateInset().
920 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
921 if an inset inside was updated.
923 * lib/configure.cmd: commented out fax-search code
925 2000-11-01 Yves Bastide <stid@acm.org>
927 * src/tabular.C (OldFormatRead): set tabular language to the
930 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
932 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
933 class names with non-letter characters (from Yves Bastide).
935 * lib/ui/default.ui: change Item to OptItem in import menu.
936 Comment out fax stuff.
938 * lib/configure.m4: comment out fax-related stuff.
940 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
942 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
943 useful xforms helper functions. At present contains only formatted().
944 Input a string and it returns it with line breaks so that in fits
947 * src/frontends/xforms/Makefile.am: add new files.
949 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
950 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
953 * src/frontends/xforms/FormPreferences.[Ch]:
954 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
955 but lots of little clean ups. Removed enum State. Make use of
956 formatted(). Constify lots of methods. Perhaps best of all: removed
957 requirement for that horrible reinterpret_cast from pointer to long in
960 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
962 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
963 conditionalize build on xforms < 0.89
965 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
967 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
969 * src/LyXAction.C (init): comment out fax
971 * src/lyxrc.h: comment out the fax enums
972 comment out the fax variables
974 * src/commandtags.h: comment out LFUN_FAX
976 * src/lyxrc.C: disable fax variables.
977 (read): disable parsing of fax variables
978 (output): disable writing of fax variables
979 (getFeedback): now description for fax variables
981 * src/lyxfunc.C: comment out MenuFax
982 (Dispatch): disable LFUN_FAX
984 * src/lyx_cb.C (MenuFax): comment out
986 * src/WorkArea.C: add <cctype>
987 (work_area_handler): better key handling, should be ok now.
988 for accented chars + etc
990 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
991 lyx_sendfax.h and lyx_sendfax_man.C
993 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
994 (show): don't call InitLyXLookup when using xforms 0.89
996 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
998 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1000 * src/support/filetools.C (GetFileContents): close to dummy change
1002 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1004 * src/trans.C (AddDeadkey): workaround stupid compilers.
1006 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1008 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1009 of two-sided document.
1011 2000-10-31 Juergen Vigna <jug@sad.it>
1013 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1015 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1016 xposition to the Edit call.
1018 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1020 * src/trans.C (AddDeadkey): cast explicitly to char.
1022 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1024 * src/tabular.C (AsciiBottomHLine): simplify?
1025 (AsciiTopHLine): simplify?
1026 (print_n_chars): simplify
1027 (DocBook): remove most of the << endl; we should flush the stream
1028 as seldom as possible.
1030 (TeXBottomHLine): ditto
1031 (TeXTopHLine): ditto
1033 (write_attribute): try a templified version.
1034 (set_row_column_number_info): lesson scope of variables
1036 * src/support/lstrings.h (tostr): new specialization of tostr
1038 * src/trans.C (AddDeadkey): slightly cleaner fix.
1040 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1042 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1043 '%%' in Toc menu labels.
1046 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1047 font_norm is iso10646-1.
1049 * src/font.C (ascent): Fixed for 16bit fonts
1050 (descent,lbearing,rbearing): ditto
1052 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1054 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1055 (getFeedback): new static method.
1057 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1058 Now use combox rather than choice to display languages.
1059 Feedback is now output using a new timer callback mechanism, identical
1060 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1062 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1064 * src/minibuffer.C: fix for older compilers
1066 2000-10-30 Juergen Vigna <jug@sad.it>
1068 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1069 has to be Left of the inset otherwise LyXText won't find it!
1071 * src/BufferView2.C (open_new_inset): delete the inset if it can
1074 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1076 * lyx.man: fix typo.
1078 2000-10-29 Marko Vendelin <markov@ioc.ee>
1079 * src/frontends/gnome/FormCitation.C
1080 * src/frontends/gnome/FormCitation.h
1081 * src/frontends/gnome/FormCopyright.C
1082 * src/frontends/gnome/FormCopyright.h
1083 * src/frontends/gnome/FormError.C
1084 * src/frontends/gnome/FormError.h
1085 * src/frontends/gnome/FormIndex.C
1086 * src/frontends/gnome/FormIndex.h
1087 * src/frontends/gnome/FormPrint.C
1088 * src/frontends/gnome/FormPrint.h
1089 * src/frontends/gnome/FormRef.C
1090 * src/frontends/gnome/FormRef.h
1091 * src/frontends/gnome/FormToc.C
1092 * src/frontends/gnome/FormToc.h
1093 * src/frontends/gnome/FormUrl.C
1094 * src/frontends/gnome/FormUrl.h
1095 * src/frontends/gnome/Menubar_pimpl.C
1096 * src/frontends/gnome/mainapp.C
1097 * src/frontends/gnome/mainapp.h
1098 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1099 changing update() to updateSlot() where appropriate
1101 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1103 * src/frontends/xforms/FormPreferences.[Ch]:
1104 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1107 2000-10-28 Juergen Vigna <jug@sad.it>
1109 * src/insets/insettabular.C (draw): fixed drawing bug.
1111 * src/insets/insettext.C (clear):
1113 (SetParagraphData): clearing the TEXT buffers when deleting the
1114 paragraphs used by it.
1116 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
1118 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
1120 2000-10-27 Juergen Vigna <jug@sad.it>
1122 * src/tabular.C (~LyXTabular): removed not needed anymore.
1124 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
1127 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1129 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
1132 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
1135 * src/frontends/xforms/FormPreferences.[Ch]:
1136 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
1137 Reorganised as modules based on tabs. Much easier to follow the
1138 flow and to add new tabs. Added warning and feedback messages.
1141 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1143 * src/tabular.h (DocBook): add std:: qualifier.
1145 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
1147 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
1148 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
1151 * insettabular.C (DocBook): uses the tabular methods to export
1154 * src/insets/insettext.h
1155 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
1157 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1159 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
1162 * src/lyxfunc.C (MenuNew): lessen the scope of fname
1163 moved misplaced AllowInput two lines up.
1165 * src/buffer.C (readFile): compare float with float, not with int
1167 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1169 * src/minibuffer.C: add "using SigC::slot" statement.
1171 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
1173 * src/frontends/xforms/forms/README: updated section about make.
1175 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
1176 Tidied some forms up, made two of form_tabular's tabs more
1177 self-consistent, fixed Jean-Marc's size problem in form_preferences,
1178 fixed translation problem with "Column".
1180 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1182 * src/minibuffer.h: use Timeout instead of the xforms timer
1184 (setTimer) rewrite for the Timeout, change to unsigned arg
1185 (set): change to unsigned timer arg
1188 * src/minibuffer.C (TimerCB): removed func
1189 (C_MiniBuffer_TimerCB): removed func
1190 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
1191 (peek_event): use a switch statement
1192 (add): don't use fl_add_timer.
1193 (Set): rewrite to use the Timeout
1196 * src/Timeout.[Ch] (setType): return a Timeout &
1197 (setTimeout): ditto, change to unsigned arg for timeout
1199 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
1201 * src/mathed/formula.C (mathed_string_width): Use string instead
1202 of a constant size char array.
1204 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1206 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
1207 the two recently added operator<< for SMInput and State.
1209 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
1211 (OkCancelPolicy): ditto
1212 (OkCancelReadOnlyPolicy): ditto
1213 (NoRepeatedApplyReadOnlyPolicy): ditto
1214 (OkApplyCancelReadOnlyPolicy): ditto
1215 (OkApplyCancelPolicy): ditto
1216 (NoRepeatedApplyPolicy): ditto
1218 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1220 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
1221 add the usual std:: qualifiers.
1223 2000-10-25 Juergen Vigna <jug@sad.it>
1225 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
1227 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1229 * src/support/filetools.C (MakeRelPath): change some types to
1232 * src/frontends/ButtonPolicies.h (operator<<): new operator for
1233 ButtonPolicy::SMInput and ButtonPolicy::State.
1235 * src/FontLoader.C (reset): small cleanup
1236 (unload): small cleanup
1238 * src/FontInfo.C (getFontname): initialize error to 10000.0
1240 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1242 * src/frontends/xforms/FormPreferences.[Ch]:
1243 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
1244 TeX encoding and default paper size sections.
1246 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1248 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
1251 * src/frontends/xforms/FormError.C (disconnect): use erase() to
1252 make the message_ empty.
1253 (FormError): don't initialize message_ in initializer list.
1255 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1257 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
1259 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1261 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
1263 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
1265 * src/frontends/kde/*data.[Ch]: _("") is not
1268 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1270 * src/buffer.C: removed redundant using directive.
1272 * src/frontends/DialogBase.h: revert to original definition of
1275 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
1276 stuff into two classes, one for each dialog, requires a new
1277 element in the dialogs vector, FormTabularCreate.
1279 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
1282 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
1283 method. Continues Allan's idea, but means that derived classes
1284 don't need to worry about "update or hide?".
1286 * src/frontends/xforms/FormError.C (showInset): add connection
1289 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
1290 one for each dialog. FormTabular now contains main tabular dialog
1293 * src/frontends/xforms/FormTabularCreate.[Ch]:
1294 * src/frontends/xforms/forms/form_tabular_create.fd: the create
1297 * src/frontends/xforms/FormGraphics.[Ch]:
1298 * src/frontends/xforms/forms/form_graphics.fd
1299 * src/frontends/xforms/FormTabular.[Ch]:
1300 * src/frontends/xforms/forms/form_tabular.fd: made daughter
1301 classes of FormInset.
1303 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
1304 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
1306 * src/frontends/xforms/Makefile.am:
1307 * src/frontends/xforms/forms/makefile: added new files.
1309 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
1310 variable. added Signal0 hide signal, in keeping with other GUI-I
1313 * src/support/lstrings.h: removed redundant std:: qualifier as
1314 it's already declared in Lsstream.h.
1316 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1318 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
1322 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1324 * src/tabular.C (Ascii): minimize scope of cell.
1326 * src/BufferView2.C (nextWord): return string() instead of 0;
1328 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1330 * src/converter.h: add a std:: qualifier
1332 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
1334 * src/importer.[Ch]: New files. Used for importing files into LyX.
1336 * src/lyxfunc.C (doImport): Use the new Importer class.
1338 * src/converter.h: Add shortcut member to the Format class.
1339 Used for holding the menu shortcut.
1341 * src/converter.C and other files: Made a distinction between
1342 format name and format extension. New formats can be defined using
1343 the \format lyxrc tag.
1344 Added two new converter flags: latex and disable.
1346 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1348 * src/support/lyxlib.h: unify namespace/struct implementation.
1349 Remove extra declarations.
1351 * src/support/chdir.C (chdir): remove version taking char const *
1353 * src/support/rename.C: ditto.
1354 * src/support/lyxsum.C: ditto.
1356 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
1358 * src/frontends/xforms/FormBase.[Ch]:
1359 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
1360 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
1361 work only for the next call to fl_show_form(). The correct place to set
1362 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
1363 done. FormBase also stores minw_, minh_ itself. All dialogs derived
1364 from FormBase have the minimum size set; no more stupid crashes with
1367 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1369 * lib/ui/default.ui: fix shortcut for Insert->Include File.
1371 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1373 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
1375 * src/support/lyxlib.h: changed second argument of mkdir to
1376 unsigned long int (unsigned int would probably have been enough,
1377 but...). Removed <sys/types.h> header.
1378 * src/support/mkdir.C (mkdir): ditto.
1382 2000-10-19 Juergen Vigna <jug@sad.it>
1384 * src/lyxfunc.C (MenuNew): small fix (form John)
1386 * src/screen.C (Update): removed unneeded code.
1388 * src/tabular.C (Ascii): refixed int != uint bug!
1390 * src/support/lyxlib.h: added sys/types.h include for now permits
1391 compiling, but I don't like this!
1393 2000-10-18 Juergen Vigna <jug@sad.it>
1395 * src/text2.C (ClearSelection): if we clear the selection we need
1396 more refresh so set the status apropriately
1398 * src/insets/insettext.C (draw): hopefully finally fixed draw
1401 2000-10-12 Juergen Vigna <jug@sad.it>
1403 * src/insets/insettext.C (draw): another small fix and make a block
1404 so that variables are localized.
1406 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
1408 * src/support/lstrings.C (lowercase, uppercase):
1409 use explicit casts to remove compiler warnings.
1411 * src/support/LRegex.C (Impl):
1412 * src/support/StrPool.C (add):
1413 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
1414 (AddPath, MakeDisplayPath):
1415 * src/support/lstrings.C (prefixIs, subst):
1416 use correct type to remove compiler warnings.
1418 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
1420 * src/support/lyxlib.h:
1421 * src/support/mkdir.C (mkdir): change parameter to mode_t for
1422 portability and to remove compiler warning with DEC cxx.
1424 * src/support/FileInfo.[Ch] (flagRWX): ditto.
1426 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1428 * src/minibuffer.C (peek_event): retun 1 when there has been a
1429 mouseclick in the minibuffer.
1433 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
1435 * src/frontends/xforms/FormParagraph.C: more space above/below
1438 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
1440 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1441 a char only if real_current_font was changed.
1443 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1445 * NEWS: update somewhat for 1.1.6
1447 * lib/ui/default.ui: clean up.
1449 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
1451 * lib/CREDITS: clean up
1453 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1455 * src/combox.[Ch] (select): changed argument back to int
1456 * src/combox.C (peek_event): removed num_bytes as it is declared but
1459 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
1460 modified calls to Combox::select() to remove warnings about type
1463 * src/insets/insetbutton.C (width): explicit cast to remove warning
1464 about type conversion.
1466 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
1469 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
1470 sel_pos_end, refering to cursor position are changed to
1471 LyXParagraph::size_type.
1473 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
1474 consistent with LyXCursor::pos().
1475 (inset_pos): changed to LyXParagraph::size_type for same reason.
1477 * src/insets/insettext.C (resizeLyXText): changed some temporary
1478 variables refing to cursor position to LyXParagraph::size_type.
1480 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
1482 * src/frontends/kde/<various>: The Great Renaming,
1485 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1487 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
1489 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1491 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
1492 0 when there are no arguments.
1494 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1496 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
1497 to segfaults when pressing Ok in InsetBibtex dialog.
1499 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1501 * forms/layout_forms.fd:
1502 * src/layout_forms.C (create_form_form_character): small change to use
1503 labelframe rather than engraved frame + text
1505 * src/lyx_gui.C (create_forms): initialise choice_language with some
1506 arbitrary value to prevent segfault when dialog is shown.
1508 2000-10-16 Baruch Even <baruch.even@writeme.com>
1510 * src/converter.C (runLaTeX, scanLog): Added a warning when there
1511 is no resulting file. This pertains only to LaTeX output.
1513 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
1515 * src/text.C (Backspace): Make sure that the row of the cursor is
1518 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1521 * src/lyx_gui.C (init): Prevent a crash when only one font from
1522 menu/popup fonts is not found.
1524 * lib/lyxrc.example: Add an example for binding a key for language
1527 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
1529 * src/converter.C (GetReachable): Changed the returned type to
1531 (IsReachable): New method
1533 * src/MenuBackend.C (expand): Handle formats that appear more
1536 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1538 * src/frontends/support/Makefile.am
1539 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
1542 * lib/CREDITS: add Garst Reese.
1544 * src/support/snprintf.h: add extern "C" {} around the definitions.
1546 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
1548 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1551 * src/frontends/xforms/FormDocument.C:
1552 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
1553 compile without "conversion to integral type of smaller size"
1556 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1558 * src/text.C (GetColumnNearX): Fixed disabled code.
1560 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1562 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
1565 * src/support/snprintf.[ch]: new files
1567 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1569 * src/frontends/kde/formprintdialog.C: add
1570 file browser for selecting postscript output
1572 * src/frontends/kde/formprintdialogdata.C:
1573 * src/frontends/kde/formprintdialogdata.h: re-generate
1576 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1578 * src/frontends/gnome/Makefile.am:
1579 * src/frontends/kde/Makefile.am: FormCommand.C
1580 disappeared from xforms
1582 * src/frontends/kde/FormCitation.C:
1583 * src/frontends/kde/FormIndex.C: read-only
1586 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1588 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
1591 * src/bufferlist.C: add using directive.
1593 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1595 * src/support/lyxfunctional.h: version of class_fun for void
1596 returns added, const versions of back_inseter_fun and compare_fun
1599 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1601 * src/frontends/xforms/FormInset.C (showInset): fix typo.
1603 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1605 * ChangeLog: cleanup.
1607 * lib/CREDITS: update to add all the contributors we've forgotten.
1608 I have obviously missed some, so tell me whether there were
1611 2000-10-13 Marko Vendelin <markov@ioc.ee>
1613 * src/frontends/gnome/FormCitation.C
1614 * src/frontends/gnome/FormCitation.h
1615 * src/frontends/gnome/FormError.C
1616 * src/frontends/gnome/FormIndex.C
1617 * src/frontends/gnome/FormRef.C
1618 * src/frontends/gnome/FormRef.h
1619 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
1621 * src/frontends/gnome/FormCitation.C
1622 * src/frontends/gnome/FormCopyright.C
1623 * src/frontends/gnome/FormError.C
1624 * src/frontends/gnome/FormIndex.C
1625 * src/frontends/gnome/FormRef.C
1626 * src/frontends/gnome/FormToc.C
1627 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
1630 * src/frontends/gnome/Menubar_pimpl.C
1631 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
1634 2000-10-11 Baruch Even <baruch.even@writeme.com>
1637 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
1638 to convey its real action.
1640 * src/minibuffer.C (peek_event): Added action when mouse clicks to
1641 clear the minibuffer and prepare to enter a command.
1643 * src/mathed/formula.C (LocalDispatch): Changed to conform with
1644 the rename from ExecCommand to PrepareForCommand.
1645 * src/lyxfunc.C (Dispatch): ditto.
1647 2000-10-11 Baruch Even <baruch.even@writeme.com>
1649 * src/buffer.C (writeFile): Added test for errors on writing, this
1650 catches all errors and not only file system full errors as intended.
1652 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1654 * src/lyx_gui.C (create_forms): better fix for crash with
1655 translated interface.
1657 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
1659 * src/frontends/kde/Makefile.am:
1660 * src/frontends/kde/FormCopyright.C:
1661 * src/frontends/kde/formcopyrightdialog.C:
1662 * src/frontends/kde/formcopyrightdialog.h:
1663 * src/frontends/kde/formcopyrightdialogdata.C:
1664 * src/frontends/kde/formcopyrightdialogdata.h:
1665 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
1666 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
1667 copyright to use qtarch
1669 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
1671 * src/encoding.C (read): Fixed bug that caused an error message at
1672 the end of the file.
1674 * po/Makefile.in.in: Fixed rule for ext_l10n.h
1676 * lib/lyxrc.example: Fixed hebrew example.
1678 2000-10-13 Allan Rae <rae@lyx.org>
1680 * src/frontends/xforms/FormPreferences.C (input): reworking the
1682 (build, update, apply): New inputs in various tabfolders
1684 * src/frontends/xforms/FormToc.C: use new button policy.
1685 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
1686 dialogs that either can't use any existing policy or where it just
1689 * src/frontends/xforms/FormTabular.h: removed copyright notice that
1692 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
1693 added a bool parameter which is ignored.
1695 * src/buffer.C (setReadonly):
1696 * src/BufferView_pimpl.C (buffer):
1697 * src/frontends/kde/FormCopyright.h (update):
1698 * src/frontends/kde/FormCitation.[Ch] (update):
1699 * src/frontends/kde/FormIndex.[Ch] (update):
1700 * src/frontends/kde/FormPrint.[Ch] (update):
1701 * src/frontends/kde/FormRef.[Ch] (update):
1702 * src/frontends/kde/FormToc.[Ch] (update):
1703 * src/frontends/kde/FormUrl.[Ch] (update):
1704 * src/frontends/gnome/FormCopyright.h (update):
1705 * src/frontends/gnome/FormCitation.[Ch] (update):
1706 * src/frontends/gnome/FormError.[Ch] (update):
1707 * src/frontends/gnome/FormIndex.[Ch] (update):
1708 * src/frontends/gnome/FormPrint.[Ch] (update):
1709 * src/frontends/gnome/FormRef.h (update):
1710 * src/frontends/gnome/FormToc.[Ch] (update):
1711 * src/frontends/gnome/FormUrl.[Ch] (update):
1712 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
1713 to updateBufferDependent and DialogBase
1715 * src/frontends/xforms/FormCitation.[hC]:
1716 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
1717 * src/frontends/xforms/FormError.[Ch]:
1718 * src/frontends/xforms/FormGraphics.[Ch]:
1719 * src/frontends/xforms/FormIndex.[Ch]:
1720 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
1721 and fixed readOnly handling.
1722 * src/frontends/xforms/FormPrint.[Ch]:
1723 * src/frontends/xforms/FormRef.[Ch]:
1724 * src/frontends/xforms/FormTabular.[Ch]:
1725 * src/frontends/xforms/FormToc.[Ch]:
1726 * src/frontends/xforms/FormUrl.[Ch]:
1727 * src/frontends/xforms/FormInset.[Ch]:
1728 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
1729 form of updateBufferDependent.
1731 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
1732 if form()->visible just in case someone does stuff to the form in a
1735 * src/frontends/DialogBase.h (enum): removed enum since we can now use
1736 the buttoncontroller for everything the enum used to be used for.
1737 (update) It would seem we need to force all dialogs to use a bool
1738 parameter or have two update functions. I chose to go with one.
1739 I did try removing update() from here and FormBase and defining the
1740 appropriate update signatures in FormBaseB[DI] but then ran into the
1741 problem of the update() call in FormBase::show(). Whatever I did
1742 to get around that would require another function and that just
1743 got more confusing. Hence the decision to make everyone have an
1744 update(bool). An alternative might have been to override show() in
1745 FormBaseB[DI] and that would allow the different and appropriate
1748 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
1749 true == buffer change occurred. I decided against using a default
1750 template parameter since not all compilers support that at present.
1752 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
1754 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
1755 army knife" by removing functionality.
1756 (clearStore): removed. All such housekeeping on hide()ing the dialog
1757 is to be carried out by overloaded disconnect() methods.
1758 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
1759 superceded by Baruch's neat test (FormGraphics) to update an existing
1760 dialog if a new signal is recieved rather than block all new signals
1762 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
1763 only to Inset dialogs.
1764 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
1765 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
1767 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
1769 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
1770 as a base class to all inset dialogs. Used solely to connect/disconnect
1771 the Inset::hide signal and to define what action to take on receipt of
1772 a UpdateBufferDependent signal.
1773 (FormCommand): now derived from FormInset.
1775 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
1778 * src/frontends/xforms/FormCopyright.[Ch]:
1779 * src/frontends/xforms/FormPreferences.[Ch]:
1780 now derived from FormBaseBI.
1782 * src/frontends/xforms/FormDocument.[Ch]:
1783 * src/frontends/xforms/FormParagraph.[Ch]:
1784 * src/frontends/xforms/FormPrint.[Ch]:
1785 now derived from FormBaseBD.
1787 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
1789 * src/frontends/xforms/FormCitation.[Ch]:
1790 * src/frontends/xforms/FormError.[Ch]:
1791 * src/frontends/xforms/FormRef.[Ch]:
1792 * src/frontends/xforms/FormToc.[Ch]:
1793 (clearStore): reworked as disconnect().
1795 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
1798 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1800 * src/converter.C (runLaTeX): constify buffer argument
1803 * src/frontends/support/Makefile.am (INCLUDES): fix.
1805 * src/buffer.h: add std:: qualifier
1806 * src/insets/figinset.C (addpidwait): ditto
1807 * src/MenuBackend.C: ditto
1808 * src/buffer.C: ditto
1809 * src/bufferlist.C: ditto
1810 * src/layout.C: ditto
1811 * src/lyxfunc.C: ditto
1813 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1815 * src/lyxtext.h (bidi_level): change return type to
1816 LyXParagraph::size_type.
1818 * src/lyxparagraph.h: change size_type to
1819 TextContainer::difference_type. This should really be
1820 TextContainer::size_type, but we need currently to support signed
1823 2000-10-11 Marko Vendelin <markov@ioc.ee>
1824 * src/frontends/gnome/FormError.h
1825 * src/frontends/gnome/FormRef.C
1826 * src/frontends/gnome/FormRef.h
1827 * src/frontends/gnome/FormError.C
1828 * src/frontends/gnome/Makefile.am
1829 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
1830 to Gnome frontend. Both dialogs use "action" area.
1832 2000-10-12 Baruch Even <baruch.even@writeme.com>
1834 * src/graphics/GraphicsCacheItem_pimpl.C:
1835 * src/graphics/Renderer.C:
1836 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
1839 2000-10-12 Juergen Vigna <jug@sad.it>
1841 * src/insets/insettext.C (draw): fixed drawing bug (specifically
1842 visible when selecting).
1844 * development/Code_rules/Rules: fixed some typos.
1846 2000-10-09 Baruch Even <baruch.even@writeme.com>
1848 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
1849 compiling on egcs 1.1.2 possible.
1851 * src/filedlg.C (comp_direntry::operator() ): ditto.
1853 2000-08-31 Baruch Even <baruch.even@writeme.com>
1855 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
1858 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
1859 transient it now only gets freed when the object is destructed.
1861 2000-08-24 Baruch Even <baruch.even@writeme.com>
1863 * src/frontends/FormGraphics.h:
1864 * src/frontends/FormGraphics.C: Changed to use ButtonController and
1867 2000-08-20 Baruch Even <baruch.even@writeme.com>
1869 * src/insets/insetgraphics.C:
1870 (draw): Added messages to the drawn rectangle to report status.
1871 (updateInset): Disabled the use of the inline graphics,
1874 2000-08-17 Baruch Even <baruch.even@writeme.com>
1876 * src/frontends/support: Directory added for the support of GUII LyX.
1878 * src/frontends/support/LyXImage.h:
1879 * src/frontends/support/LyXImage.C: Base class for GUII holding of
1882 * src/frontends/support/LyXImage_X.h:
1883 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
1884 version of LyXImage, this uses the Xlib Pixmap.
1886 * src/PainterBase.h:
1887 * src/PainterBase.C:
1889 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
1890 replacement to Pixmap.
1892 * src/insets/insetgraphics.h:
1893 * src/insets/insetgraphics.C:
1894 * src/graphics/GraphicsCacheItem.h:
1895 * src/graphics/GraphicsCacheItem.C:
1896 * src/graphics/GraphicsCacheItem_pimpl.h:
1897 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
1900 * src/graphics/GraphicsCacheItem.h:
1901 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
1902 another copy of the object.
1904 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
1905 of cacheHandle, this fixed a bug that sent LyX crashing.
1907 * src/graphics/XPM_Renderer.h:
1908 * src/graphics/XPM_Renderer.C:
1909 * src/graphics/EPS_Renderer.h:
1910 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
1912 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1914 * src/lyxfunc.C (processKeySym): only handle the
1915 lockinginset/inset stuff if we have a buffer and text loaded...
1917 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
1919 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1921 * src/support/lyxfunctional.h: add operator= that takes a reference
1923 * src/lyxserver.C (mkfifo): make first arg const
1925 * src/layout.h: renamed name(...) to setName(...) to work around
1928 * src/buffer.C (setFileName): had to change name of function to
1929 work around bugs in egcs. (renamed from fileName)
1931 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
1933 * src/support/translator.h: move helper template classes to
1934 lyxfunctional.h, include "support/lyxfunctional.h"
1936 * src/support/lyxmanip.h: add delaration of fmt
1938 * src/support/lyxfunctional.h: new file
1939 (class_fun_t): new template class
1940 (class_fun): helper template function
1941 (back_insert_fun_iterator): new template class
1942 (back_inserter_fun): helper template function
1943 (compare_memfun_t): new template class
1944 (compare_memfun): helper template function
1945 (equal_1st_in_pair): moved here from translator
1946 (equal_2nd_in_pair): moved here from translator
1948 * src/support/fmt.C: new file
1949 (fmt): new func, can be used for a printf substitute when still
1950 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
1952 * src/support/StrPool.C: add some comments
1954 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
1957 * src/insets/figinset.C (addpidwait): use std::copy with
1958 ostream_iterator to fill the pidwaitlist
1960 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
1962 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
1965 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
1968 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
1970 * src/frontends/xforms/FormDocument.C (build): remove c_str()
1971 (class_update): ditto
1972 (BulletPanel): ditto
1973 (CheckChoiceClass): move initialization of tc and tct
1975 * src/tabular.C: remove current_view
1976 (OldFormatRead): similar to right below [istream::ignore]
1978 * src/lyxlex_pimpl.C (next): add code for faster skipping of
1979 chars, unfortunately this is buggy on gcc 2.95.2, so currently
1980 unused [istream::ignore]
1982 * src/lyxfunc.C: include "support/lyxfunctional.h"
1983 (getInsetByCode): use std::find_if and compare_memfun
1985 * src/lyxfont.C (stateText): remove c_str()
1987 * src/lyx_main.C (setDebuggingLevel): make static
1988 (commandLineHelp): make static
1990 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
1991 Screen* together with fl_get_display() and fl_screen
1993 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
1994 togheter with fl_get_display() and fl_screen
1995 (create_forms): remove c_str()
1997 * src/layout.C: include "support/lyxfunctional.h"
1998 (hasLayout): use std::find_if and compare_memfun
1999 (GetLayout): use std::find_if and comapre_memfun
2000 (delete_layout): use std::remove_if and compare_memfun
2001 (NumberOfClass): use std:.find_if and compare_memfun
2003 * src/gettext.h: change for the new functions
2005 * src/gettext.C: new file, make _(char const * str) and _(string
2006 const & str) real functions.
2008 * src/font.C (width): rewrite slightly to avoid one extra variable
2010 * src/debug.C: initialize Debug::ANY here
2012 * src/commandtags.h: update number comments
2014 * src/combox.h (get): make const func
2016 (getline): make const
2018 * src/combox.C (input_cb): handle case where fl_get_input can
2021 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2022 "support/lyxfunctional.h", remove current_view variable.
2023 (resize): use std::for_each with std::mem_fun
2024 (getFileNames): use std::copy with back_inserter_fun
2025 (getBuffer): change arg type to unsigned int
2026 (emergencyWriteAll): call emergencyWrite with std::for_each and
2028 (emergencyWrite): new method, the for loop in emergencyWriteAll
2030 (exists): use std::find_if with compare_memfun
2031 (getBuffer): use std::find_if and compare_memfun
2033 * src/buffer.h: add typedefs for iterator_category, value_type
2034 difference_type, pointer and reference for inset_iterator
2035 add postfix ++ for inset_iterator
2036 make inset_iterator::getPos() const
2038 * src/buffer.C: added support/lyxmanip.h
2039 (readFile): use lyxerr << fmt instead of printf
2040 (makeLaTeXFile): use std::copy to write out encodings
2042 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2044 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2045 free and the char * temp.
2046 (hasMenu): use std::find_if and compare_memfun
2049 * src/Makefile.am (lyx_SOURCES): added gettext.C
2051 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2052 string::insert small change to avoid temporary
2054 * src/LColor.C (getGUIName): remove c_str()
2056 * several files: change all occurrences of fl_display to
2059 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2060 that -pedantic is not used for gcc 2.97 (cvs gcc)
2062 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2064 2000-10-11 Allan Rae <rae@lyx.org>
2066 * src/frontends/xforms/FormPreferences.C (input): template path must be
2067 a readable directory. It doesn't need to be writeable.
2068 (build, delete, update, apply): New inputs in the various tabfolders
2070 * src/frontends/xforms/forms/form_preferences.fd:
2071 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2072 several new entries to existing folders. Shuffled some existing stuff
2075 * src/frontends/xforms/forms/form_print.fd:
2076 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2077 Should probably rework PrinterParams as well. Note that the switch to
2078 collated is effectively the same as !unsorted so changing PrinterParams
2079 will require a lot of fiddly changes to reverse the existing logic.
2081 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2083 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2085 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2087 2000-10-10 Allan Rae <rae@lyx.org>
2090 * src/lyxfunc.C (Dispatch):
2092 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2095 * src/lyxrc.C (output): Only write the differences between system lyxrc
2096 and the users settings.
2099 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2101 I'll rewrite this later, after 1.1.6 probably, to keep a single
2102 LyXRC but two instances of a LyXRCStruct.
2104 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2106 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2108 * src/tabular.h: add a few std:: qualifiers.
2110 * src/encoding.C: add using directive.
2111 * src/language.C: ditto.
2113 * src/insets/insetquotes.C (Validate): use languages->lang()
2114 instead of only language.
2116 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
2118 * lib/languages: New file.
2120 * lib/encodings: New file.
2122 * src/language.C (Languages): New class.
2123 (read): New method. Reads the languages from the 'languages' file.
2125 * src/encoding.C (Encodings): New class.
2126 (read): New method. Reads the encodings from the 'encodings' file.
2128 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
2131 * src/bufferparams.h and a lot of files: Deleted the member language,
2132 and renamed language_info to language
2134 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
2135 * src/lyxfont.C (latexWriteStartChanges): ditto.
2136 * src/paragraph.C (validate,TeXOnePar): ditto.
2138 * src/lyxfont.C (update): Restored deleted code.
2140 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
2142 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2144 * src/BufferView_pimpl.C (buffer): cleaned up a little.
2146 * src/insets/figinset.[Ch]:
2147 * src/insets/insetinclude.[Ch]:
2148 * src/insets/insetinclude.[Ch]:
2149 * src/insets/insetparent.[Ch]:
2150 * src/insets/insetref.[Ch]:
2151 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
2153 * src/insets/*.[Ch]:
2154 * src/mathed/formula.[Ch]:
2155 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
2157 * src/buffer.C (parseSingleLyXformat2Token, readInset):
2158 * src/lyx_cb.C (FigureApplyCB):
2159 * src/lyxfunc.C (getStatus, Dispatch):
2160 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
2163 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
2165 * src/converter.[Ch] (Formats::View):
2166 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
2168 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
2169 *current_view->buffer(). This will change later, but this patch is way
2172 2000-10-09 Juergen Vigna <jug@sad.it>
2174 * src/text.C (GetRow): small fix.
2176 * src/BufferView_pimpl.C (cursorPrevious):
2177 (cursorNext): added LyXText parameter to function.
2179 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
2180 keypress depending on cursor position.
2182 2000-10-06 Juergen Vigna <jug@sad.it>
2184 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
2185 (copySelection): redone this function and also copy ascii representa-
2188 * src/tabular.C (Ascii):
2192 (print_n_chars): new functions to realize the ascii export of tabulars.
2194 2000-10-05 Juergen Vigna <jug@sad.it>
2196 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
2197 if we don't have a buffer.
2199 2000-10-10 Allan Rae <rae@lyx.org>
2201 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
2202 with closing dialog. It seems that nested tabfolders require hiding
2203 of inner tabfolders before hiding the dialog itself. Actually all I
2204 did was hide the active outer folder.
2206 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
2207 unless there really is a buffer. hideBufferDependent is called
2210 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
2211 POTFILES.in stays in $(srcdir).
2213 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
2215 * lib/lyxrc.example: Few changes.
2217 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
2219 * src/BufferView_pimpl.C (buffer): only need one the
2220 updateBufferDependent signal to be emitted once! Moved to the end of
2221 the method to allow bv_->text to be updated first.
2223 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
2224 and hSignal_ with Dialogs * and BufferDependency variables.
2225 New Buffer * parent_, initialised when the dialog is launched. Used to
2226 check whether to update() or hide() dialog in the new, private
2227 updateOrHide() method that is connected to the updateBufferDependent
2228 signal. Daughter classes dictate what to do using the
2229 ChangedBufferAction enum, passed to the c-tor.
2231 * src/frontends/xforms/FormCitation.C:
2232 * src/frontends/xforms/FormCommand.C:
2233 * src/frontends/xforms/FormCopyright.C:
2234 * src/frontends/xforms/FormDocument.C:
2235 * src/frontends/xforms/FormError.C:
2236 * src/frontends/xforms/FormIndex.C:
2237 * src/frontends/xforms/FormPreferences.C:
2238 * src/frontends/xforms/FormPrint.C:
2239 * src/frontends/xforms/FormRef.C:
2240 * src/frontends/xforms/FormToc.C:
2241 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
2244 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
2245 ChangedBufferAction enum.
2247 * src/frontends/xforms/FormParagraph.[Ch]
2248 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
2251 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2253 * lib/bind/cua.bind: fix a bit.
2254 * lib/bind/emacs.bind: ditto.
2256 * lib/bind/menus.bind: remove real menu entries from there.
2258 * src/spellchecker.C: make sure we only include strings.h when
2261 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2263 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
2264 function. It enlarges the maximum number of pup when needed.
2265 (add_toc2): Open a new menu if maximum number of items per menu has
2268 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
2270 * src/frontends/kde/FormPrint.C: fix error reporting
2272 * src/frontends/xforms/FormDocument.C: fix compiler
2275 * lib/.cvsignore: add Literate.nw
2277 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2280 * bufferview_funcs.[Ch]
2283 * text2.C: Add support for numbers in RTL text.
2285 2000-10-06 Allan Rae <rae@lyx.org>
2287 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
2288 to be gettext.m4 friendly again. ext_l10n.h is now
2289 generated into $top_srcdir instead of $top_builddir
2290 so that lyx.pot will be built correctly -- without
2291 duplicate parsing of ext_l10n.h.
2293 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2295 * src/frontends/kde/FormCitation.C: make the dialog
2296 behave more sensibly
2298 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
2300 * config/kde.m4: fix consecutive ./configure runs,
2301 look for qtarch, fix library order
2303 * src/frontends/kde/Makefile.am: tidy up,
2304 add Print dialog, add .dlg dependencies
2306 * src/frontends/kde/FormPrint.C:
2307 * src/frontends/kde/FormPrint.h:
2308 * src/frontends/kde/formprintdialog.C:
2309 * src/frontends/kde/formprintdialog.h:
2310 * src/frontends/kde/formprintdialogdata.C:
2311 * src/frontends/kde/formprintdialogdata.h:
2312 * src/frontends/kde/dlg/formprintdialog.dlg: add
2315 * src/frontends/kde/dlg/README: Added explanatory readme
2317 * src/frontends/kde/dlg/checkinitorder.pl: small perl
2318 script to double-check qtarch's output
2320 * src/frontends/kde/formindexdialog.C:
2321 * src/frontends/kde/formindexdialogdata.C:
2322 * src/frontends/kde/formindexdialogdata.h:
2323 * src/frontends/kde/dlg/formindexdialog.dlg: update
2324 for qtarch, minor fixes
2326 2000-10-05 Allan Rae <rae@lyx.org>
2328 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
2329 dialogs when switching buffers update them instead. It's up to each
2330 dialog to decide if it should still be visible or not.
2331 update() should return a bool to control visiblity within show().
