1 2001-01-03 Juergen Vigna <jug@sad.it>
3 * src/insets/insettabular.C (InsetButtonPress): look for button==2
4 and do Clipboard Paste!
6 * src/insets/insettext.C (SetText): added function.
8 * src/insets/insettabular.C (LocalDispatch): Fixed LFUN_PASTE and
9 new LFUN_PASTESELECTION.
11 * src/insets/insettext.C (draw): don't clear if top_x changes.
13 * src/insets/insettabular.C (draw): clear only if the inset didn't
14 change in the draw routine.
16 * src/insets/insettext.C (width): make the width dependant on the
19 * src/text.C (draw): comment out the UpdateInset call.
21 * src/screen.C (DrawOneRow):
22 (DrawFromTo): check for bv->text->status not text->status.
24 * src/insets/insettabular.C (calculate_dimensions_of_cells): calculate
25 dimensions of ascent-descent for the whole row.
27 * src/insets/insettext.C (draw): check also for need_update == INIT.
29 2001-01-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
31 * Makefile.am (EXTRA_DIST): add autogen.sh
33 2001-01-03 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
35 * development/OS2/quick_fix.patch:
36 * lib/configure.cmd: update OS/2 support files.
38 2001-01-02 Juergen Vigna <jug@sad.it>
40 * src/insets/insettabular.C (pasteSelection): rewritten correctly.
42 * src/tabular.C (TeXTopHLine):
43 (TeXBottomHLine): fixed Lars new code.
45 * src/insets/insettext.C (LocalDispatch): added support for math_greek.
47 * src/mathed/math_symbols.C (math_insert_greek): removed current_view
48 from this function and added a BufferView * parameter.
50 * src/mathed/math_symbols.C (math_insert_symbol): ditto
52 2000-12-31 Lars Gullik Bjønnes <larsbj@lyx.org>
54 * src/version.h: set to pre3
56 2000-12-31 Lars Gullik Bjønnes <larsbj@lyx.org>
58 * src/Makefile.am (lyx_SOURCES): added Floating.C
60 * src/Floating.h: moved all the inlines to Floating.C
62 * src/Floating.C: new file
64 2000-12-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
66 * src/frontends/xforms/FormPreferences.C (feedback): fix
67 description of RC_PRINTCOPIESFLAG and RC_PRINTCOLLCOPIESFLAG.
69 2000-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
71 * src/support/FileInfo.h: move unistd.h to after sys/types.h and
74 * src/support/FileInfo.C: don't include sys/types. and sys/stat.h
76 * src/mathed/math_inset.h: move LString.h to be included first
78 * src/insets/insetfloat.C: adjust for change in private variable names
80 * src/frontends/xforms/xform_helpers.h : don't include config.h
82 * src/frontends/xforms/xform_helpers.C: adjust the order of
83 includes, some whitespace changes.
85 * src/trans.C (Load): constify filename and res
87 * src/text2.C (SetCounter): call Floating::name()
89 * src/screen.C: change to not use owner from WorkArea, but from
92 * src/lyxfunc.C: adjust because of changes in Intl.
94 * src/intl.h: make trans a object instead of pointer, inlucd
95 trans_mgr.h in this file.
96 (getTrans): return a reference to TransManager
98 * src/intl.C: don't include trans_mgr.h here
99 modify calls to trans to work on object instead of on pointer
101 * src/WorkArea.h: add using for Signal1
102 comment out forward decl of BufferView.
104 remove class variable owner_ and getter method for this.
106 * src/WorkArea.C: don't include BufferView.h
107 (WorkArea): change to not take a BufferView.h, use signals
109 (scroll_cb): emit signal
111 * src/LaTeXFeatures.C: include Floatlist.h
112 (getPackages): only load float.sty when needed
113 (getMacros): prepare for outputting the correct code to preamble.
115 * src/Floating.h: make all variables private + rename to var_.
116 (Floating): default ctor
117 (Floating): complex ctor to set a complete Floating
123 * src/FloatList.C (FloatList): use Floating's constructor
126 (newFloat): call type()
127 (defaultPlacement): call placement()
128 (operator): new operator
130 * src/BufferView_pimpl.C (Pimpl): modify call to WorkArea
131 (scrollUp): call pimpl's scrollCB
133 (pasteClipboard): constify clip
135 * src/BufferView2.C (insertLyXFile): constify fname, fi and c.
136 (insertErrors): constify desctext, errortext, msgtxt and errorrow
137 (open_new_inset): delete some commented code.
139 * src/BufferView.[Ch] (enterView): comment out
142 (workAreaMotionNotify): ditto
143 (workAreaButtonPress): ditto
146 (workAreaButtonRelease): ditto
147 (workAreaExpose): ditto
149 * config/lyxinclude.m4 (cross_compiling): small stuff to be able
150 to compile with cvs gcc (2.97).
152 2000-12-28 Dekel Tsur <dekelts@tau.ac.il>
154 * lib/ui/default.ui: menu structure cleanup.
156 * lib/languages: add description of entries.
158 2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
160 * src/insets/ExternalTemplate.C (readTemplates): change debug
162 (readTemplate): use lyxlex.printError to report read errors.
165 * src/insets/insetexternal.C (Read): suppress debug message when
168 2000-12-21 Dekel Tsur <dekelts@tau.ac.il>
170 * src/insets/insetinclude.C (Ascii): New method. Currently
171 supports only verbatim input.
173 2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
175 * lib/bind/fi_menus.bind: update from Pauli Virtanen.
177 2000-12-22 Juergen Vigna <jug@sad.it>
179 * src/insets/insettabular.C (InsetButtonPress): do nothing if we
180 have a selection and button == 3.
181 (UpdateLocal): if what == INIT clear selection if existent!
182 (InsetButtonPress): don't activate the cell inset on button==3
184 (LocalDispatch): move curor up/down if exiting an inset which this
187 2000-12-20 Juergen Vigna <jug@sad.it>
189 * src/mathed/formula.C (LocalDispatch): return UNDISPATCHED when
190 calling for the math-panel (do not unlock the math-inset if locked)!
192 * src/text.C (GetVisibleRow): fixed drawing of depth lines inside
193 text-insets (with x-offset).
195 * src/tabular.C (TeXCellPreamble): fixed wrong output of special
196 alignment of multicolumn-cells.
198 2000-12-19 Juergen Vigna <jug@sad.it>
200 * src/lyxfunc.C (Dispatch):
201 * src/bufferview_funcs.C (changeDepth): implemented DEPTH functions
204 2000-12-19 Lars Gullik Bjønnes <larsbj@lyx.org>
206 * src/WorkArea.C (work_area_handler): simplify the key/keysym
207 handling for XForms 0.89, this might have rendered some cases
208 unusable. I have at least deadkeys, accent-xxx and KP_x working.
209 Please report proplems.
211 * src/lyxfunc.C (processKeySym): make the self-insert handling
214 2000-12-18 Baruch Even <baruch.even@writeme.com>
216 * src/LaTeX.C (deplog): fix spelling errors
217 * src/text2.C (CutSelection): ditto
218 * src/lyxfunc.C (Dispatch): ditto
220 2000-12-18 Lars Gullik Bjønnes <larsbj@lyx.org>
222 * lib/layouts/stdlayouts.inc: only allow align Center for Caption
224 * src/mathed/math_inset.C (MathMatrixInset): initialize v_align
225 and h_align in default init.
226 adjust calls to MathedRowSt
228 * src/mathed/math_iter.C: adjust calls to MathedRowSt
229 * src/mathed/math_iter.h (getAD): ditto
231 * src/mathed/math_defs.h (class MathedRowSt): remove friends, add
232 methods setBaseline, ascent, descent
233 (class MathMatrixInset): remove method GetAlign, change h_align
236 * src/lyxfunc.C (processKeySym): discover the correct argument if
237 the action is LFUN_SELFINSERT
239 2000-12-18 Dekel Tsur <dekelts@tau.ac.il>
241 * src/mathed/math_cursor.C (Interpret) Suppress a debug message
244 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
246 * src/support/copy.C: don't include filetools.h
248 * lib/images: revert to old banner, drop the cucumber.
250 2000-12-12 Dekel Tsur <dekelts@tau.ac.il>
252 * src/converter.C (Formats::View): Change the current directory to
253 the directory of the file.
255 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
257 * src/kbsequence.C (addkey): also clear sequence and modifiers if
260 * src/BufferView2.C (theLockingInset): return 0 if text is 0
262 2000-12-17 Dekel Tsur <dekelts@tau.ac.il>
264 * Many files: Fix RTL support for insettext.
266 2000-12-11 John Levon <moz@compsoc.man.ac.uk>
268 * README: add mention of broken ghostscript versions, remove
269 reference to non-existent BUGS file
271 2000-12-13 Angus Leeming <a.leeming@ic.ac.uk>
273 * src/support/lstrings.C (compare_no_case): small fix. When passed
274 length, should use it in the size comparison.
276 2000-12-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
278 * src/insets/insetexternal.C (getScreenLabel): Return a default
279 value if the template label is empty.
281 * src/lyxlookup.C: do not condition on FL_REVISION.
284 * src/sp_form.C: fix the font size of some text entries
286 * src/frontends/xforms/Menubar_pimpl.C (add_toc): honor separator
287 after TOC when there is no TOC.
289 * src/lyxrc.C (readBindFileIfNeeded): new method. Reads the main
290 bind file if it has not been done yet.
291 (read): remove local bindFile variable. Try to fix the handling of
292 RC_BIND and RC_BINDFILE.
294 * src/lyx_main.C (init): use readBindFileIfNeeded().
296 * lib/languages: Change description of german to "German (new
299 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
301 * src/frontends/xforms/FormInset.C (createInset): activate "Ok",
302 "Apply" buttons if arg is non-zero.
304 * src/lyxfunc.C (Dispatch): enable citation to be inserted without
305 launching the popup if sufficient info is passed to
306 LFUN_CITATION_CREATE.
308 2000-11-23 Dekel Tsur <dekelts@tau.ac.il>
310 * src/lyx_cb.C (MenuInsertLabel): Compute a default value for new
311 labels (disabled in 1.1.6).
313 * src/lyxrc.[Ch]: New variable label_init_length
315 * mathed/formula.C (LocalDispatch): Preserve the label when
316 changing from display math to eqnarray (however, the label
317 do not appear at the first line, as one might expects, but at the
319 (LocalDispatch): When inserting a label to a formula which already
320 have a label, the old label is used as default value.
321 Also, if the label is changed, then all references to the label
324 * src/mathed/math_iter.C (setLabel): Allow to set the label
325 even if it is empty. This is needed to allow deletion of a label
328 * src/BufferView2.C (ChangeRefsIfUnique): New method. Changes the
329 refernces only if the old label appears once in the document.
331 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
333 * lib/languages: added ngerman. Patch courtesy of Andreas Gehlert
334 <gehlert@Rcs1.urz.tu-dresden.de>
336 * src/frontends/xforms/FormBase.C: comment out debug.h
338 * src/frontends/xforms/FormGraphics.[Ch] (browseFile): removed. Reuse
339 code in xform_helpers instead.
340 (d-tor): comment out "delete dialog;" and so prevent a crash on exit.
342 * src/frontends/xforms/FormPreferences.C: use AddName() in more places.
343 Use N_(), rather than _() when creating strings to pass to browseFile()
344 because browseFile calls gettext() itself now.
346 * src/frontends/xforms/xform_helpers.C (browseFile): call gettext() and
347 display the filename correctly.
349 2000-12-09 Dekel Tsur <dekelts@tau.ac.il>
351 * src/converter.C (Move): New method. Used to move file or files
352 from temp dir to the output dir. (this fixes the bug that
353 exporting linuxdoc/docbook document to html would not move all
354 html file from temp directory).
356 * src/support/filetools.C (DirList): Fixed.
358 * src/lstrings.C (prefixIs): Fixed (how nobody noticed it before??).
360 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
362 * src/converter.C (Add): Remove $$i when setting latex_command.
364 * src/text.C (IsBoundary): Return false when pos = 0.
366 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
368 * lib/kbd/hebrew.kmap: Add Hebrew points (nikud).
370 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
372 * src/frontends/xforms/FormDocument.C (checkMarginValues): you don't
373 need to empty the fields to turn off use of the geometry package!
375 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
377 * src/lyxparagraph.h, src/paragraph.C (CopyIntoMinibuffer): pass a
378 (Buffer const &), not a (BufferParams const &) and so fix a crash
379 caused by using current_view before it had been initialised. Not
380 the best way to do this, but much easier than changing
381 Inset::Clone(Buffer const &) to Inset::Clone().
384 * src/tabular.C: changed call to CopyIntoMinibuffer().
386 2000-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
388 * lib/ui/default.ui: put TOC at the beginning of the TOC menu.
390 * src/lyxfunc.C (getStatus): disable insertion of floats in a
393 2000-12-06 Angus Leeming <a.leeming@ic.ac.uk>
395 * src/frontends/xforms/FormPreferences.C (ScreenFonts::build):
396 changed filter for screen fonts input filter from int to float
398 * src/frontends/xforms/input_validators.c: removed.
399 * src/frontends/xforms/input_validators.C: new file. Can now call C++
400 functions from within the filter functions.
402 * src/frontends/xforms/input_validators.[Ch]
403 (fl_unsigned_float_filter): new filter function.
405 * src/frontends/xforms/forms/fdfixc.sed: I defy gettext to get
406 confused now! And if you think I'm going to do this in
407 ./forms/fdfix.sh with its "sed -e" declarations, then think again!
409 2000-12-06 Lars Gullik Bjønnes <larsbj@lyx.org>
411 * src/buffer.C (asciiParagraph): small NEW_INSETS fix from Levon
413 * src/WorkArea.C (work_area_handler): don't handle button requests
414 if xbutton.button == 0
416 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
418 * lib/layouts/lyxmacros.inc: do not use \verbatim@font in lyxcode.
419 It creates a lot of interesting problems.
421 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
423 * src/frontends/xforms/Menubar_pimpl.C (openByName): check that
424 the menu exists in the current menubar before opening it.
426 * src/MenuBackend.C (hasSubmenu): new method.
428 * src/frontends/xforms/Menubar_pimpl.C: fix problem with bogus
429 action value by offsetting actions by a large constant (so that
430 bogs choice result will be less than this constant).
432 * lib/bind/fi_menus.bind: more cleanup to menus.
433 * lib/bind/sciword.bind: ditto.
434 * lib/bind/xemacs.bind: ditto.
435 * lib/bind/emacs.bind: ditto.
436 * lib/bind/pt_menus.bind: ditto.
437 * lib/bind/hu_menus.bind: ditto.
439 * src/gettext.h (locale_init): set locale LC_NUMERIC to "C".
441 * INSTALL: update PROBLEMS section.
443 * src/lyxlookup.h: remove condition on xforms version, since we
444 should not include it if not appropriate.
446 2000-12-05 John Levon <moz@compsoc.man.ac.uk>
448 * src/LColor.C: "latex text" -> "latex inset" (from
451 * src/lyxrc.C: "it's" -> "its" (from Angus Leeming)
453 * src/frontends/kde/FormTabularCreate.C:
454 * src/frontends/kde/citationdlg.C:
455 * src/frontends/kde/copyrightdlg.C:
456 * src/frontends/kde/paradlg.C:
457 * src/frontends/kde/paraextradlg.C:
458 * src/frontends/kde/parageneraldlg.C:
459 * src/frontends/kde/printdlg.C:
460 * src/frontends/kde/refdlg.C:
461 * src/frontends/kde/tabcreatedlg.C:
462 * src/frontends/kde/tocdlg.C:
463 * src/frontends/kde/urldlg.C: add necessary headers
466 * src/frontends/kde/dlg/emptytable.C:
467 * src/frontends/kde/dlg/tabstack.C: ctors shouldn't have
468 default parameters (from Angus Leeming)
470 * src/frontends/kde/dlg/moc/.cvsignore:
471 * src/frontends/kde/dlg/.cvsignore:
472 * src/frontends/kde/moc/.cvsignore: fix the library name
475 * src/frontends/kde/paradlg.C:
476 * src/frontends/kde/parageneraldlg.C:
477 * src/frontends/kde/dlg/para.dlg:
478 * src/frontends/kde/dlg/paradlgdata.C: added accelerators
480 * src/frontends/kde/dlg/README: clarified qtarch version
482 * src/frontends/kde/dlg/Makefile.am: removed the
483 dlg rules as they created spontaneous rebuilds
484 (not a good idea as it requires qtarch)
486 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
488 * config/lyxinclude.m4 (LYX_PATH_XFORMS): display also the
489 fixlevel along with xforms version.
