1 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
3 * src/frontends/kde/FormCitation.C: make the dialog
6 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
8 * config/kde.m4: fix consecutive ./configure runs,
9 look for qtarch, fix library order
11 * src/frontends/kde/Makefile.am: tidy up,
12 add Print dialog, add .dlg dependencies
14 * src/frontends/kde/FormPrint.C:
15 * src/frontends/kde/FormPrint.h:
16 * src/frontends/kde/formprintdialog.C:
17 * src/frontends/kde/formprintdialog.h:
18 * src/frontends/kde/formprintdialogdata.C:
19 * src/frontends/kde/formprintdialogdata.h:
20 * src/frontends/kde/dlg/formprintdialog.dlg: add
23 * src/frontends/kde/dlg/README: Added explanatory readme
25 * src/frontends/kde/dlg/checkinitorder.pl: small perl
26 script to double-check qtarch's output
28 * src/frontends/kde/formindexdialog.C:
29 * src/frontends/kde/formindexdialogdata.C:
30 * src/frontends/kde/formindexdialogdata.h:
31 * src/frontends/kde/dlg/formindexdialog.dlg: update
32 for qtarch, minor fixes
34 2000-10-05 Allan Rae <rae@lyx.org>
36 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
37 dialogs when switching buffers update them instead. It's up to each
38 dialog to decide if it should still be visible or not.
39 update() should return a bool to control visiblity within show().
40 Or perhaps better to set a member variable and use that to control
43 * lib/build-listerrors: create an empty "listerrors" file just to stop
44 make trying to regenerate it all the time if you don't have noweb
47 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
49 * po/Makefile.in.in (ext_l10n.h): added a rule to build
50 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
51 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
52 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
53 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
55 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
57 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
59 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
60 deleting buffer. Closes all buffer-dependent dialogs.
62 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
64 * src/frontends/xforms/FormCitation.[Ch]:
65 * src/frontends/xforms/FormPreferences.[Ch]:
66 * src/frontends/xforms/FormPrint.[Ch]:
67 * src/frontends/xforms/FormRef.[Ch]:
68 * src/frontends/xforms/FormUrl.[Ch]: ditto
70 * src/frontends/xforms/FormDocument.[Ch]:
71 * src/frontends/xforms/forms/form_document.C.patch:
72 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
73 pass through a single input() function.
75 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
77 * lib/build-listerrors: return status as OK
79 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
81 * lib/lyxrc.example: Updated to new export code
83 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
85 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
88 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
91 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
93 * lib/layouts/amsbook.layout: ditto.
95 * boost/Makefile.am: fix typo.
97 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
99 (add_lastfiles): removed.
100 (add_documents): removed.
101 (add_formats): removed.
103 * src/frontends/Menubar.C: remove useless "using" directive.
105 * src/MenuBackend.h: add a new MenuItem constructor.
107 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
110 2000-10-04 Allan Rae <rae@lyx.org>
112 * lib/Makefile.am (listerrors):
113 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
114 I haven't got notangle installed so Kayvan please test. The output
115 should end up in $builddir. This also allows people who don't have
116 noweb installed to complete the make process without error.
118 * src/frontends/xforms/FormCommand.[Ch] (showInset):
119 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
120 by JMarc's picky compiler.
122 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
125 * src/insets/insettabular.C (setPos): change for loop to not use
126 sequencing operator. Please check this Jürgen.
128 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
130 * src/insets/insetcite.C (getScreenLabel): ditto
131 * src/support/filetools.C (QuoteName): ditto
132 (ChangeExtension): ditto
134 * src/BufferView_pimpl.C (scrollCB): make heigt int
136 * src/BufferView2.C (insertInset): comment out unused arg
138 * boost/Makefile.am (EXTRADIST): new variable
140 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
142 * src/exporter.C (IsExportable): Fixed
144 * lib/configure.m4: Small fix
146 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
148 * src/insets/insetbutton.C (width): Changed to work with no GUI.
149 * src/insets/insetbib.C (bibitemWidest): ditto.
150 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
152 2000-10-03 Juergen Vigna <jug@sad.it>
154 * src/BufferView2.C (theLockingInset): removed const because of
155 Agnus's compile problems.
157 * src/insets/insettext.C (LocalDispatch): set the language of the
158 surronding paragraph on inserting the first character.
160 * various files: changed use of BufferView::the_locking_inset.
162 * src/BufferView2.C (theLockingInset):
163 (theLockingInset): new functions.
165 * src/BufferView.h: removed the_locking_inset.
167 * src/lyxtext.h: added the_locking_inset
169 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
171 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
173 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
175 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
176 * src/mathed/math_cursor.C (IsAlpha): ditto.
177 * src/mathed/math_inset.C (strnew): ditto.
178 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
179 (IMetrics): cxp set but never used; removed.
180 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
181 that the variable in question has been removed also!
184 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
185 using the Buffer * passed to Latex(), using the BufferView * passed to
186 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
188 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
189 Linuxdoc() and DocBook() rather than the stored Buffer * master.
191 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
192 * src/buffer.C (readInset): used new InsetBibtex c-tor
193 * (getBibkeyList): used new InsetBibtex::getKeys
195 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
198 * lib/build-listerrors
200 * src/exporter.C: Add literate programming support to the export code
203 * src/lyx_cb.C: Remove old literate code.
205 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
208 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
209 * src/converter.C (View, Convert): Use QuoteName.
211 * src/insets/figinset.C (Preview): Use Formats::View.
213 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
215 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
217 * src/lyxfunc.C (Dispatch): move declaration of text variable at
218 the top of the function, because compaq cxx complains that the
219 "goto exit_with_message" when the function is disabled bypasses
221 (MenuNew): try a better fix for the generation of new file names.
222 This time, I used AddName() instead of AddPath(), hoping Juergen
225 2000-10-03 Allan Rae <rae@lyx.org>
227 * src/frontends/xforms/forms/form_preferences.fd:
228 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
229 nested tabfolders has begun. The old "Miscellaneous" was renamed as
230 "Look and Feel"->"General" but will need to be split up further into
231 general output and general input tabs. Current plan is for four outer
232 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
233 stuff; "Inputs" for input and import configuration; "Outputs" for
234 output and export configuration; and one more whatever is left over
235 called "General". The leftovers at present look like being which
236 viewers to use, spellchecker, language support and might be better
237 named "Support". I've put "Paths" in "Inputs" for the moment as this
238 seems reasonable for now at least.
239 One problem remains: X error kills LyX when you close Preferences.
241 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
243 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
244 qualifier from form()
245 * src/frontends/xforms/FormCitation.[Ch]:
246 * src/frontends/xforms/FormCopyright.[Ch]:
247 * src/frontends/xforms/FormDocument.[Ch]:
248 * src/frontends/xforms/FormError.[Ch]:
249 * src/frontends/xforms/FormIndex.[Ch]:
250 * src/frontends/xforms/FormPreferences.[Ch]:
251 * src/frontends/xforms/FormPrint.[Ch]:
252 * src/frontends/xforms/FormRef.[Ch]:
253 * src/frontends/xforms/FormToc.[Ch]:
254 * src/frontends/xforms/FormUrl.[Ch]: ditto.
256 * src/frontends/xforms/FormCitation.[Ch]:
257 * src/frontends/xforms/FormIndex.[Ch]:
258 * src/frontends/xforms/FormRef.[Ch]:
259 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
260 with Allan's naming policy
262 * src/frontends/xforms/FormCitation.C: some static casts to remove
265 2000-10-02 Juergen Vigna <jug@sad.it>
267 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
268 now you can type or do stuff inside the table-cell also when in dummy
269 position, fixed visible cursor.
271 * src/insets/insettext.C (Edit): fixing cursor-view position.
273 * src/lyxfunc.C (Dispatch): use * text variable so that it can
274 be used for equal functions in lyxfunc and insettext.
276 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
278 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
280 * src/frontends/gnome/FormCitation.h:
281 * src/frontends/gnome/FormCopyright.h:
282 * src/frontends/gnome/FormIndex.h:
283 * src/frontends/gnome/FormPrint.h:
284 * src/frontends/gnome/FormToc.h:
285 * src/frontends/gnome/FormUrl.h:
286 * src/frontends/kde/FormCitation.h:
287 * src/frontends/kde/FormCopyright.h:
288 * src/frontends/kde/FormIndex.h:
289 * src/frontends/kde/FormRef.h:
290 * src/frontends/kde/FormToc.h:
291 * src/frontends/kde/FormUrl.h: fix remaining users of
294 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
296 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
298 (DocBookHandleCaption): ditto.
299 (DocBookHandleFootnote): ditto.
300 (SimpleDocBookOnePar): ditto.
302 * src/frontends/xforms/FormDocument.h (form): remove extra
303 FormDocument:: qualifier.
305 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
307 * sigc++/handle.h: ditto.
309 * src/lyx_gui_misc.C: add "using" directive.
311 * src/cheaders/cstddef: new file, needed by the boost library (for
314 2000-10-02 Juergen Vigna <jug@sad.it>
316 * src/insets/insettext.C (SetFont): better support.
318 * src/insets/insettabular.C (draw): fixed drawing of single cell.
320 * src/screen.C (DrawOneRow): some uint refixes!
322 2000-10-02 Allan Rae <rae@lyx.org>
324 * boost/.cvsignore: ignore Makefile as well
326 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
327 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
329 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
330 Left this one out by accident.
332 * src/frontends/xforms/FormBase.h (restore): default to calling
333 update() since that will restore the original/currently-applied values.
334 Any input() triggered error messages will require the derived classes
335 to redefine restore().
337 * src/frontends/xforms/FormDocument.C: initialize a few variables to
338 avoid a segfault. combo_doc_class is the main concern.
340 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
342 * Simplify build-listerrors in view of GUI-less export ability!
344 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
346 * src/lyx_main.C (easyParse): Disable gui when exporting
348 * src/insets/figinset.C:
352 * src/tabular.C: Changes to allow no-gui.
354 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
356 * src/support/utility.hpp: removed file
357 * src/support/block.h: removed file
359 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
362 * src/mathed/formula.C: add support/lyxlib.h
363 * src/mathed/formulamacro.C: ditto
365 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
366 * src/lyxparagraph.h: ditto
368 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
369 * src/frontends/Makefile.am (INCLUDES): ditto
370 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
371 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
372 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
373 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
374 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
375 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
377 * src/BufferView.h: use boost/utility.hpp
378 * src/LColor.h: ditto
380 * src/LyXAction.h: ditto
381 * src/LyXView.h: ditto
382 * src/bufferlist.h: ditto
383 * src/lastfiles.h: ditto
384 * src/layout.h: ditto
385 * src/lyx_gui.h: ditto
386 * src/lyx_main.h: ditto
387 * src/lyxlex.h: ditto
389 * src/frontends/ButtonPolicies.h: ditto
390 * src/frontends/Dialogs.h: ditto
391 * src/frontends/xforms/FormBase.h: ditto
392 * src/frontends/xforms/FormGraphics.h: ditto
393 * src/frontends/xforms/FormParagraph.h: ditto
394 * src/frontends/xforms/FormTabular.h: ditto
395 * src/graphics/GraphicsCache.h: ditto
396 * src/graphics/Renderer.h: ditto
397 * src/insets/ExternalTemplate.h: ditto
398 * src/insets/insetcommand.h: ditto
399 * src/support/path.h: ditto
401 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
402 and introduce clause for 2.97.
404 * boost/libs/README: new file
406 * boost/boost/utility.hpp: new file
408 * boost/boost/config.hpp: new file
410 * boost/boost/array.hpp: new file
412 * boost/Makefile.am: new file
414 * boost/.cvsignore: new file
416 * configure.in (AC_OUTPUT): add boost/Makefile
418 * Makefile.am (SUBDIRS): add boost
420 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
422 * src/support/lstrings.C (suffixIs): Fixed.
424 2000-10-01 Allan Rae <rae@lyx.org>
426 * src/PrinterParams.h: moved things around to avoid the "can't
427 inline call" warning.
429 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
430 into doc++ documentation.
432 * src/frontends/xforms/FormCommand.[Ch]: support button policy
434 * src/frontends/xforms/FormRef.C: make use of button controller
435 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
436 cleaned up button controller usage.
437 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
438 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
439 use the button controller
441 * src/frontends/xforms/forms/*.fd: and associated generated files
442 updated to reflect changes to FormBase. Some other FormXxxx files
443 also got minor updates to reflect changes to FormBase.
445 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
446 (hide): made virtual.
447 (input): return a bool. true == valid input
448 (RestoreCB, restore): new
449 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
450 Changes to allow derived dialogs to use a ButtonController and
451 make sense when doing so: OK button calls ok() and so on.
453 * src/frontends/xforms/ButtonController.h (class ButtonController):
454 Switch from template implementation to taking Policy parameter.
455 Allows FormBase to provide a ButtonController for any dialog.
457 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
458 Probably should rename connect and disconnect.
459 (apply): use the radio button groups
460 (form): needed by FormBase
461 (build): setup the radio button groups
463 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
465 * several files: type changes to reduce the number of warnings and
466 to unify type hangling a bit. Still much to do.
468 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
470 * lib/images/*: rename a bunch of icons to match Dekel converter
473 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
476 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
478 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
480 * sigc++/handle.h: ditto for class Handle.
482 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
484 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
486 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
488 * src/intl.C (InitKeyMapper): Correct the value of n due to the
489 removal of the "default" language.
491 * src/combox.h (getline): Check that sel > 0
493 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
495 * lib/examples/docbook_example.lyx
496 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
498 * lib/layouts/docbook-book.layout: new docbook book layout.
500 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
502 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
504 * src/insets/figinset.C (DocBook):fixed small typo.
506 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
508 * src/insets/insetinclude.h: string include_label doesn't need to be
511 2000-09-29 Allan Rae <rae@lyx.org>
513 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
514 Allow derived type to control connection and disconnection from signals
515 of its choice if desired.
517 2000-09-28 Juergen Vigna <jug@sad.it>
519 * src/insets/insettabular.C (update): fixed cursor setting when
520 the_locking_inset changed.
521 (draw): made this a bit cleaner.
522 (InsetButtonPress): fixed!
524 * various files: added LyXText Parameter to fitCursor call.
526 * src/BufferView.C (fitCursor): added LyXText parameter.
528 * src/insets/insettabular.C (draw): small draw fix.
530 * src/tabular.C: right setting of left/right celllines.
532 * src/tabular.[Ch]: fixed various types in funcions and structures.
533 * src/insets/insettabular.C: ditto
534 * src/frontends/xforms/FormTabular.C: ditto
536 2000-09-28 Allan Rae <rae@lyx.org>
538 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
539 that the #ifdef's had been applied to part of what should have been
540 a complete condition. It's possible there are other tests that
541 were specific to tables that are also wrong now that InsetTabular is
542 being used. Now we need to fix the output of '\n' after a table in a
543 float for the same reason as the original condition:
544 "don't insert this if we would be adding it before or after a table
545 in a float. This little trick is needed in order to allow use of
546 tables in \subfigures or \subtables."
547 Juergen can you check this?
549 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
551 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
552 outputed to the ostream.
554 * several files: fixed types based on warnings from cxx
556 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
558 * src/frontends/kde/Makefile.am: fix rule for
559 formindexdialogdata_moc.C
561 * src/.cvsignore: add ext_l10n.h to ignore
563 * acconfig.h: stop messing with __STRICT_ANSI__
564 * config/gnome.m4: remove option to set -ansi
565 * config/kde.m4: remove option to set -ansi
566 * config/lyxinclude.m4: don't set -ansi
568 2000-09-27 Juergen Vigna <jug@sad.it>
570 * various files: remove "default" language check.
572 * src/insets/insetquotes.C: removed use of current_view.
574 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
575 the one should have red ears by now!
577 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
578 in more then one paragraph. Fixed cursor-movement/selection.
580 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
581 paragraphs inside a text inset.
583 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
584 text-inset if this owner is an inset.
586 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
588 * src/Bullet.h: changed type of font, character and size to int
590 * src/buffer.C (asciiParagraph): remove actcell and fname1.
592 * src/insets/inseturl.[Ch]:
593 * src/insets/insetref.[Ch]:
594 * src/insets/insetlabel.[Ch]: add linelen to Ascii
596 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
598 * src/buffer.C (readFile): block-if statement rearranged to minimise
599 bloat. Patch does not reverse Jean-Marc's change ;-)
601 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
602 Class rewritten to store pointers to hide/update signals directly,
603 rather than Dialogs *. Also defined an enum to ease use. All xforms
604 forms can now be derived from this class.
606 * src/frontends/xforms/FormCommand.[Ch]
607 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
609 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
612 * src/frontends/xforms/forms/form_citation.fd
613 * src/frontends/xforms/forms/form_copyright.fd
614 * src/frontends/xforms/forms/form_error.fd
615 * src/frontends/xforms/forms/form_index.fd
616 * src/frontends/xforms/forms/form_ref.fd
617 * src/frontends/xforms/forms/form_toc.fd
618 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
620 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
622 * src/insets/insetfoot.C: removed redundent using directive.
624 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
626 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
627 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
629 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
630 created in the constructors in different groups. Then set() just
631 have to show the groups as needed. This fixes the redraw problems
632 (and is how the old menu code worked).
634 * src/support/lyxlib.h: declare the methods as static when we do
637 2000-09-26 Juergen Vigna <jug@sad.it>
639 * src/buffer.C (asciiParagraph): new function.
640 (writeFileAscii): new function with parameter ostream.
641 (writeFileAscii): use now asciiParagraph.
643 * various inset files: added the linelen parameter to the Ascii-func.
645 * src/tabular.C (Write): fixed error in writing file introduced by
646 the last changes from Lars.
648 * lib/bind/menus.bind: removed not supported functions.
650 * src/insets/insettext.C (Ascii): implemented this function.
652 * src/insets/lyxinset.h (Ascii): added linelen parameter.
654 * src/tabular.C (write_attribute[int,string,bool]): new functions.
655 (Write): use of the write_attribute functions.
657 * src/bufferlist.C (close): fixed reasking question!
659 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
661 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
662 new files use the everwhere possible.
665 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
666 src/log_form.C src/lyx.C:
669 * src/buffer.C (runLaTeX): remove func
671 * src/PaperLayout.C: removed file
672 * src/ParagraphExtra.C: likewise
673 * src/bullet_forms.C: likewise
674 * src/bullet_forms.h: likewise
675 * src/bullet_forms_cb.C: likewise
677 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
678 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
681 * several files: remove all traces of the old fd_form_paragraph,
682 and functions belonging to that.
684 * several files: remove all traces of the old fd_form_document,
685 and functions belonging to that.
687 * several files: constify local variables were possible.
689 * several files: remove all code that was dead when NEW_EXPORT was
692 * several files: removed string::c_str in as many places as
695 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
696 (e): be a bit more outspoken when patching
697 (updatesrc): only move files if changed.
699 * forms/layout_forms.h.patch: regenerated
701 * forms/layout_forms.fd: remove form_document and form_paragraph
702 and form_quotes and form_paper and form_table_options and
705 * forms/form1.fd: remove form_table
707 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
708 the fdui->... rewrite. Update some comments to xforms 0.88
710 * forms/bullet_forms.C.patch: removed file
711 * forms/bullet_forms.fd: likewise
712 * forms/bullet_forms.h.patch: likewise
714 * development/Code_rules/Rules: added a section on switch
715 statements. Updated some comment to xforms 0.88.
717 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
719 * src/buffer.C (readFile): make sure that the whole version number
720 is read after \lyxformat (even when it contains a comma)
722 * lib/ui/default.ui: change shortcut of math menu to M-a.
724 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
726 * src/vspace.C (nextToken): use isStrDbl() to check for proper
729 * src/LyXView.C (updateWindowTitle): show the full files name in
730 window title, limited to 30 characters.
732 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
733 When a number of characters has been given, we should not assume
734 that the string is 0-terminated.
736 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
737 calls (fixes some memory leaks)
739 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
740 trans member on exit.
742 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
744 * src/converter.C (GetReachable): fix typo.
746 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
747 understand ',' instead of '.'.
748 (GetInteger): rewrite to use strToInt().
750 2000-09-26 Juergen Vigna <jug@sad.it>
752 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
753 better visibility and error-message on wrong VSpace input.
755 * src/language.C (initL): added english again.
757 2000-09-25 Juergen Vigna <jug@sad.it>
759 * src/frontends/kde/Dialogs.C (Dialogs):
760 * src/frontends/gnome/Dialogs.C (Dialogs):
761 * src/frontends/kde/Makefile.am:
762 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
764 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
766 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
768 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
770 * src/frontends/xforms/FormParagraph.C:
771 * src/frontends/xforms/FormParagraph.h:
772 * src/frontends/xforms/form_paragraph.C:
773 * src/frontends/xforms/form_paragraph.h:
774 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
777 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
779 * src/tabular.C (OldFormatRead): forgot to delete the temporary
780 Paragraph-Data after use.
782 * src/insets/insettext.C (LocalDispatch): don't set the layout on
783 non breakable paragraphs.
785 2000-09-25 Garst R. Reese <reese@isn.net>
787 * src/language.C (initL): added missing language_country codes.
789 2000-09-25 Juergen Vigna <jug@sad.it>
791 * src/insets/insettext.C (InsetText):
792 (deleteLyXText): remove the not released LyXText structure!
794 2000-09-24 Marko Vendelin <markov@ioc.ee>
796 * src/frontends/gnome/mainapp.C
797 * src/frontends/gnome/mainapp.h: added support for keyboard
800 * src/frontends/gnome/FormCitation.C
801 * src/frontends/gnome/FormCitation.h
802 * src/frontends/gnome/Makefile.am
803 * src/frontends/gnome/pixbutton.h: completed the rewrite of
804 FormCitation to use "action area" in mainapp window
806 * src/frontends/gnome/Menubar_pimpl.C
807 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
810 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
812 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
813 width/descent/ascent values if name is empty.
814 (mathed_string_height): Use std::max.
816 2000-09-25 Allan Rae <rae@lyx.org>
818 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
819 segfault. This will be completely redesigned soon.
821 * sigc++: updated libsigc++. Fixes struct timespec bug.
823 * development/tools/makeLyXsigc.sh: .cvsignore addition
825 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
827 * several files: removed almost all traces of the old table
830 * src/TableLayout.C: removed file
832 2000-09-22 Juergen Vigna <jug@sad.it>
834 * src/frontends/kde/Dialogs.C: added credits forms.
836 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
838 * src/frontends/gnome/Dialogs.C: added some forms.
840 * src/spellchecker.C (init_spell_checker): set language in pspell code
841 (RunSpellChecker): some modifications for setting language string.
843 * src/language.[Ch]: added language_country code.
845 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
847 * src/frontends/Dialogs.h: added new signal showError.
848 Rearranged existing signals in some sort of alphabetical order.
850 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
851 FormError.[Ch], form_error.[Ch]
852 * src/frontends/xforms/forms/makefile: added new file form_error.fd
853 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
855 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
856 dialogs. I think that this can be used as the base to all these
859 * src/frontends/xforms/FormError.[Ch]
860 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
861 implementation of InsetError dialog.
863 * src/insets/inseterror.[Ch]: rendered GUI-independent.
865 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
866 * src/frontends/kde/Makefile.am: ditto
868 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
870 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
871 macrobf. This fixes a bug of invisible text.
873 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
875 * lib/doc/LaTeXConfig.lyx.in: updated.
877 * src/language.C (initL): remove language "francais" and change a
878 bit the names of the two other french variations.
880 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
881 string that may not be 0-terminated.
883 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
885 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
887 2000-09-20 Marko Vendelin <markov@ioc.ee>
889 * src/frontends/gnome/FormCitation.C
890 * src/frontends/gnome/FormIndex.C
891 * src/frontends/gnome/FormToc.C
892 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
893 the variable initialization to shut up the warnings
895 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
897 * src/table.[Ch]: deleted files
899 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
902 2000-09-18 Juergen Vigna <jug@sad.it>
904 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
905 problems with selection. Inserted new LFUN_PASTESELECTION.
906 (InsetButtonPress): inserted handling of middle mouse-button paste.
908 * src/spellchecker.C: changed word to word.c_str().
910 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
912 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
913 included in the ``make dist'' tarball.
915 2000-09-15 Juergen Vigna <jug@sad.it>
917 * src/CutAndPaste.C (cutSelection): small fix return the right
918 end position after cut inside one paragraph only.
920 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
921 we are locked as otherwise we don't have a valid cursor position!
923 * src/insets/figinset.C (draw): small bugfix but why is this needed???
925 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
927 * src/frontends/kde/FormRef.C: added using directive.
928 * src/frontends/kde/FormToc.C: ditto
930 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
932 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
934 2000-09-19 Marko Vendelin <markov@ioc.ee>
936 * src/frontends/gnome/Menubar_pimpl.C
937 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
938 Toc, ViewFormats, UpdateFormats, and ExportFormats.
940 * src/frontends/gnome/mainapp.C
941 * src/frontends/gnome/mainapp.h: support for menu update used
944 * src/frontends/gnome/mainapp.C
945 * src/frontends/gnome/mainapp.h: support for "action" area in the
946 main window. This area is used by small simple dialogs, such as
949 * src/frontends/gnome/FormIndex.C
950 * src/frontends/gnome/FormIndex.h
951 * src/frontends/gnome/FormUrl.C
952 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
955 * src/frontends/gnome/FormCitation.C
956 * src/frontends/gnome/FormCitation.h: rewrite to use main window
957 action area. Only "Insert new citation" is implemented.
959 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
961 * src/buffer.C (Dispatch): fix call to Dispatch
962 * src/insets/insetref.C (Edit): likewise
963 * src/insets/insetparent.C (Edit): likewise
964 * src/insets/insetinclude.C (include_cb): likewise
965 * src/frontends/xforms/FormUrl.C (apply): likewise
966 * src/frontends/xforms/FormToc.C (apply): likewise
967 * src/frontends/xforms/FormRef.C (apply): likewise
968 * src/frontends/xforms/FormIndex.C (apply): likewise
969 * src/frontends/xforms/FormCitation.C (apply): likewise
970 * src/lyxserver.C (callback): likewise
971 * src/lyxfunc.C (processKeySym): likewise
974 * src/lyx_cb.C (LayoutsCB): likewise
976 * Makefile.am (sourcedoc): small change
978 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
980 * src/main.C (main): Don't make an empty GUIRunTime object. all
981 methods are static. constify a bit remove unneded using + headers.
983 * src/tabular.C: some more const to local vars move some loop vars
985 * src/spellchecker.C: added some c_str after some word for pspell
987 * src/frontends/GUIRunTime.h: add new static method setDefaults
988 * src/frontends/xforms/GUIRunTime.C (setDefaults):
989 * src/frontends/kde/GUIRunTime.C (setDefaults):
990 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
992 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
993 with strnew in arg, use correct emptystring when calling SetName.
995 * several files: remove all commented code with relation to
996 HAVE_SSTREAM beeing false. We now only support stringstream and
999 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1001 * src/lyxfunc.C: construct correctly the automatic new file
1004 * src/text2.C (IsStringInText): change type of variable i to shut
1007 * src/support/sstream.h: do not use namespaces if the compiler
1008 does not support them.
1010 2000-09-15 Marko Vendelin <markov@ioc.ee>
1011 * src/frontends/gnome/FormCitation.C
1012 * src/frontends/gnome/FormCitation.h
1013 * src/frontends/gnome/diainsertcitation_interface.c
1014 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
1015 regexp support to FormCitation [Gnome].
1017 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
1020 * configure.in: remove unused KDE/GTKGUI define
1022 * src/frontends/kde/FormRef.C
1023 * src/frontends/kde/FormRef.h
1024 * src/frontends/kde/formrefdialog.C
1025 * src/frontends/kde/formrefdialog.h: double click will
1026 go to reference, now it is possible to change a cross-ref
1029 * src/frontends/kde/FormToc.C
1030 * src/frontends/kde/FormToc.h
1031 * src/frontends/kde/formtocdialog.C
1032 * src/frontends/kde/formtocdialog.h: add a depth
1035 * src/frontends/kde/Makefile.am: add QtLyXView.h
1038 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
1040 * src/frontends/kde/FormCitation.h: added some using directives.
1042 * src/frontends/kde/FormToc.h: corrected definition of doTree.
1044 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
1047 * src/mathed/math_defs.h: redefine SetAlign to use string rather
1050 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1052 * src/buffer.C (pop_tag): revert for the second time a change by
1053 Lars, who seems to really hate having non-local loop variables :)
1055 * src/Lsstream.h: add "using" statements.
1057 * src/support/copy.C (copy): add a bunch of std:: qualifiers
1058 * src/buffer.C (writeFile): ditto
1060 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1062 * src/buffer.C (writeFile): try to fix the locale modified format
1063 number to always be as we want it.
1065 * src/WorkArea.C (work_area_handler): try to workaround the bugs
1066 in XForms 0.89. C-space is now working again.
1068 * src/Lsstream.h src/support/sstream.h: new files.
1070 * also commented out all cases where strstream were used.
1072 * src/Bullet.h (c_str): remove method.
1074 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
1076 * a lot of files: get rid of "char const *" and "char *" is as
1077 many places as possible. We only want to use them in interaction
1078 with system of other libraries, not inside lyx.
1080 * a lot of files: return const object is not of pod type. This
1081 helps ensure that temporary objects is not modified. And fits well
1082 with "programming by contract".
1084 * configure.in: check for the locale header too
1086 * Makefile.am (sourcedoc): new tag for generation of doc++
1089 2000-09-14 Juergen Vigna <jug@sad.it>
1091 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
1092 callback to check which combo called it and do the right action.
1094 * src/combox.C (combo_cb): added combo * to the callbacks.
1095 (Hide): moved call of callback after Ungrab of the pointer.
1097 * src/intl.h: removed LCombo2 function.
1099 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
1100 function as this can now be handled in one function.
1102 * src/combox.h: added Combox * to callback prototype.
1104 * src/frontends/xforms/Toolbar_pimpl.C:
1105 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
1107 2000-09-14 Garst Reese <reese@isn.net>
1109 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
1110 moved usepackage{xxx}'s to beginning of file. Changed left margin
1111 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
1112 underlining from title. Thanks to John Culleton for useful suggestions.
1114 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1116 * src/lyxlex_pimpl.C (setFile): change error message to debug
1119 2000-09-13 Juergen Vigna <jug@sad.it>
1121 * src/frontends/xforms/FormDocument.C: implemented choice_class
1122 as combox and give callback to combo_language so OK/Apply is activated
1125 * src/bufferlist.C (newFile): small fix so already named files
1126 (via an open call) are not requested to be named again on the
1129 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
1131 * src/frontends/kde/Makefile.am
1132 * src/frontends/kde/FormRef.C
1133 * src/frontends/kde/FormRef.h
1134 * src/frontends/kde/formrefdialog.C
1135 * src/frontends/kde/formrefdialog.h: implement
1138 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
1140 * src/frontends/kde/formtocdialog.C
1141 * src/frontends/kde/formtocdialog.h
1142 * src/frontends/kde/FormToc.C
1143 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
1145 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
1147 * src/frontends/kde/FormCitation.C: fix thinko
1148 where we didn't always display the reference text
1151 * src/frontends/kde/formurldialog.C
1152 * src/frontends/kde/formurldialog.h
1153 * src/frontends/kde/FormUrl.C
1154 * src/frontends/kde/FormUrl.h: minor cleanups
1156 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
1158 * src/frontends/kde/Makefile.am
1159 * src/frontends/kde/FormToc.C
1160 * src/frontends/kde/FormToc.h
1161 * src/frontends/kde/FormCitation.C
1162 * src/frontends/kde/FormCitation.h
1163 * src/frontends/kde/FormIndex.C
1164 * src/frontends/kde/FormIndex.h
1165 * src/frontends/kde/formtocdialog.C
1166 * src/frontends/kde/formtocdialog.h
1167 * src/frontends/kde/formcitationdialog.C
1168 * src/frontends/kde/formcitationdialog.h
1169 * src/frontends/kde/formindexdialog.C
1170 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
1172 2000-09-12 Juergen Vigna <jug@sad.it>
1174 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
1177 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1179 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
1182 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
1184 * src/converter.C (Add, Convert): Added support for converter flags:
1185 needaux, resultdir, resultfile.
1186 (Convert): Added new parameter view_file.
1187 (dvips_options): Fixed letter paper option.
1189 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
1190 (Export, GetExportableFormats, GetViewableFormats): Added support
1193 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
1195 (easyParse): Fixed to work with new export code.
1197 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
1200 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
1202 * lib/bind/*.bind: Replaced
1203 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
1204 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
1206 2000-09-11 Juergen Vigna <jug@sad.it>
1208 * src/lyx_gui.C (runTime): uses global guiruntime variable.
1210 * src/main.C (main): now GUII defines global guiruntime!
1212 * src/frontends/gnome/GUIRunTime.C (initApplication):
1213 * src/frontends/kde/GUIRunTime.C (initApplication):
1214 * src/frontends/xforms/GUIRunTime.C (initApplication):
1215 * src/frontends/GUIRunTime.h: added new function initApplication.
1217 * src/spellchecker.C (sc_accept_word): change to add_to_session.
1219 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
1221 2000-09-08 Juergen Vigna <jug@sad.it>
1223 * src/lyx_gui.C (create_forms): don't display the "default" entry as
1224 we have already "Reset".
1226 * src/language.C (initL): inserted "default" language and made this
1227 THE default language (and not american!)
1229 * src/paragraph.C: inserted handling of "default" language!
1231 * src/lyxfont.C: ditto
1235 * src/paragraph.C: output the \\par only if we have a following
1236 paragraph otherwise it's not needed.
