1 2000-08-08 Juergen Vigna <jug@sad.it>
3 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
5 * src/bufferlist.C (close):
6 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
7 documents if exiting without saving.
9 * src/buffer.C (save): use removeAutosaveFile()
11 * src/support/filetools.C (removeAutosaveFile): new function.
13 * src/lyx_cb.C (MenuWrite): returns a bool now.
14 (MenuWriteAs): check if file could really be saved and revert to the
16 (MenuWriteAs): removing old autosavefile if existant.
18 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
19 before Goto toggle declaration, because of compiler warning.
21 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
23 * src/lyxfunc.C (MenuNew): small fix.
25 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
27 * src/bufferlist.C (newFile):
28 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
30 * src/lyxrc.C: added new_ask_filename tag
32 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
34 * src/lyx.fd: removed code pertaining to form_ref
37 * src/lyx_gui.C: ditto
38 * src/lyx_gui_misc.C: ditto
40 * src/BufferView_pimpl.C (restorePosition): update buffer only
43 * src/commandtags.h (LFUN_REFTOGGLE): removed
44 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
45 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
46 (LFUN_REFBACK): renamed LFUN_REF_BACK
48 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
50 * src/lyxfunc.C (Dispatch): ditto.
51 InsertRef dialog is now GUI-independent.
53 * src/texrow.C: added using std::endl;
55 * src/insets/insetref.[Ch]: strip out large amounts of code.
56 The inset is now a container and this functionality is now
57 managed by a new FormRef dialog
59 * src/frontends/Dialogs.h (showRef, createRef): new signals
61 * src/frontends/xforms/FormIndex.[Ch],
62 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
63 when setting dialog's min/max size
64 * src/frontends/xforms/FormIndex.[Ch]: ditto
66 * src/frontends/xforms/FormRef.[Ch],
67 src/frontends/xforms/forms/form_ref.fd: new xforms
68 implementation of an InsetRef dialog
70 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
73 * src/graphics/XPM_Renderer.C (isImageFormatOK):
74 ios::nocreate is not part of the standard. Removed.
76 2000-08-07 Baruch Even <baruch.even@writeme.com>
78 * src/graphics/Renderer.h:
79 * src/graphics/Renderer.C: Added base class for rendering of different
80 image formats into Pixmaps.
82 * src/graphics/XPM_Renderer.h:
83 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
86 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
87 easily add support for other formats.
89 * src/insets/figinset.C: plugged a leak of an X resource.
91 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
93 * src/CutAndPaste.[Ch]: make all metods static.
95 * development/Code_rules/Rules: more work, added section on
96 Exceptions, and a References section.
98 * a lot of header files: work to make doc++ able to generate the
99 source documentation, some workarounds of doc++ problems. Doc++ is
100 now able to generate the documentation.
102 2000-08-07 Juergen Vigna <jug@sad.it>
104 * src/insets/insettabular.C (recomputeTextInsets): removed function
106 * src/tabular.C (SetWidthOfMulticolCell):
108 (calculate_width_of_column_NMC): fixed return value so that it really
109 only returns true if the column-width has changed (there where
110 problems with muliticolumn-cells in this column).
112 2000-08-04 Juergen Vigna <jug@sad.it>
114 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
115 also on the scrollstatus of the inset.
116 (workAreaMotionNotify): ditto.
118 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
120 2000-08-01 Juergen Vigna <jug@sad.it>
122 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
125 * src/LyXAction.C (init):
126 * src/insets/inset.C (LocalDispatch): added support for
129 * src/insets/inset.C (scroll): new functions.
131 * src/insets/insettext.C (removeNewlines): new function.
132 (SetAutoBreakRows): removes forced newlines in the text of the
133 paragraph if autoBreakRows is set to false.
135 * src/tabular.C (Latex): generates a parbox around the cell contents
138 * src/frontends/xforms/FormTabular.C (local_update): removed
139 the radio_useparbox button.
141 * src/tabular.C (UseParbox): new function
143 2000-08-06 Baruch Even <baruch.even@writeme.com>
145 * src/graphics/GraphicsCache.h:
146 * src/graphics/GraphicsCache.C:
147 * src/graphics/GraphicsCacheItem.h:
148 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
151 * src/insets/insetgraphics.h:
152 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
153 drawing of the inline image.
155 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
156 into the wrong position.
158 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
161 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
163 * src/support/translator.h: move all typedefs to public section
165 * src/support/filetools.C (MakeLatexName): return string const
168 (FileOpenSearch): ditto
170 (LibFileSearch): ditto
171 (i18nLibFileSearch): ditto
174 (CreateTmpDir): ditto
175 (CreateBufferTmpDir): ditto
176 (CreateLyXTmpDir): ditto
181 (OnlyFilename): ditto
183 (NormalizePath): ditto
185 (GetFileContents): ditto
186 (ReplaceEnvironmentPath): ditto
189 (ChangeExtension): ditto
190 (MakeDisplayPath): ditto
191 (do_popen): return cmdret const
192 (findtexfile): return string const
194 * src/support/DebugStream.h: add some /// to please doc++
196 * src/frontends/DialogBase.h (endif): add some /// to please doc++
198 * src/texrow.C (same_rownumber): functor to use with find_if
199 (getIdFromRow): rewritten to use find_if and to not update the
200 positions. return true if row is found
201 (increasePos): new method, use to update positions
203 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
205 * src/lyxlex_pimpl.C (verifyTable): new method
208 (GetString): return string const
209 (pushTable): rewrite to use std::stack
211 (setFile): better check
214 * src/lyxlex.h: make LyXLex noncopyable
216 * src/lyxlex.C (text): return char const * const
217 (GetString): return string const
218 (getLongString): return string const
220 * src/lyx_gui_misc.C (askForText): return pair<...> const
222 * src/lastfiles.[Ch] (operator): return string const
224 * src/buffer.C (parseSingleLyXformat2Token): pass string to
225 istringstream not char const *.
226 move token.end() out of loop.
227 (readFile): move initializaton of token
229 * src/BufferView2.C (insertErrors): run texrow.increasePos if
230 getIdFromRow is successful.
232 * lib/bind/emacs.bind: don't include menus bind
234 * development/Code_rules/Rules: the beginnings of making this
235 better and covering more of the unwritten rules that we have.
237 * development/Code_rules/Recommendations: a couple of wording
240 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
242 * src/support/strerror.c: remove C++ comment.
244 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
246 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
247 LFUN_INDEX_INSERT_LAST
249 * src/texrow.C (getIdFromRow): changed from const_iterator to
250 iterator, allowing code to compile with DEC cxx
252 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
253 stores part of the class, as suggested by Allan. Will allow
255 (apply): test to apply uses InsetCommandParams operator!=
257 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
258 (apply): test to apply uses InsetCommandParams operator!=
260 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
261 stores part of the class.
262 (update): removed limits on min/max size.
264 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
265 (apply): test to apply uses InsetCommandParams operator!=
267 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
268 (Read, Write, scanCommand, getCommand): moved functionality
269 into InsetCommandParams.
271 (getScreenLabel): made pure virtual
272 new InsetCommandParams operators== and !=
274 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
275 c-tors based on InsetCommandParams. Removed others.
276 * src/insets/insetinclude.[Ch]: ditto
277 * src/insets/insetlabel.[Ch]: ditto
278 * src/insets/insetparent.[Ch]: ditto
279 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
281 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
282 insets derived from InsetCommand created using similar c-tors
283 based on InsetCommandParams
284 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
285 * src/menus.C (ShowRefsMenu): ditto
286 * src/paragraph.C (Clone): ditto
287 * src/text2.C (SetCounter): ditto
288 * src/lyxfunc.C (Dispatch) ditto
289 Also recreated old InsetIndex behaviour exactly. Can now
290 index-insert at the start of a paragraph and index-insert-last
291 without launching the pop-up.
293 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
295 * lib/lyxrc.example: mark te pdf options as non functional.
297 * src/support/lstrings.C (strToInt): move initalization of tmpstr
298 (isStrDbl): move tmpstr.end() out of loop.
299 (strToDbl): move intialization of tmpstr
300 (lowercase): return string const and move tmp.end() out of loop.
301 (uppercase): return string const and move tmp.edn() out of loop.
302 (prefixIs): add assertion
307 (containsOnly): ditto
308 (containsOnly): ditto
309 (containsOnly): ditto
310 (countChar): make last arg char not char const
311 (token): return string const
312 (subst): return string const, move tmp.end() out of loop.
313 (subst): return string const, add assertion
314 (strip): return string const
315 (frontStrip): return string const, add assertion
316 (frontStrip): return string const
321 * src/support/lstrings.C: add inclde "LAssert.h"
322 (isStrInt): move tmpstr.end() out of loop.
324 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
325 toollist.end() out of loop.
326 (deactivate): move toollist.end() out of loop.
327 (update): move toollist.end() out of loop.
328 (updateLayoutList): move tc.end() out of loop.
329 (add): move toollist.end() out of loop.
331 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
332 md.end() out of loop.
334 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
336 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
339 * src/paragraph.C (Erase): move fontlist.end() out of loop.
340 (Erase): move insetlist.end() out of loop.
342 * src/lyx_sendfax_main.C: make show_logfile static and to take a
343 ref to const string as first arg. Move initialization of some
344 variables, whitespace changes.
346 * src/kbmap.C (defkey): move table.end() out of loop.
347 (kb_keymap): move table.end() out of loop.
348 (findbinding): move table.end() out of loop.
350 * src/MenuBackend.C (hasMenu): move end() out of loop.
351 (getMenu): move end() out of loop.
352 (getMenu): move menulist_.end() out of loop.
354 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
356 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
359 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
360 (getFromLyXName): move infotab.end() out of loop.
362 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
363 -fvtable-thunks -ffunction-sections -fdata-sections
365 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
367 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
370 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
372 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
374 * src/frontends/xforms/FormCitation.[Ch],
375 src/frontends/xforms/FormIndex.[Ch],
376 src/frontends/xforms/FormToc.[Ch],
377 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
379 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
381 * src/commandtags.h: renamed, created some flags for citation
384 * src/lyx_gui_misc.C: stripped out old FD_index_form code
386 * src/lyxfunc.C (dispatch): use signals to insert index entry
388 * src/frontends/Dialogs.h: new signal createIndex
390 * src/frontends/xforms/FormCommand.[Ch],
391 src/frontends/xforms/FormCitation.[Ch],
392 src/frontends/xforms/FormToc.[Ch],
393 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
395 * src/insets/insetindex.[Ch]: GUI-independent
397 * src/frontends/xforms/FormIndex.[Ch],
398 * src/frontends/xforms/forms/form_index.fd: xforms implementation
401 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
403 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
404 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
406 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
408 * src/insets/insetref.C (Latex): rewrite so that there is now
409 question that a initialization is requested.
411 * src/insets/insetcommand.h: reenable the hide signal
413 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
415 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
416 fix handling of shortcuts (many bugs :)
417 (add_lastfiles): ditto.
419 * lib/ui/default.ui: fix a few shortcuts.
421 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
423 * Makefile.am: Fix ``rpmdist'' target to return the exit
424 status of the ``rpm'' command, instead of the last command in
425 the chain (the ``rm lyx.xpm'' command, which always returns
428 2000-08-02 Allan Rae <rae@lyx.org>
430 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
431 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
432 * src/frontends/xforms/FormToc.C (FormToc): ditto
434 * src/frontends/xforms/Makefile.am: A few forgotten files
436 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
437 Signals-not-copyable-problem Lars' started commenting out.
439 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
441 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
443 * src/insets/insetcommand.h: Signals is not copyable so anoter
444 scheme for automatic hiding of forms must be used.
446 * src/frontends/xforms/FormCitation.h: don't inerit from
447 noncopyable, FormCommand already does that.
448 * src/frontends/xforms/FormToc.h: ditto
449 * src/frontends/xforms/FormUrl.h: ditto
451 * src/frontends/xforms/FormCitation.C: add include <algorithm>
453 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
455 * src/insets/insetcommand.h (hide): new SigC::Signal0
456 (d-tor) new virtual destructor emits hide signal
458 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
459 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
461 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
462 LOF and LOT. Inset is now GUI-independent
464 * src/insets/insetloa.[Ch]: redundant
465 * src/insets/insetlof.[Ch]: ditto
466 * src/insets/insetlot.[Ch]: ditto
468 * src/frontends/xforms/forms/form_url.fd: tweaked!
469 * src/frontends/xforms/forms/form_citation.fd: ditto
471 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
472 dialogs dealing with InsetCommand insets
474 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
475 FormCommand base class
476 * src/frontends/xforms/FormUrl.[Ch]: ditto
478 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
480 * src/frontends/xforms/FormToc.[Ch]: ditto
482 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
483 passed a generic InsetCommand pointer
484 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
486 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
487 and modified InsetTOC class
488 * src/buffer.C: ditto
490 * forms/lyx.fd: strip out old FD_form_toc code
491 * src/lyx_gui_misc.C: ditto
492 * src/lyx_gui.C: ditto
493 * src/lyx_cb.C: ditto
494 * src/lyx.[Ch]: ditto
496 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
498 * src/support/utility.hpp: tr -d '\r'
500 2000-08-01 Juergen Vigna <jug@sad.it>
502 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
505 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
506 LFUN_TABULAR_FEATURES.
508 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
511 * src/insets/insettabular.C (getStatus): implemented helper function.
513 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
515 2000-07-31 Juergen Vigna <jug@sad.it>
517 * src/text.C (draw): fixed screen update problem for text-insets.
519 * src/text2.C (SetParagrpah): call an update of the inset-owner when
520 something changed probably this has to be added in various other
523 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
525 2000-07-31 Baruch Even <baruch.even@writeme.com>
527 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
528 templates to satisfy compaq cxx.
531 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
533 * src/support/translator.h (equal_1st_in_pair::operator()): take
534 const ref pair_type as arg.
535 (equal_2nd_in_pair::operator()): ditto
536 (Translator::~Translator): remove empty d-tor.
538 * src/graphics/GraphicsCache.C: move include config.h to top, also
539 put initialization of GraphicsCache::singleton here.
540 (~GraphicsCache): move here
541 (addFile): take const ref as arg
544 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
546 * src/BufferView2.C (insertLyXFile): change te with/without header
549 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
551 * src/frontends/xforms/FormGraphics.C (apply): add some
552 static_cast. Not very nice, but required by compaq cxx.
554 * src/frontends/xforms/RadioButtonGroup.h: include header
555 <utility> instead of <pair.h>
557 * src/insets/insetgraphicsParams.C: add using directive.
558 (readResize): change return type to void.
561 * src/lyxfunc.C (getStatus): add missing break for build-program
562 function; add test for Literate for export functions.
564 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
565 entries in Options menu.
567 2000-07-31 Baruch Even <baruch.even@writeme.com>
569 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
570 protect against auto-allocation; release icon when needed.
572 2000-07-31 Matej Cepl <CeplM@seznam.cz>
574 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
577 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
578 earlier czech.kmap), useful only for programming.
580 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
582 * src/frontends/xforms/FormCitation.h: fix conditioning around
585 2000-07-31 Juergen Vigna <jug@sad.it>
587 * src/frontends/xforms/FormTabular.C (local_update): changed
588 radio_linebreaks to radio_useparbox and added radio_useminipage.
590 * src/tabular.C: made support for using minipages/parboxes.
592 * src/bufferlist.C (QwriteAll): small fix for asking for save.
594 * src/insets/insetgraphics.C (draw): just draw the inset so that the
596 (descent): so the cursor is in the middle.
597 (width): bit smaller box.
599 * src/insets/insetgraphics.h: added display() function.
601 2000-07-31 Baruch Even <baruch.even@writeme.com>
603 * src/frontends/Dialogs.h: Added showGraphics signals.
605 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
606 xforms form definition of the graphics dialog.
608 * src/frontends/xforms/FormGraphics.h:
609 * src/frontends/xforms/FormGraphics.C: Added files, the
610 GUIndependent code of InsetGraphics
612 * src/insets/insetgraphics.h:
613 * src/insets/insetgraphics.C: Major writing to make it work.
615 * src/insets/insetgraphicsParams.h:
616 * src/insets/insetgraphicsParams.C: Added files, parameter passing
617 struct between InsetGraphics and GUI.
619 * src/LaTeXFeatures.h:
620 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
621 support for graphicx package.
623 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
624 for the graphics inset.
626 * src/support/translator.h: Added file, used in
627 InsetGraphicsParams. this is a template to translate between two
630 * src/frontends/xforms/RadioButtonGroup.h:
631 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
632 way to easily control a radio button group.
634 2000-07-28 Juergen Vigna <jug@sad.it>
636 * src/insets/insettabular.C (LocalDispatch):
637 (TabularFeatures): added support for lyx-functions of tabular features.
638 (cellstart): refixed this function after someone wrongly changed it.
641 * src/LyXAction.C (init): added support for tabular-features
643 2000-07-28 Allan Rae <rae@lyx.org>
645 * src/frontends/xforms/FormPreferences.C (build): Setup input return
646 checking. NOTE: It seems that pressing ESC to cancel the dialog also
647 triggers the callback for input checking. As a result we sometimes get
648 "LyX: This shouldn't happen..." printed to cerr.
649 (input): Started using status variable since I only free() on
650 destruction. Some input checking for paths and font sizes.
652 * src/frontends/xforms/FormPreferences.h: Use status to control
653 activation of Ok and Apply
655 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
656 callback. Also resized to stop segfaults with 0.88. The problem is
657 that xforms-0.88 requires the folder to be wide enough to fit all the
658 tabs. If it isn't it causes all sorts of problems.
660 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
662 * src/frontends/xforms/forms/README: Reflect reality.
664 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
665 * src/frontends/xforms/forms/makefile: ditto.
667 * src/commandtags.h: Get access to new Preferences dialog
668 * src/LyXAction.C: ditto
669 * src/lyxfunc.C: ditto
670 * lib/ui/default.ui: ditto
672 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
674 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
676 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
679 * src/frontends/xforms/form_url.[Ch]: added.
681 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
683 * src/insets/insetbib.h: fixed bug in previous commit
685 * src/frontends/xforms/FormUrl.h: ditto
687 * src/frontends/xforms/FormPrint.h: ditto
689 * src/frontends/xforms/FormPreferences.h: ditto
691 * src/frontends/xforms/FormCopyright.h: ditto
693 * src/frontends/xforms/FormCitation.C: ditto
695 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
696 private copyconstructor and private default contructor
698 * src/support/Makefile.am: add utility.hpp
700 * src/support/utility.hpp: new file from boost
702 * src/insets/insetbib.h: set owner in clone
704 * src/frontends/xforms/FormCitation.C: added missing include
707 * src/insets/form_url.[Ch]: removed
709 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
711 * development/lyx.spec.in
712 * Makefile.am: Fix buglet for LyX RPM generation resulting from
713 file/directory re-organization.
715 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
717 * src/insets/insetcommand.[Ch]: moved the string data and
718 associated manipulation methods into a new stand-alone class
719 InsetCommandParams. This class has two additional methods
720 getAsString() and setFromString() allowing the contents to be
721 moved around as a single string.
722 (addContents) method removed.
723 (setContents) method no longer virtual.
725 * src/buffer.C (readInset): made use of new InsetCitation,
726 InsetUrl constructors based on InsetCommandParams.
728 * src/commandtags.h: add LFUN_INSERT_URL
730 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
731 independent InsetUrl and use InsetCommandParams to extract
732 string info and create new Insets.
734 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
736 * src/frontends/xforms/FormCitation.C (apply): uses
739 * src/frontends/xforms/form_url.C
740 * src/frontends/xforms/form_url.h
741 * src/frontends/xforms/FormUrl.h
742 * src/frontends/xforms/FormUrl.C
743 * src/frontends/xforms/forms/form_url.fd: new files
745 * src/insets/insetcite.[Ch]: removed unused constructors.
747 * src/insets/insetinclude.[Ch]: no longer store filename
749 * src/insets/inseturl.[Ch]: GUI-independent.
751 2000-07-26 Juergen Vigna <jug@sad.it>
752 * renamed frontend from gtk to gnome as it is that what is realized
753 and did the necessary changes in the files.
755 2000-07-26 Marko Vendelin <markov@ioc.ee>
757 * configure.in: cleaning up gnome configuration scripts
759 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
761 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
762 shortcuts syndrom by redrawing them explicitely (a better solution
763 would be appreciated).
765 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
767 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
770 * src/lyx_cb.C (MenuExport): change html export to do the right
771 thing depending of the document type (instead of having
772 html-linuxdoc and html-docbook).
773 * src/lyxfunc.C (getStatus): update for html
774 * lib/ui/default.ui: simplify due to the above change.
775 * src/menus.C (ShowFileMenu): update too (in case we need it).
777 * src/MenuBackend.C (read): if a menu is defined twice, add the
778 new entries to the exiting one.
780 2000-07-26 Juergen Vigna <jug@sad.it>
782 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
784 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
785 and return a bool if it did actual save the file.
786 (AutoSave): don't autosave a unnamed doc.
788 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
789 check if this is an UNNAMED new file and react to it.
790 (newFile): set buffer to unnamed and change to not mark a new
791 buffer dirty if I didn't do anything with it.
793 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
795 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
797 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
798 friend as per Angus's patch posted to lyx-devel.
800 * src/ext_l10n.h: updated
802 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
803 gettext on the style string right before inserting them into the
806 * autogen.sh: add code to extract style strings form layout files,
809 * src/frontends/gtk/.cvsignore: add MAKEFILE
811 * src/MenuBackend.C (read): run the label strings through gettext
812 before storing them in the containers.
814 * src/ext_l10n.h: new file
816 * autogen.sh : generate the ext_l10n.h file here
818 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
820 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
823 * lib/ui/default.ui: fix a couple of typos.
825 * config/gnome/gtk.m4: added (and added to the list of files in
828 * src/insets/insetinclude.C (unique_id): fix when we are using
829 lyxstring instead of basic_string<>.
830 * src/insets/insettext.C (LocalDispatch): ditto.
831 * src/support/filetools.C: ditto.
833 * lib/configure.m4: create the ui/ directory if necessary.
835 * src/LyXView.[Ch] (updateToolbar): new method.
837 * src/BufferView_pimpl.C (buffer): update the toolbar when
838 opening/closing buffer.
840 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
842 * src/LyXAction.C (getActionName): enhance to return also the name
843 and options of pseudo-actions.
844 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
846 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
847 as an example of what is possible). Used in File->Build too (more
848 useful) and in the import/export menus (to mimick the complicated
849 handling of linuxdoc and friends). Try to update all the entries.
851 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
854 * src/MenuBackend.C (read): Parse the new OptItem tag.
856 * src/MenuBackend.h: Add a new optional_ data member (used if the
857 entry should be omitted when the lyxfunc is disabled).
859 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
860 function, used as a shortcut.
861 (create_submenu): align correctly the shortcuts on the widest
864 * src/MenuBackend.h: MenuItem.label() only returns the label of
865 the menu without shortcut; new method shortcut().
867 2000-07-14 Marko Vendelin <markov@ioc.ee>
869 * src/frontends/gtk/Dialogs.C:
870 * src/frontends/gtk/FormCopyright.C:
871 * src/frontends/gtk/FormCopyright.h:
872 * src/frontends/gtk/Makefile.am: added these source-files for the
873 Gtk/Gnome support of the Copyright-Dialog.
875 * src/main.C: added Gnome::Main initialization if using
876 Gtk/Gnome frontend-GUI.
878 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
880 * config/gnome/aclocal-include.m4
881 * config/gnome/compiler-flags.m4
882 * config/gnome/curses.m4
883 * config/gnome/gnome--.m4
884 * config/gnome/gnome-bonobo-check.m4
885 * config/gnome/gnome-common.m4
886 * config/gnome/gnome-fileutils.m4
887 * config/gnome/gnome-ghttp-check.m4
888 * config/gnome/gnome-gnorba-check.m4
889 * config/gnome/gnome-guile-checks.m4
890 * config/gnome/gnome-libgtop-check.m4
891 * config/gnome/gnome-objc-checks.m4
892 * config/gnome/gnome-orbit-check.m4
893 * config/gnome/gnome-print-check.m4
894 * config/gnome/gnome-pthread-check.m4
895 * config/gnome/gnome-support.m4
896 * config/gnome/gnome-undelfs.m4
897 * config/gnome/gnome-vfs.m4
898 * config/gnome/gnome-x-checks.m4
899 * config/gnome/gnome-xml-check.m4
900 * config/gnome/gnome.m4
901 * config/gnome/gperf-check.m4
902 * config/gnome/gtk--.m4
903 * config/gnome/linger.m4
904 * config/gnome/need-declaration.m4: added configuration scripts
905 for Gtk/Gnome frontend-GUI
907 * configure.in: added support for the --with-frontend=gtk option
909 * autogen.sh: added config/gnome/* to list of config-files
911 * acconfig.h: added define for GTKGUI-support
913 * config/lyxinclude.m4: added --with-frontend[=value] option value
914 for Gtk/Gnome frontend-GUI support.
916 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
918 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
922 * src/paragraph.C (GetChar): remove non-const version
924 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
927 * src/lyx_main.C (init): if "preferences" exist, read that instead
929 (ReadRcFile): return bool if the file could be read ok.
930 (ReadUIFile): add a check to see if lex file is set ok.
932 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
933 bastring can be used instead of lyxstring (still uses the old code
934 if std::string is good enough or if lyxstring is used.)
936 * src/encoding.C: make the arrays static, move ininle functions
938 * src/encoding.h: from here.
940 * src/buffer.C: have last_isnet_read as a file scope variable for now.
941 (parseSingleLyXformat2Token): move inset parsing to separate method
942 (readInset): new private method
944 * src/Variables.h: remove virtual from get().
946 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
947 access to NEW_INSETS and NEW_TABULAR
949 * src/MenuBackend.h: remove superfluous forward declaration of
950 MenuItem. Add documentations tags "///", remove empty MenuItem
951 destructor, remove private default contructor.
953 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
955 (read): more string mlabel and mname to where they are used
956 (read): remove unused variables mlabel and mname
957 (defaults): unconditional clear, make menusetup take advantage of
958 add returning Menu &.
960 * src/LyXView.h: define NEW_MENUBAR as default
962 * src/LyXAction.C: include lyxparagraph.h temporary to get access
963 to NEW_INSETS and NEW_TABULAR.
964 (init): commetn out some funcs that is obsolete when NEW_INSETS is
965 defined. Change some of the "xxxx-inset-insert" functions names to
968 * several files: more enahncements to NEW_INSETS and the resulting
971 * lib/lyxrc.example (\date_insert_format): move to misc section
973 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
974 bastring and use AC_CACHE_CHECK.
975 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
976 the system have the newest methods. uses AC_CACHE_CHECK
977 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
978 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
979 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
981 * configure.in: add LYX_CXX_GOOD_STD_STRING
983 * acinclude.m4: recreated
985 2000-07-24 Amir Karger
987 * README: add Hebrew, Arabic kmaps
990 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
992 * src/buffer.C (writeFileAscii): Define actcell as an int instead
995 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
997 * Lot of files: add pragma interface/implementation.