491 * src/WorkArea.C (work_area_handler): use stuff in lyxlookup.h when
492 xforms version is strictly less than 0.89.5.
493 * src/lyx_gui.C (LyXGUI): ditto.
494 * src/LyXView.C (show): ditto.
496 2000-12-02 Dekel Tsur <dekelts@tau.ac.il>
498 * src/BufferView_pimpl.C (workAreaMotionNotify): Fixed mouse
499 movement in inset in RTL text.
500 (checkInsetHit): Fixed mouse movement in scrolled inset in RTL text.
501 (workAreaButtonRelease): Do not open a float when there is a selection.
503 * src/insets/insettext.C (cx): Fixed for insets in RTL text.
505 * src/spellchecker.C (RunSpellChecker): Open all floats before
508 * src/text.C (InsertChar): Consider "," as a part of a number
509 (for LTR numbers in RTL text code).
510 (IsBoundary): Fixed (and simplified).
511 (InsertChar): Recalculate cursor boundary.
514 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
516 * src/spellchecker.C: fix figures with pspell enabled
518 * src/insets/figinset.C: workaround for gs hang xforms bug
520 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
522 * lib/bind/??_menus.bind: comment out the entries corresponding to
523 real menus. They should be eventually removed, but I'll let the
524 language maintainers do that.
526 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
528 * src/frontends/kde/parageneraldlg.C:
529 * src/frontends/kde/parageneraldlg.h: don't use
530 a derived class for SpaceAbove/Below
532 * src/frontends/kde/dlg/README: add some info
534 * src/frontends/kde/dlg/*: update data files, update
537 * src/frontends/kde/dlg/moc/Makefile.am: add
540 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
542 * configure.in: add new KDE Makefiles
543 * src/vspace.h: return GlueLength not a normal one
544 * src/support/lstrings.h:
545 * src/support/lstrings.C: add isStrUnsignedInt(),
548 * src/frontends/kde/*: big reorganisation, update
549 FormParagraph, add FormTabCreate
551 2000-12-04 Angus Leeming <a.leeming@ic.ac.uk>
553 * lib/ui/default.ui: small grammatical change.
555 * src/frontends/xforms/xform_macros.h: removed.
557 * src/frontends/xforms/FormBase.C:
558 * src/frontends/xforms/FormPreferences.C:
559 * src/frontends/xforms/Makefile.am: changes associated with removing
560 xform_macros.h. Should make Lars' debugging a little easier.
562 * src/frontends/xforms/FormPreferences.C:
563 * src/frontends/xforms/FormPreferences.h:
564 * src/frontends/xforms/forms/form_preferences.fd (Colors tab): no
565 longer use X11 color name database. HSV and RGB dials/sliders.
566 Please let this be the end of this!
568 2000-11-30 Dekel Tsur <dekelts@tau.ac.il>
570 * Several files: Allow compilation when the compiler doesn't
573 2000-11-30 Angus Leeming <a.leeming@ic.ac.uk>
576 * src/lyx_main.C (commandLineHelp, easyParse): documented remaining
577 command line options.
579 2000-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
581 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use
582 FL_MENU_BUTTON for items in menu bar. Not sure what difference it
585 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
587 * src/frontends/xforms/FormRef.C (updateBrowser):
588 * src/frontends/xforms/forms/form_ref.fd: try clicking on
589 different insets with the sort key active. Now apply this patch!
591 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
593 * src/frontends/xforms/FormPrint.C: set to valid()
594 when we update from the passed parameters.
596 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
598 * src/LColor.C (getFromGUIName): internationalise the comparison.
600 * src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a
601 FormPreferences choice.
603 * src/frontends/xforms/FormPreferences.C: some additional Color safety.
606 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
608 * src/lyxrc.C: more detail for the printer program config
611 * src/LColor.C: ert->latex text. LColor needs a big revamp
612 but will have to wait till after 1.1.6
614 * src/buffer.C: bring up a dialog if we load a document
615 with an un-installed text class, rather than just complain
618 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
620 * src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
621 the browser form for a combox in a tabbed folder. Bug fix courtesy of
622 Steve Lamont <spl@ncmir.ucsd.edu>.
624 * src/frontends/xforms/FormDocument.C (build):
625 * src/frontends/xforms/FormPreferences.C (Language::build):
626 pass tabfolders to Combox::add() in order to use this work around.
628 * src/frontends/xforms/FormCitation.C (connect): remove max size
630 (update): sort list of bibliography keys.
632 * src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser,
634 No max size limitation. Same popup for new and existing insets. Fixes
635 bugs reported by Rob Lahaye.
637 * src/frontends/xforms/FormCitation.C (c-tor):
638 * src/frontends/xforms/FormCopyright.C (c-tor):
639 * src/frontends/xforms/FormError.C (c-tor):
640 * src/frontends/xforms/FormGraphics.C (c-tor):
641 * src/frontends/xforms/FormIndex.C (c-tor):
642 * src/frontends/xforms/FormRef.C (c-tor):
643 * src/frontends/xforms/FormToc.C (c-tor):
644 * src/frontends/xforms/FormUrl.C (c-tor):
645 use correct policy for ButtonController.
647 * src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more.
649 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr
652 * src/frontends/xforms/forms/form_citation.fd: some resizing changes.
654 * src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons.
655 Some resizing changes.
657 2000-11-28 Lars Gullik Bjønnes <larsbj@lyx.org>
659 * configure.in: fix typo
661 * lib/languages: add ukraninian and change no to no_NO
663 * src/lyxfont.[Ch] (setGUISize): comment out setGUISize
665 * src/bufferview_funcs.C (FontSize): use setLyXSize
667 2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
669 * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
670 to check for systems where mkstemp() is available but not declared
671 in headers. The new autoconf macro lyx_CHECK_DECL can be used
672 to check for declarations in headers.
674 2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
676 * forms/bibforms.fd: tiny fix to get it to run with fdesign.
678 * forms/makefile: added bibforms.fd, include_form.fd.
679 Removed lyx_sendfax.fd.
681 * src/LaTeXLog.C (ShowLatexLog):
682 * src/LyXAction.C (init):
683 * src/bufferparams.C (readLanguage): altered messages as suggested by
686 * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
689 * src/credits.C: made fd_form_credits non-static, so that it can be
690 redrawn should the xforms colors be re-mapped.
691 * src/spellchecker.C ditto fd_form_spell_options.
693 * src/filedlg.[Ch] (redraw):
694 * src/intl.[Ch] (redraw):
695 * src/lyxfr0.[Ch] (redraw):
696 * src/insets/figinset.[Ch] (redraw):
697 * src/insets/insetexternal.[Ch] (redraw):
698 new methods, connected to Dialogs::redrawGUI.
700 * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
701 to be connected to Dialogs::redrawGUI.
703 * src/frontends/xforms/FormCitation.C (build):
704 * src/frontends/xforms/FormCopyright.C (build):
705 * src/frontends/xforms/FormError.C (build):
706 * src/frontends/xforms/FormGraphics.C (build):
707 * src/frontends/xforms/FormIndex.C (build):
708 * src/frontends/xforms/FormTabularCreate.[Ch] (update):
709 * src/frontends/xforms/FormToc.C (build):
710 * src/frontends/xforms/FormUrl.C (build):
711 use the ButtonController correctly.
713 * src/frontends/xforms/FormCopyright.C (build):
714 * src/frontends/xforms/forms/form_copyright.fd: moved the text out of
715 the .fd file and into build().
717 * src/frontends/xforms/FormPreferences.C: tiny clean-up.
719 * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
721 * src/frontends/xforms/forms/form_citation.fd:
722 * src/frontends/xforms/forms/form_copyright.fd:
723 * src/frontends/xforms/forms/form_error.fd:
724 * src/frontends/xforms/forms/form_graphics.fd:
725 * src/frontends/xforms/forms/form_index.fd:
726 * src/frontends/xforms/forms/form_toc.fd:
727 * src/frontends/xforms/forms/form_url.fd:
728 renamed some of the objects. Named others explicitly for the first time.
729 Added Restore and Apply buttons where appropriate.
731 * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
734 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
736 * src/version.h: try the pre2 again
738 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
740 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
742 * src/frontends/kde/FormParagraph.C: added using directive.
744 * src/frontends/kde/paradlg.C: added config.h and using directive.
746 * src/frontends/kde/paradlg.h: added std::qualifier.
748 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
750 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
752 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
754 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
756 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
758 * src/version.h: set back to 1.1.6cvs
760 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
762 * src/version.h: set to 1.1.6pre2
764 2000-11-20 Marko Vendelin <markov@ioc.ee>
766 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
768 * src/frontends/gnome/Makefile.am: updated list of XForms object files
770 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
772 * src/LColor.C (init):
773 * src/lyxrc.C (getDescription): changed some comments as suggested by
776 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
777 disconnect the redrawGUI signal in best-practice fashion.
779 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
780 long_opts_tab to reflect the change in name of this tabfolder, as
781 suggested by John Levon.
782 (connect, disconnect): new methods. Don't do much at present other than
783 ensuring that we can't resize the dialog. This just makes xforms go
785 (lots of methods in Colors): made void rather than bool. The idea is
786 to have an isOk() function that keeps track of whether any input is
787 genuinely invalid and should therefore block Save, Apply.
788 Easier to manipulate the counters rapidly.
789 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
790 compiler will like this code. Much cleaner way of doing things.
792 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
794 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
795 rather than simple counters, following suggestion by John Levon.
797 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
798 than engraved frame + text.
800 * src/frontends/xforms/forms/makefile: removed spurious command.
802 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
804 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
806 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
809 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
811 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
812 see what Lars has changed and what is just white space!
813 Now used X directly to ascertain the RGB color associated with the
815 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
817 Added some sort capability.
818 The X11 color name database input is only displayed if the database
819 isn't found in the standard place.
820 Got rid of struct compare_converter; it wasn't used.
821 Probably some other stuff that I've forgotten.
823 * src/frontends/xforms/FormPreferences.h: changed the names of some
824 methods in the Colors struct. Added a couple of structs to help sort
825 colors by name and by RGBColor.
827 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
828 functions into a new class RWInfo.
830 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
831 The dialog is now almost navigable using the keyboard. Unfortunately,
832 the cursor has to be inside a browser for it to be activated. There is
833 no visual feedback for the key shortcuts to the arrow keys (use
834 Alt-appropriate arrow key, Alt-x).
836 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
839 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
840 xform_helpers.[Ch]. See above.
842 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
844 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
846 * src/screen.C (setCursorColor): new method. Sets the color of the
848 (ShowManualCursor): call it.
849 Constify some local variables.
851 * src/LColor.[Ch] (LColor): add entry for cursor
852 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
855 2000-11-19 Juergen Vigna <jug@sad.it>
857 * src/insets/insettabular.C (draw): fixed text border redraw problem.
858 (calculate_dimensions_of_cells): try to boost up when inserting chars.
860 2000-11-15 Rob Lahaye <lahaye@postech.edu>
862 * lib/ui/default.ui: OptItem used for Fax entry
864 2000-11-17 Matej Cepl <cepl@bigfoot.com>
866 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
868 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
870 * src/vspace.C (nextToken): fix so it can handle length phrases like
871 "10mm+-20mm", "40inplus16mmminus10cm" etc.
873 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
875 * src/frontends/xforms/FormPreferences.C: constify several variables
876 (BrowserLyX): rewrite to not need the choice variable
877 (Modify): rewrite to not need the choide variable
878 (compare_converter): make operator const
880 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
881 correct the writing of \set_color
882 (getDescription): return a const string
884 * src/kbsequence.[Ch] (addkey): remove dead code
886 * src/Painter.C (text): remove some commented code
888 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
890 * src/ColorHandler.[Ch]: removed some header files from .h file.
891 Included LColor.h in .C file.
893 * src/LColor.[Ch]: made class copyable so that I could create a
894 system_lcolor instance.
896 * src/Painter.h: removed LColor.h.
898 * src/lyx_gui.C (create_forms): used AddName.
900 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
901 of user preferences/lyxrc file.
903 * src/lyxrc.C (output): output changes to lcolor.
905 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
907 Moved class xformColor to files xform_helpers.[Ch]. These files,
908 Color.[Ch], could now be moved into src if they would be useful to
911 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
912 Also moved FormPreferences::browseFile here as it can be used by any
913 xform dialog with a "Browse" button. FormGraphics is a perfect example.
915 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
916 ReadableFile): changed the FormPreferences methods a little and moved
917 them here as they'll be useful elsewhere also.
919 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
920 Removed some header files and used forward declarations instead.
922 Removed some methods as they'll be useful elsewhere (see above).
924 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
925 Can also now modify the LyX LColors. However, for reasons that I don't
926 yet understand, it appears that we can use
927 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
928 present. The problem appears to lie in ColorHandler, because I can
929 change the color using LColor.SetColor(). Similarly, when reading in a
930 preferences file with some set_color instances, I'll get a warning
931 like: Color sea green is undefined or may not be redefined
932 Bad lyxrc set_color for sea green
934 Once the buffer is loaded, however, I can happily change to this color.
936 Finally, it appears that I have to set the color of "inset frame"
937 explicitly, or it oscillates from "black" to "indian red" with each
940 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
942 * ANNOUNCE: corrected a spelling mistake.
944 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
947 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
949 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
951 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
954 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
955 match the requirements from the standard better. This is required
956 to work with gnu libstdc++-v3
958 * src/frontends/xforms/FormPreferences.C: add explict pair
959 arguments to browse calls. include support/lyxmanip.h remvoe
960 extern fmt. whitespace changes. reorder variables in
961 FormPreferences.h, to match initalizaton order.
963 * several files: constify more local variables.
965 * src/buffer.C: remove some commented functions.
967 * src/DepTable.C (remove_files_with_extension): temporary
968 work around for gcc 2.97
969 * src/filedlg.C (find): ditto
970 * src/Variables.C (set): ditto
971 * src/LyXAction.C (searchActionArg): ditto
972 (retrieveActionArg): ditto
974 * configure.in: check for mktemp too
976 * UPGRADING: prepare for 1.1.6
978 * Makefile.am (lgbtags): add backup tags for when etags are
979 different than usual.
981 * ANNOUNCE: prepare for 1.1.6
983 * src/support/tempname.C (make_tempfile): new function, wrapper
984 around mkstemp and mktemp. Only mkstemp has been tested.
987 2000-11-14 Rob Lahaye <lahaye@postech.edu>
989 * default.ui: capitalized some menu items to improve shortcuts.
991 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
993 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
995 * src/frontends/xforms/Dialogs.C: add "using" directive.
997 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
999 * src/filedlg.C (Select): highlight suggested file in browser, if
1002 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
1003 each tab folder is encapsulated in its own class.
1004 The Language keymaps are now chosen using a text input and a
1005 browser button, rather than a Combox.
1006 All the browser buttons are now functional, although LyXFileDlg
1007 still needs to be modified to make it straighhtforward to return a
1008 directory if that is what is desired.
1010 * src/frontends/xforms/forms/form_preferences.fd: use text input
1011 and browse button to input the Language keymaps. Add a few
1012 callbacks for the browse buttons.
1014 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1016 * src/support/tempname.C (tempName): small changes to make it
1017 safer. remove the '.' before XXXXXX
1019 * src/support/filetools.C (TmpFileName): remove func
1022 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
1023 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
1024 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
1025 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
1027 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
1028 (FormCommand): ditto
1030 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
1033 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
1034 for bp (this fixes a reproducible hard crash)
1036 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
1039 * src/frontends/xforms/FormBase.h: make bp_ private
1040 (FormBaseBI): remove default for bp
1043 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
1046 * src/frontends/xforms/Color.C (RGBColor): made several vars
1047 const, changed initialization of j to allow it to be const
1050 * several files: added const to local variables.
