1 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
4 * src/mathed/math_cursor.C (IsAlpha): ditto.
5 * src/mathed/math_inset.C (strnew): ditto.
6 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
7 (IMetrics): cxp set but never used; removed.
8 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
9 that the variable in question has been removed also!
12 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
13 using the Buffer * passed to Latex(), using the BufferView * passed to
14 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
16 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
17 Linuxdoc() and DocBook() rather than the stored Buffer * master.
19 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
20 * src/buffer.C (readInset): used new InsetBibtex c-tor
21 * (getBibkeyList): used new InsetBibtex::getKeys
23 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
26 * lib/build-listerrors
28 * src/exporter.C: Add literate programming support to the export code
31 * src/lyx_cb.C: Remove old literate code.
33 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
36 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
37 * src/converter.C (View, Convert): Use QuoteName.
39 * src/insets/figinset.C (Preview): Use Formats::View.
41 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
43 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
45 * src/lyxfunc.C (Dispatch): move declaration of text variable at
46 the top of the function, because compaq cxx complains that the
47 "goto exit_with_message" when the function is disabled bypasses
49 (MenuNew): try a better fix for the generation of new file names.
50 This time, I used AddName() instead of AddPath(), hoping Juergen
53 2000-10-03 Allan Rae <rae@lyx.org>
55 * src/frontends/xforms/forms/form_preferences.fd:
56 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
57 nested tabfolders has begun. The old "Miscellaneous" was renamed as
58 "Look and Feel"->"General" but will need to be split up further into
59 general output and general input tabs. Current plan is for four outer
60 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
61 stuff; "Inputs" for input and import configuration; "Outputs" for
62 output and export configuration; and one more whatever is left over
63 called "General". The leftovers at present look like being which
64 viewers to use, spellchecker, language support and might be better
65 named "Support". I've put "Paths" in "Inputs" for the moment as this
66 seems reasonable for now at least.
67 One problem remains: X error kills LyX when you close Preferences.
69 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
71 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
73 * src/frontends/xforms/FormCitation.[Ch]:
74 * src/frontends/xforms/FormCopyright.[Ch]:
75 * src/frontends/xforms/FormDocument.[Ch]:
76 * src/frontends/xforms/FormError.[Ch]:
77 * src/frontends/xforms/FormIndex.[Ch]:
78 * src/frontends/xforms/FormPreferences.[Ch]:
79 * src/frontends/xforms/FormPrint.[Ch]:
80 * src/frontends/xforms/FormRef.[Ch]:
81 * src/frontends/xforms/FormToc.[Ch]:
82 * src/frontends/xforms/FormUrl.[Ch]: ditto.
84 * src/frontends/xforms/FormCitation.[Ch]:
85 * src/frontends/xforms/FormIndex.[Ch]:
86 * src/frontends/xforms/FormRef.[Ch]:
87 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
88 with Allan's naming policy
90 * src/frontends/xforms/FormCitation.C: some static casts to remove
93 2000-10-02 Juergen Vigna <jug@sad.it>
95 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
96 now you can type or do stuff inside the table-cell also when in dummy
97 position, fixed visible cursor.
99 * src/insets/insettext.C (Edit): fixing cursor-view position.
101 * src/lyxfunc.C (Dispatch): use * text variable so that it can
102 be used for equal functions in lyxfunc and insettext.
104 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
106 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
108 * src/frontends/gnome/FormCitation.h:
109 * src/frontends/gnome/FormCopyright.h:
110 * src/frontends/gnome/FormIndex.h:
111 * src/frontends/gnome/FormPrint.h:
112 * src/frontends/gnome/FormToc.h:
113 * src/frontends/gnome/FormUrl.h:
114 * src/frontends/kde/FormCitation.h:
115 * src/frontends/kde/FormCopyright.h:
116 * src/frontends/kde/FormIndex.h:
117 * src/frontends/kde/FormRef.h:
118 * src/frontends/kde/FormToc.h:
119 * src/frontends/kde/FormUrl.h: fix remaining users of
122 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
124 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
126 (DocBookHandleCaption): ditto.
127 (DocBookHandleFootnote): ditto.
128 (SimpleDocBookOnePar): ditto.
130 * src/frontends/xforms/FormDocument.h (form): remove extra
131 FormDocument:: qualifier.
133 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
135 * sigc++/handle.h: ditto.
137 * src/lyx_gui_misc.C: add "using" directive.
139 * src/cheaders/cstddef: new file, needed by the boost library (for
142 2000-10-02 Juergen Vigna <jug@sad.it>
144 * src/insets/insettext.C (SetFont): better support.
146 * src/insets/insettabular.C (draw): fixed drawing of single cell.
148 * src/screen.C (DrawOneRow): some uint refixes!
150 2000-10-02 Allan Rae <rae@lyx.org>
152 * boost/.cvsignore: ignore Makefile as well
154 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
155 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
157 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
158 Left this one out by accident.
160 * src/frontends/xforms/FormBase.h (restore): default to calling
161 update() since that will restore the original/currently-applied values.
162 Any input() triggered error messages will require the derived classes
163 to redefine restore().
165 * src/frontends/xforms/FormDocument.C: initialize a few variables to
166 avoid a segfault. combo_doc_class is the main concern.
168 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
170 * Simplify build-listerrors in view of GUI-less export ability!
172 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
174 * src/lyx_main.C (easyParse): Disable gui when exporting
176 * src/insets/figinset.C:
180 * src/tabular.C: Changes to allow no-gui.
182 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
184 * src/support/utility.hpp: removed file
185 * src/support/block.h: removed file
187 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
190 * src/mathed/formula.C: add support/lyxlib.h
191 * src/mathed/formulamacro.C: ditto
193 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
194 * src/lyxparagraph.h: ditto
196 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
197 * src/frontends/Makefile.am (INCLUDES): ditto
198 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
199 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
200 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
201 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
202 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
203 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
205 * src/BufferView.h: use boost/utility.hpp
206 * src/LColor.h: ditto
208 * src/LyXAction.h: ditto
209 * src/LyXView.h: ditto
210 * src/bufferlist.h: ditto
211 * src/lastfiles.h: ditto
212 * src/layout.h: ditto
213 * src/lyx_gui.h: ditto
214 * src/lyx_main.h: ditto
215 * src/lyxlex.h: ditto
217 * src/frontends/ButtonPolicies.h: ditto
218 * src/frontends/Dialogs.h: ditto
219 * src/frontends/xforms/FormBase.h: ditto
220 * src/frontends/xforms/FormGraphics.h: ditto
221 * src/frontends/xforms/FormParagraph.h: ditto
222 * src/frontends/xforms/FormTabular.h: ditto
223 * src/graphics/GraphicsCache.h: ditto
224 * src/graphics/Renderer.h: ditto
225 * src/insets/ExternalTemplate.h: ditto
226 * src/insets/insetcommand.h: ditto
227 * src/support/path.h: ditto
229 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
230 and introduce clause for 2.97.
232 * boost/libs/README: new file
234 * boost/boost/utility.hpp: new file
236 * boost/boost/config.hpp: new file
238 * boost/boost/array.hpp: new file
240 * boost/Makefile.am: new file
242 * boost/.cvsignore: new file
244 * configure.in (AC_OUTPUT): add boost/Makefile
246 * Makefile.am (SUBDIRS): add boost
248 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
250 * src/support/lstrings.C (suffixIs): Fixed.
252 2000-10-01 Allan Rae <rae@lyx.org>
254 * src/PrinterParams.h: moved things around to avoid the "can't
255 inline call" warning.
257 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
258 into doc++ documentation.
260 * src/frontends/xforms/FormCommand.[Ch]: support button policy
262 * src/frontends/xforms/FormRef.C: make use of button controller
263 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
264 cleaned up button controller usage.
265 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
266 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
267 use the button controller
269 * src/frontends/xforms/forms/*.fd: and associated generated files
270 updated to reflect changes to FormBase. Some other FormXxxx files
271 also got minor updates to reflect changes to FormBase.
273 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
274 (hide): made virtual.
275 (input): return a bool. true == valid input
276 (RestoreCB, restore): new
277 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
278 Changes to allow derived dialogs to use a ButtonController and
279 make sense when doing so: OK button calls ok() and so on.
281 * src/frontends/xforms/ButtonController.h (class ButtonController):
282 Switch from template implementation to taking Policy parameter.
283 Allows FormBase to provide a ButtonController for any dialog.
285 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
286 Probably should rename connect and disconnect.
287 (apply): use the radio button groups
288 (form): needed by FormBase
289 (build): setup the radio button groups
291 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
293 * several files: type changes to reduce the number of warnings and
294 to unify type hangling a bit. Still much to do.
296 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
298 * lib/images/*: rename a bunch of icons to match Dekel converter
301 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
304 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
306 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
308 * sigc++/handle.h: ditto for class Handle.
310 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
312 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
314 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
316 * src/intl.C (InitKeyMapper): Correct the value of n due to the
317 removal of the "default" language.
319 * src/combox.h (getline): Check that sel > 0
321 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
323 * lib/examples/docbook_example.lyx
324 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
326 * lib/layouts/docbook-book.layout: new docbook book layout.
328 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
330 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
332 * src/insets/figinset.C (DocBook):fixed small typo.
334 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
336 * src/insets/insetinclude.h: string include_label doesn't need to be
339 2000-09-29 Allan Rae <rae@lyx.org>
341 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
342 Allow derived type to control connection and disconnection from signals
343 of its choice if desired.
345 2000-09-28 Juergen Vigna <jug@sad.it>
347 * src/insets/insettabular.C (update): fixed cursor setting when
348 the_locking_inset changed.
349 (draw): made this a bit cleaner.
350 (InsetButtonPress): fixed!
352 * various files: added LyXText Parameter to fitCursor call.
354 * src/BufferView.C (fitCursor): added LyXText parameter.
356 * src/insets/insettabular.C (draw): small draw fix.
358 * src/tabular.C: right setting of left/right celllines.
360 * src/tabular.[Ch]: fixed various types in funcions and structures.
361 * src/insets/insettabular.C: ditto
362 * src/frontends/xforms/FormTabular.C: ditto
364 2000-09-28 Allan Rae <rae@lyx.org>
366 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
367 that the #ifdef's had been applied to part of what should have been
368 a complete condition. It's possible there are other tests that
369 were specific to tables that are also wrong now that InsetTabular is
370 being used. Now we need to fix the output of '\n' after a table in a
371 float for the same reason as the original condition:
372 "don't insert this if we would be adding it before or after a table
373 in a float. This little trick is needed in order to allow use of
374 tables in \subfigures or \subtables."
375 Juergen can you check this?
377 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
379 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
380 outputed to the ostream.
382 * several files: fixed types based on warnings from cxx
384 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
386 * src/frontends/kde/Makefile.am: fix rule for
387 formindexdialogdata_moc.C
389 * src/.cvsignore: add ext_l10n.h to ignore
391 * acconfig.h: stop messing with __STRICT_ANSI__
392 * config/gnome.m4: remove option to set -ansi
393 * config/kde.m4: remove option to set -ansi
394 * config/lyxinclude.m4: don't set -ansi
396 2000-09-27 Juergen Vigna <jug@sad.it>
398 * various files: remove "default" language check.
400 * src/insets/insetquotes.C: removed use of current_view.
402 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
403 the one should have red ears by now!
405 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
406 in more then one paragraph. Fixed cursor-movement/selection.
408 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
409 paragraphs inside a text inset.
411 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
412 text-inset if this owner is an inset.
414 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
416 * src/Bullet.h: changed type of font, character and size to int
418 * src/buffer.C (asciiParagraph): remove actcell and fname1.
420 * src/insets/inseturl.[Ch]:
421 * src/insets/insetref.[Ch]:
422 * src/insets/insetlabel.[Ch]: add linelen to Ascii
424 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
426 * src/buffer.C (readFile): block-if statement rearranged to minimise
427 bloat. Patch does not reverse Jean-Marc's change ;-)
429 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
430 Class rewritten to store pointers to hide/update signals directly,
431 rather than Dialogs *. Also defined an enum to ease use. All xforms
432 forms can now be derived from this class.
434 * src/frontends/xforms/FormCommand.[Ch]
435 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
437 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
440 * src/frontends/xforms/forms/form_citation.fd
441 * src/frontends/xforms/forms/form_copyright.fd
442 * src/frontends/xforms/forms/form_error.fd
443 * src/frontends/xforms/forms/form_index.fd
444 * src/frontends/xforms/forms/form_ref.fd
445 * src/frontends/xforms/forms/form_toc.fd
446 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
448 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
450 * src/insets/insetfoot.C: removed redundent using directive.
452 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
454 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
455 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
457 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
458 created in the constructors in different groups. Then set() just
459 have to show the groups as needed. This fixes the redraw problems
460 (and is how the old menu code worked).
462 * src/support/lyxlib.h: declare the methods as static when we do
465 2000-09-26 Juergen Vigna <jug@sad.it>
467 * src/buffer.C (asciiParagraph): new function.
468 (writeFileAscii): new function with parameter ostream.
469 (writeFileAscii): use now asciiParagraph.
471 * various inset files: added the linelen parameter to the Ascii-func.
473 * src/tabular.C (Write): fixed error in writing file introduced by
474 the last changes from Lars.
476 * lib/bind/menus.bind: removed not supported functions.
478 * src/insets/insettext.C (Ascii): implemented this function.
480 * src/insets/lyxinset.h (Ascii): added linelen parameter.
482 * src/tabular.C (write_attribute[int,string,bool]): new functions.
483 (Write): use of the write_attribute functions.
485 * src/bufferlist.C (close): fixed reasking question!
487 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
489 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
490 new files use the everwhere possible.
493 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
494 src/log_form.C src/lyx.C:
497 * src/buffer.C (runLaTeX): remove func
499 * src/PaperLayout.C: removed file
500 * src/ParagraphExtra.C: likewise
501 * src/bullet_forms.C: likewise
502 * src/bullet_forms.h: likewise
503 * src/bullet_forms_cb.C: likewise
505 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
506 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
509 * several files: remove all traces of the old fd_form_paragraph,
510 and functions belonging to that.
512 * several files: remove all traces of the old fd_form_document,
513 and functions belonging to that.
515 * several files: constify local variables were possible.
517 * several files: remove all code that was dead when NEW_EXPORT was
520 * several files: removed string::c_str in as many places as
523 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
524 (e): be a bit more outspoken when patching
525 (updatesrc): only move files if changed.
527 * forms/layout_forms.h.patch: regenerated
529 * forms/layout_forms.fd: remove form_document and form_paragraph
530 and form_quotes and form_paper and form_table_options and
533 * forms/form1.fd: remove form_table
535 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
536 the fdui->... rewrite. Update some comments to xforms 0.88
538 * forms/bullet_forms.C.patch: removed file
539 * forms/bullet_forms.fd: likewise
540 * forms/bullet_forms.h.patch: likewise
542 * development/Code_rules/Rules: added a section on switch
543 statements. Updated some comment to xforms 0.88.
545 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
547 * src/buffer.C (readFile): make sure that the whole version number
548 is read after \lyxformat (even when it contains a comma)
550 * lib/ui/default.ui: change shortcut of math menu to M-a.
552 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
554 * src/vspace.C (nextToken): use isStrDbl() to check for proper
557 * src/LyXView.C (updateWindowTitle): show the full files name in
558 window title, limited to 30 characters.
560 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
561 When a number of characters has been given, we should not assume
562 that the string is 0-terminated.
564 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
565 calls (fixes some memory leaks)
567 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
568 trans member on exit.
570 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
572 * src/converter.C (GetReachable): fix typo.
574 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
575 understand ',' instead of '.'.
576 (GetInteger): rewrite to use strToInt().
578 2000-09-26 Juergen Vigna <jug@sad.it>
580 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
581 better visibility and error-message on wrong VSpace input.
583 * src/language.C (initL): added english again.
585 2000-09-25 Juergen Vigna <jug@sad.it>
587 * src/frontends/kde/Dialogs.C (Dialogs):
588 * src/frontends/gnome/Dialogs.C (Dialogs):
589 * src/frontends/kde/Makefile.am:
590 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
592 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
594 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
596 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
598 * src/frontends/xforms/FormParagraph.C:
599 * src/frontends/xforms/FormParagraph.h:
600 * src/frontends/xforms/form_paragraph.C:
601 * src/frontends/xforms/form_paragraph.h:
602 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
605 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
607 * src/tabular.C (OldFormatRead): forgot to delete the temporary
608 Paragraph-Data after use.
610 * src/insets/insettext.C (LocalDispatch): don't set the layout on
611 non breakable paragraphs.
613 2000-09-25 Garst R. Reese <reese@isn.net>
615 * src/language.C (initL): added missing language_country codes.
617 2000-09-25 Juergen Vigna <jug@sad.it>
619 * src/insets/insettext.C (InsetText):
620 (deleteLyXText): remove the not released LyXText structure!
622 2000-09-24 Marko Vendelin <markov@ioc.ee>
624 * src/frontends/gnome/mainapp.C
625 * src/frontends/gnome/mainapp.h: added support for keyboard
628 * src/frontends/gnome/FormCitation.C
629 * src/frontends/gnome/FormCitation.h
630 * src/frontends/gnome/Makefile.am
631 * src/frontends/gnome/pixbutton.h: completed the rewrite of
632 FormCitation to use "action area" in mainapp window
634 * src/frontends/gnome/Menubar_pimpl.C
635 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
638 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
640 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
641 width/descent/ascent values if name is empty.
642 (mathed_string_height): Use std::max.
644 2000-09-25 Allan Rae <rae@lyx.org>
646 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
647 segfault. This will be completely redesigned soon.
649 * sigc++: updated libsigc++. Fixes struct timespec bug.
651 * development/tools/makeLyXsigc.sh: .cvsignore addition
653 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
655 * several files: removed almost all traces of the old table
658 * src/TableLayout.C: removed file
660 2000-09-22 Juergen Vigna <jug@sad.it>
662 * src/frontends/kde/Dialogs.C: added credits forms.
664 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
666 * src/frontends/gnome/Dialogs.C: added some forms.
668 * src/spellchecker.C (init_spell_checker): set language in pspell code
669 (RunSpellChecker): some modifications for setting language string.
671 * src/language.[Ch]: added language_country code.
673 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
675 * src/frontends/Dialogs.h: added new signal showError.
676 Rearranged existing signals in some sort of alphabetical order.
678 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
679 FormError.[Ch], form_error.[Ch]
680 * src/frontends/xforms/forms/makefile: added new file form_error.fd
681 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
683 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
684 dialogs. I think that this can be used as the base to all these
687 * src/frontends/xforms/FormError.[Ch]
688 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
689 implementation of InsetError dialog.
691 * src/insets/inseterror.[Ch]: rendered GUI-independent.
693 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
694 * src/frontends/kde/Makefile.am: ditto
696 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
698 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
699 macrobf. This fixes a bug of invisible text.
701 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
703 * lib/doc/LaTeXConfig.lyx.in: updated.
705 * src/language.C (initL): remove language "francais" and change a
706 bit the names of the two other french variations.
708 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
709 string that may not be 0-terminated.
711 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
713 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
715 2000-09-20 Marko Vendelin <markov@ioc.ee>
717 * src/frontends/gnome/FormCitation.C
718 * src/frontends/gnome/FormIndex.C
719 * src/frontends/gnome/FormToc.C
720 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
721 the variable initialization to shut up the warnings
723 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
725 * src/table.[Ch]: deleted files
727 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
730 2000-09-18 Juergen Vigna <jug@sad.it>
732 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
733 problems with selection. Inserted new LFUN_PASTESELECTION.
734 (InsetButtonPress): inserted handling of middle mouse-button paste.
736 * src/spellchecker.C: changed word to word.c_str().
738 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
740 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
741 included in the ``make dist'' tarball.
743 2000-09-15 Juergen Vigna <jug@sad.it>
745 * src/CutAndPaste.C (cutSelection): small fix return the right
746 end position after cut inside one paragraph only.
748 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
749 we are locked as otherwise we don't have a valid cursor position!
751 * src/insets/figinset.C (draw): small bugfix but why is this needed???
753 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
755 * src/frontends/kde/FormRef.C: added using directive.
756 * src/frontends/kde/FormToc.C: ditto
758 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
760 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
762 2000-09-19 Marko Vendelin <markov@ioc.ee>
764 * src/frontends/gnome/Menubar_pimpl.C
765 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
766 Toc, ViewFormats, UpdateFormats, and ExportFormats.
768 * src/frontends/gnome/mainapp.C
769 * src/frontends/gnome/mainapp.h: support for menu update used
772 * src/frontends/gnome/mainapp.C
773 * src/frontends/gnome/mainapp.h: support for "action" area in the
774 main window. This area is used by small simple dialogs, such as
777 * src/frontends/gnome/FormIndex.C
778 * src/frontends/gnome/FormIndex.h
779 * src/frontends/gnome/FormUrl.C
780 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
783 * src/frontends/gnome/FormCitation.C
784 * src/frontends/gnome/FormCitation.h: rewrite to use main window
785 action area. Only "Insert new citation" is implemented.
787 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
789 * src/buffer.C (Dispatch): fix call to Dispatch
790 * src/insets/insetref.C (Edit): likewise
791 * src/insets/insetparent.C (Edit): likewise
792 * src/insets/insetinclude.C (include_cb): likewise
793 * src/frontends/xforms/FormUrl.C (apply): likewise
794 * src/frontends/xforms/FormToc.C (apply): likewise
795 * src/frontends/xforms/FormRef.C (apply): likewise
796 * src/frontends/xforms/FormIndex.C (apply): likewise
797 * src/frontends/xforms/FormCitation.C (apply): likewise
798 * src/lyxserver.C (callback): likewise
799 * src/lyxfunc.C (processKeySym): likewise
802 * src/lyx_cb.C (LayoutsCB): likewise
804 * Makefile.am (sourcedoc): small change
806 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
808 * src/main.C (main): Don't make an empty GUIRunTime object. all
809 methods are static. constify a bit remove unneded using + headers.
811 * src/tabular.C: some more const to local vars move some loop vars
813 * src/spellchecker.C: added some c_str after some word for pspell
815 * src/frontends/GUIRunTime.h: add new static method setDefaults
816 * src/frontends/xforms/GUIRunTime.C (setDefaults):
817 * src/frontends/kde/GUIRunTime.C (setDefaults):
818 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
820 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
821 with strnew in arg, use correct emptystring when calling SetName.
823 * several files: remove all commented code with relation to
824 HAVE_SSTREAM beeing false. We now only support stringstream and
827 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
829 * src/lyxfunc.C: construct correctly the automatic new file
832 * src/text2.C (IsStringInText): change type of variable i to shut
835 * src/support/sstream.h: do not use namespaces if the compiler
836 does not support them.
838 2000-09-15 Marko Vendelin <markov@ioc.ee>
839 * src/frontends/gnome/FormCitation.C
840 * src/frontends/gnome/FormCitation.h
841 * src/frontends/gnome/diainsertcitation_interface.c
842 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
843 regexp support to FormCitation [Gnome].
845 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
848 * configure.in: remove unused KDE/GTKGUI define
850 * src/frontends/kde/FormRef.C
851 * src/frontends/kde/FormRef.h
852 * src/frontends/kde/formrefdialog.C
853 * src/frontends/kde/formrefdialog.h: double click will
854 go to reference, now it is possible to change a cross-ref
857 * src/frontends/kde/FormToc.C
858 * src/frontends/kde/FormToc.h
859 * src/frontends/kde/formtocdialog.C
860 * src/frontends/kde/formtocdialog.h: add a depth
863 * src/frontends/kde/Makefile.am: add QtLyXView.h
866 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
868 * src/frontends/kde/FormCitation.h: added some using directives.
870 * src/frontends/kde/FormToc.h: corrected definition of doTree.
872 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
875 * src/mathed/math_defs.h: redefine SetAlign to use string rather
878 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
880 * src/buffer.C (pop_tag): revert for the second time a change by
881 Lars, who seems to really hate having non-local loop variables :)
883 * src/Lsstream.h: add "using" statements.
885 * src/support/copy.C (copy): add a bunch of std:: qualifiers
886 * src/buffer.C (writeFile): ditto
888 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
890 * src/buffer.C (writeFile): try to fix the locale modified format
891 number to always be as we want it.
893 * src/WorkArea.C (work_area_handler): try to workaround the bugs
894 in XForms 0.89. C-space is now working again.
896 * src/Lsstream.h src/support/sstream.h: new files.
898 * also commented out all cases where strstream were used.
900 * src/Bullet.h (c_str): remove method.
902 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
904 * a lot of files: get rid of "char const *" and "char *" is as
905 many places as possible. We only want to use them in interaction
906 with system of other libraries, not inside lyx.
908 * a lot of files: return const object is not of pod type. This
909 helps ensure that temporary objects is not modified. And fits well
910 with "programming by contract".
912 * configure.in: check for the locale header too
914 * Makefile.am (sourcedoc): new tag for generation of doc++
917 2000-09-14 Juergen Vigna <jug@sad.it>
919 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
920 callback to check which combo called it and do the right action.
922 * src/combox.C (combo_cb): added combo * to the callbacks.
923 (Hide): moved call of callback after Ungrab of the pointer.
925 * src/intl.h: removed LCombo2 function.
927 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
928 function as this can now be handled in one function.
930 * src/combox.h: added Combox * to callback prototype.
932 * src/frontends/xforms/Toolbar_pimpl.C:
933 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
935 2000-09-14 Garst Reese <reese@isn.net>
937 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
938 moved usepackage{xxx}'s to beginning of file. Changed left margin
939 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
940 underlining from title. Thanks to John Culleton for useful suggestions.
942 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
944 * src/lyxlex_pimpl.C (setFile): change error message to debug
947 2000-09-13 Juergen Vigna <jug@sad.it>
949 * src/frontends/xforms/FormDocument.C: implemented choice_class
950 as combox and give callback to combo_language so OK/Apply is activated
953 * src/bufferlist.C (newFile): small fix so already named files
954 (via an open call) are not requested to be named again on the
957 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
959 * src/frontends/kde/Makefile.am
960 * src/frontends/kde/FormRef.C
961 * src/frontends/kde/FormRef.h
962 * src/frontends/kde/formrefdialog.C
963 * src/frontends/kde/formrefdialog.h: implement
966 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
968 * src/frontends/kde/formtocdialog.C
969 * src/frontends/kde/formtocdialog.h
970 * src/frontends/kde/FormToc.C
971 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
973 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
975 * src/frontends/kde/FormCitation.C: fix thinko
976 where we didn't always display the reference text
979 * src/frontends/kde/formurldialog.C
980 * src/frontends/kde/formurldialog.h
981 * src/frontends/kde/FormUrl.C
982 * src/frontends/kde/FormUrl.h: minor cleanups
984 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
986 * src/frontends/kde/Makefile.am
987 * src/frontends/kde/FormToc.C
988 * src/frontends/kde/FormToc.h
989 * src/frontends/kde/FormCitation.C
990 * src/frontends/kde/FormCitation.h
991 * src/frontends/kde/FormIndex.C
992 * src/frontends/kde/FormIndex.h
993 * src/frontends/kde/formtocdialog.C
994 * src/frontends/kde/formtocdialog.h
995 * src/frontends/kde/formcitationdialog.C
996 * src/frontends/kde/formcitationdialog.h
997 * src/frontends/kde/formindexdialog.C
998 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
1000 2000-09-12 Juergen Vigna <jug@sad.it>
1002 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
1005 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1007 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
1010 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
1012 * src/converter.C (Add, Convert): Added support for converter flags:
1013 needaux, resultdir, resultfile.
1014 (Convert): Added new parameter view_file.
1015 (dvips_options): Fixed letter paper option.
1017 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
1018 (Export, GetExportableFormats, GetViewableFormats): Added support
1021 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
1023 (easyParse): Fixed to work with new export code.
1025 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
1028 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
1030 * lib/bind/*.bind: Replaced
1031 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
1032 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
1034 2000-09-11 Juergen Vigna <jug@sad.it>
1036 * src/lyx_gui.C (runTime): uses global guiruntime variable.
1038 * src/main.C (main): now GUII defines global guiruntime!
1040 * src/frontends/gnome/GUIRunTime.C (initApplication):
1041 * src/frontends/kde/GUIRunTime.C (initApplication):
1042 * src/frontends/xforms/GUIRunTime.C (initApplication):
1043 * src/frontends/GUIRunTime.h: added new function initApplication.
1045 * src/spellchecker.C (sc_accept_word): change to add_to_session.
1047 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
1049 2000-09-08 Juergen Vigna <jug@sad.it>
1051 * src/lyx_gui.C (create_forms): don't display the "default" entry as
1052 we have already "Reset".
1054 * src/language.C (initL): inserted "default" language and made this
1055 THE default language (and not american!)
1057 * src/paragraph.C: inserted handling of "default" language!
1059 * src/lyxfont.C: ditto
1063 * src/paragraph.C: output the \\par only if we have a following
1064 paragraph otherwise it's not needed.
1066 2000-09-05 Juergen Vigna <jug@sad.it>
1068 * config/pspell.m4: added entry to lyx-flags
1070 * src/spellchecker.C: modified version from Kevin for using pspell
1072 2000-09-01 Marko Vendelin <markov@ioc.ee>
1073 * src/frontends/gnome/Makefile.am
1074 * src/frontends/gnome/FormCitation.C
1075 * src/frontends/gnome/FormCitation.h
1076 * src/frontends/gnome/diainsertcitation_callbacks.c
1077 * src/frontends/gnome/diainsertcitation_callbacks.h
1078 * src/frontends/gnome/diainsertcitation_interface.c
1079 * src/frontends/gnome/diainsertcitation_interface.h
1080 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
1081 dialog for Gnome frontend
1083 * src/main.C: Gnome libraries require keeping application name
1084 and its version as strings
1086 * src/frontends/gnome/mainapp.C: Change the name of the main window
1087 from GnomeLyX to PACKAGE
1089 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1091 * src/frontends/Liason.C: add "using: declaration.
1093 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
1095 * src/mathed/math_macro.C (Metrics): Set the size of the template
1097 * src/mathed/formulamacro.C (Latex): Fixed the returned value
1099 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
1101 * src/converter.C (add_options): New function.
1102 (SetViewer): Change $$FName into '$$FName'.
1103 (View): Add options when running xdvi
1104 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
1105 (Convert): The 3rd parameter is now the desired filename. Converts
1106 calls to lyx::rename if necessary.
1107 Add options when running dvips.
1108 (dvi_papersize,dvips_options): New methods.
1110 * src/exporter.C (Export): Use getLatexName() instead of fileName().
1112 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
1113 using a call to Converter::dvips_options.
1114 Fixed to work with nex export code.
1116 * src/support/copy.C
1117 * src/support/rename.C: New files
1119 * src/support/syscall.h
1120 * src/support/syscall.C: Added Starttype SystemDontWait.
1122 * lib/ui/default.ui: Changed to work with new export code
1124 * lib/configure.m4: Changed to work with new export code
1126 * src/encoding.C: Changed latex name for iso8859_7 encoding.
1128 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
1130 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
1131 so that code compiles with DEC cxx.
1133 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
1134 to work correctly! Also now supports the additional elements
1137 2000-09-01 Allan Rae <rae@lyx.org>
1139 * src/frontends/ButtonPolicies.C: renamed all the references to
1140 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
1142 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
1143 since it's a const not a type.
1145 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
1147 2000-08-31 Juergen Vigna <jug@sad.it>
1149 * src/insets/figinset.C: Various changes to look if the filename has
1150 an extension and if not add it for inline previewing.
1152 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1154 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
1155 make buttonStatus and isReadOnly be const methods. (also reflect
1156 this in derived classes.)
1158 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
1159 (nextState): change to be static inline, pass the StateMachine as
1161 (PreferencesPolicy): remove casts
1162 (OkCancelPolicy): remvoe casts
1163 (OkCancelReadOnlyPolicy): remove casts
1164 (NoRepeatedApplyReadOnlyPolicy): remove casts
1165 (OkApplyCancelReadOnlyPolicy): remove casts
1166 (OkApplyCancelPolicy): remove casts
1167 (NoRepeatedApplyPolicy): remove casts
1169 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
1171 * src/converter.C: added some using directives
1173 * src/frontends/ButtonPolicies.C: changes to overcome
1174 "need lvalue" error with DEC c++
1176 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
1177 to WMHideCB for DEC c++
1179 * src/frontends/xforms/Menubar_pimpl.C: added using directive
1181 * src/frontends/xforms/forms/form_document.C.patch: use C callback
1182 to BulletBMTableCB for DEC c++
1184 2000-08-31 Allan Rae <rae@lyx.org>
1186 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
1187 character dialog separately from old document dialogs combo_language.
1190 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
1192 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
1193 Removed LFUN_REF_CREATE.
1195 * src/MenuBackend.C: Added new tags: toc and references
1197 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
1198 (add_lastfiles, add_documents, add_formats): Removed the unused smn
1200 (add_toc, add_references): New methods.
1201 (create_submenu): Handle correctly the case when there is a
1202 seperator after optional menu items.
1204 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
1205 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
1206 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
1208 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
1210 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
1212 * src/converter.[Ch]: New file for converting between different
1215 * src/export.[Ch]: New file for exporting a LyX file to different
1218 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
1219 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
1220 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
1221 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
1222 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
1223 RunDocBook, MenuExport.
1225 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
1226 Exporter::Preview methods if NEW_EXPORT is defined.
1228 * src/buffer.C (Dispatch): Use Exporter::Export.
1230 * src/lyxrc.C: Added new tags: \converter and \viewer.