999 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
1001 * lib/ui/default.ui: new file (ans new directory). Contains the
1002 default menu and toolbar.
1004 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
1005 global space. Toolbars are now read (as menus) in ui files.
1007 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
1009 * src/lyxfunc.C (getStatus): do not exit immediately if a command
1010 is disabled because the document is read-only. We want to have the
1011 toggle state of the function anyway.
1012 (getStatus): add code for LFUN_VC* functions (mimicking what is
1013 done in old-style menus)
1015 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
1016 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
1018 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
1019 * src/BufferView_pimpl.C: ditto.
1020 * src/lyxfunc.C: ditto.
1022 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
1023 default). This replaces old-style menus by new ones.
1025 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
1026 MenuItem. Contain the data structure of a menu.
1028 * src/insets/insettext.C: use LyXView::setLayout instead of
1029 accessing directly the toolbar combox.
1030 * src/lyxfunc.C (Dispatch): ditto.
1032 * src/LyXView.C (setLayout): new method, which just calls
1033 Toolbar::setLayout().
1034 (updateLayoutChoice): move part of this method in Toolbar.
1036 * src/toolbar.[Ch]: removed.
1038 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
1039 implementation the toolbar.
1041 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
1042 the toolbar. It might make sense to merge it with ToolbarDefaults
1044 (setLayout): new function.
1045 (updateLayoutList): ditto.
1046 (openLayoutList): ditto.
1048 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
1049 xforms implementation of the toolbar.
1050 (get_toolbar_func): comment out, since I do not
1051 know what it is good for.
1053 * src/ToolbarDefaults.h: Add the ItemType enum.
1055 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
1056 for a list of allocated C strings. Used in Menubar xforms
1057 implementation to avoid memory leaks.
1059 * src/support/lstrings.[Ch] (uppercase): new version taking and
1063 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
1064 * lib/bind/emacs.bind: ditto.
1066 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
1068 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
1069 forward decl of LyXView.
1071 * src/toolbar.C (toolbarItem): moved from toolbar.h
1072 (toolbarItem::clean): ditto
1073 (toolbarItem::~toolbarItem): ditto
1074 (toolbarItem::operator): ditto
1076 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
1078 * src/paragraph.h: control the NEW_TABULAR define from here
1080 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
1081 USE_TABULAR_INSETS to NEW_TABULAR
1083 * src/ToolbarDefaults.C: add include "lyxlex.h"
1085 * files using the old table/tabular: use NEW_TABULAR to control
1086 compilation of old tabular stuff.
1088 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
1091 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
1092 planemet in reading of old style floats, fix the \end_deeper
1093 problem when reading old style floats.
1095 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1097 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
1099 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
1101 * lib/bind/sciword.bind: updated.
1103 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1105 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
1106 layout write problem
1108 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1110 * src/Makefile.am (INCLUDES): remove image directory from include
1113 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
1114 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
1116 * src/LyXView.C (create_form_form_main): read the application icon
1119 * lib/images/*.xpm: change the icons to use transparent color for
1122 * src/toolbar.C (update): change the color of the button when it
1125 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1127 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
1128 setting explicitely the minibuffer.
1129 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
1131 * src/LyXView.C (showState): new function. Shows font information
1132 in minibuffer and update toolbar state.
1133 (LyXView): call Toolbar::update after creating the
1136 * src/toolbar.C: change toollist to be a vector instead of a
1138 (BubbleTimerCB): get help string directly from the callback
1139 argument of the corresponding icon (which is the action)
1140 (set): remove unnecessary ugliness.
1141 (update): new function. update the icons (depressed, disabled)
1142 depending of the status of the corresponding action.
1144 * src/toolbar.h: remove help in toolbarItem
1146 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
1148 * src/Painter.C (text): Added code for using symbol glyphs from
1149 iso10646 fonts. Currently diabled.
1151 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
1154 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
1155 magyar,turkish and usorbian.
1157 * src/paragraph.C (isMultiLingual): Made more efficient.
1159 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
1162 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
1163 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
1164 Also changed the prototype to "bool math_insert_greek(char)".
1166 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1168 * lots of files: apply the NEW_INSETS on all code that will not be
1169 needed when we move to use the new insets. Enable the define in
1170 lyxparagrah.h to try it.
1172 * src/insets/insettabular.C (cellstart): change to be a static
1174 (InsetTabular): initialize buffer in the initializer list.
1176 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
1178 * src/frontends/xforms/FormPrint.[Ch] : moved #include
1179 form_print.h out of the header file. Replaced with forward
1180 declarations of the relevant struct.
1182 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
1185 * src/commandtags.h: do not include "debug.h" which does not
1186 belong there. #include it in some other places because of this
1189 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1191 * src/insets/insetcaption.C: add a couple "using" directives.
1193 * src/toolbar.C (add): get the help text directly from lyxaction.
1195 (setPixmap): new function. Loads from disk and sets a pixmap on a
1196 botton; the name of the pixmap file is derived from the command
1199 * src/toolbar.h: remove members isBitmap and pixmap from
1202 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
1203 * lib/images/: move many files from images/banner.xpm.
1205 * src/lyx_gui.C (create_forms): read banner pixmap from file.
1207 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
1208 * src/toolbar.C: ditto.
1209 * configure.in: ditto.
1210 * INSTALL: document.
1212 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
1213 the spellchecker popup is closed from the WM.
1215 2000-07-19 Juergen Vigna <jug@sad.it>
1217 * src/insets/insetfloat.C (Write): small fix because we use the
1218 insetname for the type now!
1220 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
1222 * src/frontends/xforms/forms/form_citation.fd: object sizes are
1225 * src/frontends/Dialogs.h: removed hideCitation signal
1227 * src/insets/insetcite.h: added hide signal
1229 * src/insets/insetcite.C (~InsetCitation): emits new signal
1230 (getScreenLabel): "intelligent" label should now fit on the screen!
1232 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
1234 * src/frontends/xforms/FormCitation.C (showInset): connects
1235 hide() to the inset's hide signal
1236 (show): modified to use fl_set_object_position rather than
1237 fl_set_object_geometry wherever possible
1239 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1241 * src/insets/lyxinset.h: add caption code
1243 * src/insets/insetfloat.C (type): new method
1245 * src/insets/insetcaption.C (Write): new method
1247 (LyxCode): new method
1249 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
1250 to get it right together with using the FloatList.
1252 * src/commandtags.h: add LFUN_INSET_CAPTION
1253 * src/lyxfunc.C (Dispatch): handle it
1255 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
1258 * src/Variables.[Ch]: make expand take a const reference, remove
1259 the destructor, some whitespace changes.
1261 * src/LyXAction.C (init): add caption-inset-insert
1263 * src/FloatList.C (FloatList): update the default floats a bit.
1265 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1267 * src/Variables.[Ch]: new files. Intended to be used for language
1268 specific strings (like \chaptername) and filename substitution in
1271 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
1273 * lib/kbd/american.kmap: update
1275 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
1277 * src/bufferparams.[Ch]: remove member allowAccents.
1279 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
1281 * src/LaTeXLog.C: use the log_form.h header.
1282 * src/lyx_gui.C: ditto.
1283 * src/lyx_gui_misc.C: ditto.
1284 * src/lyxvc.h: ditto.
1286 * forms/log_form.fd: new file, created from latexoptions.fd. I
1287 kept the log popup and nuked the options form.
1289 * src/{la,}texoptions.[Ch]: removed.
1290 * src/lyx_cb.C (LaTeXOptions): ditto
1292 * src/lyx_gui.C (create_forms): do not handle the
1293 fd_latex_options form.
1295 2000-07-18 Juergen Vigna <jug@sad.it>
1297 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
1298 name of the inset so that it can be requested outside (text2.C).
1300 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
1303 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1305 * src/mathed/formula.h (ConvertFont): constify
1307 * src/mathed/formula.C (Read): add warning if \end_inset is not
1308 found on expected place.
1310 * src/insets/lyxinset.h (ConvertFont): consify
1312 * src/insets/insetquotes.C (ConvertFont): constify
1313 * src/insets/insetquotes.h: ditto
1315 * src/insets/insetinfo.h: add labelfont
1317 * src/insets/insetinfo.C (InsetInfo): set the labelfont
1318 (ascent): use labelfont
1322 (Write): make .lyx file a bit nicer
1324 * src/insets/insetfloat.C (Write): simplify somewhat...
1325 (Read): add warning if arg is not found
1327 * src/insets/insetcollapsable.C: add using std::max
1328 (Read): move string token and add warning in arg is not found
1329 (draw): use std::max to get the right ty
1330 (getMaxWidth): simplify by using std::max
1332 * src/insets/insetsection.h: new file
1333 * src/insets/insetsection.C: new file
1334 * src/insets/insetcaption.h: new file
1335 * src/insets/insetcaption.C: new file
1337 * src/insets/inset.C (ConvertFont): constify signature
1339 * src/insets/Makefile.am (libinsets_la_SOURCES): add
1340 insetcaption.[Ch] and insetsection.[Ch]
1342 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
1343 uses to use LABEL_COUNTER_CHAPTER instead.
1344 * src/text2.C (SetCounter): here
1346 * src/counters.h: new file
1347 * src/counters.C: new file
1348 * src/Sectioning.h: new file
1349 * src/Sectioning.C: new file
1351 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
1353 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1355 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
1358 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
1361 2000-07-17 Juergen Vigna <jug@sad.it>
1363 * src/tabular.C (Validate): check if array-package is needed.
1364 (SetVAlignment): added support for vertical alignment.
1365 (SetLTFoot): better support for longtable header/footers
1366 (Latex): modified to support added features.
1368 * src/LaTeXFeatures.[Ch]: added array-package.
1370 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
1372 * src/lyx_gui.C (LyXGUI): make sure that the height is large
1375 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
1377 * configure.in: do not forget to put a space after -isystem.
1379 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
1381 * lib/kbd/arabic.kmap: a few fixes.
1383 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1385 * some whitespace chagnes to a number of files.
1387 * src/support/DebugStream.h: change to make it easier for
1388 doc++ to parse correctly.
1389 * src/support/lyxstring.h: ditto
1391 * src/mathed/math_utils.C (compara): change to have only one
1393 (MathedLookupBOP): change because of the above.
1395 * src/mathed/math_delim.C (math_deco_compare): change to have only
1397 (search_deco): change becasue of the above.
1399 * src/insets/insettabular.C (DrawCellSelection): use std::swap
1400 instead of manually coded one.
1402 * src/insets/insetquotes.C (Read): read the \end_inset too
1404 * src/insets/insetlatex.h: remove file
1405 * src/insets/insetlatex.C: remove file
1407 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
1409 (InsetPrintIndex): remove destructor
1411 * src/insets/insetinclude.h: remove default constructor
1413 * src/insets/insetfloat.C: work to make it work better
1415 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
1417 * src/insets/insetcite.h (InsetCitation): remove default constructor
1419 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
1421 * src/text.C (GetColumnNearX): comment out some currently unused code.
1423 * src/paragraph.C (writeFile): move some initializations closer to
1425 (CutIntoMinibuffer): small change to use new matchIT operator
1429 (InsertInset): ditto
1432 (InsetIterator): ditto
1433 (Erase): small change to use new matchFT operator
1435 (GetFontSettings): ditto
1436 (HighestFontInRange): ditto
1439 * src/lyxparagraph.h: some chars changed to value_type
1440 (matchIT): because of some stronger checking (perhaps too strong)
1441 in SGI STL, the two operator() unified to one.
1444 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
1446 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
1447 the last inset read added
1448 (parseSingleLyXformat2Token): some more (future) compability code added
1449 (parseSingleLyXformat2Token): warning about solitary \end_inset added
1450 (parseSingleLyXformat2Token): set last_inset_read
1451 (parseSingleLyXformat2Token): more code to read new "Float" correctly
1452 (parseSingleLyXformat2Token): don't double intializw string next_token
1454 * src/TextCache.C (text_fits::operator()): add const's to the signature
1455 (has_buffer::operator()): ditto
1457 * src/Floating.h: add some comments on the class
1459 * src/FloatList.[Ch] (typeExist): new method
1462 * src/BackStack.h: added default constructor, wanted by Gcc.
1464 2000-07-14 Juergen Vigna <jug@sad.it>
1466 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
1468 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
1470 * src/insets/insettabular.C (resizeLyXText): need this to be able to
1471 do a redraw when the window is resized!
1472 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
1474 * src/insets/insettext.C (resizeLyXText): added function to correctly
1475 being able to resize the LyXWindow.
1477 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
1479 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
1481 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
1482 crashes when closing dialog to a deleted inset.
1484 * src/insets/insetcite.[Ch] (Edit) : the return of this former
1485 method! Now similar to other insets.
1487 2000-07-13 Juergen Vigna <jug@sad.it>
1489 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
1491 * lib/examples/Literate.lyx: small patch!
1493 * src/insets/insetbib.C (Read): added this function because of wrong
1494 Write (without [begin|end]_inset).
1496 2000-07-11 Juergen Vigna <jug@sad.it>
1498 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
1499 as the insertInset could not be good!
1501 * src/screen.C (ToggleSelection): fixed toggle selection bug as
1502 the bool param should not be last.
1504 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1506 * sigc++/configure.in: fix bug in threading-related code (Yes, I
1507 did submit that to Karl).
1509 * configure.in: use -isystem instead of -I for X headers. This
1510 fixes a problem on solaris with a recent gcc;
1511 put the front-end code after the X detection code;
1512 configure in sigc++ before lib/
1514 * src/lyx_main.C (commandLineHelp): remove -display from command
1517 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
1519 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
1520 Also put in Makefile rules for building the ``listerrors''
1521 program for parsing errors from literate programs written in LyX.
1523 * lib/build-listerrors: Added small shell script as part of compile
1524 process. This builds a working ``listerrors'' binary if noweb is
1525 installed and either 1) the VNC X server is installed on the machine,
1526 or 2) the user is compiling from within a GUI. The existence of a GUI
1527 is necessary to use the ``lyx --export'' feature for now. This
1528 hack can be removed once ``lyx --export'' no longer requires a GUI to
1531 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
1533 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
1534 now passed back correctly from gcc and placed "under" error
1535 buttons in a Literate LyX source.
1537 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
1539 * src/text.C (GetColumnNearX): Better behavior when a RTL
1540 paragraph is ended by LTR text.
1542 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
1545 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
1547 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
1548 true when clipboard is empty.
1550 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
1552 * text.C (Backspace): Prevent rebreaking of a row if it is the last
1553 row of the paragraph.
1554 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
1555 to prevent calculation of bidi tables
1557 2000-07-07 Juergen Vigna <jug@sad.it>
1559 * src/screen.C (ToggleSelection): added y_offset and x_offset
1562 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
1565 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
1567 * src/insets/insettext.C: fixed Layout-Display!
1569 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1571 * configure.in: add check for strings.h header.
1573 * src/spellchecker.C: include <strings.h> in order to have a
1574 definition for bzero().
1576 2000-07-07 Juergen Vigna <jug@sad.it>
1578 * src/insets/insettext.C (draw): set the status of the bv->text to
1579 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
1581 * src/screen.C (DrawOneRow):
1582 (DrawFromTo): redraw the actual row if something has changed in it
1585 * src/text.C (draw): call an update of the toplevel-inset if something
1586 has changed inside while drawing.
1588 * src/lyxtext.h: added CHANGED_IN_DRAW status.
1590 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
1592 * src/insets/insetbib.[Ch] (callback) new method, moving callback
1593 processing inside class.
1595 * src/insets/insetindex.[Ch] (callback) new method, moving callback
1596 processing inside class.
1598 * src/insets/insetindex.h new struct Holder, consistent with other
1601 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
1602 citation dialog from main code and placed it in src/frontends/xforms.
1603 Dialog launched through signals instead of callbacks
1605 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
1607 * lyx.man: update the options description.
1609 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
1611 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
1612 handle neg values, set min width to 590, add doc about -display
1614 2000-07-05 Juergen Vigna <jug@sad.it>
1616 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
1617 calls to BufferView *.
1619 * src/insets/insettext.C (checkAndActivateInset): small fix non
1620 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
1622 * src/insets/insetcommand.C (Read): Fixed as insets should read till
1623 their \end_inset token!
1625 2000-07-04 edscott <edscott@imp.mx>
1627 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
1628 lib/lyxrc.example: added option \wheel_jump
1630 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
1632 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
1633 remove support for -width,-height,-xpos and -ypos.
1635 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
1637 * src/encoding.[Ch]: New files.
1639 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
1640 (text): Call to the underline() method only when needed.
1642 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
1644 * src/buffer.C (makeLaTeXFile): Compute automatically the input
1645 encoding(s) for the document.
1647 * src/bufferparams.C (BufferParams): Changed default value of
1650 * src/language.C (newLang): Removed.
1651 (items[]): Added encoding information for all defined languages.
1653 * src/lyx_gui.C (create_forms): Added "auto" option to the input
1654 encoding choice button.
1656 * src/lyxrc.h (font_norm_type): New member variable.
1657 (set_font_norm_type): New method.
1659 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
1660 paragraphs with different encodings.
1662 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
1663 (TransformChar): Changed to work correctly with Arabic points.
1664 (draw): Added support for drawing Arabic points.
1665 (draw): Removed code for drawing underbars (this is done by
1668 * src/support/textutils.h (IsPrintableNonspace): New function.
1670 * src/BufferView_pimpl.h: Added "using SigC::Object".
1671 * src/LyXView.h: ditto.
1673 * src/insets/insetinclude.h (include_label): Changed to mutable.
1675 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
1677 * src/mathed/math_iter.h: remove empty destructor
1679 * src/mathed/math_cursor.h: remove empty destructor
1681 * src/insets/lyxinset.h: add THEOREM_CODE
1683 * src/insets/insettheorem.[Ch]: new files
1685 * src/insets/insetminipage.C: (InsertInset): remove
1687 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
1689 (InsertInset): remove
1691 * src/insets/insetlist.C: (InsertList): remove
1693 * src/insets/insetfootlike.[Ch]: new files
1695 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
1698 (InsertInset): ditto
1700 * src/insets/insetert.C: remove include Painter.h, reindent
1701 (InsertInset): move to header
1703 * src/insets/insetcollapsable.h: remove explicit from default
1704 contructor, remove empty destructor, add InsertInset
1706 * src/insets/insetcollapsable.C (InsertInset): new func
1708 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
1710 * src/vspace.h: add explicit to constructor
1712 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
1713 \textcompwordmark, please test this.
1715 * src/lyxrc.C: set ascii_linelen to 65 by default
1717 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
1719 * src/commandtags.h: add LFUN_INSET_THEOREM
1721 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
1722 (makeLinuxDocFile): remove _some_ of the nice logic
1723 (makeDocBookFile): ditto
1725 * src/Painter.[Ch]: (~Painter): removed
1727 * src/LyXAction.C (init): entry for insettheorem added
1729 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
1731 (deplog): code to detect files generated by LaTeX, needs testing
1734 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1736 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
1738 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1740 * src/LaTeX.C (deplog): Add a check for files that are going to be
1741 created by the first latex run, part of the project to remove the
1744 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
1745 contents to the extension list.
1747 2000-07-04 Juergen Vigna <jug@sad.it>
1749 * src/text.C (NextBreakPoint): added support for needFullRow()
1751 * src/insets/lyxinset.h: added needFullRow()
1753 * src/insets/insetcollapsable.C: redone now this uses a text-inset
1756 * src/insets/insettext.C: lots of changes for update!
1758 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
1760 * src/LaTeXFeatures.h: add a missing std:: qualifier.
1762 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
1764 * src/insets/insetinclude.C (InsetInclude): fixed
1765 initialization of include_label.
1766 (unique_id): now returns a string.
1768 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
1770 * src/LaTeXFeatures.h: new member IncludedFiles, for
1771 a map of key, included file name.
1773 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
1774 with the included files for inclusion in SGML preamble,
1775 i. e., linuxdoc and docbook.
1778 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
1779 nice (is the generated linuxdoc code to be exported?), that
1780 allows to remove column, and only_body that will be true for
1781 slave documents. Insets are allowed inside SGML font type.
1782 New handling of the SGML preamble for included files.
1783 (makeDocBookFile): the same for docbook.
1785 * src/insets/insetinclude.h:
1786 * src/insets/insetinclude.C (Validate): keeps a list of included files.
1788 (DocBook): new export methods.
1790 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
1791 and makeDocBookFile.
1793 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
1794 formats to export with command line argument -x.
1796 2000-06-29 Juergen Vigna <jug@sad.it>
1798 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
1799 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
1801 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
1802 region could already been cleared by an inset!
1804 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
1806 * src/BufferView_pimpl.h: remove member variables lyx_focus and
1809 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
1811 (cursorToggle): remove special handling of lyx focus.
1813 2000-06-28 Juergen Vigna <jug@sad.it>
1815 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
1818 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1820 * src/insets/insetindex.C (Edit): add a callback when popup is
1823 * src/insets/insettext.C (LocalDispatch):
1824 * src/insets/insetmarginal.h:
1825 * src/insets/insetlist.h:
1826 * src/insets/insetfoot.h:
1827 * src/insets/insetfloat.h:
1828 * src/insets/insetert.h: add a missing std:: qualifier.
1830 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
1832 * src/support/lyxsum.C (sum): '\0' teminate file read when using
1835 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
1837 * src/insets/insettext.C (Read): remove tmptok unused variable
1838 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
1839 (InsertInset): change for new InsetInset code
1841 * src/insets/insettext.h: add TEXT inline method
1843 * src/insets/insettext.C: remove TEXT macro
1845 * src/insets/insetmarginal.C (Write): new method
1846 (Latex): change output slightly
1848 * src/insets/insetfoot.C (Write): new method
1849 (Latex): change output slightly (don't use endl when no need)
1851 * src/insets/insetert.C (Write): new method
1853 * src/insets/insetcollapsable.h: make button_length, button_top_y
1854 and button_bottm_y protected.
1856 * src/insets/insetcollapsable.C (Write): simplify code by using
1857 tostr. Also do not output the float name, the children class
1858 should to that to get control over own arguments
1860 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
1861 src/insets/insetminipage.[Ch]:
1864 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
1866 * src/lyxfunc.C (Dispatch): cases for new insets/commands
1868 * src/Makefile.am (lyx_SOURCES): add the new files
1870 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
1871 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
1872 * src/commandtags.h: ditto
1874 * src/LaTeXFeatures.h: add a std::set of used floattypes
1876 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
1878 * src/FloatList.[Ch] src/Floating.h: new files
1880 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
1882 * src/lyx_cb.C (TableApplyCB): ditto
1884 * src/text2.C: ditto
1885 * src/buffer.C (SimpleLinuxDocOnePar): ditto
1886 (parseSingleLyXformat2Token): ditto + add code for
1887 backwards compability for old float styles + add code for new insets
1889 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
1891 (InsertInset(size_type, Inset *, LyXFont)): new method
1892 (InsetChar(size_type, char)): changed to use the other InsetChar
1893 with a LyXFont(ALL_INHERIT).
1894 (InsetInset(size_type, Inset*)): changed to use InsetChar to
1895 insert the META_INSET.
1897 * sigc++/thread.cc (Privete<int>::operator int&): move definition
1899 * sigc++/thread.h (Threads): from here
1901 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
1902 definition out of line
1903 * sigc++/scope.h: from here
1905 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1907 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
1908 is specified (adapted from a patch from edscott <edscott@imp.mx>).
1910 * Makefile.am (bindist): new target.
1912 * INSTALL: add instructions for doing a binary distribution.
1914 * development/tools/README.bin.example: update a bit.
1916 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
1919 * lib/lyxrc.example: new lyxrc tag \set_color.
1921 * src/lyxfunc.C (Dispatch):
1922 * src/commandtags.h:
1923 * src/LyXAction.C: new lyxfunc "set-color".
1925 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
1926 and an x11name given as strings.
1928 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
1929 cache when a color is changed.
1931 2000-06-26 Juergen Vigna <jug@sad.it>
1933 * src/lyxrow.C (width): added this functions and variable.
1935 * src/insets/insetcite.C (create_form_citation_form): some Gravity
1938 * src/text.C (SetHeightOfRow): fixed calcualting of width.
1940 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1942 * images/undo_bw.xpm: new icon.
1943 * images/redo_bw.xpm: ditto.
1945 * configure.in (INSTALL_SCRIPT): change value to
1946 ${INSTALL} to avoid failures of install-script target.
1947 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
1949 * src/BufferView.h: add a magic "friend" declaration to please
1952 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
1954 * forms/cite.fd: modified to allow resizing without messing
1957 * src/insetcite.C: Uses code from cite.fd almost without
1959 User can now resize dialog in the x-direction.
1960 Resizing the dialog in the y-direction is prevented, as the
1961 code does this intelligently already.
1963 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1965 * INSTALL: remove obsolete entry in "problems" section.
1967 * lib/examples/sl_*.lyx: update of the slovenian examples.
1969 * src/support/FileInfo.[Ch] (getBlockSize): remove.
1971 2000-06-23 Juergen Vigna <jug@sad.it>
1973 * src/lyxtext.h: added a 'cleared' flag to draw() function.
1975 * src/buffer.C (resize): delete the LyXText of textinsets.
1977 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
1979 * src/insets/lyxinset.h: added another parameter 'cleared' to
1980 the draw() function.
1982 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
1983 unlocking inset in inset.
1985 2000-06-22 Juergen Vigna <jug@sad.it>
1987 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
1988 of insets and moved first to LyXText.
1990 * src/mathed/formulamacro.[Ch]:
1991 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
1993 2000-06-21 Juergen Vigna <jug@sad.it>
1995 * src/text.C (GetVisibleRow): look if I should clear the area or not
1996 using Inset::doClearArea() function.
1998 * src/insets/lyxinset.h: added doClearArea() function and
1999 modified draw(Painter &, ...) to draw(BufferView *, ...)
2001 * src/text2.C (UpdateInset): return bool insted of int
2003 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
2005 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
2006 combox in the character popup
2008 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
2009 BufferParams const & params
2011 2000-06-20 Juergen Vigna <jug@sad.it>
2013 * src/insets/insettext.C (SetParagraphData): set insetowner on
2016 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2018 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
2019 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
2021 (form_main_): remove
2023 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
2024 (create_form_form_main): remove FD_form_main stuff, connect to
2025 autosave_timeout signal
2027 * src/LyXView.[Ch] (getMainForm): remove
2028 (UpdateTimerCB): remove
2029 * src/BufferView_pimpl.h: inherit from SigC::Object
2031 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
2032 signal instead of callback
2034 * src/BufferView.[Ch] (cursorToggleCB): remove
2036 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2038 * src/BufferView_pimpl.C: changes because of the one below
2040 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
2041 instead of storing a pointer to a LyXText.
2043 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
2045 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
2047 * src/lyxparagraph.h
2049 * src/paragraph.C: Changed fontlist to a sorted vector.
2051 2000-06-19 Juergen Vigna <jug@sad.it>
2053 * src/BufferView.h: added screen() function.
