1 2000-11-15 Rob Lahaye <lahaye@postech.edu>
3 * lib/ui/default.ui: OptItem used for Fax entry
5 2000-11-17 Matej Cepl <cepl@bigfoot.com>
7 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
9 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
11 * src/vspace.C (nextToken): fix so it can handle length phrases like
12 "10mm+-20mm", "40inplus16mmminus10cm" etc.
14 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
16 * src/frontends/xforms/FormPreferences.C: constify several variables
17 (BrowserLyX): rewrite to not need the choice variable
18 (Modify): rewrite to not need the choide variable
19 (compare_converter): make operator const
21 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
22 correct the writing of \set_color
23 (getDescription): return a const string
25 * src/kbsequence.[Ch] (addkey): remove dead code
27 * src/Painter.C (text): remove some commented code
29 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
31 * src/ColorHandler.[Ch]: removed some header files from .h file.
32 Included LColor.h in .C file.
34 * src/LColor.[Ch]: made class copyable so that I could create a
35 system_lcolor instance.
37 * src/Painter.h: removed LColor.h.
39 * src/lyx_gui.C (create_forms): used AddName.
41 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
42 of user preferences/lyxrc file.
44 * src/lyxrc.C (output): output changes to lcolor.
46 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
48 Moved class xformColor to files xform_helpers.[Ch]. These files,
49 Color.[Ch], could now be moved into src if they would be useful to
52 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
53 Also moved FormPreferences::browseFile here as it can be used by any
54 xform dialog with a "Browse" button. FormGraphics is a perfect example.
56 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
57 ReadableFile): changed the FormPreferences methods a little and moved
58 them here as they'll be useful elsewhere also.
60 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
61 Removed some header files and used forward declarations instead.
63 Removed some methods as they'll be useful elsewhere (see above).
65 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
66 Can also now modify the LyX LColors. However, for reasons that I don't
67 yet understand, it appears that we can use
68 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
69 present. The problem appears to lie in ColorHandler, because I can
70 change the color using LColor.SetColor(). Similarly, when reading in a
71 preferences file with some set_color instances, I'll get a warning
72 like: Color sea green is undefined or may not be redefined
73 Bad lyxrc set_color for sea green
75 Once the buffer is loaded, however, I can happily change to this color.
77 Finally, it appears that I have to set the color of "inset frame"
78 explicitly, or it oscillates from "black" to "indian red" with each
81 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
83 * ANNOUNCE: corrected a spelling mistake.
85 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
88 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
90 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
92 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
95 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
96 match the requirements from the standard better. This is required
97 to work with gnu libstdc++-v3
99 * src/frontends/xforms/FormPreferences.C: add explict pair
100 arguments to browse calls. include support/lyxmanip.h remvoe
101 extern fmt. whitespace changes. reorder variables in
102 FormPreferences.h, to match initalizaton order.
104 * several files: constify more local variables.
106 * src/buffer.C: remove some commented functions.
108 * src/DepTable.C (remove_files_with_extension): temporary
109 work around for gcc 2.97
110 * src/filedlg.C (find): ditto
111 * src/Variables.C (set): ditto
112 * src/LyXAction.C (searchActionArg): ditto
113 (retrieveActionArg): ditto
115 * configure.in: check for mktemp too
117 * UPGRADING: prepare for 1.1.6
119 * Makefile.am (lgbtags): add backup tags for when etags are
120 different than usual.
122 * ANNOUNCE: prepare for 1.1.6
124 * src/support/tempname.C (make_tempfile): new function, wrapper
125 around mkstemp and mktemp. Only mkstemp has been tested.
128 2000-11-14 Rob Lahaye <lahaye@postech.edu>
130 * default.ui: capitalized some menu items to improve shortcuts.
132 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
134 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
136 * src/frontends/xforms/Dialogs.C: add "using" directive.
138 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
140 * src/filedlg.C (Select): highlight suggested file in browser, if
143 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
144 each tab folder is encapsulated in its own class.
145 The Language keymaps are now chosen using a text input and a
146 browser button, rather than a Combox.
147 All the browser buttons are now functional, although LyXFileDlg
148 still needs to be modified to make it straighhtforward to return a
149 directory if that is what is desired.
151 * src/frontends/xforms/forms/form_preferences.fd: use text input
152 and browse button to input the Language keymaps. Add a few
153 callbacks for the browse buttons.
155 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
157 * src/support/tempname.C (tempName): small changes to make it
158 safer. remove the '.' before XXXXXX
160 * src/support/filetools.C (TmpFileName): remove func
163 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
164 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
165 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
166 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
168 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
171 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
174 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
175 for bp (this fixes a reproducible hard crash)
177 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
180 * src/frontends/xforms/FormBase.h: make bp_ private
181 (FormBaseBI): remove default for bp
184 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
187 * src/frontends/xforms/Color.C (RGBColor): made several vars
188 const, changed initialization of j to allow it to be const
191 * several files: added const to local variables.
193 * src/lyx_cb.C: removed several function prototypes and moved them
197 (UpdateLayoutPreamble):
199 (MenuInsertLabel): add BufferView as arguemnt
200 (LayoutsCB): make tmp const
202 * src/layout_forms.h: regenerated
204 * src/debug.C: add Debug::FILES
205 (showLevel) (showTags): translate the desc
207 * src/debug.h: add FILES as debug target
209 * src/bufferlist.C: use current_view as an interim measure becuase
210 of added arguments to MenuWrite and MenuWriteAs
212 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
214 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
216 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
217 libstdc++ is compiled with.
219 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
221 * lib/layouts/docbook-book.layout
222 * lib/layouts/docbook.layout
223 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
224 those paragraphs are expresse as SGML comments <!-- -->.
226 * src/LaTeXFeatures.h
227 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
228 parameter, this allows to express all the include files as relative
229 paths to the master buffer. The verbatim insert works as the other
232 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
234 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
236 (MakeDocBookFile): top_element is always written. Some clean up, as
237 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
239 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
240 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
241 a reference is written instead of the name.
242 (Validate): use the relative path for the filename.
244 * src/insets/insetlabel.C (DocBook): write end tag, for XML
247 * src/support/filetools.h
248 * src/support/filetools.C (IsSGMLFilename): added.
251 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
253 * development/OS2/quick_fix.patch:
255 * README.OS2: quick update to the OS/2 port.
257 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
259 * src/converter.C: add "using" directive.
261 * src/frontends/xforms/FormPreferences.C: add "using" directive.
262 (compare_converter): add "int" as return type.
264 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
267 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
269 * src/lyx_gui.C (create_forms): map the xform colours, should a
270 mapping exist. Ie, call XformColor::read().
272 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
273 and struct HSV as HSVColor.
274 (XformColor::read, XformColor::write) : new methods that
275 input/output any changes to the cform GUI colors.
277 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
280 * src/frontends/xforms/FormPreferences.C Lots of little changes
281 associated with the changed name of the RGB and HSV structs. Can
282 now save changes to xforms GUI to file. Commented out
283 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
284 used currently anyway.
286 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
288 * src/converter.C: A lot of changes:
289 - It is no longer possible to choose between two or more ways to
290 export to some format (the new code uses only the shortest path).
291 However, it is still possible to choose between pdflatex/ps2pdf
292 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
293 - Added several methods that makes the FormPreferences code simpler.
294 - Changed the tokens $$FName and $$OutName to $$i and $$o.
296 * src/exporter.C (Export): lyxrc.use_pdf is set before
297 makeLaTeXFile is called. This works but not very nice.
299 * src/frontends/xforms/FormPreferences.C: The formats/converters
300 tabs are now fully functional.
302 * src/buffer.C (getTocList): Add numbers to the captions.
304 * lib/lyxrc.example: Removed fax section
306 * src/support/rename.C (rename): Delete the old file if lyx::copy
309 2000-11-13 Rob Lahaye <lahaye@postech.edu>
311 * lib/ui/default.ui: minor polishing.
313 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
315 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
318 * lib/Makefile.am (DOCINST): do not install everything in the
319 documentation directory.
321 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
323 * src/bufferlist.C (newFile): set the filename to the constructed
326 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
327 constructed "newfileXX.lyx" name to the dialog
329 * src/frontends/DialogBase.h: make update() non-abstract so
330 KDE doesn't need to implement two update methods for every form
332 * src/frontends/kde/Makefile.am: add missing xforms objects
335 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
337 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
339 * src/frontends/xforms/Color.[Ch]: new files, defining the color
340 structs RGB and HSV. May not be the best place for these files.
341 Perhaps move them into src ?
343 * src/frontends/xforms/Makefile.am: added new files.
345 * src/frontends/xforms/forms/form_preferences.fd:
346 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
347 replaced all instances of "colour" with "color"!
349 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
352 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
353 tab. Can now alter the colors of the xform's GUI on the fly. With
354 the aid of a single static Signal (see below), can "Apply" these
355 changes to all currently open dialogs. (Well, to all of the NEW
356 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
357 subsequently opened dialogs will, of course, also have the new
358 color scheme. Cannot yet save (or load) the choices to file, so
359 they are lost when exiting LyX.
361 * src/frontends/Dialogs.h:
362 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
363 Used to trigger a redraw of any dialogs connected to it because,
364 for example, the GUI colours have been re-mapped.
366 * src/frontends/xforms/FormBase.[Ch]:
367 * src/frontends/xforms/FormDocument.[Ch]:
368 * src/frontends/xforms/FormParagraph.[Ch]:
369 * src/frontends/xforms/FormPreferences.[Ch]:
370 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
371 method, to be connected to Dialogs::redrawGUI. Method must be
372 virtual, because dialogs with tabbed folders need to redraw the
373 forms of each tab folder.
375 * src/LyXView.C (d-tor):
376 * src/frontends/xforms/FormBase.C (d-tor): connected
377 Dialogs::redrawGUI signal to redraw().
379 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
380 removed Assert, because it is identical to that in FormBase.
382 2000-11-10 Rob Lahaye <lahaye@postech.edu>
384 * lib/ui/default.ui: minor polishing.
386 2000-11-10 Juergen Vigna <jug@sad.it>
388 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
389 (deleteLyXText): ditto
391 * src/insets/insettabular.C (InsetButtonPress): don't clear the
392 selection on mouse-button-3.
394 * src/insets/insettabular.h: new function clearSelection(), use this
395 functions inside insettabular.C.
397 * src/insets/insettabular.C (TabularFeatures): clear the selection
398 on remove_row/column.
400 * src/insets/inset.C (scroll): fixed some scroll stuff.
402 * src/insets/insettabular.C (draw): fixed another minor draw problem.
404 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
406 * lib/CREDITS: add Yves Bastide
408 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
410 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
411 check whether C library functions are in the global namespace.
413 * configure.in: calls it.
415 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
418 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
420 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
421 iterators to prevent crash.
423 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
425 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
427 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
428 shortcut for xforms CB to the preemptive or post-handler function.
430 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
431 removed the HIDDEN_TIMER as it's no longer used.
432 Various other small changes.
434 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
435 preemptive handler to obtain feedback, rather than the post-handler.
436 (ColoursLoadBrowser): find "black" and "white" based on RGB values
438 Formats tab is now complete. Converters tab is nearly so.
440 2000-11-09 Juergen Vigna <jug@sad.it>
442 * src/insets/insettext.C (~InsetText):
445 (SetParagraphData): set cache.second to 0 after deleting it!
446 (getLyXText): check if cache.second is not 0 if finding it.
448 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
450 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
451 lyxlex to parse the rgb.txt file.
454 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
455 replace the default '#' comment character.
457 * src/support/tempname.C: add "using" directive
458 * src/frontends/ButtonPolicies.C: ditto.
460 * src/support/filetools.C (DirList): add an explicit cast to avoid
461 a compile error (probably not the right fix)
463 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
465 * src/support/filetools.C (DirList): implement using system functions
467 * src/support/tempname.C: new file
469 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
471 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
473 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
476 * src/frontends/xforms/ButtonController.C: new file
478 * src/os2_defines.h: remove getcwd define
480 * src/lyxvc.C: include support/lyxlib.h
481 (showLog): use lyx::tempName
483 * src/lyx_cb.C: comment out includes that we don't need
484 (AutoSave): use lyx::tempName
486 * src/filedlg.C: include support/lyxlib.h
487 (Reread): use lyx::getcwd
489 * src/converter.C: include support/filetools.h
490 (add_options): change to static inline, make tail const
491 (Add): make old_viewer const
492 (GetAllFormats): make it a const method, use const_iterator
493 (enable): make static inline
494 (SplitFormat): make using_format const
496 * src/LaTeX.C (run): use lyx::getcwd
498 * configure.in: check for mkstemp as well
500 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
502 * src/converter.[Ch] (GetAllCommands): new method.
504 * src/support/filetools.[Ch] (DirList): new method.
506 * src/frontends/xforms/FormPreferences.C: started (just!) adding
507 functionality to the converters tab.
508 The formats tab is now nearly complete.
509 The kbmap choices in Languages tab now display the contents of
510 system_lyxdir/kbd/*.kmap in readable form.
512 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
513 Moved some variables into the class.
515 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
516 inactive tab folder to FL_COL1. Haven't yet worked out how to change
517 colour of active folder to lighter grey instead. Any takers?
518 (form_colours): added an "Apply" button.
519 (form_converters): added a "Flags" input field.
520 (form_formats): added a "Shortcut" input field. Note that we can't use
521 names such as "input_shortcut" as this buggers up the sed script stuff.
523 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
531 * src/lyx_sendfax_main.C:
534 * src/spellchecker.C:
535 * src/insets/figinset.C:
536 * src/insets/insetbib.C:
537 * src/insets/insetexternal.C:
538 * src/insets/insetinclude.C:
539 * src/insets/insetinfo.C:
540 * src/mathed/math_panel.C:
541 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
542 all "daughter" dialogs now have identical "feel".
544 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
546 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
547 used (and was only used in one place prior to this patch. Incorrectly!)
549 * src/frontends/xforms/FormDocument.C: changed some instances of
550 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
551 sense. Also added fl_set_input_return() for class_->input_doc_extra and
552 for options_->input_float_placement. This fixes a bug reported by
555 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
556 functionality into d-tor.
558 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
559 input of numerals also.
561 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
562 fl_set_form_atclose(). Can now close dialog from window manager,
563 fixing a bug reported by Rob Lahaye.
565 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
567 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
568 are no longer dark. Haven't yet worked out how to lighten the colour of
569 the active tabfolder. Any ideas anybody?
570 Adjusted Colours tab a little.
571 Added Shortcut field to converters tab. Note that we can't create an
572 fdesign label like "input_shortcut" as this buggers up the sed-script
575 * src/frontends/xforms/FormPreferences.[Ch]:
576 (feedback): fixed crash due to to ob=0.
577 (LanguagesXXX): the kbmap choices now contain the files
578 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
579 be replaced by an input with a file browse button, but since the browse
580 buttons don'y yet work, this'll do for the moment.
581 (FormatsXXX): think that this is now nearly fully functional.
582 Some points/questions though:
583 1. Does "Apply" remove formats if no longer present?
584 2. I think that the browser should list the GUI names rather than the
586 3. Must ensure that we can't delete Formats used by an existing
589 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
590 if this is the best way to do this.
592 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
594 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
596 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
597 for variable assignment.
599 2000-11-07 Rob Lahaye <lahaye@postech.edu>
601 * src/lib/ui/default.ui: added sub/superscripts to menu as
602 Insert->Special characters and cleaned-up the file a bit
604 2000-11-07 Allan Rae <rae@lyx.org>
606 * src/frontends/xforms/FormPreferences.C (feedback): make sure
607 ob isn't 0 before using it. See comments in function.
609 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
611 * src/frontends/xforms/form_*.C: regenerated
613 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
615 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
617 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
618 compiling with gcc-2.96
620 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
622 * src/support/lyxstring.C: add a couple "using" directives.
624 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
625 a .c_str() here too for good measure.
626 * src/Spacing.C (set): ditto.
627 * src/lyxfunc.C (Dispatch): ditto.
629 * src/insets/insettabular.C (copySelection): change .str() to
630 .str().c_str() to fix problems with lyxstring.
631 * src/support/filetools.C (GetFileContents): ditto.
632 * src/buffer.C (asciiParagraph): ditto.
633 * src/paragraph.C (String): ditto.
635 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
636 * lib/bind/sciword.bind: ditto.
638 * src/LyXAction.C (init): remove "symbol-insert" function, which
639 shared LFUN_INSERT_MATH with "math-insert".
641 * lib/configure.m4: == is not a valid operator for command test.
643 * src/lyxrc.C: add using directive.
645 * src/converter.h: add std:: qualifier.
647 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
649 * src/converter.[Ch] and other files: Change the Format class to a
650 real class, and create two instances: formats and system_format.
652 * src/lyxrc.C (output): Output the difference between formats and
655 * src/frontends/xforms/FormPreferences.C (input): Simplify.
656 (buildFormats): Insert formats into browser.
657 (inputFormats): Made the browser and add button functional.
658 (applyFormats): Update formats from format_vec.
660 * src/converter.C: Changed all (*it). to it->
661 (Format::dummy): New method.
662 (Format::importer): New format flag.
663 (Formats::GetAllFormats): New method.
664 (Formats::Add): Delete format from the map if prettyname is empty.
665 (Converter::Convert): Print an error message if moving the file fails.
666 (Converter::GetReachableTo): New method
668 * src/MenuBackend.[Ch]: Add support for importformats tag.
670 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
672 * lib/configure.m4: Add word->tex and ps->fax converters.
674 * lib/ui/default.ui: Use ImportFormats on file->import menu.
675 Return fax to file menu.
679 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
681 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
684 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
687 * src/lyxfunc.C (processKeyEvent): removed
689 * src/bufferlist.C (emergencyWrite): removed the out commented
690 emergency write code.
692 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
694 * src/LyXView.[Ch]: remove the outcommented raw_callback code
696 * many files: change formatting to be a bit more uniform for
697 if,while,for,switch statements, remove some parantesis not needed.
700 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
702 * config/kde.m4: make config more robust when KDEDIR is set
704 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
706 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
707 not returned a pixmap for "math-insert".
709 * src/LyXAction.C (init): sort the entries a bit.
711 2000-11-03 Juergen Vigna <jug@sad.it>
713 * src/insets/insettabular.h: added fixed number to update codes so
714 that update is only in one direction.
716 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
719 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
720 before call to edit because of redraw.
722 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
724 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
726 * lib/ui/default.ui: Populate "edit_float" menu
728 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
730 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
731 "floats-operate". The name is ugly (and the func also), but this
732 is just a band-aid until we switch to new insets.
734 2000-11-03 Rob Lahaye <lahaye@postech.edu>
736 * lib/ui/default.ui: update again the menu layout (fix some
739 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
741 * src/MenuBackend.h (fulllabel): new method.
743 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
744 the menu shortcuts of a menu are unique and whether they
745 correspond to a letter of the label.
746 (expand): call checkShortcuts when debugging.
748 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
750 * src/insets/insettext.C (InsetButtonPress): shut off warning.
752 2000-11-02 Lior Silberman <lior@Princeton.EDU>
754 * lib/examples/*.lyx : '\language default' => '\language english'
756 * lib/examples/it_splash.lyx : except where it should be italian
758 * lib/templates/*.lyx : the same
760 * doc/*.lyx* : the same
762 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
764 * lib/bind/menus.bind: remove the Layout menu entries, which I
765 somehow forgot earlier.
767 2000-11-03 Rob Lahaye <lahaye@postech.edu>
769 * lib/ui/old-default.ui: keep the old one here for reference (to
772 * lib/ui/default.ui: update the menu layout
774 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
776 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
777 Can now Apply to different insets without closing the dialog.
779 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
780 Can't actually DO anything with them yet, but I'd like a little
783 * src/frontends/xforms/input_validators.[ch]
784 (fl_lowercase_filter): new.
786 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
788 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
789 of MATH_CODE. This fixes a bug with math-macros in RTL text.
791 * src/text.C (PrepareToPrint): Show math-macros block aligned.
793 2000-11-02 Juergen Vigna <jug@sad.it>
795 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
796 on char insertion as it has already be updated by bv->updateInset().
798 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
799 if an inset inside was updated.
801 * lib/configure.cmd: commented out fax-search code
803 2000-11-01 Yves Bastide <stid@acm.org>
805 * src/tabular.C (OldFormatRead): set tabular language to the
808 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
810 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
811 class names with non-letter characters (from Yves Bastide).
813 * lib/ui/default.ui: change Item to OptItem in import menu.
814 Comment out fax stuff.
816 * lib/configure.m4: comment out fax-related stuff.
818 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
820 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
821 useful xforms helper functions. At present contains only formatted().
822 Input a string and it returns it with line breaks so that in fits
825 * src/frontends/xforms/Makefile.am: add new files.
827 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
828 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
831 * src/frontends/xforms/FormPreferences.[Ch]:
832 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
833 but lots of little clean ups. Removed enum State. Make use of
834 formatted(). Constify lots of methods. Perhaps best of all: removed
835 requirement for that horrible reinterpret_cast from pointer to long in
838 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
840 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
841 conditionalize build on xforms < 0.89
843 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
845 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
847 * src/LyXAction.C (init): comment out fax
849 * src/lyxrc.h: comment out the fax enums
850 comment out the fax variables
852 * src/commandtags.h: comment out LFUN_FAX
854 * src/lyxrc.C: disable fax variables.
855 (read): disable parsing of fax variables
856 (output): disable writing of fax variables
857 (getFeedback): now description for fax variables
859 * src/lyxfunc.C: comment out MenuFax
860 (Dispatch): disable LFUN_FAX
862 * src/lyx_cb.C (MenuFax): comment out
864 * src/WorkArea.C: add <cctype>
865 (work_area_handler): better key handling, should be ok now.
866 for accented chars + etc
868 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
869 lyx_sendfax.h and lyx_sendfax_man.C
871 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
872 (show): don't call InitLyXLookup when using xforms 0.89
874 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
876 * src/trans.C (AddDeadkey): better fix, the other one could crash...
878 * src/support/filetools.C (GetFileContents): close to dummy change
880 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
882 * src/trans.C (AddDeadkey): workaround stupid compilers.
884 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
886 * src/frontends/xforms/FormDocument.C (class_update): fix setting
887 of two-sided document.
889 2000-10-31 Juergen Vigna <jug@sad.it>
891 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
893 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
894 xposition to the Edit call.
896 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
898 * src/trans.C (AddDeadkey): cast explicitly to char.
900 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
902 * src/tabular.C (AsciiBottomHLine): simplify?
903 (AsciiTopHLine): simplify?
904 (print_n_chars): simplify
905 (DocBook): remove most of the << endl; we should flush the stream
906 as seldom as possible.
908 (TeXBottomHLine): ditto
911 (write_attribute): try a templified version.
912 (set_row_column_number_info): lesson scope of variables
914 * src/support/lstrings.h (tostr): new specialization of tostr
916 * src/trans.C (AddDeadkey): slightly cleaner fix.
918 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
920 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
921 '%%' in Toc menu labels.
924 * src/insets/insetlatexaccent.C (draw): Correct rendering when
925 font_norm is iso10646-1.
927 * src/font.C (ascent): Fixed for 16bit fonts
928 (descent,lbearing,rbearing): ditto
930 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
932 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
933 (getFeedback): new static method.
935 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
936 Now use combox rather than choice to display languages.
937 Feedback is now output using a new timer callback mechanism, identical
938 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
940 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
942 * src/minibuffer.C: fix for older compilers
944 2000-10-30 Juergen Vigna <jug@sad.it>
946 * src/insets/insettext.C (InsertInset): fixed this as the cursor
947 has to be Left of the inset otherwise LyXText won't find it!
949 * src/BufferView2.C (open_new_inset): delete the inset if it can
952 2000-10-30 Rob Lahaye <lahaye@postech.edu>
956 2000-10-29 Marko Vendelin <markov@ioc.ee>
957 * src/frontends/gnome/FormCitation.C
958 * src/frontends/gnome/FormCitation.h
959 * src/frontends/gnome/FormCopyright.C
960 * src/frontends/gnome/FormCopyright.h
961 * src/frontends/gnome/FormError.C
962 * src/frontends/gnome/FormError.h
963 * src/frontends/gnome/FormIndex.C
964 * src/frontends/gnome/FormIndex.h
965 * src/frontends/gnome/FormPrint.C
966 * src/frontends/gnome/FormPrint.h
967 * src/frontends/gnome/FormRef.C
968 * src/frontends/gnome/FormRef.h
969 * src/frontends/gnome/FormToc.C
970 * src/frontends/gnome/FormToc.h
971 * src/frontends/gnome/FormUrl.C
972 * src/frontends/gnome/FormUrl.h
973 * src/frontends/gnome/Menubar_pimpl.C
974 * src/frontends/gnome/mainapp.C
975 * src/frontends/gnome/mainapp.h
976 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
977 changing update() to updateSlot() where appropriate
979 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
981 * src/frontends/xforms/FormPreferences.[Ch]:
982 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
985 2000-10-28 Juergen Vigna <jug@sad.it>
987 * src/insets/insettabular.C (draw): fixed drawing bug.
989 * src/insets/insettext.C (clear):
991 (SetParagraphData): clearing the TEXT buffers when deleting the
992 paragraphs used by it.
994 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
996 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
998 2000-10-27 Juergen Vigna <jug@sad.it>
1000 * src/tabular.C (~LyXTabular): removed not needed anymore.
1002 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
1005 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1007 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
1010 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
1013 * src/frontends/xforms/FormPreferences.[Ch]:
1014 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
1015 Reorganised as modules based on tabs. Much easier to follow the
1016 flow and to add new tabs. Added warning and feedback messages.
1019 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1021 * src/tabular.h (DocBook): add std:: qualifier.
1023 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
1025 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
1026 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
1029 * insettabular.C (DocBook): uses the tabular methods to export
1032 * src/insets/insettext.h
1033 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
1035 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1037 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
1040 * src/lyxfunc.C (MenuNew): lessen the scope of fname
1041 moved misplaced AllowInput two lines up.
1043 * src/buffer.C (readFile): compare float with float, not with int
1045 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1047 * src/minibuffer.C: add "using SigC::slot" statement.
1049 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
1051 * src/frontends/xforms/forms/README: updated section about make.
1053 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
1054 Tidied some forms up, made two of form_tabular's tabs more
1055 self-consistent, fixed Jean-Marc's size problem in form_preferences,
1056 fixed translation problem with "Column".
1058 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1060 * src/minibuffer.h: use Timeout instead of the xforms timer
1062 (setTimer) rewrite for the Timeout, change to unsigned arg
1063 (set): change to unsigned timer arg
1066 * src/minibuffer.C (TimerCB): removed func
1067 (C_MiniBuffer_TimerCB): removed func
1068 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
1069 (peek_event): use a switch statement
1070 (add): don't use fl_add_timer.
1071 (Set): rewrite to use the Timeout
1074 * src/Timeout.[Ch] (setType): return a Timeout &
1075 (setTimeout): ditto, change to unsigned arg for timeout
1077 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
1079 * src/mathed/formula.C (mathed_string_width): Use string instead
1080 of a constant size char array.
1082 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1084 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
1085 the two recently added operator<< for SMInput and State.
1087 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
1089 (OkCancelPolicy): ditto
1090 (OkCancelReadOnlyPolicy): ditto
1091 (NoRepeatedApplyReadOnlyPolicy): ditto
1092 (OkApplyCancelReadOnlyPolicy): ditto
1093 (OkApplyCancelPolicy): ditto
1094 (NoRepeatedApplyPolicy): ditto
1096 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1098 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
1099 add the usual std:: qualifiers.
1101 2000-10-25 Juergen Vigna <jug@sad.it>
1103 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
1105 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1107 * src/support/filetools.C (MakeRelPath): change some types to
1110 * src/frontends/ButtonPolicies.h (operator<<): new operator for
1111 ButtonPolicy::SMInput and ButtonPolicy::State.
1113 * src/FontLoader.C (reset): small cleanup
1114 (unload): small cleanup
1116 * src/FontInfo.C (getFontname): initialize error to 10000.0
1118 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1120 * src/frontends/xforms/FormPreferences.[Ch]:
1121 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
1122 TeX encoding and default paper size sections.
1124 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1126 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
1129 * src/frontends/xforms/FormError.C (disconnect): use erase() to
1130 make the message_ empty.
1131 (FormError): don't initialize message_ in initializer list.
1133 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1135 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
1137 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1139 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
1141 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
1143 * src/frontends/kde/*data.[Ch]: _("") is not
1146 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1148 * src/buffer.C: removed redundant using directive.
1150 * src/frontends/DialogBase.h: revert to original definition of
1153 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
1154 stuff into two classes, one for each dialog, requires a new
1155 element in the dialogs vector, FormTabularCreate.
1157 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
1160 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
1161 method. Continues Allan's idea, but means that derived classes
1162 don't need to worry about "update or hide?".
1164 * src/frontends/xforms/FormError.C (showInset): add connection
1167 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
1168 one for each dialog. FormTabular now contains main tabular dialog
1171 * src/frontends/xforms/FormTabularCreate.[Ch]:
1172 * src/frontends/xforms/forms/form_tabular_create.fd: the create
1175 * src/frontends/xforms/FormGraphics.[Ch]:
1176 * src/frontends/xforms/forms/form_graphics.fd
1177 * src/frontends/xforms/FormTabular.[Ch]:
1178 * src/frontends/xforms/forms/form_tabular.fd: made daughter
1179 classes of FormInset.
1181 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
1182 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
1184 * src/frontends/xforms/Makefile.am:
1185 * src/frontends/xforms/forms/makefile: added new files.
1187 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
1188 variable. added Signal0 hide signal, in keeping with other GUI-I
1191 * src/support/lstrings.h: removed redundant std:: qualifier as
1192 it's already declared in Lsstream.h.
1194 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1196 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
1200 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1202 * src/tabular.C (Ascii): minimize scope of cell.
1204 * src/BufferView2.C (nextWord): return string() instead of 0;
1206 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1208 * src/converter.h: add a std:: qualifier
1210 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
1212 * src/importer.[Ch]: New files. Used for importing files into LyX.
1214 * src/lyxfunc.C (doImport): Use the new Importer class.
1216 * src/converter.h: Add shortcut member to the Format class.
1217 Used for holding the menu shortcut.
1219 * src/converter.C and other files: Made a distinction between
1220 format name and format extension. New formats can be defined using
1221 the \format lyxrc tag.
1222 Added two new converter flags: latex and disable.
1224 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1226 * src/support/lyxlib.h: unify namespace/struct implementation.
1227 Remove extra declarations.
1229 * src/support/chdir.C (chdir): remove version taking char const *
1231 * src/support/rename.C: ditto.
1232 * src/support/lyxsum.C: ditto.
1234 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
1236 * src/frontends/xforms/FormBase.[Ch]:
1237 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
1238 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
1239 work only for the next call to fl_show_form(). The correct place to set
1240 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
1241 done. FormBase also stores minw_, minh_ itself. All dialogs derived
1242 from FormBase have the minimum size set; no more stupid crashes with
1245 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1247 * lib/ui/default.ui: fix shortcut for Insert->Include File.
1249 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1251 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
1253 * src/support/lyxlib.h: changed second argument of mkdir to
1254 unsigned long int (unsigned int would probably have been enough,
1255 but...). Removed <sys/types.h> header.
1256 * src/support/mkdir.C (mkdir): ditto.
1260 2000-10-19 Juergen Vigna <jug@sad.it>
1262 * src/lyxfunc.C (MenuNew): small fix (form John)
1264 * src/screen.C (Update): removed unneeded code.
1266 * src/tabular.C (Ascii): refixed int != uint bug!
1268 * src/support/lyxlib.h: added sys/types.h include for now permits
1269 compiling, but I don't like this!
1271 2000-10-18 Juergen Vigna <jug@sad.it>
1273 * src/text2.C (ClearSelection): if we clear the selection we need
1274 more refresh so set the status apropriately
1276 * src/insets/insettext.C (draw): hopefully finally fixed draw
1279 2000-10-12 Juergen Vigna <jug@sad.it>
1281 * src/insets/insettext.C (draw): another small fix and make a block
1282 so that variables are localized.
1284 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
1286 * src/support/lstrings.C (lowercase, uppercase):
1287 use explicit casts to remove compiler warnings.
1289 * src/support/LRegex.C (Impl):
1290 * src/support/StrPool.C (add):
1291 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
1292 (AddPath, MakeDisplayPath):
1293 * src/support/lstrings.C (prefixIs, subst):
1294 use correct type to remove compiler warnings.
1296 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
1298 * src/support/lyxlib.h:
1299 * src/support/mkdir.C (mkdir): change parameter to mode_t for
1300 portability and to remove compiler warning with DEC cxx.
1302 * src/support/FileInfo.[Ch] (flagRWX): ditto.
1304 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1306 * src/minibuffer.C (peek_event): retun 1 when there has been a
1307 mouseclick in the minibuffer.
1311 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
1313 * src/frontends/xforms/FormParagraph.C: more space above/below
1316 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
1318 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1319 a char only if real_current_font was changed.
1321 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1323 * NEWS: update somewhat for 1.1.6
1325 * lib/ui/default.ui: clean up.
1327 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
1329 * lib/CREDITS: clean up
1331 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1333 * src/combox.[Ch] (select): changed argument back to int
1334 * src/combox.C (peek_event): removed num_bytes as it is declared but
1337 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
1338 modified calls to Combox::select() to remove warnings about type
1341 * src/insets/insetbutton.C (width): explicit cast to remove warning
1342 about type conversion.
1344 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
1347 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
1348 sel_pos_end, refering to cursor position are changed to
1349 LyXParagraph::size_type.
1351 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
1352 consistent with LyXCursor::pos().
1353 (inset_pos): changed to LyXParagraph::size_type for same reason.
1355 * src/insets/insettext.C (resizeLyXText): changed some temporary
1356 variables refing to cursor position to LyXParagraph::size_type.
1358 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
1360 * src/frontends/kde/<various>: The Great Renaming,
1363 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1365 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
1367 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1369 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
1370 0 when there are no arguments.
1372 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1374 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
1375 to segfaults when pressing Ok in InsetBibtex dialog.
1377 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1379 * forms/layout_forms.fd:
1380 * src/layout_forms.C (create_form_form_character): small change to use
1381 labelframe rather than engraved frame + text
1383 * src/lyx_gui.C (create_forms): initialise choice_language with some
1384 arbitrary value to prevent segfault when dialog is shown.
1386 2000-10-16 Baruch Even <baruch.even@writeme.com>
1388 * src/converter.C (runLaTeX, scanLog): Added a warning when there
1389 is no resulting file. This pertains only to LaTeX output.
1391 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
1393 * src/text.C (Backspace): Make sure that the row of the cursor is
1396 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1399 * src/lyx_gui.C (init): Prevent a crash when only one font from
1400 menu/popup fonts is not found.
1402 * lib/lyxrc.example: Add an example for binding a key for language
1405 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
1407 * src/converter.C (GetReachable): Changed the returned type to
1409 (IsReachable): New method
1411 * src/MenuBackend.C (expand): Handle formats that appear more
1414 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1416 * src/frontends/support/Makefile.am
1417 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
1420 * lib/CREDITS: add Garst Reese.
1422 * src/support/snprintf.h: add extern "C" {} around the definitions.
1424 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
1426 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1429 * src/frontends/xforms/FormDocument.C:
1430 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
1431 compile without "conversion to integral type of smaller size"
1434 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1436 * src/text.C (GetColumnNearX): Fixed disabled code.
1438 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1440 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
1443 * src/support/snprintf.[ch]: new files
1445 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1447 * src/frontends/kde/formprintdialog.C: add
1448 file browser for selecting postscript output
1450 * src/frontends/kde/formprintdialogdata.C:
1451 * src/frontends/kde/formprintdialogdata.h: re-generate
1454 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1456 * src/frontends/gnome/Makefile.am:
1457 * src/frontends/kde/Makefile.am: FormCommand.C
1458 disappeared from xforms
1460 * src/frontends/kde/FormCitation.C:
1461 * src/frontends/kde/FormIndex.C: read-only
1464 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1466 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
1469 * src/bufferlist.C: add using directive.
1471 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1473 * src/support/lyxfunctional.h: version of class_fun for void
1474 returns added, const versions of back_inseter_fun and compare_fun
1477 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1479 * src/frontends/xforms/FormInset.C (showInset): fix typo.
1481 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1483 * ChangeLog: cleanup.
1485 * lib/CREDITS: update to add all the contributors we've forgotten.
1486 I have obviously missed some, so tell me whether there were
1489 2000-10-13 Marko Vendelin <markov@ioc.ee>
1491 * src/frontends/gnome/FormCitation.C
1492 * src/frontends/gnome/FormCitation.h
1493 * src/frontends/gnome/FormError.C
1494 * src/frontends/gnome/FormIndex.C
1495 * src/frontends/gnome/FormRef.C
1496 * src/frontends/gnome/FormRef.h
1497 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
1499 * src/frontends/gnome/FormCitation.C
1500 * src/frontends/gnome/FormCopyright.C
1501 * src/frontends/gnome/FormError.C
1502 * src/frontends/gnome/FormIndex.C
1503 * src/frontends/gnome/FormRef.C
1504 * src/frontends/gnome/FormToc.C
1505 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
1508 * src/frontends/gnome/Menubar_pimpl.C
1509 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
1512 2000-10-11 Baruch Even <baruch.even@writeme.com>
1515 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
1516 to convey its real action.
1518 * src/minibuffer.C (peek_event): Added action when mouse clicks to
1519 clear the minibuffer and prepare to enter a command.
1521 * src/mathed/formula.C (LocalDispatch): Changed to conform with
1522 the rename from ExecCommand to PrepareForCommand.
1523 * src/lyxfunc.C (Dispatch): ditto.
1525 2000-10-11 Baruch Even <baruch.even@writeme.com>
1527 * src/buffer.C (writeFile): Added test for errors on writing, this
1528 catches all errors and not only file system full errors as intended.
1530 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1532 * src/lyx_gui.C (create_forms): better fix for crash with
1533 translated interface.
1535 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
1537 * src/frontends/kde/Makefile.am:
1538 * src/frontends/kde/FormCopyright.C:
1539 * src/frontends/kde/formcopyrightdialog.C:
1540 * src/frontends/kde/formcopyrightdialog.h:
1541 * src/frontends/kde/formcopyrightdialogdata.C:
1542 * src/frontends/kde/formcopyrightdialogdata.h:
1543 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
1544 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
1545 copyright to use qtarch
1547 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
1549 * src/encoding.C (read): Fixed bug that caused an error message at
1550 the end of the file.
1552 * po/Makefile.in.in: Fixed rule for ext_l10n.h
1554 * lib/lyxrc.example: Fixed hebrew example.
1556 2000-10-13 Allan Rae <rae@lyx.org>
1558 * src/frontends/xforms/FormPreferences.C (input): reworking the
1560 (build, update, apply): New inputs in various tabfolders
1562 * src/frontends/xforms/FormToc.C: use new button policy.
1563 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
1564 dialogs that either can't use any existing policy or where it just
1567 * src/frontends/xforms/FormTabular.h: removed copyright notice that
1570 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
1571 added a bool parameter which is ignored.
1573 * src/buffer.C (setReadonly):
1574 * src/BufferView_pimpl.C (buffer):
1575 * src/frontends/kde/FormCopyright.h (update):
1576 * src/frontends/kde/FormCitation.[Ch] (update):
1577 * src/frontends/kde/FormIndex.[Ch] (update):
1578 * src/frontends/kde/FormPrint.[Ch] (update):
1579 * src/frontends/kde/FormRef.[Ch] (update):
1580 * src/frontends/kde/FormToc.[Ch] (update):
1581 * src/frontends/kde/FormUrl.[Ch] (update):
1582 * src/frontends/gnome/FormCopyright.h (update):
1583 * src/frontends/gnome/FormCitation.[Ch] (update):
1584 * src/frontends/gnome/FormError.[Ch] (update):
1585 * src/frontends/gnome/FormIndex.[Ch] (update):
1586 * src/frontends/gnome/FormPrint.[Ch] (update):
1587 * src/frontends/gnome/FormRef.h (update):
1588 * src/frontends/gnome/FormToc.[Ch] (update):
1589 * src/frontends/gnome/FormUrl.[Ch] (update):
1590 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
1591 to updateBufferDependent and DialogBase
1593 * src/frontends/xforms/FormCitation.[hC]:
1594 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
1595 * src/frontends/xforms/FormError.[Ch]:
1596 * src/frontends/xforms/FormGraphics.[Ch]:
1597 * src/frontends/xforms/FormIndex.[Ch]:
1598 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
1599 and fixed readOnly handling.
1600 * src/frontends/xforms/FormPrint.[Ch]:
1601 * src/frontends/xforms/FormRef.[Ch]:
1602 * src/frontends/xforms/FormTabular.[Ch]:
1603 * src/frontends/xforms/FormToc.[Ch]:
1604 * src/frontends/xforms/FormUrl.[Ch]:
1605 * src/frontends/xforms/FormInset.[Ch]:
1606 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
1607 form of updateBufferDependent.
1609 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
1610 if form()->visible just in case someone does stuff to the form in a
1613 * src/frontends/DialogBase.h (enum): removed enum since we can now use
1614 the buttoncontroller for everything the enum used to be used for.
1615 (update) It would seem we need to force all dialogs to use a bool
1616 parameter or have two update functions. I chose to go with one.