2332 Or perhaps better to set a member variable and use that to control
2335 * lib/build-listerrors: create an empty "listerrors" file just to stop
2336 make trying to regenerate it all the time if you don't have noweb
2339 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
2341 * po/Makefile.in.in (ext_l10n.h): added a rule to build
2342 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
2343 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
2344 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
2345 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
2347 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
2349 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
2351 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
2352 deleting buffer. Closes all buffer-dependent dialogs.
2354 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
2356 * src/frontends/xforms/FormCitation.[Ch]:
2357 * src/frontends/xforms/FormPreferences.[Ch]:
2358 * src/frontends/xforms/FormPrint.[Ch]:
2359 * src/frontends/xforms/FormRef.[Ch]:
2360 * src/frontends/xforms/FormUrl.[Ch]: ditto
2362 * src/frontends/xforms/FormDocument.[Ch]:
2363 * src/frontends/xforms/forms/form_document.C.patch:
2364 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
2365 pass through a single input() function.
2367 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2369 * lib/build-listerrors: return status as OK
2371 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
2373 * lib/lyxrc.example: Updated to new export code
2375 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2377 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
2380 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
2383 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
2384 LyX-Code is defined.
2385 * lib/layouts/amsbook.layout: ditto.
2387 * boost/Makefile.am: fix typo.
2389 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
2391 (add_lastfiles): removed.
2392 (add_documents): removed.
2393 (add_formats): removed.
2395 * src/frontends/Menubar.C: remove useless "using" directive.
2397 * src/MenuBackend.h: add a new MenuItem constructor.
2399 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
2402 2000-10-04 Allan Rae <rae@lyx.org>
2404 * lib/Makefile.am (listerrors):
2405 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
2406 I haven't got notangle installed so Kayvan please test. The output
2407 should end up in $builddir. This also allows people who don't have
2408 noweb installed to complete the make process without error.
2410 * src/frontends/xforms/FormCommand.[Ch] (showInset):
2411 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
2412 by JMarc's picky compiler.
2414 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2417 * src/insets/insettabular.C (setPos): change for loop to not use
2418 sequencing operator. Please check this Jürgen.
2420 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
2422 * src/insets/insetcite.C (getScreenLabel): ditto
2423 * src/support/filetools.C (QuoteName): ditto
2424 (ChangeExtension): ditto
2426 * src/BufferView_pimpl.C (scrollCB): make heigt int
2428 * src/BufferView2.C (insertInset): comment out unused arg
2430 * boost/Makefile.am (EXTRADIST): new variable
2432 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2434 * src/exporter.C (IsExportable): Fixed
2436 * lib/configure.m4: Small fix
2438 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2440 * src/insets/insetbutton.C (width): Changed to work with no GUI.
2441 * src/insets/insetbib.C (bibitemWidest): ditto.
2442 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
2444 2000-10-03 Juergen Vigna <jug@sad.it>
2446 * src/BufferView2.C (theLockingInset): removed const because of
2447 Agnus's compile problems.
2449 * src/insets/insettext.C (LocalDispatch): set the language of the
2450 surronding paragraph on inserting the first character.
2452 * various files: changed use of BufferView::the_locking_inset.
2454 * src/BufferView2.C (theLockingInset):
2455 (theLockingInset): new functions.
2457 * src/BufferView.h: removed the_locking_inset.
2459 * src/lyxtext.h: added the_locking_inset
2461 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
2463 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
2465 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2467 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
2468 * src/mathed/math_cursor.C (IsAlpha): ditto.
2469 * src/mathed/math_inset.C (strnew): ditto.
2470 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
2471 (IMetrics): cxp set but never used; removed.
2472 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
2473 that the variable in question has been removed also!
2476 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
2477 using the Buffer * passed to Latex(), using the BufferView * passed to
2478 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
2480 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
2481 Linuxdoc() and DocBook() rather than the stored Buffer * master.
2483 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
2484 * src/buffer.C (readInset): used new InsetBibtex c-tor
2485 * (getBibkeyList): used new InsetBibtex::getKeys
2487 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2490 * lib/build-listerrors
2492 * src/exporter.C: Add literate programming support to the export code
2495 * src/lyx_cb.C: Remove old literate code.
2497 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
2500 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
2501 * src/converter.C (View, Convert): Use QuoteName.
2503 * src/insets/figinset.C (Preview): Use Formats::View.
2505 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
2507 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2509 * src/lyxfunc.C (Dispatch): move declaration of text variable at
2510 the top of the function, because compaq cxx complains that the
2511 "goto exit_with_message" when the function is disabled bypasses
2513 (MenuNew): try a better fix for the generation of new file names.
2514 This time, I used AddName() instead of AddPath(), hoping Juergen
2517 2000-10-03 Allan Rae <rae@lyx.org>
2519 * src/frontends/xforms/forms/form_preferences.fd:
2520 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
2521 nested tabfolders has begun. The old "Miscellaneous" was renamed as
2522 "Look and Feel"->"General" but will need to be split up further into
2523 general output and general input tabs. Current plan is for four outer
2524 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
2525 stuff; "Inputs" for input and import configuration; "Outputs" for
2526 output and export configuration; and one more whatever is left over
2527 called "General". The leftovers at present look like being which
2528 viewers to use, spellchecker, language support and might be better
2529 named "Support". I've put "Paths" in "Inputs" for the moment as this
2530 seems reasonable for now at least.
2531 One problem remains: X error kills LyX when you close Preferences.
2533 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2535 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
2536 qualifier from form()
2537 * src/frontends/xforms/FormCitation.[Ch]:
2538 * src/frontends/xforms/FormCopyright.[Ch]:
2539 * src/frontends/xforms/FormDocument.[Ch]:
2540 * src/frontends/xforms/FormError.[Ch]:
2541 * src/frontends/xforms/FormIndex.[Ch]:
2542 * src/frontends/xforms/FormPreferences.[Ch]:
2543 * src/frontends/xforms/FormPrint.[Ch]:
2544 * src/frontends/xforms/FormRef.[Ch]:
2545 * src/frontends/xforms/FormToc.[Ch]:
2546 * src/frontends/xforms/FormUrl.[Ch]: ditto.
2548 * src/frontends/xforms/FormCitation.[Ch]:
2549 * src/frontends/xforms/FormIndex.[Ch]:
2550 * src/frontends/xforms/FormRef.[Ch]:
2551 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
2552 with Allan's naming policy
2554 * src/frontends/xforms/FormCitation.C: some static casts to remove
2557 2000-10-02 Juergen Vigna <jug@sad.it>
2559 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
2560 now you can type or do stuff inside the table-cell also when in dummy
2561 position, fixed visible cursor.
2563 * src/insets/insettext.C (Edit): fixing cursor-view position.
2565 * src/lyxfunc.C (Dispatch): use * text variable so that it can
2566 be used for equal functions in lyxfunc and insettext.
2568 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
2570 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
2572 * src/frontends/gnome/FormCitation.h:
2573 * src/frontends/gnome/FormCopyright.h:
2574 * src/frontends/gnome/FormIndex.h:
2575 * src/frontends/gnome/FormPrint.h:
2576 * src/frontends/gnome/FormToc.h:
2577 * src/frontends/gnome/FormUrl.h:
2578 * src/frontends/kde/FormCitation.h:
2579 * src/frontends/kde/FormCopyright.h:
2580 * src/frontends/kde/FormIndex.h:
2581 * src/frontends/kde/FormRef.h:
2582 * src/frontends/kde/FormToc.h:
2583 * src/frontends/kde/FormUrl.h: fix remaining users of
2586 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2588 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
2589 from depth argument.
2590 (DocBookHandleCaption): ditto.
2591 (DocBookHandleFootnote): ditto.
2592 (SimpleDocBookOnePar): ditto.
2594 * src/frontends/xforms/FormDocument.h (form): remove extra
2595 FormDocument:: qualifier.
2597 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
2599 * sigc++/handle.h: ditto.
2601 * src/lyx_gui_misc.C: add "using" directive.
2603 * src/cheaders/cstddef: new file, needed by the boost library (for
2606 2000-10-02 Juergen Vigna <jug@sad.it>
2608 * src/insets/insettext.C (SetFont): better support.
2610 * src/insets/insettabular.C (draw): fixed drawing of single cell.
2612 * src/screen.C (DrawOneRow): some uint refixes!
2614 2000-10-02 Allan Rae <rae@lyx.org>
2616 * boost/.cvsignore: ignore Makefile as well
2618 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
2619 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
2621 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
2622 Left this one out by accident.
2624 * src/frontends/xforms/FormBase.h (restore): default to calling
2625 update() since that will restore the original/currently-applied values.
2626 Any input() triggered error messages will require the derived classes
2627 to redefine restore().
2629 * src/frontends/xforms/FormDocument.C: initialize a few variables to
2630 avoid a segfault. combo_doc_class is the main concern.
2632 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
2634 * Simplify build-listerrors in view of GUI-less export ability!
2636 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2638 * src/lyx_main.C (easyParse): Disable gui when exporting
2640 * src/insets/figinset.C:
2643 * src/lyx_gui_misc.C
2644 * src/tabular.C: Changes to allow no-gui.
2646 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2648 * src/support/utility.hpp: removed file
2649 * src/support/block.h: removed file
2651 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
2654 * src/mathed/formula.C: add support/lyxlib.h
2655 * src/mathed/formulamacro.C: ditto
2657 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
2658 * src/lyxparagraph.h: ditto
2660 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
2661 * src/frontends/Makefile.am (INCLUDES): ditto
2662 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
2663 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
2664 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
2665 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
2666 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
2667 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
2669 * src/BufferView.h: use boost/utility.hpp
2670 * src/LColor.h: ditto
2671 * src/LaTeX.h: ditto
2672 * src/LyXAction.h: ditto
2673 * src/LyXView.h: ditto
2674 * src/bufferlist.h: ditto
2675 * src/lastfiles.h: ditto
2676 * src/layout.h: ditto
2677 * src/lyx_gui.h: ditto
2678 * src/lyx_main.h: ditto
2679 * src/lyxlex.h: ditto
2680 * src/lyxrc.h: ditto
2681 * src/frontends/ButtonPolicies.h: ditto
2682 * src/frontends/Dialogs.h: ditto
2683 * src/frontends/xforms/FormBase.h: ditto
2684 * src/frontends/xforms/FormGraphics.h: ditto
2685 * src/frontends/xforms/FormParagraph.h: ditto
2686 * src/frontends/xforms/FormTabular.h: ditto
2687 * src/graphics/GraphicsCache.h: ditto
2688 * src/graphics/Renderer.h: ditto
2689 * src/insets/ExternalTemplate.h: ditto
2690 * src/insets/insetcommand.h: ditto
2691 * src/support/path.h: ditto
2693 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
2694 and introduce clause for 2.97.
2696 * boost/libs/README: new file
2698 * boost/boost/utility.hpp: new file
2700 * boost/boost/config.hpp: new file
2702 * boost/boost/array.hpp: new file
2704 * boost/Makefile.am: new file
2706 * boost/.cvsignore: new file
2708 * configure.in (AC_OUTPUT): add boost/Makefile
2710 * Makefile.am (SUBDIRS): add boost
2712 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2714 * src/support/lstrings.C (suffixIs): Fixed.
2716 2000-10-01 Allan Rae <rae@lyx.org>
2718 * src/PrinterParams.h: moved things around to avoid the "can't
2719 inline call" warning.
2721 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
2722 into doc++ documentation.
2724 * src/frontends/xforms/FormCommand.[Ch]: support button policy
2726 * src/frontends/xforms/FormRef.C: make use of button controller
2727 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
2728 cleaned up button controller usage.
2729 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
2730 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
2731 use the button controller
2733 * src/frontends/xforms/forms/*.fd: and associated generated files
2734 updated to reflect changes to FormBase. Some other FormXxxx files
2735 also got minor updates to reflect changes to FormBase.
2737 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
2738 (hide): made virtual.
2739 (input): return a bool. true == valid input
2740 (RestoreCB, restore): new
2741 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
2742 Changes to allow derived dialogs to use a ButtonController and
2743 make sense when doing so: OK button calls ok() and so on.
2745 * src/frontends/xforms/ButtonController.h (class ButtonController):
2746 Switch from template implementation to taking Policy parameter.
2747 Allows FormBase to provide a ButtonController for any dialog.
2749 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
2750 Probably should rename connect and disconnect.
2751 (apply): use the radio button groups
2752 (form): needed by FormBase
2753 (build): setup the radio button groups
2755 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
2757 * several files: type changes to reduce the number of warnings and
2758 to unify type hangling a bit. Still much to do.
2760 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2762 * lib/images/*: rename a bunch of icons to match Dekel converter
2765 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
2768 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
2770 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
2772 * sigc++/handle.h: ditto for class Handle.
2774 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
2776 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
2778 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
2780 * src/intl.C (InitKeyMapper): Correct the value of n due to the
2781 removal of the "default" language.
2783 * src/combox.h (getline): Check that sel > 0
2785 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
2787 * lib/examples/docbook_example.lyx
2788 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
2790 * lib/layouts/docbook-book.layout: new docbook book layout.
2792 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
2794 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
2796 * src/insets/figinset.C (DocBook):fixed small typo.
2798 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
2800 * src/insets/insetinclude.h: string include_label doesn't need to be
2803 2000-09-29 Allan Rae <rae@lyx.org>
2805 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
2806 Allow derived type to control connection and disconnection from signals
2807 of its choice if desired.
2809 2000-09-28 Juergen Vigna <jug@sad.it>
2811 * src/insets/insettabular.C (update): fixed cursor setting when
2812 the_locking_inset changed.
2813 (draw): made this a bit cleaner.
2814 (InsetButtonPress): fixed!
2816 * various files: added LyXText Parameter to fitCursor call.
2818 * src/BufferView.C (fitCursor): added LyXText parameter.
2820 * src/insets/insettabular.C (draw): small draw fix.
2822 * src/tabular.C: right setting of left/right celllines.
2824 * src/tabular.[Ch]: fixed various types in funcions and structures.
2825 * src/insets/insettabular.C: ditto
2826 * src/frontends/xforms/FormTabular.C: ditto
2828 2000-09-28 Allan Rae <rae@lyx.org>
2830 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
2831 that the #ifdef's had been applied to part of what should have been
2832 a complete condition. It's possible there are other tests that
2833 were specific to tables that are also wrong now that InsetTabular is
2834 being used. Now we need to fix the output of '\n' after a table in a
2835 float for the same reason as the original condition:
2836 "don't insert this if we would be adding it before or after a table
2837 in a float. This little trick is needed in order to allow use of
2838 tables in \subfigures or \subtables."
2839 Juergen can you check this?
2841 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2843 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
2844 output to the ostream.
2846 * several files: fixed types based on warnings from cxx
2848 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
2850 * src/frontends/kde/Makefile.am: fix rule for
2851 formindexdialogdata_moc.C
2853 * src/.cvsignore: add ext_l10n.h to ignore
2855 * acconfig.h: stop messing with __STRICT_ANSI__
2856 * config/gnome.m4: remove option to set -ansi
2857 * config/kde.m4: remove option to set -ansi
2858 * config/lyxinclude.m4: don't set -ansi
2860 2000-09-27 Juergen Vigna <jug@sad.it>
2862 * various files: remove "default" language check.
2864 * src/insets/insetquotes.C: removed use of current_view.
2866 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
2867 the one should have red ears by now!
2869 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
2870 in more then one paragraph. Fixed cursor-movement/selection.
2872 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
2873 paragraphs inside a text inset.
2875 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
2876 text-inset if this owner is an inset.
2878 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2880 * src/Bullet.h: changed type of font, character and size to int
2882 * src/buffer.C (asciiParagraph): remove actcell and fname1.
2884 * src/insets/inseturl.[Ch]:
2885 * src/insets/insetref.[Ch]:
2886 * src/insets/insetlabel.[Ch]: add linelen to Ascii
2888 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
2890 * src/buffer.C (readFile): block-if statement rearranged to minimise
2891 bloat. Patch does not reverse Jean-Marc's change ;-)
2893 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
2894 Class rewritten to store pointers to hide/update signals directly,
2895 rather than Dialogs *. Also defined an enum to ease use. All xforms
2896 forms can now be derived from this class.
2898 * src/frontends/xforms/FormCommand.[Ch]
2899 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
2901 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
2904 * src/frontends/xforms/forms/form_citation.fd
2905 * src/frontends/xforms/forms/form_copyright.fd
2906 * src/frontends/xforms/forms/form_error.fd
2907 * src/frontends/xforms/forms/form_index.fd
2908 * src/frontends/xforms/forms/form_ref.fd
2909 * src/frontends/xforms/forms/form_toc.fd
2910 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
2912 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
2914 * src/insets/insetfoot.C: removed redundent using directive.
2916 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2918 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
2919 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
2921 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
2922 created in the constructors in different groups. Then set() just
2923 have to show the groups as needed. This fixes the redraw problems
2924 (and is how the old menu code worked).
2926 * src/support/lyxlib.h: declare the methods as static when we do
2927 not have namespaces.
2929 2000-09-26 Juergen Vigna <jug@sad.it>
2931 * src/buffer.C (asciiParagraph): new function.
2932 (writeFileAscii): new function with parameter ostream.
2933 (writeFileAscii): use now asciiParagraph.
2935 * various inset files: added the linelen parameter to the Ascii-func.
2937 * src/tabular.C (Write): fixed error in writing file introduced by
2938 the last changes from Lars.
2940 * lib/bind/menus.bind: removed not supported functions.
2942 * src/insets/insettext.C (Ascii): implemented this function.
2944 * src/insets/lyxinset.h (Ascii): added linelen parameter.
2946 * src/tabular.C (write_attribute[int,string,bool]): new functions.
2947 (Write): use of the write_attribute functions.
2949 * src/bufferlist.C (close): fixed reasking question!
2951 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2953 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
2954 new files use the everwhere possible.
2957 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
2958 src/log_form.C src/lyx.C:
2961 * src/buffer.C (runLaTeX): remove func
2963 * src/PaperLayout.C: removed file
2964 * src/ParagraphExtra.C: likewise
2965 * src/bullet_forms.C: likewise
2966 * src/bullet_forms.h: likewise
2967 * src/bullet_forms_cb.C: likewise
2969 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
2970 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
2973 * several files: remove all traces of the old fd_form_paragraph,
2974 and functions belonging to that.
2976 * several files: remove all traces of the old fd_form_document,
2977 and functions belonging to that.
2979 * several files: constify local variables were possible.
2981 * several files: remove all code that was dead when NEW_EXPORT was
2984 * several files: removed string::c_str in as many places as
2987 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
2988 (e): be a bit more outspoken when patching
2989 (updatesrc): only move files if changed.
2991 * forms/layout_forms.h.patch: regenerated
2993 * forms/layout_forms.fd: remove form_document and form_paragraph
2994 and form_quotes and form_paper and form_table_options and
2995 form_paragraph_extra
2997 * forms/form1.fd: remove form_table
2999 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3000 the fdui->... rewrite. Update some comments to xforms 0.88
3002 * forms/bullet_forms.C.patch: removed file
3003 * forms/bullet_forms.fd: likewise
3004 * forms/bullet_forms.h.patch: likewise
3006 * development/Code_rules/Rules: added a section on switch
3007 statements. Updated some comment to xforms 0.88.
3009 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3011 * src/buffer.C (readFile): make sure that the whole version number
3012 is read after \lyxformat (even when it contains a comma)
3014 * lib/ui/default.ui: change shortcut of math menu to M-a.
3016 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3018 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3021 * src/LyXView.C (updateWindowTitle): show the full files name in
3022 window title, limited to 30 characters.
3024 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3025 When a number of characters has been given, we should not assume
3026 that the string is 0-terminated.
3028 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3029 calls (fixes some memory leaks)
3031 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3032 trans member on exit.
3034 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3036 * src/converter.C (GetReachable): fix typo.
3038 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3039 understand ',' instead of '.'.
3040 (GetInteger): rewrite to use strToInt().
3042 2000-09-26 Juergen Vigna <jug@sad.it>
3044 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3045 better visibility and error-message on wrong VSpace input.
3047 * src/language.C (initL): added english again.
3049 2000-09-25 Juergen Vigna <jug@sad.it>
3051 * src/frontends/kde/Dialogs.C (Dialogs):
3052 * src/frontends/gnome/Dialogs.C (Dialogs):
3053 * src/frontends/kde/Makefile.am:
3054 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3056 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3058 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3060 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3062 * src/frontends/xforms/FormParagraph.C:
3063 * src/frontends/xforms/FormParagraph.h:
3064 * src/frontends/xforms/form_paragraph.C:
3065 * src/frontends/xforms/form_paragraph.h:
3066 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3069 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3071 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3072 Paragraph-Data after use.
3074 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3075 non breakable paragraphs.
3077 2000-09-25 Garst R. Reese <reese@isn.net>
3079 * src/language.C (initL): added missing language_country codes.
3081 2000-09-25 Juergen Vigna <jug@sad.it>
3083 * src/insets/insettext.C (InsetText):
3084 (deleteLyXText): remove the not released LyXText structure!
3086 2000-09-24 Marko Vendelin <markov@ioc.ee>
3088 * src/frontends/gnome/mainapp.C
3089 * src/frontends/gnome/mainapp.h: added support for keyboard
3092 * src/frontends/gnome/FormCitation.C
3093 * src/frontends/gnome/FormCitation.h
3094 * src/frontends/gnome/Makefile.am
3095 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3096 FormCitation to use "action area" in mainapp window
3098 * src/frontends/gnome/Menubar_pimpl.C
3099 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3102 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3104 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3105 width/descent/ascent values if name is empty.
3106 (mathed_string_height): Use std::max.
3108 2000-09-25 Allan Rae <rae@lyx.org>
3110 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
3111 segfault. This will be completely redesigned soon.
3113 * sigc++: updated libsigc++. Fixes struct timespec bug.
3115 * development/tools/makeLyXsigc.sh: .cvsignore addition
3117 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3119 * several files: removed almost all traces of the old table
3122 * src/TableLayout.C: removed file
3124 2000-09-22 Juergen Vigna <jug@sad.it>
3126 * src/frontends/kde/Dialogs.C: added credits forms.
3128 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
3130 * src/frontends/gnome/Dialogs.C: added some forms.
3132 * src/spellchecker.C (init_spell_checker): set language in pspell code
3133 (RunSpellChecker): some modifications for setting language string.
3135 * src/language.[Ch]: added language_country code.
3137 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
3139 * src/frontends/Dialogs.h: added new signal showError.
3140 Rearranged existing signals in some sort of alphabetical order.
3142 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
3143 FormError.[Ch], form_error.[Ch]
3144 * src/frontends/xforms/forms/makefile: added new file form_error.fd
3145 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
3147 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
3148 dialogs. I think that this can be used as the base to all these
3151 * src/frontends/xforms/FormError.[Ch]
3152 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
3153 implementation of InsetError dialog.
3155 * src/insets/inseterror.[Ch]: rendered GUI-independent.
3157 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
3158 * src/frontends/kde/Makefile.am: ditto
3160 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
3162 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
3163 macrobf. This fixes a bug of invisible text.
3165 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3167 * lib/doc/LaTeXConfig.lyx.in: updated.
3169 * src/language.C (initL): remove language "francais" and change a
3170 bit the names of the two other french variations.
3172 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
3173 string that may not be 0-terminated.
3175 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3177 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
3179 2000-09-20 Marko Vendelin <markov@ioc.ee>
3181 * src/frontends/gnome/FormCitation.C
3182 * src/frontends/gnome/FormIndex.C
3183 * src/frontends/gnome/FormToc.C
3184 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
3185 the variable initialization to shut up the warnings
3187 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3189 * src/table.[Ch]: deleted files
3191 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
3194 2000-09-18 Juergen Vigna <jug@sad.it>
3196 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
3197 problems with selection. Inserted new LFUN_PASTESELECTION.
3198 (InsetButtonPress): inserted handling of middle mouse-button paste.
3200 * src/spellchecker.C: changed word to word.c_str().
3202 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
3204 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
3205 included in the ``make dist'' tarball.
3207 2000-09-15 Juergen Vigna <jug@sad.it>
3209 * src/CutAndPaste.C (cutSelection): small fix return the right
3210 end position after cut inside one paragraph only.
3212 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
3213 we are locked as otherwise we don't have a valid cursor position!
3215 * src/insets/figinset.C (draw): small bugfix but why is this needed???
3217 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
3219 * src/frontends/kde/FormRef.C: added using directive.
3220 * src/frontends/kde/FormToc.C: ditto
3222 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
3224 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
3226 2000-09-19 Marko Vendelin <markov@ioc.ee>
3228 * src/frontends/gnome/Menubar_pimpl.C
3229 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
3230 Toc, ViewFormats, UpdateFormats, and ExportFormats.
3232 * src/frontends/gnome/mainapp.C
3233 * src/frontends/gnome/mainapp.h: support for menu update used
3236 * src/frontends/gnome/mainapp.C
3237 * src/frontends/gnome/mainapp.h: support for "action" area in the
3238 main window. This area is used by small simple dialogs, such as
3241 * src/frontends/gnome/FormIndex.C
3242 * src/frontends/gnome/FormIndex.h
3243 * src/frontends/gnome/FormUrl.C
3244 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
3247 * src/frontends/gnome/FormCitation.C
3248 * src/frontends/gnome/FormCitation.h: rewrite to use main window
3249 action area. Only "Insert new citation" is implemented.
3251 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3253 * src/buffer.C (Dispatch): fix call to Dispatch
3254 * src/insets/insetref.C (Edit): likewise
3255 * src/insets/insetparent.C (Edit): likewise
3256 * src/insets/insetinclude.C (include_cb): likewise
3257 * src/frontends/xforms/FormUrl.C (apply): likewise
3258 * src/frontends/xforms/FormToc.C (apply): likewise
3259 * src/frontends/xforms/FormRef.C (apply): likewise
3260 * src/frontends/xforms/FormIndex.C (apply): likewise
3261 * src/frontends/xforms/FormCitation.C (apply): likewise
3262 * src/lyxserver.C (callback): likewise
3263 * src/lyxfunc.C (processKeySym): likewise
3264 (Dispatch): likewise
3265 (Dispatch): likewise
3266 * src/lyx_cb.C (LayoutsCB): likewise
3268 * Makefile.am (sourcedoc): small change
3270 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3272 * src/main.C (main): Don't make an empty GUIRunTime object. all
3273 methods are static. constify a bit remove unneded using + headers.
3275 * src/tabular.C: some more const to local vars move some loop vars
3277 * src/spellchecker.C: added some c_str after some word for pspell
3279 * src/frontends/GUIRunTime.h: add new static method setDefaults
3280 * src/frontends/xforms/GUIRunTime.C (setDefaults):
3281 * src/frontends/kde/GUIRunTime.C (setDefaults):
3282 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
3284 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
3285 with strnew in arg, use correct emptystring when calling SetName.
3287 * several files: remove all commented code with relation to
3288 HAVE_SSTREAM beeing false. We now only support stringstream and
3291 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3293 * src/lyxfunc.C: construct correctly the automatic new file
3296 * src/text2.C (IsStringInText): change type of variable i to shut
3299 * src/support/sstream.h: do not use namespaces if the compiler
3300 does not support them.
3302 2000-09-15 Marko Vendelin <markov@ioc.ee>
3303 * src/frontends/gnome/FormCitation.C
3304 * src/frontends/gnome/FormCitation.h
3305 * src/frontends/gnome/diainsertcitation_interface.c
3306 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
3307 regexp support to FormCitation [Gnome].
3309 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
3312 * configure.in: remove unused KDE/GTKGUI define
3314 * src/frontends/kde/FormRef.C
3315 * src/frontends/kde/FormRef.h
3316 * src/frontends/kde/formrefdialog.C
3317 * src/frontends/kde/formrefdialog.h: double click will
3318 go to reference, now it is possible to change a cross-ref
3321 * src/frontends/kde/FormToc.C
3322 * src/frontends/kde/FormToc.h
3323 * src/frontends/kde/formtocdialog.C
3324 * src/frontends/kde/formtocdialog.h: add a depth
3327 * src/frontends/kde/Makefile.am: add QtLyXView.h
3330 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
3332 * src/frontends/kde/FormCitation.h: added some using directives.
3334 * src/frontends/kde/FormToc.h: corrected definition of doTree.
3336 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
3339 * src/mathed/math_defs.h: redefine SetAlign to use string rather
3342 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3344 * src/buffer.C (pop_tag): revert for the second time a change by
3345 Lars, who seems to really hate having non-local loop variables :)
3347 * src/Lsstream.h: add "using" statements.
3349 * src/support/copy.C (copy): add a bunch of std:: qualifiers
3350 * src/buffer.C (writeFile): ditto
3352 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3354 * src/buffer.C (writeFile): try to fix the locale modified format
3355 number to always be as we want it.
3357 * src/WorkArea.C (work_area_handler): try to workaround the bugs
3358 in XForms 0.89. C-space is now working again.
3360 * src/Lsstream.h src/support/sstream.h: new files.
3362 * also commented out all cases where strstream were used.
3364 * src/Bullet.h (c_str): remove method.
3366 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
3368 * a lot of files: get rid of "char const *" and "char *" is as
3369 many places as possible. We only want to use them in interaction
3370 with system of other libraries, not inside lyx.
3372 * a lot of files: return const object is not of pod type. This
3373 helps ensure that temporary objects is not modified. And fits well
3374 with "programming by contract".
3376 * configure.in: check for the locale header too
3378 * Makefile.am (sourcedoc): new tag for generation of doc++
3381 2000-09-14 Juergen Vigna <jug@sad.it>
3383 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
3384 callback to check which combo called it and do the right action.
3386 * src/combox.C (combo_cb): added combo * to the callbacks.
3387 (Hide): moved call of callback after Ungrab of the pointer.
3389 * src/intl.h: removed LCombo2 function.
3391 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
3392 function as this can now be handled in one function.
3394 * src/combox.h: added Combox * to callback prototype.
3396 * src/frontends/xforms/Toolbar_pimpl.C:
3397 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
3399 2000-09-14 Garst Reese <reese@isn.net>
3401 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
3402 moved usepackage{xxx}'s to beginning of file. Changed left margin
3403 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
3404 underlining from title. Thanks to John Culleton for useful suggestions.
3406 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3408 * src/lyxlex_pimpl.C (setFile): change error message to debug
3411 2000-09-13 Juergen Vigna <jug@sad.it>
3413 * src/frontends/xforms/FormDocument.C: implemented choice_class
3414 as combox and give callback to combo_language so OK/Apply is activated
3417 * src/bufferlist.C (newFile): small fix so already named files
3418 (via an open call) are not requested to be named again on the
3421 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3423 * src/frontends/kde/Makefile.am
3424 * src/frontends/kde/FormRef.C
3425 * src/frontends/kde/FormRef.h
3426 * src/frontends/kde/formrefdialog.C
3427 * src/frontends/kde/formrefdialog.h: implement
3430 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3432 * src/frontends/kde/formtocdialog.C
3433 * src/frontends/kde/formtocdialog.h
3434 * src/frontends/kde/FormToc.C
3435 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
3437 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
3439 * src/frontends/kde/FormCitation.C: fix thinko
3440 where we didn't always display the reference text
3443 * src/frontends/kde/formurldialog.C
3444 * src/frontends/kde/formurldialog.h
3445 * src/frontends/kde/FormUrl.C
3446 * src/frontends/kde/FormUrl.h: minor cleanups
3448 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
3450 * src/frontends/kde/Makefile.am
3451 * src/frontends/kde/FormToc.C
3452 * src/frontends/kde/FormToc.h
3453 * src/frontends/kde/FormCitation.C
3454 * src/frontends/kde/FormCitation.h
3455 * src/frontends/kde/FormIndex.C
3456 * src/frontends/kde/FormIndex.h
3457 * src/frontends/kde/formtocdialog.C
3458 * src/frontends/kde/formtocdialog.h
3459 * src/frontends/kde/formcitationdialog.C
3460 * src/frontends/kde/formcitationdialog.h
3461 * src/frontends/kde/formindexdialog.C
3462 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
3464 2000-09-12 Juergen Vigna <jug@sad.it>
3466 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
3469 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3471 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
3474 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
3476 * src/converter.C (Add, Convert): Added support for converter flags:
3477 needaux, resultdir, resultfile.
3478 (Convert): Added new parameter view_file.
3479 (dvips_options): Fixed letter paper option.
3481 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
3482 (Export, GetExportableFormats, GetViewableFormats): Added support
3485 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
3487 (easyParse): Fixed to work with new export code.
3489 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
3492 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
3494 * lib/bind/*.bind: Replaced
3495 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
3496 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
3498 2000-09-11 Juergen Vigna <jug@sad.it>
3500 * src/lyx_gui.C (runTime): uses global guiruntime variable.
3502 * src/main.C (main): now GUII defines global guiruntime!
3504 * src/frontends/gnome/GUIRunTime.C (initApplication):
3505 * src/frontends/kde/GUIRunTime.C (initApplication):
3506 * src/frontends/xforms/GUIRunTime.C (initApplication):
3507 * src/frontends/GUIRunTime.h: added new function initApplication.
3509 * src/spellchecker.C (sc_accept_word): change to add_to_session.
3511 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
3513 2000-09-08 Juergen Vigna <jug@sad.it>
3515 * src/lyx_gui.C (create_forms): don't display the "default" entry as
3516 we have already "Reset".
3518 * src/language.C (initL): inserted "default" language and made this
3519 THE default language (and not american!)
3521 * src/paragraph.C: inserted handling of "default" language!
3523 * src/lyxfont.C: ditto
3527 * src/paragraph.C: output the \\par only if we have a following
3528 paragraph otherwise it's not needed.
3530 2000-09-05 Juergen Vigna <jug@sad.it>
3532 * config/pspell.m4: added entry to lyx-flags
3534 * src/spellchecker.C: modified version from Kevin for using pspell
3536 2000-09-01 Marko Vendelin <markov@ioc.ee>
3537 * src/frontends/gnome/Makefile.am
3538 * src/frontends/gnome/FormCitation.C
3539 * src/frontends/gnome/FormCitation.h
3540 * src/frontends/gnome/diainsertcitation_callbacks.c
3541 * src/frontends/gnome/diainsertcitation_callbacks.h
3542 * src/frontends/gnome/diainsertcitation_interface.c
3543 * src/frontends/gnome/diainsertcitation_interface.h
3544 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
3545 dialog for Gnome frontend
3547 * src/main.C: Gnome libraries require keeping application name
3548 and its version as strings
3550 * src/frontends/gnome/mainapp.C: Change the name of the main window
3551 from GnomeLyX to PACKAGE
3553 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3555 * src/frontends/Liason.C: add "using: declaration.
3557 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
3559 * src/mathed/math_macro.C (Metrics): Set the size of the template
3561 * src/mathed/formulamacro.C (Latex): Fixed the returned value
3563 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
3565 * src/converter.C (add_options): New function.
3566 (SetViewer): Change $$FName into '$$FName'.
3567 (View): Add options when running xdvi
3568 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
3569 (Convert): The 3rd parameter is now the desired filename. Converts
3570 calls to lyx::rename if necessary.
3571 Add options when running dvips.
3572 (dvi_papersize,dvips_options): New methods.
3574 * src/exporter.C (Export): Use getLatexName() instead of fileName().
3576 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
3577 using a call to Converter::dvips_options.
3578 Fixed to work with nex export code.
3580 * src/support/copy.C
3581 * src/support/rename.C: New files
3583 * src/support/syscall.h
3584 * src/support/syscall.C: Added Starttype SystemDontWait.
3586 * lib/ui/default.ui: Changed to work with new export code
3588 * lib/configure.m4: Changed to work with new export code
3590 * src/encoding.C: Changed latex name for iso8859_7 encoding.
3592 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
3594 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
3595 so that code compiles with DEC cxx.
3597 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
3598 to work correctly! Also now supports the additional elements
3601 2000-09-01 Allan Rae <rae@lyx.org>
3603 * src/frontends/ButtonPolicies.C: renamed all the references to
3604 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
3606 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
3607 since it's a const not a type.
3609 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
3611 2000-08-31 Juergen Vigna <jug@sad.it>
3613 * src/insets/figinset.C: Various changes to look if the filename has
3614 an extension and if not add it for inline previewing.
3616 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3618 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
3619 make buttonStatus and isReadOnly be const methods. (also reflect
3620 this in derived classes.)
3622 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
3623 (nextState): change to be static inline, pass the StateMachine as
3625 (PreferencesPolicy): remove casts
3626 (OkCancelPolicy): remvoe casts
3627 (OkCancelReadOnlyPolicy): remove casts
3628 (NoRepeatedApplyReadOnlyPolicy): remove casts
3629 (OkApplyCancelReadOnlyPolicy): remove casts
3630 (OkApplyCancelPolicy): remove casts
3631 (NoRepeatedApplyPolicy): remove casts
3633 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
3635 * src/converter.C: added some using directives
3637 * src/frontends/ButtonPolicies.C: changes to overcome
3638 "need lvalue" error with DEC c++
3640 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
3641 to WMHideCB for DEC c++
3643 * src/frontends/xforms/Menubar_pimpl.C: added using directive
3645 * src/frontends/xforms/forms/form_document.C.patch: use C callback
3646 to BulletBMTableCB for DEC c++
3648 2000-08-31 Allan Rae <rae@lyx.org>
3650 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
3651 character dialog separately from old document dialogs combo_language.
3654 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3656 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
3657 Removed LFUN_REF_CREATE.
3659 * src/MenuBackend.C: Added new tags: toc and references
3661 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
3662 (add_lastfiles, add_documents, add_formats): Removed the unused smn
3664 (add_toc, add_references): New methods.
3665 (create_submenu): Handle correctly the case when there is a
3666 seperator after optional menu items.
3668 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
3669 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
3670 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
3672 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
3674 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3676 * src/converter.[Ch]: New file for converting between different
3679 * src/export.[Ch]: New file for exporting a LyX file to different
3682 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
3683 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
3684 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
3685 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
3686 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
3687 RunDocBook, MenuExport.
3689 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
3690 Exporter::Preview methods if NEW_EXPORT is defined.
3692 * src/buffer.C (Dispatch): Use Exporter::Export.
3694 * src/lyxrc.C: Added new tags: \converter and \viewer.
3697 * src/LyXAction.C: Define new lyx-function: buffer-update.
3698 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
3699 when NEW_EXPORT is defined.
3701 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
3703 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
3705 * lib/ui/default.ui: Added submenus "view" and "update" to the
3708 * src/filetools.C (GetExtension): New function.
3710 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
3712 2000-08-29 Allan Rae <rae@lyx.org>
3714 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
3716 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
3717 (EnableDocumentLayout): removed
3718 (DisableDocumentLayout): removed
3719 (build): make use of ButtonController's read-only handling to
3720 de/activate various objects. Replaces both of the above functions.