2055 * src/insets/insettext.C (LocalDispatch): some selection code
2058 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
2060 * src/insets/insettext.C (SetParagraphData):
2062 (InsetText): fixes for multiple paragraphs.
2064 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
2066 * development/lyx.spec.in: Call configure with ``--without-warnings''
2067 to work around a bug with the Makefiles when doing ``make lyxrpm''.
2068 This should be fine, however, since we generally don't want to be
2069 verbose when making an RPM.
2071 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
2073 * lib/scripts/fig2pstex.py: New file
2075 2000-06-16 Juergen Vigna <jug@sad.it>
2077 * src/insets/insettabular.C (UpdateLocal):
2078 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
2079 (LocalDispatch): Changed all functions to use LyXText.
2081 2000-06-15 Juergen Vigna <jug@sad.it>
2083 * src/text.C (SetHeightOfRow): call inset::update before requesting
2086 * src/insets/insettext.C (update):
2087 * src/insets/insettabular.C (update): added implementation
2089 * src/insets/lyxinset.h: added update function
2091 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2093 * src/text.C (SelectNextWord): protect against null pointers with
2094 old-style string streams. (fix from Paul Theo Gonciari
2097 * src/cite.[Ch]: remove erroneous files.
2099 * lib/configure.m4: update the list of created directories.
2101 * src/lyxrow.C: include <config.h>
2102 * src/lyxcursor.C: ditto.
2104 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2106 * lib/examples/decimal.lyx: new example file from Mike.
2108 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
2109 to find template definitions (from Dekel)
2111 * src/frontends/.cvsignore: add a few things.
2113 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
2115 * src/Timeout.C (TimeOut): remove default argument.
2117 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
2120 * src/insets/ExternalTemplate.C: add a "using" directive.
2122 * src/lyx_main.h: remove the act_ struct, which seems unused
2125 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2127 * LyX Developers Meeting: All files changed, due to random C++ (by
2128 coincidence) code generator script.
2130 - external inset (cool!)
2131 - initial online editing of preferences
2132 - insettabular breaks insettext(s contents)
2134 - some DocBook fixes
2135 - example files update
2136 - other cool stuff, create a diff and look for yourself.
2138 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
2140 * src/insets/insettext.C (computeTextRows): if the maxWidth is
2141 -1 this is a non-line-breaking textinset.
2143 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
2144 if there is no width set.
2146 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
2148 * Lots of files: Merged the dialogbase branch.
2150 2000-06-09 Allan Rae <rae@lyx.org>
2152 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
2153 and the Dispatch methods that used it.
2155 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
2156 access to functions formerly kept in Dispatch.
2158 2000-05-19 Allan Rae <rae@lyx.org>
2160 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
2161 made to_page and count_copies integers again. from_page remains a
2162 string however because I want to allow entry of a print range like
2163 "1,4,22-25" using this field.
2165 * src/LyXAction.C: added action info and commands for buffer-print-xtl
2166 and printer-params-get. These aren't useful from the minibuffer but
2167 could be used by a script/LyXServer app provided it passes a suitable
2168 auto_mem_buffer. I guess I should take a look at how the LyXServer
2169 works and make it support xtl buffers.
2171 * sigc++/: updated to libsigc++-1.0.1
2173 * src/xtl/: updated to xtl-1.3.pl.11
2175 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
2176 those changes done to the files in src/ are actually recreated when
2177 they get regenerated. Please don't ever accept a patch that changes a
2178 dialog unless that patch includes the changes to the corresponding *.fd
2181 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
2182 stringOnlyContains, renamed it and generalised it.
2184 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
2185 branch. Removed the remaining old form_print code.
2187 2000-04-26 Allan Rae <rae@lyx.org>
2189 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
2190 trap I was trying to fix with the ID: fields in src/xtl/ :-)
2192 2000-04-25 Allan Rae <rae@lyx.org>
2194 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
2195 against a base of xtl-1.3.pl.4
2197 * development/tools/lxtl.sh: fixed a couple of silly typos and now
2198 filter the Id: entries so they still show the xtl version number
2201 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
2202 into the src/xtl code. Patch still pending with José (XTL)
2204 2000-04-24 Allan Rae <rae@lyx.org>
2206 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
2207 both more generic and much safer. Use the new template functions.
2208 * src/buffer.[Ch] (Dispatch): ditto.
2210 * src/frontends/xforms/FormPrint.C (update): Use new template functions
2211 and mem buffer more intelligently. Also a little general cleanup.
2214 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
2215 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
2216 * src/xtl/Makefile.am: ditto.
2217 * src/xtl/.cvsignore: ditto.
2218 * src/Makefile.am: ditto.
2220 * src/PrinterParams.h: Removed the macros member functions. Added a
2221 testInvariant member function. A bit of tidying up and commenting.
2222 Included Angus's idea for fixing operation with egcs-1.1.2.
2224 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
2225 cool expansion of XTL's mem_buffer to support automatic memory
2226 management within the buffer itself. Removed the various macros and
2227 replaced them with template functions that use either auto_mem_buffer
2228 or mem_buffer depending on a #define. The mem_buffer support will
2229 disappear as soon as the auto_mem_buffer is confirmed to be good on
2230 other platforms/compilers. That is, it's there so you've got something
2233 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
2234 effectively forked XTL. However I expect José will include my code
2235 into the next major release. Also fixed a memory leak.
2236 * src/xtl/text.h: ditto.
2237 * src/xtl/xdr.h: ditto.
2238 * src/xtl/giop.h: ditto.
2240 2000-04-16 Allan Rae <rae@lyx.org>
2242 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
2243 by autogen.sh and removed by maintainer-clean anyway.
2244 * .cvsignore, sigc++/.cvsignore: Support the above.
2246 * sigc++/.cvsignore: Forgot that retbind.h was generated.
2248 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
2250 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
2251 macros, renamed static callback-target member functions to suit new
2252 scheme and made them public.
2253 * src/frontends/xforms/forms/form_print.fd: ditto.
2254 * src/frontends/xforms/forms/form_copyright.fd: ditto.
2256 * src/support/lxtl.h: small cleanup to use typedef instead of #define
2259 * src/xtl/: New directory containing a minimal distribution of XTL.
2260 This is XTL-1.3.pl.4.
2262 * development/tools/lxtl.sh: A script to generate the above mini-dist.
2264 2000-04-15 Allan Rae <rae@lyx.org>
2266 * development/tools/makeLyXsigc.sh: Remove the library version numbers
2268 * sigc++/: Updated to libsigc++-1.0.0
2270 2000-04-14 Allan Rae <rae@lyx.org>
2272 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
2273 use the generic ones in future. I'll modify my conversion script.
2275 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
2277 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
2278 (CloseAllBufferRelatedDialogs): Renamed.
2279 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
2281 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
2282 of the generic ones. These are the same ones my conversion script
2285 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
2286 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
2287 * src/buffer.C (Dispatch): ditto
2289 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
2290 functions for updating and hiding buffer dependent dialogs.
2291 * src/BufferView.C (buffer): ditto
2292 * src/buffer.C (setReadonly): ditto
2293 * src/lyxfunc.C (CloseBuffer): ditto
2295 * src/buffer.h: Take setReadonly() out of line so I don't have to include
2296 Dialogs.h, and hence all the SigC stuff, into every file that includes
2297 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
2299 * src/BufferView2.C: reduce the number of headers included by buffer.h
2301 2000-04-11 Allan Rae <rae@lyx.org>
2303 * src/frontends/xforms/xform_macros.h: A small collection of macros
2304 for building C callbacks.
2306 * src/frontends/xforms/Makefile.am: Added above file.
2308 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
2309 scheme again. This time it should work for JMarc. If this is
2310 successful I'll revise my conversion script to automate some of this.
2311 The static member functions in the class also have to be public for
2312 this scheme will work. If the scheme works (it's almost identical to
2313 the way BufferView::cursorToggleCB is handled so it should work) then
2314 FormCopyright and FormPrint will be ready for inclusion into the main
2315 trunk immediately after 1.1.5 is released -- provided we're prepared
2316 for complaints about lame compilers not handling XTL.
2318 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
2320 2000-04-07 Allan Rae <rae@lyx.org>
2322 * config/lyxinclude.m4: A bit more tidying up (Angus)
2324 * src/LString.h: JMarc's <string> header fix
2326 * src/PrinterParams.h: Used string for most data to remove some
2327 ugly code in the Print dialog and avoid even uglier code when
2328 appending the ints to a string for output.
2330 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
2331 and moved "default:" back to the end of switch statement. Cleaned
2332 up the printing so it uses the right function calls and so the
2333 "print to file" option actually puts the file in the right directory.
2335 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
2337 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
2338 and Ok+Apply button control into a separate method: input (Angus).
2339 (input) Cleaned it up and improved it to be very thorough now.
2340 (All CB) static_cast used instead of C style cast (Angus). This will
2341 probably change again once we've worked out how to keep gcc-2.8.1 happy
2342 with real C callbacks.
2343 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
2344 ignore some of the bool settings and has random numbers instead. Needs
2345 some more investigation. Added other input length checks and checking
2346 of file and printer names.
2348 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
2349 would link (Angus). Seems the old code doesn't compile with the pragma
2350 statement either. Separated callback entries from internal methods.
2352 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
2354 2000-03-17 Allan Rae <rae@lyx.org>
2356 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
2357 need it? Maybe it could go in Dialogs instead? I could make it a
2358 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
2359 values to get the bool return value.
2360 (Dispatch): New overloaded method for xtl support.
2362 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
2363 extern "C" callback instead of static member functions. Hopefully,
2364 JMarc will be able to compile this. I haven't changed
2365 forms/form_copyright.fd yet. Breaking one of my own rules already.
2367 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
2368 because they aren't useful from the minibuffer. Maybe a LyXServer
2369 might want a help message though?
2371 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
2373 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
2374 xtl which needs both rtti and exceptions.
2376 * src/support/Makefile.am:
2377 * src/support/lxtl.h: New file. Some helper macros for using XTL.
2379 * src/frontends/xforms/input_validators.[ch]: input filters and
2380 validators. These conrol what keys are valid in input boxes.
2381 Use them and write some more. Much better idea than waiting till
2382 after the user has pressed Ok to say that the input fields don't make
2385 * src/frontends/xforms/Makefile.am:
2386 * src/frontends/xforms/forms/form_print.fd:
2387 * src/frontends/xforms/forms/makefile:
2388 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
2389 new scheme. Still have to make sure I haven't missed anything from
2390 the current implementation.
2392 * src/Makefile.am, src/PrinterParams.h: New data store.
2394 * other files: Added a couple of copyright notices.
2396 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2398 * src/insets/insetbib.h: move Holder struct in public space.
2400 * src/frontends/include/DialogBase.h: use SigC:: only when
2401 SIGC_CXX_NAMESPACES is defined.
2402 * src/frontends/include/Dialogs.h: ditto.
2404 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
2406 * src/frontends/xforms/FormCopyright.[Ch]: do not
2407 mention SigC:: explicitely.
2409 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2411 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
2412 deals with testing KDE in main configure.in
2413 * configure.in: ditto.
2415 2000-02-22 Allan Rae <rae@lyx.org>
2417 * Lots of files: Merged from HEAD
2419 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
2420 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
2422 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
2424 * sigc++/: new minidist.
2426 2000-02-14 Allan Rae <rae@lyx.org>
2428 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
2430 2000-02-08 Juergen Vigna <jug@sad.it>
2432 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
2433 file for the buildin GUI builder of KDevelop of the copyright-dialog.
2435 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
2436 for this port and so it is much easier for other people to port
2437 dialogs in a common development environment.
2439 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
2440 the QT/KDE implementation.
2442 * src/frontends/kde/Dialogs.C:
2443 * src/frontends/kde/FormCopyright.C:
2444 * src/frontends/kde/FormCopyright.h:
2445 * src/frontends/kde/Makefile.am:
2446 * src/frontends/kde/formcopyrightdialog.C:
2447 * src/frontends/kde/formcopyrightdialog.h:
2448 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
2449 for the kde support of the Copyright-Dialog.
2451 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
2452 subdir-substitution instead of hardcoded 'xforms' as we now have also
2455 * src/frontends/include/DialogBase.h (Object): just commented the
2456 label after #endif (nasty warning and I don't like warnings ;)
2458 * src/main.C (main): added KApplication initialization if using
2461 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
2462 For now only the KDE event-loop is added if frontend==kde.
2464 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
2466 * configure.in: added support for the --with-frontend[=value] option
2468 * autogen.sh: added kde.m4 file to list of config-files
2470 * acconfig.h: added define for KDEGUI-support
2472 * config/kde.m4: added configuration functions for KDE-port
2474 * config/lyxinclude.m4: added --with-frontend[=value] option with
2475 support for xforms and KDE.
2477 2000-02-08 Allan Rae <rae@lyx.org>
2479 * all Makefile.am: Fixed up so the make targets dist, distclean,
2480 install and uninstall all work even if builddir != srcdir. Still
2481 have a new sigc++ minidist update to come.
2483 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
2485 2000-02-01 Allan Rae <rae@lyx.org>
2487 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
2488 Many mods to get builddir != srcdir working.
2490 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
2491 for building on NT and so we can do the builddir != srcdir stuff.
2493 2000-01-30 Allan Rae <rae@lyx.org>
2495 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
2496 This will stay in "rae" branch. We probably don't really need it in
2497 the main trunk as anyone who wants to help programming it should get
2498 a full library installed also. So they can check both included and
2499 system supplied library compilation.
2501 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
2502 Added a 'mini' distribution of libsigc++. If you feel the urge to
2503 change something in these directories - Resist it. If you can't
2504 resist the urge then you should modify the following script and rebuild
2505 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
2506 all happen. Still uses a hacked version of libsigc++'s configure.in.
2507 I'm quite happy with the results. I'm not sure the extra work to turn
2508 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
2509 worth the trouble and would probably lead to extra maintenance
2511 I haven't tested the following important make targets: install, dist.
2512 Not ready for prime time but very close. Maybe 1.1.5.
2514 * development/tools/makeLyXsigc.sh: A shell script to automatically
2515 generate our mini-dist of libsigc++. It can only be used with a CVS
2516 checkout of libsigc++ not a tarball distribution. It's well commented.
2517 This will end up as part of the libsigc++ distribution so other apps
2518 can easily have an included mini-dist. If someone makes mods to the
2519 sigc++ subpackage without modifying this script to generate those
2520 changes I'll be very upset!
2522 * src/frontends/: Started the gui/system indep structure.
2524 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
2525 to access the gui-indep dialogs are in this class. Much improved
2526 design compared to previous revision. Lars, please refrain from
2527 moving this header into src/ like you did with Popups.h last time.
2529 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
2531 * src/frontends/xforms/: Started the gui-indep system with a single
2532 dialog: FormCopyright. Initial testing of use of libsigc++ was very
2535 * src/frontends/xforms/forms: Repository for the xforms .fd files.
2536 Here you'll find a very useful makefile and automated fdfix.sh that
2537 makes updating dailogs a no-brainer -- provided you follow the rules
2538 set out in the README. I'm thinking about adding another script to
2539 automatically generate skeleton code for a new dialog given just the
2542 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
2543 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
2544 Made FormCopyright gui-indep and added a lyxfunc to get to it.
2546 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
2548 * src/support/LSubstring.C (operator): simplify
2550 * src/lyxtext.h: removed bparams, use buffer_->params instead
2552 * src/lyxrow.h: make Row a real class, move all variables to
2553 private and use accessors.
2555 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
2557 (isRightToLeftPar): ditto
2558 (ChangeLanguage): ditto
2559 (isMultiLingual): ditto
2562 (SimpleTeXOnePar): ditto
2563 (TeXEnvironment): ditto
2564 (GetEndLabel): ditto
2566 (SetOnlyLayout): ditto
2567 (BreakParagraph): ditto
2568 (BreakParagraphConservative): ditto
2569 (GetFontSettings): ditto
2571 (CopyIntoMinibuffer): ditto
2572 (CutIntoMinibuffer): ditto
2573 (PasteParagraph): ditto
2574 (SetPExtraType): ditto
2575 (UnsetPExtraType): ditto
2576 (DocBookContTableRows): ditto
2577 (SimpleDocBookOneTablePar): ditto
2579 (TeXFootnote): ditto
2580 (SimpleTeXOneTablePar): ditto
2581 (TeXContTableRows): ditto
2582 (SimpleTeXSpecialChars): ditto
2585 * src/lyxcursor.h: make LyXCursor a real class, move all variables
2586 to private and use accessors.
2588 * src/lyx_cb.C: remove char updatetimer, and all code that uses
2589 this, we did not use it anymore and has not been for ages. Just a
2590 waste of cpu cycles.
2592 * src/language.h: make Language a real class, move all variables
2593 to private and use accessors.
2595 * src/BufferView_pimpl.C (Pimpl): use new timer code.
2596 (create_view): remove
2597 (update): some changes for new timer
2598 (cursorToggle): use new timer
2599 (beforeChange): change for new timer
2601 * src/BufferView.h (cursorToggleCB): removed last paramter because
2604 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
2605 (cursorToggleCB): change because of new timer code
2607 * lib/CREDITS: updated own mailaddress
2609 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2611 * src/support/filetools.C (PutEnv): fix the code in case neither
2612 putenv() nor setenv() have been found.
2614 * INSTALL: mention the install-strip Makefile target.
2616 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
2617 read-only documents.
2619 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2621 * lib/reLyX/configure.in (VERSION): avoid using a previously
2622 generated reLyX wrapper to find out $prefix.
2624 * lib/examples/eu_adibide_lyx-atua.lyx:
2625 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
2626 translation of the Tutorial (Dooteo)
2628 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
2630 * forms/cite.fd: new citation dialog
2632 * src/insetcite.[Ch]: the new citation dialog is moved into
2635 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
2638 * src/insets/insetcommand.h: data members made private.
2640 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
2642 * LyX 1.1.5 released
2644 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
2646 * src/version.h (LYX_RELEASE): to 1.1.5
2648 * src/spellchecker.C (RunSpellChecker): return false if the
2649 spellchecker dies upon creation.
2651 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2653 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
2654 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
2658 * lib/CREDITS: update entry for Martin Vermeer.
2660 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
2662 * src/text.C (draw): Draw foreign language bars at the bottom of
2663 the row instead of at the baseline.
2665 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
2667 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
2669 * lib/bind/de_menus.bind: updated
2671 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
2673 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
2675 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
2677 * src/menus.C (Limit_string_length): New function
2678 (ShowTocMenu): Limit the number of items/length of items in the
2681 * src/paragraph.C (String): Correct result for a paragraph inside
2684 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
2686 * src/bufferlist.C (close): test of buf->getuser() == NULL
2688 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
2690 * src/BufferView2.C (removeAutoInsets): Fix a bug:
2691 Do not call to SetCursor when the paragraph is a closed footnote!
2693 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
2695 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
2698 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
2700 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
2703 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
2704 reference popup, that activates the reference-back action
2706 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
2708 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
2709 the menus. Also fixed a bug.
2711 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
2712 the math panels when switching buffers (unless new buffer is readonly).
2714 * src/BufferView.C (NoSavedPositions)
2715 * src/BufferView_pimpl.C (NoSavedPositions): New methods
2717 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2719 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
2720 less of dvi dirty or not.
2722 * src/trans_mgr.[Ch] (insert): change first parameter to string
2725 * src/chset.[Ch] (encodeString): add const to first parameter
2727 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2729 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
2733 * src/LaTeX.C (deplog): better searching for dependency files in
2734 the latex log. Uses now regexps.
2736 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
2737 instead of the box hack or \hfill.
2739 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2741 * src/lyxfunc.C (doImportHelper): do not create the file before
2742 doing the actual import.
2743 (doImportASCIIasLines): create a new file before doing the insert.
2744 (doImportASCIIasParagraphs): ditto.
2746 * lib/lyxrc.example: remove mention of non-existing commands
2748 * lyx.man: remove mention of color-related switches.
2750 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
2752 * src/lyx_gui.C: remove all the color-related ressources, which
2753 are not used anymore.
2755 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
2758 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
2760 * src/lyxrc.C (read): Add a missing break in the switch
2762 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
2764 * src/text2.C (InsertStringA): Fix a bug with insertion into table
2766 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
2769 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
2771 * src/text.C (draw): draw bars under foreign language words.
2773 * src/LColor.[Ch]: add LColor::language
2775 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
2777 * src/lyxcursor.h (boundary): New member variable
2779 * src/text.C (IsBoundary): New methods
2781 * src/text.C: Use the above for currect cursor movement when there
2782 is both RTL & LTR text.
2784 * src/text2.C: ditto
2786 * src/bufferview_funcs.C (ToggleAndShow): ditto
2788 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2790 * src/text.C (DeleteLineForward): set selection to true to avoid
2791 that DeleteEmptyParagraphMechanism does some magic. This is how it
2792 is done in all other functions, and seems reasonable.
2793 (DeleteWordForward): do not jump over non-word stuff, since
2794 CursorRightOneWord() already does it.
2796 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
2797 DeleteWordBackward, since they seem safe to me (since selection is
2798 set to "true") DeleteEmptyParagraphMechanism does nothing.
2800 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2802 * src/lyx_main.C (easyParse): simplify the code by factoring the
2803 part that removes parameters from the command line.
2804 (LyX): check wether wrong command line options have been given.
2806 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
2808 * src/lyx_main.C : add support for specifying user LyX
2809 directory via command line option -userdir.
2811 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
2813 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
2814 the number of items per popup.
2815 (Add_to_refs_menu): Ditto.
2817 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2819 * src/lyxparagraph.h: renamed ClearParagraph() to
2820 StripLeadingSpaces() and moved it to paragraph.C. We pass the
2821 textclass as parameter, and do nothing if free_spacing is
2822 true. This fixes part of the line-delete-forward problems.
2824 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
2825 (pasteSelection): ditto.
2826 (SwitchLayoutsBetweenClasses): more translatable strings.
2828 * src/text2.C (CutSelection): use StripLeadingSpaces.
2829 (PasteSelection): ditto.
2830 (DeleteEmptyParagraphMechanism): ditto.
2832 2000-05-26 Juergen Vigna <jug@sad.it>
2834 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
2835 is not needed in tabular insets.
2837 * src/insets/insettabular.C (TabularFeatures): added missing features.
2839 * src/tabular.C (DeleteColumn):
2841 (AppendRow): implemented this functions
2842 (cellsturct::operator=): clone the inset too;
2844 2000-05-23 Juergen Vigna <jug@sad.it>
2846 * src/insets/insettabular.C (LocalDispatch): better selection support
2847 when having multicolumn-cells.
2849 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
2851 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
2853 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2855 * src/ColorHandler.C (getGCForeground): put more test into _()
2857 * lib/examples/eu_splash.lyx: new file (Basque translation) from
2860 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
2863 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
2865 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
2866 there are no labels, or when buffer is readonly.
2868 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
2869 there are no labels, buffer is SGML, or when buffer is readonly.
2871 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2873 * src/LColor.C (LColor): change a couple of grey40 to grey60
2874 (LColor): rewore initalization to make compiles go some magnitude
2876 (getGUIName): don't use gettext until we need the string.
2878 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
2880 * src/Bullet.[Ch]: Fixed a small bug.
2882 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
2884 * src/paragraph.C (String): Several fixes/improvements
2886 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
2888 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
2890 * src/paragraph.C (String): give more correct output.
2892 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
2894 * src/lyxfont.C (stateText) Do not output the language if it is
2895 eqaul to the language of the document.
2897 * src/paragraph.C (TeXOnePar): Do not put language switch commands
2898 between two paragraphs with the same language.
2900 * src/paragraph.C (getParLanguage) Return a correct answer for an
2901 empty dummy paragraph.
2903 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
2906 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
2909 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
2910 the menus/popup, if requested fonts are unavailable.
2912 2000-05-22 Juergen Vigna <jug@sad.it>
2914 * src/insets/insettabular.C (LocalDispatch): added some more cursor
2915 movement support (Up/Down/Tab/Shift-Tab).
2916 (LocalDispatch): added also preliminari cursor-selection.
2918 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
2920 * src/paragraph.C (PasteParagraph): Hopefully now right!
2922 2000-05-22 Garst R. Reese <reese@isn.net>
2924 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
2925 of list, change all references to Environment to Command
2926 * tex/hollywood.cls : rewrite environments as commands, add
2927 \uppercase to interiorshot and exteriorshot to force uppecase.
2928 * tex/broadway.cls : rewrite environments as commands. Tweak
2931 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2933 * src/menus.C (Add_to_toc_menu): fix the code which limits the
2934 size of items: use a constant intead of the hardcoded 40, and more
2935 importantly do not remove the %m and %x tags added at the end.
2936 (Add_to_refs_menu): use vector::size_type instead of
2937 unsigned int as basic types for the variables. _Please_ do not
2938 assume that size_t is equal to unsigned int. On an alpha, this is
2939 unsigned long, which is _not_ the same.
2941 * src/language.C (initL): remove language "hungarian", since it
2942 seems that "magyar" is better.
2944 2000-05-22 Juergen Vigna <jug@sad.it>
2946 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
2948 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
2951 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
2952 next was deleted but not set to 0.
2954 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2956 * src/language.C (initL): change the initialization of languages
2957 so that compiles goes _fast_.
2959 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
2962 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
2964 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2968 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2970 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
2972 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
2976 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
2979 * src/insets/insetlo*.[Ch]: Made editable
2981 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2983 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
2984 the current selection.
2986 * src/BufferView_pimpl.C (stuffClipboard): new method
2988 * src/BufferView.C (stuffClipboard): new method
2990 * src/paragraph.C (String): new method
2992 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
2993 LColor::ignore when lyxname is not found.
2995 * src/BufferView.C (pasteSelection): new method
2997 * src/BufferView_pimpl.C (pasteSelection): new method
2999 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
3001 * src/WorkArea.C (request_clipboard_cb): new static function
3002 (getClipboard): new method
3003 (putClipboard): new method
3005 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3007 * LyX 1.1.5pre2 released
3009 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3011 * src/vspace.C (operator=): removed
3012 (operator=): removed
3014 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
3016 * src/layout.C (NumberOfClass): manually set the type in make_pair
3017 (NumberOfLayout): ditto
3019 * src/language.C: use the Language constructor for ignore_lang
3021 * src/language.h: add constructors to struct Language
3023 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
3025 * src/text2.C (SetCursorIntern): comment out #warning
3027 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
3029 * src/mathed/math_iter.h: initialize sx and sw to 0
3031 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3033 * forms/lyx.fd: Redesign of form_ref
3035 * src/LaTeXFeatures.[Ch]
3039 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
3042 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
3043 and Buffer::inset_iterator.
3045 * src/menus.C: Added new menus: TOC and Refs.
3047 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
3049 * src/buffer.C (getTocList): New method.
3051 * src/BufferView2.C (ChangeRefs): New method.
3053 * src/buffer.C (getLabelList): New method. It replaces the old
3054 getReferenceList. The return type is vector<string> instead of
3057 * src/insets/insetinclude.C (getLabelList): New method. Replaces
3058 the old getLabel() and GetNumberOfLabels() methods.