1233 * src/LyXAction.C: Define new lyx-function: buffer-update.
1234 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
1235 when NEW_EXPORT is defined.
1237 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
1239 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
1241 * lib/ui/default.ui: Added submenus "view" and "update" to the
1244 * src/filetools.C (GetExtension): New function.
1246 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
1248 2000-08-29 Allan Rae <rae@lyx.org>
1250 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
1252 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
1253 (EnableDocumentLayout): removed
1254 (DisableDocumentLayout): removed
1255 (build): make use of ButtonController's read-only handling to
1256 de/activate various objects. Replaces both of the above functions.
1258 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
1259 (readOnly): was read_only
1260 (refresh): fixed dumb mistakes with read_only_ handling
1262 * src/frontends/xforms/forms/form_document.fd:
1263 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
1264 tabbed dialogs so the tabs look more like tabs and so its easier to
1265 work out which is the current tab.
1267 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
1268 segfault with form_table
1270 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
1272 2000-08-28 Juergen Vigna <jug@sad.it>
1274 * acconfig.h: added USE_PSPELL.
1276 * src/config.h.in: added USE_PSPELL.
1278 * autogen.sh: added pspell.m4
1280 * config/pspell.m4: new file.
1282 * src/spellchecker.C: implemented support for pspell libary.
1284 2000-08-25 Juergen Vigna <jug@sad.it>
1286 * src/LyXAction.C (init): renamed LFUN_TABLE to
1287 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
1289 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
1291 * src/lyxscreen.h: add force_clear variable and fuction to force
1292 a clear area when redrawing in LyXText.
1294 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
1296 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1298 * some whitespace and comment changes.
1300 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
1302 * src/buffer.C: up te LYX_FORMAT to 2.17
1304 2000-08-23 Juergen Vigna <jug@sad.it>
1306 * src/BufferView_pimpl.C (tripleClick): disable this when in a
1309 * src/insets/insettabular.C (pasteSelection): delete the insets
1310 LyXText as it is not valid anymore.
1311 (copySelection): new function.
1312 (pasteSelection): new function.
1313 (cutSelection): new function.
1314 (LocalDispatch): implemented cut/copy/paste of cell selections.
1316 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
1317 don't have a LyXText.
1319 * src/LyXAction.C (init): a NEW_TABULAR define too much.
1321 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
1324 2000-08-22 Juergen Vigna <jug@sad.it>
1326 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
1327 ifdef form_table out if NEW_TABULAR.
1329 2000-08-21 Juergen Vigna <jug@sad.it>
1331 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
1332 (draw): fixed draw position so that the cursor is positioned in the
1334 (InsetMotionNotify): hide/show cursor so the position is updated.
1335 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
1336 using cellstart() function where it should be used.
1338 * src/insets/insettext.C (draw): ditto.
1340 * src/tabular.C: fixed initialization of some missing variables and
1341 made BoxType into an enum.
1343 2000-08-22 Marko Vendelin <markov@ioc.ee>
1344 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
1345 stock menu item using action numerical value, not its string
1349 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
1351 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
1352 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
1354 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
1356 * src/frontends/xforms/GUIRunTime.C: new file
1358 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
1359 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1361 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
1363 * src/frontends/kde/GUIRunTime.C: new file
1365 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
1366 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1368 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
1370 * src/frontends/gnome/GUIRunTime.C: new file
1372 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
1375 * src/frontends/GUIRunTime.h: removed constructor and destructor,
1376 small change to documetentation.
1378 * src/frontends/GUIRunTime.C: removed file
1380 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
1382 * src/lyxparagraph.h: enable NEW_TABULAR as default
1384 * src/lyxfunc.C (processKeySym): remove some commented code
1386 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
1387 NEW_TABULAR around the fd_form_table_options.
1389 * src/lyx_gui.C (runTime): call the static member function as
1390 GUIRunTime::runTime().
1392 2000-08-21 Allan Rae <rae@lyx.org>
1394 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
1397 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
1399 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
1401 2000-08-21 Allan Rae <rae@lyx.org>
1403 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
1404 keep Garst happy ;-)
1405 * src/frontends/xforms/FormPreferences.C (build): use setOK
1406 * src/frontends/xforms/FormDocument.C (build): use setOK
1407 (FormDocument): use the appropriate policy.
1409 2000-08-21 Allan Rae <rae@lyx.org>
1411 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
1412 automatic [de]activation of arbitrary objects when in a read-only state.
1414 * src/frontends/ButtonPolicies.h: More documentation
1415 (isReadOnly): added to support the above.
1417 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
1419 2000-08-18 Juergen Vigna <jug@sad.it>
1421 * src/insets/insettabular.C (getStatus): changed to return func_status.
1423 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
1424 display toggle menu entries if they are.
1426 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
1427 new document layout now.
1429 * src/lyxfunc.C: ditto
1431 * src/lyx_gui_misc.C: ditto
1433 * src/lyx_gui.C: ditto
1435 * lib/ui/default.ui: removed paper and quotes layout as they are now
1436 all in the document layout tabbed folder.
1438 * src/frontends/xforms/forms/form_document.fd: added Restore
1439 button and callbacks for all inputs for Allan's ButtonPolicy.
1441 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
1442 (CheckChoiceClass): added missing params setting on class change.
1443 (UpdateLayoutDocument): added for updating the layout on params.
1444 (build): forgot to RETURN_ALWAYS input_doc_spacing.
1445 (FormDocument): Implemented Allan's ButtonPolicy with the
1448 2000-08-17 Allan Rae <rae@lyx.org>
1450 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
1451 so we can at least see the credits again.
1453 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
1454 controller calls for the appropriate callbacks. Note that since Ok
1455 calls apply followed by cancel, and apply isn't a valid input for the
1456 APPLIED state, the bc_ calls have to be made in the static callback not
1457 within each of the real callbacks.
1459 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
1460 (setOk): renamed from setOkay()
1462 2000-08-17 Juergen Vigna <jug@sad.it>
1464 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
1465 in the implementation part.
1466 (composeUIInfo): don't show optional menu-items.
1468 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
1470 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
1472 * src/bufferview_funcs.C (CurrentState): fixed to show also the
1473 text-state when in a text-inset.
1475 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
1477 2000-08-17 Marko Vendelin <markov@ioc.ee>
1478 * src/frontends/gnome/FormIndex.C
1479 * src/frontends/gnome/FormIndex.h
1480 * src/frontends/gnome/FormToc.C
1481 * src/frontends/gnome/FormToc.h
1482 * src/frontends/gnome/dialogs
1483 * src/frontends/gnome/diatoc_callbacks.c
1484 * src/frontends/gnome/diatoc_callbacks.h
1485 * src/frontends/gnome/diainsertindex_callbacks.h
1486 * src/frontends/gnome/diainsertindex_callbacks.c
1487 * src/frontends/gnome/diainsertindex_interface.c
1488 * src/frontends/gnome/diainsertindex_interface.h
1489 * src/frontends/gnome/diatoc_interface.h
1490 * src/frontends/gnome/diatoc_interface.c
1491 * src/frontends/gnome/Makefile.am: Table of Contents and
1492 Insert Index dialogs implementation for Gnome frontend
1494 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
1496 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
1498 * src/frontends/gnome/diainserturl_interface.c: make the dialog
1501 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1503 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
1504 destructor. Don't definde if you don't need it
1505 (processEvents): made static, non-blocking events processing for
1507 (runTime): static method. event loop for xforms
1508 * similar as above for kde and gnome.
1510 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
1511 new Pimpl is correct
1512 (runTime): new method calss the real frontends runtime func.
1514 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
1516 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1518 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
1520 2000-08-16 Juergen Vigna <jug@sad.it>
1522 * src/lyx_gui.C (runTime): added GUII RunTime support.
1524 * src/frontends/Makefile.am:
1525 * src/frontends/GUIRunTime.[Ch]:
1526 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
1527 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
1528 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
1530 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
1532 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
1533 as this is already set in ${FRONTEND_INCLUDE} if needed.
1535 * configure.in (CPPFLAGS): setting the include dir for the frontend
1536 directory and don't set FRONTEND=xforms for now as this is executed
1539 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
1541 * src/frontends/kde/Makefile.am:
1542 * src/frontends/kde/FormUrl.C:
1543 * src/frontends/kde/FormUrl.h:
1544 * src/frontends/kde/formurldialog.h:
1545 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
1547 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
1549 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
1551 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1553 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
1556 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
1558 * src/WorkArea.C (work_area_handler): more work to get te
1559 FL_KEYBOARD to work with xforms 0.88 too, please test.
1561 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
1563 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
1565 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
1568 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1570 * src/Timeout.h: remove Qt::emit hack.
1572 * several files: changes to allo doc++ compilation
1574 * src/lyxfunc.C (processKeySym): new method
1575 (processKeyEvent): comment out if FL_REVISION < 89
1577 * src/WorkArea.C: change some debugging levels.
1578 (WorkArea): set wantkey to FL_KEY_ALL
1579 (work_area_handler): enable the FL_KEYBOARD clause, this enables
1580 clearer code and the use of compose with XForms 0.89. Change to
1581 use signals instead of calling methods in bufferview directly.
1583 * src/Painter.C: change some debugging levels.
1585 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
1588 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
1589 (workAreaKeyPress): new method
1591 2000-08-14 Juergen Vigna <jug@sad.it>
1593 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
1595 * config/kde.m4: addes some features
1597 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
1598 include missing xforms dialogs.
1600 * src/Timeout.h: a hack to be able to compile with qt/kde.
1602 * sigc++/.cvsignore: added acinclude.m4
1604 * lib/.cvsignore: added listerros
1606 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
1607 xforms tree as objects are needed for other frontends.
1609 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
1610 linking with not yet implemented xforms objects.
1612 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
1614 2000-08-14 Baruch Even <baruch.even@writeme.com>
1616 * src/frontends/xforms/FormGraphics.h:
1617 * src/frontends/xforms/FormGraphics.C:
1618 * src/frontends/xforms/RadioButtonGroup.h:
1619 * src/frontends/xforms/RadioButtonGroup.C:
1620 * src/insets/insetgraphics.h:
1621 * src/insets/insetgraphics.C:
1622 * src/insets/insetgraphicsParams.h:
1623 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
1624 instead of spaces, and various other indentation issues to make the
1625 sources more consistent.
1627 2000-08-14 Marko Vendelin <markov@ioc.ee>
1629 * src/frontends/gnome/dialogs/diaprint.glade
1630 * src/frontends/gnome/FormPrint.C
1631 * src/frontends/gnome/FormPrint.h
1632 * src/frontends/gnome/diaprint_callbacks.c
1633 * src/frontends/gnome/diaprint_callbacks.h
1634 * src/frontends/gnome/diaprint_interface.c
1635 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
1638 * src/frontends/gnome/dialogs/diainserturl.glade
1639 * src/frontends/gnome/FormUrl.C
1640 * src/frontends/gnome/FormUrl.h
1641 * src/frontends/gnome/diainserturl_callbacks.c
1642 * src/frontends/gnome/diainserturl_callbacks.h
1643 * src/frontends/gnome/diainserturl_interface.c
1644 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
1645 Gnome implementation
1647 * src/frontends/gnome/Dialogs.C
1648 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
1649 all other dialogs. Copy all unimplemented dialogs from Xforms
1652 * src/frontends/gnome/support.c
1653 * src/frontends/gnome/support.h: support files generated by Glade
1657 * config/gnome.m4: Gnome configuration scripts
1659 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
1660 configure --help message
1662 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
1663 only if there are no events pendling in Gnome/Gtk. This enhances
1664 the performance of menus.
1667 2000-08-14 Allan Rae <rae@lyx.org>
1669 * lib/Makefile.am: listerrors cleaning
1671 * lib/listerrors: removed -- generated file
1672 * acinclude.m4: ditto
1673 * sigc++/acinclude.m4: ditto
1675 * src/frontends/xforms/forms/form_citation.fd:
1676 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
1679 * src/frontends/xforms/forms/makefile: I renamed the `install` target
1680 `updatesrc` and now we have a `test` target that does what `updatesrc`
1681 used to do. I didn't like having an install target that wasn't related
1684 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
1685 on all except FormGraphics. This may yet happen. Followed by a major
1686 cleanup including using FL_TRANSIENT for most of the dialogs. More
1687 changes to come when the ButtonController below is introduced.
1689 * src/frontends/xforms/ButtonController.h: New file for managing up to
1690 four buttons on a dialog according to an externally defined policy.
1691 * src/frontends/xforms/Makefile.am: added above
1693 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
1694 Apply and Cancel/Close buttons and everything in between and beyond.
1695 * src/frontends/Makefile.am: added above.
1697 * src/frontends/xforms/forms/form_preferences.fd:
1698 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
1699 and removed variable 'status' as a result. Fixed the set_minsize thing.
1700 Use the new screen-font-update after checking screen fonts were changed
1701 Added a "Restore" button to restore the original lyxrc values while
1702 editing. This restores everything not just the last input changed.
1703 That's still a tricky one. As is the "LyX: this shouldn't happen..."
1705 * src/LyXAction.C: screen-font-update added for updating buffers after
1706 screen font settings have been changed.
1707 * src/commandtags.h: ditto
1708 * src/lyxfunc.C: ditto
1710 * forms/lyx.fd: removed screen fonts dialog.
1711 * src/lyx_gui.C: ditto
1712 * src/menus.[Ch]: ditto
1713 * src/lyx.[Ch]: ditto
1714 * src/lyx_cb.C: ditto + code from here moved to make
1715 screen-font-update. And people wonder why progress on GUII is
1716 slow. Look at how scattered this stuff was! It takes forever
1719 * forms/fdfix.sh: Fixup the spacing after commas.
1720 * forms/makefile: Remove date from generated files. Fewer clashes now.
1721 * forms/bullet_forms.C.patch: included someones handwritten changes
1723 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
1724 once I've discovered why LyXRC was made noncopyable.
1725 * src/lyx_main.C: ditto
1727 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
1729 * src/frontends/xforms/forms/fdfix.sh:
1730 * src/frontends/xforms/forms/fdfixh.sed:
1731 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
1732 * src/frontends/xforms/Form*.[hC]:
1733 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
1734 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
1735 provide a destructor for the struct FD_form_xxxx. Another version of
1736 the set_[max|min]size workaround and a few other cleanups. Actually,
1737 Angus' patch from 20000809.
1739 2000-08-13 Baruch Even <baruch.even@writeme.com>
1741 * src/insets/insetgraphics.C (Clone): Added several fields that needed
1744 2000-08-11 Juergen Vigna <jug@sad.it>
1746 * src/insets/insetgraphics.C (InsetGraphics): changing init
1747 order because of warnings.
1749 * src/frontends/xforms/forms/makefile: adding patching .C with
1752 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
1753 from .C.patch to .c.patch
1755 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
1756 order because of warning.
1758 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
1760 * src/frontends/Liason.C (setMinibuffer): new helper function
1762 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
1764 * src/lyxfunc.C (Dispatch): calling new Document-Layout
1766 * lib/ui/default.ui: commented out PaperLayout entry
1768 * src/frontends/xforms/form_document.[Ch]: new added files
1770 * src/frontends/xforms/FormDocument.[Ch]: ditto
1772 * src/frontends/xforms/forms/form_document.fd: ditto
1774 * src/frontends/xforms/forms/form_document.C.patch: ditto
1776 2000-08-10 Juergen Vigna <jug@sad.it>
1778 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
1779 (InsetGraphics): initialized cacheHandle to 0.
1780 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
1782 2000-08-10 Baruch Even <baruch.even@writeme.com>
1784 * src/graphics/GraphicsCache.h:
1785 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
1786 correctly as a cache.
1788 * src/graphics/GraphicsCacheItem.h:
1789 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
1792 * src/graphics/GraphicsCacheItem_pimpl.h:
1793 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
1796 * src/insets/insetgraphics.h:
1797 * src/insets/insetgraphics.C: Changed from using a signal notification
1798 to polling when image is not loaded.
1800 2000-08-10 Allan Rae <rae@lyx.org>
1802 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
1803 that there are two functions that have to been taken out of line by
1804 hand and aren't taken care of in the script. (Just a reminder note)
1806 * sigc++/macros/*.h.m4: Updated as above.
1808 2000-08-09 Juergen Vigna <jug@sad.it>
1810 * src/insets/insettext.C (draw): small fix for clearing rectangle.
1812 * src/insets/insettabular.C: make drawing of single cell smarter.
1814 2000-08-09 Marko Vendelin <markov@ioc.ee>
1815 * src/frontends/gnome/Menubar_pimpl.C
1816 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
1817 implementation: new files
1819 * src/frontends/gnome/mainapp.C
1820 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
1823 * src/main.C: create Gnome main window
1825 * src/frontends/xforms/Menubar_pimpl.h
1826 * src/frontends/Menubar.C
1827 * src/frontends/Menubar.h: added method Menubar::update that calls
1828 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
1830 * src/LyXView.C: calls Menubar::update to update the state
1833 * src/frontends/gnome/Makefile.am: added new files
1835 * src/frontends/Makefile.am: added frontend compiler options
1837 2000-08-08 Juergen Vigna <jug@sad.it>
1839 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
1841 * src/bufferlist.C (close):
1842 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
1843 documents if exiting without saving.
1845 * src/buffer.C (save): use removeAutosaveFile()
1847 * src/support/filetools.C (removeAutosaveFile): new function.
1849 * src/lyx_cb.C (MenuWrite): returns a bool now.
1850 (MenuWriteAs): check if file could really be saved and revert to the
1852 (MenuWriteAs): removing old autosavefile if existant.
1854 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
1855 before Goto toggle declaration, because of compiler warning.
1857 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
1859 * src/lyxfunc.C (MenuNew): small fix.
1861 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
1863 * src/bufferlist.C (newFile):
1864 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
1866 * src/lyxrc.C: added new_ask_filename tag
1868 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
1870 * src/lyx.fd: removed code pertaining to form_ref
1871 * src/lyx.[Ch]: ditto
1872 * src/lyx_cb.C: ditto
1873 * src/lyx_gui.C: ditto
1874 * src/lyx_gui_misc.C: ditto
1876 * src/BufferView_pimpl.C (restorePosition): update buffer only
1879 * src/commandtags.h (LFUN_REFTOGGLE): removed
1880 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
1881 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
1882 (LFUN_REFBACK): renamed LFUN_REF_BACK
1884 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
1885 * src/menus.C: ditto
1886 * src/lyxfunc.C (Dispatch): ditto.
1887 InsertRef dialog is now GUI-independent.
1889 * src/texrow.C: added using std::endl;
1891 * src/insets/insetref.[Ch]: strip out large amounts of code.
1892 The inset is now a container and this functionality is now
1893 managed by a new FormRef dialog
1895 * src/frontends/Dialogs.h (showRef, createRef): new signals
1897 * src/frontends/xforms/FormIndex.[Ch],
1898 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
1899 when setting dialog's min/max size
1900 * src/frontends/xforms/FormIndex.[Ch]: ditto
1902 * src/frontends/xforms/FormRef.[Ch],
1903 src/frontends/xforms/forms/form_ref.fd: new xforms
1904 implementation of an InsetRef dialog
1906 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
1909 * src/graphics/XPM_Renderer.C (isImageFormatOK):
1910 ios::nocreate is not part of the standard. Removed.
1912 2000-08-07 Baruch Even <baruch.even@writeme.com>
1914 * src/graphics/Renderer.h:
1915 * src/graphics/Renderer.C: Added base class for rendering of different
1916 image formats into Pixmaps.
1918 * src/graphics/XPM_Renderer.h:
1919 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
1920 in a different class.
1922 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
1923 easily add support for other formats.
1925 * src/insets/figinset.C: plugged a leak of an X resource.
1927 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1929 * src/CutAndPaste.[Ch]: make all metods static.
1931 * development/Code_rules/Rules: more work, added section on
1932 Exceptions, and a References section.
1934 * a lot of header files: work to make doc++ able to generate the
1935 source documentation, some workarounds of doc++ problems. Doc++ is
1936 now able to generate the documentation.
1938 2000-08-07 Juergen Vigna <jug@sad.it>
1940 * src/insets/insettabular.C (recomputeTextInsets): removed function
1942 * src/tabular.C (SetWidthOfMulticolCell):
1944 (calculate_width_of_column_NMC): fixed return value so that it really
1945 only returns true if the column-width has changed (there where
1946 problems with muliticolumn-cells in this column).
1948 2000-08-04 Juergen Vigna <jug@sad.it>
1950 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
1951 also on the scrollstatus of the inset.
1952 (workAreaMotionNotify): ditto.
1954 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
1956 2000-08-01 Juergen Vigna <jug@sad.it>
1958 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
1960 * src/commandtags.h:
1961 * src/LyXAction.C (init):
1962 * src/insets/inset.C (LocalDispatch): added support for
1965 * src/insets/inset.C (scroll): new functions.
1967 * src/insets/insettext.C (removeNewlines): new function.
1968 (SetAutoBreakRows): removes forced newlines in the text of the
1969 paragraph if autoBreakRows is set to false.
1971 * src/tabular.C (Latex): generates a parbox around the cell contents
1974 * src/frontends/xforms/FormTabular.C (local_update): removed
1975 the radio_useparbox button.
1977 * src/tabular.C (UseParbox): new function
1979 2000-08-06 Baruch Even <baruch.even@writeme.com>
1981 * src/graphics/GraphicsCache.h:
1982 * src/graphics/GraphicsCache.C:
1983 * src/graphics/GraphicsCacheItem.h:
1984 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
1987 * src/insets/insetgraphics.h:
1988 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
1989 drawing of the inline image.
1991 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
1992 into the wrong position.
1994 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
1997 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
1999 * src/support/translator.h: move all typedefs to public section
2001 * src/support/filetools.C (MakeLatexName): return string const
2003 (TmpFileName): ditto
2004 (FileOpenSearch): ditto
2006 (LibFileSearch): ditto
2007 (i18nLibFileSearch): ditto
2010 (CreateTmpDir): ditto
2011 (CreateBufferTmpDir): ditto
2012 (CreateLyXTmpDir): ditto
2015 (MakeAbsPath): ditto
2017 (OnlyFilename): ditto
2019 (NormalizePath): ditto
2020 (CleanupPath): ditto
2021 (GetFileContents): ditto
2022 (ReplaceEnvironmentPath): ditto
2023 (MakeRelPath): ditto
2025 (ChangeExtension): ditto
2026 (MakeDisplayPath): ditto
2027 (do_popen): return cmdret const
2028 (findtexfile): return string const
2030 * src/support/DebugStream.h: add some /// to please doc++
2032 * src/frontends/DialogBase.h (endif): add some /// to please doc++
2034 * src/texrow.C (same_rownumber): functor to use with find_if
2035 (getIdFromRow): rewritten to use find_if and to not update the
2036 positions. return true if row is found
2037 (increasePos): new method, use to update positions
2039 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
2041 * src/lyxlex_pimpl.C (verifyTable): new method
2044 (GetString): return string const
2045 (pushTable): rewrite to use std::stack
2047 (setFile): better check
2050 * src/lyxlex.h: make LyXLex noncopyable
2052 * src/lyxlex.C (text): return char const * const
2053 (GetString): return string const
2054 (getLongString): return string const
2056 * src/lyx_gui_misc.C (askForText): return pair<...> const
2058 * src/lastfiles.[Ch] (operator): return string const
2060 * src/buffer.C (parseSingleLyXformat2Token): pass string to
2061 istringstream not char const *.
2062 move token.end() out of loop.
2063 (readFile): move initializaton of token
2065 * src/BufferView2.C (insertErrors): run texrow.increasePos if
2066 getIdFromRow is successful.
2068 * lib/bind/emacs.bind: don't include menus bind
2070 * development/Code_rules/Rules: the beginnings of making this
2071 better and covering more of the unwritten rules that we have.
2073 * development/Code_rules/Recommendations: a couple of wording
2076 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2078 * src/support/strerror.c: remove C++ comment.
2080 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
2082 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
2083 LFUN_INDEX_INSERT_LAST
2085 * src/texrow.C (getIdFromRow): changed from const_iterator to
2086 iterator, allowing code to compile with DEC cxx
2088 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
2089 stores part of the class, as suggested by Allan. Will allow
2091 (apply): test to apply uses InsetCommandParams operator!=
2093 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
2094 (apply): test to apply uses InsetCommandParams operator!=
2096 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
2097 stores part of the class.
2098 (update): removed limits on min/max size.
2100 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
2101 (apply): test to apply uses InsetCommandParams operator!=
2103 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
2104 (Read, Write, scanCommand, getCommand): moved functionality
2105 into InsetCommandParams.
2107 (getScreenLabel): made pure virtual
2108 new InsetCommandParams operators== and !=
2110 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
2111 c-tors based on InsetCommandParams. Removed others.
2112 * src/insets/insetinclude.[Ch]: ditto
2113 * src/insets/insetlabel.[Ch]: ditto
2114 * src/insets/insetparent.[Ch]: ditto
2115 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
2117 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
2118 insets derived from InsetCommand created using similar c-tors
2119 based on InsetCommandParams
2120 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
2121 * src/menus.C (ShowRefsMenu): ditto
2122 * src/paragraph.C (Clone): ditto
2123 * src/text2.C (SetCounter): ditto
2124 * src/lyxfunc.C (Dispatch) ditto
2125 Also recreated old InsetIndex behaviour exactly. Can now
2126 index-insert at the start of a paragraph and index-insert-last
2127 without launching the pop-up.
2129 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2131 * lib/lyxrc.example: mark te pdf options as non functional.
2133 * src/support/lstrings.C (strToInt): move initalization of tmpstr
2134 (isStrDbl): move tmpstr.end() out of loop.
2135 (strToDbl): move intialization of tmpstr
2136 (lowercase): return string const and move tmp.end() out of loop.
2137 (uppercase): return string const and move tmp.edn() out of loop.
2138 (prefixIs): add assertion
2143 (containsOnly): ditto
2144 (containsOnly): ditto
2145 (containsOnly): ditto
2146 (countChar): make last arg char not char const
2147 (token): return string const
2148 (subst): return string const, move tmp.end() out of loop.
2149 (subst): return string const, add assertion
2150 (strip): return string const
2151 (frontStrip): return string const, add assertion
2152 (frontStrip): return string const
2157 * src/support/lstrings.C: add inclde "LAssert.h"
2158 (isStrInt): move tmpstr.end() out of loop.
2160 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
2161 toollist.end() out of loop.
2162 (deactivate): move toollist.end() out of loop.
2163 (update): move toollist.end() out of loop.
2164 (updateLayoutList): move tc.end() out of loop.
2165 (add): move toollist.end() out of loop.
2167 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
2168 md.end() out of loop.
2170 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
2172 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
2175 * src/paragraph.C (Erase): move fontlist.end() out of loop.
2176 (Erase): move insetlist.end() out of loop.
2178 * src/lyx_sendfax_main.C: make show_logfile static and to take a
2179 ref to const string as first arg. Move initialization of some
2180 variables, whitespace changes.
2182 * src/kbmap.C (defkey): move table.end() out of loop.
2183 (kb_keymap): move table.end() out of loop.
2184 (findbinding): move table.end() out of loop.
2186 * src/MenuBackend.C (hasMenu): move end() out of loop.
2187 (getMenu): move end() out of loop.
2188 (getMenu): move menulist_.end() out of loop.
2190 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
2192 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
2195 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
2196 (getFromLyXName): move infotab.end() out of loop.
2198 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
2199 -fvtable-thunks -ffunction-sections -fdata-sections
2201 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
2203 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
2206 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
2208 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
2210 * src/frontends/xforms/FormCitation.[Ch],
2211 src/frontends/xforms/FormIndex.[Ch],
2212 src/frontends/xforms/FormToc.[Ch],
2213 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
2215 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
2217 * src/commandtags.h: renamed, created some flags for citation
2220 * src/lyx_gui_misc.C: stripped out old FD_index_form code
2222 * src/lyxfunc.C (dispatch): use signals to insert index entry
2224 * src/frontends/Dialogs.h: new signal createIndex
2226 * src/frontends/xforms/FormCommand.[Ch],
2227 src/frontends/xforms/FormCitation.[Ch],
2228 src/frontends/xforms/FormToc.[Ch],
2229 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
2231 * src/insets/insetindex.[Ch]: GUI-independent
2233 * src/frontends/xforms/FormIndex.[Ch],
2234 * src/frontends/xforms/forms/form_index.fd: xforms implementation
2237 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
2239 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
2240 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
2242 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2244 * src/insets/insetref.C (Latex): rewrite so that there is now
2245 question that a initialization is requested.
2247 * src/insets/insetcommand.h: reenable the hide signal
2249 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2251 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
2252 fix handling of shortcuts (many bugs :)
2253 (add_lastfiles): ditto.
2255 * lib/ui/default.ui: fix a few shortcuts.
2257 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
2259 * Makefile.am: Fix ``rpmdist'' target to return the exit
2260 status of the ``rpm'' command, instead of the last command in
2261 the chain (the ``rm lyx.xpm'' command, which always returns
2264 2000-08-02 Allan Rae <rae@lyx.org>
2266 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
2267 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
2268 * src/frontends/xforms/FormToc.C (FormToc): ditto
2270 * src/frontends/xforms/Makefile.am: A few forgotten files
2272 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
2273 Signals-not-copyable-problem Lars' started commenting out.
2275 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
2277 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2279 * src/insets/insetcommand.h: Signals is not copyable so anoter
2280 scheme for automatic hiding of forms must be used.
2282 * src/frontends/xforms/FormCitation.h: don't inerit from
2283 noncopyable, FormCommand already does that.
2284 * src/frontends/xforms/FormToc.h: ditto
2285 * src/frontends/xforms/FormUrl.h: ditto
2287 * src/frontends/xforms/FormCitation.C: add include <algorithm>
2289 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
2291 * src/insets/insetcommand.h (hide): new SigC::Signal0
2292 (d-tor) new virtual destructor emits hide signal
2294 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
2295 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
2297 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
2298 LOF and LOT. Inset is now GUI-independent
2300 * src/insets/insetloa.[Ch]: redundant
2301 * src/insets/insetlof.[Ch]: ditto
2302 * src/insets/insetlot.[Ch]: ditto
2304 * src/frontends/xforms/forms/form_url.fd: tweaked!
2305 * src/frontends/xforms/forms/form_citation.fd: ditto
2307 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
2308 dialogs dealing with InsetCommand insets
2310 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
2311 FormCommand base class
2312 * src/frontends/xforms/FormUrl.[Ch]: ditto
2314 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
2316 * src/frontends/xforms/FormToc.[Ch]: ditto
2318 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
2319 passed a generic InsetCommand pointer
2320 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
2322 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
2323 and modified InsetTOC class
2324 * src/buffer.C: ditto
2326 * forms/lyx.fd: strip out old FD_form_toc code
2327 * src/lyx_gui_misc.C: ditto
2328 * src/lyx_gui.C: ditto
2329 * src/lyx_cb.C: ditto
2330 * src/lyx.[Ch]: ditto
2332 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2334 * src/support/utility.hpp: tr -d '\r'
2336 2000-08-01 Juergen Vigna <jug@sad.it>
2338 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
2340 * src/commandtags.h:
2341 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
2342 LFUN_TABULAR_FEATURES.
2344 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
2345 LFUN_LAYOUT_TABULAR.
2347 * src/insets/insettabular.C (getStatus): implemented helper function.
2349 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
2351 2000-07-31 Juergen Vigna <jug@sad.it>
2353 * src/text.C (draw): fixed screen update problem for text-insets.
2355 * src/text2.C (SetParagrpah): call an update of the inset-owner when
2356 something changed probably this has to be added in various other
2359 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
2361 2000-07-31 Baruch Even <baruch.even@writeme.com>
2363 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
2364 templates to satisfy compaq cxx.
2367 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2369 * src/support/translator.h (equal_1st_in_pair::operator()): take
2370 const ref pair_type as arg.
2371 (equal_2nd_in_pair::operator()): ditto
2372 (Translator::~Translator): remove empty d-tor.
2374 * src/graphics/GraphicsCache.C: move include config.h to top, also
2375 put initialization of GraphicsCache::singleton here.
2376 (~GraphicsCache): move here
2377 (addFile): take const ref as arg
2380 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
2382 * src/BufferView2.C (insertLyXFile): change te with/without header
2385 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2387 * src/frontends/xforms/FormGraphics.C (apply): add some
2388 static_cast. Not very nice, but required by compaq cxx.
2390 * src/frontends/xforms/RadioButtonGroup.h: include header
2391 <utility> instead of <pair.h>
2393 * src/insets/insetgraphicsParams.C: add using directive.
2394 (readResize): change return type to void.
2395 (readOrigin): ditto.
2397 * src/lyxfunc.C (getStatus): add missing break for build-program
2398 function; add test for Literate for export functions.
2400 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
2401 entries in Options menu.
2403 2000-07-31 Baruch Even <baruch.even@writeme.com>
2405 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
2406 protect against auto-allocation; release icon when needed.
2408 2000-07-31 Matej Cepl <CeplM@seznam.cz>
2410 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
2411 on usual typewriter.
2413 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
2414 earlier czech.kmap), useful only for programming.
2416 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2418 * src/frontends/xforms/FormCitation.h: fix conditioning around
2421 2000-07-31 Juergen Vigna <jug@sad.it>
2423 * src/frontends/xforms/FormTabular.C (local_update): changed
2424 radio_linebreaks to radio_useparbox and added radio_useminipage.
2426 * src/tabular.C: made support for using minipages/parboxes.