3722 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
3723 (readOnly): was read_only
3724 (refresh): fixed dumb mistakes with read_only_ handling
3726 * src/frontends/xforms/forms/form_document.fd:
3727 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
3728 tabbed dialogs so the tabs look more like tabs and so its easier to
3729 work out which is the current tab.
3731 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
3732 segfault with form_table
3734 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
3736 2000-08-28 Juergen Vigna <jug@sad.it>
3738 * acconfig.h: added USE_PSPELL.
3740 * src/config.h.in: added USE_PSPELL.
3742 * autogen.sh: added pspell.m4
3744 * config/pspell.m4: new file.
3746 * src/spellchecker.C: implemented support for pspell libary.
3748 2000-08-25 Juergen Vigna <jug@sad.it>
3750 * src/LyXAction.C (init): renamed LFUN_TABLE to
3751 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
3753 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
3755 * src/lyxscreen.h: add force_clear variable and fuction to force
3756 a clear area when redrawing in LyXText.
3758 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
3760 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3762 * some whitespace and comment changes.
3764 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
3766 * src/buffer.C: up te LYX_FORMAT to 2.17
3768 2000-08-23 Juergen Vigna <jug@sad.it>
3770 * src/BufferView_pimpl.C (tripleClick): disable this when in a
3773 * src/insets/insettabular.C (pasteSelection): delete the insets
3774 LyXText as it is not valid anymore.
3775 (copySelection): new function.
3776 (pasteSelection): new function.
3777 (cutSelection): new function.
3778 (LocalDispatch): implemented cut/copy/paste of cell selections.
3780 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
3781 don't have a LyXText.
3783 * src/LyXAction.C (init): a NEW_TABULAR define too much.
3785 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
3788 2000-08-22 Juergen Vigna <jug@sad.it>
3790 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
3791 ifdef form_table out if NEW_TABULAR.
3793 2000-08-21 Juergen Vigna <jug@sad.it>
3795 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
3796 (draw): fixed draw position so that the cursor is positioned in the
3798 (InsetMotionNotify): hide/show cursor so the position is updated.
3799 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
3800 using cellstart() function where it should be used.
3802 * src/insets/insettext.C (draw): ditto.
3804 * src/tabular.C: fixed initialization of some missing variables and
3805 made BoxType into an enum.
3807 2000-08-22 Marko Vendelin <markov@ioc.ee>
3808 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
3809 stock menu item using action numerical value, not its string
3813 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3815 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
3816 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
3818 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
3820 * src/frontends/xforms/GUIRunTime.C: new file
3822 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
3823 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3825 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
3827 * src/frontends/kde/GUIRunTime.C: new file
3829 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
3830 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3832 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
3834 * src/frontends/gnome/GUIRunTime.C: new file
3836 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
3839 * src/frontends/GUIRunTime.h: removed constructor and destructor,
3840 small change to documetentation.
3842 * src/frontends/GUIRunTime.C: removed file
3844 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
3846 * src/lyxparagraph.h: enable NEW_TABULAR as default
3848 * src/lyxfunc.C (processKeySym): remove some commented code
3850 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
3851 NEW_TABULAR around the fd_form_table_options.
3853 * src/lyx_gui.C (runTime): call the static member function as
3854 GUIRunTime::runTime().
3856 2000-08-21 Allan Rae <rae@lyx.org>
3858 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
3861 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
3863 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
3865 2000-08-21 Allan Rae <rae@lyx.org>
3867 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
3868 keep Garst happy ;-)
3869 * src/frontends/xforms/FormPreferences.C (build): use setOK
3870 * src/frontends/xforms/FormDocument.C (build): use setOK
3871 (FormDocument): use the appropriate policy.
3873 2000-08-21 Allan Rae <rae@lyx.org>
3875 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
3876 automatic [de]activation of arbitrary objects when in a read-only state.
3878 * src/frontends/ButtonPolicies.h: More documentation
3879 (isReadOnly): added to support the above.
3881 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
3883 2000-08-18 Juergen Vigna <jug@sad.it>
3885 * src/insets/insettabular.C (getStatus): changed to return func_status.
3887 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
3888 display toggle menu entries if they are.
3890 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
3891 new document layout now.
3893 * src/lyxfunc.C: ditto
3895 * src/lyx_gui_misc.C: ditto
3897 * src/lyx_gui.C: ditto
3899 * lib/ui/default.ui: removed paper and quotes layout as they are now
3900 all in the document layout tabbed folder.
3902 * src/frontends/xforms/forms/form_document.fd: added Restore
3903 button and callbacks for all inputs for Allan's ButtonPolicy.
3905 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
3906 (CheckChoiceClass): added missing params setting on class change.
3907 (UpdateLayoutDocument): added for updating the layout on params.
3908 (build): forgot to RETURN_ALWAYS input_doc_spacing.
3909 (FormDocument): Implemented Allan's ButtonPolicy with the
3912 2000-08-17 Allan Rae <rae@lyx.org>
3914 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
3915 so we can at least see the credits again.
3917 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
3918 controller calls for the appropriate callbacks. Note that since Ok
3919 calls apply followed by cancel, and apply isn't a valid input for the
3920 APPLIED state, the bc_ calls have to be made in the static callback not
3921 within each of the real callbacks.
3923 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
3924 (setOk): renamed from setOkay()
3926 2000-08-17 Juergen Vigna <jug@sad.it>
3928 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
3929 in the implementation part.
3930 (composeUIInfo): don't show optional menu-items.
3932 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
3934 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
3936 * src/bufferview_funcs.C (CurrentState): fixed to show also the
3937 text-state when in a text-inset.
3939 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
3941 2000-08-17 Marko Vendelin <markov@ioc.ee>
3942 * src/frontends/gnome/FormIndex.C
3943 * src/frontends/gnome/FormIndex.h
3944 * src/frontends/gnome/FormToc.C
3945 * src/frontends/gnome/FormToc.h
3946 * src/frontends/gnome/dialogs
3947 * src/frontends/gnome/diatoc_callbacks.c
3948 * src/frontends/gnome/diatoc_callbacks.h
3949 * src/frontends/gnome/diainsertindex_callbacks.h
3950 * src/frontends/gnome/diainsertindex_callbacks.c
3951 * src/frontends/gnome/diainsertindex_interface.c
3952 * src/frontends/gnome/diainsertindex_interface.h
3953 * src/frontends/gnome/diatoc_interface.h
3954 * src/frontends/gnome/diatoc_interface.c
3955 * src/frontends/gnome/Makefile.am: Table of Contents and
3956 Insert Index dialogs implementation for Gnome frontend
3958 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
3960 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
3962 * src/frontends/gnome/diainserturl_interface.c: make the dialog
3965 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3967 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
3968 destructor. Don't definde if you don't need it
3969 (processEvents): made static, non-blocking events processing for
3971 (runTime): static method. event loop for xforms
3972 * similar as above for kde and gnome.
3974 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
3975 new Pimpl is correct
3976 (runTime): new method calss the real frontends runtime func.
3978 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
3980 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3982 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
3984 2000-08-16 Juergen Vigna <jug@sad.it>
3986 * src/lyx_gui.C (runTime): added GUII RunTime support.
3988 * src/frontends/Makefile.am:
3989 * src/frontends/GUIRunTime.[Ch]:
3990 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
3991 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
3992 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
3994 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
3996 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
3997 as this is already set in ${FRONTEND_INCLUDE} if needed.
3999 * configure.in (CPPFLAGS): setting the include dir for the frontend
4000 directory and don't set FRONTEND=xforms for now as this is executed
4003 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4005 * src/frontends/kde/Makefile.am:
4006 * src/frontends/kde/FormUrl.C:
4007 * src/frontends/kde/FormUrl.h:
4008 * src/frontends/kde/formurldialog.h:
4009 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4011 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4013 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4015 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4017 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4020 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4022 * src/WorkArea.C (work_area_handler): more work to get te
4023 FL_KEYBOARD to work with xforms 0.88 too, please test.
4025 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4027 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4029 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4032 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4034 * src/Timeout.h: remove Qt::emit hack.
4036 * several files: changes to allo doc++ compilation
4038 * src/lyxfunc.C (processKeySym): new method
4039 (processKeyEvent): comment out if FL_REVISION < 89
4041 * src/WorkArea.C: change some debugging levels.
4042 (WorkArea): set wantkey to FL_KEY_ALL
4043 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4044 clearer code and the use of compose with XForms 0.89. Change to
4045 use signals instead of calling methods in bufferview directly.
4047 * src/Painter.C: change some debugging levels.
4049 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4052 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4053 (workAreaKeyPress): new method
4055 2000-08-14 Juergen Vigna <jug@sad.it>
4057 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4059 * config/kde.m4: addes some features
4061 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4062 include missing xforms dialogs.
4064 * src/Timeout.h: a hack to be able to compile with qt/kde.
4066 * sigc++/.cvsignore: added acinclude.m4
4068 * lib/.cvsignore: added listerros
4070 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4071 xforms tree as objects are needed for other frontends.
4073 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4074 linking with not yet implemented xforms objects.
4076 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4078 2000-08-14 Baruch Even <baruch.even@writeme.com>
4080 * src/frontends/xforms/FormGraphics.h:
4081 * src/frontends/xforms/FormGraphics.C:
4082 * src/frontends/xforms/RadioButtonGroup.h:
4083 * src/frontends/xforms/RadioButtonGroup.C:
4084 * src/insets/insetgraphics.h:
4085 * src/insets/insetgraphics.C:
4086 * src/insets/insetgraphicsParams.h:
4087 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4088 instead of spaces, and various other indentation issues to make the
4089 sources more consistent.
4091 2000-08-14 Marko Vendelin <markov@ioc.ee>
4093 * src/frontends/gnome/dialogs/diaprint.glade
4094 * src/frontends/gnome/FormPrint.C
4095 * src/frontends/gnome/FormPrint.h
4096 * src/frontends/gnome/diaprint_callbacks.c
4097 * src/frontends/gnome/diaprint_callbacks.h
4098 * src/frontends/gnome/diaprint_interface.c
4099 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4102 * src/frontends/gnome/dialogs/diainserturl.glade
4103 * src/frontends/gnome/FormUrl.C
4104 * src/frontends/gnome/FormUrl.h
4105 * src/frontends/gnome/diainserturl_callbacks.c
4106 * src/frontends/gnome/diainserturl_callbacks.h
4107 * src/frontends/gnome/diainserturl_interface.c
4108 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
4109 Gnome implementation
4111 * src/frontends/gnome/Dialogs.C
4112 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
4113 all other dialogs. Copy all unimplemented dialogs from Xforms
4116 * src/frontends/gnome/support.c
4117 * src/frontends/gnome/support.h: support files generated by Glade
4121 * config/gnome.m4: Gnome configuration scripts
4123 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4124 configure --help message
4126 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
4127 only if there are no events pendling in Gnome/Gtk. This enhances
4128 the performance of menus.
4131 2000-08-14 Allan Rae <rae@lyx.org>
4133 * lib/Makefile.am: listerrors cleaning
4135 * lib/listerrors: removed -- generated file
4136 * acinclude.m4: ditto
4137 * sigc++/acinclude.m4: ditto
4139 * src/frontends/xforms/forms/form_citation.fd:
4140 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
4143 * src/frontends/xforms/forms/makefile: I renamed the `install` target
4144 `updatesrc` and now we have a `test` target that does what `updatesrc`
4145 used to do. I didn't like having an install target that wasn't related
4148 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
4149 on all except FormGraphics. This may yet happen. Followed by a major
4150 cleanup including using FL_TRANSIENT for most of the dialogs. More
4151 changes to come when the ButtonController below is introduced.
4153 * src/frontends/xforms/ButtonController.h: New file for managing up to
4154 four buttons on a dialog according to an externally defined policy.
4155 * src/frontends/xforms/Makefile.am: added above
4157 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
4158 Apply and Cancel/Close buttons and everything in between and beyond.
4159 * src/frontends/Makefile.am: added above.
4161 * src/frontends/xforms/forms/form_preferences.fd:
4162 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
4163 and removed variable 'status' as a result. Fixed the set_minsize thing.
4164 Use the new screen-font-update after checking screen fonts were changed
4165 Added a "Restore" button to restore the original lyxrc values while
4166 editing. This restores everything not just the last input changed.
4167 That's still a tricky one. As is the "LyX: this shouldn't happen..."
4169 * src/LyXAction.C: screen-font-update added for updating buffers after
4170 screen font settings have been changed.
4171 * src/commandtags.h: ditto
4172 * src/lyxfunc.C: ditto
4174 * forms/lyx.fd: removed screen fonts dialog.
4175 * src/lyx_gui.C: ditto
4176 * src/menus.[Ch]: ditto
4177 * src/lyx.[Ch]: ditto
4178 * src/lyx_cb.C: ditto + code from here moved to make
4179 screen-font-update. And people wonder why progress on GUII is
4180 slow. Look at how scattered this stuff was! It takes forever
4183 * forms/fdfix.sh: Fixup the spacing after commas.
4184 * forms/makefile: Remove date from generated files. Fewer clashes now.
4185 * forms/bullet_forms.C.patch: included someones handwritten changes
4187 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
4188 once I've discovered why LyXRC was made noncopyable.
4189 * src/lyx_main.C: ditto
4191 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
4193 * src/frontends/xforms/forms/fdfix.sh:
4194 * src/frontends/xforms/forms/fdfixh.sed:
4195 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
4196 * src/frontends/xforms/Form*.[hC]:
4197 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
4198 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
4199 provide a destructor for the struct FD_form_xxxx. Another version of
4200 the set_[max|min]size workaround and a few other cleanups. Actually,
4201 Angus' patch from 20000809.
4203 2000-08-13 Baruch Even <baruch.even@writeme.com>
4205 * src/insets/insetgraphics.C (Clone): Added several fields that needed
4208 2000-08-11 Juergen Vigna <jug@sad.it>
4210 * src/insets/insetgraphics.C (InsetGraphics): changing init
4211 order because of warnings.
4213 * src/frontends/xforms/forms/makefile: adding patching .C with
4216 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
4217 from .C.patch to .c.patch
4219 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
4220 order because of warning.
4222 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
4224 * src/frontends/Liason.C (setMinibuffer): new helper function
4226 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
4228 * src/lyxfunc.C (Dispatch): calling new Document-Layout
4230 * lib/ui/default.ui: commented out PaperLayout entry
4232 * src/frontends/xforms/form_document.[Ch]: new added files
4234 * src/frontends/xforms/FormDocument.[Ch]: ditto
4236 * src/frontends/xforms/forms/form_document.fd: ditto
4238 * src/frontends/xforms/forms/form_document.C.patch: ditto
4240 2000-08-10 Juergen Vigna <jug@sad.it>
4242 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
4243 (InsetGraphics): initialized cacheHandle to 0.
4244 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
4246 2000-08-10 Baruch Even <baruch.even@writeme.com>
4248 * src/graphics/GraphicsCache.h:
4249 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
4250 correctly as a cache.
4252 * src/graphics/GraphicsCacheItem.h:
4253 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
4256 * src/graphics/GraphicsCacheItem_pimpl.h:
4257 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
4260 * src/insets/insetgraphics.h:
4261 * src/insets/insetgraphics.C: Changed from using a signal notification
4262 to polling when image is not loaded.
4264 2000-08-10 Allan Rae <rae@lyx.org>
4266 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
4267 that there are two functions that have to been taken out of line by
4268 hand and aren't taken care of in the script. (Just a reminder note)
4270 * sigc++/macros/*.h.m4: Updated as above.
4272 2000-08-09 Juergen Vigna <jug@sad.it>
4274 * src/insets/insettext.C (draw): small fix for clearing rectangle.
4276 * src/insets/insettabular.C: make drawing of single cell smarter.
4278 2000-08-09 Marko Vendelin <markov@ioc.ee>
4279 * src/frontends/gnome/Menubar_pimpl.C
4280 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
4281 implementation: new files
4283 * src/frontends/gnome/mainapp.C
4284 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
4287 * src/main.C: create Gnome main window
4289 * src/frontends/xforms/Menubar_pimpl.h
4290 * src/frontends/Menubar.C
4291 * src/frontends/Menubar.h: added method Menubar::update that calls
4292 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
4294 * src/LyXView.C: calls Menubar::update to update the state
4297 * src/frontends/gnome/Makefile.am: added new files
4299 * src/frontends/Makefile.am: added frontend compiler options
4301 2000-08-08 Juergen Vigna <jug@sad.it>
4303 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
4305 * src/bufferlist.C (close):
4306 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
4307 documents if exiting without saving.
4309 * src/buffer.C (save): use removeAutosaveFile()
4311 * src/support/filetools.C (removeAutosaveFile): new function.
4313 * src/lyx_cb.C (MenuWrite): returns a bool now.
4314 (MenuWriteAs): check if file could really be saved and revert to the
4316 (MenuWriteAs): removing old autosavefile if existant.
4318 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
4319 before Goto toggle declaration, because of compiler warning.
4321 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
4323 * src/lyxfunc.C (MenuNew): small fix.
4325 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
4327 * src/bufferlist.C (newFile):
4328 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
4330 * src/lyxrc.C: added new_ask_filename tag
4332 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
4334 * src/lyx.fd: removed code pertaining to form_ref
4335 * src/lyx.[Ch]: ditto
4336 * src/lyx_cb.C: ditto
4337 * src/lyx_gui.C: ditto
4338 * src/lyx_gui_misc.C: ditto
4340 * src/BufferView_pimpl.C (restorePosition): update buffer only
4343 * src/commandtags.h (LFUN_REFTOGGLE): removed
4344 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
4345 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
4346 (LFUN_REFBACK): renamed LFUN_REF_BACK
4348 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
4349 * src/menus.C: ditto
4350 * src/lyxfunc.C (Dispatch): ditto.
4351 InsertRef dialog is now GUI-independent.
4353 * src/texrow.C: added using std::endl;
4355 * src/insets/insetref.[Ch]: strip out large amounts of code.
4356 The inset is now a container and this functionality is now
4357 managed by a new FormRef dialog
4359 * src/frontends/Dialogs.h (showRef, createRef): new signals
4361 * src/frontends/xforms/FormIndex.[Ch],
4362 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
4363 when setting dialog's min/max size
4364 * src/frontends/xforms/FormIndex.[Ch]: ditto
4366 * src/frontends/xforms/FormRef.[Ch],
4367 src/frontends/xforms/forms/form_ref.fd: new xforms
4368 implementation of an InsetRef dialog
4370 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
4373 * src/graphics/XPM_Renderer.C (isImageFormatOK):
4374 ios::nocreate is not part of the standard. Removed.
4376 2000-08-07 Baruch Even <baruch.even@writeme.com>
4378 * src/graphics/Renderer.h:
4379 * src/graphics/Renderer.C: Added base class for rendering of different
4380 image formats into Pixmaps.
4382 * src/graphics/XPM_Renderer.h:
4383 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
4384 in a different class.
4386 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
4387 easily add support for other formats.
4389 * src/insets/figinset.C: plugged a leak of an X resource.
4391 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
4393 * src/CutAndPaste.[Ch]: make all metods static.
4395 * development/Code_rules/Rules: more work, added section on
4396 Exceptions, and a References section.
4398 * a lot of header files: work to make doc++ able to generate the
4399 source documentation, some workarounds of doc++ problems. Doc++ is
4400 now able to generate the documentation.
4402 2000-08-07 Juergen Vigna <jug@sad.it>
4404 * src/insets/insettabular.C (recomputeTextInsets): removed function
4406 * src/tabular.C (SetWidthOfMulticolCell):
4408 (calculate_width_of_column_NMC): fixed return value so that it really
4409 only returns true if the column-width has changed (there where
4410 problems with muliticolumn-cells in this column).
4412 2000-08-04 Juergen Vigna <jug@sad.it>
4414 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
4415 also on the scrollstatus of the inset.
4416 (workAreaMotionNotify): ditto.
4418 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
4420 2000-08-01 Juergen Vigna <jug@sad.it>
4422 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
4424 * src/commandtags.h:
4425 * src/LyXAction.C (init):
4426 * src/insets/inset.C (LocalDispatch): added support for
4429 * src/insets/inset.C (scroll): new functions.
4431 * src/insets/insettext.C (removeNewlines): new function.
4432 (SetAutoBreakRows): removes forced newlines in the text of the
4433 paragraph if autoBreakRows is set to false.
4435 * src/tabular.C (Latex): generates a parbox around the cell contents
4438 * src/frontends/xforms/FormTabular.C (local_update): removed
4439 the radio_useparbox button.
4441 * src/tabular.C (UseParbox): new function
4443 2000-08-06 Baruch Even <baruch.even@writeme.com>
4445 * src/graphics/GraphicsCache.h:
4446 * src/graphics/GraphicsCache.C:
4447 * src/graphics/GraphicsCacheItem.h:
4448 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
4451 * src/insets/insetgraphics.h:
4452 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
4453 and the drawing of the inline image.
4455 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
4456 loaded into the wrong position.
4458 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
4461 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4463 * src/support/translator.h: move all typedefs to public section
4465 * src/support/filetools.C (MakeLatexName): return string const
4467 (TmpFileName): ditto
4468 (FileOpenSearch): ditto
4470 (LibFileSearch): ditto
4471 (i18nLibFileSearch): ditto
4474 (CreateTmpDir): ditto
4475 (CreateBufferTmpDir): ditto
4476 (CreateLyXTmpDir): ditto
4479 (MakeAbsPath): ditto
4481 (OnlyFilename): ditto
4483 (NormalizePath): ditto
4484 (CleanupPath): ditto
4485 (GetFileContents): ditto
4486 (ReplaceEnvironmentPath): ditto
4487 (MakeRelPath): ditto
4489 (ChangeExtension): ditto
4490 (MakeDisplayPath): ditto
4491 (do_popen): return cmdret const
4492 (findtexfile): return string const
4494 * src/support/DebugStream.h: add some /// to please doc++
4496 * src/frontends/DialogBase.h (endif): add some /// to please doc++
4498 * src/texrow.C (same_rownumber): functor to use with find_if
4499 (getIdFromRow): rewritten to use find_if and to not update the
4500 positions. return true if row is found
4501 (increasePos): new method, use to update positions
4503 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
4505 * src/lyxlex_pimpl.C (verifyTable): new method
4508 (GetString): return string const
4509 (pushTable): rewrite to use std::stack
4511 (setFile): better check
4514 * src/lyxlex.h: make LyXLex noncopyable
4516 * src/lyxlex.C (text): return char const * const
4517 (GetString): return string const
4518 (getLongString): return string const
4520 * src/lyx_gui_misc.C (askForText): return pair<...> const
4522 * src/lastfiles.[Ch] (operator): return string const
4524 * src/buffer.C (parseSingleLyXformat2Token): pass string to
4525 istringstream not char const *.
4526 move token.end() out of loop.
4527 (readFile): move initializaton of token
4529 * src/BufferView2.C (insertErrors): run texrow.increasePos if
4530 getIdFromRow is successful.
4532 * lib/bind/emacs.bind: don't include menus bind
4534 * development/Code_rules/Rules: the beginnings of making this
4535 better and covering more of the unwritten rules that we have.
4537 * development/Code_rules/Recommendations: a couple of wording
4540 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4542 * src/support/strerror.c: remove C++ comment.
4544 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
4546 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
4547 LFUN_INDEX_INSERT_LAST
4549 * src/texrow.C (getIdFromRow): changed from const_iterator to
4550 iterator, allowing code to compile with DEC cxx
4552 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
4553 stores part of the class, as suggested by Allan. Will allow
4555 (apply): test to apply uses InsetCommandParams operator!=
4557 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
4558 (apply): test to apply uses InsetCommandParams operator!=
4560 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
4561 stores part of the class.
4562 (update): removed limits on min/max size.
4564 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
4565 (apply): test to apply uses InsetCommandParams operator!=
4567 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
4568 (Read, Write, scanCommand, getCommand): moved functionality
4569 into InsetCommandParams.
4571 (getScreenLabel): made pure virtual
4572 new InsetCommandParams operators== and !=
4574 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
4575 c-tors based on InsetCommandParams. Removed others.
4576 * src/insets/insetinclude.[Ch]: ditto
4577 * src/insets/insetlabel.[Ch]: ditto
4578 * src/insets/insetparent.[Ch]: ditto
4579 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
4581 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
4582 insets derived from InsetCommand created using similar c-tors
4583 based on InsetCommandParams
4584 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
4585 * src/menus.C (ShowRefsMenu): ditto
4586 * src/paragraph.C (Clone): ditto
4587 * src/text2.C (SetCounter): ditto
4588 * src/lyxfunc.C (Dispatch) ditto
4589 Also recreated old InsetIndex behaviour exactly. Can now
4590 index-insert at the start of a paragraph and index-insert-last
4591 without launching the pop-up.
4593 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4595 * lib/lyxrc.example: mark te pdf options as non functional.
4597 * src/support/lstrings.C (strToInt): move initalization of tmpstr
4598 (isStrDbl): move tmpstr.end() out of loop.
4599 (strToDbl): move intialization of tmpstr
4600 (lowercase): return string const and move tmp.end() out of loop.
4601 (uppercase): return string const and move tmp.edn() out of loop.
4602 (prefixIs): add assertion
4607 (containsOnly): ditto
4608 (containsOnly): ditto
4609 (containsOnly): ditto
4610 (countChar): make last arg char not char const
4611 (token): return string const
4612 (subst): return string const, move tmp.end() out of loop.
4613 (subst): return string const, add assertion
4614 (strip): return string const
4615 (frontStrip): return string const, add assertion
4616 (frontStrip): return string const
4621 * src/support/lstrings.C: add inclde "LAssert.h"
4622 (isStrInt): move tmpstr.end() out of loop.
4624 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
4625 toollist.end() out of loop.
4626 (deactivate): move toollist.end() out of loop.
4627 (update): move toollist.end() out of loop.
4628 (updateLayoutList): move tc.end() out of loop.
4629 (add): move toollist.end() out of loop.
4631 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
4632 md.end() out of loop.
4634 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
4636 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
4639 * src/paragraph.C (Erase): move fontlist.end() out of loop.
4640 (Erase): move insetlist.end() out of loop.
4642 * src/lyx_sendfax_main.C: make show_logfile static and to take a
4643 ref to const string as first arg. Move initialization of some
4644 variables, whitespace changes.
4646 * src/kbmap.C (defkey): move table.end() out of loop.
4647 (kb_keymap): move table.end() out of loop.
4648 (findbinding): move table.end() out of loop.
4650 * src/MenuBackend.C (hasMenu): move end() out of loop.
4651 (getMenu): move end() out of loop.
4652 (getMenu): move menulist_.end() out of loop.
4654 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
4656 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
4659 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
4660 (getFromLyXName): move infotab.end() out of loop.
4662 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
4663 -fvtable-thunks -ffunction-sections -fdata-sections
4665 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
4667 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
4670 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4672 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
4674 * src/frontends/xforms/FormCitation.[Ch],
4675 src/frontends/xforms/FormIndex.[Ch],
4676 src/frontends/xforms/FormToc.[Ch],
4677 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
4679 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4681 * src/commandtags.h: renamed, created some flags for citation
4684 * src/lyx_gui_misc.C: stripped out old FD_index_form code
4686 * src/lyxfunc.C (dispatch): use signals to insert index entry
4688 * src/frontends/Dialogs.h: new signal createIndex
4690 * src/frontends/xforms/FormCommand.[Ch],
4691 src/frontends/xforms/FormCitation.[Ch],
4692 src/frontends/xforms/FormToc.[Ch],
4693 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
4695 * src/insets/insetindex.[Ch]: GUI-independent
4697 * src/frontends/xforms/FormIndex.[Ch],
4698 * src/frontends/xforms/forms/form_index.fd: xforms implementation
4701 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
4703 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
4704 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
4706 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4708 * src/insets/insetref.C (Latex): rewrite so that there is now
4709 question that a initialization is requested.
4711 * src/insets/insetcommand.h: reenable the hide signal
4713 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4715 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
4716 fix handling of shortcuts (many bugs :)
4717 (add_lastfiles): ditto.
4719 * lib/ui/default.ui: fix a few shortcuts.
4721 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
4723 * Makefile.am: Fix ``rpmdist'' target to return the exit
4724 status of the ``rpm'' command, instead of the last command in
4725 the chain (the ``rm lyx.xpm'' command, which always returns
4728 2000-08-02 Allan Rae <rae@lyx.org>
4730 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
4731 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
4732 * src/frontends/xforms/FormToc.C (FormToc): ditto
4734 * src/frontends/xforms/Makefile.am: A few forgotten files
4736 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
4737 Signals-not-copyable-problem Lars' started commenting out.
4739 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
4741 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4743 * src/insets/insetcommand.h: Signals is not copyable so anoter
4744 scheme for automatic hiding of forms must be used.
4746 * src/frontends/xforms/FormCitation.h: don't inerit from
4747 noncopyable, FormCommand already does that.
4748 * src/frontends/xforms/FormToc.h: ditto
4749 * src/frontends/xforms/FormUrl.h: ditto
4751 * src/frontends/xforms/FormCitation.C: add include <algorithm>
4753 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
4755 * src/insets/insetcommand.h (hide): new SigC::Signal0
4756 (d-tor) new virtual destructor emits hide signal
4758 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
4759 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
4761 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
4762 LOF and LOT. Inset is now GUI-independent
4764 * src/insets/insetloa.[Ch]: redundant
4765 * src/insets/insetlof.[Ch]: ditto
4766 * src/insets/insetlot.[Ch]: ditto
4768 * src/frontends/xforms/forms/form_url.fd: tweaked!
4769 * src/frontends/xforms/forms/form_citation.fd: ditto
4771 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
4772 dialogs dealing with InsetCommand insets
4774 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
4775 FormCommand base class
4776 * src/frontends/xforms/FormUrl.[Ch]: ditto
4778 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
4780 * src/frontends/xforms/FormToc.[Ch]: ditto
4782 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
4783 passed a generic InsetCommand pointer
4784 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
4786 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
4787 and modified InsetTOC class
4788 * src/buffer.C: ditto
4790 * forms/lyx.fd: strip out old FD_form_toc code
4791 * src/lyx_gui_misc.C: ditto
4792 * src/lyx_gui.C: ditto
4793 * src/lyx_cb.C: ditto
4794 * src/lyx.[Ch]: ditto
4796 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4798 * src/support/utility.hpp: tr -d '\r'
4800 2000-08-01 Juergen Vigna <jug@sad.it>
4802 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
4804 * src/commandtags.h:
4805 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
4806 LFUN_TABULAR_FEATURES.
4808 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
4809 LFUN_LAYOUT_TABULAR.
4811 * src/insets/insettabular.C (getStatus): implemented helper function.
4813 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
4815 2000-07-31 Juergen Vigna <jug@sad.it>
4817 * src/text.C (draw): fixed screen update problem for text-insets.
4819 * src/text2.C (SetParagrpah): call an update of the inset-owner when
4820 something changed probably this has to be added in various other
4823 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
4825 2000-07-31 Baruch Even <baruch.even@writeme.com>
4827 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
4828 templates to satisfy compaq cxx.
4831 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4833 * src/support/translator.h (equal_1st_in_pair::operator()): take
4834 const ref pair_type as arg.
4835 (equal_2nd_in_pair::operator()): ditto
4836 (Translator::~Translator): remove empty d-tor.
4838 * src/graphics/GraphicsCache.C: move include config.h to top, also
4839 put initialization of GraphicsCache::singleton here.
4840 (~GraphicsCache): move here
4841 (addFile): take const ref as arg
4844 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
4846 * src/BufferView2.C (insertLyXFile): change te with/without header
4849 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4851 * src/frontends/xforms/FormGraphics.C (apply): add some
4852 static_cast. Not very nice, but required by compaq cxx.
4854 * src/frontends/xforms/RadioButtonGroup.h: include header
4855 <utility> instead of <pair.h>
4857 * src/insets/insetgraphicsParams.C: add using directive.
4858 (readResize): change return type to void.
4859 (readOrigin): ditto.
4861 * src/lyxfunc.C (getStatus): add missing break for build-program
4862 function; add test for Literate for export functions.
4864 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
4865 entries in Options menu.
4867 2000-07-31 Baruch Even <baruch.even@writeme.com>
4869 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
4870 protect against auto-allocation; release icon when needed.
4872 2000-07-31 Matej Cepl <CeplM@seznam.cz>
4874 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
4875 on usual typewriter.
4877 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
4878 earlier czech.kmap), useful only for programming.
4880 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4882 * src/frontends/xforms/FormCitation.h: fix conditioning around
4885 2000-07-31 Juergen Vigna <jug@sad.it>
4887 * src/frontends/xforms/FormTabular.C (local_update): changed
4888 radio_linebreaks to radio_useparbox and added radio_useminipage.
4890 * src/tabular.C: made support for using minipages/parboxes.
4892 * src/bufferlist.C (QwriteAll): small fix for asking for save.
4894 * src/insets/insetgraphics.C (draw): just draw the inset so that the
4896 (descent): so the cursor is in the middle.
4897 (width): bit smaller box.
4899 * src/insets/insetgraphics.h: added display() function.
4901 2000-07-31 Baruch Even <baruch.even@writeme.com>
4903 * src/frontends/Dialogs.h: Added showGraphics signals.
4905 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
4906 xforms form definition of the graphics dialog.
4908 * src/frontends/xforms/FormGraphics.h:
4909 * src/frontends/xforms/FormGraphics.C: Added files, the
4910 GUIndependent code of InsetGraphics
4912 * src/insets/insetgraphics.h:
4913 * src/insets/insetgraphics.C: Major writing to make it work.
4915 * src/insets/insetgraphicsParams.h:
4916 * src/insets/insetgraphicsParams.C: Added files, parameter passing
4917 struct between InsetGraphics and GUI.
4919 * src/LaTeXFeatures.h:
4920 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
4921 support for graphicx package.
4923 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
4924 for the graphics inset.
4926 * src/support/translator.h: Added file, used in
4927 InsetGraphicsParams. this is a template to translate between two
4930 * src/frontends/xforms/RadioButtonGroup.h:
4931 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
4932 way to easily control a radio button group.
4934 2000-07-28 Juergen Vigna <jug@sad.it>
4936 * src/insets/insettabular.C (LocalDispatch):
4937 (TabularFeatures): added support for lyx-functions of tabular features.
4938 (cellstart): refixed this function after someone wrongly changed it.
4940 * src/commandtags.h:
4941 * src/LyXAction.C (init): added support for tabular-features
4943 2000-07-28 Allan Rae <rae@lyx.org>
4945 * src/frontends/xforms/FormPreferences.C (build): Setup input return
4946 checking. NOTE: It seems that pressing ESC to cancel the dialog also
4947 triggers the callback for input checking. As a result we sometimes get
4948 "LyX: This shouldn't happen..." printed to cerr.
4949 (input): Started using status variable since I only free() on
4950 destruction. Some input checking for paths and font sizes.
4952 * src/frontends/xforms/FormPreferences.h: Use status to control
4953 activation of Ok and Apply
4955 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
4956 callback. Also resized to stop segfaults with 0.88. The problem is
4957 that xforms-0.88 requires the folder to be wide enough to fit all the
4958 tabs. If it isn't it causes all sorts of problems.
4960 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
4962 * src/frontends/xforms/forms/README: Reflect reality.
4964 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
4965 * src/frontends/xforms/forms/makefile: ditto.
4967 * src/commandtags.h: Get access to new Preferences dialog
4968 * src/LyXAction.C: ditto
4969 * src/lyxfunc.C: ditto
4970 * lib/ui/default.ui: ditto
4972 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4974 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
4976 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
4979 * src/frontends/xforms/form_url.[Ch]: added.
4981 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4983 * src/insets/insetbib.h: fixed bug in previous commit
4985 * src/frontends/xforms/FormUrl.h: ditto
4987 * src/frontends/xforms/FormPrint.h: ditto
4989 * src/frontends/xforms/FormPreferences.h: ditto
4991 * src/frontends/xforms/FormCopyright.h: ditto
4993 * src/frontends/xforms/FormCitation.C: ditto
4995 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
4996 private copyconstructor and private default contructor
4998 * src/support/Makefile.am: add utility.hpp
5000 * src/support/utility.hpp: new file from boost
5002 * src/insets/insetbib.h: set owner in clone
5004 * src/frontends/xforms/FormCitation.C: added missing include
5007 * src/insets/form_url.[Ch]: removed
5009 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5011 * development/lyx.spec.in
5012 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5013 file/directory re-organization.
5015 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5017 * src/insets/insetcommand.[Ch]: moved the string data and
5018 associated manipulation methods into a new stand-alone class
5019 InsetCommandParams. This class has two additional methods
5020 getAsString() and setFromString() allowing the contents to be
5021 moved around as a single string.
5022 (addContents) method removed.
5023 (setContents) method no longer virtual.
5025 * src/buffer.C (readInset): made use of new InsetCitation,
5026 InsetUrl constructors based on InsetCommandParams.
5028 * src/commandtags.h: add LFUN_INSERT_URL
5030 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5031 independent InsetUrl and use InsetCommandParams to extract
5032 string info and create new Insets.
5034 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5036 * src/frontends/xforms/FormCitation.C (apply): uses
5039 * src/frontends/xforms/form_url.C
5040 * src/frontends/xforms/form_url.h
5041 * src/frontends/xforms/FormUrl.h
5042 * src/frontends/xforms/FormUrl.C
5043 * src/frontends/xforms/forms/form_url.fd: new files
5045 * src/insets/insetcite.[Ch]: removed unused constructors.
5047 * src/insets/insetinclude.[Ch]: no longer store filename
5049 * src/insets/inseturl.[Ch]: GUI-independent.
5051 2000-07-26 Juergen Vigna <jug@sad.it>
5052 * renamed frontend from gtk to gnome as it is that what is realized
5053 and did the necessary changes in the files.
5055 2000-07-26 Marko Vendelin <markov@ioc.ee>
5057 * configure.in: cleaning up gnome configuration scripts
5059 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5061 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5062 shortcuts syndrom by redrawing them explicitely (a better solution
5063 would be appreciated).
5065 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5067 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5070 * src/lyx_cb.C (MenuExport): change html export to do the right
5071 thing depending of the document type (instead of having
5072 html-linuxdoc and html-docbook).
5073 * src/lyxfunc.C (getStatus): update for html
5074 * lib/ui/default.ui: simplify due to the above change.
5075 * src/menus.C (ShowFileMenu): update too (in case we need it).
5077 * src/MenuBackend.C (read): if a menu is defined twice, add the
5078 new entries to the exiting one.
5080 2000-07-26 Juergen Vigna <jug@sad.it>
5082 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5084 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5085 and return a bool if it did actual save the file.
5086 (AutoSave): don't autosave a unnamed doc.
5088 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5089 check if this is an UNNAMED new file and react to it.