1052 * src/lyx_cb.C: removed several function prototypes and moved them
1056 (UpdateLayoutPreamble):
1058 (MenuInsertLabel): add BufferView as arguemnt
1059 (LayoutsCB): make tmp const
1061 * src/layout_forms.h: regenerated
1063 * src/debug.C: add Debug::FILES
1064 (showLevel) (showTags): translate the desc
1066 * src/debug.h: add FILES as debug target
1068 * src/bufferlist.C: use current_view as an interim measure becuase
1069 of added arguments to MenuWrite and MenuWriteAs
1071 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
1073 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
1075 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
1076 libstdc++ is compiled with.
1078 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
1080 * lib/layouts/docbook-book.layout
1081 * lib/layouts/docbook.layout
1082 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
1083 those paragraphs are expresse as SGML comments <!-- -->.
1085 * src/LaTeXFeatures.h
1086 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
1087 parameter, this allows to express all the include files as relative
1088 paths to the master buffer. The verbatim insert works as the other
1091 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
1093 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
1095 (MakeDocBookFile): top_element is always written. Some clean up, as
1096 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
1098 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
1099 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
1100 a reference is written instead of the name.
1101 (Validate): use the relative path for the filename.
1103 * src/insets/insetlabel.C (DocBook): write end tag, for XML
1106 * src/support/filetools.h
1107 * src/support/filetools.C (IsSGMLFilename): added.
1110 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
1112 * development/OS2/quick_fix.patch:
1113 * lib/configure.cmd:
1114 * README.OS2: quick update to the OS/2 port.
1116 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1118 * src/converter.C: add "using" directive.
1120 * src/frontends/xforms/FormPreferences.C: add "using" directive.
1121 (compare_converter): add "int" as return type.
1123 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
1126 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
1128 * src/lyx_gui.C (create_forms): map the xform colours, should a
1129 mapping exist. Ie, call XformColor::read().
1131 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
1132 and struct HSV as HSVColor.
1133 (XformColor::read, XformColor::write) : new methods that
1134 input/output any changes to the cform GUI colors.
1136 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
1139 * src/frontends/xforms/FormPreferences.C Lots of little changes
1140 associated with the changed name of the RGB and HSV structs. Can
1141 now save changes to xforms GUI to file. Commented out
1142 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
1143 used currently anyway.
1145 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
1147 * src/converter.C: A lot of changes:
1148 - It is no longer possible to choose between two or more ways to
1149 export to some format (the new code uses only the shortest path).
1150 However, it is still possible to choose between pdflatex/ps2pdf
1151 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
1152 - Added several methods that makes the FormPreferences code simpler.
1153 - Changed the tokens $$FName and $$OutName to $$i and $$o.
1155 * src/exporter.C (Export): lyxrc.use_pdf is set before
1156 makeLaTeXFile is called. This works but not very nice.
1158 * src/frontends/xforms/FormPreferences.C: The formats/converters
1159 tabs are now fully functional.
1161 * src/buffer.C (getTocList): Add numbers to the captions.
1163 * lib/lyxrc.example: Removed fax section
1165 * src/support/rename.C (rename): Delete the old file if lyx::copy
1168 2000-11-13 Rob Lahaye <lahaye@postech.edu>
1170 * lib/ui/default.ui: minor polishing.
1172 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1174 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
1177 * lib/Makefile.am (DOCINST): do not install everything in the
1178 documentation directory.
1180 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
1182 * src/bufferlist.C (newFile): set the filename to the constructed
1185 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
1186 constructed "newfileXX.lyx" name to the dialog
1188 * src/frontends/DialogBase.h: make update() non-abstract so
1189 KDE doesn't need to implement two update methods for every form
1191 * src/frontends/kde/Makefile.am: add missing xforms objects
1194 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
1196 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
1198 * src/frontends/xforms/Color.[Ch]: new files, defining the color
1199 structs RGB and HSV. May not be the best place for these files.
1200 Perhaps move them into src ?
1202 * src/frontends/xforms/Makefile.am: added new files.
1204 * src/frontends/xforms/forms/form_preferences.fd:
1205 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
1206 replaced all instances of "colour" with "color"!
1208 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
1211 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
1212 tab. Can now alter the colors of the xform's GUI on the fly. With
1213 the aid of a single static Signal (see below), can "Apply" these
1214 changes to all currently open dialogs. (Well, to all of the NEW
1215 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
1216 subsequently opened dialogs will, of course, also have the new
1217 color scheme. Cannot yet save (or load) the choices to file, so
1218 they are lost when exiting LyX.
1220 * src/frontends/Dialogs.h:
1221 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
1222 Used to trigger a redraw of any dialogs connected to it because,
1223 for example, the GUI colours have been re-mapped.
1225 * src/frontends/xforms/FormBase.[Ch]:
1226 * src/frontends/xforms/FormDocument.[Ch]:
1227 * src/frontends/xforms/FormParagraph.[Ch]:
1228 * src/frontends/xforms/FormPreferences.[Ch]:
1229 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
1230 method, to be connected to Dialogs::redrawGUI. Method must be
1231 virtual, because dialogs with tabbed folders need to redraw the
1232 forms of each tab folder.
1234 * src/LyXView.C (d-tor):
1235 * src/frontends/xforms/FormBase.C (d-tor): connected
1236 Dialogs::redrawGUI signal to redraw().
1238 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
1239 removed Assert, because it is identical to that in FormBase.
1241 2000-11-10 Rob Lahaye <lahaye@postech.edu>
1243 * lib/ui/default.ui: minor polishing.
1245 2000-11-10 Juergen Vigna <jug@sad.it>
1247 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
1248 (deleteLyXText): ditto
1250 * src/insets/insettabular.C (InsetButtonPress): don't clear the
1251 selection on mouse-button-3.
1253 * src/insets/insettabular.h: new function clearSelection(), use this
1254 functions inside insettabular.C.
1256 * src/insets/insettabular.C (TabularFeatures): clear the selection
1257 on remove_row/column.
1259 * src/insets/inset.C (scroll): fixed some scroll stuff.
1261 * src/insets/insettabular.C (draw): fixed another minor draw problem.
1263 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1265 * lib/CREDITS: add Yves Bastide
1267 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
1269 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
1270 check whether C library functions are in the global namespace.
1272 * configure.in: calls it.
1274 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
1275 #ifndef __GLIBCPP__.
1277 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
1279 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
1280 iterators to prevent crash.
1282 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
1284 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
1286 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
1287 shortcut for xforms CB to the preemptive or post-handler function.
1289 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
1290 removed the HIDDEN_TIMER as it's no longer used.
1291 Various other small changes.
1293 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
1294 preemptive handler to obtain feedback, rather than the post-handler.
1295 (ColoursLoadBrowser): find "black" and "white" based on RGB values
1297 Formats tab is now complete. Converters tab is nearly so.
1299 2000-11-09 Juergen Vigna <jug@sad.it>
1301 * src/insets/insettext.C (~InsetText):
1304 (SetParagraphData): set cache.second to 0 after deleting it!
1305 (getLyXText): check if cache.second is not 0 if finding it.
1307 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1309 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
1310 lyxlex to parse the rgb.txt file.
1313 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
1314 replace the default '#' comment character.
1316 * src/support/tempname.C: add "using" directive
1317 * src/frontends/ButtonPolicies.C: ditto.
1319 * src/support/filetools.C (DirList): add an explicit cast to avoid
1320 a compile error (probably not the right fix)
1322 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
1324 * src/support/filetools.C (DirList): implement using system functions
1326 * src/support/tempname.C: new file
1328 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
1330 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
1332 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
1335 * src/frontends/xforms/ButtonController.C: new file
1337 * src/os2_defines.h: remove getcwd define
1339 * src/lyxvc.C: include support/lyxlib.h
1340 (showLog): use lyx::tempName
1342 * src/lyx_cb.C: comment out includes that we don't need
1343 (AutoSave): use lyx::tempName
1345 * src/filedlg.C: include support/lyxlib.h
1346 (Reread): use lyx::getcwd
1348 * src/converter.C: include support/filetools.h
1349 (add_options): change to static inline, make tail const
1350 (Add): make old_viewer const
1351 (GetAllFormats): make it a const method, use const_iterator
1352 (enable): make static inline
1353 (SplitFormat): make using_format const
1355 * src/LaTeX.C (run): use lyx::getcwd
1357 * configure.in: check for mkstemp as well
1359 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1361 * src/converter.[Ch] (GetAllCommands): new method.
1363 * src/support/filetools.[Ch] (DirList): new method.
1365 * src/frontends/xforms/FormPreferences.C: started (just!) adding
1366 functionality to the converters tab.
1367 The formats tab is now nearly complete.
1368 The kbmap choices in Languages tab now display the contents of
1369 system_lyxdir/kbd/*.kmap in readable form.
1371 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
1372 Moved some variables into the class.
1374 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
1375 inactive tab folder to FL_COL1. Haven't yet worked out how to change
1376 colour of active folder to lighter grey instead. Any takers?
1377 (form_colours): added an "Apply" button.
1378 (form_converters): added a "Flags" input field.
1379 (form_formats): added a "Shortcut" input field. Note that we can't use
1380 names such as "input_shortcut" as this buggers up the sed script stuff.
1382 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1390 * src/lyx_sendfax_main.C:
1393 * src/spellchecker.C:
1394 * src/insets/figinset.C:
1395 * src/insets/insetbib.C:
1396 * src/insets/insetexternal.C:
1397 * src/insets/insetinclude.C:
1398 * src/insets/insetinfo.C:
1399 * src/mathed/math_panel.C:
1400 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
1401 all "daughter" dialogs now have identical "feel".
1403 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1405 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
1406 used (and was only used in one place prior to this patch. Incorrectly!)
1408 * src/frontends/xforms/FormDocument.C: changed some instances of
1409 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
1410 sense. Also added fl_set_input_return() for class_->input_doc_extra and
1411 for options_->input_float_placement. This fixes a bug reported by
1414 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
1415 functionality into d-tor.
1417 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
1418 input of numerals also.
1420 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
1421 fl_set_form_atclose(). Can now close dialog from window manager,
1422 fixing a bug reported by Rob Lahaye.
1424 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
1426 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
1427 are no longer dark. Haven't yet worked out how to lighten the colour of
1428 the active tabfolder. Any ideas anybody?
1429 Adjusted Colours tab a little.
1430 Added Shortcut field to converters tab. Note that we can't create an
1431 fdesign label like "input_shortcut" as this buggers up the sed-script
1434 * src/frontends/xforms/FormPreferences.[Ch]:
1435 (feedback): fixed crash due to to ob=0.
1436 (LanguagesXXX): the kbmap choices now contain the files
1437 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
1438 be replaced by an input with a file browse button, but since the browse
1439 buttons don'y yet work, this'll do for the moment.
1440 (FormatsXXX): think that this is now nearly fully functional.
1441 Some points/questions though:
1442 1. Does "Apply" remove formats if no longer present?
1443 2. I think that the browser should list the GUI names rather than the
1445 3. Must ensure that we can't delete Formats used by an existing
1448 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
1449 if this is the best way to do this.
1451 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1453 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
1455 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
1456 for variable assignment.
1458 2000-11-07 Rob Lahaye <lahaye@postech.edu>
1460 * src/lib/ui/default.ui: added sub/superscripts to menu as
1461 Insert->Special characters and cleaned-up the file a bit
1463 2000-11-07 Allan Rae <rae@lyx.org>
1465 * src/frontends/xforms/FormPreferences.C (feedback): make sure
1466 ob isn't 0 before using it. See comments in function.
1468 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
1470 * src/frontends/xforms/form_*.C: regenerated
1472 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1474 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
1476 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
1477 compiling with gcc-2.96
1479 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1481 * src/support/lyxstring.C: add a couple "using" directives.
1483 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
1484 a .c_str() here too for good measure.
1485 * src/Spacing.C (set): ditto.
1486 * src/lyxfunc.C (Dispatch): ditto.
1488 * src/insets/insettabular.C (copySelection): change .str() to
1489 .str().c_str() to fix problems with lyxstring.
1490 * src/support/filetools.C (GetFileContents): ditto.
1491 * src/buffer.C (asciiParagraph): ditto.
1492 * src/paragraph.C (String): ditto.
1494 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
1495 * lib/bind/sciword.bind: ditto.
1497 * src/LyXAction.C (init): remove "symbol-insert" function, which
1498 shared LFUN_INSERT_MATH with "math-insert".
1500 * lib/configure.m4: == is not a valid operator for command test.
1502 * src/lyxrc.C: add using directive.
1504 * src/converter.h: add std:: qualifier.
1506 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
1508 * src/converter.[Ch] and other files: Change the Format class to a
1509 real class, and create two instances: formats and system_format.
1511 * src/lyxrc.C (output): Output the difference between formats and
1514 * src/frontends/xforms/FormPreferences.C (input): Simplify.
1515 (buildFormats): Insert formats into browser.
1516 (inputFormats): Made the browser and add button functional.
1517 (applyFormats): Update formats from format_vec.
1519 * src/converter.C: Changed all (*it). to it->
1520 (Format::dummy): New method.
1521 (Format::importer): New format flag.
1522 (Formats::GetAllFormats): New method.
1523 (Formats::Add): Delete format from the map if prettyname is empty.
1524 (Converter::Convert): Print an error message if moving the file fails.
1525 (Converter::GetReachableTo): New method
1527 * src/MenuBackend.[Ch]: Add support for importformats tag.
1529 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
1531 * lib/configure.m4: Add word->tex and ps->fax converters.
1533 * lib/ui/default.ui: Use ImportFormats on file->import menu.
1534 Return fax to file menu.
1538 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
1540 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
1543 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
1546 * src/lyxfunc.C (processKeyEvent): removed
1548 * src/bufferlist.C (emergencyWrite): removed the out commented
1549 emergency write code.
1551 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
1553 * src/LyXView.[Ch]: remove the outcommented raw_callback code
1555 * many files: change formatting to be a bit more uniform for
1556 if,while,for,switch statements, remove some parantesis not needed.
1559 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
1561 * config/kde.m4: make config more robust when KDEDIR is set
1563 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1565 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
1566 not returned a pixmap for "math-insert".
1568 * src/LyXAction.C (init): sort the entries a bit.
1570 2000-11-03 Juergen Vigna <jug@sad.it>
1572 * src/insets/insettabular.h: added fixed number to update codes so
1573 that update is only in one direction.
1575 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
1578 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
1579 before call to edit because of redraw.
1581 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
1583 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1585 * lib/ui/default.ui: Populate "edit_float" menu
1587 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
1589 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
1590 "floats-operate". The name is ugly (and the func also), but this
1591 is just a band-aid until we switch to new insets.
1593 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1595 * lib/ui/default.ui: update again the menu layout (fix some
1598 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1600 * src/MenuBackend.h (fulllabel): new method.
1602 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
1603 the menu shortcuts of a menu are unique and whether they
1604 correspond to a letter of the label.
1605 (expand): call checkShortcuts when debugging.
1607 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
1609 * src/insets/insettext.C (InsetButtonPress): shut off warning.
1611 2000-11-02 Lior Silberman <lior@Princeton.EDU>
1613 * lib/examples/*.lyx : '\language default' => '\language english'
1615 * lib/examples/it_splash.lyx : except where it should be italian
1617 * lib/templates/*.lyx : the same
1619 * doc/*.lyx* : the same
1621 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1623 * lib/bind/menus.bind: remove the Layout menu entries, which I
1624 somehow forgot earlier.
1626 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1628 * lib/ui/old-default.ui: keep the old one here for reference (to
1631 * lib/ui/default.ui: update the menu layout
1633 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
1635 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
1636 Can now Apply to different insets without closing the dialog.
1638 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
1639 Can't actually DO anything with them yet, but I'd like a little
1642 * src/frontends/xforms/input_validators.[ch]
1643 (fl_lowercase_filter): new.
1645 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
1647 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
1648 of MATH_CODE. This fixes a bug with math-macros in RTL text.
1650 * src/text.C (PrepareToPrint): Show math-macros block aligned.