2428 * src/bufferlist.C (QwriteAll): small fix for asking for save.
2430 * src/insets/insetgraphics.C (draw): just draw the inset so that the
2432 (descent): so the cursor is in the middle.
2433 (width): bit smaller box.
2435 * src/insets/insetgraphics.h: added display() function.
2437 2000-07-31 Baruch Even <baruch.even@writeme.com>
2439 * src/frontends/Dialogs.h: Added showGraphics signals.
2441 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
2442 xforms form definition of the graphics dialog.
2444 * src/frontends/xforms/FormGraphics.h:
2445 * src/frontends/xforms/FormGraphics.C: Added files, the
2446 GUIndependent code of InsetGraphics
2448 * src/insets/insetgraphics.h:
2449 * src/insets/insetgraphics.C: Major writing to make it work.
2451 * src/insets/insetgraphicsParams.h:
2452 * src/insets/insetgraphicsParams.C: Added files, parameter passing
2453 struct between InsetGraphics and GUI.
2455 * src/LaTeXFeatures.h:
2456 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
2457 support for graphicx package.
2459 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
2460 for the graphics inset.
2462 * src/support/translator.h: Added file, used in
2463 InsetGraphicsParams. this is a template to translate between two
2466 * src/frontends/xforms/RadioButtonGroup.h:
2467 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
2468 way to easily control a radio button group.
2470 2000-07-28 Juergen Vigna <jug@sad.it>
2472 * src/insets/insettabular.C (LocalDispatch):
2473 (TabularFeatures): added support for lyx-functions of tabular features.
2474 (cellstart): refixed this function after someone wrongly changed it.
2476 * src/commandtags.h:
2477 * src/LyXAction.C (init): added support for tabular-features
2479 2000-07-28 Allan Rae <rae@lyx.org>
2481 * src/frontends/xforms/FormPreferences.C (build): Setup input return
2482 checking. NOTE: It seems that pressing ESC to cancel the dialog also
2483 triggers the callback for input checking. As a result we sometimes get
2484 "LyX: This shouldn't happen..." printed to cerr.
2485 (input): Started using status variable since I only free() on
2486 destruction. Some input checking for paths and font sizes.
2488 * src/frontends/xforms/FormPreferences.h: Use status to control
2489 activation of Ok and Apply
2491 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
2492 callback. Also resized to stop segfaults with 0.88. The problem is
2493 that xforms-0.88 requires the folder to be wide enough to fit all the
2494 tabs. If it isn't it causes all sorts of problems.
2496 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
2498 * src/frontends/xforms/forms/README: Reflect reality.
2500 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
2501 * src/frontends/xforms/forms/makefile: ditto.
2503 * src/commandtags.h: Get access to new Preferences dialog
2504 * src/LyXAction.C: ditto
2505 * src/lyxfunc.C: ditto
2506 * lib/ui/default.ui: ditto
2508 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2510 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
2512 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
2515 * src/frontends/xforms/form_url.[Ch]: added.
2517 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2519 * src/insets/insetbib.h: fixed bug in previous commit
2521 * src/frontends/xforms/FormUrl.h: ditto
2523 * src/frontends/xforms/FormPrint.h: ditto
2525 * src/frontends/xforms/FormPreferences.h: ditto
2527 * src/frontends/xforms/FormCopyright.h: ditto
2529 * src/frontends/xforms/FormCitation.C: ditto
2531 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
2532 private copyconstructor and private default contructor
2534 * src/support/Makefile.am: add utility.hpp
2536 * src/support/utility.hpp: new file from boost
2538 * src/insets/insetbib.h: set owner in clone
2540 * src/frontends/xforms/FormCitation.C: added missing include
2543 * src/insets/form_url.[Ch]: removed
2545 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
2547 * development/lyx.spec.in
2548 * Makefile.am: Fix buglet for LyX RPM generation resulting from
2549 file/directory re-organization.
2551 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
2553 * src/insets/insetcommand.[Ch]: moved the string data and
2554 associated manipulation methods into a new stand-alone class
2555 InsetCommandParams. This class has two additional methods
2556 getAsString() and setFromString() allowing the contents to be
2557 moved around as a single string.
2558 (addContents) method removed.
2559 (setContents) method no longer virtual.
2561 * src/buffer.C (readInset): made use of new InsetCitation,
2562 InsetUrl constructors based on InsetCommandParams.
2564 * src/commandtags.h: add LFUN_INSERT_URL
2566 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
2567 independent InsetUrl and use InsetCommandParams to extract
2568 string info and create new Insets.
2570 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
2572 * src/frontends/xforms/FormCitation.C (apply): uses
2575 * src/frontends/xforms/form_url.C
2576 * src/frontends/xforms/form_url.h
2577 * src/frontends/xforms/FormUrl.h
2578 * src/frontends/xforms/FormUrl.C
2579 * src/frontends/xforms/forms/form_url.fd: new files
2581 * src/insets/insetcite.[Ch]: removed unused constructors.
2583 * src/insets/insetinclude.[Ch]: no longer store filename
2585 * src/insets/inseturl.[Ch]: GUI-independent.
2587 2000-07-26 Juergen Vigna <jug@sad.it>
2588 * renamed frontend from gtk to gnome as it is that what is realized
2589 and did the necessary changes in the files.
2591 2000-07-26 Marko Vendelin <markov@ioc.ee>
2593 * configure.in: cleaning up gnome configuration scripts
2595 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2597 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
2598 shortcuts syndrom by redrawing them explicitely (a better solution
2599 would be appreciated).
2601 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
2603 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
2606 * src/lyx_cb.C (MenuExport): change html export to do the right
2607 thing depending of the document type (instead of having
2608 html-linuxdoc and html-docbook).
2609 * src/lyxfunc.C (getStatus): update for html
2610 * lib/ui/default.ui: simplify due to the above change.
2611 * src/menus.C (ShowFileMenu): update too (in case we need it).
2613 * src/MenuBackend.C (read): if a menu is defined twice, add the
2614 new entries to the exiting one.
2616 2000-07-26 Juergen Vigna <jug@sad.it>
2618 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
2620 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
2621 and return a bool if it did actual save the file.
2622 (AutoSave): don't autosave a unnamed doc.
2624 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
2625 check if this is an UNNAMED new file and react to it.
2626 (newFile): set buffer to unnamed and change to not mark a new
2627 buffer dirty if I didn't do anything with it.
2629 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
2631 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2633 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
2634 friend as per Angus's patch posted to lyx-devel.
2636 * src/ext_l10n.h: updated
2638 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
2639 gettext on the style string right before inserting them into the
2642 * autogen.sh: add code to extract style strings form layout files,
2643 not good enough yet.
2645 * src/frontends/gtk/.cvsignore: add MAKEFILE
2647 * src/MenuBackend.C (read): run the label strings through gettext
2648 before storing them in the containers.
2650 * src/ext_l10n.h: new file
2652 * autogen.sh : generate the ext_l10n.h file here
2654 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2656 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
2659 * lib/ui/default.ui: fix a couple of typos.
2661 * config/gnome/gtk.m4: added (and added to the list of files in
2664 * src/insets/insetinclude.C (unique_id): fix when we are using
2665 lyxstring instead of basic_string<>.
2666 * src/insets/insettext.C (LocalDispatch): ditto.
2667 * src/support/filetools.C: ditto.
2669 * lib/configure.m4: create the ui/ directory if necessary.
2671 * src/LyXView.[Ch] (updateToolbar): new method.
2673 * src/BufferView_pimpl.C (buffer): update the toolbar when
2674 opening/closing buffer.
2676 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2678 * src/LyXAction.C (getActionName): enhance to return also the name
2679 and options of pseudo-actions.
2680 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
2682 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
2683 as an example of what is possible). Used in File->Build too (more
2684 useful) and in the import/export menus (to mimick the complicated
2685 handling of linuxdoc and friends). Try to update all the entries.
2687 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
2690 * src/MenuBackend.C (read): Parse the new OptItem tag.
2692 * src/MenuBackend.h: Add a new optional_ data member (used if the
2693 entry should be omitted when the lyxfunc is disabled).
2695 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
2696 function, used as a shortcut.
2697 (create_submenu): align correctly the shortcuts on the widest
2700 * src/MenuBackend.h: MenuItem.label() only returns the label of
2701 the menu without shortcut; new method shortcut().
2703 2000-07-14 Marko Vendelin <markov@ioc.ee>
2705 * src/frontends/gtk/Dialogs.C:
2706 * src/frontends/gtk/FormCopyright.C:
2707 * src/frontends/gtk/FormCopyright.h:
2708 * src/frontends/gtk/Makefile.am: added these source-files for the
2709 Gtk/Gnome support of the Copyright-Dialog.
2711 * src/main.C: added Gnome::Main initialization if using
2712 Gtk/Gnome frontend-GUI.
2714 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
2716 * config/gnome/aclocal-include.m4
2717 * config/gnome/compiler-flags.m4
2718 * config/gnome/curses.m4
2719 * config/gnome/gnome--.m4
2720 * config/gnome/gnome-bonobo-check.m4
2721 * config/gnome/gnome-common.m4
2722 * config/gnome/gnome-fileutils.m4
2723 * config/gnome/gnome-ghttp-check.m4
2724 * config/gnome/gnome-gnorba-check.m4
2725 * config/gnome/gnome-guile-checks.m4
2726 * config/gnome/gnome-libgtop-check.m4
2727 * config/gnome/gnome-objc-checks.m4
2728 * config/gnome/gnome-orbit-check.m4
2729 * config/gnome/gnome-print-check.m4
2730 * config/gnome/gnome-pthread-check.m4
2731 * config/gnome/gnome-support.m4
2732 * config/gnome/gnome-undelfs.m4
2733 * config/gnome/gnome-vfs.m4
2734 * config/gnome/gnome-x-checks.m4
2735 * config/gnome/gnome-xml-check.m4
2736 * config/gnome/gnome.m4
2737 * config/gnome/gperf-check.m4
2738 * config/gnome/gtk--.m4
2739 * config/gnome/linger.m4
2740 * config/gnome/need-declaration.m4: added configuration scripts
2741 for Gtk/Gnome frontend-GUI
2743 * configure.in: added support for the --with-frontend=gtk option
2745 * autogen.sh: added config/gnome/* to list of config-files
2747 * acconfig.h: added define for GTKGUI-support
2749 * config/lyxinclude.m4: added --with-frontend[=value] option value
2750 for Gtk/Gnome frontend-GUI support.
2752 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2754 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
2758 * src/paragraph.C (GetChar): remove non-const version
2760 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
2761 (search_kw): use it.
2763 * src/lyx_main.C (init): if "preferences" exist, read that instead
2765 (ReadRcFile): return bool if the file could be read ok.
2766 (ReadUIFile): add a check to see if lex file is set ok.
2768 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
2769 bastring can be used instead of lyxstring (still uses the old code
2770 if std::string is good enough or if lyxstring is used.)
2772 * src/encoding.C: make the arrays static, move ininle functions
2774 * src/encoding.h: from here.
2776 * src/buffer.C: have last_isnet_read as a file scope variable for now.
2777 (parseSingleLyXformat2Token): move inset parsing to separate method
2778 (readInset): new private method
2780 * src/Variables.h: remove virtual from get().
2782 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
2783 access to NEW_INSETS and NEW_TABULAR
2785 * src/MenuBackend.h: remove superfluous forward declaration of
2786 MenuItem. Add documentations tags "///", remove empty MenuItem
2787 destructor, remove private default contructor.
2789 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
2791 (read): more string mlabel and mname to where they are used
2792 (read): remove unused variables mlabel and mname
2793 (defaults): unconditional clear, make menusetup take advantage of
2794 add returning Menu &.
2796 * src/LyXView.h: define NEW_MENUBAR as default
2798 * src/LyXAction.C: include lyxparagraph.h temporary to get access
2799 to NEW_INSETS and NEW_TABULAR.
2800 (init): commetn out some funcs that is obsolete when NEW_INSETS is
2801 defined. Change some of the "xxxx-inset-insert" functions names to
2804 * several files: more enahncements to NEW_INSETS and the resulting
2807 * lib/lyxrc.example (\date_insert_format): move to misc section
2809 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
2810 bastring and use AC_CACHE_CHECK.
2811 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
2812 the system have the newest methods. uses AC_CACHE_CHECK
2813 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
2814 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
2815 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
2817 * configure.in: add LYX_CXX_GOOD_STD_STRING
2819 * acinclude.m4: recreated
2821 2000-07-24 Amir Karger
2823 * README: add Hebrew, Arabic kmaps
2826 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2828 * src/buffer.C (writeFileAscii): Define actcell as an int instead
2831 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2833 * Lot of files: add pragma interface/implementation.
2835 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
2837 * lib/ui/default.ui: new file (ans new directory). Contains the
2838 default menu and toolbar.
2840 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
2841 global space. Toolbars are now read (as menus) in ui files.
2843 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
2845 * src/lyxfunc.C (getStatus): do not exit immediately if a command
2846 is disabled because the document is read-only. We want to have the
2847 toggle state of the function anyway.
2848 (getStatus): add code for LFUN_VC* functions (mimicking what is
2849 done in old-style menus)
2851 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
2852 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
2854 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
2855 * src/BufferView_pimpl.C: ditto.
2856 * src/lyxfunc.C: ditto.
2858 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
2859 default). This replaces old-style menus by new ones.
2861 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
2862 MenuItem. Contain the data structure of a menu.
2864 * src/insets/insettext.C: use LyXView::setLayout instead of
2865 accessing directly the toolbar combox.
2866 * src/lyxfunc.C (Dispatch): ditto.
2868 * src/LyXView.C (setLayout): new method, which just calls
2869 Toolbar::setLayout().
2870 (updateLayoutChoice): move part of this method in Toolbar.
2872 * src/toolbar.[Ch]: removed.
2874 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
2875 implementation the toolbar.
2877 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
2878 the toolbar. It might make sense to merge it with ToolbarDefaults
2880 (setLayout): new function.
2881 (updateLayoutList): ditto.
2882 (openLayoutList): ditto.
2884 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
2885 xforms implementation of the toolbar.
2886 (get_toolbar_func): comment out, since I do not
2887 know what it is good for.
2889 * src/ToolbarDefaults.h: Add the ItemType enum.
2891 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
2892 for a list of allocated C strings. Used in Menubar xforms
2893 implementation to avoid memory leaks.
2895 * src/support/lstrings.[Ch] (uppercase): new version taking and
2899 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
2900 * lib/bind/emacs.bind: ditto.
2902 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2904 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
2905 forward decl of LyXView.
2907 * src/toolbar.C (toolbarItem): moved from toolbar.h
2908 (toolbarItem::clean): ditto
2909 (toolbarItem::~toolbarItem): ditto
2910 (toolbarItem::operator): ditto
2912 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
2914 * src/paragraph.h: control the NEW_TABULAR define from here
2916 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
2917 USE_TABULAR_INSETS to NEW_TABULAR
2919 * src/ToolbarDefaults.C: add include "lyxlex.h"
2921 * files using the old table/tabular: use NEW_TABULAR to control
2922 compilation of old tabular stuff.
2924 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
2927 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
2928 planemet in reading of old style floats, fix the \end_deeper
2929 problem when reading old style floats.
2931 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2933 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
2935 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
2937 * lib/bind/sciword.bind: updated.
2939 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2941 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
2942 layout write problem
2944 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2946 * src/Makefile.am (INCLUDES): remove image directory from include
2949 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
2950 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
2952 * src/LyXView.C (create_form_form_main): read the application icon
2955 * lib/images/*.xpm: change the icons to use transparent color for
2958 * src/toolbar.C (update): change the color of the button when it
2961 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2963 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
2964 setting explicitely the minibuffer.
2965 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
2967 * src/LyXView.C (showState): new function. Shows font information
2968 in minibuffer and update toolbar state.
2969 (LyXView): call Toolbar::update after creating the
2972 * src/toolbar.C: change toollist to be a vector instead of a
2974 (BubbleTimerCB): get help string directly from the callback
2975 argument of the corresponding icon (which is the action)
2976 (set): remove unnecessary ugliness.
2977 (update): new function. update the icons (depressed, disabled)
2978 depending of the status of the corresponding action.
2980 * src/toolbar.h: remove help in toolbarItem
2982 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
2984 * src/Painter.C (text): Added code for using symbol glyphs from
2985 iso10646 fonts. Currently diabled.
2987 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
2990 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
2991 magyar,turkish and usorbian.
2993 * src/paragraph.C (isMultiLingual): Made more efficient.
2995 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
2998 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
2999 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
3000 Also changed the prototype to "bool math_insert_greek(char)".
3002 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3004 * lots of files: apply the NEW_INSETS on all code that will not be
3005 needed when we move to use the new insets. Enable the define in
3006 lyxparagrah.h to try it.
3008 * src/insets/insettabular.C (cellstart): change to be a static
3010 (InsetTabular): initialize buffer in the initializer list.
3012 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
3014 * src/frontends/xforms/FormPrint.[Ch] : moved #include
3015 form_print.h out of the header file. Replaced with forward
3016 declarations of the relevant struct.
3018 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
3021 * src/commandtags.h: do not include "debug.h" which does not
3022 belong there. #include it in some other places because of this
3025 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3027 * src/insets/insetcaption.C: add a couple "using" directives.
3029 * src/toolbar.C (add): get the help text directly from lyxaction.
3031 (setPixmap): new function. Loads from disk and sets a pixmap on a
3032 botton; the name of the pixmap file is derived from the command
3035 * src/toolbar.h: remove members isBitmap and pixmap from
3038 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
3039 * lib/images/: move many files from images/banner.xpm.
3041 * src/lyx_gui.C (create_forms): read banner pixmap from file.
3043 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
3044 * src/toolbar.C: ditto.
3045 * configure.in: ditto.
3046 * INSTALL: document.
3048 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
3049 the spellchecker popup is closed from the WM.
3051 2000-07-19 Juergen Vigna <jug@sad.it>
3053 * src/insets/insetfloat.C (Write): small fix because we use the
3054 insetname for the type now!
3056 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
3058 * src/frontends/xforms/forms/form_citation.fd: object sizes are
3061 * src/frontends/Dialogs.h: removed hideCitation signal
3063 * src/insets/insetcite.h: added hide signal
3065 * src/insets/insetcite.C (~InsetCitation): emits new signal
3066 (getScreenLabel): "intelligent" label should now fit on the screen!
3068 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
3070 * src/frontends/xforms/FormCitation.C (showInset): connects
3071 hide() to the inset's hide signal
3072 (show): modified to use fl_set_object_position rather than
3073 fl_set_object_geometry wherever possible
3075 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3077 * src/insets/lyxinset.h: add caption code
3079 * src/insets/insetfloat.C (type): new method
3081 * src/insets/insetcaption.C (Write): new method
3083 (LyxCode): new method
3085 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
3086 to get it right together with using the FloatList.
3088 * src/commandtags.h: add LFUN_INSET_CAPTION
3089 * src/lyxfunc.C (Dispatch): handle it
3091 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
3094 * src/Variables.[Ch]: make expand take a const reference, remove
3095 the destructor, some whitespace changes.
3097 * src/LyXAction.C (init): add caption-inset-insert
3099 * src/FloatList.C (FloatList): update the default floats a bit.
3101 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3103 * src/Variables.[Ch]: new files. Intended to be used for language
3104 specific strings (like \chaptername) and filename substitution in
3107 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
3109 * lib/kbd/american.kmap: update
3111 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
3113 * src/bufferparams.[Ch]: remove member allowAccents.
3115 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
3117 * src/LaTeXLog.C: use the log_form.h header.
3118 * src/lyx_gui.C: ditto.
3119 * src/lyx_gui_misc.C: ditto.
3120 * src/lyxvc.h: ditto.
3122 * forms/log_form.fd: new file, created from latexoptions.fd. I
3123 kept the log popup and nuked the options form.
3125 * src/{la,}texoptions.[Ch]: removed.
3126 * src/lyx_cb.C (LaTeXOptions): ditto
3128 * src/lyx_gui.C (create_forms): do not handle the
3129 fd_latex_options form.
3131 2000-07-18 Juergen Vigna <jug@sad.it>
3133 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
3134 name of the inset so that it can be requested outside (text2.C).
3136 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
3139 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3141 * src/mathed/formula.h (ConvertFont): constify
3143 * src/mathed/formula.C (Read): add warning if \end_inset is not
3144 found on expected place.
3146 * src/insets/lyxinset.h (ConvertFont): consify
3148 * src/insets/insetquotes.C (ConvertFont): constify
3149 * src/insets/insetquotes.h: ditto
3151 * src/insets/insetinfo.h: add labelfont
3153 * src/insets/insetinfo.C (InsetInfo): set the labelfont
3154 (ascent): use labelfont
3158 (Write): make .lyx file a bit nicer
3160 * src/insets/insetfloat.C (Write): simplify somewhat...
3161 (Read): add warning if arg is not found
3163 * src/insets/insetcollapsable.C: add using std::max
3164 (Read): move string token and add warning in arg is not found
3165 (draw): use std::max to get the right ty
3166 (getMaxWidth): simplify by using std::max
3168 * src/insets/insetsection.h: new file
3169 * src/insets/insetsection.C: new file
3170 * src/insets/insetcaption.h: new file
3171 * src/insets/insetcaption.C: new file
3173 * src/insets/inset.C (ConvertFont): constify signature
3175 * src/insets/Makefile.am (libinsets_la_SOURCES): add
3176 insetcaption.[Ch] and insetsection.[Ch]
3178 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
3179 uses to use LABEL_COUNTER_CHAPTER instead.
3180 * src/text2.C (SetCounter): here
3182 * src/counters.h: new file
3183 * src/counters.C: new file
3184 * src/Sectioning.h: new file
3185 * src/Sectioning.C: new file
3187 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
3189 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3191 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
3194 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
3197 2000-07-17 Juergen Vigna <jug@sad.it>
3199 * src/tabular.C (Validate): check if array-package is needed.
3200 (SetVAlignment): added support for vertical alignment.
3201 (SetLTFoot): better support for longtable header/footers
3202 (Latex): modified to support added features.
3204 * src/LaTeXFeatures.[Ch]: added array-package.
3206 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
3208 * src/lyx_gui.C (LyXGUI): make sure that the height is large
3211 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
3213 * configure.in: do not forget to put a space after -isystem.
3215 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
3217 * lib/kbd/arabic.kmap: a few fixes.
3219 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3221 * some whitespace chagnes to a number of files.
3223 * src/support/DebugStream.h: change to make it easier for
3224 doc++ to parse correctly.
3225 * src/support/lyxstring.h: ditto
3227 * src/mathed/math_utils.C (compara): change to have only one
3229 (MathedLookupBOP): change because of the above.
3231 * src/mathed/math_delim.C (math_deco_compare): change to have only
3233 (search_deco): change becasue of the above.
3235 * src/insets/insettabular.C (DrawCellSelection): use std::swap
3236 instead of manually coded one.
3238 * src/insets/insetquotes.C (Read): read the \end_inset too
3240 * src/insets/insetlatex.h: remove file
3241 * src/insets/insetlatex.C: remove file
3243 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
3245 (InsetPrintIndex): remove destructor
3247 * src/insets/insetinclude.h: remove default constructor
3249 * src/insets/insetfloat.C: work to make it work better
3251 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
3253 * src/insets/insetcite.h (InsetCitation): remove default constructor
3255 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
3257 * src/text.C (GetColumnNearX): comment out some currently unused code.
3259 * src/paragraph.C (writeFile): move some initializations closer to
3261 (CutIntoMinibuffer): small change to use new matchIT operator
3265 (InsertInset): ditto
3268 (InsetIterator): ditto
3269 (Erase): small change to use new matchFT operator
3271 (GetFontSettings): ditto
3272 (HighestFontInRange): ditto
3275 * src/lyxparagraph.h: some chars changed to value_type
3276 (matchIT): because of some stronger checking (perhaps too strong)
3277 in SGI STL, the two operator() unified to one.
3280 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
3282 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
3283 the last inset read added
3284 (parseSingleLyXformat2Token): some more (future) compability code added
3285 (parseSingleLyXformat2Token): warning about solitary \end_inset added
3286 (parseSingleLyXformat2Token): set last_inset_read
3287 (parseSingleLyXformat2Token): more code to read new "Float" correctly
3288 (parseSingleLyXformat2Token): don't double intializw string next_token
3290 * src/TextCache.C (text_fits::operator()): add const's to the signature
3291 (has_buffer::operator()): ditto
3293 * src/Floating.h: add some comments on the class
3295 * src/FloatList.[Ch] (typeExist): new method
3298 * src/BackStack.h: added default constructor, wanted by Gcc.
3300 2000-07-14 Juergen Vigna <jug@sad.it>
3302 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
3304 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
3306 * src/insets/insettabular.C (resizeLyXText): need this to be able to
3307 do a redraw when the window is resized!
3308 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
3310 * src/insets/insettext.C (resizeLyXText): added function to correctly
3311 being able to resize the LyXWindow.
3313 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
3315 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
3317 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
3318 crashes when closing dialog to a deleted inset.
3320 * src/insets/insetcite.[Ch] (Edit) : the return of this former
3321 method! Now similar to other insets.
3323 2000-07-13 Juergen Vigna <jug@sad.it>
3325 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
3327 * lib/examples/Literate.lyx: small patch!
3329 * src/insets/insetbib.C (Read): added this function because of wrong
3330 Write (without [begin|end]_inset).
3332 2000-07-11 Juergen Vigna <jug@sad.it>
3334 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
3335 as the insertInset could not be good!
3337 * src/screen.C (ToggleSelection): fixed toggle selection bug as
3338 the bool param should not be last.
3340 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3342 * sigc++/configure.in: fix bug in threading-related code (Yes, I
3343 did submit that to Karl).
3345 * configure.in: use -isystem instead of -I for X headers. This
3346 fixes a problem on solaris with a recent gcc;
3347 put the front-end code after the X detection code;
3348 configure in sigc++ before lib/
3350 * src/lyx_main.C (commandLineHelp): remove -display from command
3353 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
3355 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
3356 Also put in Makefile rules for building the ``listerrors''
3357 program for parsing errors from literate programs written in LyX.
3359 * lib/build-listerrors: Added small shell script as part of compile
3360 process. This builds a working ``listerrors'' binary if noweb is
3361 installed and either 1) the VNC X server is installed on the machine,
3362 or 2) the user is compiling from within a GUI. The existence of a GUI
3363 is necessary to use the ``lyx --export'' feature for now. This
3364 hack can be removed once ``lyx --export'' no longer requires a GUI to
3367 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
3369 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
3370 now passed back correctly from gcc and placed "under" error
3371 buttons in a Literate LyX source.
3373 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3375 * src/text.C (GetColumnNearX): Better behavior when a RTL
3376 paragraph is ended by LTR text.
3378 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
3381 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3383 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
3384 true when clipboard is empty.
3386 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3388 * text.C (Backspace): Prevent rebreaking of a row if it is the last
3389 row of the paragraph.
3390 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
3391 to prevent calculation of bidi tables
3393 2000-07-07 Juergen Vigna <jug@sad.it>
3395 * src/screen.C (ToggleSelection): added y_offset and x_offset
3398 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
3401 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
3403 * src/insets/insettext.C: fixed Layout-Display!
3405 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3407 * configure.in: add check for strings.h header.
3409 * src/spellchecker.C: include <strings.h> in order to have a
3410 definition for bzero().
3412 2000-07-07 Juergen Vigna <jug@sad.it>
3414 * src/insets/insettext.C (draw): set the status of the bv->text to
3415 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
3417 * src/screen.C (DrawOneRow):
3418 (DrawFromTo): redraw the actual row if something has changed in it
3421 * src/text.C (draw): call an update of the toplevel-inset if something
3422 has changed inside while drawing.
3424 * src/lyxtext.h: added CHANGED_IN_DRAW status.
3426 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
3428 * src/insets/insetbib.[Ch] (callback) new method, moving callback
3429 processing inside class.
3431 * src/insets/insetindex.[Ch] (callback) new method, moving callback
3432 processing inside class.
3434 * src/insets/insetindex.h new struct Holder, consistent with other
3437 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
3438 citation dialog from main code and placed it in src/frontends/xforms.
3439 Dialog launched through signals instead of callbacks
3441 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
3443 * lyx.man: update the options description.
3445 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
3447 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
3448 handle neg values, set min width to 590, add doc about -display
3450 2000-07-05 Juergen Vigna <jug@sad.it>
3452 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
3453 calls to BufferView *.
3455 * src/insets/insettext.C (checkAndActivateInset): small fix non
3456 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
3458 * src/insets/insetcommand.C (Read): Fixed as insets should read till
3459 their \end_inset token!
3461 2000-07-04 edscott <edscott@imp.mx>
3463 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
3464 lib/lyxrc.example: added option \wheel_jump
3466 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
3468 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
3469 remove support for -width,-height,-xpos and -ypos.
3471 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
3473 * src/encoding.[Ch]: New files.
3475 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
3476 (text): Call to the underline() method only when needed.
3478 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
3480 * src/buffer.C (makeLaTeXFile): Compute automatically the input
3481 encoding(s) for the document.
3483 * src/bufferparams.C (BufferParams): Changed default value of
3486 * src/language.C (newLang): Removed.
3487 (items[]): Added encoding information for all defined languages.
3489 * src/lyx_gui.C (create_forms): Added "auto" option to the input
3490 encoding choice button.
3492 * src/lyxrc.h (font_norm_type): New member variable.
3493 (set_font_norm_type): New method.
3495 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
3496 paragraphs with different encodings.
3498 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
3499 (TransformChar): Changed to work correctly with Arabic points.
3500 (draw): Added support for drawing Arabic points.
3501 (draw): Removed code for drawing underbars (this is done by
3504 * src/support/textutils.h (IsPrintableNonspace): New function.
3506 * src/BufferView_pimpl.h: Added "using SigC::Object".
3507 * src/LyXView.h: ditto.
3509 * src/insets/insetinclude.h (include_label): Changed to mutable.
3511 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3513 * src/mathed/math_iter.h: remove empty destructor
3515 * src/mathed/math_cursor.h: remove empty destructor
3517 * src/insets/lyxinset.h: add THEOREM_CODE
3519 * src/insets/insettheorem.[Ch]: new files
3521 * src/insets/insetminipage.C: (InsertInset): remove
3523 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
3525 (InsertInset): remove
3527 * src/insets/insetlist.C: (InsertList): remove
3529 * src/insets/insetfootlike.[Ch]: new files
3531 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
3534 (InsertInset): ditto
3536 * src/insets/insetert.C: remove include Painter.h, reindent
3537 (InsertInset): move to header
3539 * src/insets/insetcollapsable.h: remove explicit from default
3540 contructor, remove empty destructor, add InsertInset
3542 * src/insets/insetcollapsable.C (InsertInset): new func
3544 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3546 * src/vspace.h: add explicit to constructor
3548 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
3549 \textcompwordmark, please test this.
3551 * src/lyxrc.C: set ascii_linelen to 65 by default
3553 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
3555 * src/commandtags.h: add LFUN_INSET_THEOREM
3557 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
3558 (makeLinuxDocFile): remove _some_ of the nice logic
3559 (makeDocBookFile): ditto
3561 * src/Painter.[Ch]: (~Painter): removed
3563 * src/LyXAction.C (init): entry for insettheorem added
3565 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
3567 (deplog): code to detect files generated by LaTeX, needs testing
3570 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3572 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
3574 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3576 * src/LaTeX.C (deplog): Add a check for files that are going to be
3577 created by the first latex run, part of the project to remove the
3580 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
3581 contents to the extension list.
3583 2000-07-04 Juergen Vigna <jug@sad.it>
3585 * src/text.C (NextBreakPoint): added support for needFullRow()
3587 * src/insets/lyxinset.h: added needFullRow()
3589 * src/insets/insetcollapsable.C: redone now this uses a text-inset
3592 * src/insets/insettext.C: lots of changes for update!
3594 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
3596 * src/LaTeXFeatures.h: add a missing std:: qualifier.
3598 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
3600 * src/insets/insetinclude.C (InsetInclude): fixed
3601 initialization of include_label.
3602 (unique_id): now returns a string.
3604 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
3606 * src/LaTeXFeatures.h: new member IncludedFiles, for
3607 a map of key, included file name.
3609 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
3610 with the included files for inclusion in SGML preamble,
3611 i. e., linuxdoc and docbook.
3614 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
3615 nice (is the generated linuxdoc code to be exported?), that
3616 allows to remove column, and only_body that will be true for
3617 slave documents. Insets are allowed inside SGML font type.
3618 New handling of the SGML preamble for included files.
3619 (makeDocBookFile): the same for docbook.
3621 * src/insets/insetinclude.h:
3622 * src/insets/insetinclude.C (Validate): keeps a list of included files.
3624 (DocBook): new export methods.
3626 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
3627 and makeDocBookFile.
3629 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
3630 formats to export with command line argument -x.
3632 2000-06-29 Juergen Vigna <jug@sad.it>
3634 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
3635 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
3637 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
3638 region could already been cleared by an inset!
3640 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3642 * src/BufferView_pimpl.h: remove member variables lyx_focus and
3645 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
3647 (cursorToggle): remove special handling of lyx focus.
3649 2000-06-28 Juergen Vigna <jug@sad.it>
3651 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
3654 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3656 * src/insets/insetindex.C (Edit): add a callback when popup is
3659 * src/insets/insettext.C (LocalDispatch):
3660 * src/insets/insetmarginal.h:
3661 * src/insets/insetlist.h:
3662 * src/insets/insetfoot.h:
3663 * src/insets/insetfloat.h:
3664 * src/insets/insetert.h: add a missing std:: qualifier.