5090 (newFile): set buffer to unnamed and change to not mark a new
5091 buffer dirty if I didn't do anything with it.
5093 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5095 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5097 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5098 friend as per Angus's patch posted to lyx-devel.
5100 * src/ext_l10n.h: updated
5102 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5103 gettext on the style string right before inserting them into the
5106 * autogen.sh: add code to extract style strings form layout files,
5107 not good enough yet.
5109 * src/frontends/gtk/.cvsignore: add MAKEFILE
5111 * src/MenuBackend.C (read): run the label strings through gettext
5112 before storing them in the containers.
5114 * src/ext_l10n.h: new file
5116 * autogen.sh : generate the ext_l10n.h file here
5118 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5120 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5123 * lib/ui/default.ui: fix a couple of typos.
5125 * config/gnome/gtk.m4: added (and added to the list of files in
5128 * src/insets/insetinclude.C (unique_id): fix when we are using
5129 lyxstring instead of basic_string<>.
5130 * src/insets/insettext.C (LocalDispatch): ditto.
5131 * src/support/filetools.C: ditto.
5133 * lib/configure.m4: create the ui/ directory if necessary.
5135 * src/LyXView.[Ch] (updateToolbar): new method.
5137 * src/BufferView_pimpl.C (buffer): update the toolbar when
5138 opening/closing buffer.
5140 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5142 * src/LyXAction.C (getActionName): enhance to return also the name
5143 and options of pseudo-actions.
5144 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
5146 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
5147 as an example of what is possible). Used in File->Build too (more
5148 useful) and in the import/export menus (to mimick the complicated
5149 handling of linuxdoc and friends). Try to update all the entries.
5151 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
5154 * src/MenuBackend.C (read): Parse the new OptItem tag.
5156 * src/MenuBackend.h: Add a new optional_ data member (used if the
5157 entry should be omitted when the lyxfunc is disabled).
5159 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
5160 function, used as a shortcut.
5161 (create_submenu): align correctly the shortcuts on the widest
5164 * src/MenuBackend.h: MenuItem.label() only returns the label of
5165 the menu without shortcut; new method shortcut().
5167 2000-07-14 Marko Vendelin <markov@ioc.ee>
5169 * src/frontends/gtk/Dialogs.C:
5170 * src/frontends/gtk/FormCopyright.C:
5171 * src/frontends/gtk/FormCopyright.h:
5172 * src/frontends/gtk/Makefile.am: added these source-files for the
5173 Gtk/Gnome support of the Copyright-Dialog.
5175 * src/main.C: added Gnome::Main initialization if using
5176 Gtk/Gnome frontend-GUI.
5178 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
5180 * config/gnome/aclocal-include.m4
5181 * config/gnome/compiler-flags.m4
5182 * config/gnome/curses.m4
5183 * config/gnome/gnome--.m4
5184 * config/gnome/gnome-bonobo-check.m4
5185 * config/gnome/gnome-common.m4
5186 * config/gnome/gnome-fileutils.m4
5187 * config/gnome/gnome-ghttp-check.m4
5188 * config/gnome/gnome-gnorba-check.m4
5189 * config/gnome/gnome-guile-checks.m4
5190 * config/gnome/gnome-libgtop-check.m4
5191 * config/gnome/gnome-objc-checks.m4
5192 * config/gnome/gnome-orbit-check.m4
5193 * config/gnome/gnome-print-check.m4
5194 * config/gnome/gnome-pthread-check.m4
5195 * config/gnome/gnome-support.m4
5196 * config/gnome/gnome-undelfs.m4
5197 * config/gnome/gnome-vfs.m4
5198 * config/gnome/gnome-x-checks.m4
5199 * config/gnome/gnome-xml-check.m4
5200 * config/gnome/gnome.m4
5201 * config/gnome/gperf-check.m4
5202 * config/gnome/gtk--.m4
5203 * config/gnome/linger.m4
5204 * config/gnome/need-declaration.m4: added configuration scripts
5205 for Gtk/Gnome frontend-GUI
5207 * configure.in: added support for the --with-frontend=gtk option
5209 * autogen.sh: added config/gnome/* to list of config-files
5211 * acconfig.h: added define for GTKGUI-support
5213 * config/lyxinclude.m4: added --with-frontend[=value] option value
5214 for Gtk/Gnome frontend-GUI support.
5216 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5218 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
5222 * src/paragraph.C (GetChar): remove non-const version
5224 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
5225 (search_kw): use it.
5227 * src/lyx_main.C (init): if "preferences" exist, read that instead
5229 (ReadRcFile): return bool if the file could be read ok.
5230 (ReadUIFile): add a check to see if lex file is set ok.
5232 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
5233 bastring can be used instead of lyxstring (still uses the old code
5234 if std::string is good enough or if lyxstring is used.)
5236 * src/encoding.C: make the arrays static, move ininle functions
5238 * src/encoding.h: from here.
5240 * src/buffer.C: have last_isnet_read as a file scope variable for now.
5241 (parseSingleLyXformat2Token): move inset parsing to separate method
5242 (readInset): new private method
5244 * src/Variables.h: remove virtual from get().
5246 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
5247 access to NEW_INSETS and NEW_TABULAR
5249 * src/MenuBackend.h: remove superfluous forward declaration of
5250 MenuItem. Add documentations tags "///", remove empty MenuItem
5251 destructor, remove private default contructor.
5253 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
5255 (read): more string mlabel and mname to where they are used
5256 (read): remove unused variables mlabel and mname
5257 (defaults): unconditional clear, make menusetup take advantage of
5258 add returning Menu &.
5260 * src/LyXView.h: define NEW_MENUBAR as default
5262 * src/LyXAction.C: include lyxparagraph.h temporary to get access
5263 to NEW_INSETS and NEW_TABULAR.
5264 (init): commetn out some funcs that is obsolete when NEW_INSETS is
5265 defined. Change some of the "xxxx-inset-insert" functions names to
5268 * several files: more enahncements to NEW_INSETS and the resulting
5271 * lib/lyxrc.example (\date_insert_format): move to misc section
5273 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
5274 bastring and use AC_CACHE_CHECK.
5275 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
5276 the system have the newest methods. uses AC_CACHE_CHECK
5277 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
5278 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
5279 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
5281 * configure.in: add LYX_CXX_GOOD_STD_STRING
5283 * acinclude.m4: recreated
5285 2000-07-24 Amir Karger <karger@lyx.org>
5287 * README: add Hebrew, Arabic kmaps
5290 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5292 * src/buffer.C (writeFileAscii): Define actcell as an int instead
5295 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5297 * Lot of files: add pragma interface/implementation.
5299 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
5301 * lib/ui/default.ui: new file (ans new directory). Contains the
5302 default menu and toolbar.
5304 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
5305 global space. Toolbars are now read (as menus) in ui files.
5307 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
5309 * src/lyxfunc.C (getStatus): do not exit immediately if a command
5310 is disabled because the document is read-only. We want to have the
5311 toggle state of the function anyway.
5312 (getStatus): add code for LFUN_VC* functions (mimicking what is
5313 done in old-style menus)
5315 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
5316 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
5318 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
5319 * src/BufferView_pimpl.C: ditto.
5320 * src/lyxfunc.C: ditto.
5322 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
5323 default). This replaces old-style menus by new ones.
5325 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
5326 MenuItem. Contain the data structure of a menu.
5328 * src/insets/insettext.C: use LyXView::setLayout instead of
5329 accessing directly the toolbar combox.
5330 * src/lyxfunc.C (Dispatch): ditto.
5332 * src/LyXView.C (setLayout): new method, which just calls
5333 Toolbar::setLayout().
5334 (updateLayoutChoice): move part of this method in Toolbar.
5336 * src/toolbar.[Ch]: removed.
5338 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
5339 implementation the toolbar.
5341 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
5342 the toolbar. It might make sense to merge it with ToolbarDefaults
5344 (setLayout): new function.
5345 (updateLayoutList): ditto.
5346 (openLayoutList): ditto.
5348 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
5349 xforms implementation of the toolbar.
5350 (get_toolbar_func): comment out, since I do not
5351 know what it is good for.
5353 * src/ToolbarDefaults.h: Add the ItemType enum.
5355 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
5356 for a list of allocated C strings. Used in Menubar xforms
5357 implementation to avoid memory leaks.
5359 * src/support/lstrings.[Ch] (uppercase): new version taking and
5363 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
5364 * lib/bind/emacs.bind: ditto.
5366 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5368 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
5369 forward decl of LyXView.
5371 * src/toolbar.C (toolbarItem): moved from toolbar.h
5372 (toolbarItem::clean): ditto
5373 (toolbarItem::~toolbarItem): ditto
5374 (toolbarItem::operator): ditto
5376 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
5378 * src/paragraph.h: control the NEW_TABULAR define from here
5380 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
5381 USE_TABULAR_INSETS to NEW_TABULAR
5383 * src/ToolbarDefaults.C: add include "lyxlex.h"
5385 * files using the old table/tabular: use NEW_TABULAR to control
5386 compilation of old tabular stuff.
5388 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
5391 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
5392 planemet in reading of old style floats, fix the \end_deeper
5393 problem when reading old style floats.
5395 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5397 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
5399 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
5401 * lib/bind/sciword.bind: updated.
5403 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5405 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
5406 layout write problem
5408 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5410 * src/Makefile.am (INCLUDES): remove image directory from include
5413 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
5414 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
5416 * src/LyXView.C (create_form_form_main): read the application icon
5419 * lib/images/*.xpm: change the icons to use transparent color for
5422 * src/toolbar.C (update): change the color of the button when it
5425 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5427 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
5428 setting explicitely the minibuffer.
5429 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
5431 * src/LyXView.C (showState): new function. Shows font information
5432 in minibuffer and update toolbar state.
5433 (LyXView): call Toolbar::update after creating the
5436 * src/toolbar.C: change toollist to be a vector instead of a
5438 (BubbleTimerCB): get help string directly from the callback
5439 argument of the corresponding icon (which is the action)
5440 (set): remove unnecessary ugliness.
5441 (update): new function. update the icons (depressed, disabled)
5442 depending of the status of the corresponding action.
5444 * src/toolbar.h: remove help in toolbarItem
5446 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
5448 * src/Painter.C (text): Added code for using symbol glyphs from
5449 iso10646 fonts. Currently diabled.
5451 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
5454 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
5455 magyar,turkish and usorbian.
5457 * src/paragraph.C (isMultiLingual): Made more efficient.
5459 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
5462 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
5463 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
5464 Also changed the prototype to "bool math_insert_greek(char)".
5466 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5468 * lots of files: apply the NEW_INSETS on all code that will not be
5469 needed when we move to use the new insets. Enable the define in
5470 lyxparagrah.h to try it.
5472 * src/insets/insettabular.C (cellstart): change to be a static
5474 (InsetTabular): initialize buffer in the initializer list.
5476 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
5478 * src/frontends/xforms/FormPrint.[Ch] : moved #include
5479 form_print.h out of the header file. Replaced with forward
5480 declarations of the relevant struct.
5482 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
5485 * src/commandtags.h: do not include "debug.h" which does not
5486 belong there. #include it in some other places because of this
5489 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5491 * src/insets/insetcaption.C: add a couple "using" directives.
5493 * src/toolbar.C (add): get the help text directly from lyxaction.
5495 (setPixmap): new function. Loads from disk and sets a pixmap on a
5496 botton; the name of the pixmap file is derived from the command
5499 * src/toolbar.h: remove members isBitmap and pixmap from
5502 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
5503 * lib/images/: move many files from images/banner.xpm.
5505 * src/lyx_gui.C (create_forms): read banner pixmap from file.
5507 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
5508 * src/toolbar.C: ditto.
5509 * configure.in: ditto.
5510 * INSTALL: document.
5512 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
5513 the spellchecker popup is closed from the WM.
5515 2000-07-19 Juergen Vigna <jug@sad.it>
5517 * src/insets/insetfloat.C (Write): small fix because we use the
5518 insetname for the type now!
5520 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
5522 * src/frontends/xforms/forms/form_citation.fd: object sizes are
5525 * src/frontends/Dialogs.h: removed hideCitation signal
5527 * src/insets/insetcite.h: added hide signal
5529 * src/insets/insetcite.C (~InsetCitation): emits new signal
5530 (getScreenLabel): "intelligent" label should now fit on the screen!
5532 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
5534 * src/frontends/xforms/FormCitation.C (showInset): connects
5535 hide() to the inset's hide signal
5536 (show): modified to use fl_set_object_position rather than
5537 fl_set_object_geometry wherever possible
5539 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5541 * src/insets/lyxinset.h: add caption code
5543 * src/insets/insetfloat.C (type): new method
5545 * src/insets/insetcaption.C (Write): new method
5547 (LyxCode): new method
5549 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
5550 to get it right together with using the FloatList.
5552 * src/commandtags.h: add LFUN_INSET_CAPTION
5553 * src/lyxfunc.C (Dispatch): handle it
5555 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
5558 * src/Variables.[Ch]: make expand take a const reference, remove
5559 the destructor, some whitespace changes.
5561 * src/LyXAction.C (init): add caption-inset-insert
5563 * src/FloatList.C (FloatList): update the default floats a bit.
5565 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5567 * src/Variables.[Ch]: new files. Intended to be used for language
5568 specific strings (like \chaptername) and filename substitution in
5571 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
5573 * lib/kbd/american.kmap: update
5575 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
5577 * src/bufferparams.[Ch]: remove member allowAccents.
5579 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
5581 * src/LaTeXLog.C: use the log_form.h header.
5582 * src/lyx_gui.C: ditto.
5583 * src/lyx_gui_misc.C: ditto.
5584 * src/lyxvc.h: ditto.
5586 * forms/log_form.fd: new file, created from latexoptions.fd. I
5587 kept the log popup and nuked the options form.
5589 * src/{la,}texoptions.[Ch]: removed.
5590 * src/lyx_cb.C (LaTeXOptions): ditto
5592 * src/lyx_gui.C (create_forms): do not handle the
5593 fd_latex_options form.
5595 2000-07-18 Juergen Vigna <jug@sad.it>
5597 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
5598 name of the inset so that it can be requested outside (text2.C).
5600 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
5603 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5605 * src/mathed/formula.h (ConvertFont): constify
5607 * src/mathed/formula.C (Read): add warning if \end_inset is not
5608 found on expected place.
5610 * src/insets/lyxinset.h (ConvertFont): consify
5612 * src/insets/insetquotes.C (ConvertFont): constify
5613 * src/insets/insetquotes.h: ditto
5615 * src/insets/insetinfo.h: add labelfont
5617 * src/insets/insetinfo.C (InsetInfo): set the labelfont
5618 (ascent): use labelfont
5622 (Write): make .lyx file a bit nicer
5624 * src/insets/insetfloat.C (Write): simplify somewhat...
5625 (Read): add warning if arg is not found
5627 * src/insets/insetcollapsable.C: add using std::max
5628 (Read): move string token and add warning in arg is not found
5629 (draw): use std::max to get the right ty
5630 (getMaxWidth): simplify by using std::max
5632 * src/insets/insetsection.h: new file
5633 * src/insets/insetsection.C: new file
5634 * src/insets/insetcaption.h: new file
5635 * src/insets/insetcaption.C: new file
5637 * src/insets/inset.C (ConvertFont): constify signature
5639 * src/insets/Makefile.am (libinsets_la_SOURCES): add
5640 insetcaption.[Ch] and insetsection.[Ch]
5642 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
5643 uses to use LABEL_COUNTER_CHAPTER instead.
5644 * src/text2.C (SetCounter): here
5646 * src/counters.h: new file
5647 * src/counters.C: new file
5648 * src/Sectioning.h: new file
5649 * src/Sectioning.C: new file
5651 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
5653 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5655 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
5658 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
5661 2000-07-17 Juergen Vigna <jug@sad.it>
5663 * src/tabular.C (Validate): check if array-package is needed.
5664 (SetVAlignment): added support for vertical alignment.
5665 (SetLTFoot): better support for longtable header/footers
5666 (Latex): modified to support added features.
5668 * src/LaTeXFeatures.[Ch]: added array-package.
5670 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
5672 * src/lyx_gui.C (LyXGUI): make sure that the height is large
5675 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
5677 * configure.in: do not forget to put a space after -isystem.
5679 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
5681 * lib/kbd/arabic.kmap: a few fixes.
5683 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5685 * some whitespace chagnes to a number of files.
5687 * src/support/DebugStream.h: change to make it easier for
5688 doc++ to parse correctly.
5689 * src/support/lyxstring.h: ditto
5691 * src/mathed/math_utils.C (compara): change to have only one
5693 (MathedLookupBOP): change because of the above.
5695 * src/mathed/math_delim.C (math_deco_compare): change to have only
5697 (search_deco): change becasue of the above.
5699 * src/insets/insettabular.C (DrawCellSelection): use std::swap
5700 instead of manually coded one.
5702 * src/insets/insetquotes.C (Read): read the \end_inset too
5704 * src/insets/insetlatex.h: remove file
5705 * src/insets/insetlatex.C: remove file
5707 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
5709 (InsetPrintIndex): remove destructor
5711 * src/insets/insetinclude.h: remove default constructor
5713 * src/insets/insetfloat.C: work to make it work better
5715 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
5717 * src/insets/insetcite.h (InsetCitation): remove default constructor
5719 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
5721 * src/text.C (GetColumnNearX): comment out some currently unused code.
5723 * src/paragraph.C (writeFile): move some initializations closer to
5725 (CutIntoMinibuffer): small change to use new matchIT operator
5729 (InsertInset): ditto
5732 (InsetIterator): ditto
5733 (Erase): small change to use new matchFT operator
5735 (GetFontSettings): ditto
5736 (HighestFontInRange): ditto
5739 * src/lyxparagraph.h: some chars changed to value_type
5740 (matchIT): because of some stronger checking (perhaps too strong)
5741 in SGI STL, the two operator() unified to one.
5744 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
5746 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
5747 the last inset read added
5748 (parseSingleLyXformat2Token): some more (future) compability code added
5749 (parseSingleLyXformat2Token): warning about solitary \end_inset added
5750 (parseSingleLyXformat2Token): set last_inset_read
5751 (parseSingleLyXformat2Token): more code to read new "Float" correctly
5752 (parseSingleLyXformat2Token): don't double intializw string next_token
5754 * src/TextCache.C (text_fits::operator()): add const's to the signature
5755 (has_buffer::operator()): ditto
5757 * src/Floating.h: add some comments on the class
5759 * src/FloatList.[Ch] (typeExist): new method
5762 * src/BackStack.h: added default constructor, wanted by Gcc.
5764 2000-07-14 Juergen Vigna <jug@sad.it>
5766 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
5768 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
5770 * src/insets/insettabular.C (resizeLyXText): need this to be able to
5771 do a redraw when the window is resized!
5772 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
5774 * src/insets/insettext.C (resizeLyXText): added function to correctly
5775 being able to resize the LyXWindow.
5777 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
5779 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
5781 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
5782 crashes when closing dialog to a deleted inset.
5784 * src/insets/insetcite.[Ch] (Edit) : the return of this former
5785 method! Now similar to other insets.
5787 2000-07-13 Juergen Vigna <jug@sad.it>
5789 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
5791 * lib/examples/Literate.lyx: small patch!
5793 * src/insets/insetbib.C (Read): added this function because of wrong
5794 Write (without [begin|end]_inset).
5796 2000-07-11 Juergen Vigna <jug@sad.it>
5798 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
5799 as the insertInset could not be good!
5801 * src/screen.C (ToggleSelection): fixed toggle selection bug as
5802 the bool param should not be last.
5804 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5806 * sigc++/configure.in: fix bug in threading-related code (Yes, I
5807 did submit that to Karl).
5809 * configure.in: use -isystem instead of -I for X headers. This
5810 fixes a problem on solaris with a recent gcc;
5811 put the front-end code after the X detection code;
5812 configure in sigc++ before lib/
5814 * src/lyx_main.C (commandLineHelp): remove -display from command
5817 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
5819 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
5820 Also put in Makefile rules for building the ``listerrors''
5821 program for parsing errors from literate programs written in LyX.
5823 * lib/build-listerrors: Added small shell script as part of compile
5824 process. This builds a working ``listerrors'' binary if noweb is
5825 installed and either 1) the VNC X server is installed on the machine,
5826 or 2) the user is compiling from within a GUI. The existence of a GUI
5827 is necessary to use the ``lyx --export'' feature for now. This
5828 hack can be removed once ``lyx --export'' no longer requires a GUI to
5831 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
5833 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
5834 now passed back correctly from gcc and placed "under" error
5835 buttons in a Literate LyX source.
5837 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5839 * src/text.C (GetColumnNearX): Better behavior when a RTL
5840 paragraph is ended by LTR text.
5842 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
5845 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5847 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
5848 true when clipboard is empty.
5850 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5852 * text.C (Backspace): Prevent rebreaking of a row if it is the last
5853 row of the paragraph.
5854 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
5855 to prevent calculation of bidi tables
5857 2000-07-07 Juergen Vigna <jug@sad.it>
5859 * src/screen.C (ToggleSelection): added y_offset and x_offset
5862 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
5865 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
5867 * src/insets/insettext.C: fixed Layout-Display!
5869 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5871 * configure.in: add check for strings.h header.
5873 * src/spellchecker.C: include <strings.h> in order to have a
5874 definition for bzero().
5876 2000-07-07 Juergen Vigna <jug@sad.it>
5878 * src/insets/insettext.C (draw): set the status of the bv->text to
5879 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
5881 * src/screen.C (DrawOneRow):
5882 (DrawFromTo): redraw the actual row if something has changed in it
5885 * src/text.C (draw): call an update of the toplevel-inset if something
5886 has changed inside while drawing.
5888 * src/lyxtext.h: added CHANGED_IN_DRAW status.
5890 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
5892 * src/insets/insetbib.[Ch] (callback) new method, moving callback
5893 processing inside class.
5895 * src/insets/insetindex.[Ch] (callback) new method, moving callback
5896 processing inside class.
5898 * src/insets/insetindex.h new struct Holder, consistent with other
5901 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
5902 citation dialog from main code and placed it in src/frontends/xforms.
5903 Dialog launched through signals instead of callbacks
5905 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
5907 * lyx.man: update the options description.
5909 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
5911 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
5912 handle neg values, set min width to 590, add doc about -display
5914 2000-07-05 Juergen Vigna <jug@sad.it>
5916 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
5917 calls to BufferView *.
5919 * src/insets/insettext.C (checkAndActivateInset): small fix non
5920 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
5922 * src/insets/insetcommand.C (Read): Fixed as insets should read till
5923 their \end_inset token!
5925 2000-07-04 edscott <edscott@imp.mx>
5927 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
5928 lib/lyxrc.example: added option \wheel_jump
5930 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
5932 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
5933 remove support for -width,-height,-xpos and -ypos.
5935 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
5937 * src/encoding.[Ch]: New files.
5939 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
5940 (text): Call to the underline() method only when needed.
5942 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
5944 * src/buffer.C (makeLaTeXFile): Compute automatically the input
5945 encoding(s) for the document.
5947 * src/bufferparams.C (BufferParams): Changed default value of
5950 * src/language.C (newLang): Removed.
5951 (items[]): Added encoding information for all defined languages.
5953 * src/lyx_gui.C (create_forms): Added "auto" option to the input
5954 encoding choice button.
5956 * src/lyxrc.h (font_norm_type): New member variable.
5957 (set_font_norm_type): New method.
5959 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
5960 paragraphs with different encodings.
5962 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
5963 (TransformChar): Changed to work correctly with Arabic points.
5964 (draw): Added support for drawing Arabic points.
5965 (draw): Removed code for drawing underbars (this is done by
5968 * src/support/textutils.h (IsPrintableNonspace): New function.
5970 * src/BufferView_pimpl.h: Added "using SigC::Object".
5971 * src/LyXView.h: ditto.
5973 * src/insets/insetinclude.h (include_label): Changed to mutable.
5975 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5977 * src/mathed/math_iter.h: remove empty destructor
5979 * src/mathed/math_cursor.h: remove empty destructor
5981 * src/insets/lyxinset.h: add THEOREM_CODE
5983 * src/insets/insettheorem.[Ch]: new files
5985 * src/insets/insetminipage.C: (InsertInset): remove
5987 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
5989 (InsertInset): remove
5991 * src/insets/insetlist.C: (InsertList): remove
5993 * src/insets/insetfootlike.[Ch]: new files
5995 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
5998 (InsertInset): ditto
6000 * src/insets/insetert.C: remove include Painter.h, reindent
6001 (InsertInset): move to header
6003 * src/insets/insetcollapsable.h: remove explicit from default
6004 contructor, remove empty destructor, add InsertInset
6006 * src/insets/insetcollapsable.C (InsertInset): new func
6008 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6010 * src/vspace.h: add explicit to constructor
6012 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6013 \textcompwordmark, please test this.
6015 * src/lyxrc.C: set ascii_linelen to 65 by default
6017 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6019 * src/commandtags.h: add LFUN_INSET_THEOREM
6021 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6022 (makeLinuxDocFile): remove _some_ of the nice logic
6023 (makeDocBookFile): ditto
6025 * src/Painter.[Ch]: (~Painter): removed
6027 * src/LyXAction.C (init): entry for insettheorem added
6029 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6031 (deplog): code to detect files generated by LaTeX, needs testing
6034 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6036 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6038 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6040 * src/LaTeX.C (deplog): Add a check for files that are going to be
6041 created by the first latex run, part of the project to remove the
6044 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6045 contents to the extension list.
6047 2000-07-04 Juergen Vigna <jug@sad.it>
6049 * src/text.C (NextBreakPoint): added support for needFullRow()
6051 * src/insets/lyxinset.h: added needFullRow()
6053 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6056 * src/insets/insettext.C: lots of changes for update!
6058 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6060 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6062 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6064 * src/insets/insetinclude.C (InsetInclude): fixed
6065 initialization of include_label.
6066 (unique_id): now returns a string.
6068 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6070 * src/LaTeXFeatures.h: new member IncludedFiles, for
6071 a map of key, included file name.
6073 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6074 with the included files for inclusion in SGML preamble,
6075 i. e., linuxdoc and docbook.
6078 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6079 nice (is the generated linuxdoc code to be exported?), that
6080 allows to remove column, and only_body that will be true for
6081 slave documents. Insets are allowed inside SGML font type.
6082 New handling of the SGML preamble for included files.
6083 (makeDocBookFile): the same for docbook.
6085 * src/insets/insetinclude.h:
6086 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6088 (DocBook): new export methods.
6090 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6091 and makeDocBookFile.
6093 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6094 formats to export with command line argument -x.
6096 2000-06-29 Juergen Vigna <jug@sad.it>
6098 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6099 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6101 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6102 region could already been cleared by an inset!
6104 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6106 * src/BufferView_pimpl.h: remove member variables lyx_focus and
6109 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
6111 (cursorToggle): remove special handling of lyx focus.
6113 2000-06-28 Juergen Vigna <jug@sad.it>
6115 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
6118 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6120 * src/insets/insetindex.C (Edit): add a callback when popup is
6123 * src/insets/insettext.C (LocalDispatch):
6124 * src/insets/insetmarginal.h:
6125 * src/insets/insetlist.h:
6126 * src/insets/insetfoot.h:
6127 * src/insets/insetfloat.h:
6128 * src/insets/insetert.h: add a missing std:: qualifier.
6130 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6132 * src/support/lyxsum.C (sum): '\0' teminate file read when using
6135 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
6137 * src/insets/insettext.C (Read): remove tmptok unused variable
6138 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
6139 (InsertInset): change for new InsetInset code
6141 * src/insets/insettext.h: add TEXT inline method
6143 * src/insets/insettext.C: remove TEXT macro
6145 * src/insets/insetmarginal.C (Write): new method
6146 (Latex): change output slightly
6148 * src/insets/insetfoot.C (Write): new method
6149 (Latex): change output slightly (don't use endl when no need)
6151 * src/insets/insetert.C (Write): new method
6153 * src/insets/insetcollapsable.h: make button_length, button_top_y
6154 and button_bottm_y protected.
6156 * src/insets/insetcollapsable.C (Write): simplify code by using
6157 tostr. Also do not output the float name, the children class
6158 should to that to get control over own arguments
6160 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
6161 src/insets/insetminipage.[Ch]:
6164 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6166 * src/lyxfunc.C (Dispatch): cases for new insets/commands
6168 * src/Makefile.am (lyx_SOURCES): add the new files
6170 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
6171 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
6172 * src/commandtags.h: ditto
6174 * src/LaTeXFeatures.h: add a std::set of used floattypes
6176 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
6178 * src/FloatList.[Ch] src/Floating.h: new files
6180 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
6182 * src/lyx_cb.C (TableApplyCB): ditto
6184 * src/text2.C: ditto
6185 * src/buffer.C (SimpleLinuxDocOnePar): ditto
6186 (parseSingleLyXformat2Token): ditto + add code for
6187 backwards compability for old float styles + add code for new insets
6189 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
6191 (InsertInset(size_type, Inset *, LyXFont)): new method
6192 (InsetChar(size_type, char)): changed to use the other InsetChar
6193 with a LyXFont(ALL_INHERIT).
6194 (InsetInset(size_type, Inset*)): changed to use InsetChar to
6195 insert the META_INSET.
6197 * sigc++/thread.cc (Privete<int>::operator int&): move definition
6199 * sigc++/thread.h (Threads): from here
6201 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
6202 definition out of line
6203 * sigc++/scope.h: from here
6205 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6207 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
6208 is specified (adapted from a patch from edscott <edscott@imp.mx>).
6210 * Makefile.am (bindist): new target.
6212 * INSTALL: add instructions for doing a binary distribution.
6214 * development/tools/README.bin.example: update a bit.
6216 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
6219 * lib/lyxrc.example: new lyxrc tag \set_color.
6221 * src/lyxfunc.C (Dispatch):
6222 * src/commandtags.h:
6223 * src/LyXAction.C: new lyxfunc "set-color".
6225 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
6226 and an x11name given as strings.
6228 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
6229 cache when a color is changed.
6231 2000-06-26 Juergen Vigna <jug@sad.it>
6233 * src/lyxrow.C (width): added this functions and variable.
6235 * src/insets/insetcite.C (create_form_citation_form): some Gravity
6238 * src/text.C (SetHeightOfRow): fixed calcualting of width.
6240 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6242 * images/undo_bw.xpm: new icon.
6243 * images/redo_bw.xpm: ditto.
6245 * configure.in (INSTALL_SCRIPT): change value to
6246 ${INSTALL} to avoid failures of install-script target.
6247 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
6249 * src/BufferView.h: add a magic "friend" declaration to please
6252 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
6254 * forms/cite.fd: modified to allow resizing without messing
6257 * src/insetcite.C: Uses code from cite.fd almost without
6259 User can now resize dialog in the x-direction.
6260 Resizing the dialog in the y-direction is prevented, as the
6261 code does this intelligently already.
6263 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6265 * INSTALL: remove obsolete entry in "problems" section.
6267 * lib/examples/sl_*.lyx: update of the slovenian examples.
6269 * src/support/FileInfo.[Ch] (getBlockSize): remove.
6271 2000-06-23 Juergen Vigna <jug@sad.it>
6273 * src/lyxtext.h: added a 'cleared' flag to draw() function.
6275 * src/buffer.C (resize): delete the LyXText of textinsets.
6277 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
6279 * src/insets/lyxinset.h: added another parameter 'cleared' to
6280 the draw() function.
6282 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
6283 unlocking inset in inset.
6285 2000-06-22 Juergen Vigna <jug@sad.it>
6287 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
6288 of insets and moved first to LyXText.
6290 * src/mathed/formulamacro.[Ch]:
6291 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
6293 2000-06-21 Juergen Vigna <jug@sad.it>
6295 * src/text.C (GetVisibleRow): look if I should clear the area or not
6296 using Inset::doClearArea() function.
6298 * src/insets/lyxinset.h: added doClearArea() function and
6299 modified draw(Painter &, ...) to draw(BufferView *, ...)
6301 * src/text2.C (UpdateInset): return bool insted of int
6303 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
6305 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
6306 combox in the character popup
6308 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
6309 BufferParams const & params
6311 2000-06-20 Juergen Vigna <jug@sad.it>
6313 * src/insets/insettext.C (SetParagraphData): set insetowner on
6316 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6318 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
6319 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
6321 (form_main_): remove
6323 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
6324 (create_form_form_main): remove FD_form_main stuff, connect to
6325 autosave_timeout signal
6327 * src/LyXView.[Ch] (getMainForm): remove
6328 (UpdateTimerCB): remove
6329 * src/BufferView_pimpl.h: inherit from SigC::Object
6331 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
6332 signal instead of callback
6334 * src/BufferView.[Ch] (cursorToggleCB): remove
6336 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6338 * src/BufferView_pimpl.C: changes because of the one below
6340 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
6341 instead of storing a pointer to a LyXText.
6343 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
6345 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
6347 * src/lyxparagraph.h
6349 * src/paragraph.C: Changed fontlist to a sorted vector.
6351 2000-06-19 Juergen Vigna <jug@sad.it>
6353 * src/BufferView.h: added screen() function.
6355 * src/insets/insettext.C (LocalDispatch): some selection code
6358 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
6360 * src/insets/insettext.C (SetParagraphData):
6362 (InsetText): fixes for multiple paragraphs.
6364 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
6366 * development/lyx.spec.in: Call configure with ``--without-warnings''
6367 to work around a bug with the Makefiles when doing ``make lyxrpm''.
6368 This should be fine, however, since we generally don't want to be
6369 verbose when making an RPM.
6371 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
6373 * lib/scripts/fig2pstex.py: New file
6375 2000-06-16 Juergen Vigna <jug@sad.it>
6377 * src/insets/insettabular.C (UpdateLocal):
6378 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
6379 (LocalDispatch): Changed all functions to use LyXText.
6381 2000-06-15 Juergen Vigna <jug@sad.it>
6383 * src/text.C (SetHeightOfRow): call inset::update before requesting
6386 * src/insets/insettext.C (update):
6387 * src/insets/insettabular.C (update): added implementation
6389 * src/insets/lyxinset.h: added update function
6391 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6393 * src/text.C (SelectNextWord): protect against null pointers with
6394 old-style string streams. (fix from Paul Theo Gonciari
6397 * src/cite.[Ch]: remove erroneous files.
6399 * lib/configure.m4: update the list of created directories.
6401 * src/lyxrow.C: include <config.h>
6402 * src/lyxcursor.C: ditto.
6404 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6406 * lib/examples/decimal.lyx: new example file from Mike.
6408 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
6409 to find template definitions (from Dekel)
6411 * src/frontends/.cvsignore: add a few things.
6413 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
6415 * src/Timeout.C (TimeOut): remove default argument.
6417 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
6420 * src/insets/ExternalTemplate.C: add a "using" directive.
6422 * src/lyx_main.h: remove the act_ struct, which seems unused
6425 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6427 * LyX Developers Meeting: All files changed, due to random C++ (by
6428 coincidence) code generator script.
6430 - external inset (cool!)
6431 - initial online editing of preferences
6432 - insettabular breaks insettext(s contents)
6434 - some DocBook fixes
6435 - example files update
6436 - other cool stuff, create a diff and look for yourself.
6438 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
6440 * src/insets/insettext.C (computeTextRows): if the maxWidth is
6441 -1 this is a non-line-breaking textinset.
6443 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
6444 if there is no width set.
6446 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6448 * Lots of files: Merged the dialogbase branch.
6450 2000-06-09 Allan Rae <rae@lyx.org>
6452 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
6453 and the Dispatch methods that used it.
6455 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
6456 access to functions formerly kept in Dispatch.
6458 2000-05-19 Allan Rae <rae@lyx.org>
6460 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
6461 made to_page and count_copies integers again. from_page remains a
6462 string however because I want to allow entry of a print range like
6463 "1,4,22-25" using this field.
6465 * src/LyXAction.C: added action info and commands for buffer-print-xtl
6466 and printer-params-get. These aren't useful from the minibuffer but
6467 could be used by a script/LyXServer app provided it passes a suitable
6468 auto_mem_buffer. I guess I should take a look at how the LyXServer
6469 works and make it support xtl buffers.
6471 * sigc++/: updated to libsigc++-1.0.1
6473 * src/xtl/: updated to xtl-1.3.pl.11
6475 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
6476 those changes done to the files in src/ are actually recreated when
6477 they get regenerated. Please don't ever accept a patch that changes a
6478 dialog unless that patch includes the changes to the corresponding *.fd
6481 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
6482 stringOnlyContains, renamed it and generalised it.
6484 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
6485 branch. Removed the remaining old form_print code.
6487 2000-04-26 Allan Rae <rae@lyx.org>
6489 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
6490 trap I was trying to fix with the ID: fields in src/xtl/ :-)
6492 2000-04-25 Allan Rae <rae@lyx.org>
6494 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
6495 against a base of xtl-1.3.pl.4
6497 * development/tools/lxtl.sh: fixed a couple of silly typos and now
6498 filter the Id: entries so they still show the xtl version number
6501 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
6502 into the src/xtl code. Patch still pending with José (XTL)
6504 2000-04-24 Allan Rae <rae@lyx.org>
6506 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
6507 both more generic and much safer. Use the new template functions.
6508 * src/buffer.[Ch] (Dispatch): ditto.
6510 * src/frontends/xforms/FormPrint.C (update): Use new template functions
6511 and mem buffer more intelligently. Also a little general cleanup.
6514 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
6515 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
6516 * src/xtl/Makefile.am: ditto.
6517 * src/xtl/.cvsignore: ditto.
6518 * src/Makefile.am: ditto.
6520 * src/PrinterParams.h: Removed the macros member functions. Added a
6521 testInvariant member function. A bit of tidying up and commenting.
6522 Included Angus's idea for fixing operation with egcs-1.1.2.
6524 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
6525 cool expansion of XTL's mem_buffer to support automatic memory
6526 management within the buffer itself. Removed the various macros and
6527 replaced them with template functions that use either auto_mem_buffer
6528 or mem_buffer depending on a #define. The mem_buffer support will
6529 disappear as soon as the auto_mem_buffer is confirmed to be good on
6530 other platforms/compilers. That is, it's there so you've got something
6533 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
6534 effectively forked XTL. However I expect José will include my code
6535 into the next major release. Also fixed a memory leak.
6536 * src/xtl/text.h: ditto.
6537 * src/xtl/xdr.h: ditto.
6538 * src/xtl/giop.h: ditto.
6540 2000-04-16 Allan Rae <rae@lyx.org>
6542 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
6543 by autogen.sh and removed by maintainer-clean anyway.
6544 * .cvsignore, sigc++/.cvsignore: Support the above.
6546 * sigc++/.cvsignore: Forgot that retbind.h was generated.
6548 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
6550 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
6551 macros, renamed static callback-target member functions to suit new
6552 scheme and made them public.