1617 I did try removing update() from here and FormBase and defining the
1618 appropriate update signatures in FormBaseB[DI] but then ran into the
1619 problem of the update() call in FormBase::show(). Whatever I did
1620 to get around that would require another function and that just
1621 got more confusing. Hence the decision to make everyone have an
1622 update(bool). An alternative might have been to override show() in
1623 FormBaseB[DI] and that would allow the different and appropriate
1626 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
1627 true == buffer change occurred. I decided against using a default
1628 template parameter since not all compilers support that at present.
1630 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
1632 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
1633 army knife" by removing functionality.
1634 (clearStore): removed. All such housekeeping on hide()ing the dialog
1635 is to be carried out by overloaded disconnect() methods.
1636 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
1637 superceded by Baruch's neat test (FormGraphics) to update an existing
1638 dialog if a new signal is recieved rather than block all new signals
1640 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
1641 only to Inset dialogs.
1642 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
1643 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
1645 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
1647 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
1648 as a base class to all inset dialogs. Used solely to connect/disconnect
1649 the Inset::hide signal and to define what action to take on receipt of
1650 a UpdateBufferDependent signal.
1651 (FormCommand): now derived from FormInset.
1653 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
1656 * src/frontends/xforms/FormCopyright.[Ch]:
1657 * src/frontends/xforms/FormPreferences.[Ch]:
1658 now derived from FormBaseBI.
1660 * src/frontends/xforms/FormDocument.[Ch]:
1661 * src/frontends/xforms/FormParagraph.[Ch]:
1662 * src/frontends/xforms/FormPrint.[Ch]:
1663 now derived from FormBaseBD.
1665 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
1667 * src/frontends/xforms/FormCitation.[Ch]:
1668 * src/frontends/xforms/FormError.[Ch]:
1669 * src/frontends/xforms/FormRef.[Ch]:
1670 * src/frontends/xforms/FormToc.[Ch]:
1671 (clearStore): reworked as disconnect().
1673 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
1676 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1678 * src/converter.C (runLaTeX): constify buffer argument
1681 * src/frontends/support/Makefile.am (INCLUDES): fix.
1683 * src/buffer.h: add std:: qualifier
1684 * src/insets/figinset.C (addpidwait): ditto
1685 * src/MenuBackend.C: ditto
1686 * src/buffer.C: ditto
1687 * src/bufferlist.C: ditto
1688 * src/layout.C: ditto
1689 * src/lyxfunc.C: ditto
1691 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1693 * src/lyxtext.h (bidi_level): change return type to
1694 LyXParagraph::size_type.
1696 * src/lyxparagraph.h: change size_type to
1697 TextContainer::difference_type. This should really be
1698 TextContainer::size_type, but we need currently to support signed
1701 2000-10-11 Marko Vendelin <markov@ioc.ee>
1702 * src/frontends/gnome/FormError.h
1703 * src/frontends/gnome/FormRef.C
1704 * src/frontends/gnome/FormRef.h
1705 * src/frontends/gnome/FormError.C
1706 * src/frontends/gnome/Makefile.am
1707 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
1708 to Gnome frontend. Both dialogs use "action" area.
1710 2000-10-12 Baruch Even <baruch.even@writeme.com>
1712 * src/graphics/GraphicsCacheItem_pimpl.C:
1713 * src/graphics/Renderer.C:
1714 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
1717 2000-10-12 Juergen Vigna <jug@sad.it>
1719 * src/insets/insettext.C (draw): fixed drawing bug (specifically
1720 visible when selecting).
1722 * development/Code_rules/Rules: fixed some typos.
1724 2000-10-09 Baruch Even <baruch.even@writeme.com>
1726 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
1727 compiling on egcs 1.1.2 possible.
1729 * src/filedlg.C (comp_direntry::operator() ): ditto.
1731 2000-08-31 Baruch Even <baruch.even@writeme.com>
1733 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
1736 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
1737 transient it now only gets freed when the object is destructed.
1739 2000-08-24 Baruch Even <baruch.even@writeme.com>
1741 * src/frontends/FormGraphics.h:
1742 * src/frontends/FormGraphics.C: Changed to use ButtonController and
1745 2000-08-20 Baruch Even <baruch.even@writeme.com>
1747 * src/insets/insetgraphics.C:
1748 (draw): Added messages to the drawn rectangle to report status.
1749 (updateInset): Disabled the use of the inline graphics,
1752 2000-08-17 Baruch Even <baruch.even@writeme.com>
1754 * src/frontends/support: Directory added for the support of GUII LyX.
1756 * src/frontends/support/LyXImage.h:
1757 * src/frontends/support/LyXImage.C: Base class for GUII holding of
1760 * src/frontends/support/LyXImage_X.h:
1761 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
1762 version of LyXImage, this uses the Xlib Pixmap.
1764 * src/PainterBase.h:
1765 * src/PainterBase.C:
1767 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
1768 replacement to Pixmap.
1770 * src/insets/insetgraphics.h:
1771 * src/insets/insetgraphics.C:
1772 * src/graphics/GraphicsCacheItem.h:
1773 * src/graphics/GraphicsCacheItem.C:
1774 * src/graphics/GraphicsCacheItem_pimpl.h:
1775 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
1778 * src/graphics/GraphicsCacheItem.h:
1779 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
1780 another copy of the object.
1782 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
1783 of cacheHandle, this fixed a bug that sent LyX crashing.
1785 * src/graphics/XPM_Renderer.h:
1786 * src/graphics/XPM_Renderer.C:
1787 * src/graphics/EPS_Renderer.h:
1788 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
1790 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1792 * src/lyxfunc.C (processKeySym): only handle the
1793 lockinginset/inset stuff if we have a buffer and text loaded...
1795 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
1797 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1799 * src/support/lyxfunctional.h: add operator= that takes a reference
1801 * src/lyxserver.C (mkfifo): make first arg const
1803 * src/layout.h: renamed name(...) to setName(...) to work around
1806 * src/buffer.C (setFileName): had to change name of function to
1807 work around bugs in egcs. (renamed from fileName)
1809 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
1811 * src/support/translator.h: move helper template classes to
1812 lyxfunctional.h, include "support/lyxfunctional.h"
1814 * src/support/lyxmanip.h: add delaration of fmt
1816 * src/support/lyxfunctional.h: new file
1817 (class_fun_t): new template class
1818 (class_fun): helper template function
1819 (back_insert_fun_iterator): new template class
1820 (back_inserter_fun): helper template function
1821 (compare_memfun_t): new template class
1822 (compare_memfun): helper template function
1823 (equal_1st_in_pair): moved here from translator
1824 (equal_2nd_in_pair): moved here from translator
1826 * src/support/fmt.C: new file
1827 (fmt): new func, can be used for a printf substitute when still
1828 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
1830 * src/support/StrPool.C: add some comments
1832 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
1835 * src/insets/figinset.C (addpidwait): use std::copy with
1836 ostream_iterator to fill the pidwaitlist
1838 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
1840 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
1843 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
1846 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
1848 * src/frontends/xforms/FormDocument.C (build): remove c_str()
1849 (class_update): ditto
1850 (BulletPanel): ditto
1851 (CheckChoiceClass): move initialization of tc and tct
1853 * src/tabular.C: remove current_view
1854 (OldFormatRead): similar to right below [istream::ignore]
1856 * src/lyxlex_pimpl.C (next): add code for faster skipping of
1857 chars, unfortunately this is buggy on gcc 2.95.2, so currently
1858 unused [istream::ignore]
1860 * src/lyxfunc.C: include "support/lyxfunctional.h"
1861 (getInsetByCode): use std::find_if and compare_memfun
1863 * src/lyxfont.C (stateText): remove c_str()
1865 * src/lyx_main.C (setDebuggingLevel): make static
1866 (commandLineHelp): make static
1868 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
1869 Screen* together with fl_get_display() and fl_screen
1871 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
1872 togheter with fl_get_display() and fl_screen
1873 (create_forms): remove c_str()
1875 * src/layout.C: include "support/lyxfunctional.h"
1876 (hasLayout): use std::find_if and compare_memfun
1877 (GetLayout): use std::find_if and comapre_memfun
1878 (delete_layout): use std::remove_if and compare_memfun
1879 (NumberOfClass): use std:.find_if and compare_memfun
1881 * src/gettext.h: change for the new functions
1883 * src/gettext.C: new file, make _(char const * str) and _(string
1884 const & str) real functions.
1886 * src/font.C (width): rewrite slightly to avoid one extra variable
1888 * src/debug.C: initialize Debug::ANY here
1890 * src/commandtags.h: update number comments
1892 * src/combox.h (get): make const func
1894 (getline): make const
1896 * src/combox.C (input_cb): handle case where fl_get_input can
1899 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
1900 "support/lyxfunctional.h", remove current_view variable.
1901 (resize): use std::for_each with std::mem_fun
1902 (getFileNames): use std::copy with back_inserter_fun
1903 (getBuffer): change arg type to unsigned int
1904 (emergencyWriteAll): call emergencyWrite with std::for_each and
1906 (emergencyWrite): new method, the for loop in emergencyWriteAll
1908 (exists): use std::find_if with compare_memfun
1909 (getBuffer): use std::find_if and compare_memfun
1911 * src/buffer.h: add typedefs for iterator_category, value_type
1912 difference_type, pointer and reference for inset_iterator
1913 add postfix ++ for inset_iterator
1914 make inset_iterator::getPos() const
1916 * src/buffer.C: added support/lyxmanip.h
1917 (readFile): use lyxerr << fmt instead of printf
1918 (makeLaTeXFile): use std::copy to write out encodings
1920 * src/Painter.C (text): rewrite slightly to avoid extra font variable
1922 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
1923 free and the char * temp.
1924 (hasMenu): use std::find_if and compare_memfun
1927 * src/Makefile.am (lyx_SOURCES): added gettext.C
1929 * src/LyXAction.C (retrieveActionArg): clear the arg, use
1930 string::insert small change to avoid temporary
1932 * src/LColor.C (getGUIName): remove c_str()
1934 * several files: change all occurrences of fl_display to
1937 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
1938 that -pedantic is not used for gcc 2.97 (cvs gcc)
1940 * boost/Makefile.am: begin slowly to prepare for a real boost lib
1942 2000-10-11 Allan Rae <rae@lyx.org>
1944 * src/frontends/xforms/FormPreferences.C (input): template path must be
1945 a readable directory. It doesn't need to be writeable.
1946 (build, delete, update, apply): New inputs in the various tabfolders
1948 * src/frontends/xforms/forms/form_preferences.fd:
1949 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
1950 several new entries to existing folders. Shuffled some existing stuff
1953 * src/frontends/xforms/forms/form_print.fd:
1954 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
1955 Should probably rework PrinterParams as well. Note that the switch to
1956 collated is effectively the same as !unsorted so changing PrinterParams
1957 will require a lot of fiddly changes to reverse the existing logic.
1959 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
1961 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1963 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
1965 2000-10-10 Allan Rae <rae@lyx.org>
1968 * src/lyxfunc.C (Dispatch):
1970 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
1973 * src/lyxrc.C (output): Only write the differences between system lyxrc
1974 and the users settings.
1977 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
1979 I'll rewrite this later, after 1.1.6 probably, to keep a single
1980 LyXRC but two instances of a LyXRCStruct.
1982 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1984 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
1986 * src/tabular.h: add a few std:: qualifiers.
1988 * src/encoding.C: add using directive.
1989 * src/language.C: ditto.
1991 * src/insets/insetquotes.C (Validate): use languages->lang()
1992 instead of only language.
1994 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
1996 * lib/languages: New file.
1998 * lib/encodings: New file.
2000 * src/language.C (Languages): New class.
2001 (read): New method. Reads the languages from the 'languages' file.
2003 * src/encoding.C (Encodings): New class.
2004 (read): New method. Reads the encodings from the 'encodings' file.
2006 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
2009 * src/bufferparams.h and a lot of files: Deleted the member language,
2010 and renamed language_info to language
2012 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
2013 * src/lyxfont.C (latexWriteStartChanges): ditto.
2014 * src/paragraph.C (validate,TeXOnePar): ditto.
2016 * src/lyxfont.C (update): Restored deleted code.
2018 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
2020 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2022 * src/BufferView_pimpl.C (buffer): cleaned up a little.
2024 * src/insets/figinset.[Ch]:
2025 * src/insets/insetinclude.[Ch]:
2026 * src/insets/insetinclude.[Ch]:
2027 * src/insets/insetparent.[Ch]:
2028 * src/insets/insetref.[Ch]:
2029 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
2031 * src/insets/*.[Ch]:
2032 * src/mathed/formula.[Ch]:
2033 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
2035 * src/buffer.C (parseSingleLyXformat2Token, readInset):
2036 * src/lyx_cb.C (FigureApplyCB):
2037 * src/lyxfunc.C (getStatus, Dispatch):
2038 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
2041 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
2043 * src/converter.[Ch] (Formats::View):
2044 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
2046 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
2047 *current_view->buffer(). This will change later, but this patch is way
2050 2000-10-09 Juergen Vigna <jug@sad.it>
2052 * src/text.C (GetRow): small fix.
2054 * src/BufferView_pimpl.C (cursorPrevious):
2055 (cursorNext): added LyXText parameter to function.
2057 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
2058 keypress depending on cursor position.
2060 2000-10-06 Juergen Vigna <jug@sad.it>
2062 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
2063 (copySelection): redone this function and also copy ascii representa-
2066 * src/tabular.C (Ascii):
2070 (print_n_chars): new functions to realize the ascii export of tabulars.
2072 2000-10-05 Juergen Vigna <jug@sad.it>
2074 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
2075 if we don't have a buffer.
2077 2000-10-10 Allan Rae <rae@lyx.org>
2079 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
2080 with closing dialog. It seems that nested tabfolders require hiding
2081 of inner tabfolders before hiding the dialog itself. Actually all I
2082 did was hide the active outer folder.
2084 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
2085 unless there really is a buffer. hideBufferDependent is called
2088 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
2089 POTFILES.in stays in $(srcdir).
2091 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
2093 * lib/lyxrc.example: Few changes.
2095 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
2097 * src/BufferView_pimpl.C (buffer): only need one the
2098 updateBufferDependent signal to be emitted once! Moved to the end of
2099 the method to allow bv_->text to be updated first.
2101 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
2102 and hSignal_ with Dialogs * and BufferDependency variables.
2103 New Buffer * parent_, initialised when the dialog is launched. Used to
2104 check whether to update() or hide() dialog in the new, private
2105 updateOrHide() method that is connected to the updateBufferDependent
2106 signal. Daughter classes dictate what to do using the
2107 ChangedBufferAction enum, passed to the c-tor.
2109 * src/frontends/xforms/FormCitation.C:
2110 * src/frontends/xforms/FormCommand.C:
2111 * src/frontends/xforms/FormCopyright.C:
2112 * src/frontends/xforms/FormDocument.C:
2113 * src/frontends/xforms/FormError.C:
2114 * src/frontends/xforms/FormIndex.C:
2115 * src/frontends/xforms/FormPreferences.C:
2116 * src/frontends/xforms/FormPrint.C:
2117 * src/frontends/xforms/FormRef.C:
2118 * src/frontends/xforms/FormToc.C:
2119 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
2122 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
2123 ChangedBufferAction enum.
2125 * src/frontends/xforms/FormParagraph.[Ch]
2126 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
2129 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2131 * lib/bind/cua.bind: fix a bit.
2132 * lib/bind/emacs.bind: ditto.
2134 * lib/bind/menus.bind: remove real menu entries from there.
2136 * src/spellchecker.C: make sure we only include strings.h when
2139 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2141 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
2142 function. It enlarges the maximum number of pup when needed.
2143 (add_toc2): Open a new menu if maximum number of items per menu has
2146 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
2148 * src/frontends/kde/FormPrint.C: fix error reporting
2150 * src/frontends/xforms/FormDocument.C: fix compiler
2153 * lib/.cvsignore: add Literate.nw
2155 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2158 * bufferview_funcs.[Ch]
2161 * text2.C: Add support for numbers in RTL text.
2163 2000-10-06 Allan Rae <rae@lyx.org>
2165 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
2166 to be gettext.m4 friendly again. ext_l10n.h is now
2167 generated into $top_srcdir instead of $top_builddir
2168 so that lyx.pot will be built correctly -- without
2169 duplicate parsing of ext_l10n.h.
2171 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2173 * src/frontends/kde/FormCitation.C: make the dialog
2174 behave more sensibly
2176 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
2178 * config/kde.m4: fix consecutive ./configure runs,
2179 look for qtarch, fix library order
2181 * src/frontends/kde/Makefile.am: tidy up,
2182 add Print dialog, add .dlg dependencies
2184 * src/frontends/kde/FormPrint.C:
2185 * src/frontends/kde/FormPrint.h:
2186 * src/frontends/kde/formprintdialog.C:
2187 * src/frontends/kde/formprintdialog.h:
2188 * src/frontends/kde/formprintdialogdata.C:
2189 * src/frontends/kde/formprintdialogdata.h:
2190 * src/frontends/kde/dlg/formprintdialog.dlg: add
2193 * src/frontends/kde/dlg/README: Added explanatory readme
2195 * src/frontends/kde/dlg/checkinitorder.pl: small perl
2196 script to double-check qtarch's output
2198 * src/frontends/kde/formindexdialog.C:
2199 * src/frontends/kde/formindexdialogdata.C:
2200 * src/frontends/kde/formindexdialogdata.h:
2201 * src/frontends/kde/dlg/formindexdialog.dlg: update
2202 for qtarch, minor fixes
2204 2000-10-05 Allan Rae <rae@lyx.org>
2206 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
2207 dialogs when switching buffers update them instead. It's up to each
2208 dialog to decide if it should still be visible or not.
2209 update() should return a bool to control visiblity within show().
2210 Or perhaps better to set a member variable and use that to control
2213 * lib/build-listerrors: create an empty "listerrors" file just to stop
2214 make trying to regenerate it all the time if you don't have noweb
2217 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
2219 * po/Makefile.in.in (ext_l10n.h): added a rule to build
2220 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
2221 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
2222 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
2223 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
2225 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
2227 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
2229 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
2230 deleting buffer. Closes all buffer-dependent dialogs.
2232 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
2234 * src/frontends/xforms/FormCitation.[Ch]:
2235 * src/frontends/xforms/FormPreferences.[Ch]:
2236 * src/frontends/xforms/FormPrint.[Ch]:
2237 * src/frontends/xforms/FormRef.[Ch]:
2238 * src/frontends/xforms/FormUrl.[Ch]: ditto
2240 * src/frontends/xforms/FormDocument.[Ch]:
2241 * src/frontends/xforms/forms/form_document.C.patch:
2242 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
2243 pass through a single input() function.
2245 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2247 * lib/build-listerrors: return status as OK
2249 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
2251 * lib/lyxrc.example: Updated to new export code
2253 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2255 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
2258 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
2261 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
2262 LyX-Code is defined.
2263 * lib/layouts/amsbook.layout: ditto.
2265 * boost/Makefile.am: fix typo.
2267 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
2269 (add_lastfiles): removed.
2270 (add_documents): removed.
2271 (add_formats): removed.
2273 * src/frontends/Menubar.C: remove useless "using" directive.
2275 * src/MenuBackend.h: add a new MenuItem constructor.
2277 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
2280 2000-10-04 Allan Rae <rae@lyx.org>
2282 * lib/Makefile.am (listerrors):
2283 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
2284 I haven't got notangle installed so Kayvan please test. The output
2285 should end up in $builddir. This also allows people who don't have
2286 noweb installed to complete the make process without error.
2288 * src/frontends/xforms/FormCommand.[Ch] (showInset):
2289 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
2290 by JMarc's picky compiler.
2292 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2295 * src/insets/insettabular.C (setPos): change for loop to not use
2296 sequencing operator. Please check this Jürgen.
2298 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
2300 * src/insets/insetcite.C (getScreenLabel): ditto
2301 * src/support/filetools.C (QuoteName): ditto
2302 (ChangeExtension): ditto
2304 * src/BufferView_pimpl.C (scrollCB): make heigt int
2306 * src/BufferView2.C (insertInset): comment out unused arg
2308 * boost/Makefile.am (EXTRADIST): new variable
2310 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2312 * src/exporter.C (IsExportable): Fixed
2314 * lib/configure.m4: Small fix
2316 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2318 * src/insets/insetbutton.C (width): Changed to work with no GUI.
2319 * src/insets/insetbib.C (bibitemWidest): ditto.
2320 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
2322 2000-10-03 Juergen Vigna <jug@sad.it>
2324 * src/BufferView2.C (theLockingInset): removed const because of
2325 Agnus's compile problems.
2327 * src/insets/insettext.C (LocalDispatch): set the language of the
2328 surronding paragraph on inserting the first character.
2330 * various files: changed use of BufferView::the_locking_inset.
2332 * src/BufferView2.C (theLockingInset):
2333 (theLockingInset): new functions.
2335 * src/BufferView.h: removed the_locking_inset.
2337 * src/lyxtext.h: added the_locking_inset
2339 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
2341 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
2343 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2345 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
2346 * src/mathed/math_cursor.C (IsAlpha): ditto.
2347 * src/mathed/math_inset.C (strnew): ditto.
2348 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
2349 (IMetrics): cxp set but never used; removed.
2350 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
2351 that the variable in question has been removed also!
2354 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
2355 using the Buffer * passed to Latex(), using the BufferView * passed to
2356 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
2358 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
2359 Linuxdoc() and DocBook() rather than the stored Buffer * master.
2361 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
2362 * src/buffer.C (readInset): used new InsetBibtex c-tor
2363 * (getBibkeyList): used new InsetBibtex::getKeys
2365 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2368 * lib/build-listerrors
2370 * src/exporter.C: Add literate programming support to the export code
2373 * src/lyx_cb.C: Remove old literate code.
2375 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
2378 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
2379 * src/converter.C (View, Convert): Use QuoteName.
2381 * src/insets/figinset.C (Preview): Use Formats::View.
2383 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
2385 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2387 * src/lyxfunc.C (Dispatch): move declaration of text variable at
2388 the top of the function, because compaq cxx complains that the
2389 "goto exit_with_message" when the function is disabled bypasses
2391 (MenuNew): try a better fix for the generation of new file names.
2392 This time, I used AddName() instead of AddPath(), hoping Juergen
2395 2000-10-03 Allan Rae <rae@lyx.org>
2397 * src/frontends/xforms/forms/form_preferences.fd:
2398 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
2399 nested tabfolders has begun. The old "Miscellaneous" was renamed as
2400 "Look and Feel"->"General" but will need to be split up further into
2401 general output and general input tabs. Current plan is for four outer
2402 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
2403 stuff; "Inputs" for input and import configuration; "Outputs" for
2404 output and export configuration; and one more whatever is left over
2405 called "General". The leftovers at present look like being which
2406 viewers to use, spellchecker, language support and might be better
2407 named "Support". I've put "Paths" in "Inputs" for the moment as this
2408 seems reasonable for now at least.
2409 One problem remains: X error kills LyX when you close Preferences.
2411 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2413 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
2414 qualifier from form()
2415 * src/frontends/xforms/FormCitation.[Ch]:
2416 * src/frontends/xforms/FormCopyright.[Ch]:
2417 * src/frontends/xforms/FormDocument.[Ch]:
2418 * src/frontends/xforms/FormError.[Ch]:
2419 * src/frontends/xforms/FormIndex.[Ch]:
2420 * src/frontends/xforms/FormPreferences.[Ch]:
2421 * src/frontends/xforms/FormPrint.[Ch]:
2422 * src/frontends/xforms/FormRef.[Ch]:
2423 * src/frontends/xforms/FormToc.[Ch]:
2424 * src/frontends/xforms/FormUrl.[Ch]: ditto.
2426 * src/frontends/xforms/FormCitation.[Ch]:
2427 * src/frontends/xforms/FormIndex.[Ch]:
2428 * src/frontends/xforms/FormRef.[Ch]:
2429 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
2430 with Allan's naming policy
2432 * src/frontends/xforms/FormCitation.C: some static casts to remove
2435 2000-10-02 Juergen Vigna <jug@sad.it>
2437 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
2438 now you can type or do stuff inside the table-cell also when in dummy
2439 position, fixed visible cursor.
2441 * src/insets/insettext.C (Edit): fixing cursor-view position.
2443 * src/lyxfunc.C (Dispatch): use * text variable so that it can
2444 be used for equal functions in lyxfunc and insettext.
2446 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
2448 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
2450 * src/frontends/gnome/FormCitation.h:
2451 * src/frontends/gnome/FormCopyright.h:
2452 * src/frontends/gnome/FormIndex.h:
2453 * src/frontends/gnome/FormPrint.h:
2454 * src/frontends/gnome/FormToc.h:
2455 * src/frontends/gnome/FormUrl.h:
2456 * src/frontends/kde/FormCitation.h:
2457 * src/frontends/kde/FormCopyright.h:
2458 * src/frontends/kde/FormIndex.h:
2459 * src/frontends/kde/FormRef.h:
2460 * src/frontends/kde/FormToc.h:
2461 * src/frontends/kde/FormUrl.h: fix remaining users of
2464 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2466 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
2467 from depth argument.
2468 (DocBookHandleCaption): ditto.
2469 (DocBookHandleFootnote): ditto.
2470 (SimpleDocBookOnePar): ditto.
2472 * src/frontends/xforms/FormDocument.h (form): remove extra
2473 FormDocument:: qualifier.
2475 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
2477 * sigc++/handle.h: ditto.
2479 * src/lyx_gui_misc.C: add "using" directive.
2481 * src/cheaders/cstddef: new file, needed by the boost library (for
2484 2000-10-02 Juergen Vigna <jug@sad.it>
2486 * src/insets/insettext.C (SetFont): better support.
2488 * src/insets/insettabular.C (draw): fixed drawing of single cell.
2490 * src/screen.C (DrawOneRow): some uint refixes!
2492 2000-10-02 Allan Rae <rae@lyx.org>
2494 * boost/.cvsignore: ignore Makefile as well
2496 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
2497 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
2499 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
2500 Left this one out by accident.
2502 * src/frontends/xforms/FormBase.h (restore): default to calling
2503 update() since that will restore the original/currently-applied values.
2504 Any input() triggered error messages will require the derived classes
2505 to redefine restore().
2507 * src/frontends/xforms/FormDocument.C: initialize a few variables to
2508 avoid a segfault. combo_doc_class is the main concern.
2510 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
2512 * Simplify build-listerrors in view of GUI-less export ability!
2514 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2516 * src/lyx_main.C (easyParse): Disable gui when exporting
2518 * src/insets/figinset.C:
2521 * src/lyx_gui_misc.C
2522 * src/tabular.C: Changes to allow no-gui.
2524 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2526 * src/support/utility.hpp: removed file
2527 * src/support/block.h: removed file
2529 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
2532 * src/mathed/formula.C: add support/lyxlib.h
2533 * src/mathed/formulamacro.C: ditto
2535 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
2536 * src/lyxparagraph.h: ditto
2538 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
2539 * src/frontends/Makefile.am (INCLUDES): ditto
2540 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
2541 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
2542 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
2543 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
2544 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
2545 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
2547 * src/BufferView.h: use boost/utility.hpp
2548 * src/LColor.h: ditto
2549 * src/LaTeX.h: ditto
2550 * src/LyXAction.h: ditto
2551 * src/LyXView.h: ditto
2552 * src/bufferlist.h: ditto
2553 * src/lastfiles.h: ditto
2554 * src/layout.h: ditto
2555 * src/lyx_gui.h: ditto
2556 * src/lyx_main.h: ditto
2557 * src/lyxlex.h: ditto
2558 * src/lyxrc.h: ditto
2559 * src/frontends/ButtonPolicies.h: ditto
2560 * src/frontends/Dialogs.h: ditto
2561 * src/frontends/xforms/FormBase.h: ditto
2562 * src/frontends/xforms/FormGraphics.h: ditto
2563 * src/frontends/xforms/FormParagraph.h: ditto
2564 * src/frontends/xforms/FormTabular.h: ditto
2565 * src/graphics/GraphicsCache.h: ditto
2566 * src/graphics/Renderer.h: ditto
2567 * src/insets/ExternalTemplate.h: ditto
2568 * src/insets/insetcommand.h: ditto
2569 * src/support/path.h: ditto
2571 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
2572 and introduce clause for 2.97.
2574 * boost/libs/README: new file
2576 * boost/boost/utility.hpp: new file
2578 * boost/boost/config.hpp: new file
2580 * boost/boost/array.hpp: new file
2582 * boost/Makefile.am: new file
2584 * boost/.cvsignore: new file
2586 * configure.in (AC_OUTPUT): add boost/Makefile
2588 * Makefile.am (SUBDIRS): add boost
2590 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2592 * src/support/lstrings.C (suffixIs): Fixed.
2594 2000-10-01 Allan Rae <rae@lyx.org>
2596 * src/PrinterParams.h: moved things around to avoid the "can't
2597 inline call" warning.
2599 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
2600 into doc++ documentation.
2602 * src/frontends/xforms/FormCommand.[Ch]: support button policy
2604 * src/frontends/xforms/FormRef.C: make use of button controller
2605 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
2606 cleaned up button controller usage.
2607 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
2608 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
2609 use the button controller
2611 * src/frontends/xforms/forms/*.fd: and associated generated files
2612 updated to reflect changes to FormBase. Some other FormXxxx files
2613 also got minor updates to reflect changes to FormBase.
2615 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
2616 (hide): made virtual.
2617 (input): return a bool. true == valid input
2618 (RestoreCB, restore): new
2619 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
2620 Changes to allow derived dialogs to use a ButtonController and
2621 make sense when doing so: OK button calls ok() and so on.
2623 * src/frontends/xforms/ButtonController.h (class ButtonController):
2624 Switch from template implementation to taking Policy parameter.
2625 Allows FormBase to provide a ButtonController for any dialog.
2627 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
2628 Probably should rename connect and disconnect.
2629 (apply): use the radio button groups
2630 (form): needed by FormBase
2631 (build): setup the radio button groups
2633 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
2635 * several files: type changes to reduce the number of warnings and
2636 to unify type hangling a bit. Still much to do.
2638 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2640 * lib/images/*: rename a bunch of icons to match Dekel converter
2643 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
2646 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
2648 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
2650 * sigc++/handle.h: ditto for class Handle.
2652 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
2654 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
2656 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
2658 * src/intl.C (InitKeyMapper): Correct the value of n due to the
2659 removal of the "default" language.
2661 * src/combox.h (getline): Check that sel > 0
2663 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
2665 * lib/examples/docbook_example.lyx
2666 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
2668 * lib/layouts/docbook-book.layout: new docbook book layout.
2670 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
2672 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
2674 * src/insets/figinset.C (DocBook):fixed small typo.
2676 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
2678 * src/insets/insetinclude.h: string include_label doesn't need to be
2681 2000-09-29 Allan Rae <rae@lyx.org>
2683 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
2684 Allow derived type to control connection and disconnection from signals
2685 of its choice if desired.
2687 2000-09-28 Juergen Vigna <jug@sad.it>
2689 * src/insets/insettabular.C (update): fixed cursor setting when
2690 the_locking_inset changed.
2691 (draw): made this a bit cleaner.
2692 (InsetButtonPress): fixed!
2694 * various files: added LyXText Parameter to fitCursor call.
2696 * src/BufferView.C (fitCursor): added LyXText parameter.
2698 * src/insets/insettabular.C (draw): small draw fix.
2700 * src/tabular.C: right setting of left/right celllines.
2702 * src/tabular.[Ch]: fixed various types in funcions and structures.
2703 * src/insets/insettabular.C: ditto
2704 * src/frontends/xforms/FormTabular.C: ditto
2706 2000-09-28 Allan Rae <rae@lyx.org>
2708 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
2709 that the #ifdef's had been applied to part of what should have been
2710 a complete condition. It's possible there are other tests that
2711 were specific to tables that are also wrong now that InsetTabular is
2712 being used. Now we need to fix the output of '\n' after a table in a
2713 float for the same reason as the original condition:
2714 "don't insert this if we would be adding it before or after a table
2715 in a float. This little trick is needed in order to allow use of
2716 tables in \subfigures or \subtables."
2717 Juergen can you check this?
2719 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2721 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
2722 output to the ostream.
2724 * several files: fixed types based on warnings from cxx
2726 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
2728 * src/frontends/kde/Makefile.am: fix rule for
2729 formindexdialogdata_moc.C
2731 * src/.cvsignore: add ext_l10n.h to ignore
2733 * acconfig.h: stop messing with __STRICT_ANSI__
2734 * config/gnome.m4: remove option to set -ansi
2735 * config/kde.m4: remove option to set -ansi
2736 * config/lyxinclude.m4: don't set -ansi
2738 2000-09-27 Juergen Vigna <jug@sad.it>
2740 * various files: remove "default" language check.
2742 * src/insets/insetquotes.C: removed use of current_view.
2744 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
2745 the one should have red ears by now!
2747 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
2748 in more then one paragraph. Fixed cursor-movement/selection.
2750 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
2751 paragraphs inside a text inset.
2753 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
2754 text-inset if this owner is an inset.
2756 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2758 * src/Bullet.h: changed type of font, character and size to int
2760 * src/buffer.C (asciiParagraph): remove actcell and fname1.
2762 * src/insets/inseturl.[Ch]:
2763 * src/insets/insetref.[Ch]:
2764 * src/insets/insetlabel.[Ch]: add linelen to Ascii
2766 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
2768 * src/buffer.C (readFile): block-if statement rearranged to minimise
2769 bloat. Patch does not reverse Jean-Marc's change ;-)
2771 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
2772 Class rewritten to store pointers to hide/update signals directly,
2773 rather than Dialogs *. Also defined an enum to ease use. All xforms
2774 forms can now be derived from this class.
2776 * src/frontends/xforms/FormCommand.[Ch]
2777 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
2779 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
2782 * src/frontends/xforms/forms/form_citation.fd
2783 * src/frontends/xforms/forms/form_copyright.fd
2784 * src/frontends/xforms/forms/form_error.fd
2785 * src/frontends/xforms/forms/form_index.fd
2786 * src/frontends/xforms/forms/form_ref.fd
2787 * src/frontends/xforms/forms/form_toc.fd
2788 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
2790 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
2792 * src/insets/insetfoot.C: removed redundent using directive.
2794 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2796 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
2797 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
2799 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
2800 created in the constructors in different groups. Then set() just
2801 have to show the groups as needed. This fixes the redraw problems
2802 (and is how the old menu code worked).
2804 * src/support/lyxlib.h: declare the methods as static when we do
2805 not have namespaces.
2807 2000-09-26 Juergen Vigna <jug@sad.it>
2809 * src/buffer.C (asciiParagraph): new function.
2810 (writeFileAscii): new function with parameter ostream.
2811 (writeFileAscii): use now asciiParagraph.
2813 * various inset files: added the linelen parameter to the Ascii-func.
2815 * src/tabular.C (Write): fixed error in writing file introduced by
2816 the last changes from Lars.
2818 * lib/bind/menus.bind: removed not supported functions.
2820 * src/insets/insettext.C (Ascii): implemented this function.
2822 * src/insets/lyxinset.h (Ascii): added linelen parameter.
2824 * src/tabular.C (write_attribute[int,string,bool]): new functions.
2825 (Write): use of the write_attribute functions.
2827 * src/bufferlist.C (close): fixed reasking question!
2829 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2831 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
2832 new files use the everwhere possible.
2835 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
2836 src/log_form.C src/lyx.C:
2839 * src/buffer.C (runLaTeX): remove func
2841 * src/PaperLayout.C: removed file
2842 * src/ParagraphExtra.C: likewise
2843 * src/bullet_forms.C: likewise
2844 * src/bullet_forms.h: likewise
2845 * src/bullet_forms_cb.C: likewise
2847 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
2848 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
2851 * several files: remove all traces of the old fd_form_paragraph,
2852 and functions belonging to that.
2854 * several files: remove all traces of the old fd_form_document,
2855 and functions belonging to that.
2857 * several files: constify local variables were possible.
2859 * several files: remove all code that was dead when NEW_EXPORT was
2862 * several files: removed string::c_str in as many places as
2865 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
2866 (e): be a bit more outspoken when patching
2867 (updatesrc): only move files if changed.
2869 * forms/layout_forms.h.patch: regenerated
2871 * forms/layout_forms.fd: remove form_document and form_paragraph
2872 and form_quotes and form_paper and form_table_options and
2873 form_paragraph_extra
2875 * forms/form1.fd: remove form_table
2877 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
2878 the fdui->... rewrite. Update some comments to xforms 0.88
2880 * forms/bullet_forms.C.patch: removed file
2881 * forms/bullet_forms.fd: likewise
2882 * forms/bullet_forms.h.patch: likewise
2884 * development/Code_rules/Rules: added a section on switch
2885 statements. Updated some comment to xforms 0.88.
2887 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2889 * src/buffer.C (readFile): make sure that the whole version number
2890 is read after \lyxformat (even when it contains a comma)
2892 * lib/ui/default.ui: change shortcut of math menu to M-a.
2894 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2896 * src/vspace.C (nextToken): use isStrDbl() to check for proper
2899 * src/LyXView.C (updateWindowTitle): show the full files name in
2900 window title, limited to 30 characters.
2902 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
2903 When a number of characters has been given, we should not assume
2904 that the string is 0-terminated.
2906 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
2907 calls (fixes some memory leaks)
2909 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
2910 trans member on exit.
2912 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2914 * src/converter.C (GetReachable): fix typo.
2916 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
2917 understand ',' instead of '.'.
2918 (GetInteger): rewrite to use strToInt().
2920 2000-09-26 Juergen Vigna <jug@sad.it>
2922 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
2923 better visibility and error-message on wrong VSpace input.
2925 * src/language.C (initL): added english again.
2927 2000-09-25 Juergen Vigna <jug@sad.it>
2929 * src/frontends/kde/Dialogs.C (Dialogs):
2930 * src/frontends/gnome/Dialogs.C (Dialogs):
2931 * src/frontends/kde/Makefile.am:
2932 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
2934 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
2936 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
2938 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
2940 * src/frontends/xforms/FormParagraph.C:
2941 * src/frontends/xforms/FormParagraph.h:
2942 * src/frontends/xforms/form_paragraph.C:
2943 * src/frontends/xforms/form_paragraph.h:
2944 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
2947 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
2949 * src/tabular.C (OldFormatRead): forgot to delete the temporary
2950 Paragraph-Data after use.
2952 * src/insets/insettext.C (LocalDispatch): don't set the layout on
2953 non breakable paragraphs.
2955 2000-09-25 Garst R. Reese <reese@isn.net>
2957 * src/language.C (initL): added missing language_country codes.
2959 2000-09-25 Juergen Vigna <jug@sad.it>
2961 * src/insets/insettext.C (InsetText):
2962 (deleteLyXText): remove the not released LyXText structure!
2964 2000-09-24 Marko Vendelin <markov@ioc.ee>
2966 * src/frontends/gnome/mainapp.C
2967 * src/frontends/gnome/mainapp.h: added support for keyboard
2970 * src/frontends/gnome/FormCitation.C
2971 * src/frontends/gnome/FormCitation.h
2972 * src/frontends/gnome/Makefile.am
2973 * src/frontends/gnome/pixbutton.h: completed the rewrite of
2974 FormCitation to use "action area" in mainapp window
2976 * src/frontends/gnome/Menubar_pimpl.C
2977 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
2980 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
2982 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
2983 width/descent/ascent values if name is empty.
2984 (mathed_string_height): Use std::max.
2986 2000-09-25 Allan Rae <rae@lyx.org>
2988 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
2989 segfault. This will be completely redesigned soon.
2991 * sigc++: updated libsigc++. Fixes struct timespec bug.
2993 * development/tools/makeLyXsigc.sh: .cvsignore addition
2995 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
2997 * several files: removed almost all traces of the old table
3000 * src/TableLayout.C: removed file
3002 2000-09-22 Juergen Vigna <jug@sad.it>
3004 * src/frontends/kde/Dialogs.C: added credits forms.
3006 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
3008 * src/frontends/gnome/Dialogs.C: added some forms.
3010 * src/spellchecker.C (init_spell_checker): set language in pspell code
3011 (RunSpellChecker): some modifications for setting language string.
3013 * src/language.[Ch]: added language_country code.
3015 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
3017 * src/frontends/Dialogs.h: added new signal showError.
3018 Rearranged existing signals in some sort of alphabetical order.
3020 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
3021 FormError.[Ch], form_error.[Ch]
3022 * src/frontends/xforms/forms/makefile: added new file form_error.fd
3023 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
3025 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
3026 dialogs. I think that this can be used as the base to all these
3029 * src/frontends/xforms/FormError.[Ch]
3030 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
3031 implementation of InsetError dialog.
3033 * src/insets/inseterror.[Ch]: rendered GUI-independent.
3035 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
3036 * src/frontends/kde/Makefile.am: ditto
3038 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
3040 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
3041 macrobf. This fixes a bug of invisible text.
3043 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3045 * lib/doc/LaTeXConfig.lyx.in: updated.
3047 * src/language.C (initL): remove language "francais" and change a
3048 bit the names of the two other french variations.
3050 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
3051 string that may not be 0-terminated.
3053 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3055 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
3057 2000-09-20 Marko Vendelin <markov@ioc.ee>
3059 * src/frontends/gnome/FormCitation.C
3060 * src/frontends/gnome/FormIndex.C
3061 * src/frontends/gnome/FormToc.C
3062 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
3063 the variable initialization to shut up the warnings
3065 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3067 * src/table.[Ch]: deleted files
3069 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
3072 2000-09-18 Juergen Vigna <jug@sad.it>
3074 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
3075 problems with selection. Inserted new LFUN_PASTESELECTION.