1652 2000-11-02 Juergen Vigna <jug@sad.it>
1654 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
1655 on char insertion as it has already be updated by bv->updateInset().
1657 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
1658 if an inset inside was updated.
1660 * lib/configure.cmd: commented out fax-search code
1662 2000-11-01 Yves Bastide <stid@acm.org>
1664 * src/tabular.C (OldFormatRead): set tabular language to the
1667 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1669 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
1670 class names with non-letter characters (from Yves Bastide).
1672 * lib/ui/default.ui: change Item to OptItem in import menu.
1673 Comment out fax stuff.
1675 * lib/configure.m4: comment out fax-related stuff.
1677 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
1679 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
1680 useful xforms helper functions. At present contains only formatted().
1681 Input a string and it returns it with line breaks so that in fits
1684 * src/frontends/xforms/Makefile.am: add new files.
1686 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
1687 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
1690 * src/frontends/xforms/FormPreferences.[Ch]:
1691 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
1692 but lots of little clean ups. Removed enum State. Make use of
1693 formatted(). Constify lots of methods. Perhaps best of all: removed
1694 requirement for that horrible reinterpret_cast from pointer to long in
1697 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1699 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
1700 conditionalize build on xforms < 0.89
1702 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
1704 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
1706 * src/LyXAction.C (init): comment out fax
1708 * src/lyxrc.h: comment out the fax enums
1709 comment out the fax variables
1711 * src/commandtags.h: comment out LFUN_FAX
1713 * src/lyxrc.C: disable fax variables.
1714 (read): disable parsing of fax variables
1715 (output): disable writing of fax variables
1716 (getFeedback): now description for fax variables
1718 * src/lyxfunc.C: comment out MenuFax
1719 (Dispatch): disable LFUN_FAX
1721 * src/lyx_cb.C (MenuFax): comment out
1723 * src/WorkArea.C: add <cctype>
1724 (work_area_handler): better key handling, should be ok now.
1725 for accented chars + etc
1727 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
1728 lyx_sendfax.h and lyx_sendfax_man.C
1730 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
1731 (show): don't call InitLyXLookup when using xforms 0.89
1733 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1735 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1737 * src/support/filetools.C (GetFileContents): close to dummy change
1739 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1741 * src/trans.C (AddDeadkey): workaround stupid compilers.
1743 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1745 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1746 of two-sided document.
1748 2000-10-31 Juergen Vigna <jug@sad.it>
1750 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1752 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1753 xposition to the Edit call.
1755 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1757 * src/trans.C (AddDeadkey): cast explicitly to char.
1759 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1761 * src/tabular.C (AsciiBottomHLine): simplify?
1762 (AsciiTopHLine): simplify?
1763 (print_n_chars): simplify
1764 (DocBook): remove most of the << endl; we should flush the stream
1765 as seldom as possible.
1767 (TeXBottomHLine): ditto
1768 (TeXTopHLine): ditto
1770 (write_attribute): try a templified version.
1771 (set_row_column_number_info): lesson scope of variables
1773 * src/support/lstrings.h (tostr): new specialization of tostr
1775 * src/trans.C (AddDeadkey): slightly cleaner fix.
1777 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1779 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1780 '%%' in Toc menu labels.
1783 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1784 font_norm is iso10646-1.
1786 * src/font.C (ascent): Fixed for 16bit fonts
1787 (descent,lbearing,rbearing): ditto
1789 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1791 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1792 (getFeedback): new static method.
1794 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1795 Now use combox rather than choice to display languages.
1796 Feedback is now output using a new timer callback mechanism, identical
1797 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1799 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1801 * src/minibuffer.C: fix for older compilers
1803 2000-10-30 Juergen Vigna <jug@sad.it>
1805 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1806 has to be Left of the inset otherwise LyXText won't find it!
1808 * src/BufferView2.C (open_new_inset): delete the inset if it can
1811 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1813 * lyx.man: fix typo.
1815 2000-10-29 Marko Vendelin <markov@ioc.ee>
1816 * src/frontends/gnome/FormCitation.C
1817 * src/frontends/gnome/FormCitation.h
1818 * src/frontends/gnome/FormCopyright.C
1819 * src/frontends/gnome/FormCopyright.h
1820 * src/frontends/gnome/FormError.C
1821 * src/frontends/gnome/FormError.h
1822 * src/frontends/gnome/FormIndex.C
1823 * src/frontends/gnome/FormIndex.h
1824 * src/frontends/gnome/FormPrint.C
1825 * src/frontends/gnome/FormPrint.h
1826 * src/frontends/gnome/FormRef.C
1827 * src/frontends/gnome/FormRef.h
1828 * src/frontends/gnome/FormToc.C
1829 * src/frontends/gnome/FormToc.h
1830 * src/frontends/gnome/FormUrl.C
1831 * src/frontends/gnome/FormUrl.h
1832 * src/frontends/gnome/Menubar_pimpl.C
1833 * src/frontends/gnome/mainapp.C
1834 * src/frontends/gnome/mainapp.h
1835 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1836 changing update() to updateSlot() where appropriate
1838 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1840 * src/frontends/xforms/FormPreferences.[Ch]:
1841 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1844 2000-10-28 Juergen Vigna <jug@sad.it>
1846 * src/insets/insettabular.C (draw): fixed drawing bug.
1848 * src/insets/insettext.C (clear):
1850 (SetParagraphData): clearing the TEXT buffers when deleting the
1851 paragraphs used by it.
1853 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
1855 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
1857 2000-10-27 Juergen Vigna <jug@sad.it>
1859 * src/tabular.C (~LyXTabular): removed not needed anymore.
1861 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
1864 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1866 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
1869 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
1872 * src/frontends/xforms/FormPreferences.[Ch]:
1873 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
1874 Reorganised as modules based on tabs. Much easier to follow the
1875 flow and to add new tabs. Added warning and feedback messages.
1878 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1880 * src/tabular.h (DocBook): add std:: qualifier.
1882 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
1884 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
1885 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
1888 * insettabular.C (DocBook): uses the tabular methods to export
1891 * src/insets/insettext.h
1892 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
1894 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1896 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
1899 * src/lyxfunc.C (MenuNew): lessen the scope of fname
1900 moved misplaced AllowInput two lines up.
1902 * src/buffer.C (readFile): compare float with float, not with int
1904 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1906 * src/minibuffer.C: add "using SigC::slot" statement.
1908 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
1910 * src/frontends/xforms/forms/README: updated section about make.
1912 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
1913 Tidied some forms up, made two of form_tabular's tabs more
1914 self-consistent, fixed Jean-Marc's size problem in form_preferences,
1915 fixed translation problem with "Column".
1917 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1919 * src/minibuffer.h: use Timeout instead of the xforms timer
1921 (setTimer) rewrite for the Timeout, change to unsigned arg
1922 (set): change to unsigned timer arg
1925 * src/minibuffer.C (TimerCB): removed func
1926 (C_MiniBuffer_TimerCB): removed func
1927 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
1928 (peek_event): use a switch statement
1929 (add): don't use fl_add_timer.
1930 (Set): rewrite to use the Timeout
1933 * src/Timeout.[Ch] (setType): return a Timeout &
1934 (setTimeout): ditto, change to unsigned arg for timeout
1936 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
1938 * src/mathed/formula.C (mathed_string_width): Use string instead
1939 of a constant size char array.
1941 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1943 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
1944 the two recently added operator<< for SMInput and State.
1946 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
1948 (OkCancelPolicy): ditto
1949 (OkCancelReadOnlyPolicy): ditto
1950 (NoRepeatedApplyReadOnlyPolicy): ditto
1951 (OkApplyCancelReadOnlyPolicy): ditto
1952 (OkApplyCancelPolicy): ditto
1953 (NoRepeatedApplyPolicy): ditto
1955 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1957 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
1958 add the usual std:: qualifiers.
1960 2000-10-25 Juergen Vigna <jug@sad.it>
1962 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
1964 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1966 * src/support/filetools.C (MakeRelPath): change some types to
1969 * src/frontends/ButtonPolicies.h (operator<<): new operator for
1970 ButtonPolicy::SMInput and ButtonPolicy::State.
1972 * src/FontLoader.C (reset): small cleanup
1973 (unload): small cleanup
1975 * src/FontInfo.C (getFontname): initialize error to 10000.0
1977 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1979 * src/frontends/xforms/FormPreferences.[Ch]:
1980 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
1981 TeX encoding and default paper size sections.
1983 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1985 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
1988 * src/frontends/xforms/FormError.C (disconnect): use erase() to
1989 make the message_ empty.
1990 (FormError): don't initialize message_ in initializer list.
1992 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1994 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
1996 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1998 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
2000 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
2002 * src/frontends/kde/*data.[Ch]: _("") is not
2005 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
2007 * src/buffer.C: removed redundant using directive.
2009 * src/frontends/DialogBase.h: revert to original definition of
2012 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
2013 stuff into two classes, one for each dialog, requires a new
2014 element in the dialogs vector, FormTabularCreate.
2016 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
2019 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
2020 method. Continues Allan's idea, but means that derived classes
2021 don't need to worry about "update or hide?".
2023 * src/frontends/xforms/FormError.C (showInset): add connection
2026 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
2027 one for each dialog. FormTabular now contains main tabular dialog
2030 * src/frontends/xforms/FormTabularCreate.[Ch]:
2031 * src/frontends/xforms/forms/form_tabular_create.fd: the create
2034 * src/frontends/xforms/FormGraphics.[Ch]:
2035 * src/frontends/xforms/forms/form_graphics.fd
2036 * src/frontends/xforms/FormTabular.[Ch]:
2037 * src/frontends/xforms/forms/form_tabular.fd: made daughter
2038 classes of FormInset.
2040 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
2041 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
2043 * src/frontends/xforms/Makefile.am:
2044 * src/frontends/xforms/forms/makefile: added new files.
2046 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
2047 variable. added Signal0 hide signal, in keeping with other GUI-I
2050 * src/support/lstrings.h: removed redundant std:: qualifier as
2051 it's already declared in Lsstream.h.
2053 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2055 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
2059 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
2061 * src/tabular.C (Ascii): minimize scope of cell.
2063 * src/BufferView2.C (nextWord): return string() instead of 0;
2065 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2067 * src/converter.h: add a std:: qualifier
2069 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
2071 * src/importer.[Ch]: New files. Used for importing files into LyX.
2073 * src/lyxfunc.C (doImport): Use the new Importer class.
2075 * src/converter.h: Add shortcut member to the Format class.
2076 Used for holding the menu shortcut.
2078 * src/converter.C and other files: Made a distinction between
2079 format name and format extension. New formats can be defined using
2080 the \format lyxrc tag.
2081 Added two new converter flags: latex and disable.
2083 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2085 * src/support/lyxlib.h: unify namespace/struct implementation.
2086 Remove extra declarations.
2088 * src/support/chdir.C (chdir): remove version taking char const *
2090 * src/support/rename.C: ditto.
2091 * src/support/lyxsum.C: ditto.
2093 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
2095 * src/frontends/xforms/FormBase.[Ch]:
2096 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
2097 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
2098 work only for the next call to fl_show_form(). The correct place to set
2099 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
2100 done. FormBase also stores minw_, minh_ itself. All dialogs derived
2101 from FormBase have the minimum size set; no more stupid crashes with
2104 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2106 * lib/ui/default.ui: fix shortcut for Insert->Include File.
2108 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2110 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
2112 * src/support/lyxlib.h: changed second argument of mkdir to
2113 unsigned long int (unsigned int would probably have been enough,
2114 but...). Removed <sys/types.h> header.
2115 * src/support/mkdir.C (mkdir): ditto.
2119 2000-10-19 Juergen Vigna <jug@sad.it>
2121 * src/lyxfunc.C (MenuNew): small fix (form John)
2123 * src/screen.C (Update): removed unneeded code.
2125 * src/tabular.C (Ascii): refixed int != uint bug!
2127 * src/support/lyxlib.h: added sys/types.h include for now permits
2128 compiling, but I don't like this!
2130 2000-10-18 Juergen Vigna <jug@sad.it>
2132 * src/text2.C (ClearSelection): if we clear the selection we need
2133 more refresh so set the status apropriately
2135 * src/insets/insettext.C (draw): hopefully finally fixed draw
2138 2000-10-12 Juergen Vigna <jug@sad.it>
2140 * src/insets/insettext.C (draw): another small fix and make a block
2141 so that variables are localized.
2143 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
2145 * src/support/lstrings.C (lowercase, uppercase):
2146 use explicit casts to remove compiler warnings.
2148 * src/support/LRegex.C (Impl):
2149 * src/support/StrPool.C (add):
2150 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
2151 (AddPath, MakeDisplayPath):
2152 * src/support/lstrings.C (prefixIs, subst):
2153 use correct type to remove compiler warnings.
2155 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
2157 * src/support/lyxlib.h:
2158 * src/support/mkdir.C (mkdir): change parameter to mode_t for
2159 portability and to remove compiler warning with DEC cxx.
2161 * src/support/FileInfo.[Ch] (flagRWX): ditto.
2163 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2165 * src/minibuffer.C (peek_event): retun 1 when there has been a
2166 mouseclick in the minibuffer.
2170 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
2172 * src/frontends/xforms/FormParagraph.C: more space above/below
2175 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
2177 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
2178 a char only if real_current_font was changed.
2180 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2182 * NEWS: update somewhat for 1.1.6
2184 * lib/ui/default.ui: clean up.
2186 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
2188 * lib/CREDITS: clean up
2190 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2192 * src/combox.[Ch] (select): changed argument back to int
2193 * src/combox.C (peek_event): removed num_bytes as it is declared but
2196 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
2197 modified calls to Combox::select() to remove warnings about type
2200 * src/insets/insetbutton.C (width): explicit cast to remove warning
2201 about type conversion.
2203 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
2206 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
2207 sel_pos_end, refering to cursor position are changed to
2208 LyXParagraph::size_type.
2210 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
2211 consistent with LyXCursor::pos().
2212 (inset_pos): changed to LyXParagraph::size_type for same reason.
2214 * src/insets/insettext.C (resizeLyXText): changed some temporary
2215 variables refing to cursor position to LyXParagraph::size_type.
2217 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
2219 * src/frontends/kde/<various>: The Great Renaming,
2222 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2224 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
2226 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2228 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
2229 0 when there are no arguments.
2231 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2233 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
2234 to segfaults when pressing Ok in InsetBibtex dialog.
2236 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2238 * forms/layout_forms.fd:
2239 * src/layout_forms.C (create_form_form_character): small change to use
2240 labelframe rather than engraved frame + text
2242 * src/lyx_gui.C (create_forms): initialise choice_language with some
2243 arbitrary value to prevent segfault when dialog is shown.
2245 2000-10-16 Baruch Even <baruch.even@writeme.com>
2247 * src/converter.C (runLaTeX, scanLog): Added a warning when there
2248 is no resulting file. This pertains only to LaTeX output.
2250 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
2252 * src/text.C (Backspace): Make sure that the row of the cursor is
2255 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
2258 * src/lyx_gui.C (init): Prevent a crash when only one font from
2259 menu/popup fonts is not found.
2261 * lib/lyxrc.example: Add an example for binding a key for language
2264 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
2266 * src/converter.C (GetReachable): Changed the returned type to
2268 (IsReachable): New method
2270 * src/MenuBackend.C (expand): Handle formats that appear more
2273 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2275 * src/frontends/support/Makefile.am
2276 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
2279 * lib/CREDITS: add Garst Reese.
2281 * src/support/snprintf.h: add extern "C" {} around the definitions.
2283 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
2285 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2288 * src/frontends/xforms/FormDocument.C:
2289 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
2290 compile without "conversion to integral type of smaller size"
2293 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2295 * src/text.C (GetColumnNearX): Fixed disabled code.
2297 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2299 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
2302 * src/support/snprintf.[ch]: new files
2304 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2306 * src/frontends/kde/formprintdialog.C: add
2307 file browser for selecting postscript output
2309 * src/frontends/kde/formprintdialogdata.C:
2310 * src/frontends/kde/formprintdialogdata.h: re-generate
2313 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2315 * src/frontends/gnome/Makefile.am:
2316 * src/frontends/kde/Makefile.am: FormCommand.C
2317 disappeared from xforms
2319 * src/frontends/kde/FormCitation.C:
2320 * src/frontends/kde/FormIndex.C: read-only
2323 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2325 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
2328 * src/bufferlist.C: add using directive.