6553 * src/frontends/xforms/forms/form_print.fd: ditto.
6554 * src/frontends/xforms/forms/form_copyright.fd: ditto.
6556 * src/support/lxtl.h: small cleanup to use typedef instead of #define
6559 * src/xtl/: New directory containing a minimal distribution of XTL.
6560 This is XTL-1.3.pl.4.
6562 * development/tools/lxtl.sh: A script to generate the above mini-dist.
6564 2000-04-15 Allan Rae <rae@lyx.org>
6566 * development/tools/makeLyXsigc.sh: Remove the library version numbers
6568 * sigc++/: Updated to libsigc++-1.0.0
6570 2000-04-14 Allan Rae <rae@lyx.org>
6572 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
6573 use the generic ones in future. I'll modify my conversion script.
6575 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
6577 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
6578 (CloseAllBufferRelatedDialogs): Renamed.
6579 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
6581 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
6582 of the generic ones. These are the same ones my conversion script
6585 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
6586 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
6587 * src/buffer.C (Dispatch): ditto
6589 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
6590 functions for updating and hiding buffer dependent dialogs.
6591 * src/BufferView.C (buffer): ditto
6592 * src/buffer.C (setReadonly): ditto
6593 * src/lyxfunc.C (CloseBuffer): ditto
6595 * src/buffer.h: Take setReadonly() out of line so I don't have to include
6596 Dialogs.h, and hence all the SigC stuff, into every file that includes
6597 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
6599 * src/BufferView2.C: reduce the number of headers included by buffer.h
6601 2000-04-11 Allan Rae <rae@lyx.org>
6603 * src/frontends/xforms/xform_macros.h: A small collection of macros
6604 for building C callbacks.
6606 * src/frontends/xforms/Makefile.am: Added above file.
6608 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
6609 scheme again. This time it should work for JMarc. If this is
6610 successful I'll revise my conversion script to automate some of this.
6611 The static member functions in the class also have to be public for
6612 this scheme will work. If the scheme works (it's almost identical to
6613 the way BufferView::cursorToggleCB is handled so it should work) then
6614 FormCopyright and FormPrint will be ready for inclusion into the main
6615 trunk immediately after 1.1.5 is released -- provided we're prepared
6616 for complaints about lame compilers not handling XTL.
6618 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
6620 2000-04-07 Allan Rae <rae@lyx.org>
6622 * config/lyxinclude.m4: A bit more tidying up (Angus)
6624 * src/LString.h: JMarc's <string> header fix
6626 * src/PrinterParams.h: Used string for most data to remove some
6627 ugly code in the Print dialog and avoid even uglier code when
6628 appending the ints to a string for output.
6630 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
6631 and moved "default:" back to the end of switch statement. Cleaned
6632 up the printing so it uses the right function calls and so the
6633 "print to file" option actually puts the file in the right directory.
6635 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
6637 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
6638 and Ok+Apply button control into a separate method: input (Angus).
6639 (input) Cleaned it up and improved it to be very thorough now.
6640 (All CB) static_cast used instead of C style cast (Angus). This will
6641 probably change again once we've worked out how to keep gcc-2.8.1 happy
6642 with real C callbacks.
6643 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
6644 ignore some of the bool settings and has random numbers instead. Needs
6645 some more investigation. Added other input length checks and checking
6646 of file and printer names.
6648 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
6649 would link (Angus). Seems the old code doesn't compile with the pragma
6650 statement either. Separated callback entries from internal methods.
6652 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
6654 2000-03-17 Allan Rae <rae@lyx.org>
6656 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
6657 need it? Maybe it could go in Dialogs instead? I could make it a
6658 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
6659 values to get the bool return value.
6660 (Dispatch): New overloaded method for xtl support.
6662 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
6663 extern "C" callback instead of static member functions. Hopefully,
6664 JMarc will be able to compile this. I haven't changed
6665 forms/form_copyright.fd yet. Breaking one of my own rules already.
6667 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
6668 because they aren't useful from the minibuffer. Maybe a LyXServer
6669 might want a help message though?
6671 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
6673 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
6674 xtl which needs both rtti and exceptions.
6676 * src/support/Makefile.am:
6677 * src/support/lxtl.h: New file. Some helper macros for using XTL.
6679 * src/frontends/xforms/input_validators.[ch]: input filters and
6680 validators. These conrol what keys are valid in input boxes.
6681 Use them and write some more. Much better idea than waiting till
6682 after the user has pressed Ok to say that the input fields don't make
6685 * src/frontends/xforms/Makefile.am:
6686 * src/frontends/xforms/forms/form_print.fd:
6687 * src/frontends/xforms/forms/makefile:
6688 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
6689 new scheme. Still have to make sure I haven't missed anything from
6690 the current implementation.
6692 * src/Makefile.am, src/PrinterParams.h: New data store.
6694 * other files: Added a couple of copyright notices.
6696 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6698 * src/insets/insetbib.h: move Holder struct in public space.
6700 * src/frontends/include/DialogBase.h: use SigC:: only when
6701 SIGC_CXX_NAMESPACES is defined.
6702 * src/frontends/include/Dialogs.h: ditto.
6704 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
6706 * src/frontends/xforms/FormCopyright.[Ch]: do not
6707 mention SigC:: explicitely.
6709 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6711 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
6712 deals with testing KDE in main configure.in
6713 * configure.in: ditto.
6715 2000-02-22 Allan Rae <rae@lyx.org>
6717 * Lots of files: Merged from HEAD
6719 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
6720 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
6722 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
6724 * sigc++/: new minidist.
6726 2000-02-14 Allan Rae <rae@lyx.org>
6728 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
6730 2000-02-08 Juergen Vigna <jug@sad.it>
6732 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
6733 file for the buildin GUI builder of KDevelop of the copyright-dialog.
6735 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
6736 for this port and so it is much easier for other people to port
6737 dialogs in a common development environment.
6739 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
6740 the QT/KDE implementation.
6742 * src/frontends/kde/Dialogs.C:
6743 * src/frontends/kde/FormCopyright.C:
6744 * src/frontends/kde/FormCopyright.h:
6745 * src/frontends/kde/Makefile.am:
6746 * src/frontends/kde/formcopyrightdialog.C:
6747 * src/frontends/kde/formcopyrightdialog.h:
6748 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
6749 for the kde support of the Copyright-Dialog.
6751 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
6752 subdir-substitution instead of hardcoded 'xforms' as we now have also
6755 * src/frontends/include/DialogBase.h (Object): just commented the
6756 label after #endif (nasty warning and I don't like warnings ;)
6758 * src/main.C (main): added KApplication initialization if using
6761 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
6762 For now only the KDE event-loop is added if frontend==kde.
6764 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
6766 * configure.in: added support for the --with-frontend[=value] option
6768 * autogen.sh: added kde.m4 file to list of config-files
6770 * acconfig.h: added define for KDEGUI-support
6772 * config/kde.m4: added configuration functions for KDE-port
6774 * config/lyxinclude.m4: added --with-frontend[=value] option with
6775 support for xforms and KDE.
6777 2000-02-08 Allan Rae <rae@lyx.org>
6779 * all Makefile.am: Fixed up so the make targets dist, distclean,
6780 install and uninstall all work even if builddir != srcdir. Still
6781 have a new sigc++ minidist update to come.
6783 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
6785 2000-02-01 Allan Rae <rae@lyx.org>
6787 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
6788 Many mods to get builddir != srcdir working.
6790 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
6791 for building on NT and so we can do the builddir != srcdir stuff.
6793 2000-01-30 Allan Rae <rae@lyx.org>
6795 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
6796 This will stay in "rae" branch. We probably don't really need it in
6797 the main trunk as anyone who wants to help programming it should get
6798 a full library installed also. So they can check both included and
6799 system supplied library compilation.
6801 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
6802 Added a 'mini' distribution of libsigc++. If you feel the urge to
6803 change something in these directories - Resist it. If you can't
6804 resist the urge then you should modify the following script and rebuild
6805 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
6806 all happen. Still uses a hacked version of libsigc++'s configure.in.
6807 I'm quite happy with the results. I'm not sure the extra work to turn
6808 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
6809 worth the trouble and would probably lead to extra maintenance
6811 I haven't tested the following important make targets: install, dist.
6812 Not ready for prime time but very close. Maybe 1.1.5.
6814 * development/tools/makeLyXsigc.sh: A shell script to automatically
6815 generate our mini-dist of libsigc++. It can only be used with a CVS
6816 checkout of libsigc++ not a tarball distribution. It's well commented.
6817 This will end up as part of the libsigc++ distribution so other apps
6818 can easily have an included mini-dist. If someone makes mods to the
6819 sigc++ subpackage without modifying this script to generate those
6820 changes I'll be very upset!
6822 * src/frontends/: Started the gui/system indep structure.
6824 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
6825 to access the gui-indep dialogs are in this class. Much improved
6826 design compared to previous revision. Lars, please refrain from
6827 moving this header into src/ like you did with Popups.h last time.
6829 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
6831 * src/frontends/xforms/: Started the gui-indep system with a single
6832 dialog: FormCopyright. Initial testing of use of libsigc++ was very
6835 * src/frontends/xforms/forms: Repository for the xforms .fd files.
6836 Here you'll find a very useful makefile and automated fdfix.sh that
6837 makes updating dailogs a no-brainer -- provided you follow the rules
6838 set out in the README. I'm thinking about adding another script to
6839 automatically generate skeleton code for a new dialog given just the
6842 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
6843 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
6844 Made FormCopyright gui-indep and added a lyxfunc to get to it.
6846 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6848 * src/support/LSubstring.C (operator): simplify
6850 * src/lyxtext.h: removed bparams, use buffer_->params instead
6852 * src/lyxrow.h: make Row a real class, move all variables to
6853 private and use accessors.
6855 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
6857 (isRightToLeftPar): ditto
6858 (ChangeLanguage): ditto
6859 (isMultiLingual): ditto
6862 (SimpleTeXOnePar): ditto
6863 (TeXEnvironment): ditto
6864 (GetEndLabel): ditto
6866 (SetOnlyLayout): ditto
6867 (BreakParagraph): ditto
6868 (BreakParagraphConservative): ditto
6869 (GetFontSettings): ditto
6871 (CopyIntoMinibuffer): ditto
6872 (CutIntoMinibuffer): ditto
6873 (PasteParagraph): ditto
6874 (SetPExtraType): ditto
6875 (UnsetPExtraType): ditto
6876 (DocBookContTableRows): ditto
6877 (SimpleDocBookOneTablePar): ditto
6879 (TeXFootnote): ditto
6880 (SimpleTeXOneTablePar): ditto
6881 (TeXContTableRows): ditto
6882 (SimpleTeXSpecialChars): ditto
6885 * src/lyxcursor.h: make LyXCursor a real class, move all variables
6886 to private and use accessors.
6888 * src/lyx_cb.C: remove char updatetimer, and all code that uses
6889 this, we did not use it anymore and has not been for ages. Just a
6890 waste of cpu cycles.
6892 * src/language.h: make Language a real class, move all variables
6893 to private and use accessors.
6895 * src/BufferView_pimpl.C (Pimpl): use new timer code.
6896 (create_view): remove
6897 (update): some changes for new timer
6898 (cursorToggle): use new timer
6899 (beforeChange): change for new timer
6901 * src/BufferView.h (cursorToggleCB): removed last paramter because
6904 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
6905 (cursorToggleCB): change because of new timer code
6907 * lib/CREDITS: updated own mailaddress
6909 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6911 * src/support/filetools.C (PutEnv): fix the code in case neither
6912 putenv() nor setenv() have been found.
6914 * INSTALL: mention the install-strip Makefile target.
6916 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
6917 read-only documents.
6919 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6921 * lib/reLyX/configure.in (VERSION): avoid using a previously
6922 generated reLyX wrapper to find out $prefix.
6924 * lib/examples/eu_adibide_lyx-atua.lyx:
6925 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
6926 translation of the Tutorial (Dooteo)
6928 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
6930 * forms/cite.fd: new citation dialog
6932 * src/insetcite.[Ch]: the new citation dialog is moved into
6935 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
6938 * src/insets/insetcommand.h: data members made private.
6940 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6942 * LyX 1.1.5 released
6944 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6946 * src/version.h (LYX_RELEASE): to 1.1.5
6948 * src/spellchecker.C (RunSpellChecker): return false if the
6949 spellchecker dies upon creation.
6951 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6953 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
6954 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
6958 * lib/CREDITS: update entry for Martin Vermeer.
6960 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
6962 * src/text.C (draw): Draw foreign language bars at the bottom of
6963 the row instead of at the baseline.
6965 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
6967 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6969 * lib/bind/de_menus.bind: updated
6971 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6973 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
6975 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6977 * src/menus.C (Limit_string_length): New function
6978 (ShowTocMenu): Limit the number of items/length of items in the
6981 * src/paragraph.C (String): Correct result for a paragraph inside
6984 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6986 * src/bufferlist.C (close): test of buf->getuser() == NULL
6988 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
6990 * src/BufferView2.C (removeAutoInsets): Fix a bug:
6991 Do not call to SetCursor when the paragraph is a closed footnote!
6993 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
6995 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
6998 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7000 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7003 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7004 reference popup, that activates the reference-back action
7006 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7008 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7009 the menus. Also fixed a bug.
7011 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7012 the math panels when switching buffers (unless new buffer is readonly).
7014 * src/BufferView.C (NoSavedPositions)
7015 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7017 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7019 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7020 less of dvi dirty or not.
7022 * src/trans_mgr.[Ch] (insert): change first parameter to string
7025 * src/chset.[Ch] (encodeString): add const to first parameter
7027 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7029 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7033 * src/LaTeX.C (deplog): better searching for dependency files in
7034 the latex log. Uses now regexps.
7036 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7037 instead of the box hack or \hfill.
7039 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7041 * src/lyxfunc.C (doImportHelper): do not create the file before
7042 doing the actual import.
7043 (doImportASCIIasLines): create a new file before doing the insert.
7044 (doImportASCIIasParagraphs): ditto.
7046 * lib/lyxrc.example: remove mention of non-existing commands
7048 * lyx.man: remove mention of color-related switches.
7050 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7052 * src/lyx_gui.C: remove all the color-related ressources, which
7053 are not used anymore.
7055 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7058 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7060 * src/lyxrc.C (read): Add a missing break in the switch
7062 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7064 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7066 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7069 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7071 * src/text.C (draw): draw bars under foreign language words.
7073 * src/LColor.[Ch]: add LColor::language
7075 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7077 * src/lyxcursor.h (boundary): New member variable
7079 * src/text.C (IsBoundary): New methods
7081 * src/text.C: Use the above for currect cursor movement when there
7082 is both RTL & LTR text.
7084 * src/text2.C: ditto
7086 * src/bufferview_funcs.C (ToggleAndShow): ditto
7088 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7090 * src/text.C (DeleteLineForward): set selection to true to avoid
7091 that DeleteEmptyParagraphMechanism does some magic. This is how it
7092 is done in all other functions, and seems reasonable.
7093 (DeleteWordForward): do not jump over non-word stuff, since
7094 CursorRightOneWord() already does it.
7096 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7097 DeleteWordBackward, since they seem safe to me (since selection is
7098 set to "true") DeleteEmptyParagraphMechanism does nothing.
7100 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7102 * src/lyx_main.C (easyParse): simplify the code by factoring the
7103 part that removes parameters from the command line.
7104 (LyX): check wether wrong command line options have been given.
7106 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7108 * src/lyx_main.C : add support for specifying user LyX
7109 directory via command line option -userdir.
7111 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
7113 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
7114 the number of items per popup.
7115 (Add_to_refs_menu): Ditto.
7117 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7119 * src/lyxparagraph.h: renamed ClearParagraph() to
7120 StripLeadingSpaces() and moved it to paragraph.C. We pass the
7121 textclass as parameter, and do nothing if free_spacing is
7122 true. This fixes part of the line-delete-forward problems.
7124 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
7125 (pasteSelection): ditto.
7126 (SwitchLayoutsBetweenClasses): more translatable strings.
7128 * src/text2.C (CutSelection): use StripLeadingSpaces.
7129 (PasteSelection): ditto.
7130 (DeleteEmptyParagraphMechanism): ditto.
7132 2000-05-26 Juergen Vigna <jug@sad.it>
7134 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
7135 is not needed in tabular insets.
7137 * src/insets/insettabular.C (TabularFeatures): added missing features.
7139 * src/tabular.C (DeleteColumn):
7141 (AppendRow): implemented this functions
7142 (cellsturct::operator=): clone the inset too;
7144 2000-05-23 Juergen Vigna <jug@sad.it>
7146 * src/insets/insettabular.C (LocalDispatch): better selection support
7147 when having multicolumn-cells.
7149 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7151 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
7153 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7155 * src/ColorHandler.C (getGCForeground): put more test into _()
7157 * lib/examples/eu_splash.lyx: new file (Basque translation) from
7160 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
7163 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
7165 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
7166 there are no labels, or when buffer is readonly.
7168 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
7169 there are no labels, buffer is SGML, or when buffer is readonly.
7171 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7173 * src/LColor.C (LColor): change a couple of grey40 to grey60
7174 (LColor): rewore initalization to make compiles go some magnitude
7176 (getGUIName): don't use gettext until we need the string.
7178 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
7180 * src/Bullet.[Ch]: Fixed a small bug.
7182 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
7184 * src/paragraph.C (String): Several fixes/improvements
7186 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
7188 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7190 * src/paragraph.C (String): give more correct output.
7192 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
7194 * src/lyxfont.C (stateText) Do not output the language if it is
7195 eqaul to the language of the document.
7197 * src/paragraph.C (TeXOnePar): Do not put language switch commands
7198 between two paragraphs with the same language.
7200 * src/paragraph.C (getParLanguage) Return a correct answer for an
7201 empty dummy paragraph.
7203 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
7206 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
7209 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
7210 the menus/popup, if requested fonts are unavailable.
7212 2000-05-22 Juergen Vigna <jug@sad.it>
7214 * src/insets/insettabular.C (LocalDispatch): added some more cursor
7215 movement support (Up/Down/Tab/Shift-Tab).
7216 (LocalDispatch): added also preliminari cursor-selection.
7218 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
7220 * src/paragraph.C (PasteParagraph): Hopefully now right!
7222 2000-05-22 Garst R. Reese <reese@isn.net>
7224 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
7225 of list, change all references to Environment to Command
7226 * tex/hollywood.cls : rewrite environments as commands, add
7227 \uppercase to interiorshot and exteriorshot to force uppecase.
7228 * tex/broadway.cls : rewrite environments as commands. Tweak
7231 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7233 * src/menus.C (Add_to_toc_menu): fix the code which limits the
7234 size of items: use a constant intead of the hardcoded 40, and more
7235 importantly do not remove the %m and %x tags added at the end.
7236 (Add_to_refs_menu): use vector::size_type instead of
7237 unsigned int as basic types for the variables. _Please_ do not
7238 assume that size_t is equal to unsigned int. On an alpha, this is
7239 unsigned long, which is _not_ the same.
7241 * src/language.C (initL): remove language "hungarian", since it
7242 seems that "magyar" is better.
7244 2000-05-22 Juergen Vigna <jug@sad.it>
7246 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
7248 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
7251 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
7252 next was deleted but not set to 0.
7254 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7256 * src/language.C (initL): change the initialization of languages
7257 so that compiles goes _fast_.
7259 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
7262 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
7264 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7268 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7270 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
7272 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
7276 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
7279 * src/insets/insetlo*.[Ch]: Made editable
7281 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7283 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
7284 the current selection.
7286 * src/BufferView_pimpl.C (stuffClipboard): new method
7288 * src/BufferView.C (stuffClipboard): new method
7290 * src/paragraph.C (String): new method
7292 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
7293 LColor::ignore when lyxname is not found.
7295 * src/BufferView.C (pasteSelection): new method
7297 * src/BufferView_pimpl.C (pasteSelection): new method
7299 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
7301 * src/WorkArea.C (request_clipboard_cb): new static function
7302 (getClipboard): new method
7303 (putClipboard): new method
7305 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7307 * LyX 1.1.5pre2 released
7309 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7311 * src/vspace.C (operator=): removed
7312 (operator=): removed
7314 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
7316 * src/layout.C (NumberOfClass): manually set the type in make_pair
7317 (NumberOfLayout): ditto
7319 * src/language.C: use the Language constructor for ignore_lang
7321 * src/language.h: add constructors to struct Language
7323 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
7325 * src/text2.C (SetCursorIntern): comment out #warning
7327 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
7329 * src/mathed/math_iter.h: initialize sx and sw to 0
7331 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7333 * forms/lyx.fd: Redesign of form_ref
7335 * src/LaTeXFeatures.[Ch]
7339 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
7342 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
7343 and Buffer::inset_iterator.
7345 * src/menus.C: Added new menus: TOC and Refs.
7347 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
7349 * src/buffer.C (getTocList): New method.
7351 * src/BufferView2.C (ChangeRefs): New method.
7353 * src/buffer.C (getLabelList): New method. It replaces the old
7354 getReferenceList. The return type is vector<string> instead of
7357 * src/insets/insetinclude.C (getLabelList): New method. Replaces
7358 the old getLabel() and GetNumberOfLabels() methods.
7359 * src/insets/insetlabel.C (getLabelList): ditto
7360 * src/mathed/formula.C (getLabelList): ditto
7362 * src/paragraph.C (String): New method.
7364 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
7365 Uses the new getTocList() method.
7366 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
7367 which automatically updates the contents of the browser.
7368 (RefUpdateCB): Use the new getLabelList method.
7370 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
7372 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
7374 * src/spellchecker.C: Added using std::reverse;
7376 2000-05-19 Juergen Vigna <jug@sad.it>
7378 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
7380 * src/insets/insettext.C (computeTextRows): small fix for display of
7381 1 character after a newline.
7383 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
7386 2000-05-18 Juergen Vigna <jug@sad.it>
7388 * src/insets/insettabular.C (TabularFeatures): fixed update of display
7389 when changing width of column.
7391 * src/tabular.C (set_row_column_number_info): setting of
7392 autobreak rows if necessary.
7394 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7396 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
7398 * src/vc-backend.*: renamed stat() to status() and vcstat to
7399 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
7400 compilation broke. The new name seems more relevant, anyway.
7402 2000-05-17 Juergen Vigna <jug@sad.it>
7404 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
7405 which was wrong if the removing caused removing of rows!
7407 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
7408 (pushToken): new function.
7410 * src/text2.C (CutSelection): fix problem discovered with purify
7412 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7414 * src/debug.C (showTags): enlarge the first column, now that we
7415 have 6-digits debug codes.
7417 * lib/layouts/hollywood.layout:
7418 * lib/tex/hollywood.cls:
7419 * lib/tex/brodway.cls:
7420 * lib/layouts/brodway.layout: more commands and fewer
7421 environments. Preambles moved in the .cls files. Broadway now has
7422 more options on scene numbering and less whitespace (from Garst)
7424 * src/insets/insetbib.C (getKeys): make sure that we are in the
7425 document directory, in case the bib file is there.
7427 * src/insets/insetbib.C (Latex): revert bogus change.
7429 2000-05-16 Juergen Vigna <jug@sad.it>
7431 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
7432 the TabularLayout on cursor move.
7434 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
7436 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
7439 (draw): fixed cursor position and drawing so that the cursor is
7440 visible when before the tabular-inset.
7442 * src/insets/insettext.C (init): drawLockedFrame was not initialized
7443 when creating from old insettext.
7445 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
7447 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7449 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
7450 * lib/tex/brodway.cls: ditto
7452 * lib/layouts/brodway.layout: change alignment of parenthical
7455 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7457 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
7458 versions 0.88 and 0.89 are supported.
7460 2000-05-15 Juergen Vigna <jug@sad.it>
7462 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
7465 * src/insets/insettext.C (computeTextRows): redone completely this
7466 function in a much cleaner way, because of problems when having a
7468 (draw): added a frame border when the inset is locked.
7469 (SetDrawLockedFrame): this sets if we draw the border or not.
7470 (SetFrameColor): this sets the frame color (default=insetframe).
7472 * src/insets/lyxinset.h: added x() and y() functions which return
7473 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
7474 function which is needed to see if we have a locking inset of some
7475 type in this inset (needed for now in insettabular).
7477 * src/vspace.C (inPixels): the same function also without a BufferView
7478 parameter as so it is easier to use it in some ocasions.
7480 * src/lyxfunc.C: changed all places where insertInset was used so
7481 that now if it couldn't be inserted it is deleted!
7483 * src/TabularLayout.C:
7484 * src/TableLayout.C: added support for new tabular-inset!
7486 * src/BufferView2.C (insertInset): this now returns a bool if the
7487 inset was really inserted!!!
7489 * src/tabular.C (GetLastCellInRow):
7490 (GetFirstCellInRow): new helper functions.
7491 (Latex): implemented for new tabular class.
7495 (TeXTopHLine): new Latex() helper functions.
7497 2000-05-12 Juergen Vigna <jug@sad.it>
7499 * src/mathed/formulamacro.C (Read):
7500 * src/mathed/formula.C (Read): read also the \end_inset here!
7502 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7504 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
7505 crush when saving formulae with unbalanced parenthesis.
7507 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
7509 * src/layout.C: Add new keyword "endlabelstring" to layout file
7511 * src/text.C (GetVisibleRow): Draw endlabel string.
7513 * lib/layouts/broadway.layout
7514 * lib/layouts/hollywood.layout: Added endlabel for the
7515 Parenthetical layout.
7517 * lib/layouts/heb-article.layout: Do not use slanted font shape
7518 for Theorem like environments.
7520 * src/buffer.C (makeLaTeXFile): Always add "american" to
7521 the UsedLanguages list if document language is RTL.
7523 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7525 * add addendum to README.OS2 and small patch (from SMiyata)
7527 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7529 * many files: correct the calls to ChangeExtension().
7531 * src/support/filetools.C (ChangeExtension): remove the no_path
7532 argument, which does not belong there. Use OnlyFileName() instead.
7534 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
7535 files when LaTeXing a non-nice latex file.
7537 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
7538 a chain of "if". Return false when deadkeys are not handled.
7540 * src/lyx_main.C (LyX): adapted the code for default bindings.
7542 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
7543 bindings for basic functionality (except deadkeys).
7544 (deadKeyBindings): new method. Performs the bindings of deadkeys.
7546 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
7547 several methods: handle override_x_deadkeys.
7549 * src/lyxrc.h: remove the "bindings" map, which did not make much
7550 sense anyway. New variable override_x_deadkeys, defaulting to "true".
7552 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7554 * src/lyxfont.C (stateText): use a saner method to determine
7555 whether the font is "default". Seems to fix the crash with DEC
7558 * src/Bullet.[Ch] (Bullet): remove const on parameters.
7560 2000-05-08 Juergen Vigna <jug@sad.it>
7562 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
7563 TabularLayoutMenu with mouse-button-3
7564 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
7566 * src/TabularLayout.C: added this file for having a Layout for
7569 2000-05-05 Juergen Vigna <jug@sad.it>
7571 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
7572 recalculating inset-widths.
7573 (TabularFeatures): activated this function so that I can change
7574 tabular-features via menu.
7576 * src/menus.C (ShowEditMenu): inserted support for insettabular so
7577 that I can test some functions with the Table menu.
7579 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7581 * src/lyxfont.C (stateText): guard against stupid c++libs.
7583 * src/tabular.C: add using std::vector
7584 some whitespace changes, + removed som autogenerated code.
7586 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
7588 2000-05-05 Juergen Vigna <jug@sad.it>
7590 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
7591 row, columns and cellstructures.
7593 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7595 * lib/lyxrc.example: remove obsolete entries.
7597 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
7598 reading of protected_separator for free_spacing.
7600 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7602 * src/text.C (draw): do not display an exclamation mark in the
7603 margin for margin notes. This is confusing, ugly and
7606 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
7607 AMS math' is checked.
7609 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
7610 name to see whether including the amsmath package is needed.
7612 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
7614 * src/paragraph.C (validate): Compute UsedLanguages correctly
7615 (don't insert the american language if it doesn't appear in the
7618 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
7619 The argument of \thanks{} command is considered moving argument
7621 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
7624 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
7626 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
7627 for appendix/minipage/depth. The lines can be now both in the footnote
7628 frame, and outside the frame.
7630 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
7633 2000-05-05 Juergen Vigna <jug@sad.it>
7635 * src/table.[Ch]: removed the inset and buffer stuff as this is now
7636 neede only in tabular.[Ch].
7638 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7640 * src/insets/insetspecialchar.C (Read): allow command == '~' for
7642 (Write): write '~' for PROTECTED_SEPARATOR
7644 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7646 * src/lyxparagraph.h: add a friend struct matchIT after the struct
7649 * src/mathed/formula.C (drawStr): rename size to siz.
7651 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
7652 possibly fix a bug by not changing the pflags = flags to piflags =
7655 2000-05-05 Juergen Vigna <jug@sad.it>
7657 * src/insets/insetbib.C: moved using directive
7659 * src/ImportNoweb.C: small fix for being able to compile (missing
7662 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7664 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
7665 to use clear, since we don't depend on this in the code. Add test
7668 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7670 * (various *.C files): add using std::foo directives to please dec
7673 * replace calls to string::clear() to string::erase() (Angus)
7675 * src/cheaders/cmath: modified to provide std::abs.
7677 2000-05-04 Juergen Vigna <jug@sad.it>
7679 * src/insets/insettext.C: Prepared all for inserting of multiple
7680 paragraphs. Still display stuff to do (alignment and other things),
7681 but I would like to use LyXText to do this when we cleaned out the
7682 table-support stuff.
7684 * src/insets/insettabular.C: Changed lot of stuff and added lots
7685 of functionality still a lot to do.
7687 * src/tabular.C: Various functions changed name and moved to be
7688 const functions. Added new Read and Write functions and changed
7689 lots of things so it works good with tabular-insets (also removed
7690 some stuff which is not needed anymore * hacks *).
7692 * src/lyxcursor.h: added operators == and != which just look if
7693 par and pos are (not) equal.
7695 * src/buffer.C (latexParagraphs): inserted this function to latex
7696 all paragraphs form par to endpar as then I can use this too for
7699 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
7700 so that I can call this to from text insets with their own cursor.
7702 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
7703 output off all paragraphs (because of the fix below)!
7705 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
7706 the very last paragraph (this could be also the last paragraph of an
7709 * src/texrow.h: added rows() call which returns the count-variable.
7711 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7713 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
7715 * lib/configure.m4: better autodetection of DocBook tools.
7717 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7719 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
7721 * src/lyx_cb.C: add using std::reverse;
7723 * src/LaTeX.C (run): on error always run deleteFilesOnError before
7726 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
7727 selected files. Should fix repeated errors from generated files.
7729 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
7731 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
7733 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
7734 the spellchecker popup.
7736 * lib/lyxrc.example: Removed the \number_inset section
7738 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7740 * src/insets/figinset.C (various): Use IsFileReadable() to make
7741 sure that the file actually exist. Relying on ghostscripts errors
7742 is a bad idea since they can lead to X server crashes.
7744 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
7746 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
7749 * lib/lyxrc.example: smallish typo in description of
7750 \view_dvi_paper_option
7752 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7755 * src/lyxfunc.C: doImportHelper to factor out common code of the
7756 various import methods. New functions doImportASCIIasLines,
7757 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
7758 doImportLinuxDoc for the format specific parts.
7761 * buffer.C: Dispatch returns now a bool to indicate success
7764 * lyx_gui.C: Add getLyXView() for member access
7766 * lyx_main.C: Change logic for batch commands: First try
7767 Buffer::Dispatch (possibly without GUI), if that fails, use
7770 * lyx_main.C: Add support for --import command line switch.
7771 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
7772 Available Formats: Everything accepted by 'buffer-import <format>'
7774 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7776 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
7779 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
7780 documents will be reformatted upon reentry.
7782 2000-04-27 Juergen Vigna <jug@sad.it>
7784 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
7785 correctly only last pos this was a bug.
7787 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7789 * release of lyx-1.1.5pre1
7791 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7793 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
7795 * src/menus.C: revert the change of naming (Figure->Graphic...)
7796 from 2000-04-11. It was incomplete and bad.
7798 * src/LColor.[Ch]: add LColor::depthbar.
7799 * src/text.C (GetVisibleRow): use it.
7801 * README: update the languages list.
7803 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7805 * src/text.C (GetVisibleRow): show the depth of paragraphs using
7808 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7810 * README: remove sections that were just wrong.
7812 * src/text2.C (GetRowNearY): remove currentrow code
7814 * src/text.C (GetRow): remove currentrow code
7816 * src/screen.C (Update): rewritten a bit.
7817 (SmallUpdate): removed func
7819 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
7821 (FullRebreak): return bool
7822 (currentrow): remove var
7823 (currentrow_y): ditto
7825 * src/lyxscreen.h (Draw): change arg to unsigned long
7826 (FitCursor): return bool
7827 (FitManualCursor): ditto
7828 (Smallpdate): remove func
7829 (first): change to unsigned long
7830 (DrawOneRow): change second arg to long (from long &)
7831 (screen_refresh_y): remove var
7832 (scree_refresh_row): ditto
7834 * src/lyxrow.h: change baseline to usigned int from unsigned
7835 short, this brings some implicit/unsigned issues out in the open.
7837 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
7839 (Dispatch): don't call updateScrollbar after fitCursor. Use update
7840 instead of smallUpdate.
7842 * src/lyxcursor.h: change y to unsigned long
7844 * src/buffer.h: don't call updateScrollbar after fitcursor
7846 * src/buffer.C (parseSingleLyXformat2Token): move variables to
7847 where they are used. Removed "\\direction", this was not present
7848 in 1.1.4 and is already obsolete. Commented out some code that I
7849 believe to never be called.
7850 (runLiterate): don't call updateScrollbar after fitCursor
7852 (buildProgram): ditto
7855 * src/WorkArea.h (workWidth): change return val to unsigned
7858 (redraw): remove the button redraws
7859 (setScrollbarValue): change for scrollbar
7860 (getScrollbarValue): change for scrollbar
7861 (getScrollbarBounds): change for scrollbar
7863 * src/WorkArea.C (C_WorkArea_up_cb): removed func
7864 (C_WorkArea_down_cb): removed func
7865 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
7866 (resize): change for scrollbar
7867 (setScrollbar): ditto
7868 (setScrollbarBounds): ditto
7869 (setScrollbarIncrements): ditto
7870 (up_cb): removed func
7871 (down_cb): removed func
7872 (scroll_cb): change for scrollbar
7873 (work_area_handler): ditto
7875 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
7876 when FitCursor did something.
7877 (updateScrollbar): some unsigned changes
7878 (downCB): removed func
7879 (scrollUpOnePage): removed func
7880 (scrollDownOnePage): remvoed func
7881 (workAreaMotionNotify): don't call screen->FitCursor but use
7882 fitCursor instead. and bool return val
7883 (workAreaButtonPress): ditto
7884 (workAreaButtonRelease): some unsigned changes
7885 (checkInsetHit): ditto
7886 (workAreaExpose): ditto
7887 (update): parts rewritten, comments about the signed char arg added
7888 (smallUpdate): removed func
7889 (cursorPrevious): call needed updateScrollbar
7892 * src/BufferView2.C (allFloats): don't call updateScrollbar after
7895 * src/BufferView.[Ch] (upCB): removed func
7896 (downCB): removed func
7897 (smallUpdate): removed func
7899 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7901 * src/lyxtext.h src/text.C src/text2.C: removed support for the
7902 currentrow, currentrow_y optimization. This did not help a lot and
7903 if we want to do this kind of optimization we should rather use
7904 cursor.row instead of the currentrow.
7906 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
7907 buffer spacing and klyx spacing support.
7909 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7911 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
7914 2000-04-26 Juergen Vigna <jug@sad.it>
7916 * src/insets/figinset.C: fixes to Lars sstream changes!
7918 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
7920 * A lot of files: Added Ascii(ostream &) methods to all inset
7921 classes. Used when exporting to ASCII.
7923 * src/buffer.C (writeFileAscii,RoffAsciiTable)
7924 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
7927 * src/text2.C (ToggleFree): Disabled implicit word selection when
7928 there is a change in the language
7930 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
7931 no output was generated for end-of-sentence inset.
7933 * src/insets/lyxinset.h
7936 * src/paragraph.C: Removed the insetnumber code
7938 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
7940 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7942 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
7943 no_babel and no_epsfig completely from the file.
7944 (parseSingleLyXformat2Token): add handling for per-paragraph
7945 spacing as written by klyx.
7947 * src/insets/figinset.C: applied patch by Andre. Made it work with
7950 2000-04-20 Juergen Vigna <jug@sad.it>
7952 * src/insets/insettext.C (cutSelection):
7953 (copySelection): Fixed with selection from right to left.
7954 (draw): now the rows are not recalculated at every draw.
7955 (computeTextRows): for now reset the inset-owner here (this is
7956 important for an undo or copy where the inset-owner is not set
7959 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
7960 motion to the_locking_inset screen->first was forgotten, this was
7961 not important till we got multiline insets.
7963 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7965 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
7966 code seems to be alright (it is code changed by Dekel, and the
7967 intent is indeed that all macros should be defined \protect'ed)
7969 * NEWS: a bit of reorganisation of the new user-visible features.
7971 2000-04-19 Juergen Vigna <jug@sad.it>
7973 * src/insets/insettext.C (init): using a LyXCursor now for cursor
7974 position. Set the inset_owner of the used paragraph so that it knows
7975 that it is inside an inset. Fixed cursor handling with mouse and
7976 cursor keys. Fixed wrong timed inset redraws and lots of other changes
7977 and cleanups to make TextInsets work better.
7979 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
7980 Changed parameters of various functions and added LockInsetInInset().
7982 * src/insets/insettext.C:
7984 * src/insets/insetcollapsable.h:
7985 * src/insets/insetcollapsable.C:
7986 * src/insets/insetfoot.h:
7987 * src/insets/insetfoot.C:
7988 * src/insets/insetert.h:
7989 * src/insets/insetert.C: cleaned up the code so that it works now
7990 correctly with insettext.
7992 * src/insets/inset.C:
7993 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
7994 that insets in insets are supported right.
7997 * src/table.C: lots of changes for use with inset tabular (and cleanup)
7999 * src/paragraph.C: some small fixes
8001 * src/debug.h: inserted INSETS debug info
8003 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8004 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8006 * src/commandtags.h:
8007 * src/LyXAction.C: insert code for InsetTabular.
8009 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8010 not Button1MotionMask.
8011 (workAreaButtonRelease): send always a InsetButtonRelease event to
8013 (checkInsetHit): some setCursor fixes (always with insets).
8015 * src/BufferView2.C (lockInset): returns a bool now and extended for
8016 locking insets inside insets.
8017 (showLockedInsetCursor): it is important to have the cursor always
8018 before the locked inset.