3076 (InsetButtonPress): inserted handling of middle mouse-button paste.
3078 * src/spellchecker.C: changed word to word.c_str().
3080 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
3082 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
3083 included in the ``make dist'' tarball.
3085 2000-09-15 Juergen Vigna <jug@sad.it>
3087 * src/CutAndPaste.C (cutSelection): small fix return the right
3088 end position after cut inside one paragraph only.
3090 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
3091 we are locked as otherwise we don't have a valid cursor position!
3093 * src/insets/figinset.C (draw): small bugfix but why is this needed???
3095 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
3097 * src/frontends/kde/FormRef.C: added using directive.
3098 * src/frontends/kde/FormToc.C: ditto
3100 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
3102 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
3104 2000-09-19 Marko Vendelin <markov@ioc.ee>
3106 * src/frontends/gnome/Menubar_pimpl.C
3107 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
3108 Toc, ViewFormats, UpdateFormats, and ExportFormats.
3110 * src/frontends/gnome/mainapp.C
3111 * src/frontends/gnome/mainapp.h: support for menu update used
3114 * src/frontends/gnome/mainapp.C
3115 * src/frontends/gnome/mainapp.h: support for "action" area in the
3116 main window. This area is used by small simple dialogs, such as
3119 * src/frontends/gnome/FormIndex.C
3120 * src/frontends/gnome/FormIndex.h
3121 * src/frontends/gnome/FormUrl.C
3122 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
3125 * src/frontends/gnome/FormCitation.C
3126 * src/frontends/gnome/FormCitation.h: rewrite to use main window
3127 action area. Only "Insert new citation" is implemented.
3129 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3131 * src/buffer.C (Dispatch): fix call to Dispatch
3132 * src/insets/insetref.C (Edit): likewise
3133 * src/insets/insetparent.C (Edit): likewise
3134 * src/insets/insetinclude.C (include_cb): likewise
3135 * src/frontends/xforms/FormUrl.C (apply): likewise
3136 * src/frontends/xforms/FormToc.C (apply): likewise
3137 * src/frontends/xforms/FormRef.C (apply): likewise
3138 * src/frontends/xforms/FormIndex.C (apply): likewise
3139 * src/frontends/xforms/FormCitation.C (apply): likewise
3140 * src/lyxserver.C (callback): likewise
3141 * src/lyxfunc.C (processKeySym): likewise
3142 (Dispatch): likewise
3143 (Dispatch): likewise
3144 * src/lyx_cb.C (LayoutsCB): likewise
3146 * Makefile.am (sourcedoc): small change
3148 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3150 * src/main.C (main): Don't make an empty GUIRunTime object. all
3151 methods are static. constify a bit remove unneded using + headers.
3153 * src/tabular.C: some more const to local vars move some loop vars
3155 * src/spellchecker.C: added some c_str after some word for pspell
3157 * src/frontends/GUIRunTime.h: add new static method setDefaults
3158 * src/frontends/xforms/GUIRunTime.C (setDefaults):
3159 * src/frontends/kde/GUIRunTime.C (setDefaults):
3160 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
3162 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
3163 with strnew in arg, use correct emptystring when calling SetName.
3165 * several files: remove all commented code with relation to
3166 HAVE_SSTREAM beeing false. We now only support stringstream and
3169 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3171 * src/lyxfunc.C: construct correctly the automatic new file
3174 * src/text2.C (IsStringInText): change type of variable i to shut
3177 * src/support/sstream.h: do not use namespaces if the compiler
3178 does not support them.
3180 2000-09-15 Marko Vendelin <markov@ioc.ee>
3181 * src/frontends/gnome/FormCitation.C
3182 * src/frontends/gnome/FormCitation.h
3183 * src/frontends/gnome/diainsertcitation_interface.c
3184 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
3185 regexp support to FormCitation [Gnome].
3187 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
3190 * configure.in: remove unused KDE/GTKGUI define
3192 * src/frontends/kde/FormRef.C
3193 * src/frontends/kde/FormRef.h
3194 * src/frontends/kde/formrefdialog.C
3195 * src/frontends/kde/formrefdialog.h: double click will
3196 go to reference, now it is possible to change a cross-ref
3199 * src/frontends/kde/FormToc.C
3200 * src/frontends/kde/FormToc.h
3201 * src/frontends/kde/formtocdialog.C
3202 * src/frontends/kde/formtocdialog.h: add a depth
3205 * src/frontends/kde/Makefile.am: add QtLyXView.h
3208 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
3210 * src/frontends/kde/FormCitation.h: added some using directives.
3212 * src/frontends/kde/FormToc.h: corrected definition of doTree.
3214 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
3217 * src/mathed/math_defs.h: redefine SetAlign to use string rather
3220 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3222 * src/buffer.C (pop_tag): revert for the second time a change by
3223 Lars, who seems to really hate having non-local loop variables :)
3225 * src/Lsstream.h: add "using" statements.
3227 * src/support/copy.C (copy): add a bunch of std:: qualifiers
3228 * src/buffer.C (writeFile): ditto
3230 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3232 * src/buffer.C (writeFile): try to fix the locale modified format
3233 number to always be as we want it.
3235 * src/WorkArea.C (work_area_handler): try to workaround the bugs
3236 in XForms 0.89. C-space is now working again.
3238 * src/Lsstream.h src/support/sstream.h: new files.
3240 * also commented out all cases where strstream were used.
3242 * src/Bullet.h (c_str): remove method.
3244 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
3246 * a lot of files: get rid of "char const *" and "char *" is as
3247 many places as possible. We only want to use them in interaction
3248 with system of other libraries, not inside lyx.
3250 * a lot of files: return const object is not of pod type. This
3251 helps ensure that temporary objects is not modified. And fits well
3252 with "programming by contract".
3254 * configure.in: check for the locale header too
3256 * Makefile.am (sourcedoc): new tag for generation of doc++
3259 2000-09-14 Juergen Vigna <jug@sad.it>
3261 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
3262 callback to check which combo called it and do the right action.
3264 * src/combox.C (combo_cb): added combo * to the callbacks.
3265 (Hide): moved call of callback after Ungrab of the pointer.
3267 * src/intl.h: removed LCombo2 function.
3269 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
3270 function as this can now be handled in one function.
3272 * src/combox.h: added Combox * to callback prototype.
3274 * src/frontends/xforms/Toolbar_pimpl.C:
3275 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
3277 2000-09-14 Garst Reese <reese@isn.net>
3279 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
3280 moved usepackage{xxx}'s to beginning of file. Changed left margin
3281 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
3282 underlining from title. Thanks to John Culleton for useful suggestions.
3284 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3286 * src/lyxlex_pimpl.C (setFile): change error message to debug
3289 2000-09-13 Juergen Vigna <jug@sad.it>
3291 * src/frontends/xforms/FormDocument.C: implemented choice_class
3292 as combox and give callback to combo_language so OK/Apply is activated
3295 * src/bufferlist.C (newFile): small fix so already named files
3296 (via an open call) are not requested to be named again on the
3299 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3301 * src/frontends/kde/Makefile.am
3302 * src/frontends/kde/FormRef.C
3303 * src/frontends/kde/FormRef.h
3304 * src/frontends/kde/formrefdialog.C
3305 * src/frontends/kde/formrefdialog.h: implement
3308 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3310 * src/frontends/kde/formtocdialog.C
3311 * src/frontends/kde/formtocdialog.h
3312 * src/frontends/kde/FormToc.C
3313 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
3315 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
3317 * src/frontends/kde/FormCitation.C: fix thinko
3318 where we didn't always display the reference text
3321 * src/frontends/kde/formurldialog.C
3322 * src/frontends/kde/formurldialog.h
3323 * src/frontends/kde/FormUrl.C
3324 * src/frontends/kde/FormUrl.h: minor cleanups
3326 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
3328 * src/frontends/kde/Makefile.am
3329 * src/frontends/kde/FormToc.C
3330 * src/frontends/kde/FormToc.h
3331 * src/frontends/kde/FormCitation.C
3332 * src/frontends/kde/FormCitation.h
3333 * src/frontends/kde/FormIndex.C
3334 * src/frontends/kde/FormIndex.h
3335 * src/frontends/kde/formtocdialog.C
3336 * src/frontends/kde/formtocdialog.h
3337 * src/frontends/kde/formcitationdialog.C
3338 * src/frontends/kde/formcitationdialog.h
3339 * src/frontends/kde/formindexdialog.C
3340 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
3342 2000-09-12 Juergen Vigna <jug@sad.it>
3344 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
3347 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3349 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
3352 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
3354 * src/converter.C (Add, Convert): Added support for converter flags:
3355 needaux, resultdir, resultfile.
3356 (Convert): Added new parameter view_file.
3357 (dvips_options): Fixed letter paper option.
3359 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
3360 (Export, GetExportableFormats, GetViewableFormats): Added support
3363 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
3365 (easyParse): Fixed to work with new export code.
3367 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
3370 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
3372 * lib/bind/*.bind: Replaced
3373 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
3374 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
3376 2000-09-11 Juergen Vigna <jug@sad.it>
3378 * src/lyx_gui.C (runTime): uses global guiruntime variable.
3380 * src/main.C (main): now GUII defines global guiruntime!
3382 * src/frontends/gnome/GUIRunTime.C (initApplication):
3383 * src/frontends/kde/GUIRunTime.C (initApplication):
3384 * src/frontends/xforms/GUIRunTime.C (initApplication):
3385 * src/frontends/GUIRunTime.h: added new function initApplication.
3387 * src/spellchecker.C (sc_accept_word): change to add_to_session.
3389 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
3391 2000-09-08 Juergen Vigna <jug@sad.it>
3393 * src/lyx_gui.C (create_forms): don't display the "default" entry as
3394 we have already "Reset".
3396 * src/language.C (initL): inserted "default" language and made this
3397 THE default language (and not american!)
3399 * src/paragraph.C: inserted handling of "default" language!
3401 * src/lyxfont.C: ditto
3405 * src/paragraph.C: output the \\par only if we have a following
3406 paragraph otherwise it's not needed.
3408 2000-09-05 Juergen Vigna <jug@sad.it>
3410 * config/pspell.m4: added entry to lyx-flags
3412 * src/spellchecker.C: modified version from Kevin for using pspell
3414 2000-09-01 Marko Vendelin <markov@ioc.ee>
3415 * src/frontends/gnome/Makefile.am
3416 * src/frontends/gnome/FormCitation.C
3417 * src/frontends/gnome/FormCitation.h
3418 * src/frontends/gnome/diainsertcitation_callbacks.c
3419 * src/frontends/gnome/diainsertcitation_callbacks.h
3420 * src/frontends/gnome/diainsertcitation_interface.c
3421 * src/frontends/gnome/diainsertcitation_interface.h
3422 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
3423 dialog for Gnome frontend
3425 * src/main.C: Gnome libraries require keeping application name
3426 and its version as strings
3428 * src/frontends/gnome/mainapp.C: Change the name of the main window
3429 from GnomeLyX to PACKAGE
3431 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3433 * src/frontends/Liason.C: add "using: declaration.
3435 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
3437 * src/mathed/math_macro.C (Metrics): Set the size of the template
3439 * src/mathed/formulamacro.C (Latex): Fixed the returned value
3441 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
3443 * src/converter.C (add_options): New function.
3444 (SetViewer): Change $$FName into '$$FName'.
3445 (View): Add options when running xdvi
3446 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
3447 (Convert): The 3rd parameter is now the desired filename. Converts
3448 calls to lyx::rename if necessary.
3449 Add options when running dvips.
3450 (dvi_papersize,dvips_options): New methods.
3452 * src/exporter.C (Export): Use getLatexName() instead of fileName().
3454 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
3455 using a call to Converter::dvips_options.
3456 Fixed to work with nex export code.
3458 * src/support/copy.C
3459 * src/support/rename.C: New files
3461 * src/support/syscall.h
3462 * src/support/syscall.C: Added Starttype SystemDontWait.
3464 * lib/ui/default.ui: Changed to work with new export code
3466 * lib/configure.m4: Changed to work with new export code
3468 * src/encoding.C: Changed latex name for iso8859_7 encoding.
3470 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
3472 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
3473 so that code compiles with DEC cxx.
3475 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
3476 to work correctly! Also now supports the additional elements
3479 2000-09-01 Allan Rae <rae@lyx.org>
3481 * src/frontends/ButtonPolicies.C: renamed all the references to
3482 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
3484 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
3485 since it's a const not a type.
3487 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
3489 2000-08-31 Juergen Vigna <jug@sad.it>
3491 * src/insets/figinset.C: Various changes to look if the filename has
3492 an extension and if not add it for inline previewing.
3494 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3496 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
3497 make buttonStatus and isReadOnly be const methods. (also reflect
3498 this in derived classes.)
3500 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
3501 (nextState): change to be static inline, pass the StateMachine as
3503 (PreferencesPolicy): remove casts
3504 (OkCancelPolicy): remvoe casts
3505 (OkCancelReadOnlyPolicy): remove casts
3506 (NoRepeatedApplyReadOnlyPolicy): remove casts
3507 (OkApplyCancelReadOnlyPolicy): remove casts
3508 (OkApplyCancelPolicy): remove casts
3509 (NoRepeatedApplyPolicy): remove casts
3511 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
3513 * src/converter.C: added some using directives
3515 * src/frontends/ButtonPolicies.C: changes to overcome
3516 "need lvalue" error with DEC c++
3518 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
3519 to WMHideCB for DEC c++
3521 * src/frontends/xforms/Menubar_pimpl.C: added using directive
3523 * src/frontends/xforms/forms/form_document.C.patch: use C callback
3524 to BulletBMTableCB for DEC c++
3526 2000-08-31 Allan Rae <rae@lyx.org>
3528 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
3529 character dialog separately from old document dialogs combo_language.
3532 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3534 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
3535 Removed LFUN_REF_CREATE.
3537 * src/MenuBackend.C: Added new tags: toc and references
3539 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
3540 (add_lastfiles, add_documents, add_formats): Removed the unused smn
3542 (add_toc, add_references): New methods.
3543 (create_submenu): Handle correctly the case when there is a
3544 seperator after optional menu items.
3546 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
3547 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
3548 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
3550 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
3552 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3554 * src/converter.[Ch]: New file for converting between different
3557 * src/export.[Ch]: New file for exporting a LyX file to different
3560 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
3561 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
3562 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
3563 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
3564 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
3565 RunDocBook, MenuExport.
3567 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
3568 Exporter::Preview methods if NEW_EXPORT is defined.
3570 * src/buffer.C (Dispatch): Use Exporter::Export.
3572 * src/lyxrc.C: Added new tags: \converter and \viewer.
3575 * src/LyXAction.C: Define new lyx-function: buffer-update.
3576 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
3577 when NEW_EXPORT is defined.
3579 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
3581 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
3583 * lib/ui/default.ui: Added submenus "view" and "update" to the
3586 * src/filetools.C (GetExtension): New function.
3588 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
3590 2000-08-29 Allan Rae <rae@lyx.org>
3592 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
3594 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
3595 (EnableDocumentLayout): removed
3596 (DisableDocumentLayout): removed
3597 (build): make use of ButtonController's read-only handling to
3598 de/activate various objects. Replaces both of the above functions.
3600 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
3601 (readOnly): was read_only
3602 (refresh): fixed dumb mistakes with read_only_ handling
3604 * src/frontends/xforms/forms/form_document.fd:
3605 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
3606 tabbed dialogs so the tabs look more like tabs and so its easier to
3607 work out which is the current tab.
3609 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
3610 segfault with form_table
3612 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
3614 2000-08-28 Juergen Vigna <jug@sad.it>
3616 * acconfig.h: added USE_PSPELL.
3618 * src/config.h.in: added USE_PSPELL.
3620 * autogen.sh: added pspell.m4
3622 * config/pspell.m4: new file.
3624 * src/spellchecker.C: implemented support for pspell libary.
3626 2000-08-25 Juergen Vigna <jug@sad.it>
3628 * src/LyXAction.C (init): renamed LFUN_TABLE to
3629 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
3631 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
3633 * src/lyxscreen.h: add force_clear variable and fuction to force
3634 a clear area when redrawing in LyXText.
3636 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
3638 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3640 * some whitespace and comment changes.
3642 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
3644 * src/buffer.C: up te LYX_FORMAT to 2.17
3646 2000-08-23 Juergen Vigna <jug@sad.it>
3648 * src/BufferView_pimpl.C (tripleClick): disable this when in a
3651 * src/insets/insettabular.C (pasteSelection): delete the insets
3652 LyXText as it is not valid anymore.
3653 (copySelection): new function.
3654 (pasteSelection): new function.
3655 (cutSelection): new function.
3656 (LocalDispatch): implemented cut/copy/paste of cell selections.
3658 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
3659 don't have a LyXText.
3661 * src/LyXAction.C (init): a NEW_TABULAR define too much.
3663 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
3666 2000-08-22 Juergen Vigna <jug@sad.it>
3668 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
3669 ifdef form_table out if NEW_TABULAR.
3671 2000-08-21 Juergen Vigna <jug@sad.it>
3673 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
3674 (draw): fixed draw position so that the cursor is positioned in the
3676 (InsetMotionNotify): hide/show cursor so the position is updated.
3677 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
3678 using cellstart() function where it should be used.
3680 * src/insets/insettext.C (draw): ditto.
3682 * src/tabular.C: fixed initialization of some missing variables and
3683 made BoxType into an enum.
3685 2000-08-22 Marko Vendelin <markov@ioc.ee>
3686 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
3687 stock menu item using action numerical value, not its string
3691 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3693 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
3694 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
3696 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
3698 * src/frontends/xforms/GUIRunTime.C: new file
3700 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
3701 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3703 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
3705 * src/frontends/kde/GUIRunTime.C: new file
3707 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
3708 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3710 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
3712 * src/frontends/gnome/GUIRunTime.C: new file
3714 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
3717 * src/frontends/GUIRunTime.h: removed constructor and destructor,
3718 small change to documetentation.
3720 * src/frontends/GUIRunTime.C: removed file
3722 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
3724 * src/lyxparagraph.h: enable NEW_TABULAR as default
3726 * src/lyxfunc.C (processKeySym): remove some commented code
3728 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
3729 NEW_TABULAR around the fd_form_table_options.
3731 * src/lyx_gui.C (runTime): call the static member function as
3732 GUIRunTime::runTime().
3734 2000-08-21 Allan Rae <rae@lyx.org>
3736 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
3739 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
3741 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
3743 2000-08-21 Allan Rae <rae@lyx.org>
3745 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
3746 keep Garst happy ;-)
3747 * src/frontends/xforms/FormPreferences.C (build): use setOK
3748 * src/frontends/xforms/FormDocument.C (build): use setOK
3749 (FormDocument): use the appropriate policy.
3751 2000-08-21 Allan Rae <rae@lyx.org>
3753 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
3754 automatic [de]activation of arbitrary objects when in a read-only state.
3756 * src/frontends/ButtonPolicies.h: More documentation
3757 (isReadOnly): added to support the above.
3759 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
3761 2000-08-18 Juergen Vigna <jug@sad.it>
3763 * src/insets/insettabular.C (getStatus): changed to return func_status.
3765 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
3766 display toggle menu entries if they are.
3768 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
3769 new document layout now.
3771 * src/lyxfunc.C: ditto
3773 * src/lyx_gui_misc.C: ditto
3775 * src/lyx_gui.C: ditto
3777 * lib/ui/default.ui: removed paper and quotes layout as they are now
3778 all in the document layout tabbed folder.
3780 * src/frontends/xforms/forms/form_document.fd: added Restore
3781 button and callbacks for all inputs for Allan's ButtonPolicy.
3783 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
3784 (CheckChoiceClass): added missing params setting on class change.
3785 (UpdateLayoutDocument): added for updating the layout on params.
3786 (build): forgot to RETURN_ALWAYS input_doc_spacing.
3787 (FormDocument): Implemented Allan's ButtonPolicy with the
3790 2000-08-17 Allan Rae <rae@lyx.org>
3792 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
3793 so we can at least see the credits again.
3795 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
3796 controller calls for the appropriate callbacks. Note that since Ok
3797 calls apply followed by cancel, and apply isn't a valid input for the
3798 APPLIED state, the bc_ calls have to be made in the static callback not
3799 within each of the real callbacks.
3801 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
3802 (setOk): renamed from setOkay()
3804 2000-08-17 Juergen Vigna <jug@sad.it>
3806 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
3807 in the implementation part.
3808 (composeUIInfo): don't show optional menu-items.
3810 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
3812 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
3814 * src/bufferview_funcs.C (CurrentState): fixed to show also the
3815 text-state when in a text-inset.
3817 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
3819 2000-08-17 Marko Vendelin <markov@ioc.ee>
3820 * src/frontends/gnome/FormIndex.C
3821 * src/frontends/gnome/FormIndex.h
3822 * src/frontends/gnome/FormToc.C
3823 * src/frontends/gnome/FormToc.h
3824 * src/frontends/gnome/dialogs
3825 * src/frontends/gnome/diatoc_callbacks.c
3826 * src/frontends/gnome/diatoc_callbacks.h
3827 * src/frontends/gnome/diainsertindex_callbacks.h
3828 * src/frontends/gnome/diainsertindex_callbacks.c
3829 * src/frontends/gnome/diainsertindex_interface.c
3830 * src/frontends/gnome/diainsertindex_interface.h
3831 * src/frontends/gnome/diatoc_interface.h
3832 * src/frontends/gnome/diatoc_interface.c
3833 * src/frontends/gnome/Makefile.am: Table of Contents and
3834 Insert Index dialogs implementation for Gnome frontend
3836 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
3838 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
3840 * src/frontends/gnome/diainserturl_interface.c: make the dialog
3843 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3845 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
3846 destructor. Don't definde if you don't need it
3847 (processEvents): made static, non-blocking events processing for
3849 (runTime): static method. event loop for xforms
3850 * similar as above for kde and gnome.
3852 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
3853 new Pimpl is correct
3854 (runTime): new method calss the real frontends runtime func.
3856 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
3858 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3860 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
3862 2000-08-16 Juergen Vigna <jug@sad.it>
3864 * src/lyx_gui.C (runTime): added GUII RunTime support.
3866 * src/frontends/Makefile.am:
3867 * src/frontends/GUIRunTime.[Ch]:
3868 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
3869 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
3870 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
3872 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
3874 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
3875 as this is already set in ${FRONTEND_INCLUDE} if needed.
3877 * configure.in (CPPFLAGS): setting the include dir for the frontend
3878 directory and don't set FRONTEND=xforms for now as this is executed
3881 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
3883 * src/frontends/kde/Makefile.am:
3884 * src/frontends/kde/FormUrl.C:
3885 * src/frontends/kde/FormUrl.h:
3886 * src/frontends/kde/formurldialog.h:
3887 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
3889 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
3891 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
3893 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3895 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
3898 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
3900 * src/WorkArea.C (work_area_handler): more work to get te
3901 FL_KEYBOARD to work with xforms 0.88 too, please test.
3903 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
3905 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
3907 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
3910 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3912 * src/Timeout.h: remove Qt::emit hack.
3914 * several files: changes to allo doc++ compilation
3916 * src/lyxfunc.C (processKeySym): new method
3917 (processKeyEvent): comment out if FL_REVISION < 89
3919 * src/WorkArea.C: change some debugging levels.
3920 (WorkArea): set wantkey to FL_KEY_ALL
3921 (work_area_handler): enable the FL_KEYBOARD clause, this enables
3922 clearer code and the use of compose with XForms 0.89. Change to
3923 use signals instead of calling methods in bufferview directly.
3925 * src/Painter.C: change some debugging levels.
3927 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
3930 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
3931 (workAreaKeyPress): new method
3933 2000-08-14 Juergen Vigna <jug@sad.it>
3935 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
3937 * config/kde.m4: addes some features
3939 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
3940 include missing xforms dialogs.
3942 * src/Timeout.h: a hack to be able to compile with qt/kde.
3944 * sigc++/.cvsignore: added acinclude.m4
3946 * lib/.cvsignore: added listerros
3948 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
3949 xforms tree as objects are needed for other frontends.
3951 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
3952 linking with not yet implemented xforms objects.
3954 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
3956 2000-08-14 Baruch Even <baruch.even@writeme.com>
3958 * src/frontends/xforms/FormGraphics.h:
3959 * src/frontends/xforms/FormGraphics.C:
3960 * src/frontends/xforms/RadioButtonGroup.h:
3961 * src/frontends/xforms/RadioButtonGroup.C:
3962 * src/insets/insetgraphics.h:
3963 * src/insets/insetgraphics.C:
3964 * src/insets/insetgraphicsParams.h:
3965 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
3966 instead of spaces, and various other indentation issues to make the
3967 sources more consistent.
3969 2000-08-14 Marko Vendelin <markov@ioc.ee>
3971 * src/frontends/gnome/dialogs/diaprint.glade
3972 * src/frontends/gnome/FormPrint.C
3973 * src/frontends/gnome/FormPrint.h
3974 * src/frontends/gnome/diaprint_callbacks.c
3975 * src/frontends/gnome/diaprint_callbacks.h
3976 * src/frontends/gnome/diaprint_interface.c
3977 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
3980 * src/frontends/gnome/dialogs/diainserturl.glade
3981 * src/frontends/gnome/FormUrl.C
3982 * src/frontends/gnome/FormUrl.h
3983 * src/frontends/gnome/diainserturl_callbacks.c
3984 * src/frontends/gnome/diainserturl_callbacks.h
3985 * src/frontends/gnome/diainserturl_interface.c
3986 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
3987 Gnome implementation
3989 * src/frontends/gnome/Dialogs.C
3990 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
3991 all other dialogs. Copy all unimplemented dialogs from Xforms
3994 * src/frontends/gnome/support.c
3995 * src/frontends/gnome/support.h: support files generated by Glade
3999 * config/gnome.m4: Gnome configuration scripts
4001 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4002 configure --help message
4004 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
4005 only if there are no events pendling in Gnome/Gtk. This enhances
4006 the performance of menus.
4009 2000-08-14 Allan Rae <rae@lyx.org>
4011 * lib/Makefile.am: listerrors cleaning
4013 * lib/listerrors: removed -- generated file
4014 * acinclude.m4: ditto
4015 * sigc++/acinclude.m4: ditto
4017 * src/frontends/xforms/forms/form_citation.fd:
4018 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
4021 * src/frontends/xforms/forms/makefile: I renamed the `install` target
4022 `updatesrc` and now we have a `test` target that does what `updatesrc`
4023 used to do. I didn't like having an install target that wasn't related
4026 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
4027 on all except FormGraphics. This may yet happen. Followed by a major
4028 cleanup including using FL_TRANSIENT for most of the dialogs. More
4029 changes to come when the ButtonController below is introduced.
4031 * src/frontends/xforms/ButtonController.h: New file for managing up to
4032 four buttons on a dialog according to an externally defined policy.
4033 * src/frontends/xforms/Makefile.am: added above
4035 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
4036 Apply and Cancel/Close buttons and everything in between and beyond.
4037 * src/frontends/Makefile.am: added above.
4039 * src/frontends/xforms/forms/form_preferences.fd:
4040 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
4041 and removed variable 'status' as a result. Fixed the set_minsize thing.
4042 Use the new screen-font-update after checking screen fonts were changed
4043 Added a "Restore" button to restore the original lyxrc values while
4044 editing. This restores everything not just the last input changed.
4045 That's still a tricky one. As is the "LyX: this shouldn't happen..."
4047 * src/LyXAction.C: screen-font-update added for updating buffers after
4048 screen font settings have been changed.
4049 * src/commandtags.h: ditto
4050 * src/lyxfunc.C: ditto
4052 * forms/lyx.fd: removed screen fonts dialog.
4053 * src/lyx_gui.C: ditto
4054 * src/menus.[Ch]: ditto
4055 * src/lyx.[Ch]: ditto
4056 * src/lyx_cb.C: ditto + code from here moved to make
4057 screen-font-update. And people wonder why progress on GUII is
4058 slow. Look at how scattered this stuff was! It takes forever
4061 * forms/fdfix.sh: Fixup the spacing after commas.
4062 * forms/makefile: Remove date from generated files. Fewer clashes now.
4063 * forms/bullet_forms.C.patch: included someones handwritten changes
4065 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
4066 once I've discovered why LyXRC was made noncopyable.
4067 * src/lyx_main.C: ditto
4069 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
4071 * src/frontends/xforms/forms/fdfix.sh:
4072 * src/frontends/xforms/forms/fdfixh.sed:
4073 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
4074 * src/frontends/xforms/Form*.[hC]:
4075 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
4076 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
4077 provide a destructor for the struct FD_form_xxxx. Another version of
4078 the set_[max|min]size workaround and a few other cleanups. Actually,
4079 Angus' patch from 20000809.
4081 2000-08-13 Baruch Even <baruch.even@writeme.com>
4083 * src/insets/insetgraphics.C (Clone): Added several fields that needed
4086 2000-08-11 Juergen Vigna <jug@sad.it>
4088 * src/insets/insetgraphics.C (InsetGraphics): changing init
4089 order because of warnings.
4091 * src/frontends/xforms/forms/makefile: adding patching .C with
4094 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
4095 from .C.patch to .c.patch
4097 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
4098 order because of warning.
4100 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
4102 * src/frontends/Liason.C (setMinibuffer): new helper function
4104 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
4106 * src/lyxfunc.C (Dispatch): calling new Document-Layout
4108 * lib/ui/default.ui: commented out PaperLayout entry
4110 * src/frontends/xforms/form_document.[Ch]: new added files
4112 * src/frontends/xforms/FormDocument.[Ch]: ditto
4114 * src/frontends/xforms/forms/form_document.fd: ditto
4116 * src/frontends/xforms/forms/form_document.C.patch: ditto
4118 2000-08-10 Juergen Vigna <jug@sad.it>
4120 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
4121 (InsetGraphics): initialized cacheHandle to 0.
4122 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
4124 2000-08-10 Baruch Even <baruch.even@writeme.com>
4126 * src/graphics/GraphicsCache.h:
4127 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
4128 correctly as a cache.
4130 * src/graphics/GraphicsCacheItem.h:
4131 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
4134 * src/graphics/GraphicsCacheItem_pimpl.h:
4135 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
4138 * src/insets/insetgraphics.h:
4139 * src/insets/insetgraphics.C: Changed from using a signal notification
4140 to polling when image is not loaded.
4142 2000-08-10 Allan Rae <rae@lyx.org>
4144 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
4145 that there are two functions that have to been taken out of line by
4146 hand and aren't taken care of in the script. (Just a reminder note)
4148 * sigc++/macros/*.h.m4: Updated as above.
4150 2000-08-09 Juergen Vigna <jug@sad.it>
4152 * src/insets/insettext.C (draw): small fix for clearing rectangle.
4154 * src/insets/insettabular.C: make drawing of single cell smarter.
4156 2000-08-09 Marko Vendelin <markov@ioc.ee>
4157 * src/frontends/gnome/Menubar_pimpl.C
4158 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
4159 implementation: new files
4161 * src/frontends/gnome/mainapp.C
4162 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
4165 * src/main.C: create Gnome main window
4167 * src/frontends/xforms/Menubar_pimpl.h
4168 * src/frontends/Menubar.C
4169 * src/frontends/Menubar.h: added method Menubar::update that calls
4170 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
4172 * src/LyXView.C: calls Menubar::update to update the state
4175 * src/frontends/gnome/Makefile.am: added new files
4177 * src/frontends/Makefile.am: added frontend compiler options
4179 2000-08-08 Juergen Vigna <jug@sad.it>
4181 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
4183 * src/bufferlist.C (close):
4184 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
4185 documents if exiting without saving.
4187 * src/buffer.C (save): use removeAutosaveFile()
4189 * src/support/filetools.C (removeAutosaveFile): new function.
4191 * src/lyx_cb.C (MenuWrite): returns a bool now.
4192 (MenuWriteAs): check if file could really be saved and revert to the
4194 (MenuWriteAs): removing old autosavefile if existant.
4196 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
4197 before Goto toggle declaration, because of compiler warning.
4199 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
4201 * src/lyxfunc.C (MenuNew): small fix.
4203 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
4205 * src/bufferlist.C (newFile):
4206 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
4208 * src/lyxrc.C: added new_ask_filename tag
4210 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
4212 * src/lyx.fd: removed code pertaining to form_ref
4213 * src/lyx.[Ch]: ditto
4214 * src/lyx_cb.C: ditto
4215 * src/lyx_gui.C: ditto
4216 * src/lyx_gui_misc.C: ditto
4218 * src/BufferView_pimpl.C (restorePosition): update buffer only
4221 * src/commandtags.h (LFUN_REFTOGGLE): removed
4222 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
4223 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
4224 (LFUN_REFBACK): renamed LFUN_REF_BACK
4226 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
4227 * src/menus.C: ditto
4228 * src/lyxfunc.C (Dispatch): ditto.
4229 InsertRef dialog is now GUI-independent.
4231 * src/texrow.C: added using std::endl;
4233 * src/insets/insetref.[Ch]: strip out large amounts of code.
4234 The inset is now a container and this functionality is now
4235 managed by a new FormRef dialog
4237 * src/frontends/Dialogs.h (showRef, createRef): new signals
4239 * src/frontends/xforms/FormIndex.[Ch],
4240 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
4241 when setting dialog's min/max size
4242 * src/frontends/xforms/FormIndex.[Ch]: ditto
4244 * src/frontends/xforms/FormRef.[Ch],
4245 src/frontends/xforms/forms/form_ref.fd: new xforms
4246 implementation of an InsetRef dialog
4248 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
4251 * src/graphics/XPM_Renderer.C (isImageFormatOK):
4252 ios::nocreate is not part of the standard. Removed.
4254 2000-08-07 Baruch Even <baruch.even@writeme.com>
4256 * src/graphics/Renderer.h:
4257 * src/graphics/Renderer.C: Added base class for rendering of different
4258 image formats into Pixmaps.
4260 * src/graphics/XPM_Renderer.h:
4261 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
4262 in a different class.
4264 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
4265 easily add support for other formats.
4267 * src/insets/figinset.C: plugged a leak of an X resource.
4269 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
4271 * src/CutAndPaste.[Ch]: make all metods static.
4273 * development/Code_rules/Rules: more work, added section on
4274 Exceptions, and a References section.
4276 * a lot of header files: work to make doc++ able to generate the
4277 source documentation, some workarounds of doc++ problems. Doc++ is
4278 now able to generate the documentation.
4280 2000-08-07 Juergen Vigna <jug@sad.it>
4282 * src/insets/insettabular.C (recomputeTextInsets): removed function
4284 * src/tabular.C (SetWidthOfMulticolCell):
4286 (calculate_width_of_column_NMC): fixed return value so that it really
4287 only returns true if the column-width has changed (there where
4288 problems with muliticolumn-cells in this column).
4290 2000-08-04 Juergen Vigna <jug@sad.it>
4292 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
4293 also on the scrollstatus of the inset.
4294 (workAreaMotionNotify): ditto.
4296 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
4298 2000-08-01 Juergen Vigna <jug@sad.it>
4300 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
4302 * src/commandtags.h:
4303 * src/LyXAction.C (init):
4304 * src/insets/inset.C (LocalDispatch): added support for
4307 * src/insets/inset.C (scroll): new functions.
4309 * src/insets/insettext.C (removeNewlines): new function.
4310 (SetAutoBreakRows): removes forced newlines in the text of the
4311 paragraph if autoBreakRows is set to false.
4313 * src/tabular.C (Latex): generates a parbox around the cell contents
4316 * src/frontends/xforms/FormTabular.C (local_update): removed
4317 the radio_useparbox button.
4319 * src/tabular.C (UseParbox): new function
4321 2000-08-06 Baruch Even <baruch.even@writeme.com>
4323 * src/graphics/GraphicsCache.h:
4324 * src/graphics/GraphicsCache.C:
4325 * src/graphics/GraphicsCacheItem.h:
4326 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
4329 * src/insets/insetgraphics.h:
4330 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
4331 and the drawing of the inline image.
4333 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
4334 loaded into the wrong position.
4336 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
4339 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4341 * src/support/translator.h: move all typedefs to public section
4343 * src/support/filetools.C (MakeLatexName): return string const
4345 (TmpFileName): ditto
4346 (FileOpenSearch): ditto
4348 (LibFileSearch): ditto
4349 (i18nLibFileSearch): ditto
4352 (CreateTmpDir): ditto
4353 (CreateBufferTmpDir): ditto
4354 (CreateLyXTmpDir): ditto
4357 (MakeAbsPath): ditto
4359 (OnlyFilename): ditto
4361 (NormalizePath): ditto
4362 (CleanupPath): ditto
4363 (GetFileContents): ditto
4364 (ReplaceEnvironmentPath): ditto
4365 (MakeRelPath): ditto
4367 (ChangeExtension): ditto
4368 (MakeDisplayPath): ditto
4369 (do_popen): return cmdret const
4370 (findtexfile): return string const
4372 * src/support/DebugStream.h: add some /// to please doc++
4374 * src/frontends/DialogBase.h (endif): add some /// to please doc++
4376 * src/texrow.C (same_rownumber): functor to use with find_if
4377 (getIdFromRow): rewritten to use find_if and to not update the
4378 positions. return true if row is found
4379 (increasePos): new method, use to update positions
4381 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
4383 * src/lyxlex_pimpl.C (verifyTable): new method
4386 (GetString): return string const
4387 (pushTable): rewrite to use std::stack
4389 (setFile): better check
4392 * src/lyxlex.h: make LyXLex noncopyable
4394 * src/lyxlex.C (text): return char const * const
4395 (GetString): return string const
4396 (getLongString): return string const
4398 * src/lyx_gui_misc.C (askForText): return pair<...> const
4400 * src/lastfiles.[Ch] (operator): return string const
4402 * src/buffer.C (parseSingleLyXformat2Token): pass string to
4403 istringstream not char const *.
4404 move token.end() out of loop.
4405 (readFile): move initializaton of token
4407 * src/BufferView2.C (insertErrors): run texrow.increasePos if
4408 getIdFromRow is successful.
4410 * lib/bind/emacs.bind: don't include menus bind
4412 * development/Code_rules/Rules: the beginnings of making this
4413 better and covering more of the unwritten rules that we have.
4415 * development/Code_rules/Recommendations: a couple of wording
4418 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4420 * src/support/strerror.c: remove C++ comment.
4422 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
4424 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
4425 LFUN_INDEX_INSERT_LAST
4427 * src/texrow.C (getIdFromRow): changed from const_iterator to
4428 iterator, allowing code to compile with DEC cxx
4430 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
4431 stores part of the class, as suggested by Allan. Will allow
4433 (apply): test to apply uses InsetCommandParams operator!=
4435 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
4436 (apply): test to apply uses InsetCommandParams operator!=
4438 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
4439 stores part of the class.
4440 (update): removed limits on min/max size.
4442 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
4443 (apply): test to apply uses InsetCommandParams operator!=
4445 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
4446 (Read, Write, scanCommand, getCommand): moved functionality
4447 into InsetCommandParams.
4449 (getScreenLabel): made pure virtual
4450 new InsetCommandParams operators== and !=
4452 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
4453 c-tors based on InsetCommandParams. Removed others.
4454 * src/insets/insetinclude.[Ch]: ditto
4455 * src/insets/insetlabel.[Ch]: ditto
4456 * src/insets/insetparent.[Ch]: ditto
4457 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
4459 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
4460 insets derived from InsetCommand created using similar c-tors
4461 based on InsetCommandParams
4462 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
4463 * src/menus.C (ShowRefsMenu): ditto
4464 * src/paragraph.C (Clone): ditto
4465 * src/text2.C (SetCounter): ditto
4466 * src/lyxfunc.C (Dispatch) ditto
4467 Also recreated old InsetIndex behaviour exactly. Can now
4468 index-insert at the start of a paragraph and index-insert-last
4469 without launching the pop-up.
4471 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4473 * lib/lyxrc.example: mark te pdf options as non functional.
4475 * src/support/lstrings.C (strToInt): move initalization of tmpstr
4476 (isStrDbl): move tmpstr.end() out of loop.
4477 (strToDbl): move intialization of tmpstr
4478 (lowercase): return string const and move tmp.end() out of loop.
4479 (uppercase): return string const and move tmp.edn() out of loop.
4480 (prefixIs): add assertion
4485 (containsOnly): ditto
4486 (containsOnly): ditto
4487 (containsOnly): ditto
4488 (countChar): make last arg char not char const
4489 (token): return string const
4490 (subst): return string const, move tmp.end() out of loop.
4491 (subst): return string const, add assertion
4492 (strip): return string const
4493 (frontStrip): return string const, add assertion
4494 (frontStrip): return string const
4499 * src/support/lstrings.C: add inclde "LAssert.h"
4500 (isStrInt): move tmpstr.end() out of loop.
4502 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
4503 toollist.end() out of loop.
4504 (deactivate): move toollist.end() out of loop.
4505 (update): move toollist.end() out of loop.
4506 (updateLayoutList): move tc.end() out of loop.
4507 (add): move toollist.end() out of loop.
4509 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
4510 md.end() out of loop.
4512 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
4514 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
4517 * src/paragraph.C (Erase): move fontlist.end() out of loop.
4518 (Erase): move insetlist.end() out of loop.
4520 * src/lyx_sendfax_main.C: make show_logfile static and to take a
4521 ref to const string as first arg. Move initialization of some
4522 variables, whitespace changes.
4524 * src/kbmap.C (defkey): move table.end() out of loop.
4525 (kb_keymap): move table.end() out of loop.
4526 (findbinding): move table.end() out of loop.