3666 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3668 * src/support/lyxsum.C (sum): '\0' teminate file read when using
3671 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
3673 * src/insets/insettext.C (Read): remove tmptok unused variable
3674 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
3675 (InsertInset): change for new InsetInset code
3677 * src/insets/insettext.h: add TEXT inline method
3679 * src/insets/insettext.C: remove TEXT macro
3681 * src/insets/insetmarginal.C (Write): new method
3682 (Latex): change output slightly
3684 * src/insets/insetfoot.C (Write): new method
3685 (Latex): change output slightly (don't use endl when no need)
3687 * src/insets/insetert.C (Write): new method
3689 * src/insets/insetcollapsable.h: make button_length, button_top_y
3690 and button_bottm_y protected.
3692 * src/insets/insetcollapsable.C (Write): simplify code by using
3693 tostr. Also do not output the float name, the children class
3694 should to that to get control over own arguments
3696 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
3697 src/insets/insetminipage.[Ch]:
3700 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3702 * src/lyxfunc.C (Dispatch): cases for new insets/commands
3704 * src/Makefile.am (lyx_SOURCES): add the new files
3706 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
3707 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
3708 * src/commandtags.h: ditto
3710 * src/LaTeXFeatures.h: add a std::set of used floattypes
3712 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
3714 * src/FloatList.[Ch] src/Floating.h: new files
3716 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
3718 * src/lyx_cb.C (TableApplyCB): ditto
3720 * src/text2.C: ditto
3721 * src/buffer.C (SimpleLinuxDocOnePar): ditto
3722 (parseSingleLyXformat2Token): ditto + add code for
3723 backwards compability for old float styles + add code for new insets
3725 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
3727 (InsertInset(size_type, Inset *, LyXFont)): new method
3728 (InsetChar(size_type, char)): changed to use the other InsetChar
3729 with a LyXFont(ALL_INHERIT).
3730 (InsetInset(size_type, Inset*)): changed to use InsetChar to
3731 insert the META_INSET.
3733 * sigc++/thread.cc (Privete<int>::operator int&): move definition
3735 * sigc++/thread.h (Threads): from here
3737 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
3738 definition out of line
3739 * sigc++/scope.h: from here
3741 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3743 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
3744 is specified (adapted from a patch from edscott <edscott@imp.mx>).
3746 * Makefile.am (bindist): new target.
3748 * INSTALL: add instructions for doing a binary distribution.
3750 * development/tools/README.bin.example: update a bit.
3752 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
3755 * lib/lyxrc.example: new lyxrc tag \set_color.
3757 * src/lyxfunc.C (Dispatch):
3758 * src/commandtags.h:
3759 * src/LyXAction.C: new lyxfunc "set-color".
3761 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
3762 and an x11name given as strings.
3764 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
3765 cache when a color is changed.
3767 2000-06-26 Juergen Vigna <jug@sad.it>
3769 * src/lyxrow.C (width): added this functions and variable.
3771 * src/insets/insetcite.C (create_form_citation_form): some Gravity
3774 * src/text.C (SetHeightOfRow): fixed calcualting of width.
3776 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3778 * images/undo_bw.xpm: new icon.
3779 * images/redo_bw.xpm: ditto.
3781 * configure.in (INSTALL_SCRIPT): change value to
3782 ${INSTALL} to avoid failures of install-script target.
3783 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
3785 * src/BufferView.h: add a magic "friend" declaration to please
3788 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
3790 * forms/cite.fd: modified to allow resizing without messing
3793 * src/insetcite.C: Uses code from cite.fd almost without
3795 User can now resize dialog in the x-direction.
3796 Resizing the dialog in the y-direction is prevented, as the
3797 code does this intelligently already.
3799 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3801 * INSTALL: remove obsolete entry in "problems" section.
3803 * lib/examples/sl_*.lyx: update of the slovenian examples.
3805 * src/support/FileInfo.[Ch] (getBlockSize): remove.
3807 2000-06-23 Juergen Vigna <jug@sad.it>
3809 * src/lyxtext.h: added a 'cleared' flag to draw() function.
3811 * src/buffer.C (resize): delete the LyXText of textinsets.
3813 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
3815 * src/insets/lyxinset.h: added another parameter 'cleared' to
3816 the draw() function.
3818 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
3819 unlocking inset in inset.
3821 2000-06-22 Juergen Vigna <jug@sad.it>
3823 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
3824 of insets and moved first to LyXText.
3826 * src/mathed/formulamacro.[Ch]:
3827 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
3829 2000-06-21 Juergen Vigna <jug@sad.it>
3831 * src/text.C (GetVisibleRow): look if I should clear the area or not
3832 using Inset::doClearArea() function.
3834 * src/insets/lyxinset.h: added doClearArea() function and
3835 modified draw(Painter &, ...) to draw(BufferView *, ...)
3837 * src/text2.C (UpdateInset): return bool insted of int
3839 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
3841 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
3842 combox in the character popup
3844 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
3845 BufferParams const & params
3847 2000-06-20 Juergen Vigna <jug@sad.it>
3849 * src/insets/insettext.C (SetParagraphData): set insetowner on
3852 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3854 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
3855 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
3857 (form_main_): remove
3859 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
3860 (create_form_form_main): remove FD_form_main stuff, connect to
3861 autosave_timeout signal
3863 * src/LyXView.[Ch] (getMainForm): remove
3864 (UpdateTimerCB): remove
3865 * src/BufferView_pimpl.h: inherit from SigC::Object
3867 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
3868 signal instead of callback
3870 * src/BufferView.[Ch] (cursorToggleCB): remove
3872 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3874 * src/BufferView_pimpl.C: changes because of the one below
3876 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
3877 instead of storing a pointer to a LyXText.
3879 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
3881 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
3883 * src/lyxparagraph.h
3885 * src/paragraph.C: Changed fontlist to a sorted vector.
3887 2000-06-19 Juergen Vigna <jug@sad.it>
3889 * src/BufferView.h: added screen() function.
3891 * src/insets/insettext.C (LocalDispatch): some selection code
3894 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
3896 * src/insets/insettext.C (SetParagraphData):
3898 (InsetText): fixes for multiple paragraphs.
3900 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
3902 * development/lyx.spec.in: Call configure with ``--without-warnings''
3903 to work around a bug with the Makefiles when doing ``make lyxrpm''.
3904 This should be fine, however, since we generally don't want to be
3905 verbose when making an RPM.
3907 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
3909 * lib/scripts/fig2pstex.py: New file
3911 2000-06-16 Juergen Vigna <jug@sad.it>
3913 * src/insets/insettabular.C (UpdateLocal):
3914 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
3915 (LocalDispatch): Changed all functions to use LyXText.
3917 2000-06-15 Juergen Vigna <jug@sad.it>
3919 * src/text.C (SetHeightOfRow): call inset::update before requesting
3922 * src/insets/insettext.C (update):
3923 * src/insets/insettabular.C (update): added implementation
3925 * src/insets/lyxinset.h: added update function
3927 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3929 * src/text.C (SelectNextWord): protect against null pointers with
3930 old-style string streams. (fix from Paul Theo Gonciari
3933 * src/cite.[Ch]: remove erroneous files.
3935 * lib/configure.m4: update the list of created directories.
3937 * src/lyxrow.C: include <config.h>
3938 * src/lyxcursor.C: ditto.
3940 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3942 * lib/examples/decimal.lyx: new example file from Mike.
3944 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
3945 to find template definitions (from Dekel)
3947 * src/frontends/.cvsignore: add a few things.
3949 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
3951 * src/Timeout.C (TimeOut): remove default argument.
3953 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
3956 * src/insets/ExternalTemplate.C: add a "using" directive.
3958 * src/lyx_main.h: remove the act_ struct, which seems unused
3961 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
3963 * LyX Developers Meeting: All files changed, due to random C++ (by
3964 coincidence) code generator script.
3966 - external inset (cool!)
3967 - initial online editing of preferences
3968 - insettabular breaks insettext(s contents)
3970 - some DocBook fixes
3971 - example files update
3972 - other cool stuff, create a diff and look for yourself.
3974 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
3976 * src/insets/insettext.C (computeTextRows): if the maxWidth is
3977 -1 this is a non-line-breaking textinset.
3979 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
3980 if there is no width set.
3982 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
3984 * Lots of files: Merged the dialogbase branch.
3986 2000-06-09 Allan Rae <rae@lyx.org>
3988 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
3989 and the Dispatch methods that used it.
3991 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
3992 access to functions formerly kept in Dispatch.
3994 2000-05-19 Allan Rae <rae@lyx.org>
3996 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
3997 made to_page and count_copies integers again. from_page remains a
3998 string however because I want to allow entry of a print range like
3999 "1,4,22-25" using this field.
4001 * src/LyXAction.C: added action info and commands for buffer-print-xtl
4002 and printer-params-get. These aren't useful from the minibuffer but
4003 could be used by a script/LyXServer app provided it passes a suitable
4004 auto_mem_buffer. I guess I should take a look at how the LyXServer
4005 works and make it support xtl buffers.
4007 * sigc++/: updated to libsigc++-1.0.1
4009 * src/xtl/: updated to xtl-1.3.pl.11
4011 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
4012 those changes done to the files in src/ are actually recreated when
4013 they get regenerated. Please don't ever accept a patch that changes a
4014 dialog unless that patch includes the changes to the corresponding *.fd
4017 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
4018 stringOnlyContains, renamed it and generalised it.
4020 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
4021 branch. Removed the remaining old form_print code.
4023 2000-04-26 Allan Rae <rae@lyx.org>
4025 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
4026 trap I was trying to fix with the ID: fields in src/xtl/ :-)
4028 2000-04-25 Allan Rae <rae@lyx.org>
4030 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
4031 against a base of xtl-1.3.pl.4
4033 * development/tools/lxtl.sh: fixed a couple of silly typos and now
4034 filter the Id: entries so they still show the xtl version number
4037 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
4038 into the src/xtl code. Patch still pending with José (XTL)
4040 2000-04-24 Allan Rae <rae@lyx.org>
4042 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
4043 both more generic and much safer. Use the new template functions.
4044 * src/buffer.[Ch] (Dispatch): ditto.
4046 * src/frontends/xforms/FormPrint.C (update): Use new template functions
4047 and mem buffer more intelligently. Also a little general cleanup.
4050 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
4051 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
4052 * src/xtl/Makefile.am: ditto.
4053 * src/xtl/.cvsignore: ditto.
4054 * src/Makefile.am: ditto.
4056 * src/PrinterParams.h: Removed the macros member functions. Added a
4057 testInvariant member function. A bit of tidying up and commenting.
4058 Included Angus's idea for fixing operation with egcs-1.1.2.
4060 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
4061 cool expansion of XTL's mem_buffer to support automatic memory
4062 management within the buffer itself. Removed the various macros and
4063 replaced them with template functions that use either auto_mem_buffer
4064 or mem_buffer depending on a #define. The mem_buffer support will
4065 disappear as soon as the auto_mem_buffer is confirmed to be good on
4066 other platforms/compilers. That is, it's there so you've got something
4069 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
4070 effectively forked XTL. However I expect José will include my code
4071 into the next major release. Also fixed a memory leak.
4072 * src/xtl/text.h: ditto.
4073 * src/xtl/xdr.h: ditto.
4074 * src/xtl/giop.h: ditto.
4076 2000-04-16 Allan Rae <rae@lyx.org>
4078 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
4079 by autogen.sh and removed by maintainer-clean anyway.
4080 * .cvsignore, sigc++/.cvsignore: Support the above.
4082 * sigc++/.cvsignore: Forgot that retbind.h was generated.
4084 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
4086 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
4087 macros, renamed static callback-target member functions to suit new
4088 scheme and made them public.
4089 * src/frontends/xforms/forms/form_print.fd: ditto.
4090 * src/frontends/xforms/forms/form_copyright.fd: ditto.
4092 * src/support/lxtl.h: small cleanup to use typedef instead of #define
4095 * src/xtl/: New directory containing a minimal distribution of XTL.
4096 This is XTL-1.3.pl.4.
4098 * development/tools/lxtl.sh: A script to generate the above mini-dist.
4100 2000-04-15 Allan Rae <rae@lyx.org>
4102 * development/tools/makeLyXsigc.sh: Remove the library version numbers
4104 * sigc++/: Updated to libsigc++-1.0.0
4106 2000-04-14 Allan Rae <rae@lyx.org>
4108 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
4109 use the generic ones in future. I'll modify my conversion script.
4111 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
4113 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
4114 (CloseAllBufferRelatedDialogs): Renamed.
4115 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
4117 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
4118 of the generic ones. These are the same ones my conversion script
4121 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
4122 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
4123 * src/buffer.C (Dispatch): ditto
4125 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
4126 functions for updating and hiding buffer dependent dialogs.
4127 * src/BufferView.C (buffer): ditto
4128 * src/buffer.C (setReadonly): ditto
4129 * src/lyxfunc.C (CloseBuffer): ditto
4131 * src/buffer.h: Take setReadonly() out of line so I don't have to include
4132 Dialogs.h, and hence all the SigC stuff, into every file that includes
4133 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
4135 * src/BufferView2.C: reduce the number of headers included by buffer.h
4137 2000-04-11 Allan Rae <rae@lyx.org>
4139 * src/frontends/xforms/xform_macros.h: A small collection of macros
4140 for building C callbacks.
4142 * src/frontends/xforms/Makefile.am: Added above file.
4144 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
4145 scheme again. This time it should work for JMarc. If this is
4146 successful I'll revise my conversion script to automate some of this.
4147 The static member functions in the class also have to be public for
4148 this scheme will work. If the scheme works (it's almost identical to
4149 the way BufferView::cursorToggleCB is handled so it should work) then
4150 FormCopyright and FormPrint will be ready for inclusion into the main
4151 trunk immediately after 1.1.5 is released -- provided we're prepared
4152 for complaints about lame compilers not handling XTL.
4154 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
4156 2000-04-07 Allan Rae <rae@lyx.org>
4158 * config/lyxinclude.m4: A bit more tidying up (Angus)
4160 * src/LString.h: JMarc's <string> header fix
4162 * src/PrinterParams.h: Used string for most data to remove some
4163 ugly code in the Print dialog and avoid even uglier code when
4164 appending the ints to a string for output.
4166 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
4167 and moved "default:" back to the end of switch statement. Cleaned
4168 up the printing so it uses the right function calls and so the
4169 "print to file" option actually puts the file in the right directory.
4171 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
4173 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
4174 and Ok+Apply button control into a separate method: input (Angus).
4175 (input) Cleaned it up and improved it to be very thorough now.
4176 (All CB) static_cast used instead of C style cast (Angus). This will
4177 probably change again once we've worked out how to keep gcc-2.8.1 happy
4178 with real C callbacks.
4179 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
4180 ignore some of the bool settings and has random numbers instead. Needs
4181 some more investigation. Added other input length checks and checking
4182 of file and printer names.
4184 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
4185 would link (Angus). Seems the old code doesn't compile with the pragma
4186 statement either. Separated callback entries from internal methods.
4188 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
4190 2000-03-17 Allan Rae <rae@lyx.org>
4192 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
4193 need it? Maybe it could go in Dialogs instead? I could make it a
4194 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
4195 values to get the bool return value.
4196 (Dispatch): New overloaded method for xtl support.
4198 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
4199 extern "C" callback instead of static member functions. Hopefully,
4200 JMarc will be able to compile this. I haven't changed
4201 forms/form_copyright.fd yet. Breaking one of my own rules already.
4203 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
4204 because they aren't useful from the minibuffer. Maybe a LyXServer
4205 might want a help message though?
4207 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
4209 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
4210 xtl which needs both rtti and exceptions.
4212 * src/support/Makefile.am:
4213 * src/support/lxtl.h: New file. Some helper macros for using XTL.
4215 * src/frontends/xforms/input_validators.[ch]: input filters and
4216 validators. These conrol what keys are valid in input boxes.
4217 Use them and write some more. Much better idea than waiting till
4218 after the user has pressed Ok to say that the input fields don't make
4221 * src/frontends/xforms/Makefile.am:
4222 * src/frontends/xforms/forms/form_print.fd:
4223 * src/frontends/xforms/forms/makefile:
4224 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
4225 new scheme. Still have to make sure I haven't missed anything from
4226 the current implementation.
4228 * src/Makefile.am, src/PrinterParams.h: New data store.
4230 * other files: Added a couple of copyright notices.
4232 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4234 * src/insets/insetbib.h: move Holder struct in public space.
4236 * src/frontends/include/DialogBase.h: use SigC:: only when
4237 SIGC_CXX_NAMESPACES is defined.
4238 * src/frontends/include/Dialogs.h: ditto.
4240 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
4242 * src/frontends/xforms/FormCopyright.[Ch]: do not
4243 mention SigC:: explicitely.
4245 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4247 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
4248 deals with testing KDE in main configure.in
4249 * configure.in: ditto.
4251 2000-02-22 Allan Rae <rae@lyx.org>
4253 * Lots of files: Merged from HEAD
4255 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
4256 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
4258 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
4260 * sigc++/: new minidist.
4262 2000-02-14 Allan Rae <rae@lyx.org>
4264 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
4266 2000-02-08 Juergen Vigna <jug@sad.it>
4268 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
4269 file for the buildin GUI builder of KDevelop of the copyright-dialog.
4271 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
4272 for this port and so it is much easier for other people to port
4273 dialogs in a common development environment.
4275 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
4276 the QT/KDE implementation.
4278 * src/frontends/kde/Dialogs.C:
4279 * src/frontends/kde/FormCopyright.C:
4280 * src/frontends/kde/FormCopyright.h:
4281 * src/frontends/kde/Makefile.am:
4282 * src/frontends/kde/formcopyrightdialog.C:
4283 * src/frontends/kde/formcopyrightdialog.h:
4284 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
4285 for the kde support of the Copyright-Dialog.
4287 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
4288 subdir-substitution instead of hardcoded 'xforms' as we now have also
4291 * src/frontends/include/DialogBase.h (Object): just commented the
4292 label after #endif (nasty warning and I don't like warnings ;)
4294 * src/main.C (main): added KApplication initialization if using
4297 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
4298 For now only the KDE event-loop is added if frontend==kde.
4300 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
4302 * configure.in: added support for the --with-frontend[=value] option
4304 * autogen.sh: added kde.m4 file to list of config-files
4306 * acconfig.h: added define for KDEGUI-support
4308 * config/kde.m4: added configuration functions for KDE-port
4310 * config/lyxinclude.m4: added --with-frontend[=value] option with
4311 support for xforms and KDE.
4313 2000-02-08 Allan Rae <rae@lyx.org>
4315 * all Makefile.am: Fixed up so the make targets dist, distclean,
4316 install and uninstall all work even if builddir != srcdir. Still
4317 have a new sigc++ minidist update to come.
4319 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
4321 2000-02-01 Allan Rae <rae@lyx.org>
4323 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
4324 Many mods to get builddir != srcdir working.
4326 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
4327 for building on NT and so we can do the builddir != srcdir stuff.
4329 2000-01-30 Allan Rae <rae@lyx.org>
4331 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
4332 This will stay in "rae" branch. We probably don't really need it in
4333 the main trunk as anyone who wants to help programming it should get
4334 a full library installed also. So they can check both included and
4335 system supplied library compilation.
4337 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
4338 Added a 'mini' distribution of libsigc++. If you feel the urge to
4339 change something in these directories - Resist it. If you can't
4340 resist the urge then you should modify the following script and rebuild
4341 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
4342 all happen. Still uses a hacked version of libsigc++'s configure.in.
4343 I'm quite happy with the results. I'm not sure the extra work to turn
4344 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
4345 worth the trouble and would probably lead to extra maintenance
4347 I haven't tested the following important make targets: install, dist.
4348 Not ready for prime time but very close. Maybe 1.1.5.
4350 * development/tools/makeLyXsigc.sh: A shell script to automatically
4351 generate our mini-dist of libsigc++. It can only be used with a CVS
4352 checkout of libsigc++ not a tarball distribution. It's well commented.
4353 This will end up as part of the libsigc++ distribution so other apps
4354 can easily have an included mini-dist. If someone makes mods to the
4355 sigc++ subpackage without modifying this script to generate those
4356 changes I'll be very upset!
4358 * src/frontends/: Started the gui/system indep structure.
4360 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
4361 to access the gui-indep dialogs are in this class. Much improved
4362 design compared to previous revision. Lars, please refrain from
4363 moving this header into src/ like you did with Popups.h last time.
4365 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
4367 * src/frontends/xforms/: Started the gui-indep system with a single
4368 dialog: FormCopyright. Initial testing of use of libsigc++ was very
4371 * src/frontends/xforms/forms: Repository for the xforms .fd files.
4372 Here you'll find a very useful makefile and automated fdfix.sh that
4373 makes updating dailogs a no-brainer -- provided you follow the rules
4374 set out in the README. I'm thinking about adding another script to
4375 automatically generate skeleton code for a new dialog given just the
4378 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
4379 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
4380 Made FormCopyright gui-indep and added a lyxfunc to get to it.
4382 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4384 * src/support/LSubstring.C (operator): simplify
4386 * src/lyxtext.h: removed bparams, use buffer_->params instead
4388 * src/lyxrow.h: make Row a real class, move all variables to
4389 private and use accessors.
4391 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
4393 (isRightToLeftPar): ditto
4394 (ChangeLanguage): ditto
4395 (isMultiLingual): ditto
4398 (SimpleTeXOnePar): ditto
4399 (TeXEnvironment): ditto
4400 (GetEndLabel): ditto
4402 (SetOnlyLayout): ditto
4403 (BreakParagraph): ditto
4404 (BreakParagraphConservative): ditto
4405 (GetFontSettings): ditto
4407 (CopyIntoMinibuffer): ditto
4408 (CutIntoMinibuffer): ditto
4409 (PasteParagraph): ditto
4410 (SetPExtraType): ditto
4411 (UnsetPExtraType): ditto
4412 (DocBookContTableRows): ditto
4413 (SimpleDocBookOneTablePar): ditto
4415 (TeXFootnote): ditto
4416 (SimpleTeXOneTablePar): ditto
4417 (TeXContTableRows): ditto
4418 (SimpleTeXSpecialChars): ditto
4421 * src/lyxcursor.h: make LyXCursor a real class, move all variables
4422 to private and use accessors.
4424 * src/lyx_cb.C: remove char updatetimer, and all code that uses
4425 this, we did not use it anymore and has not been for ages. Just a
4426 waste of cpu cycles.
4428 * src/language.h: make Language a real class, move all variables
4429 to private and use accessors.
4431 * src/BufferView_pimpl.C (Pimpl): use new timer code.
4432 (create_view): remove
4433 (update): some changes for new timer
4434 (cursorToggle): use new timer
4435 (beforeChange): change for new timer
4437 * src/BufferView.h (cursorToggleCB): removed last paramter because
4440 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
4441 (cursorToggleCB): change because of new timer code
4443 * lib/CREDITS: updated own mailaddress
4445 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4447 * src/support/filetools.C (PutEnv): fix the code in case neither
4448 putenv() nor setenv() have been found.
4450 * INSTALL: mention the install-strip Makefile target.
4452 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
4453 read-only documents.
4455 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4457 * lib/reLyX/configure.in (VERSION): avoid using a previously
4458 generated reLyX wrapper to find out $prefix.
4460 * lib/examples/eu_adibide_lyx-atua.lyx:
4461 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
4462 translation of the Tutorial (Dooteo)
4464 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
4466 * forms/cite.fd: new citation dialog
4468 * src/insetcite.[Ch]: the new citation dialog is moved into
4471 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
4474 * src/insets/insetcommand.h: data members made private.
4476 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4478 * LyX 1.1.5 released
4480 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4482 * src/version.h (LYX_RELEASE): to 1.1.5
4484 * src/spellchecker.C (RunSpellChecker): return false if the
4485 spellchecker dies upon creation.
4487 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4489 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
4490 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
4494 * lib/CREDITS: update entry for Martin Vermeer.
4496 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
4498 * src/text.C (draw): Draw foreign language bars at the bottom of
4499 the row instead of at the baseline.
4501 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
4503 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4505 * lib/bind/de_menus.bind: updated
4507 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4509 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
4511 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4513 * src/menus.C (Limit_string_length): New function
4514 (ShowTocMenu): Limit the number of items/length of items in the
4517 * src/paragraph.C (String): Correct result for a paragraph inside
4520 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4522 * src/bufferlist.C (close): test of buf->getuser() == NULL
4524 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
4526 * src/BufferView2.C (removeAutoInsets): Fix a bug:
4527 Do not call to SetCursor when the paragraph is a closed footnote!
4529 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
4531 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
4534 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
4536 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4539 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
4540 reference popup, that activates the reference-back action
4542 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
4544 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
4545 the menus. Also fixed a bug.
4547 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
4548 the math panels when switching buffers (unless new buffer is readonly).
4550 * src/BufferView.C (NoSavedPositions)
4551 * src/BufferView_pimpl.C (NoSavedPositions): New methods
4553 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4555 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
4556 less of dvi dirty or not.
4558 * src/trans_mgr.[Ch] (insert): change first parameter to string
4561 * src/chset.[Ch] (encodeString): add const to first parameter
4563 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4565 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
4569 * src/LaTeX.C (deplog): better searching for dependency files in
4570 the latex log. Uses now regexps.
4572 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
4573 instead of the box hack or \hfill.
4575 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4577 * src/lyxfunc.C (doImportHelper): do not create the file before
4578 doing the actual import.
4579 (doImportASCIIasLines): create a new file before doing the insert.
4580 (doImportASCIIasParagraphs): ditto.
4582 * lib/lyxrc.example: remove mention of non-existing commands
4584 * lyx.man: remove mention of color-related switches.
4586 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
4588 * src/lyx_gui.C: remove all the color-related ressources, which
4589 are not used anymore.
4591 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
4594 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4596 * src/lyxrc.C (read): Add a missing break in the switch
4598 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
4600 * src/text2.C (InsertStringA): Fix a bug with insertion into table
4602 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
4605 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4607 * src/text.C (draw): draw bars under foreign language words.
4609 * src/LColor.[Ch]: add LColor::language
4611 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4613 * src/lyxcursor.h (boundary): New member variable
4615 * src/text.C (IsBoundary): New methods
4617 * src/text.C: Use the above for currect cursor movement when there
4618 is both RTL & LTR text.
4620 * src/text2.C: ditto
4622 * src/bufferview_funcs.C (ToggleAndShow): ditto
4624 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4626 * src/text.C (DeleteLineForward): set selection to true to avoid
4627 that DeleteEmptyParagraphMechanism does some magic. This is how it
4628 is done in all other functions, and seems reasonable.
4629 (DeleteWordForward): do not jump over non-word stuff, since
4630 CursorRightOneWord() already does it.
4632 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
4633 DeleteWordBackward, since they seem safe to me (since selection is
4634 set to "true") DeleteEmptyParagraphMechanism does nothing.
4636 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4638 * src/lyx_main.C (easyParse): simplify the code by factoring the
4639 part that removes parameters from the command line.
4640 (LyX): check wether wrong command line options have been given.
4642 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
4644 * src/lyx_main.C : add support for specifying user LyX
4645 directory via command line option -userdir.
4647 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
4649 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
4650 the number of items per popup.
4651 (Add_to_refs_menu): Ditto.
4653 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4655 * src/lyxparagraph.h: renamed ClearParagraph() to
4656 StripLeadingSpaces() and moved it to paragraph.C. We pass the
4657 textclass as parameter, and do nothing if free_spacing is
4658 true. This fixes part of the line-delete-forward problems.
4660 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
4661 (pasteSelection): ditto.
4662 (SwitchLayoutsBetweenClasses): more translatable strings.
4664 * src/text2.C (CutSelection): use StripLeadingSpaces.
4665 (PasteSelection): ditto.
4666 (DeleteEmptyParagraphMechanism): ditto.
4668 2000-05-26 Juergen Vigna <jug@sad.it>
4670 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
4671 is not needed in tabular insets.
4673 * src/insets/insettabular.C (TabularFeatures): added missing features.
4675 * src/tabular.C (DeleteColumn):
4677 (AppendRow): implemented this functions
4678 (cellsturct::operator=): clone the inset too;
4680 2000-05-23 Juergen Vigna <jug@sad.it>
4682 * src/insets/insettabular.C (LocalDispatch): better selection support
4683 when having multicolumn-cells.
4685 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4687 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
4689 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4691 * src/ColorHandler.C (getGCForeground): put more test into _()
4693 * lib/examples/eu_splash.lyx: new file (Basque translation) from
4696 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
4699 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
4701 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
4702 there are no labels, or when buffer is readonly.
4704 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
4705 there are no labels, buffer is SGML, or when buffer is readonly.
4707 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4709 * src/LColor.C (LColor): change a couple of grey40 to grey60
4710 (LColor): rewore initalization to make compiles go some magnitude
4712 (getGUIName): don't use gettext until we need the string.
4714 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
4716 * src/Bullet.[Ch]: Fixed a small bug.
4718 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
4720 * src/paragraph.C (String): Several fixes/improvements
4722 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
4724 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4726 * src/paragraph.C (String): give more correct output.
4728 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
4730 * src/lyxfont.C (stateText) Do not output the language if it is
4731 eqaul to the language of the document.
4733 * src/paragraph.C (TeXOnePar): Do not put language switch commands
4734 between two paragraphs with the same language.
4736 * src/paragraph.C (getParLanguage) Return a correct answer for an
4737 empty dummy paragraph.
4739 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
4742 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
4745 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
4746 the menus/popup, if requested fonts are unavailable.
4748 2000-05-22 Juergen Vigna <jug@sad.it>
4750 * src/insets/insettabular.C (LocalDispatch): added some more cursor
4751 movement support (Up/Down/Tab/Shift-Tab).
4752 (LocalDispatch): added also preliminari cursor-selection.
4754 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
4756 * src/paragraph.C (PasteParagraph): Hopefully now right!
4758 2000-05-22 Garst R. Reese <reese@isn.net>
4760 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
4761 of list, change all references to Environment to Command
4762 * tex/hollywood.cls : rewrite environments as commands, add
4763 \uppercase to interiorshot and exteriorshot to force uppecase.
4764 * tex/broadway.cls : rewrite environments as commands. Tweak
4767 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4769 * src/menus.C (Add_to_toc_menu): fix the code which limits the
4770 size of items: use a constant intead of the hardcoded 40, and more
4771 importantly do not remove the %m and %x tags added at the end.
4772 (Add_to_refs_menu): use vector::size_type instead of
4773 unsigned int as basic types for the variables. _Please_ do not
4774 assume that size_t is equal to unsigned int. On an alpha, this is
4775 unsigned long, which is _not_ the same.
4777 * src/language.C (initL): remove language "hungarian", since it
4778 seems that "magyar" is better.
4780 2000-05-22 Juergen Vigna <jug@sad.it>
4782 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
4784 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
4787 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
4788 next was deleted but not set to 0.
4790 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4792 * src/language.C (initL): change the initialization of languages
4793 so that compiles goes _fast_.
4795 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
4798 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
4800 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4804 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4806 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
4808 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
4812 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
4815 * src/insets/insetlo*.[Ch]: Made editable
4817 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4819 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
4820 the current selection.
4822 * src/BufferView_pimpl.C (stuffClipboard): new method
4824 * src/BufferView.C (stuffClipboard): new method
4826 * src/paragraph.C (String): new method
4828 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
4829 LColor::ignore when lyxname is not found.
4831 * src/BufferView.C (pasteSelection): new method
4833 * src/BufferView_pimpl.C (pasteSelection): new method
4835 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
4837 * src/WorkArea.C (request_clipboard_cb): new static function
4838 (getClipboard): new method
4839 (putClipboard): new method
4841 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4843 * LyX 1.1.5pre2 released
4845 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4847 * src/vspace.C (operator=): removed
4848 (operator=): removed
4850 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
4852 * src/layout.C (NumberOfClass): manually set the type in make_pair
4853 (NumberOfLayout): ditto
4855 * src/language.C: use the Language constructor for ignore_lang
4857 * src/language.h: add constructors to struct Language
4859 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
4861 * src/text2.C (SetCursorIntern): comment out #warning
4863 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
4865 * src/mathed/math_iter.h: initialize sx and sw to 0
4867 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4869 * forms/lyx.fd: Redesign of form_ref
4871 * src/LaTeXFeatures.[Ch]
4875 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
4878 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
4879 and Buffer::inset_iterator.
4881 * src/menus.C: Added new menus: TOC and Refs.
4883 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
4885 * src/buffer.C (getTocList): New method.
4887 * src/BufferView2.C (ChangeRefs): New method.
4889 * src/buffer.C (getLabelList): New method. It replaces the old
4890 getReferenceList. The return type is vector<string> instead of
4893 * src/insets/insetinclude.C (getLabelList): New method. Replaces
4894 the old getLabel() and GetNumberOfLabels() methods.
4895 * src/insets/insetlabel.C (getLabelList): ditto
4896 * src/mathed/formula.C (getLabelList): ditto
4898 * src/paragraph.C (String): New method.
4900 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
4901 Uses the new getTocList() method.
4902 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
4903 which automatically updates the contents of the browser.
4904 (RefUpdateCB): Use the new getLabelList method.
4906 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
4908 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
4910 * src/spellchecker.C: Added using std::reverse;
4912 2000-05-19 Juergen Vigna <jug@sad.it>
4914 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
4916 * src/insets/insettext.C (computeTextRows): small fix for display of
4917 1 character after a newline.