8019 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8021 * src/BufferView.h: made lockInset return a bool.
8023 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8025 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8026 that is used also internally but can be called as public to have back
8027 a cursor pos which is not set internally.
8028 (SetCursorIntern): Changed to use above function.
8030 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8032 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8037 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8038 patches for things that should be in or should be changed.
8040 * src/* [insetfiles]: change "usigned char fragile" to bool
8041 fragile. There was only one point that could that be questioned
8042 and that is commented in formulamacro.C. Grep for "CHECK".
8044 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8045 (DeleteBuffer): take it out of CutAndPaste and make it static.
8047 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8049 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8050 output the spacing envir commands. Also the new commands used in
8051 the LaTeX output makes the result better.
8053 * src/Spacing.C (writeEnvirBegin): new method
8054 (writeEnvirEnd): new method
8056 2000-04-18 Juergen Vigna <jug@sad.it>
8058 * src/CutAndPaste.C: made textclass a static member of the class
8059 as otherwise it is not accesed right!!!
8061 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8063 * forms/layout_forms.fd
8064 * src/layout_forms.h
8065 * src/layout_forms.C (create_form_form_character)
8066 * src/lyx_cb.C (UserFreeFont)
8067 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8068 documents (in the layout->character popup).
8070 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8072 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8073 \spell_command was in fact not honored (from Kevin Atkinson).
8075 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8078 * src/lyx_gui.h: make lyxViews private (Angus)
8080 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8082 * src/mathed/math_write.C
8083 (MathMatrixInset::Write) Put \protect before \begin{array} and
8084 \end{array} if fragile
8085 (MathParInset::Write): Put \protect before \\ if fragile
8087 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8089 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8090 initialization if the LyXColorHandler must be done after the
8091 connections to the XServer has been established.
8093 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8094 get the background pixel from the lyxColorhandler so that the
8095 figures are rendered with the correct background color.
8096 (NextToken): removed functions.
8097 (GetPSSizes): use ifs >> string instead of NextToken.
8099 * src/Painter.[Ch]: the color cache moved out of this file.
8101 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8104 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8106 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8107 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
8109 * src/BufferView.C (enterView): new func
8110 (leaveView): new func
8112 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
8114 (leaveView): new func, undefines xterm cursor when approp.
8116 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
8117 (AllowInput): delete the Workarea cursor handling from this func.
8119 * src/Painter.C (underline): draw a slimer underline in most cases.
8121 * src/lyx_main.C (error_handler): use extern "C"
8123 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8125 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
8126 sent directly to me.
8128 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
8129 to the list by Dekel.
8131 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
8134 * src/bufferview_funcs.[Ch]: two new files, moved several of the
8135 methods from lyx_cb.here.
8137 * src/lyx_cb.C: in addition to the above; removed input_prohibited
8140 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8142 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
8143 instead of using current_view directly.
8145 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
8147 * src/LyXAction.C (init): add the paragraph-spacing command.
8149 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
8151 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
8153 * src/lyx_cb.C (CurrentState): output a string when the spacing is
8154 different from the documents.
8156 * src/text.C (SetHeightOfRow): take paragraph spacing into
8157 account, paragraph spacing takes precedence over buffer spacing
8158 (GetVisibleRow): ditto
8160 * src/paragraph.C (writeFile): output the spacing parameter too.
8161 (validate): set the correct features if spacing is used in the
8163 (Clear): set spacing to default
8164 (MakeSameLayout): spacing too
8165 (HasSameLayout): spacing too
8166 (SetLayout): spacing too
8167 (TeXOnePar): output the spacing commands
8169 * src/lyxparagraph.h: added a spacing variable for use with
8170 per-paragraph spacing.
8172 * src/Spacing.h: add a Default spacing and a method to check if
8173 the current spacing is default. also added an operator==
8175 * src/text2.C (DeleteEmptyParagraphMechanism): added a
8178 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8180 * src/lyxserver.C (callback): fix dispatch of functions
8182 * src/insets/insetlatexaccent.C (checkContents): turn bogus
8183 printf() into lyxerr call.
8185 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
8188 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
8189 "Table" to "Table Box", "Float" to "Floating Material"; deletes
8190 the "Float" from each of the subitems.
8191 (ShowHelpMenu): add entry for "FAQ" and "TOC".
8193 * src/support/DebugStream.h: add an #ifdef to work around a gcc
8194 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
8195 documented the change so that the workaround can be nuked later.
8197 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
8200 * src/lyxlex_pimpl.C (next): do not re-declare the default value
8202 * src/buffer.C (getLatexName): ditto
8203 (setReadonly): ditto
8205 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8207 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
8208 avoid some uses of current_view. Added also a bufferParams()
8209 method to get at this.
8211 * src/lyxtext.h: changed params->buffer and paramters->bparams.
8213 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8215 * src/lyxparagraph.[Ch]: removed
8216 operator<(LyXParagraph::InsetTable..., added a struct matchIT
8217 with operators used by lower_bound and
8218 upper_bound in InsetTable's
8219 Make struct InsetTable private again. Used matchpos.
8221 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
8223 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
8224 document, the language of existing text is changed (unless the
8225 document is multi-lingual)
8227 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
8229 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
8231 * A lot of files: A rewrite of the Right-to-Left support.
8233 2000-04-10 Juergen Vigna <jug@sad.it>
8235 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
8236 misplaced cursor when inset in inset is locked.
8238 * src/insets/insettext.C (LocalDispatch): small fix so that a
8239 BREAKLINE is not inserted if we don't permit it with autBreakRows.
8241 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
8242 footnote font should be decreased in size twice when displaying.
8244 * src/insets/insettext.C (GetDrawFont): inserted this function as
8245 the drawing-font may differ from the real paragraph font.
8247 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
8248 insets (inset in inset!).
8250 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
8251 function here because we don't want footnotes inside footnotes.
8253 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
8255 (init): now set the inset_owner in paragraph.C
8256 (LocalDispatch): added some resetPos() in the right position
8259 (pasteSelection): changed to use the new CutAndPaste-Class.
8261 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
8262 which tells if it is allowed to insert another inset inside this one.
8264 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
8265 SwitchLayoutsBetweenClasses.
8267 * src/text2.C (InsertInset): checking of the new paragraph-function
8269 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
8270 is not needed anymore here!
8273 (PasteSelection): redone (also with #ifdef) so that now this uses
8274 the CutAndPaste-Class.
8275 (SwitchLayoutsBetweenClasses): removed here and implemented in the
8278 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
8279 from/to text/insets.
8281 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
8282 so that the paragraph knows if it is inside an (text)-inset.
8283 (InsertFromMinibuffer): changed return-value to bool as now it
8284 may happen that an inset is not inserted in the paragraph.
8285 (InsertInsetAllowed): this checks if it is allowed to insert an
8286 inset in this paragraph.
8288 (BreakParagraphConservative):
8289 (BreakParagraph) : small change for the above change of the return
8290 value of InsertFromMinibuffer.
8292 * src/lyxparagraph.h: added inset_owner and the functions to handle
8293 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
8295 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8297 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
8298 functions from BufferView to BufferView::Pimpl to ease maintence.
8300 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
8301 correctly. Also use SetCursorIntern instead of SetCursor.
8303 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
8306 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8308 * src/WorkArea.C (belowMouse): manually implement below mouse.
8310 * src/*: Add "explicit" on several constructors, I added probably
8311 some unneeded ones. A couple of changes to code because of this.
8313 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
8314 implementation and private parts from the users of BufferView. Not
8317 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
8318 implementation and private parts from the users of LyXLex. Not
8321 * src/BufferView_pimpl.[Ch]: new files
8323 * src/lyxlex_pimpl.[Ch]: new files
8325 * src/LyXView.[Ch]: some inline functions move out-of-line
8327 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8329 * src/lyxparagraph.h: make struct InsetTable public.
8331 * src/support/lyxstring.h: change lyxstring::difference_type to be
8332 ptrdiff_t. Add std:: modifiers to streams.
8334 * src/font.C: include the <cctype> header, for islower() and
8337 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8339 * src/font.[Ch]: new files. Contains the metric functions for
8340 fonts, takes a LyXFont as parameter. Better separation of concepts.
8342 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
8343 changes because of this.
8345 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
8347 * src/*: compile with -Winline and move functions that don't
8350 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
8353 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8355 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
8356 (various files changed because of this)
8358 * src/Painter.C (text): fixed the drawing of smallcaps.
8360 * src/lyxfont.[Ch] (drawText): removed unused member func.
8363 * src/*.C: added needed "using" statements and "std::" qualifiers.
8365 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
8367 * src/*.h: removed all use of "using" from header files use
8368 qualifier std:: instead.
8370 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8372 * src/text.C (Backspace): some additional cleanups (we already
8373 know whether cursor.pos is 0 or not).
8375 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
8376 automake does not provide one).
8378 * src/bmtable.h: replace C++ comments with C comments.
8380 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
8382 * src/screen.C (ShowCursor): Change the shape of the cursor if
8383 the current language is not equal to the language of the document.
8384 (If the cursor change its shape unexpectedly, then you've found a bug)
8386 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
8389 * src/insets/insetnumber.[Ch]: New files.
8391 * src/LyXAction.C (init)
8392 * src/lyxfunc.C (dispatch): Add command number-inset-insert
8395 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
8397 * src/lyxparagraph.h
8398 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
8399 (the vector is kept sorted).
8401 * src/text.C (GetVisibleRow): Draw selection correctly when there
8402 is both LTR and RTL text.
8404 * src/paragraph.C (Clone): Use the assignment operator for cloning,
8405 which is much faster.
8407 * src/text.C (GetVisibleRow and other): Do not draw the last space
8408 in a row if the direction of the last letter is not equal to the
8409 direction of the paragraph.
8411 * src/lyxfont.C (latexWriteStartChanges):
8412 Check that font language is not equal to basefont language.
8413 (latexWriteEndChanges): ditto
8415 * src/lyx_cb.C (StyleReset): Don't change the language while using
8416 the font-default command.
8418 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
8419 empty paragraph before a footnote.
8421 * src/insets/insetcommand.C (draw): Increase x correctly.
8423 * src/screen.C (ShowCursor): Change cursor shape if
8424 current language != document language.
8426 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
8428 2000-03-31 Juergen Vigna <jug@sad.it>
8430 * src/paragraph.C (GetInset): commented out text[pos] = ' '
8431 (Clone): changed mode how the paragraph-data is copied to the
8432 new clone-paragraph.
8434 * src/lyxfunc.C (Dispatch): fixed small problem when calling
8435 GetInset(pos) with no inset anymore there (in inset UNDO)
8437 * src/insets/insetcommand.C (draw): small fix as here x is
8438 incremented not as much as width() returns (2 before, 2 behind = 4)
8440 2000-03-30 Juergen Vigna <jug@sad.it>
8442 * src/insets/insettext.C (InsetText): small fix in initialize
8443 widthOffset (should not be done in the init() function)
8445 2000-03-29 Amir Karger <karger@lyx.org>
8447 * lib/examples/it_ItemizeBullets.lyx: translation by
8450 * Implemented \textasciitilde and fixed a tiny bug in reLyX
8452 2000-03-29 Juergen Vigna <jug@sad.it>
8454 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
8456 * src/insets/insetfoot.C (Clone): small change as for the below
8457 new init function in the text-inset
8459 * src/insets/insettext.C (init): new function as I've seen that
8460 clone did not copy the Paragraph-Data!
8461 (LocalDispatch): Added code so that now we have some sort of Undo
8462 functionality (well actually we HAVE Undo ;)
8464 * src/text.C (Backspace): Small fix for the a | a Backspace problem
8466 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
8468 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
8471 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8473 * src/main.C: added a runtime check that verifies that the xforms
8474 header used when building LyX and the library used when running
8475 LyX match. Exit with a message if they don't match. This is a
8476 version number check only.
8478 * src/buffer.C (save): Don't allocate memory on the heap for
8479 struct utimbuf times.
8481 * *: some using changes, use iosfwd instead of the real headers.
8483 * src/lyxfont.C use char const * instead of string for the static
8484 strings. Rewrite some functions to use sstream.
8486 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8488 * src/text.C (Backspace): hopefully fix the dreaded backaspace
8491 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8493 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
8494 of Geodesy (from Martin Vermeer)
8496 * lib/layouts/svjour.inc: include file for the Springer svjour
8497 class. It can be used to support journals other than JoG.
8499 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
8500 Miskiewicz <misiek@pld.org.pl>)
8501 * lib/reLyX/Makefile.am: ditto.
8503 2000-03-27 Juergen Vigna <jug@sad.it>
8505 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
8506 also some modifications with operations on selected text.
8508 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
8509 problems with clicking on insets (last famous words ;)
8511 * src/insets/insetcommand.C (draw):
8512 (width): Changed to have a bit of space before and after the inset so
8513 that the blinking cursor can be seen (otherwise it was hidden)
8515 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8517 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
8518 would not be added to the link list when an installed gettext (not
8519 part of libc) is found.
8521 2000-03-24 Juergen Vigna <jug@sad.it>
8523 * src/insets/insetcollapsable.C (Edit):
8524 * src/mathed/formula.C (InsetButtonRelease):
8525 (InsetButtonPress): fixed for new handling of ButtonPress/Release
8528 * src/BufferView.C (workAreaButtonPress):
8529 (workAreaButtonRelease):
8530 (checkInsetHit): Finally fixed the clicking on insets be handled
8533 * src/insets/insetert.C (Edit): inserted this call so that ERT
8534 insets work always with LaTeX-font
8536 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8538 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
8539 caused lyx to startup with no GUI in place, causing in a crash
8540 upon startup when called with arguments.
8542 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8544 * src/FontLoader.C: better initialization of dummyXFontStruct.
8546 2000-03-20 José Abílio Matos <jamatos@lyx.org>
8548 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
8549 for linuxdoc and docbook import and export format options.
8551 * lib/lyxrc.example Example of default values for the previous flags.
8553 * src/lyx_cb.C Use those flags instead of the hardwired values for
8554 linuxdoc and docbook export.
8556 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
8559 * src/menus.C Added menus entries for the new import/exports formats.
8561 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8563 * src/lyxrc.*: Added support for running without Gui
8566 * src/FontLoader.C: sensible defaults if no fonts are needed
8568 * src/lyx_cb.C: New function ShowMessage (writes either to the
8569 minibuffer or cout in case of no gui
8570 New function AskOverwrite for common stuff
8571 Consequently various changes to call these functions
8573 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
8574 wild guess at sensible screen resolution when having no gui
8576 * src/lyxfont.C: no gui, no fonts... set some defaults
8578 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8580 * src/LColor.C: made the command inset background a bit lighter.
8582 2000-03-20 Hartmut Goebel <goebel@noris.net>
8584 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
8585 stdstruct.inc. Koma-Script added some title elements which
8586 otherwise have been listed below "bibliography". This split allows
8587 adding title elements to where they belong.
8589 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
8590 define the additional title elements and then include
8593 * many other layout files: changed to include stdtitle.inc just
8594 before stdstruct.inc.
8596 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
8598 * src/buffer.C: (save) Added the option to store all backup files
8599 in a single directory
8601 * src/lyxrc.[Ch]: Added variable \backupdir_path
8603 * lib/lyxrc.example: Added descriptions of recently added variables
8605 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
8606 bibtex inset, not closing the bibtex popup when deleting the inset)
8608 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8610 * src/lyx_cb.C: add a couple using directives.
8612 2000-03-17 José Abílio Matos <jamatos@lyx.org>
8613 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
8614 import based on the filename.
8616 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
8617 file would be imported at start, if the filename where of a sgml file.
8619 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
8621 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
8623 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
8624 * src/lyxfont.h Replaced the member variable bits.direction by the
8625 member variable lang. Made many changes in other files.
8626 This allows having a multi-lingual document
8628 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
8629 that change the current language to <l>.
8630 Removed the command "font-rtl"
8632 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
8633 format for Hebrew documents)
8635 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
8636 When auto_mathmode is "true", pressing a digit key in normal mode
8637 will cause entering into mathmode.
8638 If auto_mathmode is "rtl" then this behavior will be active only
8639 when writing right-to-left text.
8641 * src/text2.C (InsertStringA) The string is inserted using the
8644 * src/paragraph.C (GetEndLabel) Gives a correct result for
8645 footnote paragraphs.
8647 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
8649 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8651 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
8652 front of PasteParagraph. Never insert a ' '. This should at least
8653 fix some cause for the segfaults that we have been experiencing,
8654 it also fixes backspace behaviour slightly. (Phu!)
8656 * src/support/lstrings.C (compare_no_case): some change to make it
8657 compile with gcc 2.95.2 and stdlibc++-v3
8659 * src/text2.C (MeltFootnoteEnvironment): change type o
8660 first_footnote_par_is_not_empty to bool.
8662 * src/lyxparagraph.h: make text private. Changes in other files
8664 (fitToSize): new function
8665 (setContentsFromPar): new function
8666 (clearContents): new function
8667 (SetChar): new function
8669 * src/paragraph.C (readSimpleWholeFile): deleted.
8671 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
8672 the file, just use a simple string instead. Also read the file in
8673 a more maintainable manner.
8675 * src/text2.C (InsertStringA): deleted.
8676 (InsertStringB): deleted.
8678 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8680 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
8681 RedoParagraphs from the doublespace handling part, just set status
8682 to NEED_MORE_REFRESH. Also don't update cursor position (should be
8683 done, but perhaps not like this.)
8685 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8687 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
8688 character when inserting an inset.
8690 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8692 * src/bufferparams.C (readLanguage): now takes "default" into
8695 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
8696 also initialize the toplevel_keymap with the default bindings from
8699 * src/buffer.C (Buffer): remove lyxrc from the parameters.
8701 * all files using lyxrc: have lyxrc as a real variable and not a
8702 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
8705 * src/lyxrc.C: remove double call to defaultKeyBindings
8707 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
8708 toolbar defauls using lyxlex. Remove enums, structs, functions
8711 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
8712 toolbar defaults. Also store default keybindings in a map.
8714 * src/ToolbarDefaults.[Ch]: New file. This class is used for
8715 storing the toolbar defaults without any xforms dependencies.
8717 * src/insets/figinset.C: patch posted to list by Andre Poenitz
8718 applied. Changed to use iterators.
8720 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8722 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
8723 systems that don't have LINGUAS set to begin with.
8725 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8727 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
8728 the list by Dekel Tsur.
8730 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8732 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
8733 * src/insets/form_graphics.C: ditto.
8735 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
8737 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8739 * src/bufferparams.C (readLanguage): use the new language map
8741 * src/intl.C (InitKeyMapper): use the new language map
8743 * src/lyx_gui.C (create_forms): use the new language map
8745 * src/language.[Ch]: New files. Used for holding the information
8746 about each language. Now! Use this new language map enhance it and
8747 make it really usable for our needs.
8749 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
8751 * screen.C (ShowCursor): Removed duplicate code.
8752 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
8753 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
8755 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
8758 * src/text.C Added TransformChar method. Used for rendering Arabic
8759 text correctly (change the glyphs of the letter according to the
8760 position in the word)
8765 * src/lyxrc.C Added lyxrc command {language_command_begin,
8766 language_command_end,language_command_ltr,language_command_rtl,
8767 language_package} which allows the use of either arabtex or Omega
8770 * src/lyx_gui.C (init)
8772 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
8773 to use encoding for menu fonts which is different than the encoding
8776 * src/buffer.C (makeLaTeXFile): If params.language = "default",
8777 do not load the babel package.
8778 To write an English document with Hebrew/Arabic, change the document
8779 language to "english".
8781 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
8782 (alphaCounter): changed to return char
8783 (loweralphaCounter, hebrewCounter, romanCounter): New functions
8785 * lib/lyxrc.example Added examples for Hebrew/Arabic
8788 * src/layout.C Added layout command endlabeltype
8790 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
8792 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
8794 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8796 * src/mathed/math_delim.C (search_deco): return a
8797 math_deco_struct* instead of index.
8799 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8801 * All files with a USE_OSTREAM_ONLY within: removed all code that
8802 was unused when USE_OSTREAM_ONLY is defined.
8804 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
8805 of any less. Removed header and using.
8807 * src/text.C (GetVisibleRow): draw the string "Page Break
8808 (top/bottom)" on screen when drawing a pagebreak line.
8810 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8812 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
8814 * src/mathed/math_macro.C (draw): do some cast magic.
8817 * src/mathed/math_defs.h: change byte* argument to byte const*.
8819 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
8821 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
8822 know it is right to return InsetFoot* too, but cxx does not like
8825 * src/insets/insetcollapsable.[Ch] (Clone): make const.
8827 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
8829 * src/mathed/math_delim.C: change == to proper assignment.
8831 2000-03-09 Juergen Vigna <jug@sad.it>
8833 * src/insets/insettext.C (setPos): fixed various cursor positioning
8834 problems (via mouse and cursor-keys)
8835 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
8836 inset (still a small display problem but it works ;)
8838 * src/insets/insetcollapsable.C (draw): added button_top_y and
8839 button_bottom_y to have correct values for clicking on the inset.
8841 * src/support/lyxalgo.h: commented out 'using std::less'
8843 2000-03-08 Juergen Vigna <jug@sad.it>
8845 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
8846 Button-Release event closes as it is alos the Release-Event
8849 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
8851 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8853 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
8854 can add multiple spaces in Scrap (literate programming) styles...
8855 which, by the way, is how I got hooked on LyX to begin with.
8857 * src/mathed/formula.C (Write): Added dummy variable to an
8858 inset::Latex() call.
8859 (Latex): Add free_spacing boolean to inset::Latex()
8861 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
8863 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
8864 virtual function to include the free_spacing boolean from
8865 the containing paragraph's style.
8867 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
8868 Added free_spacing boolean arg to match inset.h
8870 * src/insets/insettext.C, src/insets/insettext.h (Latex):
8871 Added free_spacing boolean arg to match inset.h
8873 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
8874 Added free_spacing boolean and made sure that if in a free_spacing
8875 paragraph, that we output normal space if there is a protected space.
8877 * src/insets/insetref.C, src/insets/insetref.h (Latex):
8878 Added free_spacing boolean arg to match inset.h
8880 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
8881 Added free_spacing boolean arg to match inset.h
8883 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
8884 Added free_spacing boolean arg to match inset.h
8886 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
8887 Added free_spacing boolean arg to match inset.h
8889 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
8890 Added free_spacing boolean arg to match inset.h
8892 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
8893 free_spacing boolean arg to match inset.h
8895 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
8896 Added free_spacing boolean arg to match inset.h
8898 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
8899 Added free_spacing boolean arg to match inset.h
8901 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
8902 Added free_spacing boolean arg to match inset.h
8904 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
8905 Added free_spacing boolean arg to match inset.h
8907 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
8908 Added free_spacing boolean arg to match inset.h
8910 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
8911 free_spacing boolean arg to match inset.h
8913 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
8914 free_spacing boolean arg to match inset.h
8916 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
8917 ignore free_spacing paragraphs. The user's spaces are left
8920 * src/text.C (InsertChar): Fixed the free_spacing layout
8921 attribute behavior. Now, if free_spacing is set, you can
8922 add multiple spaces in a paragraph with impunity (and they
8923 get output verbatim).
8924 (SelectSelectedWord): Added dummy argument to inset::Latex()
8927 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
8930 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
8931 paragraph layouts now only input a simple space instead.
8932 Special character insets don't make any sense in free-spacing
8935 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
8936 hard-spaces in the *input* file to simple spaces if the layout
8937 is free-spacing. This converts old files which had to have
8938 hard-spaces in free-spacing layouts where a simple space was
8940 (writeFileAscii): Added free_spacing check to pass to the newly
8941 reworked inset::Latex(...) methods. The inset::Latex() code
8942 ensures that hard-spaces in free-spacing paragraphs get output
8943 as spaces (rather than "~").
8945 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8947 * src/mathed/math_delim.C (draw): draw the empty placeholder
8948 delims with a onoffdash line.
8949 (struct math_deco_compare): struct that holds the "functors" used
8950 for the sort and the binary search in math_deco_table.
8951 (class init_deco_table): class used for initial sort of the
8953 (search_deco): use lower_bound to do a binary search in the
8956 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8958 * src/lyxrc.C: a small secret thingie...
8960 * src/lyxlex.C (printTable): changed to take a ostream as paramter
8961 and to not flush the stream as often as it used to.
8963 * src/support/lyxalgo.h: new file
8964 (sorted): template function used for checking if a sequence is
8965 sorted or not. Two versions with and without user supplied
8966 compare. Uses same compare as std::sort.
8968 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
8969 it and give warning on lyxerr.
8971 (struct compare_tags): struct with function operators used for
8972 checking if sorted, sorting and lower_bound.
8973 (search_kw): use lower_bound instead of manually implemented
8976 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8978 * src/insets/insetcollapsable.h: fix Clone() declaration.
8979 * src/insets/insetfoot.h: ditto.
8981 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
8983 2000-03-08 Juergen Vigna <jug@sad.it>
8985 * src/insets/lyxinset.h: added owner call which tells us if
8986 this inset is inside another inset. Changed also the return-type
8987 of Editable to an enum so it tells clearer what the return-value is.
8989 * src/insets/insettext.C (computeTextRows): fixed computing of
8990 textinsets which split automatically on more rows.
8992 * src/insets/insetert.[Ch]: changed this to be of BaseType
8995 * src/insets/insetfoot.[Ch]: added footnote inset
8997 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
8998 collapsable insets (like footnote, ert, ...)
9000 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9002 * src/lyxdraw.h: remvoe file
9004 * src/lyxdraw.C: remove file
9006 * src/insets/insettext.C: added <algorithm>.
9008 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9010 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9011 (matrix_cb): case MM_OK use string stream
9013 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9016 * src/mathed/math_macro.C (draw): use string stream
9017 (Metrics): use string stream
9019 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9020 directly to the ostream.
9022 * src/vspace.C (asString): use string stream.
9023 (asString): use string stream
9024 (asLatexString): use string stream
9026 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9027 setting Spacing::Other.
9029 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9030 sprintf when creating the stretch vale.
9032 * src/text2.C (alphaCounter): changed to return a string and to
9033 not use a static variable internally. Also fixed a one-off bug.
9034 (SetCounter): changed the drawing of the labels to use string
9035 streams instead of sprintf.
9037 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9038 manipulator to use a scheme that does not require library support.
9039 This is also the way it is done in the new GNU libstdc++. Should
9040 work with DEC cxx now.
9042 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9044 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9045 end. This fixes a bug.
9047 * src/mathed (all files concerned with file writing): apply the
9048 USE_OSTREAM_ONLY changes to mathed too.
9050 * src/support/DebugStream.h: make the constructor explicit.
9052 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9053 count and ostream squashed.
9055 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9057 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9059 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9060 ostringstream uses STL strings, and we might not.
9062 * src/insets/insetspecialchar.C: add using directive.
9063 * src/insets/insettext.C: ditto.
9065 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9067 * lib/layouts/seminar.layout: feeble attempt at a layout for
9068 seminar.cls, far from completet and could really use some looking
9069 at from people used to write layout files.
9071 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9072 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9073 a lot nicer and works nicely with ostreams.
9075 * src/mathed/formula.C (draw): a slightly different solution that
9076 the one posted to the list, but I think this one works too. (font
9077 size wrong in headers.)
9079 * src/insets/insettext.C (computeTextRows): some fiddling on
9080 Jürgens turf, added some comments that he should read.
9082 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9083 used and it gave compiler warnings.
9084 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9087 * src/lyx_gui.C (create_forms): do the right thing when
9088 show_banner is true/false.
9090 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9091 show_banner is false.
9093 * most file writing files: Now use iostreams to do almost all of
9094 the writing. Also instead of passing string &, we now use
9095 stringstreams. mathed output is still not adapted to iostreams.
9096 This change can be turned off by commenting out all the occurences
9097 of the "#define USE_OSTREAM_ONLY 1" lines.
9099 * src/WorkArea.C (createPixmap): don't output debug messages.
9100 (WorkArea): don't output debug messages.
9102 * lib/lyxrc.example: added a comment about the new variable
9105 * development/Code_rules/Rules: Added some more commente about how
9106 to build class interfaces and on how better encapsulation can be
9109 2000-03-03 Juergen Vigna <jug@sad.it>
9111 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
9112 automatically with the width of the LyX-Window
9114 * src/insets/insettext.C (computeTextRows): fixed update bug in
9115 displaying text-insets (scrollvalues where not initialized!)
9117 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9119 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
9120 id in the check of the result from lower_bound is not enough since
9121 lower_bound can return last too, and then res->id will not be a
9124 * all insets and some code that use them: I have conditionalized
9125 removed the Latex(string & out, ...) this means that only the
9126 Latex(ostream &, ...) will be used. This is a work in progress to
9127 move towards using streams for all output of files.
9129 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
9132 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9134 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
9135 routine (this fixes bug where greek letters were surrounded by too
9138 * src/support/filetools.C (findtexfile): change a bit the search
9139 algorithm, to fix bug introduced in 1.1.4. Note that --format is
9140 no longer passed to kpsewhich, we may have to change that later.
9142 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
9143 warning options to avoid problems with X header files (from Angus
9145 * acinclude.m4: regenerated.
9147 2000-03-02 Juergen Vigna <jug@sad.it>
9149 * src/insets/insettext.C (WriteParagraphData): Using the
9150 par->writeFile() function for writing paragraph-data.
9151 (Read): Using buffer->parseSingleLyXformat2Token()-function
9152 for parsing paragraph data!
9154 * src/buffer.C (readLyXformat2): removed all parse data and using
9155 the new parseSingleLyXformat2Token()-function.
9156 (parseSingleLyXformat2Token): added this function to parse (read)
9157 lyx-file-format (this is called also from text-insets now!)
9159 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9161 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
9164 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
9165 directly instead of going through a func. One very bad thing: a
9166 static LyXFindReplace, but I don't know where to place it.
9168 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
9169 string instead of char[]. Also changed to static.
9170 (GetSelectionOrWordAtCursor): changed to static inline
9171 (SetSelectionOverLenChars): ditto.
9173 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
9174 current_view and global variables. both classes has changed names
9175 and LyXFindReplace is not inherited from SearchForm.
9177 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
9178 fl_form_search form.
9180 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
9182 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9184 * lib/bind/*.bind: make sure 'buffer-previous' function is not
9185 bound (from Kayvan).
9187 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
9189 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
9191 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9193 * some things that I should comment but the local pub says head to
9196 * comment out all code that belongs to the Roff code for Ascii
9197 export of tables. (this is unused)
9199 * src/LyXView.C: use correct type for global variable
9200 current_layout. (LyXTextClass::size_type)
9202 * some code to get the new insetgraphics closer to working I'd be
9203 grateful for any help.
9205 * src/BufferView2.C (insertInset): use the return type of
9206 NumberOfLayout properly. (also changes in other files)
9208 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
9209 this as a test. I want to know what breaks because of this.
9211 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
9213 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9215 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
9216 to use a \makebox in the label, this allows proper justification
9217 with out using protected spaces or multiple hfills. Now it is
9218 "label" for left justified, "\hfill label\hfill" for center, and
9219 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
9220 should be changed accordingly.
9222 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9224 * src/lyxtext.h: change SetLayout() to take a
9225 LyXTextClass::size_type instead of a char (when there is more than
9226 127 layouts in a class); also change type of copylayouttype.
9227 * src/text2.C (SetLayout): ditto.
9228 * src/LyXView.C (updateLayoutChoice): ditto.
9230 * src/LaTeX.C (scanLogFile): errors where the line number was not
9231 given just after the '!'-line were ignored (from Dekel Tsur).
9233 * lib/lyxrc.example: fix description of \date_insert_format
9235 * lib/layouts/llncs.layout: new layout, contributed by Martin
9238 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9240 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
9241 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
9242 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
9243 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
9244 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
9245 paragraph.C, text.C, text2.C)
9247 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9249 * src/insets/insettext.C (LocalDispatch): remove extra break
9252 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
9253 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
9255 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
9256 * src/insets/insettext.[Ch] (GetCursorPos): ditto
9258 * src/insets/insetbib.h: move InsetBibkey::Holder and
9259 InsetCitation::Holder in public space.
9261 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9263 * src/insets/insettext.h: small change to get the new files from
9264 Juergen to compile (use "string", not "class string").
9266 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
9267 const & as parameter to LocalDispatch, use LyXFont const & as
9268 paramter to some other func. This also had impacto on lyxinsets.h
9269 and the two mathed insets.
9271 2000-02-24 Juergen Vigna <jug@sad.it>
9274 * src/commandtags.h:
9276 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
9280 * src/BufferView2.C: added/updated code for various inset-functions
9282 * src/insets/insetert.[Ch]: added implementation of InsetERT
9284 * src/insets/insettext.[Ch]: added implementation of InsetText
9286 * src/insets/inset.C (Edit): added "unsigned int button" parameter
9287 (draw): added preliminary code for inset scrolling not finshed yet
9289 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
9290 as it is in lyxfunc.C now
9292 * src/insets/lyxinset.h: Added functions for text-insets
9294 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9296 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
9297 BufferView and reimplement the list as a queue put inside its own
9300 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
9302 * several files: use the new interface to the "updateinsetlist"
9304 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
9306 (work_area_handler): call BufferView::trippleClick on trippleclick.
9308 * src/BufferView.C (doubleClick): new function, selects word on
9310 (trippleClick): new function, selects line on trippleclick.
9312 2000-02-22 Allan Rae <rae@lyx.org>
9314 * lib/bind/xemacs.bind: buffer-previous not supported
9316 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9318 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
9321 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9323 * src/bufferlist.C: get rid of current_view from this file
9325 * src/spellchecker.C: get rid of current_view from this file
9327 * src/vspace.C: get rid of current_view from this file
9328 (inPixels): added BufferView parameter for this func
9329 (asLatexCommand): added a BufferParams for this func
9331 * src/text.C src/text2.C: get rid of current_view from these
9334 * src/lyxfont.C (getFontDirection): move this function here from
9337 * src/bufferparams.C (getDocumentDirection): move this function
9340 * src/paragraph.C (getParDirection): move this function here from
9342 (getLetterDirection): ditto
9344 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
9346 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
9347 resize due to wrong pixmap beeing used. Also took the opurtunity
9348 to make the LyXScreen stateless on regard to WorkArea and some
9349 general cleanup in the same files.
9351 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9353 * src/Makefile.am: add missing direction.h
9355 * src/PainterBase.h: made the width functions const.
9357 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
9360 * src/insets/insetcommand.C (draw): draw Editable as buttons.
9362 * src/insets/insetlatexaccent.C (draw): make the accents draw
9363 better, at present this will only work well with iso8859-1.
9365 * several files: remove the old drawing code, now we use the new
9368 * several files: remove support for mono_video, reverse_video and
9371 2000-02-17 Juergen Vigna <jug@sad.it>
9373 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
9374 int ** as we have to return the pointer, otherwise we have only
9375 NULL pointers in the returning function.
9377 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9379 * src/LaTeX.C (operator()): quote file name when running latex.
9381 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9383 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
9384 (bubble tip), this removes our special handling of this.
9386 * Remove all code that is unused now that we have the new
9387 workarea. (Code that are not active when NEW_WA is defined.)
9389 * Make the uses of XSync not conditionalized on define USE_XSYNC.
9391 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9393 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
9394 nonexisting layout; correctly redirect obsoleted layouts.
9396 * lib/lyxrc.example: document \view_dvi_paper_option
9398 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
9401 * src/lyx_cb.C (RunScript): handle $$FName for command names.
9402 (PreviewDVI): handle the view_dvi_paper_option variable.
9403 [Both from Roland Krause]
9405 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9407 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
9408 char const *, int, LyXFont)
9409 (text(int, int, string, LyXFont)): ditto
9411 * src/text.C (InsertCharInTable): attempt to fix the double-space
9412 feature in tables too.
9413 (BackspaceInTable): ditto.
9414 (GetVisibleRow): make bottom pagebreak line be a onoff line.
9416 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9418 * src/text2.C (owner): only complain if owner_ is set and bv != 0
9420 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
9421 newly found text in textcache to this.
9422 (buffer): set the owner of the text put into the textcache to 0
9424 * src/insets/figinset.C (draw): fixed the drawing of figures with
9427 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
9428 drawing of mathframe, hfills, protected space, table lines. I have
9429 now no outstanding drawing problems with the new Painter code.
9431 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9433 * src/PainterBase.C (ellipse, circle): do not specify the default
9436 * src/LColor.h: add using directive.
9438 * src/Painter.[Ch]: change return type of methods from Painter& to
9439 PainterBase&. Add a using directive.
9441 * src/WorkArea.C: wrap xforms callbacks in C functions
9444 * lib/layouts/foils.layout: font fix and simplifications from Carl
9447 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9449 * a lot of files: The Painter, LColor and WorkArea from the old
9450 devel branch has been ported to lyx-devel. Some new files and a
9451 lot of #ifdeffed code. The new workarea is enabled by default, but
9452 if you want to test the new Painter and LColor you have to compile
9453 with USE_PAINTER defined (do this in config.h f.ex.) There are
9454 still some rought edges, and I'd like some help to clear those
9455 out. It looks stable (loads and displays the Userguide very well).
9458 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9460 * src/buffer.C (pop_tag): revert to the previous implementation
9461 (use a global variable for both loops).
9463 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
9465 * src/lyxrc.C (LyXRC): change slightly default date format.
9467 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
9468 there is an English text with a footnote that starts with a Hebrew
9469 paragraph, or vice versa.
9470 (TeXFootnote): ditto.
9472 * src/text.C (LeftMargin): allow for negative values for
9473 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
9476 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
9477 for input encoding (cyrillic)
9479 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9481 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
9484 * src/toolbar.C (set): ditto
9485 * src/insets/insetbib.C (create_form_citation_form): ditto
9487 * lib/CREDITS: added Dekel Tsur.
9489 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
9490 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
9491 hebrew supports files from Dekel Tsur.
9493 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
9494 <tzafrir@technion.ac.il>
9496 * src/lyxrc.C: put \date_insert_format at the right place.
9498 * src/buffer.C (makeLaTeXFile): fix the handling of
9499 BufferParams::sides when writing out latex files.
9501 * src/BufferView2.C: add a "using" directive.
9503 * src/support/lyxsum.C (sum): when we use lyxstring,
9504 ostringstream::str needs an additional .c_str().
9506 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9508 * src/support/filetools.C (ChangeExtension): patch from Etienne
9511 * src/TextCache.C (show): remove const_cast and make second
9512 parameter non-const LyXText *.
9514 * src/TextCache.h: use non const LyXText in show.
9516 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
9519 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9521 * src/support/lyxsum.C: rework to be more flexible.
9523 * several places: don't check if a pointer is 0 if you are going
9526 * src/text.C: remove some dead code.