1238 2000-09-05 Juergen Vigna <jug@sad.it>
1240 * config/pspell.m4: added entry to lyx-flags
1242 * src/spellchecker.C: modified version from Kevin for using pspell
1244 2000-09-01 Marko Vendelin <markov@ioc.ee>
1245 * src/frontends/gnome/Makefile.am
1246 * src/frontends/gnome/FormCitation.C
1247 * src/frontends/gnome/FormCitation.h
1248 * src/frontends/gnome/diainsertcitation_callbacks.c
1249 * src/frontends/gnome/diainsertcitation_callbacks.h
1250 * src/frontends/gnome/diainsertcitation_interface.c
1251 * src/frontends/gnome/diainsertcitation_interface.h
1252 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
1253 dialog for Gnome frontend
1255 * src/main.C: Gnome libraries require keeping application name
1256 and its version as strings
1258 * src/frontends/gnome/mainapp.C: Change the name of the main window
1259 from GnomeLyX to PACKAGE
1261 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1263 * src/frontends/Liason.C: add "using: declaration.
1265 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
1267 * src/mathed/math_macro.C (Metrics): Set the size of the template
1269 * src/mathed/formulamacro.C (Latex): Fixed the returned value
1271 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
1273 * src/converter.C (add_options): New function.
1274 (SetViewer): Change $$FName into '$$FName'.
1275 (View): Add options when running xdvi
1276 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
1277 (Convert): The 3rd parameter is now the desired filename. Converts
1278 calls to lyx::rename if necessary.
1279 Add options when running dvips.
1280 (dvi_papersize,dvips_options): New methods.
1282 * src/exporter.C (Export): Use getLatexName() instead of fileName().
1284 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
1285 using a call to Converter::dvips_options.
1286 Fixed to work with nex export code.
1288 * src/support/copy.C
1289 * src/support/rename.C: New files
1291 * src/support/syscall.h
1292 * src/support/syscall.C: Added Starttype SystemDontWait.
1294 * lib/ui/default.ui: Changed to work with new export code
1296 * lib/configure.m4: Changed to work with new export code
1298 * src/encoding.C: Changed latex name for iso8859_7 encoding.
1300 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
1302 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
1303 so that code compiles with DEC cxx.
1305 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
1306 to work correctly! Also now supports the additional elements
1309 2000-09-01 Allan Rae <rae@lyx.org>
1311 * src/frontends/ButtonPolicies.C: renamed all the references to
1312 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
1314 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
1315 since it's a const not a type.
1317 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
1319 2000-08-31 Juergen Vigna <jug@sad.it>
1321 * src/insets/figinset.C: Various changes to look if the filename has
1322 an extension and if not add it for inline previewing.
1324 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1326 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
1327 make buttonStatus and isReadOnly be const methods. (also reflect
1328 this in derived classes.)
1330 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
1331 (nextState): change to be static inline, pass the StateMachine as
1333 (PreferencesPolicy): remove casts
1334 (OkCancelPolicy): remvoe casts
1335 (OkCancelReadOnlyPolicy): remove casts
1336 (NoRepeatedApplyReadOnlyPolicy): remove casts
1337 (OkApplyCancelReadOnlyPolicy): remove casts
1338 (OkApplyCancelPolicy): remove casts
1339 (NoRepeatedApplyPolicy): remove casts
1341 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
1343 * src/converter.C: added some using directives
1345 * src/frontends/ButtonPolicies.C: changes to overcome
1346 "need lvalue" error with DEC c++
1348 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
1349 to WMHideCB for DEC c++
1351 * src/frontends/xforms/Menubar_pimpl.C: added using directive
1353 * src/frontends/xforms/forms/form_document.C.patch: use C callback
1354 to BulletBMTableCB for DEC c++
1356 2000-08-31 Allan Rae <rae@lyx.org>
1358 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
1359 character dialog separately from old document dialogs combo_language.
1362 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
1364 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
1365 Removed LFUN_REF_CREATE.
1367 * src/MenuBackend.C: Added new tags: toc and references
1369 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
1370 (add_lastfiles, add_documents, add_formats): Removed the unused smn
1372 (add_toc, add_references): New methods.
1373 (create_submenu): Handle correctly the case when there is a
1374 seperator after optional menu items.
1376 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
1377 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
1378 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
1380 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
1382 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
1384 * src/converter.[Ch]: New file for converting between different
1387 * src/export.[Ch]: New file for exporting a LyX file to different
1390 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
1391 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
1392 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
1393 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
1394 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
1395 RunDocBook, MenuExport.
1397 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
1398 Exporter::Preview methods if NEW_EXPORT is defined.
1400 * src/buffer.C (Dispatch): Use Exporter::Export.
1402 * src/lyxrc.C: Added new tags: \converter and \viewer.
1405 * src/LyXAction.C: Define new lyx-function: buffer-update.
1406 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
1407 when NEW_EXPORT is defined.
1409 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
1411 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
1413 * lib/ui/default.ui: Added submenus "view" and "update" to the
1416 * src/filetools.C (GetExtension): New function.
1418 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
1420 2000-08-29 Allan Rae <rae@lyx.org>
1422 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
1424 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
1425 (EnableDocumentLayout): removed
1426 (DisableDocumentLayout): removed
1427 (build): make use of ButtonController's read-only handling to
1428 de/activate various objects. Replaces both of the above functions.
1430 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
1431 (readOnly): was read_only
1432 (refresh): fixed dumb mistakes with read_only_ handling
1434 * src/frontends/xforms/forms/form_document.fd:
1435 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
1436 tabbed dialogs so the tabs look more like tabs and so its easier to
1437 work out which is the current tab.
1439 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
1440 segfault with form_table
1442 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
1444 2000-08-28 Juergen Vigna <jug@sad.it>
1446 * acconfig.h: added USE_PSPELL.
1448 * src/config.h.in: added USE_PSPELL.
1450 * autogen.sh: added pspell.m4
1452 * config/pspell.m4: new file.
1454 * src/spellchecker.C: implemented support for pspell libary.
1456 2000-08-25 Juergen Vigna <jug@sad.it>
1458 * src/LyXAction.C (init): renamed LFUN_TABLE to
1459 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
1461 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
1463 * src/lyxscreen.h: add force_clear variable and fuction to force
1464 a clear area when redrawing in LyXText.
1466 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
1468 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1470 * some whitespace and comment changes.
1472 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
1474 * src/buffer.C: up te LYX_FORMAT to 2.17
1476 2000-08-23 Juergen Vigna <jug@sad.it>
1478 * src/BufferView_pimpl.C (tripleClick): disable this when in a
1481 * src/insets/insettabular.C (pasteSelection): delete the insets
1482 LyXText as it is not valid anymore.
1483 (copySelection): new function.
1484 (pasteSelection): new function.
1485 (cutSelection): new function.
1486 (LocalDispatch): implemented cut/copy/paste of cell selections.
1488 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
1489 don't have a LyXText.
1491 * src/LyXAction.C (init): a NEW_TABULAR define too much.
1493 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
1496 2000-08-22 Juergen Vigna <jug@sad.it>
1498 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
1499 ifdef form_table out if NEW_TABULAR.
1501 2000-08-21 Juergen Vigna <jug@sad.it>
1503 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
1504 (draw): fixed draw position so that the cursor is positioned in the
1506 (InsetMotionNotify): hide/show cursor so the position is updated.
1507 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
1508 using cellstart() function where it should be used.
1510 * src/insets/insettext.C (draw): ditto.
1512 * src/tabular.C: fixed initialization of some missing variables and
1513 made BoxType into an enum.
1515 2000-08-22 Marko Vendelin <markov@ioc.ee>
1516 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
1517 stock menu item using action numerical value, not its string
1521 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
1523 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
1524 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
1526 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
1528 * src/frontends/xforms/GUIRunTime.C: new file
1530 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
1531 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1533 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
1535 * src/frontends/kde/GUIRunTime.C: new file
1537 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
1538 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1540 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
1542 * src/frontends/gnome/GUIRunTime.C: new file
1544 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
1547 * src/frontends/GUIRunTime.h: removed constructor and destructor,
1548 small change to documetentation.
1550 * src/frontends/GUIRunTime.C: removed file
1552 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
1554 * src/lyxparagraph.h: enable NEW_TABULAR as default
1556 * src/lyxfunc.C (processKeySym): remove some commented code
1558 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
1559 NEW_TABULAR around the fd_form_table_options.
1561 * src/lyx_gui.C (runTime): call the static member function as
1562 GUIRunTime::runTime().
1564 2000-08-21 Allan Rae <rae@lyx.org>
1566 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
1569 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
1571 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
1573 2000-08-21 Allan Rae <rae@lyx.org>
1575 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
1576 keep Garst happy ;-)
1577 * src/frontends/xforms/FormPreferences.C (build): use setOK
1578 * src/frontends/xforms/FormDocument.C (build): use setOK
1579 (FormDocument): use the appropriate policy.
1581 2000-08-21 Allan Rae <rae@lyx.org>
1583 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
1584 automatic [de]activation of arbitrary objects when in a read-only state.
1586 * src/frontends/ButtonPolicies.h: More documentation
1587 (isReadOnly): added to support the above.
1589 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
1591 2000-08-18 Juergen Vigna <jug@sad.it>
1593 * src/insets/insettabular.C (getStatus): changed to return func_status.
1595 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
1596 display toggle menu entries if they are.
1598 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
1599 new document layout now.
1601 * src/lyxfunc.C: ditto
1603 * src/lyx_gui_misc.C: ditto
1605 * src/lyx_gui.C: ditto
1607 * lib/ui/default.ui: removed paper and quotes layout as they are now
1608 all in the document layout tabbed folder.
1610 * src/frontends/xforms/forms/form_document.fd: added Restore
1611 button and callbacks for all inputs for Allan's ButtonPolicy.
1613 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
1614 (CheckChoiceClass): added missing params setting on class change.
1615 (UpdateLayoutDocument): added for updating the layout on params.
1616 (build): forgot to RETURN_ALWAYS input_doc_spacing.
1617 (FormDocument): Implemented Allan's ButtonPolicy with the
1620 2000-08-17 Allan Rae <rae@lyx.org>
1622 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
1623 so we can at least see the credits again.
1625 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
1626 controller calls for the appropriate callbacks. Note that since Ok
1627 calls apply followed by cancel, and apply isn't a valid input for the
1628 APPLIED state, the bc_ calls have to be made in the static callback not
1629 within each of the real callbacks.
1631 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
1632 (setOk): renamed from setOkay()
1634 2000-08-17 Juergen Vigna <jug@sad.it>
1636 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
1637 in the implementation part.
1638 (composeUIInfo): don't show optional menu-items.
1640 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
1642 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
1644 * src/bufferview_funcs.C (CurrentState): fixed to show also the
1645 text-state when in a text-inset.
1647 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
1649 2000-08-17 Marko Vendelin <markov@ioc.ee>
1650 * src/frontends/gnome/FormIndex.C
1651 * src/frontends/gnome/FormIndex.h
1652 * src/frontends/gnome/FormToc.C
1653 * src/frontends/gnome/FormToc.h
1654 * src/frontends/gnome/dialogs
1655 * src/frontends/gnome/diatoc_callbacks.c
1656 * src/frontends/gnome/diatoc_callbacks.h
1657 * src/frontends/gnome/diainsertindex_callbacks.h
1658 * src/frontends/gnome/diainsertindex_callbacks.c
1659 * src/frontends/gnome/diainsertindex_interface.c
1660 * src/frontends/gnome/diainsertindex_interface.h
1661 * src/frontends/gnome/diatoc_interface.h
1662 * src/frontends/gnome/diatoc_interface.c
1663 * src/frontends/gnome/Makefile.am: Table of Contents and
1664 Insert Index dialogs implementation for Gnome frontend
1666 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
1668 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
1670 * src/frontends/gnome/diainserturl_interface.c: make the dialog
1673 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1675 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
1676 destructor. Don't definde if you don't need it
1677 (processEvents): made static, non-blocking events processing for
1679 (runTime): static method. event loop for xforms
1680 * similar as above for kde and gnome.
1682 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
1683 new Pimpl is correct
1684 (runTime): new method calss the real frontends runtime func.
1686 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
1688 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1690 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
1692 2000-08-16 Juergen Vigna <jug@sad.it>
1694 * src/lyx_gui.C (runTime): added GUII RunTime support.
1696 * src/frontends/Makefile.am:
1697 * src/frontends/GUIRunTime.[Ch]:
1698 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
1699 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
1700 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
1702 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
1704 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
1705 as this is already set in ${FRONTEND_INCLUDE} if needed.
1707 * configure.in (CPPFLAGS): setting the include dir for the frontend
1708 directory and don't set FRONTEND=xforms for now as this is executed
1711 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
1713 * src/frontends/kde/Makefile.am:
1714 * src/frontends/kde/FormUrl.C:
1715 * src/frontends/kde/FormUrl.h:
1716 * src/frontends/kde/formurldialog.h:
1717 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
1719 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
1721 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
1723 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1725 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
1728 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
1730 * src/WorkArea.C (work_area_handler): more work to get te
1731 FL_KEYBOARD to work with xforms 0.88 too, please test.
1733 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
1735 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
1737 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
1740 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1742 * src/Timeout.h: remove Qt::emit hack.
1744 * several files: changes to allo doc++ compilation
1746 * src/lyxfunc.C (processKeySym): new method
1747 (processKeyEvent): comment out if FL_REVISION < 89
1749 * src/WorkArea.C: change some debugging levels.
1750 (WorkArea): set wantkey to FL_KEY_ALL
1751 (work_area_handler): enable the FL_KEYBOARD clause, this enables
1752 clearer code and the use of compose with XForms 0.89. Change to
1753 use signals instead of calling methods in bufferview directly.
1755 * src/Painter.C: change some debugging levels.
1757 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
1760 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
1761 (workAreaKeyPress): new method
1763 2000-08-14 Juergen Vigna <jug@sad.it>
1765 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
1767 * config/kde.m4: addes some features
1769 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
1770 include missing xforms dialogs.
1772 * src/Timeout.h: a hack to be able to compile with qt/kde.
1774 * sigc++/.cvsignore: added acinclude.m4
1776 * lib/.cvsignore: added listerros
1778 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
1779 xforms tree as objects are needed for other frontends.
1781 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
1782 linking with not yet implemented xforms objects.
1784 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
1786 2000-08-14 Baruch Even <baruch.even@writeme.com>
1788 * src/frontends/xforms/FormGraphics.h:
1789 * src/frontends/xforms/FormGraphics.C:
1790 * src/frontends/xforms/RadioButtonGroup.h:
1791 * src/frontends/xforms/RadioButtonGroup.C:
1792 * src/insets/insetgraphics.h:
1793 * src/insets/insetgraphics.C:
1794 * src/insets/insetgraphicsParams.h:
1795 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
1796 instead of spaces, and various other indentation issues to make the
1797 sources more consistent.
1799 2000-08-14 Marko Vendelin <markov@ioc.ee>
1801 * src/frontends/gnome/dialogs/diaprint.glade
1802 * src/frontends/gnome/FormPrint.C
1803 * src/frontends/gnome/FormPrint.h
1804 * src/frontends/gnome/diaprint_callbacks.c
1805 * src/frontends/gnome/diaprint_callbacks.h
1806 * src/frontends/gnome/diaprint_interface.c
1807 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
1810 * src/frontends/gnome/dialogs/diainserturl.glade
1811 * src/frontends/gnome/FormUrl.C
1812 * src/frontends/gnome/FormUrl.h
1813 * src/frontends/gnome/diainserturl_callbacks.c
1814 * src/frontends/gnome/diainserturl_callbacks.h
1815 * src/frontends/gnome/diainserturl_interface.c
1816 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
1817 Gnome implementation
1819 * src/frontends/gnome/Dialogs.C
1820 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
1821 all other dialogs. Copy all unimplemented dialogs from Xforms
1824 * src/frontends/gnome/support.c
1825 * src/frontends/gnome/support.h: support files generated by Glade
1829 * config/gnome.m4: Gnome configuration scripts
1831 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
1832 configure --help message
1834 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
1835 only if there are no events pendling in Gnome/Gtk. This enhances
1836 the performance of menus.
1839 2000-08-14 Allan Rae <rae@lyx.org>
1841 * lib/Makefile.am: listerrors cleaning
1843 * lib/listerrors: removed -- generated file
1844 * acinclude.m4: ditto
1845 * sigc++/acinclude.m4: ditto
1847 * src/frontends/xforms/forms/form_citation.fd:
1848 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
1851 * src/frontends/xforms/forms/makefile: I renamed the `install` target
1852 `updatesrc` and now we have a `test` target that does what `updatesrc`
1853 used to do. I didn't like having an install target that wasn't related
1856 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
1857 on all except FormGraphics. This may yet happen. Followed by a major
1858 cleanup including using FL_TRANSIENT for most of the dialogs. More
1859 changes to come when the ButtonController below is introduced.
1861 * src/frontends/xforms/ButtonController.h: New file for managing up to
1862 four buttons on a dialog according to an externally defined policy.
1863 * src/frontends/xforms/Makefile.am: added above
1865 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
1866 Apply and Cancel/Close buttons and everything in between and beyond.
1867 * src/frontends/Makefile.am: added above.
1869 * src/frontends/xforms/forms/form_preferences.fd:
1870 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
1871 and removed variable 'status' as a result. Fixed the set_minsize thing.
1872 Use the new screen-font-update after checking screen fonts were changed
1873 Added a "Restore" button to restore the original lyxrc values while
1874 editing. This restores everything not just the last input changed.
1875 That's still a tricky one. As is the "LyX: this shouldn't happen..."
1877 * src/LyXAction.C: screen-font-update added for updating buffers after
1878 screen font settings have been changed.
1879 * src/commandtags.h: ditto
1880 * src/lyxfunc.C: ditto
1882 * forms/lyx.fd: removed screen fonts dialog.
1883 * src/lyx_gui.C: ditto
1884 * src/menus.[Ch]: ditto
1885 * src/lyx.[Ch]: ditto
1886 * src/lyx_cb.C: ditto + code from here moved to make
1887 screen-font-update. And people wonder why progress on GUII is
1888 slow. Look at how scattered this stuff was! It takes forever
1891 * forms/fdfix.sh: Fixup the spacing after commas.
1892 * forms/makefile: Remove date from generated files. Fewer clashes now.
1893 * forms/bullet_forms.C.patch: included someones handwritten changes
1895 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
1896 once I've discovered why LyXRC was made noncopyable.
1897 * src/lyx_main.C: ditto
1899 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
1901 * src/frontends/xforms/forms/fdfix.sh:
1902 * src/frontends/xforms/forms/fdfixh.sed:
1903 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
1904 * src/frontends/xforms/Form*.[hC]:
1905 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
1906 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
1907 provide a destructor for the struct FD_form_xxxx. Another version of
1908 the set_[max|min]size workaround and a few other cleanups. Actually,
1909 Angus' patch from 20000809.
1911 2000-08-13 Baruch Even <baruch.even@writeme.com>
1913 * src/insets/insetgraphics.C (Clone): Added several fields that needed
1916 2000-08-11 Juergen Vigna <jug@sad.it>
1918 * src/insets/insetgraphics.C (InsetGraphics): changing init
1919 order because of warnings.
1921 * src/frontends/xforms/forms/makefile: adding patching .C with
1924 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
1925 from .C.patch to .c.patch
1927 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
1928 order because of warning.
1930 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
1932 * src/frontends/Liason.C (setMinibuffer): new helper function
1934 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
1936 * src/lyxfunc.C (Dispatch): calling new Document-Layout
1938 * lib/ui/default.ui: commented out PaperLayout entry
1940 * src/frontends/xforms/form_document.[Ch]: new added files
1942 * src/frontends/xforms/FormDocument.[Ch]: ditto
1944 * src/frontends/xforms/forms/form_document.fd: ditto
1946 * src/frontends/xforms/forms/form_document.C.patch: ditto
1948 2000-08-10 Juergen Vigna <jug@sad.it>
1950 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
1951 (InsetGraphics): initialized cacheHandle to 0.
1952 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
1954 2000-08-10 Baruch Even <baruch.even@writeme.com>
1956 * src/graphics/GraphicsCache.h:
1957 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
1958 correctly as a cache.
1960 * src/graphics/GraphicsCacheItem.h:
1961 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
1964 * src/graphics/GraphicsCacheItem_pimpl.h:
1965 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
1968 * src/insets/insetgraphics.h:
1969 * src/insets/insetgraphics.C: Changed from using a signal notification
1970 to polling when image is not loaded.
1972 2000-08-10 Allan Rae <rae@lyx.org>
1974 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
1975 that there are two functions that have to been taken out of line by
1976 hand and aren't taken care of in the script. (Just a reminder note)
1978 * sigc++/macros/*.h.m4: Updated as above.
1980 2000-08-09 Juergen Vigna <jug@sad.it>
1982 * src/insets/insettext.C (draw): small fix for clearing rectangle.
1984 * src/insets/insettabular.C: make drawing of single cell smarter.
1986 2000-08-09 Marko Vendelin <markov@ioc.ee>
1987 * src/frontends/gnome/Menubar_pimpl.C
1988 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
1989 implementation: new files
1991 * src/frontends/gnome/mainapp.C
1992 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
1995 * src/main.C: create Gnome main window
1997 * src/frontends/xforms/Menubar_pimpl.h
1998 * src/frontends/Menubar.C
1999 * src/frontends/Menubar.h: added method Menubar::update that calls
2000 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
2002 * src/LyXView.C: calls Menubar::update to update the state
2005 * src/frontends/gnome/Makefile.am: added new files
2007 * src/frontends/Makefile.am: added frontend compiler options
2009 2000-08-08 Juergen Vigna <jug@sad.it>
2011 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
2013 * src/bufferlist.C (close):
2014 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
2015 documents if exiting without saving.
2017 * src/buffer.C (save): use removeAutosaveFile()
2019 * src/support/filetools.C (removeAutosaveFile): new function.
2021 * src/lyx_cb.C (MenuWrite): returns a bool now.
2022 (MenuWriteAs): check if file could really be saved and revert to the
2024 (MenuWriteAs): removing old autosavefile if existant.
2026 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
2027 before Goto toggle declaration, because of compiler warning.
2029 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
2031 * src/lyxfunc.C (MenuNew): small fix.
2033 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
2035 * src/bufferlist.C (newFile):
2036 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
2038 * src/lyxrc.C: added new_ask_filename tag
2040 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
2042 * src/lyx.fd: removed code pertaining to form_ref
2043 * src/lyx.[Ch]: ditto
2044 * src/lyx_cb.C: ditto
2045 * src/lyx_gui.C: ditto
2046 * src/lyx_gui_misc.C: ditto
2048 * src/BufferView_pimpl.C (restorePosition): update buffer only
2051 * src/commandtags.h (LFUN_REFTOGGLE): removed
2052 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
2053 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
2054 (LFUN_REFBACK): renamed LFUN_REF_BACK
2056 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
2057 * src/menus.C: ditto
2058 * src/lyxfunc.C (Dispatch): ditto.
2059 InsertRef dialog is now GUI-independent.
2061 * src/texrow.C: added using std::endl;
2063 * src/insets/insetref.[Ch]: strip out large amounts of code.
2064 The inset is now a container and this functionality is now
2065 managed by a new FormRef dialog
2067 * src/frontends/Dialogs.h (showRef, createRef): new signals
2069 * src/frontends/xforms/FormIndex.[Ch],
2070 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
2071 when setting dialog's min/max size
2072 * src/frontends/xforms/FormIndex.[Ch]: ditto
2074 * src/frontends/xforms/FormRef.[Ch],
2075 src/frontends/xforms/forms/form_ref.fd: new xforms
2076 implementation of an InsetRef dialog
2078 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
2081 * src/graphics/XPM_Renderer.C (isImageFormatOK):
2082 ios::nocreate is not part of the standard. Removed.
2084 2000-08-07 Baruch Even <baruch.even@writeme.com>
2086 * src/graphics/Renderer.h:
2087 * src/graphics/Renderer.C: Added base class for rendering of different
2088 image formats into Pixmaps.
2090 * src/graphics/XPM_Renderer.h:
2091 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
2092 in a different class.
2094 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
2095 easily add support for other formats.
2097 * src/insets/figinset.C: plugged a leak of an X resource.
2099 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
2101 * src/CutAndPaste.[Ch]: make all metods static.
2103 * development/Code_rules/Rules: more work, added section on
2104 Exceptions, and a References section.
2106 * a lot of header files: work to make doc++ able to generate the
2107 source documentation, some workarounds of doc++ problems. Doc++ is
2108 now able to generate the documentation.
2110 2000-08-07 Juergen Vigna <jug@sad.it>
2112 * src/insets/insettabular.C (recomputeTextInsets): removed function
2114 * src/tabular.C (SetWidthOfMulticolCell):
2116 (calculate_width_of_column_NMC): fixed return value so that it really
2117 only returns true if the column-width has changed (there where
2118 problems with muliticolumn-cells in this column).
2120 2000-08-04 Juergen Vigna <jug@sad.it>
2122 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
2123 also on the scrollstatus of the inset.
2124 (workAreaMotionNotify): ditto.
2126 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
2128 2000-08-01 Juergen Vigna <jug@sad.it>
2130 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
2132 * src/commandtags.h:
2133 * src/LyXAction.C (init):
2134 * src/insets/inset.C (LocalDispatch): added support for
2137 * src/insets/inset.C (scroll): new functions.
2139 * src/insets/insettext.C (removeNewlines): new function.
2140 (SetAutoBreakRows): removes forced newlines in the text of the
2141 paragraph if autoBreakRows is set to false.
2143 * src/tabular.C (Latex): generates a parbox around the cell contents
2146 * src/frontends/xforms/FormTabular.C (local_update): removed
2147 the radio_useparbox button.
2149 * src/tabular.C (UseParbox): new function
2151 2000-08-06 Baruch Even <baruch.even@writeme.com>
2153 * src/graphics/GraphicsCache.h:
2154 * src/graphics/GraphicsCache.C:
2155 * src/graphics/GraphicsCacheItem.h:
2156 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
2159 * src/insets/insetgraphics.h:
2160 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
2161 drawing of the inline image.
2163 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
2164 into the wrong position.
2166 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
2169 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
2171 * src/support/translator.h: move all typedefs to public section
2173 * src/support/filetools.C (MakeLatexName): return string const
2175 (TmpFileName): ditto
2176 (FileOpenSearch): ditto
2178 (LibFileSearch): ditto
2179 (i18nLibFileSearch): ditto
2182 (CreateTmpDir): ditto
2183 (CreateBufferTmpDir): ditto
2184 (CreateLyXTmpDir): ditto
2187 (MakeAbsPath): ditto
2189 (OnlyFilename): ditto
2191 (NormalizePath): ditto
2192 (CleanupPath): ditto
2193 (GetFileContents): ditto
2194 (ReplaceEnvironmentPath): ditto
2195 (MakeRelPath): ditto
2197 (ChangeExtension): ditto
2198 (MakeDisplayPath): ditto
2199 (do_popen): return cmdret const
2200 (findtexfile): return string const
2202 * src/support/DebugStream.h: add some /// to please doc++
2204 * src/frontends/DialogBase.h (endif): add some /// to please doc++
2206 * src/texrow.C (same_rownumber): functor to use with find_if
2207 (getIdFromRow): rewritten to use find_if and to not update the
2208 positions. return true if row is found
2209 (increasePos): new method, use to update positions
2211 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
2213 * src/lyxlex_pimpl.C (verifyTable): new method
2216 (GetString): return string const
2217 (pushTable): rewrite to use std::stack
2219 (setFile): better check
2222 * src/lyxlex.h: make LyXLex noncopyable
2224 * src/lyxlex.C (text): return char const * const
2225 (GetString): return string const
2226 (getLongString): return string const
2228 * src/lyx_gui_misc.C (askForText): return pair<...> const
2230 * src/lastfiles.[Ch] (operator): return string const
2232 * src/buffer.C (parseSingleLyXformat2Token): pass string to
2233 istringstream not char const *.
2234 move token.end() out of loop.
2235 (readFile): move initializaton of token
2237 * src/BufferView2.C (insertErrors): run texrow.increasePos if
2238 getIdFromRow is successful.
2240 * lib/bind/emacs.bind: don't include menus bind
2242 * development/Code_rules/Rules: the beginnings of making this
2243 better and covering more of the unwritten rules that we have.
2245 * development/Code_rules/Recommendations: a couple of wording
2248 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2250 * src/support/strerror.c: remove C++ comment.
2252 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
2254 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
2255 LFUN_INDEX_INSERT_LAST
2257 * src/texrow.C (getIdFromRow): changed from const_iterator to
2258 iterator, allowing code to compile with DEC cxx
2260 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
2261 stores part of the class, as suggested by Allan. Will allow
2263 (apply): test to apply uses InsetCommandParams operator!=
2265 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
2266 (apply): test to apply uses InsetCommandParams operator!=
2268 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
2269 stores part of the class.
2270 (update): removed limits on min/max size.
2272 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
2273 (apply): test to apply uses InsetCommandParams operator!=
2275 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
2276 (Read, Write, scanCommand, getCommand): moved functionality
2277 into InsetCommandParams.
2279 (getScreenLabel): made pure virtual
2280 new InsetCommandParams operators== and !=
2282 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
2283 c-tors based on InsetCommandParams. Removed others.
2284 * src/insets/insetinclude.[Ch]: ditto
2285 * src/insets/insetlabel.[Ch]: ditto
2286 * src/insets/insetparent.[Ch]: ditto
2287 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
2289 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
2290 insets derived from InsetCommand created using similar c-tors
2291 based on InsetCommandParams
2292 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
2293 * src/menus.C (ShowRefsMenu): ditto
2294 * src/paragraph.C (Clone): ditto
2295 * src/text2.C (SetCounter): ditto
2296 * src/lyxfunc.C (Dispatch) ditto
2297 Also recreated old InsetIndex behaviour exactly. Can now
2298 index-insert at the start of a paragraph and index-insert-last
2299 without launching the pop-up.
2301 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2303 * lib/lyxrc.example: mark te pdf options as non functional.
2305 * src/support/lstrings.C (strToInt): move initalization of tmpstr
2306 (isStrDbl): move tmpstr.end() out of loop.
2307 (strToDbl): move intialization of tmpstr
2308 (lowercase): return string const and move tmp.end() out of loop.
2309 (uppercase): return string const and move tmp.edn() out of loop.
2310 (prefixIs): add assertion
2315 (containsOnly): ditto
2316 (containsOnly): ditto
2317 (containsOnly): ditto
2318 (countChar): make last arg char not char const
2319 (token): return string const
2320 (subst): return string const, move tmp.end() out of loop.
2321 (subst): return string const, add assertion
2322 (strip): return string const
2323 (frontStrip): return string const, add assertion
2324 (frontStrip): return string const
2329 * src/support/lstrings.C: add inclde "LAssert.h"
2330 (isStrInt): move tmpstr.end() out of loop.
2332 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
2333 toollist.end() out of loop.
2334 (deactivate): move toollist.end() out of loop.
2335 (update): move toollist.end() out of loop.
2336 (updateLayoutList): move tc.end() out of loop.
2337 (add): move toollist.end() out of loop.
2339 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
2340 md.end() out of loop.
2342 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
2344 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
2347 * src/paragraph.C (Erase): move fontlist.end() out of loop.
2348 (Erase): move insetlist.end() out of loop.
2350 * src/lyx_sendfax_main.C: make show_logfile static and to take a
2351 ref to const string as first arg. Move initialization of some
2352 variables, whitespace changes.
2354 * src/kbmap.C (defkey): move table.end() out of loop.
2355 (kb_keymap): move table.end() out of loop.
2356 (findbinding): move table.end() out of loop.
2358 * src/MenuBackend.C (hasMenu): move end() out of loop.
2359 (getMenu): move end() out of loop.
2360 (getMenu): move menulist_.end() out of loop.
2362 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
2364 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
2367 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
2368 (getFromLyXName): move infotab.end() out of loop.
2370 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
2371 -fvtable-thunks -ffunction-sections -fdata-sections
2373 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
2375 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
2378 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
2380 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
2382 * src/frontends/xforms/FormCitation.[Ch],
2383 src/frontends/xforms/FormIndex.[Ch],
2384 src/frontends/xforms/FormToc.[Ch],
2385 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
2387 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
2389 * src/commandtags.h: renamed, created some flags for citation
2392 * src/lyx_gui_misc.C: stripped out old FD_index_form code
2394 * src/lyxfunc.C (dispatch): use signals to insert index entry
2396 * src/frontends/Dialogs.h: new signal createIndex
2398 * src/frontends/xforms/FormCommand.[Ch],
2399 src/frontends/xforms/FormCitation.[Ch],
2400 src/frontends/xforms/FormToc.[Ch],
2401 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
2403 * src/insets/insetindex.[Ch]: GUI-independent
2405 * src/frontends/xforms/FormIndex.[Ch],
2406 * src/frontends/xforms/forms/form_index.fd: xforms implementation
2409 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
2411 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
2412 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
2414 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2416 * src/insets/insetref.C (Latex): rewrite so that there is now
2417 question that a initialization is requested.
2419 * src/insets/insetcommand.h: reenable the hide signal
2421 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2423 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
2424 fix handling of shortcuts (many bugs :)
2425 (add_lastfiles): ditto.
2427 * lib/ui/default.ui: fix a few shortcuts.
2429 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
2431 * Makefile.am: Fix ``rpmdist'' target to return the exit
2432 status of the ``rpm'' command, instead of the last command in
2433 the chain (the ``rm lyx.xpm'' command, which always returns
2436 2000-08-02 Allan Rae <rae@lyx.org>
2438 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
2439 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
2440 * src/frontends/xforms/FormToc.C (FormToc): ditto
2442 * src/frontends/xforms/Makefile.am: A few forgotten files
2444 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
2445 Signals-not-copyable-problem Lars' started commenting out.
2447 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
2449 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2451 * src/insets/insetcommand.h: Signals is not copyable so anoter
2452 scheme for automatic hiding of forms must be used.
2454 * src/frontends/xforms/FormCitation.h: don't inerit from
2455 noncopyable, FormCommand already does that.
2456 * src/frontends/xforms/FormToc.h: ditto
2457 * src/frontends/xforms/FormUrl.h: ditto
2459 * src/frontends/xforms/FormCitation.C: add include <algorithm>
2461 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
2463 * src/insets/insetcommand.h (hide): new SigC::Signal0
2464 (d-tor) new virtual destructor emits hide signal
2466 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
2467 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
2469 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
2470 LOF and LOT. Inset is now GUI-independent
2472 * src/insets/insetloa.[Ch]: redundant
2473 * src/insets/insetlof.[Ch]: ditto
2474 * src/insets/insetlot.[Ch]: ditto
2476 * src/frontends/xforms/forms/form_url.fd: tweaked!