3059 * src/insets/insetlabel.C (getLabelList): ditto
3060 * src/mathed/formula.C (getLabelList): ditto
3062 * src/paragraph.C (String): New method.
3064 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
3065 Uses the new getTocList() method.
3066 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
3067 which automatically updates the contents of the browser.
3068 (RefUpdateCB): Use the new getLabelList method.
3070 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
3072 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
3074 * src/spellchecker.C: Added using std::reverse;
3076 2000-05-19 Juergen Vigna <jug@sad.it>
3078 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
3080 * src/insets/insettext.C (computeTextRows): small fix for display of
3081 1 character after a newline.
3083 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
3086 2000-05-18 Juergen Vigna <jug@sad.it>
3088 * src/insets/insettabular.C (TabularFeatures): fixed update of display
3089 when changing width of column.
3091 * src/tabular.C (set_row_column_number_info): setting of
3092 autobreak rows if necessary.
3094 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3096 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
3098 * src/vc-backend.*: renamed stat() to status() and vcstat to
3099 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
3100 compilation broke. The new name seems more relevant, anyway.
3102 2000-05-17 Juergen Vigna <jug@sad.it>
3104 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
3105 which was wrong if the removing caused removing of rows!
3107 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
3108 (pushToken): new function.
3110 * src/text2.C (CutSelection): fix problem discovered with purify
3112 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3114 * src/debug.C (showTags): enlarge the first column, now that we
3115 have 6-digits debug codes.
3117 * lib/layouts/hollywood.layout:
3118 * lib/tex/hollywood.cls:
3119 * lib/tex/brodway.cls:
3120 * lib/layouts/brodway.layout: more commands and fewer
3121 environments. Preambles moved in the .cls files. Broadway now has
3122 more options on scene numbering and less whitespace (from Garst)
3124 * src/insets/insetbib.C (getKeys): make sure that we are in the
3125 document directory, in case the bib file is there.
3127 * src/insets/insetbib.C (Latex): revert bogus change.
3129 2000-05-16 Juergen Vigna <jug@sad.it>
3131 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
3132 the TabularLayout on cursor move.
3134 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
3136 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
3139 (draw): fixed cursor position and drawing so that the cursor is
3140 visible when before the tabular-inset.
3142 * src/insets/insettext.C (init): drawLockedFrame was not initialized
3143 when creating from old insettext.
3145 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
3147 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3149 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
3150 * lib/tex/brodway.cls: ditto
3152 * lib/layouts/brodway.layout: change alignment of parenthical
3155 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3157 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
3158 versions 0.88 and 0.89 are supported.
3160 2000-05-15 Juergen Vigna <jug@sad.it>
3162 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
3165 * src/insets/insettext.C (computeTextRows): redone completely this
3166 function in a much cleaner way, because of problems when having a
3168 (draw): added a frame border when the inset is locked.
3169 (SetDrawLockedFrame): this sets if we draw the border or not.
3170 (SetFrameColor): this sets the frame color (default=insetframe).
3172 * src/insets/lyxinset.h: added x() and y() functions which return
3173 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
3174 function which is needed to see if we have a locking inset of some
3175 type in this inset (needed for now in insettabular).
3177 * src/vspace.C (inPixels): the same function also without a BufferView
3178 parameter as so it is easier to use it in some ocasions.
3180 * src/lyxfunc.C: changed all places where insertInset was used so
3181 that now if it couldn't be inserted it is deleted!
3183 * src/TabularLayout.C:
3184 * src/TableLayout.C: added support for new tabular-inset!
3186 * src/BufferView2.C (insertInset): this now returns a bool if the
3187 inset was really inserted!!!
3189 * src/tabular.C (GetLastCellInRow):
3190 (GetFirstCellInRow): new helper functions.
3191 (Latex): implemented for new tabular class.
3195 (TeXTopHLine): new Latex() helper functions.
3197 2000-05-12 Juergen Vigna <jug@sad.it>
3199 * src/mathed/formulamacro.C (Read):
3200 * src/mathed/formula.C (Read): read also the \end_inset here!
3202 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3204 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
3205 crush when saving formulae with unbalanced parenthesis.
3207 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
3209 * src/layout.C: Add new keyword "endlabelstring" to layout file
3211 * src/text.C (GetVisibleRow): Draw endlabel string.
3213 * lib/layouts/broadway.layout
3214 * lib/layouts/hollywood.layout: Added endlabel for the
3215 Parenthetical layout.
3217 * lib/layouts/heb-article.layout: Do not use slanted font shape
3218 for Theorem like environments.
3220 * src/buffer.C (makeLaTeXFile): Always add "american" to
3221 the UsedLanguages list if document language is RTL.
3223 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3225 * add addendum to README.OS2 and small patch (from SMiyata)
3227 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3229 * many files: correct the calls to ChangeExtension().
3231 * src/support/filetools.C (ChangeExtension): remove the no_path
3232 argument, which does not belong there. Use OnlyFileName() instead.
3234 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
3235 files when LaTeXing a non-nice latex file.
3237 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
3238 a chain of "if". Return false when deadkeys are not handled.
3240 * src/lyx_main.C (LyX): adapted the code for default bindings.
3242 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
3243 bindings for basic functionality (except deadkeys).
3244 (deadKeyBindings): new method. Performs the bindings of deadkeys.
3246 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
3247 several methods: handle override_x_deadkeys.
3249 * src/lyxrc.h: remove the "bindings" map, which did not make much
3250 sense anyway. New variable override_x_deadkeys, defaulting to "true".
3252 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3254 * src/lyxfont.C (stateText): use a saner method to determine
3255 whether the font is "default". Seems to fix the crash with DEC
3258 * src/Bullet.[Ch] (Bullet): remove const on parameters.
3260 2000-05-08 Juergen Vigna <jug@sad.it>
3262 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
3263 TabularLayoutMenu with mouse-button-3
3264 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
3266 * src/TabularLayout.C: added this file for having a Layout for
3269 2000-05-05 Juergen Vigna <jug@sad.it>
3271 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
3272 recalculating inset-widths.
3273 (TabularFeatures): activated this function so that I can change
3274 tabular-features via menu.
3276 * src/menus.C (ShowEditMenu): inserted support for insettabular so
3277 that I can test some functions with the Table menu.
3279 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3281 * src/lyxfont.C (stateText): guard against stupid c++libs.
3283 * src/tabular.C: add using std::vector
3284 some whitespace changes, + removed som autogenerated code.
3286 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
3288 2000-05-05 Juergen Vigna <jug@sad.it>
3290 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
3291 row, columns and cellstructures.
3293 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3295 * lib/lyxrc.example: remove obsolete entries.
3297 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
3298 reading of protected_separator for free_spacing.
3300 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3302 * src/text.C (draw): do not display an exclamation mark in the
3303 margin for margin notes. This is confusing, ugly and
3306 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
3307 AMS math' is checked.
3309 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
3310 name to see whether including the amsmath package is needed.
3312 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
3314 * src/paragraph.C (validate): Compute UsedLanguages correctly
3315 (don't insert the american language if it doesn't appear in the
3318 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
3319 The argument of \thanks{} command is considered moving argument
3321 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
3324 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
3326 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
3327 for appendix/minipage/depth. The lines can be now both in the footnote
3328 frame, and outside the frame.
3330 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
3333 2000-05-05 Juergen Vigna <jug@sad.it>
3335 * src/table.[Ch]: removed the inset and buffer stuff as this is now
3336 neede only in tabular.[Ch].
3338 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3340 * src/insets/insetspecialchar.C (Read): allow command == '~' for
3342 (Write): write '~' for PROTECTED_SEPARATOR
3344 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3346 * src/lyxparagraph.h: add a friend struct matchIT after the struct
3349 * src/mathed/formula.C (drawStr): rename size to siz.
3351 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
3352 possibly fix a bug by not changing the pflags = flags to piflags =
3355 2000-05-05 Juergen Vigna <jug@sad.it>
3357 * src/insets/insetbib.C: moved using directive
3359 * src/ImportNoweb.C: small fix for being able to compile (missing
3362 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3364 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
3365 to use clear, since we don't depend on this in the code. Add test
3368 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3370 * (various *.C files): add using std::foo directives to please dec
3373 * replace calls to string::clear() to string::erase() (Angus)
3375 * src/cheaders/cmath: modified to provide std::abs.
3377 2000-05-04 Juergen Vigna <jug@sad.it>
3379 * src/insets/insettext.C: Prepared all for inserting of multiple
3380 paragraphs. Still display stuff to do (alignment and other things),
3381 but I would like to use LyXText to do this when we cleaned out the
3382 table-support stuff.
3384 * src/insets/insettabular.C: Changed lot of stuff and added lots
3385 of functionality still a lot to do.
3387 * src/tabular.C: Various functions changed name and moved to be
3388 const functions. Added new Read and Write functions and changed
3389 lots of things so it works good with tabular-insets (also removed
3390 some stuff which is not needed anymore * hacks *).
3392 * src/lyxcursor.h: added operators == and != which just look if
3393 par and pos are (not) equal.
3395 * src/buffer.C (latexParagraphs): inserted this function to latex
3396 all paragraphs form par to endpar as then I can use this too for
3399 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
3400 so that I can call this to from text insets with their own cursor.
3402 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
3403 output off all paragraphs (because of the fix below)!
3405 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
3406 the very last paragraph (this could be also the last paragraph of an
3409 * src/texrow.h: added rows() call which returns the count-variable.
3411 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3413 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
3415 * lib/configure.m4: better autodetection of DocBook tools.
3417 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3419 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
3421 * src/lyx_cb.C: add using std::reverse;
3423 * src/LaTeX.C (run): on error always run deleteFilesOnError before
3426 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
3427 selected files. Should fix repeated errors from generated files.
3429 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
3431 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
3433 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
3434 the spellchecker popup.
3436 * lib/lyxrc.example: Removed the \number_inset section
3438 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3440 * src/insets/figinset.C (various): Use IsFileReadable() to make
3441 sure that the file actually exist. Relying on ghostscripts errors
3442 is a bad idea since they can lead to X server crashes.
3444 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
3446 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
3449 * lib/lyxrc.example: smallish typo in description of
3450 \view_dvi_paper_option
3452 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
3455 * src/lyxfunc.C: doImportHelper to factor out common code of the
3456 various import methods. New functions doImportASCIIasLines,
3457 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
3458 doImportLinuxDoc for the format specific parts.
3461 * buffer.C: Dispatch returns now a bool to indicate success
3464 * lyx_gui.C: Add getLyXView() for member access
3466 * lyx_main.C: Change logic for batch commands: First try
3467 Buffer::Dispatch (possibly without GUI), if that fails, use
3470 * lyx_main.C: Add support for --import command line switch.
3471 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
3472 Available Formats: Everything accepted by 'buffer-import <format>'
3474 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3476 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
3479 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
3480 documents will be reformatted upon reentry.
3482 2000-04-27 Juergen Vigna <jug@sad.it>
3484 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
3485 correctly only last pos this was a bug.
3487 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3489 * release of lyx-1.1.5pre1
3491 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3493 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
3495 * src/menus.C: revert the change of naming (Figure->Graphic...)
3496 from 2000-04-11. It was incomplete and bad.
3498 * src/LColor.[Ch]: add LColor::depthbar.
3499 * src/text.C (GetVisibleRow): use it.
3501 * README: update the languages list.
3503 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
3505 * src/text.C (GetVisibleRow): show the depth of paragraphs using
3508 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3510 * README: remove sections that were just wrong.
3512 * src/text2.C (GetRowNearY): remove currentrow code
3514 * src/text.C (GetRow): remove currentrow code
3516 * src/screen.C (Update): rewritten a bit.
3517 (SmallUpdate): removed func
3519 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
3521 (FullRebreak): return bool
3522 (currentrow): remove var
3523 (currentrow_y): ditto
3525 * src/lyxscreen.h (Draw): change arg to unsigned long
3526 (FitCursor): return bool
3527 (FitManualCursor): ditto
3528 (Smallpdate): remove func
3529 (first): change to unsigned long
3530 (DrawOneRow): change second arg to long (from long &)
3531 (screen_refresh_y): remove var
3532 (scree_refresh_row): ditto
3534 * src/lyxrow.h: change baseline to usigned int from unsigned
3535 short, this brings some implicit/unsigned issues out in the open.
3537 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
3539 (Dispatch): don't call updateScrollbar after fitCursor. Use update
3540 instead of smallUpdate.
3542 * src/lyxcursor.h: change y to unsigned long
3544 * src/buffer.h: don't call updateScrollbar after fitcursor
3546 * src/buffer.C (parseSingleLyXformat2Token): move variables to
3547 where they are used. Removed "\\direction", this was not present
3548 in 1.1.4 and is already obsolete. Commented out some code that I
3549 believe to never be called.
3550 (runLiterate): don't call updateScrollbar after fitCursor
3552 (buildProgram): ditto
3555 * src/WorkArea.h (workWidth): change return val to unsigned
3558 (redraw): remove the button redraws
3559 (setScrollbarValue): change for scrollbar
3560 (getScrollbarValue): change for scrollbar
3561 (getScrollbarBounds): change for scrollbar
3563 * src/WorkArea.C (C_WorkArea_up_cb): removed func
3564 (C_WorkArea_down_cb): removed func
3565 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
3566 (resize): change for scrollbar
3567 (setScrollbar): ditto
3568 (setScrollbarBounds): ditto
3569 (setScrollbarIncrements): ditto
3570 (up_cb): removed func
3571 (down_cb): removed func
3572 (scroll_cb): change for scrollbar
3573 (work_area_handler): ditto
3575 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
3576 when FitCursor did something.
3577 (updateScrollbar): some unsigned changes
3578 (downCB): removed func
3579 (scrollUpOnePage): removed func
3580 (scrollDownOnePage): remvoed func
3581 (workAreaMotionNotify): don't call screen->FitCursor but use
3582 fitCursor instead. and bool return val
3583 (workAreaButtonPress): ditto
3584 (workAreaButtonRelease): some unsigned changes
3585 (checkInsetHit): ditto
3586 (workAreaExpose): ditto
3587 (update): parts rewritten, comments about the signed char arg added
3588 (smallUpdate): removed func
3589 (cursorPrevious): call needed updateScrollbar
3592 * src/BufferView2.C (allFloats): don't call updateScrollbar after
3595 * src/BufferView.[Ch] (upCB): removed func
3596 (downCB): removed func
3597 (smallUpdate): removed func
3599 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3601 * src/lyxtext.h src/text.C src/text2.C: removed support for the
3602 currentrow, currentrow_y optimization. This did not help a lot and
3603 if we want to do this kind of optimization we should rather use
3604 cursor.row instead of the currentrow.
3606 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
3607 buffer spacing and klyx spacing support.
3609 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
3611 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
3614 2000-04-26 Juergen Vigna <jug@sad.it>
3616 * src/insets/figinset.C: fixes to Lars sstream changes!
3618 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
3620 * A lot of files: Added Ascii(ostream &) methods to all inset
3621 classes. Used when exporting to ASCII.
3623 * src/buffer.C (writeFileAscii,RoffAsciiTable)
3624 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
3627 * src/text2.C (ToggleFree): Disabled implicit word selection when
3628 there is a change in the language
3630 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
3631 no output was generated for end-of-sentence inset.
3633 * src/insets/lyxinset.h
3636 * src/paragraph.C: Removed the insetnumber code
3638 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
3640 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3642 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
3643 no_babel and no_epsfig completely from the file.
3644 (parseSingleLyXformat2Token): add handling for per-paragraph
3645 spacing as written by klyx.
3647 * src/insets/figinset.C: applied patch by Andre. Made it work with
3650 2000-04-20 Juergen Vigna <jug@sad.it>
3652 * src/insets/insettext.C (cutSelection):
3653 (copySelection): Fixed with selection from right to left.
3654 (draw): now the rows are not recalculated at every draw.
3655 (computeTextRows): for now reset the inset-owner here (this is
3656 important for an undo or copy where the inset-owner is not set
3659 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
3660 motion to the_locking_inset screen->first was forgotten, this was
3661 not important till we got multiline insets.
3663 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3665 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
3666 code seems to be alright (it is code changed by Dekel, and the
3667 intent is indeed that all macros should be defined \protect'ed)
3669 * NEWS: a bit of reorganisation of the new user-visible features.
3671 2000-04-19 Juergen Vigna <jug@sad.it>
3673 * src/insets/insettext.C (init): using a LyXCursor now for cursor
3674 position. Set the inset_owner of the used paragraph so that it knows
3675 that it is inside an inset. Fixed cursor handling with mouse and
3676 cursor keys. Fixed wrong timed inset redraws and lots of other changes
3677 and cleanups to make TextInsets work better.
3679 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
3680 Changed parameters of various functions and added LockInsetInInset().
3682 * src/insets/insettext.C:
3684 * src/insets/insetcollapsable.h:
3685 * src/insets/insetcollapsable.C:
3686 * src/insets/insetfoot.h:
3687 * src/insets/insetfoot.C:
3688 * src/insets/insetert.h:
3689 * src/insets/insetert.C: cleaned up the code so that it works now
3690 correctly with insettext.
3692 * src/insets/inset.C:
3693 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
3694 that insets in insets are supported right.
3697 * src/table.C: lots of changes for use with inset tabular (and cleanup)
3699 * src/paragraph.C: some small fixes
3701 * src/debug.h: inserted INSETS debug info
3703 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
3704 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
3706 * src/commandtags.h:
3707 * src/LyXAction.C: insert code for InsetTabular.
3709 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
3710 not Button1MotionMask.
3711 (workAreaButtonRelease): send always a InsetButtonRelease event to
3713 (checkInsetHit): some setCursor fixes (always with insets).
3715 * src/BufferView2.C (lockInset): returns a bool now and extended for
3716 locking insets inside insets.
3717 (showLockedInsetCursor): it is important to have the cursor always
3718 before the locked inset.
3719 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
3721 * src/BufferView.h: made lockInset return a bool.
3723 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
3725 * src/text2.C (SetCursor): This now has a version with a LyXCursor
3726 that is used also internally but can be called as public to have back
3727 a cursor pos which is not set internally.
3728 (SetCursorIntern): Changed to use above function.
3730 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
3732 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3737 * NEWS: updated for prerelease of 1.1.5. Please comment and send
3738 patches for things that should be in or should be changed.
3740 * src/* [insetfiles]: change "usigned char fragile" to bool
3741 fragile. There was only one point that could that be questioned
3742 and that is commented in formulamacro.C. Grep for "CHECK".
3744 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
3745 (DeleteBuffer): take it out of CutAndPaste and make it static.
3747 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3749 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
3750 output the spacing envir commands. Also the new commands used in
3751 the LaTeX output makes the result better.
3753 * src/Spacing.C (writeEnvirBegin): new method
3754 (writeEnvirEnd): new method
3756 2000-04-18 Juergen Vigna <jug@sad.it>
3758 * src/CutAndPaste.C: made textclass a static member of the class
3759 as otherwise it is not accesed right!!!
3761 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
3763 * forms/layout_forms.fd
3764 * src/layout_forms.h
3765 * src/layout_forms.C (create_form_form_character)
3766 * src/lyx_cb.C (UserFreeFont)
3767 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
3768 documents (in the layout->character popup).
3770 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3772 * src/spellchecker.C (create_ispell_pipe): fix a bug where
3773 \spell_command was in fact not honored (from Kevin Atkinson).
3775 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
3778 * src/lyx_gui.h: make lyxViews private (Angus)
3780 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
3782 * src/mathed/math_write.C
3783 (MathMatrixInset::Write) Put \protect before \begin{array} and
3784 \end{array} if fragile
3785 (MathParInset::Write): Put \protect before \\ if fragile
3787 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
3789 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
3790 initialization if the LyXColorHandler must be done after the
3791 connections to the XServer has been established.
3793 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
3794 get the background pixel from the lyxColorhandler so that the
3795 figures are rendered with the correct background color.
3796 (NextToken): removed functions.
3797 (GetPSSizes): use ifs >> string instead of NextToken.
3799 * src/Painter.[Ch]: the color cache moved out of this file.
3801 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
3804 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3806 * src/WorkArea.C (work_area_handler): call BufferView::enterView
3807 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
3809 * src/BufferView.C (enterView): new func
3810 (leaveView): new func
3812 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
3814 (leaveView): new func, undefines xterm cursor when approp.
3816 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
3817 (AllowInput): delete the Workarea cursor handling from this func.
3819 * src/Painter.C (underline): draw a slimer underline in most cases.
3821 * src/lyx_main.C (error_handler): use extern "C"
3823 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
3825 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
3826 sent directly to me.
3828 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
3829 to the list by Dekel.
3831 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
3834 * src/bufferview_funcs.[Ch]: two new files, moved several of the
3835 methods from lyx_cb.here.
3837 * src/lyx_cb.C: in addition to the above; removed input_prohibited
3840 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
3842 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
3843 instead of using current_view directly.
3845 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
3847 * src/LyXAction.C (init): add the paragraph-spacing command.
3849 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
3851 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
3853 * src/lyx_cb.C (CurrentState): output a string when the spacing is
3854 different from the documents.
3856 * src/text.C (SetHeightOfRow): take paragraph spacing into
3857 account, paragraph spacing takes precedence over buffer spacing
3858 (GetVisibleRow): ditto
3860 * src/paragraph.C (writeFile): output the spacing parameter too.
3861 (validate): set the correct features if spacing is used in the
3863 (Clear): set spacing to default
3864 (MakeSameLayout): spacing too
3865 (HasSameLayout): spacing too
3866 (SetLayout): spacing too
3867 (TeXOnePar): output the spacing commands
3869 * src/lyxparagraph.h: added a spacing variable for use with
3870 per-paragraph spacing.
3872 * src/Spacing.h: add a Default spacing and a method to check if
3873 the current spacing is default. also added an operator==
3875 * src/text2.C (DeleteEmptyParagraphMechanism): added a
3878 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3880 * src/lyxserver.C (callback): fix dispatch of functions
3882 * src/insets/insetlatexaccent.C (checkContents): turn bogus
3883 printf() into lyxerr call.
3885 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
3888 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
3889 "Table" to "Table Box", "Float" to "Floating Material"; deletes
3890 the "Float" from each of the subitems.
3891 (ShowHelpMenu): add entry for "FAQ" and "TOC".
3893 * src/support/DebugStream.h: add an #ifdef to work around a gcc
3894 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
3895 documented the change so that the workaround can be nuked later.
3897 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
3900 * src/lyxlex_pimpl.C (next): do not re-declare the default value
3902 * src/buffer.C (getLatexName): ditto
3903 (setReadonly): ditto
3905 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
3907 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
3908 avoid some uses of current_view. Added also a bufferParams()
3909 method to get at this.
3911 * src/lyxtext.h: changed params->buffer and paramters->bparams.
3913 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
3915 * src/lyxparagraph.[Ch]: removed
3916 operator<(LyXParagraph::InsetTable..., added a struct matchIT
3917 with operators used by lower_bound and
3918 upper_bound in InsetTable's
3919 Make struct InsetTable private again. Used matchpos.
3921 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
3923 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
3924 document, the language of existing text is changed (unless the
3925 document is multi-lingual)
3927 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
3929 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
3931 * A lot of files: A rewrite of the Right-to-Left support.
3933 2000-04-10 Juergen Vigna <jug@sad.it>
3935 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
3936 misplaced cursor when inset in inset is locked.
3938 * src/insets/insettext.C (LocalDispatch): small fix so that a
3939 BREAKLINE is not inserted if we don't permit it with autBreakRows.
3941 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
3942 footnote font should be decreased in size twice when displaying.
3944 * src/insets/insettext.C (GetDrawFont): inserted this function as
3945 the drawing-font may differ from the real paragraph font.
3947 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
3948 insets (inset in inset!).
3950 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
3951 function here because we don't want footnotes inside footnotes.
3953 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
3955 (init): now set the inset_owner in paragraph.C
3956 (LocalDispatch): added some resetPos() in the right position
3959 (pasteSelection): changed to use the new CutAndPaste-Class.
3961 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
3962 which tells if it is allowed to insert another inset inside this one.
3964 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
3965 SwitchLayoutsBetweenClasses.
3967 * src/text2.C (InsertInset): checking of the new paragraph-function
3969 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
3970 is not needed anymore here!
3973 (PasteSelection): redone (also with #ifdef) so that now this uses
3974 the CutAndPaste-Class.
3975 (SwitchLayoutsBetweenClasses): removed here and implemented in the
3978 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
3979 from/to text/insets.
3981 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
3982 so that the paragraph knows if it is inside an (text)-inset.
3983 (InsertFromMinibuffer): changed return-value to bool as now it
3984 may happen that an inset is not inserted in the paragraph.
3985 (InsertInsetAllowed): this checks if it is allowed to insert an
3986 inset in this paragraph.
3988 (BreakParagraphConservative):
3989 (BreakParagraph) : small change for the above change of the return
3990 value of InsertFromMinibuffer.
3992 * src/lyxparagraph.h: added inset_owner and the functions to handle
3993 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
3995 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
3997 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
3998 functions from BufferView to BufferView::Pimpl to ease maintence.
4000 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
4001 correctly. Also use SetCursorIntern instead of SetCursor.
4003 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
4006 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4008 * src/WorkArea.C (belowMouse): manually implement below mouse.
4010 * src/*: Add "explicit" on several constructors, I added probably
4011 some unneeded ones. A couple of changes to code because of this.
4013 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
4014 implementation and private parts from the users of BufferView. Not
4017 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
4018 implementation and private parts from the users of LyXLex. Not
4021 * src/BufferView_pimpl.[Ch]: new files
4023 * src/lyxlex_pimpl.[Ch]: new files
4025 * src/LyXView.[Ch]: some inline functions move out-of-line
4027 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4029 * src/lyxparagraph.h: make struct InsetTable public.
4031 * src/support/lyxstring.h: change lyxstring::difference_type to be
4032 ptrdiff_t. Add std:: modifiers to streams.
4034 * src/font.C: include the <cctype> header, for islower() and
4037 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4039 * src/font.[Ch]: new files. Contains the metric functions for
4040 fonts, takes a LyXFont as parameter. Better separation of concepts.
4042 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
4043 changes because of this.
4045 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
4047 * src/*: compile with -Winline and move functions that don't
4050 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
4053 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4055 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
4056 (various files changed because of this)
4058 * src/Painter.C (text): fixed the drawing of smallcaps.
4060 * src/lyxfont.[Ch] (drawText): removed unused member func.
4063 * src/*.C: added needed "using" statements and "std::" qualifiers.
4065 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4067 * src/*.h: removed all use of "using" from header files use
4068 qualifier std:: instead.
4070 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4072 * src/text.C (Backspace): some additional cleanups (we already
4073 know whether cursor.pos is 0 or not).
4075 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
4076 automake does not provide one).
4078 * src/bmtable.h: replace C++ comments with C comments.
4080 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
4082 * src/screen.C (ShowCursor): Change the shape of the cursor if
4083 the current language is not equal to the language of the document.