9528 * src/insets/figinset.C: remove some dead code
9530 * src/buffer.C: move the BufferView funcs to BufferView2.C
9531 remove all support for insetlatexdel
9532 remove support for oldpapersize stuff
9533 made some member funcs const
9535 * src/kbmap.C: use a std::list to store the bindings in.
9537 * src/BufferView2.C: new file
9539 * src/kbsequence.[Ch]: new files
9541 * src/LyXAction.C + others: remove all trace of buffer-previous
9543 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
9544 only have one copy in the binary of this table.
9546 * hebrew patch: moved some functions from LyXText to more
9547 appropriate places. (LyXParagraph, BufferParams, LyXFont)
9549 * several files: remove support for XForms older than 0.88
9551 remove some #if 0 #endif code
9553 * src/TextCache.[Ch]: new file. Holds the textcache.
9555 * src/BufferView.C: changes to use the new TextCache interface.
9556 (waitForX): remove the now unused code.
9558 * src/BackStack.h: remove some commented code
9560 * lib/bind/emacs.bind: remove binding for buffer-previous
9562 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9564 * applied the hebrew patch.
9566 * src/lyxrow.h: make sure that all Row variables are initialized.
9568 * src/text2.C (TextHandleUndo): comment out a delete, this might
9569 introduce a memory leak, but should also help us to not try to
9570 read freed memory. We need to look at this one.
9572 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
9573 (LyXParagraph): initalize footnotekind.
9575 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
9576 forgot this when applying the patch. Please heed the warnings.
9578 * src/BufferView.C (buffer): a fix for the buffer-reload problem
9579 (aka. reformat problem)
9581 * src/bufferlist.C (exists): made const, and use const_iterator
9582 (isLoaded): new func.
9583 (release): use std::find to find the correct buffer.
9585 * src/bufferlist.h: made getState a const func.
9586 made empty a const func.
9587 made exists a const func.
9590 2000-02-01 Juergen Vigna <jug@sad.it>
9592 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
9594 * po/it.po: updated a bit the italian po file and also changed the
9595 'file nuovo' for newfile to 'filenuovo' without a space, this did
9598 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
9599 for the new insert_date command.
9601 * src/lyxfunc.C (Dispatch): added support for a insert_date function
9602 from jdblair, to insert a date into the current text conforming to
9603 a strftime format (for now only considering the locale-set and not
9604 the document-language).
9606 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9608 * src/lyxfont.C (textWidth): hopefully better fix for the Array
9609 Bounds Read error seen by purify. The problem was that islower is
9610 a macros which takes an unsigned char and uses it as an index for
9611 in array of characters properties (and is thus subject to the
9615 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
9616 correctly the paper sides radio buttons.
9617 (UpdateDocumentButtons): ditto.
9619 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9621 * src/kbmap.C (getsym + others): change to return unsigned int,
9622 returning a long can give problems on 64 bit systems. (I assume
9623 that int is 32bit on 64bit systems)
9625 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9627 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
9628 LyXLookupString to be zero-terminated. Really fixes problems seen
9631 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9633 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
9634 write a (char*)0 to the lyxerr stream.
9636 * src/lastfiles.C: move algorithm before the using statemets.
9638 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9640 * src/lastfiles.C: move using directives in global scope (egcs 1.x
9641 complains otherwise).
9642 * src/table.C: ditto
9644 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
9647 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
9648 that I removed earlier... It is really needed.
9650 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
9652 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9654 * INSTALL: update xforms home page URL.
9656 * lib/configure.m4: fix a bug with unreadable layout files.
9658 * src/table.C (calculate_width_of_column): add "using std::max"
9661 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9663 * several files: marked several lines with "DEL LINE", this is
9664 lines that can be deleted without changing anything.
9665 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
9666 checks this anyway */
9669 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
9671 * src/DepTable.C (update): add a "+" at the end when the checksum
9672 is different. (debugging string only)
9674 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
9675 the next inset to not be displayed. This should also fix the list
9676 of labels in the "Insert Crossreference" dialog.
9678 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9680 * src/support/LSubstring.C (LSubstring): set pos to string::npos
9681 when regex was not found.
9683 * src/support/lstrings.C (lowercase): use handcoded transform always.
9686 * src/text.C (Delete): fixed the crash. cursor.par->prev and
9687 old_cursor.par->prev could be 0.
9689 * several files: changed post inc/dec to pre inc/dec
9691 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
9692 write the lastfiles to file.
9694 * src/BufferView.C (buffer): only show TextCache info when debugging
9696 (resizeCurrentBuffer): ditto
9697 (workAreaExpose): ditto
9699 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
9701 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
9703 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
9704 a bit better by removing the special case for \i and \j.
9706 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9708 * src/lyx_main.C (easyParse): remove test for bad comand line
9709 options, since this broke all xforms-related parsing.
9711 * src/kbmap.C (getsym): set return type to unsigned long, as
9712 declared in header. On an alpha, long is _not_ the same as int.
9714 * src/support/LOstream.h: add a "using std::flush;"
9716 * src/insets/figinset.C: ditto.
9718 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9720 * src/bufferlist.C (write): use blinding fast file copy instead of
9721 "a char at a time", now we are doing it the C++ way.
9723 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
9724 std::list<int> instead.
9725 (addpidwait): reflect move to std::list<int>
9726 (sigchldchecker): ditto
9728 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
9731 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
9732 that obviously was wrong...
9734 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
9735 c, this avoids warnings with purify and islower.
9737 * src/insets/figinset.C: rename struct queue to struct
9738 queue_element and rewrite to use a std::queue. gsqueue is now a
9739 std::queue<queue_element>
9740 (runqueue): reflect move to std::queue
9743 * src/support/lstrings.h (tostr): specialize for bool, otherwise
9744 we would get "1" "0" instead of "true" "false. Also make the tostr
9747 2000-01-21 Juergen Vigna <jug@sad.it>
9749 * src/buffer.C (writeFileAscii): Disabled code for special groff
9750 handling of tabulars till I fix this in table.C
9752 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9754 * src/support/mkdir.C (mkdir): change second argument of mkdir to
9756 * src/support/lyxlib.h: ditto.
9758 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9760 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
9761 and 'j' look better. This might fix the "macron" bug that has been
9764 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
9765 functions as one template function. Delete the old versions.
9767 * src/support/lyxsum.C: move using std::ifstream inside
9770 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
9773 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
9775 * src/mathed/formula.C: delete #include "bufferlist.h" never used
9777 * src/insets/figinset.C (InitFigures): use new instead of malloc
9778 to allocate memory for figures and bitmaps.
9779 (DoneFigures): use delete[] instead of free to deallocate memory
9780 for figures and bitmaps.
9781 (runqueue): use new to allocate
9782 (getfigdata): use new/delete[] instead of malloc/free
9783 (RegisterFigure): ditto
9785 * some files: moved some declarations closer to first use, small
9786 whitespace changes use preincrement instead of postincrement where
9787 it does not make a difference.
9789 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
9790 step on the way to use stl::containers for key maps.
9792 * src/bufferlist.h: add a typedef for const_iterator and const
9793 versions of begin and end.
9795 * src/bufferlist.[Ch]: change name of member variable _state to
9796 state_. (avoid reserved names)
9798 (getFileNames): returns the filenames of the buffers in a vector.
9800 * configure.in (ALL_LINGUAS): added ro
9802 * src/support/putenv.C: new file
9804 * src/support/mkdir.C: new file
9806 2000-01-20 Allan Rae <rae@lyx.org>
9808 * lib/layouts/IEEEtran.layout: Added several theorem environments
9810 * lib/templates/IEEEtran.lyx: Example theorem environments and a
9811 couple of minor additions.
9813 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
9814 (except for those in footnotes of course)
9816 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9818 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
9820 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
9821 std::sort and std::lower_bound instead of qsort and handwritten
9823 (struct compara): struct that holds the functors used by std::sort
9824 and std::lower_bound in MathedLookupBOP.
9826 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9828 * src/support/LAssert.h: do not do partial specialization. We do
9831 * src/support/lyxlib.h: note that lyx::getUserName() and
9832 lyx::date() are not in use right now. Should these be suppressed?
9834 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
9835 (makeLinuxDocFile): do not put date and user name in linuxdoc
9838 * src/support/lyxlib.h (kill): change first argument to long int,
9839 since that's what solaris uses.
9841 * src/support/kill.C (kill): fix declaration to match prototype.
9843 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
9844 actually check whether namespaces are supported. This is not what
9847 * src/support/lyxsum.C: add a using directive.
9849 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9851 * src/support/kill.C: if we have namespace support we don't have
9852 to include lyxlib.h.
9854 * src/support/lyxlib.h: use namespace lyx if supported.
9856 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9858 * src/support/date.C: new file
9860 * src/support/chdir.C: new file
9862 * src/support/getUserName.C: new file
9864 * src/support/getcwd.C: new file
9866 * src/support/abort.C: new file
9868 * src/support/kill.C: new file
9870 * src/support/lyxlib.h: moved all the functions in this file
9871 insede struct lyx. Added also kill and abort to this struct. This
9872 is a way to avoid the "kill is not defined in <csignal>", we make
9873 C++ wrappers for functions that are not ANSI C or ANSI C++.
9875 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
9876 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
9877 lyx it has been renamed to sum.
9879 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9881 * src/text.C: add using directives for std::min and std::max.
9883 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9885 * src/texrow.C (getIdFromRow): actually return something useful in
9886 id and pos. Hopefully fixes the bug with positionning of errorbox
9889 * src/lyx_main.C (easyParse): output an error and exit if an
9890 incorrect command line option has been given.
9892 * src/spellchecker.C (ispell_check_word): document a memory leak.
9894 * src/bufferlist.C (write): fix mismatched allocation/deletion,
9895 where a "struct utimbuf" is allocated with "new" and deleted with
9898 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9900 * src/text2.C (CutSelection): don't delete double spaces.
9901 (PasteSelection): ditto
9902 (CopySelection): ditto
9904 * src/text.C (Backspace): don't delete double spaces.
9906 * src/lyxlex.C (next): fix a bug that were only present with
9907 conformant std::istream::get to read comment lines, use
9908 std::istream::getline instead. This seems to fix the problem.
9910 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9912 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
9913 allowed to insert space before space" editing problem. Please read
9914 commends at the beginning of the function. Comments about usage
9917 * src/text.C (InsertChar): fix for the "not allowed to insert
9918 space before space" editing problem.
9920 * src/text2.C (DeleteEmptyParagraphMechanism): when
9921 IsEmptyTableRow can only return false this last "else if" will
9922 always be a no-op. Commented out.
9924 * src/text.C (RedoParagraph): As far as I can understand tmp
9925 cursor is not really needed.
9927 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
9928 present it could only return false anyway.
9929 (several functions): Did something not so smart...added a const
9930 specifier on a lot of methods.
9932 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
9933 and add a tmp->text.resize. The LyXParagraph constructor does the
9935 (BreakParagraphConservative): ditto
9937 * src/support/path.h (Path): add a define so that the wrong usage
9938 "Path("/tmp") will be flagged as a compilation error:
9939 "`unnamed_Path' undeclared (first use this function)"
9941 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9943 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
9944 which was bogus for several reasons.
9946 * src/LaTeX.C (scanAux): fix the regular expression used to scan
9950 * autogen.sh: do not use "type -path" (what's that anyway?).
9952 * src/support/filetools.C (findtexfile): remove extraneous space
9953 which caused a kpsewhich warning (at least with kpathsea version
9956 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9958 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
9960 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
9962 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
9964 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9966 * src/paragraph.C (BreakParagraph): do not reserve space on text
9967 if we don't need to (otherwise, if pos_end < pos, we end up
9968 reserving huge amounts of memory due to bad unsigned karma).
9969 (BreakParagraphConservative): ditto, although I have not seen
9970 evidence the bug can happen here.
9972 * src/lyxparagraph.h: add a using std::list.
9974 2000-01-11 Juergen Vigna <jug@sad.it>
9976 * src/menus.C (MenuDocu): output an Alert if the documentation-file
9979 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9981 * src/vc-backend.C (doVCCommand): change to be static and take one
9982 more parameter: the path to chdir too be fore executing the command.
9983 (retrive): new function equiv to "co -r"
9985 * src/bufferlist.C (loadLyXFile): implement the missing parts if
9986 file_not_found_hook is true.
9988 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
9990 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
9991 if a file is readwrite,readonly...anything else.
9993 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9995 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
9996 (CreatePostscript): name change from MenuRunDVIPS (or something)
9997 (PreviewPostscript): name change from MenuPreviewPS
9998 (PreviewDVI): name change from MenuPreviewDVI
10000 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10001 \view_pdf_command., \pdf_to_ps_command
10003 * lib/configure.m4: added search for PDF viewer, and search for
10004 PDF to PS converter.
10005 (lyxrc.defaults output): add \pdflatex_command,
10006 \view_pdf_command and \pdf_to_ps_command.
10008 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10010 * src/bufferlist.C (write): we don't use blocksize for anything so
10013 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10015 * src/support/block.h: disable operator T* (), since it causes
10016 problems with both compilers I tried. See comments in the file.
10018 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10021 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10022 variable LYX_DIR_10x to LYX_DIR_11x.
10024 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10026 * INSTALL: document --with-lyxname.
10029 * configure.in: new configure flag --with-lyxname which allows to
10030 choose the name under which lyx is installed. Default is "lyx", of
10031 course. It used to be possible to do this with --program-suffix,
10032 but the later has in fact a different meaning for autoconf.
10034 * src/support/lstrings.h (lstrchr): reformat a bit.
10036 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10037 * src/mathed/math_defs.h: ditto.
10039 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10041 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10042 true, decides if we create a backup file or not when saving. New
10043 tag and variable \pdf_mode, defaults to false. New tag and
10044 variable \pdflatex_command, defaults to pdflatex. New tag and
10045 variable \view_pdf_command, defaults to xpdf. New tag and variable
10046 \pdf_to_ps_command, defaults to pdf2ps.
10048 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10050 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10051 does not have a BufferView.
10052 (unlockInset): ditto + don't access the_locking_inset if the
10053 buffer does not have a BufferView.
10055 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10056 certain circumstances so that we don't continue a keyboard
10057 operation long after the key was released. Try f.ex. to load a
10058 large document, press PageDown for some seconds and then release
10059 it. Before this change the document would contine to scroll for
10060 some time, with this change it stops imidiatly.
10062 * src/support/block.h: don't allocate more space than needed. As
10063 long as we don't try to write to the arr[x] in a array_type arr[x]
10064 it is perfectly ok. (if you write to it you might segfault).
10065 added operator value_type*() so that is possible to pass the array
10066 to functions expecting a C-pointer.
10068 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10071 * intl/*: updated to gettext 0.10.35, tried to add our own
10072 required modifications. Please verify.
10074 * po/*: updated to gettext 0.10.35, tried to add our own required
10075 modifications. Please verify.
10077 * src/support/lstrings.C (tostr): go at fixing the problem with
10078 cxx and stringstream. When stringstream is used return
10079 oss.str().c_str() so that problems with lyxstring and basic_string
10080 are avoided. Note that the best solution would be for cxx to use
10081 basic_string all the way, but it is not conformant yet. (it seems)
10083 * src/lyx_cb.C + other files: moved several global functions to
10084 class BufferView, some have been moved to BufferView.[Ch] others
10085 are still located in lyx_cb.C. Code changes because of this. (part
10086 of "get rid of current_view project".)
10088 * src/buffer.C + other files: moved several Buffer functions to
10089 class BufferView, the functions are still present in buffer.C.
10090 Code changes because of this.
10092 * config/lcmessage.m4: updated to most recent. used when creating
10095 * config/progtest.m4: updated to most recent. used when creating
10098 * config/gettext.m4: updated to most recent. applied patch for
10101 * config/gettext.m4.patch: new file that shows what changes we
10102 have done to the local copy of gettext.m4.
10104 * config/libtool.m4: new file, used in creation of acinclude.m4
10106 * config/lyxinclude.m4: new file, this is the lyx created m4
10107 macros, used in making acinclude.m4.
10109 * autogen.sh: GNU m4 discovered as a separate task not as part of
10110 the lib/configure creation.
10111 Generate acinlucde from files in config. Actually cat
10112 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
10113 easier to upgrade .m4 files that really are external.
10115 * src/Spacing.h: moved using std::istringstream to right after
10116 <sstream>. This should fix the problem seen with some compilers.
10118 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10120 * src/lyx_cb.C: began some work to remove the dependency a lot of
10121 functions have on BufferView::text, even if not really needed.
10122 (GetCurrentTextClass): removed this func, it only hid the
10125 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
10126 forgot this in last commit.
10128 * src/Bullet.C (bulletEntry): use static char const *[] for the
10129 tables, becuase of this the return arg had to change to string.
10130 (bulletSize): ditto
10131 (~Bullet): removed unneeded destructor
10133 * src/BufferView.C (beforeChange): moved from lyx_cb.C
10134 (insetSleep): moved from Buffer
10135 (insetWakeup): moved from Buffer
10136 (insetUnlock): moved from Buffer
10138 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
10139 from Buffer to BufferView.
10141 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
10143 * config/ltmain.sh: updated to version 1.3.4 of libtool
10145 * config/ltconfig: updated to version 1.3.4 of libtool
10147 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10150 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
10151 Did I get that right?
10153 * src/lyxlex.h: add a "using" directive or two.
10154 * src/Spacing.h: ditto.
10155 * src/insets/figinset.C: ditto.
10156 * src/support/filetools.C: ditto.
10157 * src/support/lstrings.C: ditto.
10158 * src/BufferView.C: ditto.
10159 * src/bufferlist.C: ditto.
10160 * src/lyx_cb.C: ditto.
10161 * src/lyxlex.C: ditto.
10163 * NEWS: add some changes for 1.1.4.
10165 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10167 * src/BufferView.C: first go at a TextCache to speed up switching
10170 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10172 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
10173 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
10174 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
10175 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
10178 * src/mathed/math_defs.h (MathedRowSt): make sure that all
10179 members of the struct are correctly initialized to 0 (detected by
10181 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
10182 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
10184 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
10185 pidwait, since it was allocated with "new". This was potentially
10186 very bad. Thanks to Michael Schmitt for running purify for us.
10189 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10191 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
10193 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
10195 1999-12-30 Allan Rae <rae@lyx.org>
10197 * lib/templates/IEEEtran.lyx: minor change
10199 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
10200 src/mathed/formula.C (LocalDispatch): askForText changes
10202 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
10203 know when a user has cancelled input. Fixes annoying problems with
10204 inserting labels and version control.
10206 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10208 * src/support/lstrings.C (tostr): rewritten to use strstream and
10211 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10213 * src/support/filetools.C (IsFileWriteable): use fstream to check
10214 (IsDirWriteable): use fileinfo to check
10216 * src/support/filetools.h (FilePtr): whole class deleted
10218 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
10220 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
10222 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
10224 * src/bufferlist.C (write): use ifstream and ofstream instead of
10227 * src/Spacing.h: use istrstream instead of sscanf
10229 * src/mathed/math_defs.h: change first arg to istream from FILE*
10231 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
10233 * src/mathed/math_parser.C: have yyis to be an istream
10234 (LexGetArg): use istream (yyis)
10236 (mathed_parse): ditto
10237 (mathed_parser_file): first arg istream instead of FILE*, set yyis
10239 * src/mathed/formula.C (Read): rewritten to use istream
10241 * src/mathed/formulamacro.C (Read): rewritten to use istream
10243 * src/lyxlex.h (~LyXLex): deleted desturctor
10244 (getStream): new function, returns an istream
10245 (getFile): deleted funtion
10246 (IsOK): return is.good();
10248 * src/lyxlex.C (LyXLex): delete file and owns_file
10249 (setFile): open an filebuf and assign that to a istream instead of
10251 (setStream): new function, takes an istream as arg.
10252 (setFile): deleted function
10253 (EatLine): rewritten us use istream instead of FILE*
10257 * src/table.C (LyXTable): use istream instead of FILE*
10258 (Read): rewritten to take an istream instead of FILE*
10260 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10262 * src/buffer.C (Dispatch): remove an extraneous break statement.
10264 * src/support/filetools.C (QuoteName): change to do simple
10265 'quoting'. More work is necessary. Also changed to do nothing
10266 under emx (needs fix too).
10267 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
10269 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
10270 config.h.in to the AC_DEFINE_UNQUOTED() call.
10271 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
10272 needs char * as argument (because Solaris 7 declares it like
10275 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
10276 remove definition of BZERO.
10278 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10280 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
10281 defined, "lyxregex.h" if not.
10283 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
10285 (REGEX): new variable that is set to regex.c lyxregex.h when
10286 AM_CONDITIONAL USE_REGEX is set.
10287 (libsupport_la_SOURCES): add $(REGEX)
10289 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
10292 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
10295 * configure.in: add call to LYX_REGEX
10297 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
10298 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
10300 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10302 * lib/bind/fi_menus.bind: new file, from
10303 pauli.virtanen@saunalahti.fi.
10305 * src/buffer.C (getBibkeyList): pass the parameter delim to
10306 InsetInclude::getKeys and InsetBibtex::getKeys.
10308 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
10309 is passed to Buffer::getBibkeyList
10311 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
10312 instead of the hardcoded comma.
10314 * src/insets/insetbib.C (getKeys): make sure that there are not
10315 leading blanks in bibtex keys. Normal latex does not care, but
10316 harvard.sty seems to dislike blanks at the beginning of citation
10317 keys. In particular, the retturn value of the function is
10319 * INSTALL: make it clear that libstdc++ is needed and that gcc
10320 2.7.x probably does not work.
10322 * src/support/filetools.C (findtexfile): make debug message go to
10324 * src/insets/insetbib.C (getKeys): ditto
10326 * src/debug.C (showTags): make sure that the output is correctly
10329 * configure.in: add a comment for TWO_COLOR_ICON define.
10331 * acconfig.h: remove all the entries that already defined in
10332 configure.in or acinclude.m4.
10334 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
10335 to avoid user name, date and copyright.
10337 1999-12-21 Juergen Vigna <jug@sad.it>
10339 * src/table.C (Read): Now read bogus row format informations
10340 if the format is < 5 so that afterwards the table can
10341 be read by lyx but without any format-info. Fixed the
10342 crash we experienced when not doing this.
10344 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10346 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
10347 (RedoDrawingOfParagraph): ditto
10348 (RedoParagraphs): ditto
10349 (RemoveTableRow): ditto
10351 * src/text.C (Fill): rename arg paperwidth -> paper_width
10353 * src/buffer.C (insertLyXFile): rename var filename -> fname
10354 (writeFile): rename arg filename -> fname
10355 (writeFileAscii): ditto
10356 (makeLaTeXFile): ditto
10357 (makeLinuxDocFile): ditto
10358 (makeDocBookFile): ditto
10360 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
10363 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
10365 * src/bmtable.h: add extern "C" on this file when __cplusplus is
10368 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
10369 compiled by a C compiler not C++.
10371 * src/layout.h (LyXTextClass): added typedef for const_iterator
10372 (LyXTextClassList): added typedef for const_iterator + member
10373 functions begin and end.
10375 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
10376 iterators to fill the choice_class.
10377 (updateLayoutChoice): rewritten to use iterators to fill the
10378 layoutlist in the toolbar.
10380 * src/BufferView.h (BufferView::work_area_width): removed unused
10383 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
10385 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
10386 (sgmlCloseTag): ditto
10388 * src/support/lstrings.h: return type of countChar changed to
10391 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
10392 what version of this func to use. Also made to return unsigned int.
10394 * configure.in: call LYX_STD_COUNT
10396 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
10397 conforming std::count.
10399 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10401 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
10402 and a subscript would give bad display (patch from Dekel Tsur
10403 <dekel@math.tau.ac.il>).
10405 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
10407 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
10410 * src/chset.h: add a few 'using' directives
10412 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
10413 triggered when no buffer is active
10415 * src/layout.C: removed `break' after `return' in switch(), since
10418 * src/lyx_main.C (init): make sure LyX can be ran in place even
10419 when libtool has done its magic with shared libraries. Fix the
10420 test for the case when the system directory has not been found.
10422 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
10423 name for the latex file.
10424 (MenuMakeHTML): ditto
10426 * src/buffer.h: add an optional boolean argument, which is passed
10427 to ChangeExtension.
10429 1999-12-20 Allan Rae <rae@lyx.org>
10431 * lib/templates/IEEEtran.lyx: small correction and update.
10433 * configure.in: Attempted to use LYX_PATH_HEADER
10435 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
10437 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
10438 input from JMarc. Now use preprocessor to find the header.
10439 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
10440 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
10441 LYX_STL_STRING_FWD. See comments in file.
10443 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
10445 * The global MiniBuffer * minibuffer variable is dead.
10447 * The global FD_form_main * fd_form_main variable is dead.
10449 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10451 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
10453 * src/table.h: add the LOstream.h header
10454 * src/debug.h: ditto
10456 * src/LyXAction.h: change the explaination of the ReadOnly
10457 attribute: is indicates that the function _can_ be used.
10459 * src/LyXAction.C (init): find-replace _can_ be used in read-only
10462 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10464 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
10470 * src/paragraph.C (GetWord): assert on pos>=0
10473 * src/support/lyxstring.C: condition the use of an invariant on
10475 * src/support/lyxstring.h: ditto
10477 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
10478 Use LAssert.h instead of plain assert().
10480 * src/support/lstrings.h: add LAssert.h, in case it is needed.
10482 * src/lyxfunc.C: do not include LAssert.h, it is not used.
10483 * src/support/filetools.C: ditto
10485 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
10488 * INSTALL: document the new configure flags
10490 * configure.in: suppress --with-debug; add --enable-assertions
10492 * acinclude.m4: various changes in alignment of help strings.
10494 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10496 * src/kbmap.C: commented out the use of the hash map in kb_map,
10497 beginning of movement to a stl::container.
10499 * several files: removed code that was not in effect when
10500 MOVE_TEXT was defined.
10502 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
10503 for escaping should not be used. We can discuss if the string
10504 should be enclosed in f.ex. [] instead of "".
10506 * src/trans_mgr.C (insert): use the new returned value from
10507 encodeString to get deadkeys and keymaps done correctly.
10509 * src/chset.C (encodeString): changed to return a pair, to tell
10510 what to use if we know the string.
10512 * src/lyxscreen.h (fillArc): new function.
10514 * src/FontInfo.C (resize): rewritten to use more std::string like
10515 structore, especially string::replace.
10517 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
10520 * configure.in (chmod +x some scripts): remove config/gcc-hack
10522 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10524 * src/buffer.C (writeFile): change once again the top comment in a
10525 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
10526 instead of an hardcoded version number.
10527 (makeDocBookFile): ditto
10529 * src/version.h: add new define LYX_DOCVERSION
10531 * po/de.po: update from Pit Sütterlin
10532 * lib/bind/de_menus.bind: ditto.
10534 * src/lyxfunc.C (Dispatch): call MenuExport()
10535 * src/buffer.C (Dispatch): ditto
10537 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
10538 LyXFunc::Dispatch().
10539 (MenuExport): new function, moved from
10540 LyXFunc::Dispatch().
10542 * src/trans_mgr.C (insert): small cleanup
10543 * src/chset.C (loadFile): ditto
10545 * lib/kbd/iso8859-1.cdef: add missing backslashes
10547 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10549 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
10550 help with placing the manually drawn accents better.
10552 (Draw): x2 and hg changed to float to minimize rounding errors and
10553 help place the accents better.
10555 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
10556 unsigned short to char is just wrong...cast the char to unsigned
10557 char instead so that the two values can compare sanely. This
10558 should also make the display of insetlatexaccents better and
10559 perhaps also some other insets.
10561 (lbearing): new function
10564 1999-12-15 Allan Rae <rae@lyx.org>
10566 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
10567 header that provides a wrapper around the very annoying SGI STL header
10570 * src/support/lyxstring.C, src/LString.h:
10571 removed old SGI-STL-compatability attempts.
10573 * configure.in: Use LYX_STL_STRING_FWD.
10575 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
10576 stl_string_fwd.h is around and try to determine it's location.
10577 Major improvement over previous SGI STL 3.2 compatability.
10578 Three small problems remain with this function due to my zero
10579 knowledge of autoconf. JMarc and lgb see the comments in the code.
10581 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10583 * src/broken_const.h, config/hack-gcc, config/README: removed
10585 * configure.in: remove --with-gcc-hack option; do not call
10588 * INSTALL: remove documentation of --with-broken-const and
10591 * acconfig.h: remove all trace of BROKEN_CONST define
10593 * src/buffer.C (makeDocBookFile): update version number in output
10595 (SimpleDocBookOnePar): fix an assert when trying to a character
10596 access beyond string length
10599 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10601 * po/de.po: fix the Export menu
10603 * lyx.man: update the description of -dbg
10605 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
10606 (commandLineHelp): updated
10607 (easyParse): show list of available debug levels if -dbg is passed
10610 * src/Makefile.am: add debug.C
10612 * src/debug.h: moved some code to debug.C
10614 * src/debug.C: new file. Contains code to set and show debug
10617 * src/layout.C: remove 'break' after 'continue' in switch
10618 statements, since these cannot be reached.
10620 1999-12-13 Allan Rae <rae@lyx.org>
10622 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
10623 (in_word_set): hash() -> math_hash()
10625 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
10627 * acconfig.h: Added a test for whether we are using exceptions in the
10628 current compilation run. If so USING_EXCEPTIONS is defined.
10630 * config.in: Check for existance of stl_string_fwd.h
10631 * src/LString.h: If compiling --with-included-string and SGI's
10632 STL version 3.2 is present (see above test) we need to block their
10633 forward declaration of string and supply a __get_c_string().
10634 However, it turns out this is only necessary if compiling with
10635 exceptions enabled so I've a bit more to add yet.
10637 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
10638 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
10639 src/support/LRegex.h, src/undo.h:
10640 Shuffle the order of the included files a little to ensure that
10641 LString.h gets included before anything that includes stl_string_fwd.h
10643 * src/support/lyxstring.C: We need to #include LString.h instead of
10644 lyxstring.h to get the necessary definition of __get_c_string.
10645 (__get_c_string): New function. This is defined static just like SGI's
10646 although why they need to do this I'm not sure. Perhaps it should be
10647 in lstrings.C instead.
10649 * lib/templates/IEEEtran.lyx: New template file.
10651 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10653 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
10654 * intl/Makefile.in (MKINSTALLDIRS): ditto
10656 * src/LyXAction.C (init): changed to hold the LFUN data in a
10657 automatic array in stead of in callso to newFunc, this speeds up
10658 compilation a lot. Also all the memory used by the array is
10659 returned when the init is completed.
10661 * a lot of files: compiled with -Wold-style-cast, changed most of
10662 the reported offenders to C++ style casts. Did not change the
10663 offenders in C files.
10665 * src/trans.h (Match): change argument type to unsigned int.
10667 * src/support/DebugStream.C: fix some types on the streambufs so
10668 that it works on a conforming implementation.
10670 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10672 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
10674 * src/support/lyxstring.C: remove the inline added earlier since
10675 they cause a bunch of unsatisfied symbols when linking with dec
10676 cxx. Cxx likes to have the body of inlines at the place where they
10679 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
10680 accessing negative bounds in array. This fixes the crash when
10681 inserting accented characters.
10682 * src/trans.h (Match): ditto
10684 * src/buffer.C (Dispatch): since this is a void, it should not try
10685 to return anything...
10687 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10689 * src/buffer.h: removed the two friends from Buffer. Some changes
10690 because of this. Buffer::getFileName and Buffer::setFileName
10691 renamed to Buffer::fileName() and Buffer::fileName(...).
10693 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10695 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
10696 and Buffer::update(short) to BufferView. This move is currently
10697 controlled by a define MOVE_TEXT, this will be removed when all
10698 shows to be ok. This move paves the way for better separation
10699 between buffer contents and buffer view. One side effect is that
10700 the BufferView needs a rebreak when swiching buffers, if we want
10701 to avoid this we can add a cache that holds pointers to LyXText's
10702 that is not currently in use.
10704 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
10707 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10709 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
10711 * lyx_main.C: new command line option -x (or --execute) and
10712 -e (or --export). Now direct conversion from .lyx to .tex
10713 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
10714 Unfortunately, X is still needed and the GUI pops up during the
10717 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10719 * src/Spacing.C: add a using directive to bring stream stuff into
10721 * src/paragraph.C: ditto
10722 * src/buffer.C: ditto
10724 * NEWS: updated a bit the new features of 1.1.3 (took a few things
10725 from Lars' announcement).
10727 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
10728 example files from Tino Meinen.
10730 1999-12-06 Allan Rae <rae@lyx.org>
10732 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
10734 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10736 * src/support/lyxstring.C: added a lot of inline for no good
10739 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
10740 latexWriteEndChanges, they were not used.
10742 * src/layout.h (operator<<): output operator for PageSides
10744 * src/mathed/math_iter.C (my_memcpy): slightly changed.
10746 * some example files: loaded in LyX 1.0.4 and saved again to update
10747 certain constructs (table format)
10749 * a lot of files: did the change to use fstream/iostream for all
10750 writing of files. Done with a close look at Andre Poenitz's patch.
10752 * some files: whitespace changes.
10754 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10756 * src/mathed/math_iter.C (my_memcpy): new function. Since the
10757 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
10758 architecture, we provide our own. It is used unconditionnally, but
10759 I do not think this is a performance problem. Thanks to Angus
10760 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
10761 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
10763 (GetInset): use my_memcpy.
10767 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
10768 it is easier to understand, but it uses less TeX-only constructs now.
10770 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
10771 elements contain spaces
10773 * lib/configure: regenerated
10775 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
10776 elements contain spaces; display the list of programs that are
10779 * autogen.sh: make sure lib/configure is executable
10781 * lib/examples/*: rename the tutorial examples to begin with the
10782 two-letters language code.
10784 * src/lyxfunc.C (getStatus): do not query current font if no
10787 * src/lyx_cb.C (RunScript): use QuoteName
10788 (MenuRunDvips): ditto
10789 (PrintApplyCB): ditto
10791 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
10792 around argument, so that it works well with the current shell.
10793 Does not work properly with OS/2 shells currently.
10795 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
10796 * src/LyXSendto.C (SendtoApplyCB): ditto
10797 * src/lyxfunc.C (Dispatch): ditto
10798 * src/buffer.C (runLaTeX): ditto
10799 (runLiterate): ditto
10800 (buildProgram): ditto
10802 * src/lyx_cb.C (RunScript): ditto
10803 (MenuMakeLaTeX): ditto
10805 * src/buffer.h (getLatexName): new method
10807 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
10809 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10811 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
10812 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
10813 (create_math_panel): ditto
10815 * src/lyxfunc.C (getStatus): re-activate the code which gets
10816 current font and cursor; add test for export to html.
10818 * src/lyxrc.C (read): remove unreachable break statements; add a
10821 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
10823 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10825 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
10826 introduced by faulty regex.
10827 * src/buffer.C: ditto
10828 * src/lastfiles.C: ditto
10829 * src/paragraph.C: ditto
10830 * src/table.C: ditto
10831 * src/vspace.C: ditto
10832 * src/insets/figinset.C: ditto
10833 Note: most of these is absolutely harmless, except the one in
10834 src/mathed formula.C.
10836 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
10838 * src/ImportNoweb.C (documentclass): fixed bounds for substr
10839 operation, yielding correct results for the reLyX command.
10841 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10843 * src/support/filetools.C (ExpandPath): removed an over eager
10845 (ReplaceEnvironmentPath): ditto
10847 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
10848 shows that we are doing something fishy in our code...
10849 (BubblePost): ditto
10852 * src/lyxrc.C (read): use a double switch trick to get more help
10853 from the compiler. (the same trick is used in layout.C)
10854 (write): new function. opens a ofstream and pass that to output
10855 (output): new function, takes a ostream and writes the lyxrc
10856 elemts to it. uses a dummy switch to make sure no elements are
10859 * src/lyxlex.h: added a struct pushpophelper for use in functions
10860 with more than one exit point.
10862 * src/lyxlex.[Ch] (GetInteger): made it const
10866 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
10868 * src/layout.[hC] : LayoutTags splitted into several enums, new
10869 methods created, better error handling cleaner use of lyxlex. Read
10872 * src/bmtable.[Ch]: change some member prototypes because of the
10873 image const changes.
10875 * commandtags.h, src/LyXAction.C (init): new function:
10876 "preferences-save", saves the lyxrc entries into .lyx/preferences.
10877 This file is not read automatically but you can add \input
10878 preferences to your lyxrc if you want to. We need to discuss how
10881 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
10882 in .aux, also remove .bib and .bst files from dependencies when
10885 * src/BufferView.C, src/LyXView.C: add const_cast several places
10886 because of changes to images.
10888 * lib/images/*: same change as for images/*
10890 * lib/lyxrc.example: Default for accept_compound is false not no.
10892 * images/*: changed to be const, however I have som misgivings
10893 about this change so it might be changed back.
10895 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10897 * lib/configure, po/POTFILES.in: regenerated
10899 * autogen.sh: autogenerate lib/configure from lib/configure.m4
10901 * config/lib_configure.m4: removed
10903 * lib/configure.m4: new file (was config/lib_configure.m4)
10905 * configure.in: do not test for rtti, since we do not use it.
10907 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10909 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
10910 doubling of allocated space scheme. This makes it faster for large
10911 strings end to use less memory for small strings. xtra rememoved.
10913 * src/insets/figinset.C (waitalarm): commented out.
10914 (GhostscriptMsg): use static_cast
10915 (GhostscriptMsg): use new instead of malloc to allocate memory for
10916 cmap. also delete the memory after use.
10918 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
10920 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
10921 for changes in bibtex database or style.
10922 (runBibTeX): remove all .bib and .bst files from dep before we
10924 (run): use scanAuc in when dep file already exist.
10926 * src/DepTable.C (remove_files_with_extension): new method
10927 (exist): new method
10929 * src/DepTable.[Ch]: made many of the methods const.
10931 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10933 * src/bufferparams.C: make sure that the default textclass is
10934 "article". It used to be the first one by description order, but
10935 now the first one is "docbook".
10937 * src/lyx_main.C (setDebuggingLevel): change type of argument to
10938 string; call Debug::value.
10939 (easyParse): pass complete argument to setDebuggingLevel().
10941 * src/debug.h (value): fix the code that parses debug levels.
10943 * src/debug.h: add new debug type ACTION, reserved for LyXAction
10946 * src/LyXAction.C: use Debug::ACTION as debug channel.
10948 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
10950 * NEWS: updated for the future 1.1.3 release.
10952 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
10953 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
10954 it should. This is of course a controversial change (since many
10955 people will find that their lyx workscreen is suddenly full of
10956 red), but done for the sake of correctness.