2477 * src/frontends/xforms/forms/form_citation.fd: ditto
2479 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
2480 dialogs dealing with InsetCommand insets
2482 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
2483 FormCommand base class
2484 * src/frontends/xforms/FormUrl.[Ch]: ditto
2486 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
2488 * src/frontends/xforms/FormToc.[Ch]: ditto
2490 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
2491 passed a generic InsetCommand pointer
2492 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
2494 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
2495 and modified InsetTOC class
2496 * src/buffer.C: ditto
2498 * forms/lyx.fd: strip out old FD_form_toc code
2499 * src/lyx_gui_misc.C: ditto
2500 * src/lyx_gui.C: ditto
2501 * src/lyx_cb.C: ditto
2502 * src/lyx.[Ch]: ditto
2504 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2506 * src/support/utility.hpp: tr -d '\r'
2508 2000-08-01 Juergen Vigna <jug@sad.it>
2510 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
2512 * src/commandtags.h:
2513 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
2514 LFUN_TABULAR_FEATURES.
2516 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
2517 LFUN_LAYOUT_TABULAR.
2519 * src/insets/insettabular.C (getStatus): implemented helper function.
2521 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
2523 2000-07-31 Juergen Vigna <jug@sad.it>
2525 * src/text.C (draw): fixed screen update problem for text-insets.
2527 * src/text2.C (SetParagrpah): call an update of the inset-owner when
2528 something changed probably this has to be added in various other
2531 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
2533 2000-07-31 Baruch Even <baruch.even@writeme.com>
2535 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
2536 templates to satisfy compaq cxx.
2539 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2541 * src/support/translator.h (equal_1st_in_pair::operator()): take
2542 const ref pair_type as arg.
2543 (equal_2nd_in_pair::operator()): ditto
2544 (Translator::~Translator): remove empty d-tor.
2546 * src/graphics/GraphicsCache.C: move include config.h to top, also
2547 put initialization of GraphicsCache::singleton here.
2548 (~GraphicsCache): move here
2549 (addFile): take const ref as arg
2552 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
2554 * src/BufferView2.C (insertLyXFile): change te with/without header
2557 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2559 * src/frontends/xforms/FormGraphics.C (apply): add some
2560 static_cast. Not very nice, but required by compaq cxx.
2562 * src/frontends/xforms/RadioButtonGroup.h: include header
2563 <utility> instead of <pair.h>
2565 * src/insets/insetgraphicsParams.C: add using directive.
2566 (readResize): change return type to void.
2567 (readOrigin): ditto.
2569 * src/lyxfunc.C (getStatus): add missing break for build-program
2570 function; add test for Literate for export functions.
2572 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
2573 entries in Options menu.
2575 2000-07-31 Baruch Even <baruch.even@writeme.com>
2577 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
2578 protect against auto-allocation; release icon when needed.
2580 2000-07-31 Matej Cepl <CeplM@seznam.cz>
2582 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
2583 on usual typewriter.
2585 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
2586 earlier czech.kmap), useful only for programming.
2588 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2590 * src/frontends/xforms/FormCitation.h: fix conditioning around
2593 2000-07-31 Juergen Vigna <jug@sad.it>
2595 * src/frontends/xforms/FormTabular.C (local_update): changed
2596 radio_linebreaks to radio_useparbox and added radio_useminipage.
2598 * src/tabular.C: made support for using minipages/parboxes.
2600 * src/bufferlist.C (QwriteAll): small fix for asking for save.
2602 * src/insets/insetgraphics.C (draw): just draw the inset so that the
2604 (descent): so the cursor is in the middle.
2605 (width): bit smaller box.
2607 * src/insets/insetgraphics.h: added display() function.
2609 2000-07-31 Baruch Even <baruch.even@writeme.com>
2611 * src/frontends/Dialogs.h: Added showGraphics signals.
2613 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
2614 xforms form definition of the graphics dialog.
2616 * src/frontends/xforms/FormGraphics.h:
2617 * src/frontends/xforms/FormGraphics.C: Added files, the
2618 GUIndependent code of InsetGraphics
2620 * src/insets/insetgraphics.h:
2621 * src/insets/insetgraphics.C: Major writing to make it work.
2623 * src/insets/insetgraphicsParams.h:
2624 * src/insets/insetgraphicsParams.C: Added files, parameter passing
2625 struct between InsetGraphics and GUI.
2627 * src/LaTeXFeatures.h:
2628 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
2629 support for graphicx package.
2631 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
2632 for the graphics inset.
2634 * src/support/translator.h: Added file, used in
2635 InsetGraphicsParams. this is a template to translate between two
2638 * src/frontends/xforms/RadioButtonGroup.h:
2639 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
2640 way to easily control a radio button group.
2642 2000-07-28 Juergen Vigna <jug@sad.it>
2644 * src/insets/insettabular.C (LocalDispatch):
2645 (TabularFeatures): added support for lyx-functions of tabular features.
2646 (cellstart): refixed this function after someone wrongly changed it.
2648 * src/commandtags.h:
2649 * src/LyXAction.C (init): added support for tabular-features
2651 2000-07-28 Allan Rae <rae@lyx.org>
2653 * src/frontends/xforms/FormPreferences.C (build): Setup input return
2654 checking. NOTE: It seems that pressing ESC to cancel the dialog also
2655 triggers the callback for input checking. As a result we sometimes get
2656 "LyX: This shouldn't happen..." printed to cerr.
2657 (input): Started using status variable since I only free() on
2658 destruction. Some input checking for paths and font sizes.
2660 * src/frontends/xforms/FormPreferences.h: Use status to control
2661 activation of Ok and Apply
2663 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
2664 callback. Also resized to stop segfaults with 0.88. The problem is
2665 that xforms-0.88 requires the folder to be wide enough to fit all the
2666 tabs. If it isn't it causes all sorts of problems.
2668 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
2670 * src/frontends/xforms/forms/README: Reflect reality.
2672 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
2673 * src/frontends/xforms/forms/makefile: ditto.
2675 * src/commandtags.h: Get access to new Preferences dialog
2676 * src/LyXAction.C: ditto
2677 * src/lyxfunc.C: ditto
2678 * lib/ui/default.ui: ditto
2680 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2682 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
2684 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
2687 * src/frontends/xforms/form_url.[Ch]: added.
2689 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2691 * src/insets/insetbib.h: fixed bug in previous commit
2693 * src/frontends/xforms/FormUrl.h: ditto
2695 * src/frontends/xforms/FormPrint.h: ditto
2697 * src/frontends/xforms/FormPreferences.h: ditto
2699 * src/frontends/xforms/FormCopyright.h: ditto
2701 * src/frontends/xforms/FormCitation.C: ditto
2703 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
2704 private copyconstructor and private default contructor
2706 * src/support/Makefile.am: add utility.hpp
2708 * src/support/utility.hpp: new file from boost
2710 * src/insets/insetbib.h: set owner in clone
2712 * src/frontends/xforms/FormCitation.C: added missing include
2715 * src/insets/form_url.[Ch]: removed
2717 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
2719 * development/lyx.spec.in
2720 * Makefile.am: Fix buglet for LyX RPM generation resulting from
2721 file/directory re-organization.
2723 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
2725 * src/insets/insetcommand.[Ch]: moved the string data and
2726 associated manipulation methods into a new stand-alone class
2727 InsetCommandParams. This class has two additional methods
2728 getAsString() and setFromString() allowing the contents to be
2729 moved around as a single string.
2730 (addContents) method removed.
2731 (setContents) method no longer virtual.
2733 * src/buffer.C (readInset): made use of new InsetCitation,
2734 InsetUrl constructors based on InsetCommandParams.
2736 * src/commandtags.h: add LFUN_INSERT_URL
2738 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
2739 independent InsetUrl and use InsetCommandParams to extract
2740 string info and create new Insets.
2742 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
2744 * src/frontends/xforms/FormCitation.C (apply): uses
2747 * src/frontends/xforms/form_url.C
2748 * src/frontends/xforms/form_url.h
2749 * src/frontends/xforms/FormUrl.h
2750 * src/frontends/xforms/FormUrl.C
2751 * src/frontends/xforms/forms/form_url.fd: new files
2753 * src/insets/insetcite.[Ch]: removed unused constructors.
2755 * src/insets/insetinclude.[Ch]: no longer store filename
2757 * src/insets/inseturl.[Ch]: GUI-independent.
2759 2000-07-26 Juergen Vigna <jug@sad.it>
2760 * renamed frontend from gtk to gnome as it is that what is realized
2761 and did the necessary changes in the files.
2763 2000-07-26 Marko Vendelin <markov@ioc.ee>
2765 * configure.in: cleaning up gnome configuration scripts
2767 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2769 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
2770 shortcuts syndrom by redrawing them explicitely (a better solution
2771 would be appreciated).
2773 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
2775 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
2778 * src/lyx_cb.C (MenuExport): change html export to do the right
2779 thing depending of the document type (instead of having
2780 html-linuxdoc and html-docbook).
2781 * src/lyxfunc.C (getStatus): update for html
2782 * lib/ui/default.ui: simplify due to the above change.
2783 * src/menus.C (ShowFileMenu): update too (in case we need it).
2785 * src/MenuBackend.C (read): if a menu is defined twice, add the
2786 new entries to the exiting one.
2788 2000-07-26 Juergen Vigna <jug@sad.it>
2790 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
2792 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
2793 and return a bool if it did actual save the file.
2794 (AutoSave): don't autosave a unnamed doc.
2796 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
2797 check if this is an UNNAMED new file and react to it.
2798 (newFile): set buffer to unnamed and change to not mark a new
2799 buffer dirty if I didn't do anything with it.
2801 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
2803 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2805 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
2806 friend as per Angus's patch posted to lyx-devel.
2808 * src/ext_l10n.h: updated
2810 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
2811 gettext on the style string right before inserting them into the
2814 * autogen.sh: add code to extract style strings form layout files,
2815 not good enough yet.
2817 * src/frontends/gtk/.cvsignore: add MAKEFILE
2819 * src/MenuBackend.C (read): run the label strings through gettext
2820 before storing them in the containers.
2822 * src/ext_l10n.h: new file
2824 * autogen.sh : generate the ext_l10n.h file here
2826 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2828 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
2831 * lib/ui/default.ui: fix a couple of typos.
2833 * config/gnome/gtk.m4: added (and added to the list of files in
2836 * src/insets/insetinclude.C (unique_id): fix when we are using
2837 lyxstring instead of basic_string<>.
2838 * src/insets/insettext.C (LocalDispatch): ditto.
2839 * src/support/filetools.C: ditto.
2841 * lib/configure.m4: create the ui/ directory if necessary.
2843 * src/LyXView.[Ch] (updateToolbar): new method.
2845 * src/BufferView_pimpl.C (buffer): update the toolbar when
2846 opening/closing buffer.
2848 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2850 * src/LyXAction.C (getActionName): enhance to return also the name
2851 and options of pseudo-actions.
2852 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
2854 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
2855 as an example of what is possible). Used in File->Build too (more
2856 useful) and in the import/export menus (to mimick the complicated
2857 handling of linuxdoc and friends). Try to update all the entries.
2859 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
2862 * src/MenuBackend.C (read): Parse the new OptItem tag.
2864 * src/MenuBackend.h: Add a new optional_ data member (used if the
2865 entry should be omitted when the lyxfunc is disabled).
2867 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
2868 function, used as a shortcut.
2869 (create_submenu): align correctly the shortcuts on the widest
2872 * src/MenuBackend.h: MenuItem.label() only returns the label of
2873 the menu without shortcut; new method shortcut().
2875 2000-07-14 Marko Vendelin <markov@ioc.ee>
2877 * src/frontends/gtk/Dialogs.C:
2878 * src/frontends/gtk/FormCopyright.C:
2879 * src/frontends/gtk/FormCopyright.h:
2880 * src/frontends/gtk/Makefile.am: added these source-files for the
2881 Gtk/Gnome support of the Copyright-Dialog.
2883 * src/main.C: added Gnome::Main initialization if using
2884 Gtk/Gnome frontend-GUI.
2886 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
2888 * config/gnome/aclocal-include.m4
2889 * config/gnome/compiler-flags.m4
2890 * config/gnome/curses.m4
2891 * config/gnome/gnome--.m4
2892 * config/gnome/gnome-bonobo-check.m4
2893 * config/gnome/gnome-common.m4
2894 * config/gnome/gnome-fileutils.m4
2895 * config/gnome/gnome-ghttp-check.m4
2896 * config/gnome/gnome-gnorba-check.m4
2897 * config/gnome/gnome-guile-checks.m4
2898 * config/gnome/gnome-libgtop-check.m4
2899 * config/gnome/gnome-objc-checks.m4
2900 * config/gnome/gnome-orbit-check.m4
2901 * config/gnome/gnome-print-check.m4
2902 * config/gnome/gnome-pthread-check.m4
2903 * config/gnome/gnome-support.m4
2904 * config/gnome/gnome-undelfs.m4
2905 * config/gnome/gnome-vfs.m4
2906 * config/gnome/gnome-x-checks.m4
2907 * config/gnome/gnome-xml-check.m4
2908 * config/gnome/gnome.m4
2909 * config/gnome/gperf-check.m4
2910 * config/gnome/gtk--.m4
2911 * config/gnome/linger.m4
2912 * config/gnome/need-declaration.m4: added configuration scripts
2913 for Gtk/Gnome frontend-GUI
2915 * configure.in: added support for the --with-frontend=gtk option
2917 * autogen.sh: added config/gnome/* to list of config-files
2919 * acconfig.h: added define for GTKGUI-support
2921 * config/lyxinclude.m4: added --with-frontend[=value] option value
2922 for Gtk/Gnome frontend-GUI support.
2924 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2926 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
2930 * src/paragraph.C (GetChar): remove non-const version
2932 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
2933 (search_kw): use it.
2935 * src/lyx_main.C (init): if "preferences" exist, read that instead
2937 (ReadRcFile): return bool if the file could be read ok.
2938 (ReadUIFile): add a check to see if lex file is set ok.
2940 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
2941 bastring can be used instead of lyxstring (still uses the old code
2942 if std::string is good enough or if lyxstring is used.)
2944 * src/encoding.C: make the arrays static, move ininle functions
2946 * src/encoding.h: from here.
2948 * src/buffer.C: have last_isnet_read as a file scope variable for now.
2949 (parseSingleLyXformat2Token): move inset parsing to separate method
2950 (readInset): new private method
2952 * src/Variables.h: remove virtual from get().
2954 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
2955 access to NEW_INSETS and NEW_TABULAR
2957 * src/MenuBackend.h: remove superfluous forward declaration of
2958 MenuItem. Add documentations tags "///", remove empty MenuItem
2959 destructor, remove private default contructor.
2961 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
2963 (read): more string mlabel and mname to where they are used
2964 (read): remove unused variables mlabel and mname
2965 (defaults): unconditional clear, make menusetup take advantage of
2966 add returning Menu &.
2968 * src/LyXView.h: define NEW_MENUBAR as default
2970 * src/LyXAction.C: include lyxparagraph.h temporary to get access
2971 to NEW_INSETS and NEW_TABULAR.
2972 (init): commetn out some funcs that is obsolete when NEW_INSETS is
2973 defined. Change some of the "xxxx-inset-insert" functions names to
2976 * several files: more enahncements to NEW_INSETS and the resulting
2979 * lib/lyxrc.example (\date_insert_format): move to misc section
2981 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
2982 bastring and use AC_CACHE_CHECK.
2983 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
2984 the system have the newest methods. uses AC_CACHE_CHECK
2985 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
2986 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
2987 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
2989 * configure.in: add LYX_CXX_GOOD_STD_STRING
2991 * acinclude.m4: recreated
2993 2000-07-24 Amir Karger
2995 * README: add Hebrew, Arabic kmaps
2998 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3000 * src/buffer.C (writeFileAscii): Define actcell as an int instead
3003 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3005 * Lot of files: add pragma interface/implementation.
3007 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
3009 * lib/ui/default.ui: new file (ans new directory). Contains the
3010 default menu and toolbar.
3012 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
3013 global space. Toolbars are now read (as menus) in ui files.
3015 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
3017 * src/lyxfunc.C (getStatus): do not exit immediately if a command
3018 is disabled because the document is read-only. We want to have the
3019 toggle state of the function anyway.
3020 (getStatus): add code for LFUN_VC* functions (mimicking what is
3021 done in old-style menus)
3023 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
3024 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
3026 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
3027 * src/BufferView_pimpl.C: ditto.
3028 * src/lyxfunc.C: ditto.
3030 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
3031 default). This replaces old-style menus by new ones.
3033 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
3034 MenuItem. Contain the data structure of a menu.
3036 * src/insets/insettext.C: use LyXView::setLayout instead of
3037 accessing directly the toolbar combox.
3038 * src/lyxfunc.C (Dispatch): ditto.
3040 * src/LyXView.C (setLayout): new method, which just calls
3041 Toolbar::setLayout().
3042 (updateLayoutChoice): move part of this method in Toolbar.
3044 * src/toolbar.[Ch]: removed.
3046 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
3047 implementation the toolbar.
3049 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
3050 the toolbar. It might make sense to merge it with ToolbarDefaults
3052 (setLayout): new function.
3053 (updateLayoutList): ditto.
3054 (openLayoutList): ditto.
3056 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
3057 xforms implementation of the toolbar.
3058 (get_toolbar_func): comment out, since I do not
3059 know what it is good for.
3061 * src/ToolbarDefaults.h: Add the ItemType enum.
3063 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
3064 for a list of allocated C strings. Used in Menubar xforms
3065 implementation to avoid memory leaks.
3067 * src/support/lstrings.[Ch] (uppercase): new version taking and
3071 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
3072 * lib/bind/emacs.bind: ditto.
3074 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3076 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
3077 forward decl of LyXView.
3079 * src/toolbar.C (toolbarItem): moved from toolbar.h
3080 (toolbarItem::clean): ditto
3081 (toolbarItem::~toolbarItem): ditto
3082 (toolbarItem::operator): ditto
3084 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
3086 * src/paragraph.h: control the NEW_TABULAR define from here
3088 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
3089 USE_TABULAR_INSETS to NEW_TABULAR
3091 * src/ToolbarDefaults.C: add include "lyxlex.h"
3093 * files using the old table/tabular: use NEW_TABULAR to control
3094 compilation of old tabular stuff.
3096 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
3099 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
3100 planemet in reading of old style floats, fix the \end_deeper
3101 problem when reading old style floats.
3103 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3105 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
3107 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
3109 * lib/bind/sciword.bind: updated.
3111 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3113 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
3114 layout write problem
3116 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3118 * src/Makefile.am (INCLUDES): remove image directory from include
3121 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
3122 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
3124 * src/LyXView.C (create_form_form_main): read the application icon
3127 * lib/images/*.xpm: change the icons to use transparent color for
3130 * src/toolbar.C (update): change the color of the button when it
3133 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3135 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
3136 setting explicitely the minibuffer.
3137 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
3139 * src/LyXView.C (showState): new function. Shows font information
3140 in minibuffer and update toolbar state.
3141 (LyXView): call Toolbar::update after creating the
3144 * src/toolbar.C: change toollist to be a vector instead of a
3146 (BubbleTimerCB): get help string directly from the callback
3147 argument of the corresponding icon (which is the action)
3148 (set): remove unnecessary ugliness.
3149 (update): new function. update the icons (depressed, disabled)
3150 depending of the status of the corresponding action.
3152 * src/toolbar.h: remove help in toolbarItem
3154 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
3156 * src/Painter.C (text): Added code for using symbol glyphs from
3157 iso10646 fonts. Currently diabled.
3159 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
3162 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
3163 magyar,turkish and usorbian.
3165 * src/paragraph.C (isMultiLingual): Made more efficient.
3167 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
3170 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
3171 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
3172 Also changed the prototype to "bool math_insert_greek(char)".
3174 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3176 * lots of files: apply the NEW_INSETS on all code that will not be
3177 needed when we move to use the new insets. Enable the define in
3178 lyxparagrah.h to try it.
3180 * src/insets/insettabular.C (cellstart): change to be a static
3182 (InsetTabular): initialize buffer in the initializer list.
3184 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
3186 * src/frontends/xforms/FormPrint.[Ch] : moved #include
3187 form_print.h out of the header file. Replaced with forward
3188 declarations of the relevant struct.
3190 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
3193 * src/commandtags.h: do not include "debug.h" which does not
3194 belong there. #include it in some other places because of this
3197 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3199 * src/insets/insetcaption.C: add a couple "using" directives.
3201 * src/toolbar.C (add): get the help text directly from lyxaction.
3203 (setPixmap): new function. Loads from disk and sets a pixmap on a
3204 botton; the name of the pixmap file is derived from the command
3207 * src/toolbar.h: remove members isBitmap and pixmap from
3210 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
3211 * lib/images/: move many files from images/banner.xpm.
3213 * src/lyx_gui.C (create_forms): read banner pixmap from file.
3215 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
3216 * src/toolbar.C: ditto.
3217 * configure.in: ditto.
3218 * INSTALL: document.
3220 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
3221 the spellchecker popup is closed from the WM.
3223 2000-07-19 Juergen Vigna <jug@sad.it>
3225 * src/insets/insetfloat.C (Write): small fix because we use the
3226 insetname for the type now!
3228 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
3230 * src/frontends/xforms/forms/form_citation.fd: object sizes are
3233 * src/frontends/Dialogs.h: removed hideCitation signal
3235 * src/insets/insetcite.h: added hide signal
3237 * src/insets/insetcite.C (~InsetCitation): emits new signal
3238 (getScreenLabel): "intelligent" label should now fit on the screen!
3240 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
3242 * src/frontends/xforms/FormCitation.C (showInset): connects
3243 hide() to the inset's hide signal
3244 (show): modified to use fl_set_object_position rather than
3245 fl_set_object_geometry wherever possible
3247 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3249 * src/insets/lyxinset.h: add caption code
3251 * src/insets/insetfloat.C (type): new method
3253 * src/insets/insetcaption.C (Write): new method
3255 (LyxCode): new method
3257 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
3258 to get it right together with using the FloatList.
3260 * src/commandtags.h: add LFUN_INSET_CAPTION
3261 * src/lyxfunc.C (Dispatch): handle it
3263 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
3266 * src/Variables.[Ch]: make expand take a const reference, remove
3267 the destructor, some whitespace changes.
3269 * src/LyXAction.C (init): add caption-inset-insert
3271 * src/FloatList.C (FloatList): update the default floats a bit.
3273 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3275 * src/Variables.[Ch]: new files. Intended to be used for language
3276 specific strings (like \chaptername) and filename substitution in
3279 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
3281 * lib/kbd/american.kmap: update
3283 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
3285 * src/bufferparams.[Ch]: remove member allowAccents.
3287 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
3289 * src/LaTeXLog.C: use the log_form.h header.
3290 * src/lyx_gui.C: ditto.
3291 * src/lyx_gui_misc.C: ditto.
3292 * src/lyxvc.h: ditto.
3294 * forms/log_form.fd: new file, created from latexoptions.fd. I
3295 kept the log popup and nuked the options form.
3297 * src/{la,}texoptions.[Ch]: removed.
3298 * src/lyx_cb.C (LaTeXOptions): ditto
3300 * src/lyx_gui.C (create_forms): do not handle the
3301 fd_latex_options form.
3303 2000-07-18 Juergen Vigna <jug@sad.it>
3305 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
3306 name of the inset so that it can be requested outside (text2.C).
3308 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
3311 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3313 * src/mathed/formula.h (ConvertFont): constify
3315 * src/mathed/formula.C (Read): add warning if \end_inset is not
3316 found on expected place.
3318 * src/insets/lyxinset.h (ConvertFont): consify
3320 * src/insets/insetquotes.C (ConvertFont): constify
3321 * src/insets/insetquotes.h: ditto
3323 * src/insets/insetinfo.h: add labelfont
3325 * src/insets/insetinfo.C (InsetInfo): set the labelfont
3326 (ascent): use labelfont
3330 (Write): make .lyx file a bit nicer
3332 * src/insets/insetfloat.C (Write): simplify somewhat...
3333 (Read): add warning if arg is not found
3335 * src/insets/insetcollapsable.C: add using std::max
3336 (Read): move string token and add warning in arg is not found
3337 (draw): use std::max to get the right ty
3338 (getMaxWidth): simplify by using std::max
3340 * src/insets/insetsection.h: new file
3341 * src/insets/insetsection.C: new file
3342 * src/insets/insetcaption.h: new file
3343 * src/insets/insetcaption.C: new file
3345 * src/insets/inset.C (ConvertFont): constify signature
3347 * src/insets/Makefile.am (libinsets_la_SOURCES): add
3348 insetcaption.[Ch] and insetsection.[Ch]
3350 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
3351 uses to use LABEL_COUNTER_CHAPTER instead.
3352 * src/text2.C (SetCounter): here
3354 * src/counters.h: new file
3355 * src/counters.C: new file
3356 * src/Sectioning.h: new file
3357 * src/Sectioning.C: new file
3359 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
3361 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3363 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
3366 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
3369 2000-07-17 Juergen Vigna <jug@sad.it>
3371 * src/tabular.C (Validate): check if array-package is needed.
3372 (SetVAlignment): added support for vertical alignment.
3373 (SetLTFoot): better support for longtable header/footers
3374 (Latex): modified to support added features.
3376 * src/LaTeXFeatures.[Ch]: added array-package.
3378 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
3380 * src/lyx_gui.C (LyXGUI): make sure that the height is large
3383 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
3385 * configure.in: do not forget to put a space after -isystem.
3387 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
3389 * lib/kbd/arabic.kmap: a few fixes.
3391 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3393 * some whitespace chagnes to a number of files.
3395 * src/support/DebugStream.h: change to make it easier for
3396 doc++ to parse correctly.
3397 * src/support/lyxstring.h: ditto
3399 * src/mathed/math_utils.C (compara): change to have only one
3401 (MathedLookupBOP): change because of the above.
3403 * src/mathed/math_delim.C (math_deco_compare): change to have only
3405 (search_deco): change becasue of the above.
3407 * src/insets/insettabular.C (DrawCellSelection): use std::swap
3408 instead of manually coded one.
3410 * src/insets/insetquotes.C (Read): read the \end_inset too
3412 * src/insets/insetlatex.h: remove file
3413 * src/insets/insetlatex.C: remove file
3415 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
3417 (InsetPrintIndex): remove destructor
3419 * src/insets/insetinclude.h: remove default constructor
3421 * src/insets/insetfloat.C: work to make it work better
3423 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
3425 * src/insets/insetcite.h (InsetCitation): remove default constructor
3427 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
3429 * src/text.C (GetColumnNearX): comment out some currently unused code.
3431 * src/paragraph.C (writeFile): move some initializations closer to
3433 (CutIntoMinibuffer): small change to use new matchIT operator
3437 (InsertInset): ditto
3440 (InsetIterator): ditto
3441 (Erase): small change to use new matchFT operator
3443 (GetFontSettings): ditto
3444 (HighestFontInRange): ditto
3447 * src/lyxparagraph.h: some chars changed to value_type
3448 (matchIT): because of some stronger checking (perhaps too strong)
3449 in SGI STL, the two operator() unified to one.
3452 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
3454 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
3455 the last inset read added
3456 (parseSingleLyXformat2Token): some more (future) compability code added
3457 (parseSingleLyXformat2Token): warning about solitary \end_inset added
3458 (parseSingleLyXformat2Token): set last_inset_read
3459 (parseSingleLyXformat2Token): more code to read new "Float" correctly
3460 (parseSingleLyXformat2Token): don't double intializw string next_token
3462 * src/TextCache.C (text_fits::operator()): add const's to the signature
3463 (has_buffer::operator()): ditto
3465 * src/Floating.h: add some comments on the class
3467 * src/FloatList.[Ch] (typeExist): new method
3470 * src/BackStack.h: added default constructor, wanted by Gcc.
3472 2000-07-14 Juergen Vigna <jug@sad.it>
3474 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
3476 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
3478 * src/insets/insettabular.C (resizeLyXText): need this to be able to
3479 do a redraw when the window is resized!
3480 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
3482 * src/insets/insettext.C (resizeLyXText): added function to correctly
3483 being able to resize the LyXWindow.
3485 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
3487 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
3489 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
3490 crashes when closing dialog to a deleted inset.
3492 * src/insets/insetcite.[Ch] (Edit) : the return of this former
3493 method! Now similar to other insets.
3495 2000-07-13 Juergen Vigna <jug@sad.it>
3497 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
3499 * lib/examples/Literate.lyx: small patch!
3501 * src/insets/insetbib.C (Read): added this function because of wrong
3502 Write (without [begin|end]_inset).
3504 2000-07-11 Juergen Vigna <jug@sad.it>
3506 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
3507 as the insertInset could not be good!
3509 * src/screen.C (ToggleSelection): fixed toggle selection bug as
3510 the bool param should not be last.
3512 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3514 * sigc++/configure.in: fix bug in threading-related code (Yes, I
3515 did submit that to Karl).
3517 * configure.in: use -isystem instead of -I for X headers. This
3518 fixes a problem on solaris with a recent gcc;
3519 put the front-end code after the X detection code;
3520 configure in sigc++ before lib/
3522 * src/lyx_main.C (commandLineHelp): remove -display from command
3525 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
3527 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
3528 Also put in Makefile rules for building the ``listerrors''
3529 program for parsing errors from literate programs written in LyX.
3531 * lib/build-listerrors: Added small shell script as part of compile
3532 process. This builds a working ``listerrors'' binary if noweb is
3533 installed and either 1) the VNC X server is installed on the machine,
3534 or 2) the user is compiling from within a GUI. The existence of a GUI
3535 is necessary to use the ``lyx --export'' feature for now. This
3536 hack can be removed once ``lyx --export'' no longer requires a GUI to
3539 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
3541 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
3542 now passed back correctly from gcc and placed "under" error
3543 buttons in a Literate LyX source.
3545 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3547 * src/text.C (GetColumnNearX): Better behavior when a RTL
3548 paragraph is ended by LTR text.
3550 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
3553 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3555 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
3556 true when clipboard is empty.
3558 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3560 * text.C (Backspace): Prevent rebreaking of a row if it is the last
3561 row of the paragraph.
3562 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
3563 to prevent calculation of bidi tables
3565 2000-07-07 Juergen Vigna <jug@sad.it>
3567 * src/screen.C (ToggleSelection): added y_offset and x_offset
3570 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
3573 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
3575 * src/insets/insettext.C: fixed Layout-Display!
3577 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3579 * configure.in: add check for strings.h header.
3581 * src/spellchecker.C: include <strings.h> in order to have a
3582 definition for bzero().
3584 2000-07-07 Juergen Vigna <jug@sad.it>
3586 * src/insets/insettext.C (draw): set the status of the bv->text to
3587 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
3589 * src/screen.C (DrawOneRow):
3590 (DrawFromTo): redraw the actual row if something has changed in it
3593 * src/text.C (draw): call an update of the toplevel-inset if something
3594 has changed inside while drawing.
3596 * src/lyxtext.h: added CHANGED_IN_DRAW status.
3598 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
3600 * src/insets/insetbib.[Ch] (callback) new method, moving callback
3601 processing inside class.
3603 * src/insets/insetindex.[Ch] (callback) new method, moving callback
3604 processing inside class.
3606 * src/insets/insetindex.h new struct Holder, consistent with other
3609 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
3610 citation dialog from main code and placed it in src/frontends/xforms.
3611 Dialog launched through signals instead of callbacks
3613 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
3615 * lyx.man: update the options description.
3617 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
3619 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
3620 handle neg values, set min width to 590, add doc about -display
3622 2000-07-05 Juergen Vigna <jug@sad.it>
3624 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
3625 calls to BufferView *.
3627 * src/insets/insettext.C (checkAndActivateInset): small fix non
3628 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
3630 * src/insets/insetcommand.C (Read): Fixed as insets should read till
3631 their \end_inset token!
3633 2000-07-04 edscott <edscott@imp.mx>
3635 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
3636 lib/lyxrc.example: added option \wheel_jump
3638 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
3640 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
3641 remove support for -width,-height,-xpos and -ypos.
3643 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
3645 * src/encoding.[Ch]: New files.
3647 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
3648 (text): Call to the underline() method only when needed.
3650 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
3652 * src/buffer.C (makeLaTeXFile): Compute automatically the input
3653 encoding(s) for the document.
3655 * src/bufferparams.C (BufferParams): Changed default value of
3658 * src/language.C (newLang): Removed.
3659 (items[]): Added encoding information for all defined languages.
3661 * src/lyx_gui.C (create_forms): Added "auto" option to the input
3662 encoding choice button.
3664 * src/lyxrc.h (font_norm_type): New member variable.
3665 (set_font_norm_type): New method.
3667 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
3668 paragraphs with different encodings.
3670 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
3671 (TransformChar): Changed to work correctly with Arabic points.
3672 (draw): Added support for drawing Arabic points.
3673 (draw): Removed code for drawing underbars (this is done by
3676 * src/support/textutils.h (IsPrintableNonspace): New function.
3678 * src/BufferView_pimpl.h: Added "using SigC::Object".
3679 * src/LyXView.h: ditto.
3681 * src/insets/insetinclude.h (include_label): Changed to mutable.
3683 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3685 * src/mathed/math_iter.h: remove empty destructor
3687 * src/mathed/math_cursor.h: remove empty destructor
3689 * src/insets/lyxinset.h: add THEOREM_CODE
3691 * src/insets/insettheorem.[Ch]: new files
3693 * src/insets/insetminipage.C: (InsertInset): remove
3695 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
3697 (InsertInset): remove
3699 * src/insets/insetlist.C: (InsertList): remove
3701 * src/insets/insetfootlike.[Ch]: new files
3703 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
3706 (InsertInset): ditto
3708 * src/insets/insetert.C: remove include Painter.h, reindent
3709 (InsertInset): move to header
3711 * src/insets/insetcollapsable.h: remove explicit from default
3712 contructor, remove empty destructor, add InsertInset
3714 * src/insets/insetcollapsable.C (InsertInset): new func
3716 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3718 * src/vspace.h: add explicit to constructor
3720 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
3721 \textcompwordmark, please test this.