4084 (If the cursor change its shape unexpectedly, then you've found a bug)
4086 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
4089 * src/insets/insetnumber.[Ch]: New files.
4091 * src/LyXAction.C (init)
4092 * src/lyxfunc.C (dispatch): Add command number-inset-insert
4095 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
4097 * src/lyxparagraph.h
4098 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
4099 (the vector is kept sorted).
4101 * src/text.C (GetVisibleRow): Draw selection correctly when there
4102 is both LTR and RTL text.
4104 * src/paragraph.C (Clone): Use the assignment operator for cloning,
4105 which is much faster.
4107 * src/text.C (GetVisibleRow and other): Do not draw the last space
4108 in a row if the direction of the last letter is not equal to the
4109 direction of the paragraph.
4111 * src/lyxfont.C (latexWriteStartChanges):
4112 Check that font language is not equal to basefont language.
4113 (latexWriteEndChanges): ditto
4115 * src/lyx_cb.C (StyleReset): Don't change the language while using
4116 the font-default command.
4118 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
4119 empty paragraph before a footnote.
4121 * src/insets/insetcommand.C (draw): Increase x correctly.
4123 * src/screen.C (ShowCursor): Change cursor shape if
4124 current language != document language.
4126 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
4128 2000-03-31 Juergen Vigna <jug@sad.it>
4130 * src/paragraph.C (GetInset): commented out text[pos] = ' '
4131 (Clone): changed mode how the paragraph-data is copied to the
4132 new clone-paragraph.
4134 * src/lyxfunc.C (Dispatch): fixed small problem when calling
4135 GetInset(pos) with no inset anymore there (in inset UNDO)
4137 * src/insets/insetcommand.C (draw): small fix as here x is
4138 incremented not as much as width() returns (2 before, 2 behind = 4)
4140 2000-03-30 Juergen Vigna <jug@sad.it>
4142 * src/insets/insettext.C (InsetText): small fix in initialize
4143 widthOffset (should not be done in the init() function)
4145 2000-03-29 Amir Karger <karger@lyx.org>
4147 * lib/examples/it_ItemizeBullets.lyx: translation by
4150 * Implemented \textasciitilde and fixed a tiny bug in reLyX
4152 2000-03-29 Juergen Vigna <jug@sad.it>
4154 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
4156 * src/insets/insetfoot.C (Clone): small change as for the below
4157 new init function in the text-inset
4159 * src/insets/insettext.C (init): new function as I've seen that
4160 clone did not copy the Paragraph-Data!
4161 (LocalDispatch): Added code so that now we have some sort of Undo
4162 functionality (well actually we HAVE Undo ;)
4164 * src/text.C (Backspace): Small fix for the a | a Backspace problem
4166 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
4168 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
4171 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4173 * src/main.C: added a runtime check that verifies that the xforms
4174 header used when building LyX and the library used when running
4175 LyX match. Exit with a message if they don't match. This is a
4176 version number check only.
4178 * src/buffer.C (save): Don't allocate memory on the heap for
4179 struct utimbuf times.
4181 * *: some using changes, use iosfwd instead of the real headers.
4183 * src/lyxfont.C use char const * instead of string for the static
4184 strings. Rewrite some functions to use sstream.
4186 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4188 * src/text.C (Backspace): hopefully fix the dreaded backaspace
4191 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4193 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
4194 of Geodesy (from Martin Vermeer)
4196 * lib/layouts/svjour.inc: include file for the Springer svjour
4197 class. It can be used to support journals other than JoG.
4199 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
4200 Miskiewicz <misiek@pld.org.pl>)
4201 * lib/reLyX/Makefile.am: ditto.
4203 2000-03-27 Juergen Vigna <jug@sad.it>
4205 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
4206 also some modifications with operations on selected text.
4208 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
4209 problems with clicking on insets (last famous words ;)
4211 * src/insets/insetcommand.C (draw):
4212 (width): Changed to have a bit of space before and after the inset so
4213 that the blinking cursor can be seen (otherwise it was hidden)
4215 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4217 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
4218 would not be added to the link list when an installed gettext (not
4219 part of libc) is found.
4221 2000-03-24 Juergen Vigna <jug@sad.it>
4223 * src/insets/insetcollapsable.C (Edit):
4224 * src/mathed/formula.C (InsetButtonRelease):
4225 (InsetButtonPress): fixed for new handling of ButtonPress/Release
4228 * src/BufferView.C (workAreaButtonPress):
4229 (workAreaButtonRelease):
4230 (checkInsetHit): Finally fixed the clicking on insets be handled
4233 * src/insets/insetert.C (Edit): inserted this call so that ERT
4234 insets work always with LaTeX-font
4236 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
4238 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
4239 caused lyx to startup with no GUI in place, causing in a crash
4240 upon startup when called with arguments.
4242 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4244 * src/FontLoader.C: better initialization of dummyXFontStruct.
4246 2000-03-20 José Abílio Matos <jamatos@lyx.org>
4248 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
4249 for linuxdoc and docbook import and export format options.
4251 * lib/lyxrc.example Example of default values for the previous flags.
4253 * src/lyx_cb.C Use those flags instead of the hardwired values for
4254 linuxdoc and docbook export.
4256 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
4259 * src/menus.C Added menus entries for the new import/exports formats.
4261 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4263 * src/lyxrc.*: Added support for running without Gui
4266 * src/FontLoader.C: sensible defaults if no fonts are needed
4268 * src/lyx_cb.C: New function ShowMessage (writes either to the
4269 minibuffer or cout in case of no gui
4270 New function AskOverwrite for common stuff
4271 Consequently various changes to call these functions
4273 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
4274 wild guess at sensible screen resolution when having no gui
4276 * src/lyxfont.C: no gui, no fonts... set some defaults
4278 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4280 * src/LColor.C: made the command inset background a bit lighter.
4282 2000-03-20 Hartmut Goebel <goebel@noris.net>
4284 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
4285 stdstruct.inc. Koma-Script added some title elements which
4286 otherwise have been listed below "bibliography". This split allows
4287 adding title elements to where they belong.
4289 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
4290 define the additional tilte elements and then include
4293 * many other layout files: changed to include stdtitle.inc just
4294 before stdstruct.inc.
4296 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
4298 * src/buffer.C: (save) Added the option to store all backup files
4299 in a single directory
4301 * src/lyxrc.[Ch]: Added variable \backupdir_path
4303 * lib/lyxrc.example: Added descriptions of recently added variables
4305 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
4306 bibtex inset, not closing the bibtex popup when deleting the inset)
4308 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4310 * src/lyx_cb.C: add a couple using directives.
4312 2000-03-17 José Abílio Matos <jamatos@lyx.org>
4313 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
4314 import based on the filename.
4316 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
4317 file would be imported at start, if the filename where of a sgml file.
4319 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
4321 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
4323 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
4324 * src/lyxfont.h Replaced the member variable bits.direction by the
4325 member variable lang. Made many changes in other files.
4326 This allows having a multi-lingual document
4328 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
4329 that change the current language to <l>.
4330 Removed the command "font-rtl"
4332 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
4333 format for Hebrew documents)
4335 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
4336 When auto_mathmode is "true", pressing a digit key in normal mode
4337 will cause entering into mathmode.
4338 If auto_mathmode is "rtl" then this behavior will be active only
4339 when writing right-to-left text.
4341 * src/text2.C (InsertStringA) The string is inserted using the
4344 * src/paragraph.C (GetEndLabel) Gives a correct result for
4345 footnote paragraphs.
4347 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
4349 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4351 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
4352 front of PasteParagraph. Never insert a ' '. This should at least
4353 fix some cause for the segfaults that we have been experiencing,
4354 it also fixes backspace behaviour slightly. (Phu!)
4356 * src/support/lstrings.C (compare_no_case): some change to make it
4357 compile with gcc 2.95.2 and stdlibc++-v3
4359 * src/text2.C (MeltFootnoteEnvironment): change type o
4360 first_footnote_par_is_not_empty to bool.
4362 * src/lyxparagraph.h: make text private. Changes in other files
4364 (fitToSize): new function
4365 (setContentsFromPar): new function
4366 (clearContents): new function
4367 (SetChar): new function
4369 * src/paragraph.C (readSimpleWholeFile): deleted.
4371 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
4372 the file, just use a simple string instead. Also read the file in
4373 a more maintainable manner.
4375 * src/text2.C (InsertStringA): deleted.
4376 (InsertStringB): deleted.
4378 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4380 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
4381 RedoParagraphs from the doublespace handling part, just set status
4382 to NEED_MORE_REFRESH. Also don't update cursor position (should be
4383 done, but perhaps not like this.)
4385 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4387 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
4388 character when inserting an inset.
4390 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4392 * src/bufferparams.C (readLanguage): now takes "default" into
4395 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
4396 also initialize the toplevel_keymap with the default bindings from
4399 * src/buffer.C (Buffer): remove lyxrc from the parameters.
4401 * all files using lyxrc: have lyxrc as a real variable and not a
4402 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
4405 * src/lyxrc.C: remove double call to defaultKeyBindings
4407 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
4408 toolbar defauls using lyxlex. Remove enums, structs, functions
4411 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
4412 toolbar defaults. Also store default keybindings in a map.
4414 * src/ToolbarDefaults.[Ch]: New file. This class is used for
4415 storing the toolbar defaults without any xforms dependencies.
4417 * src/insets/figinset.C: patch posted to list by Andre Poenitz
4418 applied. Changed to use iterators.
4420 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
4422 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
4423 systems that don't have LINGUAS set to begin with.
4425 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4427 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
4428 the list by Dekel Tsur.
4430 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4432 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
4433 * src/insets/form_graphics.C: ditto.
4435 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
4437 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4439 * src/bufferparams.C (readLanguage): use the new language map
4441 * src/intl.C (InitKeyMapper): use the new language map
4443 * src/lyx_gui.C (create_forms): use the new language map
4445 * src/language.[Ch]: New files. Used for holding the information
4446 about each language. Now! Use this new language map enhance it and
4447 make it really usable for our needs.
4449 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
4451 * screen.C (ShowCursor): Removed duplicate code.
4452 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
4453 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
4455 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
4458 * src/text.C Added TransformChar method. Used for rendering Arabic
4459 text correctly (change the glyphs of the letter according to the
4460 position in the word)
4465 * src/lyxrc.C Added lyxrc command {language_command_begin,
4466 language_command_end,language_command_ltr,language_command_rtl,
4467 language_package} which allows the use of either arabtex or Omega
4470 * src/lyx_gui.C (init)
4472 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
4473 to use encoding for menu fonts which is different than the encoding
4476 * src/buffer.C (makeLaTeXFile): If params.language = "default",
4477 do not load the babel package.
4478 To write an English document with Hebrew/Arabic, change the document
4479 language to "english".
4481 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
4482 (alphaCounter): changed to return char
4483 (loweralphaCounter, hebrewCounter, romanCounter): New functions
4485 * lib/lyxrc.example Added examples for Hebrew/Arabic
4488 * src/layout.C Added layout command endlabeltype
4490 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
4492 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
4494 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4496 * src/mathed/math_delim.C (search_deco): return a
4497 math_deco_struct* instead of index.
4499 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4501 * All files with a USE_OSTREAM_ONLY within: removed all code that
4502 was unused when USE_OSTREAM_ONLY is defined.
4504 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
4505 of any less. Removed header and using.
4507 * src/text.C (GetVisibleRow): draw the string "Page Break
4508 (top/bottom)" on screen when drawing a pagebreak line.
4510 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4512 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
4514 * src/mathed/math_macro.C (draw): do some cast magic.
4517 * src/mathed/math_defs.h: change byte* argument to byte const*.
4519 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
4521 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
4522 know it is right to return InsetFoot* too, but cxx does not like
4525 * src/insets/insetcollapsable.[Ch] (Clone): make const.
4527 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
4529 * src/mathed/math_delim.C: change == to proper assignment.
4531 2000-03-09 Juergen Vigna <jug@sad.it>
4533 * src/insets/insettext.C (setPos): fixed various cursor positioning
4534 problems (via mouse and cursor-keys)
4535 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
4536 inset (still a small display problem but it works ;)
4538 * src/insets/insetcollapsable.C (draw): added button_top_y and
4539 button_bottom_y to have correct values for clicking on the inset.
4541 * src/support/lyxalgo.h: commented out 'using std::less'
4543 2000-03-08 Juergen Vigna <jug@sad.it>
4545 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
4546 Button-Release event closes as it is alos the Release-Event
4549 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
4551 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
4553 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
4554 can add multiple spaces in Scrap (literate programming) styles...
4555 which, by the way, is how I got hooked on LyX to begin with.
4557 * src/mathed/formula.C (Write): Added dummy variable to an
4558 inset::Latex() call.
4559 (Latex): Add free_spacing boolean to inset::Latex()
4561 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
4563 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
4564 virtual function to include the free_spacing boolean from
4565 the containing paragraph's style.
4567 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
4568 Added free_spacing boolean arg to match inset.h
4570 * src/insets/insettext.C, src/insets/insettext.h (Latex):
4571 Added free_spacing boolean arg to match inset.h
4573 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
4574 Added free_spacing boolean and made sure that if in a free_spacing
4575 paragraph, that we output normal space if there is a protected space.
4577 * src/insets/insetref.C, src/insets/insetref.h (Latex):
4578 Added free_spacing boolean arg to match inset.h
4580 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
4581 Added free_spacing boolean arg to match inset.h
4583 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
4584 Added free_spacing boolean arg to match inset.h
4586 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
4587 Added free_spacing boolean arg to match inset.h
4589 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
4590 Added free_spacing boolean arg to match inset.h
4592 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
4593 free_spacing boolean arg to match inset.h
4595 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
4596 Added free_spacing boolean arg to match inset.h
4598 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
4599 Added free_spacing boolean arg to match inset.h
4601 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
4602 Added free_spacing boolean arg to match inset.h
4604 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
4605 Added free_spacing boolean arg to match inset.h
4607 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
4608 Added free_spacing boolean arg to match inset.h
4610 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
4611 free_spacing boolean arg to match inset.h
4613 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
4614 free_spacing boolean arg to match inset.h
4616 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
4617 ignore free_spacing paragraphs. The user's spaces are left
4620 * src/text.C (InsertChar): Fixed the free_spacing layout
4621 attribute behavior. Now, if free_spacing is set, you can
4622 add multiple spaces in a paragraph with impunity (and they
4623 get output verbatim).
4624 (SelectSelectedWord): Added dummy argument to inset::Latex()
4627 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
4630 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
4631 paragraph layouts now only input a simple space instead.
4632 Special character insets don't make any sense in free-spacing
4635 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
4636 hard-spaces in the *input* file to simple spaces if the layout
4637 is free-spacing. This converts old files which had to have
4638 hard-spaces in free-spacing layouts where a simple space was
4640 (writeFileAscii): Added free_spacing check to pass to the newly
4641 reworked inset::Latex(...) methods. The inset::Latex() code
4642 ensures that hard-spaces in free-spacing paragraphs get output
4643 as spaces (rather than "~").
4645 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4647 * src/mathed/math_delim.C (draw): draw the empty placeholder
4648 delims with a onoffdash line.
4649 (struct math_deco_compare): struct that holds the "functors" used
4650 for the sort and the binary search in math_deco_table.
4651 (class init_deco_table): class used for initial sort of the
4653 (search_deco): use lower_bound to do a binary search in the
4656 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4658 * src/lyxrc.C: a small secret thingie...
4660 * src/lyxlex.C (printTable): changed to take a ostream as paramter
4661 and to not flush the stream as often as it used to.
4663 * src/support/lyxalgo.h: new file
4664 (sorted): template function used for checking if a sequence is
4665 sorted or not. Two versions with and without user supplied
4666 compare. Uses same compare as std::sort.
4668 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
4669 it and give warning on lyxerr.
4671 (struct compare_tags): struct with function operators used for
4672 checking if sorted, sorting and lower_bound.
4673 (search_kw): use lower_bound instead of manually implemented
4676 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4678 * src/insets/insetcollapsable.h: fix Clone() declaration.
4679 * src/insets/insetfoot.h: ditto.
4681 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
4683 2000-03-08 Juergen Vigna <jug@sad.it>
4685 * src/insets/lyxinset.h: added owner call which tells us if
4686 this inset is inside another inset. Changed also the return-type
4687 of Editable to an enum so it tells clearer what the return-value is.
4689 * src/insets/insettext.C (computeTextRows): fixed computing of
4690 textinsets which split automatically on more rows.
4692 * src/insets/insetert.[Ch]: changed this to be of BaseType
4695 * src/insets/insetfoot.[Ch]: added footnote inset
4697 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
4698 collapsable insets (like footnote, ert, ...)
4700 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4702 * src/lyxdraw.h: remvoe file
4704 * src/lyxdraw.C: remove file
4706 * src/insets/insettext.C: added <algorithm>.
4708 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
4710 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
4711 (matrix_cb): case MM_OK use string stream
4713 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
4716 * src/mathed/math_macro.C (draw): use string stream
4717 (Metrics): use string stream
4719 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
4720 directly to the ostream.
4722 * src/vspace.C (asString): use string stream.
4723 (asString): use string stream
4724 (asLatexString): use string stream
4726 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
4727 setting Spacing::Other.
4729 * src/LaTeXFeatures.C (getPackages): use string stream instead of
4730 sprintf when creating the stretch vale.
4732 * src/text2.C (alphaCounter): changed to return a string and to
4733 not use a static variable internally. Also fixed a one-off bug.
4734 (SetCounter): changed the drawing of the labels to use string
4735 streams instead of sprintf.
4737 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
4738 manipulator to use a scheme that does not require library support.
4739 This is also the way it is done in the new GNU libstdc++. Should
4740 work with DEC cxx now.
4742 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4744 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
4745 end. This fixes a bug.
4747 * src/mathed (all files concerned with file writing): apply the
4748 USE_OSTREAM_ONLY changes to mathed too.
4750 * src/support/DebugStream.h: make the constructor explicit.
4752 * src/lyxfont.C (latexWriteStartChanges): small bug related to
4753 count and ostream squashed.
4755 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4757 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
4759 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
4760 ostringstream uses STL strings, and we might not.
4762 * src/insets/insetspecialchar.C: add using directive.
4763 * src/insets/insettext.C: ditto.
4765 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4767 * lib/layouts/seminar.layout: feeble attempt at a layout for
4768 seminar.cls, far from completet and could really use some looking
4769 at from people used to write layout files.
4771 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
4772 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
4773 a lot nicer and works nicely with ostreams.
4775 * src/mathed/formula.C (draw): a slightly different solution that
4776 the one posted to the list, but I think this one works too. (font
4777 size wrong in headers.)
4779 * src/insets/insettext.C (computeTextRows): some fiddling on
4780 Jürgens turf, added some comments that he should read.
4782 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
4783 used and it gave compiler warnings.
4784 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
4787 * src/lyx_gui.C (create_forms): do the right thing when
4788 show_banner is true/false.
4790 * src/lyx_cb.C (TimerCB): no need to close or do anything if
4791 show_banner is false.
4793 * most file writing files: Now use iostreams to do almost all of
4794 the writing. Also instead of passing string &, we now use
4795 stringstreams. mathed output is still not adapted to iostreams.
4796 This change can be turned off by commenting out all the occurences
4797 of the "#define USE_OSTREAM_ONLY 1" lines.
4799 * src/WorkArea.C (createPixmap): don't output debug messages.
4800 (WorkArea): don't output debug messages.
4802 * lib/lyxrc.example: added a comment about the new variable
4805 * development/Code_rules/Rules: Added some more commente about how
4806 to build class interfaces and on how better encapsulation can be
4809 2000-03-03 Juergen Vigna <jug@sad.it>
4811 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
4812 automatically with the width of the LyX-Window
4814 * src/insets/insettext.C (computeTextRows): fixed update bug in
4815 displaying text-insets (scrollvalues where not initialized!)
4817 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4819 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
4820 id in the check of the result from lower_bound is not enough since
4821 lower_bound can return last too, and then res->id will not be a
4824 * all insets and some code that use them: I have conditionalized
4825 removed the Latex(string & out, ...) this means that only the
4826 Latex(ostream &, ...) will be used. This is a work in progress to
4827 move towards using streams for all output of files.
4829 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
4832 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4834 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
4835 routine (this fixes bug where greek letters were surrounded by too
4838 * src/support/filetools.C (findtexfile): change a bit the search
4839 algorithm, to fix bug introduced in 1.1.4. Note that --format is
4840 no longer passed to kpsewhich, we may have to change that later.
4842 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
4843 warning options to avoid problems with X header files (from Angus
4845 * acinclude.m4: regenerated.
4847 2000-03-02 Juergen Vigna <jug@sad.it>
4849 * src/insets/insettext.C (WriteParagraphData): Using the
4850 par->writeFile() function for writing paragraph-data.
4851 (Read): Using buffer->parseSingleLyXformat2Token()-function
4852 for parsing paragraph data!
4854 * src/buffer.C (readLyXformat2): removed all parse data and using
4855 the new parseSingleLyXformat2Token()-function.
4856 (parseSingleLyXformat2Token): added this function to parse (read)
4857 lyx-file-format (this is called also from text-insets now!)
4859 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4861 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
4864 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
4865 directly instead of going through a func. One very bad thing: a
4866 static LyXFindReplace, but I don't know where to place it.
4868 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
4869 string instead of char[]. Also changed to static.
4870 (GetSelectionOrWordAtCursor): changed to static inline
4871 (SetSelectionOverLenChars): ditto.
4873 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
4874 current_view and global variables. both classes has changed names
4875 and LyXFindReplace is not inherited from SearchForm.
4877 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
4878 fl_form_search form.
4880 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
4882 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4884 * lib/bind/*.bind: make sure 'buffer-previous' function is not
4885 bound (from Kayvan).
4887 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
4889 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
4891 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4893 * some things that I should comment but the local pub says head to
4896 * comment out all code that belongs to the Roff code for Ascii
4897 export of tables. (this is unused)
4899 * src/LyXView.C: use correct type for global variable
4900 current_layout. (LyXTextClass::size_type)
4902 * some code to get the new insetgraphics closer to working I'd be
4903 grateful for any help.
4905 * src/BufferView2.C (insertInset): use the return type of
4906 NumberOfLayout properly. (also changes in other files)
4908 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
4909 this as a test. I want to know what breaks because of this.
4911 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
4913 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
4915 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
4916 to use a \makebox in the label, this allows proper justification
4917 with out using protected spaces or multiple hfills. Now it is
4918 "label" for left justified, "\hfill label\hfill" for center, and
4919 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
4920 should be changed accordingly.
4922 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4924 * src/lyxtext.h: change SetLayout() to take a
4925 LyXTextClass::size_type instead of a char (when there is more than
4926 127 layouts in a class); also change type of copylayouttype.
4927 * src/text2.C (SetLayout): ditto.
4928 * src/LyXView.C (updateLayoutChoice): ditto.
4930 * src/LaTeX.C (scanLogFile): errors where the line number was not
4931 given just after the '!'-line were ignored (from Dekel Tsur).
4933 * lib/lyxrc.example: fix description of \date_insert_format
4935 * lib/layouts/llncs.layout: new layout, contributed by Martin
4938 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4940 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
4941 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
4942 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
4943 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
4944 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
4945 paragraph.C, text.C, text2.C)
4947 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4949 * src/insets/insettext.C (LocalDispatch): remove extra break
4952 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
4953 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
4955 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
4956 * src/insets/insettext.[Ch] (GetCursorPos): ditto
4958 * src/insets/insetbib.h: move InsetBibkey::Holder and
4959 InsetCitation::Holder in public space.
4961 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4963 * src/insets/insettext.h: small change to get the new files from
4964 Juergen to compile (use "string", not "class string").
4966 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
4967 const & as parameter to LocalDispatch, use LyXFont const & as
4968 paramter to some other func. This also had impacto on lyxinsets.h
4969 and the two mathed insets.
4971 2000-02-24 Juergen Vigna <jug@sad.it>
4974 * src/commandtags.h:
4976 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
4980 * src/BufferView2.C: added/updated code for various inset-functions
4982 * src/insets/insetert.[Ch]: added implementation of InsetERT
4984 * src/insets/insettext.[Ch]: added implementation of InsetText
4986 * src/insets/inset.C (Edit): added "unsigned int button" parameter
4987 (draw): added preliminary code for inset scrolling not finshed yet
4989 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
4990 as it is in lyxfunc.C now
4992 * src/insets/lyxinset.h: Added functions for text-insets
4994 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4996 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
4997 BufferView and reimplement the list as a queue put inside its own
5000 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
5002 * several files: use the new interface to the "updateinsetlist"
5004 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
5006 (work_area_handler): call BufferView::trippleClick on trippleclick.
5008 * src/BufferView.C (doubleClick): new function, selects word on
5010 (trippleClick): new function, selects line on trippleclick.
5012 2000-02-22 Allan Rae <rae@lyx.org>
5014 * lib/bind/xemacs.bind: buffer-previous not supported
5016 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5018 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
5021 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5023 * src/bufferlist.C: get rid of current_view from this file
5025 * src/spellchecker.C: get rid of current_view from this file
5027 * src/vspace.C: get rid of current_view from this file
5028 (inPixels): added BufferView parameter for this func
5029 (asLatexCommand): added a BufferParams for this func
5031 * src/text.C src/text2.C: get rid of current_view from these
5034 * src/lyxfont.C (getFontDirection): move this function here from
5037 * src/bufferparams.C (getDocumentDirection): move this function
5040 * src/paragraph.C (getParDirection): move this function here from
5042 (getLetterDirection): ditto
5044 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5046 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
5047 resize due to wrong pixmap beeing used. Also took the opurtunity
5048 to make the LyXScreen stateless on regard to WorkArea and some
5049 general cleanup in the same files.
5051 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5053 * src/Makefile.am: add missing direction.h
5055 * src/PainterBase.h: made the width functions const.
5057 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
5060 * src/insets/insetcommand.C (draw): draw Editable as buttons.
5062 * src/insets/insetlatexaccent.C (draw): make the accents draw
5063 better, at present this will only work well with iso8859-1.
5065 * several files: remove the old drawing code, now we use the new
5068 * several files: remove support for mono_video, reverse_video and
5071 2000-02-17 Juergen Vigna <jug@sad.it>
5073 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
5074 int ** as we have to return the pointer, otherwise we have only
5075 NULL pointers in the returning function.
5077 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5079 * src/LaTeX.C (operator()): quote file name when running latex.
5081 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5083 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
5084 (bubble tip), this removes our special handling of this.
5086 * Remove all code that is unused now that we have the new
5087 workarea. (Code that are not active when NEW_WA is defined.)
5089 * Make the uses of XSync not conditionalized on define USE_XSYNC.
5091 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5093 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
5094 nonexisting layout; correctly redirect obsoleted layouts.
5096 * lib/lyxrc.example: document \view_dvi_paper_option
5098 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
5101 * src/lyx_cb.C (RunScript): handle $$FName for command names.