10958 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
10959 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
10961 * src/insets/inseterror.h, src/insets/inseturl.h,
10962 src/insets/insetinfo.h, src/insets/figinset.h,
10963 src/mathed/formulamacro.h, src/mathed/math_macro.h
10964 (EditMessage): add a missing const and add _() to make sure that
10965 translation happens
10967 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
10968 src/insets/insetbib.C, src/support/filetools.C: add `using'
10969 directives for cxx.
10971 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
10972 doing 'Insert index of last word' at the beginning of a paragraph.
10974 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10976 * several files: white-space changes.
10978 * src/mathed/formula.C: removed IsAlpha and IsDigit
10980 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
10981 .bib file. use a ifstream instead of FilePtr when parsing the .bib
10984 * src/insets/figinset.C (GetPSSizes): don't break when
10985 "EndComments" is seen. But break when a boundingbox is read.
10987 * all classes inherited from Inset: return value of Clone
10988 changed back to Inset *.
10990 * all classes inherited form MathInset: return value of Clone
10991 changed back to MathedInset *.
10993 * src/insets/figinset.C (runqueue): use a ofstream to output the
10994 gs/ps file. Might need some setpresicion or setw. However I can
10995 see no problem with the current code.
10996 (runqueue): use sleep instead of the alarm/signal code. I just
10997 can't see the difference.
10999 * src/paragraph.C (LyXParagraph): reserve space in the new
11000 paragraph and resize the inserted paragraph to just fit.
11002 * src/lyxfunc.h (operator|=): added operator for func_status.
11004 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11005 check for readable file.
11007 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11008 check for readable file.
11009 (MenuMakeLinuxDoc): ditto
11010 (MenuMakeDocBook): ditto
11011 (MenuMakeAscii): ditto
11012 (InsertAsciiFile): split the test for openable and readable
11014 * src/bmtable.C (draw_bitmaptable): use
11015 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11017 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11018 findtexfile from LaTeX to filetools.
11020 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11021 instead of FilePtr. Needs to be verified by a literate user.
11023 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11025 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11026 (EditMessage): likewise.
11028 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11029 respectively as \textasciitilde and \textasciicircum.
11031 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11033 * src/support/lyxstring.h: made the methods that take iterators
11034 use const_iterator.
11036 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11037 (regexMatch): made is use the real regex class.
11039 * src/support/Makefile.am: changed to use libtool
11041 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11043 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11045 (MathIsInset ++): changed several macros to be inline functions
11048 * src/mathed/Makefile.am: changed to use libtool
11050 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11052 * src/insets/inset* : Clone changed to const and return type is
11053 the true insettype not just Inset*.
11055 * src/insets/Makefile.am: changed to use libtool
11057 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11059 * src/undo.[Ch] : added empty() and changed some of the method
11062 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11064 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11065 setID use block<> for the bullets array, added const several places.
11067 * src/lyxfunc.C (getStatus): new function
11069 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11070 LyXAction, added const to several funtions.
11072 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11073 a std::map, and to store the dir items in a vector.
11075 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11078 * src/LyXView.[Ch] + other files : changed currentView to view.
11080 * src/LyXAction.[Ch] : ported from the old devel branch.
11082 * src/.cvsignore: added .libs and a.out
11084 * configure.in : changes to use libtool.
11086 * acinclude.m4 : inserted libtool.m4
11088 * .cvsignore: added libtool
11090 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11092 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11093 file name in insets and mathed directories (otherwise the
11094 dependency is not taken in account under cygwin).
11096 * src/text2.C (InsertString[AB]): make sure that we do not try to
11097 read characters past the string length.
11099 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11101 * lib/doc/LaTeXConfig.lyx.in,
11102 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11104 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11105 file saying who created them and when this heppened; this is
11106 useless and annoys tools like cvs.
11108 * lib/layouts/g-brief-{en,de}.layout,
11109 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
11110 from Thomas Hartkens <thomas@hartkens.de>.
11112 * src/{insets,mathed}/Makefile.am: do not declare an empty
11113 LDFLAGS, so that it can be set at configure time (useful on Irix
11116 * lib/reLyX/configure.in: make sure that the prefix is set
11117 correctly in LYX_DIR.
11119 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11121 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11122 be used by 'command-sequence' this allows to bind a key to a
11123 sequence of LyX-commands
11124 (Example: 'command-sequence math-insert alpha; math-insert beta;")
11126 * src/LyXAction.C: add "command-sequence"
11128 * src/LyXFunction.C: handling of "command-sequence"
11130 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
11131 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
11133 * src/lyxserver.C, src/minibuffer.C: Use this new interface
11135 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11137 * src/buffer.C (writeFile): Do not output a comment giving user
11138 and date at the beginning of a .lyx file. This is useless and
11139 annoys cvs anyway; update version number to 1.1.
11141 * src/Makefile.am (LYX_DIR): add this definition, so that a
11142 default path is hardcoded in LyX.
11144 * configure.in: Use LYX_GNU_GETTEXT.
11146 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
11147 AM_GNU_GETTEXT with a bug fixed.
11149 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
11151 * src/chset.C: add "using std::ifstream;" to please dec cxx.
11153 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
11154 which is used to point to LyX data is now LYX_DIR_11x.
11156 * lyx.man: convert to a unix text file; small updates.
11158 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11160 * src/support/LSubstring.[Ch]: made the second arg of most of the
11161 constructors be a const reference.
11163 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
11166 * src/support/lyxstring.[Ch] (swap): added missing member function
11167 and specialization of swap(str, str);
11169 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
11171 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
11172 trace of the old one.
11174 * src/undo.[Ch]: made the undostack use std::list to store undo's in
11175 put the member definitions in undo.C.
11177 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
11178 NEW_TEXT and have now only code that was included when this was
11181 * src/intl.C (LCombo): use static_cast
11183 (DispatchCallback): ditto
11185 * src/definitions.h: removed whole file
11187 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
11189 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
11190 parsing and stores in a std:map. a regex defines the file format.
11191 removed unneeded members.
11193 * src/bufferparams.h: added several enums from definitions.h here.
11194 Removed unsused destructor. Changed some types to use proper enum
11195 types. use block to have the temp_bullets and user_defined_bullets
11196 and to make the whole class assignable.
11198 * src/bufferparams.C (Copy): removed this functions, use a default
11199 assignment instead.
11201 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
11204 * src/buffer.C (readLyXformat2): commend out all that have with
11205 oldpapersize to do. also comment out all that hve to do with
11206 insetlatex and insetlatexdel.
11207 (setOldPaperStuff): commented out
11209 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
11211 * src/LyXAction.C: remove use of inset-latex-insert
11213 * src/mathed/math_panel.C (button_cb): use static_cast
11215 * src/insets/Makefile.am (insets_o_SOURCES): removed
11218 * src/support/lyxstring.C (helper): use the unsigned long
11219 specifier, UL, instead of a static_cast.
11221 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
11223 * src/support/block.h: new file. to be used as a c-style array in
11224 classes, so that the class can be assignable.
11226 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11228 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
11229 NULL, make sure to return an empty string (it is not possible to
11230 set a string to NULL).
11232 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11234 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
11236 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
11238 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
11239 link line, so that Irix users (for example) can set it explicitely to
11242 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
11243 it can be overidden at make time (static or dynamic link, for
11246 * src/vc-backend.C, src/LaTeXFeatures.h,
11247 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
11248 statements to bring templates to global namespace.
11250 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11252 * src/support/lyxstring.C (operator[] const): make it standard
11255 * src/minibuffer.C (Init): changed to reflect that more
11256 information is given from the lyxvc and need not be provided here.
11258 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
11260 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
11262 * src/LyXView.C (UpdateTimerCB): use static_cast
11263 (KeyPressMask_raw_callback): ditto
11265 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
11266 buffer_, a lot of changes because of this. currentBuffer() ->
11267 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
11268 also changes to other files because of this.
11270 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11272 * src/vc-backend.[Ch]: new files. The backends for vc handling,
11273 have no support for RCS and partial support for CVS, will be
11276 * src/insets/ several files: changes because of function name
11277 changes in Bufferview and LyXView.
11279 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
11281 * src/support/LSubstring.[Ch]: new files. These implement a
11282 Substring that can be very convenient to use. i.e. is this
11284 string a = "Mary had a little sheep";
11285 Substring(a, "sheep") = "lamb";
11286 a is now "Mary has a little lamb".
11288 * src/support/LRegex.[Ch]: a regex class that can be used to pick
11289 out patterns and subpatterns of strings. It is used by LSubstring
11290 and also by vc-backend.C
11292 * src/support/lyxstring.C: went over all the assertions used and
11293 tried to correct the wrong ones and flag which of them is required
11294 by the standard. some bugs found because of this. Also removed a
11295 couple of assertions.
11297 * src/support/Makefile.am (libsupport_a_SOURCES): added
11298 LSubstring.[Ch] and LRegex.[Ch]
11300 * src/support/FileInfo.h: have struct stat buf as an object and
11301 not a pointer to one, some changes because of this.
11303 * src/LaTeXFeatures.C (getTClassPreamble): also use the
11304 information in layout when adding the layouts preamble to the
11305 textclass preamble.
11307 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
11310 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
11311 because of bug in OS/2.
11313 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11315 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
11316 \verbatim@font instead of \ttfamily, so that it can be redefined.
11318 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
11319 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
11320 src/layout.h, src/text2.C: add 'using' directive to bring the
11321 STL templates we need from the std:: namespace to the global one.
11322 Needed by DEC cxx in strict ansi mode.
11324 * src/support/LIstream.h,src/support/LOstream.h,
11325 src/support/lyxstring.h,src/table.h,
11326 src/lyxlookup.h: do not include <config.h> in header
11327 files. This should be done in the .C files only.
11329 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
11333 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11335 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
11336 from Kayvan to fix the tth invokation.
11338 * development/lyx.spec.in: updates from Kayvan to reflect the
11339 changes of file names.
11341 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11343 * src/text2.C (InsertStringB): use std::copy
11344 (InsertStringA): use std::copy
11346 * src/bufferlist.C: use a vector to store the buffers in. This is
11347 an internal change and should not affect any other thing.
11349 * src/BufferView.C (waitForX): use XSync instead of the lengthy
11352 * src/text.C (Fill): fix potential bug, one off bug.
11354 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11356 * src/Makefile.am (lyx_main.o): add more files it depends on.
11358 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
11360 * src/support/lyxstring.C: use size_t for the reference count,
11361 size, reserved memory and xtra.
11362 (internal_compare): new private member function. Now the compare
11363 functions should work for std::strings that have embedded '\0'
11365 (compare): all compare functions rewritten to use
11368 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11370 * src/support/lyxstring.C (compare): pass c_str()
11371 (compare): pass c_str
11372 (compare): pass c_str
11374 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11376 * src/support/DebugStream.C: <config.h> was not included correctly.
11378 * lib/configure: forgot to re-generate it :( I'll make this file
11379 auto generated soon.
11381 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11383 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
11386 * src/support/lyxstring.C: some changes from length() to rep->sz.
11387 avoids a function call.
11389 * src/support/filetools.C (SpaceLess): yet another version of the
11390 algorithm...now per Jean-Marc's suggestions.
11392 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11394 * src/layout.C (less_textclass_desc): functor for use in sorting
11396 (LyXTextClass::Read): sort the textclasses after reading.
11398 * src/support/filetools.C (SpaceLess): new version of the
11399 SpaceLess functions. What problems does this one give? Please
11402 * images/banner_bw.xbm: made the arrays unsigned char *
11404 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11406 * src/support/lyxstring.C (find): remove bogus assertion in the
11407 two versions of find where this has not been done yet.
11409 * src/support/lyxlib.h: add missing int return type to
11412 * src/menus.C (ShowFileMenu): disable exporting to html if no
11413 html export command is present.
11415 * config/lib_configure.m4: add a test for an HTML converter. The
11416 programs checked for are, in this order: tth, latex2html and
11419 * lib/configure: generated from config/lib_configure.m4.
11421 * src/lyxfunc.C (Dispatch): update and improve the execution of an
11422 html converter. The parameters are now passed through $$FName and
11423 $$OutName, instead of standard input/output.
11425 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
11427 * lib/lyxrc.example: update description of \html_command.
11428 add "quotes" around \screen_font_xxx font setting examples to help
11429 people who use fonts with spaces in their names.
11431 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11433 * Distribution files: updates for v1.1.2
11435 * src/support/lyxstring.C (find): remove bogus assert and return
11436 npos for the same condition.
11438 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11440 * added patch for OS/2 from SMiyata.
11442 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11444 * src/text2.C (CutSelection): make space_wrapped a bool
11445 (CutSelection): dont declare int i until we have to.
11446 (alphaCounter): return a char const *.
11448 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11450 * src/support/syscall.C (Systemcalls::kill):
11451 src/support/filetools.C (PutEnv, PutEnvPath):
11452 src/lyx_cb.C (addNewlineAndDepth):
11453 src/FontInfo.C (FontInfo::resize): condition some #warning
11454 directives with WITH_WARNINGS.
11457 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11459 * src/layout.[Ch] + several files: access to class variables
11460 limited and made accessor functions instead a lot of code changed
11461 becuase of this. Also instead of returning pointers often a const
11462 reference is returned instead.
11464 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
11466 * src/Makefile.am (dist-hook): added used to remove the CVS from
11467 cheaders upon creating a dist
11468 (EXTRA_DIST): added cheaders
11470 * src/support/lstrings.C (tostr(char)): fix it to handle param as
11471 a character not as a small integer.
11473 * src/support/lyxstring.C (find): removed Assert and added i >=
11474 rep->sz to the first if.
11476 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11478 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
11479 src/LyXView.C src/buffer.C src/bufferparams.C
11480 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
11481 src/text2.C src/insets/insetinclude.C:
11482 lyxlayout renamed to textclasslist.
11484 * src/layout.C: some lyxerr changes.
11486 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
11487 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
11488 (LyXLayoutList): removed all traces of this class.
11489 (LyXTextClass::Read): rewrote LT_STYLE
11490 (LyXTextClass::hasLayout): new function
11491 (LyXTextClass::GetLayout): rewritten to return an iterator + has
11492 both const and nonconst version.
11493 (LyXTextClass::delete_layout): new function.
11494 (LyXTextClassList::Style): bug fix. do the right thing if layout
11496 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
11497 (LyXTextClassList::NameOfLayout): ditto
11498 (LyXTextClassList::Load): ditto
11500 * src/buffer.C (makeLaTeXFile): new access to layoutlist
11502 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
11504 * src/LyXAction.C (LookupFunc): added a workaround for sun
11505 compiler, on the other hand...we don't know if the current code
11506 compiles on sun at all...
11508 * src/support/filetools.C (CleanupPath): subst fix
11510 * src/insets/insetbib.C (delDatabase): subst fix, this looks
11513 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
11514 complained about this one?
11516 * src/insets/insetinclude.C (Latex): subst fix
11518 * src/insets/insetbib.C (getKeys): subst fix
11520 * src/LyXSendto.C (SendtoApplyCB): subst fix
11522 * src/lyx_main.C (init): subst fix
11524 * src/layout.C (Read): subst fix
11526 * src/lyx_sendfax_main.C (button_send): subst fix
11528 * src/buffer.C (RoffAsciiTable): subst fix
11530 * src/lyx_cb.C (MenuFax): subst fix
11531 (PrintApplyCB): subst fix
11533 1999-10-26 Juergen Vigna <jug@sad.it>
11535 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
11537 (Read): Cleaned up this code so now we read only format vestion >= 5
11539 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11541 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
11542 come nobody has complained about this one?
11544 * src/insets/insetinclude.C (Latex): subst fix
11546 * src/insets/insetbib.C (getKeys): subst fix
11548 * src/lyx_main.C (init): subst fix
11550 * src/layout.C (Read): subst fix
11552 * src/buffer.C (RoffAsciiTable): subst fix
11554 * src/lyx_cb.C (MenuFax): subst fix.
11556 * src/layout.[hC] + some other files: rewrote to use
11557 std::container to store textclasses and layouts in.
11558 Simplified, removed a lot of code. Make all classes
11559 assignable. Further simplifications and review of type
11560 use still to be one.
11562 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
11563 lastfiles to create the lastfiles partr of the menu.
11565 * src/lastfiles.[Ch]: rewritten to use deque to store the
11566 lastfiles in. Uses fstream for reading and writing. Simplifies
11569 * src/support/syscall.C: remove explicit cast.
11571 * src/BufferView.C (CursorToggleCB): removed code snippets that
11572 were commented out.
11573 use explicat C++ style casts instead of C style casts. also use
11574 u_vdata instea of passing pointers in longs.
11576 * src/PaperLayout.C: removed code snippets that were commented out.
11578 * src/lyx_gui_misc.C: removed code snippets that were commented out.
11580 * src/lyx_main.C: removed code snippets that wer commented out.
11582 * src/paragraph.C: removed code snippets that were commented out.
11584 * src/lyxvc.C (logClose): use static_cast
11586 (viewLog): remove explicit cast to void*
11587 (showLog): removed old commented code
11589 * src/menus.C: use static_cast instead of C style casts. use
11590 u_vdata instead of u_ldata. remove explicit cast to (long) for
11591 pointers. Removed old code that was commented out.
11593 * src/insets/inset.C: removed old commented func
11595 * src/insets/insetref.C (InsetRef): removed old code that had been
11596 commented out for a long time.
11598 (escape): removed C style cast
11600 * src/insets/insetlatexaccent.C (Draw): removed old commented code
11602 * src/insets/insetlatex.C (Draw): removed old commented code
11603 (Read): rewritten to use string
11605 * src/insets/insetlabel.C (escape): removed C style cast
11607 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
11609 * src/insets/insetindex.C: use static_cast and u_vdata, removed
11610 old commented code.
11612 * src/insets/insetinclude.h: removed a couple of stupid bools
11614 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
11615 (Clone): remove C style cast
11616 (getKeys): changed list to lst because of std::list
11618 * src/insets/inseterror.C (Draw): removed som old commented code.
11620 * src/insets/insetcommand.C (Draw): removed some old commented code.
11622 * src/insets/insetbib.C (bibitem_cb): removed code that has been
11623 commented out forever.
11624 (bibitem_cb): use static_cast instead of C style cast
11625 use of vdata changed to u_vdata.
11627 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
11629 (CloseUrlCB): use static_cast instead of C style cast.
11630 (CloseUrlCB): added a fl_free form...it seemed to be missing.
11632 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
11633 (C_InsetInfo_CloseInfoCB): forward the ob parameter
11634 (CloseInfoCB): static_cast from ob->u_vdata instead.
11635 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
11638 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
11639 (C_InsetError_CloseErrorCB): forward the ob parameter
11640 (CloseErrorCB): static_cast from ob->u_vdata instead.
11642 * src/vspace.h: include LString.h since we use string in this class.
11644 * src/vspace.C (lyx_advance): changed name from advance because of
11645 nameclash with stl. And since we cannot use namespaces yet...I
11646 used a lyx_ prefix instead. Expect this to change when we begin
11649 * src/BufferView.[Ch] (BufferView::~BufferView): removed
11651 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
11652 and removed now defunct constructor and deconstructor.
11654 * src/BufferView.h: have backstack as a object not as a pointer.
11655 removed initialization from constructor. added include for BackStack
11657 * development/lyx.spec.in (%build): add CFLAGS also.
11659 * src/screen.C (drawFrame): removed another warning.
11661 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11663 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
11664 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
11665 README and ANNOUNCE a bit for the next release. More work is
11668 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
11669 unbreakable if we are in freespacing mode (LyX-Code), but not in
11672 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
11674 * src/BackStack.h: fixed initialization order in constructor
11676 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
11678 * acinclude.m4 (VERSION): new rules for when a version is
11679 development, added also a variable for prerelease.
11680 (warnings): we set with_warnings=yes for prereleases
11681 (lyx_opt): prereleases compile with same optimization as development
11682 (CXXFLAGS): only use pedantic if we are a development version
11684 * src/BufferView.C (restorePosition): don't do anything if the
11685 backstack is empty.
11687 * src/BackStack.h: added member empty, use this to test if there
11688 is anything to pop...
11690 1999-10-25 Juergen Vigna <jug@sad.it>
11693 * forms/layout_forms.fd +
11694 * forms/latexoptions.fd +
11695 * lyx.fd: changed for various form resize issues
11697 * src/mathed/math_panel.C +
11698 * src/insets/inseterror.C +
11699 * src/insets/insetinfo.C +
11700 * src/insets/inseturl.C +
11701 * src/insets/inseturl.h +
11703 * src/LyXSendto.C +
11704 * src/PaperLayout.C +
11705 * src/ParagraphExtra.C +
11706 * src/TableLayout.C +
11708 * src/layout_forms.C +
11715 * src/menus.C: fixed various resize issues. So now forms can be
11716 resized savely or not be resized at all.
11718 * forms/form_url.fd +
11719 * src/insets/form_url.[Ch]: added because it's cleaner and easier
11722 * src/insets/Makefile.am: added files form_url.[Ch]
11724 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11726 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
11727 (and presumably 6.2).
11729 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
11730 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
11731 remaining static member callbacks.
11733 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
11736 * src/support/lyxstring.h: declare struct Srep as friend of
11737 lyxstring, since DEC cxx complains otherwise.
11739 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11741 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11743 * src/LaTeX.C (run): made run_bibtex also depend on files with
11745 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
11746 are put into the dependency file.
11748 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
11749 the code has shown itself to work
11750 (create_ispell_pipe): removed another warning, added a comment
11753 * src/minibuffer.C (ExecutingCB): removed code that has been
11754 commented out a long time
11756 * src/lyxfunc.C (processKeyEvent): removed some very old commented
11757 out code + a warning.
11759 * src/support/lyxstring.h: comment out the three private
11760 operators, when compiling with string ansi conforming compilers
11761 they make problems.
11763 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
11765 (pixmapFromBitmapData): change type of bdata to be unsigned char *
11766 (pixmapFromBitmapData): add a reinterpret_cast in the call to
11769 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
11772 * src/mathed/math_panel.C (create_math_panel): remove explicit
11775 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
11778 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
11779 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
11780 to XCreatePixmapFromBitmapData
11781 (fl_set_bmtable_data): change the last argument to be unsigned
11783 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
11784 and bh to be unsigned int, remove explicit casts in call to
11785 XReadBitmapFileData.
11787 * images/arrows.xbm: made the arrays unsigned char *
11788 * images/varsz.xbm: ditto
11789 * images/misc.xbm: ditto
11790 * images/greek.xbm: ditto
11791 * images/dots.xbm: ditto
11792 * images/brel.xbm: ditto
11793 * images/bop.xbm: ditto
11795 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
11797 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
11798 (LYX_PROG_CXX): added -pedantic to g++ compile options when
11799 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
11801 (LYX_CXX_CHEADERS): added <clocale> to the test.
11803 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
11805 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
11807 * src/support/lyxstring.C (append): fixed something that must be a
11808 bug, rep->assign was used instead of rep->append.
11810 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
11813 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
11814 lyx insert double chars. Fix spotted by Kayvan.
11816 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11818 * Fixed the tth support. I messed up with the Emacs patch apply feature
11819 and omitted the changes in lyxrc.C.
11821 1999-10-22 Juergen Vigna <jug@sad.it>
11823 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
11825 * src/lyx_cb.C (MenuInsertRef) +
11826 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
11827 the form cannot be resized under it limits (fixes a segfault)
11829 * src/lyx.C (create_form_form_ref) +
11830 * forms/lyx.fd: Changed Gravity on name input field so that it is
11833 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11835 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
11836 <ostream> and <istream>.
11838 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
11839 whether <fstream> provides the latest standard features, or if we
11840 have an oldstyle library (like in egcs).
11841 (LYX_CXX_STL_STRING): fix the test.
11843 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
11844 code on MODERN_STL_STREAM.
11846 * src/support/lyxstring.h: use L{I,O}stream.h.
11848 * src/support/L{I,O}stream.h: new files, designed to setup
11849 correctly streams for our use
11850 - includes the right header depending on STL capabilities
11851 - puts std::ostream and std::endl (for LOStream.h) or
11852 std::istream (LIStream.h) in toplevel namespace.
11854 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11856 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
11857 was a bib file that had been changed we ensure that bibtex is run.
11858 (runBibTeX): enhanced to extract the names of the bib files and
11859 getting their absolute path and enter them into the dep file.
11860 (findtexfile): static func that is used to look for tex-files,
11861 checks for absolute patchs and tries also with kpsewhich.
11862 Alternative ways of finding the correct files are wanted. Will
11864 (do_popen): function that runs a command using popen and returns
11865 the whole output of that command in a string. Should be moved to
11868 * src/DepTable.[Ch] (extchanged): new function that returns true if a
11869 file with extension ext has changed.
11871 * src/insets/figinset.C: added ifdef guards around the fl_free
11872 code that jug commented out. Now it is commented out when
11873 compiling with XForms == 0.89.
11875 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
11876 to lyxstring.C, and only keep a forward declaration in
11877 lyxstring.h. Simplifies the header file a bit and should help a
11878 bit on compile time too. Also changes to Srep will not mandate a
11879 recompile of code just using string.
11880 (~lyxstring): definition moved here since it uses srep.
11881 (size): definition moved here since it uses srep.
11883 * src/support/lyxstring.h: removed a couple of "inline" that should
11886 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11888 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
11891 1999-10-21 Juergen Vigna <jug@sad.it>
11893 * src/table.C (SetPWidth): Just a small fix so the alignment is not
11894 set to left if I just remove the width entry (or it is empty).
11896 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
11897 paragraph when having dummy paragraphs.
11899 1999-10-20 Juergen Vigna <jug@sad.it>
11901 * src/insets/figinset.C: just commented some fl_free_form calls
11902 and added warnings so that this calls should be activated later
11903 again. This avoids for now a segfault, but we have a memory leak!
11905 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
11906 'const char * argument' to 'string argument', this should
11907 fix some Asserts() in lyxstring.C.
11909 * src/lyxfunc.h: Removed the function argAsString(const char *)
11910 as it is not used anymore.
11912 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
11914 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
11917 * src/Literate.h: some funcs moved from public to private to make
11918 interface clearer. Unneeded args removed.
11920 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
11922 (scanBuildLogFile): ditto
11924 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
11925 normal TeX Error. Still room for improvement.
11927 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
11929 * src/buffer.C (insertErrors): changes to make the error
11930 desctription show properly.
11932 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
11935 * src/support/lyxstring.C (helper): changed to use
11936 sizeof(object->rep->ref).
11937 (operator>>): changed to use a pointer instead.
11939 * src/support/lyxstring.h: changed const reference & to value_type
11940 const & lets see if that helps.
11942 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
11944 * Makefile.am (rpmdist): fixed to have non static package and
11947 * src/support/lyxstring.C: removed the compilation guards
11949 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
11952 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
11953 conditional compile of lyxstring.Ch
11955 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
11956 stupid check, but it is a lot better than the bastring hack.
11957 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
11959 * several files: changed string::erase into string::clear. Not
11962 * src/chset.C (encodeString): use a char temporary instead
11964 * src/table.C (TexEndOfCell): added tostr around
11965 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
11966 (TexEndOfCell): ditto
11967 (TexEndOfCell): ditto
11968 (TexEndOfCell): ditto
11969 (DocBookEndOfCell): ditto
11970 (DocBookEndOfCell): ditto
11971 (DocBookEndOfCell): ditto
11972 (DocBookEndOfCell): ditto
11974 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
11976 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
11978 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
11979 (MenuBuildProg): added tostr around ret
11980 (MenuRunChktex): added tostr around ret
11981 (DocumentApplyCB): added tostr around ret
11983 * src/chset.C (encodeString): added tostr around t->ic
11985 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
11986 (makeLaTeXFile): added tostr around tocdepth
11987 (makeLaTeXFile): added tostr around ftcound - 1
11989 * src/insets/insetbib.C (setCounter): added tostr around counter.
11991 * src/support/lyxstring.h: added an operator+=(int) to catch more
11994 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
11995 (lyxstring): We DON'T allow NULL pointers.
11997 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11999 * src/mathed/math_macro.C (MathMacroArgument::Write,
12000 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12001 when writing them out.
12003 * src/LString.C: remove, since it is not used anymore.
12005 * src/support/lyxstring.C: condition the content to
12006 USE_INCLUDED_STRING macro.
12008 * src/mathed/math_symbols.C, src/support/lstrings.C,
12009 src/support/lyxstring.C: add `using' directive to specify what
12010 we need in <algorithm>. I do not think that we need to
12011 conditionalize this, but any thought is appreciated.
12013 * many files: change all callback functions to "C" linkage
12014 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12015 strict_ansi. Those who were static are now global.
12016 The case of callbacks which are static class members is
12017 trickier, since we have to make C wrappers around them (see
12018 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12019 did not finish this yet, since it defeats the purpose of
12020 encapsulation, and I am not sure what the best route is.
12022 1999-10-19 Juergen Vigna <jug@sad.it>
12024 * src/support/lyxstring.C (lyxstring): we permit to have a null
12025 pointer as assignment value and just don't assign it.
12027 * src/vspace.C (nextToken): corrected this function substituting
12028 find_first(_not)_of with find_last_of.
12030 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12031 (TableOptCloseCB) (TableSpeCloseCB):
12032 inserted fl_set_focus call for problem with fl_hide_form() in
12035 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12037 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12040 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12042 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12043 LyXLex::next() and not eatline() to get its argument.
12045 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12047 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12048 instead, use fstreams for io of the depfile, removed unneeded
12049 functions and variables.
12051 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12052 vector instead, removed all functions and variables that is not in
12055 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12057 * src/buffer.C (insertErrors): use new interface to TeXError
12059 * Makefile.am (rpmdist): added a rpmdist target
12061 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12062 per Kayvan's instructions.
12064 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12066 * src/Makefile.am: add a definition for localedir, so that locales
12067 are found after installation (Kayvan)
12069 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12071 * development/.cvsignore: new file.
12073 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12075 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12076 C++ compiler provides wrappers for C headers and use our alternate
12079 * configure.in: use LYX_CXX_CHEADERS.
12081 * src/cheader/: new directory, populated with cname headers from
12082 libstdc++-2.8.1. They are a bit old, but probably good enough for
12083 what we want (support compilers who lack them).
12085 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12086 from includes. It turns out is was stupid.
12088 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12090 * lib/Makefile.am (install-data-local): forgot a ';'
12091 (install-data-local): forgot a '\'
12092 (libinstalldirs): needed after all. reintroduced.
12094 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12096 * configure.in (AC_OUTPUT): added lyx.spec
12098 * development/lyx.spec: removed file
12100 * development/lyx.spec.in: new file
12102 * po/*.po: merged with lyx.pot becuase of make distcheck
12104 * lib/Makefile.am (dist-hook): added dist-hook so that
12105 documentation files will be included when doing a make
12106 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12107 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
12109 more: tried to make install do the right thing, exclude CVS dirs
12112 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
12113 Path would fit in more nicely.
12115 * all files that used to use pathstack: uses now Path instead.
12116 This change was a lot easier than expected.
12118 * src/support/path.h: new file
12120 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12122 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12124 * src/support/lyxstring.C (getline): Default arg was given for
12127 * Configure.cmd: removed file
12129 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12131 * src/support/DebugStream.[Ch]: remove the explicit std:: before
12132 streams classes and types, add the proper 'using' statements when
12133 MODERN_STL is defined.
12135 * src/debug.h: move the << operator definition after the inclusion
12138 * src/support/filetools.C: include "LAssert.h", which is needed
12141 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
12144 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
12145 include "debug.h" to define a proper ostream.
12147 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12149 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
12150 method to the SystemCall class which can kill a process, but it's
12151 not fully implemented yet.
12153 * src/*.C: Changed Systemcalls::Startscript() to startscript()
12155 * src/support/FileInfo.h: Better documentation
12157 * src/lyxfunc.C: Added support for buffer-export html
12159 * src/menus.C: Added Export->As HTML...
12161 * lib/bind/*.bind: Added short-cut for buffer-export html
12163 * src/lyxrc.*: Added support for new \tth_command
12165 * lib/lyxrc.example: Added stuff for new \tth_command
12167 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
12169 * lib/Makefile.am (IMAGES): removed images/README
12170 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
12171 installes in correct place. Check permisions is installed
12174 * src/LaTeX.C: some no-op changes moved declaration of some
12177 * src/LaTeX.h (LATEX_H): changed include guard name
12179 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12181 * lib/reLyX/Makefile.am: install noweb2lyx.
12183 * lib/Makefile.am: install configure.
12185 * lib/reLyX/configure.in: declare a config aux dir; set package
12186 name to lyx (not sure what the best solution is); generate noweb2lyx.
12188 * lib/layouts/egs.layout: fix the bibliography layout.
12190 1999-10-08 Jürgen Vigna <jug@sad.it>
12192 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
12193 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
12194 it returned without continuing to search the path.
12196 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
12198 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
12199 also fixes a bug. It is not allowed to do tricks with std::strings
12200 like: string a("hei"); &a[e]; this will not give what you
12201 think... Any reason for the complexity in this func?
12203 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
12205 * Updated README and INSTALL a bit, mostly to check that my
12206 CVS rights are correctly set up.
12208 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
12210 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
12211 does not allow '\0' chars but lyxstring and std::string does.
12213 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12215 * autogen.sh (AUTOCONF): let the autogen script create the
12216 POTFILES.in file too. POTFILES.in should perhaps now not be
12217 included in the cvs module.
12219 * some more files changed to use C++ includes instead of C ones.
12221 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
12223 (Reread): added tostr to nlink. buggy output otherwise.
12224 (Reread): added a string() around szMode when assigning to Buffer,
12225 without this I got a log of garbled info strings.
12227 * acconfig.h: commented out the PTR_AS_INT macros. They should not
12230 * I have added several ostream & operator<<(ostream &, some_type)
12231 functions. This has been done to avoid casting and warnings when
12232 outputting enums to lyxerr. This as thus eliminated a lot of
12233 explicit casts and has made the code clearer. Among the enums
12234 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
12235 mathed enums, some font enum the Debug::type enum.
12237 * src/support/lyxstring.h (clear): missing method. equivalent of
12240 * all files that contained "stderr": rewrote constructs that used
12241 stderr to use lyxerr instead. (except bmtable)
12243 * src/support/DebugStream.h (level): and the passed t with
12244 Debug::ANY to avoid spurious bits set.
12246 * src/debug.h (Debug::type value): made it accept strings of the
12247 type INFO,INIT,KEY.
12249 * configure.in (Check for programs): Added a check for kpsewhich,
12250 the latex generation will use this later to better the dicovery of
12253 * src/BufferView.C (create_view): we don't need to cast this to
12254 (void*) that is done automatically.
12255 (WorkAreaButtonPress): removed some dead code.
12257 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12259 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
12260 is not overwritten when translated (David Sua'rez de Lis).
12262 * lib/CREDITS: Added David Sua'rez de Lis
12264 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
12266 * src/bufferparams.C (BufferParams): default input encoding is now
12269 * acinclude.m4 (cross_compiling): comment out macro
12270 LYX_GXX_STRENGTH_REDUCE.
12272 * acconfig.h: make sure that const is not defined (to empty) when
12273 we are compiling C++. Remove commented out code using SIZEOF_xx
12276 * configure.in : move the test for const and inline as late as
12277 possible so that these C tests do not interefere with C++ ones.
12278 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
12279 has not been proven.
12281 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12283 * src/table.C (getDocBookAlign): remove bad default value for
12284 isColumn parameter.
12286 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
12288 (ShowFileMenu2): ditto.
12290 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
12291 of files to ignore.
12293 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12295 * Most files: finished the change from the old error code to use
12296 DebugStream for all lyxerr debugging. Only minor changes remain
12297 (e.g. the setting of debug levels using strings instead of number)
12299 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12301 * src/layout.C (Add): Changed to use compare_no_case instead of
12304 * src/FontInfo.C: changed loop variable type too string::size_type.
12306 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12308 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
12309 set ETAGS_ARGS to --c++
12311 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
12313 * src/table.C (DocBookEndOfCell): commented out two unused variables
12315 * src/paragraph.C: commented out four unused variables.
12317 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
12318 insed a if clause with type string::size_type.
12320 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
12323 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
12325 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
12326 variable, also changed loop to go from 0 to lenght + 1, instead of
12327 -1 to length. This should be correct.
12329 * src/LaTeX.C (scanError): use string::size_type as loop variable
12332 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
12333 (l.896) since y_tmp and row was not used anyway.
12335 * src/insets/insetref.C (escape): use string::size_type as loop
12338 * src/insets/insetquotes.C (Width): use string::size_type as loop
12340 (Draw): use string::size_type as loop variable type.
12342 * src/insets/insetlatexaccent.C (checkContents): use
12343 string::size_type as loop variable type.
12345 * src/insets/insetlabel.C (escape): use string::size_type as loop
12348 * src/insets/insetinfo.C: added an extern for current_view.
12350 * src/insets/insetcommand.C (scanCommand): use string::size_type
12351 as loop variable type.
12353 * most files: removed the RCS tags. With them we had to recompile
12354 a lot of files after a simple cvs commit. Also we have never used
12355 them for anything meaningful.
12357 * most files: tags-query-replace NULL 0. As adviced several plases
12358 we now use "0" instead of "NULL" in our code.
12360 * src/support/filetools.C (SpaceLess): use string::size_type as
12361 loop variable type.
12363 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12365 * src/paragraph.C: fixed up some more string stuff.
12367 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12369 * src/support/filetools.h: make modestr a std::string.
12371 * src/filetools.C (GetEnv): made ch really const.
12373 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
12374 made code that used these use max/min from <algorithm> instead.
12376 * changed several c library include files to their equivalent c++
12377 library include files. All is not changed yet.
12379 * created a support subdir in src, put lyxstring and lstrings
12380 there + the extra files atexit, fileblock, strerror. Created
12381 Makefile.am. edited configure.in and src/Makefile.am to use this
12382 new subdir. More files moved to support.
12384 * imported som of the functions from repository lyx, filetools
12386 * ran tags-query-replace on LString -> string, corrected the bogus
12387 cases. Tried to make use of lstrings.[hC], debugged a lot. There
12388 is still some errors in there. This is errors where too much or
12389 too litle get deleted from strings (string::erase, string::substr,
12390 string::replace), there can also be some off by one errors, or
12391 just plain wrong use of functions from lstrings. Viewing of quotes
12394 * LyX is now running fairly well with string, but there are
12395 certainly some bugs yet (see above) also string is quite different
12396 from LString among others in that it does not allow null pointers
12397 passed in and will abort if it gets any.
12399 * Added the revtex4 files I forgot when setting up the repository.
12401 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12403 * All over: Tried to clean everything up so that only the files
12404 that we really need are included in the cvs repository.
12405 * Switched to use automake.
12406 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
12407 * Install has not been checked.
12409 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12411 * po/pt.po: Three errors:
12412 l.533 and l.538 format specification error
12413 l. 402 duplicate entry, I just deleted it.