4528 * src/MenuBackend.C (hasMenu): move end() out of loop.
4529 (getMenu): move end() out of loop.
4530 (getMenu): move menulist_.end() out of loop.
4532 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
4534 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
4537 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
4538 (getFromLyXName): move infotab.end() out of loop.
4540 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
4541 -fvtable-thunks -ffunction-sections -fdata-sections
4543 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
4545 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
4548 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4550 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
4552 * src/frontends/xforms/FormCitation.[Ch],
4553 src/frontends/xforms/FormIndex.[Ch],
4554 src/frontends/xforms/FormToc.[Ch],
4555 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
4557 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4559 * src/commandtags.h: renamed, created some flags for citation
4562 * src/lyx_gui_misc.C: stripped out old FD_index_form code
4564 * src/lyxfunc.C (dispatch): use signals to insert index entry
4566 * src/frontends/Dialogs.h: new signal createIndex
4568 * src/frontends/xforms/FormCommand.[Ch],
4569 src/frontends/xforms/FormCitation.[Ch],
4570 src/frontends/xforms/FormToc.[Ch],
4571 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
4573 * src/insets/insetindex.[Ch]: GUI-independent
4575 * src/frontends/xforms/FormIndex.[Ch],
4576 * src/frontends/xforms/forms/form_index.fd: xforms implementation
4579 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
4581 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
4582 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
4584 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4586 * src/insets/insetref.C (Latex): rewrite so that there is now
4587 question that a initialization is requested.
4589 * src/insets/insetcommand.h: reenable the hide signal
4591 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4593 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
4594 fix handling of shortcuts (many bugs :)
4595 (add_lastfiles): ditto.
4597 * lib/ui/default.ui: fix a few shortcuts.
4599 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
4601 * Makefile.am: Fix ``rpmdist'' target to return the exit
4602 status of the ``rpm'' command, instead of the last command in
4603 the chain (the ``rm lyx.xpm'' command, which always returns
4606 2000-08-02 Allan Rae <rae@lyx.org>
4608 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
4609 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
4610 * src/frontends/xforms/FormToc.C (FormToc): ditto
4612 * src/frontends/xforms/Makefile.am: A few forgotten files
4614 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
4615 Signals-not-copyable-problem Lars' started commenting out.
4617 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
4619 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4621 * src/insets/insetcommand.h: Signals is not copyable so anoter
4622 scheme for automatic hiding of forms must be used.
4624 * src/frontends/xforms/FormCitation.h: don't inerit from
4625 noncopyable, FormCommand already does that.
4626 * src/frontends/xforms/FormToc.h: ditto
4627 * src/frontends/xforms/FormUrl.h: ditto
4629 * src/frontends/xforms/FormCitation.C: add include <algorithm>
4631 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
4633 * src/insets/insetcommand.h (hide): new SigC::Signal0
4634 (d-tor) new virtual destructor emits hide signal
4636 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
4637 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
4639 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
4640 LOF and LOT. Inset is now GUI-independent
4642 * src/insets/insetloa.[Ch]: redundant
4643 * src/insets/insetlof.[Ch]: ditto
4644 * src/insets/insetlot.[Ch]: ditto
4646 * src/frontends/xforms/forms/form_url.fd: tweaked!
4647 * src/frontends/xforms/forms/form_citation.fd: ditto
4649 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
4650 dialogs dealing with InsetCommand insets
4652 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
4653 FormCommand base class
4654 * src/frontends/xforms/FormUrl.[Ch]: ditto
4656 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
4658 * src/frontends/xforms/FormToc.[Ch]: ditto
4660 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
4661 passed a generic InsetCommand pointer
4662 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
4664 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
4665 and modified InsetTOC class
4666 * src/buffer.C: ditto
4668 * forms/lyx.fd: strip out old FD_form_toc code
4669 * src/lyx_gui_misc.C: ditto
4670 * src/lyx_gui.C: ditto
4671 * src/lyx_cb.C: ditto
4672 * src/lyx.[Ch]: ditto
4674 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4676 * src/support/utility.hpp: tr -d '\r'
4678 2000-08-01 Juergen Vigna <jug@sad.it>
4680 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
4682 * src/commandtags.h:
4683 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
4684 LFUN_TABULAR_FEATURES.
4686 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
4687 LFUN_LAYOUT_TABULAR.
4689 * src/insets/insettabular.C (getStatus): implemented helper function.
4691 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
4693 2000-07-31 Juergen Vigna <jug@sad.it>
4695 * src/text.C (draw): fixed screen update problem for text-insets.
4697 * src/text2.C (SetParagrpah): call an update of the inset-owner when
4698 something changed probably this has to be added in various other
4701 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
4703 2000-07-31 Baruch Even <baruch.even@writeme.com>
4705 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
4706 templates to satisfy compaq cxx.
4709 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4711 * src/support/translator.h (equal_1st_in_pair::operator()): take
4712 const ref pair_type as arg.
4713 (equal_2nd_in_pair::operator()): ditto
4714 (Translator::~Translator): remove empty d-tor.
4716 * src/graphics/GraphicsCache.C: move include config.h to top, also
4717 put initialization of GraphicsCache::singleton here.
4718 (~GraphicsCache): move here
4719 (addFile): take const ref as arg
4722 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
4724 * src/BufferView2.C (insertLyXFile): change te with/without header
4727 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4729 * src/frontends/xforms/FormGraphics.C (apply): add some
4730 static_cast. Not very nice, but required by compaq cxx.
4732 * src/frontends/xforms/RadioButtonGroup.h: include header
4733 <utility> instead of <pair.h>
4735 * src/insets/insetgraphicsParams.C: add using directive.
4736 (readResize): change return type to void.
4737 (readOrigin): ditto.
4739 * src/lyxfunc.C (getStatus): add missing break for build-program
4740 function; add test for Literate for export functions.
4742 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
4743 entries in Options menu.
4745 2000-07-31 Baruch Even <baruch.even@writeme.com>
4747 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
4748 protect against auto-allocation; release icon when needed.
4750 2000-07-31 Matej Cepl <CeplM@seznam.cz>
4752 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
4753 on usual typewriter.
4755 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
4756 earlier czech.kmap), useful only for programming.
4758 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4760 * src/frontends/xforms/FormCitation.h: fix conditioning around
4763 2000-07-31 Juergen Vigna <jug@sad.it>
4765 * src/frontends/xforms/FormTabular.C (local_update): changed
4766 radio_linebreaks to radio_useparbox and added radio_useminipage.
4768 * src/tabular.C: made support for using minipages/parboxes.
4770 * src/bufferlist.C (QwriteAll): small fix for asking for save.
4772 * src/insets/insetgraphics.C (draw): just draw the inset so that the
4774 (descent): so the cursor is in the middle.
4775 (width): bit smaller box.
4777 * src/insets/insetgraphics.h: added display() function.
4779 2000-07-31 Baruch Even <baruch.even@writeme.com>
4781 * src/frontends/Dialogs.h: Added showGraphics signals.
4783 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
4784 xforms form definition of the graphics dialog.
4786 * src/frontends/xforms/FormGraphics.h:
4787 * src/frontends/xforms/FormGraphics.C: Added files, the
4788 GUIndependent code of InsetGraphics
4790 * src/insets/insetgraphics.h:
4791 * src/insets/insetgraphics.C: Major writing to make it work.
4793 * src/insets/insetgraphicsParams.h:
4794 * src/insets/insetgraphicsParams.C: Added files, parameter passing
4795 struct between InsetGraphics and GUI.
4797 * src/LaTeXFeatures.h:
4798 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
4799 support for graphicx package.
4801 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
4802 for the graphics inset.
4804 * src/support/translator.h: Added file, used in
4805 InsetGraphicsParams. this is a template to translate between two
4808 * src/frontends/xforms/RadioButtonGroup.h:
4809 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
4810 way to easily control a radio button group.
4812 2000-07-28 Juergen Vigna <jug@sad.it>
4814 * src/insets/insettabular.C (LocalDispatch):
4815 (TabularFeatures): added support for lyx-functions of tabular features.
4816 (cellstart): refixed this function after someone wrongly changed it.
4818 * src/commandtags.h:
4819 * src/LyXAction.C (init): added support for tabular-features
4821 2000-07-28 Allan Rae <rae@lyx.org>
4823 * src/frontends/xforms/FormPreferences.C (build): Setup input return
4824 checking. NOTE: It seems that pressing ESC to cancel the dialog also
4825 triggers the callback for input checking. As a result we sometimes get
4826 "LyX: This shouldn't happen..." printed to cerr.
4827 (input): Started using status variable since I only free() on
4828 destruction. Some input checking for paths and font sizes.
4830 * src/frontends/xforms/FormPreferences.h: Use status to control
4831 activation of Ok and Apply
4833 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
4834 callback. Also resized to stop segfaults with 0.88. The problem is
4835 that xforms-0.88 requires the folder to be wide enough to fit all the
4836 tabs. If it isn't it causes all sorts of problems.
4838 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
4840 * src/frontends/xforms/forms/README: Reflect reality.
4842 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
4843 * src/frontends/xforms/forms/makefile: ditto.
4845 * src/commandtags.h: Get access to new Preferences dialog
4846 * src/LyXAction.C: ditto
4847 * src/lyxfunc.C: ditto
4848 * lib/ui/default.ui: ditto
4850 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4852 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
4854 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
4857 * src/frontends/xforms/form_url.[Ch]: added.
4859 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4861 * src/insets/insetbib.h: fixed bug in previous commit
4863 * src/frontends/xforms/FormUrl.h: ditto
4865 * src/frontends/xforms/FormPrint.h: ditto
4867 * src/frontends/xforms/FormPreferences.h: ditto
4869 * src/frontends/xforms/FormCopyright.h: ditto
4871 * src/frontends/xforms/FormCitation.C: ditto
4873 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
4874 private copyconstructor and private default contructor
4876 * src/support/Makefile.am: add utility.hpp
4878 * src/support/utility.hpp: new file from boost
4880 * src/insets/insetbib.h: set owner in clone
4882 * src/frontends/xforms/FormCitation.C: added missing include
4885 * src/insets/form_url.[Ch]: removed
4887 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
4889 * development/lyx.spec.in
4890 * Makefile.am: Fix buglet for LyX RPM generation resulting from
4891 file/directory re-organization.
4893 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
4895 * src/insets/insetcommand.[Ch]: moved the string data and
4896 associated manipulation methods into a new stand-alone class
4897 InsetCommandParams. This class has two additional methods
4898 getAsString() and setFromString() allowing the contents to be
4899 moved around as a single string.
4900 (addContents) method removed.
4901 (setContents) method no longer virtual.
4903 * src/buffer.C (readInset): made use of new InsetCitation,
4904 InsetUrl constructors based on InsetCommandParams.
4906 * src/commandtags.h: add LFUN_INSERT_URL
4908 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
4909 independent InsetUrl and use InsetCommandParams to extract
4910 string info and create new Insets.
4912 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
4914 * src/frontends/xforms/FormCitation.C (apply): uses
4917 * src/frontends/xforms/form_url.C
4918 * src/frontends/xforms/form_url.h
4919 * src/frontends/xforms/FormUrl.h
4920 * src/frontends/xforms/FormUrl.C
4921 * src/frontends/xforms/forms/form_url.fd: new files
4923 * src/insets/insetcite.[Ch]: removed unused constructors.
4925 * src/insets/insetinclude.[Ch]: no longer store filename
4927 * src/insets/inseturl.[Ch]: GUI-independent.
4929 2000-07-26 Juergen Vigna <jug@sad.it>
4930 * renamed frontend from gtk to gnome as it is that what is realized
4931 and did the necessary changes in the files.
4933 2000-07-26 Marko Vendelin <markov@ioc.ee>
4935 * configure.in: cleaning up gnome configuration scripts
4937 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4939 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
4940 shortcuts syndrom by redrawing them explicitely (a better solution
4941 would be appreciated).
4943 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
4945 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
4948 * src/lyx_cb.C (MenuExport): change html export to do the right
4949 thing depending of the document type (instead of having
4950 html-linuxdoc and html-docbook).
4951 * src/lyxfunc.C (getStatus): update for html
4952 * lib/ui/default.ui: simplify due to the above change.
4953 * src/menus.C (ShowFileMenu): update too (in case we need it).
4955 * src/MenuBackend.C (read): if a menu is defined twice, add the
4956 new entries to the exiting one.
4958 2000-07-26 Juergen Vigna <jug@sad.it>
4960 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
4962 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
4963 and return a bool if it did actual save the file.
4964 (AutoSave): don't autosave a unnamed doc.
4966 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
4967 check if this is an UNNAMED new file and react to it.
4968 (newFile): set buffer to unnamed and change to not mark a new
4969 buffer dirty if I didn't do anything with it.
4971 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
4973 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4975 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
4976 friend as per Angus's patch posted to lyx-devel.
4978 * src/ext_l10n.h: updated
4980 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
4981 gettext on the style string right before inserting them into the
4984 * autogen.sh: add code to extract style strings form layout files,
4985 not good enough yet.
4987 * src/frontends/gtk/.cvsignore: add MAKEFILE
4989 * src/MenuBackend.C (read): run the label strings through gettext
4990 before storing them in the containers.
4992 * src/ext_l10n.h: new file
4994 * autogen.sh : generate the ext_l10n.h file here
4996 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4998 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5001 * lib/ui/default.ui: fix a couple of typos.
5003 * config/gnome/gtk.m4: added (and added to the list of files in
5006 * src/insets/insetinclude.C (unique_id): fix when we are using
5007 lyxstring instead of basic_string<>.
5008 * src/insets/insettext.C (LocalDispatch): ditto.
5009 * src/support/filetools.C: ditto.
5011 * lib/configure.m4: create the ui/ directory if necessary.
5013 * src/LyXView.[Ch] (updateToolbar): new method.
5015 * src/BufferView_pimpl.C (buffer): update the toolbar when
5016 opening/closing buffer.
5018 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5020 * src/LyXAction.C (getActionName): enhance to return also the name
5021 and options of pseudo-actions.
5022 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
5024 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
5025 as an example of what is possible). Used in File->Build too (more
5026 useful) and in the import/export menus (to mimick the complicated
5027 handling of linuxdoc and friends). Try to update all the entries.
5029 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
5032 * src/MenuBackend.C (read): Parse the new OptItem tag.
5034 * src/MenuBackend.h: Add a new optional_ data member (used if the
5035 entry should be omitted when the lyxfunc is disabled).
5037 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
5038 function, used as a shortcut.
5039 (create_submenu): align correctly the shortcuts on the widest
5042 * src/MenuBackend.h: MenuItem.label() only returns the label of
5043 the menu without shortcut; new method shortcut().
5045 2000-07-14 Marko Vendelin <markov@ioc.ee>
5047 * src/frontends/gtk/Dialogs.C:
5048 * src/frontends/gtk/FormCopyright.C:
5049 * src/frontends/gtk/FormCopyright.h:
5050 * src/frontends/gtk/Makefile.am: added these source-files for the
5051 Gtk/Gnome support of the Copyright-Dialog.
5053 * src/main.C: added Gnome::Main initialization if using
5054 Gtk/Gnome frontend-GUI.
5056 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
5058 * config/gnome/aclocal-include.m4
5059 * config/gnome/compiler-flags.m4
5060 * config/gnome/curses.m4
5061 * config/gnome/gnome--.m4
5062 * config/gnome/gnome-bonobo-check.m4
5063 * config/gnome/gnome-common.m4
5064 * config/gnome/gnome-fileutils.m4
5065 * config/gnome/gnome-ghttp-check.m4
5066 * config/gnome/gnome-gnorba-check.m4
5067 * config/gnome/gnome-guile-checks.m4
5068 * config/gnome/gnome-libgtop-check.m4
5069 * config/gnome/gnome-objc-checks.m4
5070 * config/gnome/gnome-orbit-check.m4
5071 * config/gnome/gnome-print-check.m4
5072 * config/gnome/gnome-pthread-check.m4
5073 * config/gnome/gnome-support.m4
5074 * config/gnome/gnome-undelfs.m4
5075 * config/gnome/gnome-vfs.m4
5076 * config/gnome/gnome-x-checks.m4
5077 * config/gnome/gnome-xml-check.m4
5078 * config/gnome/gnome.m4
5079 * config/gnome/gperf-check.m4
5080 * config/gnome/gtk--.m4
5081 * config/gnome/linger.m4
5082 * config/gnome/need-declaration.m4: added configuration scripts
5083 for Gtk/Gnome frontend-GUI
5085 * configure.in: added support for the --with-frontend=gtk option
5087 * autogen.sh: added config/gnome/* to list of config-files
5089 * acconfig.h: added define for GTKGUI-support
5091 * config/lyxinclude.m4: added --with-frontend[=value] option value
5092 for Gtk/Gnome frontend-GUI support.
5094 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5096 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
5100 * src/paragraph.C (GetChar): remove non-const version
5102 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
5103 (search_kw): use it.
5105 * src/lyx_main.C (init): if "preferences" exist, read that instead
5107 (ReadRcFile): return bool if the file could be read ok.
5108 (ReadUIFile): add a check to see if lex file is set ok.
5110 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
5111 bastring can be used instead of lyxstring (still uses the old code
5112 if std::string is good enough or if lyxstring is used.)
5114 * src/encoding.C: make the arrays static, move ininle functions
5116 * src/encoding.h: from here.
5118 * src/buffer.C: have last_isnet_read as a file scope variable for now.
5119 (parseSingleLyXformat2Token): move inset parsing to separate method
5120 (readInset): new private method
5122 * src/Variables.h: remove virtual from get().
5124 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
5125 access to NEW_INSETS and NEW_TABULAR
5127 * src/MenuBackend.h: remove superfluous forward declaration of
5128 MenuItem. Add documentations tags "///", remove empty MenuItem
5129 destructor, remove private default contructor.
5131 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
5133 (read): more string mlabel and mname to where they are used
5134 (read): remove unused variables mlabel and mname
5135 (defaults): unconditional clear, make menusetup take advantage of
5136 add returning Menu &.
5138 * src/LyXView.h: define NEW_MENUBAR as default
5140 * src/LyXAction.C: include lyxparagraph.h temporary to get access
5141 to NEW_INSETS and NEW_TABULAR.
5142 (init): commetn out some funcs that is obsolete when NEW_INSETS is
5143 defined. Change some of the "xxxx-inset-insert" functions names to
5146 * several files: more enahncements to NEW_INSETS and the resulting
5149 * lib/lyxrc.example (\date_insert_format): move to misc section
5151 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
5152 bastring and use AC_CACHE_CHECK.
5153 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
5154 the system have the newest methods. uses AC_CACHE_CHECK
5155 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
5156 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
5157 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
5159 * configure.in: add LYX_CXX_GOOD_STD_STRING
5161 * acinclude.m4: recreated
5163 2000-07-24 Amir Karger <karger@lyx.org>
5165 * README: add Hebrew, Arabic kmaps
5168 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5170 * src/buffer.C (writeFileAscii): Define actcell as an int instead
5173 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5175 * Lot of files: add pragma interface/implementation.
5177 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
5179 * lib/ui/default.ui: new file (ans new directory). Contains the
5180 default menu and toolbar.
5182 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
5183 global space. Toolbars are now read (as menus) in ui files.
5185 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
5187 * src/lyxfunc.C (getStatus): do not exit immediately if a command
5188 is disabled because the document is read-only. We want to have the
5189 toggle state of the function anyway.
5190 (getStatus): add code for LFUN_VC* functions (mimicking what is
5191 done in old-style menus)
5193 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
5194 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
5196 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
5197 * src/BufferView_pimpl.C: ditto.
5198 * src/lyxfunc.C: ditto.
5200 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
5201 default). This replaces old-style menus by new ones.
5203 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
5204 MenuItem. Contain the data structure of a menu.
5206 * src/insets/insettext.C: use LyXView::setLayout instead of
5207 accessing directly the toolbar combox.
5208 * src/lyxfunc.C (Dispatch): ditto.
5210 * src/LyXView.C (setLayout): new method, which just calls
5211 Toolbar::setLayout().
5212 (updateLayoutChoice): move part of this method in Toolbar.
5214 * src/toolbar.[Ch]: removed.
5216 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
5217 implementation the toolbar.
5219 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
5220 the toolbar. It might make sense to merge it with ToolbarDefaults
5222 (setLayout): new function.
5223 (updateLayoutList): ditto.
5224 (openLayoutList): ditto.
5226 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
5227 xforms implementation of the toolbar.
5228 (get_toolbar_func): comment out, since I do not
5229 know what it is good for.
5231 * src/ToolbarDefaults.h: Add the ItemType enum.
5233 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
5234 for a list of allocated C strings. Used in Menubar xforms
5235 implementation to avoid memory leaks.
5237 * src/support/lstrings.[Ch] (uppercase): new version taking and
5241 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
5242 * lib/bind/emacs.bind: ditto.
5244 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5246 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
5247 forward decl of LyXView.
5249 * src/toolbar.C (toolbarItem): moved from toolbar.h
5250 (toolbarItem::clean): ditto
5251 (toolbarItem::~toolbarItem): ditto
5252 (toolbarItem::operator): ditto
5254 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
5256 * src/paragraph.h: control the NEW_TABULAR define from here
5258 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
5259 USE_TABULAR_INSETS to NEW_TABULAR
5261 * src/ToolbarDefaults.C: add include "lyxlex.h"
5263 * files using the old table/tabular: use NEW_TABULAR to control
5264 compilation of old tabular stuff.
5266 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
5269 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
5270 planemet in reading of old style floats, fix the \end_deeper
5271 problem when reading old style floats.
5273 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5275 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
5277 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
5279 * lib/bind/sciword.bind: updated.
5281 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5283 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
5284 layout write problem
5286 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5288 * src/Makefile.am (INCLUDES): remove image directory from include
5291 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
5292 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
5294 * src/LyXView.C (create_form_form_main): read the application icon
5297 * lib/images/*.xpm: change the icons to use transparent color for
5300 * src/toolbar.C (update): change the color of the button when it
5303 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5305 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
5306 setting explicitely the minibuffer.
5307 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
5309 * src/LyXView.C (showState): new function. Shows font information
5310 in minibuffer and update toolbar state.
5311 (LyXView): call Toolbar::update after creating the
5314 * src/toolbar.C: change toollist to be a vector instead of a
5316 (BubbleTimerCB): get help string directly from the callback
5317 argument of the corresponding icon (which is the action)
5318 (set): remove unnecessary ugliness.
5319 (update): new function. update the icons (depressed, disabled)
5320 depending of the status of the corresponding action.
5322 * src/toolbar.h: remove help in toolbarItem
5324 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
5326 * src/Painter.C (text): Added code for using symbol glyphs from
5327 iso10646 fonts. Currently diabled.
5329 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
5332 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
5333 magyar,turkish and usorbian.
5335 * src/paragraph.C (isMultiLingual): Made more efficient.
5337 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
5340 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
5341 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
5342 Also changed the prototype to "bool math_insert_greek(char)".
5344 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5346 * lots of files: apply the NEW_INSETS on all code that will not be
5347 needed when we move to use the new insets. Enable the define in
5348 lyxparagrah.h to try it.
5350 * src/insets/insettabular.C (cellstart): change to be a static
5352 (InsetTabular): initialize buffer in the initializer list.
5354 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
5356 * src/frontends/xforms/FormPrint.[Ch] : moved #include
5357 form_print.h out of the header file. Replaced with forward
5358 declarations of the relevant struct.
5360 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
5363 * src/commandtags.h: do not include "debug.h" which does not
5364 belong there. #include it in some other places because of this
5367 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5369 * src/insets/insetcaption.C: add a couple "using" directives.
5371 * src/toolbar.C (add): get the help text directly from lyxaction.
5373 (setPixmap): new function. Loads from disk and sets a pixmap on a
5374 botton; the name of the pixmap file is derived from the command
5377 * src/toolbar.h: remove members isBitmap and pixmap from
5380 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
5381 * lib/images/: move many files from images/banner.xpm.
5383 * src/lyx_gui.C (create_forms): read banner pixmap from file.
5385 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
5386 * src/toolbar.C: ditto.
5387 * configure.in: ditto.
5388 * INSTALL: document.
5390 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
5391 the spellchecker popup is closed from the WM.
5393 2000-07-19 Juergen Vigna <jug@sad.it>
5395 * src/insets/insetfloat.C (Write): small fix because we use the
5396 insetname for the type now!
5398 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
5400 * src/frontends/xforms/forms/form_citation.fd: object sizes are
5403 * src/frontends/Dialogs.h: removed hideCitation signal
5405 * src/insets/insetcite.h: added hide signal
5407 * src/insets/insetcite.C (~InsetCitation): emits new signal
5408 (getScreenLabel): "intelligent" label should now fit on the screen!
5410 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
5412 * src/frontends/xforms/FormCitation.C (showInset): connects
5413 hide() to the inset's hide signal
5414 (show): modified to use fl_set_object_position rather than
5415 fl_set_object_geometry wherever possible
5417 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5419 * src/insets/lyxinset.h: add caption code
5421 * src/insets/insetfloat.C (type): new method
5423 * src/insets/insetcaption.C (Write): new method
5425 (LyxCode): new method
5427 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
5428 to get it right together with using the FloatList.
5430 * src/commandtags.h: add LFUN_INSET_CAPTION
5431 * src/lyxfunc.C (Dispatch): handle it
5433 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
5436 * src/Variables.[Ch]: make expand take a const reference, remove
5437 the destructor, some whitespace changes.
5439 * src/LyXAction.C (init): add caption-inset-insert
5441 * src/FloatList.C (FloatList): update the default floats a bit.
5443 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5445 * src/Variables.[Ch]: new files. Intended to be used for language
5446 specific strings (like \chaptername) and filename substitution in
5449 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
5451 * lib/kbd/american.kmap: update
5453 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
5455 * src/bufferparams.[Ch]: remove member allowAccents.
5457 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
5459 * src/LaTeXLog.C: use the log_form.h header.
5460 * src/lyx_gui.C: ditto.
5461 * src/lyx_gui_misc.C: ditto.
5462 * src/lyxvc.h: ditto.
5464 * forms/log_form.fd: new file, created from latexoptions.fd. I
5465 kept the log popup and nuked the options form.
5467 * src/{la,}texoptions.[Ch]: removed.
5468 * src/lyx_cb.C (LaTeXOptions): ditto
5470 * src/lyx_gui.C (create_forms): do not handle the
5471 fd_latex_options form.
5473 2000-07-18 Juergen Vigna <jug@sad.it>
5475 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
5476 name of the inset so that it can be requested outside (text2.C).
5478 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
5481 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5483 * src/mathed/formula.h (ConvertFont): constify
5485 * src/mathed/formula.C (Read): add warning if \end_inset is not
5486 found on expected place.
5488 * src/insets/lyxinset.h (ConvertFont): consify
5490 * src/insets/insetquotes.C (ConvertFont): constify
5491 * src/insets/insetquotes.h: ditto
5493 * src/insets/insetinfo.h: add labelfont
5495 * src/insets/insetinfo.C (InsetInfo): set the labelfont
5496 (ascent): use labelfont
5500 (Write): make .lyx file a bit nicer
5502 * src/insets/insetfloat.C (Write): simplify somewhat...
5503 (Read): add warning if arg is not found
5505 * src/insets/insetcollapsable.C: add using std::max
5506 (Read): move string token and add warning in arg is not found
5507 (draw): use std::max to get the right ty
5508 (getMaxWidth): simplify by using std::max
5510 * src/insets/insetsection.h: new file
5511 * src/insets/insetsection.C: new file
5512 * src/insets/insetcaption.h: new file
5513 * src/insets/insetcaption.C: new file
5515 * src/insets/inset.C (ConvertFont): constify signature
5517 * src/insets/Makefile.am (libinsets_la_SOURCES): add
5518 insetcaption.[Ch] and insetsection.[Ch]
5520 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
5521 uses to use LABEL_COUNTER_CHAPTER instead.
5522 * src/text2.C (SetCounter): here
5524 * src/counters.h: new file
5525 * src/counters.C: new file
5526 * src/Sectioning.h: new file
5527 * src/Sectioning.C: new file
5529 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
5531 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5533 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
5536 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
5539 2000-07-17 Juergen Vigna <jug@sad.it>
5541 * src/tabular.C (Validate): check if array-package is needed.
5542 (SetVAlignment): added support for vertical alignment.
5543 (SetLTFoot): better support for longtable header/footers
5544 (Latex): modified to support added features.
5546 * src/LaTeXFeatures.[Ch]: added array-package.
5548 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
5550 * src/lyx_gui.C (LyXGUI): make sure that the height is large
5553 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
5555 * configure.in: do not forget to put a space after -isystem.
5557 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
5559 * lib/kbd/arabic.kmap: a few fixes.
5561 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5563 * some whitespace chagnes to a number of files.
5565 * src/support/DebugStream.h: change to make it easier for
5566 doc++ to parse correctly.
5567 * src/support/lyxstring.h: ditto
5569 * src/mathed/math_utils.C (compara): change to have only one
5571 (MathedLookupBOP): change because of the above.
5573 * src/mathed/math_delim.C (math_deco_compare): change to have only
5575 (search_deco): change becasue of the above.
5577 * src/insets/insettabular.C (DrawCellSelection): use std::swap
5578 instead of manually coded one.
5580 * src/insets/insetquotes.C (Read): read the \end_inset too
5582 * src/insets/insetlatex.h: remove file
5583 * src/insets/insetlatex.C: remove file
5585 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
5587 (InsetPrintIndex): remove destructor
5589 * src/insets/insetinclude.h: remove default constructor
5591 * src/insets/insetfloat.C: work to make it work better
5593 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
5595 * src/insets/insetcite.h (InsetCitation): remove default constructor
5597 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
5599 * src/text.C (GetColumnNearX): comment out some currently unused code.
5601 * src/paragraph.C (writeFile): move some initializations closer to
5603 (CutIntoMinibuffer): small change to use new matchIT operator
5607 (InsertInset): ditto
5610 (InsetIterator): ditto
5611 (Erase): small change to use new matchFT operator
5613 (GetFontSettings): ditto
5614 (HighestFontInRange): ditto
5617 * src/lyxparagraph.h: some chars changed to value_type
5618 (matchIT): because of some stronger checking (perhaps too strong)
5619 in SGI STL, the two operator() unified to one.
5622 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
5624 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
5625 the last inset read added
5626 (parseSingleLyXformat2Token): some more (future) compability code added
5627 (parseSingleLyXformat2Token): warning about solitary \end_inset added
5628 (parseSingleLyXformat2Token): set last_inset_read
5629 (parseSingleLyXformat2Token): more code to read new "Float" correctly
5630 (parseSingleLyXformat2Token): don't double intializw string next_token
5632 * src/TextCache.C (text_fits::operator()): add const's to the signature
5633 (has_buffer::operator()): ditto
5635 * src/Floating.h: add some comments on the class
5637 * src/FloatList.[Ch] (typeExist): new method
5640 * src/BackStack.h: added default constructor, wanted by Gcc.
5642 2000-07-14 Juergen Vigna <jug@sad.it>
5644 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
5646 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
5648 * src/insets/insettabular.C (resizeLyXText): need this to be able to
5649 do a redraw when the window is resized!
5650 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
5652 * src/insets/insettext.C (resizeLyXText): added function to correctly
5653 being able to resize the LyXWindow.
5655 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
5657 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
5659 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
5660 crashes when closing dialog to a deleted inset.
5662 * src/insets/insetcite.[Ch] (Edit) : the return of this former
5663 method! Now similar to other insets.
5665 2000-07-13 Juergen Vigna <jug@sad.it>
5667 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
5669 * lib/examples/Literate.lyx: small patch!
5671 * src/insets/insetbib.C (Read): added this function because of wrong
5672 Write (without [begin|end]_inset).
5674 2000-07-11 Juergen Vigna <jug@sad.it>
5676 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
5677 as the insertInset could not be good!
5679 * src/screen.C (ToggleSelection): fixed toggle selection bug as
5680 the bool param should not be last.
5682 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5684 * sigc++/configure.in: fix bug in threading-related code (Yes, I
5685 did submit that to Karl).
5687 * configure.in: use -isystem instead of -I for X headers. This
5688 fixes a problem on solaris with a recent gcc;
5689 put the front-end code after the X detection code;
5690 configure in sigc++ before lib/
5692 * src/lyx_main.C (commandLineHelp): remove -display from command
5695 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
5697 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
5698 Also put in Makefile rules for building the ``listerrors''
5699 program for parsing errors from literate programs written in LyX.
5701 * lib/build-listerrors: Added small shell script as part of compile
5702 process. This builds a working ``listerrors'' binary if noweb is
5703 installed and either 1) the VNC X server is installed on the machine,
5704 or 2) the user is compiling from within a GUI. The existence of a GUI
5705 is necessary to use the ``lyx --export'' feature for now. This
5706 hack can be removed once ``lyx --export'' no longer requires a GUI to
5709 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
5711 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
5712 now passed back correctly from gcc and placed "under" error
5713 buttons in a Literate LyX source.
5715 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5717 * src/text.C (GetColumnNearX): Better behavior when a RTL
5718 paragraph is ended by LTR text.
5720 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
5723 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5725 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
5726 true when clipboard is empty.
5728 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5730 * text.C (Backspace): Prevent rebreaking of a row if it is the last
5731 row of the paragraph.
5732 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
5733 to prevent calculation of bidi tables
5735 2000-07-07 Juergen Vigna <jug@sad.it>
5737 * src/screen.C (ToggleSelection): added y_offset and x_offset
5740 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
5743 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
5745 * src/insets/insettext.C: fixed Layout-Display!
5747 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5749 * configure.in: add check for strings.h header.
5751 * src/spellchecker.C: include <strings.h> in order to have a
5752 definition for bzero().
5754 2000-07-07 Juergen Vigna <jug@sad.it>
5756 * src/insets/insettext.C (draw): set the status of the bv->text to
5757 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
5759 * src/screen.C (DrawOneRow):
5760 (DrawFromTo): redraw the actual row if something has changed in it
5763 * src/text.C (draw): call an update of the toplevel-inset if something
5764 has changed inside while drawing.
5766 * src/lyxtext.h: added CHANGED_IN_DRAW status.
5768 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
5770 * src/insets/insetbib.[Ch] (callback) new method, moving callback
5771 processing inside class.
5773 * src/insets/insetindex.[Ch] (callback) new method, moving callback
5774 processing inside class.
5776 * src/insets/insetindex.h new struct Holder, consistent with other
5779 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
5780 citation dialog from main code and placed it in src/frontends/xforms.
5781 Dialog launched through signals instead of callbacks
5783 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
5785 * lyx.man: update the options description.
5787 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
5789 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
5790 handle neg values, set min width to 590, add doc about -display
5792 2000-07-05 Juergen Vigna <jug@sad.it>
5794 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
5795 calls to BufferView *.
5797 * src/insets/insettext.C (checkAndActivateInset): small fix non
5798 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
5800 * src/insets/insetcommand.C (Read): Fixed as insets should read till
5801 their \end_inset token!
5803 2000-07-04 edscott <edscott@imp.mx>
5805 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
5806 lib/lyxrc.example: added option \wheel_jump
5808 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
5810 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
5811 remove support for -width,-height,-xpos and -ypos.
5813 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
5815 * src/encoding.[Ch]: New files.
5817 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
5818 (text): Call to the underline() method only when needed.
5820 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
5822 * src/buffer.C (makeLaTeXFile): Compute automatically the input
5823 encoding(s) for the document.
5825 * src/bufferparams.C (BufferParams): Changed default value of
5828 * src/language.C (newLang): Removed.
5829 (items[]): Added encoding information for all defined languages.
5831 * src/lyx_gui.C (create_forms): Added "auto" option to the input
5832 encoding choice button.
5834 * src/lyxrc.h (font_norm_type): New member variable.
5835 (set_font_norm_type): New method.
5837 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
5838 paragraphs with different encodings.
5840 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
5841 (TransformChar): Changed to work correctly with Arabic points.
5842 (draw): Added support for drawing Arabic points.
5843 (draw): Removed code for drawing underbars (this is done by
5846 * src/support/textutils.h (IsPrintableNonspace): New function.
5848 * src/BufferView_pimpl.h: Added "using SigC::Object".
5849 * src/LyXView.h: ditto.
5851 * src/insets/insetinclude.h (include_label): Changed to mutable.
5853 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5855 * src/mathed/math_iter.h: remove empty destructor
5857 * src/mathed/math_cursor.h: remove empty destructor
5859 * src/insets/lyxinset.h: add THEOREM_CODE
5861 * src/insets/insettheorem.[Ch]: new files
5863 * src/insets/insetminipage.C: (InsertInset): remove
5865 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
5867 (InsertInset): remove
5869 * src/insets/insetlist.C: (InsertList): remove
5871 * src/insets/insetfootlike.[Ch]: new files
5873 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
5876 (InsertInset): ditto
5878 * src/insets/insetert.C: remove include Painter.h, reindent
5879 (InsertInset): move to header
5881 * src/insets/insetcollapsable.h: remove explicit from default
5882 contructor, remove empty destructor, add InsertInset
5884 * src/insets/insetcollapsable.C (InsertInset): new func
5886 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5888 * src/vspace.h: add explicit to constructor
5890 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
5891 \textcompwordmark, please test this.
5893 * src/lyxrc.C: set ascii_linelen to 65 by default
5895 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
5897 * src/commandtags.h: add LFUN_INSET_THEOREM
5899 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
5900 (makeLinuxDocFile): remove _some_ of the nice logic
5901 (makeDocBookFile): ditto
5903 * src/Painter.[Ch]: (~Painter): removed
5905 * src/LyXAction.C (init): entry for insettheorem added
5907 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
5909 (deplog): code to detect files generated by LaTeX, needs testing
5912 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5914 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
5916 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5918 * src/LaTeX.C (deplog): Add a check for files that are going to be
5919 created by the first latex run, part of the project to remove the
5922 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
5923 contents to the extension list.
5925 2000-07-04 Juergen Vigna <jug@sad.it>
5927 * src/text.C (NextBreakPoint): added support for needFullRow()
5929 * src/insets/lyxinset.h: added needFullRow()
5931 * src/insets/insetcollapsable.C: redone now this uses a text-inset
5934 * src/insets/insettext.C: lots of changes for update!
5936 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
5938 * src/LaTeXFeatures.h: add a missing std:: qualifier.
5940 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
5942 * src/insets/insetinclude.C (InsetInclude): fixed
5943 initialization of include_label.
5944 (unique_id): now returns a string.
5946 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
5948 * src/LaTeXFeatures.h: new member IncludedFiles, for
5949 a map of key, included file name.
5951 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
5952 with the included files for inclusion in SGML preamble,
5953 i. e., linuxdoc and docbook.
5956 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
5957 nice (is the generated linuxdoc code to be exported?), that
5958 allows to remove column, and only_body that will be true for
5959 slave documents. Insets are allowed inside SGML font type.
5960 New handling of the SGML preamble for included files.
5961 (makeDocBookFile): the same for docbook.
5963 * src/insets/insetinclude.h:
5964 * src/insets/insetinclude.C (Validate): keeps a list of included files.
5966 (DocBook): new export methods.
5968 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
5969 and makeDocBookFile.
5971 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
5972 formats to export with command line argument -x.
5974 2000-06-29 Juergen Vigna <jug@sad.it>
5976 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
5977 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
5979 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
5980 region could already been cleared by an inset!
5982 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5984 * src/BufferView_pimpl.h: remove member variables lyx_focus and
5987 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
5989 (cursorToggle): remove special handling of lyx focus.
5991 2000-06-28 Juergen Vigna <jug@sad.it>
5993 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
5996 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5998 * src/insets/insetindex.C (Edit): add a callback when popup is
6001 * src/insets/insettext.C (LocalDispatch):
6002 * src/insets/insetmarginal.h:
6003 * src/insets/insetlist.h:
6004 * src/insets/insetfoot.h:
6005 * src/insets/insetfloat.h:
6006 * src/insets/insetert.h: add a missing std:: qualifier.
6008 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6010 * src/support/lyxsum.C (sum): '\0' teminate file read when using
6013 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
6015 * src/insets/insettext.C (Read): remove tmptok unused variable
6016 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
6017 (InsertInset): change for new InsetInset code
6019 * src/insets/insettext.h: add TEXT inline method
6021 * src/insets/insettext.C: remove TEXT macro
6023 * src/insets/insetmarginal.C (Write): new method
6024 (Latex): change output slightly
6026 * src/insets/insetfoot.C (Write): new method
6027 (Latex): change output slightly (don't use endl when no need)
6029 * src/insets/insetert.C (Write): new method
6031 * src/insets/insetcollapsable.h: make button_length, button_top_y
6032 and button_bottm_y protected.
6034 * src/insets/insetcollapsable.C (Write): simplify code by using
6035 tostr. Also do not output the float name, the children class
6036 should to that to get control over own arguments
6038 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
6039 src/insets/insetminipage.[Ch]:
6042 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6044 * src/lyxfunc.C (Dispatch): cases for new insets/commands
6046 * src/Makefile.am (lyx_SOURCES): add the new files
6048 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
6049 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
6050 * src/commandtags.h: ditto
6052 * src/LaTeXFeatures.h: add a std::set of used floattypes
6054 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
6056 * src/FloatList.[Ch] src/Floating.h: new files
6058 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
6060 * src/lyx_cb.C (TableApplyCB): ditto
6062 * src/text2.C: ditto
6063 * src/buffer.C (SimpleLinuxDocOnePar): ditto
6064 (parseSingleLyXformat2Token): ditto + add code for
6065 backwards compability for old float styles + add code for new insets
6067 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
6069 (InsertInset(size_type, Inset *, LyXFont)): new method
6070 (InsetChar(size_type, char)): changed to use the other InsetChar
6071 with a LyXFont(ALL_INHERIT).
