1 2000-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use
4 FL_MENU_BUTTON for items in menu bar. Not sure what difference it
7 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
9 * src/frontends/xforms/FormRef.C (updateBrowser):
10 * src/frontends/xforms/forms/form_ref.fd: try clicking on
11 different insets with the sort key active. Now apply this patch!
13 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
15 * src/frontends/xforms/FormPrint.C: set to valid()
16 when we update from the passed parameters.
18 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
20 * src/LColor.C (getFromGUIName): internationalise the comparison.
22 * src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a
23 FormPreferences choice.
25 * src/frontends/xforms/FormPreferences.C: some additional Color safety.
28 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
30 * src/lyxrc.C: more detail for the printer program config
33 * src/LColor.C: ert->latex text. LColor needs a big revamp
34 but will have to wait till after 1.1.6
36 * src/buffer.C: bring up a dialog if we load a document
37 with an un-installed text class, rather than just complain
40 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
42 * src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
43 the browser form for a combox in a tabbed folder. Bug fix courtesy of
44 Steve Lamont <spl@ncmir.ucsd.edu>.
46 * src/frontends/xforms/FormDocument.C (build):
47 * src/frontends/xforms/FormPreferences.C (Language::build):
48 pass tabfolders to Combox::add() in order to use this work around.
50 * src/frontends/xforms/FormCitation.C (connect): remove max size
52 (update): sort list of bibliography keys.
54 * src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser,
56 No max size limitation. Same popup for new and existing insets. Fixes
57 bugs reported by Rob Lahaye.
59 * src/frontends/xforms/FormCitation.C (c-tor):
60 * src/frontends/xforms/FormCopyright.C (c-tor):
61 * src/frontends/xforms/FormError.C (c-tor):
62 * src/frontends/xforms/FormGraphics.C (c-tor):
63 * src/frontends/xforms/FormIndex.C (c-tor):
64 * src/frontends/xforms/FormRef.C (c-tor):
65 * src/frontends/xforms/FormToc.C (c-tor):
66 * src/frontends/xforms/FormUrl.C (c-tor):
67 use correct policy for ButtonController.
69 * src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more.
71 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr
74 * src/frontends/xforms/forms/form_citation.fd: some resizing changes.
76 * src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons.
77 Some resizing changes.
79 2000-11-28 Lars Gullik Bjønnes <larsbj@lyx.org>
81 * configure.in: fix typo
83 * lib/languages: add ukraninian and change no to no_NO
85 * src/lyxfont.[Ch] (setGUISize): comment out setGUISize
87 * src/bufferview_funcs.C (FontSize): use setLyXSize
89 2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
91 * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
92 to check for systems where mkstemp() is available but not declared
93 in headers. The new autoconf macro lyx_CHECK_DECL can be used
94 to check for declarations in headers.
96 2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
98 * forms/bibforms.fd: tiny fix to get it to run with fdesign.
100 * forms/makefile: added bibforms.fd, include_form.fd.
101 Removed lyx_sendfax.fd.
103 * src/LaTeXLog.C (ShowLatexLog):
104 * src/LyXAction.C (init):
105 * src/bufferparams.C (readLanguage): altered messages as suggested by
108 * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
111 * src/credits.C: made fd_form_credits non-static, so that it can be
112 redrawn should the xforms colors be re-mapped.
113 * src/spellchecker.C ditto fd_form_spell_options.
115 * src/filedlg.[Ch] (redraw):
116 * src/intl.[Ch] (redraw):
117 * src/lyxfr0.[Ch] (redraw):
118 * src/insets/figinset.[Ch] (redraw):
119 * src/insets/insetexternal.[Ch] (redraw):
120 new methods, connected to Dialogs::redrawGUI.
122 * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
123 to be connected to Dialogs::redrawGUI.
125 * src/frontends/xforms/FormCitation.C (build):
126 * src/frontends/xforms/FormCopyright.C (build):
127 * src/frontends/xforms/FormError.C (build):
128 * src/frontends/xforms/FormGraphics.C (build):
129 * src/frontends/xforms/FormIndex.C (build):
130 * src/frontends/xforms/FormTabularCreate.[Ch] (update):
131 * src/frontends/xforms/FormToc.C (build):
132 * src/frontends/xforms/FormUrl.C (build):
133 use the ButtonController correctly.
135 * src/frontends/xforms/FormCopyright.C (build):
136 * src/frontends/xforms/forms/form_copyright.fd: moved the text out of
137 the .fd file and into build().
139 * src/frontends/xforms/FormPreferences.C: tiny clean-up.
141 * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
143 * src/frontends/xforms/forms/form_citation.fd:
144 * src/frontends/xforms/forms/form_copyright.fd:
145 * src/frontends/xforms/forms/form_error.fd:
146 * src/frontends/xforms/forms/form_graphics.fd:
147 * src/frontends/xforms/forms/form_index.fd:
148 * src/frontends/xforms/forms/form_toc.fd:
149 * src/frontends/xforms/forms/form_url.fd:
150 renamed some of the objects. Named others explicitly for the first time.
151 Added Restore and Apply buttons where appropriate.
153 * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
156 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
158 * src/version.h: try the pre2 again
160 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
162 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
164 * src/frontends/kde/FormParagraph.C: added using directive.
166 * src/frontends/kde/paradlg.C: added config.h and using directive.
168 * src/frontends/kde/paradlg.h: added std::qualifier.
170 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
172 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
174 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
176 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
178 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
180 * src/version.h: set back to 1.1.6cvs
182 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
184 * src/version.h: set to 1.1.6pre2
186 2000-11-20 Marko Vendelin <markov@ioc.ee>
188 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
190 * src/frontends/gnome/Makefile.am: updated list of XForms object files
192 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
194 * src/LColor.C (init):
195 * src/lyxrc.C (getDescription): changed some comments as suggested by
198 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
199 disconnect the redrawGUI signal in best-practice fashion.
201 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
202 long_opts_tab to reflect the change in name of this tabfolder, as
203 suggested by John Levon.
204 (connect, disconnect): new methods. Don't do much at present other than
205 ensuring that we can't resize the dialog. This just makes xforms go
207 (lots of methods in Colors): made void rather than bool. The idea is
208 to have an isOk() function that keeps track of whether any input is
209 genuinely invalid and should therefore block Save, Apply.
210 Easier to manipulate the counters rapidly.
211 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
212 compiler will like this code. Much cleaner way of doing things.
214 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
216 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
217 rather than simple counters, following suggestion by John Levon.
219 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
220 than engraved frame + text.
222 * src/frontends/xforms/forms/makefile: removed spurious command.
224 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
226 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
228 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
231 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
233 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
234 see what Lars has changed and what is just white space!
235 Now used X directly to ascertain the RGB color associated with the
237 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
239 Added some sort capability.
240 The X11 color name database input is only displayed if the database
241 isn't found in the standard place.
242 Got rid of struct compare_converter; it wasn't used.
243 Probably some other stuff that I've forgotten.
245 * src/frontends/xforms/FormPreferences.h: changed the names of some
246 methods in the Colors struct. Added a couple of structs to help sort
247 colors by name and by RGBColor.
249 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
250 functions into a new class RWInfo.
252 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
253 The dialog is now almost navigable using the keyboard. Unfortunately,
254 the cursor has to be inside a browser for it to be activated. There is
255 no visual feedback for the key shortcuts to the arrow keys (use
256 Alt-appropriate arrow key, Alt-x).
258 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
261 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
262 xform_helpers.[Ch]. See above.
264 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
266 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
268 * src/screen.C (setCursorColor): new method. Sets the color of the
270 (ShowManualCursor): call it.
271 Constify some local variables.
273 * src/LColor.[Ch] (LColor): add entry for cursor
274 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
277 2000-11-19 Juergen Vigna <jug@sad.it>
279 * src/insets/insettabular.C (draw): fixed text border redraw problem.
280 (calculate_dimensions_of_cells): try to boost up when inserting chars.
282 2000-11-15 Rob Lahaye <lahaye@postech.edu>
284 * lib/ui/default.ui: OptItem used for Fax entry
286 2000-11-17 Matej Cepl <cepl@bigfoot.com>
288 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
290 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
292 * src/vspace.C (nextToken): fix so it can handle length phrases like
293 "10mm+-20mm", "40inplus16mmminus10cm" etc.
295 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
297 * src/frontends/xforms/FormPreferences.C: constify several variables
298 (BrowserLyX): rewrite to not need the choice variable
299 (Modify): rewrite to not need the choide variable
300 (compare_converter): make operator const
302 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
303 correct the writing of \set_color
304 (getDescription): return a const string
306 * src/kbsequence.[Ch] (addkey): remove dead code
308 * src/Painter.C (text): remove some commented code
310 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
312 * src/ColorHandler.[Ch]: removed some header files from .h file.
313 Included LColor.h in .C file.
315 * src/LColor.[Ch]: made class copyable so that I could create a
316 system_lcolor instance.
318 * src/Painter.h: removed LColor.h.
320 * src/lyx_gui.C (create_forms): used AddName.
322 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
323 of user preferences/lyxrc file.
325 * src/lyxrc.C (output): output changes to lcolor.
327 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
329 Moved class xformColor to files xform_helpers.[Ch]. These files,
330 Color.[Ch], could now be moved into src if they would be useful to
333 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
334 Also moved FormPreferences::browseFile here as it can be used by any
335 xform dialog with a "Browse" button. FormGraphics is a perfect example.
337 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
338 ReadableFile): changed the FormPreferences methods a little and moved
339 them here as they'll be useful elsewhere also.
341 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
342 Removed some header files and used forward declarations instead.
344 Removed some methods as they'll be useful elsewhere (see above).
346 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
347 Can also now modify the LyX LColors. However, for reasons that I don't
348 yet understand, it appears that we can use
349 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
350 present. The problem appears to lie in ColorHandler, because I can
351 change the color using LColor.SetColor(). Similarly, when reading in a
352 preferences file with some set_color instances, I'll get a warning
353 like: Color sea green is undefined or may not be redefined
354 Bad lyxrc set_color for sea green
356 Once the buffer is loaded, however, I can happily change to this color.
358 Finally, it appears that I have to set the color of "inset frame"
359 explicitly, or it oscillates from "black" to "indian red" with each
362 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
364 * ANNOUNCE: corrected a spelling mistake.
366 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
369 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
371 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
373 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
376 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
377 match the requirements from the standard better. This is required
378 to work with gnu libstdc++-v3
380 * src/frontends/xforms/FormPreferences.C: add explict pair
381 arguments to browse calls. include support/lyxmanip.h remvoe
382 extern fmt. whitespace changes. reorder variables in
383 FormPreferences.h, to match initalizaton order.
385 * several files: constify more local variables.
387 * src/buffer.C: remove some commented functions.
389 * src/DepTable.C (remove_files_with_extension): temporary
390 work around for gcc 2.97
391 * src/filedlg.C (find): ditto
392 * src/Variables.C (set): ditto
393 * src/LyXAction.C (searchActionArg): ditto
394 (retrieveActionArg): ditto
396 * configure.in: check for mktemp too
398 * UPGRADING: prepare for 1.1.6
400 * Makefile.am (lgbtags): add backup tags for when etags are
401 different than usual.
403 * ANNOUNCE: prepare for 1.1.6
405 * src/support/tempname.C (make_tempfile): new function, wrapper
406 around mkstemp and mktemp. Only mkstemp has been tested.
409 2000-11-14 Rob Lahaye <lahaye@postech.edu>
411 * default.ui: capitalized some menu items to improve shortcuts.
413 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
415 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
417 * src/frontends/xforms/Dialogs.C: add "using" directive.
419 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
421 * src/filedlg.C (Select): highlight suggested file in browser, if
424 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
425 each tab folder is encapsulated in its own class.
426 The Language keymaps are now chosen using a text input and a
427 browser button, rather than a Combox.
428 All the browser buttons are now functional, although LyXFileDlg
429 still needs to be modified to make it straighhtforward to return a
430 directory if that is what is desired.
432 * src/frontends/xforms/forms/form_preferences.fd: use text input
433 and browse button to input the Language keymaps. Add a few
434 callbacks for the browse buttons.
436 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
438 * src/support/tempname.C (tempName): small changes to make it
439 safer. remove the '.' before XXXXXX
441 * src/support/filetools.C (TmpFileName): remove func
444 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
445 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
446 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
447 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
449 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
452 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
455 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
456 for bp (this fixes a reproducible hard crash)
458 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
461 * src/frontends/xforms/FormBase.h: make bp_ private
462 (FormBaseBI): remove default for bp
465 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
468 * src/frontends/xforms/Color.C (RGBColor): made several vars
469 const, changed initialization of j to allow it to be const
472 * several files: added const to local variables.
474 * src/lyx_cb.C: removed several function prototypes and moved them
478 (UpdateLayoutPreamble):
480 (MenuInsertLabel): add BufferView as arguemnt
481 (LayoutsCB): make tmp const
483 * src/layout_forms.h: regenerated
485 * src/debug.C: add Debug::FILES
486 (showLevel) (showTags): translate the desc
488 * src/debug.h: add FILES as debug target
490 * src/bufferlist.C: use current_view as an interim measure becuase
491 of added arguments to MenuWrite and MenuWriteAs
493 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
495 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
497 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
498 libstdc++ is compiled with.
500 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
502 * lib/layouts/docbook-book.layout
503 * lib/layouts/docbook.layout
504 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
505 those paragraphs are expresse as SGML comments <!-- -->.
507 * src/LaTeXFeatures.h
508 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
509 parameter, this allows to express all the include files as relative
510 paths to the master buffer. The verbatim insert works as the other
513 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
515 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
517 (MakeDocBookFile): top_element is always written. Some clean up, as
518 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
520 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
521 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
522 a reference is written instead of the name.
523 (Validate): use the relative path for the filename.
525 * src/insets/insetlabel.C (DocBook): write end tag, for XML
528 * src/support/filetools.h
529 * src/support/filetools.C (IsSGMLFilename): added.
532 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
534 * development/OS2/quick_fix.patch:
536 * README.OS2: quick update to the OS/2 port.
538 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
540 * src/converter.C: add "using" directive.
542 * src/frontends/xforms/FormPreferences.C: add "using" directive.
543 (compare_converter): add "int" as return type.
545 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
548 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
550 * src/lyx_gui.C (create_forms): map the xform colours, should a
551 mapping exist. Ie, call XformColor::read().
553 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
554 and struct HSV as HSVColor.
555 (XformColor::read, XformColor::write) : new methods that
556 input/output any changes to the cform GUI colors.
558 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
561 * src/frontends/xforms/FormPreferences.C Lots of little changes
562 associated with the changed name of the RGB and HSV structs. Can
563 now save changes to xforms GUI to file. Commented out
564 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
565 used currently anyway.
567 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
569 * src/converter.C: A lot of changes:
570 - It is no longer possible to choose between two or more ways to
571 export to some format (the new code uses only the shortest path).
572 However, it is still possible to choose between pdflatex/ps2pdf
573 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
574 - Added several methods that makes the FormPreferences code simpler.
575 - Changed the tokens $$FName and $$OutName to $$i and $$o.
577 * src/exporter.C (Export): lyxrc.use_pdf is set before
578 makeLaTeXFile is called. This works but not very nice.
580 * src/frontends/xforms/FormPreferences.C: The formats/converters
581 tabs are now fully functional.
583 * src/buffer.C (getTocList): Add numbers to the captions.
585 * lib/lyxrc.example: Removed fax section
587 * src/support/rename.C (rename): Delete the old file if lyx::copy
590 2000-11-13 Rob Lahaye <lahaye@postech.edu>
592 * lib/ui/default.ui: minor polishing.
594 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
596 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
599 * lib/Makefile.am (DOCINST): do not install everything in the
600 documentation directory.
602 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
604 * src/bufferlist.C (newFile): set the filename to the constructed
607 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
608 constructed "newfileXX.lyx" name to the dialog
610 * src/frontends/DialogBase.h: make update() non-abstract so
611 KDE doesn't need to implement two update methods for every form
613 * src/frontends/kde/Makefile.am: add missing xforms objects
616 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
618 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
620 * src/frontends/xforms/Color.[Ch]: new files, defining the color
621 structs RGB and HSV. May not be the best place for these files.
622 Perhaps move them into src ?
624 * src/frontends/xforms/Makefile.am: added new files.
626 * src/frontends/xforms/forms/form_preferences.fd:
627 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
628 replaced all instances of "colour" with "color"!
630 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
633 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
634 tab. Can now alter the colors of the xform's GUI on the fly. With
635 the aid of a single static Signal (see below), can "Apply" these
636 changes to all currently open dialogs. (Well, to all of the NEW
637 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
638 subsequently opened dialogs will, of course, also have the new
639 color scheme. Cannot yet save (or load) the choices to file, so
640 they are lost when exiting LyX.
642 * src/frontends/Dialogs.h:
643 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
644 Used to trigger a redraw of any dialogs connected to it because,
645 for example, the GUI colours have been re-mapped.
647 * src/frontends/xforms/FormBase.[Ch]:
648 * src/frontends/xforms/FormDocument.[Ch]:
649 * src/frontends/xforms/FormParagraph.[Ch]:
650 * src/frontends/xforms/FormPreferences.[Ch]:
651 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
652 method, to be connected to Dialogs::redrawGUI. Method must be
653 virtual, because dialogs with tabbed folders need to redraw the
654 forms of each tab folder.
656 * src/LyXView.C (d-tor):
657 * src/frontends/xforms/FormBase.C (d-tor): connected
658 Dialogs::redrawGUI signal to redraw().
660 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
661 removed Assert, because it is identical to that in FormBase.
663 2000-11-10 Rob Lahaye <lahaye@postech.edu>
665 * lib/ui/default.ui: minor polishing.
667 2000-11-10 Juergen Vigna <jug@sad.it>
669 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
670 (deleteLyXText): ditto
672 * src/insets/insettabular.C (InsetButtonPress): don't clear the
673 selection on mouse-button-3.
675 * src/insets/insettabular.h: new function clearSelection(), use this
676 functions inside insettabular.C.
678 * src/insets/insettabular.C (TabularFeatures): clear the selection
679 on remove_row/column.
681 * src/insets/inset.C (scroll): fixed some scroll stuff.
683 * src/insets/insettabular.C (draw): fixed another minor draw problem.
685 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
687 * lib/CREDITS: add Yves Bastide
689 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
691 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
692 check whether C library functions are in the global namespace.
694 * configure.in: calls it.
696 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
699 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
701 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
702 iterators to prevent crash.
704 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
706 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
708 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
709 shortcut for xforms CB to the preemptive or post-handler function.
711 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
712 removed the HIDDEN_TIMER as it's no longer used.
713 Various other small changes.
715 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
716 preemptive handler to obtain feedback, rather than the post-handler.
717 (ColoursLoadBrowser): find "black" and "white" based on RGB values
719 Formats tab is now complete. Converters tab is nearly so.
721 2000-11-09 Juergen Vigna <jug@sad.it>
723 * src/insets/insettext.C (~InsetText):
726 (SetParagraphData): set cache.second to 0 after deleting it!
727 (getLyXText): check if cache.second is not 0 if finding it.
729 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
731 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
732 lyxlex to parse the rgb.txt file.
735 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
736 replace the default '#' comment character.
738 * src/support/tempname.C: add "using" directive
739 * src/frontends/ButtonPolicies.C: ditto.
741 * src/support/filetools.C (DirList): add an explicit cast to avoid
742 a compile error (probably not the right fix)
744 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
746 * src/support/filetools.C (DirList): implement using system functions
748 * src/support/tempname.C: new file
750 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
752 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
754 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
757 * src/frontends/xforms/ButtonController.C: new file
759 * src/os2_defines.h: remove getcwd define
761 * src/lyxvc.C: include support/lyxlib.h
762 (showLog): use lyx::tempName
764 * src/lyx_cb.C: comment out includes that we don't need
765 (AutoSave): use lyx::tempName
767 * src/filedlg.C: include support/lyxlib.h
768 (Reread): use lyx::getcwd
770 * src/converter.C: include support/filetools.h
771 (add_options): change to static inline, make tail const
772 (Add): make old_viewer const
773 (GetAllFormats): make it a const method, use const_iterator
774 (enable): make static inline
775 (SplitFormat): make using_format const
777 * src/LaTeX.C (run): use lyx::getcwd
779 * configure.in: check for mkstemp as well
781 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
783 * src/converter.[Ch] (GetAllCommands): new method.
785 * src/support/filetools.[Ch] (DirList): new method.
787 * src/frontends/xforms/FormPreferences.C: started (just!) adding
788 functionality to the converters tab.
789 The formats tab is now nearly complete.
790 The kbmap choices in Languages tab now display the contents of
791 system_lyxdir/kbd/*.kmap in readable form.
793 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
794 Moved some variables into the class.
796 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
797 inactive tab folder to FL_COL1. Haven't yet worked out how to change
798 colour of active folder to lighter grey instead. Any takers?
799 (form_colours): added an "Apply" button.
800 (form_converters): added a "Flags" input field.
801 (form_formats): added a "Shortcut" input field. Note that we can't use
802 names such as "input_shortcut" as this buggers up the sed script stuff.
804 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
812 * src/lyx_sendfax_main.C:
815 * src/spellchecker.C:
816 * src/insets/figinset.C:
817 * src/insets/insetbib.C:
818 * src/insets/insetexternal.C:
819 * src/insets/insetinclude.C:
820 * src/insets/insetinfo.C:
821 * src/mathed/math_panel.C:
822 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
823 all "daughter" dialogs now have identical "feel".
825 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
827 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
828 used (and was only used in one place prior to this patch. Incorrectly!)
830 * src/frontends/xforms/FormDocument.C: changed some instances of
831 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
832 sense. Also added fl_set_input_return() for class_->input_doc_extra and
833 for options_->input_float_placement. This fixes a bug reported by
836 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
837 functionality into d-tor.
839 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
840 input of numerals also.
842 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
843 fl_set_form_atclose(). Can now close dialog from window manager,
844 fixing a bug reported by Rob Lahaye.
846 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
848 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
849 are no longer dark. Haven't yet worked out how to lighten the colour of
850 the active tabfolder. Any ideas anybody?
851 Adjusted Colours tab a little.
852 Added Shortcut field to converters tab. Note that we can't create an
853 fdesign label like "input_shortcut" as this buggers up the sed-script
856 * src/frontends/xforms/FormPreferences.[Ch]:
857 (feedback): fixed crash due to to ob=0.
858 (LanguagesXXX): the kbmap choices now contain the files
859 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
860 be replaced by an input with a file browse button, but since the browse
861 buttons don'y yet work, this'll do for the moment.
862 (FormatsXXX): think that this is now nearly fully functional.
863 Some points/questions though:
864 1. Does "Apply" remove formats if no longer present?
865 2. I think that the browser should list the GUI names rather than the
867 3. Must ensure that we can't delete Formats used by an existing
870 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
871 if this is the best way to do this.
873 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
875 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
877 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
878 for variable assignment.
880 2000-11-07 Rob Lahaye <lahaye@postech.edu>
882 * src/lib/ui/default.ui: added sub/superscripts to menu as
883 Insert->Special characters and cleaned-up the file a bit
885 2000-11-07 Allan Rae <rae@lyx.org>
887 * src/frontends/xforms/FormPreferences.C (feedback): make sure
888 ob isn't 0 before using it. See comments in function.
890 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
892 * src/frontends/xforms/form_*.C: regenerated
894 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
896 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
898 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
899 compiling with gcc-2.96
901 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
903 * src/support/lyxstring.C: add a couple "using" directives.
905 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
906 a .c_str() here too for good measure.
907 * src/Spacing.C (set): ditto.
908 * src/lyxfunc.C (Dispatch): ditto.
910 * src/insets/insettabular.C (copySelection): change .str() to
911 .str().c_str() to fix problems with lyxstring.
912 * src/support/filetools.C (GetFileContents): ditto.
913 * src/buffer.C (asciiParagraph): ditto.
914 * src/paragraph.C (String): ditto.
916 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
917 * lib/bind/sciword.bind: ditto.
919 * src/LyXAction.C (init): remove "symbol-insert" function, which
920 shared LFUN_INSERT_MATH with "math-insert".
922 * lib/configure.m4: == is not a valid operator for command test.
924 * src/lyxrc.C: add using directive.
926 * src/converter.h: add std:: qualifier.
928 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
930 * src/converter.[Ch] and other files: Change the Format class to a
931 real class, and create two instances: formats and system_format.
933 * src/lyxrc.C (output): Output the difference between formats and
936 * src/frontends/xforms/FormPreferences.C (input): Simplify.
937 (buildFormats): Insert formats into browser.
938 (inputFormats): Made the browser and add button functional.
939 (applyFormats): Update formats from format_vec.
941 * src/converter.C: Changed all (*it). to it->
942 (Format::dummy): New method.
943 (Format::importer): New format flag.
944 (Formats::GetAllFormats): New method.
945 (Formats::Add): Delete format from the map if prettyname is empty.
946 (Converter::Convert): Print an error message if moving the file fails.
947 (Converter::GetReachableTo): New method
949 * src/MenuBackend.[Ch]: Add support for importformats tag.
951 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
953 * lib/configure.m4: Add word->tex and ps->fax converters.
955 * lib/ui/default.ui: Use ImportFormats on file->import menu.
956 Return fax to file menu.
960 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
962 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
965 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
968 * src/lyxfunc.C (processKeyEvent): removed
970 * src/bufferlist.C (emergencyWrite): removed the out commented
971 emergency write code.
973 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
975 * src/LyXView.[Ch]: remove the outcommented raw_callback code
977 * many files: change formatting to be a bit more uniform for
978 if,while,for,switch statements, remove some parantesis not needed.
981 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
983 * config/kde.m4: make config more robust when KDEDIR is set
985 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
987 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
988 not returned a pixmap for "math-insert".
990 * src/LyXAction.C (init): sort the entries a bit.
992 2000-11-03 Juergen Vigna <jug@sad.it>
994 * src/insets/insettabular.h: added fixed number to update codes so
995 that update is only in one direction.
997 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
1000 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
1001 before call to edit because of redraw.
1003 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
1005 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1007 * lib/ui/default.ui: Populate "edit_float" menu
1009 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
1011 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
1012 "floats-operate". The name is ugly (and the func also), but this
1013 is just a band-aid until we switch to new insets.
1015 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1017 * lib/ui/default.ui: update again the menu layout (fix some
1020 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1022 * src/MenuBackend.h (fulllabel): new method.
1024 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
1025 the menu shortcuts of a menu are unique and whether they
1026 correspond to a letter of the label.
1027 (expand): call checkShortcuts when debugging.
1029 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
1031 * src/insets/insettext.C (InsetButtonPress): shut off warning.
1033 2000-11-02 Lior Silberman <lior@Princeton.EDU>
1035 * lib/examples/*.lyx : '\language default' => '\language english'
1037 * lib/examples/it_splash.lyx : except where it should be italian
1039 * lib/templates/*.lyx : the same
1041 * doc/*.lyx* : the same
1043 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1045 * lib/bind/menus.bind: remove the Layout menu entries, which I
1046 somehow forgot earlier.
1048 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1050 * lib/ui/old-default.ui: keep the old one here for reference (to
1053 * lib/ui/default.ui: update the menu layout
1055 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
1057 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
1058 Can now Apply to different insets without closing the dialog.
1060 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
1061 Can't actually DO anything with them yet, but I'd like a little
1064 * src/frontends/xforms/input_validators.[ch]
1065 (fl_lowercase_filter): new.
1067 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
1069 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
1070 of MATH_CODE. This fixes a bug with math-macros in RTL text.
1072 * src/text.C (PrepareToPrint): Show math-macros block aligned.
1074 2000-11-02 Juergen Vigna <jug@sad.it>
1076 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
1077 on char insertion as it has already be updated by bv->updateInset().
1079 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
1080 if an inset inside was updated.
1082 * lib/configure.cmd: commented out fax-search code
1084 2000-11-01 Yves Bastide <stid@acm.org>
1086 * src/tabular.C (OldFormatRead): set tabular language to the
1089 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1091 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
1092 class names with non-letter characters (from Yves Bastide).
1094 * lib/ui/default.ui: change Item to OptItem in import menu.
1095 Comment out fax stuff.
1097 * lib/configure.m4: comment out fax-related stuff.
1099 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
1101 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
1102 useful xforms helper functions. At present contains only formatted().
1103 Input a string and it returns it with line breaks so that in fits
1106 * src/frontends/xforms/Makefile.am: add new files.
1108 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
1109 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
1112 * src/frontends/xforms/FormPreferences.[Ch]:
1113 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
1114 but lots of little clean ups. Removed enum State. Make use of
1115 formatted(). Constify lots of methods. Perhaps best of all: removed
1116 requirement for that horrible reinterpret_cast from pointer to long in
1119 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1121 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
1122 conditionalize build on xforms < 0.89
1124 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
1126 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
1128 * src/LyXAction.C (init): comment out fax
1130 * src/lyxrc.h: comment out the fax enums
1131 comment out the fax variables
1133 * src/commandtags.h: comment out LFUN_FAX
1135 * src/lyxrc.C: disable fax variables.
1136 (read): disable parsing of fax variables
1137 (output): disable writing of fax variables
1138 (getFeedback): now description for fax variables
1140 * src/lyxfunc.C: comment out MenuFax
1141 (Dispatch): disable LFUN_FAX
1143 * src/lyx_cb.C (MenuFax): comment out
1145 * src/WorkArea.C: add <cctype>
1146 (work_area_handler): better key handling, should be ok now.
1147 for accented chars + etc
1149 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
1150 lyx_sendfax.h and lyx_sendfax_man.C
1152 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
1153 (show): don't call InitLyXLookup when using xforms 0.89
1155 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1157 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1159 * src/support/filetools.C (GetFileContents): close to dummy change
1161 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1163 * src/trans.C (AddDeadkey): workaround stupid compilers.
1165 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1167 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1168 of two-sided document.
1170 2000-10-31 Juergen Vigna <jug@sad.it>
1172 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1174 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1175 xposition to the Edit call.
1177 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1179 * src/trans.C (AddDeadkey): cast explicitly to char.
1181 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1183 * src/tabular.C (AsciiBottomHLine): simplify?
1184 (AsciiTopHLine): simplify?
1185 (print_n_chars): simplify
1186 (DocBook): remove most of the << endl; we should flush the stream
1187 as seldom as possible.
1189 (TeXBottomHLine): ditto
1190 (TeXTopHLine): ditto
1192 (write_attribute): try a templified version.
1193 (set_row_column_number_info): lesson scope of variables
1195 * src/support/lstrings.h (tostr): new specialization of tostr
1197 * src/trans.C (AddDeadkey): slightly cleaner fix.
1199 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1201 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1202 '%%' in Toc menu labels.
1205 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1206 font_norm is iso10646-1.
1208 * src/font.C (ascent): Fixed for 16bit fonts
1209 (descent,lbearing,rbearing): ditto
1211 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1213 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1214 (getFeedback): new static method.
1216 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1217 Now use combox rather than choice to display languages.
1218 Feedback is now output using a new timer callback mechanism, identical
1219 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1221 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1223 * src/minibuffer.C: fix for older compilers
1225 2000-10-30 Juergen Vigna <jug@sad.it>
1227 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1228 has to be Left of the inset otherwise LyXText won't find it!
1230 * src/BufferView2.C (open_new_inset): delete the inset if it can
1233 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1235 * lyx.man: fix typo.
1237 2000-10-29 Marko Vendelin <markov@ioc.ee>
1238 * src/frontends/gnome/FormCitation.C
1239 * src/frontends/gnome/FormCitation.h
1240 * src/frontends/gnome/FormCopyright.C
1241 * src/frontends/gnome/FormCopyright.h
1242 * src/frontends/gnome/FormError.C
1243 * src/frontends/gnome/FormError.h
1244 * src/frontends/gnome/FormIndex.C
1245 * src/frontends/gnome/FormIndex.h
1246 * src/frontends/gnome/FormPrint.C
1247 * src/frontends/gnome/FormPrint.h
1248 * src/frontends/gnome/FormRef.C
1249 * src/frontends/gnome/FormRef.h
1250 * src/frontends/gnome/FormToc.C
1251 * src/frontends/gnome/FormToc.h
1252 * src/frontends/gnome/FormUrl.C
1253 * src/frontends/gnome/FormUrl.h
1254 * src/frontends/gnome/Menubar_pimpl.C
1255 * src/frontends/gnome/mainapp.C
1256 * src/frontends/gnome/mainapp.h
1257 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1258 changing update() to updateSlot() where appropriate
1260 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1262 * src/frontends/xforms/FormPreferences.[Ch]:
1263 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1266 2000-10-28 Juergen Vigna <jug@sad.it>
1268 * src/insets/insettabular.C (draw): fixed drawing bug.
1270 * src/insets/insettext.C (clear):
1272 (SetParagraphData): clearing the TEXT buffers when deleting the
1273 paragraphs used by it.
1275 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
1277 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
1279 2000-10-27 Juergen Vigna <jug@sad.it>
1281 * src/tabular.C (~LyXTabular): removed not needed anymore.
1283 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
1286 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1288 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
1291 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
1294 * src/frontends/xforms/FormPreferences.[Ch]:
1295 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
1296 Reorganised as modules based on tabs. Much easier to follow the
1297 flow and to add new tabs. Added warning and feedback messages.
1300 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1302 * src/tabular.h (DocBook): add std:: qualifier.
1304 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
1306 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
1307 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
1310 * insettabular.C (DocBook): uses the tabular methods to export
1313 * src/insets/insettext.h
1314 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
1316 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1318 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
1321 * src/lyxfunc.C (MenuNew): lessen the scope of fname
1322 moved misplaced AllowInput two lines up.
1324 * src/buffer.C (readFile): compare float with float, not with int
1326 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1328 * src/minibuffer.C: add "using SigC::slot" statement.
1330 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
1332 * src/frontends/xforms/forms/README: updated section about make.
1334 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
1335 Tidied some forms up, made two of form_tabular's tabs more
1336 self-consistent, fixed Jean-Marc's size problem in form_preferences,
1337 fixed translation problem with "Column".
1339 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1341 * src/minibuffer.h: use Timeout instead of the xforms timer
1343 (setTimer) rewrite for the Timeout, change to unsigned arg
1344 (set): change to unsigned timer arg
1347 * src/minibuffer.C (TimerCB): removed func
1348 (C_MiniBuffer_TimerCB): removed func
1349 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
1350 (peek_event): use a switch statement
1351 (add): don't use fl_add_timer.
1352 (Set): rewrite to use the Timeout
1355 * src/Timeout.[Ch] (setType): return a Timeout &
1356 (setTimeout): ditto, change to unsigned arg for timeout
1358 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
1360 * src/mathed/formula.C (mathed_string_width): Use string instead
1361 of a constant size char array.
1363 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1365 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
1366 the two recently added operator<< for SMInput and State.
1368 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
1370 (OkCancelPolicy): ditto
1371 (OkCancelReadOnlyPolicy): ditto
1372 (NoRepeatedApplyReadOnlyPolicy): ditto
1373 (OkApplyCancelReadOnlyPolicy): ditto
1374 (OkApplyCancelPolicy): ditto
1375 (NoRepeatedApplyPolicy): ditto
1377 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1379 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
1380 add the usual std:: qualifiers.
1382 2000-10-25 Juergen Vigna <jug@sad.it>
1384 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
1386 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1388 * src/support/filetools.C (MakeRelPath): change some types to
1391 * src/frontends/ButtonPolicies.h (operator<<): new operator for
1392 ButtonPolicy::SMInput and ButtonPolicy::State.
1394 * src/FontLoader.C (reset): small cleanup
1395 (unload): small cleanup
1397 * src/FontInfo.C (getFontname): initialize error to 10000.0
1399 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1401 * src/frontends/xforms/FormPreferences.[Ch]:
1402 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
1403 TeX encoding and default paper size sections.
1405 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1407 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
1410 * src/frontends/xforms/FormError.C (disconnect): use erase() to
1411 make the message_ empty.
1412 (FormError): don't initialize message_ in initializer list.
1414 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1416 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
1418 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1420 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
1422 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
1424 * src/frontends/kde/*data.[Ch]: _("") is not
1427 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1429 * src/buffer.C: removed redundant using directive.
1431 * src/frontends/DialogBase.h: revert to original definition of
1434 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
1435 stuff into two classes, one for each dialog, requires a new
1436 element in the dialogs vector, FormTabularCreate.
1438 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
1441 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
1442 method. Continues Allan's idea, but means that derived classes
1443 don't need to worry about "update or hide?".
1445 * src/frontends/xforms/FormError.C (showInset): add connection
1448 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
1449 one for each dialog. FormTabular now contains main tabular dialog
1452 * src/frontends/xforms/FormTabularCreate.[Ch]:
1453 * src/frontends/xforms/forms/form_tabular_create.fd: the create
1456 * src/frontends/xforms/FormGraphics.[Ch]:
1457 * src/frontends/xforms/forms/form_graphics.fd
1458 * src/frontends/xforms/FormTabular.[Ch]:
1459 * src/frontends/xforms/forms/form_tabular.fd: made daughter
1460 classes of FormInset.
1462 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
1463 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
1465 * src/frontends/xforms/Makefile.am:
1466 * src/frontends/xforms/forms/makefile: added new files.
1468 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
1469 variable. added Signal0 hide signal, in keeping with other GUI-I
1472 * src/support/lstrings.h: removed redundant std:: qualifier as
1473 it's already declared in Lsstream.h.
1475 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1477 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
1481 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1483 * src/tabular.C (Ascii): minimize scope of cell.
1485 * src/BufferView2.C (nextWord): return string() instead of 0;
1487 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1489 * src/converter.h: add a std:: qualifier
1491 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
1493 * src/importer.[Ch]: New files. Used for importing files into LyX.
1495 * src/lyxfunc.C (doImport): Use the new Importer class.
1497 * src/converter.h: Add shortcut member to the Format class.
1498 Used for holding the menu shortcut.
1500 * src/converter.C and other files: Made a distinction between
1501 format name and format extension. New formats can be defined using
1502 the \format lyxrc tag.
1503 Added two new converter flags: latex and disable.
1505 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1507 * src/support/lyxlib.h: unify namespace/struct implementation.
1508 Remove extra declarations.
1510 * src/support/chdir.C (chdir): remove version taking char const *
1512 * src/support/rename.C: ditto.
1513 * src/support/lyxsum.C: ditto.
1515 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
1517 * src/frontends/xforms/FormBase.[Ch]:
1518 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
1519 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
1520 work only for the next call to fl_show_form(). The correct place to set
1521 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
1522 done. FormBase also stores minw_, minh_ itself. All dialogs derived
1523 from FormBase have the minimum size set; no more stupid crashes with
1526 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1528 * lib/ui/default.ui: fix shortcut for Insert->Include File.
1530 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1532 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
1534 * src/support/lyxlib.h: changed second argument of mkdir to
1535 unsigned long int (unsigned int would probably have been enough,
1536 but...). Removed <sys/types.h> header.
1537 * src/support/mkdir.C (mkdir): ditto.
1541 2000-10-19 Juergen Vigna <jug@sad.it>
1543 * src/lyxfunc.C (MenuNew): small fix (form John)
1545 * src/screen.C (Update): removed unneeded code.
1547 * src/tabular.C (Ascii): refixed int != uint bug!
1549 * src/support/lyxlib.h: added sys/types.h include for now permits
1550 compiling, but I don't like this!
1552 2000-10-18 Juergen Vigna <jug@sad.it>
1554 * src/text2.C (ClearSelection): if we clear the selection we need
1555 more refresh so set the status apropriately
1557 * src/insets/insettext.C (draw): hopefully finally fixed draw
1560 2000-10-12 Juergen Vigna <jug@sad.it>
1562 * src/insets/insettext.C (draw): another small fix and make a block
1563 so that variables are localized.
1565 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
1567 * src/support/lstrings.C (lowercase, uppercase):
1568 use explicit casts to remove compiler warnings.
1570 * src/support/LRegex.C (Impl):
1571 * src/support/StrPool.C (add):
1572 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
1573 (AddPath, MakeDisplayPath):
1574 * src/support/lstrings.C (prefixIs, subst):
1575 use correct type to remove compiler warnings.
1577 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
1579 * src/support/lyxlib.h:
1580 * src/support/mkdir.C (mkdir): change parameter to mode_t for
1581 portability and to remove compiler warning with DEC cxx.
1583 * src/support/FileInfo.[Ch] (flagRWX): ditto.
1585 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1587 * src/minibuffer.C (peek_event): retun 1 when there has been a
1588 mouseclick in the minibuffer.
1592 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
1594 * src/frontends/xforms/FormParagraph.C: more space above/below
1597 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
1599 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1600 a char only if real_current_font was changed.
1602 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1604 * NEWS: update somewhat for 1.1.6
1606 * lib/ui/default.ui: clean up.
1608 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
1610 * lib/CREDITS: clean up
1612 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1614 * src/combox.[Ch] (select): changed argument back to int
1615 * src/combox.C (peek_event): removed num_bytes as it is declared but
1618 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
1619 modified calls to Combox::select() to remove warnings about type
1622 * src/insets/insetbutton.C (width): explicit cast to remove warning
1623 about type conversion.
1625 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
1628 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
1629 sel_pos_end, refering to cursor position are changed to
1630 LyXParagraph::size_type.
1632 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
1633 consistent with LyXCursor::pos().
1634 (inset_pos): changed to LyXParagraph::size_type for same reason.
1636 * src/insets/insettext.C (resizeLyXText): changed some temporary
1637 variables refing to cursor position to LyXParagraph::size_type.
1639 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
1641 * src/frontends/kde/<various>: The Great Renaming,
1644 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1646 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
1648 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1650 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
1651 0 when there are no arguments.
1653 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1655 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
1656 to segfaults when pressing Ok in InsetBibtex dialog.
1658 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1660 * forms/layout_forms.fd:
1661 * src/layout_forms.C (create_form_form_character): small change to use
1662 labelframe rather than engraved frame + text
1664 * src/lyx_gui.C (create_forms): initialise choice_language with some
1665 arbitrary value to prevent segfault when dialog is shown.
1667 2000-10-16 Baruch Even <baruch.even@writeme.com>
1669 * src/converter.C (runLaTeX, scanLog): Added a warning when there
1670 is no resulting file. This pertains only to LaTeX output.