5102 (PreviewDVI): handle the view_dvi_paper_option variable.
5103 [Both from Roland Krause]
5105 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5107 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
5108 char const *, int, LyXFont)
5109 (text(int, int, string, LyXFont)): ditto
5111 * src/text.C (InsertCharInTable): attempt to fix the double-space
5112 feature in tables too.
5113 (BackspaceInTable): ditto.
5114 (GetVisibleRow): make bottom pagebreak line be a onoff line.
5116 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5118 * src/text2.C (owner): only complain if owner_ is set and bv != 0
5120 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
5121 newly found text in textcache to this.
5122 (buffer): set the owner of the text put into the textcache to 0
5124 * src/insets/figinset.C (draw): fixed the drawing of figures with
5127 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
5128 drawing of mathframe, hfills, protected space, table lines. I have
5129 now no outstanding drawing problems with the new Painter code.
5131 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5133 * src/PainterBase.C (ellipse, circle): do not specify the default
5136 * src/LColor.h: add using directive.
5138 * src/Painter.[Ch]: change return type of methods from Painter& to
5139 PainterBase&. Add a using directive.
5141 * src/WorkArea.C: wrap xforms callbacks in C functions
5144 * lib/layouts/foils.layout: font fix and simplifications from Carl
5147 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5149 * a lot of files: The Painter, LColor and WorkArea from the old
5150 devel branch has been ported to lyx-devel. Some new files and a
5151 lot of #ifdeffed code. The new workarea is enabled by default, but
5152 if you want to test the new Painter and LColor you have to compile
5153 with USE_PAINTER defined (do this in config.h f.ex.) There are
5154 still some rought edges, and I'd like some help to clear those
5155 out. It looks stable (loads and displays the Userguide very well).
5158 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5160 * src/buffer.C (pop_tag): revert to the previous implementation
5161 (use a global variable for both loops).
5163 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
5165 * src/lyxrc.C (LyXRC): change slightly default date format.
5167 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
5168 there is an English text with a footnote that starts with a Hebrew
5169 paragraph, or vice versa.
5170 (TeXFootnote): ditto.
5172 * src/text.C (LeftMargin): allow for negative values for
5173 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
5176 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
5177 for input encoding (cyrillic)
5179 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5181 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
5184 * src/toolbar.C (set): ditto
5185 * src/insets/insetbib.C (create_form_citation_form): ditto
5187 * lib/CREDITS: added Dekel Tsur.
5189 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
5190 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
5191 hebrew supports files from Dekel Tsur.
5193 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
5194 <tzafrir@technion.ac.il>
5196 * src/lyxrc.C: put \date_insert_format at the right place.
5198 * src/buffer.C (makeLaTeXFile): fix the handling of
5199 BufferParams::sides when writing out latex files.
5201 * src/BufferView2.C: add a "using" directive.
5203 * src/support/lyxsum.C (sum): when we use lyxstring,
5204 ostringstream::str needs an additional .c_str().
5206 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5208 * src/support/filetools.C (ChangeExtension): patch from Etienne
5211 * src/TextCache.C (show): remove const_cast and make second
5212 parameter non-const LyXText *.
5214 * src/TextCache.h: use non const LyXText in show.
5216 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
5219 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5221 * src/support/lyxsum.C: rework to be more flexible.
5223 * several places: don't check if a pointer is 0 if you are going
5226 * src/text.C: remove some dead code.
5228 * src/insets/figinset.C: remove some dead code
5230 * src/buffer.C: move the BufferView funcs to BufferView2.C
5231 remove all support for insetlatexdel
5232 remove support for oldpapersize stuff
5233 made some member funcs const
5235 * src/kbmap.C: use a std::list to store the bindings in.
5237 * src/BufferView2.C: new file
5239 * src/kbsequence.[Ch]: new files
5241 * src/LyXAction.C + others: remove all trace of buffer-previous
5243 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
5244 only have one copy in the binary of this table.
5246 * hebrew patch: moved some functions from LyXText to more
5247 appropriate places. (LyXParagraph, BufferParams, LyXFont)
5249 * several files: remove support for XForms older than 0.88
5251 remove some #if 0 #endif code
5253 * src/TextCache.[Ch]: new file. Holds the textcache.
5255 * src/BufferView.C: changes to use the new TextCache interface.
5256 (waitForX): remove the now unused code.
5258 * src/BackStack.h: remove some commented code
5260 * lib/bind/emacs.bind: remove binding for buffer-previous
5262 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5264 * applied the hebrew patch.
5266 * src/lyxrow.h: make sure that all Row variables are initialized.
5268 * src/text2.C (TextHandleUndo): comment out a delete, this might
5269 introduce a memory leak, but should also help us to not try to
5270 read freed memory. We need to look at this one.
5272 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
5273 (LyXParagraph): initalize footnotekind.
5275 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
5276 forgot this when applying the patch. Please heed the warnings.
5278 * src/BufferView.C (buffer): a fix for the buffer-reload problem
5279 (aka. reformat problem)
5281 * src/bufferlist.C (exists): made const, and use const_iterator
5282 (isLoaded): new func.
5283 (release): use std::find to find the correct buffer.
5285 * src/bufferlist.h: made getState a const func.
5286 made empty a const func.
5287 made exists a const func.
5290 2000-02-01 Juergen Vigna <jug@sad.it>
5292 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
5294 * po/it.po: updated a bit the italian po file and also changed the
5295 'file nuovo' for newfile to 'filenuovo' without a space, this did
5298 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
5299 for the new insert_date command.
5301 * src/lyxfunc.C (Dispatch): added support for a insert_date function
5302 from jdblair, to insert a date into the current text conforming to
5303 a strftime format (for now only considering the locale-set and not
5304 the document-language).
5306 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5308 * src/lyxfont.C (textWidth): hopefully better fix for the Array
5309 Bounds Read error seen by purify. The problem was that islower is
5310 a macros which takes an unsigned char and uses it as an index for
5311 in array of characters properties (and is thus subject to the
5315 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
5316 correctly the paper sides radio buttons.
5317 (UpdateDocumentButtons): ditto.
5319 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5321 * src/kbmap.C (getsym + others): change to return unsigned int,
5322 returning a long can give problems on 64 bit systems. (I assume
5323 that int is 32bit on 64bit systems)
5325 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5327 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
5328 LyXLookupString to be zero-terminated. Really fixes problems seen
5331 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5333 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
5334 write a (char*)0 to the lyxerr stream.
5336 * src/lastfiles.C: move algorithm before the using statemets.
5338 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5340 * src/lastfiles.C: move using directives in global scope (egcs 1.x
5341 complains otherwise).
5342 * src/table.C: ditto
5344 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
5347 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
5348 that I removed earlier... It is really needed.
5350 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
5352 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5354 * INSTALL: update xforms home page URL.
5356 * lib/configure.m4: fix a bug with unreadable layout files.
5358 * src/table.C (calculate_width_of_column): add "using std::max"
5361 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5363 * several files: marked several lines with "DEL LINE", this is
5364 lines that can be deleted without changing anything.
5365 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
5366 checks this anyway */
5369 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
5371 * src/DepTable.C (update): add a "+" at the end when the checksum
5372 is different. (debugging string only)
5374 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
5375 the next inset to not be displayed. This should also fix the list
5376 of labels in the "Insert Crossreference" dialog.
5378 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
5380 * src/support/LSubstring.C (LSubstring): set pos to string::npos
5381 when regex was not found.
5383 * src/support/lstrings.C (lowercase): use handcoded transform always.
5386 * src/text.C (Delete): fixed the crash. cursor.par->prev and
5387 old_cursor.par->prev could be 0.
5389 * several files: changed post inc/dec to pre inc/dec
5391 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
5392 write the lastfiles to file.
5394 * src/BufferView.C (buffer): only show TextCache info when debugging
5396 (resizeCurrentBuffer): ditto
5397 (workAreaExpose): ditto
5399 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
5401 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
5403 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
5404 a bit better by removing the special case for \i and \j.
5406 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5408 * src/lyx_main.C (easyParse): remove test for bad comand line
5409 options, since this broke all xforms-related parsing.
5411 * src/kbmap.C (getsym): set return type to unsigned long, as
5412 declared in header. On an alpha, long is _not_ the same as int.
5414 * src/support/LOstream.h: add a "using std::flush;"
5416 * src/insets/figinset.C: ditto.
5418 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5420 * src/bufferlist.C (write): use blinding fast file copy instead of
5421 "a char at a time", now we are doing it the C++ way.
5423 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
5424 std::list<int> instead.
5425 (addpidwait): reflect move to std::list<int>
5426 (sigchldchecker): ditto
5428 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
5431 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
5432 that obviously was wrong...
5434 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
5435 c, this avoids warnings with purify and islower.
5437 * src/insets/figinset.C: rename struct queue to struct
5438 queue_element and rewrite to use a std::queue. gsqueue is now a
5439 std::queue<queue_element>
5440 (runqueue): reflect move to std::queue
5443 * src/support/lstrings.h (tostr): specialize for bool, otherwise
5444 we would get "1" "0" instead of "true" "false. Also make the tostr
5447 2000-01-21 Juergen Vigna <jug@sad.it>
5449 * src/buffer.C (writeFileAscii): Disabled code for special groff
5450 handling of tabulars till I fix this in table.C
5452 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5454 * src/support/mkdir.C (mkdir): change second argument of mkdir to
5456 * src/support/lyxlib.h: ditto.
5458 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5460 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
5461 and 'j' look better. This might fix the "macron" bug that has been
5464 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
5465 functions as one template function. Delete the old versions.
5467 * src/support/lyxsum.C: move using std::ifstream inside
5470 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
5473 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
5475 * src/mathed/formula.C: delete #include "bufferlist.h" never used
5477 * src/insets/figinset.C (InitFigures): use new instead of malloc
5478 to allocate memory for figures and bitmaps.
5479 (DoneFigures): use delete[] instead of free to deallocate memory
5480 for figures and bitmaps.
5481 (runqueue): use new to allocate
5482 (getfigdata): use new/delete[] instead of malloc/free
5483 (RegisterFigure): ditto
5485 * some files: moved some declarations closer to first use, small
5486 whitespace changes use preincrement instead of postincrement where
5487 it does not make a difference.
5489 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
5490 step on the way to use stl::containers for key maps.
5492 * src/bufferlist.h: add a typedef for const_iterator and const
5493 versions of begin and end.
5495 * src/bufferlist.[Ch]: change name of member variable _state to
5496 state_. (avoid reserved names)
5498 (getFileNames): returns the filenames of the buffers in a vector.
5500 * configure.in (ALL_LINGUAS): added ro
5502 * src/support/putenv.C: new file
5504 * src/support/mkdir.C: new file
5506 2000-01-20 Allan Rae <rae@lyx.org>
5508 * lib/layouts/IEEEtran.layout: Added several theorem environments
5510 * lib/templates/IEEEtran.lyx: Example theorem environments and a
5511 couple of minor additions.
5513 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
5514 (except for those in footnotes of course)
5516 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5518 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
5520 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
5521 std::sort and std::lower_bound instead of qsort and handwritten
5523 (struct compara): struct that holds the functors used by std::sort
5524 and std::lower_bound in MathedLookupBOP.
5526 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5528 * src/support/LAssert.h: do not do partial specialization. We do
5531 * src/support/lyxlib.h: note that lyx::getUserName() and
5532 lyx::date() are not in use right now. Should these be suppressed?
5534 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
5535 (makeLinuxDocFile): do not put date and user name in linuxdoc
5538 * src/support/lyxlib.h (kill): change first argument to long int,
5539 since that's what solaris uses.
5541 * src/support/kill.C (kill): fix declaration to match prototype.
5543 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
5544 actually check whether namespaces are supported. This is not what
5547 * src/support/lyxsum.C: add a using directive.
5549 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5551 * src/support/kill.C: if we have namespace support we don't have
5552 to include lyxlib.h.
5554 * src/support/lyxlib.h: use namespace lyx if supported.
5556 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5558 * src/support/date.C: new file
5560 * src/support/chdir.C: new file
5562 * src/support/getUserName.C: new file
5564 * src/support/getcwd.C: new file
5566 * src/support/abort.C: new file
5568 * src/support/kill.C: new file
5570 * src/support/lyxlib.h: moved all the functions in this file
5571 insede struct lyx. Added also kill and abort to this struct. This
5572 is a way to avoid the "kill is not defined in <csignal>", we make
5573 C++ wrappers for functions that are not ANSI C or ANSI C++.
5575 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
5576 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
5577 lyx it has been renamed to sum.
5579 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5581 * src/text.C: add using directives for std::min and std::max.
5583 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5585 * src/texrow.C (getIdFromRow): actually return something useful in
5586 id and pos. Hopefully fixes the bug with positionning of errorbox
5589 * src/lyx_main.C (easyParse): output an error and exit if an
5590 incorrect command line option has been given.
5592 * src/spellchecker.C (ispell_check_word): document a memory leak.
5594 * src/bufferlist.C (write): fix mismatched allocation/deletion,
5595 where a "struct utimbuf" is allocated with "new" and deleted with
5598 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
5600 * src/text2.C (CutSelection): don't delete double spaces.
5601 (PasteSelection): ditto
5602 (CopySelection): ditto
5604 * src/text.C (Backspace): don't delete double spaces.
5606 * src/lyxlex.C (next): fix a bug that were only present with
5607 conformant std::istream::get to read comment lines, use
5608 std::istream::getline instead. This seems to fix the problem.
5610 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5612 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
5613 allowed to insert space before space" editing problem. Please read
5614 commends at the beginning of the function. Comments about usage
5617 * src/text.C (InsertChar): fix for the "not allowed to insert
5618 space before space" editing problem.
5620 * src/text2.C (DeleteEmptyParagraphMechanism): when
5621 IsEmptyTableRow can only return false this last "else if" will
5622 always be a no-op. Commented out.
5624 * src/text.C (RedoParagraph): As far as I can understand tmp
5625 cursor is not really needed.
5627 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
5628 present it could only return false anyway.
5629 (several functions): Did something not so smart...added a const
5630 specifier on a lot of methods.
5632 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
5633 and add a tmp->text.resize. The LyXParagraph constructor does the
5635 (BreakParagraphConservative): ditto
5637 * src/support/path.h (Path): add a define so that the wrong usage
5638 "Path("/tmp") will be flagged as a compilation error:
5639 "`unnamed_Path' undeclared (first use this function)"
5641 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5643 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
5644 which was bogus for several reasons.
5646 * src/LaTeX.C (scanAux): fix the regular expression used to scan
5650 * autogen.sh: do not use "type -path" (what's that anyway?).
5652 * src/support/filetools.C (findtexfile): remove extraneous space
5653 which caused a kpsewhich warning (at least with kpathsea version
5656 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5658 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
5660 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
5662 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
5664 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5666 * src/paragraph.C (BreakParagraph): do not reserve space on text
5667 if we don't need to (otherwise, if pos_end < pos, we end up
5668 reserving huge amounts of memory due to bad unsigned karma).
5669 (BreakParagraphConservative): ditto, although I have not seen
5670 evidence the bug can happen here.
5672 * src/lyxparagraph.h: add a using std::list.
5674 2000-01-11 Juergen Vigna <jug@sad.it>
5676 * src/menus.C (MenuDocu): output an Alert if the documentation-file
5679 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5681 * src/vc-backend.C (doVCCommand): change to be static and take one
5682 more parameter: the path to chdir too be fore executing the command.
5683 (retrive): new function equiv to "co -r"
5685 * src/bufferlist.C (loadLyXFile): implement the missing parts if
5686 file_not_found_hook is true.
5688 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
5690 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
5691 if a file is readwrite,readonly...anything else.
5693 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5695 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
5696 (CreatePostscript): name change from MenuRunDVIPS (or something)
5697 (PreviewPostscript): name change from MenuPreviewPS
5698 (PreviewDVI): name change from MenuPreviewDVI
5700 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
5701 \view_pdf_command., \pdf_to_ps_command
5703 * lib/configure.m4: added search for PDF viewer, and search for
5704 PDF to PS converter.
5705 (lyxrc.defaults output): add \pdflatex_command,
5706 \view_pdf_command and \pdf_to_ps_command.
5708 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
5710 * src/bufferlist.C (write): we don't use blocksize for anything so
5713 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5715 * src/support/block.h: disable operator T* (), since it causes
5716 problems with both compilers I tried. See comments in the file.
5718 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
5721 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
5722 variable LYX_DIR_10x to LYX_DIR_11x.
5724 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
5726 * INSTALL: document --with-lyxname.
5729 * configure.in: new configure flag --with-lyxname which allows to
5730 choose the name under which lyx is installed. Default is "lyx", of
5731 course. It used to be possible to do this with --program-suffix,
5732 but the later has in fact a different meaning for autoconf.
5734 * src/support/lstrings.h (lstrchr): reformat a bit.
5736 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
5737 * src/mathed/math_defs.h: ditto.
5739 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5741 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
5742 true, decides if we create a backup file or not when saving. New
5743 tag and variable \pdf_mode, defaults to false. New tag and
5744 variable \pdflatex_command, defaults to pdflatex. New tag and
5745 variable \view_pdf_command, defaults to xpdf. New tag and variable
5746 \pdf_to_ps_command, defaults to pdf2ps.
5748 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5750 * src/bufferlist.C (close): don't call insetUnlock if the buffer
5751 does not have a BufferView.
5752 (unlockInset): ditto + don't access the_locking_inset if the
5753 buffer does not have a BufferView.
5755 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
5756 certain circumstances so that we don't continue a keyboard
5757 operation long after the key was released. Try f.ex. to load a
5758 large document, press PageDown for some seconds and then release
5759 it. Before this change the document would contine to scroll for
5760 some time, with this change it stops imidiatly.
5762 * src/support/block.h: don't allocate more space than needed. As
5763 long as we don't try to write to the arr[x] in a array_type arr[x]
5764 it is perfectly ok. (if you write to it you might segfault).
5765 added operator value_type*() so that is possible to pass the array
5766 to functions expecting a C-pointer.
5768 * lib/Makefile.am (dist-hook): don't fail completely if unable to
5771 * intl/*: updated to gettext 0.10.35, tried to add our own
5772 required modifications. Please verify.
5774 * po/*: updated to gettext 0.10.35, tried to add our own required
5775 modifications. Please verify.
5777 * src/support/lstrings.C (tostr): go at fixing the problem with
5778 cxx and stringstream. When stringstream is used return
5779 oss.str().c_str() so that problems with lyxstring and basic_string
5780 are avoided. Note that the best solution would be for cxx to use
5781 basic_string all the way, but it is not conformant yet. (it seems)
5783 * src/lyx_cb.C + other files: moved several global functions to
5784 class BufferView, some have been moved to BufferView.[Ch] others
5785 are still located in lyx_cb.C. Code changes because of this. (part
5786 of "get rid of current_view project".)
5788 * src/buffer.C + other files: moved several Buffer functions to
5789 class BufferView, the functions are still present in buffer.C.
5790 Code changes because of this.
5792 * config/lcmessage.m4: updated to most recent. used when creating
5795 * config/progtest.m4: updated to most recent. used when creating
5798 * config/gettext.m4: updated to most recent. applied patch for
5801 * config/gettext.m4.patch: new file that shows what changes we
5802 have done to the local copy of gettext.m4.
5804 * config/libtool.m4: new file, used in creation of acinclude.m4
5806 * config/lyxinclude.m4: new file, this is the lyx created m4
5807 macros, used in making acinclude.m4.
5809 * autogen.sh: GNU m4 discovered as a separate task not as part of
5810 the lib/configure creation.
5811 Generate acinlucde from files in config. Actually cat
5812 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
5813 easier to upgrade .m4 files that really are external.
5815 * src/Spacing.h: moved using std::istringstream to right after
5816 <sstream>. This should fix the problem seen with some compilers.
5818 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5820 * src/lyx_cb.C: began some work to remove the dependency a lot of
5821 functions have on BufferView::text, even if not really needed.
5822 (GetCurrentTextClass): removed this func, it only hid the
5825 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
5826 forgot this in last commit.
5828 * src/Bullet.C (bulletEntry): use static char const *[] for the
5829 tables, becuase of this the return arg had to change to string.
5831 (~Bullet): removed unneeded destructor
5833 * src/BufferView.C (beforeChange): moved from lyx_cb.C
5834 (insetSleep): moved from Buffer
5835 (insetWakeup): moved from Buffer
5836 (insetUnlock): moved from Buffer
5838 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
5839 from Buffer to BufferView.
5841 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
5843 * config/ltmain.sh: updated to version 1.3.4 of libtool
5845 * config/ltconfig: updated to version 1.3.4 of libtool
5847 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5850 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
5851 Did I get that right?
5853 * src/lyxlex.h: add a "using" directive or two.
5854 * src/Spacing.h: ditto.
5855 * src/insets/figinset.C: ditto.
5856 * src/support/filetools.C: ditto.
5857 * src/support/lstrings.C: ditto.
5858 * src/BufferView.C: ditto.
5859 * src/bufferlist.C: ditto.
5860 * src/lyx_cb.C: ditto.
5861 * src/lyxlex.C: ditto.
5863 * NEWS: add some changes for 1.1.4.
5865 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5867 * src/BufferView.C: first go at a TextCache to speed up switching
5870 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5872 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
5873 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
5874 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
5875 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
5878 * src/mathed/math_defs.h (MathedRowSt): make sure that all
5879 members of the struct are correctly initialized to 0 (detected by
5881 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
5882 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
5884 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
5885 pidwait, since it was allocated with "new". This was potentially
5886 very bad. Thanks to Michael Schmitt for running purify for us.
5889 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5891 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
5893 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
5895 1999-12-30 Allan Rae <rae@lyx.org>
5897 * lib/templates/IEEEtran.lyx: minor change
5899 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
5900 src/mathed/formula.C (LocalDispatch): askForText changes
5902 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
5903 know when a user has cancelled input. Fixes annoying problems with
5904 inserting labels and version control.
5906 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
5908 * src/support/lstrings.C (tostr): rewritten to use strstream and
5911 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5913 * src/support/filetools.C (IsFileWriteable): use fstream to check
5914 (IsDirWriteable): use fileinfo to check
5916 * src/support/filetools.h (FilePtr): whole class deleted
5918 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
5920 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
5922 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
5924 * src/bufferlist.C (write): use ifstream and ofstream instead of
5927 * src/Spacing.h: use istrstream instead of sscanf
5929 * src/mathed/math_defs.h: change first arg to istream from FILE*
5931 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
5933 * src/mathed/math_parser.C: have yyis to be an istream
5934 (LexGetArg): use istream (yyis)
5936 (mathed_parse): ditto
5937 (mathed_parser_file): first arg istream instead of FILE*, set yyis
5939 * src/mathed/formula.C (Read): rewritten to use istream
5941 * src/mathed/formulamacro.C (Read): rewritten to use istream
5943 * src/lyxlex.h (~LyXLex): deleted desturctor
5944 (getStream): new function, returns an istream
5945 (getFile): deleted funtion
5946 (IsOK): return is.good();
5948 * src/lyxlex.C (LyXLex): delete file and owns_file
5949 (setFile): open an filebuf and assign that to a istream instead of
5951 (setStream): new function, takes an istream as arg.
5952 (setFile): deleted function
5953 (EatLine): rewritten us use istream instead of FILE*
5957 * src/table.C (LyXTable): use istream instead of FILE*
5958 (Read): rewritten to take an istream instead of FILE*
5960 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5962 * src/buffer.C (Dispatch): remove an extraneous break statement.
5964 * src/support/filetools.C (QuoteName): change to do simple
5965 'quoting'. More work is necessary. Also changed to do nothing
5966 under emx (needs fix too).
5967 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
5969 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
5970 config.h.in to the AC_DEFINE_UNQUOTED() call.
5971 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
5972 needs char * as argument (because Solaris 7 declares it like
5975 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
5976 remove definition of BZERO.
5978 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
5980 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
5981 defined, "lyxregex.h" if not.
5983 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
5985 (REGEX): new variable that is set to regex.c lyxregex.h when
5986 AM_CONDITIONAL USE_REGEX is set.
5987 (libsupport_la_SOURCES): add $(REGEX)
5989 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
5992 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
5995 * configure.in: add call to LYX_REGEX
5997 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
5998 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
6000 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6002 * lib/bind/fi_menus.bind: new file, from
6003 pauli.virtanen@saunalahti.fi.
6005 * src/buffer.C (getBibkeyList): pass the parameter delim to
6006 InsetInclude::getKeys and InsetBibtex::getKeys.
6008 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
6009 is passed to Buffer::getBibkeyList
6011 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
6012 instead of the hardcoded comma.
6014 * src/insets/insetbib.C (getKeys): make sure that there are not
6015 leading blanks in bibtex keys. Normal latex does not care, but
6016 harvard.sty seems to dislike blanks at the beginning of citation
6017 keys. In particular, the retturn value of the function is
6019 * INSTALL: make it clear that libstdc++ is needed and that gcc
6020 2.7.x probably does not work.
6022 * src/support/filetools.C (findtexfile): make debug message go to
6024 * src/insets/insetbib.C (getKeys): ditto
6026 * src/debug.C (showTags): make sure that the output is correctly
6029 * configure.in: add a comment for TWO_COLOR_ICON define.
6031 * acconfig.h: remove all the entries that already defined in
6032 configure.in or acinclude.m4.
6034 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
6035 to avoid user name, date and copyright.
6037 1999-12-21 Juergen Vigna <jug@sad.it>
6039 * src/table.C (Read): Now read bogus row format informations
6040 if the format is < 5 so that afterwards the table can
6041 be read by lyx but without any format-info. Fixed the
6042 crash we experienced when not doing this.
6044 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6046 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
6047 (RedoDrawingOfParagraph): ditto
6048 (RedoParagraphs): ditto
6049 (RemoveTableRow): ditto
6051 * src/text.C (Fill): rename arg paperwidth -> paper_width
6053 * src/buffer.C (insertLyXFile): rename var filename -> fname
6054 (writeFile): rename arg filename -> fname
6055 (writeFileAscii): ditto
6056 (makeLaTeXFile): ditto
6057 (makeLinuxDocFile): ditto
6058 (makeDocBookFile): ditto
6060 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
6063 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
6065 * src/bmtable.h: add extern "C" on this file when __cplusplus is
6068 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
6069 compiled by a C compiler not C++.
6071 * src/layout.h (LyXTextClass): added typedef for const_iterator
6072 (LyXTextClassList): added typedef for const_iterator + member
6073 functions begin and end.
6075 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
6076 iterators to fill the choice_class.
6077 (updateLayoutChoice): rewritten to use iterators to fill the
6078 layoutlist in the toolbar.
6080 * src/BufferView.h (BufferView::work_area_width): removed unused
6083 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
6085 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
6086 (sgmlCloseTag): ditto
6088 * src/support/lstrings.h: return type of countChar changed to
6091 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
6092 what version of this func to use. Also made to return unsigned int.
6094 * configure.in: call LYX_STD_COUNT
6096 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
6097 conforming std::count.