6072 (InsetInset(size_type, Inset*)): changed to use InsetChar to
6073 insert the META_INSET.
6075 * sigc++/thread.cc (Privete<int>::operator int&): move definition
6077 * sigc++/thread.h (Threads): from here
6079 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
6080 definition out of line
6081 * sigc++/scope.h: from here
6083 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6085 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
6086 is specified (adapted from a patch from edscott <edscott@imp.mx>).
6088 * Makefile.am (bindist): new target.
6090 * INSTALL: add instructions for doing a binary distribution.
6092 * development/tools/README.bin.example: update a bit.
6094 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
6097 * lib/lyxrc.example: new lyxrc tag \set_color.
6099 * src/lyxfunc.C (Dispatch):
6100 * src/commandtags.h:
6101 * src/LyXAction.C: new lyxfunc "set-color".
6103 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
6104 and an x11name given as strings.
6106 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
6107 cache when a color is changed.
6109 2000-06-26 Juergen Vigna <jug@sad.it>
6111 * src/lyxrow.C (width): added this functions and variable.
6113 * src/insets/insetcite.C (create_form_citation_form): some Gravity
6116 * src/text.C (SetHeightOfRow): fixed calcualting of width.
6118 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6120 * images/undo_bw.xpm: new icon.
6121 * images/redo_bw.xpm: ditto.
6123 * configure.in (INSTALL_SCRIPT): change value to
6124 ${INSTALL} to avoid failures of install-script target.
6125 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
6127 * src/BufferView.h: add a magic "friend" declaration to please
6130 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
6132 * forms/cite.fd: modified to allow resizing without messing
6135 * src/insetcite.C: Uses code from cite.fd almost without
6137 User can now resize dialog in the x-direction.
6138 Resizing the dialog in the y-direction is prevented, as the
6139 code does this intelligently already.
6141 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6143 * INSTALL: remove obsolete entry in "problems" section.
6145 * lib/examples/sl_*.lyx: update of the slovenian examples.
6147 * src/support/FileInfo.[Ch] (getBlockSize): remove.
6149 2000-06-23 Juergen Vigna <jug@sad.it>
6151 * src/lyxtext.h: added a 'cleared' flag to draw() function.
6153 * src/buffer.C (resize): delete the LyXText of textinsets.
6155 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
6157 * src/insets/lyxinset.h: added another parameter 'cleared' to
6158 the draw() function.
6160 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
6161 unlocking inset in inset.
6163 2000-06-22 Juergen Vigna <jug@sad.it>
6165 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
6166 of insets and moved first to LyXText.
6168 * src/mathed/formulamacro.[Ch]:
6169 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
6171 2000-06-21 Juergen Vigna <jug@sad.it>
6173 * src/text.C (GetVisibleRow): look if I should clear the area or not
6174 using Inset::doClearArea() function.
6176 * src/insets/lyxinset.h: added doClearArea() function and
6177 modified draw(Painter &, ...) to draw(BufferView *, ...)
6179 * src/text2.C (UpdateInset): return bool insted of int
6181 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
6183 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
6184 combox in the character popup
6186 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
6187 BufferParams const & params
6189 2000-06-20 Juergen Vigna <jug@sad.it>
6191 * src/insets/insettext.C (SetParagraphData): set insetowner on
6194 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6196 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
6197 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
6199 (form_main_): remove
6201 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
6202 (create_form_form_main): remove FD_form_main stuff, connect to
6203 autosave_timeout signal
6205 * src/LyXView.[Ch] (getMainForm): remove
6206 (UpdateTimerCB): remove
6207 * src/BufferView_pimpl.h: inherit from SigC::Object
6209 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
6210 signal instead of callback
6212 * src/BufferView.[Ch] (cursorToggleCB): remove
6214 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6216 * src/BufferView_pimpl.C: changes because of the one below
6218 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
6219 instead of storing a pointer to a LyXText.
6221 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
6223 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
6225 * src/lyxparagraph.h
6227 * src/paragraph.C: Changed fontlist to a sorted vector.
6229 2000-06-19 Juergen Vigna <jug@sad.it>
6231 * src/BufferView.h: added screen() function.
6233 * src/insets/insettext.C (LocalDispatch): some selection code
6236 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
6238 * src/insets/insettext.C (SetParagraphData):
6240 (InsetText): fixes for multiple paragraphs.
6242 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
6244 * development/lyx.spec.in: Call configure with ``--without-warnings''
6245 to work around a bug with the Makefiles when doing ``make lyxrpm''.
6246 This should be fine, however, since we generally don't want to be
6247 verbose when making an RPM.
6249 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
6251 * lib/scripts/fig2pstex.py: New file
6253 2000-06-16 Juergen Vigna <jug@sad.it>
6255 * src/insets/insettabular.C (UpdateLocal):
6256 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
6257 (LocalDispatch): Changed all functions to use LyXText.
6259 2000-06-15 Juergen Vigna <jug@sad.it>
6261 * src/text.C (SetHeightOfRow): call inset::update before requesting
6264 * src/insets/insettext.C (update):
6265 * src/insets/insettabular.C (update): added implementation
6267 * src/insets/lyxinset.h: added update function
6269 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6271 * src/text.C (SelectNextWord): protect against null pointers with
6272 old-style string streams. (fix from Paul Theo Gonciari
6275 * src/cite.[Ch]: remove erroneous files.
6277 * lib/configure.m4: update the list of created directories.
6279 * src/lyxrow.C: include <config.h>
6280 * src/lyxcursor.C: ditto.
6282 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6284 * lib/examples/decimal.lyx: new example file from Mike.
6286 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
6287 to find template definitions (from Dekel)
6289 * src/frontends/.cvsignore: add a few things.
6291 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
6293 * src/Timeout.C (TimeOut): remove default argument.
6295 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
6298 * src/insets/ExternalTemplate.C: add a "using" directive.
6300 * src/lyx_main.h: remove the act_ struct, which seems unused
6303 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6305 * LyX Developers Meeting: All files changed, due to random C++ (by
6306 coincidence) code generator script.
6308 - external inset (cool!)
6309 - initial online editing of preferences
6310 - insettabular breaks insettext(s contents)
6312 - some DocBook fixes
6313 - example files update
6314 - other cool stuff, create a diff and look for yourself.
6316 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
6318 * src/insets/insettext.C (computeTextRows): if the maxWidth is
6319 -1 this is a non-line-breaking textinset.
6321 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
6322 if there is no width set.
6324 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6326 * Lots of files: Merged the dialogbase branch.
6328 2000-06-09 Allan Rae <rae@lyx.org>
6330 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
6331 and the Dispatch methods that used it.
6333 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
6334 access to functions formerly kept in Dispatch.
6336 2000-05-19 Allan Rae <rae@lyx.org>
6338 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
6339 made to_page and count_copies integers again. from_page remains a
6340 string however because I want to allow entry of a print range like
6341 "1,4,22-25" using this field.
6343 * src/LyXAction.C: added action info and commands for buffer-print-xtl
6344 and printer-params-get. These aren't useful from the minibuffer but
6345 could be used by a script/LyXServer app provided it passes a suitable
6346 auto_mem_buffer. I guess I should take a look at how the LyXServer
6347 works and make it support xtl buffers.
6349 * sigc++/: updated to libsigc++-1.0.1
6351 * src/xtl/: updated to xtl-1.3.pl.11
6353 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
6354 those changes done to the files in src/ are actually recreated when
6355 they get regenerated. Please don't ever accept a patch that changes a
6356 dialog unless that patch includes the changes to the corresponding *.fd
6359 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
6360 stringOnlyContains, renamed it and generalised it.
6362 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
6363 branch. Removed the remaining old form_print code.
6365 2000-04-26 Allan Rae <rae@lyx.org>
6367 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
6368 trap I was trying to fix with the ID: fields in src/xtl/ :-)
6370 2000-04-25 Allan Rae <rae@lyx.org>
6372 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
6373 against a base of xtl-1.3.pl.4
6375 * development/tools/lxtl.sh: fixed a couple of silly typos and now
6376 filter the Id: entries so they still show the xtl version number
6379 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
6380 into the src/xtl code. Patch still pending with José (XTL)
6382 2000-04-24 Allan Rae <rae@lyx.org>
6384 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
6385 both more generic and much safer. Use the new template functions.
6386 * src/buffer.[Ch] (Dispatch): ditto.
6388 * src/frontends/xforms/FormPrint.C (update): Use new template functions
6389 and mem buffer more intelligently. Also a little general cleanup.
6392 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
6393 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
6394 * src/xtl/Makefile.am: ditto.
6395 * src/xtl/.cvsignore: ditto.
6396 * src/Makefile.am: ditto.
6398 * src/PrinterParams.h: Removed the macros member functions. Added a
6399 testInvariant member function. A bit of tidying up and commenting.
6400 Included Angus's idea for fixing operation with egcs-1.1.2.
6402 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
6403 cool expansion of XTL's mem_buffer to support automatic memory
6404 management within the buffer itself. Removed the various macros and
6405 replaced them with template functions that use either auto_mem_buffer
6406 or mem_buffer depending on a #define. The mem_buffer support will
6407 disappear as soon as the auto_mem_buffer is confirmed to be good on
6408 other platforms/compilers. That is, it's there so you've got something
6411 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
6412 effectively forked XTL. However I expect José will include my code
6413 into the next major release. Also fixed a memory leak.
6414 * src/xtl/text.h: ditto.
6415 * src/xtl/xdr.h: ditto.
6416 * src/xtl/giop.h: ditto.
6418 2000-04-16 Allan Rae <rae@lyx.org>
6420 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
6421 by autogen.sh and removed by maintainer-clean anyway.
6422 * .cvsignore, sigc++/.cvsignore: Support the above.
6424 * sigc++/.cvsignore: Forgot that retbind.h was generated.
6426 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
6428 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
6429 macros, renamed static callback-target member functions to suit new
6430 scheme and made them public.
6431 * src/frontends/xforms/forms/form_print.fd: ditto.
6432 * src/frontends/xforms/forms/form_copyright.fd: ditto.
6434 * src/support/lxtl.h: small cleanup to use typedef instead of #define
6437 * src/xtl/: New directory containing a minimal distribution of XTL.
6438 This is XTL-1.3.pl.4.
6440 * development/tools/lxtl.sh: A script to generate the above mini-dist.
6442 2000-04-15 Allan Rae <rae@lyx.org>
6444 * development/tools/makeLyXsigc.sh: Remove the library version numbers
6446 * sigc++/: Updated to libsigc++-1.0.0
6448 2000-04-14 Allan Rae <rae@lyx.org>
6450 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
6451 use the generic ones in future. I'll modify my conversion script.
6453 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
6455 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
6456 (CloseAllBufferRelatedDialogs): Renamed.
6457 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
6459 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
6460 of the generic ones. These are the same ones my conversion script
6463 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
6464 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
6465 * src/buffer.C (Dispatch): ditto
6467 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
6468 functions for updating and hiding buffer dependent dialogs.
6469 * src/BufferView.C (buffer): ditto
6470 * src/buffer.C (setReadonly): ditto
6471 * src/lyxfunc.C (CloseBuffer): ditto
6473 * src/buffer.h: Take setReadonly() out of line so I don't have to include
6474 Dialogs.h, and hence all the SigC stuff, into every file that includes
6475 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
6477 * src/BufferView2.C: reduce the number of headers included by buffer.h
6479 2000-04-11 Allan Rae <rae@lyx.org>
6481 * src/frontends/xforms/xform_macros.h: A small collection of macros
6482 for building C callbacks.
6484 * src/frontends/xforms/Makefile.am: Added above file.
6486 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
6487 scheme again. This time it should work for JMarc. If this is
6488 successful I'll revise my conversion script to automate some of this.
6489 The static member functions in the class also have to be public for
6490 this scheme will work. If the scheme works (it's almost identical to
6491 the way BufferView::cursorToggleCB is handled so it should work) then
6492 FormCopyright and FormPrint will be ready for inclusion into the main
6493 trunk immediately after 1.1.5 is released -- provided we're prepared
6494 for complaints about lame compilers not handling XTL.
6496 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
6498 2000-04-07 Allan Rae <rae@lyx.org>
6500 * config/lyxinclude.m4: A bit more tidying up (Angus)
6502 * src/LString.h: JMarc's <string> header fix
6504 * src/PrinterParams.h: Used string for most data to remove some
6505 ugly code in the Print dialog and avoid even uglier code when
6506 appending the ints to a string for output.
6508 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
6509 and moved "default:" back to the end of switch statement. Cleaned
6510 up the printing so it uses the right function calls and so the
6511 "print to file" option actually puts the file in the right directory.
6513 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
6515 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
6516 and Ok+Apply button control into a separate method: input (Angus).
6517 (input) Cleaned it up and improved it to be very thorough now.
6518 (All CB) static_cast used instead of C style cast (Angus). This will
6519 probably change again once we've worked out how to keep gcc-2.8.1 happy
6520 with real C callbacks.
6521 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
6522 ignore some of the bool settings and has random numbers instead. Needs
6523 some more investigation. Added other input length checks and checking
6524 of file and printer names.
6526 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
6527 would link (Angus). Seems the old code doesn't compile with the pragma
6528 statement either. Separated callback entries from internal methods.
6530 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
6532 2000-03-17 Allan Rae <rae@lyx.org>
6534 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
6535 need it? Maybe it could go in Dialogs instead? I could make it a
6536 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
6537 values to get the bool return value.
6538 (Dispatch): New overloaded method for xtl support.
6540 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
6541 extern "C" callback instead of static member functions. Hopefully,
6542 JMarc will be able to compile this. I haven't changed
6543 forms/form_copyright.fd yet. Breaking one of my own rules already.
6545 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
6546 because they aren't useful from the minibuffer. Maybe a LyXServer
6547 might want a help message though?
6549 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
6551 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
6552 xtl which needs both rtti and exceptions.
6554 * src/support/Makefile.am:
6555 * src/support/lxtl.h: New file. Some helper macros for using XTL.
6557 * src/frontends/xforms/input_validators.[ch]: input filters and
6558 validators. These conrol what keys are valid in input boxes.
6559 Use them and write some more. Much better idea than waiting till
6560 after the user has pressed Ok to say that the input fields don't make
6563 * src/frontends/xforms/Makefile.am:
6564 * src/frontends/xforms/forms/form_print.fd:
6565 * src/frontends/xforms/forms/makefile:
6566 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
6567 new scheme. Still have to make sure I haven't missed anything from
6568 the current implementation.
6570 * src/Makefile.am, src/PrinterParams.h: New data store.
6572 * other files: Added a couple of copyright notices.
6574 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6576 * src/insets/insetbib.h: move Holder struct in public space.
6578 * src/frontends/include/DialogBase.h: use SigC:: only when
6579 SIGC_CXX_NAMESPACES is defined.
6580 * src/frontends/include/Dialogs.h: ditto.
6582 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
6584 * src/frontends/xforms/FormCopyright.[Ch]: do not
6585 mention SigC:: explicitely.
6587 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6589 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
6590 deals with testing KDE in main configure.in
6591 * configure.in: ditto.
6593 2000-02-22 Allan Rae <rae@lyx.org>
6595 * Lots of files: Merged from HEAD
6597 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
6598 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
6600 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
6602 * sigc++/: new minidist.
6604 2000-02-14 Allan Rae <rae@lyx.org>
6606 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
6608 2000-02-08 Juergen Vigna <jug@sad.it>
6610 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
6611 file for the buildin GUI builder of KDevelop of the copyright-dialog.
6613 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
6614 for this port and so it is much easier for other people to port
6615 dialogs in a common development environment.
6617 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
6618 the QT/KDE implementation.
6620 * src/frontends/kde/Dialogs.C:
6621 * src/frontends/kde/FormCopyright.C:
6622 * src/frontends/kde/FormCopyright.h:
6623 * src/frontends/kde/Makefile.am:
6624 * src/frontends/kde/formcopyrightdialog.C:
6625 * src/frontends/kde/formcopyrightdialog.h:
6626 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
6627 for the kde support of the Copyright-Dialog.
6629 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
6630 subdir-substitution instead of hardcoded 'xforms' as we now have also
6633 * src/frontends/include/DialogBase.h (Object): just commented the
6634 label after #endif (nasty warning and I don't like warnings ;)
6636 * src/main.C (main): added KApplication initialization if using
6639 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
6640 For now only the KDE event-loop is added if frontend==kde.
6642 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
6644 * configure.in: added support for the --with-frontend[=value] option
6646 * autogen.sh: added kde.m4 file to list of config-files
6648 * acconfig.h: added define for KDEGUI-support
6650 * config/kde.m4: added configuration functions for KDE-port
6652 * config/lyxinclude.m4: added --with-frontend[=value] option with
6653 support for xforms and KDE.
6655 2000-02-08 Allan Rae <rae@lyx.org>
6657 * all Makefile.am: Fixed up so the make targets dist, distclean,
6658 install and uninstall all work even if builddir != srcdir. Still
6659 have a new sigc++ minidist update to come.
6661 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
6663 2000-02-01 Allan Rae <rae@lyx.org>
6665 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
6666 Many mods to get builddir != srcdir working.
6668 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
6669 for building on NT and so we can do the builddir != srcdir stuff.
6671 2000-01-30 Allan Rae <rae@lyx.org>
6673 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
6674 This will stay in "rae" branch. We probably don't really need it in
6675 the main trunk as anyone who wants to help programming it should get
6676 a full library installed also. So they can check both included and
6677 system supplied library compilation.
6679 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
6680 Added a 'mini' distribution of libsigc++. If you feel the urge to
6681 change something in these directories - Resist it. If you can't
6682 resist the urge then you should modify the following script and rebuild
6683 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
6684 all happen. Still uses a hacked version of libsigc++'s configure.in.
6685 I'm quite happy with the results. I'm not sure the extra work to turn
6686 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
6687 worth the trouble and would probably lead to extra maintenance
6689 I haven't tested the following important make targets: install, dist.
6690 Not ready for prime time but very close. Maybe 1.1.5.
6692 * development/tools/makeLyXsigc.sh: A shell script to automatically
6693 generate our mini-dist of libsigc++. It can only be used with a CVS
6694 checkout of libsigc++ not a tarball distribution. It's well commented.
6695 This will end up as part of the libsigc++ distribution so other apps
6696 can easily have an included mini-dist. If someone makes mods to the
6697 sigc++ subpackage without modifying this script to generate those
6698 changes I'll be very upset!
6700 * src/frontends/: Started the gui/system indep structure.
6702 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
6703 to access the gui-indep dialogs are in this class. Much improved
6704 design compared to previous revision. Lars, please refrain from
6705 moving this header into src/ like you did with Popups.h last time.
6707 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
6709 * src/frontends/xforms/: Started the gui-indep system with a single
6710 dialog: FormCopyright. Initial testing of use of libsigc++ was very
6713 * src/frontends/xforms/forms: Repository for the xforms .fd files.
6714 Here you'll find a very useful makefile and automated fdfix.sh that
6715 makes updating dailogs a no-brainer -- provided you follow the rules
6716 set out in the README. I'm thinking about adding another script to
6717 automatically generate skeleton code for a new dialog given just the
6720 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
6721 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
6722 Made FormCopyright gui-indep and added a lyxfunc to get to it.
6724 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6726 * src/support/LSubstring.C (operator): simplify
6728 * src/lyxtext.h: removed bparams, use buffer_->params instead
6730 * src/lyxrow.h: make Row a real class, move all variables to
6731 private and use accessors.
6733 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
6735 (isRightToLeftPar): ditto
6736 (ChangeLanguage): ditto
6737 (isMultiLingual): ditto
6740 (SimpleTeXOnePar): ditto
6741 (TeXEnvironment): ditto
6742 (GetEndLabel): ditto
6744 (SetOnlyLayout): ditto
6745 (BreakParagraph): ditto
6746 (BreakParagraphConservative): ditto
6747 (GetFontSettings): ditto
6749 (CopyIntoMinibuffer): ditto
6750 (CutIntoMinibuffer): ditto
6751 (PasteParagraph): ditto
6752 (SetPExtraType): ditto
6753 (UnsetPExtraType): ditto
6754 (DocBookContTableRows): ditto
6755 (SimpleDocBookOneTablePar): ditto
6757 (TeXFootnote): ditto
6758 (SimpleTeXOneTablePar): ditto
6759 (TeXContTableRows): ditto
6760 (SimpleTeXSpecialChars): ditto
6763 * src/lyxcursor.h: make LyXCursor a real class, move all variables
6764 to private and use accessors.
6766 * src/lyx_cb.C: remove char updatetimer, and all code that uses
6767 this, we did not use it anymore and has not been for ages. Just a
6768 waste of cpu cycles.
6770 * src/language.h: make Language a real class, move all variables
6771 to private and use accessors.
6773 * src/BufferView_pimpl.C (Pimpl): use new timer code.
6774 (create_view): remove
6775 (update): some changes for new timer
6776 (cursorToggle): use new timer
6777 (beforeChange): change for new timer
6779 * src/BufferView.h (cursorToggleCB): removed last paramter because
6782 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
6783 (cursorToggleCB): change because of new timer code
6785 * lib/CREDITS: updated own mailaddress
6787 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6789 * src/support/filetools.C (PutEnv): fix the code in case neither
6790 putenv() nor setenv() have been found.
6792 * INSTALL: mention the install-strip Makefile target.
6794 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
6795 read-only documents.
6797 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6799 * lib/reLyX/configure.in (VERSION): avoid using a previously
6800 generated reLyX wrapper to find out $prefix.
6802 * lib/examples/eu_adibide_lyx-atua.lyx:
6803 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
6804 translation of the Tutorial (Dooteo)
6806 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
6808 * forms/cite.fd: new citation dialog
6810 * src/insetcite.[Ch]: the new citation dialog is moved into
6813 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
6816 * src/insets/insetcommand.h: data members made private.
6818 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6820 * LyX 1.1.5 released
6822 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6824 * src/version.h (LYX_RELEASE): to 1.1.5
6826 * src/spellchecker.C (RunSpellChecker): return false if the
6827 spellchecker dies upon creation.
6829 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6831 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
6832 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
6836 * lib/CREDITS: update entry for Martin Vermeer.
6838 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
6840 * src/text.C (draw): Draw foreign language bars at the bottom of
6841 the row instead of at the baseline.
6843 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
6845 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6847 * lib/bind/de_menus.bind: updated
6849 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6851 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
6853 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6855 * src/menus.C (Limit_string_length): New function
6856 (ShowTocMenu): Limit the number of items/length of items in the
6859 * src/paragraph.C (String): Correct result for a paragraph inside
6862 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6864 * src/bufferlist.C (close): test of buf->getuser() == NULL
6866 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
6868 * src/BufferView2.C (removeAutoInsets): Fix a bug:
6869 Do not call to SetCursor when the paragraph is a closed footnote!
6871 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
6873 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
6876 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
6878 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6881 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
6882 reference popup, that activates the reference-back action
6884 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
6886 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
6887 the menus. Also fixed a bug.
6889 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
6890 the math panels when switching buffers (unless new buffer is readonly).
6892 * src/BufferView.C (NoSavedPositions)
6893 * src/BufferView_pimpl.C (NoSavedPositions): New methods
6895 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6897 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
6898 less of dvi dirty or not.
6900 * src/trans_mgr.[Ch] (insert): change first parameter to string
6903 * src/chset.[Ch] (encodeString): add const to first parameter
6905 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6907 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
6911 * src/LaTeX.C (deplog): better searching for dependency files in
6912 the latex log. Uses now regexps.
6914 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
6915 instead of the box hack or \hfill.
6917 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6919 * src/lyxfunc.C (doImportHelper): do not create the file before
6920 doing the actual import.
6921 (doImportASCIIasLines): create a new file before doing the insert.
6922 (doImportASCIIasParagraphs): ditto.
6924 * lib/lyxrc.example: remove mention of non-existing commands
6926 * lyx.man: remove mention of color-related switches.
6928 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
6930 * src/lyx_gui.C: remove all the color-related ressources, which
6931 are not used anymore.
6933 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
6936 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6938 * src/lyxrc.C (read): Add a missing break in the switch
6940 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
6942 * src/text2.C (InsertStringA): Fix a bug with insertion into table
6944 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
6947 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6949 * src/text.C (draw): draw bars under foreign language words.
6951 * src/LColor.[Ch]: add LColor::language
6953 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6955 * src/lyxcursor.h (boundary): New member variable
6957 * src/text.C (IsBoundary): New methods
6959 * src/text.C: Use the above for currect cursor movement when there
6960 is both RTL & LTR text.
6962 * src/text2.C: ditto
6964 * src/bufferview_funcs.C (ToggleAndShow): ditto
6966 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6968 * src/text.C (DeleteLineForward): set selection to true to avoid
6969 that DeleteEmptyParagraphMechanism does some magic. This is how it
6970 is done in all other functions, and seems reasonable.
6971 (DeleteWordForward): do not jump over non-word stuff, since
6972 CursorRightOneWord() already does it.
6974 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
6975 DeleteWordBackward, since they seem safe to me (since selection is
6976 set to "true") DeleteEmptyParagraphMechanism does nothing.
6978 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6980 * src/lyx_main.C (easyParse): simplify the code by factoring the
6981 part that removes parameters from the command line.
6982 (LyX): check wether wrong command line options have been given.
6984 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
6986 * src/lyx_main.C : add support for specifying user LyX
6987 directory via command line option -userdir.
6989 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
6991 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
6992 the number of items per popup.
6993 (Add_to_refs_menu): Ditto.
6995 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6997 * src/lyxparagraph.h: renamed ClearParagraph() to
6998 StripLeadingSpaces() and moved it to paragraph.C. We pass the
6999 textclass as parameter, and do nothing if free_spacing is
7000 true. This fixes part of the line-delete-forward problems.
7002 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
7003 (pasteSelection): ditto.
7004 (SwitchLayoutsBetweenClasses): more translatable strings.
7006 * src/text2.C (CutSelection): use StripLeadingSpaces.
7007 (PasteSelection): ditto.
7008 (DeleteEmptyParagraphMechanism): ditto.
7010 2000-05-26 Juergen Vigna <jug@sad.it>
7012 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
7013 is not needed in tabular insets.
7015 * src/insets/insettabular.C (TabularFeatures): added missing features.
7017 * src/tabular.C (DeleteColumn):
7019 (AppendRow): implemented this functions
7020 (cellsturct::operator=): clone the inset too;
7022 2000-05-23 Juergen Vigna <jug@sad.it>
7024 * src/insets/insettabular.C (LocalDispatch): better selection support
7025 when having multicolumn-cells.
7027 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7029 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
7031 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7033 * src/ColorHandler.C (getGCForeground): put more test into _()
7035 * lib/examples/eu_splash.lyx: new file (Basque translation) from
7038 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
7041 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
7043 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
7044 there are no labels, or when buffer is readonly.
7046 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
7047 there are no labels, buffer is SGML, or when buffer is readonly.
7049 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7051 * src/LColor.C (LColor): change a couple of grey40 to grey60
7052 (LColor): rewore initalization to make compiles go some magnitude
7054 (getGUIName): don't use gettext until we need the string.
7056 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
7058 * src/Bullet.[Ch]: Fixed a small bug.
7060 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
7062 * src/paragraph.C (String): Several fixes/improvements
7064 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
7066 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7068 * src/paragraph.C (String): give more correct output.
7070 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
7072 * src/lyxfont.C (stateText) Do not output the language if it is
7073 eqaul to the language of the document.
7075 * src/paragraph.C (TeXOnePar): Do not put language switch commands
7076 between two paragraphs with the same language.
7078 * src/paragraph.C (getParLanguage) Return a correct answer for an
7079 empty dummy paragraph.
7081 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
7084 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
7087 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
7088 the menus/popup, if requested fonts are unavailable.
7090 2000-05-22 Juergen Vigna <jug@sad.it>
7092 * src/insets/insettabular.C (LocalDispatch): added some more cursor
7093 movement support (Up/Down/Tab/Shift-Tab).
7094 (LocalDispatch): added also preliminari cursor-selection.
7096 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
7098 * src/paragraph.C (PasteParagraph): Hopefully now right!
7100 2000-05-22 Garst R. Reese <reese@isn.net>
7102 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
7103 of list, change all references to Environment to Command
7104 * tex/hollywood.cls : rewrite environments as commands, add
7105 \uppercase to interiorshot and exteriorshot to force uppecase.
7106 * tex/broadway.cls : rewrite environments as commands. Tweak
7109 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7111 * src/menus.C (Add_to_toc_menu): fix the code which limits the
7112 size of items: use a constant intead of the hardcoded 40, and more
7113 importantly do not remove the %m and %x tags added at the end.
7114 (Add_to_refs_menu): use vector::size_type instead of
7115 unsigned int as basic types for the variables. _Please_ do not
7116 assume that size_t is equal to unsigned int. On an alpha, this is
7117 unsigned long, which is _not_ the same.
7119 * src/language.C (initL): remove language "hungarian", since it
7120 seems that "magyar" is better.
7122 2000-05-22 Juergen Vigna <jug@sad.it>
7124 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
7126 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
7129 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
7130 next was deleted but not set to 0.
7132 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7134 * src/language.C (initL): change the initialization of languages
7135 so that compiles goes _fast_.
7137 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
7140 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
7142 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7146 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7148 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
7150 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
7154 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
7157 * src/insets/insetlo*.[Ch]: Made editable
7159 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7161 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
7162 the current selection.
7164 * src/BufferView_pimpl.C (stuffClipboard): new method
7166 * src/BufferView.C (stuffClipboard): new method
7168 * src/paragraph.C (String): new method
7170 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
7171 LColor::ignore when lyxname is not found.
7173 * src/BufferView.C (pasteSelection): new method
7175 * src/BufferView_pimpl.C (pasteSelection): new method
7177 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
7179 * src/WorkArea.C (request_clipboard_cb): new static function
7180 (getClipboard): new method
7181 (putClipboard): new method
7183 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7185 * LyX 1.1.5pre2 released
7187 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7189 * src/vspace.C (operator=): removed
7190 (operator=): removed
7192 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
7194 * src/layout.C (NumberOfClass): manually set the type in make_pair
7195 (NumberOfLayout): ditto
7197 * src/language.C: use the Language constructor for ignore_lang
7199 * src/language.h: add constructors to struct Language
7201 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
7203 * src/text2.C (SetCursorIntern): comment out #warning
7205 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
7207 * src/mathed/math_iter.h: initialize sx and sw to 0
7209 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7211 * forms/lyx.fd: Redesign of form_ref
7213 * src/LaTeXFeatures.[Ch]
7217 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
7220 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
7221 and Buffer::inset_iterator.
7223 * src/menus.C: Added new menus: TOC and Refs.
7225 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
7227 * src/buffer.C (getTocList): New method.
7229 * src/BufferView2.C (ChangeRefs): New method.
7231 * src/buffer.C (getLabelList): New method. It replaces the old
7232 getReferenceList. The return type is vector<string> instead of
7235 * src/insets/insetinclude.C (getLabelList): New method. Replaces
7236 the old getLabel() and GetNumberOfLabels() methods.
7237 * src/insets/insetlabel.C (getLabelList): ditto
7238 * src/mathed/formula.C (getLabelList): ditto
7240 * src/paragraph.C (String): New method.
7242 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
7243 Uses the new getTocList() method.
7244 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
7245 which automatically updates the contents of the browser.
7246 (RefUpdateCB): Use the new getLabelList method.
7248 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
7250 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
7252 * src/spellchecker.C: Added using std::reverse;
7254 2000-05-19 Juergen Vigna <jug@sad.it>
7256 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
7258 * src/insets/insettext.C (computeTextRows): small fix for display of
7259 1 character after a newline.
7261 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
7264 2000-05-18 Juergen Vigna <jug@sad.it>
7266 * src/insets/insettabular.C (TabularFeatures): fixed update of display
7267 when changing width of column.
7269 * src/tabular.C (set_row_column_number_info): setting of
7270 autobreak rows if necessary.
7272 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7274 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
7276 * src/vc-backend.*: renamed stat() to status() and vcstat to
7277 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
7278 compilation broke. The new name seems more relevant, anyway.
7280 2000-05-17 Juergen Vigna <jug@sad.it>
7282 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
7283 which was wrong if the removing caused removing of rows!
7285 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
7286 (pushToken): new function.
7288 * src/text2.C (CutSelection): fix problem discovered with purify
7290 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7292 * src/debug.C (showTags): enlarge the first column, now that we
7293 have 6-digits debug codes.
7295 * lib/layouts/hollywood.layout:
7296 * lib/tex/hollywood.cls:
7297 * lib/tex/brodway.cls:
7298 * lib/layouts/brodway.layout: more commands and fewer
7299 environments. Preambles moved in the .cls files. Broadway now has
7300 more options on scene numbering and less whitespace (from Garst)
7302 * src/insets/insetbib.C (getKeys): make sure that we are in the
7303 document directory, in case the bib file is there.
7305 * src/insets/insetbib.C (Latex): revert bogus change.
7307 2000-05-16 Juergen Vigna <jug@sad.it>
7309 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
7310 the TabularLayout on cursor move.
7312 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
7314 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
7317 (draw): fixed cursor position and drawing so that the cursor is
7318 visible when before the tabular-inset.
7320 * src/insets/insettext.C (init): drawLockedFrame was not initialized
7321 when creating from old insettext.
7323 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
7325 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7327 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
7328 * lib/tex/brodway.cls: ditto
7330 * lib/layouts/brodway.layout: change alignment of parenthical
7333 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7335 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
7336 versions 0.88 and 0.89 are supported.
7338 2000-05-15 Juergen Vigna <jug@sad.it>
7340 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
7343 * src/insets/insettext.C (computeTextRows): redone completely this
7344 function in a much cleaner way, because of problems when having a
7346 (draw): added a frame border when the inset is locked.
7347 (SetDrawLockedFrame): this sets if we draw the border or not.
7348 (SetFrameColor): this sets the frame color (default=insetframe).
7350 * src/insets/lyxinset.h: added x() and y() functions which return
7351 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
7352 function which is needed to see if we have a locking inset of some
7353 type in this inset (needed for now in insettabular).
7355 * src/vspace.C (inPixels): the same function also without a BufferView
7356 parameter as so it is easier to use it in some ocasions.
7358 * src/lyxfunc.C: changed all places where insertInset was used so
7359 that now if it couldn't be inserted it is deleted!
7361 * src/TabularLayout.C:
7362 * src/TableLayout.C: added support for new tabular-inset!
7364 * src/BufferView2.C (insertInset): this now returns a bool if the
7365 inset was really inserted!!!
7367 * src/tabular.C (GetLastCellInRow):
7368 (GetFirstCellInRow): new helper functions.
7369 (Latex): implemented for new tabular class.
7373 (TeXTopHLine): new Latex() helper functions.
7375 2000-05-12 Juergen Vigna <jug@sad.it>
7377 * src/mathed/formulamacro.C (Read):
7378 * src/mathed/formula.C (Read): read also the \end_inset here!
7380 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7382 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
7383 crush when saving formulae with unbalanced parenthesis.
7385 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
7387 * src/layout.C: Add new keyword "endlabelstring" to layout file
7389 * src/text.C (GetVisibleRow): Draw endlabel string.
7391 * lib/layouts/broadway.layout
7392 * lib/layouts/hollywood.layout: Added endlabel for the
7393 Parenthetical layout.
7395 * lib/layouts/heb-article.layout: Do not use slanted font shape
7396 for Theorem like environments.
7398 * src/buffer.C (makeLaTeXFile): Always add "american" to
7399 the UsedLanguages list if document language is RTL.
7401 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7403 * add addendum to README.OS2 and small patch (from SMiyata)
7405 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7407 * many files: correct the calls to ChangeExtension().
7409 * src/support/filetools.C (ChangeExtension): remove the no_path
7410 argument, which does not belong there. Use OnlyFileName() instead.
7412 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
7413 files when LaTeXing a non-nice latex file.
7415 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
7416 a chain of "if". Return false when deadkeys are not handled.
7418 * src/lyx_main.C (LyX): adapted the code for default bindings.
7420 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
7421 bindings for basic functionality (except deadkeys).
7422 (deadKeyBindings): new method. Performs the bindings of deadkeys.
7424 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
7425 several methods: handle override_x_deadkeys.
7427 * src/lyxrc.h: remove the "bindings" map, which did not make much
7428 sense anyway. New variable override_x_deadkeys, defaulting to "true".
7430 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7432 * src/lyxfont.C (stateText): use a saner method to determine
7433 whether the font is "default". Seems to fix the crash with DEC
7436 * src/Bullet.[Ch] (Bullet): remove const on parameters.
7438 2000-05-08 Juergen Vigna <jug@sad.it>
7440 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
7441 TabularLayoutMenu with mouse-button-3
7442 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
7444 * src/TabularLayout.C: added this file for having a Layout for
7447 2000-05-05 Juergen Vigna <jug@sad.it>
7449 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
7450 recalculating inset-widths.
7451 (TabularFeatures): activated this function so that I can change
7452 tabular-features via menu.
7454 * src/menus.C (ShowEditMenu): inserted support for insettabular so
7455 that I can test some functions with the Table menu.
7457 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7459 * src/lyxfont.C (stateText): guard against stupid c++libs.
7461 * src/tabular.C: add using std::vector
7462 some whitespace changes, + removed som autogenerated code.
7464 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
7466 2000-05-05 Juergen Vigna <jug@sad.it>
7468 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
7469 row, columns and cellstructures.
7471 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7473 * lib/lyxrc.example: remove obsolete entries.
7475 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
7476 reading of protected_separator for free_spacing.
7478 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7480 * src/text.C (draw): do not display an exclamation mark in the
7481 margin for margin notes. This is confusing, ugly and
7484 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
7485 AMS math' is checked.
7487 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
7488 name to see whether including the amsmath package is needed.
7490 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
7492 * src/paragraph.C (validate): Compute UsedLanguages correctly
7493 (don't insert the american language if it doesn't appear in the
7496 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
7497 The argument of \thanks{} command is considered moving argument
7499 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
7502 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
7504 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
7505 for appendix/minipage/depth. The lines can be now both in the footnote
7506 frame, and outside the frame.
7508 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
7511 2000-05-05 Juergen Vigna <jug@sad.it>
7513 * src/table.[Ch]: removed the inset and buffer stuff as this is now
7514 neede only in tabular.[Ch].
7516 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7518 * src/insets/insetspecialchar.C (Read): allow command == '~' for
7520 (Write): write '~' for PROTECTED_SEPARATOR
7522 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7524 * src/lyxparagraph.h: add a friend struct matchIT after the struct
7527 * src/mathed/formula.C (drawStr): rename size to siz.
7529 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
7530 possibly fix a bug by not changing the pflags = flags to piflags =
7533 2000-05-05 Juergen Vigna <jug@sad.it>
7535 * src/insets/insetbib.C: moved using directive
7537 * src/ImportNoweb.C: small fix for being able to compile (missing
7540 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7542 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
7543 to use clear, since we don't depend on this in the code. Add test
7546 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7548 * (various *.C files): add using std::foo directives to please dec
7551 * replace calls to string::clear() to string::erase() (Angus)
7553 * src/cheaders/cmath: modified to provide std::abs.
7555 2000-05-04 Juergen Vigna <jug@sad.it>
7557 * src/insets/insettext.C: Prepared all for inserting of multiple
7558 paragraphs. Still display stuff to do (alignment and other things),
7559 but I would like to use LyXText to do this when we cleaned out the
7560 table-support stuff.
7562 * src/insets/insettabular.C: Changed lot of stuff and added lots
7563 of functionality still a lot to do.
7565 * src/tabular.C: Various functions changed name and moved to be
7566 const functions. Added new Read and Write functions and changed
7567 lots of things so it works good with tabular-insets (also removed
7568 some stuff which is not needed anymore * hacks *).
7570 * src/lyxcursor.h: added operators == and != which just look if
7571 par and pos are (not) equal.
7573 * src/buffer.C (latexParagraphs): inserted this function to latex
7574 all paragraphs form par to endpar as then I can use this too for
7577 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
7578 so that I can call this to from text insets with their own cursor.
7580 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
7581 output off all paragraphs (because of the fix below)!
7583 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
7584 the very last paragraph (this could be also the last paragraph of an
7587 * src/texrow.h: added rows() call which returns the count-variable.
7589 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7591 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
7593 * lib/configure.m4: better autodetection of DocBook tools.
7595 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7597 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
7599 * src/lyx_cb.C: add using std::reverse;
7601 * src/LaTeX.C (run): on error always run deleteFilesOnError before
7604 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
7605 selected files. Should fix repeated errors from generated files.
7607 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
7609 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
7611 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
7612 the spellchecker popup.
7614 * lib/lyxrc.example: Removed the \number_inset section
7616 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7618 * src/insets/figinset.C (various): Use IsFileReadable() to make
7619 sure that the file actually exist. Relying on ghostscripts errors
7620 is a bad idea since they can lead to X server crashes.
7622 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
7624 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
7627 * lib/lyxrc.example: smallish typo in description of
7628 \view_dvi_paper_option
7630 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7633 * src/lyxfunc.C: doImportHelper to factor out common code of the
7634 various import methods. New functions doImportASCIIasLines,
7635 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
7636 doImportLinuxDoc for the format specific parts.