1672 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
1674 * src/text.C (Backspace): Make sure that the row of the cursor is
1677 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1680 * src/lyx_gui.C (init): Prevent a crash when only one font from
1681 menu/popup fonts is not found.
1683 * lib/lyxrc.example: Add an example for binding a key for language
1686 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
1688 * src/converter.C (GetReachable): Changed the returned type to
1690 (IsReachable): New method
1692 * src/MenuBackend.C (expand): Handle formats that appear more
1695 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1697 * src/frontends/support/Makefile.am
1698 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
1701 * lib/CREDITS: add Garst Reese.
1703 * src/support/snprintf.h: add extern "C" {} around the definitions.
1705 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
1707 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1710 * src/frontends/xforms/FormDocument.C:
1711 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
1712 compile without "conversion to integral type of smaller size"
1715 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1717 * src/text.C (GetColumnNearX): Fixed disabled code.
1719 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1721 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
1724 * src/support/snprintf.[ch]: new files
1726 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1728 * src/frontends/kde/formprintdialog.C: add
1729 file browser for selecting postscript output
1731 * src/frontends/kde/formprintdialogdata.C:
1732 * src/frontends/kde/formprintdialogdata.h: re-generate
1735 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1737 * src/frontends/gnome/Makefile.am:
1738 * src/frontends/kde/Makefile.am: FormCommand.C
1739 disappeared from xforms
1741 * src/frontends/kde/FormCitation.C:
1742 * src/frontends/kde/FormIndex.C: read-only
1745 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1747 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
1750 * src/bufferlist.C: add using directive.
1752 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1754 * src/support/lyxfunctional.h: version of class_fun for void
1755 returns added, const versions of back_inseter_fun and compare_fun
1758 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1760 * src/frontends/xforms/FormInset.C (showInset): fix typo.
1762 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1764 * ChangeLog: cleanup.
1766 * lib/CREDITS: update to add all the contributors we've forgotten.
1767 I have obviously missed some, so tell me whether there were
1770 2000-10-13 Marko Vendelin <markov@ioc.ee>
1772 * src/frontends/gnome/FormCitation.C
1773 * src/frontends/gnome/FormCitation.h
1774 * src/frontends/gnome/FormError.C
1775 * src/frontends/gnome/FormIndex.C
1776 * src/frontends/gnome/FormRef.C
1777 * src/frontends/gnome/FormRef.h
1778 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
1780 * src/frontends/gnome/FormCitation.C
1781 * src/frontends/gnome/FormCopyright.C
1782 * src/frontends/gnome/FormError.C
1783 * src/frontends/gnome/FormIndex.C
1784 * src/frontends/gnome/FormRef.C
1785 * src/frontends/gnome/FormToc.C
1786 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
1789 * src/frontends/gnome/Menubar_pimpl.C
1790 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
1793 2000-10-11 Baruch Even <baruch.even@writeme.com>
1796 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
1797 to convey its real action.
1799 * src/minibuffer.C (peek_event): Added action when mouse clicks to
1800 clear the minibuffer and prepare to enter a command.
1802 * src/mathed/formula.C (LocalDispatch): Changed to conform with
1803 the rename from ExecCommand to PrepareForCommand.
1804 * src/lyxfunc.C (Dispatch): ditto.
1806 2000-10-11 Baruch Even <baruch.even@writeme.com>
1808 * src/buffer.C (writeFile): Added test for errors on writing, this
1809 catches all errors and not only file system full errors as intended.
1811 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1813 * src/lyx_gui.C (create_forms): better fix for crash with
1814 translated interface.
1816 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
1818 * src/frontends/kde/Makefile.am:
1819 * src/frontends/kde/FormCopyright.C:
1820 * src/frontends/kde/formcopyrightdialog.C:
1821 * src/frontends/kde/formcopyrightdialog.h:
1822 * src/frontends/kde/formcopyrightdialogdata.C:
1823 * src/frontends/kde/formcopyrightdialogdata.h:
1824 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
1825 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
1826 copyright to use qtarch
1828 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
1830 * src/encoding.C (read): Fixed bug that caused an error message at
1831 the end of the file.
1833 * po/Makefile.in.in: Fixed rule for ext_l10n.h
1835 * lib/lyxrc.example: Fixed hebrew example.
1837 2000-10-13 Allan Rae <rae@lyx.org>
1839 * src/frontends/xforms/FormPreferences.C (input): reworking the
1841 (build, update, apply): New inputs in various tabfolders
1843 * src/frontends/xforms/FormToc.C: use new button policy.
1844 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
1845 dialogs that either can't use any existing policy or where it just
1848 * src/frontends/xforms/FormTabular.h: removed copyright notice that
1851 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
1852 added a bool parameter which is ignored.
1854 * src/buffer.C (setReadonly):
1855 * src/BufferView_pimpl.C (buffer):
1856 * src/frontends/kde/FormCopyright.h (update):
1857 * src/frontends/kde/FormCitation.[Ch] (update):
1858 * src/frontends/kde/FormIndex.[Ch] (update):
1859 * src/frontends/kde/FormPrint.[Ch] (update):
1860 * src/frontends/kde/FormRef.[Ch] (update):
1861 * src/frontends/kde/FormToc.[Ch] (update):
1862 * src/frontends/kde/FormUrl.[Ch] (update):
1863 * src/frontends/gnome/FormCopyright.h (update):
1864 * src/frontends/gnome/FormCitation.[Ch] (update):
1865 * src/frontends/gnome/FormError.[Ch] (update):
1866 * src/frontends/gnome/FormIndex.[Ch] (update):
1867 * src/frontends/gnome/FormPrint.[Ch] (update):
1868 * src/frontends/gnome/FormRef.h (update):
1869 * src/frontends/gnome/FormToc.[Ch] (update):
1870 * src/frontends/gnome/FormUrl.[Ch] (update):
1871 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
1872 to updateBufferDependent and DialogBase
1874 * src/frontends/xforms/FormCitation.[hC]:
1875 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
1876 * src/frontends/xforms/FormError.[Ch]:
1877 * src/frontends/xforms/FormGraphics.[Ch]:
1878 * src/frontends/xforms/FormIndex.[Ch]:
1879 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
1880 and fixed readOnly handling.
1881 * src/frontends/xforms/FormPrint.[Ch]:
1882 * src/frontends/xforms/FormRef.[Ch]:
1883 * src/frontends/xforms/FormTabular.[Ch]:
1884 * src/frontends/xforms/FormToc.[Ch]:
1885 * src/frontends/xforms/FormUrl.[Ch]:
1886 * src/frontends/xforms/FormInset.[Ch]:
1887 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
1888 form of updateBufferDependent.
1890 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
1891 if form()->visible just in case someone does stuff to the form in a
1894 * src/frontends/DialogBase.h (enum): removed enum since we can now use
1895 the buttoncontroller for everything the enum used to be used for.
1896 (update) It would seem we need to force all dialogs to use a bool
1897 parameter or have two update functions. I chose to go with one.
1898 I did try removing update() from here and FormBase and defining the
1899 appropriate update signatures in FormBaseB[DI] but then ran into the
1900 problem of the update() call in FormBase::show(). Whatever I did
1901 to get around that would require another function and that just
1902 got more confusing. Hence the decision to make everyone have an
1903 update(bool). An alternative might have been to override show() in
1904 FormBaseB[DI] and that would allow the different and appropriate
1907 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
1908 true == buffer change occurred. I decided against using a default
1909 template parameter since not all compilers support that at present.
1911 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
1913 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
1914 army knife" by removing functionality.
1915 (clearStore): removed. All such housekeeping on hide()ing the dialog
1916 is to be carried out by overloaded disconnect() methods.
1917 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
1918 superceded by Baruch's neat test (FormGraphics) to update an existing
1919 dialog if a new signal is recieved rather than block all new signals
1921 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
1922 only to Inset dialogs.
1923 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
1924 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
1926 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
1928 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
1929 as a base class to all inset dialogs. Used solely to connect/disconnect
1930 the Inset::hide signal and to define what action to take on receipt of
1931 a UpdateBufferDependent signal.
1932 (FormCommand): now derived from FormInset.
1934 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
1937 * src/frontends/xforms/FormCopyright.[Ch]:
1938 * src/frontends/xforms/FormPreferences.[Ch]:
1939 now derived from FormBaseBI.
1941 * src/frontends/xforms/FormDocument.[Ch]:
1942 * src/frontends/xforms/FormParagraph.[Ch]:
1943 * src/frontends/xforms/FormPrint.[Ch]:
1944 now derived from FormBaseBD.
1946 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
1948 * src/frontends/xforms/FormCitation.[Ch]:
1949 * src/frontends/xforms/FormError.[Ch]:
1950 * src/frontends/xforms/FormRef.[Ch]:
1951 * src/frontends/xforms/FormToc.[Ch]:
1952 (clearStore): reworked as disconnect().
1954 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
1957 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1959 * src/converter.C (runLaTeX): constify buffer argument
1962 * src/frontends/support/Makefile.am (INCLUDES): fix.
1964 * src/buffer.h: add std:: qualifier
1965 * src/insets/figinset.C (addpidwait): ditto
1966 * src/MenuBackend.C: ditto
1967 * src/buffer.C: ditto
1968 * src/bufferlist.C: ditto
1969 * src/layout.C: ditto
1970 * src/lyxfunc.C: ditto
1972 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1974 * src/lyxtext.h (bidi_level): change return type to
1975 LyXParagraph::size_type.
1977 * src/lyxparagraph.h: change size_type to
1978 TextContainer::difference_type. This should really be
1979 TextContainer::size_type, but we need currently to support signed
1982 2000-10-11 Marko Vendelin <markov@ioc.ee>
1983 * src/frontends/gnome/FormError.h
1984 * src/frontends/gnome/FormRef.C
1985 * src/frontends/gnome/FormRef.h
1986 * src/frontends/gnome/FormError.C
1987 * src/frontends/gnome/Makefile.am
1988 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
1989 to Gnome frontend. Both dialogs use "action" area.
1991 2000-10-12 Baruch Even <baruch.even@writeme.com>
1993 * src/graphics/GraphicsCacheItem_pimpl.C:
1994 * src/graphics/Renderer.C:
1995 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
1998 2000-10-12 Juergen Vigna <jug@sad.it>
2000 * src/insets/insettext.C (draw): fixed drawing bug (specifically
2001 visible when selecting).
2003 * development/Code_rules/Rules: fixed some typos.
2005 2000-10-09 Baruch Even <baruch.even@writeme.com>
2007 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
2008 compiling on egcs 1.1.2 possible.
2010 * src/filedlg.C (comp_direntry::operator() ): ditto.
2012 2000-08-31 Baruch Even <baruch.even@writeme.com>
2014 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
2017 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
2018 transient it now only gets freed when the object is destructed.
2020 2000-08-24 Baruch Even <baruch.even@writeme.com>
2022 * src/frontends/FormGraphics.h:
2023 * src/frontends/FormGraphics.C: Changed to use ButtonController and
2026 2000-08-20 Baruch Even <baruch.even@writeme.com>
2028 * src/insets/insetgraphics.C:
2029 (draw): Added messages to the drawn rectangle to report status.
2030 (updateInset): Disabled the use of the inline graphics,
2033 2000-08-17 Baruch Even <baruch.even@writeme.com>
2035 * src/frontends/support: Directory added for the support of GUII LyX.
2037 * src/frontends/support/LyXImage.h:
2038 * src/frontends/support/LyXImage.C: Base class for GUII holding of
2041 * src/frontends/support/LyXImage_X.h:
2042 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
2043 version of LyXImage, this uses the Xlib Pixmap.
2045 * src/PainterBase.h:
2046 * src/PainterBase.C:
2048 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
2049 replacement to Pixmap.
2051 * src/insets/insetgraphics.h:
2052 * src/insets/insetgraphics.C:
2053 * src/graphics/GraphicsCacheItem.h:
2054 * src/graphics/GraphicsCacheItem.C:
2055 * src/graphics/GraphicsCacheItem_pimpl.h:
2056 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
2059 * src/graphics/GraphicsCacheItem.h:
2060 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
2061 another copy of the object.
2063 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
2064 of cacheHandle, this fixed a bug that sent LyX crashing.
2066 * src/graphics/XPM_Renderer.h:
2067 * src/graphics/XPM_Renderer.C:
2068 * src/graphics/EPS_Renderer.h:
2069 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
2071 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2073 * src/lyxfunc.C (processKeySym): only handle the
2074 lockinginset/inset stuff if we have a buffer and text loaded...
2076 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
2078 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2080 * src/support/lyxfunctional.h: add operator= that takes a reference
2082 * src/lyxserver.C (mkfifo): make first arg const
2084 * src/layout.h: renamed name(...) to setName(...) to work around
2087 * src/buffer.C (setFileName): had to change name of function to
2088 work around bugs in egcs. (renamed from fileName)
2090 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
2092 * src/support/translator.h: move helper template classes to
2093 lyxfunctional.h, include "support/lyxfunctional.h"
2095 * src/support/lyxmanip.h: add delaration of fmt
2097 * src/support/lyxfunctional.h: new file
2098 (class_fun_t): new template class
2099 (class_fun): helper template function
2100 (back_insert_fun_iterator): new template class
2101 (back_inserter_fun): helper template function
2102 (compare_memfun_t): new template class
2103 (compare_memfun): helper template function
2104 (equal_1st_in_pair): moved here from translator
2105 (equal_2nd_in_pair): moved here from translator
2107 * src/support/fmt.C: new file
2108 (fmt): new func, can be used for a printf substitute when still
2109 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
2111 * src/support/StrPool.C: add some comments
2113 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
2116 * src/insets/figinset.C (addpidwait): use std::copy with
2117 ostream_iterator to fill the pidwaitlist
2119 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
2121 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
2124 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
2127 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
2129 * src/frontends/xforms/FormDocument.C (build): remove c_str()
2130 (class_update): ditto
2131 (BulletPanel): ditto
2132 (CheckChoiceClass): move initialization of tc and tct
2134 * src/tabular.C: remove current_view
2135 (OldFormatRead): similar to right below [istream::ignore]
2137 * src/lyxlex_pimpl.C (next): add code for faster skipping of
2138 chars, unfortunately this is buggy on gcc 2.95.2, so currently
2139 unused [istream::ignore]
2141 * src/lyxfunc.C: include "support/lyxfunctional.h"
2142 (getInsetByCode): use std::find_if and compare_memfun
2144 * src/lyxfont.C (stateText): remove c_str()
2146 * src/lyx_main.C (setDebuggingLevel): make static
2147 (commandLineHelp): make static
2149 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
2150 Screen* together with fl_get_display() and fl_screen
2152 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
2153 togheter with fl_get_display() and fl_screen
2154 (create_forms): remove c_str()
2156 * src/layout.C: include "support/lyxfunctional.h"
2157 (hasLayout): use std::find_if and compare_memfun
2158 (GetLayout): use std::find_if and comapre_memfun
2159 (delete_layout): use std::remove_if and compare_memfun
2160 (NumberOfClass): use std:.find_if and compare_memfun
2162 * src/gettext.h: change for the new functions
2164 * src/gettext.C: new file, make _(char const * str) and _(string
2165 const & str) real functions.
2167 * src/font.C (width): rewrite slightly to avoid one extra variable
2169 * src/debug.C: initialize Debug::ANY here
2171 * src/commandtags.h: update number comments
2173 * src/combox.h (get): make const func
2175 (getline): make const
2177 * src/combox.C (input_cb): handle case where fl_get_input can
2180 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2181 "support/lyxfunctional.h", remove current_view variable.
2182 (resize): use std::for_each with std::mem_fun
2183 (getFileNames): use std::copy with back_inserter_fun
2184 (getBuffer): change arg type to unsigned int
2185 (emergencyWriteAll): call emergencyWrite with std::for_each and
2187 (emergencyWrite): new method, the for loop in emergencyWriteAll
2189 (exists): use std::find_if with compare_memfun
2190 (getBuffer): use std::find_if and compare_memfun
2192 * src/buffer.h: add typedefs for iterator_category, value_type
2193 difference_type, pointer and reference for inset_iterator
2194 add postfix ++ for inset_iterator
2195 make inset_iterator::getPos() const
2197 * src/buffer.C: added support/lyxmanip.h
2198 (readFile): use lyxerr << fmt instead of printf
2199 (makeLaTeXFile): use std::copy to write out encodings
2201 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2203 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2204 free and the char * temp.
2205 (hasMenu): use std::find_if and compare_memfun
2208 * src/Makefile.am (lyx_SOURCES): added gettext.C
2210 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2211 string::insert small change to avoid temporary
2213 * src/LColor.C (getGUIName): remove c_str()
2215 * several files: change all occurrences of fl_display to
2218 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2219 that -pedantic is not used for gcc 2.97 (cvs gcc)
2221 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2223 2000-10-11 Allan Rae <rae@lyx.org>
2225 * src/frontends/xforms/FormPreferences.C (input): template path must be
2226 a readable directory. It doesn't need to be writeable.
2227 (build, delete, update, apply): New inputs in the various tabfolders
2229 * src/frontends/xforms/forms/form_preferences.fd:
2230 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2231 several new entries to existing folders. Shuffled some existing stuff
2234 * src/frontends/xforms/forms/form_print.fd:
2235 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2236 Should probably rework PrinterParams as well. Note that the switch to
2237 collated is effectively the same as !unsorted so changing PrinterParams
2238 will require a lot of fiddly changes to reverse the existing logic.
2240 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2242 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2244 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2246 2000-10-10 Allan Rae <rae@lyx.org>
2249 * src/lyxfunc.C (Dispatch):
2251 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2254 * src/lyxrc.C (output): Only write the differences between system lyxrc
2255 and the users settings.
2258 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2260 I'll rewrite this later, after 1.1.6 probably, to keep a single
2261 LyXRC but two instances of a LyXRCStruct.
2263 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2265 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2267 * src/tabular.h: add a few std:: qualifiers.
2269 * src/encoding.C: add using directive.
2270 * src/language.C: ditto.
2272 * src/insets/insetquotes.C (Validate): use languages->lang()
2273 instead of only language.
2275 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
2277 * lib/languages: New file.
2279 * lib/encodings: New file.
2281 * src/language.C (Languages): New class.
2282 (read): New method. Reads the languages from the 'languages' file.
2284 * src/encoding.C (Encodings): New class.
2285 (read): New method. Reads the encodings from the 'encodings' file.
2287 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
2290 * src/bufferparams.h and a lot of files: Deleted the member language,
2291 and renamed language_info to language
2293 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
2294 * src/lyxfont.C (latexWriteStartChanges): ditto.
2295 * src/paragraph.C (validate,TeXOnePar): ditto.
2297 * src/lyxfont.C (update): Restored deleted code.
2299 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
2301 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2303 * src/BufferView_pimpl.C (buffer): cleaned up a little.
2305 * src/insets/figinset.[Ch]:
2306 * src/insets/insetinclude.[Ch]:
2307 * src/insets/insetinclude.[Ch]:
2308 * src/insets/insetparent.[Ch]:
2309 * src/insets/insetref.[Ch]:
2310 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
2312 * src/insets/*.[Ch]:
2313 * src/mathed/formula.[Ch]:
2314 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
2316 * src/buffer.C (parseSingleLyXformat2Token, readInset):
2317 * src/lyx_cb.C (FigureApplyCB):
2318 * src/lyxfunc.C (getStatus, Dispatch):
2319 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
2322 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
2324 * src/converter.[Ch] (Formats::View):
2325 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
2327 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
2328 *current_view->buffer(). This will change later, but this patch is way
2331 2000-10-09 Juergen Vigna <jug@sad.it>
2333 * src/text.C (GetRow): small fix.
2335 * src/BufferView_pimpl.C (cursorPrevious):
2336 (cursorNext): added LyXText parameter to function.
2338 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
2339 keypress depending on cursor position.
2341 2000-10-06 Juergen Vigna <jug@sad.it>
2343 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
2344 (copySelection): redone this function and also copy ascii representa-
2347 * src/tabular.C (Ascii):
2351 (print_n_chars): new functions to realize the ascii export of tabulars.
2353 2000-10-05 Juergen Vigna <jug@sad.it>
2355 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
2356 if we don't have a buffer.
2358 2000-10-10 Allan Rae <rae@lyx.org>
2360 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
2361 with closing dialog. It seems that nested tabfolders require hiding
2362 of inner tabfolders before hiding the dialog itself. Actually all I
2363 did was hide the active outer folder.
2365 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
2366 unless there really is a buffer. hideBufferDependent is called
2369 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
2370 POTFILES.in stays in $(srcdir).
2372 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
2374 * lib/lyxrc.example: Few changes.
2376 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
2378 * src/BufferView_pimpl.C (buffer): only need one the
2379 updateBufferDependent signal to be emitted once! Moved to the end of
2380 the method to allow bv_->text to be updated first.
2382 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
2383 and hSignal_ with Dialogs * and BufferDependency variables.
2384 New Buffer * parent_, initialised when the dialog is launched. Used to
2385 check whether to update() or hide() dialog in the new, private
2386 updateOrHide() method that is connected to the updateBufferDependent
2387 signal. Daughter classes dictate what to do using the
2388 ChangedBufferAction enum, passed to the c-tor.
2390 * src/frontends/xforms/FormCitation.C:
2391 * src/frontends/xforms/FormCommand.C:
2392 * src/frontends/xforms/FormCopyright.C:
2393 * src/frontends/xforms/FormDocument.C:
2394 * src/frontends/xforms/FormError.C:
2395 * src/frontends/xforms/FormIndex.C:
2396 * src/frontends/xforms/FormPreferences.C:
2397 * src/frontends/xforms/FormPrint.C:
2398 * src/frontends/xforms/FormRef.C:
2399 * src/frontends/xforms/FormToc.C:
2400 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
2403 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
2404 ChangedBufferAction enum.
2406 * src/frontends/xforms/FormParagraph.[Ch]
2407 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
2410 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2412 * lib/bind/cua.bind: fix a bit.
2413 * lib/bind/emacs.bind: ditto.
2415 * lib/bind/menus.bind: remove real menu entries from there.
2417 * src/spellchecker.C: make sure we only include strings.h when
2420 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2422 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
2423 function. It enlarges the maximum number of pup when needed.
2424 (add_toc2): Open a new menu if maximum number of items per menu has
2427 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
2429 * src/frontends/kde/FormPrint.C: fix error reporting
2431 * src/frontends/xforms/FormDocument.C: fix compiler
2434 * lib/.cvsignore: add Literate.nw
2436 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2439 * bufferview_funcs.[Ch]
2442 * text2.C: Add support for numbers in RTL text.
2444 2000-10-06 Allan Rae <rae@lyx.org>
2446 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
2447 to be gettext.m4 friendly again. ext_l10n.h is now
2448 generated into $top_srcdir instead of $top_builddir
2449 so that lyx.pot will be built correctly -- without
2450 duplicate parsing of ext_l10n.h.
2452 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2454 * src/frontends/kde/FormCitation.C: make the dialog
2455 behave more sensibly
2457 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
2459 * config/kde.m4: fix consecutive ./configure runs,
2460 look for qtarch, fix library order
2462 * src/frontends/kde/Makefile.am: tidy up,
2463 add Print dialog, add .dlg dependencies
2465 * src/frontends/kde/FormPrint.C:
2466 * src/frontends/kde/FormPrint.h:
2467 * src/frontends/kde/formprintdialog.C:
2468 * src/frontends/kde/formprintdialog.h:
2469 * src/frontends/kde/formprintdialogdata.C:
2470 * src/frontends/kde/formprintdialogdata.h:
2471 * src/frontends/kde/dlg/formprintdialog.dlg: add
2474 * src/frontends/kde/dlg/README: Added explanatory readme
2476 * src/frontends/kde/dlg/checkinitorder.pl: small perl
2477 script to double-check qtarch's output
2479 * src/frontends/kde/formindexdialog.C:
2480 * src/frontends/kde/formindexdialogdata.C:
2481 * src/frontends/kde/formindexdialogdata.h:
2482 * src/frontends/kde/dlg/formindexdialog.dlg: update
2483 for qtarch, minor fixes
2485 2000-10-05 Allan Rae <rae@lyx.org>
2487 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
2488 dialogs when switching buffers update them instead. It's up to each
2489 dialog to decide if it should still be visible or not.
2490 update() should return a bool to control visiblity within show().
2491 Or perhaps better to set a member variable and use that to control
2494 * lib/build-listerrors: create an empty "listerrors" file just to stop
2495 make trying to regenerate it all the time if you don't have noweb
2498 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
2500 * po/Makefile.in.in (ext_l10n.h): added a rule to build
2501 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
2502 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
2503 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
2504 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
2506 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
2508 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
2510 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
2511 deleting buffer. Closes all buffer-dependent dialogs.
2513 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
2515 * src/frontends/xforms/FormCitation.[Ch]:
2516 * src/frontends/xforms/FormPreferences.[Ch]:
2517 * src/frontends/xforms/FormPrint.[Ch]:
2518 * src/frontends/xforms/FormRef.[Ch]:
2519 * src/frontends/xforms/FormUrl.[Ch]: ditto
2521 * src/frontends/xforms/FormDocument.[Ch]:
2522 * src/frontends/xforms/forms/form_document.C.patch:
2523 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
2524 pass through a single input() function.
2526 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2528 * lib/build-listerrors: return status as OK
2530 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
2532 * lib/lyxrc.example: Updated to new export code
2534 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2536 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
2539 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
2542 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
2543 LyX-Code is defined.
2544 * lib/layouts/amsbook.layout: ditto.
2546 * boost/Makefile.am: fix typo.
2548 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
2550 (add_lastfiles): removed.
2551 (add_documents): removed.
2552 (add_formats): removed.
2554 * src/frontends/Menubar.C: remove useless "using" directive.
2556 * src/MenuBackend.h: add a new MenuItem constructor.
2558 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
2561 2000-10-04 Allan Rae <rae@lyx.org>
2563 * lib/Makefile.am (listerrors):
2564 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
2565 I haven't got notangle installed so Kayvan please test. The output
2566 should end up in $builddir. This also allows people who don't have
2567 noweb installed to complete the make process without error.
2569 * src/frontends/xforms/FormCommand.[Ch] (showInset):
2570 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
2571 by JMarc's picky compiler.
2573 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2576 * src/insets/insettabular.C (setPos): change for loop to not use
2577 sequencing operator. Please check this Jürgen.
2579 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
2581 * src/insets/insetcite.C (getScreenLabel): ditto
2582 * src/support/filetools.C (QuoteName): ditto
2583 (ChangeExtension): ditto
2585 * src/BufferView_pimpl.C (scrollCB): make heigt int
2587 * src/BufferView2.C (insertInset): comment out unused arg
2589 * boost/Makefile.am (EXTRADIST): new variable
2591 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2593 * src/exporter.C (IsExportable): Fixed
2595 * lib/configure.m4: Small fix
2597 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2599 * src/insets/insetbutton.C (width): Changed to work with no GUI.
2600 * src/insets/insetbib.C (bibitemWidest): ditto.
2601 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
2603 2000-10-03 Juergen Vigna <jug@sad.it>
2605 * src/BufferView2.C (theLockingInset): removed const because of
2606 Agnus's compile problems.
2608 * src/insets/insettext.C (LocalDispatch): set the language of the
2609 surronding paragraph on inserting the first character.
2611 * various files: changed use of BufferView::the_locking_inset.
2613 * src/BufferView2.C (theLockingInset):
2614 (theLockingInset): new functions.
2616 * src/BufferView.h: removed the_locking_inset.
2618 * src/lyxtext.h: added the_locking_inset
2620 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
2622 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
2624 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2626 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
2627 * src/mathed/math_cursor.C (IsAlpha): ditto.
2628 * src/mathed/math_inset.C (strnew): ditto.
2629 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
2630 (IMetrics): cxp set but never used; removed.
2631 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
2632 that the variable in question has been removed also!
2635 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
2636 using the Buffer * passed to Latex(), using the BufferView * passed to
2637 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
2639 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
2640 Linuxdoc() and DocBook() rather than the stored Buffer * master.
2642 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
2643 * src/buffer.C (readInset): used new InsetBibtex c-tor
2644 * (getBibkeyList): used new InsetBibtex::getKeys
2646 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2649 * lib/build-listerrors
2651 * src/exporter.C: Add literate programming support to the export code
2654 * src/lyx_cb.C: Remove old literate code.
2656 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
2659 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
2660 * src/converter.C (View, Convert): Use QuoteName.
2662 * src/insets/figinset.C (Preview): Use Formats::View.
2664 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
2666 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2668 * src/lyxfunc.C (Dispatch): move declaration of text variable at
2669 the top of the function, because compaq cxx complains that the
2670 "goto exit_with_message" when the function is disabled bypasses
2672 (MenuNew): try a better fix for the generation of new file names.
2673 This time, I used AddName() instead of AddPath(), hoping Juergen
2676 2000-10-03 Allan Rae <rae@lyx.org>
2678 * src/frontends/xforms/forms/form_preferences.fd:
2679 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
2680 nested tabfolders has begun. The old "Miscellaneous" was renamed as
2681 "Look and Feel"->"General" but will need to be split up further into
2682 general output and general input tabs. Current plan is for four outer
2683 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
2684 stuff; "Inputs" for input and import configuration; "Outputs" for
2685 output and export configuration; and one more whatever is left over
2686 called "General". The leftovers at present look like being which
2687 viewers to use, spellchecker, language support and might be better
2688 named "Support". I've put "Paths" in "Inputs" for the moment as this
2689 seems reasonable for now at least.
2690 One problem remains: X error kills LyX when you close Preferences.
2692 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2694 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
2695 qualifier from form()
2696 * src/frontends/xforms/FormCitation.[Ch]:
2697 * src/frontends/xforms/FormCopyright.[Ch]:
2698 * src/frontends/xforms/FormDocument.[Ch]:
2699 * src/frontends/xforms/FormError.[Ch]:
2700 * src/frontends/xforms/FormIndex.[Ch]:
2701 * src/frontends/xforms/FormPreferences.[Ch]:
2702 * src/frontends/xforms/FormPrint.[Ch]:
2703 * src/frontends/xforms/FormRef.[Ch]:
2704 * src/frontends/xforms/FormToc.[Ch]:
2705 * src/frontends/xforms/FormUrl.[Ch]: ditto.
2707 * src/frontends/xforms/FormCitation.[Ch]:
2708 * src/frontends/xforms/FormIndex.[Ch]:
2709 * src/frontends/xforms/FormRef.[Ch]:
2710 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
2711 with Allan's naming policy
2713 * src/frontends/xforms/FormCitation.C: some static casts to remove
2716 2000-10-02 Juergen Vigna <jug@sad.it>
2718 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
2719 now you can type or do stuff inside the table-cell also when in dummy
2720 position, fixed visible cursor.
2722 * src/insets/insettext.C (Edit): fixing cursor-view position.
2724 * src/lyxfunc.C (Dispatch): use * text variable so that it can
2725 be used for equal functions in lyxfunc and insettext.
2727 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
2729 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
2731 * src/frontends/gnome/FormCitation.h:
2732 * src/frontends/gnome/FormCopyright.h:
2733 * src/frontends/gnome/FormIndex.h:
2734 * src/frontends/gnome/FormPrint.h:
2735 * src/frontends/gnome/FormToc.h:
2736 * src/frontends/gnome/FormUrl.h:
2737 * src/frontends/kde/FormCitation.h:
2738 * src/frontends/kde/FormCopyright.h:
2739 * src/frontends/kde/FormIndex.h:
2740 * src/frontends/kde/FormRef.h:
2741 * src/frontends/kde/FormToc.h:
2742 * src/frontends/kde/FormUrl.h: fix remaining users of
2745 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2747 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
2748 from depth argument.
2749 (DocBookHandleCaption): ditto.
2750 (DocBookHandleFootnote): ditto.
2751 (SimpleDocBookOnePar): ditto.
2753 * src/frontends/xforms/FormDocument.h (form): remove extra
2754 FormDocument:: qualifier.
2756 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
2758 * sigc++/handle.h: ditto.
2760 * src/lyx_gui_misc.C: add "using" directive.
2762 * src/cheaders/cstddef: new file, needed by the boost library (for
2765 2000-10-02 Juergen Vigna <jug@sad.it>
2767 * src/insets/insettext.C (SetFont): better support.
2769 * src/insets/insettabular.C (draw): fixed drawing of single cell.
2771 * src/screen.C (DrawOneRow): some uint refixes!
2773 2000-10-02 Allan Rae <rae@lyx.org>
2775 * boost/.cvsignore: ignore Makefile as well
2777 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
2778 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
2780 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
2781 Left this one out by accident.
2783 * src/frontends/xforms/FormBase.h (restore): default to calling
2784 update() since that will restore the original/currently-applied values.
2785 Any input() triggered error messages will require the derived classes
2786 to redefine restore().
2788 * src/frontends/xforms/FormDocument.C: initialize a few variables to
2789 avoid a segfault. combo_doc_class is the main concern.
2791 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
2793 * Simplify build-listerrors in view of GUI-less export ability!
2795 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2797 * src/lyx_main.C (easyParse): Disable gui when exporting
2799 * src/insets/figinset.C:
2802 * src/lyx_gui_misc.C
2803 * src/tabular.C: Changes to allow no-gui.
2805 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2807 * src/support/utility.hpp: removed file
2808 * src/support/block.h: removed file
2810 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
2813 * src/mathed/formula.C: add support/lyxlib.h
2814 * src/mathed/formulamacro.C: ditto
2816 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
2817 * src/lyxparagraph.h: ditto
2819 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
2820 * src/frontends/Makefile.am (INCLUDES): ditto
2821 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
2822 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
2823 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
2824 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
2825 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
2826 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
2828 * src/BufferView.h: use boost/utility.hpp
2829 * src/LColor.h: ditto
2830 * src/LaTeX.h: ditto
2831 * src/LyXAction.h: ditto
2832 * src/LyXView.h: ditto
2833 * src/bufferlist.h: ditto
2834 * src/lastfiles.h: ditto
2835 * src/layout.h: ditto
2836 * src/lyx_gui.h: ditto
2837 * src/lyx_main.h: ditto
2838 * src/lyxlex.h: ditto
2839 * src/lyxrc.h: ditto
2840 * src/frontends/ButtonPolicies.h: ditto
2841 * src/frontends/Dialogs.h: ditto
2842 * src/frontends/xforms/FormBase.h: ditto
2843 * src/frontends/xforms/FormGraphics.h: ditto
2844 * src/frontends/xforms/FormParagraph.h: ditto
2845 * src/frontends/xforms/FormTabular.h: ditto
2846 * src/graphics/GraphicsCache.h: ditto
2847 * src/graphics/Renderer.h: ditto
2848 * src/insets/ExternalTemplate.h: ditto
2849 * src/insets/insetcommand.h: ditto
2850 * src/support/path.h: ditto
2852 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
2853 and introduce clause for 2.97.
2855 * boost/libs/README: new file
2857 * boost/boost/utility.hpp: new file
2859 * boost/boost/config.hpp: new file
2861 * boost/boost/array.hpp: new file
2863 * boost/Makefile.am: new file
2865 * boost/.cvsignore: new file
2867 * configure.in (AC_OUTPUT): add boost/Makefile
2869 * Makefile.am (SUBDIRS): add boost
2871 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2873 * src/support/lstrings.C (suffixIs): Fixed.
2875 2000-10-01 Allan Rae <rae@lyx.org>
2877 * src/PrinterParams.h: moved things around to avoid the "can't
2878 inline call" warning.
2880 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
2881 into doc++ documentation.
2883 * src/frontends/xforms/FormCommand.[Ch]: support button policy
2885 * src/frontends/xforms/FormRef.C: make use of button controller
2886 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
2887 cleaned up button controller usage.
2888 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
2889 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
2890 use the button controller
2892 * src/frontends/xforms/forms/*.fd: and associated generated files
2893 updated to reflect changes to FormBase. Some other FormXxxx files
2894 also got minor updates to reflect changes to FormBase.
2896 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
2897 (hide): made virtual.
2898 (input): return a bool. true == valid input
2899 (RestoreCB, restore): new
2900 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
2901 Changes to allow derived dialogs to use a ButtonController and
2902 make sense when doing so: OK button calls ok() and so on.
2904 * src/frontends/xforms/ButtonController.h (class ButtonController):
2905 Switch from template implementation to taking Policy parameter.
2906 Allows FormBase to provide a ButtonController for any dialog.
2908 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
2909 Probably should rename connect and disconnect.
2910 (apply): use the radio button groups
2911 (form): needed by FormBase
2912 (build): setup the radio button groups
2914 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
2916 * several files: type changes to reduce the number of warnings and
2917 to unify type hangling a bit. Still much to do.
2919 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2921 * lib/images/*: rename a bunch of icons to match Dekel converter
2924 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
2927 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
2929 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
2931 * sigc++/handle.h: ditto for class Handle.
2933 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
2935 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
2937 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
2939 * src/intl.C (InitKeyMapper): Correct the value of n due to the
2940 removal of the "default" language.
2942 * src/combox.h (getline): Check that sel > 0
2944 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
2946 * lib/examples/docbook_example.lyx
2947 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
2949 * lib/layouts/docbook-book.layout: new docbook book layout.
2951 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
2953 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
2955 * src/insets/figinset.C (DocBook):fixed small typo.
2957 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
2959 * src/insets/insetinclude.h: string include_label doesn't need to be
2962 2000-09-29 Allan Rae <rae@lyx.org>
2964 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
2965 Allow derived type to control connection and disconnection from signals
2966 of its choice if desired.
2968 2000-09-28 Juergen Vigna <jug@sad.it>
2970 * src/insets/insettabular.C (update): fixed cursor setting when
2971 the_locking_inset changed.
2972 (draw): made this a bit cleaner.
2973 (InsetButtonPress): fixed!
2975 * various files: added LyXText Parameter to fitCursor call.
2977 * src/BufferView.C (fitCursor): added LyXText parameter.
2979 * src/insets/insettabular.C (draw): small draw fix.
2981 * src/tabular.C: right setting of left/right celllines.
2983 * src/tabular.[Ch]: fixed various types in funcions and structures.
2984 * src/insets/insettabular.C: ditto
2985 * src/frontends/xforms/FormTabular.C: ditto
2987 2000-09-28 Allan Rae <rae@lyx.org>
2989 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
2990 that the #ifdef's had been applied to part of what should have been
2991 a complete condition. It's possible there are other tests that
2992 were specific to tables that are also wrong now that InsetTabular is
2993 being used. Now we need to fix the output of '\n' after a table in a
2994 float for the same reason as the original condition:
2995 "don't insert this if we would be adding it before or after a table
2996 in a float. This little trick is needed in order to allow use of
2997 tables in \subfigures or \subtables."
2998 Juergen can you check this?
3000 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3002 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
3003 output to the ostream.
3005 * several files: fixed types based on warnings from cxx
3007 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
3009 * src/frontends/kde/Makefile.am: fix rule for
3010 formindexdialogdata_moc.C
3012 * src/.cvsignore: add ext_l10n.h to ignore
3014 * acconfig.h: stop messing with __STRICT_ANSI__
3015 * config/gnome.m4: remove option to set -ansi
3016 * config/kde.m4: remove option to set -ansi
3017 * config/lyxinclude.m4: don't set -ansi
3019 2000-09-27 Juergen Vigna <jug@sad.it>
3021 * various files: remove "default" language check.
3023 * src/insets/insetquotes.C: removed use of current_view.
3025 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
3026 the one should have red ears by now!
3028 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
3029 in more then one paragraph. Fixed cursor-movement/selection.
3031 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
3032 paragraphs inside a text inset.
3034 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
3035 text-inset if this owner is an inset.
3037 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3039 * src/Bullet.h: changed type of font, character and size to int
3041 * src/buffer.C (asciiParagraph): remove actcell and fname1.
3043 * src/insets/inseturl.[Ch]:
3044 * src/insets/insetref.[Ch]:
3045 * src/insets/insetlabel.[Ch]: add linelen to Ascii
3047 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
3049 * src/buffer.C (readFile): block-if statement rearranged to minimise
3050 bloat. Patch does not reverse Jean-Marc's change ;-)
3052 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
3053 Class rewritten to store pointers to hide/update signals directly,
3054 rather than Dialogs *. Also defined an enum to ease use. All xforms
3055 forms can now be derived from this class.
3057 * src/frontends/xforms/FormCommand.[Ch]
3058 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
3060 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
3063 * src/frontends/xforms/forms/form_citation.fd
3064 * src/frontends/xforms/forms/form_copyright.fd
3065 * src/frontends/xforms/forms/form_error.fd
3066 * src/frontends/xforms/forms/form_index.fd
3067 * src/frontends/xforms/forms/form_ref.fd
3068 * src/frontends/xforms/forms/form_toc.fd
3069 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
3071 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
3073 * src/insets/insetfoot.C: removed redundent using directive.
3075 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3077 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
3078 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
3080 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
3081 created in the constructors in different groups. Then set() just
3082 have to show the groups as needed. This fixes the redraw problems
3083 (and is how the old menu code worked).
3085 * src/support/lyxlib.h: declare the methods as static when we do
3086 not have namespaces.
3088 2000-09-26 Juergen Vigna <jug@sad.it>
3090 * src/buffer.C (asciiParagraph): new function.
3091 (writeFileAscii): new function with parameter ostream.
3092 (writeFileAscii): use now asciiParagraph.
3094 * various inset files: added the linelen parameter to the Ascii-func.
3096 * src/tabular.C (Write): fixed error in writing file introduced by
3097 the last changes from Lars.
3099 * lib/bind/menus.bind: removed not supported functions.
3101 * src/insets/insettext.C (Ascii): implemented this function.
3103 * src/insets/lyxinset.h (Ascii): added linelen parameter.
3105 * src/tabular.C (write_attribute[int,string,bool]): new functions.
3106 (Write): use of the write_attribute functions.
3108 * src/bufferlist.C (close): fixed reasking question!
3110 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3112 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
3113 new files use the everwhere possible.
3116 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
3117 src/log_form.C src/lyx.C:
3120 * src/buffer.C (runLaTeX): remove func
3122 * src/PaperLayout.C: removed file
3123 * src/ParagraphExtra.C: likewise
3124 * src/bullet_forms.C: likewise
3125 * src/bullet_forms.h: likewise
3126 * src/bullet_forms_cb.C: likewise
3128 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
3129 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
3132 * several files: remove all traces of the old fd_form_paragraph,
3133 and functions belonging to that.