3723 * src/lyxrc.C: set ascii_linelen to 65 by default
3725 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
3727 * src/commandtags.h: add LFUN_INSET_THEOREM
3729 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
3730 (makeLinuxDocFile): remove _some_ of the nice logic
3731 (makeDocBookFile): ditto
3733 * src/Painter.[Ch]: (~Painter): removed
3735 * src/LyXAction.C (init): entry for insettheorem added
3737 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
3739 (deplog): code to detect files generated by LaTeX, needs testing
3742 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3744 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
3746 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3748 * src/LaTeX.C (deplog): Add a check for files that are going to be
3749 created by the first latex run, part of the project to remove the
3752 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
3753 contents to the extension list.
3755 2000-07-04 Juergen Vigna <jug@sad.it>
3757 * src/text.C (NextBreakPoint): added support for needFullRow()
3759 * src/insets/lyxinset.h: added needFullRow()
3761 * src/insets/insetcollapsable.C: redone now this uses a text-inset
3764 * src/insets/insettext.C: lots of changes for update!
3766 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
3768 * src/LaTeXFeatures.h: add a missing std:: qualifier.
3770 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
3772 * src/insets/insetinclude.C (InsetInclude): fixed
3773 initialization of include_label.
3774 (unique_id): now returns a string.
3776 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
3778 * src/LaTeXFeatures.h: new member IncludedFiles, for
3779 a map of key, included file name.
3781 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
3782 with the included files for inclusion in SGML preamble,
3783 i. e., linuxdoc and docbook.
3786 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
3787 nice (is the generated linuxdoc code to be exported?), that
3788 allows to remove column, and only_body that will be true for
3789 slave documents. Insets are allowed inside SGML font type.
3790 New handling of the SGML preamble for included files.
3791 (makeDocBookFile): the same for docbook.
3793 * src/insets/insetinclude.h:
3794 * src/insets/insetinclude.C (Validate): keeps a list of included files.
3796 (DocBook): new export methods.
3798 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
3799 and makeDocBookFile.
3801 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
3802 formats to export with command line argument -x.
3804 2000-06-29 Juergen Vigna <jug@sad.it>
3806 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
3807 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
3809 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
3810 region could already been cleared by an inset!
3812 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3814 * src/BufferView_pimpl.h: remove member variables lyx_focus and
3817 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
3819 (cursorToggle): remove special handling of lyx focus.
3821 2000-06-28 Juergen Vigna <jug@sad.it>
3823 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
3826 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3828 * src/insets/insetindex.C (Edit): add a callback when popup is
3831 * src/insets/insettext.C (LocalDispatch):
3832 * src/insets/insetmarginal.h:
3833 * src/insets/insetlist.h:
3834 * src/insets/insetfoot.h:
3835 * src/insets/insetfloat.h:
3836 * src/insets/insetert.h: add a missing std:: qualifier.
3838 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3840 * src/support/lyxsum.C (sum): '\0' teminate file read when using
3843 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
3845 * src/insets/insettext.C (Read): remove tmptok unused variable
3846 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
3847 (InsertInset): change for new InsetInset code
3849 * src/insets/insettext.h: add TEXT inline method
3851 * src/insets/insettext.C: remove TEXT macro
3853 * src/insets/insetmarginal.C (Write): new method
3854 (Latex): change output slightly
3856 * src/insets/insetfoot.C (Write): new method
3857 (Latex): change output slightly (don't use endl when no need)
3859 * src/insets/insetert.C (Write): new method
3861 * src/insets/insetcollapsable.h: make button_length, button_top_y
3862 and button_bottm_y protected.
3864 * src/insets/insetcollapsable.C (Write): simplify code by using
3865 tostr. Also do not output the float name, the children class
3866 should to that to get control over own arguments
3868 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
3869 src/insets/insetminipage.[Ch]:
3872 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3874 * src/lyxfunc.C (Dispatch): cases for new insets/commands
3876 * src/Makefile.am (lyx_SOURCES): add the new files
3878 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
3879 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
3880 * src/commandtags.h: ditto
3882 * src/LaTeXFeatures.h: add a std::set of used floattypes
3884 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
3886 * src/FloatList.[Ch] src/Floating.h: new files
3888 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
3890 * src/lyx_cb.C (TableApplyCB): ditto
3892 * src/text2.C: ditto
3893 * src/buffer.C (SimpleLinuxDocOnePar): ditto
3894 (parseSingleLyXformat2Token): ditto + add code for
3895 backwards compability for old float styles + add code for new insets
3897 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
3899 (InsertInset(size_type, Inset *, LyXFont)): new method
3900 (InsetChar(size_type, char)): changed to use the other InsetChar
3901 with a LyXFont(ALL_INHERIT).
3902 (InsetInset(size_type, Inset*)): changed to use InsetChar to
3903 insert the META_INSET.
3905 * sigc++/thread.cc (Privete<int>::operator int&): move definition
3907 * sigc++/thread.h (Threads): from here
3909 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
3910 definition out of line
3911 * sigc++/scope.h: from here
3913 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3915 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
3916 is specified (adapted from a patch from edscott <edscott@imp.mx>).
3918 * Makefile.am (bindist): new target.
3920 * INSTALL: add instructions for doing a binary distribution.
3922 * development/tools/README.bin.example: update a bit.
3924 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
3927 * lib/lyxrc.example: new lyxrc tag \set_color.
3929 * src/lyxfunc.C (Dispatch):
3930 * src/commandtags.h:
3931 * src/LyXAction.C: new lyxfunc "set-color".
3933 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
3934 and an x11name given as strings.
3936 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
3937 cache when a color is changed.
3939 2000-06-26 Juergen Vigna <jug@sad.it>
3941 * src/lyxrow.C (width): added this functions and variable.
3943 * src/insets/insetcite.C (create_form_citation_form): some Gravity
3946 * src/text.C (SetHeightOfRow): fixed calcualting of width.
3948 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3950 * images/undo_bw.xpm: new icon.
3951 * images/redo_bw.xpm: ditto.
3953 * configure.in (INSTALL_SCRIPT): change value to
3954 ${INSTALL} to avoid failures of install-script target.
3955 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
3957 * src/BufferView.h: add a magic "friend" declaration to please
3960 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
3962 * forms/cite.fd: modified to allow resizing without messing
3965 * src/insetcite.C: Uses code from cite.fd almost without
3967 User can now resize dialog in the x-direction.
3968 Resizing the dialog in the y-direction is prevented, as the
3969 code does this intelligently already.
3971 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3973 * INSTALL: remove obsolete entry in "problems" section.
3975 * lib/examples/sl_*.lyx: update of the slovenian examples.
3977 * src/support/FileInfo.[Ch] (getBlockSize): remove.
3979 2000-06-23 Juergen Vigna <jug@sad.it>
3981 * src/lyxtext.h: added a 'cleared' flag to draw() function.
3983 * src/buffer.C (resize): delete the LyXText of textinsets.
3985 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
3987 * src/insets/lyxinset.h: added another parameter 'cleared' to
3988 the draw() function.
3990 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
3991 unlocking inset in inset.
3993 2000-06-22 Juergen Vigna <jug@sad.it>
3995 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
3996 of insets and moved first to LyXText.
3998 * src/mathed/formulamacro.[Ch]:
3999 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
4001 2000-06-21 Juergen Vigna <jug@sad.it>
4003 * src/text.C (GetVisibleRow): look if I should clear the area or not
4004 using Inset::doClearArea() function.
4006 * src/insets/lyxinset.h: added doClearArea() function and
4007 modified draw(Painter &, ...) to draw(BufferView *, ...)
4009 * src/text2.C (UpdateInset): return bool insted of int
4011 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
4013 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
4014 combox in the character popup
4016 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
4017 BufferParams const & params
4019 2000-06-20 Juergen Vigna <jug@sad.it>
4021 * src/insets/insettext.C (SetParagraphData): set insetowner on
4024 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4026 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
4027 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
4029 (form_main_): remove
4031 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
4032 (create_form_form_main): remove FD_form_main stuff, connect to
4033 autosave_timeout signal
4035 * src/LyXView.[Ch] (getMainForm): remove
4036 (UpdateTimerCB): remove
4037 * src/BufferView_pimpl.h: inherit from SigC::Object
4039 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
4040 signal instead of callback
4042 * src/BufferView.[Ch] (cursorToggleCB): remove
4044 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4046 * src/BufferView_pimpl.C: changes because of the one below
4048 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
4049 instead of storing a pointer to a LyXText.
4051 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
4053 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
4055 * src/lyxparagraph.h
4057 * src/paragraph.C: Changed fontlist to a sorted vector.
4059 2000-06-19 Juergen Vigna <jug@sad.it>
4061 * src/BufferView.h: added screen() function.
4063 * src/insets/insettext.C (LocalDispatch): some selection code
4066 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
4068 * src/insets/insettext.C (SetParagraphData):
4070 (InsetText): fixes for multiple paragraphs.
4072 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
4074 * development/lyx.spec.in: Call configure with ``--without-warnings''
4075 to work around a bug with the Makefiles when doing ``make lyxrpm''.
4076 This should be fine, however, since we generally don't want to be
4077 verbose when making an RPM.
4079 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
4081 * lib/scripts/fig2pstex.py: New file
4083 2000-06-16 Juergen Vigna <jug@sad.it>
4085 * src/insets/insettabular.C (UpdateLocal):
4086 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
4087 (LocalDispatch): Changed all functions to use LyXText.
4089 2000-06-15 Juergen Vigna <jug@sad.it>
4091 * src/text.C (SetHeightOfRow): call inset::update before requesting
4094 * src/insets/insettext.C (update):
4095 * src/insets/insettabular.C (update): added implementation
4097 * src/insets/lyxinset.h: added update function
4099 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4101 * src/text.C (SelectNextWord): protect against null pointers with
4102 old-style string streams. (fix from Paul Theo Gonciari
4105 * src/cite.[Ch]: remove erroneous files.
4107 * lib/configure.m4: update the list of created directories.
4109 * src/lyxrow.C: include <config.h>
4110 * src/lyxcursor.C: ditto.
4112 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4114 * lib/examples/decimal.lyx: new example file from Mike.
4116 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
4117 to find template definitions (from Dekel)
4119 * src/frontends/.cvsignore: add a few things.
4121 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
4123 * src/Timeout.C (TimeOut): remove default argument.
4125 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
4128 * src/insets/ExternalTemplate.C: add a "using" directive.
4130 * src/lyx_main.h: remove the act_ struct, which seems unused
4133 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4135 * LyX Developers Meeting: All files changed, due to random C++ (by
4136 coincidence) code generator script.
4138 - external inset (cool!)
4139 - initial online editing of preferences
4140 - insettabular breaks insettext(s contents)
4142 - some DocBook fixes
4143 - example files update
4144 - other cool stuff, create a diff and look for yourself.
4146 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
4148 * src/insets/insettext.C (computeTextRows): if the maxWidth is
4149 -1 this is a non-line-breaking textinset.
4151 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
4152 if there is no width set.
4154 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4156 * Lots of files: Merged the dialogbase branch.
4158 2000-06-09 Allan Rae <rae@lyx.org>
4160 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
4161 and the Dispatch methods that used it.
4163 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
4164 access to functions formerly kept in Dispatch.
4166 2000-05-19 Allan Rae <rae@lyx.org>
4168 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
4169 made to_page and count_copies integers again. from_page remains a
4170 string however because I want to allow entry of a print range like
4171 "1,4,22-25" using this field.
4173 * src/LyXAction.C: added action info and commands for buffer-print-xtl
4174 and printer-params-get. These aren't useful from the minibuffer but
4175 could be used by a script/LyXServer app provided it passes a suitable
4176 auto_mem_buffer. I guess I should take a look at how the LyXServer
4177 works and make it support xtl buffers.
4179 * sigc++/: updated to libsigc++-1.0.1
4181 * src/xtl/: updated to xtl-1.3.pl.11
4183 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
4184 those changes done to the files in src/ are actually recreated when
4185 they get regenerated. Please don't ever accept a patch that changes a
4186 dialog unless that patch includes the changes to the corresponding *.fd
4189 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
4190 stringOnlyContains, renamed it and generalised it.
4192 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
4193 branch. Removed the remaining old form_print code.
4195 2000-04-26 Allan Rae <rae@lyx.org>
4197 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
4198 trap I was trying to fix with the ID: fields in src/xtl/ :-)
4200 2000-04-25 Allan Rae <rae@lyx.org>
4202 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
4203 against a base of xtl-1.3.pl.4
4205 * development/tools/lxtl.sh: fixed a couple of silly typos and now
4206 filter the Id: entries so they still show the xtl version number
4209 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
4210 into the src/xtl code. Patch still pending with José (XTL)
4212 2000-04-24 Allan Rae <rae@lyx.org>
4214 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
4215 both more generic and much safer. Use the new template functions.
4216 * src/buffer.[Ch] (Dispatch): ditto.
4218 * src/frontends/xforms/FormPrint.C (update): Use new template functions
4219 and mem buffer more intelligently. Also a little general cleanup.
4222 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
4223 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
4224 * src/xtl/Makefile.am: ditto.
4225 * src/xtl/.cvsignore: ditto.
4226 * src/Makefile.am: ditto.
4228 * src/PrinterParams.h: Removed the macros member functions. Added a
4229 testInvariant member function. A bit of tidying up and commenting.
4230 Included Angus's idea for fixing operation with egcs-1.1.2.
4232 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
4233 cool expansion of XTL's mem_buffer to support automatic memory
4234 management within the buffer itself. Removed the various macros and
4235 replaced them with template functions that use either auto_mem_buffer
4236 or mem_buffer depending on a #define. The mem_buffer support will
4237 disappear as soon as the auto_mem_buffer is confirmed to be good on
4238 other platforms/compilers. That is, it's there so you've got something
4241 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
4242 effectively forked XTL. However I expect José will include my code
4243 into the next major release. Also fixed a memory leak.
4244 * src/xtl/text.h: ditto.
4245 * src/xtl/xdr.h: ditto.
4246 * src/xtl/giop.h: ditto.
4248 2000-04-16 Allan Rae <rae@lyx.org>
4250 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
4251 by autogen.sh and removed by maintainer-clean anyway.
4252 * .cvsignore, sigc++/.cvsignore: Support the above.
4254 * sigc++/.cvsignore: Forgot that retbind.h was generated.
4256 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
4258 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
4259 macros, renamed static callback-target member functions to suit new
4260 scheme and made them public.
4261 * src/frontends/xforms/forms/form_print.fd: ditto.
4262 * src/frontends/xforms/forms/form_copyright.fd: ditto.
4264 * src/support/lxtl.h: small cleanup to use typedef instead of #define
4267 * src/xtl/: New directory containing a minimal distribution of XTL.
4268 This is XTL-1.3.pl.4.
4270 * development/tools/lxtl.sh: A script to generate the above mini-dist.
4272 2000-04-15 Allan Rae <rae@lyx.org>
4274 * development/tools/makeLyXsigc.sh: Remove the library version numbers
4276 * sigc++/: Updated to libsigc++-1.0.0
4278 2000-04-14 Allan Rae <rae@lyx.org>
4280 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
4281 use the generic ones in future. I'll modify my conversion script.
4283 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
4285 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
4286 (CloseAllBufferRelatedDialogs): Renamed.
4287 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
4289 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
4290 of the generic ones. These are the same ones my conversion script
4293 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
4294 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
4295 * src/buffer.C (Dispatch): ditto
4297 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
4298 functions for updating and hiding buffer dependent dialogs.
4299 * src/BufferView.C (buffer): ditto
4300 * src/buffer.C (setReadonly): ditto
4301 * src/lyxfunc.C (CloseBuffer): ditto
4303 * src/buffer.h: Take setReadonly() out of line so I don't have to include
4304 Dialogs.h, and hence all the SigC stuff, into every file that includes
4305 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
4307 * src/BufferView2.C: reduce the number of headers included by buffer.h
4309 2000-04-11 Allan Rae <rae@lyx.org>
4311 * src/frontends/xforms/xform_macros.h: A small collection of macros
4312 for building C callbacks.
4314 * src/frontends/xforms/Makefile.am: Added above file.
4316 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
4317 scheme again. This time it should work for JMarc. If this is
4318 successful I'll revise my conversion script to automate some of this.
4319 The static member functions in the class also have to be public for
4320 this scheme will work. If the scheme works (it's almost identical to
4321 the way BufferView::cursorToggleCB is handled so it should work) then
4322 FormCopyright and FormPrint will be ready for inclusion into the main
4323 trunk immediately after 1.1.5 is released -- provided we're prepared
4324 for complaints about lame compilers not handling XTL.
4326 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
4328 2000-04-07 Allan Rae <rae@lyx.org>
4330 * config/lyxinclude.m4: A bit more tidying up (Angus)
4332 * src/LString.h: JMarc's <string> header fix
4334 * src/PrinterParams.h: Used string for most data to remove some
4335 ugly code in the Print dialog and avoid even uglier code when
4336 appending the ints to a string for output.
4338 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
4339 and moved "default:" back to the end of switch statement. Cleaned
4340 up the printing so it uses the right function calls and so the
4341 "print to file" option actually puts the file in the right directory.
4343 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
4345 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
4346 and Ok+Apply button control into a separate method: input (Angus).
4347 (input) Cleaned it up and improved it to be very thorough now.
4348 (All CB) static_cast used instead of C style cast (Angus). This will
4349 probably change again once we've worked out how to keep gcc-2.8.1 happy
4350 with real C callbacks.
4351 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
4352 ignore some of the bool settings and has random numbers instead. Needs
4353 some more investigation. Added other input length checks and checking
4354 of file and printer names.
4356 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
4357 would link (Angus). Seems the old code doesn't compile with the pragma
4358 statement either. Separated callback entries from internal methods.
4360 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
4362 2000-03-17 Allan Rae <rae@lyx.org>
4364 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
4365 need it? Maybe it could go in Dialogs instead? I could make it a
4366 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
4367 values to get the bool return value.
4368 (Dispatch): New overloaded method for xtl support.
4370 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
4371 extern "C" callback instead of static member functions. Hopefully,
4372 JMarc will be able to compile this. I haven't changed
4373 forms/form_copyright.fd yet. Breaking one of my own rules already.
4375 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
4376 because they aren't useful from the minibuffer. Maybe a LyXServer
4377 might want a help message though?
4379 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
4381 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
4382 xtl which needs both rtti and exceptions.
4384 * src/support/Makefile.am:
4385 * src/support/lxtl.h: New file. Some helper macros for using XTL.
4387 * src/frontends/xforms/input_validators.[ch]: input filters and
4388 validators. These conrol what keys are valid in input boxes.
4389 Use them and write some more. Much better idea than waiting till
4390 after the user has pressed Ok to say that the input fields don't make
4393 * src/frontends/xforms/Makefile.am:
4394 * src/frontends/xforms/forms/form_print.fd:
4395 * src/frontends/xforms/forms/makefile:
4396 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
4397 new scheme. Still have to make sure I haven't missed anything from
4398 the current implementation.
4400 * src/Makefile.am, src/PrinterParams.h: New data store.
4402 * other files: Added a couple of copyright notices.
4404 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4406 * src/insets/insetbib.h: move Holder struct in public space.
4408 * src/frontends/include/DialogBase.h: use SigC:: only when
4409 SIGC_CXX_NAMESPACES is defined.
4410 * src/frontends/include/Dialogs.h: ditto.
4412 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
4414 * src/frontends/xforms/FormCopyright.[Ch]: do not
4415 mention SigC:: explicitely.
4417 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4419 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
4420 deals with testing KDE in main configure.in
4421 * configure.in: ditto.
4423 2000-02-22 Allan Rae <rae@lyx.org>
4425 * Lots of files: Merged from HEAD
4427 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
4428 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
4430 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
4432 * sigc++/: new minidist.
4434 2000-02-14 Allan Rae <rae@lyx.org>
4436 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
4438 2000-02-08 Juergen Vigna <jug@sad.it>
4440 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
4441 file for the buildin GUI builder of KDevelop of the copyright-dialog.
4443 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
4444 for this port and so it is much easier for other people to port
4445 dialogs in a common development environment.
4447 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
4448 the QT/KDE implementation.
4450 * src/frontends/kde/Dialogs.C:
4451 * src/frontends/kde/FormCopyright.C:
4452 * src/frontends/kde/FormCopyright.h:
4453 * src/frontends/kde/Makefile.am:
4454 * src/frontends/kde/formcopyrightdialog.C:
4455 * src/frontends/kde/formcopyrightdialog.h:
4456 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
4457 for the kde support of the Copyright-Dialog.
4459 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
4460 subdir-substitution instead of hardcoded 'xforms' as we now have also
4463 * src/frontends/include/DialogBase.h (Object): just commented the
4464 label after #endif (nasty warning and I don't like warnings ;)
4466 * src/main.C (main): added KApplication initialization if using
4469 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
4470 For now only the KDE event-loop is added if frontend==kde.
4472 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
4474 * configure.in: added support for the --with-frontend[=value] option
4476 * autogen.sh: added kde.m4 file to list of config-files
4478 * acconfig.h: added define for KDEGUI-support
4480 * config/kde.m4: added configuration functions for KDE-port
4482 * config/lyxinclude.m4: added --with-frontend[=value] option with
4483 support for xforms and KDE.
4485 2000-02-08 Allan Rae <rae@lyx.org>
4487 * all Makefile.am: Fixed up so the make targets dist, distclean,
4488 install and uninstall all work even if builddir != srcdir. Still
4489 have a new sigc++ minidist update to come.
4491 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
4493 2000-02-01 Allan Rae <rae@lyx.org>
4495 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
4496 Many mods to get builddir != srcdir working.
4498 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
4499 for building on NT and so we can do the builddir != srcdir stuff.
4501 2000-01-30 Allan Rae <rae@lyx.org>
4503 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
4504 This will stay in "rae" branch. We probably don't really need it in
4505 the main trunk as anyone who wants to help programming it should get
4506 a full library installed also. So they can check both included and
4507 system supplied library compilation.
4509 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
4510 Added a 'mini' distribution of libsigc++. If you feel the urge to
4511 change something in these directories - Resist it. If you can't
4512 resist the urge then you should modify the following script and rebuild
4513 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
4514 all happen. Still uses a hacked version of libsigc++'s configure.in.
4515 I'm quite happy with the results. I'm not sure the extra work to turn
4516 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
4517 worth the trouble and would probably lead to extra maintenance
4519 I haven't tested the following important make targets: install, dist.
4520 Not ready for prime time but very close. Maybe 1.1.5.
4522 * development/tools/makeLyXsigc.sh: A shell script to automatically
4523 generate our mini-dist of libsigc++. It can only be used with a CVS
4524 checkout of libsigc++ not a tarball distribution. It's well commented.
4525 This will end up as part of the libsigc++ distribution so other apps
4526 can easily have an included mini-dist. If someone makes mods to the
4527 sigc++ subpackage without modifying this script to generate those
4528 changes I'll be very upset!
4530 * src/frontends/: Started the gui/system indep structure.
4532 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
4533 to access the gui-indep dialogs are in this class. Much improved
4534 design compared to previous revision. Lars, please refrain from
4535 moving this header into src/ like you did with Popups.h last time.
4537 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
4539 * src/frontends/xforms/: Started the gui-indep system with a single
4540 dialog: FormCopyright. Initial testing of use of libsigc++ was very
4543 * src/frontends/xforms/forms: Repository for the xforms .fd files.
4544 Here you'll find a very useful makefile and automated fdfix.sh that
4545 makes updating dailogs a no-brainer -- provided you follow the rules
4546 set out in the README. I'm thinking about adding another script to
4547 automatically generate skeleton code for a new dialog given just the
4550 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
4551 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
4552 Made FormCopyright gui-indep and added a lyxfunc to get to it.
4554 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4556 * src/support/LSubstring.C (operator): simplify
4558 * src/lyxtext.h: removed bparams, use buffer_->params instead
4560 * src/lyxrow.h: make Row a real class, move all variables to
4561 private and use accessors.
4563 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
4565 (isRightToLeftPar): ditto
4566 (ChangeLanguage): ditto
4567 (isMultiLingual): ditto
4570 (SimpleTeXOnePar): ditto
4571 (TeXEnvironment): ditto
4572 (GetEndLabel): ditto
4574 (SetOnlyLayout): ditto
4575 (BreakParagraph): ditto
4576 (BreakParagraphConservative): ditto
4577 (GetFontSettings): ditto
4579 (CopyIntoMinibuffer): ditto
4580 (CutIntoMinibuffer): ditto
4581 (PasteParagraph): ditto
4582 (SetPExtraType): ditto
4583 (UnsetPExtraType): ditto
4584 (DocBookContTableRows): ditto
4585 (SimpleDocBookOneTablePar): ditto
4587 (TeXFootnote): ditto
4588 (SimpleTeXOneTablePar): ditto
4589 (TeXContTableRows): ditto
4590 (SimpleTeXSpecialChars): ditto
4593 * src/lyxcursor.h: make LyXCursor a real class, move all variables
4594 to private and use accessors.
4596 * src/lyx_cb.C: remove char updatetimer, and all code that uses
4597 this, we did not use it anymore and has not been for ages. Just a
4598 waste of cpu cycles.
4600 * src/language.h: make Language a real class, move all variables
4601 to private and use accessors.
4603 * src/BufferView_pimpl.C (Pimpl): use new timer code.
4604 (create_view): remove
4605 (update): some changes for new timer
4606 (cursorToggle): use new timer
4607 (beforeChange): change for new timer
4609 * src/BufferView.h (cursorToggleCB): removed last paramter because
4612 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
4613 (cursorToggleCB): change because of new timer code
4615 * lib/CREDITS: updated own mailaddress
4617 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4619 * src/support/filetools.C (PutEnv): fix the code in case neither
4620 putenv() nor setenv() have been found.
4622 * INSTALL: mention the install-strip Makefile target.
4624 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
4625 read-only documents.
4627 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4629 * lib/reLyX/configure.in (VERSION): avoid using a previously
4630 generated reLyX wrapper to find out $prefix.
4632 * lib/examples/eu_adibide_lyx-atua.lyx:
4633 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
4634 translation of the Tutorial (Dooteo)
4636 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
4638 * forms/cite.fd: new citation dialog
4640 * src/insetcite.[Ch]: the new citation dialog is moved into
4643 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
4646 * src/insets/insetcommand.h: data members made private.
4648 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4650 * LyX 1.1.5 released
4652 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4654 * src/version.h (LYX_RELEASE): to 1.1.5
4656 * src/spellchecker.C (RunSpellChecker): return false if the
4657 spellchecker dies upon creation.
4659 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4661 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
4662 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
4666 * lib/CREDITS: update entry for Martin Vermeer.
4668 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
4670 * src/text.C (draw): Draw foreign language bars at the bottom of
4671 the row instead of at the baseline.
4673 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
4675 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4677 * lib/bind/de_menus.bind: updated
4679 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4681 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
4683 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4685 * src/menus.C (Limit_string_length): New function
4686 (ShowTocMenu): Limit the number of items/length of items in the
4689 * src/paragraph.C (String): Correct result for a paragraph inside
4692 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4694 * src/bufferlist.C (close): test of buf->getuser() == NULL
4696 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
4698 * src/BufferView2.C (removeAutoInsets): Fix a bug:
4699 Do not call to SetCursor when the paragraph is a closed footnote!
4701 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
4703 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
4706 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
4708 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4711 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
4712 reference popup, that activates the reference-back action
4714 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
4716 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
4717 the menus. Also fixed a bug.
4719 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
4720 the math panels when switching buffers (unless new buffer is readonly).
4722 * src/BufferView.C (NoSavedPositions)
4723 * src/BufferView_pimpl.C (NoSavedPositions): New methods
4725 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4727 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
4728 less of dvi dirty or not.
4730 * src/trans_mgr.[Ch] (insert): change first parameter to string
4733 * src/chset.[Ch] (encodeString): add const to first parameter
4735 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4737 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
4741 * src/LaTeX.C (deplog): better searching for dependency files in
4742 the latex log. Uses now regexps.
4744 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
4745 instead of the box hack or \hfill.
4747 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4749 * src/lyxfunc.C (doImportHelper): do not create the file before
4750 doing the actual import.
4751 (doImportASCIIasLines): create a new file before doing the insert.
4752 (doImportASCIIasParagraphs): ditto.
4754 * lib/lyxrc.example: remove mention of non-existing commands
4756 * lyx.man: remove mention of color-related switches.
4758 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
4760 * src/lyx_gui.C: remove all the color-related ressources, which
4761 are not used anymore.
4763 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
4766 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4768 * src/lyxrc.C (read): Add a missing break in the switch
4770 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
4772 * src/text2.C (InsertStringA): Fix a bug with insertion into table
4774 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
4777 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4779 * src/text.C (draw): draw bars under foreign language words.
4781 * src/LColor.[Ch]: add LColor::language
4783 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4785 * src/lyxcursor.h (boundary): New member variable
4787 * src/text.C (IsBoundary): New methods
4789 * src/text.C: Use the above for currect cursor movement when there
4790 is both RTL & LTR text.
4792 * src/text2.C: ditto
4794 * src/bufferview_funcs.C (ToggleAndShow): ditto
4796 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4798 * src/text.C (DeleteLineForward): set selection to true to avoid
4799 that DeleteEmptyParagraphMechanism does some magic. This is how it
4800 is done in all other functions, and seems reasonable.
4801 (DeleteWordForward): do not jump over non-word stuff, since
4802 CursorRightOneWord() already does it.
4804 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
4805 DeleteWordBackward, since they seem safe to me (since selection is
4806 set to "true") DeleteEmptyParagraphMechanism does nothing.
4808 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4810 * src/lyx_main.C (easyParse): simplify the code by factoring the
4811 part that removes parameters from the command line.
4812 (LyX): check wether wrong command line options have been given.
4814 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
4816 * src/lyx_main.C : add support for specifying user LyX
4817 directory via command line option -userdir.
4819 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
4821 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
4822 the number of items per popup.
4823 (Add_to_refs_menu): Ditto.
4825 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4827 * src/lyxparagraph.h: renamed ClearParagraph() to
4828 StripLeadingSpaces() and moved it to paragraph.C. We pass the
4829 textclass as parameter, and do nothing if free_spacing is
4830 true. This fixes part of the line-delete-forward problems.
4832 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
4833 (pasteSelection): ditto.
4834 (SwitchLayoutsBetweenClasses): more translatable strings.
4836 * src/text2.C (CutSelection): use StripLeadingSpaces.
4837 (PasteSelection): ditto.
4838 (DeleteEmptyParagraphMechanism): ditto.
4840 2000-05-26 Juergen Vigna <jug@sad.it>
4842 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
4843 is not needed in tabular insets.
4845 * src/insets/insettabular.C (TabularFeatures): added missing features.
4847 * src/tabular.C (DeleteColumn):
4849 (AppendRow): implemented this functions
4850 (cellsturct::operator=): clone the inset too;
4852 2000-05-23 Juergen Vigna <jug@sad.it>
4854 * src/insets/insettabular.C (LocalDispatch): better selection support
4855 when having multicolumn-cells.
4857 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4859 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
4861 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4863 * src/ColorHandler.C (getGCForeground): put more test into _()
4865 * lib/examples/eu_splash.lyx: new file (Basque translation) from
4868 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
4871 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
4873 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
4874 there are no labels, or when buffer is readonly.
4876 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
4877 there are no labels, buffer is SGML, or when buffer is readonly.
4879 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4881 * src/LColor.C (LColor): change a couple of grey40 to grey60
4882 (LColor): rewore initalization to make compiles go some magnitude
4884 (getGUIName): don't use gettext until we need the string.
4886 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
4888 * src/Bullet.[Ch]: Fixed a small bug.
4890 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
4892 * src/paragraph.C (String): Several fixes/improvements
4894 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
4896 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4898 * src/paragraph.C (String): give more correct output.
4900 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
4902 * src/lyxfont.C (stateText) Do not output the language if it is
4903 eqaul to the language of the document.
4905 * src/paragraph.C (TeXOnePar): Do not put language switch commands
4906 between two paragraphs with the same language.
4908 * src/paragraph.C (getParLanguage) Return a correct answer for an
4909 empty dummy paragraph.
4911 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
4914 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
4917 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
4918 the menus/popup, if requested fonts are unavailable.
4920 2000-05-22 Juergen Vigna <jug@sad.it>
4922 * src/insets/insettabular.C (LocalDispatch): added some more cursor
4923 movement support (Up/Down/Tab/Shift-Tab).
4924 (LocalDispatch): added also preliminari cursor-selection.
4926 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
4928 * src/paragraph.C (PasteParagraph): Hopefully now right!
4930 2000-05-22 Garst R. Reese <reese@isn.net>
4932 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
4933 of list, change all references to Environment to Command
4934 * tex/hollywood.cls : rewrite environments as commands, add
4935 \uppercase to interiorshot and exteriorshot to force uppecase.
4936 * tex/broadway.cls : rewrite environments as commands. Tweak
4939 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4941 * src/menus.C (Add_to_toc_menu): fix the code which limits the
4942 size of items: use a constant intead of the hardcoded 40, and more
4943 importantly do not remove the %m and %x tags added at the end.
4944 (Add_to_refs_menu): use vector::size_type instead of
4945 unsigned int as basic types for the variables. _Please_ do not
4946 assume that size_t is equal to unsigned int. On an alpha, this is
4947 unsigned long, which is _not_ the same.
4949 * src/language.C (initL): remove language "hungarian", since it
4950 seems that "magyar" is better.
4952 2000-05-22 Juergen Vigna <jug@sad.it>
4954 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
4956 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
4959 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
4960 next was deleted but not set to 0.
4962 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4964 * src/language.C (initL): change the initialization of languages
4965 so that compiles goes _fast_.
4967 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
4970 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
4972 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4976 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4978 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
4980 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
4984 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
4987 * src/insets/insetlo*.[Ch]: Made editable
4989 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4991 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
4992 the current selection.