6099 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6101 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
6102 and a subscript would give bad display (patch from Dekel Tsur
6103 <dekel@math.tau.ac.il>).
6105 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
6107 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
6110 * src/chset.h: add a few 'using' directives
6112 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
6113 triggered when no buffer is active
6115 * src/layout.C: removed `break' after `return' in switch(), since
6118 * src/lyx_main.C (init): make sure LyX can be ran in place even
6119 when libtool has done its magic with shared libraries. Fix the
6120 test for the case when the system directory has not been found.
6122 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
6123 name for the latex file.
6124 (MenuMakeHTML): ditto
6126 * src/buffer.h: add an optional boolean argument, which is passed
6129 1999-12-20 Allan Rae <rae@lyx.org>
6131 * lib/templates/IEEEtran.lyx: small correction and update.
6133 * configure.in: Attempted to use LYX_PATH_HEADER
6135 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
6137 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
6138 input from JMarc. Now use preprocessor to find the header.
6139 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
6140 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
6141 LYX_STL_STRING_FWD. See comments in file.
6143 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
6145 * The global MiniBuffer * minibuffer variable is dead.
6147 * The global FD_form_main * fd_form_main variable is dead.
6149 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6151 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
6153 * src/table.h: add the LOstream.h header
6154 * src/debug.h: ditto
6156 * src/LyXAction.h: change the explaination of the ReadOnly
6157 attribute: is indicates that the function _can_ be used.
6159 * src/LyXAction.C (init): find-replace _can_ be used in read-only
6162 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6164 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
6170 * src/paragraph.C (GetWord): assert on pos>=0
6173 * src/support/lyxstring.C: condition the use of an invariant on
6175 * src/support/lyxstring.h: ditto
6177 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
6178 Use LAssert.h instead of plain assert().
6180 * src/support/lstrings.h: add LAssert.h, in case it is needed.
6182 * src/lyxfunc.C: do not include LAssert.h, it is not used.
6183 * src/support/filetools.C: ditto
6185 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
6188 * INSTALL: document the new configure flags
6190 * configure.in: suppress --with-debug; add --enable-assertions
6192 * acinclude.m4: various changes in alignment of help strings.
6194 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6196 * src/kbmap.C: commented out the use of the hash map in kb_map,
6197 beginning of movement to a stl::container.
6199 * several files: removed code that was not in effect when
6200 MOVE_TEXT was defined.
6202 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
6203 for escaping should not be used. We can discuss if the string
6204 should be enclosed in f.ex. [] instead of "".
6206 * src/trans_mgr.C (insert): use the new returned value from
6207 encodeString to get deadkeys and keymaps done correctly.
6209 * src/chset.C (encodeString): changed to return a pair, to tell
6210 what to use if we know the string.
6212 * src/lyxscreen.h (fillArc): new function.
6214 * src/FontInfo.C (resize): rewritten to use more std::string like
6215 structore, especially string::replace.
6217 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
6220 * configure.in (chmod +x some scripts): remove config/gcc-hack
6222 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6224 * src/buffer.C (writeFile): change once again the top comment in a
6225 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
6226 instead of an hardcoded version number.
6227 (makeDocBookFile): ditto
6229 * src/version.h: add new define LYX_DOCVERSION
6231 * po/de.po: update from Pit Sütterlin
6232 * lib/bind/de_menus.bind: ditto.
6234 * src/lyxfunc.C (Dispatch): call MenuExport()
6235 * src/buffer.C (Dispatch): ditto
6237 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
6238 LyXFunc::Dispatch().
6239 (MenuExport): new function, moved from
6240 LyXFunc::Dispatch().
6242 * src/trans_mgr.C (insert): small cleanup
6243 * src/chset.C (loadFile): ditto
6245 * lib/kbd/iso8859-1.cdef: add missing backslashes
6247 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6249 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
6250 help with placing the manually drawn accents better.
6252 (Draw): x2 and hg changed to float to minimize rounding errors and
6253 help place the accents better.
6255 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
6256 unsigned short to char is just wrong...cast the char to unsigned
6257 char instead so that the two values can compare sanely. This
6258 should also make the display of insetlatexaccents better and
6259 perhaps also some other insets.
6261 (lbearing): new function
6264 1999-12-15 Allan Rae <rae@lyx.org>
6266 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
6267 header that provides a wrapper around the very annoying SGI STL header
6270 * src/support/lyxstring.C, src/LString.h:
6271 removed old SGI-STL-compatability attempts.
6273 * configure.in: Use LYX_STL_STRING_FWD.
6275 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
6276 stl_string_fwd.h is around and try to determine it's location.
6277 Major improvement over previous SGI STL 3.2 compatability.
6278 Three small problems remain with this function due to my zero
6279 knowledge of autoconf. JMarc and lgb see the comments in the code.
6281 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6283 * src/broken_const.h, config/hack-gcc, config/README: removed
6285 * configure.in: remove --with-gcc-hack option; do not call
6288 * INSTALL: remove documentation of --with-broken-const and
6291 * acconfig.h: remove all trace of BROKEN_CONST define
6293 * src/buffer.C (makeDocBookFile): update version number in output
6295 (SimpleDocBookOnePar): fix an assert when trying to a character
6296 access beyond string length
6299 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6301 * po/de.po: fix the Export menu
6303 * lyx.man: update the description of -dbg
6305 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
6306 (commandLineHelp): updated
6307 (easyParse): show list of available debug levels if -dbg is passed
6310 * src/Makefile.am: add debug.C
6312 * src/debug.h: moved some code to debug.C
6314 * src/debug.C: new file. Contains code to set and show debug
6317 * src/layout.C: remove 'break' after 'continue' in switch
6318 statements, since these cannot be reached.
6320 1999-12-13 Allan Rae <rae@lyx.org>
6322 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
6323 (in_word_set): hash() -> math_hash()
6325 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
6327 * acconfig.h: Added a test for whether we are using exceptions in the
6328 current compilation run. If so USING_EXCEPTIONS is defined.
6330 * config.in: Check for existance of stl_string_fwd.h
6331 * src/LString.h: If compiling --with-included-string and SGI's
6332 STL version 3.2 is present (see above test) we need to block their
6333 forward declaration of string and supply a __get_c_string().
6334 However, it turns out this is only necessary if compiling with
6335 exceptions enabled so I've a bit more to add yet.
6337 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
6338 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
6339 src/support/LRegex.h, src/undo.h:
6340 Shuffle the order of the included files a little to ensure that
6341 LString.h gets included before anything that includes stl_string_fwd.h
6343 * src/support/lyxstring.C: We need to #include LString.h instead of
6344 lyxstring.h to get the necessary definition of __get_c_string.
6345 (__get_c_string): New function. This is defined static just like SGI's
6346 although why they need to do this I'm not sure. Perhaps it should be
6347 in lstrings.C instead.
6349 * lib/templates/IEEEtran.lyx: New template file.
6351 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6353 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
6354 * intl/Makefile.in (MKINSTALLDIRS): ditto
6356 * src/LyXAction.C (init): changed to hold the LFUN data in a
6357 automatic array in stead of in callso to newFunc, this speeds up
6358 compilation a lot. Also all the memory used by the array is
6359 returned when the init is completed.
6361 * a lot of files: compiled with -Wold-style-cast, changed most of
6362 the reported offenders to C++ style casts. Did not change the
6363 offenders in C files.
6365 * src/trans.h (Match): change argument type to unsigned int.
6367 * src/support/DebugStream.C: fix some types on the streambufs so
6368 that it works on a conforming implementation.
6370 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6372 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
6374 * src/support/lyxstring.C: remove the inline added earlier since
6375 they cause a bunch of unsatisfied symbols when linking with dec
6376 cxx. Cxx likes to have the body of inlines at the place where they
6379 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
6380 accessing negative bounds in array. This fixes the crash when
6381 inserting accented characters.
6382 * src/trans.h (Match): ditto
6384 * src/buffer.C (Dispatch): since this is a void, it should not try
6385 to return anything...
6387 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6389 * src/buffer.h: removed the two friends from Buffer. Some changes
6390 because of this. Buffer::getFileName and Buffer::setFileName
6391 renamed to Buffer::fileName() and Buffer::fileName(...).
6393 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6395 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
6396 and Buffer::update(short) to BufferView. This move is currently
6397 controlled by a define MOVE_TEXT, this will be removed when all
6398 shows to be ok. This move paves the way for better separation
6399 between buffer contents and buffer view. One side effect is that
6400 the BufferView needs a rebreak when swiching buffers, if we want
6401 to avoid this we can add a cache that holds pointers to LyXText's
6402 that is not currently in use.
6404 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
6407 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6409 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
6411 * lyx_main.C: new command line option -x (or --execute) and
6412 -e (or --export). Now direct conversion from .lyx to .tex
6413 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
6414 Unfortunately, X is still needed and the GUI pops up during the
6417 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6419 * src/Spacing.C: add a using directive to bring stream stuff into
6421 * src/paragraph.C: ditto
6422 * src/buffer.C: ditto
6424 * NEWS: updated a bit the new features of 1.1.3 (took a few things
6425 from Lars' announcement).
6427 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
6428 example files from Tino Meinen.
6430 1999-12-06 Allan Rae <rae@lyx.org>
6432 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
6434 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6436 * src/support/lyxstring.C: added a lot of inline for no good
6439 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
6440 latexWriteEndChanges, they were not used.
6442 * src/layout.h (operator<<): output operator for PageSides
6444 * src/mathed/math_iter.C (my_memcpy): slightly changed.
6446 * some example files: loaded in LyX 1.0.4 and saved again to update
6447 certain constructs (table format)
6449 * a lot of files: did the change to use fstream/iostream for all
6450 writing of files. Done with a close look at Andre Poenitz's patch.
6452 * some files: whitespace changes.
6454 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6456 * src/mathed/math_iter.C (my_memcpy): new function. Since the
6457 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
6458 architecture, we provide our own. It is used unconditionnally, but
6459 I do not think this is a performance problem. Thanks to Angus
6460 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
6461 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
6463 (GetInset): use my_memcpy.
6467 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
6468 it is easier to understand, but it uses less TeX-only constructs now.
6470 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
6471 elements contain spaces
6473 * lib/configure: regenerated
6475 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
6476 elements contain spaces; display the list of programs that are
6479 * autogen.sh: make sure lib/configure is executable
6481 * lib/examples/*: rename the tutorial examples to begin with the
6482 two-letters language code.
6484 * src/lyxfunc.C (getStatus): do not query current font if no
6487 * src/lyx_cb.C (RunScript): use QuoteName
6488 (MenuRunDvips): ditto
6489 (PrintApplyCB): ditto
6491 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
6492 around argument, so that it works well with the current shell.
6493 Does not work properly with OS/2 shells currently.
6495 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
6496 * src/LyXSendto.C (SendtoApplyCB): ditto
6497 * src/lyxfunc.C (Dispatch): ditto
6498 * src/buffer.C (runLaTeX): ditto
6499 (runLiterate): ditto
6500 (buildProgram): ditto
6502 * src/lyx_cb.C (RunScript): ditto
6503 (MenuMakeLaTeX): ditto
6505 * src/buffer.h (getLatexName): new method
6507 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
6509 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6511 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
6512 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
6513 (create_math_panel): ditto
6515 * src/lyxfunc.C (getStatus): re-activate the code which gets
6516 current font and cursor; add test for export to html.
6518 * src/lyxrc.C (read): remove unreachable break statements; add a
6521 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
6523 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6525 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
6526 introduced by faulty regex.
6527 * src/buffer.C: ditto
6528 * src/lastfiles.C: ditto
6529 * src/paragraph.C: ditto
6530 * src/table.C: ditto
6531 * src/vspace.C: ditto
6532 * src/insets/figinset.C: ditto
6533 Note: most of these is absolutely harmless, except the one in
6534 src/mathed formula.C.
6536 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
6538 * src/ImportNoweb.C (documentclass): fixed bounds for substr
6539 operation, yielding correct results for the reLyX command.
6541 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6543 * src/support/filetools.C (ExpandPath): removed an over eager
6545 (ReplaceEnvironmentPath): ditto
6547 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
6548 shows that we are doing something fishy in our code...
6552 * src/lyxrc.C (read): use a double switch trick to get more help
6553 from the compiler. (the same trick is used in layout.C)
6554 (write): new function. opens a ofstream and pass that to output
6555 (output): new function, takes a ostream and writes the lyxrc
6556 elemts to it. uses a dummy switch to make sure no elements are
6559 * src/lyxlex.h: added a struct pushpophelper for use in functions
6560 with more than one exit point.
6562 * src/lyxlex.[Ch] (GetInteger): made it const
6566 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
6568 * src/layout.[hC] : LayoutTags splitted into several enums, new
6569 methods created, better error handling cleaner use of lyxlex. Read
6572 * src/bmtable.[Ch]: change some member prototypes because of the
6573 image const changes.
6575 * commandtags.h, src/LyXAction.C (init): new function:
6576 "preferences-save", saves the lyxrc entries into .lyx/preferences.
6577 This file is not read automatically but you can add \input
6578 preferences to your lyxrc if you want to. We need to discuss how
6581 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
6582 in .aux, also remove .bib and .bst files from dependencies when
6585 * src/BufferView.C, src/LyXView.C: add const_cast several places
6586 because of changes to images.
6588 * lib/images/*: same change as for images/*
6590 * lib/lyxrc.example: Default for accept_compound is false not no.
6592 * images/*: changed to be const, however I have som misgivings
6593 about this change so it might be changed back.
6595 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6597 * lib/configure, po/POTFILES.in: regenerated
6599 * autogen.sh: autogenerate lib/configure from lib/configure.m4
6601 * config/lib_configure.m4: removed
6603 * lib/configure.m4: new file (was config/lib_configure.m4)
6605 * configure.in: do not test for rtti, since we do not use it.
6607 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6609 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
6610 doubling of allocated space scheme. This makes it faster for large
6611 strings end to use less memory for small strings. xtra rememoved.
6613 * src/insets/figinset.C (waitalarm): commented out.
6614 (GhostscriptMsg): use static_cast
6615 (GhostscriptMsg): use new instead of malloc to allocate memory for
6616 cmap. also delete the memory after use.
6618 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
6620 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
6621 for changes in bibtex database or style.
6622 (runBibTeX): remove all .bib and .bst files from dep before we
6624 (run): use scanAuc in when dep file already exist.
6626 * src/DepTable.C (remove_files_with_extension): new method
6629 * src/DepTable.[Ch]: made many of the methods const.
6631 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6633 * src/bufferparams.C: make sure that the default textclass is
6634 "article". It used to be the first one by description order, but
6635 now the first one is "docbook".
6637 * src/lyx_main.C (setDebuggingLevel): change type of argument to
6638 string; call Debug::value.
6639 (easyParse): pass complete argument to setDebuggingLevel().
6641 * src/debug.h (value): fix the code that parses debug levels.
6643 * src/debug.h: add new debug type ACTION, reserved for LyXAction
6646 * src/LyXAction.C: use Debug::ACTION as debug channel.
6648 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
6650 * NEWS: updated for the future 1.1.3 release.
6652 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
6653 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
6654 it should. This is of course a controversial change (since many
6655 people will find that their lyx workscreen is suddenly full of
6656 red), but done for the sake of correctness.
6658 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
6659 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
6661 * src/insets/inseterror.h, src/insets/inseturl.h,
6662 src/insets/insetinfo.h, src/insets/figinset.h,
6663 src/mathed/formulamacro.h, src/mathed/math_macro.h
6664 (EditMessage): add a missing const and add _() to make sure that
6667 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
6668 src/insets/insetbib.C, src/support/filetools.C: add `using'
6671 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
6672 doing 'Insert index of last word' at the beginning of a paragraph.
6674 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6676 * several files: white-space changes.
6678 * src/mathed/formula.C: removed IsAlpha and IsDigit
6680 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
6681 .bib file. use a ifstream instead of FilePtr when parsing the .bib
6684 * src/insets/figinset.C (GetPSSizes): don't break when
6685 "EndComments" is seen. But break when a boundingbox is read.
6687 * all classes inherited from Inset: return value of Clone
6688 changed back to Inset *.
6690 * all classes inherited form MathInset: return value of Clone
6691 changed back to MathedInset *.
6693 * src/insets/figinset.C (runqueue): use a ofstream to output the
6694 gs/ps file. Might need some setpresicion or setw. However I can
6695 see no problem with the current code.
6696 (runqueue): use sleep instead of the alarm/signal code. I just
6697 can't see the difference.
6699 * src/paragraph.C (LyXParagraph): reserve space in the new
6700 paragraph and resize the inserted paragraph to just fit.
6702 * src/lyxfunc.h (operator|=): added operator for func_status.
6704 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
6705 check for readable file.
6707 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
6708 check for readable file.
6709 (MenuMakeLinuxDoc): ditto
6710 (MenuMakeDocBook): ditto
6711 (MenuMakeAscii): ditto
6712 (InsertAsciiFile): split the test for openable and readable
6714 * src/bmtable.C (draw_bitmaptable): use
6715 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
6717 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
6718 findtexfile from LaTeX to filetools.
6720 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
6721 instead of FilePtr. Needs to be verified by a literate user.
6723 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6725 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
6726 (EditMessage): likewise.
6728 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
6729 respectively as \textasciitilde and \textasciicircum.
6731 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6733 * src/support/lyxstring.h: made the methods that take iterators
6736 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
6737 (regexMatch): made is use the real regex class.
6739 * src/support/Makefile.am: changed to use libtool
6741 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
6743 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
6745 (MathIsInset ++): changed several macros to be inline functions
6748 * src/mathed/Makefile.am: changed to use libtool
6750 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
6752 * src/insets/inset* : Clone changed to const and return type is
6753 the true insettype not just Inset*.
6755 * src/insets/Makefile.am: changed to use libtool
6757 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
6759 * src/undo.[Ch] : added empty() and changed some of the method
6762 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
6764 * src/lyxparagraph.h: use id() and id(...) instead of getID and
6765 setID use block<> for the bullets array, added const several places.
6767 * src/lyxfunc.C (getStatus): new function
6769 * src/lyxfunc.[Ch] : small changes to take advantage of the new
6770 LyXAction, added const to several funtions.
6772 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
6773 a std::map, and to store the dir items in a vector.
6775 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
6778 * src/LyXView.[Ch] + other files : changed currentView to view.
6780 * src/LyXAction.[Ch] : ported from the old devel branch.
6782 * src/.cvsignore: added .libs and a.out
6784 * configure.in : changes to use libtool.
6786 * acinclude.m4 : inserted libtool.m4
6788 * .cvsignore: added libtool
6790 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6792 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
6793 file name in insets and mathed directories (otherwise the
6794 dependency is not taken in account under cygwin).
6796 * src/text2.C (InsertString[AB]): make sure that we do not try to
6797 read characters past the string length.
6799 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6801 * lib/doc/LaTeXConfig.lyx.in,
6802 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
6804 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
6805 file saying who created them and when this heppened; this is
6806 useless and annoys tools like cvs.
6808 * lib/layouts/g-brief-{en,de}.layout,
6809 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
6810 from Thomas Hartkens <thomas@hartkens.de>.
6812 * src/{insets,mathed}/Makefile.am: do not declare an empty
6813 LDFLAGS, so that it can be set at configure time (useful on Irix
6816 * lib/reLyX/configure.in: make sure that the prefix is set
6817 correctly in LYX_DIR.
6819 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6821 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
6822 be used by 'command-sequence' this allows to bind a key to a
6823 sequence of LyX-commands
6824 (Example: 'command-sequence math-insert alpha; math-insert beta;")
6826 * src/LyXAction.C: add "command-sequence"
6828 * src/LyXFunction.C: handling of "command-sequence"
6830 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
6831 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
6833 * src/lyxserver.C, src/minibuffer.C: Use this new interface
6835 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6837 * src/buffer.C (writeFile): Do not output a comment giving user
6838 and date at the beginning of a .lyx file. This is useless and
6839 annoys cvs anyway; update version number to 1.1.
6841 * src/Makefile.am (LYX_DIR): add this definition, so that a
6842 default path is hardcoded in LyX.
6844 * configure.in: Use LYX_GNU_GETTEXT.
6846 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
6847 AM_GNU_GETTEXT with a bug fixed.
6849 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
6851 * src/chset.C: add "using std::ifstream;" to please dec cxx.
6853 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
6854 which is used to point to LyX data is now LYX_DIR_11x.
6856 * lyx.man: convert to a unix text file; small updates.
6858 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6860 * src/support/LSubstring.[Ch]: made the second arg of most of the
6861 constructors be a const reference.
6863 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
6866 * src/support/lyxstring.[Ch] (swap): added missing member function
6867 and specialization of swap(str, str);
6869 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
6871 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
6872 trace of the old one.
6874 * src/undo.[Ch]: made the undostack use std::list to store undo's in
6875 put the member definitions in undo.C.
6877 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
6878 NEW_TEXT and have now only code that was included when this was
6881 * src/intl.C (LCombo): use static_cast
6883 (DispatchCallback): ditto
6885 * src/definitions.h: removed whole file
6887 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
6889 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
6890 parsing and stores in a std:map. a regex defines the file format.
6891 removed unneeded members.
6893 * src/bufferparams.h: added several enums from definitions.h here.
6894 Removed unsused destructor. Changed some types to use proper enum
6895 types. use block to have the temp_bullets and user_defined_bullets
6896 and to make the whole class assignable.
6898 * src/bufferparams.C (Copy): removed this functions, use a default
6901 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
6904 * src/buffer.C (readLyXformat2): commend out all that have with
6905 oldpapersize to do. also comment out all that hve to do with
6906 insetlatex and insetlatexdel.
6907 (setOldPaperStuff): commented out
6909 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
6911 * src/LyXAction.C: remove use of inset-latex-insert
6913 * src/mathed/math_panel.C (button_cb): use static_cast
6915 * src/insets/Makefile.am (insets_o_SOURCES): removed
6918 * src/support/lyxstring.C (helper): use the unsigned long
6919 specifier, UL, instead of a static_cast.
6921 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
6923 * src/support/block.h: new file. to be used as a c-style array in
6924 classes, so that the class can be assignable.
6926 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6928 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
6929 NULL, make sure to return an empty string (it is not possible to
6930 set a string to NULL).
6932 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6934 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
6936 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
6938 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
6939 link line, so that Irix users (for example) can set it explicitely to
6942 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
6943 it can be overidden at make time (static or dynamic link, for
6946 * src/vc-backend.C, src/LaTeXFeatures.h,
6947 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
6948 statements to bring templates to global namespace.
6950 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6952 * src/support/lyxstring.C (operator[] const): make it standard
6955 * src/minibuffer.C (Init): changed to reflect that more
6956 information is given from the lyxvc and need not be provided here.
6958 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
6960 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
6962 * src/LyXView.C (UpdateTimerCB): use static_cast
6963 (KeyPressMask_raw_callback): ditto
6965 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
6966 buffer_, a lot of changes because of this. currentBuffer() ->
6967 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
6968 also changes to other files because of this.
6970 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6972 * src/vc-backend.[Ch]: new files. The backends for vc handling,
6973 have no support for RCS and partial support for CVS, will be
6976 * src/insets/ several files: changes because of function name
6977 changes in Bufferview and LyXView.
6979 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
6981 * src/support/LSubstring.[Ch]: new files. These implement a
6982 Substring that can be very convenient to use. i.e. is this
6984 string a = "Mary had a little sheep";
6985 Substring(a, "sheep") = "lamb";
6986 a is now "Mary has a little lamb".
6988 * src/support/LRegex.[Ch]: a regex class that can be used to pick
6989 out patterns and subpatterns of strings. It is used by LSubstring
6990 and also by vc-backend.C
6992 * src/support/lyxstring.C: went over all the assertions used and
6993 tried to correct the wrong ones and flag which of them is required
6994 by the standard. some bugs found because of this. Also removed a
6995 couple of assertions.
6997 * src/support/Makefile.am (libsupport_a_SOURCES): added
6998 LSubstring.[Ch] and LRegex.[Ch]
7000 * src/support/FileInfo.h: have struct stat buf as an object and
7001 not a pointer to one, some changes because of this.
7003 * src/LaTeXFeatures.C (getTClassPreamble): also use the
7004 information in layout when adding the layouts preamble to the
7007 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
7010 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
7011 because of bug in OS/2.
7013 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7015 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
7016 \verbatim@font instead of \ttfamily, so that it can be redefined.
7018 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
7019 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
7020 src/layout.h, src/text2.C: add 'using' directive to bring the
7021 STL templates we need from the std:: namespace to the global one.
7022 Needed by DEC cxx in strict ansi mode.
7024 * src/support/LIstream.h,src/support/LOstream.h,
7025 src/support/lyxstring.h,src/table.h,
7026 src/lyxlookup.h: do not include <config.h> in header
7027 files. This should be done in the .C files only.
7029 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
7033 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7035 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
7036 from Kayvan to fix the tth invokation.
7038 * development/lyx.spec.in: updates from Kayvan to reflect the
7039 changes of file names.
7041 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7043 * src/text2.C (InsertStringB): use std::copy
7044 (InsertStringA): use std::copy
7046 * src/bufferlist.C: use a vector to store the buffers in. This is
7047 an internal change and should not affect any other thing.
7049 * src/BufferView.C (waitForX): use XSync instead of the lengthy
7052 * src/text.C (Fill): fix potential bug, one off bug.
7054 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7056 * src/Makefile.am (lyx_main.o): add more files it depends on.
7058 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
7060 * src/support/lyxstring.C: use size_t for the reference count,
7061 size, reserved memory and xtra.
7062 (internal_compare): new private member function. Now the compare
7063 functions should work for std::strings that have embedded '\0'
7065 (compare): all compare functions rewritten to use
7068 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7070 * src/support/lyxstring.C (compare): pass c_str()
7071 (compare): pass c_str
7072 (compare): pass c_str
7074 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7076 * src/support/DebugStream.C: <config.h> was not included correctly.
7078 * lib/configure: forgot to re-generate it :( I'll make this file
7079 auto generated soon.
7081 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7083 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
7086 * src/support/lyxstring.C: some changes from length() to rep->sz.
7087 avoids a function call.
7089 * src/support/filetools.C (SpaceLess): yet another version of the
7090 algorithm...now per Jean-Marc's suggestions.
7092 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7094 * src/layout.C (less_textclass_desc): functor for use in sorting
7096 (LyXTextClass::Read): sort the textclasses after reading.
7098 * src/support/filetools.C (SpaceLess): new version of the
7099 SpaceLess functions. What problems does this one give? Please
7102 * images/banner_bw.xbm: made the arrays unsigned char *
7104 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7106 * src/support/lyxstring.C (find): remove bogus assertion in the
7107 two versions of find where this has not been done yet.
7109 * src/support/lyxlib.h: add missing int return type to
7112 * src/menus.C (ShowFileMenu): disable exporting to html if no
7113 html export command is present.
7115 * config/lib_configure.m4: add a test for an HTML converter. The
7116 programs checked for are, in this order: tth, latex2html and
7119 * lib/configure: generated from config/lib_configure.m4.