3135 * several files: remove all traces of the old fd_form_document,
3136 and functions belonging to that.
3138 * several files: constify local variables were possible.
3140 * several files: remove all code that was dead when NEW_EXPORT was
3143 * several files: removed string::c_str in as many places as
3146 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
3147 (e): be a bit more outspoken when patching
3148 (updatesrc): only move files if changed.
3150 * forms/layout_forms.h.patch: regenerated
3152 * forms/layout_forms.fd: remove form_document and form_paragraph
3153 and form_quotes and form_paper and form_table_options and
3154 form_paragraph_extra
3156 * forms/form1.fd: remove form_table
3158 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3159 the fdui->... rewrite. Update some comments to xforms 0.88
3161 * forms/bullet_forms.C.patch: removed file
3162 * forms/bullet_forms.fd: likewise
3163 * forms/bullet_forms.h.patch: likewise
3165 * development/Code_rules/Rules: added a section on switch
3166 statements. Updated some comment to xforms 0.88.
3168 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3170 * src/buffer.C (readFile): make sure that the whole version number
3171 is read after \lyxformat (even when it contains a comma)
3173 * lib/ui/default.ui: change shortcut of math menu to M-a.
3175 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3177 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3180 * src/LyXView.C (updateWindowTitle): show the full files name in
3181 window title, limited to 30 characters.
3183 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3184 When a number of characters has been given, we should not assume
3185 that the string is 0-terminated.
3187 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3188 calls (fixes some memory leaks)
3190 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3191 trans member on exit.
3193 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3195 * src/converter.C (GetReachable): fix typo.
3197 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3198 understand ',' instead of '.'.
3199 (GetInteger): rewrite to use strToInt().
3201 2000-09-26 Juergen Vigna <jug@sad.it>
3203 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3204 better visibility and error-message on wrong VSpace input.
3206 * src/language.C (initL): added english again.
3208 2000-09-25 Juergen Vigna <jug@sad.it>
3210 * src/frontends/kde/Dialogs.C (Dialogs):
3211 * src/frontends/gnome/Dialogs.C (Dialogs):
3212 * src/frontends/kde/Makefile.am:
3213 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3215 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3217 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3219 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3221 * src/frontends/xforms/FormParagraph.C:
3222 * src/frontends/xforms/FormParagraph.h:
3223 * src/frontends/xforms/form_paragraph.C:
3224 * src/frontends/xforms/form_paragraph.h:
3225 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3228 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3230 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3231 Paragraph-Data after use.
3233 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3234 non breakable paragraphs.
3236 2000-09-25 Garst R. Reese <reese@isn.net>
3238 * src/language.C (initL): added missing language_country codes.
3240 2000-09-25 Juergen Vigna <jug@sad.it>
3242 * src/insets/insettext.C (InsetText):
3243 (deleteLyXText): remove the not released LyXText structure!
3245 2000-09-24 Marko Vendelin <markov@ioc.ee>
3247 * src/frontends/gnome/mainapp.C
3248 * src/frontends/gnome/mainapp.h: added support for keyboard
3251 * src/frontends/gnome/FormCitation.C
3252 * src/frontends/gnome/FormCitation.h
3253 * src/frontends/gnome/Makefile.am
3254 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3255 FormCitation to use "action area" in mainapp window
3257 * src/frontends/gnome/Menubar_pimpl.C
3258 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3261 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3263 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3264 width/descent/ascent values if name is empty.
3265 (mathed_string_height): Use std::max.
3267 2000-09-25 Allan Rae <rae@lyx.org>
3269 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
3270 segfault. This will be completely redesigned soon.
3272 * sigc++: updated libsigc++. Fixes struct timespec bug.
3274 * development/tools/makeLyXsigc.sh: .cvsignore addition
3276 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3278 * several files: removed almost all traces of the old table
3281 * src/TableLayout.C: removed file
3283 2000-09-22 Juergen Vigna <jug@sad.it>
3285 * src/frontends/kde/Dialogs.C: added credits forms.
3287 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
3289 * src/frontends/gnome/Dialogs.C: added some forms.
3291 * src/spellchecker.C (init_spell_checker): set language in pspell code
3292 (RunSpellChecker): some modifications for setting language string.
3294 * src/language.[Ch]: added language_country code.
3296 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
3298 * src/frontends/Dialogs.h: added new signal showError.
3299 Rearranged existing signals in some sort of alphabetical order.
3301 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
3302 FormError.[Ch], form_error.[Ch]
3303 * src/frontends/xforms/forms/makefile: added new file form_error.fd
3304 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
3306 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
3307 dialogs. I think that this can be used as the base to all these
3310 * src/frontends/xforms/FormError.[Ch]
3311 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
3312 implementation of InsetError dialog.
3314 * src/insets/inseterror.[Ch]: rendered GUI-independent.
3316 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
3317 * src/frontends/kde/Makefile.am: ditto
3319 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
3321 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
3322 macrobf. This fixes a bug of invisible text.
3324 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3326 * lib/doc/LaTeXConfig.lyx.in: updated.
3328 * src/language.C (initL): remove language "francais" and change a
3329 bit the names of the two other french variations.
3331 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
3332 string that may not be 0-terminated.
3334 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3336 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
3338 2000-09-20 Marko Vendelin <markov@ioc.ee>
3340 * src/frontends/gnome/FormCitation.C
3341 * src/frontends/gnome/FormIndex.C
3342 * src/frontends/gnome/FormToc.C
3343 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
3344 the variable initialization to shut up the warnings
3346 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3348 * src/table.[Ch]: deleted files
3350 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
3353 2000-09-18 Juergen Vigna <jug@sad.it>
3355 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
3356 problems with selection. Inserted new LFUN_PASTESELECTION.
3357 (InsetButtonPress): inserted handling of middle mouse-button paste.
3359 * src/spellchecker.C: changed word to word.c_str().
3361 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
3363 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
3364 included in the ``make dist'' tarball.
3366 2000-09-15 Juergen Vigna <jug@sad.it>
3368 * src/CutAndPaste.C (cutSelection): small fix return the right
3369 end position after cut inside one paragraph only.
3371 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
3372 we are locked as otherwise we don't have a valid cursor position!
3374 * src/insets/figinset.C (draw): small bugfix but why is this needed???
3376 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
3378 * src/frontends/kde/FormRef.C: added using directive.
3379 * src/frontends/kde/FormToc.C: ditto
3381 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
3383 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
3385 2000-09-19 Marko Vendelin <markov@ioc.ee>
3387 * src/frontends/gnome/Menubar_pimpl.C
3388 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
3389 Toc, ViewFormats, UpdateFormats, and ExportFormats.
3391 * src/frontends/gnome/mainapp.C
3392 * src/frontends/gnome/mainapp.h: support for menu update used
3395 * src/frontends/gnome/mainapp.C
3396 * src/frontends/gnome/mainapp.h: support for "action" area in the
3397 main window. This area is used by small simple dialogs, such as
3400 * src/frontends/gnome/FormIndex.C
3401 * src/frontends/gnome/FormIndex.h
3402 * src/frontends/gnome/FormUrl.C
3403 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
3406 * src/frontends/gnome/FormCitation.C
3407 * src/frontends/gnome/FormCitation.h: rewrite to use main window
3408 action area. Only "Insert new citation" is implemented.
3410 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3412 * src/buffer.C (Dispatch): fix call to Dispatch
3413 * src/insets/insetref.C (Edit): likewise
3414 * src/insets/insetparent.C (Edit): likewise
3415 * src/insets/insetinclude.C (include_cb): likewise
3416 * src/frontends/xforms/FormUrl.C (apply): likewise
3417 * src/frontends/xforms/FormToc.C (apply): likewise
3418 * src/frontends/xforms/FormRef.C (apply): likewise
3419 * src/frontends/xforms/FormIndex.C (apply): likewise
3420 * src/frontends/xforms/FormCitation.C (apply): likewise
3421 * src/lyxserver.C (callback): likewise
3422 * src/lyxfunc.C (processKeySym): likewise
3423 (Dispatch): likewise
3424 (Dispatch): likewise
3425 * src/lyx_cb.C (LayoutsCB): likewise
3427 * Makefile.am (sourcedoc): small change
3429 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3431 * src/main.C (main): Don't make an empty GUIRunTime object. all
3432 methods are static. constify a bit remove unneded using + headers.
3434 * src/tabular.C: some more const to local vars move some loop vars
3436 * src/spellchecker.C: added some c_str after some word for pspell
3438 * src/frontends/GUIRunTime.h: add new static method setDefaults
3439 * src/frontends/xforms/GUIRunTime.C (setDefaults):
3440 * src/frontends/kde/GUIRunTime.C (setDefaults):
3441 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
3443 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
3444 with strnew in arg, use correct emptystring when calling SetName.
3446 * several files: remove all commented code with relation to
3447 HAVE_SSTREAM beeing false. We now only support stringstream and
3450 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3452 * src/lyxfunc.C: construct correctly the automatic new file
3455 * src/text2.C (IsStringInText): change type of variable i to shut
3458 * src/support/sstream.h: do not use namespaces if the compiler
3459 does not support them.
3461 2000-09-15 Marko Vendelin <markov@ioc.ee>
3462 * src/frontends/gnome/FormCitation.C
3463 * src/frontends/gnome/FormCitation.h
3464 * src/frontends/gnome/diainsertcitation_interface.c
3465 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
3466 regexp support to FormCitation [Gnome].
3468 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
3471 * configure.in: remove unused KDE/GTKGUI define
3473 * src/frontends/kde/FormRef.C
3474 * src/frontends/kde/FormRef.h
3475 * src/frontends/kde/formrefdialog.C
3476 * src/frontends/kde/formrefdialog.h: double click will
3477 go to reference, now it is possible to change a cross-ref
3480 * src/frontends/kde/FormToc.C
3481 * src/frontends/kde/FormToc.h
3482 * src/frontends/kde/formtocdialog.C
3483 * src/frontends/kde/formtocdialog.h: add a depth
3486 * src/frontends/kde/Makefile.am: add QtLyXView.h
3489 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
3491 * src/frontends/kde/FormCitation.h: added some using directives.
3493 * src/frontends/kde/FormToc.h: corrected definition of doTree.
3495 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
3498 * src/mathed/math_defs.h: redefine SetAlign to use string rather
3501 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3503 * src/buffer.C (pop_tag): revert for the second time a change by
3504 Lars, who seems to really hate having non-local loop variables :)
3506 * src/Lsstream.h: add "using" statements.
3508 * src/support/copy.C (copy): add a bunch of std:: qualifiers
3509 * src/buffer.C (writeFile): ditto
3511 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3513 * src/buffer.C (writeFile): try to fix the locale modified format
3514 number to always be as we want it.
3516 * src/WorkArea.C (work_area_handler): try to workaround the bugs
3517 in XForms 0.89. C-space is now working again.
3519 * src/Lsstream.h src/support/sstream.h: new files.
3521 * also commented out all cases where strstream were used.
3523 * src/Bullet.h (c_str): remove method.
3525 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
3527 * a lot of files: get rid of "char const *" and "char *" is as
3528 many places as possible. We only want to use them in interaction
3529 with system of other libraries, not inside lyx.
3531 * a lot of files: return const object is not of pod type. This
3532 helps ensure that temporary objects is not modified. And fits well
3533 with "programming by contract".
3535 * configure.in: check for the locale header too
3537 * Makefile.am (sourcedoc): new tag for generation of doc++
3540 2000-09-14 Juergen Vigna <jug@sad.it>
3542 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
3543 callback to check which combo called it and do the right action.
3545 * src/combox.C (combo_cb): added combo * to the callbacks.
3546 (Hide): moved call of callback after Ungrab of the pointer.
3548 * src/intl.h: removed LCombo2 function.
3550 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
3551 function as this can now be handled in one function.
3553 * src/combox.h: added Combox * to callback prototype.
3555 * src/frontends/xforms/Toolbar_pimpl.C:
3556 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
3558 2000-09-14 Garst Reese <reese@isn.net>
3560 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
3561 moved usepackage{xxx}'s to beginning of file. Changed left margin
3562 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
3563 underlining from title. Thanks to John Culleton for useful suggestions.
3565 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3567 * src/lyxlex_pimpl.C (setFile): change error message to debug
3570 2000-09-13 Juergen Vigna <jug@sad.it>
3572 * src/frontends/xforms/FormDocument.C: implemented choice_class
3573 as combox and give callback to combo_language so OK/Apply is activated
3576 * src/bufferlist.C (newFile): small fix so already named files
3577 (via an open call) are not requested to be named again on the
3580 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3582 * src/frontends/kde/Makefile.am
3583 * src/frontends/kde/FormRef.C
3584 * src/frontends/kde/FormRef.h
3585 * src/frontends/kde/formrefdialog.C
3586 * src/frontends/kde/formrefdialog.h: implement
3589 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3591 * src/frontends/kde/formtocdialog.C
3592 * src/frontends/kde/formtocdialog.h
3593 * src/frontends/kde/FormToc.C
3594 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
3596 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
3598 * src/frontends/kde/FormCitation.C: fix thinko
3599 where we didn't always display the reference text
3602 * src/frontends/kde/formurldialog.C
3603 * src/frontends/kde/formurldialog.h
3604 * src/frontends/kde/FormUrl.C
3605 * src/frontends/kde/FormUrl.h: minor cleanups
3607 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
3609 * src/frontends/kde/Makefile.am
3610 * src/frontends/kde/FormToc.C
3611 * src/frontends/kde/FormToc.h
3612 * src/frontends/kde/FormCitation.C
3613 * src/frontends/kde/FormCitation.h
3614 * src/frontends/kde/FormIndex.C
3615 * src/frontends/kde/FormIndex.h
3616 * src/frontends/kde/formtocdialog.C
3617 * src/frontends/kde/formtocdialog.h
3618 * src/frontends/kde/formcitationdialog.C
3619 * src/frontends/kde/formcitationdialog.h
3620 * src/frontends/kde/formindexdialog.C
3621 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
3623 2000-09-12 Juergen Vigna <jug@sad.it>
3625 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
3628 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3630 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
3633 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
3635 * src/converter.C (Add, Convert): Added support for converter flags:
3636 needaux, resultdir, resultfile.
3637 (Convert): Added new parameter view_file.
3638 (dvips_options): Fixed letter paper option.
3640 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
3641 (Export, GetExportableFormats, GetViewableFormats): Added support
3644 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
3646 (easyParse): Fixed to work with new export code.
3648 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
3651 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
3653 * lib/bind/*.bind: Replaced
3654 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
3655 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
3657 2000-09-11 Juergen Vigna <jug@sad.it>
3659 * src/lyx_gui.C (runTime): uses global guiruntime variable.
3661 * src/main.C (main): now GUII defines global guiruntime!
3663 * src/frontends/gnome/GUIRunTime.C (initApplication):
3664 * src/frontends/kde/GUIRunTime.C (initApplication):
3665 * src/frontends/xforms/GUIRunTime.C (initApplication):
3666 * src/frontends/GUIRunTime.h: added new function initApplication.
3668 * src/spellchecker.C (sc_accept_word): change to add_to_session.
3670 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
3672 2000-09-08 Juergen Vigna <jug@sad.it>
3674 * src/lyx_gui.C (create_forms): don't display the "default" entry as
3675 we have already "Reset".
3677 * src/language.C (initL): inserted "default" language and made this
3678 THE default language (and not american!)
3680 * src/paragraph.C: inserted handling of "default" language!
3682 * src/lyxfont.C: ditto
3686 * src/paragraph.C: output the \\par only if we have a following
3687 paragraph otherwise it's not needed.
3689 2000-09-05 Juergen Vigna <jug@sad.it>
3691 * config/pspell.m4: added entry to lyx-flags
3693 * src/spellchecker.C: modified version from Kevin for using pspell
3695 2000-09-01 Marko Vendelin <markov@ioc.ee>
3696 * src/frontends/gnome/Makefile.am
3697 * src/frontends/gnome/FormCitation.C
3698 * src/frontends/gnome/FormCitation.h
3699 * src/frontends/gnome/diainsertcitation_callbacks.c
3700 * src/frontends/gnome/diainsertcitation_callbacks.h
3701 * src/frontends/gnome/diainsertcitation_interface.c
3702 * src/frontends/gnome/diainsertcitation_interface.h
3703 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
3704 dialog for Gnome frontend
3706 * src/main.C: Gnome libraries require keeping application name
3707 and its version as strings
3709 * src/frontends/gnome/mainapp.C: Change the name of the main window
3710 from GnomeLyX to PACKAGE
3712 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3714 * src/frontends/Liason.C: add "using: declaration.
3716 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
3718 * src/mathed/math_macro.C (Metrics): Set the size of the template
3720 * src/mathed/formulamacro.C (Latex): Fixed the returned value
3722 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
3724 * src/converter.C (add_options): New function.
3725 (SetViewer): Change $$FName into '$$FName'.
3726 (View): Add options when running xdvi
3727 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
3728 (Convert): The 3rd parameter is now the desired filename. Converts
3729 calls to lyx::rename if necessary.
3730 Add options when running dvips.
3731 (dvi_papersize,dvips_options): New methods.
3733 * src/exporter.C (Export): Use getLatexName() instead of fileName().
3735 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
3736 using a call to Converter::dvips_options.
3737 Fixed to work with nex export code.
3739 * src/support/copy.C
3740 * src/support/rename.C: New files
3742 * src/support/syscall.h
3743 * src/support/syscall.C: Added Starttype SystemDontWait.
3745 * lib/ui/default.ui: Changed to work with new export code
3747 * lib/configure.m4: Changed to work with new export code
3749 * src/encoding.C: Changed latex name for iso8859_7 encoding.
3751 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
3753 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
3754 so that code compiles with DEC cxx.
3756 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
3757 to work correctly! Also now supports the additional elements
3760 2000-09-01 Allan Rae <rae@lyx.org>
3762 * src/frontends/ButtonPolicies.C: renamed all the references to
3763 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
3765 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
3766 since it's a const not a type.
3768 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
3770 2000-08-31 Juergen Vigna <jug@sad.it>
3772 * src/insets/figinset.C: Various changes to look if the filename has
3773 an extension and if not add it for inline previewing.
3775 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3777 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
3778 make buttonStatus and isReadOnly be const methods. (also reflect
3779 this in derived classes.)
3781 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
3782 (nextState): change to be static inline, pass the StateMachine as
3784 (PreferencesPolicy): remove casts
3785 (OkCancelPolicy): remvoe casts
3786 (OkCancelReadOnlyPolicy): remove casts
3787 (NoRepeatedApplyReadOnlyPolicy): remove casts
3788 (OkApplyCancelReadOnlyPolicy): remove casts
3789 (OkApplyCancelPolicy): remove casts
3790 (NoRepeatedApplyPolicy): remove casts
3792 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
3794 * src/converter.C: added some using directives
3796 * src/frontends/ButtonPolicies.C: changes to overcome
3797 "need lvalue" error with DEC c++
3799 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
3800 to WMHideCB for DEC c++
3802 * src/frontends/xforms/Menubar_pimpl.C: added using directive
3804 * src/frontends/xforms/forms/form_document.C.patch: use C callback
3805 to BulletBMTableCB for DEC c++
3807 2000-08-31 Allan Rae <rae@lyx.org>
3809 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
3810 character dialog separately from old document dialogs combo_language.
3813 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3815 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
3816 Removed LFUN_REF_CREATE.
3818 * src/MenuBackend.C: Added new tags: toc and references
3820 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
3821 (add_lastfiles, add_documents, add_formats): Removed the unused smn
3823 (add_toc, add_references): New methods.
3824 (create_submenu): Handle correctly the case when there is a
3825 seperator after optional menu items.
3827 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
3828 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
3829 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
3831 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
3833 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3835 * src/converter.[Ch]: New file for converting between different
3838 * src/export.[Ch]: New file for exporting a LyX file to different
3841 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
3842 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
3843 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
3844 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
3845 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
3846 RunDocBook, MenuExport.
3848 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
3849 Exporter::Preview methods if NEW_EXPORT is defined.
3851 * src/buffer.C (Dispatch): Use Exporter::Export.
3853 * src/lyxrc.C: Added new tags: \converter and \viewer.
3856 * src/LyXAction.C: Define new lyx-function: buffer-update.
3857 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
3858 when NEW_EXPORT is defined.
3860 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
3862 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
3864 * lib/ui/default.ui: Added submenus "view" and "update" to the
3867 * src/filetools.C (GetExtension): New function.
3869 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
3871 2000-08-29 Allan Rae <rae@lyx.org>
3873 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
3875 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
3876 (EnableDocumentLayout): removed
3877 (DisableDocumentLayout): removed
3878 (build): make use of ButtonController's read-only handling to
3879 de/activate various objects. Replaces both of the above functions.
3881 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
3882 (readOnly): was read_only
3883 (refresh): fixed dumb mistakes with read_only_ handling
3885 * src/frontends/xforms/forms/form_document.fd:
3886 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
3887 tabbed dialogs so the tabs look more like tabs and so its easier to
3888 work out which is the current tab.
3890 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
3891 segfault with form_table
3893 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
3895 2000-08-28 Juergen Vigna <jug@sad.it>
3897 * acconfig.h: added USE_PSPELL.
3899 * src/config.h.in: added USE_PSPELL.
3901 * autogen.sh: added pspell.m4
3903 * config/pspell.m4: new file.
3905 * src/spellchecker.C: implemented support for pspell libary.
3907 2000-08-25 Juergen Vigna <jug@sad.it>
3909 * src/LyXAction.C (init): renamed LFUN_TABLE to
3910 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
3912 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
3914 * src/lyxscreen.h: add force_clear variable and fuction to force
3915 a clear area when redrawing in LyXText.
3917 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
3919 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3921 * some whitespace and comment changes.
3923 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
3925 * src/buffer.C: up te LYX_FORMAT to 2.17
3927 2000-08-23 Juergen Vigna <jug@sad.it>
3929 * src/BufferView_pimpl.C (tripleClick): disable this when in a
3932 * src/insets/insettabular.C (pasteSelection): delete the insets
3933 LyXText as it is not valid anymore.
3934 (copySelection): new function.
3935 (pasteSelection): new function.
3936 (cutSelection): new function.
3937 (LocalDispatch): implemented cut/copy/paste of cell selections.
3939 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
3940 don't have a LyXText.
3942 * src/LyXAction.C (init): a NEW_TABULAR define too much.
3944 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
3947 2000-08-22 Juergen Vigna <jug@sad.it>
3949 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
3950 ifdef form_table out if NEW_TABULAR.
3952 2000-08-21 Juergen Vigna <jug@sad.it>
3954 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
3955 (draw): fixed draw position so that the cursor is positioned in the
3957 (InsetMotionNotify): hide/show cursor so the position is updated.
3958 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
3959 using cellstart() function where it should be used.
3961 * src/insets/insettext.C (draw): ditto.
3963 * src/tabular.C: fixed initialization of some missing variables and
3964 made BoxType into an enum.
3966 2000-08-22 Marko Vendelin <markov@ioc.ee>
3967 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
3968 stock menu item using action numerical value, not its string
3972 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3974 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
3975 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
3977 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
3979 * src/frontends/xforms/GUIRunTime.C: new file
3981 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
3982 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3984 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
3986 * src/frontends/kde/GUIRunTime.C: new file
3988 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
3989 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3991 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
3993 * src/frontends/gnome/GUIRunTime.C: new file
3995 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
3998 * src/frontends/GUIRunTime.h: removed constructor and destructor,
3999 small change to documetentation.
4001 * src/frontends/GUIRunTime.C: removed file
4003 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
4005 * src/lyxparagraph.h: enable NEW_TABULAR as default
4007 * src/lyxfunc.C (processKeySym): remove some commented code
4009 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
4010 NEW_TABULAR around the fd_form_table_options.
4012 * src/lyx_gui.C (runTime): call the static member function as
4013 GUIRunTime::runTime().
4015 2000-08-21 Allan Rae <rae@lyx.org>
4017 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
4020 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
4022 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
4024 2000-08-21 Allan Rae <rae@lyx.org>
4026 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
4027 keep Garst happy ;-)
4028 * src/frontends/xforms/FormPreferences.C (build): use setOK
4029 * src/frontends/xforms/FormDocument.C (build): use setOK
4030 (FormDocument): use the appropriate policy.
4032 2000-08-21 Allan Rae <rae@lyx.org>
4034 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
4035 automatic [de]activation of arbitrary objects when in a read-only state.
4037 * src/frontends/ButtonPolicies.h: More documentation
4038 (isReadOnly): added to support the above.
4040 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
4042 2000-08-18 Juergen Vigna <jug@sad.it>
4044 * src/insets/insettabular.C (getStatus): changed to return func_status.
4046 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
4047 display toggle menu entries if they are.
4049 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
4050 new document layout now.
4052 * src/lyxfunc.C: ditto
4054 * src/lyx_gui_misc.C: ditto
4056 * src/lyx_gui.C: ditto
4058 * lib/ui/default.ui: removed paper and quotes layout as they are now
4059 all in the document layout tabbed folder.
4061 * src/frontends/xforms/forms/form_document.fd: added Restore
4062 button and callbacks for all inputs for Allan's ButtonPolicy.
4064 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
4065 (CheckChoiceClass): added missing params setting on class change.
4066 (UpdateLayoutDocument): added for updating the layout on params.
4067 (build): forgot to RETURN_ALWAYS input_doc_spacing.
4068 (FormDocument): Implemented Allan's ButtonPolicy with the
4071 2000-08-17 Allan Rae <rae@lyx.org>
4073 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
4074 so we can at least see the credits again.
4076 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
4077 controller calls for the appropriate callbacks. Note that since Ok
4078 calls apply followed by cancel, and apply isn't a valid input for the
4079 APPLIED state, the bc_ calls have to be made in the static callback not
4080 within each of the real callbacks.
4082 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
4083 (setOk): renamed from setOkay()
4085 2000-08-17 Juergen Vigna <jug@sad.it>
4087 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
4088 in the implementation part.
4089 (composeUIInfo): don't show optional menu-items.
4091 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
4093 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
4095 * src/bufferview_funcs.C (CurrentState): fixed to show also the
4096 text-state when in a text-inset.
4098 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
4100 2000-08-17 Marko Vendelin <markov@ioc.ee>
4101 * src/frontends/gnome/FormIndex.C
4102 * src/frontends/gnome/FormIndex.h
4103 * src/frontends/gnome/FormToc.C
4104 * src/frontends/gnome/FormToc.h
4105 * src/frontends/gnome/dialogs
4106 * src/frontends/gnome/diatoc_callbacks.c
4107 * src/frontends/gnome/diatoc_callbacks.h
4108 * src/frontends/gnome/diainsertindex_callbacks.h
4109 * src/frontends/gnome/diainsertindex_callbacks.c
4110 * src/frontends/gnome/diainsertindex_interface.c
4111 * src/frontends/gnome/diainsertindex_interface.h
4112 * src/frontends/gnome/diatoc_interface.h
4113 * src/frontends/gnome/diatoc_interface.c
4114 * src/frontends/gnome/Makefile.am: Table of Contents and
4115 Insert Index dialogs implementation for Gnome frontend
4117 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
4119 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
4121 * src/frontends/gnome/diainserturl_interface.c: make the dialog
4124 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4126 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
4127 destructor. Don't definde if you don't need it
4128 (processEvents): made static, non-blocking events processing for
4130 (runTime): static method. event loop for xforms
4131 * similar as above for kde and gnome.
4133 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
4134 new Pimpl is correct
4135 (runTime): new method calss the real frontends runtime func.
4137 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
4139 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4141 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
4143 2000-08-16 Juergen Vigna <jug@sad.it>
4145 * src/lyx_gui.C (runTime): added GUII RunTime support.
4147 * src/frontends/Makefile.am:
4148 * src/frontends/GUIRunTime.[Ch]:
4149 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
4150 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
4151 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
4153 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
4155 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
4156 as this is already set in ${FRONTEND_INCLUDE} if needed.
4158 * configure.in (CPPFLAGS): setting the include dir for the frontend
4159 directory and don't set FRONTEND=xforms for now as this is executed
4162 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4164 * src/frontends/kde/Makefile.am:
4165 * src/frontends/kde/FormUrl.C:
4166 * src/frontends/kde/FormUrl.h:
4167 * src/frontends/kde/formurldialog.h:
4168 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4170 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4172 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4174 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4176 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4179 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4181 * src/WorkArea.C (work_area_handler): more work to get te
4182 FL_KEYBOARD to work with xforms 0.88 too, please test.
4184 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4186 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4188 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4191 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4193 * src/Timeout.h: remove Qt::emit hack.
4195 * several files: changes to allo doc++ compilation
4197 * src/lyxfunc.C (processKeySym): new method
4198 (processKeyEvent): comment out if FL_REVISION < 89
4200 * src/WorkArea.C: change some debugging levels.
4201 (WorkArea): set wantkey to FL_KEY_ALL
4202 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4203 clearer code and the use of compose with XForms 0.89. Change to
4204 use signals instead of calling methods in bufferview directly.
4206 * src/Painter.C: change some debugging levels.
4208 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4211 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4212 (workAreaKeyPress): new method
4214 2000-08-14 Juergen Vigna <jug@sad.it>
4216 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4218 * config/kde.m4: addes some features
4220 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4221 include missing xforms dialogs.
4223 * src/Timeout.h: a hack to be able to compile with qt/kde.
4225 * sigc++/.cvsignore: added acinclude.m4
4227 * lib/.cvsignore: added listerros
4229 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4230 xforms tree as objects are needed for other frontends.
4232 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4233 linking with not yet implemented xforms objects.
4235 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4237 2000-08-14 Baruch Even <baruch.even@writeme.com>
4239 * src/frontends/xforms/FormGraphics.h:
4240 * src/frontends/xforms/FormGraphics.C:
4241 * src/frontends/xforms/RadioButtonGroup.h:
4242 * src/frontends/xforms/RadioButtonGroup.C:
4243 * src/insets/insetgraphics.h:
4244 * src/insets/insetgraphics.C:
4245 * src/insets/insetgraphicsParams.h:
4246 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4247 instead of spaces, and various other indentation issues to make the
4248 sources more consistent.
4250 2000-08-14 Marko Vendelin <markov@ioc.ee>
4252 * src/frontends/gnome/dialogs/diaprint.glade
4253 * src/frontends/gnome/FormPrint.C
4254 * src/frontends/gnome/FormPrint.h
4255 * src/frontends/gnome/diaprint_callbacks.c
4256 * src/frontends/gnome/diaprint_callbacks.h
4257 * src/frontends/gnome/diaprint_interface.c
4258 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4261 * src/frontends/gnome/dialogs/diainserturl.glade
4262 * src/frontends/gnome/FormUrl.C
4263 * src/frontends/gnome/FormUrl.h
4264 * src/frontends/gnome/diainserturl_callbacks.c
4265 * src/frontends/gnome/diainserturl_callbacks.h
4266 * src/frontends/gnome/diainserturl_interface.c
4267 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
4268 Gnome implementation
4270 * src/frontends/gnome/Dialogs.C
4271 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
4272 all other dialogs. Copy all unimplemented dialogs from Xforms
4275 * src/frontends/gnome/support.c
4276 * src/frontends/gnome/support.h: support files generated by Glade
4280 * config/gnome.m4: Gnome configuration scripts
4282 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4283 configure --help message
4285 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
4286 only if there are no events pendling in Gnome/Gtk. This enhances
4287 the performance of menus.
4290 2000-08-14 Allan Rae <rae@lyx.org>
4292 * lib/Makefile.am: listerrors cleaning
4294 * lib/listerrors: removed -- generated file
4295 * acinclude.m4: ditto
4296 * sigc++/acinclude.m4: ditto
4298 * src/frontends/xforms/forms/form_citation.fd:
4299 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
4302 * src/frontends/xforms/forms/makefile: I renamed the `install` target
4303 `updatesrc` and now we have a `test` target that does what `updatesrc`
4304 used to do. I didn't like having an install target that wasn't related
4307 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
4308 on all except FormGraphics. This may yet happen. Followed by a major
4309 cleanup including using FL_TRANSIENT for most of the dialogs. More
4310 changes to come when the ButtonController below is introduced.
4312 * src/frontends/xforms/ButtonController.h: New file for managing up to
4313 four buttons on a dialog according to an externally defined policy.
4314 * src/frontends/xforms/Makefile.am: added above
4316 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
4317 Apply and Cancel/Close buttons and everything in between and beyond.
4318 * src/frontends/Makefile.am: added above.
4320 * src/frontends/xforms/forms/form_preferences.fd:
4321 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
4322 and removed variable 'status' as a result. Fixed the set_minsize thing.
4323 Use the new screen-font-update after checking screen fonts were changed
4324 Added a "Restore" button to restore the original lyxrc values while
4325 editing. This restores everything not just the last input changed.
4326 That's still a tricky one. As is the "LyX: this shouldn't happen..."
4328 * src/LyXAction.C: screen-font-update added for updating buffers after
4329 screen font settings have been changed.
4330 * src/commandtags.h: ditto
4331 * src/lyxfunc.C: ditto
4333 * forms/lyx.fd: removed screen fonts dialog.
4334 * src/lyx_gui.C: ditto
4335 * src/menus.[Ch]: ditto
4336 * src/lyx.[Ch]: ditto
4337 * src/lyx_cb.C: ditto + code from here moved to make
4338 screen-font-update. And people wonder why progress on GUII is
4339 slow. Look at how scattered this stuff was! It takes forever
4342 * forms/fdfix.sh: Fixup the spacing after commas.
4343 * forms/makefile: Remove date from generated files. Fewer clashes now.
4344 * forms/bullet_forms.C.patch: included someones handwritten changes
4346 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
4347 once I've discovered why LyXRC was made noncopyable.
4348 * src/lyx_main.C: ditto
4350 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
4352 * src/frontends/xforms/forms/fdfix.sh:
4353 * src/frontends/xforms/forms/fdfixh.sed:
4354 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
4355 * src/frontends/xforms/Form*.[hC]:
4356 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
4357 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
4358 provide a destructor for the struct FD_form_xxxx. Another version of
4359 the set_[max|min]size workaround and a few other cleanups. Actually,
4360 Angus' patch from 20000809.
4362 2000-08-13 Baruch Even <baruch.even@writeme.com>
4364 * src/insets/insetgraphics.C (Clone): Added several fields that needed
4367 2000-08-11 Juergen Vigna <jug@sad.it>
4369 * src/insets/insetgraphics.C (InsetGraphics): changing init
4370 order because of warnings.
4372 * src/frontends/xforms/forms/makefile: adding patching .C with
4375 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
4376 from .C.patch to .c.patch
4378 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
4379 order because of warning.
4381 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
4383 * src/frontends/Liason.C (setMinibuffer): new helper function
4385 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
4387 * src/lyxfunc.C (Dispatch): calling new Document-Layout
4389 * lib/ui/default.ui: commented out PaperLayout entry
4391 * src/frontends/xforms/form_document.[Ch]: new added files
4393 * src/frontends/xforms/FormDocument.[Ch]: ditto
4395 * src/frontends/xforms/forms/form_document.fd: ditto
4397 * src/frontends/xforms/forms/form_document.C.patch: ditto
4399 2000-08-10 Juergen Vigna <jug@sad.it>
4401 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
4402 (InsetGraphics): initialized cacheHandle to 0.
4403 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
4405 2000-08-10 Baruch Even <baruch.even@writeme.com>
4407 * src/graphics/GraphicsCache.h:
4408 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
4409 correctly as a cache.
4411 * src/graphics/GraphicsCacheItem.h:
4412 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
4415 * src/graphics/GraphicsCacheItem_pimpl.h:
4416 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
4419 * src/insets/insetgraphics.h:
4420 * src/insets/insetgraphics.C: Changed from using a signal notification
4421 to polling when image is not loaded.
4423 2000-08-10 Allan Rae <rae@lyx.org>
4425 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
4426 that there are two functions that have to been taken out of line by
4427 hand and aren't taken care of in the script. (Just a reminder note)
4429 * sigc++/macros/*.h.m4: Updated as above.
4431 2000-08-09 Juergen Vigna <jug@sad.it>
4433 * src/insets/insettext.C (draw): small fix for clearing rectangle.
4435 * src/insets/insettabular.C: make drawing of single cell smarter.
4437 2000-08-09 Marko Vendelin <markov@ioc.ee>
4438 * src/frontends/gnome/Menubar_pimpl.C
4439 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
4440 implementation: new files
4442 * src/frontends/gnome/mainapp.C
4443 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
4446 * src/main.C: create Gnome main window
4448 * src/frontends/xforms/Menubar_pimpl.h
4449 * src/frontends/Menubar.C
4450 * src/frontends/Menubar.h: added method Menubar::update that calls
4451 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
4453 * src/LyXView.C: calls Menubar::update to update the state
4456 * src/frontends/gnome/Makefile.am: added new files
4458 * src/frontends/Makefile.am: added frontend compiler options
4460 2000-08-08 Juergen Vigna <jug@sad.it>
4462 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
4464 * src/bufferlist.C (close):
4465 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
4466 documents if exiting without saving.
4468 * src/buffer.C (save): use removeAutosaveFile()
4470 * src/support/filetools.C (removeAutosaveFile): new function.
4472 * src/lyx_cb.C (MenuWrite): returns a bool now.
4473 (MenuWriteAs): check if file could really be saved and revert to the
4475 (MenuWriteAs): removing old autosavefile if existant.
4477 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
4478 before Goto toggle declaration, because of compiler warning.
4480 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
4482 * src/lyxfunc.C (MenuNew): small fix.
4484 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
4486 * src/bufferlist.C (newFile):
4487 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
4489 * src/lyxrc.C: added new_ask_filename tag
4491 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
4493 * src/lyx.fd: removed code pertaining to form_ref
4494 * src/lyx.[Ch]: ditto
4495 * src/lyx_cb.C: ditto
4496 * src/lyx_gui.C: ditto
4497 * src/lyx_gui_misc.C: ditto
4499 * src/BufferView_pimpl.C (restorePosition): update buffer only
4502 * src/commandtags.h (LFUN_REFTOGGLE): removed
4503 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
4504 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
4505 (LFUN_REFBACK): renamed LFUN_REF_BACK
4507 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
4508 * src/menus.C: ditto
4509 * src/lyxfunc.C (Dispatch): ditto.
4510 InsertRef dialog is now GUI-independent.
4512 * src/texrow.C: added using std::endl;
4514 * src/insets/insetref.[Ch]: strip out large amounts of code.
4515 The inset is now a container and this functionality is now
4516 managed by a new FormRef dialog
4518 * src/frontends/Dialogs.h (showRef, createRef): new signals
4520 * src/frontends/xforms/FormIndex.[Ch],
4521 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
4522 when setting dialog's min/max size
4523 * src/frontends/xforms/FormIndex.[Ch]: ditto
4525 * src/frontends/xforms/FormRef.[Ch],
4526 src/frontends/xforms/forms/form_ref.fd: new xforms
4527 implementation of an InsetRef dialog
4529 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
4532 * src/graphics/XPM_Renderer.C (isImageFormatOK):
4533 ios::nocreate is not part of the standard. Removed.
4535 2000-08-07 Baruch Even <baruch.even@writeme.com>
4537 * src/graphics/Renderer.h:
4538 * src/graphics/Renderer.C: Added base class for rendering of different
4539 image formats into Pixmaps.
4541 * src/graphics/XPM_Renderer.h:
4542 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
4543 in a different class.
4545 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
4546 easily add support for other formats.
4548 * src/insets/figinset.C: plugged a leak of an X resource.
4550 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
4552 * src/CutAndPaste.[Ch]: make all metods static.
4554 * development/Code_rules/Rules: more work, added section on
4555 Exceptions, and a References section.
4557 * a lot of header files: work to make doc++ able to generate the
4558 source documentation, some workarounds of doc++ problems. Doc++ is
4559 now able to generate the documentation.
4561 2000-08-07 Juergen Vigna <jug@sad.it>
4563 * src/insets/insettabular.C (recomputeTextInsets): removed function
4565 * src/tabular.C (SetWidthOfMulticolCell):
4567 (calculate_width_of_column_NMC): fixed return value so that it really
4568 only returns true if the column-width has changed (there where
4569 problems with muliticolumn-cells in this column).
4571 2000-08-04 Juergen Vigna <jug@sad.it>
4573 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
4574 also on the scrollstatus of the inset.
4575 (workAreaMotionNotify): ditto.
4577 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
4579 2000-08-01 Juergen Vigna <jug@sad.it>
4581 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
4583 * src/commandtags.h:
4584 * src/LyXAction.C (init):
4585 * src/insets/inset.C (LocalDispatch): added support for
4588 * src/insets/inset.C (scroll): new functions.
4590 * src/insets/insettext.C (removeNewlines): new function.
4591 (SetAutoBreakRows): removes forced newlines in the text of the
4592 paragraph if autoBreakRows is set to false.
4594 * src/tabular.C (Latex): generates a parbox around the cell contents
4597 * src/frontends/xforms/FormTabular.C (local_update): removed
4598 the radio_useparbox button.
4600 * src/tabular.C (UseParbox): new function
4602 2000-08-06 Baruch Even <baruch.even@writeme.com>
4604 * src/graphics/GraphicsCache.h:
4605 * src/graphics/GraphicsCache.C:
4606 * src/graphics/GraphicsCacheItem.h:
4607 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
4610 * src/insets/insetgraphics.h:
4611 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
4612 and the drawing of the inline image.
4614 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
4615 loaded into the wrong position.