7639 * buffer.C: Dispatch returns now a bool to indicate success
7642 * lyx_gui.C: Add getLyXView() for member access
7644 * lyx_main.C: Change logic for batch commands: First try
7645 Buffer::Dispatch (possibly without GUI), if that fails, use
7648 * lyx_main.C: Add support for --import command line switch.
7649 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
7650 Available Formats: Everything accepted by 'buffer-import <format>'
7652 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7654 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
7657 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
7658 documents will be reformatted upon reentry.
7660 2000-04-27 Juergen Vigna <jug@sad.it>
7662 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
7663 correctly only last pos this was a bug.
7665 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7667 * release of lyx-1.1.5pre1
7669 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7671 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
7673 * src/menus.C: revert the change of naming (Figure->Graphic...)
7674 from 2000-04-11. It was incomplete and bad.
7676 * src/LColor.[Ch]: add LColor::depthbar.
7677 * src/text.C (GetVisibleRow): use it.
7679 * README: update the languages list.
7681 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7683 * src/text.C (GetVisibleRow): show the depth of paragraphs using
7686 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7688 * README: remove sections that were just wrong.
7690 * src/text2.C (GetRowNearY): remove currentrow code
7692 * src/text.C (GetRow): remove currentrow code
7694 * src/screen.C (Update): rewritten a bit.
7695 (SmallUpdate): removed func
7697 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
7699 (FullRebreak): return bool
7700 (currentrow): remove var
7701 (currentrow_y): ditto
7703 * src/lyxscreen.h (Draw): change arg to unsigned long
7704 (FitCursor): return bool
7705 (FitManualCursor): ditto
7706 (Smallpdate): remove func
7707 (first): change to unsigned long
7708 (DrawOneRow): change second arg to long (from long &)
7709 (screen_refresh_y): remove var
7710 (scree_refresh_row): ditto
7712 * src/lyxrow.h: change baseline to usigned int from unsigned
7713 short, this brings some implicit/unsigned issues out in the open.
7715 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
7717 (Dispatch): don't call updateScrollbar after fitCursor. Use update
7718 instead of smallUpdate.
7720 * src/lyxcursor.h: change y to unsigned long
7722 * src/buffer.h: don't call updateScrollbar after fitcursor
7724 * src/buffer.C (parseSingleLyXformat2Token): move variables to
7725 where they are used. Removed "\\direction", this was not present
7726 in 1.1.4 and is already obsolete. Commented out some code that I
7727 believe to never be called.
7728 (runLiterate): don't call updateScrollbar after fitCursor
7730 (buildProgram): ditto
7733 * src/WorkArea.h (workWidth): change return val to unsigned
7736 (redraw): remove the button redraws
7737 (setScrollbarValue): change for scrollbar
7738 (getScrollbarValue): change for scrollbar
7739 (getScrollbarBounds): change for scrollbar
7741 * src/WorkArea.C (C_WorkArea_up_cb): removed func
7742 (C_WorkArea_down_cb): removed func
7743 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
7744 (resize): change for scrollbar
7745 (setScrollbar): ditto
7746 (setScrollbarBounds): ditto
7747 (setScrollbarIncrements): ditto
7748 (up_cb): removed func
7749 (down_cb): removed func
7750 (scroll_cb): change for scrollbar
7751 (work_area_handler): ditto
7753 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
7754 when FitCursor did something.
7755 (updateScrollbar): some unsigned changes
7756 (downCB): removed func
7757 (scrollUpOnePage): removed func
7758 (scrollDownOnePage): remvoed func
7759 (workAreaMotionNotify): don't call screen->FitCursor but use
7760 fitCursor instead. and bool return val
7761 (workAreaButtonPress): ditto
7762 (workAreaButtonRelease): some unsigned changes
7763 (checkInsetHit): ditto
7764 (workAreaExpose): ditto
7765 (update): parts rewritten, comments about the signed char arg added
7766 (smallUpdate): removed func
7767 (cursorPrevious): call needed updateScrollbar
7770 * src/BufferView2.C (allFloats): don't call updateScrollbar after
7773 * src/BufferView.[Ch] (upCB): removed func
7774 (downCB): removed func
7775 (smallUpdate): removed func
7777 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7779 * src/lyxtext.h src/text.C src/text2.C: removed support for the
7780 currentrow, currentrow_y optimization. This did not help a lot and
7781 if we want to do this kind of optimization we should rather use
7782 cursor.row instead of the currentrow.
7784 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
7785 buffer spacing and klyx spacing support.
7787 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7789 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
7792 2000-04-26 Juergen Vigna <jug@sad.it>
7794 * src/insets/figinset.C: fixes to Lars sstream changes!
7796 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
7798 * A lot of files: Added Ascii(ostream &) methods to all inset
7799 classes. Used when exporting to ASCII.
7801 * src/buffer.C (writeFileAscii,RoffAsciiTable)
7802 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
7805 * src/text2.C (ToggleFree): Disabled implicit word selection when
7806 there is a change in the language
7808 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
7809 no output was generated for end-of-sentence inset.
7811 * src/insets/lyxinset.h
7814 * src/paragraph.C: Removed the insetnumber code
7816 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
7818 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7820 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
7821 no_babel and no_epsfig completely from the file.
7822 (parseSingleLyXformat2Token): add handling for per-paragraph
7823 spacing as written by klyx.
7825 * src/insets/figinset.C: applied patch by Andre. Made it work with
7828 2000-04-20 Juergen Vigna <jug@sad.it>
7830 * src/insets/insettext.C (cutSelection):
7831 (copySelection): Fixed with selection from right to left.
7832 (draw): now the rows are not recalculated at every draw.
7833 (computeTextRows): for now reset the inset-owner here (this is
7834 important for an undo or copy where the inset-owner is not set
7837 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
7838 motion to the_locking_inset screen->first was forgotten, this was
7839 not important till we got multiline insets.
7841 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7843 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
7844 code seems to be alright (it is code changed by Dekel, and the
7845 intent is indeed that all macros should be defined \protect'ed)
7847 * NEWS: a bit of reorganisation of the new user-visible features.
7849 2000-04-19 Juergen Vigna <jug@sad.it>
7851 * src/insets/insettext.C (init): using a LyXCursor now for cursor
7852 position. Set the inset_owner of the used paragraph so that it knows
7853 that it is inside an inset. Fixed cursor handling with mouse and
7854 cursor keys. Fixed wrong timed inset redraws and lots of other changes
7855 and cleanups to make TextInsets work better.
7857 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
7858 Changed parameters of various functions and added LockInsetInInset().
7860 * src/insets/insettext.C:
7862 * src/insets/insetcollapsable.h:
7863 * src/insets/insetcollapsable.C:
7864 * src/insets/insetfoot.h:
7865 * src/insets/insetfoot.C:
7866 * src/insets/insetert.h:
7867 * src/insets/insetert.C: cleaned up the code so that it works now
7868 correctly with insettext.
7870 * src/insets/inset.C:
7871 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
7872 that insets in insets are supported right.
7875 * src/table.C: lots of changes for use with inset tabular (and cleanup)
7877 * src/paragraph.C: some small fixes
7879 * src/debug.h: inserted INSETS debug info
7881 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
7882 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
7884 * src/commandtags.h:
7885 * src/LyXAction.C: insert code for InsetTabular.
7887 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
7888 not Button1MotionMask.
7889 (workAreaButtonRelease): send always a InsetButtonRelease event to
7891 (checkInsetHit): some setCursor fixes (always with insets).
7893 * src/BufferView2.C (lockInset): returns a bool now and extended for
7894 locking insets inside insets.
7895 (showLockedInsetCursor): it is important to have the cursor always
7896 before the locked inset.
7897 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
7899 * src/BufferView.h: made lockInset return a bool.
7901 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
7903 * src/text2.C (SetCursor): This now has a version with a LyXCursor
7904 that is used also internally but can be called as public to have back
7905 a cursor pos which is not set internally.
7906 (SetCursorIntern): Changed to use above function.
7908 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
7910 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7915 * NEWS: updated for prerelease of 1.1.5. Please comment and send
7916 patches for things that should be in or should be changed.
7918 * src/* [insetfiles]: change "usigned char fragile" to bool
7919 fragile. There was only one point that could that be questioned
7920 and that is commented in formulamacro.C. Grep for "CHECK".
7922 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
7923 (DeleteBuffer): take it out of CutAndPaste and make it static.
7925 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7927 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
7928 output the spacing envir commands. Also the new commands used in
7929 the LaTeX output makes the result better.
7931 * src/Spacing.C (writeEnvirBegin): new method
7932 (writeEnvirEnd): new method
7934 2000-04-18 Juergen Vigna <jug@sad.it>
7936 * src/CutAndPaste.C: made textclass a static member of the class
7937 as otherwise it is not accesed right!!!
7939 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
7941 * forms/layout_forms.fd
7942 * src/layout_forms.h
7943 * src/layout_forms.C (create_form_form_character)
7944 * src/lyx_cb.C (UserFreeFont)
7945 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
7946 documents (in the layout->character popup).
7948 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7950 * src/spellchecker.C (create_ispell_pipe): fix a bug where
7951 \spell_command was in fact not honored (from Kevin Atkinson).
7953 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
7956 * src/lyx_gui.h: make lyxViews private (Angus)
7958 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
7960 * src/mathed/math_write.C
7961 (MathMatrixInset::Write) Put \protect before \begin{array} and
7962 \end{array} if fragile
7963 (MathParInset::Write): Put \protect before \\ if fragile
7965 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7967 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
7968 initialization if the LyXColorHandler must be done after the
7969 connections to the XServer has been established.
7971 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
7972 get the background pixel from the lyxColorhandler so that the
7973 figures are rendered with the correct background color.
7974 (NextToken): removed functions.
7975 (GetPSSizes): use ifs >> string instead of NextToken.
7977 * src/Painter.[Ch]: the color cache moved out of this file.
7979 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
7982 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7984 * src/WorkArea.C (work_area_handler): call BufferView::enterView
7985 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
7987 * src/BufferView.C (enterView): new func
7988 (leaveView): new func
7990 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
7992 (leaveView): new func, undefines xterm cursor when approp.
7994 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
7995 (AllowInput): delete the Workarea cursor handling from this func.
7997 * src/Painter.C (underline): draw a slimer underline in most cases.
7999 * src/lyx_main.C (error_handler): use extern "C"
8001 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8003 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
8004 sent directly to me.
8006 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
8007 to the list by Dekel.
8009 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
8012 * src/bufferview_funcs.[Ch]: two new files, moved several of the
8013 methods from lyx_cb.here.
8015 * src/lyx_cb.C: in addition to the above; removed input_prohibited
8018 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8020 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
8021 instead of using current_view directly.
8023 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
8025 * src/LyXAction.C (init): add the paragraph-spacing command.
8027 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
8029 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
8031 * src/lyx_cb.C (CurrentState): output a string when the spacing is
8032 different from the documents.
8034 * src/text.C (SetHeightOfRow): take paragraph spacing into
8035 account, paragraph spacing takes precedence over buffer spacing
8036 (GetVisibleRow): ditto
8038 * src/paragraph.C (writeFile): output the spacing parameter too.
8039 (validate): set the correct features if spacing is used in the
8041 (Clear): set spacing to default
8042 (MakeSameLayout): spacing too
8043 (HasSameLayout): spacing too
8044 (SetLayout): spacing too
8045 (TeXOnePar): output the spacing commands
8047 * src/lyxparagraph.h: added a spacing variable for use with
8048 per-paragraph spacing.
8050 * src/Spacing.h: add a Default spacing and a method to check if
8051 the current spacing is default. also added an operator==
8053 * src/text2.C (DeleteEmptyParagraphMechanism): added a
8056 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8058 * src/lyxserver.C (callback): fix dispatch of functions
8060 * src/insets/insetlatexaccent.C (checkContents): turn bogus
8061 printf() into lyxerr call.
8063 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
8066 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
8067 "Table" to "Table Box", "Float" to "Floating Material"; deletes
8068 the "Float" from each of the subitems.
8069 (ShowHelpMenu): add entry for "FAQ" and "TOC".
8071 * src/support/DebugStream.h: add an #ifdef to work around a gcc
8072 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
8073 documented the change so that the workaround can be nuked later.
8075 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
8078 * src/lyxlex_pimpl.C (next): do not re-declare the default value
8080 * src/buffer.C (getLatexName): ditto
8081 (setReadonly): ditto
8083 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8085 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
8086 avoid some uses of current_view. Added also a bufferParams()
8087 method to get at this.
8089 * src/lyxtext.h: changed params->buffer and paramters->bparams.
8091 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8093 * src/lyxparagraph.[Ch]: removed
8094 operator<(LyXParagraph::InsetTable..., added a struct matchIT
8095 with operators used by lower_bound and
8096 upper_bound in InsetTable's
8097 Make struct InsetTable private again. Used matchpos.
8099 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
8101 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
8102 document, the language of existing text is changed (unless the
8103 document is multi-lingual)
8105 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
8107 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
8109 * A lot of files: A rewrite of the Right-to-Left support.
8111 2000-04-10 Juergen Vigna <jug@sad.it>
8113 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
8114 misplaced cursor when inset in inset is locked.
8116 * src/insets/insettext.C (LocalDispatch): small fix so that a
8117 BREAKLINE is not inserted if we don't permit it with autBreakRows.
8119 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
8120 footnote font should be decreased in size twice when displaying.
8122 * src/insets/insettext.C (GetDrawFont): inserted this function as
8123 the drawing-font may differ from the real paragraph font.
8125 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
8126 insets (inset in inset!).
8128 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
8129 function here because we don't want footnotes inside footnotes.
8131 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
8133 (init): now set the inset_owner in paragraph.C
8134 (LocalDispatch): added some resetPos() in the right position
8137 (pasteSelection): changed to use the new CutAndPaste-Class.
8139 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
8140 which tells if it is allowed to insert another inset inside this one.
8142 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
8143 SwitchLayoutsBetweenClasses.
8145 * src/text2.C (InsertInset): checking of the new paragraph-function
8147 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
8148 is not needed anymore here!
8151 (PasteSelection): redone (also with #ifdef) so that now this uses
8152 the CutAndPaste-Class.
8153 (SwitchLayoutsBetweenClasses): removed here and implemented in the
8156 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
8157 from/to text/insets.
8159 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
8160 so that the paragraph knows if it is inside an (text)-inset.
8161 (InsertFromMinibuffer): changed return-value to bool as now it
8162 may happen that an inset is not inserted in the paragraph.
8163 (InsertInsetAllowed): this checks if it is allowed to insert an
8164 inset in this paragraph.
8166 (BreakParagraphConservative):
8167 (BreakParagraph) : small change for the above change of the return
8168 value of InsertFromMinibuffer.
8170 * src/lyxparagraph.h: added inset_owner and the functions to handle
8171 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
8173 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8175 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
8176 functions from BufferView to BufferView::Pimpl to ease maintence.
8178 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
8179 correctly. Also use SetCursorIntern instead of SetCursor.
8181 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
8184 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8186 * src/WorkArea.C (belowMouse): manually implement below mouse.
8188 * src/*: Add "explicit" on several constructors, I added probably
8189 some unneeded ones. A couple of changes to code because of this.
8191 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
8192 implementation and private parts from the users of BufferView. Not
8195 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
8196 implementation and private parts from the users of LyXLex. Not
8199 * src/BufferView_pimpl.[Ch]: new files
8201 * src/lyxlex_pimpl.[Ch]: new files
8203 * src/LyXView.[Ch]: some inline functions move out-of-line
8205 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8207 * src/lyxparagraph.h: make struct InsetTable public.
8209 * src/support/lyxstring.h: change lyxstring::difference_type to be
8210 ptrdiff_t. Add std:: modifiers to streams.
8212 * src/font.C: include the <cctype> header, for islower() and
8215 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8217 * src/font.[Ch]: new files. Contains the metric functions for
8218 fonts, takes a LyXFont as parameter. Better separation of concepts.
8220 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
8221 changes because of this.
8223 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
8225 * src/*: compile with -Winline and move functions that don't
8228 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
8231 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8233 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
8234 (various files changed because of this)
8236 * src/Painter.C (text): fixed the drawing of smallcaps.
8238 * src/lyxfont.[Ch] (drawText): removed unused member func.
8241 * src/*.C: added needed "using" statements and "std::" qualifiers.
8243 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
8245 * src/*.h: removed all use of "using" from header files use
8246 qualifier std:: instead.
8248 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8250 * src/text.C (Backspace): some additional cleanups (we already
8251 know whether cursor.pos is 0 or not).
8253 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
8254 automake does not provide one).
8256 * src/bmtable.h: replace C++ comments with C comments.
8258 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
8260 * src/screen.C (ShowCursor): Change the shape of the cursor if
8261 the current language is not equal to the language of the document.
8262 (If the cursor change its shape unexpectedly, then you've found a bug)
8264 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
8267 * src/insets/insetnumber.[Ch]: New files.
8269 * src/LyXAction.C (init)
8270 * src/lyxfunc.C (dispatch): Add command number-inset-insert
8273 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
8275 * src/lyxparagraph.h
8276 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
8277 (the vector is kept sorted).
8279 * src/text.C (GetVisibleRow): Draw selection correctly when there
8280 is both LTR and RTL text.
8282 * src/paragraph.C (Clone): Use the assignment operator for cloning,
8283 which is much faster.
8285 * src/text.C (GetVisibleRow and other): Do not draw the last space
8286 in a row if the direction of the last letter is not equal to the
8287 direction of the paragraph.
8289 * src/lyxfont.C (latexWriteStartChanges):
8290 Check that font language is not equal to basefont language.
8291 (latexWriteEndChanges): ditto
8293 * src/lyx_cb.C (StyleReset): Don't change the language while using
8294 the font-default command.
8296 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
8297 empty paragraph before a footnote.
8299 * src/insets/insetcommand.C (draw): Increase x correctly.
8301 * src/screen.C (ShowCursor): Change cursor shape if
8302 current language != document language.
8304 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
8306 2000-03-31 Juergen Vigna <jug@sad.it>
8308 * src/paragraph.C (GetInset): commented out text[pos] = ' '
8309 (Clone): changed mode how the paragraph-data is copied to the
8310 new clone-paragraph.
8312 * src/lyxfunc.C (Dispatch): fixed small problem when calling
8313 GetInset(pos) with no inset anymore there (in inset UNDO)
8315 * src/insets/insetcommand.C (draw): small fix as here x is
8316 incremented not as much as width() returns (2 before, 2 behind = 4)
8318 2000-03-30 Juergen Vigna <jug@sad.it>
8320 * src/insets/insettext.C (InsetText): small fix in initialize
8321 widthOffset (should not be done in the init() function)
8323 2000-03-29 Amir Karger <karger@lyx.org>
8325 * lib/examples/it_ItemizeBullets.lyx: translation by
8328 * Implemented \textasciitilde and fixed a tiny bug in reLyX
8330 2000-03-29 Juergen Vigna <jug@sad.it>
8332 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
8334 * src/insets/insetfoot.C (Clone): small change as for the below
8335 new init function in the text-inset
8337 * src/insets/insettext.C (init): new function as I've seen that
8338 clone did not copy the Paragraph-Data!
8339 (LocalDispatch): Added code so that now we have some sort of Undo
8340 functionality (well actually we HAVE Undo ;)
8342 * src/text.C (Backspace): Small fix for the a | a Backspace problem
8344 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
8346 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
8349 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8351 * src/main.C: added a runtime check that verifies that the xforms
8352 header used when building LyX and the library used when running
8353 LyX match. Exit with a message if they don't match. This is a
8354 version number check only.
8356 * src/buffer.C (save): Don't allocate memory on the heap for
8357 struct utimbuf times.
8359 * *: some using changes, use iosfwd instead of the real headers.
8361 * src/lyxfont.C use char const * instead of string for the static
8362 strings. Rewrite some functions to use sstream.
8364 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8366 * src/text.C (Backspace): hopefully fix the dreaded backaspace
8369 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8371 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
8372 of Geodesy (from Martin Vermeer)
8374 * lib/layouts/svjour.inc: include file for the Springer svjour
8375 class. It can be used to support journals other than JoG.
8377 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
8378 Miskiewicz <misiek@pld.org.pl>)
8379 * lib/reLyX/Makefile.am: ditto.
8381 2000-03-27 Juergen Vigna <jug@sad.it>
8383 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
8384 also some modifications with operations on selected text.
8386 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
8387 problems with clicking on insets (last famous words ;)
8389 * src/insets/insetcommand.C (draw):
8390 (width): Changed to have a bit of space before and after the inset so
8391 that the blinking cursor can be seen (otherwise it was hidden)
8393 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8395 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
8396 would not be added to the link list when an installed gettext (not
8397 part of libc) is found.
8399 2000-03-24 Juergen Vigna <jug@sad.it>
8401 * src/insets/insetcollapsable.C (Edit):
8402 * src/mathed/formula.C (InsetButtonRelease):
8403 (InsetButtonPress): fixed for new handling of ButtonPress/Release
8406 * src/BufferView.C (workAreaButtonPress):
8407 (workAreaButtonRelease):
8408 (checkInsetHit): Finally fixed the clicking on insets be handled
8411 * src/insets/insetert.C (Edit): inserted this call so that ERT
8412 insets work always with LaTeX-font
8414 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8416 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
8417 caused lyx to startup with no GUI in place, causing in a crash
8418 upon startup when called with arguments.
8420 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8422 * src/FontLoader.C: better initialization of dummyXFontStruct.
8424 2000-03-20 José Abílio Matos <jamatos@lyx.org>
8426 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
8427 for linuxdoc and docbook import and export format options.
8429 * lib/lyxrc.example Example of default values for the previous flags.
8431 * src/lyx_cb.C Use those flags instead of the hardwired values for
8432 linuxdoc and docbook export.
8434 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
8437 * src/menus.C Added menus entries for the new import/exports formats.
8439 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8441 * src/lyxrc.*: Added support for running without Gui
8444 * src/FontLoader.C: sensible defaults if no fonts are needed
8446 * src/lyx_cb.C: New function ShowMessage (writes either to the
8447 minibuffer or cout in case of no gui
8448 New function AskOverwrite for common stuff
8449 Consequently various changes to call these functions
8451 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
8452 wild guess at sensible screen resolution when having no gui
8454 * src/lyxfont.C: no gui, no fonts... set some defaults
8456 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8458 * src/LColor.C: made the command inset background a bit lighter.
8460 2000-03-20 Hartmut Goebel <goebel@noris.net>
8462 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
8463 stdstruct.inc. Koma-Script added some title elements which
8464 otherwise have been listed below "bibliography". This split allows
8465 adding title elements to where they belong.
8467 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
8468 define the additional title elements and then include
8471 * many other layout files: changed to include stdtitle.inc just
8472 before stdstruct.inc.
8474 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
8476 * src/buffer.C: (save) Added the option to store all backup files
8477 in a single directory
8479 * src/lyxrc.[Ch]: Added variable \backupdir_path
8481 * lib/lyxrc.example: Added descriptions of recently added variables
8483 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
8484 bibtex inset, not closing the bibtex popup when deleting the inset)
8486 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8488 * src/lyx_cb.C: add a couple using directives.
8490 2000-03-17 José Abílio Matos <jamatos@lyx.org>
8491 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
8492 import based on the filename.
8494 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
8495 file would be imported at start, if the filename where of a sgml file.
8497 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
8499 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
8501 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
8502 * src/lyxfont.h Replaced the member variable bits.direction by the
8503 member variable lang. Made many changes in other files.
8504 This allows having a multi-lingual document
8506 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
8507 that change the current language to <l>.
8508 Removed the command "font-rtl"
8510 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
8511 format for Hebrew documents)
8513 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
8514 When auto_mathmode is "true", pressing a digit key in normal mode
8515 will cause entering into mathmode.
8516 If auto_mathmode is "rtl" then this behavior will be active only
8517 when writing right-to-left text.
8519 * src/text2.C (InsertStringA) The string is inserted using the
8522 * src/paragraph.C (GetEndLabel) Gives a correct result for
8523 footnote paragraphs.
8525 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
8527 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8529 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
8530 front of PasteParagraph. Never insert a ' '. This should at least
8531 fix some cause for the segfaults that we have been experiencing,
8532 it also fixes backspace behaviour slightly. (Phu!)
8534 * src/support/lstrings.C (compare_no_case): some change to make it
8535 compile with gcc 2.95.2 and stdlibc++-v3
8537 * src/text2.C (MeltFootnoteEnvironment): change type o
8538 first_footnote_par_is_not_empty to bool.
8540 * src/lyxparagraph.h: make text private. Changes in other files
8542 (fitToSize): new function
8543 (setContentsFromPar): new function
8544 (clearContents): new function
8545 (SetChar): new function
8547 * src/paragraph.C (readSimpleWholeFile): deleted.
8549 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
8550 the file, just use a simple string instead. Also read the file in
8551 a more maintainable manner.
8553 * src/text2.C (InsertStringA): deleted.
8554 (InsertStringB): deleted.
8556 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8558 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
8559 RedoParagraphs from the doublespace handling part, just set status
8560 to NEED_MORE_REFRESH. Also don't update cursor position (should be
8561 done, but perhaps not like this.)
8563 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8565 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
8566 character when inserting an inset.
8568 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8570 * src/bufferparams.C (readLanguage): now takes "default" into
8573 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
8574 also initialize the toplevel_keymap with the default bindings from
8577 * src/buffer.C (Buffer): remove lyxrc from the parameters.
8579 * all files using lyxrc: have lyxrc as a real variable and not a
8580 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
8583 * src/lyxrc.C: remove double call to defaultKeyBindings
8585 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
8586 toolbar defauls using lyxlex. Remove enums, structs, functions
8589 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
8590 toolbar defaults. Also store default keybindings in a map.
8592 * src/ToolbarDefaults.[Ch]: New file. This class is used for
8593 storing the toolbar defaults without any xforms dependencies.
8595 * src/insets/figinset.C: patch posted to list by Andre Poenitz
8596 applied. Changed to use iterators.
8598 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8600 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
8601 systems that don't have LINGUAS set to begin with.
8603 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8605 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
8606 the list by Dekel Tsur.
8608 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8610 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
8611 * src/insets/form_graphics.C: ditto.
8613 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
8615 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8617 * src/bufferparams.C (readLanguage): use the new language map
8619 * src/intl.C (InitKeyMapper): use the new language map
8621 * src/lyx_gui.C (create_forms): use the new language map
8623 * src/language.[Ch]: New files. Used for holding the information
8624 about each language. Now! Use this new language map enhance it and
8625 make it really usable for our needs.
8627 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
8629 * screen.C (ShowCursor): Removed duplicate code.
8630 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
8631 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
8633 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
8636 * src/text.C Added TransformChar method. Used for rendering Arabic
8637 text correctly (change the glyphs of the letter according to the
8638 position in the word)
8643 * src/lyxrc.C Added lyxrc command {language_command_begin,
8644 language_command_end,language_command_ltr,language_command_rtl,
8645 language_package} which allows the use of either arabtex or Omega
8648 * src/lyx_gui.C (init)
8650 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
8651 to use encoding for menu fonts which is different than the encoding
8654 * src/buffer.C (makeLaTeXFile): If params.language = "default",
8655 do not load the babel package.
8656 To write an English document with Hebrew/Arabic, change the document
8657 language to "english".
8659 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
8660 (alphaCounter): changed to return char
8661 (loweralphaCounter, hebrewCounter, romanCounter): New functions
8663 * lib/lyxrc.example Added examples for Hebrew/Arabic
8666 * src/layout.C Added layout command endlabeltype
8668 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
8670 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
8672 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8674 * src/mathed/math_delim.C (search_deco): return a
8675 math_deco_struct* instead of index.
8677 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8679 * All files with a USE_OSTREAM_ONLY within: removed all code that
8680 was unused when USE_OSTREAM_ONLY is defined.
8682 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
8683 of any less. Removed header and using.
8685 * src/text.C (GetVisibleRow): draw the string "Page Break
8686 (top/bottom)" on screen when drawing a pagebreak line.
8688 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8690 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
8692 * src/mathed/math_macro.C (draw): do some cast magic.
8695 * src/mathed/math_defs.h: change byte* argument to byte const*.
8697 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
8699 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
8700 know it is right to return InsetFoot* too, but cxx does not like
8703 * src/insets/insetcollapsable.[Ch] (Clone): make const.
8705 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
8707 * src/mathed/math_delim.C: change == to proper assignment.
8709 2000-03-09 Juergen Vigna <jug@sad.it>
8711 * src/insets/insettext.C (setPos): fixed various cursor positioning
8712 problems (via mouse and cursor-keys)
8713 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
8714 inset (still a small display problem but it works ;)
8716 * src/insets/insetcollapsable.C (draw): added button_top_y and
8717 button_bottom_y to have correct values for clicking on the inset.
8719 * src/support/lyxalgo.h: commented out 'using std::less'
8721 2000-03-08 Juergen Vigna <jug@sad.it>
8723 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
8724 Button-Release event closes as it is alos the Release-Event
8727 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
8729 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8731 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
8732 can add multiple spaces in Scrap (literate programming) styles...
8733 which, by the way, is how I got hooked on LyX to begin with.
8735 * src/mathed/formula.C (Write): Added dummy variable to an
8736 inset::Latex() call.
8737 (Latex): Add free_spacing boolean to inset::Latex()
8739 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
8741 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
8742 virtual function to include the free_spacing boolean from
8743 the containing paragraph's style.
8745 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
8746 Added free_spacing boolean arg to match inset.h
8748 * src/insets/insettext.C, src/insets/insettext.h (Latex):
8749 Added free_spacing boolean arg to match inset.h
8751 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
8752 Added free_spacing boolean and made sure that if in a free_spacing
8753 paragraph, that we output normal space if there is a protected space.
8755 * src/insets/insetref.C, src/insets/insetref.h (Latex):
8756 Added free_spacing boolean arg to match inset.h
8758 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
8759 Added free_spacing boolean arg to match inset.h
8761 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
8762 Added free_spacing boolean arg to match inset.h
8764 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
8765 Added free_spacing boolean arg to match inset.h
8767 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
8768 Added free_spacing boolean arg to match inset.h
8770 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
8771 free_spacing boolean arg to match inset.h
8773 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
8774 Added free_spacing boolean arg to match inset.h
8776 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
8777 Added free_spacing boolean arg to match inset.h
8779 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
8780 Added free_spacing boolean arg to match inset.h
8782 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
8783 Added free_spacing boolean arg to match inset.h
8785 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
8786 Added free_spacing boolean arg to match inset.h
8788 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
8789 free_spacing boolean arg to match inset.h
8791 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
8792 free_spacing boolean arg to match inset.h
8794 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
8795 ignore free_spacing paragraphs. The user's spaces are left
8798 * src/text.C (InsertChar): Fixed the free_spacing layout
8799 attribute behavior. Now, if free_spacing is set, you can
8800 add multiple spaces in a paragraph with impunity (and they
8801 get output verbatim).
8802 (SelectSelectedWord): Added dummy argument to inset::Latex()
8805 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
8808 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
8809 paragraph layouts now only input a simple space instead.
8810 Special character insets don't make any sense in free-spacing
8813 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
8814 hard-spaces in the *input* file to simple spaces if the layout
8815 is free-spacing. This converts old files which had to have
8816 hard-spaces in free-spacing layouts where a simple space was
8818 (writeFileAscii): Added free_spacing check to pass to the newly
8819 reworked inset::Latex(...) methods. The inset::Latex() code
8820 ensures that hard-spaces in free-spacing paragraphs get output
8821 as spaces (rather than "~").
8823 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8825 * src/mathed/math_delim.C (draw): draw the empty placeholder
8826 delims with a onoffdash line.
8827 (struct math_deco_compare): struct that holds the "functors" used
8828 for the sort and the binary search in math_deco_table.
8829 (class init_deco_table): class used for initial sort of the
8831 (search_deco): use lower_bound to do a binary search in the
8834 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8836 * src/lyxrc.C: a small secret thingie...
8838 * src/lyxlex.C (printTable): changed to take a ostream as paramter
8839 and to not flush the stream as often as it used to.
8841 * src/support/lyxalgo.h: new file
8842 (sorted): template function used for checking if a sequence is
8843 sorted or not. Two versions with and without user supplied
8844 compare. Uses same compare as std::sort.
8846 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
8847 it and give warning on lyxerr.
8849 (struct compare_tags): struct with function operators used for
8850 checking if sorted, sorting and lower_bound.
8851 (search_kw): use lower_bound instead of manually implemented
8854 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8856 * src/insets/insetcollapsable.h: fix Clone() declaration.
8857 * src/insets/insetfoot.h: ditto.
8859 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
8861 2000-03-08 Juergen Vigna <jug@sad.it>
8863 * src/insets/lyxinset.h: added owner call which tells us if
8864 this inset is inside another inset. Changed also the return-type
8865 of Editable to an enum so it tells clearer what the return-value is.
8867 * src/insets/insettext.C (computeTextRows): fixed computing of
8868 textinsets which split automatically on more rows.
8870 * src/insets/insetert.[Ch]: changed this to be of BaseType
8873 * src/insets/insetfoot.[Ch]: added footnote inset
8875 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
8876 collapsable insets (like footnote, ert, ...)
8878 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8880 * src/lyxdraw.h: remvoe file
8882 * src/lyxdraw.C: remove file
8884 * src/insets/insettext.C: added <algorithm>.
8886 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8888 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
8889 (matrix_cb): case MM_OK use string stream
8891 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
8894 * src/mathed/math_macro.C (draw): use string stream
8895 (Metrics): use string stream
8897 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
8898 directly to the ostream.
8900 * src/vspace.C (asString): use string stream.
8901 (asString): use string stream
8902 (asLatexString): use string stream
8904 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
8905 setting Spacing::Other.
8907 * src/LaTeXFeatures.C (getPackages): use string stream instead of
8908 sprintf when creating the stretch vale.
8910 * src/text2.C (alphaCounter): changed to return a string and to
8911 not use a static variable internally. Also fixed a one-off bug.
8912 (SetCounter): changed the drawing of the labels to use string
8913 streams instead of sprintf.
8915 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
8916 manipulator to use a scheme that does not require library support.
8917 This is also the way it is done in the new GNU libstdc++. Should
8918 work with DEC cxx now.
8920 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8922 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
8923 end. This fixes a bug.
8925 * src/mathed (all files concerned with file writing): apply the
8926 USE_OSTREAM_ONLY changes to mathed too.
8928 * src/support/DebugStream.h: make the constructor explicit.
8930 * src/lyxfont.C (latexWriteStartChanges): small bug related to
8931 count and ostream squashed.
8933 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8935 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
8937 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
8938 ostringstream uses STL strings, and we might not.
8940 * src/insets/insetspecialchar.C: add using directive.
8941 * src/insets/insettext.C: ditto.
8943 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8945 * lib/layouts/seminar.layout: feeble attempt at a layout for
8946 seminar.cls, far from completet and could really use some looking
8947 at from people used to write layout files.
8949 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
8950 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
8951 a lot nicer and works nicely with ostreams.
8953 * src/mathed/formula.C (draw): a slightly different solution that
8954 the one posted to the list, but I think this one works too. (font
8955 size wrong in headers.)
8957 * src/insets/insettext.C (computeTextRows): some fiddling on
8958 Jürgens turf, added some comments that he should read.
8960 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
8961 used and it gave compiler warnings.
8962 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
8965 * src/lyx_gui.C (create_forms): do the right thing when
8966 show_banner is true/false.
8968 * src/lyx_cb.C (TimerCB): no need to close or do anything if
8969 show_banner is false.
8971 * most file writing files: Now use iostreams to do almost all of
8972 the writing. Also instead of passing string &, we now use
8973 stringstreams. mathed output is still not adapted to iostreams.
8974 This change can be turned off by commenting out all the occurences
8975 of the "#define USE_OSTREAM_ONLY 1" lines.
8977 * src/WorkArea.C (createPixmap): don't output debug messages.
8978 (WorkArea): don't output debug messages.
8980 * lib/lyxrc.example: added a comment about the new variable
8983 * development/Code_rules/Rules: Added some more commente about how
8984 to build class interfaces and on how better encapsulation can be
8987 2000-03-03 Juergen Vigna <jug@sad.it>
8989 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
8990 automatically with the width of the LyX-Window
8992 * src/insets/insettext.C (computeTextRows): fixed update bug in
8993 displaying text-insets (scrollvalues where not initialized!)
8995 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8997 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
8998 id in the check of the result from lower_bound is not enough since
8999 lower_bound can return last too, and then res->id will not be a
9002 * all insets and some code that use them: I have conditionalized
9003 removed the Latex(string & out, ...) this means that only the
9004 Latex(ostream &, ...) will be used. This is a work in progress to
9005 move towards using streams for all output of files.
9007 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
9010 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9012 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
9013 routine (this fixes bug where greek letters were surrounded by too
9016 * src/support/filetools.C (findtexfile): change a bit the search
9017 algorithm, to fix bug introduced in 1.1.4. Note that --format is
9018 no longer passed to kpsewhich, we may have to change that later.
9020 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
9021 warning options to avoid problems with X header files (from Angus
9023 * acinclude.m4: regenerated.
9025 2000-03-02 Juergen Vigna <jug@sad.it>
9027 * src/insets/insettext.C (WriteParagraphData): Using the
9028 par->writeFile() function for writing paragraph-data.
9029 (Read): Using buffer->parseSingleLyXformat2Token()-function
9030 for parsing paragraph data!
9032 * src/buffer.C (readLyXformat2): removed all parse data and using
9033 the new parseSingleLyXformat2Token()-function.
9034 (parseSingleLyXformat2Token): added this function to parse (read)
9035 lyx-file-format (this is called also from text-insets now!)
9037 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9039 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
9042 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
9043 directly instead of going through a func. One very bad thing: a
9044 static LyXFindReplace, but I don't know where to place it.
9046 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
9047 string instead of char[]. Also changed to static.
9048 (GetSelectionOrWordAtCursor): changed to static inline
9049 (SetSelectionOverLenChars): ditto.
9051 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
9052 current_view and global variables. both classes has changed names
9053 and LyXFindReplace is not inherited from SearchForm.
9055 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
9056 fl_form_search form.
9058 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
9060 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9062 * lib/bind/*.bind: make sure 'buffer-previous' function is not
9063 bound (from Kayvan).
9065 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
9067 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
9069 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9071 * some things that I should comment but the local pub says head to
9074 * comment out all code that belongs to the Roff code for Ascii
9075 export of tables. (this is unused)
9077 * src/LyXView.C: use correct type for global variable
9078 current_layout. (LyXTextClass::size_type)
9080 * some code to get the new insetgraphics closer to working I'd be
9081 grateful for any help.
9083 * src/BufferView2.C (insertInset): use the return type of
9084 NumberOfLayout properly. (also changes in other files)
9086 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
9087 this as a test. I want to know what breaks because of this.
9089 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
9091 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9093 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
9094 to use a \makebox in the label, this allows proper justification
9095 with out using protected spaces or multiple hfills. Now it is
9096 "label" for left justified, "\hfill label\hfill" for center, and
9097 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
9098 should be changed accordingly.
9100 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9102 * src/lyxtext.h: change SetLayout() to take a
9103 LyXTextClass::size_type instead of a char (when there is more than
9104 127 layouts in a class); also change type of copylayouttype.
9105 * src/text2.C (SetLayout): ditto.
9106 * src/LyXView.C (updateLayoutChoice): ditto.
9108 * src/LaTeX.C (scanLogFile): errors where the line number was not
9109 given just after the '!'-line were ignored (from Dekel Tsur).
9111 * lib/lyxrc.example: fix description of \date_insert_format
9113 * lib/layouts/llncs.layout: new layout, contributed by Martin
9116 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9118 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
9119 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
9120 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
9121 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
9122 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
9123 paragraph.C, text.C, text2.C)
9125 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9127 * src/insets/insettext.C (LocalDispatch): remove extra break
9130 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
9131 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
9133 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
9134 * src/insets/insettext.[Ch] (GetCursorPos): ditto
9136 * src/insets/insetbib.h: move InsetBibkey::Holder and
9137 InsetCitation::Holder in public space.
9139 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9141 * src/insets/insettext.h: small change to get the new files from
9142 Juergen to compile (use "string", not "class string").
9144 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
9145 const & as parameter to LocalDispatch, use LyXFont const & as
9146 paramter to some other func. This also had impacto on lyxinsets.h
9147 and the two mathed insets.
9149 2000-02-24 Juergen Vigna <jug@sad.it>
9152 * src/commandtags.h:
9154 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
9158 * src/BufferView2.C: added/updated code for various inset-functions
9160 * src/insets/insetert.[Ch]: added implementation of InsetERT
9162 * src/insets/insettext.[Ch]: added implementation of InsetText
9164 * src/insets/inset.C (Edit): added "unsigned int button" parameter
9165 (draw): added preliminary code for inset scrolling not finshed yet
9167 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
9168 as it is in lyxfunc.C now
9170 * src/insets/lyxinset.h: Added functions for text-insets
9172 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9174 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
9175 BufferView and reimplement the list as a queue put inside its own
9178 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
9180 * several files: use the new interface to the "updateinsetlist"
9182 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
9184 (work_area_handler): call BufferView::trippleClick on trippleclick.
9186 * src/BufferView.C (doubleClick): new function, selects word on
9188 (trippleClick): new function, selects line on trippleclick.