2330 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2332 * src/support/lyxfunctional.h: version of class_fun for void
2333 returns added, const versions of back_inseter_fun and compare_fun
2336 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2338 * src/frontends/xforms/FormInset.C (showInset): fix typo.
2340 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2342 * ChangeLog: cleanup.
2344 * lib/CREDITS: update to add all the contributors we've forgotten.
2345 I have obviously missed some, so tell me whether there were
2348 2000-10-13 Marko Vendelin <markov@ioc.ee>
2350 * src/frontends/gnome/FormCitation.C
2351 * src/frontends/gnome/FormCitation.h
2352 * src/frontends/gnome/FormError.C
2353 * src/frontends/gnome/FormIndex.C
2354 * src/frontends/gnome/FormRef.C
2355 * src/frontends/gnome/FormRef.h
2356 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
2358 * src/frontends/gnome/FormCitation.C
2359 * src/frontends/gnome/FormCopyright.C
2360 * src/frontends/gnome/FormError.C
2361 * src/frontends/gnome/FormIndex.C
2362 * src/frontends/gnome/FormRef.C
2363 * src/frontends/gnome/FormToc.C
2364 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
2367 * src/frontends/gnome/Menubar_pimpl.C
2368 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
2371 2000-10-11 Baruch Even <baruch.even@writeme.com>
2374 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
2375 to convey its real action.
2377 * src/minibuffer.C (peek_event): Added action when mouse clicks to
2378 clear the minibuffer and prepare to enter a command.
2380 * src/mathed/formula.C (LocalDispatch): Changed to conform with
2381 the rename from ExecCommand to PrepareForCommand.
2382 * src/lyxfunc.C (Dispatch): ditto.
2384 2000-10-11 Baruch Even <baruch.even@writeme.com>
2386 * src/buffer.C (writeFile): Added test for errors on writing, this
2387 catches all errors and not only file system full errors as intended.
2389 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2391 * src/lyx_gui.C (create_forms): better fix for crash with
2392 translated interface.
2394 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
2396 * src/frontends/kde/Makefile.am:
2397 * src/frontends/kde/FormCopyright.C:
2398 * src/frontends/kde/formcopyrightdialog.C:
2399 * src/frontends/kde/formcopyrightdialog.h:
2400 * src/frontends/kde/formcopyrightdialogdata.C:
2401 * src/frontends/kde/formcopyrightdialogdata.h:
2402 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
2403 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
2404 copyright to use qtarch
2406 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
2408 * src/encoding.C (read): Fixed bug that caused an error message at
2409 the end of the file.
2411 * po/Makefile.in.in: Fixed rule for ext_l10n.h
2413 * lib/lyxrc.example: Fixed hebrew example.
2415 2000-10-13 Allan Rae <rae@lyx.org>
2417 * src/frontends/xforms/FormPreferences.C (input): reworking the
2419 (build, update, apply): New inputs in various tabfolders
2421 * src/frontends/xforms/FormToc.C: use new button policy.
2422 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
2423 dialogs that either can't use any existing policy or where it just
2426 * src/frontends/xforms/FormTabular.h: removed copyright notice that
2429 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
2430 added a bool parameter which is ignored.
2432 * src/buffer.C (setReadonly):
2433 * src/BufferView_pimpl.C (buffer):
2434 * src/frontends/kde/FormCopyright.h (update):
2435 * src/frontends/kde/FormCitation.[Ch] (update):
2436 * src/frontends/kde/FormIndex.[Ch] (update):
2437 * src/frontends/kde/FormPrint.[Ch] (update):
2438 * src/frontends/kde/FormRef.[Ch] (update):
2439 * src/frontends/kde/FormToc.[Ch] (update):
2440 * src/frontends/kde/FormUrl.[Ch] (update):
2441 * src/frontends/gnome/FormCopyright.h (update):
2442 * src/frontends/gnome/FormCitation.[Ch] (update):
2443 * src/frontends/gnome/FormError.[Ch] (update):
2444 * src/frontends/gnome/FormIndex.[Ch] (update):
2445 * src/frontends/gnome/FormPrint.[Ch] (update):
2446 * src/frontends/gnome/FormRef.h (update):
2447 * src/frontends/gnome/FormToc.[Ch] (update):
2448 * src/frontends/gnome/FormUrl.[Ch] (update):
2449 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
2450 to updateBufferDependent and DialogBase
2452 * src/frontends/xforms/FormCitation.[hC]:
2453 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
2454 * src/frontends/xforms/FormError.[Ch]:
2455 * src/frontends/xforms/FormGraphics.[Ch]:
2456 * src/frontends/xforms/FormIndex.[Ch]:
2457 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
2458 and fixed readOnly handling.
2459 * src/frontends/xforms/FormPrint.[Ch]:
2460 * src/frontends/xforms/FormRef.[Ch]:
2461 * src/frontends/xforms/FormTabular.[Ch]:
2462 * src/frontends/xforms/FormToc.[Ch]:
2463 * src/frontends/xforms/FormUrl.[Ch]:
2464 * src/frontends/xforms/FormInset.[Ch]:
2465 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
2466 form of updateBufferDependent.
2468 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
2469 if form()->visible just in case someone does stuff to the form in a
2472 * src/frontends/DialogBase.h (enum): removed enum since we can now use
2473 the buttoncontroller for everything the enum used to be used for.
2474 (update) It would seem we need to force all dialogs to use a bool
2475 parameter or have two update functions. I chose to go with one.
2476 I did try removing update() from here and FormBase and defining the
2477 appropriate update signatures in FormBaseB[DI] but then ran into the
2478 problem of the update() call in FormBase::show(). Whatever I did
2479 to get around that would require another function and that just
2480 got more confusing. Hence the decision to make everyone have an
2481 update(bool). An alternative might have been to override show() in
2482 FormBaseB[DI] and that would allow the different and appropriate
2485 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
2486 true == buffer change occurred. I decided against using a default
2487 template parameter since not all compilers support that at present.
2489 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
2491 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
2492 army knife" by removing functionality.
2493 (clearStore): removed. All such housekeeping on hide()ing the dialog
2494 is to be carried out by overloaded disconnect() methods.
2495 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
2496 superceded by Baruch's neat test (FormGraphics) to update an existing
2497 dialog if a new signal is recieved rather than block all new signals
2499 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
2500 only to Inset dialogs.
2501 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
2502 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
2504 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
2506 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
2507 as a base class to all inset dialogs. Used solely to connect/disconnect
2508 the Inset::hide signal and to define what action to take on receipt of
2509 a UpdateBufferDependent signal.
2510 (FormCommand): now derived from FormInset.
2512 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
2515 * src/frontends/xforms/FormCopyright.[Ch]:
2516 * src/frontends/xforms/FormPreferences.[Ch]:
2517 now derived from FormBaseBI.
2519 * src/frontends/xforms/FormDocument.[Ch]:
2520 * src/frontends/xforms/FormParagraph.[Ch]:
2521 * src/frontends/xforms/FormPrint.[Ch]:
2522 now derived from FormBaseBD.
2524 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
2526 * src/frontends/xforms/FormCitation.[Ch]:
2527 * src/frontends/xforms/FormError.[Ch]:
2528 * src/frontends/xforms/FormRef.[Ch]:
2529 * src/frontends/xforms/FormToc.[Ch]:
2530 (clearStore): reworked as disconnect().
2532 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
2535 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2537 * src/converter.C (runLaTeX): constify buffer argument
2540 * src/frontends/support/Makefile.am (INCLUDES): fix.
2542 * src/buffer.h: add std:: qualifier
2543 * src/insets/figinset.C (addpidwait): ditto
2544 * src/MenuBackend.C: ditto
2545 * src/buffer.C: ditto
2546 * src/bufferlist.C: ditto
2547 * src/layout.C: ditto
2548 * src/lyxfunc.C: ditto
2550 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2552 * src/lyxtext.h (bidi_level): change return type to
2553 LyXParagraph::size_type.
2555 * src/lyxparagraph.h: change size_type to
2556 TextContainer::difference_type. This should really be
2557 TextContainer::size_type, but we need currently to support signed
2560 2000-10-11 Marko Vendelin <markov@ioc.ee>
2561 * src/frontends/gnome/FormError.h
2562 * src/frontends/gnome/FormRef.C
2563 * src/frontends/gnome/FormRef.h
2564 * src/frontends/gnome/FormError.C
2565 * src/frontends/gnome/Makefile.am
2566 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
2567 to Gnome frontend. Both dialogs use "action" area.
2569 2000-10-12 Baruch Even <baruch.even@writeme.com>
2571 * src/graphics/GraphicsCacheItem_pimpl.C:
2572 * src/graphics/Renderer.C:
2573 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
2576 2000-10-12 Juergen Vigna <jug@sad.it>
2578 * src/insets/insettext.C (draw): fixed drawing bug (specifically
2579 visible when selecting).
2581 * development/Code_rules/Rules: fixed some typos.
2583 2000-10-09 Baruch Even <baruch.even@writeme.com>
2585 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
2586 compiling on egcs 1.1.2 possible.
2588 * src/filedlg.C (comp_direntry::operator() ): ditto.
2590 2000-08-31 Baruch Even <baruch.even@writeme.com>
2592 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
2595 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
2596 transient it now only gets freed when the object is destructed.
2598 2000-08-24 Baruch Even <baruch.even@writeme.com>
2600 * src/frontends/FormGraphics.h:
2601 * src/frontends/FormGraphics.C: Changed to use ButtonController and
2604 2000-08-20 Baruch Even <baruch.even@writeme.com>
2606 * src/insets/insetgraphics.C:
2607 (draw): Added messages to the drawn rectangle to report status.
2608 (updateInset): Disabled the use of the inline graphics,
2611 2000-08-17 Baruch Even <baruch.even@writeme.com>
2613 * src/frontends/support: Directory added for the support of GUII LyX.
2615 * src/frontends/support/LyXImage.h:
2616 * src/frontends/support/LyXImage.C: Base class for GUII holding of
2619 * src/frontends/support/LyXImage_X.h:
2620 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
2621 version of LyXImage, this uses the Xlib Pixmap.
2623 * src/PainterBase.h:
2624 * src/PainterBase.C:
2626 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
2627 replacement to Pixmap.
2629 * src/insets/insetgraphics.h:
2630 * src/insets/insetgraphics.C:
2631 * src/graphics/GraphicsCacheItem.h:
2632 * src/graphics/GraphicsCacheItem.C:
2633 * src/graphics/GraphicsCacheItem_pimpl.h:
2634 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
2637 * src/graphics/GraphicsCacheItem.h:
2638 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
2639 another copy of the object.
2641 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
2642 of cacheHandle, this fixed a bug that sent LyX crashing.
2644 * src/graphics/XPM_Renderer.h:
2645 * src/graphics/XPM_Renderer.C:
2646 * src/graphics/EPS_Renderer.h:
2647 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
2649 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2651 * src/lyxfunc.C (processKeySym): only handle the
2652 lockinginset/inset stuff if we have a buffer and text loaded...
2654 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
2656 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2658 * src/support/lyxfunctional.h: add operator= that takes a reference
2660 * src/lyxserver.C (mkfifo): make first arg const
2662 * src/layout.h: renamed name(...) to setName(...) to work around
2665 * src/buffer.C (setFileName): had to change name of function to
2666 work around bugs in egcs. (renamed from fileName)
2668 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
2670 * src/support/translator.h: move helper template classes to
2671 lyxfunctional.h, include "support/lyxfunctional.h"
2673 * src/support/lyxmanip.h: add delaration of fmt
2675 * src/support/lyxfunctional.h: new file
2676 (class_fun_t): new template class
2677 (class_fun): helper template function
2678 (back_insert_fun_iterator): new template class
2679 (back_inserter_fun): helper template function
2680 (compare_memfun_t): new template class
2681 (compare_memfun): helper template function
2682 (equal_1st_in_pair): moved here from translator
2683 (equal_2nd_in_pair): moved here from translator
2685 * src/support/fmt.C: new file
2686 (fmt): new func, can be used for a printf substitute when still
2687 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
2689 * src/support/StrPool.C: add some comments
2691 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
2694 * src/insets/figinset.C (addpidwait): use std::copy with
2695 ostream_iterator to fill the pidwaitlist
2697 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
2699 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
2702 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
2705 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
2707 * src/frontends/xforms/FormDocument.C (build): remove c_str()
2708 (class_update): ditto
2709 (BulletPanel): ditto
2710 (CheckChoiceClass): move initialization of tc and tct
2712 * src/tabular.C: remove current_view
2713 (OldFormatRead): similar to right below [istream::ignore]
2715 * src/lyxlex_pimpl.C (next): add code for faster skipping of
2716 chars, unfortunately this is buggy on gcc 2.95.2, so currently
2717 unused [istream::ignore]
2719 * src/lyxfunc.C: include "support/lyxfunctional.h"
2720 (getInsetByCode): use std::find_if and compare_memfun
2722 * src/lyxfont.C (stateText): remove c_str()
2724 * src/lyx_main.C (setDebuggingLevel): make static
2725 (commandLineHelp): make static
2727 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
2728 Screen* together with fl_get_display() and fl_screen
2730 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
2731 togheter with fl_get_display() and fl_screen
2732 (create_forms): remove c_str()
2734 * src/layout.C: include "support/lyxfunctional.h"
2735 (hasLayout): use std::find_if and compare_memfun
2736 (GetLayout): use std::find_if and comapre_memfun
2737 (delete_layout): use std::remove_if and compare_memfun
2738 (NumberOfClass): use std:.find_if and compare_memfun
2740 * src/gettext.h: change for the new functions
2742 * src/gettext.C: new file, make _(char const * str) and _(string
2743 const & str) real functions.
2745 * src/font.C (width): rewrite slightly to avoid one extra variable
2747 * src/debug.C: initialize Debug::ANY here
2749 * src/commandtags.h: update number comments
2751 * src/combox.h (get): make const func
2753 (getline): make const
2755 * src/combox.C (input_cb): handle case where fl_get_input can
2758 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2759 "support/lyxfunctional.h", remove current_view variable.
2760 (resize): use std::for_each with std::mem_fun
2761 (getFileNames): use std::copy with back_inserter_fun
2762 (getBuffer): change arg type to unsigned int
2763 (emergencyWriteAll): call emergencyWrite with std::for_each and
2765 (emergencyWrite): new method, the for loop in emergencyWriteAll
2767 (exists): use std::find_if with compare_memfun
2768 (getBuffer): use std::find_if and compare_memfun
2770 * src/buffer.h: add typedefs for iterator_category, value_type
2771 difference_type, pointer and reference for inset_iterator
2772 add postfix ++ for inset_iterator
2773 make inset_iterator::getPos() const
2775 * src/buffer.C: added support/lyxmanip.h
2776 (readFile): use lyxerr << fmt instead of printf
2777 (makeLaTeXFile): use std::copy to write out encodings
2779 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2781 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2782 free and the char * temp.
2783 (hasMenu): use std::find_if and compare_memfun
2786 * src/Makefile.am (lyx_SOURCES): added gettext.C
2788 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2789 string::insert small change to avoid temporary
2791 * src/LColor.C (getGUIName): remove c_str()
2793 * several files: change all occurrences of fl_display to
2796 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2797 that -pedantic is not used for gcc 2.97 (cvs gcc)
2799 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2801 2000-10-11 Allan Rae <rae@lyx.org>
2803 * src/frontends/xforms/FormPreferences.C (input): template path must be
2804 a readable directory. It doesn't need to be writeable.
2805 (build, delete, update, apply): New inputs in the various tabfolders
2807 * src/frontends/xforms/forms/form_preferences.fd:
2808 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2809 several new entries to existing folders. Shuffled some existing stuff
2812 * src/frontends/xforms/forms/form_print.fd:
2813 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2814 Should probably rework PrinterParams as well. Note that the switch to
2815 collated is effectively the same as !unsorted so changing PrinterParams
2816 will require a lot of fiddly changes to reverse the existing logic.