4617 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
4620 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4622 * src/support/translator.h: move all typedefs to public section
4624 * src/support/filetools.C (MakeLatexName): return string const
4626 (TmpFileName): ditto
4627 (FileOpenSearch): ditto
4629 (LibFileSearch): ditto
4630 (i18nLibFileSearch): ditto
4633 (CreateTmpDir): ditto
4634 (CreateBufferTmpDir): ditto
4635 (CreateLyXTmpDir): ditto
4638 (MakeAbsPath): ditto
4640 (OnlyFilename): ditto
4642 (NormalizePath): ditto
4643 (CleanupPath): ditto
4644 (GetFileContents): ditto
4645 (ReplaceEnvironmentPath): ditto
4646 (MakeRelPath): ditto
4648 (ChangeExtension): ditto
4649 (MakeDisplayPath): ditto
4650 (do_popen): return cmdret const
4651 (findtexfile): return string const
4653 * src/support/DebugStream.h: add some /// to please doc++
4655 * src/frontends/DialogBase.h (endif): add some /// to please doc++
4657 * src/texrow.C (same_rownumber): functor to use with find_if
4658 (getIdFromRow): rewritten to use find_if and to not update the
4659 positions. return true if row is found
4660 (increasePos): new method, use to update positions
4662 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
4664 * src/lyxlex_pimpl.C (verifyTable): new method
4667 (GetString): return string const
4668 (pushTable): rewrite to use std::stack
4670 (setFile): better check
4673 * src/lyxlex.h: make LyXLex noncopyable
4675 * src/lyxlex.C (text): return char const * const
4676 (GetString): return string const
4677 (getLongString): return string const
4679 * src/lyx_gui_misc.C (askForText): return pair<...> const
4681 * src/lastfiles.[Ch] (operator): return string const
4683 * src/buffer.C (parseSingleLyXformat2Token): pass string to
4684 istringstream not char const *.
4685 move token.end() out of loop.
4686 (readFile): move initializaton of token
4688 * src/BufferView2.C (insertErrors): run texrow.increasePos if
4689 getIdFromRow is successful.
4691 * lib/bind/emacs.bind: don't include menus bind
4693 * development/Code_rules/Rules: the beginnings of making this
4694 better and covering more of the unwritten rules that we have.
4696 * development/Code_rules/Recommendations: a couple of wording
4699 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4701 * src/support/strerror.c: remove C++ comment.
4703 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
4705 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
4706 LFUN_INDEX_INSERT_LAST
4708 * src/texrow.C (getIdFromRow): changed from const_iterator to
4709 iterator, allowing code to compile with DEC cxx
4711 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
4712 stores part of the class, as suggested by Allan. Will allow
4714 (apply): test to apply uses InsetCommandParams operator!=
4716 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
4717 (apply): test to apply uses InsetCommandParams operator!=
4719 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
4720 stores part of the class.
4721 (update): removed limits on min/max size.
4723 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
4724 (apply): test to apply uses InsetCommandParams operator!=
4726 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
4727 (Read, Write, scanCommand, getCommand): moved functionality
4728 into InsetCommandParams.
4730 (getScreenLabel): made pure virtual
4731 new InsetCommandParams operators== and !=
4733 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
4734 c-tors based on InsetCommandParams. Removed others.
4735 * src/insets/insetinclude.[Ch]: ditto
4736 * src/insets/insetlabel.[Ch]: ditto
4737 * src/insets/insetparent.[Ch]: ditto
4738 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
4740 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
4741 insets derived from InsetCommand created using similar c-tors
4742 based on InsetCommandParams
4743 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
4744 * src/menus.C (ShowRefsMenu): ditto
4745 * src/paragraph.C (Clone): ditto
4746 * src/text2.C (SetCounter): ditto
4747 * src/lyxfunc.C (Dispatch) ditto
4748 Also recreated old InsetIndex behaviour exactly. Can now
4749 index-insert at the start of a paragraph and index-insert-last
4750 without launching the pop-up.
4752 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4754 * lib/lyxrc.example: mark te pdf options as non functional.
4756 * src/support/lstrings.C (strToInt): move initalization of tmpstr
4757 (isStrDbl): move tmpstr.end() out of loop.
4758 (strToDbl): move intialization of tmpstr
4759 (lowercase): return string const and move tmp.end() out of loop.
4760 (uppercase): return string const and move tmp.edn() out of loop.
4761 (prefixIs): add assertion
4766 (containsOnly): ditto
4767 (containsOnly): ditto
4768 (containsOnly): ditto
4769 (countChar): make last arg char not char const
4770 (token): return string const
4771 (subst): return string const, move tmp.end() out of loop.
4772 (subst): return string const, add assertion
4773 (strip): return string const
4774 (frontStrip): return string const, add assertion
4775 (frontStrip): return string const
4780 * src/support/lstrings.C: add inclde "LAssert.h"
4781 (isStrInt): move tmpstr.end() out of loop.
4783 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
4784 toollist.end() out of loop.
4785 (deactivate): move toollist.end() out of loop.
4786 (update): move toollist.end() out of loop.
4787 (updateLayoutList): move tc.end() out of loop.
4788 (add): move toollist.end() out of loop.
4790 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
4791 md.end() out of loop.
4793 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
4795 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
4798 * src/paragraph.C (Erase): move fontlist.end() out of loop.
4799 (Erase): move insetlist.end() out of loop.
4801 * src/lyx_sendfax_main.C: make show_logfile static and to take a
4802 ref to const string as first arg. Move initialization of some
4803 variables, whitespace changes.
4805 * src/kbmap.C (defkey): move table.end() out of loop.
4806 (kb_keymap): move table.end() out of loop.
4807 (findbinding): move table.end() out of loop.
4809 * src/MenuBackend.C (hasMenu): move end() out of loop.
4810 (getMenu): move end() out of loop.
4811 (getMenu): move menulist_.end() out of loop.
4813 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
4815 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
4818 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
4819 (getFromLyXName): move infotab.end() out of loop.
4821 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
4822 -fvtable-thunks -ffunction-sections -fdata-sections
4824 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
4826 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
4829 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4831 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
4833 * src/frontends/xforms/FormCitation.[Ch],
4834 src/frontends/xforms/FormIndex.[Ch],
4835 src/frontends/xforms/FormToc.[Ch],
4836 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
4838 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4840 * src/commandtags.h: renamed, created some flags for citation
4843 * src/lyx_gui_misc.C: stripped out old FD_index_form code
4845 * src/lyxfunc.C (dispatch): use signals to insert index entry
4847 * src/frontends/Dialogs.h: new signal createIndex
4849 * src/frontends/xforms/FormCommand.[Ch],
4850 src/frontends/xforms/FormCitation.[Ch],
4851 src/frontends/xforms/FormToc.[Ch],
4852 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
4854 * src/insets/insetindex.[Ch]: GUI-independent
4856 * src/frontends/xforms/FormIndex.[Ch],
4857 * src/frontends/xforms/forms/form_index.fd: xforms implementation
4860 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
4862 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
4863 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
4865 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4867 * src/insets/insetref.C (Latex): rewrite so that there is now
4868 question that a initialization is requested.
4870 * src/insets/insetcommand.h: reenable the hide signal
4872 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4874 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
4875 fix handling of shortcuts (many bugs :)
4876 (add_lastfiles): ditto.
4878 * lib/ui/default.ui: fix a few shortcuts.
4880 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
4882 * Makefile.am: Fix ``rpmdist'' target to return the exit
4883 status of the ``rpm'' command, instead of the last command in
4884 the chain (the ``rm lyx.xpm'' command, which always returns
4887 2000-08-02 Allan Rae <rae@lyx.org>
4889 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
4890 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
4891 * src/frontends/xforms/FormToc.C (FormToc): ditto
4893 * src/frontends/xforms/Makefile.am: A few forgotten files
4895 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
4896 Signals-not-copyable-problem Lars' started commenting out.
4898 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
4900 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4902 * src/insets/insetcommand.h: Signals is not copyable so anoter
4903 scheme for automatic hiding of forms must be used.
4905 * src/frontends/xforms/FormCitation.h: don't inerit from
4906 noncopyable, FormCommand already does that.
4907 * src/frontends/xforms/FormToc.h: ditto
4908 * src/frontends/xforms/FormUrl.h: ditto
4910 * src/frontends/xforms/FormCitation.C: add include <algorithm>
4912 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
4914 * src/insets/insetcommand.h (hide): new SigC::Signal0
4915 (d-tor) new virtual destructor emits hide signal
4917 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
4918 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
4920 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
4921 LOF and LOT. Inset is now GUI-independent
4923 * src/insets/insetloa.[Ch]: redundant
4924 * src/insets/insetlof.[Ch]: ditto
4925 * src/insets/insetlot.[Ch]: ditto
4927 * src/frontends/xforms/forms/form_url.fd: tweaked!
4928 * src/frontends/xforms/forms/form_citation.fd: ditto
4930 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
4931 dialogs dealing with InsetCommand insets
4933 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
4934 FormCommand base class
4935 * src/frontends/xforms/FormUrl.[Ch]: ditto
4937 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
4939 * src/frontends/xforms/FormToc.[Ch]: ditto
4941 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
4942 passed a generic InsetCommand pointer
4943 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
4945 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
4946 and modified InsetTOC class
4947 * src/buffer.C: ditto
4949 * forms/lyx.fd: strip out old FD_form_toc code
4950 * src/lyx_gui_misc.C: ditto
4951 * src/lyx_gui.C: ditto
4952 * src/lyx_cb.C: ditto
4953 * src/lyx.[Ch]: ditto
4955 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4957 * src/support/utility.hpp: tr -d '\r'
4959 2000-08-01 Juergen Vigna <jug@sad.it>
4961 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
4963 * src/commandtags.h:
4964 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
4965 LFUN_TABULAR_FEATURES.
4967 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
4968 LFUN_LAYOUT_TABULAR.
4970 * src/insets/insettabular.C (getStatus): implemented helper function.
4972 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
4974 2000-07-31 Juergen Vigna <jug@sad.it>
4976 * src/text.C (draw): fixed screen update problem for text-insets.
4978 * src/text2.C (SetParagrpah): call an update of the inset-owner when
4979 something changed probably this has to be added in various other
4982 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
4984 2000-07-31 Baruch Even <baruch.even@writeme.com>
4986 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
4987 templates to satisfy compaq cxx.
4990 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4992 * src/support/translator.h (equal_1st_in_pair::operator()): take
4993 const ref pair_type as arg.
4994 (equal_2nd_in_pair::operator()): ditto
4995 (Translator::~Translator): remove empty d-tor.
4997 * src/graphics/GraphicsCache.C: move include config.h to top, also
4998 put initialization of GraphicsCache::singleton here.
4999 (~GraphicsCache): move here
5000 (addFile): take const ref as arg
5003 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
5005 * src/BufferView2.C (insertLyXFile): change te with/without header
5008 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5010 * src/frontends/xforms/FormGraphics.C (apply): add some
5011 static_cast. Not very nice, but required by compaq cxx.
5013 * src/frontends/xforms/RadioButtonGroup.h: include header
5014 <utility> instead of <pair.h>
5016 * src/insets/insetgraphicsParams.C: add using directive.
5017 (readResize): change return type to void.
5018 (readOrigin): ditto.
5020 * src/lyxfunc.C (getStatus): add missing break for build-program
5021 function; add test for Literate for export functions.
5023 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
5024 entries in Options menu.
5026 2000-07-31 Baruch Even <baruch.even@writeme.com>
5028 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
5029 protect against auto-allocation; release icon when needed.
5031 2000-07-31 Matej Cepl <CeplM@seznam.cz>
5033 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
5034 on usual typewriter.
5036 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
5037 earlier czech.kmap), useful only for programming.
5039 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5041 * src/frontends/xforms/FormCitation.h: fix conditioning around
5044 2000-07-31 Juergen Vigna <jug@sad.it>
5046 * src/frontends/xforms/FormTabular.C (local_update): changed
5047 radio_linebreaks to radio_useparbox and added radio_useminipage.
5049 * src/tabular.C: made support for using minipages/parboxes.
5051 * src/bufferlist.C (QwriteAll): small fix for asking for save.
5053 * src/insets/insetgraphics.C (draw): just draw the inset so that the
5055 (descent): so the cursor is in the middle.
5056 (width): bit smaller box.
5058 * src/insets/insetgraphics.h: added display() function.
5060 2000-07-31 Baruch Even <baruch.even@writeme.com>
5062 * src/frontends/Dialogs.h: Added showGraphics signals.
5064 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
5065 xforms form definition of the graphics dialog.
5067 * src/frontends/xforms/FormGraphics.h:
5068 * src/frontends/xforms/FormGraphics.C: Added files, the
5069 GUIndependent code of InsetGraphics
5071 * src/insets/insetgraphics.h:
5072 * src/insets/insetgraphics.C: Major writing to make it work.
5074 * src/insets/insetgraphicsParams.h:
5075 * src/insets/insetgraphicsParams.C: Added files, parameter passing
5076 struct between InsetGraphics and GUI.
5078 * src/LaTeXFeatures.h:
5079 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
5080 support for graphicx package.
5082 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
5083 for the graphics inset.
5085 * src/support/translator.h: Added file, used in
5086 InsetGraphicsParams. this is a template to translate between two
5089 * src/frontends/xforms/RadioButtonGroup.h:
5090 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
5091 way to easily control a radio button group.
5093 2000-07-28 Juergen Vigna <jug@sad.it>
5095 * src/insets/insettabular.C (LocalDispatch):
5096 (TabularFeatures): added support for lyx-functions of tabular features.
5097 (cellstart): refixed this function after someone wrongly changed it.
5099 * src/commandtags.h:
5100 * src/LyXAction.C (init): added support for tabular-features
5102 2000-07-28 Allan Rae <rae@lyx.org>
5104 * src/frontends/xforms/FormPreferences.C (build): Setup input return
5105 checking. NOTE: It seems that pressing ESC to cancel the dialog also
5106 triggers the callback for input checking. As a result we sometimes get
5107 "LyX: This shouldn't happen..." printed to cerr.
5108 (input): Started using status variable since I only free() on
5109 destruction. Some input checking for paths and font sizes.
5111 * src/frontends/xforms/FormPreferences.h: Use status to control
5112 activation of Ok and Apply
5114 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
5115 callback. Also resized to stop segfaults with 0.88. The problem is
5116 that xforms-0.88 requires the folder to be wide enough to fit all the
5117 tabs. If it isn't it causes all sorts of problems.
5119 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
5121 * src/frontends/xforms/forms/README: Reflect reality.
5123 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
5124 * src/frontends/xforms/forms/makefile: ditto.
5126 * src/commandtags.h: Get access to new Preferences dialog
5127 * src/LyXAction.C: ditto
5128 * src/lyxfunc.C: ditto
5129 * lib/ui/default.ui: ditto
5131 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5133 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
5135 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
5138 * src/frontends/xforms/form_url.[Ch]: added.
5140 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5142 * src/insets/insetbib.h: fixed bug in previous commit
5144 * src/frontends/xforms/FormUrl.h: ditto
5146 * src/frontends/xforms/FormPrint.h: ditto
5148 * src/frontends/xforms/FormPreferences.h: ditto
5150 * src/frontends/xforms/FormCopyright.h: ditto
5152 * src/frontends/xforms/FormCitation.C: ditto
5154 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
5155 private copyconstructor and private default contructor
5157 * src/support/Makefile.am: add utility.hpp
5159 * src/support/utility.hpp: new file from boost
5161 * src/insets/insetbib.h: set owner in clone
5163 * src/frontends/xforms/FormCitation.C: added missing include
5166 * src/insets/form_url.[Ch]: removed
5168 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5170 * development/lyx.spec.in
5171 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5172 file/directory re-organization.
5174 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5176 * src/insets/insetcommand.[Ch]: moved the string data and
5177 associated manipulation methods into a new stand-alone class
5178 InsetCommandParams. This class has two additional methods
5179 getAsString() and setFromString() allowing the contents to be
5180 moved around as a single string.
5181 (addContents) method removed.
5182 (setContents) method no longer virtual.
5184 * src/buffer.C (readInset): made use of new InsetCitation,
5185 InsetUrl constructors based on InsetCommandParams.
5187 * src/commandtags.h: add LFUN_INSERT_URL
5189 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5190 independent InsetUrl and use InsetCommandParams to extract
5191 string info and create new Insets.
5193 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5195 * src/frontends/xforms/FormCitation.C (apply): uses
5198 * src/frontends/xforms/form_url.C
5199 * src/frontends/xforms/form_url.h
5200 * src/frontends/xforms/FormUrl.h
5201 * src/frontends/xforms/FormUrl.C
5202 * src/frontends/xforms/forms/form_url.fd: new files
5204 * src/insets/insetcite.[Ch]: removed unused constructors.
5206 * src/insets/insetinclude.[Ch]: no longer store filename
5208 * src/insets/inseturl.[Ch]: GUI-independent.
5210 2000-07-26 Juergen Vigna <jug@sad.it>
5211 * renamed frontend from gtk to gnome as it is that what is realized
5212 and did the necessary changes in the files.
5214 2000-07-26 Marko Vendelin <markov@ioc.ee>
5216 * configure.in: cleaning up gnome configuration scripts
5218 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5220 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5221 shortcuts syndrom by redrawing them explicitely (a better solution
5222 would be appreciated).
5224 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5226 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5229 * src/lyx_cb.C (MenuExport): change html export to do the right
5230 thing depending of the document type (instead of having
5231 html-linuxdoc and html-docbook).
5232 * src/lyxfunc.C (getStatus): update for html
5233 * lib/ui/default.ui: simplify due to the above change.
5234 * src/menus.C (ShowFileMenu): update too (in case we need it).
5236 * src/MenuBackend.C (read): if a menu is defined twice, add the
5237 new entries to the exiting one.
5239 2000-07-26 Juergen Vigna <jug@sad.it>
5241 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5243 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5244 and return a bool if it did actual save the file.
5245 (AutoSave): don't autosave a unnamed doc.
5247 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5248 check if this is an UNNAMED new file and react to it.
5249 (newFile): set buffer to unnamed and change to not mark a new
5250 buffer dirty if I didn't do anything with it.
5252 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5254 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5256 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5257 friend as per Angus's patch posted to lyx-devel.
5259 * src/ext_l10n.h: updated
5261 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5262 gettext on the style string right before inserting them into the
5265 * autogen.sh: add code to extract style strings form layout files,
5266 not good enough yet.
5268 * src/frontends/gtk/.cvsignore: add MAKEFILE
5270 * src/MenuBackend.C (read): run the label strings through gettext
5271 before storing them in the containers.
5273 * src/ext_l10n.h: new file
5275 * autogen.sh : generate the ext_l10n.h file here
5277 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5279 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5282 * lib/ui/default.ui: fix a couple of typos.
5284 * config/gnome/gtk.m4: added (and added to the list of files in
5287 * src/insets/insetinclude.C (unique_id): fix when we are using
5288 lyxstring instead of basic_string<>.
5289 * src/insets/insettext.C (LocalDispatch): ditto.
5290 * src/support/filetools.C: ditto.
5292 * lib/configure.m4: create the ui/ directory if necessary.
5294 * src/LyXView.[Ch] (updateToolbar): new method.
5296 * src/BufferView_pimpl.C (buffer): update the toolbar when
5297 opening/closing buffer.
5299 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5301 * src/LyXAction.C (getActionName): enhance to return also the name
5302 and options of pseudo-actions.
5303 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
5305 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
5306 as an example of what is possible). Used in File->Build too (more
5307 useful) and in the import/export menus (to mimick the complicated
5308 handling of linuxdoc and friends). Try to update all the entries.
5310 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
5313 * src/MenuBackend.C (read): Parse the new OptItem tag.
5315 * src/MenuBackend.h: Add a new optional_ data member (used if the
5316 entry should be omitted when the lyxfunc is disabled).
5318 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
5319 function, used as a shortcut.
5320 (create_submenu): align correctly the shortcuts on the widest
5323 * src/MenuBackend.h: MenuItem.label() only returns the label of
5324 the menu without shortcut; new method shortcut().
5326 2000-07-14 Marko Vendelin <markov@ioc.ee>
5328 * src/frontends/gtk/Dialogs.C:
5329 * src/frontends/gtk/FormCopyright.C:
5330 * src/frontends/gtk/FormCopyright.h:
5331 * src/frontends/gtk/Makefile.am: added these source-files for the
5332 Gtk/Gnome support of the Copyright-Dialog.
5334 * src/main.C: added Gnome::Main initialization if using
5335 Gtk/Gnome frontend-GUI.
5337 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
5339 * config/gnome/aclocal-include.m4
5340 * config/gnome/compiler-flags.m4
5341 * config/gnome/curses.m4
5342 * config/gnome/gnome--.m4
5343 * config/gnome/gnome-bonobo-check.m4
5344 * config/gnome/gnome-common.m4
5345 * config/gnome/gnome-fileutils.m4
5346 * config/gnome/gnome-ghttp-check.m4
5347 * config/gnome/gnome-gnorba-check.m4
5348 * config/gnome/gnome-guile-checks.m4
5349 * config/gnome/gnome-libgtop-check.m4
5350 * config/gnome/gnome-objc-checks.m4
5351 * config/gnome/gnome-orbit-check.m4
5352 * config/gnome/gnome-print-check.m4
5353 * config/gnome/gnome-pthread-check.m4
5354 * config/gnome/gnome-support.m4
5355 * config/gnome/gnome-undelfs.m4
5356 * config/gnome/gnome-vfs.m4
5357 * config/gnome/gnome-x-checks.m4
5358 * config/gnome/gnome-xml-check.m4
5359 * config/gnome/gnome.m4
5360 * config/gnome/gperf-check.m4
5361 * config/gnome/gtk--.m4
5362 * config/gnome/linger.m4
5363 * config/gnome/need-declaration.m4: added configuration scripts
5364 for Gtk/Gnome frontend-GUI
5366 * configure.in: added support for the --with-frontend=gtk option
5368 * autogen.sh: added config/gnome/* to list of config-files
5370 * acconfig.h: added define for GTKGUI-support
5372 * config/lyxinclude.m4: added --with-frontend[=value] option value
5373 for Gtk/Gnome frontend-GUI support.
5375 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5377 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
5381 * src/paragraph.C (GetChar): remove non-const version
5383 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
5384 (search_kw): use it.
5386 * src/lyx_main.C (init): if "preferences" exist, read that instead
5388 (ReadRcFile): return bool if the file could be read ok.
5389 (ReadUIFile): add a check to see if lex file is set ok.
5391 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
5392 bastring can be used instead of lyxstring (still uses the old code
5393 if std::string is good enough or if lyxstring is used.)
5395 * src/encoding.C: make the arrays static, move ininle functions
5397 * src/encoding.h: from here.
5399 * src/buffer.C: have last_isnet_read as a file scope variable for now.
5400 (parseSingleLyXformat2Token): move inset parsing to separate method
5401 (readInset): new private method
5403 * src/Variables.h: remove virtual from get().
5405 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
5406 access to NEW_INSETS and NEW_TABULAR
5408 * src/MenuBackend.h: remove superfluous forward declaration of
5409 MenuItem. Add documentations tags "///", remove empty MenuItem
5410 destructor, remove private default contructor.
5412 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
5414 (read): more string mlabel and mname to where they are used
5415 (read): remove unused variables mlabel and mname
5416 (defaults): unconditional clear, make menusetup take advantage of
5417 add returning Menu &.
5419 * src/LyXView.h: define NEW_MENUBAR as default
5421 * src/LyXAction.C: include lyxparagraph.h temporary to get access
5422 to NEW_INSETS and NEW_TABULAR.
5423 (init): commetn out some funcs that is obsolete when NEW_INSETS is
5424 defined. Change some of the "xxxx-inset-insert" functions names to
5427 * several files: more enahncements to NEW_INSETS and the resulting
5430 * lib/lyxrc.example (\date_insert_format): move to misc section
5432 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
5433 bastring and use AC_CACHE_CHECK.
5434 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
5435 the system have the newest methods. uses AC_CACHE_CHECK
5436 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
5437 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
5438 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
5440 * configure.in: add LYX_CXX_GOOD_STD_STRING
5442 * acinclude.m4: recreated
5444 2000-07-24 Amir Karger <karger@lyx.org>
5446 * README: add Hebrew, Arabic kmaps
5449 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5451 * src/buffer.C (writeFileAscii): Define actcell as an int instead
5454 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5456 * Lot of files: add pragma interface/implementation.
5458 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
5460 * lib/ui/default.ui: new file (ans new directory). Contains the
5461 default menu and toolbar.
5463 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
5464 global space. Toolbars are now read (as menus) in ui files.
5466 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
5468 * src/lyxfunc.C (getStatus): do not exit immediately if a command
5469 is disabled because the document is read-only. We want to have the
5470 toggle state of the function anyway.
5471 (getStatus): add code for LFUN_VC* functions (mimicking what is
5472 done in old-style menus)
5474 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
5475 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
5477 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
5478 * src/BufferView_pimpl.C: ditto.
5479 * src/lyxfunc.C: ditto.
5481 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
5482 default). This replaces old-style menus by new ones.
5484 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
5485 MenuItem. Contain the data structure of a menu.
5487 * src/insets/insettext.C: use LyXView::setLayout instead of
5488 accessing directly the toolbar combox.
5489 * src/lyxfunc.C (Dispatch): ditto.
5491 * src/LyXView.C (setLayout): new method, which just calls
5492 Toolbar::setLayout().
5493 (updateLayoutChoice): move part of this method in Toolbar.
5495 * src/toolbar.[Ch]: removed.
5497 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
5498 implementation the toolbar.
5500 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
5501 the toolbar. It might make sense to merge it with ToolbarDefaults
5503 (setLayout): new function.
5504 (updateLayoutList): ditto.
5505 (openLayoutList): ditto.
5507 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
5508 xforms implementation of the toolbar.
5509 (get_toolbar_func): comment out, since I do not
5510 know what it is good for.
5512 * src/ToolbarDefaults.h: Add the ItemType enum.
5514 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
5515 for a list of allocated C strings. Used in Menubar xforms
5516 implementation to avoid memory leaks.
5518 * src/support/lstrings.[Ch] (uppercase): new version taking and
5522 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
5523 * lib/bind/emacs.bind: ditto.
5525 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5527 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
5528 forward decl of LyXView.
5530 * src/toolbar.C (toolbarItem): moved from toolbar.h
5531 (toolbarItem::clean): ditto
5532 (toolbarItem::~toolbarItem): ditto
5533 (toolbarItem::operator): ditto
5535 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
5537 * src/paragraph.h: control the NEW_TABULAR define from here
5539 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
5540 USE_TABULAR_INSETS to NEW_TABULAR
5542 * src/ToolbarDefaults.C: add include "lyxlex.h"
5544 * files using the old table/tabular: use NEW_TABULAR to control
5545 compilation of old tabular stuff.
5547 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
5550 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
5551 planemet in reading of old style floats, fix the \end_deeper
5552 problem when reading old style floats.
5554 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5556 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
5558 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
5560 * lib/bind/sciword.bind: updated.
5562 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5564 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
5565 layout write problem
5567 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5569 * src/Makefile.am (INCLUDES): remove image directory from include
5572 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
5573 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
5575 * src/LyXView.C (create_form_form_main): read the application icon
5578 * lib/images/*.xpm: change the icons to use transparent color for
5581 * src/toolbar.C (update): change the color of the button when it
5584 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5586 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
5587 setting explicitely the minibuffer.
5588 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
5590 * src/LyXView.C (showState): new function. Shows font information
5591 in minibuffer and update toolbar state.
5592 (LyXView): call Toolbar::update after creating the
5595 * src/toolbar.C: change toollist to be a vector instead of a
5597 (BubbleTimerCB): get help string directly from the callback
5598 argument of the corresponding icon (which is the action)
5599 (set): remove unnecessary ugliness.
5600 (update): new function. update the icons (depressed, disabled)
5601 depending of the status of the corresponding action.
5603 * src/toolbar.h: remove help in toolbarItem
5605 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
5607 * src/Painter.C (text): Added code for using symbol glyphs from
5608 iso10646 fonts. Currently diabled.
5610 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
5613 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
5614 magyar,turkish and usorbian.
5616 * src/paragraph.C (isMultiLingual): Made more efficient.
5618 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
5621 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
5622 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
5623 Also changed the prototype to "bool math_insert_greek(char)".
5625 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5627 * lots of files: apply the NEW_INSETS on all code that will not be
5628 needed when we move to use the new insets. Enable the define in
5629 lyxparagrah.h to try it.
5631 * src/insets/insettabular.C (cellstart): change to be a static
5633 (InsetTabular): initialize buffer in the initializer list.
5635 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
5637 * src/frontends/xforms/FormPrint.[Ch] : moved #include
5638 form_print.h out of the header file. Replaced with forward
5639 declarations of the relevant struct.
5641 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
5644 * src/commandtags.h: do not include "debug.h" which does not
5645 belong there. #include it in some other places because of this
5648 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5650 * src/insets/insetcaption.C: add a couple "using" directives.
5652 * src/toolbar.C (add): get the help text directly from lyxaction.
5654 (setPixmap): new function. Loads from disk and sets a pixmap on a
5655 botton; the name of the pixmap file is derived from the command
5658 * src/toolbar.h: remove members isBitmap and pixmap from
5661 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
5662 * lib/images/: move many files from images/banner.xpm.
5664 * src/lyx_gui.C (create_forms): read banner pixmap from file.
5666 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
5667 * src/toolbar.C: ditto.
5668 * configure.in: ditto.
5669 * INSTALL: document.
5671 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
5672 the spellchecker popup is closed from the WM.
5674 2000-07-19 Juergen Vigna <jug@sad.it>
5676 * src/insets/insetfloat.C (Write): small fix because we use the
5677 insetname for the type now!
5679 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
5681 * src/frontends/xforms/forms/form_citation.fd: object sizes are
5684 * src/frontends/Dialogs.h: removed hideCitation signal
5686 * src/insets/insetcite.h: added hide signal
5688 * src/insets/insetcite.C (~InsetCitation): emits new signal
5689 (getScreenLabel): "intelligent" label should now fit on the screen!
5691 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
5693 * src/frontends/xforms/FormCitation.C (showInset): connects
5694 hide() to the inset's hide signal
5695 (show): modified to use fl_set_object_position rather than
5696 fl_set_object_geometry wherever possible
5698 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5700 * src/insets/lyxinset.h: add caption code
5702 * src/insets/insetfloat.C (type): new method
5704 * src/insets/insetcaption.C (Write): new method
5706 (LyxCode): new method
5708 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
5709 to get it right together with using the FloatList.
5711 * src/commandtags.h: add LFUN_INSET_CAPTION
5712 * src/lyxfunc.C (Dispatch): handle it
5714 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
5717 * src/Variables.[Ch]: make expand take a const reference, remove
5718 the destructor, some whitespace changes.
5720 * src/LyXAction.C (init): add caption-inset-insert
5722 * src/FloatList.C (FloatList): update the default floats a bit.
5724 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5726 * src/Variables.[Ch]: new files. Intended to be used for language
5727 specific strings (like \chaptername) and filename substitution in
5730 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
5732 * lib/kbd/american.kmap: update
5734 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
5736 * src/bufferparams.[Ch]: remove member allowAccents.
5738 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
5740 * src/LaTeXLog.C: use the log_form.h header.
5741 * src/lyx_gui.C: ditto.
5742 * src/lyx_gui_misc.C: ditto.
5743 * src/lyxvc.h: ditto.
5745 * forms/log_form.fd: new file, created from latexoptions.fd. I
5746 kept the log popup and nuked the options form.
5748 * src/{la,}texoptions.[Ch]: removed.
5749 * src/lyx_cb.C (LaTeXOptions): ditto
5751 * src/lyx_gui.C (create_forms): do not handle the
5752 fd_latex_options form.
5754 2000-07-18 Juergen Vigna <jug@sad.it>
5756 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
5757 name of the inset so that it can be requested outside (text2.C).
5759 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
5762 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5764 * src/mathed/formula.h (ConvertFont): constify
5766 * src/mathed/formula.C (Read): add warning if \end_inset is not
5767 found on expected place.
5769 * src/insets/lyxinset.h (ConvertFont): consify
5771 * src/insets/insetquotes.C (ConvertFont): constify
5772 * src/insets/insetquotes.h: ditto
5774 * src/insets/insetinfo.h: add labelfont
5776 * src/insets/insetinfo.C (InsetInfo): set the labelfont
5777 (ascent): use labelfont
5781 (Write): make .lyx file a bit nicer
5783 * src/insets/insetfloat.C (Write): simplify somewhat...
5784 (Read): add warning if arg is not found
5786 * src/insets/insetcollapsable.C: add using std::max
5787 (Read): move string token and add warning in arg is not found
5788 (draw): use std::max to get the right ty
5789 (getMaxWidth): simplify by using std::max
5791 * src/insets/insetsection.h: new file
5792 * src/insets/insetsection.C: new file
5793 * src/insets/insetcaption.h: new file
5794 * src/insets/insetcaption.C: new file
5796 * src/insets/inset.C (ConvertFont): constify signature
5798 * src/insets/Makefile.am (libinsets_la_SOURCES): add
5799 insetcaption.[Ch] and insetsection.[Ch]
5801 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
5802 uses to use LABEL_COUNTER_CHAPTER instead.
5803 * src/text2.C (SetCounter): here
5805 * src/counters.h: new file
5806 * src/counters.C: new file
5807 * src/Sectioning.h: new file
5808 * src/Sectioning.C: new file
5810 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
5812 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5814 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
5817 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
5820 2000-07-17 Juergen Vigna <jug@sad.it>
5822 * src/tabular.C (Validate): check if array-package is needed.
5823 (SetVAlignment): added support for vertical alignment.
5824 (SetLTFoot): better support for longtable header/footers
5825 (Latex): modified to support added features.
5827 * src/LaTeXFeatures.[Ch]: added array-package.
5829 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
5831 * src/lyx_gui.C (LyXGUI): make sure that the height is large
5834 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
5836 * configure.in: do not forget to put a space after -isystem.
5838 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
5840 * lib/kbd/arabic.kmap: a few fixes.
5842 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5844 * some whitespace chagnes to a number of files.
5846 * src/support/DebugStream.h: change to make it easier for
5847 doc++ to parse correctly.
5848 * src/support/lyxstring.h: ditto
5850 * src/mathed/math_utils.C (compara): change to have only one
5852 (MathedLookupBOP): change because of the above.
5854 * src/mathed/math_delim.C (math_deco_compare): change to have only
5856 (search_deco): change becasue of the above.
5858 * src/insets/insettabular.C (DrawCellSelection): use std::swap
5859 instead of manually coded one.
5861 * src/insets/insetquotes.C (Read): read the \end_inset too
5863 * src/insets/insetlatex.h: remove file
5864 * src/insets/insetlatex.C: remove file
5866 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
5868 (InsetPrintIndex): remove destructor
5870 * src/insets/insetinclude.h: remove default constructor
5872 * src/insets/insetfloat.C: work to make it work better
5874 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
5876 * src/insets/insetcite.h (InsetCitation): remove default constructor
5878 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
5880 * src/text.C (GetColumnNearX): comment out some currently unused code.
5882 * src/paragraph.C (writeFile): move some initializations closer to
5884 (CutIntoMinibuffer): small change to use new matchIT operator
5888 (InsertInset): ditto
5891 (InsetIterator): ditto
5892 (Erase): small change to use new matchFT operator
5894 (GetFontSettings): ditto
5895 (HighestFontInRange): ditto
5898 * src/lyxparagraph.h: some chars changed to value_type
5899 (matchIT): because of some stronger checking (perhaps too strong)
5900 in SGI STL, the two operator() unified to one.
5903 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
5905 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
5906 the last inset read added
5907 (parseSingleLyXformat2Token): some more (future) compability code added
5908 (parseSingleLyXformat2Token): warning about solitary \end_inset added
5909 (parseSingleLyXformat2Token): set last_inset_read
5910 (parseSingleLyXformat2Token): more code to read new "Float" correctly
5911 (parseSingleLyXformat2Token): don't double intializw string next_token
5913 * src/TextCache.C (text_fits::operator()): add const's to the signature
5914 (has_buffer::operator()): ditto
5916 * src/Floating.h: add some comments on the class
5918 * src/FloatList.[Ch] (typeExist): new method
5921 * src/BackStack.h: added default constructor, wanted by Gcc.
5923 2000-07-14 Juergen Vigna <jug@sad.it>
5925 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
5927 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
5929 * src/insets/insettabular.C (resizeLyXText): need this to be able to
5930 do a redraw when the window is resized!
5931 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
5933 * src/insets/insettext.C (resizeLyXText): added function to correctly
5934 being able to resize the LyXWindow.
5936 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
5938 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
5940 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
5941 crashes when closing dialog to a deleted inset.
5943 * src/insets/insetcite.[Ch] (Edit) : the return of this former
5944 method! Now similar to other insets.
5946 2000-07-13 Juergen Vigna <jug@sad.it>
5948 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
5950 * lib/examples/Literate.lyx: small patch!
5952 * src/insets/insetbib.C (Read): added this function because of wrong
5953 Write (without [begin|end]_inset).
5955 2000-07-11 Juergen Vigna <jug@sad.it>
5957 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
5958 as the insertInset could not be good!
5960 * src/screen.C (ToggleSelection): fixed toggle selection bug as
5961 the bool param should not be last.
5963 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5965 * sigc++/configure.in: fix bug in threading-related code (Yes, I
5966 did submit that to Karl).
5968 * configure.in: use -isystem instead of -I for X headers. This
5969 fixes a problem on solaris with a recent gcc;
5970 put the front-end code after the X detection code;
5971 configure in sigc++ before lib/
5973 * src/lyx_main.C (commandLineHelp): remove -display from command
5976 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
5978 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
5979 Also put in Makefile rules for building the ``listerrors''
5980 program for parsing errors from literate programs written in LyX.
5982 * lib/build-listerrors: Added small shell script as part of compile
5983 process. This builds a working ``listerrors'' binary if noweb is
5984 installed and either 1) the VNC X server is installed on the machine,
5985 or 2) the user is compiling from within a GUI. The existence of a GUI
5986 is necessary to use the ``lyx --export'' feature for now. This
5987 hack can be removed once ``lyx --export'' no longer requires a GUI to
5990 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
5992 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
5993 now passed back correctly from gcc and placed "under" error
5994 buttons in a Literate LyX source.
5996 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5998 * src/text.C (GetColumnNearX): Better behavior when a RTL
5999 paragraph is ended by LTR text.
6001 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
6004 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6006 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
6007 true when clipboard is empty.
6009 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6011 * text.C (Backspace): Prevent rebreaking of a row if it is the last
6012 row of the paragraph.
6013 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
6014 to prevent calculation of bidi tables
6016 2000-07-07 Juergen Vigna <jug@sad.it>
6018 * src/screen.C (ToggleSelection): added y_offset and x_offset
6021 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
6024 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
6026 * src/insets/insettext.C: fixed Layout-Display!
6028 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6030 * configure.in: add check for strings.h header.
6032 * src/spellchecker.C: include <strings.h> in order to have a
6033 definition for bzero().
6035 2000-07-07 Juergen Vigna <jug@sad.it>
6037 * src/insets/insettext.C (draw): set the status of the bv->text to
6038 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
6040 * src/screen.C (DrawOneRow):
6041 (DrawFromTo): redraw the actual row if something has changed in it
6044 * src/text.C (draw): call an update of the toplevel-inset if something
6045 has changed inside while drawing.
6047 * src/lyxtext.h: added CHANGED_IN_DRAW status.
6049 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
6051 * src/insets/insetbib.[Ch] (callback) new method, moving callback
6052 processing inside class.
6054 * src/insets/insetindex.[Ch] (callback) new method, moving callback
6055 processing inside class.
6057 * src/insets/insetindex.h new struct Holder, consistent with other
6060 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
6061 citation dialog from main code and placed it in src/frontends/xforms.
6062 Dialog launched through signals instead of callbacks
6064 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
6066 * lyx.man: update the options description.
6068 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
6070 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
6071 handle neg values, set min width to 590, add doc about -display
6073 2000-07-05 Juergen Vigna <jug@sad.it>
6075 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
6076 calls to BufferView *.
6078 * src/insets/insettext.C (checkAndActivateInset): small fix non
6079 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
6081 * src/insets/insetcommand.C (Read): Fixed as insets should read till
6082 their \end_inset token!
6084 2000-07-04 edscott <edscott@imp.mx>
6086 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
6087 lib/lyxrc.example: added option \wheel_jump
6089 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
6091 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
6092 remove support for -width,-height,-xpos and -ypos.
6094 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
6096 * src/encoding.[Ch]: New files.
6098 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
6099 (text): Call to the underline() method only when needed.
6101 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
6103 * src/buffer.C (makeLaTeXFile): Compute automatically the input
6104 encoding(s) for the document.
6106 * src/bufferparams.C (BufferParams): Changed default value of
6109 * src/language.C (newLang): Removed.
6110 (items[]): Added encoding information for all defined languages.
6112 * src/lyx_gui.C (create_forms): Added "auto" option to the input
6113 encoding choice button.
6115 * src/lyxrc.h (font_norm_type): New member variable.
6116 (set_font_norm_type): New method.
6118 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
6119 paragraphs with different encodings.
6121 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
6122 (TransformChar): Changed to work correctly with Arabic points.
6123 (draw): Added support for drawing Arabic points.
6124 (draw): Removed code for drawing underbars (this is done by
6127 * src/support/textutils.h (IsPrintableNonspace): New function.
6129 * src/BufferView_pimpl.h: Added "using SigC::Object".
6130 * src/LyXView.h: ditto.
6132 * src/insets/insetinclude.h (include_label): Changed to mutable.
6134 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6136 * src/mathed/math_iter.h: remove empty destructor
6138 * src/mathed/math_cursor.h: remove empty destructor
6140 * src/insets/lyxinset.h: add THEOREM_CODE
6142 * src/insets/insettheorem.[Ch]: new files
6144 * src/insets/insetminipage.C: (InsertInset): remove
6146 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
6148 (InsertInset): remove
6150 * src/insets/insetlist.C: (InsertList): remove
6152 * src/insets/insetfootlike.[Ch]: new files
6154 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
6157 (InsertInset): ditto
6159 * src/insets/insetert.C: remove include Painter.h, reindent
6160 (InsertInset): move to header
6162 * src/insets/insetcollapsable.h: remove explicit from default
6163 contructor, remove empty destructor, add InsertInset
6165 * src/insets/insetcollapsable.C (InsertInset): new func
6167 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6169 * src/vspace.h: add explicit to constructor
6171 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6172 \textcompwordmark, please test this.