9190 2000-02-22 Allan Rae <rae@lyx.org>
9192 * lib/bind/xemacs.bind: buffer-previous not supported
9194 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9196 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
9199 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9201 * src/bufferlist.C: get rid of current_view from this file
9203 * src/spellchecker.C: get rid of current_view from this file
9205 * src/vspace.C: get rid of current_view from this file
9206 (inPixels): added BufferView parameter for this func
9207 (asLatexCommand): added a BufferParams for this func
9209 * src/text.C src/text2.C: get rid of current_view from these
9212 * src/lyxfont.C (getFontDirection): move this function here from
9215 * src/bufferparams.C (getDocumentDirection): move this function
9218 * src/paragraph.C (getParDirection): move this function here from
9220 (getLetterDirection): ditto
9222 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
9224 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
9225 resize due to wrong pixmap beeing used. Also took the opurtunity
9226 to make the LyXScreen stateless on regard to WorkArea and some
9227 general cleanup in the same files.
9229 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9231 * src/Makefile.am: add missing direction.h
9233 * src/PainterBase.h: made the width functions const.
9235 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
9238 * src/insets/insetcommand.C (draw): draw Editable as buttons.
9240 * src/insets/insetlatexaccent.C (draw): make the accents draw
9241 better, at present this will only work well with iso8859-1.
9243 * several files: remove the old drawing code, now we use the new
9246 * several files: remove support for mono_video, reverse_video and
9249 2000-02-17 Juergen Vigna <jug@sad.it>
9251 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
9252 int ** as we have to return the pointer, otherwise we have only
9253 NULL pointers in the returning function.
9255 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9257 * src/LaTeX.C (operator()): quote file name when running latex.
9259 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9261 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
9262 (bubble tip), this removes our special handling of this.
9264 * Remove all code that is unused now that we have the new
9265 workarea. (Code that are not active when NEW_WA is defined.)
9267 * Make the uses of XSync not conditionalized on define USE_XSYNC.
9269 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9271 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
9272 nonexisting layout; correctly redirect obsoleted layouts.
9274 * lib/lyxrc.example: document \view_dvi_paper_option
9276 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
9279 * src/lyx_cb.C (RunScript): handle $$FName for command names.
9280 (PreviewDVI): handle the view_dvi_paper_option variable.
9281 [Both from Roland Krause]
9283 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9285 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
9286 char const *, int, LyXFont)
9287 (text(int, int, string, LyXFont)): ditto
9289 * src/text.C (InsertCharInTable): attempt to fix the double-space
9290 feature in tables too.
9291 (BackspaceInTable): ditto.
9292 (GetVisibleRow): make bottom pagebreak line be a onoff line.
9294 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9296 * src/text2.C (owner): only complain if owner_ is set and bv != 0
9298 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
9299 newly found text in textcache to this.
9300 (buffer): set the owner of the text put into the textcache to 0
9302 * src/insets/figinset.C (draw): fixed the drawing of figures with
9305 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
9306 drawing of mathframe, hfills, protected space, table lines. I have
9307 now no outstanding drawing problems with the new Painter code.
9309 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9311 * src/PainterBase.C (ellipse, circle): do not specify the default
9314 * src/LColor.h: add using directive.
9316 * src/Painter.[Ch]: change return type of methods from Painter& to
9317 PainterBase&. Add a using directive.
9319 * src/WorkArea.C: wrap xforms callbacks in C functions
9322 * lib/layouts/foils.layout: font fix and simplifications from Carl
9325 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9327 * a lot of files: The Painter, LColor and WorkArea from the old
9328 devel branch has been ported to lyx-devel. Some new files and a
9329 lot of #ifdeffed code. The new workarea is enabled by default, but
9330 if you want to test the new Painter and LColor you have to compile
9331 with USE_PAINTER defined (do this in config.h f.ex.) There are
9332 still some rought edges, and I'd like some help to clear those
9333 out. It looks stable (loads and displays the Userguide very well).
9336 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9338 * src/buffer.C (pop_tag): revert to the previous implementation
9339 (use a global variable for both loops).
9341 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
9343 * src/lyxrc.C (LyXRC): change slightly default date format.
9345 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
9346 there is an English text with a footnote that starts with a Hebrew
9347 paragraph, or vice versa.
9348 (TeXFootnote): ditto.
9350 * src/text.C (LeftMargin): allow for negative values for
9351 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
9354 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
9355 for input encoding (cyrillic)
9357 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9359 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
9362 * src/toolbar.C (set): ditto
9363 * src/insets/insetbib.C (create_form_citation_form): ditto
9365 * lib/CREDITS: added Dekel Tsur.
9367 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
9368 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
9369 hebrew supports files from Dekel Tsur.
9371 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
9372 <tzafrir@technion.ac.il>
9374 * src/lyxrc.C: put \date_insert_format at the right place.
9376 * src/buffer.C (makeLaTeXFile): fix the handling of
9377 BufferParams::sides when writing out latex files.
9379 * src/BufferView2.C: add a "using" directive.
9381 * src/support/lyxsum.C (sum): when we use lyxstring,
9382 ostringstream::str needs an additional .c_str().
9384 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9386 * src/support/filetools.C (ChangeExtension): patch from Etienne
9389 * src/TextCache.C (show): remove const_cast and make second
9390 parameter non-const LyXText *.
9392 * src/TextCache.h: use non const LyXText in show.
9394 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
9397 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9399 * src/support/lyxsum.C: rework to be more flexible.
9401 * several places: don't check if a pointer is 0 if you are going
9404 * src/text.C: remove some dead code.
9406 * src/insets/figinset.C: remove some dead code
9408 * src/buffer.C: move the BufferView funcs to BufferView2.C
9409 remove all support for insetlatexdel
9410 remove support for oldpapersize stuff
9411 made some member funcs const
9413 * src/kbmap.C: use a std::list to store the bindings in.
9415 * src/BufferView2.C: new file
9417 * src/kbsequence.[Ch]: new files
9419 * src/LyXAction.C + others: remove all trace of buffer-previous
9421 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
9422 only have one copy in the binary of this table.
9424 * hebrew patch: moved some functions from LyXText to more
9425 appropriate places. (LyXParagraph, BufferParams, LyXFont)
9427 * several files: remove support for XForms older than 0.88
9429 remove some #if 0 #endif code
9431 * src/TextCache.[Ch]: new file. Holds the textcache.
9433 * src/BufferView.C: changes to use the new TextCache interface.
9434 (waitForX): remove the now unused code.
9436 * src/BackStack.h: remove some commented code
9438 * lib/bind/emacs.bind: remove binding for buffer-previous
9440 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9442 * applied the hebrew patch.
9444 * src/lyxrow.h: make sure that all Row variables are initialized.
9446 * src/text2.C (TextHandleUndo): comment out a delete, this might
9447 introduce a memory leak, but should also help us to not try to
9448 read freed memory. We need to look at this one.
9450 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
9451 (LyXParagraph): initalize footnotekind.
9453 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
9454 forgot this when applying the patch. Please heed the warnings.
9456 * src/BufferView.C (buffer): a fix for the buffer-reload problem
9457 (aka. reformat problem)
9459 * src/bufferlist.C (exists): made const, and use const_iterator
9460 (isLoaded): new func.
9461 (release): use std::find to find the correct buffer.
9463 * src/bufferlist.h: made getState a const func.
9464 made empty a const func.
9465 made exists a const func.
9468 2000-02-01 Juergen Vigna <jug@sad.it>
9470 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
9472 * po/it.po: updated a bit the italian po file and also changed the
9473 'file nuovo' for newfile to 'filenuovo' without a space, this did
9476 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
9477 for the new insert_date command.
9479 * src/lyxfunc.C (Dispatch): added support for a insert_date function
9480 from jdblair, to insert a date into the current text conforming to
9481 a strftime format (for now only considering the locale-set and not
9482 the document-language).
9484 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9486 * src/lyxfont.C (textWidth): hopefully better fix for the Array
9487 Bounds Read error seen by purify. The problem was that islower is
9488 a macros which takes an unsigned char and uses it as an index for
9489 in array of characters properties (and is thus subject to the
9493 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
9494 correctly the paper sides radio buttons.
9495 (UpdateDocumentButtons): ditto.
9497 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9499 * src/kbmap.C (getsym + others): change to return unsigned int,
9500 returning a long can give problems on 64 bit systems. (I assume
9501 that int is 32bit on 64bit systems)
9503 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9505 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
9506 LyXLookupString to be zero-terminated. Really fixes problems seen
9509 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9511 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
9512 write a (char*)0 to the lyxerr stream.
9514 * src/lastfiles.C: move algorithm before the using statemets.
9516 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9518 * src/lastfiles.C: move using directives in global scope (egcs 1.x
9519 complains otherwise).
9520 * src/table.C: ditto
9522 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
9525 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
9526 that I removed earlier... It is really needed.
9528 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
9530 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9532 * INSTALL: update xforms home page URL.
9534 * lib/configure.m4: fix a bug with unreadable layout files.
9536 * src/table.C (calculate_width_of_column): add "using std::max"
9539 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9541 * several files: marked several lines with "DEL LINE", this is
9542 lines that can be deleted without changing anything.
9543 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
9544 checks this anyway */
9547 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
9549 * src/DepTable.C (update): add a "+" at the end when the checksum
9550 is different. (debugging string only)
9552 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
9553 the next inset to not be displayed. This should also fix the list
9554 of labels in the "Insert Crossreference" dialog.
9556 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9558 * src/support/LSubstring.C (LSubstring): set pos to string::npos
9559 when regex was not found.
9561 * src/support/lstrings.C (lowercase): use handcoded transform always.
9564 * src/text.C (Delete): fixed the crash. cursor.par->prev and
9565 old_cursor.par->prev could be 0.
9567 * several files: changed post inc/dec to pre inc/dec
9569 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
9570 write the lastfiles to file.
9572 * src/BufferView.C (buffer): only show TextCache info when debugging
9574 (resizeCurrentBuffer): ditto
9575 (workAreaExpose): ditto
9577 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
9579 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
9581 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
9582 a bit better by removing the special case for \i and \j.
9584 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9586 * src/lyx_main.C (easyParse): remove test for bad comand line
9587 options, since this broke all xforms-related parsing.
9589 * src/kbmap.C (getsym): set return type to unsigned long, as
9590 declared in header. On an alpha, long is _not_ the same as int.
9592 * src/support/LOstream.h: add a "using std::flush;"
9594 * src/insets/figinset.C: ditto.
9596 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9598 * src/bufferlist.C (write): use blinding fast file copy instead of
9599 "a char at a time", now we are doing it the C++ way.
9601 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
9602 std::list<int> instead.
9603 (addpidwait): reflect move to std::list<int>
9604 (sigchldchecker): ditto
9606 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
9609 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
9610 that obviously was wrong...
9612 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
9613 c, this avoids warnings with purify and islower.
9615 * src/insets/figinset.C: rename struct queue to struct
9616 queue_element and rewrite to use a std::queue. gsqueue is now a
9617 std::queue<queue_element>
9618 (runqueue): reflect move to std::queue
9621 * src/support/lstrings.h (tostr): specialize for bool, otherwise
9622 we would get "1" "0" instead of "true" "false. Also make the tostr
9625 2000-01-21 Juergen Vigna <jug@sad.it>
9627 * src/buffer.C (writeFileAscii): Disabled code for special groff
9628 handling of tabulars till I fix this in table.C
9630 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9632 * src/support/mkdir.C (mkdir): change second argument of mkdir to
9634 * src/support/lyxlib.h: ditto.
9636 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9638 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
9639 and 'j' look better. This might fix the "macron" bug that has been
9642 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
9643 functions as one template function. Delete the old versions.
9645 * src/support/lyxsum.C: move using std::ifstream inside
9648 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
9651 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
9653 * src/mathed/formula.C: delete #include "bufferlist.h" never used
9655 * src/insets/figinset.C (InitFigures): use new instead of malloc
9656 to allocate memory for figures and bitmaps.
9657 (DoneFigures): use delete[] instead of free to deallocate memory
9658 for figures and bitmaps.
9659 (runqueue): use new to allocate
9660 (getfigdata): use new/delete[] instead of malloc/free
9661 (RegisterFigure): ditto
9663 * some files: moved some declarations closer to first use, small
9664 whitespace changes use preincrement instead of postincrement where
9665 it does not make a difference.
9667 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
9668 step on the way to use stl::containers for key maps.
9670 * src/bufferlist.h: add a typedef for const_iterator and const
9671 versions of begin and end.
9673 * src/bufferlist.[Ch]: change name of member variable _state to
9674 state_. (avoid reserved names)
9676 (getFileNames): returns the filenames of the buffers in a vector.
9678 * configure.in (ALL_LINGUAS): added ro
9680 * src/support/putenv.C: new file
9682 * src/support/mkdir.C: new file
9684 2000-01-20 Allan Rae <rae@lyx.org>
9686 * lib/layouts/IEEEtran.layout: Added several theorem environments
9688 * lib/templates/IEEEtran.lyx: Example theorem environments and a
9689 couple of minor additions.
9691 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
9692 (except for those in footnotes of course)
9694 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9696 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
9698 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
9699 std::sort and std::lower_bound instead of qsort and handwritten
9701 (struct compara): struct that holds the functors used by std::sort
9702 and std::lower_bound in MathedLookupBOP.
9704 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9706 * src/support/LAssert.h: do not do partial specialization. We do
9709 * src/support/lyxlib.h: note that lyx::getUserName() and
9710 lyx::date() are not in use right now. Should these be suppressed?
9712 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
9713 (makeLinuxDocFile): do not put date and user name in linuxdoc
9716 * src/support/lyxlib.h (kill): change first argument to long int,
9717 since that's what solaris uses.
9719 * src/support/kill.C (kill): fix declaration to match prototype.
9721 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
9722 actually check whether namespaces are supported. This is not what
9725 * src/support/lyxsum.C: add a using directive.
9727 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9729 * src/support/kill.C: if we have namespace support we don't have
9730 to include lyxlib.h.
9732 * src/support/lyxlib.h: use namespace lyx if supported.
9734 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9736 * src/support/date.C: new file
9738 * src/support/chdir.C: new file
9740 * src/support/getUserName.C: new file
9742 * src/support/getcwd.C: new file
9744 * src/support/abort.C: new file
9746 * src/support/kill.C: new file
9748 * src/support/lyxlib.h: moved all the functions in this file
9749 insede struct lyx. Added also kill and abort to this struct. This
9750 is a way to avoid the "kill is not defined in <csignal>", we make
9751 C++ wrappers for functions that are not ANSI C or ANSI C++.
9753 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
9754 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
9755 lyx it has been renamed to sum.
9757 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9759 * src/text.C: add using directives for std::min and std::max.
9761 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9763 * src/texrow.C (getIdFromRow): actually return something useful in
9764 id and pos. Hopefully fixes the bug with positionning of errorbox
9767 * src/lyx_main.C (easyParse): output an error and exit if an
9768 incorrect command line option has been given.
9770 * src/spellchecker.C (ispell_check_word): document a memory leak.
9772 * src/bufferlist.C (write): fix mismatched allocation/deletion,
9773 where a "struct utimbuf" is allocated with "new" and deleted with
9776 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9778 * src/text2.C (CutSelection): don't delete double spaces.
9779 (PasteSelection): ditto
9780 (CopySelection): ditto
9782 * src/text.C (Backspace): don't delete double spaces.
9784 * src/lyxlex.C (next): fix a bug that were only present with
9785 conformant std::istream::get to read comment lines, use
9786 std::istream::getline instead. This seems to fix the problem.
9788 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9790 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
9791 allowed to insert space before space" editing problem. Please read
9792 commends at the beginning of the function. Comments about usage
9795 * src/text.C (InsertChar): fix for the "not allowed to insert
9796 space before space" editing problem.
9798 * src/text2.C (DeleteEmptyParagraphMechanism): when
9799 IsEmptyTableRow can only return false this last "else if" will
9800 always be a no-op. Commented out.
9802 * src/text.C (RedoParagraph): As far as I can understand tmp
9803 cursor is not really needed.
9805 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
9806 present it could only return false anyway.
9807 (several functions): Did something not so smart...added a const
9808 specifier on a lot of methods.
9810 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
9811 and add a tmp->text.resize. The LyXParagraph constructor does the
9813 (BreakParagraphConservative): ditto
9815 * src/support/path.h (Path): add a define so that the wrong usage
9816 "Path("/tmp") will be flagged as a compilation error:
9817 "`unnamed_Path' undeclared (first use this function)"
9819 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9821 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
9822 which was bogus for several reasons.
9824 * src/LaTeX.C (scanAux): fix the regular expression used to scan
9828 * autogen.sh: do not use "type -path" (what's that anyway?).
9830 * src/support/filetools.C (findtexfile): remove extraneous space
9831 which caused a kpsewhich warning (at least with kpathsea version
9834 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9836 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
9838 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
9840 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
9842 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9844 * src/paragraph.C (BreakParagraph): do not reserve space on text
9845 if we don't need to (otherwise, if pos_end < pos, we end up
9846 reserving huge amounts of memory due to bad unsigned karma).
9847 (BreakParagraphConservative): ditto, although I have not seen
9848 evidence the bug can happen here.
9850 * src/lyxparagraph.h: add a using std::list.
9852 2000-01-11 Juergen Vigna <jug@sad.it>
9854 * src/menus.C (MenuDocu): output an Alert if the documentation-file
9857 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9859 * src/vc-backend.C (doVCCommand): change to be static and take one
9860 more parameter: the path to chdir too be fore executing the command.
9861 (retrive): new function equiv to "co -r"
9863 * src/bufferlist.C (loadLyXFile): implement the missing parts if
9864 file_not_found_hook is true.
9866 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
9868 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
9869 if a file is readwrite,readonly...anything else.
9871 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9873 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
9874 (CreatePostscript): name change from MenuRunDVIPS (or something)
9875 (PreviewPostscript): name change from MenuPreviewPS
9876 (PreviewDVI): name change from MenuPreviewDVI
9878 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
9879 \view_pdf_command., \pdf_to_ps_command
9881 * lib/configure.m4: added search for PDF viewer, and search for
9882 PDF to PS converter.
9883 (lyxrc.defaults output): add \pdflatex_command,
9884 \view_pdf_command and \pdf_to_ps_command.
9886 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
9888 * src/bufferlist.C (write): we don't use blocksize for anything so
9891 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9893 * src/support/block.h: disable operator T* (), since it causes
9894 problems with both compilers I tried. See comments in the file.
9896 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
9899 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
9900 variable LYX_DIR_10x to LYX_DIR_11x.
9902 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
9904 * INSTALL: document --with-lyxname.
9907 * configure.in: new configure flag --with-lyxname which allows to
9908 choose the name under which lyx is installed. Default is "lyx", of
9909 course. It used to be possible to do this with --program-suffix,
9910 but the later has in fact a different meaning for autoconf.
9912 * src/support/lstrings.h (lstrchr): reformat a bit.
9914 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
9915 * src/mathed/math_defs.h: ditto.
9917 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9919 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
9920 true, decides if we create a backup file or not when saving. New
9921 tag and variable \pdf_mode, defaults to false. New tag and
9922 variable \pdflatex_command, defaults to pdflatex. New tag and
9923 variable \view_pdf_command, defaults to xpdf. New tag and variable
9924 \pdf_to_ps_command, defaults to pdf2ps.
9926 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9928 * src/bufferlist.C (close): don't call insetUnlock if the buffer
9929 does not have a BufferView.
9930 (unlockInset): ditto + don't access the_locking_inset if the
9931 buffer does not have a BufferView.
9933 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
9934 certain circumstances so that we don't continue a keyboard
9935 operation long after the key was released. Try f.ex. to load a
9936 large document, press PageDown for some seconds and then release
9937 it. Before this change the document would contine to scroll for
9938 some time, with this change it stops imidiatly.
9940 * src/support/block.h: don't allocate more space than needed. As
9941 long as we don't try to write to the arr[x] in a array_type arr[x]
9942 it is perfectly ok. (if you write to it you might segfault).
9943 added operator value_type*() so that is possible to pass the array
9944 to functions expecting a C-pointer.
9946 * lib/Makefile.am (dist-hook): don't fail completely if unable to
9949 * intl/*: updated to gettext 0.10.35, tried to add our own
9950 required modifications. Please verify.
9952 * po/*: updated to gettext 0.10.35, tried to add our own required
9953 modifications. Please verify.
9955 * src/support/lstrings.C (tostr): go at fixing the problem with
9956 cxx and stringstream. When stringstream is used return
9957 oss.str().c_str() so that problems with lyxstring and basic_string
9958 are avoided. Note that the best solution would be for cxx to use
9959 basic_string all the way, but it is not conformant yet. (it seems)
9961 * src/lyx_cb.C + other files: moved several global functions to
9962 class BufferView, some have been moved to BufferView.[Ch] others
9963 are still located in lyx_cb.C. Code changes because of this. (part
9964 of "get rid of current_view project".)
9966 * src/buffer.C + other files: moved several Buffer functions to
9967 class BufferView, the functions are still present in buffer.C.
9968 Code changes because of this.
9970 * config/lcmessage.m4: updated to most recent. used when creating
9973 * config/progtest.m4: updated to most recent. used when creating
9976 * config/gettext.m4: updated to most recent. applied patch for
9979 * config/gettext.m4.patch: new file that shows what changes we
9980 have done to the local copy of gettext.m4.
9982 * config/libtool.m4: new file, used in creation of acinclude.m4
9984 * config/lyxinclude.m4: new file, this is the lyx created m4
9985 macros, used in making acinclude.m4.
9987 * autogen.sh: GNU m4 discovered as a separate task not as part of
9988 the lib/configure creation.
9989 Generate acinlucde from files in config. Actually cat
9990 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
9991 easier to upgrade .m4 files that really are external.
9993 * src/Spacing.h: moved using std::istringstream to right after
9994 <sstream>. This should fix the problem seen with some compilers.
9996 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9998 * src/lyx_cb.C: began some work to remove the dependency a lot of
9999 functions have on BufferView::text, even if not really needed.
10000 (GetCurrentTextClass): removed this func, it only hid the
10003 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
10004 forgot this in last commit.
10006 * src/Bullet.C (bulletEntry): use static char const *[] for the
10007 tables, becuase of this the return arg had to change to string.
10008 (bulletSize): ditto
10009 (~Bullet): removed unneeded destructor
10011 * src/BufferView.C (beforeChange): moved from lyx_cb.C
10012 (insetSleep): moved from Buffer
10013 (insetWakeup): moved from Buffer
10014 (insetUnlock): moved from Buffer
10016 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
10017 from Buffer to BufferView.
10019 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
10021 * config/ltmain.sh: updated to version 1.3.4 of libtool
10023 * config/ltconfig: updated to version 1.3.4 of libtool
10025 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10028 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
10029 Did I get that right?
10031 * src/lyxlex.h: add a "using" directive or two.
10032 * src/Spacing.h: ditto.
10033 * src/insets/figinset.C: ditto.
10034 * src/support/filetools.C: ditto.
10035 * src/support/lstrings.C: ditto.
10036 * src/BufferView.C: ditto.
10037 * src/bufferlist.C: ditto.
10038 * src/lyx_cb.C: ditto.
10039 * src/lyxlex.C: ditto.
10041 * NEWS: add some changes for 1.1.4.
10043 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10045 * src/BufferView.C: first go at a TextCache to speed up switching
10048 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10050 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
10051 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
10052 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
10053 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
10056 * src/mathed/math_defs.h (MathedRowSt): make sure that all
10057 members of the struct are correctly initialized to 0 (detected by
10059 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
10060 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
10062 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
10063 pidwait, since it was allocated with "new". This was potentially
10064 very bad. Thanks to Michael Schmitt for running purify for us.
10067 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10069 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
10071 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
10073 1999-12-30 Allan Rae <rae@lyx.org>
10075 * lib/templates/IEEEtran.lyx: minor change
10077 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
10078 src/mathed/formula.C (LocalDispatch): askForText changes
10080 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
10081 know when a user has cancelled input. Fixes annoying problems with
10082 inserting labels and version control.
10084 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10086 * src/support/lstrings.C (tostr): rewritten to use strstream and
10089 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10091 * src/support/filetools.C (IsFileWriteable): use fstream to check
10092 (IsDirWriteable): use fileinfo to check
10094 * src/support/filetools.h (FilePtr): whole class deleted
10096 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
10098 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
10100 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
10102 * src/bufferlist.C (write): use ifstream and ofstream instead of
10105 * src/Spacing.h: use istrstream instead of sscanf
10107 * src/mathed/math_defs.h: change first arg to istream from FILE*
10109 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
10111 * src/mathed/math_parser.C: have yyis to be an istream
10112 (LexGetArg): use istream (yyis)
10114 (mathed_parse): ditto
10115 (mathed_parser_file): first arg istream instead of FILE*, set yyis
10117 * src/mathed/formula.C (Read): rewritten to use istream
10119 * src/mathed/formulamacro.C (Read): rewritten to use istream
10121 * src/lyxlex.h (~LyXLex): deleted desturctor
10122 (getStream): new function, returns an istream
10123 (getFile): deleted funtion
10124 (IsOK): return is.good();
10126 * src/lyxlex.C (LyXLex): delete file and owns_file
10127 (setFile): open an filebuf and assign that to a istream instead of
10129 (setStream): new function, takes an istream as arg.
10130 (setFile): deleted function
10131 (EatLine): rewritten us use istream instead of FILE*
10135 * src/table.C (LyXTable): use istream instead of FILE*
10136 (Read): rewritten to take an istream instead of FILE*
10138 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10140 * src/buffer.C (Dispatch): remove an extraneous break statement.
10142 * src/support/filetools.C (QuoteName): change to do simple
10143 'quoting'. More work is necessary. Also changed to do nothing
10144 under emx (needs fix too).
10145 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
10147 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
10148 config.h.in to the AC_DEFINE_UNQUOTED() call.
10149 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
10150 needs char * as argument (because Solaris 7 declares it like
10153 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
10154 remove definition of BZERO.
10156 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10158 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
10159 defined, "lyxregex.h" if not.
10161 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
10163 (REGEX): new variable that is set to regex.c lyxregex.h when
10164 AM_CONDITIONAL USE_REGEX is set.
10165 (libsupport_la_SOURCES): add $(REGEX)
10167 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
10170 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
10173 * configure.in: add call to LYX_REGEX
10175 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
10176 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
10178 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10180 * lib/bind/fi_menus.bind: new file, from
10181 pauli.virtanen@saunalahti.fi.
10183 * src/buffer.C (getBibkeyList): pass the parameter delim to
10184 InsetInclude::getKeys and InsetBibtex::getKeys.
10186 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
10187 is passed to Buffer::getBibkeyList
10189 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
10190 instead of the hardcoded comma.
10192 * src/insets/insetbib.C (getKeys): make sure that there are not
10193 leading blanks in bibtex keys. Normal latex does not care, but
10194 harvard.sty seems to dislike blanks at the beginning of citation
10195 keys. In particular, the retturn value of the function is
10197 * INSTALL: make it clear that libstdc++ is needed and that gcc
10198 2.7.x probably does not work.
10200 * src/support/filetools.C (findtexfile): make debug message go to
10202 * src/insets/insetbib.C (getKeys): ditto
10204 * src/debug.C (showTags): make sure that the output is correctly
10207 * configure.in: add a comment for TWO_COLOR_ICON define.
10209 * acconfig.h: remove all the entries that already defined in
10210 configure.in or acinclude.m4.
10212 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
10213 to avoid user name, date and copyright.
10215 1999-12-21 Juergen Vigna <jug@sad.it>
10217 * src/table.C (Read): Now read bogus row format informations
10218 if the format is < 5 so that afterwards the table can
10219 be read by lyx but without any format-info. Fixed the
10220 crash we experienced when not doing this.
10222 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10224 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
10225 (RedoDrawingOfParagraph): ditto
10226 (RedoParagraphs): ditto
10227 (RemoveTableRow): ditto
10229 * src/text.C (Fill): rename arg paperwidth -> paper_width
10231 * src/buffer.C (insertLyXFile): rename var filename -> fname
10232 (writeFile): rename arg filename -> fname
10233 (writeFileAscii): ditto
10234 (makeLaTeXFile): ditto
10235 (makeLinuxDocFile): ditto
10236 (makeDocBookFile): ditto
10238 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
10241 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
10243 * src/bmtable.h: add extern "C" on this file when __cplusplus is
10246 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
10247 compiled by a C compiler not C++.
10249 * src/layout.h (LyXTextClass): added typedef for const_iterator
10250 (LyXTextClassList): added typedef for const_iterator + member
10251 functions begin and end.
10253 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
10254 iterators to fill the choice_class.
10255 (updateLayoutChoice): rewritten to use iterators to fill the
10256 layoutlist in the toolbar.
10258 * src/BufferView.h (BufferView::work_area_width): removed unused
10261 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
10263 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
10264 (sgmlCloseTag): ditto
10266 * src/support/lstrings.h: return type of countChar changed to
10269 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
10270 what version of this func to use. Also made to return unsigned int.
10272 * configure.in: call LYX_STD_COUNT
10274 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
10275 conforming std::count.
10277 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10279 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
10280 and a subscript would give bad display (patch from Dekel Tsur
10281 <dekel@math.tau.ac.il>).
10283 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
10285 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
10288 * src/chset.h: add a few 'using' directives
10290 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
10291 triggered when no buffer is active
10293 * src/layout.C: removed `break' after `return' in switch(), since
10296 * src/lyx_main.C (init): make sure LyX can be ran in place even
10297 when libtool has done its magic with shared libraries. Fix the
10298 test for the case when the system directory has not been found.
10300 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
10301 name for the latex file.
10302 (MenuMakeHTML): ditto
10304 * src/buffer.h: add an optional boolean argument, which is passed
10305 to ChangeExtension.
10307 1999-12-20 Allan Rae <rae@lyx.org>
10309 * lib/templates/IEEEtran.lyx: small correction and update.
10311 * configure.in: Attempted to use LYX_PATH_HEADER
10313 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
10315 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
10316 input from JMarc. Now use preprocessor to find the header.
10317 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
10318 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
10319 LYX_STL_STRING_FWD. See comments in file.
10321 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
10323 * The global MiniBuffer * minibuffer variable is dead.
10325 * The global FD_form_main * fd_form_main variable is dead.
10327 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10329 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
10331 * src/table.h: add the LOstream.h header
10332 * src/debug.h: ditto
10334 * src/LyXAction.h: change the explaination of the ReadOnly
10335 attribute: is indicates that the function _can_ be used.
10337 * src/LyXAction.C (init): find-replace _can_ be used in read-only
10340 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10342 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
10348 * src/paragraph.C (GetWord): assert on pos>=0
10351 * src/support/lyxstring.C: condition the use of an invariant on
10353 * src/support/lyxstring.h: ditto
10355 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
10356 Use LAssert.h instead of plain assert().
10358 * src/support/lstrings.h: add LAssert.h, in case it is needed.
10360 * src/lyxfunc.C: do not include LAssert.h, it is not used.
10361 * src/support/filetools.C: ditto
10363 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
10366 * INSTALL: document the new configure flags
10368 * configure.in: suppress --with-debug; add --enable-assertions
10370 * acinclude.m4: various changes in alignment of help strings.
10372 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10374 * src/kbmap.C: commented out the use of the hash map in kb_map,
10375 beginning of movement to a stl::container.
10377 * several files: removed code that was not in effect when
10378 MOVE_TEXT was defined.
10380 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
10381 for escaping should not be used. We can discuss if the string
10382 should be enclosed in f.ex. [] instead of "".
10384 * src/trans_mgr.C (insert): use the new returned value from
10385 encodeString to get deadkeys and keymaps done correctly.
10387 * src/chset.C (encodeString): changed to return a pair, to tell
10388 what to use if we know the string.
10390 * src/lyxscreen.h (fillArc): new function.
10392 * src/FontInfo.C (resize): rewritten to use more std::string like
10393 structore, especially string::replace.
10395 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
10398 * configure.in (chmod +x some scripts): remove config/gcc-hack
10400 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10402 * src/buffer.C (writeFile): change once again the top comment in a
10403 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
10404 instead of an hardcoded version number.
10405 (makeDocBookFile): ditto
10407 * src/version.h: add new define LYX_DOCVERSION
10409 * po/de.po: update from Pit Sütterlin
10410 * lib/bind/de_menus.bind: ditto.
10412 * src/lyxfunc.C (Dispatch): call MenuExport()
10413 * src/buffer.C (Dispatch): ditto
10415 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
10416 LyXFunc::Dispatch().
10417 (MenuExport): new function, moved from
10418 LyXFunc::Dispatch().
10420 * src/trans_mgr.C (insert): small cleanup
10421 * src/chset.C (loadFile): ditto
10423 * lib/kbd/iso8859-1.cdef: add missing backslashes
10425 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10427 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
10428 help with placing the manually drawn accents better.
10430 (Draw): x2 and hg changed to float to minimize rounding errors and
10431 help place the accents better.
10433 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
10434 unsigned short to char is just wrong...cast the char to unsigned
10435 char instead so that the two values can compare sanely. This
10436 should also make the display of insetlatexaccents better and
10437 perhaps also some other insets.
10439 (lbearing): new function
10442 1999-12-15 Allan Rae <rae@lyx.org>
10444 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
10445 header that provides a wrapper around the very annoying SGI STL header
10448 * src/support/lyxstring.C, src/LString.h:
10449 removed old SGI-STL-compatability attempts.
10451 * configure.in: Use LYX_STL_STRING_FWD.
10453 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
10454 stl_string_fwd.h is around and try to determine it's location.
10455 Major improvement over previous SGI STL 3.2 compatability.
10456 Three small problems remain with this function due to my zero
10457 knowledge of autoconf. JMarc and lgb see the comments in the code.
10459 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10461 * src/broken_const.h, config/hack-gcc, config/README: removed
10463 * configure.in: remove --with-gcc-hack option; do not call
10466 * INSTALL: remove documentation of --with-broken-const and
10469 * acconfig.h: remove all trace of BROKEN_CONST define
10471 * src/buffer.C (makeDocBookFile): update version number in output
10473 (SimpleDocBookOnePar): fix an assert when trying to a character
10474 access beyond string length
10477 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10479 * po/de.po: fix the Export menu
10481 * lyx.man: update the description of -dbg
10483 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
10484 (commandLineHelp): updated
10485 (easyParse): show list of available debug levels if -dbg is passed
10488 * src/Makefile.am: add debug.C
10490 * src/debug.h: moved some code to debug.C
10492 * src/debug.C: new file. Contains code to set and show debug
10495 * src/layout.C: remove 'break' after 'continue' in switch
10496 statements, since these cannot be reached.
10498 1999-12-13 Allan Rae <rae@lyx.org>
10500 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
10501 (in_word_set): hash() -> math_hash()
10503 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
10505 * acconfig.h: Added a test for whether we are using exceptions in the
10506 current compilation run. If so USING_EXCEPTIONS is defined.
10508 * config.in: Check for existance of stl_string_fwd.h
10509 * src/LString.h: If compiling --with-included-string and SGI's
10510 STL version 3.2 is present (see above test) we need to block their
10511 forward declaration of string and supply a __get_c_string().
10512 However, it turns out this is only necessary if compiling with
10513 exceptions enabled so I've a bit more to add yet.
10515 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
10516 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
10517 src/support/LRegex.h, src/undo.h:
10518 Shuffle the order of the included files a little to ensure that
10519 LString.h gets included before anything that includes stl_string_fwd.h
10521 * src/support/lyxstring.C: We need to #include LString.h instead of
10522 lyxstring.h to get the necessary definition of __get_c_string.
10523 (__get_c_string): New function. This is defined static just like SGI's
10524 although why they need to do this I'm not sure. Perhaps it should be
10525 in lstrings.C instead.
10527 * lib/templates/IEEEtran.lyx: New template file.
10529 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10531 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
10532 * intl/Makefile.in (MKINSTALLDIRS): ditto
10534 * src/LyXAction.C (init): changed to hold the LFUN data in a
10535 automatic array in stead of in callso to newFunc, this speeds up
10536 compilation a lot. Also all the memory used by the array is
10537 returned when the init is completed.
10539 * a lot of files: compiled with -Wold-style-cast, changed most of
10540 the reported offenders to C++ style casts. Did not change the
10541 offenders in C files.
10543 * src/trans.h (Match): change argument type to unsigned int.
10545 * src/support/DebugStream.C: fix some types on the streambufs so
10546 that it works on a conforming implementation.
10548 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10550 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
10552 * src/support/lyxstring.C: remove the inline added earlier since
10553 they cause a bunch of unsatisfied symbols when linking with dec
10554 cxx. Cxx likes to have the body of inlines at the place where they
10557 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
10558 accessing negative bounds in array. This fixes the crash when
10559 inserting accented characters.
10560 * src/trans.h (Match): ditto
10562 * src/buffer.C (Dispatch): since this is a void, it should not try
10563 to return anything...
10565 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10567 * src/buffer.h: removed the two friends from Buffer. Some changes
10568 because of this. Buffer::getFileName and Buffer::setFileName
10569 renamed to Buffer::fileName() and Buffer::fileName(...).
10571 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10573 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
10574 and Buffer::update(short) to BufferView. This move is currently
10575 controlled by a define MOVE_TEXT, this will be removed when all
10576 shows to be ok. This move paves the way for better separation
10577 between buffer contents and buffer view. One side effect is that
10578 the BufferView needs a rebreak when swiching buffers, if we want
10579 to avoid this we can add a cache that holds pointers to LyXText's
10580 that is not currently in use.
10582 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
10585 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10587 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
10589 * lyx_main.C: new command line option -x (or --execute) and
10590 -e (or --export). Now direct conversion from .lyx to .tex
10591 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
10592 Unfortunately, X is still needed and the GUI pops up during the
10595 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10597 * src/Spacing.C: add a using directive to bring stream stuff into
10599 * src/paragraph.C: ditto
10600 * src/buffer.C: ditto
10602 * NEWS: updated a bit the new features of 1.1.3 (took a few things
10603 from Lars' announcement).
10605 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
10606 example files from Tino Meinen.
10608 1999-12-06 Allan Rae <rae@lyx.org>
10610 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
10612 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10614 * src/support/lyxstring.C: added a lot of inline for no good
10617 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
10618 latexWriteEndChanges, they were not used.
10620 * src/layout.h (operator<<): output operator for PageSides
10622 * src/mathed/math_iter.C (my_memcpy): slightly changed.
10624 * some example files: loaded in LyX 1.0.4 and saved again to update
10625 certain constructs (table format)
10627 * a lot of files: did the change to use fstream/iostream for all
10628 writing of files. Done with a close look at Andre Poenitz's patch.
10630 * some files: whitespace changes.
10632 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10634 * src/mathed/math_iter.C (my_memcpy): new function. Since the
10635 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
10636 architecture, we provide our own. It is used unconditionnally, but
10637 I do not think this is a performance problem. Thanks to Angus
10638 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
10639 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
10641 (GetInset): use my_memcpy.
10645 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
10646 it is easier to understand, but it uses less TeX-only constructs now.
10648 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
10649 elements contain spaces
10651 * lib/configure: regenerated
10653 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
10654 elements contain spaces; display the list of programs that are
10657 * autogen.sh: make sure lib/configure is executable
10659 * lib/examples/*: rename the tutorial examples to begin with the
10660 two-letters language code.
10662 * src/lyxfunc.C (getStatus): do not query current font if no
10665 * src/lyx_cb.C (RunScript): use QuoteName
10666 (MenuRunDvips): ditto
10667 (PrintApplyCB): ditto
10669 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
10670 around argument, so that it works well with the current shell.
10671 Does not work properly with OS/2 shells currently.
10673 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
10674 * src/LyXSendto.C (SendtoApplyCB): ditto
10675 * src/lyxfunc.C (Dispatch): ditto
10676 * src/buffer.C (runLaTeX): ditto
10677 (runLiterate): ditto
10678 (buildProgram): ditto
10680 * src/lyx_cb.C (RunScript): ditto
10681 (MenuMakeLaTeX): ditto
10683 * src/buffer.h (getLatexName): new method
10685 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
10687 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10689 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
10690 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
10691 (create_math_panel): ditto
10693 * src/lyxfunc.C (getStatus): re-activate the code which gets
10694 current font and cursor; add test for export to html.
10696 * src/lyxrc.C (read): remove unreachable break statements; add a
10699 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
10701 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10703 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
10704 introduced by faulty regex.
10705 * src/buffer.C: ditto
10706 * src/lastfiles.C: ditto
10707 * src/paragraph.C: ditto
10708 * src/table.C: ditto
10709 * src/vspace.C: ditto
10710 * src/insets/figinset.C: ditto
10711 Note: most of these is absolutely harmless, except the one in
10712 src/mathed formula.C.
10714 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
10716 * src/ImportNoweb.C (documentclass): fixed bounds for substr
10717 operation, yielding correct results for the reLyX command.
10719 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10721 * src/support/filetools.C (ExpandPath): removed an over eager
10723 (ReplaceEnvironmentPath): ditto
10725 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
10726 shows that we are doing something fishy in our code...
10727 (BubblePost): ditto
10730 * src/lyxrc.C (read): use a double switch trick to get more help
10731 from the compiler. (the same trick is used in layout.C)
10732 (write): new function. opens a ofstream and pass that to output
10733 (output): new function, takes a ostream and writes the lyxrc
10734 elemts to it. uses a dummy switch to make sure no elements are
10737 * src/lyxlex.h: added a struct pushpophelper for use in functions
10738 with more than one exit point.
10740 * src/lyxlex.[Ch] (GetInteger): made it const
10744 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
10746 * src/layout.[hC] : LayoutTags splitted into several enums, new
10747 methods created, better error handling cleaner use of lyxlex. Read
10750 * src/bmtable.[Ch]: change some member prototypes because of the
10751 image const changes.
10753 * commandtags.h, src/LyXAction.C (init): new function:
10754 "preferences-save", saves the lyxrc entries into .lyx/preferences.