2818 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2820 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2822 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2824 2000-10-10 Allan Rae <rae@lyx.org>
2827 * src/lyxfunc.C (Dispatch):
2829 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2832 * src/lyxrc.C (output): Only write the differences between system lyxrc
2833 and the users settings.
2836 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2838 I'll rewrite this later, after 1.1.6 probably, to keep a single
2839 LyXRC but two instances of a LyXRCStruct.
2841 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2843 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2845 * src/tabular.h: add a few std:: qualifiers.
2847 * src/encoding.C: add using directive.
2848 * src/language.C: ditto.
2850 * src/insets/insetquotes.C (Validate): use languages->lang()
2851 instead of only language.
2853 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
2855 * lib/languages: New file.
2857 * lib/encodings: New file.
2859 * src/language.C (Languages): New class.
2860 (read): New method. Reads the languages from the 'languages' file.
2862 * src/encoding.C (Encodings): New class.
2863 (read): New method. Reads the encodings from the 'encodings' file.
2865 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
2868 * src/bufferparams.h and a lot of files: Deleted the member language,
2869 and renamed language_info to language
2871 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
2872 * src/lyxfont.C (latexWriteStartChanges): ditto.
2873 * src/paragraph.C (validate,TeXOnePar): ditto.
2875 * src/lyxfont.C (update): Restored deleted code.
2877 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
2879 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2881 * src/BufferView_pimpl.C (buffer): cleaned up a little.
2883 * src/insets/figinset.[Ch]:
2884 * src/insets/insetinclude.[Ch]:
2885 * src/insets/insetinclude.[Ch]:
2886 * src/insets/insetparent.[Ch]:
2887 * src/insets/insetref.[Ch]:
2888 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
2890 * src/insets/*.[Ch]:
2891 * src/mathed/formula.[Ch]:
2892 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
2894 * src/buffer.C (parseSingleLyXformat2Token, readInset):
2895 * src/lyx_cb.C (FigureApplyCB):
2896 * src/lyxfunc.C (getStatus, Dispatch):
2897 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
2900 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
2902 * src/converter.[Ch] (Formats::View):
2903 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
2905 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
2906 *current_view->buffer(). This will change later, but this patch is way
2909 2000-10-09 Juergen Vigna <jug@sad.it>
2911 * src/text.C (GetRow): small fix.
2913 * src/BufferView_pimpl.C (cursorPrevious):
2914 (cursorNext): added LyXText parameter to function.
2916 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
2917 keypress depending on cursor position.
2919 2000-10-06 Juergen Vigna <jug@sad.it>
2921 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
2922 (copySelection): redone this function and also copy ascii representa-
2925 * src/tabular.C (Ascii):
2929 (print_n_chars): new functions to realize the ascii export of tabulars.
2931 2000-10-05 Juergen Vigna <jug@sad.it>
2933 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
2934 if we don't have a buffer.
2936 2000-10-10 Allan Rae <rae@lyx.org>
2938 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
2939 with closing dialog. It seems that nested tabfolders require hiding
2940 of inner tabfolders before hiding the dialog itself. Actually all I
2941 did was hide the active outer folder.
2943 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
2944 unless there really is a buffer. hideBufferDependent is called
2947 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
2948 POTFILES.in stays in $(srcdir).
2950 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
2952 * lib/lyxrc.example: Few changes.
2954 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
2956 * src/BufferView_pimpl.C (buffer): only need one the
2957 updateBufferDependent signal to be emitted once! Moved to the end of
2958 the method to allow bv_->text to be updated first.
2960 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
2961 and hSignal_ with Dialogs * and BufferDependency variables.
2962 New Buffer * parent_, initialised when the dialog is launched. Used to
2963 check whether to update() or hide() dialog in the new, private
2964 updateOrHide() method that is connected to the updateBufferDependent
2965 signal. Daughter classes dictate what to do using the
2966 ChangedBufferAction enum, passed to the c-tor.
2968 * src/frontends/xforms/FormCitation.C:
2969 * src/frontends/xforms/FormCommand.C:
2970 * src/frontends/xforms/FormCopyright.C:
2971 * src/frontends/xforms/FormDocument.C:
2972 * src/frontends/xforms/FormError.C:
2973 * src/frontends/xforms/FormIndex.C:
2974 * src/frontends/xforms/FormPreferences.C:
2975 * src/frontends/xforms/FormPrint.C:
2976 * src/frontends/xforms/FormRef.C:
2977 * src/frontends/xforms/FormToc.C:
2978 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
2981 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
2982 ChangedBufferAction enum.
2984 * src/frontends/xforms/FormParagraph.[Ch]
2985 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
2988 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2990 * lib/bind/cua.bind: fix a bit.
2991 * lib/bind/emacs.bind: ditto.
2993 * lib/bind/menus.bind: remove real menu entries from there.
2995 * src/spellchecker.C: make sure we only include strings.h when
2998 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
3000 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
3001 function. It enlarges the maximum number of pup when needed.
3002 (add_toc2): Open a new menu if maximum number of items per menu has
3005 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
3007 * src/frontends/kde/FormPrint.C: fix error reporting
3009 * src/frontends/xforms/FormDocument.C: fix compiler
3012 * lib/.cvsignore: add Literate.nw
3014 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
3017 * bufferview_funcs.[Ch]
3020 * text2.C: Add support for numbers in RTL text.
3022 2000-10-06 Allan Rae <rae@lyx.org>
3024 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
3025 to be gettext.m4 friendly again. ext_l10n.h is now
3026 generated into $top_srcdir instead of $top_builddir
3027 so that lyx.pot will be built correctly -- without
3028 duplicate parsing of ext_l10n.h.
3030 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
3032 * src/frontends/kde/FormCitation.C: make the dialog
3033 behave more sensibly
3035 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
3037 * config/kde.m4: fix consecutive ./configure runs,
3038 look for qtarch, fix library order
3040 * src/frontends/kde/Makefile.am: tidy up,
3041 add Print dialog, add .dlg dependencies
3043 * src/frontends/kde/FormPrint.C:
3044 * src/frontends/kde/FormPrint.h:
3045 * src/frontends/kde/formprintdialog.C:
3046 * src/frontends/kde/formprintdialog.h:
3047 * src/frontends/kde/formprintdialogdata.C:
3048 * src/frontends/kde/formprintdialogdata.h:
3049 * src/frontends/kde/dlg/formprintdialog.dlg: add
3052 * src/frontends/kde/dlg/README: Added explanatory readme
3054 * src/frontends/kde/dlg/checkinitorder.pl: small perl
3055 script to double-check qtarch's output
3057 * src/frontends/kde/formindexdialog.C:
3058 * src/frontends/kde/formindexdialogdata.C:
3059 * src/frontends/kde/formindexdialogdata.h:
3060 * src/frontends/kde/dlg/formindexdialog.dlg: update
3061 for qtarch, minor fixes
3063 2000-10-05 Allan Rae <rae@lyx.org>
3065 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
3066 dialogs when switching buffers update them instead. It's up to each
3067 dialog to decide if it should still be visible or not.
3068 update() should return a bool to control visiblity within show().
3069 Or perhaps better to set a member variable and use that to control
3072 * lib/build-listerrors: create an empty "listerrors" file just to stop
3073 make trying to regenerate it all the time if you don't have noweb
3076 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
3078 * po/Makefile.in.in (ext_l10n.h): added a rule to build
3079 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
3080 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
3081 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
3082 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
3084 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
3086 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
3088 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
3089 deleting buffer. Closes all buffer-dependent dialogs.
3091 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
3093 * src/frontends/xforms/FormCitation.[Ch]:
3094 * src/frontends/xforms/FormPreferences.[Ch]:
3095 * src/frontends/xforms/FormPrint.[Ch]:
3096 * src/frontends/xforms/FormRef.[Ch]:
3097 * src/frontends/xforms/FormUrl.[Ch]: ditto
3099 * src/frontends/xforms/FormDocument.[Ch]:
3100 * src/frontends/xforms/forms/form_document.C.patch:
3101 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
3102 pass through a single input() function.
3104 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
3106 * lib/build-listerrors: return status as OK
3108 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
3110 * lib/lyxrc.example: Updated to new export code
3112 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3114 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
3117 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
3120 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
3121 LyX-Code is defined.
3122 * lib/layouts/amsbook.layout: ditto.
3124 * boost/Makefile.am: fix typo.
3126 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
3128 (add_lastfiles): removed.
3129 (add_documents): removed.
3130 (add_formats): removed.
3132 * src/frontends/Menubar.C: remove useless "using" directive.
3134 * src/MenuBackend.h: add a new MenuItem constructor.
3136 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
3139 2000-10-04 Allan Rae <rae@lyx.org>
3141 * lib/Makefile.am (listerrors):
3142 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
3143 I haven't got notangle installed so Kayvan please test. The output
3144 should end up in $builddir. This also allows people who don't have
3145 noweb installed to complete the make process without error.
3147 * src/frontends/xforms/FormCommand.[Ch] (showInset):
3148 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
3149 by JMarc's picky compiler.
3151 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3154 * src/insets/insettabular.C (setPos): change for loop to not use
3155 sequencing operator. Please check this Jürgen.
3157 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
3159 * src/insets/insetcite.C (getScreenLabel): ditto
3160 * src/support/filetools.C (QuoteName): ditto
3161 (ChangeExtension): ditto
3163 * src/BufferView_pimpl.C (scrollCB): make heigt int
3165 * src/BufferView2.C (insertInset): comment out unused arg
3167 * boost/Makefile.am (EXTRADIST): new variable
3169 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
3171 * src/exporter.C (IsExportable): Fixed
3173 * lib/configure.m4: Small fix
3175 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
3177 * src/insets/insetbutton.C (width): Changed to work with no GUI.
3178 * src/insets/insetbib.C (bibitemWidest): ditto.
3179 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
3181 2000-10-03 Juergen Vigna <jug@sad.it>
3183 * src/BufferView2.C (theLockingInset): removed const because of
3184 Agnus's compile problems.
3186 * src/insets/insettext.C (LocalDispatch): set the language of the
3187 surronding paragraph on inserting the first character.
3189 * various files: changed use of BufferView::the_locking_inset.
3191 * src/BufferView2.C (theLockingInset):
3192 (theLockingInset): new functions.
3194 * src/BufferView.h: removed the_locking_inset.
3196 * src/lyxtext.h: added the_locking_inset
3198 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
3200 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
3202 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3204 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
3205 * src/mathed/math_cursor.C (IsAlpha): ditto.
3206 * src/mathed/math_inset.C (strnew): ditto.
3207 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
3208 (IMetrics): cxp set but never used; removed.
3209 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
3210 that the variable in question has been removed also!
3213 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
3214 using the Buffer * passed to Latex(), using the BufferView * passed to
3215 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
3217 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
3218 Linuxdoc() and DocBook() rather than the stored Buffer * master.
3220 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
3221 * src/buffer.C (readInset): used new InsetBibtex c-tor
3222 * (getBibkeyList): used new InsetBibtex::getKeys
3224 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3227 * lib/build-listerrors
3229 * src/exporter.C: Add literate programming support to the export code
3232 * src/lyx_cb.C: Remove old literate code.
3234 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
3237 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
3238 * src/converter.C (View, Convert): Use QuoteName.
3240 * src/insets/figinset.C (Preview): Use Formats::View.
3242 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
3244 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3246 * src/lyxfunc.C (Dispatch): move declaration of text variable at
3247 the top of the function, because compaq cxx complains that the
3248 "goto exit_with_message" when the function is disabled bypasses
3250 (MenuNew): try a better fix for the generation of new file names.
3251 This time, I used AddName() instead of AddPath(), hoping Juergen
3254 2000-10-03 Allan Rae <rae@lyx.org>
3256 * src/frontends/xforms/forms/form_preferences.fd:
3257 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
3258 nested tabfolders has begun. The old "Miscellaneous" was renamed as
3259 "Look and Feel"->"General" but will need to be split up further into
3260 general output and general input tabs. Current plan is for four outer
3261 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
3262 stuff; "Inputs" for input and import configuration; "Outputs" for
3263 output and export configuration; and one more whatever is left over
3264 called "General". The leftovers at present look like being which
3265 viewers to use, spellchecker, language support and might be better
3266 named "Support". I've put "Paths" in "Inputs" for the moment as this
3267 seems reasonable for now at least.
3268 One problem remains: X error kills LyX when you close Preferences.
3270 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3272 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
3273 qualifier from form()
3274 * src/frontends/xforms/FormCitation.[Ch]:
3275 * src/frontends/xforms/FormCopyright.[Ch]:
3276 * src/frontends/xforms/FormDocument.[Ch]:
3277 * src/frontends/xforms/FormError.[Ch]:
3278 * src/frontends/xforms/FormIndex.[Ch]:
3279 * src/frontends/xforms/FormPreferences.[Ch]:
3280 * src/frontends/xforms/FormPrint.[Ch]:
3281 * src/frontends/xforms/FormRef.[Ch]:
3282 * src/frontends/xforms/FormToc.[Ch]:
3283 * src/frontends/xforms/FormUrl.[Ch]: ditto.
3285 * src/frontends/xforms/FormCitation.[Ch]:
3286 * src/frontends/xforms/FormIndex.[Ch]:
3287 * src/frontends/xforms/FormRef.[Ch]:
3288 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
3289 with Allan's naming policy
3291 * src/frontends/xforms/FormCitation.C: some static casts to remove
3294 2000-10-02 Juergen Vigna <jug@sad.it>
3296 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
3297 now you can type or do stuff inside the table-cell also when in dummy
3298 position, fixed visible cursor.
3300 * src/insets/insettext.C (Edit): fixing cursor-view position.
3302 * src/lyxfunc.C (Dispatch): use * text variable so that it can
3303 be used for equal functions in lyxfunc and insettext.
3305 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
3307 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
3309 * src/frontends/gnome/FormCitation.h:
3310 * src/frontends/gnome/FormCopyright.h:
3311 * src/frontends/gnome/FormIndex.h:
3312 * src/frontends/gnome/FormPrint.h:
3313 * src/frontends/gnome/FormToc.h:
3314 * src/frontends/gnome/FormUrl.h:
3315 * src/frontends/kde/FormCitation.h:
3316 * src/frontends/kde/FormCopyright.h:
3317 * src/frontends/kde/FormIndex.h:
3318 * src/frontends/kde/FormRef.h:
3319 * src/frontends/kde/FormToc.h:
3320 * src/frontends/kde/FormUrl.h: fix remaining users of
3323 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3325 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
3326 from depth argument.
3327 (DocBookHandleCaption): ditto.
3328 (DocBookHandleFootnote): ditto.
3329 (SimpleDocBookOnePar): ditto.
3331 * src/frontends/xforms/FormDocument.h (form): remove extra
3332 FormDocument:: qualifier.
3334 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
3336 * sigc++/handle.h: ditto.
3338 * src/lyx_gui_misc.C: add "using" directive.
3340 * src/cheaders/cstddef: new file, needed by the boost library (for
3343 2000-10-02 Juergen Vigna <jug@sad.it>
3345 * src/insets/insettext.C (SetFont): better support.
3347 * src/insets/insettabular.C (draw): fixed drawing of single cell.
3349 * src/screen.C (DrawOneRow): some uint refixes!
3351 2000-10-02 Allan Rae <rae@lyx.org>
3353 * boost/.cvsignore: ignore Makefile as well
3355 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
3356 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
3358 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
3359 Left this one out by accident.
3361 * src/frontends/xforms/FormBase.h (restore): default to calling
3362 update() since that will restore the original/currently-applied values.
3363 Any input() triggered error messages will require the derived classes
3364 to redefine restore().
3366 * src/frontends/xforms/FormDocument.C: initialize a few variables to
3367 avoid a segfault. combo_doc_class is the main concern.
3369 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
3371 * Simplify build-listerrors in view of GUI-less export ability!
3373 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3375 * src/lyx_main.C (easyParse): Disable gui when exporting
3377 * src/insets/figinset.C:
3380 * src/lyx_gui_misc.C
3381 * src/tabular.C: Changes to allow no-gui.