6174 * src/lyxrc.C: set ascii_linelen to 65 by default
6176 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6178 * src/commandtags.h: add LFUN_INSET_THEOREM
6180 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6181 (makeLinuxDocFile): remove _some_ of the nice logic
6182 (makeDocBookFile): ditto
6184 * src/Painter.[Ch]: (~Painter): removed
6186 * src/LyXAction.C (init): entry for insettheorem added
6188 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6190 (deplog): code to detect files generated by LaTeX, needs testing
6193 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6195 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6197 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6199 * src/LaTeX.C (deplog): Add a check for files that are going to be
6200 created by the first latex run, part of the project to remove the
6203 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6204 contents to the extension list.
6206 2000-07-04 Juergen Vigna <jug@sad.it>
6208 * src/text.C (NextBreakPoint): added support for needFullRow()
6210 * src/insets/lyxinset.h: added needFullRow()
6212 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6215 * src/insets/insettext.C: lots of changes for update!
6217 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6219 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6221 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6223 * src/insets/insetinclude.C (InsetInclude): fixed
6224 initialization of include_label.
6225 (unique_id): now returns a string.
6227 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6229 * src/LaTeXFeatures.h: new member IncludedFiles, for
6230 a map of key, included file name.
6232 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6233 with the included files for inclusion in SGML preamble,
6234 i. e., linuxdoc and docbook.
6237 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6238 nice (is the generated linuxdoc code to be exported?), that
6239 allows to remove column, and only_body that will be true for
6240 slave documents. Insets are allowed inside SGML font type.
6241 New handling of the SGML preamble for included files.
6242 (makeDocBookFile): the same for docbook.
6244 * src/insets/insetinclude.h:
6245 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6247 (DocBook): new export methods.
6249 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6250 and makeDocBookFile.
6252 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6253 formats to export with command line argument -x.
6255 2000-06-29 Juergen Vigna <jug@sad.it>
6257 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6258 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6260 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6261 region could already been cleared by an inset!
6263 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6265 * src/BufferView_pimpl.h: remove member variables lyx_focus and
6268 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
6270 (cursorToggle): remove special handling of lyx focus.
6272 2000-06-28 Juergen Vigna <jug@sad.it>
6274 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
6277 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6279 * src/insets/insetindex.C (Edit): add a callback when popup is
6282 * src/insets/insettext.C (LocalDispatch):
6283 * src/insets/insetmarginal.h:
6284 * src/insets/insetlist.h:
6285 * src/insets/insetfoot.h:
6286 * src/insets/insetfloat.h:
6287 * src/insets/insetert.h: add a missing std:: qualifier.
6289 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6291 * src/support/lyxsum.C (sum): '\0' teminate file read when using
6294 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
6296 * src/insets/insettext.C (Read): remove tmptok unused variable
6297 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
6298 (InsertInset): change for new InsetInset code
6300 * src/insets/insettext.h: add TEXT inline method
6302 * src/insets/insettext.C: remove TEXT macro
6304 * src/insets/insetmarginal.C (Write): new method
6305 (Latex): change output slightly
6307 * src/insets/insetfoot.C (Write): new method
6308 (Latex): change output slightly (don't use endl when no need)
6310 * src/insets/insetert.C (Write): new method
6312 * src/insets/insetcollapsable.h: make button_length, button_top_y
6313 and button_bottm_y protected.
6315 * src/insets/insetcollapsable.C (Write): simplify code by using
6316 tostr. Also do not output the float name, the children class
6317 should to that to get control over own arguments
6319 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
6320 src/insets/insetminipage.[Ch]:
6323 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6325 * src/lyxfunc.C (Dispatch): cases for new insets/commands
6327 * src/Makefile.am (lyx_SOURCES): add the new files
6329 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
6330 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
6331 * src/commandtags.h: ditto
6333 * src/LaTeXFeatures.h: add a std::set of used floattypes
6335 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
6337 * src/FloatList.[Ch] src/Floating.h: new files
6339 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
6341 * src/lyx_cb.C (TableApplyCB): ditto
6343 * src/text2.C: ditto
6344 * src/buffer.C (SimpleLinuxDocOnePar): ditto
6345 (parseSingleLyXformat2Token): ditto + add code for
6346 backwards compability for old float styles + add code for new insets
6348 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
6350 (InsertInset(size_type, Inset *, LyXFont)): new method
6351 (InsetChar(size_type, char)): changed to use the other InsetChar
6352 with a LyXFont(ALL_INHERIT).
6353 (InsetInset(size_type, Inset*)): changed to use InsetChar to
6354 insert the META_INSET.
6356 * sigc++/thread.cc (Privete<int>::operator int&): move definition
6358 * sigc++/thread.h (Threads): from here
6360 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
6361 definition out of line
6362 * sigc++/scope.h: from here
6364 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6366 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
6367 is specified (adapted from a patch from edscott <edscott@imp.mx>).
6369 * Makefile.am (bindist): new target.
6371 * INSTALL: add instructions for doing a binary distribution.
6373 * development/tools/README.bin.example: update a bit.
6375 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
6378 * lib/lyxrc.example: new lyxrc tag \set_color.
6380 * src/lyxfunc.C (Dispatch):
6381 * src/commandtags.h:
6382 * src/LyXAction.C: new lyxfunc "set-color".
6384 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
6385 and an x11name given as strings.
6387 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
6388 cache when a color is changed.
6390 2000-06-26 Juergen Vigna <jug@sad.it>
6392 * src/lyxrow.C (width): added this functions and variable.
6394 * src/insets/insetcite.C (create_form_citation_form): some Gravity
6397 * src/text.C (SetHeightOfRow): fixed calcualting of width.
6399 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6401 * images/undo_bw.xpm: new icon.
6402 * images/redo_bw.xpm: ditto.
6404 * configure.in (INSTALL_SCRIPT): change value to
6405 ${INSTALL} to avoid failures of install-script target.
6406 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
6408 * src/BufferView.h: add a magic "friend" declaration to please
6411 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
6413 * forms/cite.fd: modified to allow resizing without messing
6416 * src/insetcite.C: Uses code from cite.fd almost without
6418 User can now resize dialog in the x-direction.
6419 Resizing the dialog in the y-direction is prevented, as the
6420 code does this intelligently already.
6422 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6424 * INSTALL: remove obsolete entry in "problems" section.
6426 * lib/examples/sl_*.lyx: update of the slovenian examples.
6428 * src/support/FileInfo.[Ch] (getBlockSize): remove.
6430 2000-06-23 Juergen Vigna <jug@sad.it>
6432 * src/lyxtext.h: added a 'cleared' flag to draw() function.
6434 * src/buffer.C (resize): delete the LyXText of textinsets.
6436 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
6438 * src/insets/lyxinset.h: added another parameter 'cleared' to
6439 the draw() function.
6441 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
6442 unlocking inset in inset.
6444 2000-06-22 Juergen Vigna <jug@sad.it>
6446 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
6447 of insets and moved first to LyXText.
6449 * src/mathed/formulamacro.[Ch]:
6450 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
6452 2000-06-21 Juergen Vigna <jug@sad.it>
6454 * src/text.C (GetVisibleRow): look if I should clear the area or not
6455 using Inset::doClearArea() function.
6457 * src/insets/lyxinset.h: added doClearArea() function and
6458 modified draw(Painter &, ...) to draw(BufferView *, ...)
6460 * src/text2.C (UpdateInset): return bool insted of int
6462 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
6464 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
6465 combox in the character popup
6467 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
6468 BufferParams const & params
6470 2000-06-20 Juergen Vigna <jug@sad.it>
6472 * src/insets/insettext.C (SetParagraphData): set insetowner on
6475 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6477 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
6478 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
6480 (form_main_): remove
6482 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
6483 (create_form_form_main): remove FD_form_main stuff, connect to
6484 autosave_timeout signal
6486 * src/LyXView.[Ch] (getMainForm): remove
6487 (UpdateTimerCB): remove
6488 * src/BufferView_pimpl.h: inherit from SigC::Object
6490 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
6491 signal instead of callback
6493 * src/BufferView.[Ch] (cursorToggleCB): remove
6495 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6497 * src/BufferView_pimpl.C: changes because of the one below
6499 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
6500 instead of storing a pointer to a LyXText.
6502 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
6504 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
6506 * src/lyxparagraph.h
6508 * src/paragraph.C: Changed fontlist to a sorted vector.
6510 2000-06-19 Juergen Vigna <jug@sad.it>
6512 * src/BufferView.h: added screen() function.
6514 * src/insets/insettext.C (LocalDispatch): some selection code
6517 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
6519 * src/insets/insettext.C (SetParagraphData):
6521 (InsetText): fixes for multiple paragraphs.
6523 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
6525 * development/lyx.spec.in: Call configure with ``--without-warnings''
6526 to work around a bug with the Makefiles when doing ``make lyxrpm''.
6527 This should be fine, however, since we generally don't want to be
6528 verbose when making an RPM.
6530 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
6532 * lib/scripts/fig2pstex.py: New file
6534 2000-06-16 Juergen Vigna <jug@sad.it>
6536 * src/insets/insettabular.C (UpdateLocal):
6537 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
6538 (LocalDispatch): Changed all functions to use LyXText.
6540 2000-06-15 Juergen Vigna <jug@sad.it>
6542 * src/text.C (SetHeightOfRow): call inset::update before requesting
6545 * src/insets/insettext.C (update):
6546 * src/insets/insettabular.C (update): added implementation
6548 * src/insets/lyxinset.h: added update function
6550 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6552 * src/text.C (SelectNextWord): protect against null pointers with
6553 old-style string streams. (fix from Paul Theo Gonciari
6556 * src/cite.[Ch]: remove erroneous files.
6558 * lib/configure.m4: update the list of created directories.
6560 * src/lyxrow.C: include <config.h>
6561 * src/lyxcursor.C: ditto.
6563 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6565 * lib/examples/decimal.lyx: new example file from Mike.
6567 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
6568 to find template definitions (from Dekel)
6570 * src/frontends/.cvsignore: add a few things.
6572 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
6574 * src/Timeout.C (TimeOut): remove default argument.
6576 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
6579 * src/insets/ExternalTemplate.C: add a "using" directive.
6581 * src/lyx_main.h: remove the act_ struct, which seems unused
6584 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6586 * LyX Developers Meeting: All files changed, due to random C++ (by
6587 coincidence) code generator script.
6589 - external inset (cool!)
6590 - initial online editing of preferences
6591 - insettabular breaks insettext(s contents)
6593 - some DocBook fixes
6594 - example files update
6595 - other cool stuff, create a diff and look for yourself.
6597 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
6599 * src/insets/insettext.C (computeTextRows): if the maxWidth is
6600 -1 this is a non-line-breaking textinset.
6602 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
6603 if there is no width set.
6605 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6607 * Lots of files: Merged the dialogbase branch.
6609 2000-06-09 Allan Rae <rae@lyx.org>
6611 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
6612 and the Dispatch methods that used it.
6614 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
6615 access to functions formerly kept in Dispatch.
6617 2000-05-19 Allan Rae <rae@lyx.org>
6619 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
6620 made to_page and count_copies integers again. from_page remains a
6621 string however because I want to allow entry of a print range like
6622 "1,4,22-25" using this field.
6624 * src/LyXAction.C: added action info and commands for buffer-print-xtl
6625 and printer-params-get. These aren't useful from the minibuffer but
6626 could be used by a script/LyXServer app provided it passes a suitable
6627 auto_mem_buffer. I guess I should take a look at how the LyXServer
6628 works and make it support xtl buffers.
6630 * sigc++/: updated to libsigc++-1.0.1
6632 * src/xtl/: updated to xtl-1.3.pl.11
6634 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
6635 those changes done to the files in src/ are actually recreated when
6636 they get regenerated. Please don't ever accept a patch that changes a
6637 dialog unless that patch includes the changes to the corresponding *.fd
6640 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
6641 stringOnlyContains, renamed it and generalised it.
6643 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
6644 branch. Removed the remaining old form_print code.
6646 2000-04-26 Allan Rae <rae@lyx.org>
6648 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
6649 trap I was trying to fix with the ID: fields in src/xtl/ :-)
6651 2000-04-25 Allan Rae <rae@lyx.org>
6653 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
6654 against a base of xtl-1.3.pl.4
6656 * development/tools/lxtl.sh: fixed a couple of silly typos and now
6657 filter the Id: entries so they still show the xtl version number
6660 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
6661 into the src/xtl code. Patch still pending with José (XTL)
6663 2000-04-24 Allan Rae <rae@lyx.org>
6665 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
6666 both more generic and much safer. Use the new template functions.
6667 * src/buffer.[Ch] (Dispatch): ditto.
6669 * src/frontends/xforms/FormPrint.C (update): Use new template functions
6670 and mem buffer more intelligently. Also a little general cleanup.
6673 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
6674 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
6675 * src/xtl/Makefile.am: ditto.
6676 * src/xtl/.cvsignore: ditto.
6677 * src/Makefile.am: ditto.
6679 * src/PrinterParams.h: Removed the macros member functions. Added a
6680 testInvariant member function. A bit of tidying up and commenting.
6681 Included Angus's idea for fixing operation with egcs-1.1.2.
6683 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
6684 cool expansion of XTL's mem_buffer to support automatic memory
6685 management within the buffer itself. Removed the various macros and
6686 replaced them with template functions that use either auto_mem_buffer
6687 or mem_buffer depending on a #define. The mem_buffer support will
6688 disappear as soon as the auto_mem_buffer is confirmed to be good on
6689 other platforms/compilers. That is, it's there so you've got something
6692 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
6693 effectively forked XTL. However I expect José will include my code
6694 into the next major release. Also fixed a memory leak.
6695 * src/xtl/text.h: ditto.
6696 * src/xtl/xdr.h: ditto.
6697 * src/xtl/giop.h: ditto.
6699 2000-04-16 Allan Rae <rae@lyx.org>
6701 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
6702 by autogen.sh and removed by maintainer-clean anyway.
6703 * .cvsignore, sigc++/.cvsignore: Support the above.
6705 * sigc++/.cvsignore: Forgot that retbind.h was generated.
6707 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
6709 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
6710 macros, renamed static callback-target member functions to suit new
6711 scheme and made them public.
6712 * src/frontends/xforms/forms/form_print.fd: ditto.
6713 * src/frontends/xforms/forms/form_copyright.fd: ditto.
6715 * src/support/lxtl.h: small cleanup to use typedef instead of #define
6718 * src/xtl/: New directory containing a minimal distribution of XTL.
6719 This is XTL-1.3.pl.4.
6721 * development/tools/lxtl.sh: A script to generate the above mini-dist.
6723 2000-04-15 Allan Rae <rae@lyx.org>
6725 * development/tools/makeLyXsigc.sh: Remove the library version numbers
6727 * sigc++/: Updated to libsigc++-1.0.0
6729 2000-04-14 Allan Rae <rae@lyx.org>
6731 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
6732 use the generic ones in future. I'll modify my conversion script.
6734 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
6736 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
6737 (CloseAllBufferRelatedDialogs): Renamed.
6738 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
6740 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
6741 of the generic ones. These are the same ones my conversion script
6744 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
6745 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
6746 * src/buffer.C (Dispatch): ditto
6748 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
6749 functions for updating and hiding buffer dependent dialogs.
6750 * src/BufferView.C (buffer): ditto
6751 * src/buffer.C (setReadonly): ditto
6752 * src/lyxfunc.C (CloseBuffer): ditto
6754 * src/buffer.h: Take setReadonly() out of line so I don't have to include
6755 Dialogs.h, and hence all the SigC stuff, into every file that includes
6756 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
6758 * src/BufferView2.C: reduce the number of headers included by buffer.h
6760 2000-04-11 Allan Rae <rae@lyx.org>
6762 * src/frontends/xforms/xform_macros.h: A small collection of macros
6763 for building C callbacks.
6765 * src/frontends/xforms/Makefile.am: Added above file.
6767 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
6768 scheme again. This time it should work for JMarc. If this is
6769 successful I'll revise my conversion script to automate some of this.
6770 The static member functions in the class also have to be public for
6771 this scheme will work. If the scheme works (it's almost identical to
6772 the way BufferView::cursorToggleCB is handled so it should work) then
6773 FormCopyright and FormPrint will be ready for inclusion into the main
6774 trunk immediately after 1.1.5 is released -- provided we're prepared
6775 for complaints about lame compilers not handling XTL.
6777 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
6779 2000-04-07 Allan Rae <rae@lyx.org>
6781 * config/lyxinclude.m4: A bit more tidying up (Angus)
6783 * src/LString.h: JMarc's <string> header fix
6785 * src/PrinterParams.h: Used string for most data to remove some
6786 ugly code in the Print dialog and avoid even uglier code when
6787 appending the ints to a string for output.
6789 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
6790 and moved "default:" back to the end of switch statement. Cleaned
6791 up the printing so it uses the right function calls and so the
6792 "print to file" option actually puts the file in the right directory.
6794 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
6796 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
6797 and Ok+Apply button control into a separate method: input (Angus).
6798 (input) Cleaned it up and improved it to be very thorough now.
6799 (All CB) static_cast used instead of C style cast (Angus). This will
6800 probably change again once we've worked out how to keep gcc-2.8.1 happy
6801 with real C callbacks.
6802 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
6803 ignore some of the bool settings and has random numbers instead. Needs
6804 some more investigation. Added other input length checks and checking
6805 of file and printer names.
6807 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
6808 would link (Angus). Seems the old code doesn't compile with the pragma
6809 statement either. Separated callback entries from internal methods.
6811 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
6813 2000-03-17 Allan Rae <rae@lyx.org>
6815 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
6816 need it? Maybe it could go in Dialogs instead? I could make it a
6817 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
6818 values to get the bool return value.
6819 (Dispatch): New overloaded method for xtl support.
6821 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
6822 extern "C" callback instead of static member functions. Hopefully,
6823 JMarc will be able to compile this. I haven't changed
6824 forms/form_copyright.fd yet. Breaking one of my own rules already.
6826 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
6827 because they aren't useful from the minibuffer. Maybe a LyXServer
6828 might want a help message though?
6830 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
6832 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
6833 xtl which needs both rtti and exceptions.
6835 * src/support/Makefile.am:
6836 * src/support/lxtl.h: New file. Some helper macros for using XTL.
6838 * src/frontends/xforms/input_validators.[ch]: input filters and
6839 validators. These conrol what keys are valid in input boxes.
6840 Use them and write some more. Much better idea than waiting till
6841 after the user has pressed Ok to say that the input fields don't make
6844 * src/frontends/xforms/Makefile.am:
6845 * src/frontends/xforms/forms/form_print.fd:
6846 * src/frontends/xforms/forms/makefile:
6847 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
6848 new scheme. Still have to make sure I haven't missed anything from
6849 the current implementation.
6851 * src/Makefile.am, src/PrinterParams.h: New data store.
6853 * other files: Added a couple of copyright notices.
6855 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6857 * src/insets/insetbib.h: move Holder struct in public space.
6859 * src/frontends/include/DialogBase.h: use SigC:: only when
6860 SIGC_CXX_NAMESPACES is defined.
6861 * src/frontends/include/Dialogs.h: ditto.
6863 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
6865 * src/frontends/xforms/FormCopyright.[Ch]: do not
6866 mention SigC:: explicitely.
6868 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6870 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
6871 deals with testing KDE in main configure.in
6872 * configure.in: ditto.
6874 2000-02-22 Allan Rae <rae@lyx.org>
6876 * Lots of files: Merged from HEAD
6878 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
6879 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
6881 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
6883 * sigc++/: new minidist.
6885 2000-02-14 Allan Rae <rae@lyx.org>
6887 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
6889 2000-02-08 Juergen Vigna <jug@sad.it>
6891 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
6892 file for the buildin GUI builder of KDevelop of the copyright-dialog.
6894 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
6895 for this port and so it is much easier for other people to port
6896 dialogs in a common development environment.
6898 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
6899 the QT/KDE implementation.
6901 * src/frontends/kde/Dialogs.C:
6902 * src/frontends/kde/FormCopyright.C:
6903 * src/frontends/kde/FormCopyright.h:
6904 * src/frontends/kde/Makefile.am:
6905 * src/frontends/kde/formcopyrightdialog.C:
6906 * src/frontends/kde/formcopyrightdialog.h:
6907 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
6908 for the kde support of the Copyright-Dialog.
6910 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
6911 subdir-substitution instead of hardcoded 'xforms' as we now have also
6914 * src/frontends/include/DialogBase.h (Object): just commented the
6915 label after #endif (nasty warning and I don't like warnings ;)
6917 * src/main.C (main): added KApplication initialization if using
6920 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
6921 For now only the KDE event-loop is added if frontend==kde.
6923 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
6925 * configure.in: added support for the --with-frontend[=value] option
6927 * autogen.sh: added kde.m4 file to list of config-files
6929 * acconfig.h: added define for KDEGUI-support
6931 * config/kde.m4: added configuration functions for KDE-port
6933 * config/lyxinclude.m4: added --with-frontend[=value] option with
6934 support for xforms and KDE.
6936 2000-02-08 Allan Rae <rae@lyx.org>
6938 * all Makefile.am: Fixed up so the make targets dist, distclean,
6939 install and uninstall all work even if builddir != srcdir. Still
6940 have a new sigc++ minidist update to come.
6942 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
6944 2000-02-01 Allan Rae <rae@lyx.org>
6946 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
6947 Many mods to get builddir != srcdir working.
6949 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
6950 for building on NT and so we can do the builddir != srcdir stuff.
6952 2000-01-30 Allan Rae <rae@lyx.org>
6954 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
6955 This will stay in "rae" branch. We probably don't really need it in
6956 the main trunk as anyone who wants to help programming it should get
6957 a full library installed also. So they can check both included and
6958 system supplied library compilation.
6960 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
6961 Added a 'mini' distribution of libsigc++. If you feel the urge to
6962 change something in these directories - Resist it. If you can't
6963 resist the urge then you should modify the following script and rebuild
6964 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
6965 all happen. Still uses a hacked version of libsigc++'s configure.in.
6966 I'm quite happy with the results. I'm not sure the extra work to turn
6967 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
6968 worth the trouble and would probably lead to extra maintenance
6970 I haven't tested the following important make targets: install, dist.
6971 Not ready for prime time but very close. Maybe 1.1.5.
6973 * development/tools/makeLyXsigc.sh: A shell script to automatically
6974 generate our mini-dist of libsigc++. It can only be used with a CVS
6975 checkout of libsigc++ not a tarball distribution. It's well commented.
6976 This will end up as part of the libsigc++ distribution so other apps
6977 can easily have an included mini-dist. If someone makes mods to the
6978 sigc++ subpackage without modifying this script to generate those
6979 changes I'll be very upset!
6981 * src/frontends/: Started the gui/system indep structure.
6983 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
6984 to access the gui-indep dialogs are in this class. Much improved
6985 design compared to previous revision. Lars, please refrain from
6986 moving this header into src/ like you did with Popups.h last time.
6988 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
6990 * src/frontends/xforms/: Started the gui-indep system with a single
6991 dialog: FormCopyright. Initial testing of use of libsigc++ was very
6994 * src/frontends/xforms/forms: Repository for the xforms .fd files.
6995 Here you'll find a very useful makefile and automated fdfix.sh that
6996 makes updating dailogs a no-brainer -- provided you follow the rules
6997 set out in the README. I'm thinking about adding another script to
6998 automatically generate skeleton code for a new dialog given just the
7001 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
7002 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
7003 Made FormCopyright gui-indep and added a lyxfunc to get to it.
7005 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7007 * src/support/LSubstring.C (operator): simplify
7009 * src/lyxtext.h: removed bparams, use buffer_->params instead
7011 * src/lyxrow.h: make Row a real class, move all variables to
7012 private and use accessors.
7014 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
7016 (isRightToLeftPar): ditto
7017 (ChangeLanguage): ditto
7018 (isMultiLingual): ditto
7021 (SimpleTeXOnePar): ditto
7022 (TeXEnvironment): ditto
7023 (GetEndLabel): ditto
7025 (SetOnlyLayout): ditto
7026 (BreakParagraph): ditto
7027 (BreakParagraphConservative): ditto
7028 (GetFontSettings): ditto
7030 (CopyIntoMinibuffer): ditto
7031 (CutIntoMinibuffer): ditto
7032 (PasteParagraph): ditto
7033 (SetPExtraType): ditto
7034 (UnsetPExtraType): ditto
7035 (DocBookContTableRows): ditto
7036 (SimpleDocBookOneTablePar): ditto
7038 (TeXFootnote): ditto
7039 (SimpleTeXOneTablePar): ditto
7040 (TeXContTableRows): ditto
7041 (SimpleTeXSpecialChars): ditto
7044 * src/lyxcursor.h: make LyXCursor a real class, move all variables
7045 to private and use accessors.
7047 * src/lyx_cb.C: remove char updatetimer, and all code that uses
7048 this, we did not use it anymore and has not been for ages. Just a
7049 waste of cpu cycles.
7051 * src/language.h: make Language a real class, move all variables
7052 to private and use accessors.
7054 * src/BufferView_pimpl.C (Pimpl): use new timer code.
7055 (create_view): remove
7056 (update): some changes for new timer
7057 (cursorToggle): use new timer
7058 (beforeChange): change for new timer
7060 * src/BufferView.h (cursorToggleCB): removed last paramter because
7063 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
7064 (cursorToggleCB): change because of new timer code
7066 * lib/CREDITS: updated own mailaddress
7068 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7070 * src/support/filetools.C (PutEnv): fix the code in case neither
7071 putenv() nor setenv() have been found.
7073 * INSTALL: mention the install-strip Makefile target.
7075 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
7076 read-only documents.
7078 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7080 * lib/reLyX/configure.in (VERSION): avoid using a previously
7081 generated reLyX wrapper to find out $prefix.
7083 * lib/examples/eu_adibide_lyx-atua.lyx:
7084 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
7085 translation of the Tutorial (Dooteo)
7087 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
7089 * forms/cite.fd: new citation dialog
7091 * src/insetcite.[Ch]: the new citation dialog is moved into
7094 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
7097 * src/insets/insetcommand.h: data members made private.
7099 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7101 * LyX 1.1.5 released
7103 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7105 * src/version.h (LYX_RELEASE): to 1.1.5
7107 * src/spellchecker.C (RunSpellChecker): return false if the
7108 spellchecker dies upon creation.
7110 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7112 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
7113 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
7117 * lib/CREDITS: update entry for Martin Vermeer.
7119 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
7121 * src/text.C (draw): Draw foreign language bars at the bottom of
7122 the row instead of at the baseline.
7124 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
7126 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7128 * lib/bind/de_menus.bind: updated
7130 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7132 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
7134 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7136 * src/menus.C (Limit_string_length): New function
7137 (ShowTocMenu): Limit the number of items/length of items in the
7140 * src/paragraph.C (String): Correct result for a paragraph inside
7143 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7145 * src/bufferlist.C (close): test of buf->getuser() == NULL
7147 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
7149 * src/BufferView2.C (removeAutoInsets): Fix a bug:
7150 Do not call to SetCursor when the paragraph is a closed footnote!
7152 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
7154 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
7157 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7159 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7162 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7163 reference popup, that activates the reference-back action
7165 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7167 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7168 the menus. Also fixed a bug.
7170 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7171 the math panels when switching buffers (unless new buffer is readonly).
7173 * src/BufferView.C (NoSavedPositions)
7174 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7176 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7178 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7179 less of dvi dirty or not.
7181 * src/trans_mgr.[Ch] (insert): change first parameter to string
7184 * src/chset.[Ch] (encodeString): add const to first parameter
7186 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7188 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7192 * src/LaTeX.C (deplog): better searching for dependency files in
7193 the latex log. Uses now regexps.
7195 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7196 instead of the box hack or \hfill.
7198 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7200 * src/lyxfunc.C (doImportHelper): do not create the file before
7201 doing the actual import.
7202 (doImportASCIIasLines): create a new file before doing the insert.
7203 (doImportASCIIasParagraphs): ditto.
7205 * lib/lyxrc.example: remove mention of non-existing commands
7207 * lyx.man: remove mention of color-related switches.
7209 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7211 * src/lyx_gui.C: remove all the color-related ressources, which
7212 are not used anymore.
7214 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7217 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7219 * src/lyxrc.C (read): Add a missing break in the switch
7221 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7223 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7225 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7228 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7230 * src/text.C (draw): draw bars under foreign language words.
7232 * src/LColor.[Ch]: add LColor::language
7234 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7236 * src/lyxcursor.h (boundary): New member variable
7238 * src/text.C (IsBoundary): New methods
7240 * src/text.C: Use the above for currect cursor movement when there
7241 is both RTL & LTR text.
7243 * src/text2.C: ditto
7245 * src/bufferview_funcs.C (ToggleAndShow): ditto
7247 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7249 * src/text.C (DeleteLineForward): set selection to true to avoid
7250 that DeleteEmptyParagraphMechanism does some magic. This is how it
7251 is done in all other functions, and seems reasonable.
7252 (DeleteWordForward): do not jump over non-word stuff, since
7253 CursorRightOneWord() already does it.
7255 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7256 DeleteWordBackward, since they seem safe to me (since selection is
7257 set to "true") DeleteEmptyParagraphMechanism does nothing.
7259 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7261 * src/lyx_main.C (easyParse): simplify the code by factoring the
7262 part that removes parameters from the command line.
7263 (LyX): check wether wrong command line options have been given.
7265 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7267 * src/lyx_main.C : add support for specifying user LyX
7268 directory via command line option -userdir.
7270 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
7272 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
7273 the number of items per popup.
7274 (Add_to_refs_menu): Ditto.
7276 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7278 * src/lyxparagraph.h: renamed ClearParagraph() to
7279 StripLeadingSpaces() and moved it to paragraph.C. We pass the
7280 textclass as parameter, and do nothing if free_spacing is
7281 true. This fixes part of the line-delete-forward problems.
7283 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
7284 (pasteSelection): ditto.
7285 (SwitchLayoutsBetweenClasses): more translatable strings.
7287 * src/text2.C (CutSelection): use StripLeadingSpaces.
7288 (PasteSelection): ditto.
7289 (DeleteEmptyParagraphMechanism): ditto.
7291 2000-05-26 Juergen Vigna <jug@sad.it>
7293 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
7294 is not needed in tabular insets.
7296 * src/insets/insettabular.C (TabularFeatures): added missing features.
7298 * src/tabular.C (DeleteColumn):
7300 (AppendRow): implemented this functions
7301 (cellsturct::operator=): clone the inset too;
7303 2000-05-23 Juergen Vigna <jug@sad.it>
7305 * src/insets/insettabular.C (LocalDispatch): better selection support
7306 when having multicolumn-cells.
7308 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7310 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
7312 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7314 * src/ColorHandler.C (getGCForeground): put more test into _()
7316 * lib/examples/eu_splash.lyx: new file (Basque translation) from
7319 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
7322 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
7324 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
7325 there are no labels, or when buffer is readonly.
7327 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
7328 there are no labels, buffer is SGML, or when buffer is readonly.
7330 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7332 * src/LColor.C (LColor): change a couple of grey40 to grey60
7333 (LColor): rewore initalization to make compiles go some magnitude
7335 (getGUIName): don't use gettext until we need the string.
7337 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
7339 * src/Bullet.[Ch]: Fixed a small bug.
7341 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
7343 * src/paragraph.C (String): Several fixes/improvements
7345 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
7347 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7349 * src/paragraph.C (String): give more correct output.
7351 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
7353 * src/lyxfont.C (stateText) Do not output the language if it is
7354 eqaul to the language of the document.
7356 * src/paragraph.C (TeXOnePar): Do not put language switch commands
7357 between two paragraphs with the same language.
7359 * src/paragraph.C (getParLanguage) Return a correct answer for an
7360 empty dummy paragraph.
7362 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
7365 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
7368 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
7369 the menus/popup, if requested fonts are unavailable.
7371 2000-05-22 Juergen Vigna <jug@sad.it>
7373 * src/insets/insettabular.C (LocalDispatch): added some more cursor
7374 movement support (Up/Down/Tab/Shift-Tab).
7375 (LocalDispatch): added also preliminari cursor-selection.
7377 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
7379 * src/paragraph.C (PasteParagraph): Hopefully now right!
7381 2000-05-22 Garst R. Reese <reese@isn.net>
7383 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
7384 of list, change all references to Environment to Command
7385 * tex/hollywood.cls : rewrite environments as commands, add
7386 \uppercase to interiorshot and exteriorshot to force uppecase.
7387 * tex/broadway.cls : rewrite environments as commands. Tweak
7390 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7392 * src/menus.C (Add_to_toc_menu): fix the code which limits the
7393 size of items: use a constant intead of the hardcoded 40, and more
7394 importantly do not remove the %m and %x tags added at the end.
7395 (Add_to_refs_menu): use vector::size_type instead of
7396 unsigned int as basic types for the variables. _Please_ do not
7397 assume that size_t is equal to unsigned int. On an alpha, this is
7398 unsigned long, which is _not_ the same.
7400 * src/language.C (initL): remove language "hungarian", since it
7401 seems that "magyar" is better.
7403 2000-05-22 Juergen Vigna <jug@sad.it>
7405 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
7407 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
7410 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
7411 next was deleted but not set to 0.
7413 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7415 * src/language.C (initL): change the initialization of languages
7416 so that compiles goes _fast_.
7418 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
7421 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
7423 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7427 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7429 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
7431 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
7435 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
7438 * src/insets/insetlo*.[Ch]: Made editable
7440 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7442 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
7443 the current selection.
7445 * src/BufferView_pimpl.C (stuffClipboard): new method
7447 * src/BufferView.C (stuffClipboard): new method
7449 * src/paragraph.C (String): new method
7451 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
7452 LColor::ignore when lyxname is not found.
7454 * src/BufferView.C (pasteSelection): new method
7456 * src/BufferView_pimpl.C (pasteSelection): new method
7458 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
7460 * src/WorkArea.C (request_clipboard_cb): new static function
7461 (getClipboard): new method
7462 (putClipboard): new method
7464 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7466 * LyX 1.1.5pre2 released
7468 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7470 * src/vspace.C (operator=): removed
7471 (operator=): removed
7473 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
7475 * src/layout.C (NumberOfClass): manually set the type in make_pair
7476 (NumberOfLayout): ditto
7478 * src/language.C: use the Language constructor for ignore_lang
7480 * src/language.h: add constructors to struct Language
7482 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
7484 * src/text2.C (SetCursorIntern): comment out #warning
7486 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
7488 * src/mathed/math_iter.h: initialize sx and sw to 0
7490 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7492 * forms/lyx.fd: Redesign of form_ref
7494 * src/LaTeXFeatures.[Ch]
7498 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
7501 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
7502 and Buffer::inset_iterator.
7504 * src/menus.C: Added new menus: TOC and Refs.
7506 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
7508 * src/buffer.C (getTocList): New method.
7510 * src/BufferView2.C (ChangeRefs): New method.
7512 * src/buffer.C (getLabelList): New method. It replaces the old
7513 getReferenceList. The return type is vector<string> instead of
7516 * src/insets/insetinclude.C (getLabelList): New method. Replaces
7517 the old getLabel() and GetNumberOfLabels() methods.
7518 * src/insets/insetlabel.C (getLabelList): ditto
7519 * src/mathed/formula.C (getLabelList): ditto
7521 * src/paragraph.C (String): New method.
7523 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
7524 Uses the new getTocList() method.
7525 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
7526 which automatically updates the contents of the browser.
7527 (RefUpdateCB): Use the new getLabelList method.
7529 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
7531 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
7533 * src/spellchecker.C: Added using std::reverse;
7535 2000-05-19 Juergen Vigna <jug@sad.it>
7537 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
7539 * src/insets/insettext.C (computeTextRows): small fix for display of
7540 1 character after a newline.
7542 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
7545 2000-05-18 Juergen Vigna <jug@sad.it>
7547 * src/insets/insettabular.C (TabularFeatures): fixed update of display
7548 when changing width of column.
7550 * src/tabular.C (set_row_column_number_info): setting of
7551 autobreak rows if necessary.
7553 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7555 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
7557 * src/vc-backend.*: renamed stat() to status() and vcstat to
7558 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
7559 compilation broke. The new name seems more relevant, anyway.
7561 2000-05-17 Juergen Vigna <jug@sad.it>
7563 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
7564 which was wrong if the removing caused removing of rows!
7566 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
7567 (pushToken): new function.
7569 * src/text2.C (CutSelection): fix problem discovered with purify
7571 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7573 * src/debug.C (showTags): enlarge the first column, now that we
7574 have 6-digits debug codes.
7576 * lib/layouts/hollywood.layout:
7577 * lib/tex/hollywood.cls:
7578 * lib/tex/brodway.cls:
7579 * lib/layouts/brodway.layout: more commands and fewer
7580 environments. Preambles moved in the .cls files. Broadway now has
7581 more options on scene numbering and less whitespace (from Garst)
7583 * src/insets/insetbib.C (getKeys): make sure that we are in the
7584 document directory, in case the bib file is there.
7586 * src/insets/insetbib.C (Latex): revert bogus change.
7588 2000-05-16 Juergen Vigna <jug@sad.it>
7590 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
7591 the TabularLayout on cursor move.
7593 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
7595 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
7598 (draw): fixed cursor position and drawing so that the cursor is
7599 visible when before the tabular-inset.
7601 * src/insets/insettext.C (init): drawLockedFrame was not initialized
7602 when creating from old insettext.
7604 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
7606 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7608 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
7609 * lib/tex/brodway.cls: ditto
7611 * lib/layouts/brodway.layout: change alignment of parenthical
7614 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7616 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
7617 versions 0.88 and 0.89 are supported.
7619 2000-05-15 Juergen Vigna <jug@sad.it>
7621 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
7624 * src/insets/insettext.C (computeTextRows): redone completely this
7625 function in a much cleaner way, because of problems when having a
7627 (draw): added a frame border when the inset is locked.
7628 (SetDrawLockedFrame): this sets if we draw the border or not.
7629 (SetFrameColor): this sets the frame color (default=insetframe).
7631 * src/insets/lyxinset.h: added x() and y() functions which return
7632 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
7633 function which is needed to see if we have a locking inset of some
7634 type in this inset (needed for now in insettabular).
7636 * src/vspace.C (inPixels): the same function also without a BufferView
7637 parameter as so it is easier to use it in some ocasions.
7639 * src/lyxfunc.C: changed all places where insertInset was used so
7640 that now if it couldn't be inserted it is deleted!
7642 * src/TabularLayout.C:
7643 * src/TableLayout.C: added support for new tabular-inset!
7645 * src/BufferView2.C (insertInset): this now returns a bool if the
7646 inset was really inserted!!!
7648 * src/tabular.C (GetLastCellInRow):
7649 (GetFirstCellInRow): new helper functions.
7650 (Latex): implemented for new tabular class.
7654 (TeXTopHLine): new Latex() helper functions.
7656 2000-05-12 Juergen Vigna <jug@sad.it>
7658 * src/mathed/formulamacro.C (Read):
7659 * src/mathed/formula.C (Read): read also the \end_inset here!
7661 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7663 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
7664 crush when saving formulae with unbalanced parenthesis.
7666 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
7668 * src/layout.C: Add new keyword "endlabelstring" to layout file
7670 * src/text.C (GetVisibleRow): Draw endlabel string.
7672 * lib/layouts/broadway.layout
7673 * lib/layouts/hollywood.layout: Added endlabel for the
7674 Parenthetical layout.
7676 * lib/layouts/heb-article.layout: Do not use slanted font shape
7677 for Theorem like environments.
7679 * src/buffer.C (makeLaTeXFile): Always add "american" to
7680 the UsedLanguages list if document language is RTL.
7682 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7684 * add addendum to README.OS2 and small patch (from SMiyata)
7686 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7688 * many files: correct the calls to ChangeExtension().
7690 * src/support/filetools.C (ChangeExtension): remove the no_path
7691 argument, which does not belong there. Use OnlyFileName() instead.
7693 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
7694 files when LaTeXing a non-nice latex file.
7696 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
7697 a chain of "if". Return false when deadkeys are not handled.
7699 * src/lyx_main.C (LyX): adapted the code for default bindings.
7701 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
7702 bindings for basic functionality (except deadkeys).
7703 (deadKeyBindings): new method. Performs the bindings of deadkeys.
7705 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
7706 several methods: handle override_x_deadkeys.
7708 * src/lyxrc.h: remove the "bindings" map, which did not make much
7709 sense anyway. New variable override_x_deadkeys, defaulting to "true".
7711 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7713 * src/lyxfont.C (stateText): use a saner method to determine
7714 whether the font is "default". Seems to fix the crash with DEC
7717 * src/Bullet.[Ch] (Bullet): remove const on parameters.
7719 2000-05-08 Juergen Vigna <jug@sad.it>
7721 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
7722 TabularLayoutMenu with mouse-button-3
7723 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
7725 * src/TabularLayout.C: added this file for having a Layout for
7728 2000-05-05 Juergen Vigna <jug@sad.it>
7730 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
7731 recalculating inset-widths.
7732 (TabularFeatures): activated this function so that I can change
7733 tabular-features via menu.
7735 * src/menus.C (ShowEditMenu): inserted support for insettabular so
7736 that I can test some functions with the Table menu.
7738 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7740 * src/lyxfont.C (stateText): guard against stupid c++libs.
7742 * src/tabular.C: add using std::vector
7743 some whitespace changes, + removed som autogenerated code.
7745 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
7747 2000-05-05 Juergen Vigna <jug@sad.it>
7749 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
7750 row, columns and cellstructures.
7752 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7754 * lib/lyxrc.example: remove obsolete entries.
7756 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
7757 reading of protected_separator for free_spacing.
7759 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7761 * src/text.C (draw): do not display an exclamation mark in the
7762 margin for margin notes. This is confusing, ugly and
7765 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
7766 AMS math' is checked.
7768 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
7769 name to see whether including the amsmath package is needed.
7771 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
7773 * src/paragraph.C (validate): Compute UsedLanguages correctly
7774 (don't insert the american language if it doesn't appear in the
7777 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
7778 The argument of \thanks{} command is considered moving argument
7780 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
7783 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
7785 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
7786 for appendix/minipage/depth. The lines can be now both in the footnote
7787 frame, and outside the frame.
7789 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
7792 2000-05-05 Juergen Vigna <jug@sad.it>
7794 * src/table.[Ch]: removed the inset and buffer stuff as this is now
7795 neede only in tabular.[Ch].