4919 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
4922 2000-05-18 Juergen Vigna <jug@sad.it>
4924 * src/insets/insettabular.C (TabularFeatures): fixed update of display
4925 when changing width of column.
4927 * src/tabular.C (set_row_column_number_info): setting of
4928 autobreak rows if necessary.
4930 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4932 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
4934 * src/vc-backend.*: renamed stat() to status() and vcstat to
4935 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
4936 compilation broke. The new name seems more relevant, anyway.
4938 2000-05-17 Juergen Vigna <jug@sad.it>
4940 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
4941 which was wrong if the removing caused removing of rows!
4943 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
4944 (pushToken): new function.
4946 * src/text2.C (CutSelection): fix problem discovered with purify
4948 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4950 * src/debug.C (showTags): enlarge the first column, now that we
4951 have 6-digits debug codes.
4953 * lib/layouts/hollywood.layout:
4954 * lib/tex/hollywood.cls:
4955 * lib/tex/brodway.cls:
4956 * lib/layouts/brodway.layout: more commands and fewer
4957 environments. Preambles moved in the .cls files. Broadway now has
4958 more options on scene numbering and less whitespace (from Garst)
4960 * src/insets/insetbib.C (getKeys): make sure that we are in the
4961 document directory, in case the bib file is there.
4963 * src/insets/insetbib.C (Latex): revert bogus change.
4965 2000-05-16 Juergen Vigna <jug@sad.it>
4967 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
4968 the TabularLayout on cursor move.
4970 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
4972 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
4975 (draw): fixed cursor position and drawing so that the cursor is
4976 visible when before the tabular-inset.
4978 * src/insets/insettext.C (init): drawLockedFrame was not initialized
4979 when creating from old insettext.
4981 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
4983 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4985 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
4986 * lib/tex/brodway.cls: ditto
4988 * lib/layouts/brodway.layout: change alignment of parenthical
4991 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4993 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
4994 versions 0.88 and 0.89 are supported.
4996 2000-05-15 Juergen Vigna <jug@sad.it>
4998 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
5001 * src/insets/insettext.C (computeTextRows): redone completely this
5002 function in a much cleaner way, because of problems when having a
5004 (draw): added a frame border when the inset is locked.
5005 (SetDrawLockedFrame): this sets if we draw the border or not.
5006 (SetFrameColor): this sets the frame color (default=insetframe).
5008 * src/insets/lyxinset.h: added x() and y() functions which return
5009 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
5010 function which is needed to see if we have a locking inset of some
5011 type in this inset (needed for now in insettabular).
5013 * src/vspace.C (inPixels): the same function also without a BufferView
5014 parameter as so it is easier to use it in some ocasions.
5016 * src/lyxfunc.C: changed all places where insertInset was used so
5017 that now if it couldn't be inserted it is deleted!
5019 * src/TabularLayout.C:
5020 * src/TableLayout.C: added support for new tabular-inset!
5022 * src/BufferView2.C (insertInset): this now returns a bool if the
5023 inset was really inserted!!!
5025 * src/tabular.C (GetLastCellInRow):
5026 (GetFirstCellInRow): new helper functions.
5027 (Latex): implemented for new tabular class.
5031 (TeXTopHLine): new Latex() helper functions.
5033 2000-05-12 Juergen Vigna <jug@sad.it>
5035 * src/mathed/formulamacro.C (Read):
5036 * src/mathed/formula.C (Read): read also the \end_inset here!
5038 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
5040 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
5041 crush when saving formulae with unbalanced parenthesis.
5043 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
5045 * src/layout.C: Add new keyword "endlabelstring" to layout file
5047 * src/text.C (GetVisibleRow): Draw endlabel string.
5049 * lib/layouts/broadway.layout
5050 * lib/layouts/hollywood.layout: Added endlabel for the
5051 Parenthetical layout.
5053 * lib/layouts/heb-article.layout: Do not use slanted font shape
5054 for Theorem like environments.
5056 * src/buffer.C (makeLaTeXFile): Always add "american" to
5057 the UsedLanguages list if document language is RTL.
5059 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5061 * add addendum to README.OS2 and small patch (from SMiyata)
5063 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5065 * many files: correct the calls to ChangeExtension().
5067 * src/support/filetools.C (ChangeExtension): remove the no_path
5068 argument, which does not belong there. Use OnlyFileName() instead.
5070 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
5071 files when LaTeXing a non-nice latex file.
5073 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
5074 a chain of "if". Return false when deadkeys are not handled.
5076 * src/lyx_main.C (LyX): adapted the code for default bindings.
5078 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
5079 bindings for basic functionality (except deadkeys).
5080 (deadKeyBindings): new method. Performs the bindings of deadkeys.
5082 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
5083 several methods: handle override_x_deadkeys.
5085 * src/lyxrc.h: remove the "bindings" map, which did not make much
5086 sense anyway. New variable override_x_deadkeys, defaulting to "true".
5088 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5090 * src/lyxfont.C (stateText): use a saner method to determine
5091 whether the font is "default". Seems to fix the crash with DEC
5094 * src/Bullet.[Ch] (Bullet): remove const on parameters.
5096 2000-05-08 Juergen Vigna <jug@sad.it>
5098 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
5099 TabularLayoutMenu with mouse-button-3
5100 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
5102 * src/TabularLayout.C: added this file for having a Layout for
5105 2000-05-05 Juergen Vigna <jug@sad.it>
5107 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
5108 recalculating inset-widths.
5109 (TabularFeatures): activated this function so that I can change
5110 tabular-features via menu.
5112 * src/menus.C (ShowEditMenu): inserted support for insettabular so
5113 that I can test some functions with the Table menu.
5115 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5117 * src/lyxfont.C (stateText): guard against stupid c++libs.
5119 * src/tabular.C: add using std::vector
5120 some whitespace changes, + removed som autogenerated code.
5122 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
5124 2000-05-05 Juergen Vigna <jug@sad.it>
5126 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
5127 row, columns and cellstructures.
5129 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5131 * lib/lyxrc.example: remove obsolete entries.
5133 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
5134 reading of protected_separator for free_spacing.
5136 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5138 * src/text.C (draw): do not display an exclamation mark in the
5139 margin for margin notes. This is confusing, ugly and
5142 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
5143 AMS math' is checked.
5145 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
5146 name to see whether including the amsmath package is needed.
5148 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
5150 * src/paragraph.C (validate): Compute UsedLanguages correctly
5151 (don't insert the american language if it doesn't appear in the
5154 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
5155 The argument of \thanks{} command is considered moving argument
5157 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
5160 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
5162 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
5163 for appendix/minipage/depth. The lines can be now both in the footnote
5164 frame, and outside the frame.
5166 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
5169 2000-05-05 Juergen Vigna <jug@sad.it>
5171 * src/table.[Ch]: removed the inset and buffer stuff as this is now
5172 neede only in tabular.[Ch].
5174 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5176 * src/insets/insetspecialchar.C (Read): allow command == '~' for
5178 (Write): write '~' for PROTECTED_SEPARATOR
5180 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5182 * src/lyxparagraph.h: add a friend struct matchIT after the struct
5185 * src/mathed/formula.C (drawStr): rename size to siz.
5187 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
5188 possibly fix a bug by not changing the pflags = flags to piflags =
5191 2000-05-05 Juergen Vigna <jug@sad.it>
5193 * src/insets/insetbib.C: moved using directive
5195 * src/ImportNoweb.C: small fix for being able to compile (missing
5198 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5200 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
5201 to use clear, since we don't depend on this in the code. Add test
5204 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5206 * (various *.C files): add using std::foo directives to please dec
5209 * replace calls to string::clear() to string::erase() (Angus)
5211 * src/cheaders/cmath: modified to provide std::abs.
5213 2000-05-04 Juergen Vigna <jug@sad.it>
5215 * src/insets/insettext.C: Prepared all for inserting of multiple
5216 paragraphs. Still display stuff to do (alignment and other things),
5217 but I would like to use LyXText to do this when we cleaned out the
5218 table-support stuff.
5220 * src/insets/insettabular.C: Changed lot of stuff and added lots
5221 of functionality still a lot to do.
5223 * src/tabular.C: Various functions changed name and moved to be
5224 const functions. Added new Read and Write functions and changed
5225 lots of things so it works good with tabular-insets (also removed
5226 some stuff which is not needed anymore * hacks *).
5228 * src/lyxcursor.h: added operators == and != which just look if
5229 par and pos are (not) equal.
5231 * src/buffer.C (latexParagraphs): inserted this function to latex
5232 all paragraphs form par to endpar as then I can use this too for
5235 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
5236 so that I can call this to from text insets with their own cursor.
5238 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
5239 output off all paragraphs (because of the fix below)!
5241 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
5242 the very last paragraph (this could be also the last paragraph of an
5245 * src/texrow.h: added rows() call which returns the count-variable.
5247 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
5249 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
5251 * lib/configure.m4: better autodetection of DocBook tools.
5253 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5255 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
5257 * src/lyx_cb.C: add using std::reverse;
5259 * src/LaTeX.C (run): on error always run deleteFilesOnError before
5262 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
5263 selected files. Should fix repeated errors from generated files.
5265 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
5267 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
5269 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
5270 the spellchecker popup.
5272 * lib/lyxrc.example: Removed the \number_inset section
5274 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5276 * src/insets/figinset.C (various): Use IsFileReadable() to make
5277 sure that the file actually exist. Relying on ghostscripts errors
5278 is a bad idea since they can lead to X server crashes.
5280 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
5282 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
5285 * lib/lyxrc.example: smallish typo in description of
5286 \view_dvi_paper_option
5288 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5291 * src/lyxfunc.C: doImportHelper to factor out common code of the
5292 various import methods. New functions doImportASCIIasLines,
5293 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
5294 doImportLinuxDoc for the format specific parts.
5297 * buffer.C: Dispatch returns now a bool to indicate success
5300 * lyx_gui.C: Add getLyXView() for member access
5302 * lyx_main.C: Change logic for batch commands: First try
5303 Buffer::Dispatch (possibly without GUI), if that fails, use
5306 * lyx_main.C: Add support for --import command line switch.
5307 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
5308 Available Formats: Everything accepted by 'buffer-import <format>'
5310 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5312 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
5315 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
5316 documents will be reformatted upon reentry.
5318 2000-04-27 Juergen Vigna <jug@sad.it>
5320 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
5321 correctly only last pos this was a bug.
5323 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5325 * release of lyx-1.1.5pre1
5327 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5329 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
5331 * src/menus.C: revert the change of naming (Figure->Graphic...)
5332 from 2000-04-11. It was incomplete and bad.
5334 * src/LColor.[Ch]: add LColor::depthbar.
5335 * src/text.C (GetVisibleRow): use it.
5337 * README: update the languages list.
5339 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5341 * src/text.C (GetVisibleRow): show the depth of paragraphs using
5344 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5346 * README: remove sections that were just wrong.
5348 * src/text2.C (GetRowNearY): remove currentrow code
5350 * src/text.C (GetRow): remove currentrow code
5352 * src/screen.C (Update): rewritten a bit.
5353 (SmallUpdate): removed func
5355 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
5357 (FullRebreak): return bool
5358 (currentrow): remove var
5359 (currentrow_y): ditto
5361 * src/lyxscreen.h (Draw): change arg to unsigned long
5362 (FitCursor): return bool
5363 (FitManualCursor): ditto
5364 (Smallpdate): remove func
5365 (first): change to unsigned long
5366 (DrawOneRow): change second arg to long (from long &)
5367 (screen_refresh_y): remove var
5368 (scree_refresh_row): ditto
5370 * src/lyxrow.h: change baseline to usigned int from unsigned
5371 short, this brings some implicit/unsigned issues out in the open.
5373 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
5375 (Dispatch): don't call updateScrollbar after fitCursor. Use update
5376 instead of smallUpdate.
5378 * src/lyxcursor.h: change y to unsigned long
5380 * src/buffer.h: don't call updateScrollbar after fitcursor
5382 * src/buffer.C (parseSingleLyXformat2Token): move variables to
5383 where they are used. Removed "\\direction", this was not present
5384 in 1.1.4 and is already obsolete. Commented out some code that I
5385 believe to never be called.
5386 (runLiterate): don't call updateScrollbar after fitCursor
5388 (buildProgram): ditto
5391 * src/WorkArea.h (workWidth): change return val to unsigned
5394 (redraw): remove the button redraws
5395 (setScrollbarValue): change for scrollbar
5396 (getScrollbarValue): change for scrollbar
5397 (getScrollbarBounds): change for scrollbar
5399 * src/WorkArea.C (C_WorkArea_up_cb): removed func
5400 (C_WorkArea_down_cb): removed func
5401 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
5402 (resize): change for scrollbar
5403 (setScrollbar): ditto
5404 (setScrollbarBounds): ditto
5405 (setScrollbarIncrements): ditto
5406 (up_cb): removed func
5407 (down_cb): removed func
5408 (scroll_cb): change for scrollbar
5409 (work_area_handler): ditto
5411 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
5412 when FitCursor did something.
5413 (updateScrollbar): some unsigned changes
5414 (downCB): removed func
5415 (scrollUpOnePage): removed func
5416 (scrollDownOnePage): remvoed func
5417 (workAreaMotionNotify): don't call screen->FitCursor but use
5418 fitCursor instead. and bool return val
5419 (workAreaButtonPress): ditto
5420 (workAreaButtonRelease): some unsigned changes
5421 (checkInsetHit): ditto
5422 (workAreaExpose): ditto
5423 (update): parts rewritten, comments about the signed char arg added
5424 (smallUpdate): removed func
5425 (cursorPrevious): call needed updateScrollbar
5428 * src/BufferView2.C (allFloats): don't call updateScrollbar after
5431 * src/BufferView.[Ch] (upCB): removed func
5432 (downCB): removed func
5433 (smallUpdate): removed func
5435 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5437 * src/lyxtext.h src/text.C src/text2.C: removed support for the
5438 currentrow, currentrow_y optimization. This did not help a lot and
5439 if we want to do this kind of optimization we should rather use
5440 cursor.row instead of the currentrow.
5442 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
5443 buffer spacing and klyx spacing support.
5445 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5447 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
5450 2000-04-26 Juergen Vigna <jug@sad.it>
5452 * src/insets/figinset.C: fixes to Lars sstream changes!
5454 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
5456 * A lot of files: Added Ascii(ostream &) methods to all inset
5457 classes. Used when exporting to ASCII.
5459 * src/buffer.C (writeFileAscii,RoffAsciiTable)
5460 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
5463 * src/text2.C (ToggleFree): Disabled implicit word selection when
5464 there is a change in the language
5466 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
5467 no output was generated for end-of-sentence inset.
5469 * src/insets/lyxinset.h
5472 * src/paragraph.C: Removed the insetnumber code
5474 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
5476 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5478 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
5479 no_babel and no_epsfig completely from the file.
5480 (parseSingleLyXformat2Token): add handling for per-paragraph
5481 spacing as written by klyx.
5483 * src/insets/figinset.C: applied patch by Andre. Made it work with
5486 2000-04-20 Juergen Vigna <jug@sad.it>
5488 * src/insets/insettext.C (cutSelection):
5489 (copySelection): Fixed with selection from right to left.
5490 (draw): now the rows are not recalculated at every draw.
5491 (computeTextRows): for now reset the inset-owner here (this is
5492 important for an undo or copy where the inset-owner is not set
5495 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
5496 motion to the_locking_inset screen->first was forgotten, this was
5497 not important till we got multiline insets.
5499 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5501 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
5502 code seems to be alright (it is code changed by Dekel, and the
5503 intent is indeed that all macros should be defined \protect'ed)
5505 * NEWS: a bit of reorganisation of the new user-visible features.
5507 2000-04-19 Juergen Vigna <jug@sad.it>
5509 * src/insets/insettext.C (init): using a LyXCursor now for cursor
5510 position. Set the inset_owner of the used paragraph so that it knows
5511 that it is inside an inset. Fixed cursor handling with mouse and
5512 cursor keys. Fixed wrong timed inset redraws and lots of other changes
5513 and cleanups to make TextInsets work better.
5515 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
5516 Changed parameters of various functions and added LockInsetInInset().
5518 * src/insets/insettext.C:
5520 * src/insets/insetcollapsable.h:
5521 * src/insets/insetcollapsable.C:
5522 * src/insets/insetfoot.h:
5523 * src/insets/insetfoot.C:
5524 * src/insets/insetert.h:
5525 * src/insets/insetert.C: cleaned up the code so that it works now
5526 correctly with insettext.
5528 * src/insets/inset.C:
5529 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
5530 that insets in insets are supported right.
5533 * src/table.C: lots of changes for use with inset tabular (and cleanup)
5535 * src/paragraph.C: some small fixes
5537 * src/debug.h: inserted INSETS debug info
5539 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
5540 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
5542 * src/commandtags.h:
5543 * src/LyXAction.C: insert code for InsetTabular.
5545 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
5546 not Button1MotionMask.
5547 (workAreaButtonRelease): send always a InsetButtonRelease event to
5549 (checkInsetHit): some setCursor fixes (always with insets).
5551 * src/BufferView2.C (lockInset): returns a bool now and extended for
5552 locking insets inside insets.
5553 (showLockedInsetCursor): it is important to have the cursor always
5554 before the locked inset.
5555 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
5557 * src/BufferView.h: made lockInset return a bool.
5559 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
5561 * src/text2.C (SetCursor): This now has a version with a LyXCursor
5562 that is used also internally but can be called as public to have back
5563 a cursor pos which is not set internally.
5564 (SetCursorIntern): Changed to use above function.
5566 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
5568 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5573 * NEWS: updated for prerelease of 1.1.5. Please comment and send
5574 patches for things that should be in or should be changed.
5576 * src/* [insetfiles]: change "usigned char fragile" to bool
5577 fragile. There was only one point that could that be questioned
5578 and that is commented in formulamacro.C. Grep for "CHECK".
5580 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
5581 (DeleteBuffer): take it out of CutAndPaste and make it static.
5583 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5585 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
5586 output the spacing envir commands. Also the new commands used in
5587 the LaTeX output makes the result better.
5589 * src/Spacing.C (writeEnvirBegin): new method
5590 (writeEnvirEnd): new method
5592 2000-04-18 Juergen Vigna <jug@sad.it>
5594 * src/CutAndPaste.C: made textclass a static member of the class
5595 as otherwise it is not accesed right!!!
5597 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
5599 * forms/layout_forms.fd
5600 * src/layout_forms.h
5601 * src/layout_forms.C (create_form_form_character)
5602 * src/lyx_cb.C (UserFreeFont)
5603 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
5604 documents (in the layout->character popup).
5606 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5608 * src/spellchecker.C (create_ispell_pipe): fix a bug where
5609 \spell_command was in fact not honored (from Kevin Atkinson).
5611 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
5614 * src/lyx_gui.h: make lyxViews private (Angus)
5616 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
5618 * src/mathed/math_write.C
5619 (MathMatrixInset::Write) Put \protect before \begin{array} and
5620 \end{array} if fragile
5621 (MathParInset::Write): Put \protect before \\ if fragile
5623 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5625 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
5626 initialization if the LyXColorHandler must be done after the
5627 connections to the XServer has been established.
5629 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
5630 get the background pixel from the lyxColorhandler so that the
5631 figures are rendered with the correct background color.
5632 (NextToken): removed functions.
5633 (GetPSSizes): use ifs >> string instead of NextToken.
5635 * src/Painter.[Ch]: the color cache moved out of this file.
5637 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
5640 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5642 * src/WorkArea.C (work_area_handler): call BufferView::enterView
5643 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
5645 * src/BufferView.C (enterView): new func
5646 (leaveView): new func
5648 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
5650 (leaveView): new func, undefines xterm cursor when approp.
5652 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
5653 (AllowInput): delete the Workarea cursor handling from this func.
5655 * src/Painter.C (underline): draw a slimer underline in most cases.
5657 * src/lyx_main.C (error_handler): use extern "C"
5659 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5661 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
5662 sent directly to me.
5664 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
5665 to the list by Dekel.
5667 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
5670 * src/bufferview_funcs.[Ch]: two new files, moved several of the
5671 methods from lyx_cb.here.
5673 * src/lyx_cb.C: in addition to the above; removed input_prohibited
5676 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5678 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
5679 instead of using current_view directly.
5681 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
5683 * src/LyXAction.C (init): add the paragraph-spacing command.
5685 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
5687 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
5689 * src/lyx_cb.C (CurrentState): output a string when the spacing is
5690 different from the documents.
5692 * src/text.C (SetHeightOfRow): take paragraph spacing into
5693 account, paragraph spacing takes precedence over buffer spacing
5694 (GetVisibleRow): ditto
5696 * src/paragraph.C (writeFile): output the spacing parameter too.
5697 (validate): set the correct features if spacing is used in the
5699 (Clear): set spacing to default
5700 (MakeSameLayout): spacing too
5701 (HasSameLayout): spacing too
5702 (SetLayout): spacing too
5703 (TeXOnePar): output the spacing commands
5705 * src/lyxparagraph.h: added a spacing variable for use with
5706 per-paragraph spacing.
5708 * src/Spacing.h: add a Default spacing and a method to check if
5709 the current spacing is default. also added an operator==
5711 * src/text2.C (DeleteEmptyParagraphMechanism): added a
5714 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5716 * src/lyxserver.C (callback): fix dispatch of functions
5718 * src/insets/insetlatexaccent.C (checkContents): turn bogus
5719 printf() into lyxerr call.
5721 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
5724 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
5725 "Table" to "Table Box", "Float" to "Floating Material"; deletes
5726 the "Float" from each of the subitems.
5727 (ShowHelpMenu): add entry for "FAQ" and "TOC".
5729 * src/support/DebugStream.h: add an #ifdef to work around a gcc
5730 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
5731 documented the change so that the workaround can be nuked later.
5733 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
5736 * src/lyxlex_pimpl.C (next): do not re-declare the default value
5738 * src/buffer.C (getLatexName): ditto
5739 (setReadonly): ditto
5741 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5743 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
5744 avoid some uses of current_view. Added also a bufferParams()
5745 method to get at this.
5747 * src/lyxtext.h: changed params->buffer and paramters->bparams.
5749 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5751 * src/lyxparagraph.[Ch]: removed
5752 operator<(LyXParagraph::InsetTable..., added a struct matchIT
5753 with operators used by lower_bound and
5754 upper_bound in InsetTable's
5755 Make struct InsetTable private again. Used matchpos.
5757 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
5759 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
5760 document, the language of existing text is changed (unless the
5761 document is multi-lingual)
5763 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
5765 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
5767 * A lot of files: A rewrite of the Right-to-Left support.
5769 2000-04-10 Juergen Vigna <jug@sad.it>
5771 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
5772 misplaced cursor when inset in inset is locked.
5774 * src/insets/insettext.C (LocalDispatch): small fix so that a
5775 BREAKLINE is not inserted if we don't permit it with autBreakRows.
5777 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
5778 footnote font should be decreased in size twice when displaying.
5780 * src/insets/insettext.C (GetDrawFont): inserted this function as
5781 the drawing-font may differ from the real paragraph font.
5783 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
5784 insets (inset in inset!).
5786 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
5787 function here because we don't want footnotes inside footnotes.
5789 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
5791 (init): now set the inset_owner in paragraph.C
5792 (LocalDispatch): added some resetPos() in the right position
5795 (pasteSelection): changed to use the new CutAndPaste-Class.
5797 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
5798 which tells if it is allowed to insert another inset inside this one.
5800 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
5801 SwitchLayoutsBetweenClasses.
5803 * src/text2.C (InsertInset): checking of the new paragraph-function
5805 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
5806 is not needed anymore here!
5809 (PasteSelection): redone (also with #ifdef) so that now this uses
5810 the CutAndPaste-Class.
5811 (SwitchLayoutsBetweenClasses): removed here and implemented in the
5814 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
5815 from/to text/insets.
5817 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
5818 so that the paragraph knows if it is inside an (text)-inset.
5819 (InsertFromMinibuffer): changed return-value to bool as now it
5820 may happen that an inset is not inserted in the paragraph.
5821 (InsertInsetAllowed): this checks if it is allowed to insert an
5822 inset in this paragraph.
5824 (BreakParagraphConservative):
5825 (BreakParagraph) : small change for the above change of the return
5826 value of InsertFromMinibuffer.
5828 * src/lyxparagraph.h: added inset_owner and the functions to handle
5829 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
5831 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5833 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
5834 functions from BufferView to BufferView::Pimpl to ease maintence.
5836 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
5837 correctly. Also use SetCursorIntern instead of SetCursor.
5839 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
5842 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5844 * src/WorkArea.C (belowMouse): manually implement below mouse.
5846 * src/*: Add "explicit" on several constructors, I added probably
5847 some unneeded ones. A couple of changes to code because of this.
5849 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
5850 implementation and private parts from the users of BufferView. Not
5853 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
5854 implementation and private parts from the users of LyXLex. Not
5857 * src/BufferView_pimpl.[Ch]: new files
5859 * src/lyxlex_pimpl.[Ch]: new files
5861 * src/LyXView.[Ch]: some inline functions move out-of-line
5863 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5865 * src/lyxparagraph.h: make struct InsetTable public.
5867 * src/support/lyxstring.h: change lyxstring::difference_type to be
5868 ptrdiff_t. Add std:: modifiers to streams.
5870 * src/font.C: include the <cctype> header, for islower() and
5873 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5875 * src/font.[Ch]: new files. Contains the metric functions for
5876 fonts, takes a LyXFont as parameter. Better separation of concepts.
5878 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
5879 changes because of this.
5881 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
5883 * src/*: compile with -Winline and move functions that don't
5886 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
5889 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5891 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
5892 (various files changed because of this)
5894 * src/Painter.C (text): fixed the drawing of smallcaps.
5896 * src/lyxfont.[Ch] (drawText): removed unused member func.
5899 * src/*.C: added needed "using" statements and "std::" qualifiers.
5901 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5903 * src/*.h: removed all use of "using" from header files use
5904 qualifier std:: instead.
5906 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5908 * src/text.C (Backspace): some additional cleanups (we already
5909 know whether cursor.pos is 0 or not).
5911 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
5912 automake does not provide one).
5914 * src/bmtable.h: replace C++ comments with C comments.
5916 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
5918 * src/screen.C (ShowCursor): Change the shape of the cursor if
5919 the current language is not equal to the language of the document.
5920 (If the cursor change its shape unexpectedly, then you've found a bug)
5922 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
5925 * src/insets/insetnumber.[Ch]: New files.
5927 * src/LyXAction.C (init)
5928 * src/lyxfunc.C (dispatch): Add command number-inset-insert
5931 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
5933 * src/lyxparagraph.h
5934 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
5935 (the vector is kept sorted).
5937 * src/text.C (GetVisibleRow): Draw selection correctly when there
5938 is both LTR and RTL text.
5940 * src/paragraph.C (Clone): Use the assignment operator for cloning,
5941 which is much faster.
5943 * src/text.C (GetVisibleRow and other): Do not draw the last space
5944 in a row if the direction of the last letter is not equal to the
5945 direction of the paragraph.
5947 * src/lyxfont.C (latexWriteStartChanges):
5948 Check that font language is not equal to basefont language.
5949 (latexWriteEndChanges): ditto
5951 * src/lyx_cb.C (StyleReset): Don't change the language while using
5952 the font-default command.
5954 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
5955 empty paragraph before a footnote.
5957 * src/insets/insetcommand.C (draw): Increase x correctly.
5959 * src/screen.C (ShowCursor): Change cursor shape if
5960 current language != document language.
5962 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
5964 2000-03-31 Juergen Vigna <jug@sad.it>
5966 * src/paragraph.C (GetInset): commented out text[pos] = ' '
5967 (Clone): changed mode how the paragraph-data is copied to the
5968 new clone-paragraph.
5970 * src/lyxfunc.C (Dispatch): fixed small problem when calling
5971 GetInset(pos) with no inset anymore there (in inset UNDO)
5973 * src/insets/insetcommand.C (draw): small fix as here x is
5974 incremented not as much as width() returns (2 before, 2 behind = 4)
5976 2000-03-30 Juergen Vigna <jug@sad.it>
5978 * src/insets/insettext.C (InsetText): small fix in initialize
5979 widthOffset (should not be done in the init() function)
5981 2000-03-29 Amir Karger <karger@lyx.org>
5983 * lib/examples/it_ItemizeBullets.lyx: translation by
5986 * Implemented \textasciitilde and fixed a tiny bug in reLyX
5988 2000-03-29 Juergen Vigna <jug@sad.it>
5990 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
5992 * src/insets/insetfoot.C (Clone): small change as for the below
5993 new init function in the text-inset
5995 * src/insets/insettext.C (init): new function as I've seen that
5996 clone did not copy the Paragraph-Data!
5997 (LocalDispatch): Added code so that now we have some sort of Undo
5998 functionality (well actually we HAVE Undo ;)
6000 * src/text.C (Backspace): Small fix for the a | a Backspace problem
6002 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
6004 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
6007 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6009 * src/main.C: added a runtime check that verifies that the xforms
6010 header used when building LyX and the library used when running
6011 LyX match. Exit with a message if they don't match. This is a
6012 version number check only.
6014 * src/buffer.C (save): Don't allocate memory on the heap for
6015 struct utimbuf times.
6017 * *: some using changes, use iosfwd instead of the real headers.
6019 * src/lyxfont.C use char const * instead of string for the static
6020 strings. Rewrite some functions to use sstream.
6022 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6024 * src/text.C (Backspace): hopefully fix the dreaded backaspace
6027 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6029 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
6030 of Geodesy (from Martin Vermeer)
6032 * lib/layouts/svjour.inc: include file for the Springer svjour
6033 class. It can be used to support journals other than JoG.
6035 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
6036 Miskiewicz <misiek@pld.org.pl>)
6037 * lib/reLyX/Makefile.am: ditto.
6039 2000-03-27 Juergen Vigna <jug@sad.it>
6041 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
6042 also some modifications with operations on selected text.
6044 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
6045 problems with clicking on insets (last famous words ;)
6047 * src/insets/insetcommand.C (draw):
6048 (width): Changed to have a bit of space before and after the inset so
6049 that the blinking cursor can be seen (otherwise it was hidden)
6051 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6053 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
6054 would not be added to the link list when an installed gettext (not
6055 part of libc) is found.
6057 2000-03-24 Juergen Vigna <jug@sad.it>
6059 * src/insets/insetcollapsable.C (Edit):
6060 * src/mathed/formula.C (InsetButtonRelease):
6061 (InsetButtonPress): fixed for new handling of ButtonPress/Release
6064 * src/BufferView.C (workAreaButtonPress):
6065 (workAreaButtonRelease):
6066 (checkInsetHit): Finally fixed the clicking on insets be handled
6069 * src/insets/insetert.C (Edit): inserted this call so that ERT
6070 insets work always with LaTeX-font
6072 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6074 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
6075 caused lyx to startup with no GUI in place, causing in a crash
6076 upon startup when called with arguments.
6078 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6080 * src/FontLoader.C: better initialization of dummyXFontStruct.
6082 2000-03-20 José Abílio Matos <jamatos@lyx.org>
6084 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
6085 for linuxdoc and docbook import and export format options.
6087 * lib/lyxrc.example Example of default values for the previous flags.
6089 * src/lyx_cb.C Use those flags instead of the hardwired values for
6090 linuxdoc and docbook export.
6092 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
6095 * src/menus.C Added menus entries for the new import/exports formats.
6097 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6099 * src/lyxrc.*: Added support for running without Gui
6102 * src/FontLoader.C: sensible defaults if no fonts are needed
6104 * src/lyx_cb.C: New function ShowMessage (writes either to the
6105 minibuffer or cout in case of no gui
6106 New function AskOverwrite for common stuff
6107 Consequently various changes to call these functions
6109 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
6110 wild guess at sensible screen resolution when having no gui
6112 * src/lyxfont.C: no gui, no fonts... set some defaults
6114 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6116 * src/LColor.C: made the command inset background a bit lighter.
6118 2000-03-20 Hartmut Goebel <goebel@noris.net>
6120 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
6121 stdstruct.inc. Koma-Script added some title elements which
6122 otherwise have been listed below "bibliography". This split allows
6123 adding title elements to where they belong.
6125 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
6126 define the additional tilte elements and then include
6129 * many other layout files: changed to include stdtitle.inc just
6130 before stdstruct.inc.
6132 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
6134 * src/buffer.C: (save) Added the option to store all backup files
6135 in a single directory
6137 * src/lyxrc.[Ch]: Added variable \backupdir_path
6139 * lib/lyxrc.example: Added descriptions of recently added variables
6141 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
6142 bibtex inset, not closing the bibtex popup when deleting the inset)
6144 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6146 * src/lyx_cb.C: add a couple using directives.
6148 2000-03-17 José Abílio Matos <jamatos@lyx.org>
6149 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
6150 import based on the filename.
6152 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
6153 file would be imported at start, if the filename where of a sgml file.
6155 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
6157 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
6159 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
6160 * src/lyxfont.h Replaced the member variable bits.direction by the
6161 member variable lang. Made many changes in other files.
6162 This allows having a multi-lingual document
6164 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
6165 that change the current language to <l>.
6166 Removed the command "font-rtl"
6168 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
6169 format for Hebrew documents)
6171 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
6172 When auto_mathmode is "true", pressing a digit key in normal mode
6173 will cause entering into mathmode.
6174 If auto_mathmode is "rtl" then this behavior will be active only
6175 when writing right-to-left text.