10755 This file is not read automatically but you can add \input
10756 preferences to your lyxrc if you want to. We need to discuss how
10759 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
10760 in .aux, also remove .bib and .bst files from dependencies when
10763 * src/BufferView.C, src/LyXView.C: add const_cast several places
10764 because of changes to images.
10766 * lib/images/*: same change as for images/*
10768 * lib/lyxrc.example: Default for accept_compound is false not no.
10770 * images/*: changed to be const, however I have som misgivings
10771 about this change so it might be changed back.
10773 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10775 * lib/configure, po/POTFILES.in: regenerated
10777 * autogen.sh: autogenerate lib/configure from lib/configure.m4
10779 * config/lib_configure.m4: removed
10781 * lib/configure.m4: new file (was config/lib_configure.m4)
10783 * configure.in: do not test for rtti, since we do not use it.
10785 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10787 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
10788 doubling of allocated space scheme. This makes it faster for large
10789 strings end to use less memory for small strings. xtra rememoved.
10791 * src/insets/figinset.C (waitalarm): commented out.
10792 (GhostscriptMsg): use static_cast
10793 (GhostscriptMsg): use new instead of malloc to allocate memory for
10794 cmap. also delete the memory after use.
10796 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
10798 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
10799 for changes in bibtex database or style.
10800 (runBibTeX): remove all .bib and .bst files from dep before we
10802 (run): use scanAuc in when dep file already exist.
10804 * src/DepTable.C (remove_files_with_extension): new method
10805 (exist): new method
10807 * src/DepTable.[Ch]: made many of the methods const.
10809 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10811 * src/bufferparams.C: make sure that the default textclass is
10812 "article". It used to be the first one by description order, but
10813 now the first one is "docbook".
10815 * src/lyx_main.C (setDebuggingLevel): change type of argument to
10816 string; call Debug::value.
10817 (easyParse): pass complete argument to setDebuggingLevel().
10819 * src/debug.h (value): fix the code that parses debug levels.
10821 * src/debug.h: add new debug type ACTION, reserved for LyXAction
10824 * src/LyXAction.C: use Debug::ACTION as debug channel.
10826 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
10828 * NEWS: updated for the future 1.1.3 release.
10830 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
10831 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
10832 it should. This is of course a controversial change (since many
10833 people will find that their lyx workscreen is suddenly full of
10834 red), but done for the sake of correctness.
10836 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
10837 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
10839 * src/insets/inseterror.h, src/insets/inseturl.h,
10840 src/insets/insetinfo.h, src/insets/figinset.h,
10841 src/mathed/formulamacro.h, src/mathed/math_macro.h
10842 (EditMessage): add a missing const and add _() to make sure that
10843 translation happens
10845 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
10846 src/insets/insetbib.C, src/support/filetools.C: add `using'
10847 directives for cxx.
10849 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
10850 doing 'Insert index of last word' at the beginning of a paragraph.
10852 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10854 * several files: white-space changes.
10856 * src/mathed/formula.C: removed IsAlpha and IsDigit
10858 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
10859 .bib file. use a ifstream instead of FilePtr when parsing the .bib
10862 * src/insets/figinset.C (GetPSSizes): don't break when
10863 "EndComments" is seen. But break when a boundingbox is read.
10865 * all classes inherited from Inset: return value of Clone
10866 changed back to Inset *.
10868 * all classes inherited form MathInset: return value of Clone
10869 changed back to MathedInset *.
10871 * src/insets/figinset.C (runqueue): use a ofstream to output the
10872 gs/ps file. Might need some setpresicion or setw. However I can
10873 see no problem with the current code.
10874 (runqueue): use sleep instead of the alarm/signal code. I just
10875 can't see the difference.
10877 * src/paragraph.C (LyXParagraph): reserve space in the new
10878 paragraph and resize the inserted paragraph to just fit.
10880 * src/lyxfunc.h (operator|=): added operator for func_status.
10882 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
10883 check for readable file.
10885 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
10886 check for readable file.
10887 (MenuMakeLinuxDoc): ditto
10888 (MenuMakeDocBook): ditto
10889 (MenuMakeAscii): ditto
10890 (InsertAsciiFile): split the test for openable and readable
10892 * src/bmtable.C (draw_bitmaptable): use
10893 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
10895 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
10896 findtexfile from LaTeX to filetools.
10898 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
10899 instead of FilePtr. Needs to be verified by a literate user.
10901 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10903 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
10904 (EditMessage): likewise.
10906 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
10907 respectively as \textasciitilde and \textasciicircum.
10909 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10911 * src/support/lyxstring.h: made the methods that take iterators
10912 use const_iterator.
10914 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
10915 (regexMatch): made is use the real regex class.
10917 * src/support/Makefile.am: changed to use libtool
10919 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
10921 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
10923 (MathIsInset ++): changed several macros to be inline functions
10926 * src/mathed/Makefile.am: changed to use libtool
10928 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
10930 * src/insets/inset* : Clone changed to const and return type is
10931 the true insettype not just Inset*.
10933 * src/insets/Makefile.am: changed to use libtool
10935 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
10937 * src/undo.[Ch] : added empty() and changed some of the method
10940 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
10942 * src/lyxparagraph.h: use id() and id(...) instead of getID and
10943 setID use block<> for the bullets array, added const several places.
10945 * src/lyxfunc.C (getStatus): new function
10947 * src/lyxfunc.[Ch] : small changes to take advantage of the new
10948 LyXAction, added const to several funtions.
10950 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
10951 a std::map, and to store the dir items in a vector.
10953 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
10956 * src/LyXView.[Ch] + other files : changed currentView to view.
10958 * src/LyXAction.[Ch] : ported from the old devel branch.
10960 * src/.cvsignore: added .libs and a.out
10962 * configure.in : changes to use libtool.
10964 * acinclude.m4 : inserted libtool.m4
10966 * .cvsignore: added libtool
10968 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10970 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
10971 file name in insets and mathed directories (otherwise the
10972 dependency is not taken in account under cygwin).
10974 * src/text2.C (InsertString[AB]): make sure that we do not try to
10975 read characters past the string length.
10977 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10979 * lib/doc/LaTeXConfig.lyx.in,
10980 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
10982 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
10983 file saying who created them and when this heppened; this is
10984 useless and annoys tools like cvs.
10986 * lib/layouts/g-brief-{en,de}.layout,
10987 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
10988 from Thomas Hartkens <thomas@hartkens.de>.
10990 * src/{insets,mathed}/Makefile.am: do not declare an empty
10991 LDFLAGS, so that it can be set at configure time (useful on Irix
10994 * lib/reLyX/configure.in: make sure that the prefix is set
10995 correctly in LYX_DIR.
10997 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10999 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11000 be used by 'command-sequence' this allows to bind a key to a
11001 sequence of LyX-commands
11002 (Example: 'command-sequence math-insert alpha; math-insert beta;")
11004 * src/LyXAction.C: add "command-sequence"
11006 * src/LyXFunction.C: handling of "command-sequence"
11008 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
11009 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
11011 * src/lyxserver.C, src/minibuffer.C: Use this new interface
11013 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11015 * src/buffer.C (writeFile): Do not output a comment giving user
11016 and date at the beginning of a .lyx file. This is useless and
11017 annoys cvs anyway; update version number to 1.1.
11019 * src/Makefile.am (LYX_DIR): add this definition, so that a
11020 default path is hardcoded in LyX.
11022 * configure.in: Use LYX_GNU_GETTEXT.
11024 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
11025 AM_GNU_GETTEXT with a bug fixed.
11027 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
11029 * src/chset.C: add "using std::ifstream;" to please dec cxx.
11031 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
11032 which is used to point to LyX data is now LYX_DIR_11x.
11034 * lyx.man: convert to a unix text file; small updates.
11036 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11038 * src/support/LSubstring.[Ch]: made the second arg of most of the
11039 constructors be a const reference.
11041 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
11044 * src/support/lyxstring.[Ch] (swap): added missing member function
11045 and specialization of swap(str, str);
11047 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
11049 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
11050 trace of the old one.
11052 * src/undo.[Ch]: made the undostack use std::list to store undo's in
11053 put the member definitions in undo.C.
11055 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
11056 NEW_TEXT and have now only code that was included when this was
11059 * src/intl.C (LCombo): use static_cast
11061 (DispatchCallback): ditto
11063 * src/definitions.h: removed whole file
11065 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
11067 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
11068 parsing and stores in a std:map. a regex defines the file format.
11069 removed unneeded members.
11071 * src/bufferparams.h: added several enums from definitions.h here.
11072 Removed unsused destructor. Changed some types to use proper enum
11073 types. use block to have the temp_bullets and user_defined_bullets
11074 and to make the whole class assignable.
11076 * src/bufferparams.C (Copy): removed this functions, use a default
11077 assignment instead.
11079 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
11082 * src/buffer.C (readLyXformat2): commend out all that have with
11083 oldpapersize to do. also comment out all that hve to do with
11084 insetlatex and insetlatexdel.
11085 (setOldPaperStuff): commented out
11087 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
11089 * src/LyXAction.C: remove use of inset-latex-insert
11091 * src/mathed/math_panel.C (button_cb): use static_cast
11093 * src/insets/Makefile.am (insets_o_SOURCES): removed
11096 * src/support/lyxstring.C (helper): use the unsigned long
11097 specifier, UL, instead of a static_cast.
11099 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
11101 * src/support/block.h: new file. to be used as a c-style array in
11102 classes, so that the class can be assignable.
11104 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11106 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
11107 NULL, make sure to return an empty string (it is not possible to
11108 set a string to NULL).
11110 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11112 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
11114 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
11116 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
11117 link line, so that Irix users (for example) can set it explicitely to
11120 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
11121 it can be overidden at make time (static or dynamic link, for
11124 * src/vc-backend.C, src/LaTeXFeatures.h,
11125 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
11126 statements to bring templates to global namespace.
11128 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11130 * src/support/lyxstring.C (operator[] const): make it standard
11133 * src/minibuffer.C (Init): changed to reflect that more
11134 information is given from the lyxvc and need not be provided here.
11136 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
11138 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
11140 * src/LyXView.C (UpdateTimerCB): use static_cast
11141 (KeyPressMask_raw_callback): ditto
11143 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
11144 buffer_, a lot of changes because of this. currentBuffer() ->
11145 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
11146 also changes to other files because of this.
11148 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11150 * src/vc-backend.[Ch]: new files. The backends for vc handling,
11151 have no support for RCS and partial support for CVS, will be
11154 * src/insets/ several files: changes because of function name
11155 changes in Bufferview and LyXView.
11157 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
11159 * src/support/LSubstring.[Ch]: new files. These implement a
11160 Substring that can be very convenient to use. i.e. is this
11162 string a = "Mary had a little sheep";
11163 Substring(a, "sheep") = "lamb";
11164 a is now "Mary has a little lamb".
11166 * src/support/LRegex.[Ch]: a regex class that can be used to pick
11167 out patterns and subpatterns of strings. It is used by LSubstring
11168 and also by vc-backend.C
11170 * src/support/lyxstring.C: went over all the assertions used and
11171 tried to correct the wrong ones and flag which of them is required
11172 by the standard. some bugs found because of this. Also removed a
11173 couple of assertions.
11175 * src/support/Makefile.am (libsupport_a_SOURCES): added
11176 LSubstring.[Ch] and LRegex.[Ch]
11178 * src/support/FileInfo.h: have struct stat buf as an object and
11179 not a pointer to one, some changes because of this.
11181 * src/LaTeXFeatures.C (getTClassPreamble): also use the
11182 information in layout when adding the layouts preamble to the
11183 textclass preamble.
11185 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
11188 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
11189 because of bug in OS/2.
11191 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11193 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
11194 \verbatim@font instead of \ttfamily, so that it can be redefined.
11196 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
11197 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
11198 src/layout.h, src/text2.C: add 'using' directive to bring the
11199 STL templates we need from the std:: namespace to the global one.
11200 Needed by DEC cxx in strict ansi mode.
11202 * src/support/LIstream.h,src/support/LOstream.h,
11203 src/support/lyxstring.h,src/table.h,
11204 src/lyxlookup.h: do not include <config.h> in header
11205 files. This should be done in the .C files only.
11207 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
11211 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11213 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
11214 from Kayvan to fix the tth invokation.
11216 * development/lyx.spec.in: updates from Kayvan to reflect the
11217 changes of file names.
11219 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11221 * src/text2.C (InsertStringB): use std::copy
11222 (InsertStringA): use std::copy
11224 * src/bufferlist.C: use a vector to store the buffers in. This is
11225 an internal change and should not affect any other thing.
11227 * src/BufferView.C (waitForX): use XSync instead of the lengthy
11230 * src/text.C (Fill): fix potential bug, one off bug.
11232 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11234 * src/Makefile.am (lyx_main.o): add more files it depends on.
11236 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
11238 * src/support/lyxstring.C: use size_t for the reference count,
11239 size, reserved memory and xtra.
11240 (internal_compare): new private member function. Now the compare
11241 functions should work for std::strings that have embedded '\0'
11243 (compare): all compare functions rewritten to use
11246 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11248 * src/support/lyxstring.C (compare): pass c_str()
11249 (compare): pass c_str
11250 (compare): pass c_str
11252 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11254 * src/support/DebugStream.C: <config.h> was not included correctly.
11256 * lib/configure: forgot to re-generate it :( I'll make this file
11257 auto generated soon.
11259 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11261 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
11264 * src/support/lyxstring.C: some changes from length() to rep->sz.
11265 avoids a function call.
11267 * src/support/filetools.C (SpaceLess): yet another version of the
11268 algorithm...now per Jean-Marc's suggestions.
11270 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11272 * src/layout.C (less_textclass_desc): functor for use in sorting
11274 (LyXTextClass::Read): sort the textclasses after reading.
11276 * src/support/filetools.C (SpaceLess): new version of the
11277 SpaceLess functions. What problems does this one give? Please
11280 * images/banner_bw.xbm: made the arrays unsigned char *
11282 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11284 * src/support/lyxstring.C (find): remove bogus assertion in the
11285 two versions of find where this has not been done yet.
11287 * src/support/lyxlib.h: add missing int return type to
11290 * src/menus.C (ShowFileMenu): disable exporting to html if no
11291 html export command is present.
11293 * config/lib_configure.m4: add a test for an HTML converter. The
11294 programs checked for are, in this order: tth, latex2html and
11297 * lib/configure: generated from config/lib_configure.m4.
11299 * src/lyxfunc.C (Dispatch): update and improve the execution of an
11300 html converter. The parameters are now passed through $$FName and
11301 $$OutName, instead of standard input/output.
11303 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
11305 * lib/lyxrc.example: update description of \html_command.
11306 add "quotes" around \screen_font_xxx font setting examples to help
11307 people who use fonts with spaces in their names.
11309 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11311 * Distribution files: updates for v1.1.2
11313 * src/support/lyxstring.C (find): remove bogus assert and return
11314 npos for the same condition.
11316 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11318 * added patch for OS/2 from SMiyata.
11320 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11322 * src/text2.C (CutSelection): make space_wrapped a bool
11323 (CutSelection): dont declare int i until we have to.
11324 (alphaCounter): return a char const *.
11326 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11328 * src/support/syscall.C (Systemcalls::kill):
11329 src/support/filetools.C (PutEnv, PutEnvPath):
11330 src/lyx_cb.C (addNewlineAndDepth):
11331 src/FontInfo.C (FontInfo::resize): condition some #warning
11332 directives with WITH_WARNINGS.
11335 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11337 * src/layout.[Ch] + several files: access to class variables
11338 limited and made accessor functions instead a lot of code changed
11339 becuase of this. Also instead of returning pointers often a const
11340 reference is returned instead.
11342 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
11344 * src/Makefile.am (dist-hook): added used to remove the CVS from
11345 cheaders upon creating a dist
11346 (EXTRA_DIST): added cheaders
11348 * src/support/lstrings.C (tostr(char)): fix it to handle param as
11349 a character not as a small integer.
11351 * src/support/lyxstring.C (find): removed Assert and added i >=
11352 rep->sz to the first if.
11354 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11356 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
11357 src/LyXView.C src/buffer.C src/bufferparams.C
11358 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
11359 src/text2.C src/insets/insetinclude.C:
11360 lyxlayout renamed to textclasslist.
11362 * src/layout.C: some lyxerr changes.
11364 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
11365 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
11366 (LyXLayoutList): removed all traces of this class.
11367 (LyXTextClass::Read): rewrote LT_STYLE
11368 (LyXTextClass::hasLayout): new function
11369 (LyXTextClass::GetLayout): rewritten to return an iterator + has
11370 both const and nonconst version.
11371 (LyXTextClass::delete_layout): new function.
11372 (LyXTextClassList::Style): bug fix. do the right thing if layout
11374 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
11375 (LyXTextClassList::NameOfLayout): ditto
11376 (LyXTextClassList::Load): ditto
11378 * src/buffer.C (makeLaTeXFile): new access to layoutlist
11380 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
11382 * src/LyXAction.C (LookupFunc): added a workaround for sun
11383 compiler, on the other hand...we don't know if the current code
11384 compiles on sun at all...
11386 * src/support/filetools.C (CleanupPath): subst fix
11388 * src/insets/insetbib.C (delDatabase): subst fix, this looks
11391 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
11392 complained about this one?
11394 * src/insets/insetinclude.C (Latex): subst fix
11396 * src/insets/insetbib.C (getKeys): subst fix
11398 * src/LyXSendto.C (SendtoApplyCB): subst fix
11400 * src/lyx_main.C (init): subst fix
11402 * src/layout.C (Read): subst fix
11404 * src/lyx_sendfax_main.C (button_send): subst fix
11406 * src/buffer.C (RoffAsciiTable): subst fix
11408 * src/lyx_cb.C (MenuFax): subst fix
11409 (PrintApplyCB): subst fix
11411 1999-10-26 Juergen Vigna <jug@sad.it>
11413 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
11415 (Read): Cleaned up this code so now we read only format vestion >= 5
11417 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11419 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
11420 come nobody has complained about this one?
11422 * src/insets/insetinclude.C (Latex): subst fix
11424 * src/insets/insetbib.C (getKeys): subst fix
11426 * src/lyx_main.C (init): subst fix
11428 * src/layout.C (Read): subst fix
11430 * src/buffer.C (RoffAsciiTable): subst fix
11432 * src/lyx_cb.C (MenuFax): subst fix.
11434 * src/layout.[hC] + some other files: rewrote to use
11435 std::container to store textclasses and layouts in.
11436 Simplified, removed a lot of code. Make all classes
11437 assignable. Further simplifications and review of type
11438 use still to be one.
11440 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
11441 lastfiles to create the lastfiles partr of the menu.
11443 * src/lastfiles.[Ch]: rewritten to use deque to store the
11444 lastfiles in. Uses fstream for reading and writing. Simplifies
11447 * src/support/syscall.C: remove explicit cast.
11449 * src/BufferView.C (CursorToggleCB): removed code snippets that
11450 were commented out.
11451 use explicat C++ style casts instead of C style casts. also use
11452 u_vdata instea of passing pointers in longs.
11454 * src/PaperLayout.C: removed code snippets that were commented out.
11456 * src/lyx_gui_misc.C: removed code snippets that were commented out.
11458 * src/lyx_main.C: removed code snippets that wer commented out.
11460 * src/paragraph.C: removed code snippets that were commented out.
11462 * src/lyxvc.C (logClose): use static_cast
11464 (viewLog): remove explicit cast to void*
11465 (showLog): removed old commented code
11467 * src/menus.C: use static_cast instead of C style casts. use
11468 u_vdata instead of u_ldata. remove explicit cast to (long) for
11469 pointers. Removed old code that was commented out.
11471 * src/insets/inset.C: removed old commented func
11473 * src/insets/insetref.C (InsetRef): removed old code that had been
11474 commented out for a long time.
11476 (escape): removed C style cast
11478 * src/insets/insetlatexaccent.C (Draw): removed old commented code
11480 * src/insets/insetlatex.C (Draw): removed old commented code
11481 (Read): rewritten to use string
11483 * src/insets/insetlabel.C (escape): removed C style cast
11485 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
11487 * src/insets/insetindex.C: use static_cast and u_vdata, removed
11488 old commented code.
11490 * src/insets/insetinclude.h: removed a couple of stupid bools
11492 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
11493 (Clone): remove C style cast
11494 (getKeys): changed list to lst because of std::list
11496 * src/insets/inseterror.C (Draw): removed som old commented code.
11498 * src/insets/insetcommand.C (Draw): removed some old commented code.
11500 * src/insets/insetbib.C (bibitem_cb): removed code that has been
11501 commented out forever.
11502 (bibitem_cb): use static_cast instead of C style cast
11503 use of vdata changed to u_vdata.
11505 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
11507 (CloseUrlCB): use static_cast instead of C style cast.
11508 (CloseUrlCB): added a fl_free form...it seemed to be missing.
11510 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
11511 (C_InsetInfo_CloseInfoCB): forward the ob parameter
11512 (CloseInfoCB): static_cast from ob->u_vdata instead.
11513 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
11516 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
11517 (C_InsetError_CloseErrorCB): forward the ob parameter
11518 (CloseErrorCB): static_cast from ob->u_vdata instead.
11520 * src/vspace.h: include LString.h since we use string in this class.
11522 * src/vspace.C (lyx_advance): changed name from advance because of
11523 nameclash with stl. And since we cannot use namespaces yet...I
11524 used a lyx_ prefix instead. Expect this to change when we begin
11527 * src/BufferView.[Ch] (BufferView::~BufferView): removed
11529 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
11530 and removed now defunct constructor and deconstructor.
11532 * src/BufferView.h: have backstack as a object not as a pointer.
11533 removed initialization from constructor. added include for BackStack
11535 * development/lyx.spec.in (%build): add CFLAGS also.
11537 * src/screen.C (drawFrame): removed another warning.
11539 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11541 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
11542 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
11543 README and ANNOUNCE a bit for the next release. More work is
11546 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
11547 unbreakable if we are in freespacing mode (LyX-Code), but not in
11550 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
11552 * src/BackStack.h: fixed initialization order in constructor
11554 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
11556 * acinclude.m4 (VERSION): new rules for when a version is
11557 development, added also a variable for prerelease.
11558 (warnings): we set with_warnings=yes for prereleases
11559 (lyx_opt): prereleases compile with same optimization as development
11560 (CXXFLAGS): only use pedantic if we are a development version
11562 * src/BufferView.C (restorePosition): don't do anything if the
11563 backstack is empty.
11565 * src/BackStack.h: added member empty, use this to test if there
11566 is anything to pop...
11568 1999-10-25 Juergen Vigna <jug@sad.it>
11571 * forms/layout_forms.fd +
11572 * forms/latexoptions.fd +
11573 * lyx.fd: changed for various form resize issues
11575 * src/mathed/math_panel.C +
11576 * src/insets/inseterror.C +
11577 * src/insets/insetinfo.C +
11578 * src/insets/inseturl.C +
11579 * src/insets/inseturl.h +
11581 * src/LyXSendto.C +
11582 * src/PaperLayout.C +
11583 * src/ParagraphExtra.C +
11584 * src/TableLayout.C +
11586 * src/layout_forms.C +
11593 * src/menus.C: fixed various resize issues. So now forms can be
11594 resized savely or not be resized at all.
11596 * forms/form_url.fd +
11597 * src/insets/form_url.[Ch]: added because it's cleaner and easier
11600 * src/insets/Makefile.am: added files form_url.[Ch]
11602 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11604 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
11605 (and presumably 6.2).
11607 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
11608 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
11609 remaining static member callbacks.
11611 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
11614 * src/support/lyxstring.h: declare struct Srep as friend of
11615 lyxstring, since DEC cxx complains otherwise.
11617 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11619 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11621 * src/LaTeX.C (run): made run_bibtex also depend on files with
11623 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
11624 are put into the dependency file.
11626 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
11627 the code has shown itself to work
11628 (create_ispell_pipe): removed another warning, added a comment
11631 * src/minibuffer.C (ExecutingCB): removed code that has been
11632 commented out a long time
11634 * src/lyxfunc.C (processKeyEvent): removed some very old commented
11635 out code + a warning.
11637 * src/support/lyxstring.h: comment out the three private
11638 operators, when compiling with string ansi conforming compilers
11639 they make problems.
11641 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
11643 (pixmapFromBitmapData): change type of bdata to be unsigned char *
11644 (pixmapFromBitmapData): add a reinterpret_cast in the call to
11647 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
11650 * src/mathed/math_panel.C (create_math_panel): remove explicit
11653 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
11656 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
11657 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
11658 to XCreatePixmapFromBitmapData
11659 (fl_set_bmtable_data): change the last argument to be unsigned
11661 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
11662 and bh to be unsigned int, remove explicit casts in call to
11663 XReadBitmapFileData.
11665 * images/arrows.xbm: made the arrays unsigned char *
11666 * images/varsz.xbm: ditto
11667 * images/misc.xbm: ditto
11668 * images/greek.xbm: ditto
11669 * images/dots.xbm: ditto
11670 * images/brel.xbm: ditto
11671 * images/bop.xbm: ditto
11673 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
11675 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
11676 (LYX_PROG_CXX): added -pedantic to g++ compile options when
11677 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
11679 (LYX_CXX_CHEADERS): added <clocale> to the test.
11681 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
11683 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
11685 * src/support/lyxstring.C (append): fixed something that must be a
11686 bug, rep->assign was used instead of rep->append.
11688 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
11691 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
11692 lyx insert double chars. Fix spotted by Kayvan.
11694 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11696 * Fixed the tth support. I messed up with the Emacs patch apply feature
11697 and omitted the changes in lyxrc.C.
11699 1999-10-22 Juergen Vigna <jug@sad.it>
11701 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
11703 * src/lyx_cb.C (MenuInsertRef) +
11704 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
11705 the form cannot be resized under it limits (fixes a segfault)
11707 * src/lyx.C (create_form_form_ref) +
11708 * forms/lyx.fd: Changed Gravity on name input field so that it is
11711 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11713 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
11714 <ostream> and <istream>.
11716 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
11717 whether <fstream> provides the latest standard features, or if we
11718 have an oldstyle library (like in egcs).
11719 (LYX_CXX_STL_STRING): fix the test.
11721 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
11722 code on MODERN_STL_STREAM.
11724 * src/support/lyxstring.h: use L{I,O}stream.h.
11726 * src/support/L{I,O}stream.h: new files, designed to setup
11727 correctly streams for our use
11728 - includes the right header depending on STL capabilities
11729 - puts std::ostream and std::endl (for LOStream.h) or
11730 std::istream (LIStream.h) in toplevel namespace.
11732 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11734 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
11735 was a bib file that had been changed we ensure that bibtex is run.
11736 (runBibTeX): enhanced to extract the names of the bib files and
11737 getting their absolute path and enter them into the dep file.
11738 (findtexfile): static func that is used to look for tex-files,
11739 checks for absolute patchs and tries also with kpsewhich.
11740 Alternative ways of finding the correct files are wanted. Will
11742 (do_popen): function that runs a command using popen and returns
11743 the whole output of that command in a string. Should be moved to
11746 * src/DepTable.[Ch] (extchanged): new function that returns true if a
11747 file with extension ext has changed.
11749 * src/insets/figinset.C: added ifdef guards around the fl_free
11750 code that jug commented out. Now it is commented out when
11751 compiling with XForms == 0.89.
11753 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
11754 to lyxstring.C, and only keep a forward declaration in
11755 lyxstring.h. Simplifies the header file a bit and should help a
11756 bit on compile time too. Also changes to Srep will not mandate a
11757 recompile of code just using string.
11758 (~lyxstring): definition moved here since it uses srep.
11759 (size): definition moved here since it uses srep.
11761 * src/support/lyxstring.h: removed a couple of "inline" that should
11764 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11766 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
11769 1999-10-21 Juergen Vigna <jug@sad.it>
11771 * src/table.C (SetPWidth): Just a small fix so the alignment is not
11772 set to left if I just remove the width entry (or it is empty).
11774 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
11775 paragraph when having dummy paragraphs.
11777 1999-10-20 Juergen Vigna <jug@sad.it>
11779 * src/insets/figinset.C: just commented some fl_free_form calls
11780 and added warnings so that this calls should be activated later
11781 again. This avoids for now a segfault, but we have a memory leak!
11783 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
11784 'const char * argument' to 'string argument', this should
11785 fix some Asserts() in lyxstring.C.
11787 * src/lyxfunc.h: Removed the function argAsString(const char *)
11788 as it is not used anymore.
11790 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
11792 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
11795 * src/Literate.h: some funcs moved from public to private to make
11796 interface clearer. Unneeded args removed.
11798 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
11800 (scanBuildLogFile): ditto
11802 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
11803 normal TeX Error. Still room for improvement.
11805 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
11807 * src/buffer.C (insertErrors): changes to make the error
11808 desctription show properly.
11810 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
11813 * src/support/lyxstring.C (helper): changed to use
11814 sizeof(object->rep->ref).
11815 (operator>>): changed to use a pointer instead.
11817 * src/support/lyxstring.h: changed const reference & to value_type
11818 const & lets see if that helps.
11820 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
11822 * Makefile.am (rpmdist): fixed to have non static package and
11825 * src/support/lyxstring.C: removed the compilation guards
11827 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
11830 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
11831 conditional compile of lyxstring.Ch
11833 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
11834 stupid check, but it is a lot better than the bastring hack.
11835 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
11837 * several files: changed string::erase into string::clear. Not
11840 * src/chset.C (encodeString): use a char temporary instead
11842 * src/table.C (TexEndOfCell): added tostr around
11843 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
11844 (TexEndOfCell): ditto
11845 (TexEndOfCell): ditto
11846 (TexEndOfCell): ditto
11847 (DocBookEndOfCell): ditto
11848 (DocBookEndOfCell): ditto
11849 (DocBookEndOfCell): ditto
11850 (DocBookEndOfCell): ditto
11852 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
11854 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
11856 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
11857 (MenuBuildProg): added tostr around ret
11858 (MenuRunChktex): added tostr around ret
11859 (DocumentApplyCB): added tostr around ret
11861 * src/chset.C (encodeString): added tostr around t->ic
11863 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
11864 (makeLaTeXFile): added tostr around tocdepth
11865 (makeLaTeXFile): added tostr around ftcound - 1
11867 * src/insets/insetbib.C (setCounter): added tostr around counter.
11869 * src/support/lyxstring.h: added an operator+=(int) to catch more
11872 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
11873 (lyxstring): We DON'T allow NULL pointers.
11875 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11877 * src/mathed/math_macro.C (MathMacroArgument::Write,
11878 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
11879 when writing them out.
11881 * src/LString.C: remove, since it is not used anymore.
11883 * src/support/lyxstring.C: condition the content to
11884 USE_INCLUDED_STRING macro.
11886 * src/mathed/math_symbols.C, src/support/lstrings.C,
11887 src/support/lyxstring.C: add `using' directive to specify what
11888 we need in <algorithm>. I do not think that we need to
11889 conditionalize this, but any thought is appreciated.
11891 * many files: change all callback functions to "C" linkage
11892 functions to please strict C++ compilers like DEC cxx 6.1 in mode
11893 strict_ansi. Those who were static are now global.
11894 The case of callbacks which are static class members is
11895 trickier, since we have to make C wrappers around them (see
11896 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
11897 did not finish this yet, since it defeats the purpose of
11898 encapsulation, and I am not sure what the best route is.
11900 1999-10-19 Juergen Vigna <jug@sad.it>
11902 * src/support/lyxstring.C (lyxstring): we permit to have a null
11903 pointer as assignment value and just don't assign it.
11905 * src/vspace.C (nextToken): corrected this function substituting
11906 find_first(_not)_of with find_last_of.
11908 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
11909 (TableOptCloseCB) (TableSpeCloseCB):
11910 inserted fl_set_focus call for problem with fl_hide_form() in
11913 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11915 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
11918 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11920 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
11921 LyXLex::next() and not eatline() to get its argument.
11923 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
11925 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
11926 instead, use fstreams for io of the depfile, removed unneeded
11927 functions and variables.
11929 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
11930 vector instead, removed all functions and variables that is not in
11933 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11935 * src/buffer.C (insertErrors): use new interface to TeXError
11937 * Makefile.am (rpmdist): added a rpmdist target
11939 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
11940 per Kayvan's instructions.
11942 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11944 * src/Makefile.am: add a definition for localedir, so that locales
11945 are found after installation (Kayvan)
11947 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11949 * development/.cvsignore: new file.
11951 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11953 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
11954 C++ compiler provides wrappers for C headers and use our alternate
11957 * configure.in: use LYX_CXX_CHEADERS.
11959 * src/cheader/: new directory, populated with cname headers from
11960 libstdc++-2.8.1. They are a bit old, but probably good enough for
11961 what we want (support compilers who lack them).
11963 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
11964 from includes. It turns out is was stupid.
11966 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11968 * lib/Makefile.am (install-data-local): forgot a ';'
11969 (install-data-local): forgot a '\'
11970 (libinstalldirs): needed after all. reintroduced.
11972 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
11974 * configure.in (AC_OUTPUT): added lyx.spec
11976 * development/lyx.spec: removed file
11978 * development/lyx.spec.in: new file
11980 * po/*.po: merged with lyx.pot becuase of make distcheck
11982 * lib/Makefile.am (dist-hook): added dist-hook so that
11983 documentation files will be included when doing a make
11984 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
11985 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
11987 more: tried to make install do the right thing, exclude CVS dirs
11990 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
11991 Path would fit in more nicely.
11993 * all files that used to use pathstack: uses now Path instead.
11994 This change was a lot easier than expected.
11996 * src/support/path.h: new file
11998 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12000 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12002 * src/support/lyxstring.C (getline): Default arg was given for
12005 * Configure.cmd: removed file
12007 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12009 * src/support/DebugStream.[Ch]: remove the explicit std:: before
12010 streams classes and types, add the proper 'using' statements when
12011 MODERN_STL is defined.
12013 * src/debug.h: move the << operator definition after the inclusion
12016 * src/support/filetools.C: include "LAssert.h", which is needed
12019 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
12022 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
12023 include "debug.h" to define a proper ostream.
12025 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12027 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
12028 method to the SystemCall class which can kill a process, but it's
12029 not fully implemented yet.
12031 * src/*.C: Changed Systemcalls::Startscript() to startscript()
12033 * src/support/FileInfo.h: Better documentation
12035 * src/lyxfunc.C: Added support for buffer-export html
12037 * src/menus.C: Added Export->As HTML...
12039 * lib/bind/*.bind: Added short-cut for buffer-export html
12041 * src/lyxrc.*: Added support for new \tth_command
12043 * lib/lyxrc.example: Added stuff for new \tth_command
12045 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
12047 * lib/Makefile.am (IMAGES): removed images/README
12048 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
12049 installes in correct place. Check permisions is installed
12052 * src/LaTeX.C: some no-op changes moved declaration of some
12055 * src/LaTeX.h (LATEX_H): changed include guard name
12057 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12059 * lib/reLyX/Makefile.am: install noweb2lyx.
12061 * lib/Makefile.am: install configure.
12063 * lib/reLyX/configure.in: declare a config aux dir; set package
12064 name to lyx (not sure what the best solution is); generate noweb2lyx.
12066 * lib/layouts/egs.layout: fix the bibliography layout.
12068 1999-10-08 Jürgen Vigna <jug@sad.it>
12070 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
12071 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
12072 it returned without continuing to search the path.
12074 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
12076 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
12077 also fixes a bug. It is not allowed to do tricks with std::strings
12078 like: string a("hei"); &a[e]; this will not give what you
12079 think... Any reason for the complexity in this func?
12081 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
12083 * Updated README and INSTALL a bit, mostly to check that my
12084 CVS rights are correctly set up.
12086 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
12088 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
12089 does not allow '\0' chars but lyxstring and std::string does.
12091 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12093 * autogen.sh (AUTOCONF): let the autogen script create the
12094 POTFILES.in file too. POTFILES.in should perhaps now not be
12095 included in the cvs module.
12097 * some more files changed to use C++ includes instead of C ones.
12099 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
12101 (Reread): added tostr to nlink. buggy output otherwise.
12102 (Reread): added a string() around szMode when assigning to Buffer,
12103 without this I got a log of garbled info strings.
12105 * acconfig.h: commented out the PTR_AS_INT macros. They should not
12108 * I have added several ostream & operator<<(ostream &, some_type)
12109 functions. This has been done to avoid casting and warnings when
12110 outputting enums to lyxerr. This as thus eliminated a lot of
12111 explicit casts and has made the code clearer. Among the enums
12112 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
12113 mathed enums, some font enum the Debug::type enum.
12115 * src/support/lyxstring.h (clear): missing method. equivalent of
12118 * all files that contained "stderr": rewrote constructs that used
12119 stderr to use lyxerr instead. (except bmtable)
12121 * src/support/DebugStream.h (level): and the passed t with
12122 Debug::ANY to avoid spurious bits set.
12124 * src/debug.h (Debug::type value): made it accept strings of the
12125 type INFO,INIT,KEY.
12127 * configure.in (Check for programs): Added a check for kpsewhich,
12128 the latex generation will use this later to better the dicovery of
12131 * src/BufferView.C (create_view): we don't need to cast this to
12132 (void*) that is done automatically.
12133 (WorkAreaButtonPress): removed some dead code.
12135 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12137 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
12138 is not overwritten when translated (David Sua'rez de Lis).
12140 * lib/CREDITS: Added David Sua'rez de Lis
12142 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
12144 * src/bufferparams.C (BufferParams): default input encoding is now
12147 * acinclude.m4 (cross_compiling): comment out macro
12148 LYX_GXX_STRENGTH_REDUCE.
12150 * acconfig.h: make sure that const is not defined (to empty) when
12151 we are compiling C++. Remove commented out code using SIZEOF_xx
12154 * configure.in : move the test for const and inline as late as
12155 possible so that these C tests do not interefere with C++ ones.
12156 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
12157 has not been proven.
12159 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12161 * src/table.C (getDocBookAlign): remove bad default value for
12162 isColumn parameter.
12164 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
12166 (ShowFileMenu2): ditto.
12168 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
12169 of files to ignore.
12171 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12173 * Most files: finished the change from the old error code to use
12174 DebugStream for all lyxerr debugging. Only minor changes remain
12175 (e.g. the setting of debug levels using strings instead of number)
12177 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12179 * src/layout.C (Add): Changed to use compare_no_case instead of
12182 * src/FontInfo.C: changed loop variable type too string::size_type.
12184 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12186 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
12187 set ETAGS_ARGS to --c++
12189 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
12191 * src/table.C (DocBookEndOfCell): commented out two unused variables
12193 * src/paragraph.C: commented out four unused variables.
12195 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
12196 insed a if clause with type string::size_type.
12198 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
12201 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
12203 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
12204 variable, also changed loop to go from 0 to lenght + 1, instead of
12205 -1 to length. This should be correct.
12207 * src/LaTeX.C (scanError): use string::size_type as loop variable
12210 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
12211 (l.896) since y_tmp and row was not used anyway.
12213 * src/insets/insetref.C (escape): use string::size_type as loop
12216 * src/insets/insetquotes.C (Width): use string::size_type as loop
12218 (Draw): use string::size_type as loop variable type.
12220 * src/insets/insetlatexaccent.C (checkContents): use
12221 string::size_type as loop variable type.
12223 * src/insets/insetlabel.C (escape): use string::size_type as loop
12226 * src/insets/insetinfo.C: added an extern for current_view.
12228 * src/insets/insetcommand.C (scanCommand): use string::size_type
12229 as loop variable type.
12231 * most files: removed the RCS tags. With them we had to recompile
12232 a lot of files after a simple cvs commit. Also we have never used
12233 them for anything meaningful.
12235 * most files: tags-query-replace NULL 0. As adviced several plases
12236 we now use "0" instead of "NULL" in our code.
12238 * src/support/filetools.C (SpaceLess): use string::size_type as
12239 loop variable type.
12241 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12243 * src/paragraph.C: fixed up some more string stuff.
12245 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12247 * src/support/filetools.h: make modestr a std::string.
12249 * src/filetools.C (GetEnv): made ch really const.
12251 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
12252 made code that used these use max/min from <algorithm> instead.
12254 * changed several c library include files to their equivalent c++
12255 library include files. All is not changed yet.
12257 * created a support subdir in src, put lyxstring and lstrings
12258 there + the extra files atexit, fileblock, strerror. Created
12259 Makefile.am. edited configure.in and src/Makefile.am to use this
12260 new subdir. More files moved to support.
12262 * imported som of the functions from repository lyx, filetools
12264 * ran tags-query-replace on LString -> string, corrected the bogus
12265 cases. Tried to make use of lstrings.[hC], debugged a lot. There
12266 is still some errors in there. This is errors where too much or
12267 too litle get deleted from strings (string::erase, string::substr,
12268 string::replace), there can also be some off by one errors, or
12269 just plain wrong use of functions from lstrings. Viewing of quotes
12272 * LyX is now running fairly well with string, but there are
12273 certainly some bugs yet (see above) also string is quite different
12274 from LString among others in that it does not allow null pointers
12275 passed in and will abort if it gets any.
12277 * Added the revtex4 files I forgot when setting up the repository.
12279 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12281 * All over: Tried to clean everything up so that only the files
12282 that we really need are included in the cvs repository.
12283 * Switched to use automake.
12284 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
12285 * Install has not been checked.
12287 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12289 * po/pt.po: Three errors:
12290 l.533 and l.538 format specification error
12291 l. 402 duplicate entry, I just deleted it.