7797 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7799 * src/insets/insetspecialchar.C (Read): allow command == '~' for
7801 (Write): write '~' for PROTECTED_SEPARATOR
7803 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7805 * src/lyxparagraph.h: add a friend struct matchIT after the struct
7808 * src/mathed/formula.C (drawStr): rename size to siz.
7810 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
7811 possibly fix a bug by not changing the pflags = flags to piflags =
7814 2000-05-05 Juergen Vigna <jug@sad.it>
7816 * src/insets/insetbib.C: moved using directive
7818 * src/ImportNoweb.C: small fix for being able to compile (missing
7821 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7823 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
7824 to use clear, since we don't depend on this in the code. Add test
7827 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7829 * (various *.C files): add using std::foo directives to please dec
7832 * replace calls to string::clear() to string::erase() (Angus)
7834 * src/cheaders/cmath: modified to provide std::abs.
7836 2000-05-04 Juergen Vigna <jug@sad.it>
7838 * src/insets/insettext.C: Prepared all for inserting of multiple
7839 paragraphs. Still display stuff to do (alignment and other things),
7840 but I would like to use LyXText to do this when we cleaned out the
7841 table-support stuff.
7843 * src/insets/insettabular.C: Changed lot of stuff and added lots
7844 of functionality still a lot to do.
7846 * src/tabular.C: Various functions changed name and moved to be
7847 const functions. Added new Read and Write functions and changed
7848 lots of things so it works good with tabular-insets (also removed
7849 some stuff which is not needed anymore * hacks *).
7851 * src/lyxcursor.h: added operators == and != which just look if
7852 par and pos are (not) equal.
7854 * src/buffer.C (latexParagraphs): inserted this function to latex
7855 all paragraphs form par to endpar as then I can use this too for
7858 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
7859 so that I can call this to from text insets with their own cursor.
7861 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
7862 output off all paragraphs (because of the fix below)!
7864 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
7865 the very last paragraph (this could be also the last paragraph of an
7868 * src/texrow.h: added rows() call which returns the count-variable.
7870 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7872 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
7874 * lib/configure.m4: better autodetection of DocBook tools.
7876 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7878 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
7880 * src/lyx_cb.C: add using std::reverse;
7882 * src/LaTeX.C (run): on error always run deleteFilesOnError before
7885 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
7886 selected files. Should fix repeated errors from generated files.
7888 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
7890 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
7892 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
7893 the spellchecker popup.
7895 * lib/lyxrc.example: Removed the \number_inset section
7897 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7899 * src/insets/figinset.C (various): Use IsFileReadable() to make
7900 sure that the file actually exist. Relying on ghostscripts errors
7901 is a bad idea since they can lead to X server crashes.
7903 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
7905 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
7908 * lib/lyxrc.example: smallish typo in description of
7909 \view_dvi_paper_option
7911 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7914 * src/lyxfunc.C: doImportHelper to factor out common code of the
7915 various import methods. New functions doImportASCIIasLines,
7916 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
7917 doImportLinuxDoc for the format specific parts.
7920 * buffer.C: Dispatch returns now a bool to indicate success
7923 * lyx_gui.C: Add getLyXView() for member access
7925 * lyx_main.C: Change logic for batch commands: First try
7926 Buffer::Dispatch (possibly without GUI), if that fails, use
7929 * lyx_main.C: Add support for --import command line switch.
7930 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
7931 Available Formats: Everything accepted by 'buffer-import <format>'
7933 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7935 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
7938 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
7939 documents will be reformatted upon reentry.
7941 2000-04-27 Juergen Vigna <jug@sad.it>
7943 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
7944 correctly only last pos this was a bug.
7946 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7948 * release of lyx-1.1.5pre1
7950 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7952 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
7954 * src/menus.C: revert the change of naming (Figure->Graphic...)
7955 from 2000-04-11. It was incomplete and bad.
7957 * src/LColor.[Ch]: add LColor::depthbar.
7958 * src/text.C (GetVisibleRow): use it.
7960 * README: update the languages list.
7962 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7964 * src/text.C (GetVisibleRow): show the depth of paragraphs using
7967 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7969 * README: remove sections that were just wrong.
7971 * src/text2.C (GetRowNearY): remove currentrow code
7973 * src/text.C (GetRow): remove currentrow code
7975 * src/screen.C (Update): rewritten a bit.
7976 (SmallUpdate): removed func
7978 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
7980 (FullRebreak): return bool
7981 (currentrow): remove var
7982 (currentrow_y): ditto
7984 * src/lyxscreen.h (Draw): change arg to unsigned long
7985 (FitCursor): return bool
7986 (FitManualCursor): ditto
7987 (Smallpdate): remove func
7988 (first): change to unsigned long
7989 (DrawOneRow): change second arg to long (from long &)
7990 (screen_refresh_y): remove var
7991 (scree_refresh_row): ditto
7993 * src/lyxrow.h: change baseline to usigned int from unsigned
7994 short, this brings some implicit/unsigned issues out in the open.
7996 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
7998 (Dispatch): don't call updateScrollbar after fitCursor. Use update
7999 instead of smallUpdate.
8001 * src/lyxcursor.h: change y to unsigned long
8003 * src/buffer.h: don't call updateScrollbar after fitcursor
8005 * src/buffer.C (parseSingleLyXformat2Token): move variables to
8006 where they are used. Removed "\\direction", this was not present
8007 in 1.1.4 and is already obsolete. Commented out some code that I
8008 believe to never be called.
8009 (runLiterate): don't call updateScrollbar after fitCursor
8011 (buildProgram): ditto
8014 * src/WorkArea.h (workWidth): change return val to unsigned
8017 (redraw): remove the button redraws
8018 (setScrollbarValue): change for scrollbar
8019 (getScrollbarValue): change for scrollbar
8020 (getScrollbarBounds): change for scrollbar
8022 * src/WorkArea.C (C_WorkArea_up_cb): removed func
8023 (C_WorkArea_down_cb): removed func
8024 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
8025 (resize): change for scrollbar
8026 (setScrollbar): ditto
8027 (setScrollbarBounds): ditto
8028 (setScrollbarIncrements): ditto
8029 (up_cb): removed func
8030 (down_cb): removed func
8031 (scroll_cb): change for scrollbar
8032 (work_area_handler): ditto
8034 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
8035 when FitCursor did something.
8036 (updateScrollbar): some unsigned changes
8037 (downCB): removed func
8038 (scrollUpOnePage): removed func
8039 (scrollDownOnePage): remvoed func
8040 (workAreaMotionNotify): don't call screen->FitCursor but use
8041 fitCursor instead. and bool return val
8042 (workAreaButtonPress): ditto
8043 (workAreaButtonRelease): some unsigned changes
8044 (checkInsetHit): ditto
8045 (workAreaExpose): ditto
8046 (update): parts rewritten, comments about the signed char arg added
8047 (smallUpdate): removed func
8048 (cursorPrevious): call needed updateScrollbar
8051 * src/BufferView2.C (allFloats): don't call updateScrollbar after
8054 * src/BufferView.[Ch] (upCB): removed func
8055 (downCB): removed func
8056 (smallUpdate): removed func
8058 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8060 * src/lyxtext.h src/text.C src/text2.C: removed support for the
8061 currentrow, currentrow_y optimization. This did not help a lot and
8062 if we want to do this kind of optimization we should rather use
8063 cursor.row instead of the currentrow.
8065 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
8066 buffer spacing and klyx spacing support.
8068 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8070 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
8073 2000-04-26 Juergen Vigna <jug@sad.it>
8075 * src/insets/figinset.C: fixes to Lars sstream changes!
8077 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
8079 * A lot of files: Added Ascii(ostream &) methods to all inset
8080 classes. Used when exporting to ASCII.
8082 * src/buffer.C (writeFileAscii,RoffAsciiTable)
8083 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
8086 * src/text2.C (ToggleFree): Disabled implicit word selection when
8087 there is a change in the language
8089 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
8090 no output was generated for end-of-sentence inset.
8092 * src/insets/lyxinset.h
8095 * src/paragraph.C: Removed the insetnumber code
8097 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
8099 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8101 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
8102 no_babel and no_epsfig completely from the file.
8103 (parseSingleLyXformat2Token): add handling for per-paragraph
8104 spacing as written by klyx.
8106 * src/insets/figinset.C: applied patch by Andre. Made it work with
8109 2000-04-20 Juergen Vigna <jug@sad.it>
8111 * src/insets/insettext.C (cutSelection):
8112 (copySelection): Fixed with selection from right to left.
8113 (draw): now the rows are not recalculated at every draw.
8114 (computeTextRows): for now reset the inset-owner here (this is
8115 important for an undo or copy where the inset-owner is not set
8118 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
8119 motion to the_locking_inset screen->first was forgotten, this was
8120 not important till we got multiline insets.
8122 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8124 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
8125 code seems to be alright (it is code changed by Dekel, and the
8126 intent is indeed that all macros should be defined \protect'ed)
8128 * NEWS: a bit of reorganisation of the new user-visible features.
8130 2000-04-19 Juergen Vigna <jug@sad.it>
8132 * src/insets/insettext.C (init): using a LyXCursor now for cursor
8133 position. Set the inset_owner of the used paragraph so that it knows
8134 that it is inside an inset. Fixed cursor handling with mouse and
8135 cursor keys. Fixed wrong timed inset redraws and lots of other changes
8136 and cleanups to make TextInsets work better.
8138 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
8139 Changed parameters of various functions and added LockInsetInInset().
8141 * src/insets/insettext.C:
8143 * src/insets/insetcollapsable.h:
8144 * src/insets/insetcollapsable.C:
8145 * src/insets/insetfoot.h:
8146 * src/insets/insetfoot.C:
8147 * src/insets/insetert.h:
8148 * src/insets/insetert.C: cleaned up the code so that it works now
8149 correctly with insettext.
8151 * src/insets/inset.C:
8152 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
8153 that insets in insets are supported right.
8156 * src/table.C: lots of changes for use with inset tabular (and cleanup)
8158 * src/paragraph.C: some small fixes
8160 * src/debug.h: inserted INSETS debug info
8162 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8163 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8165 * src/commandtags.h:
8166 * src/LyXAction.C: insert code for InsetTabular.
8168 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8169 not Button1MotionMask.
8170 (workAreaButtonRelease): send always a InsetButtonRelease event to
8172 (checkInsetHit): some setCursor fixes (always with insets).
8174 * src/BufferView2.C (lockInset): returns a bool now and extended for
8175 locking insets inside insets.
8176 (showLockedInsetCursor): it is important to have the cursor always
8177 before the locked inset.
8178 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8180 * src/BufferView.h: made lockInset return a bool.
8182 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8184 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8185 that is used also internally but can be called as public to have back
8186 a cursor pos which is not set internally.
8187 (SetCursorIntern): Changed to use above function.
8189 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8191 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8196 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8197 patches for things that should be in or should be changed.
8199 * src/* [insetfiles]: change "usigned char fragile" to bool
8200 fragile. There was only one point that could that be questioned
8201 and that is commented in formulamacro.C. Grep for "CHECK".
8203 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8204 (DeleteBuffer): take it out of CutAndPaste and make it static.
8206 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8208 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8209 output the spacing envir commands. Also the new commands used in
8210 the LaTeX output makes the result better.
8212 * src/Spacing.C (writeEnvirBegin): new method
8213 (writeEnvirEnd): new method
8215 2000-04-18 Juergen Vigna <jug@sad.it>
8217 * src/CutAndPaste.C: made textclass a static member of the class
8218 as otherwise it is not accesed right!!!
8220 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8222 * forms/layout_forms.fd
8223 * src/layout_forms.h
8224 * src/layout_forms.C (create_form_form_character)
8225 * src/lyx_cb.C (UserFreeFont)
8226 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8227 documents (in the layout->character popup).
8229 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8231 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8232 \spell_command was in fact not honored (from Kevin Atkinson).
8234 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8237 * src/lyx_gui.h: make lyxViews private (Angus)
8239 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8241 * src/mathed/math_write.C
8242 (MathMatrixInset::Write) Put \protect before \begin{array} and
8243 \end{array} if fragile
8244 (MathParInset::Write): Put \protect before \\ if fragile
8246 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8248 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8249 initialization if the LyXColorHandler must be done after the
8250 connections to the XServer has been established.
8252 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8253 get the background pixel from the lyxColorhandler so that the
8254 figures are rendered with the correct background color.
8255 (NextToken): removed functions.
8256 (GetPSSizes): use ifs >> string instead of NextToken.
8258 * src/Painter.[Ch]: the color cache moved out of this file.
8260 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8263 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8265 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8266 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
8268 * src/BufferView.C (enterView): new func
8269 (leaveView): new func
8271 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
8273 (leaveView): new func, undefines xterm cursor when approp.
8275 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
8276 (AllowInput): delete the Workarea cursor handling from this func.
8278 * src/Painter.C (underline): draw a slimer underline in most cases.
8280 * src/lyx_main.C (error_handler): use extern "C"
8282 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8284 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
8285 sent directly to me.
8287 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
8288 to the list by Dekel.
8290 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
8293 * src/bufferview_funcs.[Ch]: two new files, moved several of the
8294 methods from lyx_cb.here.
8296 * src/lyx_cb.C: in addition to the above; removed input_prohibited
8299 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8301 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
8302 instead of using current_view directly.
8304 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
8306 * src/LyXAction.C (init): add the paragraph-spacing command.
8308 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
8310 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
8312 * src/lyx_cb.C (CurrentState): output a string when the spacing is
8313 different from the documents.
8315 * src/text.C (SetHeightOfRow): take paragraph spacing into
8316 account, paragraph spacing takes precedence over buffer spacing
8317 (GetVisibleRow): ditto
8319 * src/paragraph.C (writeFile): output the spacing parameter too.
8320 (validate): set the correct features if spacing is used in the
8322 (Clear): set spacing to default
8323 (MakeSameLayout): spacing too
8324 (HasSameLayout): spacing too
8325 (SetLayout): spacing too
8326 (TeXOnePar): output the spacing commands
8328 * src/lyxparagraph.h: added a spacing variable for use with
8329 per-paragraph spacing.
8331 * src/Spacing.h: add a Default spacing and a method to check if
8332 the current spacing is default. also added an operator==
8334 * src/text2.C (DeleteEmptyParagraphMechanism): added a
8337 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8339 * src/lyxserver.C (callback): fix dispatch of functions
8341 * src/insets/insetlatexaccent.C (checkContents): turn bogus
8342 printf() into lyxerr call.
8344 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
8347 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
8348 "Table" to "Table Box", "Float" to "Floating Material"; deletes
8349 the "Float" from each of the subitems.
8350 (ShowHelpMenu): add entry for "FAQ" and "TOC".
8352 * src/support/DebugStream.h: add an #ifdef to work around a gcc
8353 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
8354 documented the change so that the workaround can be nuked later.
8356 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
8359 * src/lyxlex_pimpl.C (next): do not re-declare the default value
8361 * src/buffer.C (getLatexName): ditto
8362 (setReadonly): ditto
8364 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8366 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
8367 avoid some uses of current_view. Added also a bufferParams()
8368 method to get at this.
8370 * src/lyxtext.h: changed params->buffer and paramters->bparams.
8372 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8374 * src/lyxparagraph.[Ch]: removed
8375 operator<(LyXParagraph::InsetTable..., added a struct matchIT
8376 with operators used by lower_bound and
8377 upper_bound in InsetTable's
8378 Make struct InsetTable private again. Used matchpos.
8380 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
8382 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
8383 document, the language of existing text is changed (unless the
8384 document is multi-lingual)
8386 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
8388 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
8390 * A lot of files: A rewrite of the Right-to-Left support.
8392 2000-04-10 Juergen Vigna <jug@sad.it>
8394 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
8395 misplaced cursor when inset in inset is locked.
8397 * src/insets/insettext.C (LocalDispatch): small fix so that a
8398 BREAKLINE is not inserted if we don't permit it with autBreakRows.
8400 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
8401 footnote font should be decreased in size twice when displaying.
8403 * src/insets/insettext.C (GetDrawFont): inserted this function as
8404 the drawing-font may differ from the real paragraph font.
8406 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
8407 insets (inset in inset!).
8409 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
8410 function here because we don't want footnotes inside footnotes.
8412 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
8414 (init): now set the inset_owner in paragraph.C
8415 (LocalDispatch): added some resetPos() in the right position
8418 (pasteSelection): changed to use the new CutAndPaste-Class.
8420 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
8421 which tells if it is allowed to insert another inset inside this one.
8423 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
8424 SwitchLayoutsBetweenClasses.
8426 * src/text2.C (InsertInset): checking of the new paragraph-function
8428 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
8429 is not needed anymore here!
8432 (PasteSelection): redone (also with #ifdef) so that now this uses
8433 the CutAndPaste-Class.
8434 (SwitchLayoutsBetweenClasses): removed here and implemented in the
8437 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
8438 from/to text/insets.
8440 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
8441 so that the paragraph knows if it is inside an (text)-inset.
8442 (InsertFromMinibuffer): changed return-value to bool as now it
8443 may happen that an inset is not inserted in the paragraph.
8444 (InsertInsetAllowed): this checks if it is allowed to insert an
8445 inset in this paragraph.
8447 (BreakParagraphConservative):
8448 (BreakParagraph) : small change for the above change of the return
8449 value of InsertFromMinibuffer.
8451 * src/lyxparagraph.h: added inset_owner and the functions to handle
8452 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
8454 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8456 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
8457 functions from BufferView to BufferView::Pimpl to ease maintence.
8459 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
8460 correctly. Also use SetCursorIntern instead of SetCursor.
8462 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
8465 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8467 * src/WorkArea.C (belowMouse): manually implement below mouse.
8469 * src/*: Add "explicit" on several constructors, I added probably
8470 some unneeded ones. A couple of changes to code because of this.
8472 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
8473 implementation and private parts from the users of BufferView. Not
8476 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
8477 implementation and private parts from the users of LyXLex. Not
8480 * src/BufferView_pimpl.[Ch]: new files
8482 * src/lyxlex_pimpl.[Ch]: new files
8484 * src/LyXView.[Ch]: some inline functions move out-of-line
8486 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8488 * src/lyxparagraph.h: make struct InsetTable public.
8490 * src/support/lyxstring.h: change lyxstring::difference_type to be
8491 ptrdiff_t. Add std:: modifiers to streams.
8493 * src/font.C: include the <cctype> header, for islower() and
8496 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8498 * src/font.[Ch]: new files. Contains the metric functions for
8499 fonts, takes a LyXFont as parameter. Better separation of concepts.
8501 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
8502 changes because of this.
8504 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
8506 * src/*: compile with -Winline and move functions that don't
8509 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
8512 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8514 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
8515 (various files changed because of this)
8517 * src/Painter.C (text): fixed the drawing of smallcaps.
8519 * src/lyxfont.[Ch] (drawText): removed unused member func.
8522 * src/*.C: added needed "using" statements and "std::" qualifiers.
8524 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
8526 * src/*.h: removed all use of "using" from header files use
8527 qualifier std:: instead.
8529 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8531 * src/text.C (Backspace): some additional cleanups (we already
8532 know whether cursor.pos is 0 or not).
8534 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
8535 automake does not provide one).
8537 * src/bmtable.h: replace C++ comments with C comments.
8539 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
8541 * src/screen.C (ShowCursor): Change the shape of the cursor if
8542 the current language is not equal to the language of the document.
8543 (If the cursor change its shape unexpectedly, then you've found a bug)
8545 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
8548 * src/insets/insetnumber.[Ch]: New files.
8550 * src/LyXAction.C (init)
8551 * src/lyxfunc.C (dispatch): Add command number-inset-insert
8554 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
8556 * src/lyxparagraph.h
8557 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
8558 (the vector is kept sorted).
8560 * src/text.C (GetVisibleRow): Draw selection correctly when there
8561 is both LTR and RTL text.
8563 * src/paragraph.C (Clone): Use the assignment operator for cloning,
8564 which is much faster.
8566 * src/text.C (GetVisibleRow and other): Do not draw the last space
8567 in a row if the direction of the last letter is not equal to the
8568 direction of the paragraph.
8570 * src/lyxfont.C (latexWriteStartChanges):
8571 Check that font language is not equal to basefont language.
8572 (latexWriteEndChanges): ditto
8574 * src/lyx_cb.C (StyleReset): Don't change the language while using
8575 the font-default command.
8577 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
8578 empty paragraph before a footnote.
8580 * src/insets/insetcommand.C (draw): Increase x correctly.
8582 * src/screen.C (ShowCursor): Change cursor shape if
8583 current language != document language.
8585 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
8587 2000-03-31 Juergen Vigna <jug@sad.it>
8589 * src/paragraph.C (GetInset): commented out text[pos] = ' '
8590 (Clone): changed mode how the paragraph-data is copied to the
8591 new clone-paragraph.
8593 * src/lyxfunc.C (Dispatch): fixed small problem when calling
8594 GetInset(pos) with no inset anymore there (in inset UNDO)
8596 * src/insets/insetcommand.C (draw): small fix as here x is
8597 incremented not as much as width() returns (2 before, 2 behind = 4)
8599 2000-03-30 Juergen Vigna <jug@sad.it>
8601 * src/insets/insettext.C (InsetText): small fix in initialize
8602 widthOffset (should not be done in the init() function)
8604 2000-03-29 Amir Karger <karger@lyx.org>
8606 * lib/examples/it_ItemizeBullets.lyx: translation by
8609 * Implemented \textasciitilde and fixed a tiny bug in reLyX
8611 2000-03-29 Juergen Vigna <jug@sad.it>
8613 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
8615 * src/insets/insetfoot.C (Clone): small change as for the below
8616 new init function in the text-inset
8618 * src/insets/insettext.C (init): new function as I've seen that
8619 clone did not copy the Paragraph-Data!
8620 (LocalDispatch): Added code so that now we have some sort of Undo
8621 functionality (well actually we HAVE Undo ;)
8623 * src/text.C (Backspace): Small fix for the a | a Backspace problem
8625 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
8627 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
8630 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8632 * src/main.C: added a runtime check that verifies that the xforms
8633 header used when building LyX and the library used when running
8634 LyX match. Exit with a message if they don't match. This is a
8635 version number check only.
8637 * src/buffer.C (save): Don't allocate memory on the heap for
8638 struct utimbuf times.
8640 * *: some using changes, use iosfwd instead of the real headers.
8642 * src/lyxfont.C use char const * instead of string for the static
8643 strings. Rewrite some functions to use sstream.
8645 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8647 * src/text.C (Backspace): hopefully fix the dreaded backaspace
8650 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8652 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
8653 of Geodesy (from Martin Vermeer)
8655 * lib/layouts/svjour.inc: include file for the Springer svjour
8656 class. It can be used to support journals other than JoG.
8658 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
8659 Miskiewicz <misiek@pld.org.pl>)
8660 * lib/reLyX/Makefile.am: ditto.
8662 2000-03-27 Juergen Vigna <jug@sad.it>
8664 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
8665 also some modifications with operations on selected text.
8667 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
8668 problems with clicking on insets (last famous words ;)
8670 * src/insets/insetcommand.C (draw):
8671 (width): Changed to have a bit of space before and after the inset so
8672 that the blinking cursor can be seen (otherwise it was hidden)
8674 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8676 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
8677 would not be added to the link list when an installed gettext (not
8678 part of libc) is found.
8680 2000-03-24 Juergen Vigna <jug@sad.it>
8682 * src/insets/insetcollapsable.C (Edit):
8683 * src/mathed/formula.C (InsetButtonRelease):
8684 (InsetButtonPress): fixed for new handling of ButtonPress/Release
8687 * src/BufferView.C (workAreaButtonPress):
8688 (workAreaButtonRelease):
8689 (checkInsetHit): Finally fixed the clicking on insets be handled
8692 * src/insets/insetert.C (Edit): inserted this call so that ERT
8693 insets work always with LaTeX-font
8695 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8697 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
8698 caused lyx to startup with no GUI in place, causing in a crash
8699 upon startup when called with arguments.
8701 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8703 * src/FontLoader.C: better initialization of dummyXFontStruct.
8705 2000-03-20 José Abílio Matos <jamatos@lyx.org>
8707 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
8708 for linuxdoc and docbook import and export format options.
8710 * lib/lyxrc.example Example of default values for the previous flags.
8712 * src/lyx_cb.C Use those flags instead of the hardwired values for
8713 linuxdoc and docbook export.
8715 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
8718 * src/menus.C Added menus entries for the new import/exports formats.
8720 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8722 * src/lyxrc.*: Added support for running without Gui
8725 * src/FontLoader.C: sensible defaults if no fonts are needed
8727 * src/lyx_cb.C: New function ShowMessage (writes either to the
8728 minibuffer or cout in case of no gui
8729 New function AskOverwrite for common stuff
8730 Consequently various changes to call these functions
8732 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
8733 wild guess at sensible screen resolution when having no gui
8735 * src/lyxfont.C: no gui, no fonts... set some defaults
8737 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8739 * src/LColor.C: made the command inset background a bit lighter.
8741 2000-03-20 Hartmut Goebel <goebel@noris.net>
8743 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
8744 stdstruct.inc. Koma-Script added some title elements which
8745 otherwise have been listed below "bibliography". This split allows
8746 adding title elements to where they belong.
8748 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
8749 define the additional title elements and then include
8752 * many other layout files: changed to include stdtitle.inc just
8753 before stdstruct.inc.
8755 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
8757 * src/buffer.C: (save) Added the option to store all backup files
8758 in a single directory
8760 * src/lyxrc.[Ch]: Added variable \backupdir_path
8762 * lib/lyxrc.example: Added descriptions of recently added variables
8764 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
8765 bibtex inset, not closing the bibtex popup when deleting the inset)
8767 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8769 * src/lyx_cb.C: add a couple using directives.
8771 2000-03-17 José Abílio Matos <jamatos@lyx.org>
8772 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
8773 import based on the filename.
8775 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
8776 file would be imported at start, if the filename where of a sgml file.
8778 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
8780 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
8782 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
8783 * src/lyxfont.h Replaced the member variable bits.direction by the
8784 member variable lang. Made many changes in other files.
8785 This allows having a multi-lingual document
8787 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
8788 that change the current language to <l>.
8789 Removed the command "font-rtl"
8791 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
8792 format for Hebrew documents)
8794 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
8795 When auto_mathmode is "true", pressing a digit key in normal mode
8796 will cause entering into mathmode.
8797 If auto_mathmode is "rtl" then this behavior will be active only
8798 when writing right-to-left text.
8800 * src/text2.C (InsertStringA) The string is inserted using the
8803 * src/paragraph.C (GetEndLabel) Gives a correct result for
8804 footnote paragraphs.
8806 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
8808 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8810 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
8811 front of PasteParagraph. Never insert a ' '. This should at least
8812 fix some cause for the segfaults that we have been experiencing,
8813 it also fixes backspace behaviour slightly. (Phu!)
8815 * src/support/lstrings.C (compare_no_case): some change to make it
8816 compile with gcc 2.95.2 and stdlibc++-v3
8818 * src/text2.C (MeltFootnoteEnvironment): change type o
8819 first_footnote_par_is_not_empty to bool.
8821 * src/lyxparagraph.h: make text private. Changes in other files
8823 (fitToSize): new function
8824 (setContentsFromPar): new function
8825 (clearContents): new function
8826 (SetChar): new function
8828 * src/paragraph.C (readSimpleWholeFile): deleted.
8830 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
8831 the file, just use a simple string instead. Also read the file in
8832 a more maintainable manner.
8834 * src/text2.C (InsertStringA): deleted.
8835 (InsertStringB): deleted.
8837 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8839 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
8840 RedoParagraphs from the doublespace handling part, just set status
8841 to NEED_MORE_REFRESH. Also don't update cursor position (should be
8842 done, but perhaps not like this.)
8844 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8846 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
8847 character when inserting an inset.
8849 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8851 * src/bufferparams.C (readLanguage): now takes "default" into
8854 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
8855 also initialize the toplevel_keymap with the default bindings from
8858 * src/buffer.C (Buffer): remove lyxrc from the parameters.
8860 * all files using lyxrc: have lyxrc as a real variable and not a
8861 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
8864 * src/lyxrc.C: remove double call to defaultKeyBindings
8866 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
8867 toolbar defauls using lyxlex. Remove enums, structs, functions
8870 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
8871 toolbar defaults. Also store default keybindings in a map.
8873 * src/ToolbarDefaults.[Ch]: New file. This class is used for
8874 storing the toolbar defaults without any xforms dependencies.
8876 * src/insets/figinset.C: patch posted to list by Andre Poenitz
8877 applied. Changed to use iterators.
8879 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8881 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
8882 systems that don't have LINGUAS set to begin with.
8884 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8886 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
8887 the list by Dekel Tsur.
8889 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8891 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
8892 * src/insets/form_graphics.C: ditto.
8894 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
8896 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8898 * src/bufferparams.C (readLanguage): use the new language map
8900 * src/intl.C (InitKeyMapper): use the new language map
8902 * src/lyx_gui.C (create_forms): use the new language map
8904 * src/language.[Ch]: New files. Used for holding the information
8905 about each language. Now! Use this new language map enhance it and
8906 make it really usable for our needs.
8908 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
8910 * screen.C (ShowCursor): Removed duplicate code.
8911 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
8912 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
8914 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
8917 * src/text.C Added TransformChar method. Used for rendering Arabic
8918 text correctly (change the glyphs of the letter according to the
8919 position in the word)
8924 * src/lyxrc.C Added lyxrc command {language_command_begin,
8925 language_command_end,language_command_ltr,language_command_rtl,
8926 language_package} which allows the use of either arabtex or Omega
8929 * src/lyx_gui.C (init)
8931 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
8932 to use encoding for menu fonts which is different than the encoding
8935 * src/buffer.C (makeLaTeXFile): If params.language = "default",
8936 do not load the babel package.
8937 To write an English document with Hebrew/Arabic, change the document
8938 language to "english".
8940 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
8941 (alphaCounter): changed to return char
8942 (loweralphaCounter, hebrewCounter, romanCounter): New functions
8944 * lib/lyxrc.example Added examples for Hebrew/Arabic
8947 * src/layout.C Added layout command endlabeltype
8949 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
8951 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
8953 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8955 * src/mathed/math_delim.C (search_deco): return a
8956 math_deco_struct* instead of index.
8958 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8960 * All files with a USE_OSTREAM_ONLY within: removed all code that
8961 was unused when USE_OSTREAM_ONLY is defined.
8963 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
8964 of any less. Removed header and using.
8966 * src/text.C (GetVisibleRow): draw the string "Page Break
8967 (top/bottom)" on screen when drawing a pagebreak line.
8969 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8971 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
8973 * src/mathed/math_macro.C (draw): do some cast magic.
8976 * src/mathed/math_defs.h: change byte* argument to byte const*.
8978 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
8980 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
8981 know it is right to return InsetFoot* too, but cxx does not like
8984 * src/insets/insetcollapsable.[Ch] (Clone): make const.
8986 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
8988 * src/mathed/math_delim.C: change == to proper assignment.
8990 2000-03-09 Juergen Vigna <jug@sad.it>
8992 * src/insets/insettext.C (setPos): fixed various cursor positioning
8993 problems (via mouse and cursor-keys)
8994 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
8995 inset (still a small display problem but it works ;)
8997 * src/insets/insetcollapsable.C (draw): added button_top_y and
8998 button_bottom_y to have correct values for clicking on the inset.
9000 * src/support/lyxalgo.h: commented out 'using std::less'
9002 2000-03-08 Juergen Vigna <jug@sad.it>
9004 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
9005 Button-Release event closes as it is alos the Release-Event
9008 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
9010 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9012 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
9013 can add multiple spaces in Scrap (literate programming) styles...
9014 which, by the way, is how I got hooked on LyX to begin with.
9016 * src/mathed/formula.C (Write): Added dummy variable to an
9017 inset::Latex() call.
9018 (Latex): Add free_spacing boolean to inset::Latex()
9020 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
9022 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
9023 virtual function to include the free_spacing boolean from
9024 the containing paragraph's style.
9026 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
9027 Added free_spacing boolean arg to match inset.h
9029 * src/insets/insettext.C, src/insets/insettext.h (Latex):
9030 Added free_spacing boolean arg to match inset.h
9032 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
9033 Added free_spacing boolean and made sure that if in a free_spacing
9034 paragraph, that we output normal space if there is a protected space.
9036 * src/insets/insetref.C, src/insets/insetref.h (Latex):
9037 Added free_spacing boolean arg to match inset.h
9039 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
9040 Added free_spacing boolean arg to match inset.h
9042 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
9043 Added free_spacing boolean arg to match inset.h
9045 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
9046 Added free_spacing boolean arg to match inset.h
9048 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
9049 Added free_spacing boolean arg to match inset.h
9051 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
9052 free_spacing boolean arg to match inset.h
9054 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
9055 Added free_spacing boolean arg to match inset.h
9057 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
9058 Added free_spacing boolean arg to match inset.h
9060 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
9061 Added free_spacing boolean arg to match inset.h
9063 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
9064 Added free_spacing boolean arg to match inset.h
9066 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
9067 Added free_spacing boolean arg to match inset.h
9069 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
9070 free_spacing boolean arg to match inset.h
9072 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
9073 free_spacing boolean arg to match inset.h
9075 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
9076 ignore free_spacing paragraphs. The user's spaces are left
9079 * src/text.C (InsertChar): Fixed the free_spacing layout
9080 attribute behavior. Now, if free_spacing is set, you can
9081 add multiple spaces in a paragraph with impunity (and they
9082 get output verbatim).
9083 (SelectSelectedWord): Added dummy argument to inset::Latex()
9086 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
9089 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
9090 paragraph layouts now only input a simple space instead.
9091 Special character insets don't make any sense in free-spacing
9094 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
9095 hard-spaces in the *input* file to simple spaces if the layout
9096 is free-spacing. This converts old files which had to have
9097 hard-spaces in free-spacing layouts where a simple space was
9099 (writeFileAscii): Added free_spacing check to pass to the newly
9100 reworked inset::Latex(...) methods. The inset::Latex() code
9101 ensures that hard-spaces in free-spacing paragraphs get output
9102 as spaces (rather than "~").
9104 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9106 * src/mathed/math_delim.C (draw): draw the empty placeholder
9107 delims with a onoffdash line.
9108 (struct math_deco_compare): struct that holds the "functors" used
9109 for the sort and the binary search in math_deco_table.
9110 (class init_deco_table): class used for initial sort of the
9112 (search_deco): use lower_bound to do a binary search in the
9115 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9117 * src/lyxrc.C: a small secret thingie...
9119 * src/lyxlex.C (printTable): changed to take a ostream as paramter
9120 and to not flush the stream as often as it used to.
9122 * src/support/lyxalgo.h: new file
9123 (sorted): template function used for checking if a sequence is
9124 sorted or not. Two versions with and without user supplied
9125 compare. Uses same compare as std::sort.
9127 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
9128 it and give warning on lyxerr.
9130 (struct compare_tags): struct with function operators used for
9131 checking if sorted, sorting and lower_bound.
9132 (search_kw): use lower_bound instead of manually implemented
9135 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9137 * src/insets/insetcollapsable.h: fix Clone() declaration.
9138 * src/insets/insetfoot.h: ditto.
9140 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
9142 2000-03-08 Juergen Vigna <jug@sad.it>
9144 * src/insets/lyxinset.h: added owner call which tells us if
9145 this inset is inside another inset. Changed also the return-type
9146 of Editable to an enum so it tells clearer what the return-value is.
9148 * src/insets/insettext.C (computeTextRows): fixed computing of
9149 textinsets which split automatically on more rows.
9151 * src/insets/insetert.[Ch]: changed this to be of BaseType
9154 * src/insets/insetfoot.[Ch]: added footnote inset
9156 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
9157 collapsable insets (like footnote, ert, ...)
9159 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9161 * src/lyxdraw.h: remvoe file
9163 * src/lyxdraw.C: remove file
9165 * src/insets/insettext.C: added <algorithm>.
9167 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9169 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9170 (matrix_cb): case MM_OK use string stream
9172 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9175 * src/mathed/math_macro.C (draw): use string stream
9176 (Metrics): use string stream
9178 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9179 directly to the ostream.
9181 * src/vspace.C (asString): use string stream.
9182 (asString): use string stream
9183 (asLatexString): use string stream
9185 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9186 setting Spacing::Other.
9188 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9189 sprintf when creating the stretch vale.
9191 * src/text2.C (alphaCounter): changed to return a string and to
9192 not use a static variable internally. Also fixed a one-off bug.
9193 (SetCounter): changed the drawing of the labels to use string
9194 streams instead of sprintf.
9196 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9197 manipulator to use a scheme that does not require library support.
9198 This is also the way it is done in the new GNU libstdc++. Should
9199 work with DEC cxx now.
9201 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9203 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9204 end. This fixes a bug.
9206 * src/mathed (all files concerned with file writing): apply the
9207 USE_OSTREAM_ONLY changes to mathed too.
9209 * src/support/DebugStream.h: make the constructor explicit.
9211 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9212 count and ostream squashed.
9214 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9216 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9218 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9219 ostringstream uses STL strings, and we might not.
9221 * src/insets/insetspecialchar.C: add using directive.
9222 * src/insets/insettext.C: ditto.
9224 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9226 * lib/layouts/seminar.layout: feeble attempt at a layout for
9227 seminar.cls, far from completet and could really use some looking
9228 at from people used to write layout files.
9230 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9231 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9232 a lot nicer and works nicely with ostreams.
9234 * src/mathed/formula.C (draw): a slightly different solution that
9235 the one posted to the list, but I think this one works too. (font
9236 size wrong in headers.)
9238 * src/insets/insettext.C (computeTextRows): some fiddling on
9239 Jürgens turf, added some comments that he should read.
9241 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9242 used and it gave compiler warnings.
9243 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9246 * src/lyx_gui.C (create_forms): do the right thing when
9247 show_banner is true/false.
9249 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9250 show_banner is false.
9252 * most file writing files: Now use iostreams to do almost all of
9253 the writing. Also instead of passing string &, we now use
9254 stringstreams. mathed output is still not adapted to iostreams.
9255 This change can be turned off by commenting out all the occurences
9256 of the "#define USE_OSTREAM_ONLY 1" lines.
9258 * src/WorkArea.C (createPixmap): don't output debug messages.
9259 (WorkArea): don't output debug messages.
9261 * lib/lyxrc.example: added a comment about the new variable
9264 * development/Code_rules/Rules: Added some more commente about how
9265 to build class interfaces and on how better encapsulation can be
9268 2000-03-03 Juergen Vigna <jug@sad.it>
9270 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
9271 automatically with the width of the LyX-Window
9273 * src/insets/insettext.C (computeTextRows): fixed update bug in
9274 displaying text-insets (scrollvalues where not initialized!)
9276 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9278 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
9279 id in the check of the result from lower_bound is not enough since
9280 lower_bound can return last too, and then res->id will not be a
9283 * all insets and some code that use them: I have conditionalized
9284 removed the Latex(string & out, ...) this means that only the
9285 Latex(ostream &, ...) will be used. This is a work in progress to
9286 move towards using streams for all output of files.
9288 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
9291 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9293 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
9294 routine (this fixes bug where greek letters were surrounded by too
9297 * src/support/filetools.C (findtexfile): change a bit the search
9298 algorithm, to fix bug introduced in 1.1.4. Note that --format is
9299 no longer passed to kpsewhich, we may have to change that later.
9301 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
9302 warning options to avoid problems with X header files (from Angus
9304 * acinclude.m4: regenerated.
9306 2000-03-02 Juergen Vigna <jug@sad.it>
9308 * src/insets/insettext.C (WriteParagraphData): Using the
9309 par->writeFile() function for writing paragraph-data.
9310 (Read): Using buffer->parseSingleLyXformat2Token()-function
9311 for parsing paragraph data!
9313 * src/buffer.C (readLyXformat2): removed all parse data and using
9314 the new parseSingleLyXformat2Token()-function.
9315 (parseSingleLyXformat2Token): added this function to parse (read)
9316 lyx-file-format (this is called also from text-insets now!)
9318 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9320 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
9323 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
9324 directly instead of going through a func. One very bad thing: a
9325 static LyXFindReplace, but I don't know where to place it.
9327 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
9328 string instead of char[]. Also changed to static.
9329 (GetSelectionOrWordAtCursor): changed to static inline
9330 (SetSelectionOverLenChars): ditto.
9332 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
9333 current_view and global variables. both classes has changed names
9334 and LyXFindReplace is not inherited from SearchForm.
9336 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
9337 fl_form_search form.
9339 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
9341 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9343 * lib/bind/*.bind: make sure 'buffer-previous' function is not
9344 bound (from Kayvan).
9346 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
9348 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
9350 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9352 * some things that I should comment but the local pub says head to
9355 * comment out all code that belongs to the Roff code for Ascii
9356 export of tables. (this is unused)
9358 * src/LyXView.C: use correct type for global variable
9359 current_layout. (LyXTextClass::size_type)
9361 * some code to get the new insetgraphics closer to working I'd be
9362 grateful for any help.
9364 * src/BufferView2.C (insertInset): use the return type of
9365 NumberOfLayout properly. (also changes in other files)
9367 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
9368 this as a test. I want to know what breaks because of this.
9370 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
9372 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9374 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
9375 to use a \makebox in the label, this allows proper justification
9376 with out using protected spaces or multiple hfills. Now it is
9377 "label" for left justified, "\hfill label\hfill" for center, and
9378 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
9379 should be changed accordingly.
9381 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9383 * src/lyxtext.h: change SetLayout() to take a
9384 LyXTextClass::size_type instead of a char (when there is more than
9385 127 layouts in a class); also change type of copylayouttype.
9386 * src/text2.C (SetLayout): ditto.
9387 * src/LyXView.C (updateLayoutChoice): ditto.
9389 * src/LaTeX.C (scanLogFile): errors where the line number was not
9390 given just after the '!'-line were ignored (from Dekel Tsur).