4994 * src/BufferView_pimpl.C (stuffClipboard): new method
4996 * src/BufferView.C (stuffClipboard): new method
4998 * src/paragraph.C (String): new method
5000 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
5001 LColor::ignore when lyxname is not found.
5003 * src/BufferView.C (pasteSelection): new method
5005 * src/BufferView_pimpl.C (pasteSelection): new method
5007 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
5009 * src/WorkArea.C (request_clipboard_cb): new static function
5010 (getClipboard): new method
5011 (putClipboard): new method
5013 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5015 * LyX 1.1.5pre2 released
5017 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5019 * src/vspace.C (operator=): removed
5020 (operator=): removed
5022 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
5024 * src/layout.C (NumberOfClass): manually set the type in make_pair
5025 (NumberOfLayout): ditto
5027 * src/language.C: use the Language constructor for ignore_lang
5029 * src/language.h: add constructors to struct Language
5031 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
5033 * src/text2.C (SetCursorIntern): comment out #warning
5035 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
5037 * src/mathed/math_iter.h: initialize sx and sw to 0
5039 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
5041 * forms/lyx.fd: Redesign of form_ref
5043 * src/LaTeXFeatures.[Ch]
5047 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
5050 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
5051 and Buffer::inset_iterator.
5053 * src/menus.C: Added new menus: TOC and Refs.
5055 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
5057 * src/buffer.C (getTocList): New method.
5059 * src/BufferView2.C (ChangeRefs): New method.
5061 * src/buffer.C (getLabelList): New method. It replaces the old
5062 getReferenceList. The return type is vector<string> instead of
5065 * src/insets/insetinclude.C (getLabelList): New method. Replaces
5066 the old getLabel() and GetNumberOfLabels() methods.
5067 * src/insets/insetlabel.C (getLabelList): ditto
5068 * src/mathed/formula.C (getLabelList): ditto
5070 * src/paragraph.C (String): New method.
5072 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
5073 Uses the new getTocList() method.
5074 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
5075 which automatically updates the contents of the browser.
5076 (RefUpdateCB): Use the new getLabelList method.
5078 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
5080 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
5082 * src/spellchecker.C: Added using std::reverse;
5084 2000-05-19 Juergen Vigna <jug@sad.it>
5086 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
5088 * src/insets/insettext.C (computeTextRows): small fix for display of
5089 1 character after a newline.
5091 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
5094 2000-05-18 Juergen Vigna <jug@sad.it>
5096 * src/insets/insettabular.C (TabularFeatures): fixed update of display
5097 when changing width of column.
5099 * src/tabular.C (set_row_column_number_info): setting of
5100 autobreak rows if necessary.
5102 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5104 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
5106 * src/vc-backend.*: renamed stat() to status() and vcstat to
5107 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
5108 compilation broke. The new name seems more relevant, anyway.
5110 2000-05-17 Juergen Vigna <jug@sad.it>
5112 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
5113 which was wrong if the removing caused removing of rows!
5115 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
5116 (pushToken): new function.
5118 * src/text2.C (CutSelection): fix problem discovered with purify
5120 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5122 * src/debug.C (showTags): enlarge the first column, now that we
5123 have 6-digits debug codes.
5125 * lib/layouts/hollywood.layout:
5126 * lib/tex/hollywood.cls:
5127 * lib/tex/brodway.cls:
5128 * lib/layouts/brodway.layout: more commands and fewer
5129 environments. Preambles moved in the .cls files. Broadway now has
5130 more options on scene numbering and less whitespace (from Garst)
5132 * src/insets/insetbib.C (getKeys): make sure that we are in the
5133 document directory, in case the bib file is there.
5135 * src/insets/insetbib.C (Latex): revert bogus change.
5137 2000-05-16 Juergen Vigna <jug@sad.it>
5139 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
5140 the TabularLayout on cursor move.
5142 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
5144 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
5147 (draw): fixed cursor position and drawing so that the cursor is
5148 visible when before the tabular-inset.
5150 * src/insets/insettext.C (init): drawLockedFrame was not initialized
5151 when creating from old insettext.
5153 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
5155 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5157 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
5158 * lib/tex/brodway.cls: ditto
5160 * lib/layouts/brodway.layout: change alignment of parenthical
5163 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5165 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
5166 versions 0.88 and 0.89 are supported.
5168 2000-05-15 Juergen Vigna <jug@sad.it>
5170 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
5173 * src/insets/insettext.C (computeTextRows): redone completely this
5174 function in a much cleaner way, because of problems when having a
5176 (draw): added a frame border when the inset is locked.
5177 (SetDrawLockedFrame): this sets if we draw the border or not.
5178 (SetFrameColor): this sets the frame color (default=insetframe).
5180 * src/insets/lyxinset.h: added x() and y() functions which return
5181 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
5182 function which is needed to see if we have a locking inset of some
5183 type in this inset (needed for now in insettabular).
5185 * src/vspace.C (inPixels): the same function also without a BufferView
5186 parameter as so it is easier to use it in some ocasions.
5188 * src/lyxfunc.C: changed all places where insertInset was used so
5189 that now if it couldn't be inserted it is deleted!
5191 * src/TabularLayout.C:
5192 * src/TableLayout.C: added support for new tabular-inset!
5194 * src/BufferView2.C (insertInset): this now returns a bool if the
5195 inset was really inserted!!!
5197 * src/tabular.C (GetLastCellInRow):
5198 (GetFirstCellInRow): new helper functions.
5199 (Latex): implemented for new tabular class.
5203 (TeXTopHLine): new Latex() helper functions.
5205 2000-05-12 Juergen Vigna <jug@sad.it>
5207 * src/mathed/formulamacro.C (Read):
5208 * src/mathed/formula.C (Read): read also the \end_inset here!
5210 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
5212 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
5213 crush when saving formulae with unbalanced parenthesis.
5215 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
5217 * src/layout.C: Add new keyword "endlabelstring" to layout file
5219 * src/text.C (GetVisibleRow): Draw endlabel string.
5221 * lib/layouts/broadway.layout
5222 * lib/layouts/hollywood.layout: Added endlabel for the
5223 Parenthetical layout.
5225 * lib/layouts/heb-article.layout: Do not use slanted font shape
5226 for Theorem like environments.
5228 * src/buffer.C (makeLaTeXFile): Always add "american" to
5229 the UsedLanguages list if document language is RTL.
5231 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5233 * add addendum to README.OS2 and small patch (from SMiyata)
5235 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5237 * many files: correct the calls to ChangeExtension().
5239 * src/support/filetools.C (ChangeExtension): remove the no_path
5240 argument, which does not belong there. Use OnlyFileName() instead.
5242 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
5243 files when LaTeXing a non-nice latex file.
5245 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
5246 a chain of "if". Return false when deadkeys are not handled.
5248 * src/lyx_main.C (LyX): adapted the code for default bindings.
5250 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
5251 bindings for basic functionality (except deadkeys).
5252 (deadKeyBindings): new method. Performs the bindings of deadkeys.
5254 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
5255 several methods: handle override_x_deadkeys.
5257 * src/lyxrc.h: remove the "bindings" map, which did not make much
5258 sense anyway. New variable override_x_deadkeys, defaulting to "true".
5260 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5262 * src/lyxfont.C (stateText): use a saner method to determine
5263 whether the font is "default". Seems to fix the crash with DEC
5266 * src/Bullet.[Ch] (Bullet): remove const on parameters.
5268 2000-05-08 Juergen Vigna <jug@sad.it>
5270 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
5271 TabularLayoutMenu with mouse-button-3
5272 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
5274 * src/TabularLayout.C: added this file for having a Layout for
5277 2000-05-05 Juergen Vigna <jug@sad.it>
5279 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
5280 recalculating inset-widths.
5281 (TabularFeatures): activated this function so that I can change
5282 tabular-features via menu.
5284 * src/menus.C (ShowEditMenu): inserted support for insettabular so
5285 that I can test some functions with the Table menu.
5287 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5289 * src/lyxfont.C (stateText): guard against stupid c++libs.
5291 * src/tabular.C: add using std::vector
5292 some whitespace changes, + removed som autogenerated code.
5294 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
5296 2000-05-05 Juergen Vigna <jug@sad.it>
5298 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
5299 row, columns and cellstructures.
5301 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5303 * lib/lyxrc.example: remove obsolete entries.
5305 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
5306 reading of protected_separator for free_spacing.
5308 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5310 * src/text.C (draw): do not display an exclamation mark in the
5311 margin for margin notes. This is confusing, ugly and
5314 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
5315 AMS math' is checked.
5317 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
5318 name to see whether including the amsmath package is needed.
5320 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
5322 * src/paragraph.C (validate): Compute UsedLanguages correctly
5323 (don't insert the american language if it doesn't appear in the
5326 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
5327 The argument of \thanks{} command is considered moving argument
5329 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
5332 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
5334 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
5335 for appendix/minipage/depth. The lines can be now both in the footnote
5336 frame, and outside the frame.
5338 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
5341 2000-05-05 Juergen Vigna <jug@sad.it>
5343 * src/table.[Ch]: removed the inset and buffer stuff as this is now
5344 neede only in tabular.[Ch].
5346 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5348 * src/insets/insetspecialchar.C (Read): allow command == '~' for
5350 (Write): write '~' for PROTECTED_SEPARATOR
5352 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5354 * src/lyxparagraph.h: add a friend struct matchIT after the struct
5357 * src/mathed/formula.C (drawStr): rename size to siz.
5359 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
5360 possibly fix a bug by not changing the pflags = flags to piflags =
5363 2000-05-05 Juergen Vigna <jug@sad.it>
5365 * src/insets/insetbib.C: moved using directive
5367 * src/ImportNoweb.C: small fix for being able to compile (missing
5370 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5372 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
5373 to use clear, since we don't depend on this in the code. Add test
5376 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5378 * (various *.C files): add using std::foo directives to please dec
5381 * replace calls to string::clear() to string::erase() (Angus)
5383 * src/cheaders/cmath: modified to provide std::abs.
5385 2000-05-04 Juergen Vigna <jug@sad.it>
5387 * src/insets/insettext.C: Prepared all for inserting of multiple
5388 paragraphs. Still display stuff to do (alignment and other things),
5389 but I would like to use LyXText to do this when we cleaned out the
5390 table-support stuff.
5392 * src/insets/insettabular.C: Changed lot of stuff and added lots
5393 of functionality still a lot to do.
5395 * src/tabular.C: Various functions changed name and moved to be
5396 const functions. Added new Read and Write functions and changed
5397 lots of things so it works good with tabular-insets (also removed
5398 some stuff which is not needed anymore * hacks *).
5400 * src/lyxcursor.h: added operators == and != which just look if
5401 par and pos are (not) equal.
5403 * src/buffer.C (latexParagraphs): inserted this function to latex
5404 all paragraphs form par to endpar as then I can use this too for
5407 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
5408 so that I can call this to from text insets with their own cursor.
5410 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
5411 output off all paragraphs (because of the fix below)!
5413 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
5414 the very last paragraph (this could be also the last paragraph of an
5417 * src/texrow.h: added rows() call which returns the count-variable.
5419 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
5421 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
5423 * lib/configure.m4: better autodetection of DocBook tools.
5425 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5427 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
5429 * src/lyx_cb.C: add using std::reverse;
5431 * src/LaTeX.C (run): on error always run deleteFilesOnError before
5434 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
5435 selected files. Should fix repeated errors from generated files.
5437 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
5439 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
5441 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
5442 the spellchecker popup.
5444 * lib/lyxrc.example: Removed the \number_inset section
5446 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5448 * src/insets/figinset.C (various): Use IsFileReadable() to make
5449 sure that the file actually exist. Relying on ghostscripts errors
5450 is a bad idea since they can lead to X server crashes.
5452 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
5454 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
5457 * lib/lyxrc.example: smallish typo in description of
5458 \view_dvi_paper_option
5460 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5463 * src/lyxfunc.C: doImportHelper to factor out common code of the
5464 various import methods. New functions doImportASCIIasLines,
5465 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
5466 doImportLinuxDoc for the format specific parts.
5469 * buffer.C: Dispatch returns now a bool to indicate success
5472 * lyx_gui.C: Add getLyXView() for member access
5474 * lyx_main.C: Change logic for batch commands: First try
5475 Buffer::Dispatch (possibly without GUI), if that fails, use
5478 * lyx_main.C: Add support for --import command line switch.
5479 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
5480 Available Formats: Everything accepted by 'buffer-import <format>'
5482 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5484 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
5487 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
5488 documents will be reformatted upon reentry.
5490 2000-04-27 Juergen Vigna <jug@sad.it>
5492 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
5493 correctly only last pos this was a bug.
5495 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5497 * release of lyx-1.1.5pre1
5499 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5501 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
5503 * src/menus.C: revert the change of naming (Figure->Graphic...)
5504 from 2000-04-11. It was incomplete and bad.
5506 * src/LColor.[Ch]: add LColor::depthbar.
5507 * src/text.C (GetVisibleRow): use it.
5509 * README: update the languages list.
5511 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5513 * src/text.C (GetVisibleRow): show the depth of paragraphs using
5516 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5518 * README: remove sections that were just wrong.
5520 * src/text2.C (GetRowNearY): remove currentrow code
5522 * src/text.C (GetRow): remove currentrow code
5524 * src/screen.C (Update): rewritten a bit.
5525 (SmallUpdate): removed func
5527 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
5529 (FullRebreak): return bool
5530 (currentrow): remove var
5531 (currentrow_y): ditto
5533 * src/lyxscreen.h (Draw): change arg to unsigned long
5534 (FitCursor): return bool
5535 (FitManualCursor): ditto
5536 (Smallpdate): remove func
5537 (first): change to unsigned long
5538 (DrawOneRow): change second arg to long (from long &)
5539 (screen_refresh_y): remove var
5540 (scree_refresh_row): ditto
5542 * src/lyxrow.h: change baseline to usigned int from unsigned
5543 short, this brings some implicit/unsigned issues out in the open.
5545 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
5547 (Dispatch): don't call updateScrollbar after fitCursor. Use update
5548 instead of smallUpdate.
5550 * src/lyxcursor.h: change y to unsigned long
5552 * src/buffer.h: don't call updateScrollbar after fitcursor
5554 * src/buffer.C (parseSingleLyXformat2Token): move variables to
5555 where they are used. Removed "\\direction", this was not present
5556 in 1.1.4 and is already obsolete. Commented out some code that I
5557 believe to never be called.
5558 (runLiterate): don't call updateScrollbar after fitCursor
5560 (buildProgram): ditto
5563 * src/WorkArea.h (workWidth): change return val to unsigned
5566 (redraw): remove the button redraws
5567 (setScrollbarValue): change for scrollbar
5568 (getScrollbarValue): change for scrollbar
5569 (getScrollbarBounds): change for scrollbar
5571 * src/WorkArea.C (C_WorkArea_up_cb): removed func
5572 (C_WorkArea_down_cb): removed func
5573 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
5574 (resize): change for scrollbar
5575 (setScrollbar): ditto
5576 (setScrollbarBounds): ditto
5577 (setScrollbarIncrements): ditto
5578 (up_cb): removed func
5579 (down_cb): removed func
5580 (scroll_cb): change for scrollbar
5581 (work_area_handler): ditto
5583 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
5584 when FitCursor did something.
5585 (updateScrollbar): some unsigned changes
5586 (downCB): removed func
5587 (scrollUpOnePage): removed func
5588 (scrollDownOnePage): remvoed func
5589 (workAreaMotionNotify): don't call screen->FitCursor but use
5590 fitCursor instead. and bool return val
5591 (workAreaButtonPress): ditto
5592 (workAreaButtonRelease): some unsigned changes
5593 (checkInsetHit): ditto
5594 (workAreaExpose): ditto
5595 (update): parts rewritten, comments about the signed char arg added
5596 (smallUpdate): removed func
5597 (cursorPrevious): call needed updateScrollbar
5600 * src/BufferView2.C (allFloats): don't call updateScrollbar after
5603 * src/BufferView.[Ch] (upCB): removed func
5604 (downCB): removed func
5605 (smallUpdate): removed func
5607 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5609 * src/lyxtext.h src/text.C src/text2.C: removed support for the
5610 currentrow, currentrow_y optimization. This did not help a lot and
5611 if we want to do this kind of optimization we should rather use
5612 cursor.row instead of the currentrow.
5614 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
5615 buffer spacing and klyx spacing support.
5617 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5619 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
5622 2000-04-26 Juergen Vigna <jug@sad.it>
5624 * src/insets/figinset.C: fixes to Lars sstream changes!
5626 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
5628 * A lot of files: Added Ascii(ostream &) methods to all inset
5629 classes. Used when exporting to ASCII.
5631 * src/buffer.C (writeFileAscii,RoffAsciiTable)
5632 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
5635 * src/text2.C (ToggleFree): Disabled implicit word selection when
5636 there is a change in the language
5638 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
5639 no output was generated for end-of-sentence inset.
5641 * src/insets/lyxinset.h
5644 * src/paragraph.C: Removed the insetnumber code
5646 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
5648 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5650 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
5651 no_babel and no_epsfig completely from the file.
5652 (parseSingleLyXformat2Token): add handling for per-paragraph
5653 spacing as written by klyx.
5655 * src/insets/figinset.C: applied patch by Andre. Made it work with
5658 2000-04-20 Juergen Vigna <jug@sad.it>
5660 * src/insets/insettext.C (cutSelection):
5661 (copySelection): Fixed with selection from right to left.
5662 (draw): now the rows are not recalculated at every draw.
5663 (computeTextRows): for now reset the inset-owner here (this is
5664 important for an undo or copy where the inset-owner is not set
5667 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
5668 motion to the_locking_inset screen->first was forgotten, this was
5669 not important till we got multiline insets.
5671 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5673 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
5674 code seems to be alright (it is code changed by Dekel, and the
5675 intent is indeed that all macros should be defined \protect'ed)
5677 * NEWS: a bit of reorganisation of the new user-visible features.
5679 2000-04-19 Juergen Vigna <jug@sad.it>
5681 * src/insets/insettext.C (init): using a LyXCursor now for cursor
5682 position. Set the inset_owner of the used paragraph so that it knows
5683 that it is inside an inset. Fixed cursor handling with mouse and
5684 cursor keys. Fixed wrong timed inset redraws and lots of other changes
5685 and cleanups to make TextInsets work better.
5687 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
5688 Changed parameters of various functions and added LockInsetInInset().
5690 * src/insets/insettext.C:
5692 * src/insets/insetcollapsable.h:
5693 * src/insets/insetcollapsable.C:
5694 * src/insets/insetfoot.h:
5695 * src/insets/insetfoot.C:
5696 * src/insets/insetert.h:
5697 * src/insets/insetert.C: cleaned up the code so that it works now
5698 correctly with insettext.
5700 * src/insets/inset.C:
5701 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
5702 that insets in insets are supported right.
5705 * src/table.C: lots of changes for use with inset tabular (and cleanup)
5707 * src/paragraph.C: some small fixes
5709 * src/debug.h: inserted INSETS debug info
5711 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
5712 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
5714 * src/commandtags.h:
5715 * src/LyXAction.C: insert code for InsetTabular.
5717 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
5718 not Button1MotionMask.
5719 (workAreaButtonRelease): send always a InsetButtonRelease event to
5721 (checkInsetHit): some setCursor fixes (always with insets).
5723 * src/BufferView2.C (lockInset): returns a bool now and extended for
5724 locking insets inside insets.
5725 (showLockedInsetCursor): it is important to have the cursor always
5726 before the locked inset.
5727 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
5729 * src/BufferView.h: made lockInset return a bool.
5731 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
5733 * src/text2.C (SetCursor): This now has a version with a LyXCursor
5734 that is used also internally but can be called as public to have back
5735 a cursor pos which is not set internally.
5736 (SetCursorIntern): Changed to use above function.
5738 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
5740 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5745 * NEWS: updated for prerelease of 1.1.5. Please comment and send
5746 patches for things that should be in or should be changed.
5748 * src/* [insetfiles]: change "usigned char fragile" to bool
5749 fragile. There was only one point that could that be questioned
5750 and that is commented in formulamacro.C. Grep for "CHECK".
5752 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
5753 (DeleteBuffer): take it out of CutAndPaste and make it static.
5755 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5757 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
5758 output the spacing envir commands. Also the new commands used in
5759 the LaTeX output makes the result better.
5761 * src/Spacing.C (writeEnvirBegin): new method
5762 (writeEnvirEnd): new method
5764 2000-04-18 Juergen Vigna <jug@sad.it>
5766 * src/CutAndPaste.C: made textclass a static member of the class
5767 as otherwise it is not accesed right!!!
5769 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
5771 * forms/layout_forms.fd
5772 * src/layout_forms.h
5773 * src/layout_forms.C (create_form_form_character)
5774 * src/lyx_cb.C (UserFreeFont)
5775 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
5776 documents (in the layout->character popup).
5778 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5780 * src/spellchecker.C (create_ispell_pipe): fix a bug where
5781 \spell_command was in fact not honored (from Kevin Atkinson).
5783 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
5786 * src/lyx_gui.h: make lyxViews private (Angus)
5788 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
5790 * src/mathed/math_write.C
5791 (MathMatrixInset::Write) Put \protect before \begin{array} and
5792 \end{array} if fragile
5793 (MathParInset::Write): Put \protect before \\ if fragile
5795 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5797 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
5798 initialization if the LyXColorHandler must be done after the
5799 connections to the XServer has been established.
5801 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
5802 get the background pixel from the lyxColorhandler so that the
5803 figures are rendered with the correct background color.
5804 (NextToken): removed functions.
5805 (GetPSSizes): use ifs >> string instead of NextToken.
5807 * src/Painter.[Ch]: the color cache moved out of this file.
5809 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
5812 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5814 * src/WorkArea.C (work_area_handler): call BufferView::enterView
5815 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
5817 * src/BufferView.C (enterView): new func
5818 (leaveView): new func
5820 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
5822 (leaveView): new func, undefines xterm cursor when approp.
5824 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
5825 (AllowInput): delete the Workarea cursor handling from this func.
5827 * src/Painter.C (underline): draw a slimer underline in most cases.
5829 * src/lyx_main.C (error_handler): use extern "C"
5831 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5833 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
5834 sent directly to me.
5836 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
5837 to the list by Dekel.
5839 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
5842 * src/bufferview_funcs.[Ch]: two new files, moved several of the
5843 methods from lyx_cb.here.
5845 * src/lyx_cb.C: in addition to the above; removed input_prohibited
5848 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5850 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
5851 instead of using current_view directly.
5853 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
5855 * src/LyXAction.C (init): add the paragraph-spacing command.
5857 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
5859 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
5861 * src/lyx_cb.C (CurrentState): output a string when the spacing is
5862 different from the documents.
5864 * src/text.C (SetHeightOfRow): take paragraph spacing into
5865 account, paragraph spacing takes precedence over buffer spacing
5866 (GetVisibleRow): ditto
5868 * src/paragraph.C (writeFile): output the spacing parameter too.
5869 (validate): set the correct features if spacing is used in the
5871 (Clear): set spacing to default
5872 (MakeSameLayout): spacing too
5873 (HasSameLayout): spacing too
5874 (SetLayout): spacing too
5875 (TeXOnePar): output the spacing commands
5877 * src/lyxparagraph.h: added a spacing variable for use with
5878 per-paragraph spacing.
5880 * src/Spacing.h: add a Default spacing and a method to check if
5881 the current spacing is default. also added an operator==
5883 * src/text2.C (DeleteEmptyParagraphMechanism): added a
5886 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5888 * src/lyxserver.C (callback): fix dispatch of functions
5890 * src/insets/insetlatexaccent.C (checkContents): turn bogus
5891 printf() into lyxerr call.
5893 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
5896 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
5897 "Table" to "Table Box", "Float" to "Floating Material"; deletes
5898 the "Float" from each of the subitems.
5899 (ShowHelpMenu): add entry for "FAQ" and "TOC".
5901 * src/support/DebugStream.h: add an #ifdef to work around a gcc
5902 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
5903 documented the change so that the workaround can be nuked later.
5905 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
5908 * src/lyxlex_pimpl.C (next): do not re-declare the default value
5910 * src/buffer.C (getLatexName): ditto
5911 (setReadonly): ditto
5913 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5915 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
5916 avoid some uses of current_view. Added also a bufferParams()
5917 method to get at this.
5919 * src/lyxtext.h: changed params->buffer and paramters->bparams.
5921 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5923 * src/lyxparagraph.[Ch]: removed
5924 operator<(LyXParagraph::InsetTable..., added a struct matchIT
5925 with operators used by lower_bound and
5926 upper_bound in InsetTable's
5927 Make struct InsetTable private again. Used matchpos.
5929 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
5931 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
5932 document, the language of existing text is changed (unless the
5933 document is multi-lingual)
5935 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
5937 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
5939 * A lot of files: A rewrite of the Right-to-Left support.
5941 2000-04-10 Juergen Vigna <jug@sad.it>
5943 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
5944 misplaced cursor when inset in inset is locked.
5946 * src/insets/insettext.C (LocalDispatch): small fix so that a
5947 BREAKLINE is not inserted if we don't permit it with autBreakRows.
5949 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
5950 footnote font should be decreased in size twice when displaying.
5952 * src/insets/insettext.C (GetDrawFont): inserted this function as
5953 the drawing-font may differ from the real paragraph font.
5955 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
5956 insets (inset in inset!).
5958 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
5959 function here because we don't want footnotes inside footnotes.
5961 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
5963 (init): now set the inset_owner in paragraph.C
5964 (LocalDispatch): added some resetPos() in the right position
5967 (pasteSelection): changed to use the new CutAndPaste-Class.
5969 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
5970 which tells if it is allowed to insert another inset inside this one.
5972 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
5973 SwitchLayoutsBetweenClasses.
5975 * src/text2.C (InsertInset): checking of the new paragraph-function
5977 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
5978 is not needed anymore here!
5981 (PasteSelection): redone (also with #ifdef) so that now this uses
5982 the CutAndPaste-Class.
5983 (SwitchLayoutsBetweenClasses): removed here and implemented in the
5986 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
5987 from/to text/insets.
5989 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
5990 so that the paragraph knows if it is inside an (text)-inset.
5991 (InsertFromMinibuffer): changed return-value to bool as now it
5992 may happen that an inset is not inserted in the paragraph.
5993 (InsertInsetAllowed): this checks if it is allowed to insert an
5994 inset in this paragraph.
5996 (BreakParagraphConservative):
5997 (BreakParagraph) : small change for the above change of the return
5998 value of InsertFromMinibuffer.
6000 * src/lyxparagraph.h: added inset_owner and the functions to handle
6001 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
6003 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6005 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
6006 functions from BufferView to BufferView::Pimpl to ease maintence.
6008 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
6009 correctly. Also use SetCursorIntern instead of SetCursor.
6011 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
6014 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6016 * src/WorkArea.C (belowMouse): manually implement below mouse.
6018 * src/*: Add "explicit" on several constructors, I added probably
6019 some unneeded ones. A couple of changes to code because of this.
6021 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
6022 implementation and private parts from the users of BufferView. Not
6025 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
6026 implementation and private parts from the users of LyXLex. Not
6029 * src/BufferView_pimpl.[Ch]: new files
6031 * src/lyxlex_pimpl.[Ch]: new files
6033 * src/LyXView.[Ch]: some inline functions move out-of-line
6035 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6037 * src/lyxparagraph.h: make struct InsetTable public.
6039 * src/support/lyxstring.h: change lyxstring::difference_type to be
6040 ptrdiff_t. Add std:: modifiers to streams.
6042 * src/font.C: include the <cctype> header, for islower() and
6045 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6047 * src/font.[Ch]: new files. Contains the metric functions for
6048 fonts, takes a LyXFont as parameter. Better separation of concepts.
6050 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
6051 changes because of this.
6053 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
6055 * src/*: compile with -Winline and move functions that don't
6058 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
6061 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6063 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
6064 (various files changed because of this)
6066 * src/Painter.C (text): fixed the drawing of smallcaps.
6068 * src/lyxfont.[Ch] (drawText): removed unused member func.
6071 * src/*.C: added needed "using" statements and "std::" qualifiers.
6073 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6075 * src/*.h: removed all use of "using" from header files use
6076 qualifier std:: instead.
6078 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6080 * src/text.C (Backspace): some additional cleanups (we already
6081 know whether cursor.pos is 0 or not).
6083 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
6084 automake does not provide one).
6086 * src/bmtable.h: replace C++ comments with C comments.
6088 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
6090 * src/screen.C (ShowCursor): Change the shape of the cursor if
6091 the current language is not equal to the language of the document.
6092 (If the cursor change its shape unexpectedly, then you've found a bug)
6094 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
6097 * src/insets/insetnumber.[Ch]: New files.
6099 * src/LyXAction.C (init)
6100 * src/lyxfunc.C (dispatch): Add command number-inset-insert
6103 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
6105 * src/lyxparagraph.h
6106 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
6107 (the vector is kept sorted).
6109 * src/text.C (GetVisibleRow): Draw selection correctly when there
6110 is both LTR and RTL text.
6112 * src/paragraph.C (Clone): Use the assignment operator for cloning,
6113 which is much faster.
6115 * src/text.C (GetVisibleRow and other): Do not draw the last space
6116 in a row if the direction of the last letter is not equal to the
6117 direction of the paragraph.
6119 * src/lyxfont.C (latexWriteStartChanges):
6120 Check that font language is not equal to basefont language.
6121 (latexWriteEndChanges): ditto
6123 * src/lyx_cb.C (StyleReset): Don't change the language while using
6124 the font-default command.
6126 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
6127 empty paragraph before a footnote.
6129 * src/insets/insetcommand.C (draw): Increase x correctly.
6131 * src/screen.C (ShowCursor): Change cursor shape if
6132 current language != document language.
6134 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
6136 2000-03-31 Juergen Vigna <jug@sad.it>
6138 * src/paragraph.C (GetInset): commented out text[pos] = ' '
6139 (Clone): changed mode how the paragraph-data is copied to the
6140 new clone-paragraph.
6142 * src/lyxfunc.C (Dispatch): fixed small problem when calling
6143 GetInset(pos) with no inset anymore there (in inset UNDO)
6145 * src/insets/insetcommand.C (draw): small fix as here x is
6146 incremented not as much as width() returns (2 before, 2 behind = 4)
6148 2000-03-30 Juergen Vigna <jug@sad.it>
6150 * src/insets/insettext.C (InsetText): small fix in initialize
6151 widthOffset (should not be done in the init() function)
6153 2000-03-29 Amir Karger <karger@lyx.org>
6155 * lib/examples/it_ItemizeBullets.lyx: translation by
6158 * Implemented \textasciitilde and fixed a tiny bug in reLyX
6160 2000-03-29 Juergen Vigna <jug@sad.it>
6162 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
6164 * src/insets/insetfoot.C (Clone): small change as for the below
6165 new init function in the text-inset
6167 * src/insets/insettext.C (init): new function as I've seen that
6168 clone did not copy the Paragraph-Data!
6169 (LocalDispatch): Added code so that now we have some sort of Undo
6170 functionality (well actually we HAVE Undo ;)
6172 * src/text.C (Backspace): Small fix for the a | a Backspace problem
6174 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
6176 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
6179 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6181 * src/main.C: added a runtime check that verifies that the xforms
6182 header used when building LyX and the library used when running
6183 LyX match. Exit with a message if they don't match. This is a
6184 version number check only.
6186 * src/buffer.C (save): Don't allocate memory on the heap for
6187 struct utimbuf times.
6189 * *: some using changes, use iosfwd instead of the real headers.
6191 * src/lyxfont.C use char const * instead of string for the static
6192 strings. Rewrite some functions to use sstream.
6194 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6196 * src/text.C (Backspace): hopefully fix the dreaded backaspace
6199 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6201 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
6202 of Geodesy (from Martin Vermeer)
6204 * lib/layouts/svjour.inc: include file for the Springer svjour
6205 class. It can be used to support journals other than JoG.
6207 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
6208 Miskiewicz <misiek@pld.org.pl>)
6209 * lib/reLyX/Makefile.am: ditto.
6211 2000-03-27 Juergen Vigna <jug@sad.it>
6213 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
6214 also some modifications with operations on selected text.
6216 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
6217 problems with clicking on insets (last famous words ;)
6219 * src/insets/insetcommand.C (draw):
6220 (width): Changed to have a bit of space before and after the inset so
6221 that the blinking cursor can be seen (otherwise it was hidden)
6223 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6225 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
6226 would not be added to the link list when an installed gettext (not
6227 part of libc) is found.
6229 2000-03-24 Juergen Vigna <jug@sad.it>
6231 * src/insets/insetcollapsable.C (Edit):
6232 * src/mathed/formula.C (InsetButtonRelease):
6233 (InsetButtonPress): fixed for new handling of ButtonPress/Release
6236 * src/BufferView.C (workAreaButtonPress):
6237 (workAreaButtonRelease):
6238 (checkInsetHit): Finally fixed the clicking on insets be handled
6241 * src/insets/insetert.C (Edit): inserted this call so that ERT
6242 insets work always with LaTeX-font
6244 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6246 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
6247 caused lyx to startup with no GUI in place, causing in a crash
6248 upon startup when called with arguments.
6250 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6252 * src/FontLoader.C: better initialization of dummyXFontStruct.
6254 2000-03-20 José Abílio Matos <jamatos@lyx.org>
6256 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
6257 for linuxdoc and docbook import and export format options.
6259 * lib/lyxrc.example Example of default values for the previous flags.
6261 * src/lyx_cb.C Use those flags instead of the hardwired values for
6262 linuxdoc and docbook export.
6264 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
6267 * src/menus.C Added menus entries for the new import/exports formats.
6269 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6271 * src/lyxrc.*: Added support for running without Gui
6274 * src/FontLoader.C: sensible defaults if no fonts are needed
6276 * src/lyx_cb.C: New function ShowMessage (writes either to the
6277 minibuffer or cout in case of no gui
6278 New function AskOverwrite for common stuff
6279 Consequently various changes to call these functions
6281 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
6282 wild guess at sensible screen resolution when having no gui
6284 * src/lyxfont.C: no gui, no fonts... set some defaults
6286 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6288 * src/LColor.C: made the command inset background a bit lighter.