3383 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3385 * src/support/utility.hpp: removed file
3386 * src/support/block.h: removed file
3388 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
3391 * src/mathed/formula.C: add support/lyxlib.h
3392 * src/mathed/formulamacro.C: ditto
3394 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
3395 * src/lyxparagraph.h: ditto
3397 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
3398 * src/frontends/Makefile.am (INCLUDES): ditto
3399 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
3400 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
3401 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
3402 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
3403 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
3404 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
3406 * src/BufferView.h: use boost/utility.hpp
3407 * src/LColor.h: ditto
3408 * src/LaTeX.h: ditto
3409 * src/LyXAction.h: ditto
3410 * src/LyXView.h: ditto
3411 * src/bufferlist.h: ditto
3412 * src/lastfiles.h: ditto
3413 * src/layout.h: ditto
3414 * src/lyx_gui.h: ditto
3415 * src/lyx_main.h: ditto
3416 * src/lyxlex.h: ditto
3417 * src/lyxrc.h: ditto
3418 * src/frontends/ButtonPolicies.h: ditto
3419 * src/frontends/Dialogs.h: ditto
3420 * src/frontends/xforms/FormBase.h: ditto
3421 * src/frontends/xforms/FormGraphics.h: ditto
3422 * src/frontends/xforms/FormParagraph.h: ditto
3423 * src/frontends/xforms/FormTabular.h: ditto
3424 * src/graphics/GraphicsCache.h: ditto
3425 * src/graphics/Renderer.h: ditto
3426 * src/insets/ExternalTemplate.h: ditto
3427 * src/insets/insetcommand.h: ditto
3428 * src/support/path.h: ditto
3430 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
3431 and introduce clause for 2.97.
3433 * boost/libs/README: new file
3435 * boost/boost/utility.hpp: new file
3437 * boost/boost/config.hpp: new file
3439 * boost/boost/array.hpp: new file
3441 * boost/Makefile.am: new file
3443 * boost/.cvsignore: new file
3445 * configure.in (AC_OUTPUT): add boost/Makefile
3447 * Makefile.am (SUBDIRS): add boost
3449 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3451 * src/support/lstrings.C (suffixIs): Fixed.
3453 2000-10-01 Allan Rae <rae@lyx.org>
3455 * src/PrinterParams.h: moved things around to avoid the "can't
3456 inline call" warning.
3458 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
3459 into doc++ documentation.
3461 * src/frontends/xforms/FormCommand.[Ch]: support button policy
3463 * src/frontends/xforms/FormRef.C: make use of button controller
3464 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
3465 cleaned up button controller usage.
3466 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
3467 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
3468 use the button controller
3470 * src/frontends/xforms/forms/*.fd: and associated generated files
3471 updated to reflect changes to FormBase. Some other FormXxxx files
3472 also got minor updates to reflect changes to FormBase.
3474 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
3475 (hide): made virtual.
3476 (input): return a bool. true == valid input
3477 (RestoreCB, restore): new
3478 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
3479 Changes to allow derived dialogs to use a ButtonController and
3480 make sense when doing so: OK button calls ok() and so on.
3482 * src/frontends/xforms/ButtonController.h (class ButtonController):
3483 Switch from template implementation to taking Policy parameter.
3484 Allows FormBase to provide a ButtonController for any dialog.
3486 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
3487 Probably should rename connect and disconnect.
3488 (apply): use the radio button groups
3489 (form): needed by FormBase
3490 (build): setup the radio button groups
3492 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
3494 * several files: type changes to reduce the number of warnings and
3495 to unify type hangling a bit. Still much to do.
3497 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3499 * lib/images/*: rename a bunch of icons to match Dekel converter
3502 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
3505 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
3507 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
3509 * sigc++/handle.h: ditto for class Handle.
3511 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
3513 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
3515 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
3517 * src/intl.C (InitKeyMapper): Correct the value of n due to the
3518 removal of the "default" language.
3520 * src/combox.h (getline): Check that sel > 0
3522 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
3524 * lib/examples/docbook_example.lyx
3525 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
3527 * lib/layouts/docbook-book.layout: new docbook book layout.
3529 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
3531 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
3533 * src/insets/figinset.C (DocBook):fixed small typo.
3535 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
3537 * src/insets/insetinclude.h: string include_label doesn't need to be
3540 2000-09-29 Allan Rae <rae@lyx.org>
3542 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
3543 Allow derived type to control connection and disconnection from signals
3544 of its choice if desired.
3546 2000-09-28 Juergen Vigna <jug@sad.it>
3548 * src/insets/insettabular.C (update): fixed cursor setting when
3549 the_locking_inset changed.
3550 (draw): made this a bit cleaner.
3551 (InsetButtonPress): fixed!
3553 * various files: added LyXText Parameter to fitCursor call.
3555 * src/BufferView.C (fitCursor): added LyXText parameter.
3557 * src/insets/insettabular.C (draw): small draw fix.
3559 * src/tabular.C: right setting of left/right celllines.
3561 * src/tabular.[Ch]: fixed various types in funcions and structures.
3562 * src/insets/insettabular.C: ditto
3563 * src/frontends/xforms/FormTabular.C: ditto
3565 2000-09-28 Allan Rae <rae@lyx.org>
3567 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
3568 that the #ifdef's had been applied to part of what should have been
3569 a complete condition. It's possible there are other tests that
3570 were specific to tables that are also wrong now that InsetTabular is
3571 being used. Now we need to fix the output of '\n' after a table in a
3572 float for the same reason as the original condition:
3573 "don't insert this if we would be adding it before or after a table
3574 in a float. This little trick is needed in order to allow use of
3575 tables in \subfigures or \subtables."
3576 Juergen can you check this?
3578 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3580 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
3581 output to the ostream.
3583 * several files: fixed types based on warnings from cxx
3585 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
3587 * src/frontends/kde/Makefile.am: fix rule for
3588 formindexdialogdata_moc.C
3590 * src/.cvsignore: add ext_l10n.h to ignore
3592 * acconfig.h: stop messing with __STRICT_ANSI__
3593 * config/gnome.m4: remove option to set -ansi
3594 * config/kde.m4: remove option to set -ansi
3595 * config/lyxinclude.m4: don't set -ansi
3597 2000-09-27 Juergen Vigna <jug@sad.it>
3599 * various files: remove "default" language check.
3601 * src/insets/insetquotes.C: removed use of current_view.
3603 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
3604 the one should have red ears by now!
3606 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
3607 in more then one paragraph. Fixed cursor-movement/selection.
3609 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
3610 paragraphs inside a text inset.
3612 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
3613 text-inset if this owner is an inset.
3615 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3617 * src/Bullet.h: changed type of font, character and size to int
3619 * src/buffer.C (asciiParagraph): remove actcell and fname1.
3621 * src/insets/inseturl.[Ch]:
3622 * src/insets/insetref.[Ch]:
3623 * src/insets/insetlabel.[Ch]: add linelen to Ascii
3625 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
3627 * src/buffer.C (readFile): block-if statement rearranged to minimise
3628 bloat. Patch does not reverse Jean-Marc's change ;-)
3630 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
3631 Class rewritten to store pointers to hide/update signals directly,
3632 rather than Dialogs *. Also defined an enum to ease use. All xforms
3633 forms can now be derived from this class.
3635 * src/frontends/xforms/FormCommand.[Ch]
3636 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
3638 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
3641 * src/frontends/xforms/forms/form_citation.fd
3642 * src/frontends/xforms/forms/form_copyright.fd
3643 * src/frontends/xforms/forms/form_error.fd
3644 * src/frontends/xforms/forms/form_index.fd
3645 * src/frontends/xforms/forms/form_ref.fd
3646 * src/frontends/xforms/forms/form_toc.fd
3647 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
3649 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
3651 * src/insets/insetfoot.C: removed redundent using directive.
3653 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3655 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
3656 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
3658 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
3659 created in the constructors in different groups. Then set() just
3660 have to show the groups as needed. This fixes the redraw problems
3661 (and is how the old menu code worked).
3663 * src/support/lyxlib.h: declare the methods as static when we do
3664 not have namespaces.
3666 2000-09-26 Juergen Vigna <jug@sad.it>
3668 * src/buffer.C (asciiParagraph): new function.
3669 (writeFileAscii): new function with parameter ostream.
3670 (writeFileAscii): use now asciiParagraph.
3672 * various inset files: added the linelen parameter to the Ascii-func.
3674 * src/tabular.C (Write): fixed error in writing file introduced by
3675 the last changes from Lars.
3677 * lib/bind/menus.bind: removed not supported functions.
3679 * src/insets/insettext.C (Ascii): implemented this function.
3681 * src/insets/lyxinset.h (Ascii): added linelen parameter.
3683 * src/tabular.C (write_attribute[int,string,bool]): new functions.
3684 (Write): use of the write_attribute functions.
3686 * src/bufferlist.C (close): fixed reasking question!
3688 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3690 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
3691 new files use the everwhere possible.
3694 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
3695 src/log_form.C src/lyx.C:
3698 * src/buffer.C (runLaTeX): remove func
3700 * src/PaperLayout.C: removed file
3701 * src/ParagraphExtra.C: likewise
3702 * src/bullet_forms.C: likewise
3703 * src/bullet_forms.h: likewise
3704 * src/bullet_forms_cb.C: likewise
3706 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
3707 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
3710 * several files: remove all traces of the old fd_form_paragraph,
3711 and functions belonging to that.
3713 * several files: remove all traces of the old fd_form_document,
3714 and functions belonging to that.
3716 * several files: constify local variables were possible.
3718 * several files: remove all code that was dead when NEW_EXPORT was
3721 * several files: removed string::c_str in as many places as
3724 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
3725 (e): be a bit more outspoken when patching
3726 (updatesrc): only move files if changed.
3728 * forms/layout_forms.h.patch: regenerated
3730 * forms/layout_forms.fd: remove form_document and form_paragraph
3731 and form_quotes and form_paper and form_table_options and
3732 form_paragraph_extra
3734 * forms/form1.fd: remove form_table
3736 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3737 the fdui->... rewrite. Update some comments to xforms 0.88
3739 * forms/bullet_forms.C.patch: removed file
3740 * forms/bullet_forms.fd: likewise
3741 * forms/bullet_forms.h.patch: likewise
3743 * development/Code_rules/Rules: added a section on switch
3744 statements. Updated some comment to xforms 0.88.
3746 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3748 * src/buffer.C (readFile): make sure that the whole version number
3749 is read after \lyxformat (even when it contains a comma)
3751 * lib/ui/default.ui: change shortcut of math menu to M-a.
3753 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3755 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3758 * src/LyXView.C (updateWindowTitle): show the full files name in
3759 window title, limited to 30 characters.
3761 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3762 When a number of characters has been given, we should not assume
3763 that the string is 0-terminated.
3765 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3766 calls (fixes some memory leaks)
3768 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3769 trans member on exit.
3771 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3773 * src/converter.C (GetReachable): fix typo.
3775 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3776 understand ',' instead of '.'.
3777 (GetInteger): rewrite to use strToInt().
3779 2000-09-26 Juergen Vigna <jug@sad.it>
3781 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3782 better visibility and error-message on wrong VSpace input.
3784 * src/language.C (initL): added english again.
3786 2000-09-25 Juergen Vigna <jug@sad.it>
3788 * src/frontends/kde/Dialogs.C (Dialogs):
3789 * src/frontends/gnome/Dialogs.C (Dialogs):
3790 * src/frontends/kde/Makefile.am:
3791 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3793 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3795 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3797 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3799 * src/frontends/xforms/FormParagraph.C:
3800 * src/frontends/xforms/FormParagraph.h:
3801 * src/frontends/xforms/form_paragraph.C:
3802 * src/frontends/xforms/form_paragraph.h:
3803 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3806 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3808 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3809 Paragraph-Data after use.
3811 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3812 non breakable paragraphs.
3814 2000-09-25 Garst R. Reese <reese@isn.net>
3816 * src/language.C (initL): added missing language_country codes.
3818 2000-09-25 Juergen Vigna <jug@sad.it>
3820 * src/insets/insettext.C (InsetText):
3821 (deleteLyXText): remove the not released LyXText structure!
3823 2000-09-24 Marko Vendelin <markov@ioc.ee>
3825 * src/frontends/gnome/mainapp.C
3826 * src/frontends/gnome/mainapp.h: added support for keyboard
3829 * src/frontends/gnome/FormCitation.C
3830 * src/frontends/gnome/FormCitation.h
3831 * src/frontends/gnome/Makefile.am
3832 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3833 FormCitation to use "action area" in mainapp window
3835 * src/frontends/gnome/Menubar_pimpl.C
3836 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3839 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3841 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3842 width/descent/ascent values if name is empty.
3843 (mathed_string_height): Use std::max.
3845 2000-09-25 Allan Rae <rae@lyx.org>
3847 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
3848 segfault. This will be completely redesigned soon.
3850 * sigc++: updated libsigc++. Fixes struct timespec bug.
3852 * development/tools/makeLyXsigc.sh: .cvsignore addition
3854 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3856 * several files: removed almost all traces of the old table
3859 * src/TableLayout.C: removed file
3861 2000-09-22 Juergen Vigna <jug@sad.it>
3863 * src/frontends/kde/Dialogs.C: added credits forms.
3865 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
3867 * src/frontends/gnome/Dialogs.C: added some forms.
3869 * src/spellchecker.C (init_spell_checker): set language in pspell code
3870 (RunSpellChecker): some modifications for setting language string.
3872 * src/language.[Ch]: added language_country code.
3874 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
3876 * src/frontends/Dialogs.h: added new signal showError.
3877 Rearranged existing signals in some sort of alphabetical order.
3879 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
3880 FormError.[Ch], form_error.[Ch]
3881 * src/frontends/xforms/forms/makefile: added new file form_error.fd
3882 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
3884 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
3885 dialogs. I think that this can be used as the base to all these
3888 * src/frontends/xforms/FormError.[Ch]
3889 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
3890 implementation of InsetError dialog.
3892 * src/insets/inseterror.[Ch]: rendered GUI-independent.
3894 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
3895 * src/frontends/kde/Makefile.am: ditto
3897 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
3899 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
3900 macrobf. This fixes a bug of invisible text.
3902 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3904 * lib/doc/LaTeXConfig.lyx.in: updated.
3906 * src/language.C (initL): remove language "francais" and change a
3907 bit the names of the two other french variations.
3909 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
3910 string that may not be 0-terminated.
3912 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3914 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
3916 2000-09-20 Marko Vendelin <markov@ioc.ee>
3918 * src/frontends/gnome/FormCitation.C
3919 * src/frontends/gnome/FormIndex.C
3920 * src/frontends/gnome/FormToc.C
3921 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
3922 the variable initialization to shut up the warnings
3924 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3926 * src/table.[Ch]: deleted files
3928 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
3931 2000-09-18 Juergen Vigna <jug@sad.it>
3933 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
3934 problems with selection. Inserted new LFUN_PASTESELECTION.
3935 (InsetButtonPress): inserted handling of middle mouse-button paste.
3937 * src/spellchecker.C: changed word to word.c_str().
3939 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
3941 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
3942 included in the ``make dist'' tarball.
3944 2000-09-15 Juergen Vigna <jug@sad.it>
3946 * src/CutAndPaste.C (cutSelection): small fix return the right
3947 end position after cut inside one paragraph only.
3949 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
3950 we are locked as otherwise we don't have a valid cursor position!
3952 * src/insets/figinset.C (draw): small bugfix but why is this needed???
3954 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
3956 * src/frontends/kde/FormRef.C: added using directive.
3957 * src/frontends/kde/FormToc.C: ditto
3959 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
3961 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
3963 2000-09-19 Marko Vendelin <markov@ioc.ee>
3965 * src/frontends/gnome/Menubar_pimpl.C
3966 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
3967 Toc, ViewFormats, UpdateFormats, and ExportFormats.
3969 * src/frontends/gnome/mainapp.C
3970 * src/frontends/gnome/mainapp.h: support for menu update used
3973 * src/frontends/gnome/mainapp.C
3974 * src/frontends/gnome/mainapp.h: support for "action" area in the
3975 main window. This area is used by small simple dialogs, such as
3978 * src/frontends/gnome/FormIndex.C
3979 * src/frontends/gnome/FormIndex.h
3980 * src/frontends/gnome/FormUrl.C
3981 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
3984 * src/frontends/gnome/FormCitation.C
3985 * src/frontends/gnome/FormCitation.h: rewrite to use main window
3986 action area. Only "Insert new citation" is implemented.