7121 * src/lyxfunc.C (Dispatch): update and improve the execution of an
7122 html converter. The parameters are now passed through $$FName and
7123 $$OutName, instead of standard input/output.
7125 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
7127 * lib/lyxrc.example: update description of \html_command.
7128 add "quotes" around \screen_font_xxx font setting examples to help
7129 people who use fonts with spaces in their names.
7131 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7133 * Distribution files: updates for v1.1.2
7135 * src/support/lyxstring.C (find): remove bogus assert and return
7136 npos for the same condition.
7138 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7140 * added patch for OS/2 from SMiyata.
7142 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7144 * src/text2.C (CutSelection): make space_wrapped a bool
7145 (CutSelection): dont declare int i until we have to.
7146 (alphaCounter): return a char const *.
7148 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7150 * src/support/syscall.C (Systemcalls::kill):
7151 src/support/filetools.C (PutEnv, PutEnvPath):
7152 src/lyx_cb.C (addNewlineAndDepth):
7153 src/FontInfo.C (FontInfo::resize): condition some #warning
7154 directives with WITH_WARNINGS.
7157 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7159 * src/layout.[Ch] + several files: access to class variables
7160 limited and made accessor functions instead a lot of code changed
7161 becuase of this. Also instead of returning pointers often a const
7162 reference is returned instead.
7164 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
7166 * src/Makefile.am (dist-hook): added used to remove the CVS from
7167 cheaders upon creating a dist
7168 (EXTRA_DIST): added cheaders
7170 * src/support/lstrings.C (tostr(char)): fix it to handle param as
7171 a character not as a small integer.
7173 * src/support/lyxstring.C (find): removed Assert and added i >=
7174 rep->sz to the first if.
7176 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7178 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
7179 src/LyXView.C src/buffer.C src/bufferparams.C
7180 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
7181 src/text2.C src/insets/insetinclude.C:
7182 lyxlayout renamed to textclasslist.
7184 * src/layout.C: some lyxerr changes.
7186 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
7187 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
7188 (LyXLayoutList): removed all traces of this class.
7189 (LyXTextClass::Read): rewrote LT_STYLE
7190 (LyXTextClass::hasLayout): new function
7191 (LyXTextClass::GetLayout): rewritten to return an iterator + has
7192 both const and nonconst version.
7193 (LyXTextClass::delete_layout): new function.
7194 (LyXTextClassList::Style): bug fix. do the right thing if layout
7196 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
7197 (LyXTextClassList::NameOfLayout): ditto
7198 (LyXTextClassList::Load): ditto
7200 * src/buffer.C (makeLaTeXFile): new access to layoutlist
7202 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
7204 * src/LyXAction.C (LookupFunc): added a workaround for sun
7205 compiler, on the other hand...we don't know if the current code
7206 compiles on sun at all...
7208 * src/support/filetools.C (CleanupPath): subst fix
7210 * src/insets/insetbib.C (delDatabase): subst fix, this looks
7213 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
7214 complained about this one?
7216 * src/insets/insetinclude.C (Latex): subst fix
7218 * src/insets/insetbib.C (getKeys): subst fix
7220 * src/LyXSendto.C (SendtoApplyCB): subst fix
7222 * src/lyx_main.C (init): subst fix
7224 * src/layout.C (Read): subst fix
7226 * src/lyx_sendfax_main.C (button_send): subst fix
7228 * src/buffer.C (RoffAsciiTable): subst fix
7230 * src/lyx_cb.C (MenuFax): subst fix
7231 (PrintApplyCB): subst fix
7233 1999-10-26 Juergen Vigna <jug@sad.it>
7235 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
7237 (Read): Cleaned up this code so now we read only format vestion >= 5
7239 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7241 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
7242 come nobody has complained about this one?
7244 * src/insets/insetinclude.C (Latex): subst fix
7246 * src/insets/insetbib.C (getKeys): subst fix
7248 * src/lyx_main.C (init): subst fix
7250 * src/layout.C (Read): subst fix
7252 * src/buffer.C (RoffAsciiTable): subst fix
7254 * src/lyx_cb.C (MenuFax): subst fix.
7256 * src/layout.[hC] + some other files: rewrote to use
7257 std::container to store textclasses and layouts in.
7258 Simplified, removed a lot of code. Make all classes
7259 assignable. Further simplifications and review of type
7260 use still to be one.
7262 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
7263 lastfiles to create the lastfiles partr of the menu.
7265 * src/lastfiles.[Ch]: rewritten to use deque to store the
7266 lastfiles in. Uses fstream for reading and writing. Simplifies
7269 * src/support/syscall.C: remove explicit cast.
7271 * src/BufferView.C (CursorToggleCB): removed code snippets that
7273 use explicat C++ style casts instead of C style casts. also use
7274 u_vdata instea of passing pointers in longs.
7276 * src/PaperLayout.C: removed code snippets that were commented out.
7278 * src/lyx_gui_misc.C: removed code snippets that were commented out.
7280 * src/lyx_main.C: removed code snippets that wer commented out.
7282 * src/paragraph.C: removed code snippets that were commented out.
7284 * src/lyxvc.C (logClose): use static_cast
7286 (viewLog): remove explicit cast to void*
7287 (showLog): removed old commented code
7289 * src/menus.C: use static_cast instead of C style casts. use
7290 u_vdata instead of u_ldata. remove explicit cast to (long) for
7291 pointers. Removed old code that was commented out.
7293 * src/insets/inset.C: removed old commented func
7295 * src/insets/insetref.C (InsetRef): removed old code that had been
7296 commented out for a long time.
7298 (escape): removed C style cast
7300 * src/insets/insetlatexaccent.C (Draw): removed old commented code
7302 * src/insets/insetlatex.C (Draw): removed old commented code
7303 (Read): rewritten to use string
7305 * src/insets/insetlabel.C (escape): removed C style cast
7307 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
7309 * src/insets/insetindex.C: use static_cast and u_vdata, removed
7312 * src/insets/insetinclude.h: removed a couple of stupid bools
7314 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
7315 (Clone): remove C style cast
7316 (getKeys): changed list to lst because of std::list
7318 * src/insets/inseterror.C (Draw): removed som old commented code.
7320 * src/insets/insetcommand.C (Draw): removed some old commented code.
7322 * src/insets/insetbib.C (bibitem_cb): removed code that has been
7323 commented out forever.
7324 (bibitem_cb): use static_cast instead of C style cast
7325 use of vdata changed to u_vdata.
7327 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
7329 (CloseUrlCB): use static_cast instead of C style cast.
7330 (CloseUrlCB): added a fl_free form...it seemed to be missing.
7332 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
7333 (C_InsetInfo_CloseInfoCB): forward the ob parameter
7334 (CloseInfoCB): static_cast from ob->u_vdata instead.
7335 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
7338 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
7339 (C_InsetError_CloseErrorCB): forward the ob parameter
7340 (CloseErrorCB): static_cast from ob->u_vdata instead.
7342 * src/vspace.h: include LString.h since we use string in this class.
7344 * src/vspace.C (lyx_advance): changed name from advance because of
7345 nameclash with stl. And since we cannot use namespaces yet...I
7346 used a lyx_ prefix instead. Expect this to change when we begin
7349 * src/BufferView.[Ch] (BufferView::~BufferView): removed
7351 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
7352 and removed now defunct constructor and deconstructor.
7354 * src/BufferView.h: have backstack as a object not as a pointer.
7355 removed initialization from constructor. added include for BackStack
7357 * development/lyx.spec.in (%build): add CFLAGS also.
7359 * src/screen.C (drawFrame): removed another warning.
7361 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7363 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
7364 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
7365 README and ANNOUNCE a bit for the next release. More work is
7368 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
7369 unbreakable if we are in freespacing mode (LyX-Code), but not in
7372 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7374 * src/BackStack.h: fixed initialization order in constructor
7376 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
7378 * acinclude.m4 (VERSION): new rules for when a version is
7379 development, added also a variable for prerelease.
7380 (warnings): we set with_warnings=yes for prereleases
7381 (lyx_opt): prereleases compile with same optimization as development
7382 (CXXFLAGS): only use pedantic if we are a development version
7384 * src/BufferView.C (restorePosition): don't do anything if the
7387 * src/BackStack.h: added member empty, use this to test if there
7388 is anything to pop...
7390 1999-10-25 Juergen Vigna <jug@sad.it>
7393 * forms/layout_forms.fd +
7394 * forms/latexoptions.fd +
7395 * lyx.fd: changed for various form resize issues
7397 * src/mathed/math_panel.C +
7398 * src/insets/inseterror.C +
7399 * src/insets/insetinfo.C +
7400 * src/insets/inseturl.C +
7401 * src/insets/inseturl.h +
7404 * src/PaperLayout.C +
7405 * src/ParagraphExtra.C +
7406 * src/TableLayout.C +
7408 * src/layout_forms.C +
7415 * src/menus.C: fixed various resize issues. So now forms can be
7416 resized savely or not be resized at all.
7418 * forms/form_url.fd +
7419 * src/insets/form_url.[Ch]: added because it's cleaner and easier
7422 * src/insets/Makefile.am: added files form_url.[Ch]
7424 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7426 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
7427 (and presumably 6.2).
7429 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
7430 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
7431 remaining static member callbacks.
7433 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
7436 * src/support/lyxstring.h: declare struct Srep as friend of
7437 lyxstring, since DEC cxx complains otherwise.
7439 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7441 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7443 * src/LaTeX.C (run): made run_bibtex also depend on files with
7445 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
7446 are put into the dependency file.
7448 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
7449 the code has shown itself to work
7450 (create_ispell_pipe): removed another warning, added a comment
7453 * src/minibuffer.C (ExecutingCB): removed code that has been
7454 commented out a long time
7456 * src/lyxfunc.C (processKeyEvent): removed some very old commented
7457 out code + a warning.
7459 * src/support/lyxstring.h: comment out the three private
7460 operators, when compiling with string ansi conforming compilers
7463 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
7465 (pixmapFromBitmapData): change type of bdata to be unsigned char *
7466 (pixmapFromBitmapData): add a reinterpret_cast in the call to
7469 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
7472 * src/mathed/math_panel.C (create_math_panel): remove explicit
7475 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
7478 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
7479 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
7480 to XCreatePixmapFromBitmapData
7481 (fl_set_bmtable_data): change the last argument to be unsigned
7483 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
7484 and bh to be unsigned int, remove explicit casts in call to
7485 XReadBitmapFileData.
7487 * images/arrows.xbm: made the arrays unsigned char *
7488 * images/varsz.xbm: ditto
7489 * images/misc.xbm: ditto
7490 * images/greek.xbm: ditto
7491 * images/dots.xbm: ditto
7492 * images/brel.xbm: ditto
7493 * images/bop.xbm: ditto
7495 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
7497 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
7498 (LYX_PROG_CXX): added -pedantic to g++ compile options when
7499 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
7501 (LYX_CXX_CHEADERS): added <clocale> to the test.
7503 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
7505 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
7507 * src/support/lyxstring.C (append): fixed something that must be a
7508 bug, rep->assign was used instead of rep->append.
7510 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
7513 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
7514 lyx insert double chars. Fix spotted by Kayvan.
7516 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
7518 * Fixed the tth support. I messed up with the Emacs patch apply feature
7519 and omitted the changes in lyxrc.C.
7521 1999-10-22 Juergen Vigna <jug@sad.it>
7523 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
7525 * src/lyx_cb.C (MenuInsertRef) +
7526 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
7527 the form cannot be resized under it limits (fixes a segfault)
7529 * src/lyx.C (create_form_form_ref) +
7530 * forms/lyx.fd: Changed Gravity on name input field so that it is
7533 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7535 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
7536 <ostream> and <istream>.
7538 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
7539 whether <fstream> provides the latest standard features, or if we
7540 have an oldstyle library (like in egcs).
7541 (LYX_CXX_STL_STRING): fix the test.
7543 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
7544 code on MODERN_STL_STREAM.
7546 * src/support/lyxstring.h: use L{I,O}stream.h.
7548 * src/support/L{I,O}stream.h: new files, designed to setup
7549 correctly streams for our use
7550 - includes the right header depending on STL capabilities
7551 - puts std::ostream and std::endl (for LOStream.h) or
7552 std::istream (LIStream.h) in toplevel namespace.
7554 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7556 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
7557 was a bib file that had been changed we ensure that bibtex is run.
7558 (runBibTeX): enhanced to extract the names of the bib files and
7559 getting their absolute path and enter them into the dep file.
7560 (findtexfile): static func that is used to look for tex-files,
7561 checks for absolute patchs and tries also with kpsewhich.
7562 Alternative ways of finding the correct files are wanted. Will
7564 (do_popen): function that runs a command using popen and returns
7565 the whole output of that command in a string. Should be moved to
7568 * src/DepTable.[Ch] (extchanged): new function that returns true if a
7569 file with extension ext has changed.
7571 * src/insets/figinset.C: added ifdef guards around the fl_free
7572 code that jug commented out. Now it is commented out when
7573 compiling with XForms == 0.89.
7575 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
7576 to lyxstring.C, and only keep a forward declaration in
7577 lyxstring.h. Simplifies the header file a bit and should help a
7578 bit on compile time too. Also changes to Srep will not mandate a
7579 recompile of code just using string.
7580 (~lyxstring): definition moved here since it uses srep.
7581 (size): definition moved here since it uses srep.
7583 * src/support/lyxstring.h: removed a couple of "inline" that should
7586 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7588 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
7591 1999-10-21 Juergen Vigna <jug@sad.it>
7593 * src/table.C (SetPWidth): Just a small fix so the alignment is not
7594 set to left if I just remove the width entry (or it is empty).
7596 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
7597 paragraph when having dummy paragraphs.
7599 1999-10-20 Juergen Vigna <jug@sad.it>
7601 * src/insets/figinset.C: just commented some fl_free_form calls
7602 and added warnings so that this calls should be activated later
7603 again. This avoids for now a segfault, but we have a memory leak!
7605 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
7606 'const char * argument' to 'string argument', this should
7607 fix some Asserts() in lyxstring.C.
7609 * src/lyxfunc.h: Removed the function argAsString(const char *)
7610 as it is not used anymore.
7612 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7614 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
7617 * src/Literate.h: some funcs moved from public to private to make
7618 interface clearer. Unneeded args removed.
7620 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
7622 (scanBuildLogFile): ditto
7624 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
7625 normal TeX Error. Still room for improvement.
7627 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
7629 * src/buffer.C (insertErrors): changes to make the error
7630 desctription show properly.
7632 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
7635 * src/support/lyxstring.C (helper): changed to use
7636 sizeof(object->rep->ref).
7637 (operator>>): changed to use a pointer instead.
7639 * src/support/lyxstring.h: changed const reference & to value_type
7640 const & lets see if that helps.
7642 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7644 * Makefile.am (rpmdist): fixed to have non static package and
7647 * src/support/lyxstring.C: removed the compilation guards
7649 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
7652 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
7653 conditional compile of lyxstring.Ch
7655 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
7656 stupid check, but it is a lot better than the bastring hack.
7657 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
7659 * several files: changed string::erase into string::clear. Not
7662 * src/chset.C (encodeString): use a char temporary instead
7664 * src/table.C (TexEndOfCell): added tostr around
7665 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
7666 (TexEndOfCell): ditto
7667 (TexEndOfCell): ditto
7668 (TexEndOfCell): ditto
7669 (DocBookEndOfCell): ditto
7670 (DocBookEndOfCell): ditto
7671 (DocBookEndOfCell): ditto
7672 (DocBookEndOfCell): ditto
7674 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
7676 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
7678 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
7679 (MenuBuildProg): added tostr around ret
7680 (MenuRunChktex): added tostr around ret
7681 (DocumentApplyCB): added tostr around ret
7683 * src/chset.C (encodeString): added tostr around t->ic
7685 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
7686 (makeLaTeXFile): added tostr around tocdepth
7687 (makeLaTeXFile): added tostr around ftcound - 1
7689 * src/insets/insetbib.C (setCounter): added tostr around counter.
7691 * src/support/lyxstring.h: added an operator+=(int) to catch more
7694 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
7695 (lyxstring): We DON'T allow NULL pointers.
7697 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7699 * src/mathed/math_macro.C (MathMacroArgument::Write,
7700 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
7701 when writing them out.
7703 * src/LString.C: remove, since it is not used anymore.
7705 * src/support/lyxstring.C: condition the content to
7706 USE_INCLUDED_STRING macro.
7708 * src/mathed/math_symbols.C, src/support/lstrings.C,
7709 src/support/lyxstring.C: add `using' directive to specify what
7710 we need in <algorithm>. I do not think that we need to
7711 conditionalize this, but any thought is appreciated.
7713 * many files: change all callback functions to "C" linkage
7714 functions to please strict C++ compilers like DEC cxx 6.1 in mode
7715 strict_ansi. Those who were static are now global.
7716 The case of callbacks which are static class members is
7717 trickier, since we have to make C wrappers around them (see
7718 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
7719 did not finish this yet, since it defeats the purpose of
7720 encapsulation, and I am not sure what the best route is.
7722 1999-10-19 Juergen Vigna <jug@sad.it>
7724 * src/support/lyxstring.C (lyxstring): we permit to have a null
7725 pointer as assignment value and just don't assign it.
7727 * src/vspace.C (nextToken): corrected this function substituting
7728 find_first(_not)_of with find_last_of.
7730 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
7731 (TableOptCloseCB) (TableSpeCloseCB):
7732 inserted fl_set_focus call for problem with fl_hide_form() in
7735 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7737 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
7740 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7742 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
7743 LyXLex::next() and not eatline() to get its argument.
7745 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7747 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
7748 instead, use fstreams for io of the depfile, removed unneeded
7749 functions and variables.
7751 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
7752 vector instead, removed all functions and variables that is not in
7755 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7757 * src/buffer.C (insertErrors): use new interface to TeXError
7759 * Makefile.am (rpmdist): added a rpmdist target
7761 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
7762 per Kayvan's instructions.
7764 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7766 * src/Makefile.am: add a definition for localedir, so that locales
7767 are found after installation (Kayvan)
7769 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7771 * development/.cvsignore: new file.
7773 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7775 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
7776 C++ compiler provides wrappers for C headers and use our alternate
7779 * configure.in: use LYX_CXX_CHEADERS.
7781 * src/cheader/: new directory, populated with cname headers from
7782 libstdc++-2.8.1. They are a bit old, but probably good enough for
7783 what we want (support compilers who lack them).
7785 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
7786 from includes. It turns out is was stupid.
7788 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7790 * lib/Makefile.am (install-data-local): forgot a ';'
7791 (install-data-local): forgot a '\'
7792 (libinstalldirs): needed after all. reintroduced.
7794 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
7796 * configure.in (AC_OUTPUT): added lyx.spec
7798 * development/lyx.spec: removed file
7800 * development/lyx.spec.in: new file
7802 * po/*.po: merged with lyx.pot becuase of make distcheck
7804 * lib/Makefile.am (dist-hook): added dist-hook so that
7805 documentation files will be included when doing a make
7806 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
7807 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
7809 more: tried to make install do the right thing, exclude CVS dirs
7812 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
7813 Path would fit in more nicely.
7815 * all files that used to use pathstack: uses now Path instead.
7816 This change was a lot easier than expected.
7818 * src/support/path.h: new file
7820 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
7822 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
7824 * src/support/lyxstring.C (getline): Default arg was given for
7827 * Configure.cmd: removed file
7829 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7831 * src/support/DebugStream.[Ch]: remove the explicit std:: before
7832 streams classes and types, add the proper 'using' statements when
7833 MODERN_STL is defined.
7835 * src/debug.h: move the << operator definition after the inclusion
7838 * src/support/filetools.C: include "LAssert.h", which is needed
7841 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
7844 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
7845 include "debug.h" to define a proper ostream.
7847 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
7849 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
7850 method to the SystemCall class which can kill a process, but it's
7851 not fully implemented yet.
7853 * src/*.C: Changed Systemcalls::Startscript() to startscript()
7855 * src/support/FileInfo.h: Better documentation
7857 * src/lyxfunc.C: Added support for buffer-export html
7859 * src/menus.C: Added Export->As HTML...
7861 * lib/bind/*.bind: Added short-cut for buffer-export html
7863 * src/lyxrc.*: Added support for new \tth_command
7865 * lib/lyxrc.example: Added stuff for new \tth_command
7867 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7869 * lib/Makefile.am (IMAGES): removed images/README
7870 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
7871 installes in correct place. Check permisions is installed
7874 * src/LaTeX.C: some no-op changes moved declaration of some
7877 * src/LaTeX.h (LATEX_H): changed include guard name
7879 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7881 * lib/reLyX/Makefile.am: install noweb2lyx.
7883 * lib/Makefile.am: install configure.
7885 * lib/reLyX/configure.in: declare a config aux dir; set package
7886 name to lyx (not sure what the best solution is); generate noweb2lyx.
7888 * lib/layouts/egs.layout: fix the bibliography layout.
7890 1999-10-08 Jürgen Vigna <jug@sad.it>
7892 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
7893 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
7894 it returned without continuing to search the path.
7896 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7898 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
7899 also fixes a bug. It is not allowed to do tricks with std::strings
7900 like: string a("hei"); &a[e]; this will not give what you
7901 think... Any reason for the complexity in this func?
7903 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
7905 * Updated README and INSTALL a bit, mostly to check that my
7906 CVS rights are correctly set up.
7908 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7910 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
7911 does not allow '\0' chars but lyxstring and std::string does.
7913 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7915 * autogen.sh (AUTOCONF): let the autogen script create the
7916 POTFILES.in file too. POTFILES.in should perhaps now not be
7917 included in the cvs module.
7919 * some more files changed to use C++ includes instead of C ones.
7921 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
7923 (Reread): added tostr to nlink. buggy output otherwise.
7924 (Reread): added a string() around szMode when assigning to Buffer,
7925 without this I got a log of garbled info strings.
7927 * acconfig.h: commented out the PTR_AS_INT macros. They should not
7930 * I have added several ostream & operator<<(ostream &, some_type)
7931 functions. This has been done to avoid casting and warnings when
7932 outputting enums to lyxerr. This as thus eliminated a lot of
7933 explicit casts and has made the code clearer. Among the enums
7934 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
7935 mathed enums, some font enum the Debug::type enum.
7937 * src/support/lyxstring.h (clear): missing method. equivalent of
7940 * all files that contained "stderr": rewrote constructs that used
7941 stderr to use lyxerr instead. (except bmtable)
7943 * src/support/DebugStream.h (level): and the passed t with
7944 Debug::ANY to avoid spurious bits set.
7946 * src/debug.h (Debug::type value): made it accept strings of the
7949 * configure.in (Check for programs): Added a check for kpsewhich,
7950 the latex generation will use this later to better the dicovery of
7953 * src/BufferView.C (create_view): we don't need to cast this to
7954 (void*) that is done automatically.
7955 (WorkAreaButtonPress): removed some dead code.
7957 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7959 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
7960 is not overwritten when translated (David Sua'rez de Lis).
7962 * lib/CREDITS: Added David Sua'rez de Lis
7964 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
7966 * src/bufferparams.C (BufferParams): default input encoding is now
7969 * acinclude.m4 (cross_compiling): comment out macro
7970 LYX_GXX_STRENGTH_REDUCE.
7972 * acconfig.h: make sure that const is not defined (to empty) when
7973 we are compiling C++. Remove commented out code using SIZEOF_xx
7976 * configure.in : move the test for const and inline as late as
7977 possible so that these C tests do not interefere with C++ ones.
7978 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
7979 has not been proven.
7981 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7983 * src/table.C (getDocBookAlign): remove bad default value for
7986 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
7988 (ShowFileMenu2): ditto.
7990 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
7993 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7995 * Most files: finished the change from the old error code to use
7996 DebugStream for all lyxerr debugging. Only minor changes remain
7997 (e.g. the setting of debug levels using strings instead of number)
7999 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8001 * src/layout.C (Add): Changed to use compare_no_case instead of
8004 * src/FontInfo.C: changed loop variable type too string::size_type.
8006 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8008 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
8009 set ETAGS_ARGS to --c++
8011 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
8013 * src/table.C (DocBookEndOfCell): commented out two unused variables
8015 * src/paragraph.C: commented out four unused variables.
8017 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
8018 insed a if clause with type string::size_type.
8020 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
8023 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
8025 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
8026 variable, also changed loop to go from 0 to lenght + 1, instead of
8027 -1 to length. This should be correct.
8029 * src/LaTeX.C (scanError): use string::size_type as loop variable
8032 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
8033 (l.896) since y_tmp and row was not used anyway.
8035 * src/insets/insetref.C (escape): use string::size_type as loop
8038 * src/insets/insetquotes.C (Width): use string::size_type as loop
8040 (Draw): use string::size_type as loop variable type.
8042 * src/insets/insetlatexaccent.C (checkContents): use
8043 string::size_type as loop variable type.
8045 * src/insets/insetlabel.C (escape): use string::size_type as loop
8048 * src/insets/insetinfo.C: added an extern for current_view.
8050 * src/insets/insetcommand.C (scanCommand): use string::size_type
8051 as loop variable type.
8053 * most files: removed the RCS tags. With them we had to recompile
8054 a lot of files after a simple cvs commit. Also we have never used
8055 them for anything meaningful.
8057 * most files: tags-query-replace NULL 0. As adviced several plases
8058 we now use "0" instead of "NULL" in our code.
8060 * src/support/filetools.C (SpaceLess): use string::size_type as
8063 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8065 * src/paragraph.C: fixed up some more string stuff.
8067 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8069 * src/support/filetools.h: make modestr a std::string.
8071 * src/filetools.C (GetEnv): made ch really const.
8073 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
8074 made code that used these use max/min from <algorithm> instead.
8076 * changed several c library include files to their equivalent c++
8077 library include files. All is not changed yet.
8079 * created a support subdir in src, put lyxstring and lstrings
8080 there + the extra files atexit, fileblock, strerror. Created
8081 Makefile.am. edited configure.in and src/Makefile.am to use this
8082 new subdir. More files moved to support.
8084 * imported som of the functions from repository lyx, filetools
8086 * ran tags-query-replace on LString -> string, corrected the bogus
8087 cases. Tried to make use of lstrings.[hC], debugged a lot. There
8088 is still some errors in there. This is errors where too much or
8089 too litle get deleted from strings (string::erase, string::substr,
8090 string::replace), there can also be some off by one errors, or
8091 just plain wrong use of functions from lstrings. Viewing of quotes
8094 * LyX is now running fairly well with string, but there are
8095 certainly some bugs yet (see above) also string is quite different
8096 from LString among others in that it does not allow null pointers
8097 passed in and will abort if it gets any.
8099 * Added the revtex4 files I forgot when setting up the repository.
8101 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8103 * All over: Tried to clean everything up so that only the files
8104 that we really need are included in the cvs repository.
8105 * Switched to use automake.
8106 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
8107 * Install has not been checked.
8109 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8111 * po/pt.po: Three errors:
8112 l.533 and l.538 format specification error
8113 l. 402 duplicate entry, I just deleted it.