6290 2000-03-20 Hartmut Goebel <goebel@noris.net>
6292 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
6293 stdstruct.inc. Koma-Script added some title elements which
6294 otherwise have been listed below "bibliography". This split allows
6295 adding title elements to where they belong.
6297 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
6298 define the additional tilte elements and then include
6301 * many other layout files: changed to include stdtitle.inc just
6302 before stdstruct.inc.
6304 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
6306 * src/buffer.C: (save) Added the option to store all backup files
6307 in a single directory
6309 * src/lyxrc.[Ch]: Added variable \backupdir_path
6311 * lib/lyxrc.example: Added descriptions of recently added variables
6313 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
6314 bibtex inset, not closing the bibtex popup when deleting the inset)
6316 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6318 * src/lyx_cb.C: add a couple using directives.
6320 2000-03-17 José Abílio Matos <jamatos@lyx.org>
6321 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
6322 import based on the filename.
6324 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
6325 file would be imported at start, if the filename where of a sgml file.
6327 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
6329 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
6331 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
6332 * src/lyxfont.h Replaced the member variable bits.direction by the
6333 member variable lang. Made many changes in other files.
6334 This allows having a multi-lingual document
6336 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
6337 that change the current language to <l>.
6338 Removed the command "font-rtl"
6340 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
6341 format for Hebrew documents)
6343 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
6344 When auto_mathmode is "true", pressing a digit key in normal mode
6345 will cause entering into mathmode.
6346 If auto_mathmode is "rtl" then this behavior will be active only
6347 when writing right-to-left text.
6349 * src/text2.C (InsertStringA) The string is inserted using the
6352 * src/paragraph.C (GetEndLabel) Gives a correct result for
6353 footnote paragraphs.
6355 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
6357 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6359 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
6360 front of PasteParagraph. Never insert a ' '. This should at least
6361 fix some cause for the segfaults that we have been experiencing,
6362 it also fixes backspace behaviour slightly. (Phu!)
6364 * src/support/lstrings.C (compare_no_case): some change to make it
6365 compile with gcc 2.95.2 and stdlibc++-v3
6367 * src/text2.C (MeltFootnoteEnvironment): change type o
6368 first_footnote_par_is_not_empty to bool.
6370 * src/lyxparagraph.h: make text private. Changes in other files
6372 (fitToSize): new function
6373 (setContentsFromPar): new function
6374 (clearContents): new function
6375 (SetChar): new function
6377 * src/paragraph.C (readSimpleWholeFile): deleted.
6379 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
6380 the file, just use a simple string instead. Also read the file in
6381 a more maintainable manner.
6383 * src/text2.C (InsertStringA): deleted.
6384 (InsertStringB): deleted.
6386 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6388 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
6389 RedoParagraphs from the doublespace handling part, just set status
6390 to NEED_MORE_REFRESH. Also don't update cursor position (should be
6391 done, but perhaps not like this.)
6393 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6395 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
6396 character when inserting an inset.
6398 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6400 * src/bufferparams.C (readLanguage): now takes "default" into
6403 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
6404 also initialize the toplevel_keymap with the default bindings from
6407 * src/buffer.C (Buffer): remove lyxrc from the parameters.
6409 * all files using lyxrc: have lyxrc as a real variable and not a
6410 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
6413 * src/lyxrc.C: remove double call to defaultKeyBindings
6415 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
6416 toolbar defauls using lyxlex. Remove enums, structs, functions
6419 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
6420 toolbar defaults. Also store default keybindings in a map.
6422 * src/ToolbarDefaults.[Ch]: New file. This class is used for
6423 storing the toolbar defaults without any xforms dependencies.
6425 * src/insets/figinset.C: patch posted to list by Andre Poenitz
6426 applied. Changed to use iterators.
6428 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
6430 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
6431 systems that don't have LINGUAS set to begin with.
6433 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6435 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
6436 the list by Dekel Tsur.
6438 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6440 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
6441 * src/insets/form_graphics.C: ditto.
6443 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
6445 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6447 * src/bufferparams.C (readLanguage): use the new language map
6449 * src/intl.C (InitKeyMapper): use the new language map
6451 * src/lyx_gui.C (create_forms): use the new language map
6453 * src/language.[Ch]: New files. Used for holding the information
6454 about each language. Now! Use this new language map enhance it and
6455 make it really usable for our needs.
6457 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
6459 * screen.C (ShowCursor): Removed duplicate code.
6460 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
6461 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
6463 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
6466 * src/text.C Added TransformChar method. Used for rendering Arabic
6467 text correctly (change the glyphs of the letter according to the
6468 position in the word)
6473 * src/lyxrc.C Added lyxrc command {language_command_begin,
6474 language_command_end,language_command_ltr,language_command_rtl,
6475 language_package} which allows the use of either arabtex or Omega
6478 * src/lyx_gui.C (init)
6480 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
6481 to use encoding for menu fonts which is different than the encoding
6484 * src/buffer.C (makeLaTeXFile): If params.language = "default",
6485 do not load the babel package.
6486 To write an English document with Hebrew/Arabic, change the document
6487 language to "english".
6489 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
6490 (alphaCounter): changed to return char
6491 (loweralphaCounter, hebrewCounter, romanCounter): New functions
6493 * lib/lyxrc.example Added examples for Hebrew/Arabic
6496 * src/layout.C Added layout command endlabeltype
6498 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
6500 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
6502 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6504 * src/mathed/math_delim.C (search_deco): return a
6505 math_deco_struct* instead of index.
6507 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6509 * All files with a USE_OSTREAM_ONLY within: removed all code that
6510 was unused when USE_OSTREAM_ONLY is defined.
6512 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
6513 of any less. Removed header and using.
6515 * src/text.C (GetVisibleRow): draw the string "Page Break
6516 (top/bottom)" on screen when drawing a pagebreak line.
6518 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6520 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
6522 * src/mathed/math_macro.C (draw): do some cast magic.
6525 * src/mathed/math_defs.h: change byte* argument to byte const*.
6527 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
6529 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
6530 know it is right to return InsetFoot* too, but cxx does not like
6533 * src/insets/insetcollapsable.[Ch] (Clone): make const.
6535 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
6537 * src/mathed/math_delim.C: change == to proper assignment.
6539 2000-03-09 Juergen Vigna <jug@sad.it>
6541 * src/insets/insettext.C (setPos): fixed various cursor positioning
6542 problems (via mouse and cursor-keys)
6543 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
6544 inset (still a small display problem but it works ;)
6546 * src/insets/insetcollapsable.C (draw): added button_top_y and
6547 button_bottom_y to have correct values for clicking on the inset.
6549 * src/support/lyxalgo.h: commented out 'using std::less'
6551 2000-03-08 Juergen Vigna <jug@sad.it>
6553 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
6554 Button-Release event closes as it is alos the Release-Event
6557 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
6559 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6561 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
6562 can add multiple spaces in Scrap (literate programming) styles...
6563 which, by the way, is how I got hooked on LyX to begin with.
6565 * src/mathed/formula.C (Write): Added dummy variable to an
6566 inset::Latex() call.
6567 (Latex): Add free_spacing boolean to inset::Latex()
6569 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
6571 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
6572 virtual function to include the free_spacing boolean from
6573 the containing paragraph's style.
6575 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
6576 Added free_spacing boolean arg to match inset.h
6578 * src/insets/insettext.C, src/insets/insettext.h (Latex):
6579 Added free_spacing boolean arg to match inset.h
6581 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
6582 Added free_spacing boolean and made sure that if in a free_spacing
6583 paragraph, that we output normal space if there is a protected space.
6585 * src/insets/insetref.C, src/insets/insetref.h (Latex):
6586 Added free_spacing boolean arg to match inset.h
6588 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
6589 Added free_spacing boolean arg to match inset.h
6591 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
6592 Added free_spacing boolean arg to match inset.h
6594 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
6595 Added free_spacing boolean arg to match inset.h
6597 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
6598 Added free_spacing boolean arg to match inset.h
6600 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
6601 free_spacing boolean arg to match inset.h
6603 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
6604 Added free_spacing boolean arg to match inset.h
6606 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
6607 Added free_spacing boolean arg to match inset.h
6609 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
6610 Added free_spacing boolean arg to match inset.h
6612 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
6613 Added free_spacing boolean arg to match inset.h
6615 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
6616 Added free_spacing boolean arg to match inset.h
6618 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
6619 free_spacing boolean arg to match inset.h
6621 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
6622 free_spacing boolean arg to match inset.h
6624 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
6625 ignore free_spacing paragraphs. The user's spaces are left
6628 * src/text.C (InsertChar): Fixed the free_spacing layout
6629 attribute behavior. Now, if free_spacing is set, you can
6630 add multiple spaces in a paragraph with impunity (and they
6631 get output verbatim).
6632 (SelectSelectedWord): Added dummy argument to inset::Latex()
6635 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
6638 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
6639 paragraph layouts now only input a simple space instead.
6640 Special character insets don't make any sense in free-spacing
6643 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
6644 hard-spaces in the *input* file to simple spaces if the layout
6645 is free-spacing. This converts old files which had to have
6646 hard-spaces in free-spacing layouts where a simple space was
6648 (writeFileAscii): Added free_spacing check to pass to the newly
6649 reworked inset::Latex(...) methods. The inset::Latex() code
6650 ensures that hard-spaces in free-spacing paragraphs get output
6651 as spaces (rather than "~").
6653 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6655 * src/mathed/math_delim.C (draw): draw the empty placeholder
6656 delims with a onoffdash line.
6657 (struct math_deco_compare): struct that holds the "functors" used
6658 for the sort and the binary search in math_deco_table.
6659 (class init_deco_table): class used for initial sort of the
6661 (search_deco): use lower_bound to do a binary search in the
6664 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6666 * src/lyxrc.C: a small secret thingie...
6668 * src/lyxlex.C (printTable): changed to take a ostream as paramter
6669 and to not flush the stream as often as it used to.
6671 * src/support/lyxalgo.h: new file
6672 (sorted): template function used for checking if a sequence is
6673 sorted or not. Two versions with and without user supplied
6674 compare. Uses same compare as std::sort.
6676 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
6677 it and give warning on lyxerr.
6679 (struct compare_tags): struct with function operators used for
6680 checking if sorted, sorting and lower_bound.
6681 (search_kw): use lower_bound instead of manually implemented
6684 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6686 * src/insets/insetcollapsable.h: fix Clone() declaration.
6687 * src/insets/insetfoot.h: ditto.
6689 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
6691 2000-03-08 Juergen Vigna <jug@sad.it>
6693 * src/insets/lyxinset.h: added owner call which tells us if
6694 this inset is inside another inset. Changed also the return-type
6695 of Editable to an enum so it tells clearer what the return-value is.
6697 * src/insets/insettext.C (computeTextRows): fixed computing of
6698 textinsets which split automatically on more rows.
6700 * src/insets/insetert.[Ch]: changed this to be of BaseType
6703 * src/insets/insetfoot.[Ch]: added footnote inset
6705 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
6706 collapsable insets (like footnote, ert, ...)
6708 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6710 * src/lyxdraw.h: remvoe file
6712 * src/lyxdraw.C: remove file
6714 * src/insets/insettext.C: added <algorithm>.
6716 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6718 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
6719 (matrix_cb): case MM_OK use string stream
6721 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
6724 * src/mathed/math_macro.C (draw): use string stream
6725 (Metrics): use string stream
6727 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
6728 directly to the ostream.
6730 * src/vspace.C (asString): use string stream.
6731 (asString): use string stream
6732 (asLatexString): use string stream
6734 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
6735 setting Spacing::Other.
6737 * src/LaTeXFeatures.C (getPackages): use string stream instead of
6738 sprintf when creating the stretch vale.
6740 * src/text2.C (alphaCounter): changed to return a string and to
6741 not use a static variable internally. Also fixed a one-off bug.
6742 (SetCounter): changed the drawing of the labels to use string
6743 streams instead of sprintf.
6745 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
6746 manipulator to use a scheme that does not require library support.
6747 This is also the way it is done in the new GNU libstdc++. Should
6748 work with DEC cxx now.
6750 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6752 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
6753 end. This fixes a bug.
6755 * src/mathed (all files concerned with file writing): apply the
6756 USE_OSTREAM_ONLY changes to mathed too.
6758 * src/support/DebugStream.h: make the constructor explicit.
6760 * src/lyxfont.C (latexWriteStartChanges): small bug related to
6761 count and ostream squashed.
6763 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6765 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
6767 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
6768 ostringstream uses STL strings, and we might not.
6770 * src/insets/insetspecialchar.C: add using directive.
6771 * src/insets/insettext.C: ditto.
6773 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6775 * lib/layouts/seminar.layout: feeble attempt at a layout for
6776 seminar.cls, far from completet and could really use some looking
6777 at from people used to write layout files.
6779 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
6780 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
6781 a lot nicer and works nicely with ostreams.
6783 * src/mathed/formula.C (draw): a slightly different solution that
6784 the one posted to the list, but I think this one works too. (font
6785 size wrong in headers.)
6787 * src/insets/insettext.C (computeTextRows): some fiddling on
6788 Jürgens turf, added some comments that he should read.
6790 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
6791 used and it gave compiler warnings.
6792 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
6795 * src/lyx_gui.C (create_forms): do the right thing when
6796 show_banner is true/false.
6798 * src/lyx_cb.C (TimerCB): no need to close or do anything if
6799 show_banner is false.
6801 * most file writing files: Now use iostreams to do almost all of
6802 the writing. Also instead of passing string &, we now use
6803 stringstreams. mathed output is still not adapted to iostreams.
6804 This change can be turned off by commenting out all the occurences
6805 of the "#define USE_OSTREAM_ONLY 1" lines.
6807 * src/WorkArea.C (createPixmap): don't output debug messages.
6808 (WorkArea): don't output debug messages.
6810 * lib/lyxrc.example: added a comment about the new variable
6813 * development/Code_rules/Rules: Added some more commente about how
6814 to build class interfaces and on how better encapsulation can be
6817 2000-03-03 Juergen Vigna <jug@sad.it>
6819 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
6820 automatically with the width of the LyX-Window
6822 * src/insets/insettext.C (computeTextRows): fixed update bug in
6823 displaying text-insets (scrollvalues where not initialized!)
6825 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6827 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
6828 id in the check of the result from lower_bound is not enough since
6829 lower_bound can return last too, and then res->id will not be a
6832 * all insets and some code that use them: I have conditionalized
6833 removed the Latex(string & out, ...) this means that only the
6834 Latex(ostream &, ...) will be used. This is a work in progress to
6835 move towards using streams for all output of files.
6837 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
6840 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6842 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
6843 routine (this fixes bug where greek letters were surrounded by too
6846 * src/support/filetools.C (findtexfile): change a bit the search
6847 algorithm, to fix bug introduced in 1.1.4. Note that --format is
6848 no longer passed to kpsewhich, we may have to change that later.
6850 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
6851 warning options to avoid problems with X header files (from Angus
6853 * acinclude.m4: regenerated.
6855 2000-03-02 Juergen Vigna <jug@sad.it>
6857 * src/insets/insettext.C (WriteParagraphData): Using the
6858 par->writeFile() function for writing paragraph-data.
6859 (Read): Using buffer->parseSingleLyXformat2Token()-function
6860 for parsing paragraph data!
6862 * src/buffer.C (readLyXformat2): removed all parse data and using
6863 the new parseSingleLyXformat2Token()-function.
6864 (parseSingleLyXformat2Token): added this function to parse (read)
6865 lyx-file-format (this is called also from text-insets now!)
6867 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6869 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
6872 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
6873 directly instead of going through a func. One very bad thing: a
6874 static LyXFindReplace, but I don't know where to place it.
6876 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
6877 string instead of char[]. Also changed to static.
6878 (GetSelectionOrWordAtCursor): changed to static inline
6879 (SetSelectionOverLenChars): ditto.
6881 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
6882 current_view and global variables. both classes has changed names
6883 and LyXFindReplace is not inherited from SearchForm.
6885 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
6886 fl_form_search form.
6888 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
6890 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6892 * lib/bind/*.bind: make sure 'buffer-previous' function is not
6893 bound (from Kayvan).
6895 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
6897 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
6899 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6901 * some things that I should comment but the local pub says head to
6904 * comment out all code that belongs to the Roff code for Ascii
6905 export of tables. (this is unused)
6907 * src/LyXView.C: use correct type for global variable
6908 current_layout. (LyXTextClass::size_type)
6910 * some code to get the new insetgraphics closer to working I'd be
6911 grateful for any help.
6913 * src/BufferView2.C (insertInset): use the return type of
6914 NumberOfLayout properly. (also changes in other files)
6916 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
6917 this as a test. I want to know what breaks because of this.
6919 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
6921 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6923 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
6924 to use a \makebox in the label, this allows proper justification
6925 with out using protected spaces or multiple hfills. Now it is
6926 "label" for left justified, "\hfill label\hfill" for center, and
6927 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
6928 should be changed accordingly.
6930 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6932 * src/lyxtext.h: change SetLayout() to take a
6933 LyXTextClass::size_type instead of a char (when there is more than
6934 127 layouts in a class); also change type of copylayouttype.
6935 * src/text2.C (SetLayout): ditto.
6936 * src/LyXView.C (updateLayoutChoice): ditto.
6938 * src/LaTeX.C (scanLogFile): errors where the line number was not
6939 given just after the '!'-line were ignored (from Dekel Tsur).
6941 * lib/lyxrc.example: fix description of \date_insert_format
6943 * lib/layouts/llncs.layout: new layout, contributed by Martin
6946 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6948 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
6949 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
6950 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
6951 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
6952 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
6953 paragraph.C, text.C, text2.C)
6955 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6957 * src/insets/insettext.C (LocalDispatch): remove extra break
6960 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
6961 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
6963 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
6964 * src/insets/insettext.[Ch] (GetCursorPos): ditto
6966 * src/insets/insetbib.h: move InsetBibkey::Holder and
6967 InsetCitation::Holder in public space.
6969 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6971 * src/insets/insettext.h: small change to get the new files from
6972 Juergen to compile (use "string", not "class string").
6974 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
6975 const & as parameter to LocalDispatch, use LyXFont const & as
6976 paramter to some other func. This also had impacto on lyxinsets.h
6977 and the two mathed insets.
6979 2000-02-24 Juergen Vigna <jug@sad.it>
6982 * src/commandtags.h:
6984 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
6988 * src/BufferView2.C: added/updated code for various inset-functions
6990 * src/insets/insetert.[Ch]: added implementation of InsetERT
6992 * src/insets/insettext.[Ch]: added implementation of InsetText
6994 * src/insets/inset.C (Edit): added "unsigned int button" parameter
6995 (draw): added preliminary code for inset scrolling not finshed yet
6997 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
6998 as it is in lyxfunc.C now
7000 * src/insets/lyxinset.h: Added functions for text-insets
7002 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7004 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
7005 BufferView and reimplement the list as a queue put inside its own
7008 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
7010 * several files: use the new interface to the "updateinsetlist"
7012 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
7014 (work_area_handler): call BufferView::trippleClick on trippleclick.
7016 * src/BufferView.C (doubleClick): new function, selects word on
7018 (trippleClick): new function, selects line on trippleclick.
7020 2000-02-22 Allan Rae <rae@lyx.org>
7022 * lib/bind/xemacs.bind: buffer-previous not supported
7024 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7026 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
7029 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7031 * src/bufferlist.C: get rid of current_view from this file
7033 * src/spellchecker.C: get rid of current_view from this file
7035 * src/vspace.C: get rid of current_view from this file
7036 (inPixels): added BufferView parameter for this func
7037 (asLatexCommand): added a BufferParams for this func
7039 * src/text.C src/text2.C: get rid of current_view from these
7042 * src/lyxfont.C (getFontDirection): move this function here from
7045 * src/bufferparams.C (getDocumentDirection): move this function
7048 * src/paragraph.C (getParDirection): move this function here from
7050 (getLetterDirection): ditto
7052 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
7054 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
7055 resize due to wrong pixmap beeing used. Also took the opurtunity
7056 to make the LyXScreen stateless on regard to WorkArea and some
7057 general cleanup in the same files.
7059 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7061 * src/Makefile.am: add missing direction.h
7063 * src/PainterBase.h: made the width functions const.
7065 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
7068 * src/insets/insetcommand.C (draw): draw Editable as buttons.
7070 * src/insets/insetlatexaccent.C (draw): make the accents draw
7071 better, at present this will only work well with iso8859-1.
7073 * several files: remove the old drawing code, now we use the new
7076 * several files: remove support for mono_video, reverse_video and
7079 2000-02-17 Juergen Vigna <jug@sad.it>
7081 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
7082 int ** as we have to return the pointer, otherwise we have only
7083 NULL pointers in the returning function.
7085 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7087 * src/LaTeX.C (operator()): quote file name when running latex.
7089 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7091 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
7092 (bubble tip), this removes our special handling of this.
7094 * Remove all code that is unused now that we have the new
7095 workarea. (Code that are not active when NEW_WA is defined.)
7097 * Make the uses of XSync not conditionalized on define USE_XSYNC.
7099 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7101 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
7102 nonexisting layout; correctly redirect obsoleted layouts.
7104 * lib/lyxrc.example: document \view_dvi_paper_option
7106 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
7109 * src/lyx_cb.C (RunScript): handle $$FName for command names.
7110 (PreviewDVI): handle the view_dvi_paper_option variable.
7111 [Both from Roland Krause]
7113 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7115 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
7116 char const *, int, LyXFont)
7117 (text(int, int, string, LyXFont)): ditto
7119 * src/text.C (InsertCharInTable): attempt to fix the double-space
7120 feature in tables too.
7121 (BackspaceInTable): ditto.
7122 (GetVisibleRow): make bottom pagebreak line be a onoff line.
7124 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7126 * src/text2.C (owner): only complain if owner_ is set and bv != 0
7128 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
7129 newly found text in textcache to this.
7130 (buffer): set the owner of the text put into the textcache to 0
7132 * src/insets/figinset.C (draw): fixed the drawing of figures with
7135 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
7136 drawing of mathframe, hfills, protected space, table lines. I have
7137 now no outstanding drawing problems with the new Painter code.
7139 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7141 * src/PainterBase.C (ellipse, circle): do not specify the default
7144 * src/LColor.h: add using directive.
7146 * src/Painter.[Ch]: change return type of methods from Painter& to
7147 PainterBase&. Add a using directive.
7149 * src/WorkArea.C: wrap xforms callbacks in C functions
7152 * lib/layouts/foils.layout: font fix and simplifications from Carl
7155 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7157 * a lot of files: The Painter, LColor and WorkArea from the old
7158 devel branch has been ported to lyx-devel. Some new files and a
7159 lot of #ifdeffed code. The new workarea is enabled by default, but
7160 if you want to test the new Painter and LColor you have to compile
7161 with USE_PAINTER defined (do this in config.h f.ex.) There are
7162 still some rought edges, and I'd like some help to clear those
7163 out. It looks stable (loads and displays the Userguide very well).
7166 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7168 * src/buffer.C (pop_tag): revert to the previous implementation
7169 (use a global variable for both loops).
7171 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
7173 * src/lyxrc.C (LyXRC): change slightly default date format.
7175 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
7176 there is an English text with a footnote that starts with a Hebrew
7177 paragraph, or vice versa.
7178 (TeXFootnote): ditto.
7180 * src/text.C (LeftMargin): allow for negative values for
7181 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
7184 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
7185 for input encoding (cyrillic)
7187 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7189 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
7192 * src/toolbar.C (set): ditto
7193 * src/insets/insetbib.C (create_form_citation_form): ditto
7195 * lib/CREDITS: added Dekel Tsur.
7197 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
7198 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
7199 hebrew supports files from Dekel Tsur.
7201 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
7202 <tzafrir@technion.ac.il>
7204 * src/lyxrc.C: put \date_insert_format at the right place.
7206 * src/buffer.C (makeLaTeXFile): fix the handling of
7207 BufferParams::sides when writing out latex files.
7209 * src/BufferView2.C: add a "using" directive.
7211 * src/support/lyxsum.C (sum): when we use lyxstring,
7212 ostringstream::str needs an additional .c_str().
7214 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7216 * src/support/filetools.C (ChangeExtension): patch from Etienne
7219 * src/TextCache.C (show): remove const_cast and make second
7220 parameter non-const LyXText *.
7222 * src/TextCache.h: use non const LyXText in show.
7224 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
7227 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7229 * src/support/lyxsum.C: rework to be more flexible.
7231 * several places: don't check if a pointer is 0 if you are going
7234 * src/text.C: remove some dead code.
7236 * src/insets/figinset.C: remove some dead code
7238 * src/buffer.C: move the BufferView funcs to BufferView2.C
7239 remove all support for insetlatexdel
7240 remove support for oldpapersize stuff
7241 made some member funcs const
7243 * src/kbmap.C: use a std::list to store the bindings in.
7245 * src/BufferView2.C: new file
7247 * src/kbsequence.[Ch]: new files
7249 * src/LyXAction.C + others: remove all trace of buffer-previous
7251 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
7252 only have one copy in the binary of this table.
7254 * hebrew patch: moved some functions from LyXText to more
7255 appropriate places. (LyXParagraph, BufferParams, LyXFont)
7257 * several files: remove support for XForms older than 0.88
7259 remove some #if 0 #endif code
7261 * src/TextCache.[Ch]: new file. Holds the textcache.
7263 * src/BufferView.C: changes to use the new TextCache interface.
7264 (waitForX): remove the now unused code.
7266 * src/BackStack.h: remove some commented code
7268 * lib/bind/emacs.bind: remove binding for buffer-previous
7270 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7272 * applied the hebrew patch.
7274 * src/lyxrow.h: make sure that all Row variables are initialized.
7276 * src/text2.C (TextHandleUndo): comment out a delete, this might
7277 introduce a memory leak, but should also help us to not try to
7278 read freed memory. We need to look at this one.
7280 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
7281 (LyXParagraph): initalize footnotekind.
7283 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
7284 forgot this when applying the patch. Please heed the warnings.
7286 * src/BufferView.C (buffer): a fix for the buffer-reload problem
7287 (aka. reformat problem)
7289 * src/bufferlist.C (exists): made const, and use const_iterator
7290 (isLoaded): new func.
7291 (release): use std::find to find the correct buffer.
7293 * src/bufferlist.h: made getState a const func.
7294 made empty a const func.
7295 made exists a const func.
7298 2000-02-01 Juergen Vigna <jug@sad.it>
7300 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
7302 * po/it.po: updated a bit the italian po file and also changed the
7303 'file nuovo' for newfile to 'filenuovo' without a space, this did
7306 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
7307 for the new insert_date command.
7309 * src/lyxfunc.C (Dispatch): added support for a insert_date function
7310 from jdblair, to insert a date into the current text conforming to
7311 a strftime format (for now only considering the locale-set and not
7312 the document-language).
7314 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7316 * src/lyxfont.C (textWidth): hopefully better fix for the Array
7317 Bounds Read error seen by purify. The problem was that islower is
7318 a macros which takes an unsigned char and uses it as an index for
7319 in array of characters properties (and is thus subject to the
7323 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
7324 correctly the paper sides radio buttons.
7325 (UpdateDocumentButtons): ditto.
7327 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7329 * src/kbmap.C (getsym + others): change to return unsigned int,
7330 returning a long can give problems on 64 bit systems. (I assume
7331 that int is 32bit on 64bit systems)
7333 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7335 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
7336 LyXLookupString to be zero-terminated. Really fixes problems seen
7339 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7341 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
7342 write a (char*)0 to the lyxerr stream.
7344 * src/lastfiles.C: move algorithm before the using statemets.
7346 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7348 * src/lastfiles.C: move using directives in global scope (egcs 1.x
7349 complains otherwise).
7350 * src/table.C: ditto
7352 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
7355 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
7356 that I removed earlier... It is really needed.
7358 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
7360 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7362 * INSTALL: update xforms home page URL.
7364 * lib/configure.m4: fix a bug with unreadable layout files.
7366 * src/table.C (calculate_width_of_column): add "using std::max"
7369 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7371 * several files: marked several lines with "DEL LINE", this is
7372 lines that can be deleted without changing anything.
7373 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
7374 checks this anyway */
7377 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
7379 * src/DepTable.C (update): add a "+" at the end when the checksum
7380 is different. (debugging string only)
7382 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
7383 the next inset to not be displayed. This should also fix the list
7384 of labels in the "Insert Crossreference" dialog.
7386 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7388 * src/support/LSubstring.C (LSubstring): set pos to string::npos
7389 when regex was not found.
7391 * src/support/lstrings.C (lowercase): use handcoded transform always.
7394 * src/text.C (Delete): fixed the crash. cursor.par->prev and
7395 old_cursor.par->prev could be 0.
7397 * several files: changed post inc/dec to pre inc/dec
7399 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
7400 write the lastfiles to file.
7402 * src/BufferView.C (buffer): only show TextCache info when debugging
7404 (resizeCurrentBuffer): ditto
7405 (workAreaExpose): ditto
7407 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
7409 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
7411 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
7412 a bit better by removing the special case for \i and \j.
7414 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7416 * src/lyx_main.C (easyParse): remove test for bad comand line
7417 options, since this broke all xforms-related parsing.
7419 * src/kbmap.C (getsym): set return type to unsigned long, as
7420 declared in header. On an alpha, long is _not_ the same as int.
7422 * src/support/LOstream.h: add a "using std::flush;"
7424 * src/insets/figinset.C: ditto.
7426 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7428 * src/bufferlist.C (write): use blinding fast file copy instead of
7429 "a char at a time", now we are doing it the C++ way.
7431 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
7432 std::list<int> instead.
7433 (addpidwait): reflect move to std::list<int>
7434 (sigchldchecker): ditto
7436 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
7439 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
7440 that obviously was wrong...
7442 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
7443 c, this avoids warnings with purify and islower.
7445 * src/insets/figinset.C: rename struct queue to struct
7446 queue_element and rewrite to use a std::queue. gsqueue is now a
7447 std::queue<queue_element>
7448 (runqueue): reflect move to std::queue
7451 * src/support/lstrings.h (tostr): specialize for bool, otherwise
7452 we would get "1" "0" instead of "true" "false. Also make the tostr
7455 2000-01-21 Juergen Vigna <jug@sad.it>
7457 * src/buffer.C (writeFileAscii): Disabled code for special groff
7458 handling of tabulars till I fix this in table.C
7460 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7462 * src/support/mkdir.C (mkdir): change second argument of mkdir to
7464 * src/support/lyxlib.h: ditto.
7466 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7468 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
7469 and 'j' look better. This might fix the "macron" bug that has been
7472 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
7473 functions as one template function. Delete the old versions.
7475 * src/support/lyxsum.C: move using std::ifstream inside
7478 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
7481 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
7483 * src/mathed/formula.C: delete #include "bufferlist.h" never used
7485 * src/insets/figinset.C (InitFigures): use new instead of malloc
7486 to allocate memory for figures and bitmaps.
7487 (DoneFigures): use delete[] instead of free to deallocate memory
7488 for figures and bitmaps.
7489 (runqueue): use new to allocate
7490 (getfigdata): use new/delete[] instead of malloc/free
7491 (RegisterFigure): ditto
7493 * some files: moved some declarations closer to first use, small
7494 whitespace changes use preincrement instead of postincrement where
7495 it does not make a difference.
7497 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
7498 step on the way to use stl::containers for key maps.
7500 * src/bufferlist.h: add a typedef for const_iterator and const
7501 versions of begin and end.
7503 * src/bufferlist.[Ch]: change name of member variable _state to
7504 state_. (avoid reserved names)
7506 (getFileNames): returns the filenames of the buffers in a vector.
7508 * configure.in (ALL_LINGUAS): added ro
7510 * src/support/putenv.C: new file
7512 * src/support/mkdir.C: new file
7514 2000-01-20 Allan Rae <rae@lyx.org>
7516 * lib/layouts/IEEEtran.layout: Added several theorem environments
7518 * lib/templates/IEEEtran.lyx: Example theorem environments and a
7519 couple of minor additions.
7521 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
7522 (except for those in footnotes of course)
7524 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7526 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
7528 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
7529 std::sort and std::lower_bound instead of qsort and handwritten
7531 (struct compara): struct that holds the functors used by std::sort
7532 and std::lower_bound in MathedLookupBOP.
7534 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7536 * src/support/LAssert.h: do not do partial specialization. We do
7539 * src/support/lyxlib.h: note that lyx::getUserName() and
7540 lyx::date() are not in use right now. Should these be suppressed?
7542 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
7543 (makeLinuxDocFile): do not put date and user name in linuxdoc
7546 * src/support/lyxlib.h (kill): change first argument to long int,
7547 since that's what solaris uses.
7549 * src/support/kill.C (kill): fix declaration to match prototype.
7551 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
7552 actually check whether namespaces are supported. This is not what
7555 * src/support/lyxsum.C: add a using directive.
7557 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7559 * src/support/kill.C: if we have namespace support we don't have
7560 to include lyxlib.h.
7562 * src/support/lyxlib.h: use namespace lyx if supported.
7564 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7566 * src/support/date.C: new file
7568 * src/support/chdir.C: new file
7570 * src/support/getUserName.C: new file
7572 * src/support/getcwd.C: new file
7574 * src/support/abort.C: new file
7576 * src/support/kill.C: new file
7578 * src/support/lyxlib.h: moved all the functions in this file
7579 insede struct lyx. Added also kill and abort to this struct. This
7580 is a way to avoid the "kill is not defined in <csignal>", we make
7581 C++ wrappers for functions that are not ANSI C or ANSI C++.
7583 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
7584 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
7585 lyx it has been renamed to sum.
7587 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7589 * src/text.C: add using directives for std::min and std::max.
7591 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7593 * src/texrow.C (getIdFromRow): actually return something useful in
7594 id and pos. Hopefully fixes the bug with positionning of errorbox
7597 * src/lyx_main.C (easyParse): output an error and exit if an
7598 incorrect command line option has been given.