6177 * src/text2.C (InsertStringA) The string is inserted using the
6180 * src/paragraph.C (GetEndLabel) Gives a correct result for
6181 footnote paragraphs.
6183 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
6185 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6187 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
6188 front of PasteParagraph. Never insert a ' '. This should at least
6189 fix some cause for the segfaults that we have been experiencing,
6190 it also fixes backspace behaviour slightly. (Phu!)
6192 * src/support/lstrings.C (compare_no_case): some change to make it
6193 compile with gcc 2.95.2 and stdlibc++-v3
6195 * src/text2.C (MeltFootnoteEnvironment): change type o
6196 first_footnote_par_is_not_empty to bool.
6198 * src/lyxparagraph.h: make text private. Changes in other files
6200 (fitToSize): new function
6201 (setContentsFromPar): new function
6202 (clearContents): new function
6203 (SetChar): new function
6205 * src/paragraph.C (readSimpleWholeFile): deleted.
6207 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
6208 the file, just use a simple string instead. Also read the file in
6209 a more maintainable manner.
6211 * src/text2.C (InsertStringA): deleted.
6212 (InsertStringB): deleted.
6214 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6216 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
6217 RedoParagraphs from the doublespace handling part, just set status
6218 to NEED_MORE_REFRESH. Also don't update cursor position (should be
6219 done, but perhaps not like this.)
6221 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6223 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
6224 character when inserting an inset.
6226 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6228 * src/bufferparams.C (readLanguage): now takes "default" into
6231 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
6232 also initialize the toplevel_keymap with the default bindings from
6235 * src/buffer.C (Buffer): remove lyxrc from the parameters.
6237 * all files using lyxrc: have lyxrc as a real variable and not a
6238 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
6241 * src/lyxrc.C: remove double call to defaultKeyBindings
6243 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
6244 toolbar defauls using lyxlex. Remove enums, structs, functions
6247 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
6248 toolbar defaults. Also store default keybindings in a map.
6250 * src/ToolbarDefaults.[Ch]: New file. This class is used for
6251 storing the toolbar defaults without any xforms dependencies.
6253 * src/insets/figinset.C: patch posted to list by Andre Poenitz
6254 applied. Changed to use iterators.
6256 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
6258 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
6259 systems that don't have LINGUAS set to begin with.
6261 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6263 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
6264 the list by Dekel Tsur.
6266 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6268 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
6269 * src/insets/form_graphics.C: ditto.
6271 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
6273 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6275 * src/bufferparams.C (readLanguage): use the new language map
6277 * src/intl.C (InitKeyMapper): use the new language map
6279 * src/lyx_gui.C (create_forms): use the new language map
6281 * src/language.[Ch]: New files. Used for holding the information
6282 about each language. Now! Use this new language map enhance it and
6283 make it really usable for our needs.
6285 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
6287 * screen.C (ShowCursor): Removed duplicate code.
6288 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
6289 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
6291 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
6294 * src/text.C Added TransformChar method. Used for rendering Arabic
6295 text correctly (change the glyphs of the letter according to the
6296 position in the word)
6301 * src/lyxrc.C Added lyxrc command {language_command_begin,
6302 language_command_end,language_command_ltr,language_command_rtl,
6303 language_package} which allows the use of either arabtex or Omega
6306 * src/lyx_gui.C (init)
6308 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
6309 to use encoding for menu fonts which is different than the encoding
6312 * src/buffer.C (makeLaTeXFile): If params.language = "default",
6313 do not load the babel package.
6314 To write an English document with Hebrew/Arabic, change the document
6315 language to "english".
6317 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
6318 (alphaCounter): changed to return char
6319 (loweralphaCounter, hebrewCounter, romanCounter): New functions
6321 * lib/lyxrc.example Added examples for Hebrew/Arabic
6324 * src/layout.C Added layout command endlabeltype
6326 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
6328 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
6330 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6332 * src/mathed/math_delim.C (search_deco): return a
6333 math_deco_struct* instead of index.
6335 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6337 * All files with a USE_OSTREAM_ONLY within: removed all code that
6338 was unused when USE_OSTREAM_ONLY is defined.
6340 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
6341 of any less. Removed header and using.
6343 * src/text.C (GetVisibleRow): draw the string "Page Break
6344 (top/bottom)" on screen when drawing a pagebreak line.
6346 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6348 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
6350 * src/mathed/math_macro.C (draw): do some cast magic.
6353 * src/mathed/math_defs.h: change byte* argument to byte const*.
6355 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
6357 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
6358 know it is right to return InsetFoot* too, but cxx does not like
6361 * src/insets/insetcollapsable.[Ch] (Clone): make const.
6363 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
6365 * src/mathed/math_delim.C: change == to proper assignment.
6367 2000-03-09 Juergen Vigna <jug@sad.it>
6369 * src/insets/insettext.C (setPos): fixed various cursor positioning
6370 problems (via mouse and cursor-keys)
6371 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
6372 inset (still a small display problem but it works ;)
6374 * src/insets/insetcollapsable.C (draw): added button_top_y and
6375 button_bottom_y to have correct values for clicking on the inset.
6377 * src/support/lyxalgo.h: commented out 'using std::less'
6379 2000-03-08 Juergen Vigna <jug@sad.it>
6381 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
6382 Button-Release event closes as it is alos the Release-Event
6385 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
6387 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6389 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
6390 can add multiple spaces in Scrap (literate programming) styles...
6391 which, by the way, is how I got hooked on LyX to begin with.
6393 * src/mathed/formula.C (Write): Added dummy variable to an
6394 inset::Latex() call.
6395 (Latex): Add free_spacing boolean to inset::Latex()
6397 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
6399 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
6400 virtual function to include the free_spacing boolean from
6401 the containing paragraph's style.
6403 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
6404 Added free_spacing boolean arg to match inset.h
6406 * src/insets/insettext.C, src/insets/insettext.h (Latex):
6407 Added free_spacing boolean arg to match inset.h
6409 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
6410 Added free_spacing boolean and made sure that if in a free_spacing
6411 paragraph, that we output normal space if there is a protected space.
6413 * src/insets/insetref.C, src/insets/insetref.h (Latex):
6414 Added free_spacing boolean arg to match inset.h
6416 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
6417 Added free_spacing boolean arg to match inset.h
6419 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
6420 Added free_spacing boolean arg to match inset.h
6422 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
6423 Added free_spacing boolean arg to match inset.h
6425 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
6426 Added free_spacing boolean arg to match inset.h
6428 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
6429 free_spacing boolean arg to match inset.h
6431 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
6432 Added free_spacing boolean arg to match inset.h
6434 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
6435 Added free_spacing boolean arg to match inset.h
6437 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
6438 Added free_spacing boolean arg to match inset.h
6440 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
6441 Added free_spacing boolean arg to match inset.h
6443 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
6444 Added free_spacing boolean arg to match inset.h
6446 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
6447 free_spacing boolean arg to match inset.h
6449 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
6450 free_spacing boolean arg to match inset.h
6452 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
6453 ignore free_spacing paragraphs. The user's spaces are left
6456 * src/text.C (InsertChar): Fixed the free_spacing layout
6457 attribute behavior. Now, if free_spacing is set, you can
6458 add multiple spaces in a paragraph with impunity (and they
6459 get output verbatim).
6460 (SelectSelectedWord): Added dummy argument to inset::Latex()
6463 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
6466 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
6467 paragraph layouts now only input a simple space instead.
6468 Special character insets don't make any sense in free-spacing
6471 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
6472 hard-spaces in the *input* file to simple spaces if the layout
6473 is free-spacing. This converts old files which had to have
6474 hard-spaces in free-spacing layouts where a simple space was
6476 (writeFileAscii): Added free_spacing check to pass to the newly
6477 reworked inset::Latex(...) methods. The inset::Latex() code
6478 ensures that hard-spaces in free-spacing paragraphs get output
6479 as spaces (rather than "~").
6481 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6483 * src/mathed/math_delim.C (draw): draw the empty placeholder
6484 delims with a onoffdash line.
6485 (struct math_deco_compare): struct that holds the "functors" used
6486 for the sort and the binary search in math_deco_table.
6487 (class init_deco_table): class used for initial sort of the
6489 (search_deco): use lower_bound to do a binary search in the
6492 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6494 * src/lyxrc.C: a small secret thingie...
6496 * src/lyxlex.C (printTable): changed to take a ostream as paramter
6497 and to not flush the stream as often as it used to.
6499 * src/support/lyxalgo.h: new file
6500 (sorted): template function used for checking if a sequence is
6501 sorted or not. Two versions with and without user supplied
6502 compare. Uses same compare as std::sort.
6504 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
6505 it and give warning on lyxerr.
6507 (struct compare_tags): struct with function operators used for
6508 checking if sorted, sorting and lower_bound.
6509 (search_kw): use lower_bound instead of manually implemented
6512 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6514 * src/insets/insetcollapsable.h: fix Clone() declaration.
6515 * src/insets/insetfoot.h: ditto.
6517 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
6519 2000-03-08 Juergen Vigna <jug@sad.it>
6521 * src/insets/lyxinset.h: added owner call which tells us if
6522 this inset is inside another inset. Changed also the return-type
6523 of Editable to an enum so it tells clearer what the return-value is.
6525 * src/insets/insettext.C (computeTextRows): fixed computing of
6526 textinsets which split automatically on more rows.
6528 * src/insets/insetert.[Ch]: changed this to be of BaseType
6531 * src/insets/insetfoot.[Ch]: added footnote inset
6533 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
6534 collapsable insets (like footnote, ert, ...)
6536 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6538 * src/lyxdraw.h: remvoe file
6540 * src/lyxdraw.C: remove file
6542 * src/insets/insettext.C: added <algorithm>.
6544 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6546 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
6547 (matrix_cb): case MM_OK use string stream
6549 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
6552 * src/mathed/math_macro.C (draw): use string stream
6553 (Metrics): use string stream
6555 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
6556 directly to the ostream.
6558 * src/vspace.C (asString): use string stream.
6559 (asString): use string stream
6560 (asLatexString): use string stream
6562 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
6563 setting Spacing::Other.
6565 * src/LaTeXFeatures.C (getPackages): use string stream instead of
6566 sprintf when creating the stretch vale.
6568 * src/text2.C (alphaCounter): changed to return a string and to
6569 not use a static variable internally. Also fixed a one-off bug.
6570 (SetCounter): changed the drawing of the labels to use string
6571 streams instead of sprintf.
6573 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
6574 manipulator to use a scheme that does not require library support.
6575 This is also the way it is done in the new GNU libstdc++. Should
6576 work with DEC cxx now.
6578 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6580 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
6581 end. This fixes a bug.
6583 * src/mathed (all files concerned with file writing): apply the
6584 USE_OSTREAM_ONLY changes to mathed too.
6586 * src/support/DebugStream.h: make the constructor explicit.
6588 * src/lyxfont.C (latexWriteStartChanges): small bug related to
6589 count and ostream squashed.
6591 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6593 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
6595 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
6596 ostringstream uses STL strings, and we might not.
6598 * src/insets/insetspecialchar.C: add using directive.
6599 * src/insets/insettext.C: ditto.
6601 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6603 * lib/layouts/seminar.layout: feeble attempt at a layout for
6604 seminar.cls, far from completet and could really use some looking
6605 at from people used to write layout files.
6607 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
6608 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
6609 a lot nicer and works nicely with ostreams.
6611 * src/mathed/formula.C (draw): a slightly different solution that
6612 the one posted to the list, but I think this one works too. (font
6613 size wrong in headers.)
6615 * src/insets/insettext.C (computeTextRows): some fiddling on
6616 Jürgens turf, added some comments that he should read.
6618 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
6619 used and it gave compiler warnings.
6620 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
6623 * src/lyx_gui.C (create_forms): do the right thing when
6624 show_banner is true/false.
6626 * src/lyx_cb.C (TimerCB): no need to close or do anything if
6627 show_banner is false.
6629 * most file writing files: Now use iostreams to do almost all of
6630 the writing. Also instead of passing string &, we now use
6631 stringstreams. mathed output is still not adapted to iostreams.
6632 This change can be turned off by commenting out all the occurences
6633 of the "#define USE_OSTREAM_ONLY 1" lines.
6635 * src/WorkArea.C (createPixmap): don't output debug messages.
6636 (WorkArea): don't output debug messages.
6638 * lib/lyxrc.example: added a comment about the new variable
6641 * development/Code_rules/Rules: Added some more commente about how
6642 to build class interfaces and on how better encapsulation can be
6645 2000-03-03 Juergen Vigna <jug@sad.it>
6647 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
6648 automatically with the width of the LyX-Window
6650 * src/insets/insettext.C (computeTextRows): fixed update bug in
6651 displaying text-insets (scrollvalues where not initialized!)
6653 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6655 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
6656 id in the check of the result from lower_bound is not enough since
6657 lower_bound can return last too, and then res->id will not be a
6660 * all insets and some code that use them: I have conditionalized
6661 removed the Latex(string & out, ...) this means that only the
6662 Latex(ostream &, ...) will be used. This is a work in progress to
6663 move towards using streams for all output of files.
6665 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
6668 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6670 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
6671 routine (this fixes bug where greek letters were surrounded by too
6674 * src/support/filetools.C (findtexfile): change a bit the search
6675 algorithm, to fix bug introduced in 1.1.4. Note that --format is
6676 no longer passed to kpsewhich, we may have to change that later.
6678 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
6679 warning options to avoid problems with X header files (from Angus
6681 * acinclude.m4: regenerated.
6683 2000-03-02 Juergen Vigna <jug@sad.it>
6685 * src/insets/insettext.C (WriteParagraphData): Using the
6686 par->writeFile() function for writing paragraph-data.
6687 (Read): Using buffer->parseSingleLyXformat2Token()-function
6688 for parsing paragraph data!
6690 * src/buffer.C (readLyXformat2): removed all parse data and using
6691 the new parseSingleLyXformat2Token()-function.
6692 (parseSingleLyXformat2Token): added this function to parse (read)
6693 lyx-file-format (this is called also from text-insets now!)
6695 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6697 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
6700 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
6701 directly instead of going through a func. One very bad thing: a
6702 static LyXFindReplace, but I don't know where to place it.
6704 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
6705 string instead of char[]. Also changed to static.
6706 (GetSelectionOrWordAtCursor): changed to static inline
6707 (SetSelectionOverLenChars): ditto.
6709 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
6710 current_view and global variables. both classes has changed names
6711 and LyXFindReplace is not inherited from SearchForm.
6713 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
6714 fl_form_search form.
6716 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
6718 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6720 * lib/bind/*.bind: make sure 'buffer-previous' function is not
6721 bound (from Kayvan).
6723 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
6725 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
6727 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6729 * some things that I should comment but the local pub says head to
6732 * comment out all code that belongs to the Roff code for Ascii
6733 export of tables. (this is unused)
6735 * src/LyXView.C: use correct type for global variable
6736 current_layout. (LyXTextClass::size_type)
6738 * some code to get the new insetgraphics closer to working I'd be
6739 grateful for any help.
6741 * src/BufferView2.C (insertInset): use the return type of
6742 NumberOfLayout properly. (also changes in other files)
6744 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
6745 this as a test. I want to know what breaks because of this.
6747 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
6749 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6751 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
6752 to use a \makebox in the label, this allows proper justification
6753 with out using protected spaces or multiple hfills. Now it is
6754 "label" for left justified, "\hfill label\hfill" for center, and
6755 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
6756 should be changed accordingly.
6758 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6760 * src/lyxtext.h: change SetLayout() to take a
6761 LyXTextClass::size_type instead of a char (when there is more than
6762 127 layouts in a class); also change type of copylayouttype.
6763 * src/text2.C (SetLayout): ditto.
6764 * src/LyXView.C (updateLayoutChoice): ditto.
6766 * src/LaTeX.C (scanLogFile): errors where the line number was not
6767 given just after the '!'-line were ignored (from Dekel Tsur).
6769 * lib/lyxrc.example: fix description of \date_insert_format
6771 * lib/layouts/llncs.layout: new layout, contributed by Martin
6774 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6776 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
6777 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
6778 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
6779 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
6780 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
6781 paragraph.C, text.C, text2.C)
6783 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6785 * src/insets/insettext.C (LocalDispatch): remove extra break
6788 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
6789 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
6791 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
6792 * src/insets/insettext.[Ch] (GetCursorPos): ditto
6794 * src/insets/insetbib.h: move InsetBibkey::Holder and
6795 InsetCitation::Holder in public space.
6797 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6799 * src/insets/insettext.h: small change to get the new files from
6800 Juergen to compile (use "string", not "class string").
6802 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
6803 const & as parameter to LocalDispatch, use LyXFont const & as
6804 paramter to some other func. This also had impacto on lyxinsets.h
6805 and the two mathed insets.
6807 2000-02-24 Juergen Vigna <jug@sad.it>
6810 * src/commandtags.h:
6812 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
6816 * src/BufferView2.C: added/updated code for various inset-functions
6818 * src/insets/insetert.[Ch]: added implementation of InsetERT
6820 * src/insets/insettext.[Ch]: added implementation of InsetText
6822 * src/insets/inset.C (Edit): added "unsigned int button" parameter
6823 (draw): added preliminary code for inset scrolling not finshed yet
6825 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
6826 as it is in lyxfunc.C now
6828 * src/insets/lyxinset.h: Added functions for text-insets
6830 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6832 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
6833 BufferView and reimplement the list as a queue put inside its own
6836 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
6838 * several files: use the new interface to the "updateinsetlist"
6840 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
6842 (work_area_handler): call BufferView::trippleClick on trippleclick.
6844 * src/BufferView.C (doubleClick): new function, selects word on
6846 (trippleClick): new function, selects line on trippleclick.
6848 2000-02-22 Allan Rae <rae@lyx.org>
6850 * lib/bind/xemacs.bind: buffer-previous not supported
6852 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6854 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
6857 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6859 * src/bufferlist.C: get rid of current_view from this file
6861 * src/spellchecker.C: get rid of current_view from this file
6863 * src/vspace.C: get rid of current_view from this file
6864 (inPixels): added BufferView parameter for this func
6865 (asLatexCommand): added a BufferParams for this func
6867 * src/text.C src/text2.C: get rid of current_view from these
6870 * src/lyxfont.C (getFontDirection): move this function here from
6873 * src/bufferparams.C (getDocumentDirection): move this function
6876 * src/paragraph.C (getParDirection): move this function here from
6878 (getLetterDirection): ditto
6880 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6882 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
6883 resize due to wrong pixmap beeing used. Also took the opurtunity
6884 to make the LyXScreen stateless on regard to WorkArea and some
6885 general cleanup in the same files.
6887 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6889 * src/Makefile.am: add missing direction.h
6891 * src/PainterBase.h: made the width functions const.
6893 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
6896 * src/insets/insetcommand.C (draw): draw Editable as buttons.
6898 * src/insets/insetlatexaccent.C (draw): make the accents draw
6899 better, at present this will only work well with iso8859-1.
6901 * several files: remove the old drawing code, now we use the new
6904 * several files: remove support for mono_video, reverse_video and
6907 2000-02-17 Juergen Vigna <jug@sad.it>
6909 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
6910 int ** as we have to return the pointer, otherwise we have only
6911 NULL pointers in the returning function.
6913 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6915 * src/LaTeX.C (operator()): quote file name when running latex.
6917 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6919 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
6920 (bubble tip), this removes our special handling of this.
6922 * Remove all code that is unused now that we have the new
6923 workarea. (Code that are not active when NEW_WA is defined.)
6925 * Make the uses of XSync not conditionalized on define USE_XSYNC.
6927 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6929 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
6930 nonexisting layout; correctly redirect obsoleted layouts.
6932 * lib/lyxrc.example: document \view_dvi_paper_option
6934 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
6937 * src/lyx_cb.C (RunScript): handle $$FName for command names.
6938 (PreviewDVI): handle the view_dvi_paper_option variable.
6939 [Both from Roland Krause]
6941 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6943 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
6944 char const *, int, LyXFont)
6945 (text(int, int, string, LyXFont)): ditto
6947 * src/text.C (InsertCharInTable): attempt to fix the double-space
6948 feature in tables too.
6949 (BackspaceInTable): ditto.
6950 (GetVisibleRow): make bottom pagebreak line be a onoff line.
6952 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6954 * src/text2.C (owner): only complain if owner_ is set and bv != 0
6956 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
6957 newly found text in textcache to this.
6958 (buffer): set the owner of the text put into the textcache to 0
6960 * src/insets/figinset.C (draw): fixed the drawing of figures with
6963 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
6964 drawing of mathframe, hfills, protected space, table lines. I have
6965 now no outstanding drawing problems with the new Painter code.
6967 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6969 * src/PainterBase.C (ellipse, circle): do not specify the default
6972 * src/LColor.h: add using directive.
6974 * src/Painter.[Ch]: change return type of methods from Painter& to
6975 PainterBase&. Add a using directive.
6977 * src/WorkArea.C: wrap xforms callbacks in C functions
6980 * lib/layouts/foils.layout: font fix and simplifications from Carl
6983 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6985 * a lot of files: The Painter, LColor and WorkArea from the old
6986 devel branch has been ported to lyx-devel. Some new files and a
6987 lot of #ifdeffed code. The new workarea is enabled by default, but
6988 if you want to test the new Painter and LColor you have to compile
6989 with USE_PAINTER defined (do this in config.h f.ex.) There are
6990 still some rought edges, and I'd like some help to clear those
6991 out. It looks stable (loads and displays the Userguide very well).
6994 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6996 * src/buffer.C (pop_tag): revert to the previous implementation
6997 (use a global variable for both loops).
6999 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
7001 * src/lyxrc.C (LyXRC): change slightly default date format.
7003 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
7004 there is an English text with a footnote that starts with a Hebrew
7005 paragraph, or vice versa.
7006 (TeXFootnote): ditto.
7008 * src/text.C (LeftMargin): allow for negative values for
7009 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
7012 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
7013 for input encoding (cyrillic)
7015 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7017 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
7020 * src/toolbar.C (set): ditto
7021 * src/insets/insetbib.C (create_form_citation_form): ditto
7023 * lib/CREDITS: added Dekel Tsur.
7025 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
7026 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
7027 hebrew supports files from Dekel Tsur.
7029 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
7030 <tzafrir@technion.ac.il>
7032 * src/lyxrc.C: put \date_insert_format at the right place.
7034 * src/buffer.C (makeLaTeXFile): fix the handling of
7035 BufferParams::sides when writing out latex files.
7037 * src/BufferView2.C: add a "using" directive.
7039 * src/support/lyxsum.C (sum): when we use lyxstring,
7040 ostringstream::str needs an additional .c_str().
7042 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7044 * src/support/filetools.C (ChangeExtension): patch from Etienne
7047 * src/TextCache.C (show): remove const_cast and make second
7048 parameter non-const LyXText *.
7050 * src/TextCache.h: use non const LyXText in show.
7052 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
7055 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7057 * src/support/lyxsum.C: rework to be more flexible.
7059 * several places: don't check if a pointer is 0 if you are going
7062 * src/text.C: remove some dead code.
7064 * src/insets/figinset.C: remove some dead code
7066 * src/buffer.C: move the BufferView funcs to BufferView2.C
7067 remove all support for insetlatexdel
7068 remove support for oldpapersize stuff
7069 made some member funcs const
7071 * src/kbmap.C: use a std::list to store the bindings in.
7073 * src/BufferView2.C: new file
7075 * src/kbsequence.[Ch]: new files
7077 * src/LyXAction.C + others: remove all trace of buffer-previous
7079 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
7080 only have one copy in the binary of this table.
7082 * hebrew patch: moved some functions from LyXText to more
7083 appropriate places. (LyXParagraph, BufferParams, LyXFont)
7085 * several files: remove support for XForms older than 0.88
7087 remove some #if 0 #endif code
7089 * src/TextCache.[Ch]: new file. Holds the textcache.
7091 * src/BufferView.C: changes to use the new TextCache interface.
7092 (waitForX): remove the now unused code.
7094 * src/BackStack.h: remove some commented code
7096 * lib/bind/emacs.bind: remove binding for buffer-previous
7098 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7100 * applied the hebrew patch.
7102 * src/lyxrow.h: make sure that all Row variables are initialized.
7104 * src/text2.C (TextHandleUndo): comment out a delete, this might
7105 introduce a memory leak, but should also help us to not try to
7106 read freed memory. We need to look at this one.
7108 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
7109 (LyXParagraph): initalize footnotekind.
7111 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
7112 forgot this when applying the patch. Please heed the warnings.
7114 * src/BufferView.C (buffer): a fix for the buffer-reload problem
7115 (aka. reformat problem)
7117 * src/bufferlist.C (exists): made const, and use const_iterator
7118 (isLoaded): new func.
7119 (release): use std::find to find the correct buffer.
7121 * src/bufferlist.h: made getState a const func.
7122 made empty a const func.
7123 made exists a const func.
7126 2000-02-01 Juergen Vigna <jug@sad.it>
7128 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
7130 * po/it.po: updated a bit the italian po file and also changed the
7131 'file nuovo' for newfile to 'filenuovo' without a space, this did
7134 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
7135 for the new insert_date command.
7137 * src/lyxfunc.C (Dispatch): added support for a insert_date function
7138 from jdblair, to insert a date into the current text conforming to
7139 a strftime format (for now only considering the locale-set and not
7140 the document-language).
7142 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7144 * src/lyxfont.C (textWidth): hopefully better fix for the Array
7145 Bounds Read error seen by purify. The problem was that islower is
7146 a macros which takes an unsigned char and uses it as an index for
7147 in array of characters properties (and is thus subject to the
7151 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
7152 correctly the paper sides radio buttons.
7153 (UpdateDocumentButtons): ditto.
7155 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7157 * src/kbmap.C (getsym + others): change to return unsigned int,
7158 returning a long can give problems on 64 bit systems. (I assume
7159 that int is 32bit on 64bit systems)
7161 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7163 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
7164 LyXLookupString to be zero-terminated. Really fixes problems seen
7167 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7169 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
7170 write a (char*)0 to the lyxerr stream.
7172 * src/lastfiles.C: move algorithm before the using statemets.
7174 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7176 * src/lastfiles.C: move using directives in global scope (egcs 1.x
7177 complains otherwise).
7178 * src/table.C: ditto
7180 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
7183 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
7184 that I removed earlier... It is really needed.
7186 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
7188 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7190 * INSTALL: update xforms home page URL.
7192 * lib/configure.m4: fix a bug with unreadable layout files.
7194 * src/table.C (calculate_width_of_column): add "using std::max"
7197 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7199 * several files: marked several lines with "DEL LINE", this is
7200 lines that can be deleted without changing anything.
7201 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
7202 checks this anyway */
7205 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
7207 * src/DepTable.C (update): add a "+" at the end when the checksum
7208 is different. (debugging string only)
7210 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
7211 the next inset to not be displayed. This should also fix the list
7212 of labels in the "Insert Crossreference" dialog.
7214 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7216 * src/support/LSubstring.C (LSubstring): set pos to string::npos
7217 when regex was not found.
7219 * src/support/lstrings.C (lowercase): use handcoded transform always.
7222 * src/text.C (Delete): fixed the crash. cursor.par->prev and
7223 old_cursor.par->prev could be 0.
7225 * several files: changed post inc/dec to pre inc/dec
7227 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
7228 write the lastfiles to file.
7230 * src/BufferView.C (buffer): only show TextCache info when debugging
7232 (resizeCurrentBuffer): ditto
7233 (workAreaExpose): ditto
7235 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
7237 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
7239 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
7240 a bit better by removing the special case for \i and \j.
7242 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7244 * src/lyx_main.C (easyParse): remove test for bad comand line
7245 options, since this broke all xforms-related parsing.
7247 * src/kbmap.C (getsym): set return type to unsigned long, as
7248 declared in header. On an alpha, long is _not_ the same as int.
7250 * src/support/LOstream.h: add a "using std::flush;"
7252 * src/insets/figinset.C: ditto.
7254 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7256 * src/bufferlist.C (write): use blinding fast file copy instead of
7257 "a char at a time", now we are doing it the C++ way.
7259 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
7260 std::list<int> instead.
7261 (addpidwait): reflect move to std::list<int>
7262 (sigchldchecker): ditto
7264 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
7267 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
7268 that obviously was wrong...
7270 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
7271 c, this avoids warnings with purify and islower.
7273 * src/insets/figinset.C: rename struct queue to struct
7274 queue_element and rewrite to use a std::queue. gsqueue is now a
7275 std::queue<queue_element>
7276 (runqueue): reflect move to std::queue
7279 * src/support/lstrings.h (tostr): specialize for bool, otherwise
7280 we would get "1" "0" instead of "true" "false. Also make the tostr
7283 2000-01-21 Juergen Vigna <jug@sad.it>
7285 * src/buffer.C (writeFileAscii): Disabled code for special groff
7286 handling of tabulars till I fix this in table.C
7288 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7290 * src/support/mkdir.C (mkdir): change second argument of mkdir to
7292 * src/support/lyxlib.h: ditto.
7294 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7296 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
7297 and 'j' look better. This might fix the "macron" bug that has been
7300 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
7301 functions as one template function. Delete the old versions.
7303 * src/support/lyxsum.C: move using std::ifstream inside
7306 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
7309 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
7311 * src/mathed/formula.C: delete #include "bufferlist.h" never used
7313 * src/insets/figinset.C (InitFigures): use new instead of malloc
7314 to allocate memory for figures and bitmaps.
7315 (DoneFigures): use delete[] instead of free to deallocate memory
7316 for figures and bitmaps.
7317 (runqueue): use new to allocate
7318 (getfigdata): use new/delete[] instead of malloc/free
7319 (RegisterFigure): ditto
7321 * some files: moved some declarations closer to first use, small
7322 whitespace changes use preincrement instead of postincrement where
7323 it does not make a difference.
7325 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
7326 step on the way to use stl::containers for key maps.
7328 * src/bufferlist.h: add a typedef for const_iterator and const
7329 versions of begin and end.
7331 * src/bufferlist.[Ch]: change name of member variable _state to
7332 state_. (avoid reserved names)
7334 (getFileNames): returns the filenames of the buffers in a vector.
7336 * configure.in (ALL_LINGUAS): added ro
7338 * src/support/putenv.C: new file
7340 * src/support/mkdir.C: new file
7342 2000-01-20 Allan Rae <rae@lyx.org>
7344 * lib/layouts/IEEEtran.layout: Added several theorem environments
7346 * lib/templates/IEEEtran.lyx: Example theorem environments and a
7347 couple of minor additions.
7349 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
7350 (except for those in footnotes of course)
7352 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7354 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
7356 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
7357 std::sort and std::lower_bound instead of qsort and handwritten
7359 (struct compara): struct that holds the functors used by std::sort
7360 and std::lower_bound in MathedLookupBOP.
7362 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7364 * src/support/LAssert.h: do not do partial specialization. We do
7367 * src/support/lyxlib.h: note that lyx::getUserName() and
7368 lyx::date() are not in use right now. Should these be suppressed?
7370 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
7371 (makeLinuxDocFile): do not put date and user name in linuxdoc
7374 * src/support/lyxlib.h (kill): change first argument to long int,
7375 since that's what solaris uses.
7377 * src/support/kill.C (kill): fix declaration to match prototype.
7379 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
7380 actually check whether namespaces are supported. This is not what
7383 * src/support/lyxsum.C: add a using directive.
7385 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7387 * src/support/kill.C: if we have namespace support we don't have
7388 to include lyxlib.h.
7390 * src/support/lyxlib.h: use namespace lyx if supported.
7392 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7394 * src/support/date.C: new file
7396 * src/support/chdir.C: new file
7398 * src/support/getUserName.C: new file
7400 * src/support/getcwd.C: new file
7402 * src/support/abort.C: new file
7404 * src/support/kill.C: new file
7406 * src/support/lyxlib.h: moved all the functions in this file
7407 insede struct lyx. Added also kill and abort to this struct. This
7408 is a way to avoid the "kill is not defined in <csignal>", we make
7409 C++ wrappers for functions that are not ANSI C or ANSI C++.
7411 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
7412 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
7413 lyx it has been renamed to sum.
7415 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7417 * src/text.C: add using directives for std::min and std::max.
7419 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7421 * src/texrow.C (getIdFromRow): actually return something useful in
7422 id and pos. Hopefully fixes the bug with positionning of errorbox
7425 * src/lyx_main.C (easyParse): output an error and exit if an
7426 incorrect command line option has been given.
7428 * src/spellchecker.C (ispell_check_word): document a memory leak.
7430 * src/bufferlist.C (write): fix mismatched allocation/deletion,
7431 where a "struct utimbuf" is allocated with "new" and deleted with
7434 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
7436 * src/text2.C (CutSelection): don't delete double spaces.
7437 (PasteSelection): ditto
7438 (CopySelection): ditto
7440 * src/text.C (Backspace): don't delete double spaces.
7442 * src/lyxlex.C (next): fix a bug that were only present with
7443 conformant std::istream::get to read comment lines, use
7444 std::istream::getline instead. This seems to fix the problem.
7446 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7448 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
7449 allowed to insert space before space" editing problem. Please read
7450 commends at the beginning of the function. Comments about usage
7453 * src/text.C (InsertChar): fix for the "not allowed to insert
7454 space before space" editing problem.
7456 * src/text2.C (DeleteEmptyParagraphMechanism): when
7457 IsEmptyTableRow can only return false this last "else if" will
7458 always be a no-op. Commented out.
7460 * src/text.C (RedoParagraph): As far as I can understand tmp
7461 cursor is not really needed.
7463 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
7464 present it could only return false anyway.