9392 * lib/lyxrc.example: fix description of \date_insert_format
9394 * lib/layouts/llncs.layout: new layout, contributed by Martin
9397 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9399 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
9400 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
9401 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
9402 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
9403 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
9404 paragraph.C, text.C, text2.C)
9406 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9408 * src/insets/insettext.C (LocalDispatch): remove extra break
9411 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
9412 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
9414 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
9415 * src/insets/insettext.[Ch] (GetCursorPos): ditto
9417 * src/insets/insetbib.h: move InsetBibkey::Holder and
9418 InsetCitation::Holder in public space.
9420 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9422 * src/insets/insettext.h: small change to get the new files from
9423 Juergen to compile (use "string", not "class string").
9425 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
9426 const & as parameter to LocalDispatch, use LyXFont const & as
9427 paramter to some other func. This also had impacto on lyxinsets.h
9428 and the two mathed insets.
9430 2000-02-24 Juergen Vigna <jug@sad.it>
9433 * src/commandtags.h:
9435 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
9439 * src/BufferView2.C: added/updated code for various inset-functions
9441 * src/insets/insetert.[Ch]: added implementation of InsetERT
9443 * src/insets/insettext.[Ch]: added implementation of InsetText
9445 * src/insets/inset.C (Edit): added "unsigned int button" parameter
9446 (draw): added preliminary code for inset scrolling not finshed yet
9448 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
9449 as it is in lyxfunc.C now
9451 * src/insets/lyxinset.h: Added functions for text-insets
9453 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9455 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
9456 BufferView and reimplement the list as a queue put inside its own
9459 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
9461 * several files: use the new interface to the "updateinsetlist"
9463 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
9465 (work_area_handler): call BufferView::trippleClick on trippleclick.
9467 * src/BufferView.C (doubleClick): new function, selects word on
9469 (trippleClick): new function, selects line on trippleclick.
9471 2000-02-22 Allan Rae <rae@lyx.org>
9473 * lib/bind/xemacs.bind: buffer-previous not supported
9475 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9477 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
9480 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9482 * src/bufferlist.C: get rid of current_view from this file
9484 * src/spellchecker.C: get rid of current_view from this file
9486 * src/vspace.C: get rid of current_view from this file
9487 (inPixels): added BufferView parameter for this func
9488 (asLatexCommand): added a BufferParams for this func
9490 * src/text.C src/text2.C: get rid of current_view from these
9493 * src/lyxfont.C (getFontDirection): move this function here from
9496 * src/bufferparams.C (getDocumentDirection): move this function
9499 * src/paragraph.C (getParDirection): move this function here from
9501 (getLetterDirection): ditto
9503 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
9505 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
9506 resize due to wrong pixmap beeing used. Also took the opurtunity
9507 to make the LyXScreen stateless on regard to WorkArea and some
9508 general cleanup in the same files.
9510 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9512 * src/Makefile.am: add missing direction.h
9514 * src/PainterBase.h: made the width functions const.
9516 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
9519 * src/insets/insetcommand.C (draw): draw Editable as buttons.
9521 * src/insets/insetlatexaccent.C (draw): make the accents draw
9522 better, at present this will only work well with iso8859-1.
9524 * several files: remove the old drawing code, now we use the new
9527 * several files: remove support for mono_video, reverse_video and
9530 2000-02-17 Juergen Vigna <jug@sad.it>
9532 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
9533 int ** as we have to return the pointer, otherwise we have only
9534 NULL pointers in the returning function.
9536 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9538 * src/LaTeX.C (operator()): quote file name when running latex.
9540 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9542 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
9543 (bubble tip), this removes our special handling of this.
9545 * Remove all code that is unused now that we have the new
9546 workarea. (Code that are not active when NEW_WA is defined.)
9548 * Make the uses of XSync not conditionalized on define USE_XSYNC.
9550 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9552 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
9553 nonexisting layout; correctly redirect obsoleted layouts.
9555 * lib/lyxrc.example: document \view_dvi_paper_option
9557 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
9560 * src/lyx_cb.C (RunScript): handle $$FName for command names.
9561 (PreviewDVI): handle the view_dvi_paper_option variable.
9562 [Both from Roland Krause]
9564 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9566 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
9567 char const *, int, LyXFont)
9568 (text(int, int, string, LyXFont)): ditto
9570 * src/text.C (InsertCharInTable): attempt to fix the double-space
9571 feature in tables too.
9572 (BackspaceInTable): ditto.
9573 (GetVisibleRow): make bottom pagebreak line be a onoff line.
9575 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9577 * src/text2.C (owner): only complain if owner_ is set and bv != 0
9579 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
9580 newly found text in textcache to this.
9581 (buffer): set the owner of the text put into the textcache to 0
9583 * src/insets/figinset.C (draw): fixed the drawing of figures with
9586 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
9587 drawing of mathframe, hfills, protected space, table lines. I have
9588 now no outstanding drawing problems with the new Painter code.
9590 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9592 * src/PainterBase.C (ellipse, circle): do not specify the default
9595 * src/LColor.h: add using directive.
9597 * src/Painter.[Ch]: change return type of methods from Painter& to
9598 PainterBase&. Add a using directive.
9600 * src/WorkArea.C: wrap xforms callbacks in C functions
9603 * lib/layouts/foils.layout: font fix and simplifications from Carl
9606 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9608 * a lot of files: The Painter, LColor and WorkArea from the old
9609 devel branch has been ported to lyx-devel. Some new files and a
9610 lot of #ifdeffed code. The new workarea is enabled by default, but
9611 if you want to test the new Painter and LColor you have to compile
9612 with USE_PAINTER defined (do this in config.h f.ex.) There are
9613 still some rought edges, and I'd like some help to clear those
9614 out. It looks stable (loads and displays the Userguide very well).
9617 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9619 * src/buffer.C (pop_tag): revert to the previous implementation
9620 (use a global variable for both loops).
9622 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
9624 * src/lyxrc.C (LyXRC): change slightly default date format.
9626 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
9627 there is an English text with a footnote that starts with a Hebrew
9628 paragraph, or vice versa.
9629 (TeXFootnote): ditto.
9631 * src/text.C (LeftMargin): allow for negative values for
9632 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
9635 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
9636 for input encoding (cyrillic)
9638 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9640 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
9643 * src/toolbar.C (set): ditto
9644 * src/insets/insetbib.C (create_form_citation_form): ditto
9646 * lib/CREDITS: added Dekel Tsur.
9648 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
9649 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
9650 hebrew supports files from Dekel Tsur.
9652 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
9653 <tzafrir@technion.ac.il>
9655 * src/lyxrc.C: put \date_insert_format at the right place.
9657 * src/buffer.C (makeLaTeXFile): fix the handling of
9658 BufferParams::sides when writing out latex files.
9660 * src/BufferView2.C: add a "using" directive.
9662 * src/support/lyxsum.C (sum): when we use lyxstring,
9663 ostringstream::str needs an additional .c_str().
9665 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9667 * src/support/filetools.C (ChangeExtension): patch from Etienne
9670 * src/TextCache.C (show): remove const_cast and make second
9671 parameter non-const LyXText *.
9673 * src/TextCache.h: use non const LyXText in show.
9675 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
9678 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9680 * src/support/lyxsum.C: rework to be more flexible.
9682 * several places: don't check if a pointer is 0 if you are going
9685 * src/text.C: remove some dead code.
9687 * src/insets/figinset.C: remove some dead code
9689 * src/buffer.C: move the BufferView funcs to BufferView2.C
9690 remove all support for insetlatexdel
9691 remove support for oldpapersize stuff
9692 made some member funcs const
9694 * src/kbmap.C: use a std::list to store the bindings in.
9696 * src/BufferView2.C: new file
9698 * src/kbsequence.[Ch]: new files
9700 * src/LyXAction.C + others: remove all trace of buffer-previous
9702 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
9703 only have one copy in the binary of this table.
9705 * hebrew patch: moved some functions from LyXText to more
9706 appropriate places. (LyXParagraph, BufferParams, LyXFont)
9708 * several files: remove support for XForms older than 0.88
9710 remove some #if 0 #endif code
9712 * src/TextCache.[Ch]: new file. Holds the textcache.
9714 * src/BufferView.C: changes to use the new TextCache interface.
9715 (waitForX): remove the now unused code.
9717 * src/BackStack.h: remove some commented code
9719 * lib/bind/emacs.bind: remove binding for buffer-previous
9721 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9723 * applied the hebrew patch.
9725 * src/lyxrow.h: make sure that all Row variables are initialized.
9727 * src/text2.C (TextHandleUndo): comment out a delete, this might
9728 introduce a memory leak, but should also help us to not try to
9729 read freed memory. We need to look at this one.
9731 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
9732 (LyXParagraph): initalize footnotekind.
9734 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
9735 forgot this when applying the patch. Please heed the warnings.
9737 * src/BufferView.C (buffer): a fix for the buffer-reload problem
9738 (aka. reformat problem)
9740 * src/bufferlist.C (exists): made const, and use const_iterator
9741 (isLoaded): new func.
9742 (release): use std::find to find the correct buffer.
9744 * src/bufferlist.h: made getState a const func.
9745 made empty a const func.
9746 made exists a const func.
9749 2000-02-01 Juergen Vigna <jug@sad.it>
9751 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
9753 * po/it.po: updated a bit the italian po file and also changed the
9754 'file nuovo' for newfile to 'filenuovo' without a space, this did
9757 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
9758 for the new insert_date command.
9760 * src/lyxfunc.C (Dispatch): added support for a insert_date function
9761 from jdblair, to insert a date into the current text conforming to
9762 a strftime format (for now only considering the locale-set and not
9763 the document-language).
9765 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9767 * src/lyxfont.C (textWidth): hopefully better fix for the Array
9768 Bounds Read error seen by purify. The problem was that islower is
9769 a macros which takes an unsigned char and uses it as an index for
9770 in array of characters properties (and is thus subject to the
9774 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
9775 correctly the paper sides radio buttons.
9776 (UpdateDocumentButtons): ditto.
9778 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9780 * src/kbmap.C (getsym + others): change to return unsigned int,
9781 returning a long can give problems on 64 bit systems. (I assume
9782 that int is 32bit on 64bit systems)
9784 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9786 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
9787 LyXLookupString to be zero-terminated. Really fixes problems seen
9790 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9792 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
9793 write a (char*)0 to the lyxerr stream.
9795 * src/lastfiles.C: move algorithm before the using statemets.
9797 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9799 * src/lastfiles.C: move using directives in global scope (egcs 1.x
9800 complains otherwise).
9801 * src/table.C: ditto
9803 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
9806 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
9807 that I removed earlier... It is really needed.
9809 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
9811 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9813 * INSTALL: update xforms home page URL.
9815 * lib/configure.m4: fix a bug with unreadable layout files.
9817 * src/table.C (calculate_width_of_column): add "using std::max"
9820 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9822 * several files: marked several lines with "DEL LINE", this is
9823 lines that can be deleted without changing anything.
9824 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
9825 checks this anyway */
9828 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
9830 * src/DepTable.C (update): add a "+" at the end when the checksum
9831 is different. (debugging string only)
9833 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
9834 the next inset to not be displayed. This should also fix the list
9835 of labels in the "Insert Crossreference" dialog.
9837 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9839 * src/support/LSubstring.C (LSubstring): set pos to string::npos
9840 when regex was not found.
9842 * src/support/lstrings.C (lowercase): use handcoded transform always.
9845 * src/text.C (Delete): fixed the crash. cursor.par->prev and
9846 old_cursor.par->prev could be 0.
9848 * several files: changed post inc/dec to pre inc/dec
9850 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
9851 write the lastfiles to file.
9853 * src/BufferView.C (buffer): only show TextCache info when debugging
9855 (resizeCurrentBuffer): ditto
9856 (workAreaExpose): ditto
9858 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
9860 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
9862 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
9863 a bit better by removing the special case for \i and \j.
9865 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9867 * src/lyx_main.C (easyParse): remove test for bad comand line
9868 options, since this broke all xforms-related parsing.
9870 * src/kbmap.C (getsym): set return type to unsigned long, as
9871 declared in header. On an alpha, long is _not_ the same as int.
9873 * src/support/LOstream.h: add a "using std::flush;"
9875 * src/insets/figinset.C: ditto.
9877 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9879 * src/bufferlist.C (write): use blinding fast file copy instead of
9880 "a char at a time", now we are doing it the C++ way.
9882 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
9883 std::list<int> instead.
9884 (addpidwait): reflect move to std::list<int>
9885 (sigchldchecker): ditto
9887 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
9890 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
9891 that obviously was wrong...
9893 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
9894 c, this avoids warnings with purify and islower.
9896 * src/insets/figinset.C: rename struct queue to struct
9897 queue_element and rewrite to use a std::queue. gsqueue is now a
9898 std::queue<queue_element>
9899 (runqueue): reflect move to std::queue
9902 * src/support/lstrings.h (tostr): specialize for bool, otherwise
9903 we would get "1" "0" instead of "true" "false. Also make the tostr
9906 2000-01-21 Juergen Vigna <jug@sad.it>
9908 * src/buffer.C (writeFileAscii): Disabled code for special groff
9909 handling of tabulars till I fix this in table.C
9911 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9913 * src/support/mkdir.C (mkdir): change second argument of mkdir to
9915 * src/support/lyxlib.h: ditto.
9917 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9919 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
9920 and 'j' look better. This might fix the "macron" bug that has been
9923 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
9924 functions as one template function. Delete the old versions.
9926 * src/support/lyxsum.C: move using std::ifstream inside
9929 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
9932 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
9934 * src/mathed/formula.C: delete #include "bufferlist.h" never used
9936 * src/insets/figinset.C (InitFigures): use new instead of malloc
9937 to allocate memory for figures and bitmaps.
9938 (DoneFigures): use delete[] instead of free to deallocate memory
9939 for figures and bitmaps.
9940 (runqueue): use new to allocate
9941 (getfigdata): use new/delete[] instead of malloc/free
9942 (RegisterFigure): ditto
9944 * some files: moved some declarations closer to first use, small
9945 whitespace changes use preincrement instead of postincrement where
9946 it does not make a difference.
9948 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
9949 step on the way to use stl::containers for key maps.
9951 * src/bufferlist.h: add a typedef for const_iterator and const
9952 versions of begin and end.
9954 * src/bufferlist.[Ch]: change name of member variable _state to
9955 state_. (avoid reserved names)
9957 (getFileNames): returns the filenames of the buffers in a vector.
9959 * configure.in (ALL_LINGUAS): added ro
9961 * src/support/putenv.C: new file
9963 * src/support/mkdir.C: new file
9965 2000-01-20 Allan Rae <rae@lyx.org>
9967 * lib/layouts/IEEEtran.layout: Added several theorem environments
9969 * lib/templates/IEEEtran.lyx: Example theorem environments and a
9970 couple of minor additions.
9972 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
9973 (except for those in footnotes of course)
9975 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9977 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
9979 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
9980 std::sort and std::lower_bound instead of qsort and handwritten
9982 (struct compara): struct that holds the functors used by std::sort
9983 and std::lower_bound in MathedLookupBOP.
9985 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9987 * src/support/LAssert.h: do not do partial specialization. We do
9990 * src/support/lyxlib.h: note that lyx::getUserName() and
9991 lyx::date() are not in use right now. Should these be suppressed?
9993 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
9994 (makeLinuxDocFile): do not put date and user name in linuxdoc
9997 * src/support/lyxlib.h (kill): change first argument to long int,
9998 since that's what solaris uses.
10000 * src/support/kill.C (kill): fix declaration to match prototype.
10002 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
10003 actually check whether namespaces are supported. This is not what
10006 * src/support/lyxsum.C: add a using directive.
10008 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10010 * src/support/kill.C: if we have namespace support we don't have
10011 to include lyxlib.h.
10013 * src/support/lyxlib.h: use namespace lyx if supported.
10015 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10017 * src/support/date.C: new file
10019 * src/support/chdir.C: new file
10021 * src/support/getUserName.C: new file
10023 * src/support/getcwd.C: new file
10025 * src/support/abort.C: new file
10027 * src/support/kill.C: new file
10029 * src/support/lyxlib.h: moved all the functions in this file
10030 insede struct lyx. Added also kill and abort to this struct. This
10031 is a way to avoid the "kill is not defined in <csignal>", we make
10032 C++ wrappers for functions that are not ANSI C or ANSI C++.
10034 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
10035 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
10036 lyx it has been renamed to sum.
10038 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10040 * src/text.C: add using directives for std::min and std::max.
10042 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10044 * src/texrow.C (getIdFromRow): actually return something useful in
10045 id and pos. Hopefully fixes the bug with positionning of errorbox
10048 * src/lyx_main.C (easyParse): output an error and exit if an
10049 incorrect command line option has been given.
10051 * src/spellchecker.C (ispell_check_word): document a memory leak.
10053 * src/bufferlist.C (write): fix mismatched allocation/deletion,
10054 where a "struct utimbuf" is allocated with "new" and deleted with
10057 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10059 * src/text2.C (CutSelection): don't delete double spaces.
10060 (PasteSelection): ditto
10061 (CopySelection): ditto
10063 * src/text.C (Backspace): don't delete double spaces.
10065 * src/lyxlex.C (next): fix a bug that were only present with
10066 conformant std::istream::get to read comment lines, use
10067 std::istream::getline instead. This seems to fix the problem.
10069 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10071 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
10072 allowed to insert space before space" editing problem. Please read
10073 commends at the beginning of the function. Comments about usage
10076 * src/text.C (InsertChar): fix for the "not allowed to insert
10077 space before space" editing problem.
10079 * src/text2.C (DeleteEmptyParagraphMechanism): when
10080 IsEmptyTableRow can only return false this last "else if" will
10081 always be a no-op. Commented out.
10083 * src/text.C (RedoParagraph): As far as I can understand tmp
10084 cursor is not really needed.
10086 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
10087 present it could only return false anyway.
10088 (several functions): Did something not so smart...added a const
10089 specifier on a lot of methods.
10091 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
10092 and add a tmp->text.resize. The LyXParagraph constructor does the
10094 (BreakParagraphConservative): ditto
10096 * src/support/path.h (Path): add a define so that the wrong usage
10097 "Path("/tmp") will be flagged as a compilation error:
10098 "`unnamed_Path' undeclared (first use this function)"
10100 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10102 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
10103 which was bogus for several reasons.
10105 * src/LaTeX.C (scanAux): fix the regular expression used to scan
10107 (runBibTeX): ditto.
10109 * autogen.sh: do not use "type -path" (what's that anyway?).
10111 * src/support/filetools.C (findtexfile): remove extraneous space
10112 which caused a kpsewhich warning (at least with kpathsea version
10115 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10117 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
10119 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
10121 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
10123 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10125 * src/paragraph.C (BreakParagraph): do not reserve space on text
10126 if we don't need to (otherwise, if pos_end < pos, we end up
10127 reserving huge amounts of memory due to bad unsigned karma).
10128 (BreakParagraphConservative): ditto, although I have not seen
10129 evidence the bug can happen here.
10131 * src/lyxparagraph.h: add a using std::list.
10133 2000-01-11 Juergen Vigna <jug@sad.it>
10135 * src/menus.C (MenuDocu): output an Alert if the documentation-file
10136 could not be found.
10138 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10140 * src/vc-backend.C (doVCCommand): change to be static and take one
10141 more parameter: the path to chdir too be fore executing the command.
10142 (retrive): new function equiv to "co -r"
10144 * src/bufferlist.C (loadLyXFile): implement the missing parts if
10145 file_not_found_hook is true.
10147 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
10149 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
10150 if a file is readwrite,readonly...anything else.
10152 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10154 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
10155 (CreatePostscript): name change from MenuRunDVIPS (or something)
10156 (PreviewPostscript): name change from MenuPreviewPS
10157 (PreviewDVI): name change from MenuPreviewDVI
10159 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10160 \view_pdf_command., \pdf_to_ps_command
10162 * lib/configure.m4: added search for PDF viewer, and search for
10163 PDF to PS converter.
10164 (lyxrc.defaults output): add \pdflatex_command,
10165 \view_pdf_command and \pdf_to_ps_command.
10167 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10169 * src/bufferlist.C (write): we don't use blocksize for anything so
10172 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10174 * src/support/block.h: disable operator T* (), since it causes
10175 problems with both compilers I tried. See comments in the file.
10177 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10180 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10181 variable LYX_DIR_10x to LYX_DIR_11x.
10183 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10185 * INSTALL: document --with-lyxname.
10188 * configure.in: new configure flag --with-lyxname which allows to
10189 choose the name under which lyx is installed. Default is "lyx", of
10190 course. It used to be possible to do this with --program-suffix,
10191 but the later has in fact a different meaning for autoconf.
10193 * src/support/lstrings.h (lstrchr): reformat a bit.
10195 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10196 * src/mathed/math_defs.h: ditto.
10198 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10200 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10201 true, decides if we create a backup file or not when saving. New
10202 tag and variable \pdf_mode, defaults to false. New tag and
10203 variable \pdflatex_command, defaults to pdflatex. New tag and
10204 variable \view_pdf_command, defaults to xpdf. New tag and variable
10205 \pdf_to_ps_command, defaults to pdf2ps.
10207 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10209 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10210 does not have a BufferView.
10211 (unlockInset): ditto + don't access the_locking_inset if the
10212 buffer does not have a BufferView.
10214 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10215 certain circumstances so that we don't continue a keyboard
10216 operation long after the key was released. Try f.ex. to load a
10217 large document, press PageDown for some seconds and then release
10218 it. Before this change the document would contine to scroll for
10219 some time, with this change it stops imidiatly.
10221 * src/support/block.h: don't allocate more space than needed. As
10222 long as we don't try to write to the arr[x] in a array_type arr[x]
10223 it is perfectly ok. (if you write to it you might segfault).
10224 added operator value_type*() so that is possible to pass the array
10225 to functions expecting a C-pointer.
10227 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10230 * intl/*: updated to gettext 0.10.35, tried to add our own
10231 required modifications. Please verify.
10233 * po/*: updated to gettext 0.10.35, tried to add our own required
10234 modifications. Please verify.
10236 * src/support/lstrings.C (tostr): go at fixing the problem with
10237 cxx and stringstream. When stringstream is used return
10238 oss.str().c_str() so that problems with lyxstring and basic_string
10239 are avoided. Note that the best solution would be for cxx to use
10240 basic_string all the way, but it is not conformant yet. (it seems)
10242 * src/lyx_cb.C + other files: moved several global functions to
10243 class BufferView, some have been moved to BufferView.[Ch] others
10244 are still located in lyx_cb.C. Code changes because of this. (part
10245 of "get rid of current_view project".)
10247 * src/buffer.C + other files: moved several Buffer functions to
10248 class BufferView, the functions are still present in buffer.C.
10249 Code changes because of this.
10251 * config/lcmessage.m4: updated to most recent. used when creating
10254 * config/progtest.m4: updated to most recent. used when creating
10257 * config/gettext.m4: updated to most recent. applied patch for
10260 * config/gettext.m4.patch: new file that shows what changes we
10261 have done to the local copy of gettext.m4.
10263 * config/libtool.m4: new file, used in creation of acinclude.m4
10265 * config/lyxinclude.m4: new file, this is the lyx created m4
10266 macros, used in making acinclude.m4.
10268 * autogen.sh: GNU m4 discovered as a separate task not as part of
10269 the lib/configure creation.
10270 Generate acinlucde from files in config. Actually cat
10271 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
10272 easier to upgrade .m4 files that really are external.
10274 * src/Spacing.h: moved using std::istringstream to right after
10275 <sstream>. This should fix the problem seen with some compilers.
10277 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10279 * src/lyx_cb.C: began some work to remove the dependency a lot of
10280 functions have on BufferView::text, even if not really needed.
10281 (GetCurrentTextClass): removed this func, it only hid the
10284 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
10285 forgot this in last commit.
10287 * src/Bullet.C (bulletEntry): use static char const *[] for the
10288 tables, becuase of this the return arg had to change to string.
10289 (bulletSize): ditto
10290 (~Bullet): removed unneeded destructor
10292 * src/BufferView.C (beforeChange): moved from lyx_cb.C
10293 (insetSleep): moved from Buffer
10294 (insetWakeup): moved from Buffer
10295 (insetUnlock): moved from Buffer
10297 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
10298 from Buffer to BufferView.
10300 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
10302 * config/ltmain.sh: updated to version 1.3.4 of libtool
10304 * config/ltconfig: updated to version 1.3.4 of libtool
10306 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10309 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
10310 Did I get that right?
10312 * src/lyxlex.h: add a "using" directive or two.
10313 * src/Spacing.h: ditto.
10314 * src/insets/figinset.C: ditto.
10315 * src/support/filetools.C: ditto.
10316 * src/support/lstrings.C: ditto.
10317 * src/BufferView.C: ditto.
10318 * src/bufferlist.C: ditto.
10319 * src/lyx_cb.C: ditto.
10320 * src/lyxlex.C: ditto.
10322 * NEWS: add some changes for 1.1.4.
10324 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10326 * src/BufferView.C: first go at a TextCache to speed up switching
10329 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10331 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
10332 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
10333 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
10334 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
10337 * src/mathed/math_defs.h (MathedRowSt): make sure that all
10338 members of the struct are correctly initialized to 0 (detected by
10340 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
10341 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
10343 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
10344 pidwait, since it was allocated with "new". This was potentially
10345 very bad. Thanks to Michael Schmitt for running purify for us.
10348 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10350 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
10352 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
10354 1999-12-30 Allan Rae <rae@lyx.org>
10356 * lib/templates/IEEEtran.lyx: minor change
10358 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
10359 src/mathed/formula.C (LocalDispatch): askForText changes
10361 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
10362 know when a user has cancelled input. Fixes annoying problems with
10363 inserting labels and version control.
10365 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10367 * src/support/lstrings.C (tostr): rewritten to use strstream and
10370 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10372 * src/support/filetools.C (IsFileWriteable): use fstream to check
10373 (IsDirWriteable): use fileinfo to check
10375 * src/support/filetools.h (FilePtr): whole class deleted
10377 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
10379 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
10381 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
10383 * src/bufferlist.C (write): use ifstream and ofstream instead of
10386 * src/Spacing.h: use istrstream instead of sscanf
10388 * src/mathed/math_defs.h: change first arg to istream from FILE*
10390 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
10392 * src/mathed/math_parser.C: have yyis to be an istream
10393 (LexGetArg): use istream (yyis)
10395 (mathed_parse): ditto
10396 (mathed_parser_file): first arg istream instead of FILE*, set yyis
10398 * src/mathed/formula.C (Read): rewritten to use istream
10400 * src/mathed/formulamacro.C (Read): rewritten to use istream
10402 * src/lyxlex.h (~LyXLex): deleted desturctor
10403 (getStream): new function, returns an istream
10404 (getFile): deleted funtion
10405 (IsOK): return is.good();
10407 * src/lyxlex.C (LyXLex): delete file and owns_file
10408 (setFile): open an filebuf and assign that to a istream instead of
10410 (setStream): new function, takes an istream as arg.
10411 (setFile): deleted function
10412 (EatLine): rewritten us use istream instead of FILE*
10416 * src/table.C (LyXTable): use istream instead of FILE*
10417 (Read): rewritten to take an istream instead of FILE*
10419 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10421 * src/buffer.C (Dispatch): remove an extraneous break statement.
10423 * src/support/filetools.C (QuoteName): change to do simple
10424 'quoting'. More work is necessary. Also changed to do nothing
10425 under emx (needs fix too).
10426 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
10428 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
10429 config.h.in to the AC_DEFINE_UNQUOTED() call.
10430 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
10431 needs char * as argument (because Solaris 7 declares it like
10434 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
10435 remove definition of BZERO.
10437 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10439 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
10440 defined, "lyxregex.h" if not.
10442 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
10444 (REGEX): new variable that is set to regex.c lyxregex.h when
10445 AM_CONDITIONAL USE_REGEX is set.
10446 (libsupport_la_SOURCES): add $(REGEX)
10448 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
10451 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
10454 * configure.in: add call to LYX_REGEX
10456 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
10457 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
10459 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10461 * lib/bind/fi_menus.bind: new file, from
10462 pauli.virtanen@saunalahti.fi.
10464 * src/buffer.C (getBibkeyList): pass the parameter delim to
10465 InsetInclude::getKeys and InsetBibtex::getKeys.
10467 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
10468 is passed to Buffer::getBibkeyList
10470 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
10471 instead of the hardcoded comma.
10473 * src/insets/insetbib.C (getKeys): make sure that there are not
10474 leading blanks in bibtex keys. Normal latex does not care, but
10475 harvard.sty seems to dislike blanks at the beginning of citation
10476 keys. In particular, the retturn value of the function is
10478 * INSTALL: make it clear that libstdc++ is needed and that gcc
10479 2.7.x probably does not work.
10481 * src/support/filetools.C (findtexfile): make debug message go to
10483 * src/insets/insetbib.C (getKeys): ditto
10485 * src/debug.C (showTags): make sure that the output is correctly
10488 * configure.in: add a comment for TWO_COLOR_ICON define.
10490 * acconfig.h: remove all the entries that already defined in
10491 configure.in or acinclude.m4.
10493 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
10494 to avoid user name, date and copyright.
10496 1999-12-21 Juergen Vigna <jug@sad.it>
10498 * src/table.C (Read): Now read bogus row format informations
10499 if the format is < 5 so that afterwards the table can
10500 be read by lyx but without any format-info. Fixed the
10501 crash we experienced when not doing this.
10503 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10505 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
10506 (RedoDrawingOfParagraph): ditto
10507 (RedoParagraphs): ditto
10508 (RemoveTableRow): ditto
10510 * src/text.C (Fill): rename arg paperwidth -> paper_width
10512 * src/buffer.C (insertLyXFile): rename var filename -> fname
10513 (writeFile): rename arg filename -> fname
10514 (writeFileAscii): ditto
10515 (makeLaTeXFile): ditto
10516 (makeLinuxDocFile): ditto
10517 (makeDocBookFile): ditto
10519 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
10522 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
10524 * src/bmtable.h: add extern "C" on this file when __cplusplus is
10527 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
10528 compiled by a C compiler not C++.
10530 * src/layout.h (LyXTextClass): added typedef for const_iterator
10531 (LyXTextClassList): added typedef for const_iterator + member
10532 functions begin and end.
10534 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
10535 iterators to fill the choice_class.
10536 (updateLayoutChoice): rewritten to use iterators to fill the
10537 layoutlist in the toolbar.
10539 * src/BufferView.h (BufferView::work_area_width): removed unused
10542 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
10544 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
10545 (sgmlCloseTag): ditto
10547 * src/support/lstrings.h: return type of countChar changed to
10550 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
10551 what version of this func to use. Also made to return unsigned int.
10553 * configure.in: call LYX_STD_COUNT
10555 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
10556 conforming std::count.
10558 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10560 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
10561 and a subscript would give bad display (patch from Dekel Tsur
10562 <dekel@math.tau.ac.il>).
10564 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
10566 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
10569 * src/chset.h: add a few 'using' directives
10571 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
10572 triggered when no buffer is active
10574 * src/layout.C: removed `break' after `return' in switch(), since
10577 * src/lyx_main.C (init): make sure LyX can be ran in place even
10578 when libtool has done its magic with shared libraries. Fix the
10579 test for the case when the system directory has not been found.
10581 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
10582 name for the latex file.
10583 (MenuMakeHTML): ditto
10585 * src/buffer.h: add an optional boolean argument, which is passed
10586 to ChangeExtension.
10588 1999-12-20 Allan Rae <rae@lyx.org>
10590 * lib/templates/IEEEtran.lyx: small correction and update.
10592 * configure.in: Attempted to use LYX_PATH_HEADER
10594 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
10596 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
10597 input from JMarc. Now use preprocessor to find the header.
10598 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
10599 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
10600 LYX_STL_STRING_FWD. See comments in file.
10602 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
10604 * The global MiniBuffer * minibuffer variable is dead.
10606 * The global FD_form_main * fd_form_main variable is dead.
10608 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10610 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
10612 * src/table.h: add the LOstream.h header
10613 * src/debug.h: ditto
10615 * src/LyXAction.h: change the explaination of the ReadOnly
10616 attribute: is indicates that the function _can_ be used.
10618 * src/LyXAction.C (init): find-replace _can_ be used in read-only
10621 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10623 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
10629 * src/paragraph.C (GetWord): assert on pos>=0
10632 * src/support/lyxstring.C: condition the use of an invariant on
10634 * src/support/lyxstring.h: ditto
10636 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
10637 Use LAssert.h instead of plain assert().
10639 * src/support/lstrings.h: add LAssert.h, in case it is needed.
10641 * src/lyxfunc.C: do not include LAssert.h, it is not used.
10642 * src/support/filetools.C: ditto
10644 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
10647 * INSTALL: document the new configure flags
10649 * configure.in: suppress --with-debug; add --enable-assertions
10651 * acinclude.m4: various changes in alignment of help strings.
10653 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10655 * src/kbmap.C: commented out the use of the hash map in kb_map,
10656 beginning of movement to a stl::container.
10658 * several files: removed code that was not in effect when
10659 MOVE_TEXT was defined.
10661 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
10662 for escaping should not be used. We can discuss if the string
10663 should be enclosed in f.ex. [] instead of "".
10665 * src/trans_mgr.C (insert): use the new returned value from
10666 encodeString to get deadkeys and keymaps done correctly.
10668 * src/chset.C (encodeString): changed to return a pair, to tell
10669 what to use if we know the string.
10671 * src/lyxscreen.h (fillArc): new function.
10673 * src/FontInfo.C (resize): rewritten to use more std::string like
10674 structore, especially string::replace.
10676 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
10679 * configure.in (chmod +x some scripts): remove config/gcc-hack
10681 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10683 * src/buffer.C (writeFile): change once again the top comment in a
10684 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
10685 instead of an hardcoded version number.
10686 (makeDocBookFile): ditto
10688 * src/version.h: add new define LYX_DOCVERSION
10690 * po/de.po: update from Pit Sütterlin
10691 * lib/bind/de_menus.bind: ditto.
10693 * src/lyxfunc.C (Dispatch): call MenuExport()
10694 * src/buffer.C (Dispatch): ditto
10696 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
10697 LyXFunc::Dispatch().
10698 (MenuExport): new function, moved from
10699 LyXFunc::Dispatch().
10701 * src/trans_mgr.C (insert): small cleanup
10702 * src/chset.C (loadFile): ditto
10704 * lib/kbd/iso8859-1.cdef: add missing backslashes
10706 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10708 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
10709 help with placing the manually drawn accents better.
10711 (Draw): x2 and hg changed to float to minimize rounding errors and
10712 help place the accents better.
10714 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
10715 unsigned short to char is just wrong...cast the char to unsigned
10716 char instead so that the two values can compare sanely. This
10717 should also make the display of insetlatexaccents better and
10718 perhaps also some other insets.
10720 (lbearing): new function
10723 1999-12-15 Allan Rae <rae@lyx.org>
10725 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
10726 header that provides a wrapper around the very annoying SGI STL header
10729 * src/support/lyxstring.C, src/LString.h:
10730 removed old SGI-STL-compatability attempts.
10732 * configure.in: Use LYX_STL_STRING_FWD.
10734 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
10735 stl_string_fwd.h is around and try to determine it's location.
10736 Major improvement over previous SGI STL 3.2 compatability.
10737 Three small problems remain with this function due to my zero
10738 knowledge of autoconf. JMarc and lgb see the comments in the code.
10740 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10742 * src/broken_const.h, config/hack-gcc, config/README: removed
10744 * configure.in: remove --with-gcc-hack option; do not call
10747 * INSTALL: remove documentation of --with-broken-const and
10750 * acconfig.h: remove all trace of BROKEN_CONST define
10752 * src/buffer.C (makeDocBookFile): update version number in output
10754 (SimpleDocBookOnePar): fix an assert when trying to a character
10755 access beyond string length
10758 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10760 * po/de.po: fix the Export menu
10762 * lyx.man: update the description of -dbg
10764 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
10765 (commandLineHelp): updated
10766 (easyParse): show list of available debug levels if -dbg is passed
10769 * src/Makefile.am: add debug.C
10771 * src/debug.h: moved some code to debug.C
10773 * src/debug.C: new file. Contains code to set and show debug
10776 * src/layout.C: remove 'break' after 'continue' in switch
10777 statements, since these cannot be reached.
10779 1999-12-13 Allan Rae <rae@lyx.org>
10781 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
10782 (in_word_set): hash() -> math_hash()
10784 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
10786 * acconfig.h: Added a test for whether we are using exceptions in the
10787 current compilation run. If so USING_EXCEPTIONS is defined.
10789 * config.in: Check for existance of stl_string_fwd.h
10790 * src/LString.h: If compiling --with-included-string and SGI's
10791 STL version 3.2 is present (see above test) we need to block their
10792 forward declaration of string and supply a __get_c_string().
10793 However, it turns out this is only necessary if compiling with
10794 exceptions enabled so I've a bit more to add yet.
10796 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
10797 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
10798 src/support/LRegex.h, src/undo.h:
10799 Shuffle the order of the included files a little to ensure that
10800 LString.h gets included before anything that includes stl_string_fwd.h
10802 * src/support/lyxstring.C: We need to #include LString.h instead of
10803 lyxstring.h to get the necessary definition of __get_c_string.
10804 (__get_c_string): New function. This is defined static just like SGI's
10805 although why they need to do this I'm not sure. Perhaps it should be
10806 in lstrings.C instead.
10808 * lib/templates/IEEEtran.lyx: New template file.
10810 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10812 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
10813 * intl/Makefile.in (MKINSTALLDIRS): ditto
10815 * src/LyXAction.C (init): changed to hold the LFUN data in a
10816 automatic array in stead of in callso to newFunc, this speeds up
10817 compilation a lot. Also all the memory used by the array is
10818 returned when the init is completed.
10820 * a lot of files: compiled with -Wold-style-cast, changed most of
10821 the reported offenders to C++ style casts. Did not change the
10822 offenders in C files.
10824 * src/trans.h (Match): change argument type to unsigned int.
10826 * src/support/DebugStream.C: fix some types on the streambufs so
10827 that it works on a conforming implementation.
10829 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10831 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
10833 * src/support/lyxstring.C: remove the inline added earlier since
10834 they cause a bunch of unsatisfied symbols when linking with dec
10835 cxx. Cxx likes to have the body of inlines at the place where they
10838 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
10839 accessing negative bounds in array. This fixes the crash when
10840 inserting accented characters.
10841 * src/trans.h (Match): ditto
10843 * src/buffer.C (Dispatch): since this is a void, it should not try
10844 to return anything...
10846 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10848 * src/buffer.h: removed the two friends from Buffer. Some changes
10849 because of this. Buffer::getFileName and Buffer::setFileName
10850 renamed to Buffer::fileName() and Buffer::fileName(...).
10852 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10854 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
10855 and Buffer::update(short) to BufferView. This move is currently
10856 controlled by a define MOVE_TEXT, this will be removed when all
10857 shows to be ok. This move paves the way for better separation
10858 between buffer contents and buffer view. One side effect is that
10859 the BufferView needs a rebreak when swiching buffers, if we want
10860 to avoid this we can add a cache that holds pointers to LyXText's
10861 that is not currently in use.
10863 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
10866 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10868 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
10870 * lyx_main.C: new command line option -x (or --execute) and
10871 -e (or --export). Now direct conversion from .lyx to .tex
10872 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
10873 Unfortunately, X is still needed and the GUI pops up during the
10876 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10878 * src/Spacing.C: add a using directive to bring stream stuff into
10880 * src/paragraph.C: ditto
10881 * src/buffer.C: ditto
10883 * NEWS: updated a bit the new features of 1.1.3 (took a few things
10884 from Lars' announcement).
10886 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
10887 example files from Tino Meinen.
10889 1999-12-06 Allan Rae <rae@lyx.org>
10891 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
10893 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10895 * src/support/lyxstring.C: added a lot of inline for no good
10898 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
10899 latexWriteEndChanges, they were not used.
10901 * src/layout.h (operator<<): output operator for PageSides
10903 * src/mathed/math_iter.C (my_memcpy): slightly changed.
10905 * some example files: loaded in LyX 1.0.4 and saved again to update
10906 certain constructs (table format)
10908 * a lot of files: did the change to use fstream/iostream for all
10909 writing of files. Done with a close look at Andre Poenitz's patch.
10911 * some files: whitespace changes.
10913 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10915 * src/mathed/math_iter.C (my_memcpy): new function. Since the
10916 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
10917 architecture, we provide our own. It is used unconditionnally, but
10918 I do not think this is a performance problem. Thanks to Angus
10919 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
10920 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
10922 (GetInset): use my_memcpy.
10926 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
10927 it is easier to understand, but it uses less TeX-only constructs now.
10929 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
10930 elements contain spaces
10932 * lib/configure: regenerated
10934 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
10935 elements contain spaces; display the list of programs that are
10938 * autogen.sh: make sure lib/configure is executable
10940 * lib/examples/*: rename the tutorial examples to begin with the
10941 two-letters language code.
10943 * src/lyxfunc.C (getStatus): do not query current font if no
10946 * src/lyx_cb.C (RunScript): use QuoteName
10947 (MenuRunDvips): ditto
10948 (PrintApplyCB): ditto
10950 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
10951 around argument, so that it works well with the current shell.
10952 Does not work properly with OS/2 shells currently.
10954 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
10955 * src/LyXSendto.C (SendtoApplyCB): ditto
10956 * src/lyxfunc.C (Dispatch): ditto
10957 * src/buffer.C (runLaTeX): ditto
10958 (runLiterate): ditto
10959 (buildProgram): ditto
10961 * src/lyx_cb.C (RunScript): ditto
10962 (MenuMakeLaTeX): ditto
10964 * src/buffer.h (getLatexName): new method
10966 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
10968 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10970 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
10971 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
10972 (create_math_panel): ditto
10974 * src/lyxfunc.C (getStatus): re-activate the code which gets
10975 current font and cursor; add test for export to html.
10977 * src/lyxrc.C (read): remove unreachable break statements; add a
10980 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
10982 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10984 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
10985 introduced by faulty regex.
10986 * src/buffer.C: ditto
10987 * src/lastfiles.C: ditto
10988 * src/paragraph.C: ditto
10989 * src/table.C: ditto
10990 * src/vspace.C: ditto
10991 * src/insets/figinset.C: ditto
10992 Note: most of these is absolutely harmless, except the one in
10993 src/mathed formula.C.
10995 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
10997 * src/ImportNoweb.C (documentclass): fixed bounds for substr
10998 operation, yielding correct results for the reLyX command.