7600 * src/spellchecker.C (ispell_check_word): document a memory leak.
7602 * src/bufferlist.C (write): fix mismatched allocation/deletion,
7603 where a "struct utimbuf" is allocated with "new" and deleted with
7606 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
7608 * src/text2.C (CutSelection): don't delete double spaces.
7609 (PasteSelection): ditto
7610 (CopySelection): ditto
7612 * src/text.C (Backspace): don't delete double spaces.
7614 * src/lyxlex.C (next): fix a bug that were only present with
7615 conformant std::istream::get to read comment lines, use
7616 std::istream::getline instead. This seems to fix the problem.
7618 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7620 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
7621 allowed to insert space before space" editing problem. Please read
7622 commends at the beginning of the function. Comments about usage
7625 * src/text.C (InsertChar): fix for the "not allowed to insert
7626 space before space" editing problem.
7628 * src/text2.C (DeleteEmptyParagraphMechanism): when
7629 IsEmptyTableRow can only return false this last "else if" will
7630 always be a no-op. Commented out.
7632 * src/text.C (RedoParagraph): As far as I can understand tmp
7633 cursor is not really needed.
7635 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
7636 present it could only return false anyway.
7637 (several functions): Did something not so smart...added a const
7638 specifier on a lot of methods.
7640 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
7641 and add a tmp->text.resize. The LyXParagraph constructor does the
7643 (BreakParagraphConservative): ditto
7645 * src/support/path.h (Path): add a define so that the wrong usage
7646 "Path("/tmp") will be flagged as a compilation error:
7647 "`unnamed_Path' undeclared (first use this function)"
7649 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7651 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
7652 which was bogus for several reasons.
7654 * src/LaTeX.C (scanAux): fix the regular expression used to scan
7658 * autogen.sh: do not use "type -path" (what's that anyway?).
7660 * src/support/filetools.C (findtexfile): remove extraneous space
7661 which caused a kpsewhich warning (at least with kpathsea version
7664 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7666 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
7668 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
7670 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
7672 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7674 * src/paragraph.C (BreakParagraph): do not reserve space on text
7675 if we don't need to (otherwise, if pos_end < pos, we end up
7676 reserving huge amounts of memory due to bad unsigned karma).
7677 (BreakParagraphConservative): ditto, although I have not seen
7678 evidence the bug can happen here.
7680 * src/lyxparagraph.h: add a using std::list.
7682 2000-01-11 Juergen Vigna <jug@sad.it>
7684 * src/menus.C (MenuDocu): output an Alert if the documentation-file
7687 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7689 * src/vc-backend.C (doVCCommand): change to be static and take one
7690 more parameter: the path to chdir too be fore executing the command.
7691 (retrive): new function equiv to "co -r"
7693 * src/bufferlist.C (loadLyXFile): implement the missing parts if
7694 file_not_found_hook is true.
7696 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
7698 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
7699 if a file is readwrite,readonly...anything else.
7701 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7703 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
7704 (CreatePostscript): name change from MenuRunDVIPS (or something)
7705 (PreviewPostscript): name change from MenuPreviewPS
7706 (PreviewDVI): name change from MenuPreviewDVI
7708 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
7709 \view_pdf_command., \pdf_to_ps_command
7711 * lib/configure.m4: added search for PDF viewer, and search for
7712 PDF to PS converter.
7713 (lyxrc.defaults output): add \pdflatex_command,
7714 \view_pdf_command and \pdf_to_ps_command.
7716 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
7718 * src/bufferlist.C (write): we don't use blocksize for anything so
7721 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7723 * src/support/block.h: disable operator T* (), since it causes
7724 problems with both compilers I tried. See comments in the file.
7726 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
7729 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
7730 variable LYX_DIR_10x to LYX_DIR_11x.
7732 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
7734 * INSTALL: document --with-lyxname.
7737 * configure.in: new configure flag --with-lyxname which allows to
7738 choose the name under which lyx is installed. Default is "lyx", of
7739 course. It used to be possible to do this with --program-suffix,
7740 but the later has in fact a different meaning for autoconf.
7742 * src/support/lstrings.h (lstrchr): reformat a bit.
7744 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
7745 * src/mathed/math_defs.h: ditto.
7747 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7749 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
7750 true, decides if we create a backup file or not when saving. New
7751 tag and variable \pdf_mode, defaults to false. New tag and
7752 variable \pdflatex_command, defaults to pdflatex. New tag and
7753 variable \view_pdf_command, defaults to xpdf. New tag and variable
7754 \pdf_to_ps_command, defaults to pdf2ps.
7756 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7758 * src/bufferlist.C (close): don't call insetUnlock if the buffer
7759 does not have a BufferView.
7760 (unlockInset): ditto + don't access the_locking_inset if the
7761 buffer does not have a BufferView.
7763 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
7764 certain circumstances so that we don't continue a keyboard
7765 operation long after the key was released. Try f.ex. to load a
7766 large document, press PageDown for some seconds and then release
7767 it. Before this change the document would contine to scroll for
7768 some time, with this change it stops imidiatly.
7770 * src/support/block.h: don't allocate more space than needed. As
7771 long as we don't try to write to the arr[x] in a array_type arr[x]
7772 it is perfectly ok. (if you write to it you might segfault).
7773 added operator value_type*() so that is possible to pass the array
7774 to functions expecting a C-pointer.
7776 * lib/Makefile.am (dist-hook): don't fail completely if unable to
7779 * intl/*: updated to gettext 0.10.35, tried to add our own
7780 required modifications. Please verify.
7782 * po/*: updated to gettext 0.10.35, tried to add our own required
7783 modifications. Please verify.
7785 * src/support/lstrings.C (tostr): go at fixing the problem with
7786 cxx and stringstream. When stringstream is used return
7787 oss.str().c_str() so that problems with lyxstring and basic_string
7788 are avoided. Note that the best solution would be for cxx to use
7789 basic_string all the way, but it is not conformant yet. (it seems)
7791 * src/lyx_cb.C + other files: moved several global functions to
7792 class BufferView, some have been moved to BufferView.[Ch] others
7793 are still located in lyx_cb.C. Code changes because of this. (part
7794 of "get rid of current_view project".)
7796 * src/buffer.C + other files: moved several Buffer functions to
7797 class BufferView, the functions are still present in buffer.C.
7798 Code changes because of this.
7800 * config/lcmessage.m4: updated to most recent. used when creating
7803 * config/progtest.m4: updated to most recent. used when creating
7806 * config/gettext.m4: updated to most recent. applied patch for
7809 * config/gettext.m4.patch: new file that shows what changes we
7810 have done to the local copy of gettext.m4.
7812 * config/libtool.m4: new file, used in creation of acinclude.m4
7814 * config/lyxinclude.m4: new file, this is the lyx created m4
7815 macros, used in making acinclude.m4.
7817 * autogen.sh: GNU m4 discovered as a separate task not as part of
7818 the lib/configure creation.
7819 Generate acinlucde from files in config. Actually cat
7820 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
7821 easier to upgrade .m4 files that really are external.
7823 * src/Spacing.h: moved using std::istringstream to right after
7824 <sstream>. This should fix the problem seen with some compilers.
7826 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7828 * src/lyx_cb.C: began some work to remove the dependency a lot of
7829 functions have on BufferView::text, even if not really needed.
7830 (GetCurrentTextClass): removed this func, it only hid the
7833 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
7834 forgot this in last commit.
7836 * src/Bullet.C (bulletEntry): use static char const *[] for the
7837 tables, becuase of this the return arg had to change to string.
7839 (~Bullet): removed unneeded destructor
7841 * src/BufferView.C (beforeChange): moved from lyx_cb.C
7842 (insetSleep): moved from Buffer
7843 (insetWakeup): moved from Buffer
7844 (insetUnlock): moved from Buffer
7846 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
7847 from Buffer to BufferView.
7849 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
7851 * config/ltmain.sh: updated to version 1.3.4 of libtool
7853 * config/ltconfig: updated to version 1.3.4 of libtool
7855 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7858 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
7859 Did I get that right?
7861 * src/lyxlex.h: add a "using" directive or two.
7862 * src/Spacing.h: ditto.
7863 * src/insets/figinset.C: ditto.
7864 * src/support/filetools.C: ditto.
7865 * src/support/lstrings.C: ditto.
7866 * src/BufferView.C: ditto.
7867 * src/bufferlist.C: ditto.
7868 * src/lyx_cb.C: ditto.
7869 * src/lyxlex.C: ditto.
7871 * NEWS: add some changes for 1.1.4.
7873 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7875 * src/BufferView.C: first go at a TextCache to speed up switching
7878 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7880 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
7881 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
7882 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
7883 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
7886 * src/mathed/math_defs.h (MathedRowSt): make sure that all
7887 members of the struct are correctly initialized to 0 (detected by
7889 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
7890 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
7892 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
7893 pidwait, since it was allocated with "new". This was potentially
7894 very bad. Thanks to Michael Schmitt for running purify for us.
7897 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7899 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
7901 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
7903 1999-12-30 Allan Rae <rae@lyx.org>
7905 * lib/templates/IEEEtran.lyx: minor change
7907 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
7908 src/mathed/formula.C (LocalDispatch): askForText changes
7910 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
7911 know when a user has cancelled input. Fixes annoying problems with
7912 inserting labels and version control.
7914 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7916 * src/support/lstrings.C (tostr): rewritten to use strstream and
7919 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7921 * src/support/filetools.C (IsFileWriteable): use fstream to check
7922 (IsDirWriteable): use fileinfo to check
7924 * src/support/filetools.h (FilePtr): whole class deleted
7926 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
7928 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
7930 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
7932 * src/bufferlist.C (write): use ifstream and ofstream instead of
7935 * src/Spacing.h: use istrstream instead of sscanf
7937 * src/mathed/math_defs.h: change first arg to istream from FILE*
7939 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
7941 * src/mathed/math_parser.C: have yyis to be an istream
7942 (LexGetArg): use istream (yyis)
7944 (mathed_parse): ditto
7945 (mathed_parser_file): first arg istream instead of FILE*, set yyis
7947 * src/mathed/formula.C (Read): rewritten to use istream
7949 * src/mathed/formulamacro.C (Read): rewritten to use istream
7951 * src/lyxlex.h (~LyXLex): deleted desturctor
7952 (getStream): new function, returns an istream
7953 (getFile): deleted funtion
7954 (IsOK): return is.good();
7956 * src/lyxlex.C (LyXLex): delete file and owns_file
7957 (setFile): open an filebuf and assign that to a istream instead of
7959 (setStream): new function, takes an istream as arg.
7960 (setFile): deleted function
7961 (EatLine): rewritten us use istream instead of FILE*
7965 * src/table.C (LyXTable): use istream instead of FILE*
7966 (Read): rewritten to take an istream instead of FILE*
7968 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7970 * src/buffer.C (Dispatch): remove an extraneous break statement.
7972 * src/support/filetools.C (QuoteName): change to do simple
7973 'quoting'. More work is necessary. Also changed to do nothing
7974 under emx (needs fix too).
7975 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
7977 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
7978 config.h.in to the AC_DEFINE_UNQUOTED() call.
7979 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
7980 needs char * as argument (because Solaris 7 declares it like
7983 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
7984 remove definition of BZERO.
7986 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7988 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
7989 defined, "lyxregex.h" if not.
7991 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
7993 (REGEX): new variable that is set to regex.c lyxregex.h when
7994 AM_CONDITIONAL USE_REGEX is set.
7995 (libsupport_la_SOURCES): add $(REGEX)
7997 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
8000 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
8003 * configure.in: add call to LYX_REGEX
8005 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
8006 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
8008 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8010 * lib/bind/fi_menus.bind: new file, from
8011 pauli.virtanen@saunalahti.fi.
8013 * src/buffer.C (getBibkeyList): pass the parameter delim to
8014 InsetInclude::getKeys and InsetBibtex::getKeys.
8016 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
8017 is passed to Buffer::getBibkeyList
8019 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
8020 instead of the hardcoded comma.
8022 * src/insets/insetbib.C (getKeys): make sure that there are not
8023 leading blanks in bibtex keys. Normal latex does not care, but
8024 harvard.sty seems to dislike blanks at the beginning of citation
8025 keys. In particular, the retturn value of the function is
8027 * INSTALL: make it clear that libstdc++ is needed and that gcc
8028 2.7.x probably does not work.
8030 * src/support/filetools.C (findtexfile): make debug message go to
8032 * src/insets/insetbib.C (getKeys): ditto
8034 * src/debug.C (showTags): make sure that the output is correctly
8037 * configure.in: add a comment for TWO_COLOR_ICON define.
8039 * acconfig.h: remove all the entries that already defined in
8040 configure.in or acinclude.m4.
8042 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
8043 to avoid user name, date and copyright.
8045 1999-12-21 Juergen Vigna <jug@sad.it>
8047 * src/table.C (Read): Now read bogus row format informations
8048 if the format is < 5 so that afterwards the table can
8049 be read by lyx but without any format-info. Fixed the
8050 crash we experienced when not doing this.
8052 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8054 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
8055 (RedoDrawingOfParagraph): ditto
8056 (RedoParagraphs): ditto
8057 (RemoveTableRow): ditto
8059 * src/text.C (Fill): rename arg paperwidth -> paper_width
8061 * src/buffer.C (insertLyXFile): rename var filename -> fname
8062 (writeFile): rename arg filename -> fname
8063 (writeFileAscii): ditto
8064 (makeLaTeXFile): ditto
8065 (makeLinuxDocFile): ditto
8066 (makeDocBookFile): ditto
8068 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
8071 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
8073 * src/bmtable.h: add extern "C" on this file when __cplusplus is
8076 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
8077 compiled by a C compiler not C++.
8079 * src/layout.h (LyXTextClass): added typedef for const_iterator
8080 (LyXTextClassList): added typedef for const_iterator + member
8081 functions begin and end.
8083 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
8084 iterators to fill the choice_class.
8085 (updateLayoutChoice): rewritten to use iterators to fill the
8086 layoutlist in the toolbar.
8088 * src/BufferView.h (BufferView::work_area_width): removed unused
8091 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
8093 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
8094 (sgmlCloseTag): ditto
8096 * src/support/lstrings.h: return type of countChar changed to
8099 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
8100 what version of this func to use. Also made to return unsigned int.
8102 * configure.in: call LYX_STD_COUNT
8104 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
8105 conforming std::count.
8107 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8109 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
8110 and a subscript would give bad display (patch from Dekel Tsur
8111 <dekel@math.tau.ac.il>).
8113 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
8115 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
8118 * src/chset.h: add a few 'using' directives
8120 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
8121 triggered when no buffer is active
8123 * src/layout.C: removed `break' after `return' in switch(), since
8126 * src/lyx_main.C (init): make sure LyX can be ran in place even
8127 when libtool has done its magic with shared libraries. Fix the
8128 test for the case when the system directory has not been found.
8130 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
8131 name for the latex file.
8132 (MenuMakeHTML): ditto
8134 * src/buffer.h: add an optional boolean argument, which is passed
8137 1999-12-20 Allan Rae <rae@lyx.org>
8139 * lib/templates/IEEEtran.lyx: small correction and update.
8141 * configure.in: Attempted to use LYX_PATH_HEADER
8143 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
8145 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
8146 input from JMarc. Now use preprocessor to find the header.
8147 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
8148 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
8149 LYX_STL_STRING_FWD. See comments in file.
8151 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
8153 * The global MiniBuffer * minibuffer variable is dead.
8155 * The global FD_form_main * fd_form_main variable is dead.
8157 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8159 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
8161 * src/table.h: add the LOstream.h header
8162 * src/debug.h: ditto
8164 * src/LyXAction.h: change the explaination of the ReadOnly
8165 attribute: is indicates that the function _can_ be used.
8167 * src/LyXAction.C (init): find-replace _can_ be used in read-only
8170 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8172 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
8178 * src/paragraph.C (GetWord): assert on pos>=0
8181 * src/support/lyxstring.C: condition the use of an invariant on
8183 * src/support/lyxstring.h: ditto
8185 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
8186 Use LAssert.h instead of plain assert().
8188 * src/support/lstrings.h: add LAssert.h, in case it is needed.
8190 * src/lyxfunc.C: do not include LAssert.h, it is not used.
8191 * src/support/filetools.C: ditto
8193 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
8196 * INSTALL: document the new configure flags
8198 * configure.in: suppress --with-debug; add --enable-assertions
8200 * acinclude.m4: various changes in alignment of help strings.
8202 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8204 * src/kbmap.C: commented out the use of the hash map in kb_map,
8205 beginning of movement to a stl::container.
8207 * several files: removed code that was not in effect when
8208 MOVE_TEXT was defined.
8210 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
8211 for escaping should not be used. We can discuss if the string
8212 should be enclosed in f.ex. [] instead of "".
8214 * src/trans_mgr.C (insert): use the new returned value from
8215 encodeString to get deadkeys and keymaps done correctly.
8217 * src/chset.C (encodeString): changed to return a pair, to tell
8218 what to use if we know the string.
8220 * src/lyxscreen.h (fillArc): new function.
8222 * src/FontInfo.C (resize): rewritten to use more std::string like
8223 structore, especially string::replace.
8225 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
8228 * configure.in (chmod +x some scripts): remove config/gcc-hack
8230 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8232 * src/buffer.C (writeFile): change once again the top comment in a
8233 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
8234 instead of an hardcoded version number.
8235 (makeDocBookFile): ditto
8237 * src/version.h: add new define LYX_DOCVERSION
8239 * po/de.po: update from Pit Sütterlin
8240 * lib/bind/de_menus.bind: ditto.
8242 * src/lyxfunc.C (Dispatch): call MenuExport()
8243 * src/buffer.C (Dispatch): ditto
8245 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
8246 LyXFunc::Dispatch().
8247 (MenuExport): new function, moved from
8248 LyXFunc::Dispatch().
8250 * src/trans_mgr.C (insert): small cleanup
8251 * src/chset.C (loadFile): ditto
8253 * lib/kbd/iso8859-1.cdef: add missing backslashes
8255 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8257 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
8258 help with placing the manually drawn accents better.
8260 (Draw): x2 and hg changed to float to minimize rounding errors and
8261 help place the accents better.
8263 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
8264 unsigned short to char is just wrong...cast the char to unsigned
8265 char instead so that the two values can compare sanely. This
8266 should also make the display of insetlatexaccents better and
8267 perhaps also some other insets.
8269 (lbearing): new function
8272 1999-12-15 Allan Rae <rae@lyx.org>
8274 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
8275 header that provides a wrapper around the very annoying SGI STL header
8278 * src/support/lyxstring.C, src/LString.h:
8279 removed old SGI-STL-compatability attempts.
8281 * configure.in: Use LYX_STL_STRING_FWD.
8283 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
8284 stl_string_fwd.h is around and try to determine it's location.
8285 Major improvement over previous SGI STL 3.2 compatability.
8286 Three small problems remain with this function due to my zero
8287 knowledge of autoconf. JMarc and lgb see the comments in the code.
8289 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8291 * src/broken_const.h, config/hack-gcc, config/README: removed
8293 * configure.in: remove --with-gcc-hack option; do not call
8296 * INSTALL: remove documentation of --with-broken-const and
8299 * acconfig.h: remove all trace of BROKEN_CONST define
8301 * src/buffer.C (makeDocBookFile): update version number in output
8303 (SimpleDocBookOnePar): fix an assert when trying to a character
8304 access beyond string length
8307 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8309 * po/de.po: fix the Export menu
8311 * lyx.man: update the description of -dbg
8313 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
8314 (commandLineHelp): updated
8315 (easyParse): show list of available debug levels if -dbg is passed
8318 * src/Makefile.am: add debug.C
8320 * src/debug.h: moved some code to debug.C
8322 * src/debug.C: new file. Contains code to set and show debug
8325 * src/layout.C: remove 'break' after 'continue' in switch
8326 statements, since these cannot be reached.
8328 1999-12-13 Allan Rae <rae@lyx.org>
8330 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
8331 (in_word_set): hash() -> math_hash()
8333 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
8335 * acconfig.h: Added a test for whether we are using exceptions in the
8336 current compilation run. If so USING_EXCEPTIONS is defined.
8338 * config.in: Check for existance of stl_string_fwd.h
8339 * src/LString.h: If compiling --with-included-string and SGI's
8340 STL version 3.2 is present (see above test) we need to block their
8341 forward declaration of string and supply a __get_c_string().
8342 However, it turns out this is only necessary if compiling with
8343 exceptions enabled so I've a bit more to add yet.
8345 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
8346 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
8347 src/support/LRegex.h, src/undo.h:
8348 Shuffle the order of the included files a little to ensure that
8349 LString.h gets included before anything that includes stl_string_fwd.h
8351 * src/support/lyxstring.C: We need to #include LString.h instead of
8352 lyxstring.h to get the necessary definition of __get_c_string.
8353 (__get_c_string): New function. This is defined static just like SGI's
8354 although why they need to do this I'm not sure. Perhaps it should be
8355 in lstrings.C instead.
8357 * lib/templates/IEEEtran.lyx: New template file.
8359 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8361 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
8362 * intl/Makefile.in (MKINSTALLDIRS): ditto
8364 * src/LyXAction.C (init): changed to hold the LFUN data in a
8365 automatic array in stead of in callso to newFunc, this speeds up
8366 compilation a lot. Also all the memory used by the array is
8367 returned when the init is completed.
8369 * a lot of files: compiled with -Wold-style-cast, changed most of
8370 the reported offenders to C++ style casts. Did not change the
8371 offenders in C files.
8373 * src/trans.h (Match): change argument type to unsigned int.
8375 * src/support/DebugStream.C: fix some types on the streambufs so
8376 that it works on a conforming implementation.
8378 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8380 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
8382 * src/support/lyxstring.C: remove the inline added earlier since
8383 they cause a bunch of unsatisfied symbols when linking with dec
8384 cxx. Cxx likes to have the body of inlines at the place where they
8387 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
8388 accessing negative bounds in array. This fixes the crash when
8389 inserting accented characters.
8390 * src/trans.h (Match): ditto
8392 * src/buffer.C (Dispatch): since this is a void, it should not try
8393 to return anything...
8395 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8397 * src/buffer.h: removed the two friends from Buffer. Some changes
8398 because of this. Buffer::getFileName and Buffer::setFileName
8399 renamed to Buffer::fileName() and Buffer::fileName(...).
8401 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8403 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
8404 and Buffer::update(short) to BufferView. This move is currently
8405 controlled by a define MOVE_TEXT, this will be removed when all
8406 shows to be ok. This move paves the way for better separation
8407 between buffer contents and buffer view. One side effect is that
8408 the BufferView needs a rebreak when swiching buffers, if we want
8409 to avoid this we can add a cache that holds pointers to LyXText's
8410 that is not currently in use.
8412 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
8415 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8417 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
8419 * lyx_main.C: new command line option -x (or --execute) and
8420 -e (or --export). Now direct conversion from .lyx to .tex
8421 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
8422 Unfortunately, X is still needed and the GUI pops up during the
8425 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8427 * src/Spacing.C: add a using directive to bring stream stuff into
8429 * src/paragraph.C: ditto
8430 * src/buffer.C: ditto
8432 * NEWS: updated a bit the new features of 1.1.3 (took a few things
8433 from Lars' announcement).
8435 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
8436 example files from Tino Meinen.
8438 1999-12-06 Allan Rae <rae@lyx.org>
8440 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
8442 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8444 * src/support/lyxstring.C: added a lot of inline for no good
8447 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
8448 latexWriteEndChanges, they were not used.
8450 * src/layout.h (operator<<): output operator for PageSides
8452 * src/mathed/math_iter.C (my_memcpy): slightly changed.
8454 * some example files: loaded in LyX 1.0.4 and saved again to update
8455 certain constructs (table format)
8457 * a lot of files: did the change to use fstream/iostream for all
8458 writing of files. Done with a close look at Andre Poenitz's patch.
8460 * some files: whitespace changes.
8462 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8464 * src/mathed/math_iter.C (my_memcpy): new function. Since the
8465 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
8466 architecture, we provide our own. It is used unconditionnally, but
8467 I do not think this is a performance problem. Thanks to Angus
8468 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
8469 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
8471 (GetInset): use my_memcpy.
8475 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
8476 it is easier to understand, but it uses less TeX-only constructs now.
8478 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
8479 elements contain spaces
8481 * lib/configure: regenerated
8483 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
8484 elements contain spaces; display the list of programs that are
8487 * autogen.sh: make sure lib/configure is executable
8489 * lib/examples/*: rename the tutorial examples to begin with the
8490 two-letters language code.
8492 * src/lyxfunc.C (getStatus): do not query current font if no
8495 * src/lyx_cb.C (RunScript): use QuoteName
8496 (MenuRunDvips): ditto
8497 (PrintApplyCB): ditto
8499 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
8500 around argument, so that it works well with the current shell.
8501 Does not work properly with OS/2 shells currently.
8503 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
8504 * src/LyXSendto.C (SendtoApplyCB): ditto
8505 * src/lyxfunc.C (Dispatch): ditto
8506 * src/buffer.C (runLaTeX): ditto
8507 (runLiterate): ditto
8508 (buildProgram): ditto
8510 * src/lyx_cb.C (RunScript): ditto
8511 (MenuMakeLaTeX): ditto
8513 * src/buffer.h (getLatexName): new method
8515 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
8517 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8519 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
8520 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
8521 (create_math_panel): ditto
8523 * src/lyxfunc.C (getStatus): re-activate the code which gets
8524 current font and cursor; add test for export to html.
8526 * src/lyxrc.C (read): remove unreachable break statements; add a
8529 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
8531 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8533 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
8534 introduced by faulty regex.
8535 * src/buffer.C: ditto
8536 * src/lastfiles.C: ditto
8537 * src/paragraph.C: ditto
8538 * src/table.C: ditto
8539 * src/vspace.C: ditto
8540 * src/insets/figinset.C: ditto
8541 Note: most of these is absolutely harmless, except the one in
8542 src/mathed formula.C.
8544 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8546 * src/ImportNoweb.C (documentclass): fixed bounds for substr
8547 operation, yielding correct results for the reLyX command.
8549 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8551 * src/support/filetools.C (ExpandPath): removed an over eager
8553 (ReplaceEnvironmentPath): ditto
8555 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
8556 shows that we are doing something fishy in our code...
8560 * src/lyxrc.C (read): use a double switch trick to get more help
8561 from the compiler. (the same trick is used in layout.C)
8562 (write): new function. opens a ofstream and pass that to output
8563 (output): new function, takes a ostream and writes the lyxrc
8564 elemts to it. uses a dummy switch to make sure no elements are
8567 * src/lyxlex.h: added a struct pushpophelper for use in functions
8568 with more than one exit point.
8570 * src/lyxlex.[Ch] (GetInteger): made it const
8574 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
8576 * src/layout.[hC] : LayoutTags splitted into several enums, new
8577 methods created, better error handling cleaner use of lyxlex. Read
8580 * src/bmtable.[Ch]: change some member prototypes because of the
8581 image const changes.
8583 * commandtags.h, src/LyXAction.C (init): new function:
8584 "preferences-save", saves the lyxrc entries into .lyx/preferences.
8585 This file is not read automatically but you can add \input
8586 preferences to your lyxrc if you want to. We need to discuss how
8589 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
8590 in .aux, also remove .bib and .bst files from dependencies when
8593 * src/BufferView.C, src/LyXView.C: add const_cast several places
8594 because of changes to images.
8596 * lib/images/*: same change as for images/*
8598 * lib/lyxrc.example: Default for accept_compound is false not no.
8600 * images/*: changed to be const, however I have som misgivings
8601 about this change so it might be changed back.
8603 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8605 * lib/configure, po/POTFILES.in: regenerated
8607 * autogen.sh: autogenerate lib/configure from lib/configure.m4
8609 * config/lib_configure.m4: removed
8611 * lib/configure.m4: new file (was config/lib_configure.m4)
8613 * configure.in: do not test for rtti, since we do not use it.
8615 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8617 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
8618 doubling of allocated space scheme. This makes it faster for large
8619 strings end to use less memory for small strings. xtra rememoved.
8621 * src/insets/figinset.C (waitalarm): commented out.
8622 (GhostscriptMsg): use static_cast
8623 (GhostscriptMsg): use new instead of malloc to allocate memory for
8624 cmap. also delete the memory after use.
8626 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
8628 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
8629 for changes in bibtex database or style.
8630 (runBibTeX): remove all .bib and .bst files from dep before we
8632 (run): use scanAuc in when dep file already exist.
8634 * src/DepTable.C (remove_files_with_extension): new method
8637 * src/DepTable.[Ch]: made many of the methods const.
8639 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8641 * src/bufferparams.C: make sure that the default textclass is
8642 "article". It used to be the first one by description order, but
8643 now the first one is "docbook".
8645 * src/lyx_main.C (setDebuggingLevel): change type of argument to
8646 string; call Debug::value.
8647 (easyParse): pass complete argument to setDebuggingLevel().
8649 * src/debug.h (value): fix the code that parses debug levels.
8651 * src/debug.h: add new debug type ACTION, reserved for LyXAction
8654 * src/LyXAction.C: use Debug::ACTION as debug channel.
8656 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
8658 * NEWS: updated for the future 1.1.3 release.
8660 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
8661 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
8662 it should. This is of course a controversial change (since many
8663 people will find that their lyx workscreen is suddenly full of
8664 red), but done for the sake of correctness.
8666 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
8667 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
8669 * src/insets/inseterror.h, src/insets/inseturl.h,
8670 src/insets/insetinfo.h, src/insets/figinset.h,
8671 src/mathed/formulamacro.h, src/mathed/math_macro.h
8672 (EditMessage): add a missing const and add _() to make sure that
8675 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
8676 src/insets/insetbib.C, src/support/filetools.C: add `using'
8679 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
8680 doing 'Insert index of last word' at the beginning of a paragraph.
8682 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8684 * several files: white-space changes.
8686 * src/mathed/formula.C: removed IsAlpha and IsDigit
8688 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
8689 .bib file. use a ifstream instead of FilePtr when parsing the .bib
8692 * src/insets/figinset.C (GetPSSizes): don't break when
8693 "EndComments" is seen. But break when a boundingbox is read.
8695 * all classes inherited from Inset: return value of Clone
8696 changed back to Inset *.
8698 * all classes inherited form MathInset: return value of Clone
8699 changed back to MathedInset *.
8701 * src/insets/figinset.C (runqueue): use a ofstream to output the
8702 gs/ps file. Might need some setpresicion or setw. However I can
8703 see no problem with the current code.
8704 (runqueue): use sleep instead of the alarm/signal code. I just
8705 can't see the difference.
8707 * src/paragraph.C (LyXParagraph): reserve space in the new
8708 paragraph and resize the inserted paragraph to just fit.
8710 * src/lyxfunc.h (operator|=): added operator for func_status.
8712 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
8713 check for readable file.
8715 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
8716 check for readable file.
8717 (MenuMakeLinuxDoc): ditto
8718 (MenuMakeDocBook): ditto
8719 (MenuMakeAscii): ditto
8720 (InsertAsciiFile): split the test for openable and readable
8722 * src/bmtable.C (draw_bitmaptable): use
8723 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
8725 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
8726 findtexfile from LaTeX to filetools.
8728 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
8729 instead of FilePtr. Needs to be verified by a literate user.
8731 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8733 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
8734 (EditMessage): likewise.
8736 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
8737 respectively as \textasciitilde and \textasciicircum.
8739 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8741 * src/support/lyxstring.h: made the methods that take iterators
8744 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
8745 (regexMatch): made is use the real regex class.
8747 * src/support/Makefile.am: changed to use libtool
8749 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
8751 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
8753 (MathIsInset ++): changed several macros to be inline functions
8756 * src/mathed/Makefile.am: changed to use libtool
8758 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
8760 * src/insets/inset* : Clone changed to const and return type is
8761 the true insettype not just Inset*.
8763 * src/insets/Makefile.am: changed to use libtool
8765 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
8767 * src/undo.[Ch] : added empty() and changed some of the method
8770 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
8772 * src/lyxparagraph.h: use id() and id(...) instead of getID and
8773 setID use block<> for the bullets array, added const several places.
8775 * src/lyxfunc.C (getStatus): new function
8777 * src/lyxfunc.[Ch] : small changes to take advantage of the new
8778 LyXAction, added const to several funtions.
8780 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
8781 a std::map, and to store the dir items in a vector.
8783 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
8786 * src/LyXView.[Ch] + other files : changed currentView to view.
8788 * src/LyXAction.[Ch] : ported from the old devel branch.
8790 * src/.cvsignore: added .libs and a.out
8792 * configure.in : changes to use libtool.
8794 * acinclude.m4 : inserted libtool.m4
8796 * .cvsignore: added libtool
8798 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8800 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
8801 file name in insets and mathed directories (otherwise the
8802 dependency is not taken in account under cygwin).
8804 * src/text2.C (InsertString[AB]): make sure that we do not try to
8805 read characters past the string length.
8807 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8809 * lib/doc/LaTeXConfig.lyx.in,
8810 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
8812 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
8813 file saying who created them and when this heppened; this is
8814 useless and annoys tools like cvs.
8816 * lib/layouts/g-brief-{en,de}.layout,
8817 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
8818 from Thomas Hartkens <thomas@hartkens.de>.
8820 * src/{insets,mathed}/Makefile.am: do not declare an empty
8821 LDFLAGS, so that it can be set at configure time (useful on Irix
8824 * lib/reLyX/configure.in: make sure that the prefix is set
8825 correctly in LYX_DIR.
8827 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8829 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
8830 be used by 'command-sequence' this allows to bind a key to a
8831 sequence of LyX-commands
8832 (Example: 'command-sequence math-insert alpha; math-insert beta;")
8834 * src/LyXAction.C: add "command-sequence"
8836 * src/LyXFunction.C: handling of "command-sequence"
8838 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
8839 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
8841 * src/lyxserver.C, src/minibuffer.C: Use this new interface
8843 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8845 * src/buffer.C (writeFile): Do not output a comment giving user
8846 and date at the beginning of a .lyx file. This is useless and
8847 annoys cvs anyway; update version number to 1.1.