7465 (several functions): Did something not so smart...added a const
7466 specifier on a lot of methods.
7468 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
7469 and add a tmp->text.resize. The LyXParagraph constructor does the
7471 (BreakParagraphConservative): ditto
7473 * src/support/path.h (Path): add a define so that the wrong usage
7474 "Path("/tmp") will be flagged as a compilation error:
7475 "`unnamed_Path' undeclared (first use this function)"
7477 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7479 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
7480 which was bogus for several reasons.
7482 * src/LaTeX.C (scanAux): fix the regular expression used to scan
7486 * autogen.sh: do not use "type -path" (what's that anyway?).
7488 * src/support/filetools.C (findtexfile): remove extraneous space
7489 which caused a kpsewhich warning (at least with kpathsea version
7492 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7494 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
7496 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
7498 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
7500 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7502 * src/paragraph.C (BreakParagraph): do not reserve space on text
7503 if we don't need to (otherwise, if pos_end < pos, we end up
7504 reserving huge amounts of memory due to bad unsigned karma).
7505 (BreakParagraphConservative): ditto, although I have not seen
7506 evidence the bug can happen here.
7508 * src/lyxparagraph.h: add a using std::list.
7510 2000-01-11 Juergen Vigna <jug@sad.it>
7512 * src/menus.C (MenuDocu): output an Alert if the documentation-file
7515 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7517 * src/vc-backend.C (doVCCommand): change to be static and take one
7518 more parameter: the path to chdir too be fore executing the command.
7519 (retrive): new function equiv to "co -r"
7521 * src/bufferlist.C (loadLyXFile): implement the missing parts if
7522 file_not_found_hook is true.
7524 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
7526 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
7527 if a file is readwrite,readonly...anything else.
7529 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7531 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
7532 (CreatePostscript): name change from MenuRunDVIPS (or something)
7533 (PreviewPostscript): name change from MenuPreviewPS
7534 (PreviewDVI): name change from MenuPreviewDVI
7536 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
7537 \view_pdf_command., \pdf_to_ps_command
7539 * lib/configure.m4: added search for PDF viewer, and search for
7540 PDF to PS converter.
7541 (lyxrc.defaults output): add \pdflatex_command,
7542 \view_pdf_command and \pdf_to_ps_command.
7544 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
7546 * src/bufferlist.C (write): we don't use blocksize for anything so
7549 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7551 * src/support/block.h: disable operator T* (), since it causes
7552 problems with both compilers I tried. See comments in the file.
7554 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
7557 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
7558 variable LYX_DIR_10x to LYX_DIR_11x.
7560 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
7562 * INSTALL: document --with-lyxname.
7565 * configure.in: new configure flag --with-lyxname which allows to
7566 choose the name under which lyx is installed. Default is "lyx", of
7567 course. It used to be possible to do this with --program-suffix,
7568 but the later has in fact a different meaning for autoconf.
7570 * src/support/lstrings.h (lstrchr): reformat a bit.
7572 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
7573 * src/mathed/math_defs.h: ditto.
7575 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7577 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
7578 true, decides if we create a backup file or not when saving. New
7579 tag and variable \pdf_mode, defaults to false. New tag and
7580 variable \pdflatex_command, defaults to pdflatex. New tag and
7581 variable \view_pdf_command, defaults to xpdf. New tag and variable
7582 \pdf_to_ps_command, defaults to pdf2ps.
7584 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7586 * src/bufferlist.C (close): don't call insetUnlock if the buffer
7587 does not have a BufferView.
7588 (unlockInset): ditto + don't access the_locking_inset if the
7589 buffer does not have a BufferView.
7591 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
7592 certain circumstances so that we don't continue a keyboard
7593 operation long after the key was released. Try f.ex. to load a
7594 large document, press PageDown for some seconds and then release
7595 it. Before this change the document would contine to scroll for
7596 some time, with this change it stops imidiatly.
7598 * src/support/block.h: don't allocate more space than needed. As
7599 long as we don't try to write to the arr[x] in a array_type arr[x]
7600 it is perfectly ok. (if you write to it you might segfault).
7601 added operator value_type*() so that is possible to pass the array
7602 to functions expecting a C-pointer.
7604 * lib/Makefile.am (dist-hook): don't fail completely if unable to
7607 * intl/*: updated to gettext 0.10.35, tried to add our own
7608 required modifications. Please verify.
7610 * po/*: updated to gettext 0.10.35, tried to add our own required
7611 modifications. Please verify.
7613 * src/support/lstrings.C (tostr): go at fixing the problem with
7614 cxx and stringstream. When stringstream is used return
7615 oss.str().c_str() so that problems with lyxstring and basic_string
7616 are avoided. Note that the best solution would be for cxx to use
7617 basic_string all the way, but it is not conformant yet. (it seems)
7619 * src/lyx_cb.C + other files: moved several global functions to
7620 class BufferView, some have been moved to BufferView.[Ch] others
7621 are still located in lyx_cb.C. Code changes because of this. (part
7622 of "get rid of current_view project".)
7624 * src/buffer.C + other files: moved several Buffer functions to
7625 class BufferView, the functions are still present in buffer.C.
7626 Code changes because of this.
7628 * config/lcmessage.m4: updated to most recent. used when creating
7631 * config/progtest.m4: updated to most recent. used when creating
7634 * config/gettext.m4: updated to most recent. applied patch for
7637 * config/gettext.m4.patch: new file that shows what changes we
7638 have done to the local copy of gettext.m4.
7640 * config/libtool.m4: new file, used in creation of acinclude.m4
7642 * config/lyxinclude.m4: new file, this is the lyx created m4
7643 macros, used in making acinclude.m4.
7645 * autogen.sh: GNU m4 discovered as a separate task not as part of
7646 the lib/configure creation.
7647 Generate acinlucde from files in config. Actually cat
7648 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
7649 easier to upgrade .m4 files that really are external.
7651 * src/Spacing.h: moved using std::istringstream to right after
7652 <sstream>. This should fix the problem seen with some compilers.
7654 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7656 * src/lyx_cb.C: began some work to remove the dependency a lot of
7657 functions have on BufferView::text, even if not really needed.
7658 (GetCurrentTextClass): removed this func, it only hid the
7661 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
7662 forgot this in last commit.
7664 * src/Bullet.C (bulletEntry): use static char const *[] for the
7665 tables, becuase of this the return arg had to change to string.
7667 (~Bullet): removed unneeded destructor
7669 * src/BufferView.C (beforeChange): moved from lyx_cb.C
7670 (insetSleep): moved from Buffer
7671 (insetWakeup): moved from Buffer
7672 (insetUnlock): moved from Buffer
7674 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
7675 from Buffer to BufferView.
7677 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
7679 * config/ltmain.sh: updated to version 1.3.4 of libtool
7681 * config/ltconfig: updated to version 1.3.4 of libtool
7683 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7686 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
7687 Did I get that right?
7689 * src/lyxlex.h: add a "using" directive or two.
7690 * src/Spacing.h: ditto.
7691 * src/insets/figinset.C: ditto.
7692 * src/support/filetools.C: ditto.
7693 * src/support/lstrings.C: ditto.
7694 * src/BufferView.C: ditto.
7695 * src/bufferlist.C: ditto.
7696 * src/lyx_cb.C: ditto.
7697 * src/lyxlex.C: ditto.
7699 * NEWS: add some changes for 1.1.4.
7701 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7703 * src/BufferView.C: first go at a TextCache to speed up switching
7706 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7708 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
7709 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
7710 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
7711 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
7714 * src/mathed/math_defs.h (MathedRowSt): make sure that all
7715 members of the struct are correctly initialized to 0 (detected by
7717 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
7718 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
7720 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
7721 pidwait, since it was allocated with "new". This was potentially
7722 very bad. Thanks to Michael Schmitt for running purify for us.
7725 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7727 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
7729 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
7731 1999-12-30 Allan Rae <rae@lyx.org>
7733 * lib/templates/IEEEtran.lyx: minor change
7735 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
7736 src/mathed/formula.C (LocalDispatch): askForText changes
7738 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
7739 know when a user has cancelled input. Fixes annoying problems with
7740 inserting labels and version control.
7742 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7744 * src/support/lstrings.C (tostr): rewritten to use strstream and
7747 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7749 * src/support/filetools.C (IsFileWriteable): use fstream to check
7750 (IsDirWriteable): use fileinfo to check
7752 * src/support/filetools.h (FilePtr): whole class deleted
7754 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
7756 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
7758 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
7760 * src/bufferlist.C (write): use ifstream and ofstream instead of
7763 * src/Spacing.h: use istrstream instead of sscanf
7765 * src/mathed/math_defs.h: change first arg to istream from FILE*
7767 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
7769 * src/mathed/math_parser.C: have yyis to be an istream
7770 (LexGetArg): use istream (yyis)
7772 (mathed_parse): ditto
7773 (mathed_parser_file): first arg istream instead of FILE*, set yyis
7775 * src/mathed/formula.C (Read): rewritten to use istream
7777 * src/mathed/formulamacro.C (Read): rewritten to use istream
7779 * src/lyxlex.h (~LyXLex): deleted desturctor
7780 (getStream): new function, returns an istream
7781 (getFile): deleted funtion
7782 (IsOK): return is.good();
7784 * src/lyxlex.C (LyXLex): delete file and owns_file
7785 (setFile): open an filebuf and assign that to a istream instead of
7787 (setStream): new function, takes an istream as arg.
7788 (setFile): deleted function
7789 (EatLine): rewritten us use istream instead of FILE*
7793 * src/table.C (LyXTable): use istream instead of FILE*
7794 (Read): rewritten to take an istream instead of FILE*
7796 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7798 * src/buffer.C (Dispatch): remove an extraneous break statement.
7800 * src/support/filetools.C (QuoteName): change to do simple
7801 'quoting'. More work is necessary. Also changed to do nothing
7802 under emx (needs fix too).
7803 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
7805 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
7806 config.h.in to the AC_DEFINE_UNQUOTED() call.
7807 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
7808 needs char * as argument (because Solaris 7 declares it like
7811 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
7812 remove definition of BZERO.
7814 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7816 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
7817 defined, "lyxregex.h" if not.
7819 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
7821 (REGEX): new variable that is set to regex.c lyxregex.h when
7822 AM_CONDITIONAL USE_REGEX is set.
7823 (libsupport_la_SOURCES): add $(REGEX)
7825 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
7828 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
7831 * configure.in: add call to LYX_REGEX
7833 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
7834 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
7836 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7838 * lib/bind/fi_menus.bind: new file, from
7839 pauli.virtanen@saunalahti.fi.
7841 * src/buffer.C (getBibkeyList): pass the parameter delim to
7842 InsetInclude::getKeys and InsetBibtex::getKeys.
7844 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
7845 is passed to Buffer::getBibkeyList
7847 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
7848 instead of the hardcoded comma.
7850 * src/insets/insetbib.C (getKeys): make sure that there are not
7851 leading blanks in bibtex keys. Normal latex does not care, but
7852 harvard.sty seems to dislike blanks at the beginning of citation
7853 keys. In particular, the retturn value of the function is
7855 * INSTALL: make it clear that libstdc++ is needed and that gcc
7856 2.7.x probably does not work.
7858 * src/support/filetools.C (findtexfile): make debug message go to
7860 * src/insets/insetbib.C (getKeys): ditto
7862 * src/debug.C (showTags): make sure that the output is correctly
7865 * configure.in: add a comment for TWO_COLOR_ICON define.
7867 * acconfig.h: remove all the entries that already defined in
7868 configure.in or acinclude.m4.
7870 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
7871 to avoid user name, date and copyright.
7873 1999-12-21 Juergen Vigna <jug@sad.it>
7875 * src/table.C (Read): Now read bogus row format informations
7876 if the format is < 5 so that afterwards the table can
7877 be read by lyx but without any format-info. Fixed the
7878 crash we experienced when not doing this.
7880 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7882 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
7883 (RedoDrawingOfParagraph): ditto
7884 (RedoParagraphs): ditto
7885 (RemoveTableRow): ditto
7887 * src/text.C (Fill): rename arg paperwidth -> paper_width
7889 * src/buffer.C (insertLyXFile): rename var filename -> fname
7890 (writeFile): rename arg filename -> fname
7891 (writeFileAscii): ditto
7892 (makeLaTeXFile): ditto
7893 (makeLinuxDocFile): ditto
7894 (makeDocBookFile): ditto
7896 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
7899 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
7901 * src/bmtable.h: add extern "C" on this file when __cplusplus is
7904 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
7905 compiled by a C compiler not C++.
7907 * src/layout.h (LyXTextClass): added typedef for const_iterator
7908 (LyXTextClassList): added typedef for const_iterator + member
7909 functions begin and end.
7911 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
7912 iterators to fill the choice_class.
7913 (updateLayoutChoice): rewritten to use iterators to fill the
7914 layoutlist in the toolbar.
7916 * src/BufferView.h (BufferView::work_area_width): removed unused
7919 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
7921 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
7922 (sgmlCloseTag): ditto
7924 * src/support/lstrings.h: return type of countChar changed to
7927 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
7928 what version of this func to use. Also made to return unsigned int.
7930 * configure.in: call LYX_STD_COUNT
7932 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
7933 conforming std::count.
7935 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7937 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
7938 and a subscript would give bad display (patch from Dekel Tsur
7939 <dekel@math.tau.ac.il>).
7941 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
7943 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
7946 * src/chset.h: add a few 'using' directives
7948 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
7949 triggered when no buffer is active
7951 * src/layout.C: removed `break' after `return' in switch(), since
7954 * src/lyx_main.C (init): make sure LyX can be ran in place even
7955 when libtool has done its magic with shared libraries. Fix the
7956 test for the case when the system directory has not been found.
7958 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
7959 name for the latex file.
7960 (MenuMakeHTML): ditto
7962 * src/buffer.h: add an optional boolean argument, which is passed
7965 1999-12-20 Allan Rae <rae@lyx.org>
7967 * lib/templates/IEEEtran.lyx: small correction and update.
7969 * configure.in: Attempted to use LYX_PATH_HEADER
7971 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
7973 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
7974 input from JMarc. Now use preprocessor to find the header.
7975 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
7976 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
7977 LYX_STL_STRING_FWD. See comments in file.
7979 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
7981 * The global MiniBuffer * minibuffer variable is dead.
7983 * The global FD_form_main * fd_form_main variable is dead.
7985 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7987 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
7989 * src/table.h: add the LOstream.h header
7990 * src/debug.h: ditto
7992 * src/LyXAction.h: change the explaination of the ReadOnly
7993 attribute: is indicates that the function _can_ be used.
7995 * src/LyXAction.C (init): find-replace _can_ be used in read-only
7998 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8000 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
8006 * src/paragraph.C (GetWord): assert on pos>=0
8009 * src/support/lyxstring.C: condition the use of an invariant on
8011 * src/support/lyxstring.h: ditto
8013 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
8014 Use LAssert.h instead of plain assert().
8016 * src/support/lstrings.h: add LAssert.h, in case it is needed.
8018 * src/lyxfunc.C: do not include LAssert.h, it is not used.
8019 * src/support/filetools.C: ditto
8021 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
8024 * INSTALL: document the new configure flags
8026 * configure.in: suppress --with-debug; add --enable-assertions
8028 * acinclude.m4: various changes in alignment of help strings.
8030 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8032 * src/kbmap.C: commented out the use of the hash map in kb_map,
8033 beginning of movement to a stl::container.
8035 * several files: removed code that was not in effect when
8036 MOVE_TEXT was defined.
8038 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
8039 for escaping should not be used. We can discuss if the string
8040 should be enclosed in f.ex. [] instead of "".
8042 * src/trans_mgr.C (insert): use the new returned value from
8043 encodeString to get deadkeys and keymaps done correctly.
8045 * src/chset.C (encodeString): changed to return a pair, to tell
8046 what to use if we know the string.
8048 * src/lyxscreen.h (fillArc): new function.
8050 * src/FontInfo.C (resize): rewritten to use more std::string like
8051 structore, especially string::replace.
8053 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
8056 * configure.in (chmod +x some scripts): remove config/gcc-hack
8058 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8060 * src/buffer.C (writeFile): change once again the top comment in a
8061 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
8062 instead of an hardcoded version number.
8063 (makeDocBookFile): ditto
8065 * src/version.h: add new define LYX_DOCVERSION
8067 * po/de.po: update from Pit Sütterlin
8068 * lib/bind/de_menus.bind: ditto.
8070 * src/lyxfunc.C (Dispatch): call MenuExport()
8071 * src/buffer.C (Dispatch): ditto
8073 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
8074 LyXFunc::Dispatch().
8075 (MenuExport): new function, moved from
8076 LyXFunc::Dispatch().
8078 * src/trans_mgr.C (insert): small cleanup
8079 * src/chset.C (loadFile): ditto
8081 * lib/kbd/iso8859-1.cdef: add missing backslashes
8083 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8085 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
8086 help with placing the manually drawn accents better.
8088 (Draw): x2 and hg changed to float to minimize rounding errors and
8089 help place the accents better.
8091 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
8092 unsigned short to char is just wrong...cast the char to unsigned
8093 char instead so that the two values can compare sanely. This
8094 should also make the display of insetlatexaccents better and
8095 perhaps also some other insets.
8097 (lbearing): new function
8100 1999-12-15 Allan Rae <rae@lyx.org>
8102 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
8103 header that provides a wrapper around the very annoying SGI STL header
8106 * src/support/lyxstring.C, src/LString.h:
8107 removed old SGI-STL-compatability attempts.
8109 * configure.in: Use LYX_STL_STRING_FWD.
8111 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
8112 stl_string_fwd.h is around and try to determine it's location.
8113 Major improvement over previous SGI STL 3.2 compatability.
8114 Three small problems remain with this function due to my zero
8115 knowledge of autoconf. JMarc and lgb see the comments in the code.
8117 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8119 * src/broken_const.h, config/hack-gcc, config/README: removed
8121 * configure.in: remove --with-gcc-hack option; do not call
8124 * INSTALL: remove documentation of --with-broken-const and
8127 * acconfig.h: remove all trace of BROKEN_CONST define
8129 * src/buffer.C (makeDocBookFile): update version number in output
8131 (SimpleDocBookOnePar): fix an assert when trying to a character
8132 access beyond string length
8135 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8137 * po/de.po: fix the Export menu
8139 * lyx.man: update the description of -dbg
8141 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
8142 (commandLineHelp): updated
8143 (easyParse): show list of available debug levels if -dbg is passed
8146 * src/Makefile.am: add debug.C
8148 * src/debug.h: moved some code to debug.C
8150 * src/debug.C: new file. Contains code to set and show debug
8153 * src/layout.C: remove 'break' after 'continue' in switch
8154 statements, since these cannot be reached.
8156 1999-12-13 Allan Rae <rae@lyx.org>
8158 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
8159 (in_word_set): hash() -> math_hash()
8161 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
8163 * acconfig.h: Added a test for whether we are using exceptions in the
8164 current compilation run. If so USING_EXCEPTIONS is defined.
8166 * config.in: Check for existance of stl_string_fwd.h
8167 * src/LString.h: If compiling --with-included-string and SGI's
8168 STL version 3.2 is present (see above test) we need to block their
8169 forward declaration of string and supply a __get_c_string().
8170 However, it turns out this is only necessary if compiling with
8171 exceptions enabled so I've a bit more to add yet.
8173 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
8174 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
8175 src/support/LRegex.h, src/undo.h:
8176 Shuffle the order of the included files a little to ensure that
8177 LString.h gets included before anything that includes stl_string_fwd.h
8179 * src/support/lyxstring.C: We need to #include LString.h instead of
8180 lyxstring.h to get the necessary definition of __get_c_string.
8181 (__get_c_string): New function. This is defined static just like SGI's
8182 although why they need to do this I'm not sure. Perhaps it should be
8183 in lstrings.C instead.
8185 * lib/templates/IEEEtran.lyx: New template file.
8187 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8189 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
8190 * intl/Makefile.in (MKINSTALLDIRS): ditto
8192 * src/LyXAction.C (init): changed to hold the LFUN data in a
8193 automatic array in stead of in callso to newFunc, this speeds up
8194 compilation a lot. Also all the memory used by the array is
8195 returned when the init is completed.
8197 * a lot of files: compiled with -Wold-style-cast, changed most of
8198 the reported offenders to C++ style casts. Did not change the
8199 offenders in C files.
8201 * src/trans.h (Match): change argument type to unsigned int.
8203 * src/support/DebugStream.C: fix some types on the streambufs so
8204 that it works on a conforming implementation.
8206 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8208 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
8210 * src/support/lyxstring.C: remove the inline added earlier since
8211 they cause a bunch of unsatisfied symbols when linking with dec
8212 cxx. Cxx likes to have the body of inlines at the place where they
8215 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
8216 accessing negative bounds in array. This fixes the crash when
8217 inserting accented characters.
8218 * src/trans.h (Match): ditto
8220 * src/buffer.C (Dispatch): since this is a void, it should not try
8221 to return anything...
8223 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8225 * src/buffer.h: removed the two friends from Buffer. Some changes
8226 because of this. Buffer::getFileName and Buffer::setFileName
8227 renamed to Buffer::fileName() and Buffer::fileName(...).
8229 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8231 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
8232 and Buffer::update(short) to BufferView. This move is currently
8233 controlled by a define MOVE_TEXT, this will be removed when all
8234 shows to be ok. This move paves the way for better separation
8235 between buffer contents and buffer view. One side effect is that
8236 the BufferView needs a rebreak when swiching buffers, if we want
8237 to avoid this we can add a cache that holds pointers to LyXText's
8238 that is not currently in use.
8240 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
8243 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8245 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
8247 * lyx_main.C: new command line option -x (or --execute) and
8248 -e (or --export). Now direct conversion from .lyx to .tex
8249 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
8250 Unfortunately, X is still needed and the GUI pops up during the
8253 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8255 * src/Spacing.C: add a using directive to bring stream stuff into
8257 * src/paragraph.C: ditto
8258 * src/buffer.C: ditto
8260 * NEWS: updated a bit the new features of 1.1.3 (took a few things
8261 from Lars' announcement).
8263 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
8264 example files from Tino Meinen.
8266 1999-12-06 Allan Rae <rae@lyx.org>
8268 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
8270 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8272 * src/support/lyxstring.C: added a lot of inline for no good
8275 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
8276 latexWriteEndChanges, they were not used.
8278 * src/layout.h (operator<<): output operator for PageSides
8280 * src/mathed/math_iter.C (my_memcpy): slightly changed.
8282 * some example files: loaded in LyX 1.0.4 and saved again to update
8283 certain constructs (table format)
8285 * a lot of files: did the change to use fstream/iostream for all
8286 writing of files. Done with a close look at Andre Poenitz's patch.
8288 * some files: whitespace changes.
8290 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8292 * src/mathed/math_iter.C (my_memcpy): new function. Since the
8293 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
8294 architecture, we provide our own. It is used unconditionnally, but
8295 I do not think this is a performance problem. Thanks to Angus
8296 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
8297 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
8299 (GetInset): use my_memcpy.
8303 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
8304 it is easier to understand, but it uses less TeX-only constructs now.
8306 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
8307 elements contain spaces
8309 * lib/configure: regenerated
8311 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
8312 elements contain spaces; display the list of programs that are
8315 * autogen.sh: make sure lib/configure is executable
8317 * lib/examples/*: rename the tutorial examples to begin with the
8318 two-letters language code.
8320 * src/lyxfunc.C (getStatus): do not query current font if no
8323 * src/lyx_cb.C (RunScript): use QuoteName
8324 (MenuRunDvips): ditto
8325 (PrintApplyCB): ditto
8327 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
8328 around argument, so that it works well with the current shell.
8329 Does not work properly with OS/2 shells currently.
8331 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
8332 * src/LyXSendto.C (SendtoApplyCB): ditto
8333 * src/lyxfunc.C (Dispatch): ditto
8334 * src/buffer.C (runLaTeX): ditto
8335 (runLiterate): ditto
8336 (buildProgram): ditto
8338 * src/lyx_cb.C (RunScript): ditto
8339 (MenuMakeLaTeX): ditto
8341 * src/buffer.h (getLatexName): new method
8343 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
8345 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8347 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
8348 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
8349 (create_math_panel): ditto
8351 * src/lyxfunc.C (getStatus): re-activate the code which gets
8352 current font and cursor; add test for export to html.
8354 * src/lyxrc.C (read): remove unreachable break statements; add a
8357 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
8359 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8361 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
8362 introduced by faulty regex.
8363 * src/buffer.C: ditto
8364 * src/lastfiles.C: ditto
8365 * src/paragraph.C: ditto
8366 * src/table.C: ditto
8367 * src/vspace.C: ditto
8368 * src/insets/figinset.C: ditto
8369 Note: most of these is absolutely harmless, except the one in
8370 src/mathed formula.C.
8372 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8374 * src/ImportNoweb.C (documentclass): fixed bounds for substr
8375 operation, yielding correct results for the reLyX command.
8377 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8379 * src/support/filetools.C (ExpandPath): removed an over eager
8381 (ReplaceEnvironmentPath): ditto
8383 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
8384 shows that we are doing something fishy in our code...
8388 * src/lyxrc.C (read): use a double switch trick to get more help
8389 from the compiler. (the same trick is used in layout.C)
8390 (write): new function. opens a ofstream and pass that to output
8391 (output): new function, takes a ostream and writes the lyxrc
8392 elemts to it. uses a dummy switch to make sure no elements are
8395 * src/lyxlex.h: added a struct pushpophelper for use in functions
8396 with more than one exit point.
8398 * src/lyxlex.[Ch] (GetInteger): made it const
8402 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
8404 * src/layout.[hC] : LayoutTags splitted into several enums, new
8405 methods created, better error handling cleaner use of lyxlex. Read
8408 * src/bmtable.[Ch]: change some member prototypes because of the
8409 image const changes.
8411 * commandtags.h, src/LyXAction.C (init): new function:
8412 "preferences-save", saves the lyxrc entries into .lyx/preferences.
8413 This file is not read automatically but you can add \input
8414 preferences to your lyxrc if you want to. We need to discuss how
8417 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
8418 in .aux, also remove .bib and .bst files from dependencies when
8421 * src/BufferView.C, src/LyXView.C: add const_cast several places
8422 because of changes to images.
8424 * lib/images/*: same change as for images/*
8426 * lib/lyxrc.example: Default for accept_compound is false not no.
8428 * images/*: changed to be const, however I have som misgivings
8429 about this change so it might be changed back.
8431 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8433 * lib/configure, po/POTFILES.in: regenerated
8435 * autogen.sh: autogenerate lib/configure from lib/configure.m4
8437 * config/lib_configure.m4: removed
8439 * lib/configure.m4: new file (was config/lib_configure.m4)
8441 * configure.in: do not test for rtti, since we do not use it.
8443 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8445 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
8446 doubling of allocated space scheme. This makes it faster for large
8447 strings end to use less memory for small strings. xtra rememoved.
8449 * src/insets/figinset.C (waitalarm): commented out.
8450 (GhostscriptMsg): use static_cast
8451 (GhostscriptMsg): use new instead of malloc to allocate memory for
8452 cmap. also delete the memory after use.
8454 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
8456 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
8457 for changes in bibtex database or style.
8458 (runBibTeX): remove all .bib and .bst files from dep before we
8460 (run): use scanAuc in when dep file already exist.
8462 * src/DepTable.C (remove_files_with_extension): new method
8465 * src/DepTable.[Ch]: made many of the methods const.
8467 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8469 * src/bufferparams.C: make sure that the default textclass is
8470 "article". It used to be the first one by description order, but
8471 now the first one is "docbook".
8473 * src/lyx_main.C (setDebuggingLevel): change type of argument to
8474 string; call Debug::value.
8475 (easyParse): pass complete argument to setDebuggingLevel().
8477 * src/debug.h (value): fix the code that parses debug levels.
8479 * src/debug.h: add new debug type ACTION, reserved for LyXAction
8482 * src/LyXAction.C: use Debug::ACTION as debug channel.
8484 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
8486 * NEWS: updated for the future 1.1.3 release.
8488 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
8489 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
8490 it should. This is of course a controversial change (since many
8491 people will find that their lyx workscreen is suddenly full of
8492 red), but done for the sake of correctness.
8494 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
8495 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
8497 * src/insets/inseterror.h, src/insets/inseturl.h,
8498 src/insets/insetinfo.h, src/insets/figinset.h,
8499 src/mathed/formulamacro.h, src/mathed/math_macro.h
8500 (EditMessage): add a missing const and add _() to make sure that
8503 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
8504 src/insets/insetbib.C, src/support/filetools.C: add `using'
8507 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
8508 doing 'Insert index of last word' at the beginning of a paragraph.
8510 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8512 * several files: white-space changes.
8514 * src/mathed/formula.C: removed IsAlpha and IsDigit
8516 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
8517 .bib file. use a ifstream instead of FilePtr when parsing the .bib
8520 * src/insets/figinset.C (GetPSSizes): don't break when
8521 "EndComments" is seen. But break when a boundingbox is read.
8523 * all classes inherited from Inset: return value of Clone
8524 changed back to Inset *.
8526 * all classes inherited form MathInset: return value of Clone
8527 changed back to MathedInset *.
8529 * src/insets/figinset.C (runqueue): use a ofstream to output the
8530 gs/ps file. Might need some setpresicion or setw. However I can
8531 see no problem with the current code.
8532 (runqueue): use sleep instead of the alarm/signal code. I just
8533 can't see the difference.
8535 * src/paragraph.C (LyXParagraph): reserve space in the new
8536 paragraph and resize the inserted paragraph to just fit.
8538 * src/lyxfunc.h (operator|=): added operator for func_status.
8540 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
8541 check for readable file.
8543 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
8544 check for readable file.
8545 (MenuMakeLinuxDoc): ditto
8546 (MenuMakeDocBook): ditto
8547 (MenuMakeAscii): ditto
8548 (InsertAsciiFile): split the test for openable and readable
8550 * src/bmtable.C (draw_bitmaptable): use
8551 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
8553 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
8554 findtexfile from LaTeX to filetools.
8556 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
8557 instead of FilePtr. Needs to be verified by a literate user.
8559 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8561 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
8562 (EditMessage): likewise.
8564 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
8565 respectively as \textasciitilde and \textasciicircum.
8567 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8569 * src/support/lyxstring.h: made the methods that take iterators
8572 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
8573 (regexMatch): made is use the real regex class.
8575 * src/support/Makefile.am: changed to use libtool
8577 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
8579 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
8581 (MathIsInset ++): changed several macros to be inline functions
8584 * src/mathed/Makefile.am: changed to use libtool
8586 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
8588 * src/insets/inset* : Clone changed to const and return type is
8589 the true insettype not just Inset*.
8591 * src/insets/Makefile.am: changed to use libtool
8593 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
8595 * src/undo.[Ch] : added empty() and changed some of the method
8598 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
8600 * src/lyxparagraph.h: use id() and id(...) instead of getID and
8601 setID use block<> for the bullets array, added const several places.
8603 * src/lyxfunc.C (getStatus): new function
8605 * src/lyxfunc.[Ch] : small changes to take advantage of the new
8606 LyXAction, added const to several funtions.
8608 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
8609 a std::map, and to store the dir items in a vector.
8611 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
8614 * src/LyXView.[Ch] + other files : changed currentView to view.
8616 * src/LyXAction.[Ch] : ported from the old devel branch.
8618 * src/.cvsignore: added .libs and a.out
8620 * configure.in : changes to use libtool.
8622 * acinclude.m4 : inserted libtool.m4
8624 * .cvsignore: added libtool
8626 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8628 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
8629 file name in insets and mathed directories (otherwise the
8630 dependency is not taken in account under cygwin).
8632 * src/text2.C (InsertString[AB]): make sure that we do not try to
8633 read characters past the string length.
8635 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8637 * lib/doc/LaTeXConfig.lyx.in,
8638 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
8640 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
8641 file saying who created them and when this heppened; this is
8642 useless and annoys tools like cvs.
8644 * lib/layouts/g-brief-{en,de}.layout,
8645 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
8646 from Thomas Hartkens <thomas@hartkens.de>.
8648 * src/{insets,mathed}/Makefile.am: do not declare an empty
8649 LDFLAGS, so that it can be set at configure time (useful on Irix
8652 * lib/reLyX/configure.in: make sure that the prefix is set
8653 correctly in LYX_DIR.
8655 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8657 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
8658 be used by 'command-sequence' this allows to bind a key to a
8659 sequence of LyX-commands
8660 (Example: 'command-sequence math-insert alpha; math-insert beta;")
8662 * src/LyXAction.C: add "command-sequence"
8664 * src/LyXFunction.C: handling of "command-sequence"
8666 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
8667 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
8669 * src/lyxserver.C, src/minibuffer.C: Use this new interface
8671 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8673 * src/buffer.C (writeFile): Do not output a comment giving user
8674 and date at the beginning of a .lyx file. This is useless and
8675 annoys cvs anyway; update version number to 1.1.
8677 * src/Makefile.am (LYX_DIR): add this definition, so that a
8678 default path is hardcoded in LyX.
8680 * configure.in: Use LYX_GNU_GETTEXT.
8682 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
8683 AM_GNU_GETTEXT with a bug fixed.
8685 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
8687 * src/chset.C: add "using std::ifstream;" to please dec cxx.
8689 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
8690 which is used to point to LyX data is now LYX_DIR_11x.
8692 * lyx.man: convert to a unix text file; small updates.
8694 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8696 * src/support/LSubstring.[Ch]: made the second arg of most of the
8697 constructors be a const reference.