11000 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11002 * src/support/filetools.C (ExpandPath): removed an over eager
11004 (ReplaceEnvironmentPath): ditto
11006 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
11007 shows that we are doing something fishy in our code...
11008 (BubblePost): ditto
11011 * src/lyxrc.C (read): use a double switch trick to get more help
11012 from the compiler. (the same trick is used in layout.C)
11013 (write): new function. opens a ofstream and pass that to output
11014 (output): new function, takes a ostream and writes the lyxrc
11015 elemts to it. uses a dummy switch to make sure no elements are
11018 * src/lyxlex.h: added a struct pushpophelper for use in functions
11019 with more than one exit point.
11021 * src/lyxlex.[Ch] (GetInteger): made it const
11025 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
11027 * src/layout.[hC] : LayoutTags splitted into several enums, new
11028 methods created, better error handling cleaner use of lyxlex. Read
11031 * src/bmtable.[Ch]: change some member prototypes because of the
11032 image const changes.
11034 * commandtags.h, src/LyXAction.C (init): new function:
11035 "preferences-save", saves the lyxrc entries into .lyx/preferences.
11036 This file is not read automatically but you can add \input
11037 preferences to your lyxrc if you want to. We need to discuss how
11040 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
11041 in .aux, also remove .bib and .bst files from dependencies when
11044 * src/BufferView.C, src/LyXView.C: add const_cast several places
11045 because of changes to images.
11047 * lib/images/*: same change as for images/*
11049 * lib/lyxrc.example: Default for accept_compound is false not no.
11051 * images/*: changed to be const, however I have som misgivings
11052 about this change so it might be changed back.
11054 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11056 * lib/configure, po/POTFILES.in: regenerated
11058 * autogen.sh: autogenerate lib/configure from lib/configure.m4
11060 * config/lib_configure.m4: removed
11062 * lib/configure.m4: new file (was config/lib_configure.m4)
11064 * configure.in: do not test for rtti, since we do not use it.
11066 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11068 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
11069 doubling of allocated space scheme. This makes it faster for large
11070 strings end to use less memory for small strings. xtra rememoved.
11072 * src/insets/figinset.C (waitalarm): commented out.
11073 (GhostscriptMsg): use static_cast
11074 (GhostscriptMsg): use new instead of malloc to allocate memory for
11075 cmap. also delete the memory after use.
11077 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
11079 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
11080 for changes in bibtex database or style.
11081 (runBibTeX): remove all .bib and .bst files from dep before we
11083 (run): use scanAuc in when dep file already exist.
11085 * src/DepTable.C (remove_files_with_extension): new method
11086 (exist): new method
11088 * src/DepTable.[Ch]: made many of the methods const.
11090 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11092 * src/bufferparams.C: make sure that the default textclass is
11093 "article". It used to be the first one by description order, but
11094 now the first one is "docbook".
11096 * src/lyx_main.C (setDebuggingLevel): change type of argument to
11097 string; call Debug::value.
11098 (easyParse): pass complete argument to setDebuggingLevel().
11100 * src/debug.h (value): fix the code that parses debug levels.
11102 * src/debug.h: add new debug type ACTION, reserved for LyXAction
11105 * src/LyXAction.C: use Debug::ACTION as debug channel.
11107 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
11109 * NEWS: updated for the future 1.1.3 release.
11111 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
11112 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
11113 it should. This is of course a controversial change (since many
11114 people will find that their lyx workscreen is suddenly full of
11115 red), but done for the sake of correctness.
11117 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
11118 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
11120 * src/insets/inseterror.h, src/insets/inseturl.h,
11121 src/insets/insetinfo.h, src/insets/figinset.h,
11122 src/mathed/formulamacro.h, src/mathed/math_macro.h
11123 (EditMessage): add a missing const and add _() to make sure that
11124 translation happens
11126 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
11127 src/insets/insetbib.C, src/support/filetools.C: add `using'
11128 directives for cxx.
11130 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
11131 doing 'Insert index of last word' at the beginning of a paragraph.
11133 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11135 * several files: white-space changes.
11137 * src/mathed/formula.C: removed IsAlpha and IsDigit
11139 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
11140 .bib file. use a ifstream instead of FilePtr when parsing the .bib
11143 * src/insets/figinset.C (GetPSSizes): don't break when
11144 "EndComments" is seen. But break when a boundingbox is read.
11146 * all classes inherited from Inset: return value of Clone
11147 changed back to Inset *.
11149 * all classes inherited form MathInset: return value of Clone
11150 changed back to MathedInset *.
11152 * src/insets/figinset.C (runqueue): use a ofstream to output the
11153 gs/ps file. Might need some setpresicion or setw. However I can
11154 see no problem with the current code.
11155 (runqueue): use sleep instead of the alarm/signal code. I just
11156 can't see the difference.
11158 * src/paragraph.C (LyXParagraph): reserve space in the new
11159 paragraph and resize the inserted paragraph to just fit.
11161 * src/lyxfunc.h (operator|=): added operator for func_status.
11163 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11164 check for readable file.
11166 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11167 check for readable file.
11168 (MenuMakeLinuxDoc): ditto
11169 (MenuMakeDocBook): ditto
11170 (MenuMakeAscii): ditto
11171 (InsertAsciiFile): split the test for openable and readable
11173 * src/bmtable.C (draw_bitmaptable): use
11174 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11176 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11177 findtexfile from LaTeX to filetools.
11179 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11180 instead of FilePtr. Needs to be verified by a literate user.
11182 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11184 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11185 (EditMessage): likewise.
11187 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11188 respectively as \textasciitilde and \textasciicircum.
11190 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11192 * src/support/lyxstring.h: made the methods that take iterators
11193 use const_iterator.
11195 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11196 (regexMatch): made is use the real regex class.
11198 * src/support/Makefile.am: changed to use libtool
11200 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11202 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11204 (MathIsInset ++): changed several macros to be inline functions
11207 * src/mathed/Makefile.am: changed to use libtool
11209 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11211 * src/insets/inset* : Clone changed to const and return type is
11212 the true insettype not just Inset*.
11214 * src/insets/Makefile.am: changed to use libtool
11216 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11218 * src/undo.[Ch] : added empty() and changed some of the method
11221 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11223 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11224 setID use block<> for the bullets array, added const several places.
11226 * src/lyxfunc.C (getStatus): new function
11228 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11229 LyXAction, added const to several funtions.
11231 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11232 a std::map, and to store the dir items in a vector.
11234 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11237 * src/LyXView.[Ch] + other files : changed currentView to view.
11239 * src/LyXAction.[Ch] : ported from the old devel branch.
11241 * src/.cvsignore: added .libs and a.out
11243 * configure.in : changes to use libtool.
11245 * acinclude.m4 : inserted libtool.m4
11247 * .cvsignore: added libtool
11249 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11251 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11252 file name in insets and mathed directories (otherwise the
11253 dependency is not taken in account under cygwin).
11255 * src/text2.C (InsertString[AB]): make sure that we do not try to
11256 read characters past the string length.
11258 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11260 * lib/doc/LaTeXConfig.lyx.in,
11261 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11263 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11264 file saying who created them and when this heppened; this is
11265 useless and annoys tools like cvs.
11267 * lib/layouts/g-brief-{en,de}.layout,
11268 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
11269 from Thomas Hartkens <thomas@hartkens.de>.
11271 * src/{insets,mathed}/Makefile.am: do not declare an empty
11272 LDFLAGS, so that it can be set at configure time (useful on Irix
11275 * lib/reLyX/configure.in: make sure that the prefix is set
11276 correctly in LYX_DIR.
11278 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11280 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11281 be used by 'command-sequence' this allows to bind a key to a
11282 sequence of LyX-commands
11283 (Example: 'command-sequence math-insert alpha; math-insert beta;")
11285 * src/LyXAction.C: add "command-sequence"
11287 * src/LyXFunction.C: handling of "command-sequence"
11289 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
11290 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
11292 * src/lyxserver.C, src/minibuffer.C: Use this new interface
11294 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11296 * src/buffer.C (writeFile): Do not output a comment giving user
11297 and date at the beginning of a .lyx file. This is useless and
11298 annoys cvs anyway; update version number to 1.1.
11300 * src/Makefile.am (LYX_DIR): add this definition, so that a
11301 default path is hardcoded in LyX.
11303 * configure.in: Use LYX_GNU_GETTEXT.
11305 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
11306 AM_GNU_GETTEXT with a bug fixed.
11308 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
11310 * src/chset.C: add "using std::ifstream;" to please dec cxx.
11312 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
11313 which is used to point to LyX data is now LYX_DIR_11x.
11315 * lyx.man: convert to a unix text file; small updates.
11317 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11319 * src/support/LSubstring.[Ch]: made the second arg of most of the
11320 constructors be a const reference.
11322 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
11325 * src/support/lyxstring.[Ch] (swap): added missing member function
11326 and specialization of swap(str, str);
11328 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
11330 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
11331 trace of the old one.
11333 * src/undo.[Ch]: made the undostack use std::list to store undo's in
11334 put the member definitions in undo.C.
11336 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
11337 NEW_TEXT and have now only code that was included when this was
11340 * src/intl.C (LCombo): use static_cast
11342 (DispatchCallback): ditto
11344 * src/definitions.h: removed whole file
11346 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
11348 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
11349 parsing and stores in a std:map. a regex defines the file format.
11350 removed unneeded members.
11352 * src/bufferparams.h: added several enums from definitions.h here.
11353 Removed unsused destructor. Changed some types to use proper enum
11354 types. use block to have the temp_bullets and user_defined_bullets
11355 and to make the whole class assignable.
11357 * src/bufferparams.C (Copy): removed this functions, use a default
11358 assignment instead.
11360 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
11363 * src/buffer.C (readLyXformat2): commend out all that have with
11364 oldpapersize to do. also comment out all that hve to do with
11365 insetlatex and insetlatexdel.
11366 (setOldPaperStuff): commented out
11368 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
11370 * src/LyXAction.C: remove use of inset-latex-insert
11372 * src/mathed/math_panel.C (button_cb): use static_cast
11374 * src/insets/Makefile.am (insets_o_SOURCES): removed
11377 * src/support/lyxstring.C (helper): use the unsigned long
11378 specifier, UL, instead of a static_cast.
11380 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
11382 * src/support/block.h: new file. to be used as a c-style array in
11383 classes, so that the class can be assignable.
11385 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11387 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
11388 NULL, make sure to return an empty string (it is not possible to
11389 set a string to NULL).
11391 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11393 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
11395 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
11397 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
11398 link line, so that Irix users (for example) can set it explicitely to
11401 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
11402 it can be overidden at make time (static or dynamic link, for
11405 * src/vc-backend.C, src/LaTeXFeatures.h,
11406 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
11407 statements to bring templates to global namespace.
11409 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11411 * src/support/lyxstring.C (operator[] const): make it standard
11414 * src/minibuffer.C (Init): changed to reflect that more
11415 information is given from the lyxvc and need not be provided here.
11417 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
11419 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
11421 * src/LyXView.C (UpdateTimerCB): use static_cast
11422 (KeyPressMask_raw_callback): ditto
11424 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
11425 buffer_, a lot of changes because of this. currentBuffer() ->
11426 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
11427 also changes to other files because of this.
11429 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11431 * src/vc-backend.[Ch]: new files. The backends for vc handling,
11432 have no support for RCS and partial support for CVS, will be
11435 * src/insets/ several files: changes because of function name
11436 changes in Bufferview and LyXView.
11438 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
11440 * src/support/LSubstring.[Ch]: new files. These implement a
11441 Substring that can be very convenient to use. i.e. is this
11443 string a = "Mary had a little sheep";
11444 Substring(a, "sheep") = "lamb";
11445 a is now "Mary has a little lamb".
11447 * src/support/LRegex.[Ch]: a regex class that can be used to pick
11448 out patterns and subpatterns of strings. It is used by LSubstring
11449 and also by vc-backend.C
11451 * src/support/lyxstring.C: went over all the assertions used and
11452 tried to correct the wrong ones and flag which of them is required
11453 by the standard. some bugs found because of this. Also removed a
11454 couple of assertions.
11456 * src/support/Makefile.am (libsupport_a_SOURCES): added
11457 LSubstring.[Ch] and LRegex.[Ch]
11459 * src/support/FileInfo.h: have struct stat buf as an object and
11460 not a pointer to one, some changes because of this.
11462 * src/LaTeXFeatures.C (getTClassPreamble): also use the
11463 information in layout when adding the layouts preamble to the
11464 textclass preamble.
11466 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
11469 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
11470 because of bug in OS/2.
11472 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11474 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
11475 \verbatim@font instead of \ttfamily, so that it can be redefined.
11477 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
11478 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
11479 src/layout.h, src/text2.C: add 'using' directive to bring the
11480 STL templates we need from the std:: namespace to the global one.
11481 Needed by DEC cxx in strict ansi mode.
11483 * src/support/LIstream.h,src/support/LOstream.h,
11484 src/support/lyxstring.h,src/table.h,
11485 src/lyxlookup.h: do not include <config.h> in header
11486 files. This should be done in the .C files only.
11488 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
11492 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11494 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
11495 from Kayvan to fix the tth invokation.
11497 * development/lyx.spec.in: updates from Kayvan to reflect the
11498 changes of file names.
11500 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11502 * src/text2.C (InsertStringB): use std::copy
11503 (InsertStringA): use std::copy
11505 * src/bufferlist.C: use a vector to store the buffers in. This is
11506 an internal change and should not affect any other thing.
11508 * src/BufferView.C (waitForX): use XSync instead of the lengthy
11511 * src/text.C (Fill): fix potential bug, one off bug.
11513 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11515 * src/Makefile.am (lyx_main.o): add more files it depends on.
11517 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
11519 * src/support/lyxstring.C: use size_t for the reference count,
11520 size, reserved memory and xtra.
11521 (internal_compare): new private member function. Now the compare
11522 functions should work for std::strings that have embedded '\0'
11524 (compare): all compare functions rewritten to use
11527 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11529 * src/support/lyxstring.C (compare): pass c_str()
11530 (compare): pass c_str
11531 (compare): pass c_str
11533 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11535 * src/support/DebugStream.C: <config.h> was not included correctly.
11537 * lib/configure: forgot to re-generate it :( I'll make this file
11538 auto generated soon.
11540 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11542 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
11545 * src/support/lyxstring.C: some changes from length() to rep->sz.
11546 avoids a function call.
11548 * src/support/filetools.C (SpaceLess): yet another version of the
11549 algorithm...now per Jean-Marc's suggestions.
11551 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11553 * src/layout.C (less_textclass_desc): functor for use in sorting
11555 (LyXTextClass::Read): sort the textclasses after reading.
11557 * src/support/filetools.C (SpaceLess): new version of the
11558 SpaceLess functions. What problems does this one give? Please
11561 * images/banner_bw.xbm: made the arrays unsigned char *
11563 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11565 * src/support/lyxstring.C (find): remove bogus assertion in the
11566 two versions of find where this has not been done yet.
11568 * src/support/lyxlib.h: add missing int return type to
11571 * src/menus.C (ShowFileMenu): disable exporting to html if no
11572 html export command is present.
11574 * config/lib_configure.m4: add a test for an HTML converter. The
11575 programs checked for are, in this order: tth, latex2html and
11578 * lib/configure: generated from config/lib_configure.m4.
11580 * src/lyxfunc.C (Dispatch): update and improve the execution of an
11581 html converter. The parameters are now passed through $$FName and
11582 $$OutName, instead of standard input/output.
11584 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
11586 * lib/lyxrc.example: update description of \html_command.
11587 add "quotes" around \screen_font_xxx font setting examples to help
11588 people who use fonts with spaces in their names.
11590 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11592 * Distribution files: updates for v1.1.2
11594 * src/support/lyxstring.C (find): remove bogus assert and return
11595 npos for the same condition.
11597 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11599 * added patch for OS/2 from SMiyata.
11601 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11603 * src/text2.C (CutSelection): make space_wrapped a bool
11604 (CutSelection): dont declare int i until we have to.
11605 (alphaCounter): return a char const *.
11607 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11609 * src/support/syscall.C (Systemcalls::kill):
11610 src/support/filetools.C (PutEnv, PutEnvPath):
11611 src/lyx_cb.C (addNewlineAndDepth):
11612 src/FontInfo.C (FontInfo::resize): condition some #warning
11613 directives with WITH_WARNINGS.
11616 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11618 * src/layout.[Ch] + several files: access to class variables
11619 limited and made accessor functions instead a lot of code changed
11620 becuase of this. Also instead of returning pointers often a const
11621 reference is returned instead.
11623 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
11625 * src/Makefile.am (dist-hook): added used to remove the CVS from
11626 cheaders upon creating a dist
11627 (EXTRA_DIST): added cheaders
11629 * src/support/lstrings.C (tostr(char)): fix it to handle param as
11630 a character not as a small integer.
11632 * src/support/lyxstring.C (find): removed Assert and added i >=
11633 rep->sz to the first if.
11635 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11637 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
11638 src/LyXView.C src/buffer.C src/bufferparams.C
11639 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
11640 src/text2.C src/insets/insetinclude.C:
11641 lyxlayout renamed to textclasslist.
11643 * src/layout.C: some lyxerr changes.
11645 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
11646 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
11647 (LyXLayoutList): removed all traces of this class.
11648 (LyXTextClass::Read): rewrote LT_STYLE
11649 (LyXTextClass::hasLayout): new function
11650 (LyXTextClass::GetLayout): rewritten to return an iterator + has
11651 both const and nonconst version.
11652 (LyXTextClass::delete_layout): new function.
11653 (LyXTextClassList::Style): bug fix. do the right thing if layout
11655 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
11656 (LyXTextClassList::NameOfLayout): ditto
11657 (LyXTextClassList::Load): ditto
11659 * src/buffer.C (makeLaTeXFile): new access to layoutlist
11661 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
11663 * src/LyXAction.C (LookupFunc): added a workaround for sun
11664 compiler, on the other hand...we don't know if the current code
11665 compiles on sun at all...
11667 * src/support/filetools.C (CleanupPath): subst fix
11669 * src/insets/insetbib.C (delDatabase): subst fix, this looks
11672 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
11673 complained about this one?
11675 * src/insets/insetinclude.C (Latex): subst fix
11677 * src/insets/insetbib.C (getKeys): subst fix
11679 * src/LyXSendto.C (SendtoApplyCB): subst fix
11681 * src/lyx_main.C (init): subst fix
11683 * src/layout.C (Read): subst fix
11685 * src/lyx_sendfax_main.C (button_send): subst fix
11687 * src/buffer.C (RoffAsciiTable): subst fix
11689 * src/lyx_cb.C (MenuFax): subst fix
11690 (PrintApplyCB): subst fix
11692 1999-10-26 Juergen Vigna <jug@sad.it>
11694 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
11696 (Read): Cleaned up this code so now we read only format vestion >= 5
11698 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11700 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
11701 come nobody has complained about this one?
11703 * src/insets/insetinclude.C (Latex): subst fix
11705 * src/insets/insetbib.C (getKeys): subst fix
11707 * src/lyx_main.C (init): subst fix
11709 * src/layout.C (Read): subst fix
11711 * src/buffer.C (RoffAsciiTable): subst fix
11713 * src/lyx_cb.C (MenuFax): subst fix.
11715 * src/layout.[hC] + some other files: rewrote to use
11716 std::container to store textclasses and layouts in.
11717 Simplified, removed a lot of code. Make all classes
11718 assignable. Further simplifications and review of type
11719 use still to be one.
11721 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
11722 lastfiles to create the lastfiles partr of the menu.
11724 * src/lastfiles.[Ch]: rewritten to use deque to store the
11725 lastfiles in. Uses fstream for reading and writing. Simplifies
11728 * src/support/syscall.C: remove explicit cast.
11730 * src/BufferView.C (CursorToggleCB): removed code snippets that
11731 were commented out.
11732 use explicat C++ style casts instead of C style casts. also use
11733 u_vdata instea of passing pointers in longs.
11735 * src/PaperLayout.C: removed code snippets that were commented out.
11737 * src/lyx_gui_misc.C: removed code snippets that were commented out.
11739 * src/lyx_main.C: removed code snippets that wer commented out.
11741 * src/paragraph.C: removed code snippets that were commented out.
11743 * src/lyxvc.C (logClose): use static_cast
11745 (viewLog): remove explicit cast to void*
11746 (showLog): removed old commented code
11748 * src/menus.C: use static_cast instead of C style casts. use
11749 u_vdata instead of u_ldata. remove explicit cast to (long) for
11750 pointers. Removed old code that was commented out.
11752 * src/insets/inset.C: removed old commented func
11754 * src/insets/insetref.C (InsetRef): removed old code that had been
11755 commented out for a long time.
11757 (escape): removed C style cast
11759 * src/insets/insetlatexaccent.C (Draw): removed old commented code
11761 * src/insets/insetlatex.C (Draw): removed old commented code
11762 (Read): rewritten to use string
11764 * src/insets/insetlabel.C (escape): removed C style cast
11766 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
11768 * src/insets/insetindex.C: use static_cast and u_vdata, removed
11769 old commented code.
11771 * src/insets/insetinclude.h: removed a couple of stupid bools
11773 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
11774 (Clone): remove C style cast
11775 (getKeys): changed list to lst because of std::list
11777 * src/insets/inseterror.C (Draw): removed som old commented code.
11779 * src/insets/insetcommand.C (Draw): removed some old commented code.
11781 * src/insets/insetbib.C (bibitem_cb): removed code that has been
11782 commented out forever.
11783 (bibitem_cb): use static_cast instead of C style cast
11784 use of vdata changed to u_vdata.
11786 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
11788 (CloseUrlCB): use static_cast instead of C style cast.
11789 (CloseUrlCB): added a fl_free form...it seemed to be missing.
11791 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
11792 (C_InsetInfo_CloseInfoCB): forward the ob parameter
11793 (CloseInfoCB): static_cast from ob->u_vdata instead.
11794 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
11797 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
11798 (C_InsetError_CloseErrorCB): forward the ob parameter
11799 (CloseErrorCB): static_cast from ob->u_vdata instead.
11801 * src/vspace.h: include LString.h since we use string in this class.
11803 * src/vspace.C (lyx_advance): changed name from advance because of
11804 nameclash with stl. And since we cannot use namespaces yet...I
11805 used a lyx_ prefix instead. Expect this to change when we begin
11808 * src/BufferView.[Ch] (BufferView::~BufferView): removed
11810 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
11811 and removed now defunct constructor and deconstructor.
11813 * src/BufferView.h: have backstack as a object not as a pointer.
11814 removed initialization from constructor. added include for BackStack
11816 * development/lyx.spec.in (%build): add CFLAGS also.
11818 * src/screen.C (drawFrame): removed another warning.
11820 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11822 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
11823 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
11824 README and ANNOUNCE a bit for the next release. More work is
11827 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
11828 unbreakable if we are in freespacing mode (LyX-Code), but not in
11831 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
11833 * src/BackStack.h: fixed initialization order in constructor
11835 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
11837 * acinclude.m4 (VERSION): new rules for when a version is
11838 development, added also a variable for prerelease.
11839 (warnings): we set with_warnings=yes for prereleases
11840 (lyx_opt): prereleases compile with same optimization as development
11841 (CXXFLAGS): only use pedantic if we are a development version
11843 * src/BufferView.C (restorePosition): don't do anything if the
11844 backstack is empty.
11846 * src/BackStack.h: added member empty, use this to test if there
11847 is anything to pop...
11849 1999-10-25 Juergen Vigna <jug@sad.it>
11852 * forms/layout_forms.fd +
11853 * forms/latexoptions.fd +
11854 * lyx.fd: changed for various form resize issues
11856 * src/mathed/math_panel.C +
11857 * src/insets/inseterror.C +
11858 * src/insets/insetinfo.C +
11859 * src/insets/inseturl.C +
11860 * src/insets/inseturl.h +
11862 * src/LyXSendto.C +
11863 * src/PaperLayout.C +
11864 * src/ParagraphExtra.C +
11865 * src/TableLayout.C +
11867 * src/layout_forms.C +
11874 * src/menus.C: fixed various resize issues. So now forms can be
11875 resized savely or not be resized at all.
11877 * forms/form_url.fd +
11878 * src/insets/form_url.[Ch]: added because it's cleaner and easier
11881 * src/insets/Makefile.am: added files form_url.[Ch]
11883 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11885 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
11886 (and presumably 6.2).
11888 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
11889 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
11890 remaining static member callbacks.
11892 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
11895 * src/support/lyxstring.h: declare struct Srep as friend of
11896 lyxstring, since DEC cxx complains otherwise.
11898 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11900 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11902 * src/LaTeX.C (run): made run_bibtex also depend on files with
11904 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
11905 are put into the dependency file.
11907 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
11908 the code has shown itself to work
11909 (create_ispell_pipe): removed another warning, added a comment
11912 * src/minibuffer.C (ExecutingCB): removed code that has been
11913 commented out a long time
11915 * src/lyxfunc.C (processKeyEvent): removed some very old commented
11916 out code + a warning.
11918 * src/support/lyxstring.h: comment out the three private
11919 operators, when compiling with string ansi conforming compilers
11920 they make problems.
11922 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
11924 (pixmapFromBitmapData): change type of bdata to be unsigned char *
11925 (pixmapFromBitmapData): add a reinterpret_cast in the call to
11928 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
11931 * src/mathed/math_panel.C (create_math_panel): remove explicit
11934 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
11937 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
11938 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
11939 to XCreatePixmapFromBitmapData
11940 (fl_set_bmtable_data): change the last argument to be unsigned
11942 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
11943 and bh to be unsigned int, remove explicit casts in call to
11944 XReadBitmapFileData.
11946 * images/arrows.xbm: made the arrays unsigned char *
11947 * images/varsz.xbm: ditto
11948 * images/misc.xbm: ditto
11949 * images/greek.xbm: ditto
11950 * images/dots.xbm: ditto
11951 * images/brel.xbm: ditto
11952 * images/bop.xbm: ditto
11954 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
11956 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
11957 (LYX_PROG_CXX): added -pedantic to g++ compile options when
11958 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
11960 (LYX_CXX_CHEADERS): added <clocale> to the test.
11962 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
11964 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
11966 * src/support/lyxstring.C (append): fixed something that must be a
11967 bug, rep->assign was used instead of rep->append.
11969 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
11972 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
11973 lyx insert double chars. Fix spotted by Kayvan.
11975 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11977 * Fixed the tth support. I messed up with the Emacs patch apply feature
11978 and omitted the changes in lyxrc.C.
11980 1999-10-22 Juergen Vigna <jug@sad.it>
11982 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
11984 * src/lyx_cb.C (MenuInsertRef) +
11985 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
11986 the form cannot be resized under it limits (fixes a segfault)
11988 * src/lyx.C (create_form_form_ref) +
11989 * forms/lyx.fd: Changed Gravity on name input field so that it is
11992 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11994 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
11995 <ostream> and <istream>.
11997 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
11998 whether <fstream> provides the latest standard features, or if we
11999 have an oldstyle library (like in egcs).
12000 (LYX_CXX_STL_STRING): fix the test.
12002 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
12003 code on MODERN_STL_STREAM.
12005 * src/support/lyxstring.h: use L{I,O}stream.h.
12007 * src/support/L{I,O}stream.h: new files, designed to setup
12008 correctly streams for our use
12009 - includes the right header depending on STL capabilities
12010 - puts std::ostream and std::endl (for LOStream.h) or
12011 std::istream (LIStream.h) in toplevel namespace.
12013 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12015 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
12016 was a bib file that had been changed we ensure that bibtex is run.
12017 (runBibTeX): enhanced to extract the names of the bib files and
12018 getting their absolute path and enter them into the dep file.
12019 (findtexfile): static func that is used to look for tex-files,
12020 checks for absolute patchs and tries also with kpsewhich.
12021 Alternative ways of finding the correct files are wanted. Will
12023 (do_popen): function that runs a command using popen and returns
12024 the whole output of that command in a string. Should be moved to
12027 * src/DepTable.[Ch] (extchanged): new function that returns true if a
12028 file with extension ext has changed.
12030 * src/insets/figinset.C: added ifdef guards around the fl_free
12031 code that jug commented out. Now it is commented out when
12032 compiling with XForms == 0.89.
12034 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
12035 to lyxstring.C, and only keep a forward declaration in
12036 lyxstring.h. Simplifies the header file a bit and should help a
12037 bit on compile time too. Also changes to Srep will not mandate a
12038 recompile of code just using string.
12039 (~lyxstring): definition moved here since it uses srep.
12040 (size): definition moved here since it uses srep.
12042 * src/support/lyxstring.h: removed a couple of "inline" that should
12045 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12047 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
12050 1999-10-21 Juergen Vigna <jug@sad.it>
12052 * src/table.C (SetPWidth): Just a small fix so the alignment is not
12053 set to left if I just remove the width entry (or it is empty).
12055 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
12056 paragraph when having dummy paragraphs.
12058 1999-10-20 Juergen Vigna <jug@sad.it>
12060 * src/insets/figinset.C: just commented some fl_free_form calls
12061 and added warnings so that this calls should be activated later
12062 again. This avoids for now a segfault, but we have a memory leak!
12064 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
12065 'const char * argument' to 'string argument', this should
12066 fix some Asserts() in lyxstring.C.
12068 * src/lyxfunc.h: Removed the function argAsString(const char *)
12069 as it is not used anymore.
12071 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
12073 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
12076 * src/Literate.h: some funcs moved from public to private to make
12077 interface clearer. Unneeded args removed.
12079 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
12081 (scanBuildLogFile): ditto
12083 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
12084 normal TeX Error. Still room for improvement.
12086 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
12088 * src/buffer.C (insertErrors): changes to make the error
12089 desctription show properly.
12091 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
12094 * src/support/lyxstring.C (helper): changed to use
12095 sizeof(object->rep->ref).
12096 (operator>>): changed to use a pointer instead.
12098 * src/support/lyxstring.h: changed const reference & to value_type
12099 const & lets see if that helps.
12101 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
12103 * Makefile.am (rpmdist): fixed to have non static package and
12106 * src/support/lyxstring.C: removed the compilation guards
12108 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
12111 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
12112 conditional compile of lyxstring.Ch
12114 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
12115 stupid check, but it is a lot better than the bastring hack.
12116 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
12118 * several files: changed string::erase into string::clear. Not
12121 * src/chset.C (encodeString): use a char temporary instead
12123 * src/table.C (TexEndOfCell): added tostr around
12124 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
12125 (TexEndOfCell): ditto
12126 (TexEndOfCell): ditto
12127 (TexEndOfCell): ditto
12128 (DocBookEndOfCell): ditto
12129 (DocBookEndOfCell): ditto
12130 (DocBookEndOfCell): ditto
12131 (DocBookEndOfCell): ditto
12133 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
12135 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
12137 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
12138 (MenuBuildProg): added tostr around ret
12139 (MenuRunChktex): added tostr around ret
12140 (DocumentApplyCB): added tostr around ret
12142 * src/chset.C (encodeString): added tostr around t->ic
12144 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
12145 (makeLaTeXFile): added tostr around tocdepth
12146 (makeLaTeXFile): added tostr around ftcound - 1
12148 * src/insets/insetbib.C (setCounter): added tostr around counter.
12150 * src/support/lyxstring.h: added an operator+=(int) to catch more
12153 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
12154 (lyxstring): We DON'T allow NULL pointers.
12156 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12158 * src/mathed/math_macro.C (MathMacroArgument::Write,
12159 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12160 when writing them out.
12162 * src/LString.C: remove, since it is not used anymore.
12164 * src/support/lyxstring.C: condition the content to
12165 USE_INCLUDED_STRING macro.
12167 * src/mathed/math_symbols.C, src/support/lstrings.C,
12168 src/support/lyxstring.C: add `using' directive to specify what
12169 we need in <algorithm>. I do not think that we need to
12170 conditionalize this, but any thought is appreciated.
12172 * many files: change all callback functions to "C" linkage
12173 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12174 strict_ansi. Those who were static are now global.
12175 The case of callbacks which are static class members is
12176 trickier, since we have to make C wrappers around them (see
12177 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12178 did not finish this yet, since it defeats the purpose of
12179 encapsulation, and I am not sure what the best route is.
12181 1999-10-19 Juergen Vigna <jug@sad.it>
12183 * src/support/lyxstring.C (lyxstring): we permit to have a null
12184 pointer as assignment value and just don't assign it.
12186 * src/vspace.C (nextToken): corrected this function substituting
12187 find_first(_not)_of with find_last_of.
12189 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12190 (TableOptCloseCB) (TableSpeCloseCB):
12191 inserted fl_set_focus call for problem with fl_hide_form() in
12194 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12196 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12199 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12201 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12202 LyXLex::next() and not eatline() to get its argument.
12204 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12206 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12207 instead, use fstreams for io of the depfile, removed unneeded
12208 functions and variables.
12210 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12211 vector instead, removed all functions and variables that is not in
12214 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12216 * src/buffer.C (insertErrors): use new interface to TeXError
12218 * Makefile.am (rpmdist): added a rpmdist target
12220 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12221 per Kayvan's instructions.
12223 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12225 * src/Makefile.am: add a definition for localedir, so that locales
12226 are found after installation (Kayvan)
12228 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12230 * development/.cvsignore: new file.
12232 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12234 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12235 C++ compiler provides wrappers for C headers and use our alternate
12238 * configure.in: use LYX_CXX_CHEADERS.
12240 * src/cheader/: new directory, populated with cname headers from
12241 libstdc++-2.8.1. They are a bit old, but probably good enough for
12242 what we want (support compilers who lack them).
12244 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12245 from includes. It turns out is was stupid.
12247 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12249 * lib/Makefile.am (install-data-local): forgot a ';'
12250 (install-data-local): forgot a '\'
12251 (libinstalldirs): needed after all. reintroduced.
12253 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12255 * configure.in (AC_OUTPUT): added lyx.spec
12257 * development/lyx.spec: removed file
12259 * development/lyx.spec.in: new file
12261 * po/*.po: merged with lyx.pot becuase of make distcheck
12263 * lib/Makefile.am (dist-hook): added dist-hook so that
12264 documentation files will be included when doing a make
12265 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12266 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
12268 more: tried to make install do the right thing, exclude CVS dirs
12271 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
12272 Path would fit in more nicely.
12274 * all files that used to use pathstack: uses now Path instead.
12275 This change was a lot easier than expected.
12277 * src/support/path.h: new file
12279 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12281 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12283 * src/support/lyxstring.C (getline): Default arg was given for
12286 * Configure.cmd: removed file
12288 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12290 * src/support/DebugStream.[Ch]: remove the explicit std:: before
12291 streams classes and types, add the proper 'using' statements when
12292 MODERN_STL is defined.
12294 * src/debug.h: move the << operator definition after the inclusion
12297 * src/support/filetools.C: include "LAssert.h", which is needed
12300 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
12303 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
12304 include "debug.h" to define a proper ostream.
12306 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12308 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
12309 method to the SystemCall class which can kill a process, but it's
12310 not fully implemented yet.
12312 * src/*.C: Changed Systemcalls::Startscript() to startscript()
12314 * src/support/FileInfo.h: Better documentation
12316 * src/lyxfunc.C: Added support for buffer-export html
12318 * src/menus.C: Added Export->As HTML...
12320 * lib/bind/*.bind: Added short-cut for buffer-export html
12322 * src/lyxrc.*: Added support for new \tth_command
12324 * lib/lyxrc.example: Added stuff for new \tth_command
12326 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
12328 * lib/Makefile.am (IMAGES): removed images/README
12329 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
12330 installes in correct place. Check permisions is installed
12333 * src/LaTeX.C: some no-op changes moved declaration of some
12336 * src/LaTeX.h (LATEX_H): changed include guard name
12338 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12340 * lib/reLyX/Makefile.am: install noweb2lyx.
12342 * lib/Makefile.am: install configure.
12344 * lib/reLyX/configure.in: declare a config aux dir; set package
12345 name to lyx (not sure what the best solution is); generate noweb2lyx.
12347 * lib/layouts/egs.layout: fix the bibliography layout.
12349 1999-10-08 Jürgen Vigna <jug@sad.it>
12351 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
12352 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
12353 it returned without continuing to search the path.
12355 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
12357 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
12358 also fixes a bug. It is not allowed to do tricks with std::strings
12359 like: string a("hei"); &a[e]; this will not give what you
12360 think... Any reason for the complexity in this func?
12362 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
12364 * Updated README and INSTALL a bit, mostly to check that my
12365 CVS rights are correctly set up.
12367 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
12369 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
12370 does not allow '\0' chars but lyxstring and std::string does.
12372 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12374 * autogen.sh (AUTOCONF): let the autogen script create the
12375 POTFILES.in file too. POTFILES.in should perhaps now not be
12376 included in the cvs module.
12378 * some more files changed to use C++ includes instead of C ones.
12380 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
12382 (Reread): added tostr to nlink. buggy output otherwise.
12383 (Reread): added a string() around szMode when assigning to Buffer,
12384 without this I got a log of garbled info strings.
12386 * acconfig.h: commented out the PTR_AS_INT macros. They should not
12389 * I have added several ostream & operator<<(ostream &, some_type)
12390 functions. This has been done to avoid casting and warnings when
12391 outputting enums to lyxerr. This as thus eliminated a lot of
12392 explicit casts and has made the code clearer. Among the enums
12393 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
12394 mathed enums, some font enum the Debug::type enum.
12396 * src/support/lyxstring.h (clear): missing method. equivalent of
12399 * all files that contained "stderr": rewrote constructs that used
12400 stderr to use lyxerr instead. (except bmtable)
12402 * src/support/DebugStream.h (level): and the passed t with
12403 Debug::ANY to avoid spurious bits set.
12405 * src/debug.h (Debug::type value): made it accept strings of the
12406 type INFO,INIT,KEY.
12408 * configure.in (Check for programs): Added a check for kpsewhich,
12409 the latex generation will use this later to better the dicovery of
12412 * src/BufferView.C (create_view): we don't need to cast this to
12413 (void*) that is done automatically.
12414 (WorkAreaButtonPress): removed some dead code.
12416 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12418 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
12419 is not overwritten when translated (David Sua'rez de Lis).
12421 * lib/CREDITS: Added David Sua'rez de Lis
12423 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
12425 * src/bufferparams.C (BufferParams): default input encoding is now
12428 * acinclude.m4 (cross_compiling): comment out macro
12429 LYX_GXX_STRENGTH_REDUCE.
12431 * acconfig.h: make sure that const is not defined (to empty) when
12432 we are compiling C++. Remove commented out code using SIZEOF_xx
12435 * configure.in : move the test for const and inline as late as
12436 possible so that these C tests do not interefere with C++ ones.
12437 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
12438 has not been proven.
12440 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12442 * src/table.C (getDocBookAlign): remove bad default value for
12443 isColumn parameter.
12445 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
12447 (ShowFileMenu2): ditto.
12449 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
12450 of files to ignore.
12452 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12454 * Most files: finished the change from the old error code to use
12455 DebugStream for all lyxerr debugging. Only minor changes remain
12456 (e.g. the setting of debug levels using strings instead of number)
12458 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12460 * src/layout.C (Add): Changed to use compare_no_case instead of
12463 * src/FontInfo.C: changed loop variable type too string::size_type.
12465 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12467 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
12468 set ETAGS_ARGS to --c++
12470 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
12472 * src/table.C (DocBookEndOfCell): commented out two unused variables
12474 * src/paragraph.C: commented out four unused variables.
12476 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
12477 insed a if clause with type string::size_type.
12479 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
12482 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
12484 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
12485 variable, also changed loop to go from 0 to lenght + 1, instead of
12486 -1 to length. This should be correct.
12488 * src/LaTeX.C (scanError): use string::size_type as loop variable
12491 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
12492 (l.896) since y_tmp and row was not used anyway.
12494 * src/insets/insetref.C (escape): use string::size_type as loop
12497 * src/insets/insetquotes.C (Width): use string::size_type as loop
12499 (Draw): use string::size_type as loop variable type.
12501 * src/insets/insetlatexaccent.C (checkContents): use
12502 string::size_type as loop variable type.
12504 * src/insets/insetlabel.C (escape): use string::size_type as loop
12507 * src/insets/insetinfo.C: added an extern for current_view.
12509 * src/insets/insetcommand.C (scanCommand): use string::size_type
12510 as loop variable type.
12512 * most files: removed the RCS tags. With them we had to recompile
12513 a lot of files after a simple cvs commit. Also we have never used
12514 them for anything meaningful.
12516 * most files: tags-query-replace NULL 0. As adviced several plases
12517 we now use "0" instead of "NULL" in our code.
12519 * src/support/filetools.C (SpaceLess): use string::size_type as
12520 loop variable type.
12522 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12524 * src/paragraph.C: fixed up some more string stuff.
12526 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12528 * src/support/filetools.h: make modestr a std::string.
12530 * src/filetools.C (GetEnv): made ch really const.
12532 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
12533 made code that used these use max/min from <algorithm> instead.
12535 * changed several c library include files to their equivalent c++
12536 library include files. All is not changed yet.
12538 * created a support subdir in src, put lyxstring and lstrings
12539 there + the extra files atexit, fileblock, strerror. Created
12540 Makefile.am. edited configure.in and src/Makefile.am to use this
12541 new subdir. More files moved to support.
12543 * imported som of the functions from repository lyx, filetools
12545 * ran tags-query-replace on LString -> string, corrected the bogus
12546 cases. Tried to make use of lstrings.[hC], debugged a lot. There
12547 is still some errors in there. This is errors where too much or
12548 too litle get deleted from strings (string::erase, string::substr,
12549 string::replace), there can also be some off by one errors, or
12550 just plain wrong use of functions from lstrings. Viewing of quotes
12553 * LyX is now running fairly well with string, but there are
12554 certainly some bugs yet (see above) also string is quite different
12555 from LString among others in that it does not allow null pointers
12556 passed in and will abort if it gets any.
12558 * Added the revtex4 files I forgot when setting up the repository.
12560 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12562 * All over: Tried to clean everything up so that only the files
12563 that we really need are included in the cvs repository.
12564 * Switched to use automake.
12565 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
12566 * Install has not been checked.
12568 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12570 * po/pt.po: Three errors:
12571 l.533 and l.538 format specification error
12572 l. 402 duplicate entry, I just deleted it.