8849 * src/Makefile.am (LYX_DIR): add this definition, so that a
8850 default path is hardcoded in LyX.
8852 * configure.in: Use LYX_GNU_GETTEXT.
8854 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
8855 AM_GNU_GETTEXT with a bug fixed.
8857 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
8859 * src/chset.C: add "using std::ifstream;" to please dec cxx.
8861 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
8862 which is used to point to LyX data is now LYX_DIR_11x.
8864 * lyx.man: convert to a unix text file; small updates.
8866 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8868 * src/support/LSubstring.[Ch]: made the second arg of most of the
8869 constructors be a const reference.
8871 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
8874 * src/support/lyxstring.[Ch] (swap): added missing member function
8875 and specialization of swap(str, str);
8877 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
8879 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
8880 trace of the old one.
8882 * src/undo.[Ch]: made the undostack use std::list to store undo's in
8883 put the member definitions in undo.C.
8885 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
8886 NEW_TEXT and have now only code that was included when this was
8889 * src/intl.C (LCombo): use static_cast
8891 (DispatchCallback): ditto
8893 * src/definitions.h: removed whole file
8895 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
8897 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
8898 parsing and stores in a std:map. a regex defines the file format.
8899 removed unneeded members.
8901 * src/bufferparams.h: added several enums from definitions.h here.
8902 Removed unsused destructor. Changed some types to use proper enum
8903 types. use block to have the temp_bullets and user_defined_bullets
8904 and to make the whole class assignable.
8906 * src/bufferparams.C (Copy): removed this functions, use a default
8909 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
8912 * src/buffer.C (readLyXformat2): commend out all that have with
8913 oldpapersize to do. also comment out all that hve to do with
8914 insetlatex and insetlatexdel.
8915 (setOldPaperStuff): commented out
8917 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
8919 * src/LyXAction.C: remove use of inset-latex-insert
8921 * src/mathed/math_panel.C (button_cb): use static_cast
8923 * src/insets/Makefile.am (insets_o_SOURCES): removed
8926 * src/support/lyxstring.C (helper): use the unsigned long
8927 specifier, UL, instead of a static_cast.
8929 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
8931 * src/support/block.h: new file. to be used as a c-style array in
8932 classes, so that the class can be assignable.
8934 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8936 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
8937 NULL, make sure to return an empty string (it is not possible to
8938 set a string to NULL).
8940 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8942 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
8944 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
8946 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
8947 link line, so that Irix users (for example) can set it explicitely to
8950 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
8951 it can be overidden at make time (static or dynamic link, for
8954 * src/vc-backend.C, src/LaTeXFeatures.h,
8955 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
8956 statements to bring templates to global namespace.
8958 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8960 * src/support/lyxstring.C (operator[] const): make it standard
8963 * src/minibuffer.C (Init): changed to reflect that more
8964 information is given from the lyxvc and need not be provided here.
8966 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
8968 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
8970 * src/LyXView.C (UpdateTimerCB): use static_cast
8971 (KeyPressMask_raw_callback): ditto
8973 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
8974 buffer_, a lot of changes because of this. currentBuffer() ->
8975 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
8976 also changes to other files because of this.
8978 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8980 * src/vc-backend.[Ch]: new files. The backends for vc handling,
8981 have no support for RCS and partial support for CVS, will be
8984 * src/insets/ several files: changes because of function name
8985 changes in Bufferview and LyXView.
8987 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
8989 * src/support/LSubstring.[Ch]: new files. These implement a
8990 Substring that can be very convenient to use. i.e. is this
8992 string a = "Mary had a little sheep";
8993 Substring(a, "sheep") = "lamb";
8994 a is now "Mary has a little lamb".
8996 * src/support/LRegex.[Ch]: a regex class that can be used to pick
8997 out patterns and subpatterns of strings. It is used by LSubstring
8998 and also by vc-backend.C
9000 * src/support/lyxstring.C: went over all the assertions used and
9001 tried to correct the wrong ones and flag which of them is required
9002 by the standard. some bugs found because of this. Also removed a
9003 couple of assertions.
9005 * src/support/Makefile.am (libsupport_a_SOURCES): added
9006 LSubstring.[Ch] and LRegex.[Ch]
9008 * src/support/FileInfo.h: have struct stat buf as an object and
9009 not a pointer to one, some changes because of this.
9011 * src/LaTeXFeatures.C (getTClassPreamble): also use the
9012 information in layout when adding the layouts preamble to the
9015 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
9018 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
9019 because of bug in OS/2.
9021 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9023 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
9024 \verbatim@font instead of \ttfamily, so that it can be redefined.
9026 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
9027 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
9028 src/layout.h, src/text2.C: add 'using' directive to bring the
9029 STL templates we need from the std:: namespace to the global one.
9030 Needed by DEC cxx in strict ansi mode.
9032 * src/support/LIstream.h,src/support/LOstream.h,
9033 src/support/lyxstring.h,src/table.h,
9034 src/lyxlookup.h: do not include <config.h> in header
9035 files. This should be done in the .C files only.
9037 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
9041 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9043 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
9044 from Kayvan to fix the tth invokation.
9046 * development/lyx.spec.in: updates from Kayvan to reflect the
9047 changes of file names.
9049 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9051 * src/text2.C (InsertStringB): use std::copy
9052 (InsertStringA): use std::copy
9054 * src/bufferlist.C: use a vector to store the buffers in. This is
9055 an internal change and should not affect any other thing.
9057 * src/BufferView.C (waitForX): use XSync instead of the lengthy
9060 * src/text.C (Fill): fix potential bug, one off bug.
9062 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9064 * src/Makefile.am (lyx_main.o): add more files it depends on.
9066 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
9068 * src/support/lyxstring.C: use size_t for the reference count,
9069 size, reserved memory and xtra.
9070 (internal_compare): new private member function. Now the compare
9071 functions should work for std::strings that have embedded '\0'
9073 (compare): all compare functions rewritten to use
9076 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9078 * src/support/lyxstring.C (compare): pass c_str()
9079 (compare): pass c_str
9080 (compare): pass c_str
9082 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9084 * src/support/DebugStream.C: <config.h> was not included correctly.
9086 * lib/configure: forgot to re-generate it :( I'll make this file
9087 auto generated soon.
9089 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9091 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
9094 * src/support/lyxstring.C: some changes from length() to rep->sz.
9095 avoids a function call.
9097 * src/support/filetools.C (SpaceLess): yet another version of the
9098 algorithm...now per Jean-Marc's suggestions.
9100 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9102 * src/layout.C (less_textclass_desc): functor for use in sorting
9104 (LyXTextClass::Read): sort the textclasses after reading.
9106 * src/support/filetools.C (SpaceLess): new version of the
9107 SpaceLess functions. What problems does this one give? Please
9110 * images/banner_bw.xbm: made the arrays unsigned char *
9112 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9114 * src/support/lyxstring.C (find): remove bogus assertion in the
9115 two versions of find where this has not been done yet.
9117 * src/support/lyxlib.h: add missing int return type to
9120 * src/menus.C (ShowFileMenu): disable exporting to html if no
9121 html export command is present.
9123 * config/lib_configure.m4: add a test for an HTML converter. The
9124 programs checked for are, in this order: tth, latex2html and
9127 * lib/configure: generated from config/lib_configure.m4.
9129 * src/lyxfunc.C (Dispatch): update and improve the execution of an
9130 html converter. The parameters are now passed through $$FName and
9131 $$OutName, instead of standard input/output.
9133 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
9135 * lib/lyxrc.example: update description of \html_command.
9136 add "quotes" around \screen_font_xxx font setting examples to help
9137 people who use fonts with spaces in their names.
9139 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9141 * Distribution files: updates for v1.1.2
9143 * src/support/lyxstring.C (find): remove bogus assert and return
9144 npos for the same condition.
9146 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9148 * added patch for OS/2 from SMiyata.
9150 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9152 * src/text2.C (CutSelection): make space_wrapped a bool
9153 (CutSelection): dont declare int i until we have to.
9154 (alphaCounter): return a char const *.
9156 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9158 * src/support/syscall.C (Systemcalls::kill):
9159 src/support/filetools.C (PutEnv, PutEnvPath):
9160 src/lyx_cb.C (addNewlineAndDepth):
9161 src/FontInfo.C (FontInfo::resize): condition some #warning
9162 directives with WITH_WARNINGS.
9165 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9167 * src/layout.[Ch] + several files: access to class variables
9168 limited and made accessor functions instead a lot of code changed
9169 becuase of this. Also instead of returning pointers often a const
9170 reference is returned instead.
9172 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
9174 * src/Makefile.am (dist-hook): added used to remove the CVS from
9175 cheaders upon creating a dist
9176 (EXTRA_DIST): added cheaders
9178 * src/support/lstrings.C (tostr(char)): fix it to handle param as
9179 a character not as a small integer.
9181 * src/support/lyxstring.C (find): removed Assert and added i >=
9182 rep->sz to the first if.
9184 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9186 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
9187 src/LyXView.C src/buffer.C src/bufferparams.C
9188 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
9189 src/text2.C src/insets/insetinclude.C:
9190 lyxlayout renamed to textclasslist.
9192 * src/layout.C: some lyxerr changes.
9194 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
9195 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
9196 (LyXLayoutList): removed all traces of this class.
9197 (LyXTextClass::Read): rewrote LT_STYLE
9198 (LyXTextClass::hasLayout): new function
9199 (LyXTextClass::GetLayout): rewritten to return an iterator + has
9200 both const and nonconst version.
9201 (LyXTextClass::delete_layout): new function.
9202 (LyXTextClassList::Style): bug fix. do the right thing if layout
9204 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
9205 (LyXTextClassList::NameOfLayout): ditto
9206 (LyXTextClassList::Load): ditto
9208 * src/buffer.C (makeLaTeXFile): new access to layoutlist
9210 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
9212 * src/LyXAction.C (LookupFunc): added a workaround for sun
9213 compiler, on the other hand...we don't know if the current code
9214 compiles on sun at all...
9216 * src/support/filetools.C (CleanupPath): subst fix
9218 * src/insets/insetbib.C (delDatabase): subst fix, this looks
9221 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
9222 complained about this one?
9224 * src/insets/insetinclude.C (Latex): subst fix
9226 * src/insets/insetbib.C (getKeys): subst fix
9228 * src/LyXSendto.C (SendtoApplyCB): subst fix
9230 * src/lyx_main.C (init): subst fix
9232 * src/layout.C (Read): subst fix
9234 * src/lyx_sendfax_main.C (button_send): subst fix
9236 * src/buffer.C (RoffAsciiTable): subst fix
9238 * src/lyx_cb.C (MenuFax): subst fix
9239 (PrintApplyCB): subst fix
9241 1999-10-26 Juergen Vigna <jug@sad.it>
9243 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
9245 (Read): Cleaned up this code so now we read only format vestion >= 5
9247 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9249 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
9250 come nobody has complained about this one?
9252 * src/insets/insetinclude.C (Latex): subst fix
9254 * src/insets/insetbib.C (getKeys): subst fix
9256 * src/lyx_main.C (init): subst fix
9258 * src/layout.C (Read): subst fix
9260 * src/buffer.C (RoffAsciiTable): subst fix
9262 * src/lyx_cb.C (MenuFax): subst fix.
9264 * src/layout.[hC] + some other files: rewrote to use
9265 std::container to store textclasses and layouts in.
9266 Simplified, removed a lot of code. Make all classes
9267 assignable. Further simplifications and review of type
9268 use still to be one.
9270 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
9271 lastfiles to create the lastfiles partr of the menu.
9273 * src/lastfiles.[Ch]: rewritten to use deque to store the
9274 lastfiles in. Uses fstream for reading and writing. Simplifies
9277 * src/support/syscall.C: remove explicit cast.
9279 * src/BufferView.C (CursorToggleCB): removed code snippets that
9281 use explicat C++ style casts instead of C style casts. also use
9282 u_vdata instea of passing pointers in longs.
9284 * src/PaperLayout.C: removed code snippets that were commented out.
9286 * src/lyx_gui_misc.C: removed code snippets that were commented out.
9288 * src/lyx_main.C: removed code snippets that wer commented out.
9290 * src/paragraph.C: removed code snippets that were commented out.
9292 * src/lyxvc.C (logClose): use static_cast
9294 (viewLog): remove explicit cast to void*
9295 (showLog): removed old commented code
9297 * src/menus.C: use static_cast instead of C style casts. use
9298 u_vdata instead of u_ldata. remove explicit cast to (long) for
9299 pointers. Removed old code that was commented out.
9301 * src/insets/inset.C: removed old commented func
9303 * src/insets/insetref.C (InsetRef): removed old code that had been
9304 commented out for a long time.
9306 (escape): removed C style cast
9308 * src/insets/insetlatexaccent.C (Draw): removed old commented code
9310 * src/insets/insetlatex.C (Draw): removed old commented code
9311 (Read): rewritten to use string
9313 * src/insets/insetlabel.C (escape): removed C style cast
9315 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
9317 * src/insets/insetindex.C: use static_cast and u_vdata, removed
9320 * src/insets/insetinclude.h: removed a couple of stupid bools
9322 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
9323 (Clone): remove C style cast
9324 (getKeys): changed list to lst because of std::list
9326 * src/insets/inseterror.C (Draw): removed som old commented code.
9328 * src/insets/insetcommand.C (Draw): removed some old commented code.
9330 * src/insets/insetbib.C (bibitem_cb): removed code that has been
9331 commented out forever.
9332 (bibitem_cb): use static_cast instead of C style cast
9333 use of vdata changed to u_vdata.
9335 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
9337 (CloseUrlCB): use static_cast instead of C style cast.
9338 (CloseUrlCB): added a fl_free form...it seemed to be missing.
9340 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
9341 (C_InsetInfo_CloseInfoCB): forward the ob parameter
9342 (CloseInfoCB): static_cast from ob->u_vdata instead.
9343 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
9346 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
9347 (C_InsetError_CloseErrorCB): forward the ob parameter
9348 (CloseErrorCB): static_cast from ob->u_vdata instead.
9350 * src/vspace.h: include LString.h since we use string in this class.
9352 * src/vspace.C (lyx_advance): changed name from advance because of
9353 nameclash with stl. And since we cannot use namespaces yet...I
9354 used a lyx_ prefix instead. Expect this to change when we begin
9357 * src/BufferView.[Ch] (BufferView::~BufferView): removed
9359 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
9360 and removed now defunct constructor and deconstructor.
9362 * src/BufferView.h: have backstack as a object not as a pointer.
9363 removed initialization from constructor. added include for BackStack
9365 * development/lyx.spec.in (%build): add CFLAGS also.
9367 * src/screen.C (drawFrame): removed another warning.
9369 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9371 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
9372 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
9373 README and ANNOUNCE a bit for the next release. More work is
9376 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
9377 unbreakable if we are in freespacing mode (LyX-Code), but not in
9380 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9382 * src/BackStack.h: fixed initialization order in constructor
9384 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
9386 * acinclude.m4 (VERSION): new rules for when a version is
9387 development, added also a variable for prerelease.
9388 (warnings): we set with_warnings=yes for prereleases
9389 (lyx_opt): prereleases compile with same optimization as development
9390 (CXXFLAGS): only use pedantic if we are a development version
9392 * src/BufferView.C (restorePosition): don't do anything if the
9395 * src/BackStack.h: added member empty, use this to test if there
9396 is anything to pop...
9398 1999-10-25 Juergen Vigna <jug@sad.it>
9401 * forms/layout_forms.fd +
9402 * forms/latexoptions.fd +
9403 * lyx.fd: changed for various form resize issues
9405 * src/mathed/math_panel.C +
9406 * src/insets/inseterror.C +
9407 * src/insets/insetinfo.C +
9408 * src/insets/inseturl.C +
9409 * src/insets/inseturl.h +
9412 * src/PaperLayout.C +
9413 * src/ParagraphExtra.C +
9414 * src/TableLayout.C +
9416 * src/layout_forms.C +
9423 * src/menus.C: fixed various resize issues. So now forms can be
9424 resized savely or not be resized at all.
9426 * forms/form_url.fd +
9427 * src/insets/form_url.[Ch]: added because it's cleaner and easier
9430 * src/insets/Makefile.am: added files form_url.[Ch]
9432 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9434 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
9435 (and presumably 6.2).
9437 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
9438 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
9439 remaining static member callbacks.
9441 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
9444 * src/support/lyxstring.h: declare struct Srep as friend of
9445 lyxstring, since DEC cxx complains otherwise.
9447 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9449 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9451 * src/LaTeX.C (run): made run_bibtex also depend on files with
9453 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
9454 are put into the dependency file.
9456 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
9457 the code has shown itself to work
9458 (create_ispell_pipe): removed another warning, added a comment
9461 * src/minibuffer.C (ExecutingCB): removed code that has been
9462 commented out a long time
9464 * src/lyxfunc.C (processKeyEvent): removed some very old commented
9465 out code + a warning.
9467 * src/support/lyxstring.h: comment out the three private
9468 operators, when compiling with string ansi conforming compilers
9471 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
9473 (pixmapFromBitmapData): change type of bdata to be unsigned char *
9474 (pixmapFromBitmapData): add a reinterpret_cast in the call to
9477 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
9480 * src/mathed/math_panel.C (create_math_panel): remove explicit
9483 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
9486 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
9487 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
9488 to XCreatePixmapFromBitmapData
9489 (fl_set_bmtable_data): change the last argument to be unsigned
9491 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
9492 and bh to be unsigned int, remove explicit casts in call to
9493 XReadBitmapFileData.
9495 * images/arrows.xbm: made the arrays unsigned char *
9496 * images/varsz.xbm: ditto
9497 * images/misc.xbm: ditto
9498 * images/greek.xbm: ditto
9499 * images/dots.xbm: ditto
9500 * images/brel.xbm: ditto
9501 * images/bop.xbm: ditto
9503 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
9505 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
9506 (LYX_PROG_CXX): added -pedantic to g++ compile options when
9507 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
9509 (LYX_CXX_CHEADERS): added <clocale> to the test.
9511 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
9513 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
9515 * src/support/lyxstring.C (append): fixed something that must be a
9516 bug, rep->assign was used instead of rep->append.
9518 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
9521 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
9522 lyx insert double chars. Fix spotted by Kayvan.
9524 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9526 * Fixed the tth support. I messed up with the Emacs patch apply feature
9527 and omitted the changes in lyxrc.C.
9529 1999-10-22 Juergen Vigna <jug@sad.it>
9531 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
9533 * src/lyx_cb.C (MenuInsertRef) +
9534 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
9535 the form cannot be resized under it limits (fixes a segfault)
9537 * src/lyx.C (create_form_form_ref) +
9538 * forms/lyx.fd: Changed Gravity on name input field so that it is
9541 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9543 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
9544 <ostream> and <istream>.
9546 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
9547 whether <fstream> provides the latest standard features, or if we
9548 have an oldstyle library (like in egcs).
9549 (LYX_CXX_STL_STRING): fix the test.
9551 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
9552 code on MODERN_STL_STREAM.
9554 * src/support/lyxstring.h: use L{I,O}stream.h.
9556 * src/support/L{I,O}stream.h: new files, designed to setup
9557 correctly streams for our use
9558 - includes the right header depending on STL capabilities
9559 - puts std::ostream and std::endl (for LOStream.h) or
9560 std::istream (LIStream.h) in toplevel namespace.
9562 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9564 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
9565 was a bib file that had been changed we ensure that bibtex is run.
9566 (runBibTeX): enhanced to extract the names of the bib files and
9567 getting their absolute path and enter them into the dep file.
9568 (findtexfile): static func that is used to look for tex-files,
9569 checks for absolute patchs and tries also with kpsewhich.
9570 Alternative ways of finding the correct files are wanted. Will
9572 (do_popen): function that runs a command using popen and returns
9573 the whole output of that command in a string. Should be moved to
9576 * src/DepTable.[Ch] (extchanged): new function that returns true if a
9577 file with extension ext has changed.
9579 * src/insets/figinset.C: added ifdef guards around the fl_free
9580 code that jug commented out. Now it is commented out when
9581 compiling with XForms == 0.89.
9583 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
9584 to lyxstring.C, and only keep a forward declaration in
9585 lyxstring.h. Simplifies the header file a bit and should help a
9586 bit on compile time too. Also changes to Srep will not mandate a
9587 recompile of code just using string.
9588 (~lyxstring): definition moved here since it uses srep.
9589 (size): definition moved here since it uses srep.
9591 * src/support/lyxstring.h: removed a couple of "inline" that should
9594 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9596 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
9599 1999-10-21 Juergen Vigna <jug@sad.it>
9601 * src/table.C (SetPWidth): Just a small fix so the alignment is not
9602 set to left if I just remove the width entry (or it is empty).
9604 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
9605 paragraph when having dummy paragraphs.
9607 1999-10-20 Juergen Vigna <jug@sad.it>
9609 * src/insets/figinset.C: just commented some fl_free_form calls
9610 and added warnings so that this calls should be activated later
9611 again. This avoids for now a segfault, but we have a memory leak!
9613 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
9614 'const char * argument' to 'string argument', this should
9615 fix some Asserts() in lyxstring.C.
9617 * src/lyxfunc.h: Removed the function argAsString(const char *)
9618 as it is not used anymore.
9620 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9622 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
9625 * src/Literate.h: some funcs moved from public to private to make
9626 interface clearer. Unneeded args removed.
9628 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
9630 (scanBuildLogFile): ditto
9632 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
9633 normal TeX Error. Still room for improvement.
9635 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
9637 * src/buffer.C (insertErrors): changes to make the error
9638 desctription show properly.
9640 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
9643 * src/support/lyxstring.C (helper): changed to use
9644 sizeof(object->rep->ref).
9645 (operator>>): changed to use a pointer instead.
9647 * src/support/lyxstring.h: changed const reference & to value_type
9648 const & lets see if that helps.
9650 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9652 * Makefile.am (rpmdist): fixed to have non static package and
9655 * src/support/lyxstring.C: removed the compilation guards
9657 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
9660 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
9661 conditional compile of lyxstring.Ch
9663 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
9664 stupid check, but it is a lot better than the bastring hack.
9665 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
9667 * several files: changed string::erase into string::clear. Not
9670 * src/chset.C (encodeString): use a char temporary instead
9672 * src/table.C (TexEndOfCell): added tostr around
9673 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
9674 (TexEndOfCell): ditto
9675 (TexEndOfCell): ditto
9676 (TexEndOfCell): ditto
9677 (DocBookEndOfCell): ditto
9678 (DocBookEndOfCell): ditto
9679 (DocBookEndOfCell): ditto
9680 (DocBookEndOfCell): ditto
9682 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
9684 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
9686 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
9687 (MenuBuildProg): added tostr around ret
9688 (MenuRunChktex): added tostr around ret
9689 (DocumentApplyCB): added tostr around ret
9691 * src/chset.C (encodeString): added tostr around t->ic
9693 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
9694 (makeLaTeXFile): added tostr around tocdepth
9695 (makeLaTeXFile): added tostr around ftcound - 1
9697 * src/insets/insetbib.C (setCounter): added tostr around counter.
9699 * src/support/lyxstring.h: added an operator+=(int) to catch more
9702 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
9703 (lyxstring): We DON'T allow NULL pointers.
9705 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9707 * src/mathed/math_macro.C (MathMacroArgument::Write,
9708 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
9709 when writing them out.
9711 * src/LString.C: remove, since it is not used anymore.
9713 * src/support/lyxstring.C: condition the content to
9714 USE_INCLUDED_STRING macro.
9716 * src/mathed/math_symbols.C, src/support/lstrings.C,
9717 src/support/lyxstring.C: add `using' directive to specify what
9718 we need in <algorithm>. I do not think that we need to
9719 conditionalize this, but any thought is appreciated.
9721 * many files: change all callback functions to "C" linkage
9722 functions to please strict C++ compilers like DEC cxx 6.1 in mode
9723 strict_ansi. Those who were static are now global.
9724 The case of callbacks which are static class members is
9725 trickier, since we have to make C wrappers around them (see
9726 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
9727 did not finish this yet, since it defeats the purpose of
9728 encapsulation, and I am not sure what the best route is.
9730 1999-10-19 Juergen Vigna <jug@sad.it>
9732 * src/support/lyxstring.C (lyxstring): we permit to have a null
9733 pointer as assignment value and just don't assign it.
9735 * src/vspace.C (nextToken): corrected this function substituting
9736 find_first(_not)_of with find_last_of.
9738 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
9739 (TableOptCloseCB) (TableSpeCloseCB):
9740 inserted fl_set_focus call for problem with fl_hide_form() in
9743 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9745 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
9748 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9750 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
9751 LyXLex::next() and not eatline() to get its argument.
9753 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9755 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
9756 instead, use fstreams for io of the depfile, removed unneeded
9757 functions and variables.
9759 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
9760 vector instead, removed all functions and variables that is not in
9763 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9765 * src/buffer.C (insertErrors): use new interface to TeXError
9767 * Makefile.am (rpmdist): added a rpmdist target
9769 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
9770 per Kayvan's instructions.
9772 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9774 * src/Makefile.am: add a definition for localedir, so that locales
9775 are found after installation (Kayvan)
9777 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9779 * development/.cvsignore: new file.
9781 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9783 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
9784 C++ compiler provides wrappers for C headers and use our alternate
9787 * configure.in: use LYX_CXX_CHEADERS.
9789 * src/cheader/: new directory, populated with cname headers from
9790 libstdc++-2.8.1. They are a bit old, but probably good enough for
9791 what we want (support compilers who lack them).
9793 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
9794 from includes. It turns out is was stupid.
9796 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9798 * lib/Makefile.am (install-data-local): forgot a ';'
9799 (install-data-local): forgot a '\'
9800 (libinstalldirs): needed after all. reintroduced.
9802 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9804 * configure.in (AC_OUTPUT): added lyx.spec
9806 * development/lyx.spec: removed file
9808 * development/lyx.spec.in: new file
9810 * po/*.po: merged with lyx.pot becuase of make distcheck
9812 * lib/Makefile.am (dist-hook): added dist-hook so that
9813 documentation files will be included when doing a make
9814 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
9815 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
9817 more: tried to make install do the right thing, exclude CVS dirs
9820 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
9821 Path would fit in more nicely.
9823 * all files that used to use pathstack: uses now Path instead.
9824 This change was a lot easier than expected.
9826 * src/support/path.h: new file
9828 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
9830 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
9832 * src/support/lyxstring.C (getline): Default arg was given for
9835 * Configure.cmd: removed file
9837 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9839 * src/support/DebugStream.[Ch]: remove the explicit std:: before
9840 streams classes and types, add the proper 'using' statements when
9841 MODERN_STL is defined.
9843 * src/debug.h: move the << operator definition after the inclusion
9846 * src/support/filetools.C: include "LAssert.h", which is needed
9849 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
9852 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
9853 include "debug.h" to define a proper ostream.
9855 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9857 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
9858 method to the SystemCall class which can kill a process, but it's
9859 not fully implemented yet.
9861 * src/*.C: Changed Systemcalls::Startscript() to startscript()
9863 * src/support/FileInfo.h: Better documentation
9865 * src/lyxfunc.C: Added support for buffer-export html
9867 * src/menus.C: Added Export->As HTML...
9869 * lib/bind/*.bind: Added short-cut for buffer-export html
9871 * src/lyxrc.*: Added support for new \tth_command
9873 * lib/lyxrc.example: Added stuff for new \tth_command
9875 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9877 * lib/Makefile.am (IMAGES): removed images/README
9878 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
9879 installes in correct place. Check permisions is installed
9882 * src/LaTeX.C: some no-op changes moved declaration of some
9885 * src/LaTeX.h (LATEX_H): changed include guard name
9887 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9889 * lib/reLyX/Makefile.am: install noweb2lyx.
9891 * lib/Makefile.am: install configure.
9893 * lib/reLyX/configure.in: declare a config aux dir; set package
9894 name to lyx (not sure what the best solution is); generate noweb2lyx.
9896 * lib/layouts/egs.layout: fix the bibliography layout.
9898 1999-10-08 Jürgen Vigna <jug@sad.it>
9900 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
9901 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
9902 it returned without continuing to search the path.
9904 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9906 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
9907 also fixes a bug. It is not allowed to do tricks with std::strings
9908 like: string a("hei"); &a[e]; this will not give what you
9909 think... Any reason for the complexity in this func?
9911 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
9913 * Updated README and INSTALL a bit, mostly to check that my
9914 CVS rights are correctly set up.
9916 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9918 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
9919 does not allow '\0' chars but lyxstring and std::string does.
9921 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9923 * autogen.sh (AUTOCONF): let the autogen script create the
9924 POTFILES.in file too. POTFILES.in should perhaps now not be
9925 included in the cvs module.
9927 * some more files changed to use C++ includes instead of C ones.
9929 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
9931 (Reread): added tostr to nlink. buggy output otherwise.
9932 (Reread): added a string() around szMode when assigning to Buffer,
9933 without this I got a log of garbled info strings.
9935 * acconfig.h: commented out the PTR_AS_INT macros. They should not
9938 * I have added several ostream & operator<<(ostream &, some_type)
9939 functions. This has been done to avoid casting and warnings when
9940 outputting enums to lyxerr. This as thus eliminated a lot of
9941 explicit casts and has made the code clearer. Among the enums
9942 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
9943 mathed enums, some font enum the Debug::type enum.
9945 * src/support/lyxstring.h (clear): missing method. equivalent of
9948 * all files that contained "stderr": rewrote constructs that used
9949 stderr to use lyxerr instead. (except bmtable)
9951 * src/support/DebugStream.h (level): and the passed t with
9952 Debug::ANY to avoid spurious bits set.
9954 * src/debug.h (Debug::type value): made it accept strings of the
9957 * configure.in (Check for programs): Added a check for kpsewhich,
9958 the latex generation will use this later to better the dicovery of
9961 * src/BufferView.C (create_view): we don't need to cast this to
9962 (void*) that is done automatically.
9963 (WorkAreaButtonPress): removed some dead code.
9965 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9967 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
9968 is not overwritten when translated (David Sua'rez de Lis).
9970 * lib/CREDITS: Added David Sua'rez de Lis
9972 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
9974 * src/bufferparams.C (BufferParams): default input encoding is now
9977 * acinclude.m4 (cross_compiling): comment out macro
9978 LYX_GXX_STRENGTH_REDUCE.
9980 * acconfig.h: make sure that const is not defined (to empty) when
9981 we are compiling C++. Remove commented out code using SIZEOF_xx
9984 * configure.in : move the test for const and inline as late as
9985 possible so that these C tests do not interefere with C++ ones.
9986 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
9987 has not been proven.
9989 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9991 * src/table.C (getDocBookAlign): remove bad default value for
9994 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
9996 (ShowFileMenu2): ditto.
9998 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
10001 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10003 * Most files: finished the change from the old error code to use
10004 DebugStream for all lyxerr debugging. Only minor changes remain
10005 (e.g. the setting of debug levels using strings instead of number)
10007 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10009 * src/layout.C (Add): Changed to use compare_no_case instead of
10012 * src/FontInfo.C: changed loop variable type too string::size_type.
10014 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10016 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
10017 set ETAGS_ARGS to --c++
10019 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
10021 * src/table.C (DocBookEndOfCell): commented out two unused variables
10023 * src/paragraph.C: commented out four unused variables.
10025 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
10026 insed a if clause with type string::size_type.
10028 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
10031 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
10033 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
10034 variable, also changed loop to go from 0 to lenght + 1, instead of
10035 -1 to length. This should be correct.
10037 * src/LaTeX.C (scanError): use string::size_type as loop variable
10040 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
10041 (l.896) since y_tmp and row was not used anyway.
10043 * src/insets/insetref.C (escape): use string::size_type as loop
10046 * src/insets/insetquotes.C (Width): use string::size_type as loop
10048 (Draw): use string::size_type as loop variable type.
10050 * src/insets/insetlatexaccent.C (checkContents): use
10051 string::size_type as loop variable type.
10053 * src/insets/insetlabel.C (escape): use string::size_type as loop
10056 * src/insets/insetinfo.C: added an extern for current_view.
10058 * src/insets/insetcommand.C (scanCommand): use string::size_type
10059 as loop variable type.
10061 * most files: removed the RCS tags. With them we had to recompile
10062 a lot of files after a simple cvs commit. Also we have never used
10063 them for anything meaningful.
10065 * most files: tags-query-replace NULL 0. As adviced several plases
10066 we now use "0" instead of "NULL" in our code.
10068 * src/support/filetools.C (SpaceLess): use string::size_type as
10069 loop variable type.
10071 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10073 * src/paragraph.C: fixed up some more string stuff.
10075 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10077 * src/support/filetools.h: make modestr a std::string.
10079 * src/filetools.C (GetEnv): made ch really const.
10081 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
10082 made code that used these use max/min from <algorithm> instead.
10084 * changed several c library include files to their equivalent c++
10085 library include files. All is not changed yet.
10087 * created a support subdir in src, put lyxstring and lstrings
10088 there + the extra files atexit, fileblock, strerror. Created
10089 Makefile.am. edited configure.in and src/Makefile.am to use this
10090 new subdir. More files moved to support.
10092 * imported som of the functions from repository lyx, filetools
10094 * ran tags-query-replace on LString -> string, corrected the bogus
10095 cases. Tried to make use of lstrings.[hC], debugged a lot. There
10096 is still some errors in there. This is errors where too much or
10097 too litle get deleted from strings (string::erase, string::substr,
10098 string::replace), there can also be some off by one errors, or
10099 just plain wrong use of functions from lstrings. Viewing of quotes
10102 * LyX is now running fairly well with string, but there are
10103 certainly some bugs yet (see above) also string is quite different
10104 from LString among others in that it does not allow null pointers
10105 passed in and will abort if it gets any.
10107 * Added the revtex4 files I forgot when setting up the repository.
10109 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10111 * All over: Tried to clean everything up so that only the files
10112 that we really need are included in the cvs repository.
10113 * Switched to use automake.
10114 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
10115 * Install has not been checked.
10117 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10119 * po/pt.po: Three errors:
10120 l.533 and l.538 format specification error
10121 l. 402 duplicate entry, I just deleted it.