8699 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
8702 * src/support/lyxstring.[Ch] (swap): added missing member function
8703 and specialization of swap(str, str);
8705 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
8707 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
8708 trace of the old one.
8710 * src/undo.[Ch]: made the undostack use std::list to store undo's in
8711 put the member definitions in undo.C.
8713 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
8714 NEW_TEXT and have now only code that was included when this was
8717 * src/intl.C (LCombo): use static_cast
8719 (DispatchCallback): ditto
8721 * src/definitions.h: removed whole file
8723 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
8725 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
8726 parsing and stores in a std:map. a regex defines the file format.
8727 removed unneeded members.
8729 * src/bufferparams.h: added several enums from definitions.h here.
8730 Removed unsused destructor. Changed some types to use proper enum
8731 types. use block to have the temp_bullets and user_defined_bullets
8732 and to make the whole class assignable.
8734 * src/bufferparams.C (Copy): removed this functions, use a default
8737 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
8740 * src/buffer.C (readLyXformat2): commend out all that have with
8741 oldpapersize to do. also comment out all that hve to do with
8742 insetlatex and insetlatexdel.
8743 (setOldPaperStuff): commented out
8745 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
8747 * src/LyXAction.C: remove use of inset-latex-insert
8749 * src/mathed/math_panel.C (button_cb): use static_cast
8751 * src/insets/Makefile.am (insets_o_SOURCES): removed
8754 * src/support/lyxstring.C (helper): use the unsigned long
8755 specifier, UL, instead of a static_cast.
8757 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
8759 * src/support/block.h: new file. to be used as a c-style array in
8760 classes, so that the class can be assignable.
8762 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8764 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
8765 NULL, make sure to return an empty string (it is not possible to
8766 set a string to NULL).
8768 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8770 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
8772 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
8774 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
8775 link line, so that Irix users (for example) can set it explicitely to
8778 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
8779 it can be overidden at make time (static or dynamic link, for
8782 * src/vc-backend.C, src/LaTeXFeatures.h,
8783 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
8784 statements to bring templates to global namespace.
8786 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8788 * src/support/lyxstring.C (operator[] const): make it standard
8791 * src/minibuffer.C (Init): changed to reflect that more
8792 information is given from the lyxvc and need not be provided here.
8794 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
8796 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
8798 * src/LyXView.C (UpdateTimerCB): use static_cast
8799 (KeyPressMask_raw_callback): ditto
8801 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
8802 buffer_, a lot of changes because of this. currentBuffer() ->
8803 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
8804 also changes to other files because of this.
8806 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8808 * src/vc-backend.[Ch]: new files. The backends for vc handling,
8809 have no support for RCS and partial support for CVS, will be
8812 * src/insets/ several files: changes because of function name
8813 changes in Bufferview and LyXView.
8815 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
8817 * src/support/LSubstring.[Ch]: new files. These implement a
8818 Substring that can be very convenient to use. i.e. is this
8820 string a = "Mary had a little sheep";
8821 Substring(a, "sheep") = "lamb";
8822 a is now "Mary has a little lamb".
8824 * src/support/LRegex.[Ch]: a regex class that can be used to pick
8825 out patterns and subpatterns of strings. It is used by LSubstring
8826 and also by vc-backend.C
8828 * src/support/lyxstring.C: went over all the assertions used and
8829 tried to correct the wrong ones and flag which of them is required
8830 by the standard. some bugs found because of this. Also removed a
8831 couple of assertions.
8833 * src/support/Makefile.am (libsupport_a_SOURCES): added
8834 LSubstring.[Ch] and LRegex.[Ch]
8836 * src/support/FileInfo.h: have struct stat buf as an object and
8837 not a pointer to one, some changes because of this.
8839 * src/LaTeXFeatures.C (getTClassPreamble): also use the
8840 information in layout when adding the layouts preamble to the
8843 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
8846 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
8847 because of bug in OS/2.
8849 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8851 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
8852 \verbatim@font instead of \ttfamily, so that it can be redefined.
8854 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
8855 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
8856 src/layout.h, src/text2.C: add 'using' directive to bring the
8857 STL templates we need from the std:: namespace to the global one.
8858 Needed by DEC cxx in strict ansi mode.
8860 * src/support/LIstream.h,src/support/LOstream.h,
8861 src/support/lyxstring.h,src/table.h,
8862 src/lyxlookup.h: do not include <config.h> in header
8863 files. This should be done in the .C files only.
8865 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
8869 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8871 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
8872 from Kayvan to fix the tth invokation.
8874 * development/lyx.spec.in: updates from Kayvan to reflect the
8875 changes of file names.
8877 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8879 * src/text2.C (InsertStringB): use std::copy
8880 (InsertStringA): use std::copy
8882 * src/bufferlist.C: use a vector to store the buffers in. This is
8883 an internal change and should not affect any other thing.
8885 * src/BufferView.C (waitForX): use XSync instead of the lengthy
8888 * src/text.C (Fill): fix potential bug, one off bug.
8890 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8892 * src/Makefile.am (lyx_main.o): add more files it depends on.
8894 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
8896 * src/support/lyxstring.C: use size_t for the reference count,
8897 size, reserved memory and xtra.
8898 (internal_compare): new private member function. Now the compare
8899 functions should work for std::strings that have embedded '\0'
8901 (compare): all compare functions rewritten to use
8904 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8906 * src/support/lyxstring.C (compare): pass c_str()
8907 (compare): pass c_str
8908 (compare): pass c_str
8910 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8912 * src/support/DebugStream.C: <config.h> was not included correctly.
8914 * lib/configure: forgot to re-generate it :( I'll make this file
8915 auto generated soon.
8917 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8919 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
8922 * src/support/lyxstring.C: some changes from length() to rep->sz.
8923 avoids a function call.
8925 * src/support/filetools.C (SpaceLess): yet another version of the
8926 algorithm...now per Jean-Marc's suggestions.
8928 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8930 * src/layout.C (less_textclass_desc): functor for use in sorting
8932 (LyXTextClass::Read): sort the textclasses after reading.
8934 * src/support/filetools.C (SpaceLess): new version of the
8935 SpaceLess functions. What problems does this one give? Please
8938 * images/banner_bw.xbm: made the arrays unsigned char *
8940 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8942 * src/support/lyxstring.C (find): remove bogus assertion in the
8943 two versions of find where this has not been done yet.
8945 * src/support/lyxlib.h: add missing int return type to
8948 * src/menus.C (ShowFileMenu): disable exporting to html if no
8949 html export command is present.
8951 * config/lib_configure.m4: add a test for an HTML converter. The
8952 programs checked for are, in this order: tth, latex2html and
8955 * lib/configure: generated from config/lib_configure.m4.
8957 * src/lyxfunc.C (Dispatch): update and improve the execution of an
8958 html converter. The parameters are now passed through $$FName and
8959 $$OutName, instead of standard input/output.
8961 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
8963 * lib/lyxrc.example: update description of \html_command.
8964 add "quotes" around \screen_font_xxx font setting examples to help
8965 people who use fonts with spaces in their names.
8967 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8969 * Distribution files: updates for v1.1.2
8971 * src/support/lyxstring.C (find): remove bogus assert and return
8972 npos for the same condition.
8974 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8976 * added patch for OS/2 from SMiyata.
8978 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8980 * src/text2.C (CutSelection): make space_wrapped a bool
8981 (CutSelection): dont declare int i until we have to.
8982 (alphaCounter): return a char const *.
8984 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8986 * src/support/syscall.C (Systemcalls::kill):
8987 src/support/filetools.C (PutEnv, PutEnvPath):
8988 src/lyx_cb.C (addNewlineAndDepth):
8989 src/FontInfo.C (FontInfo::resize): condition some #warning
8990 directives with WITH_WARNINGS.
8993 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8995 * src/layout.[Ch] + several files: access to class variables
8996 limited and made accessor functions instead a lot of code changed
8997 becuase of this. Also instead of returning pointers often a const
8998 reference is returned instead.
9000 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
9002 * src/Makefile.am (dist-hook): added used to remove the CVS from
9003 cheaders upon creating a dist
9004 (EXTRA_DIST): added cheaders
9006 * src/support/lstrings.C (tostr(char)): fix it to handle param as
9007 a character not as a small integer.
9009 * src/support/lyxstring.C (find): removed Assert and added i >=
9010 rep->sz to the first if.
9012 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9014 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
9015 src/LyXView.C src/buffer.C src/bufferparams.C
9016 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
9017 src/text2.C src/insets/insetinclude.C:
9018 lyxlayout renamed to textclasslist.
9020 * src/layout.C: some lyxerr changes.
9022 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
9023 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
9024 (LyXLayoutList): removed all traces of this class.
9025 (LyXTextClass::Read): rewrote LT_STYLE
9026 (LyXTextClass::hasLayout): new function
9027 (LyXTextClass::GetLayout): rewritten to return an iterator + has
9028 both const and nonconst version.
9029 (LyXTextClass::delete_layout): new function.
9030 (LyXTextClassList::Style): bug fix. do the right thing if layout
9032 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
9033 (LyXTextClassList::NameOfLayout): ditto
9034 (LyXTextClassList::Load): ditto
9036 * src/buffer.C (makeLaTeXFile): new access to layoutlist
9038 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
9040 * src/LyXAction.C (LookupFunc): added a workaround for sun
9041 compiler, on the other hand...we don't know if the current code
9042 compiles on sun at all...
9044 * src/support/filetools.C (CleanupPath): subst fix
9046 * src/insets/insetbib.C (delDatabase): subst fix, this looks
9049 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
9050 complained about this one?
9052 * src/insets/insetinclude.C (Latex): subst fix
9054 * src/insets/insetbib.C (getKeys): subst fix
9056 * src/LyXSendto.C (SendtoApplyCB): subst fix
9058 * src/lyx_main.C (init): subst fix
9060 * src/layout.C (Read): subst fix
9062 * src/lyx_sendfax_main.C (button_send): subst fix
9064 * src/buffer.C (RoffAsciiTable): subst fix
9066 * src/lyx_cb.C (MenuFax): subst fix
9067 (PrintApplyCB): subst fix
9069 1999-10-26 Juergen Vigna <jug@sad.it>
9071 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
9073 (Read): Cleaned up this code so now we read only format vestion >= 5
9075 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9077 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
9078 come nobody has complained about this one?
9080 * src/insets/insetinclude.C (Latex): subst fix
9082 * src/insets/insetbib.C (getKeys): subst fix
9084 * src/lyx_main.C (init): subst fix
9086 * src/layout.C (Read): subst fix
9088 * src/buffer.C (RoffAsciiTable): subst fix
9090 * src/lyx_cb.C (MenuFax): subst fix.
9092 * src/layout.[hC] + some other files: rewrote to use
9093 std::container to store textclasses and layouts in.
9094 Simplified, removed a lot of code. Make all classes
9095 assignable. Further simplifications and review of type
9096 use still to be one.
9098 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
9099 lastfiles to create the lastfiles partr of the menu.
9101 * src/lastfiles.[Ch]: rewritten to use deque to store the
9102 lastfiles in. Uses fstream for reading and writing. Simplifies
9105 * src/support/syscall.C: remove explicit cast.
9107 * src/BufferView.C (CursorToggleCB): removed code snippets that
9109 use explicat C++ style casts instead of C style casts. also use
9110 u_vdata instea of passing pointers in longs.
9112 * src/PaperLayout.C: removed code snippets that were commented out.
9114 * src/lyx_gui_misc.C: removed code snippets that were commented out.
9116 * src/lyx_main.C: removed code snippets that wer commented out.
9118 * src/paragraph.C: removed code snippets that were commented out.
9120 * src/lyxvc.C (logClose): use static_cast
9122 (viewLog): remove explicit cast to void*
9123 (showLog): removed old commented code
9125 * src/menus.C: use static_cast instead of C style casts. use
9126 u_vdata instead of u_ldata. remove explicit cast to (long) for
9127 pointers. Removed old code that was commented out.
9129 * src/insets/inset.C: removed old commented func
9131 * src/insets/insetref.C (InsetRef): removed old code that had been
9132 commented out for a long time.
9134 (escape): removed C style cast
9136 * src/insets/insetlatexaccent.C (Draw): removed old commented code
9138 * src/insets/insetlatex.C (Draw): removed old commented code
9139 (Read): rewritten to use string
9141 * src/insets/insetlabel.C (escape): removed C style cast
9143 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
9145 * src/insets/insetindex.C: use static_cast and u_vdata, removed
9148 * src/insets/insetinclude.h: removed a couple of stupid bools
9150 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
9151 (Clone): remove C style cast
9152 (getKeys): changed list to lst because of std::list
9154 * src/insets/inseterror.C (Draw): removed som old commented code.
9156 * src/insets/insetcommand.C (Draw): removed some old commented code.
9158 * src/insets/insetbib.C (bibitem_cb): removed code that has been
9159 commented out forever.
9160 (bibitem_cb): use static_cast instead of C style cast
9161 use of vdata changed to u_vdata.
9163 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
9165 (CloseUrlCB): use static_cast instead of C style cast.
9166 (CloseUrlCB): added a fl_free form...it seemed to be missing.
9168 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
9169 (C_InsetInfo_CloseInfoCB): forward the ob parameter
9170 (CloseInfoCB): static_cast from ob->u_vdata instead.
9171 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
9174 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
9175 (C_InsetError_CloseErrorCB): forward the ob parameter
9176 (CloseErrorCB): static_cast from ob->u_vdata instead.
9178 * src/vspace.h: include LString.h since we use string in this class.
9180 * src/vspace.C (lyx_advance): changed name from advance because of
9181 nameclash with stl. And since we cannot use namespaces yet...I
9182 used a lyx_ prefix instead. Expect this to change when we begin
9185 * src/BufferView.[Ch] (BufferView::~BufferView): removed
9187 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
9188 and removed now defunct constructor and deconstructor.
9190 * src/BufferView.h: have backstack as a object not as a pointer.
9191 removed initialization from constructor. added include for BackStack
9193 * development/lyx.spec.in (%build): add CFLAGS also.
9195 * src/screen.C (drawFrame): removed another warning.
9197 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9199 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
9200 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
9201 README and ANNOUNCE a bit for the next release. More work is
9204 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
9205 unbreakable if we are in freespacing mode (LyX-Code), but not in
9208 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9210 * src/BackStack.h: fixed initialization order in constructor
9212 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
9214 * acinclude.m4 (VERSION): new rules for when a version is
9215 development, added also a variable for prerelease.
9216 (warnings): we set with_warnings=yes for prereleases
9217 (lyx_opt): prereleases compile with same optimization as development
9218 (CXXFLAGS): only use pedantic if we are a development version
9220 * src/BufferView.C (restorePosition): don't do anything if the
9223 * src/BackStack.h: added member empty, use this to test if there
9224 is anything to pop...
9226 1999-10-25 Juergen Vigna <jug@sad.it>
9229 * forms/layout_forms.fd +
9230 * forms/latexoptions.fd +
9231 * lyx.fd: changed for various form resize issues
9233 * src/mathed/math_panel.C +
9234 * src/insets/inseterror.C +
9235 * src/insets/insetinfo.C +
9236 * src/insets/inseturl.C +
9237 * src/insets/inseturl.h +
9240 * src/PaperLayout.C +
9241 * src/ParagraphExtra.C +
9242 * src/TableLayout.C +
9244 * src/layout_forms.C +
9251 * src/menus.C: fixed various resize issues. So now forms can be
9252 resized savely or not be resized at all.
9254 * forms/form_url.fd +
9255 * src/insets/form_url.[Ch]: added because it's cleaner and easier
9258 * src/insets/Makefile.am: added files form_url.[Ch]
9260 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9262 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
9263 (and presumably 6.2).
9265 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
9266 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
9267 remaining static member callbacks.
9269 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
9272 * src/support/lyxstring.h: declare struct Srep as friend of
9273 lyxstring, since DEC cxx complains otherwise.
9275 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9277 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9279 * src/LaTeX.C (run): made run_bibtex also depend on files with
9281 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
9282 are put into the dependency file.
9284 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
9285 the code has shown itself to work
9286 (create_ispell_pipe): removed another warning, added a comment
9289 * src/minibuffer.C (ExecutingCB): removed code that has been
9290 commented out a long time
9292 * src/lyxfunc.C (processKeyEvent): removed some very old commented
9293 out code + a warning.
9295 * src/support/lyxstring.h: comment out the three private
9296 operators, when compiling with string ansi conforming compilers
9299 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
9301 (pixmapFromBitmapData): change type of bdata to be unsigned char *
9302 (pixmapFromBitmapData): add a reinterpret_cast in the call to
9305 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
9308 * src/mathed/math_panel.C (create_math_panel): remove explicit
9311 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
9314 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
9315 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
9316 to XCreatePixmapFromBitmapData
9317 (fl_set_bmtable_data): change the last argument to be unsigned
9319 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
9320 and bh to be unsigned int, remove explicit casts in call to
9321 XReadBitmapFileData.
9323 * images/arrows.xbm: made the arrays unsigned char *
9324 * images/varsz.xbm: ditto
9325 * images/misc.xbm: ditto
9326 * images/greek.xbm: ditto
9327 * images/dots.xbm: ditto
9328 * images/brel.xbm: ditto
9329 * images/bop.xbm: ditto
9331 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
9333 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
9334 (LYX_PROG_CXX): added -pedantic to g++ compile options when
9335 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
9337 (LYX_CXX_CHEADERS): added <clocale> to the test.
9339 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
9341 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
9343 * src/support/lyxstring.C (append): fixed something that must be a
9344 bug, rep->assign was used instead of rep->append.
9346 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
9349 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
9350 lyx insert double chars. Fix spotted by Kayvan.
9352 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9354 * Fixed the tth support. I messed up with the Emacs patch apply feature
9355 and omitted the changes in lyxrc.C.
9357 1999-10-22 Juergen Vigna <jug@sad.it>
9359 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
9361 * src/lyx_cb.C (MenuInsertRef) +
9362 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
9363 the form cannot be resized under it limits (fixes a segfault)
9365 * src/lyx.C (create_form_form_ref) +
9366 * forms/lyx.fd: Changed Gravity on name input field so that it is
9369 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9371 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
9372 <ostream> and <istream>.
9374 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
9375 whether <fstream> provides the latest standard features, or if we
9376 have an oldstyle library (like in egcs).
9377 (LYX_CXX_STL_STRING): fix the test.
9379 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
9380 code on MODERN_STL_STREAM.
9382 * src/support/lyxstring.h: use L{I,O}stream.h.
9384 * src/support/L{I,O}stream.h: new files, designed to setup
9385 correctly streams for our use
9386 - includes the right header depending on STL capabilities
9387 - puts std::ostream and std::endl (for LOStream.h) or
9388 std::istream (LIStream.h) in toplevel namespace.
9390 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9392 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
9393 was a bib file that had been changed we ensure that bibtex is run.
9394 (runBibTeX): enhanced to extract the names of the bib files and
9395 getting their absolute path and enter them into the dep file.
9396 (findtexfile): static func that is used to look for tex-files,
9397 checks for absolute patchs and tries also with kpsewhich.
9398 Alternative ways of finding the correct files are wanted. Will
9400 (do_popen): function that runs a command using popen and returns
9401 the whole output of that command in a string. Should be moved to
9404 * src/DepTable.[Ch] (extchanged): new function that returns true if a
9405 file with extension ext has changed.
9407 * src/insets/figinset.C: added ifdef guards around the fl_free
9408 code that jug commented out. Now it is commented out when
9409 compiling with XForms == 0.89.
9411 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
9412 to lyxstring.C, and only keep a forward declaration in
9413 lyxstring.h. Simplifies the header file a bit and should help a
9414 bit on compile time too. Also changes to Srep will not mandate a
9415 recompile of code just using string.
9416 (~lyxstring): definition moved here since it uses srep.
9417 (size): definition moved here since it uses srep.
9419 * src/support/lyxstring.h: removed a couple of "inline" that should
9422 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9424 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
9427 1999-10-21 Juergen Vigna <jug@sad.it>
9429 * src/table.C (SetPWidth): Just a small fix so the alignment is not
9430 set to left if I just remove the width entry (or it is empty).
9432 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
9433 paragraph when having dummy paragraphs.
9435 1999-10-20 Juergen Vigna <jug@sad.it>
9437 * src/insets/figinset.C: just commented some fl_free_form calls
9438 and added warnings so that this calls should be activated later
9439 again. This avoids for now a segfault, but we have a memory leak!
9441 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
9442 'const char * argument' to 'string argument', this should
9443 fix some Asserts() in lyxstring.C.
9445 * src/lyxfunc.h: Removed the function argAsString(const char *)
9446 as it is not used anymore.
9448 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9450 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
9453 * src/Literate.h: some funcs moved from public to private to make
9454 interface clearer. Unneeded args removed.
9456 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
9458 (scanBuildLogFile): ditto
9460 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
9461 normal TeX Error. Still room for improvement.
9463 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
9465 * src/buffer.C (insertErrors): changes to make the error
9466 desctription show properly.
9468 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
9471 * src/support/lyxstring.C (helper): changed to use
9472 sizeof(object->rep->ref).
9473 (operator>>): changed to use a pointer instead.
9475 * src/support/lyxstring.h: changed const reference & to value_type
9476 const & lets see if that helps.
9478 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9480 * Makefile.am (rpmdist): fixed to have non static package and
9483 * src/support/lyxstring.C: removed the compilation guards
9485 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
9488 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
9489 conditional compile of lyxstring.Ch
9491 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
9492 stupid check, but it is a lot better than the bastring hack.
9493 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
9495 * several files: changed string::erase into string::clear. Not
9498 * src/chset.C (encodeString): use a char temporary instead
9500 * src/table.C (TexEndOfCell): added tostr around
9501 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
9502 (TexEndOfCell): ditto
9503 (TexEndOfCell): ditto
9504 (TexEndOfCell): ditto
9505 (DocBookEndOfCell): ditto
9506 (DocBookEndOfCell): ditto
9507 (DocBookEndOfCell): ditto
9508 (DocBookEndOfCell): ditto
9510 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
9512 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
9514 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
9515 (MenuBuildProg): added tostr around ret
9516 (MenuRunChktex): added tostr around ret
9517 (DocumentApplyCB): added tostr around ret
9519 * src/chset.C (encodeString): added tostr around t->ic
9521 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
9522 (makeLaTeXFile): added tostr around tocdepth
9523 (makeLaTeXFile): added tostr around ftcound - 1
9525 * src/insets/insetbib.C (setCounter): added tostr around counter.
9527 * src/support/lyxstring.h: added an operator+=(int) to catch more
9530 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
9531 (lyxstring): We DON'T allow NULL pointers.
9533 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9535 * src/mathed/math_macro.C (MathMacroArgument::Write,
9536 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
9537 when writing them out.
9539 * src/LString.C: remove, since it is not used anymore.
9541 * src/support/lyxstring.C: condition the content to
9542 USE_INCLUDED_STRING macro.
9544 * src/mathed/math_symbols.C, src/support/lstrings.C,
9545 src/support/lyxstring.C: add `using' directive to specify what
9546 we need in <algorithm>. I do not think that we need to
9547 conditionalize this, but any thought is appreciated.
9549 * many files: change all callback functions to "C" linkage
9550 functions to please strict C++ compilers like DEC cxx 6.1 in mode
9551 strict_ansi. Those who were static are now global.
9552 The case of callbacks which are static class members is
9553 trickier, since we have to make C wrappers around them (see
9554 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
9555 did not finish this yet, since it defeats the purpose of
9556 encapsulation, and I am not sure what the best route is.
9558 1999-10-19 Juergen Vigna <jug@sad.it>
9560 * src/support/lyxstring.C (lyxstring): we permit to have a null
9561 pointer as assignment value and just don't assign it.
9563 * src/vspace.C (nextToken): corrected this function substituting
9564 find_first(_not)_of with find_last_of.
9566 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
9567 (TableOptCloseCB) (TableSpeCloseCB):
9568 inserted fl_set_focus call for problem with fl_hide_form() in
9571 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9573 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
9576 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9578 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
9579 LyXLex::next() and not eatline() to get its argument.
9581 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9583 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
9584 instead, use fstreams for io of the depfile, removed unneeded
9585 functions and variables.
9587 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
9588 vector instead, removed all functions and variables that is not in
9591 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9593 * src/buffer.C (insertErrors): use new interface to TeXError
9595 * Makefile.am (rpmdist): added a rpmdist target
9597 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
9598 per Kayvan's instructions.
9600 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9602 * src/Makefile.am: add a definition for localedir, so that locales
9603 are found after installation (Kayvan)
9605 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9607 * development/.cvsignore: new file.
9609 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9611 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
9612 C++ compiler provides wrappers for C headers and use our alternate
9615 * configure.in: use LYX_CXX_CHEADERS.
9617 * src/cheader/: new directory, populated with cname headers from
9618 libstdc++-2.8.1. They are a bit old, but probably good enough for
9619 what we want (support compilers who lack them).
9621 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
9622 from includes. It turns out is was stupid.
9624 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9626 * lib/Makefile.am (install-data-local): forgot a ';'
9627 (install-data-local): forgot a '\'
9628 (libinstalldirs): needed after all. reintroduced.
9630 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9632 * configure.in (AC_OUTPUT): added lyx.spec
9634 * development/lyx.spec: removed file
9636 * development/lyx.spec.in: new file
9638 * po/*.po: merged with lyx.pot becuase of make distcheck
9640 * lib/Makefile.am (dist-hook): added dist-hook so that
9641 documentation files will be included when doing a make
9642 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
9643 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
9645 more: tried to make install do the right thing, exclude CVS dirs
9648 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
9649 Path would fit in more nicely.
9651 * all files that used to use pathstack: uses now Path instead.
9652 This change was a lot easier than expected.
9654 * src/support/path.h: new file
9656 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
9658 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
9660 * src/support/lyxstring.C (getline): Default arg was given for
9663 * Configure.cmd: removed file
9665 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9667 * src/support/DebugStream.[Ch]: remove the explicit std:: before
9668 streams classes and types, add the proper 'using' statements when
9669 MODERN_STL is defined.
9671 * src/debug.h: move the << operator definition after the inclusion
9674 * src/support/filetools.C: include "LAssert.h", which is needed
9677 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
9680 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
9681 include "debug.h" to define a proper ostream.
9683 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9685 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
9686 method to the SystemCall class which can kill a process, but it's
9687 not fully implemented yet.
9689 * src/*.C: Changed Systemcalls::Startscript() to startscript()
9691 * src/support/FileInfo.h: Better documentation
9693 * src/lyxfunc.C: Added support for buffer-export html
9695 * src/menus.C: Added Export->As HTML...
9697 * lib/bind/*.bind: Added short-cut for buffer-export html
9699 * src/lyxrc.*: Added support for new \tth_command
9701 * lib/lyxrc.example: Added stuff for new \tth_command
9703 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9705 * lib/Makefile.am (IMAGES): removed images/README
9706 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
9707 installes in correct place. Check permisions is installed
9710 * src/LaTeX.C: some no-op changes moved declaration of some
9713 * src/LaTeX.h (LATEX_H): changed include guard name
9715 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9717 * lib/reLyX/Makefile.am: install noweb2lyx.
9719 * lib/Makefile.am: install configure.
9721 * lib/reLyX/configure.in: declare a config aux dir; set package
9722 name to lyx (not sure what the best solution is); generate noweb2lyx.
9724 * lib/layouts/egs.layout: fix the bibliography layout.
9726 1999-10-08 Jürgen Vigna <jug@sad.it>
9728 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
9729 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
9730 it returned without continuing to search the path.
9732 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9734 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
9735 also fixes a bug. It is not allowed to do tricks with std::strings
9736 like: string a("hei"); &a[e]; this will not give what you
9737 think... Any reason for the complexity in this func?
9739 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
9741 * Updated README and INSTALL a bit, mostly to check that my
9742 CVS rights are correctly set up.
9744 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9746 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
9747 does not allow '\0' chars but lyxstring and std::string does.
9749 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9751 * autogen.sh (AUTOCONF): let the autogen script create the
9752 POTFILES.in file too. POTFILES.in should perhaps now not be
9753 included in the cvs module.
9755 * some more files changed to use C++ includes instead of C ones.
9757 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
9759 (Reread): added tostr to nlink. buggy output otherwise.
9760 (Reread): added a string() around szMode when assigning to Buffer,
9761 without this I got a log of garbled info strings.
9763 * acconfig.h: commented out the PTR_AS_INT macros. They should not
9766 * I have added several ostream & operator<<(ostream &, some_type)
9767 functions. This has been done to avoid casting and warnings when
9768 outputting enums to lyxerr. This as thus eliminated a lot of
9769 explicit casts and has made the code clearer. Among the enums
9770 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
9771 mathed enums, some font enum the Debug::type enum.
9773 * src/support/lyxstring.h (clear): missing method. equivalent of
9776 * all files that contained "stderr": rewrote constructs that used
9777 stderr to use lyxerr instead. (except bmtable)
9779 * src/support/DebugStream.h (level): and the passed t with
9780 Debug::ANY to avoid spurious bits set.
9782 * src/debug.h (Debug::type value): made it accept strings of the
9785 * configure.in (Check for programs): Added a check for kpsewhich,
9786 the latex generation will use this later to better the dicovery of
9789 * src/BufferView.C (create_view): we don't need to cast this to
9790 (void*) that is done automatically.
9791 (WorkAreaButtonPress): removed some dead code.
9793 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9795 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
9796 is not overwritten when translated (David Sua'rez de Lis).
9798 * lib/CREDITS: Added David Sua'rez de Lis
9800 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
9802 * src/bufferparams.C (BufferParams): default input encoding is now
9805 * acinclude.m4 (cross_compiling): comment out macro
9806 LYX_GXX_STRENGTH_REDUCE.
9808 * acconfig.h: make sure that const is not defined (to empty) when
9809 we are compiling C++. Remove commented out code using SIZEOF_xx
9812 * configure.in : move the test for const and inline as late as
9813 possible so that these C tests do not interefere with C++ ones.
9814 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
9815 has not been proven.
9817 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9819 * src/table.C (getDocBookAlign): remove bad default value for
9822 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
9824 (ShowFileMenu2): ditto.
9826 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
9829 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9831 * Most files: finished the change from the old error code to use
9832 DebugStream for all lyxerr debugging. Only minor changes remain
9833 (e.g. the setting of debug levels using strings instead of number)
9835 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9837 * src/layout.C (Add): Changed to use compare_no_case instead of
9840 * src/FontInfo.C: changed loop variable type too string::size_type.
9842 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9844 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
9845 set ETAGS_ARGS to --c++
9847 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
9849 * src/table.C (DocBookEndOfCell): commented out two unused variables
9851 * src/paragraph.C: commented out four unused variables.
9853 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
9854 insed a if clause with type string::size_type.
9856 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
9859 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
9861 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
9862 variable, also changed loop to go from 0 to lenght + 1, instead of
9863 -1 to length. This should be correct.
9865 * src/LaTeX.C (scanError): use string::size_type as loop variable
9868 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
9869 (l.896) since y_tmp and row was not used anyway.
9871 * src/insets/insetref.C (escape): use string::size_type as loop
9874 * src/insets/insetquotes.C (Width): use string::size_type as loop
9876 (Draw): use string::size_type as loop variable type.
9878 * src/insets/insetlatexaccent.C (checkContents): use
9879 string::size_type as loop variable type.
9881 * src/insets/insetlabel.C (escape): use string::size_type as loop
9884 * src/insets/insetinfo.C: added an extern for current_view.
9886 * src/insets/insetcommand.C (scanCommand): use string::size_type
9887 as loop variable type.
9889 * most files: removed the RCS tags. With them we had to recompile
9890 a lot of files after a simple cvs commit. Also we have never used
9891 them for anything meaningful.
9893 * most files: tags-query-replace NULL 0. As adviced several plases
9894 we now use "0" instead of "NULL" in our code.
9896 * src/support/filetools.C (SpaceLess): use string::size_type as
9899 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9901 * src/paragraph.C: fixed up some more string stuff.
9903 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9905 * src/support/filetools.h: make modestr a std::string.
9907 * src/filetools.C (GetEnv): made ch really const.
9909 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
9910 made code that used these use max/min from <algorithm> instead.
9912 * changed several c library include files to their equivalent c++
9913 library include files. All is not changed yet.
9915 * created a support subdir in src, put lyxstring and lstrings
9916 there + the extra files atexit, fileblock, strerror. Created
9917 Makefile.am. edited configure.in and src/Makefile.am to use this
9918 new subdir. More files moved to support.
9920 * imported som of the functions from repository lyx, filetools
9922 * ran tags-query-replace on LString -> string, corrected the bogus
9923 cases. Tried to make use of lstrings.[hC], debugged a lot. There
9924 is still some errors in there. This is errors where too much or
9925 too litle get deleted from strings (string::erase, string::substr,
9926 string::replace), there can also be some off by one errors, or
9927 just plain wrong use of functions from lstrings. Viewing of quotes
9930 * LyX is now running fairly well with string, but there are
9931 certainly some bugs yet (see above) also string is quite different
9932 from LString among others in that it does not allow null pointers
9933 passed in and will abort if it gets any.
9935 * Added the revtex4 files I forgot when setting up the repository.
9937 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9939 * All over: Tried to clean everything up so that only the files
9940 that we really need are included in the cvs repository.
9941 * Switched to use automake.
9942 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
9943 * Install has not been checked.
9945 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9947 * po/pt.po: Three errors:
9948 l.533 and l.538 format specification error
9949 l. 402 duplicate entry, I just deleted it.