3988 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3990 * src/buffer.C (Dispatch): fix call to Dispatch
3991 * src/insets/insetref.C (Edit): likewise
3992 * src/insets/insetparent.C (Edit): likewise
3993 * src/insets/insetinclude.C (include_cb): likewise
3994 * src/frontends/xforms/FormUrl.C (apply): likewise
3995 * src/frontends/xforms/FormToc.C (apply): likewise
3996 * src/frontends/xforms/FormRef.C (apply): likewise
3997 * src/frontends/xforms/FormIndex.C (apply): likewise
3998 * src/frontends/xforms/FormCitation.C (apply): likewise
3999 * src/lyxserver.C (callback): likewise
4000 * src/lyxfunc.C (processKeySym): likewise
4001 (Dispatch): likewise
4002 (Dispatch): likewise
4003 * src/lyx_cb.C (LayoutsCB): likewise
4005 * Makefile.am (sourcedoc): small change
4007 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4009 * src/main.C (main): Don't make an empty GUIRunTime object. all
4010 methods are static. constify a bit remove unneded using + headers.
4012 * src/tabular.C: some more const to local vars move some loop vars
4014 * src/spellchecker.C: added some c_str after some word for pspell
4016 * src/frontends/GUIRunTime.h: add new static method setDefaults
4017 * src/frontends/xforms/GUIRunTime.C (setDefaults):
4018 * src/frontends/kde/GUIRunTime.C (setDefaults):
4019 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
4021 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
4022 with strnew in arg, use correct emptystring when calling SetName.
4024 * several files: remove all commented code with relation to
4025 HAVE_SSTREAM beeing false. We now only support stringstream and
4028 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4030 * src/lyxfunc.C: construct correctly the automatic new file
4033 * src/text2.C (IsStringInText): change type of variable i to shut
4036 * src/support/sstream.h: do not use namespaces if the compiler
4037 does not support them.
4039 2000-09-15 Marko Vendelin <markov@ioc.ee>
4040 * src/frontends/gnome/FormCitation.C
4041 * src/frontends/gnome/FormCitation.h
4042 * src/frontends/gnome/diainsertcitation_interface.c
4043 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
4044 regexp support to FormCitation [Gnome].
4046 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
4049 * configure.in: remove unused KDE/GTKGUI define
4051 * src/frontends/kde/FormRef.C
4052 * src/frontends/kde/FormRef.h
4053 * src/frontends/kde/formrefdialog.C
4054 * src/frontends/kde/formrefdialog.h: double click will
4055 go to reference, now it is possible to change a cross-ref
4058 * src/frontends/kde/FormToc.C
4059 * src/frontends/kde/FormToc.h
4060 * src/frontends/kde/formtocdialog.C
4061 * src/frontends/kde/formtocdialog.h: add a depth
4064 * src/frontends/kde/Makefile.am: add QtLyXView.h
4067 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
4069 * src/frontends/kde/FormCitation.h: added some using directives.
4071 * src/frontends/kde/FormToc.h: corrected definition of doTree.
4073 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
4076 * src/mathed/math_defs.h: redefine SetAlign to use string rather
4079 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4081 * src/buffer.C (pop_tag): revert for the second time a change by
4082 Lars, who seems to really hate having non-local loop variables :)
4084 * src/Lsstream.h: add "using" statements.
4086 * src/support/copy.C (copy): add a bunch of std:: qualifiers
4087 * src/buffer.C (writeFile): ditto
4089 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4091 * src/buffer.C (writeFile): try to fix the locale modified format
4092 number to always be as we want it.
4094 * src/WorkArea.C (work_area_handler): try to workaround the bugs
4095 in XForms 0.89. C-space is now working again.
4097 * src/Lsstream.h src/support/sstream.h: new files.
4099 * also commented out all cases where strstream were used.
4101 * src/Bullet.h (c_str): remove method.
4103 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
4105 * a lot of files: get rid of "char const *" and "char *" is as
4106 many places as possible. We only want to use them in interaction
4107 with system of other libraries, not inside lyx.
4109 * a lot of files: return const object is not of pod type. This
4110 helps ensure that temporary objects is not modified. And fits well
4111 with "programming by contract".
4113 * configure.in: check for the locale header too
4115 * Makefile.am (sourcedoc): new tag for generation of doc++
4118 2000-09-14 Juergen Vigna <jug@sad.it>
4120 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
4121 callback to check which combo called it and do the right action.
4123 * src/combox.C (combo_cb): added combo * to the callbacks.
4124 (Hide): moved call of callback after Ungrab of the pointer.
4126 * src/intl.h: removed LCombo2 function.
4128 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
4129 function as this can now be handled in one function.
4131 * src/combox.h: added Combox * to callback prototype.
4133 * src/frontends/xforms/Toolbar_pimpl.C:
4134 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
4136 2000-09-14 Garst Reese <reese@isn.net>
4138 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
4139 moved usepackage{xxx}'s to beginning of file. Changed left margin
4140 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
4141 underlining from title. Thanks to John Culleton for useful suggestions.
4143 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4145 * src/lyxlex_pimpl.C (setFile): change error message to debug
4148 2000-09-13 Juergen Vigna <jug@sad.it>
4150 * src/frontends/xforms/FormDocument.C: implemented choice_class
4151 as combox and give callback to combo_language so OK/Apply is activated
4154 * src/bufferlist.C (newFile): small fix so already named files
4155 (via an open call) are not requested to be named again on the
4158 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
4160 * src/frontends/kde/Makefile.am
4161 * src/frontends/kde/FormRef.C
4162 * src/frontends/kde/FormRef.h
4163 * src/frontends/kde/formrefdialog.C
4164 * src/frontends/kde/formrefdialog.h: implement
4167 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
4169 * src/frontends/kde/formtocdialog.C
4170 * src/frontends/kde/formtocdialog.h
4171 * src/frontends/kde/FormToc.C
4172 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
4174 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
4176 * src/frontends/kde/FormCitation.C: fix thinko
4177 where we didn't always display the reference text
4180 * src/frontends/kde/formurldialog.C
4181 * src/frontends/kde/formurldialog.h
4182 * src/frontends/kde/FormUrl.C
4183 * src/frontends/kde/FormUrl.h: minor cleanups
4185 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
4187 * src/frontends/kde/Makefile.am
4188 * src/frontends/kde/FormToc.C
4189 * src/frontends/kde/FormToc.h
4190 * src/frontends/kde/FormCitation.C
4191 * src/frontends/kde/FormCitation.h
4192 * src/frontends/kde/FormIndex.C
4193 * src/frontends/kde/FormIndex.h
4194 * src/frontends/kde/formtocdialog.C
4195 * src/frontends/kde/formtocdialog.h
4196 * src/frontends/kde/formcitationdialog.C
4197 * src/frontends/kde/formcitationdialog.h
4198 * src/frontends/kde/formindexdialog.C
4199 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
4201 2000-09-12 Juergen Vigna <jug@sad.it>
4203 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
4206 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4208 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
4211 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
4213 * src/converter.C (Add, Convert): Added support for converter flags:
4214 needaux, resultdir, resultfile.
4215 (Convert): Added new parameter view_file.
4216 (dvips_options): Fixed letter paper option.
4218 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
4219 (Export, GetExportableFormats, GetViewableFormats): Added support
4222 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
4224 (easyParse): Fixed to work with new export code.
4226 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
4229 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
4231 * lib/bind/*.bind: Replaced
4232 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
4233 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
4235 2000-09-11 Juergen Vigna <jug@sad.it>
4237 * src/lyx_gui.C (runTime): uses global guiruntime variable.
4239 * src/main.C (main): now GUII defines global guiruntime!
4241 * src/frontends/gnome/GUIRunTime.C (initApplication):
4242 * src/frontends/kde/GUIRunTime.C (initApplication):
4243 * src/frontends/xforms/GUIRunTime.C (initApplication):
4244 * src/frontends/GUIRunTime.h: added new function initApplication.
4246 * src/spellchecker.C (sc_accept_word): change to add_to_session.
4248 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
4250 2000-09-08 Juergen Vigna <jug@sad.it>
4252 * src/lyx_gui.C (create_forms): don't display the "default" entry as
4253 we have already "Reset".
4255 * src/language.C (initL): inserted "default" language and made this
4256 THE default language (and not american!)
4258 * src/paragraph.C: inserted handling of "default" language!
4260 * src/lyxfont.C: ditto
4264 * src/paragraph.C: output the \\par only if we have a following
4265 paragraph otherwise it's not needed.
4267 2000-09-05 Juergen Vigna <jug@sad.it>
4269 * config/pspell.m4: added entry to lyx-flags
4271 * src/spellchecker.C: modified version from Kevin for using pspell
4273 2000-09-01 Marko Vendelin <markov@ioc.ee>
4274 * src/frontends/gnome/Makefile.am
4275 * src/frontends/gnome/FormCitation.C
4276 * src/frontends/gnome/FormCitation.h
4277 * src/frontends/gnome/diainsertcitation_callbacks.c
4278 * src/frontends/gnome/diainsertcitation_callbacks.h
4279 * src/frontends/gnome/diainsertcitation_interface.c
4280 * src/frontends/gnome/diainsertcitation_interface.h
4281 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
4282 dialog for Gnome frontend
4284 * src/main.C: Gnome libraries require keeping application name
4285 and its version as strings
4287 * src/frontends/gnome/mainapp.C: Change the name of the main window
4288 from GnomeLyX to PACKAGE
4290 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4292 * src/frontends/Liason.C: add "using: declaration.
4294 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
4296 * src/mathed/math_macro.C (Metrics): Set the size of the template
4298 * src/mathed/formulamacro.C (Latex): Fixed the returned value
4300 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
4302 * src/converter.C (add_options): New function.
4303 (SetViewer): Change $$FName into '$$FName'.
4304 (View): Add options when running xdvi
4305 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
4306 (Convert): The 3rd parameter is now the desired filename. Converts
4307 calls to lyx::rename if necessary.
4308 Add options when running dvips.
4309 (dvi_papersize,dvips_options): New methods.
4311 * src/exporter.C (Export): Use getLatexName() instead of fileName().
4313 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
4314 using a call to Converter::dvips_options.
4315 Fixed to work with nex export code.
4317 * src/support/copy.C
4318 * src/support/rename.C: New files
4320 * src/support/syscall.h
4321 * src/support/syscall.C: Added Starttype SystemDontWait.
4323 * lib/ui/default.ui: Changed to work with new export code
4325 * lib/configure.m4: Changed to work with new export code
4327 * src/encoding.C: Changed latex name for iso8859_7 encoding.
4329 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
4331 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
4332 so that code compiles with DEC cxx.
4334 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
4335 to work correctly! Also now supports the additional elements
4338 2000-09-01 Allan Rae <rae@lyx.org>
4340 * src/frontends/ButtonPolicies.C: renamed all the references to
4341 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
4343 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
4344 since it's a const not a type.
4346 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
4348 2000-08-31 Juergen Vigna <jug@sad.it>
4350 * src/insets/figinset.C: Various changes to look if the filename has
4351 an extension and if not add it for inline previewing.
4353 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4355 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
4356 make buttonStatus and isReadOnly be const methods. (also reflect
4357 this in derived classes.)
4359 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
4360 (nextState): change to be static inline, pass the StateMachine as
4362 (PreferencesPolicy): remove casts
4363 (OkCancelPolicy): remvoe casts
4364 (OkCancelReadOnlyPolicy): remove casts
4365 (NoRepeatedApplyReadOnlyPolicy): remove casts
4366 (OkApplyCancelReadOnlyPolicy): remove casts
4367 (OkApplyCancelPolicy): remove casts
4368 (NoRepeatedApplyPolicy): remove casts
4370 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
4372 * src/converter.C: added some using directives
4374 * src/frontends/ButtonPolicies.C: changes to overcome
4375 "need lvalue" error with DEC c++
4377 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
4378 to WMHideCB for DEC c++
4380 * src/frontends/xforms/Menubar_pimpl.C: added using directive
4382 * src/frontends/xforms/forms/form_document.C.patch: use C callback
4383 to BulletBMTableCB for DEC c++
4385 2000-08-31 Allan Rae <rae@lyx.org>
4387 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
4388 character dialog separately from old document dialogs combo_language.
4391 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4393 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
4394 Removed LFUN_REF_CREATE.
4396 * src/MenuBackend.C: Added new tags: toc and references
4398 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
4399 (add_lastfiles, add_documents, add_formats): Removed the unused smn
4401 (add_toc, add_references): New methods.
4402 (create_submenu): Handle correctly the case when there is a
4403 seperator after optional menu items.
4405 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
4406 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
4407 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
4409 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
4411 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4413 * src/converter.[Ch]: New file for converting between different
4416 * src/export.[Ch]: New file for exporting a LyX file to different
4419 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
4420 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
4421 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
4422 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
4423 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
4424 RunDocBook, MenuExport.
4426 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
4427 Exporter::Preview methods if NEW_EXPORT is defined.
4429 * src/buffer.C (Dispatch): Use Exporter::Export.
4431 * src/lyxrc.C: Added new tags: \converter and \viewer.
4434 * src/LyXAction.C: Define new lyx-function: buffer-update.
4435 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
4436 when NEW_EXPORT is defined.
4438 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
4440 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
4442 * lib/ui/default.ui: Added submenus "view" and "update" to the
4445 * src/filetools.C (GetExtension): New function.
4447 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
4449 2000-08-29 Allan Rae <rae@lyx.org>
4451 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
4453 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
4454 (EnableDocumentLayout): removed
4455 (DisableDocumentLayout): removed
4456 (build): make use of ButtonController's read-only handling to
4457 de/activate various objects. Replaces both of the above functions.
4459 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
4460 (readOnly): was read_only
4461 (refresh): fixed dumb mistakes with read_only_ handling
4463 * src/frontends/xforms/forms/form_document.fd:
4464 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
4465 tabbed dialogs so the tabs look more like tabs and so its easier to
4466 work out which is the current tab.
4468 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
4469 segfault with form_table
4471 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
4473 2000-08-28 Juergen Vigna <jug@sad.it>
4475 * acconfig.h: added USE_PSPELL.
4477 * src/config.h.in: added USE_PSPELL.
4479 * autogen.sh: added pspell.m4
4481 * config/pspell.m4: new file.
4483 * src/spellchecker.C: implemented support for pspell libary.
4485 2000-08-25 Juergen Vigna <jug@sad.it>
4487 * src/LyXAction.C (init): renamed LFUN_TABLE to
4488 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
4490 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
4492 * src/lyxscreen.h: add force_clear variable and fuction to force
4493 a clear area when redrawing in LyXText.
4495 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
4497 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4499 * some whitespace and comment changes.
4501 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
4503 * src/buffer.C: up te LYX_FORMAT to 2.17
4505 2000-08-23 Juergen Vigna <jug@sad.it>
4507 * src/BufferView_pimpl.C (tripleClick): disable this when in a
4510 * src/insets/insettabular.C (pasteSelection): delete the insets
4511 LyXText as it is not valid anymore.
4512 (copySelection): new function.
4513 (pasteSelection): new function.
4514 (cutSelection): new function.
4515 (LocalDispatch): implemented cut/copy/paste of cell selections.
4517 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
4518 don't have a LyXText.
4520 * src/LyXAction.C (init): a NEW_TABULAR define too much.
4522 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
4525 2000-08-22 Juergen Vigna <jug@sad.it>
4527 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
4528 ifdef form_table out if NEW_TABULAR.
4530 2000-08-21 Juergen Vigna <jug@sad.it>
4532 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
4533 (draw): fixed draw position so that the cursor is positioned in the
4535 (InsetMotionNotify): hide/show cursor so the position is updated.
4536 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
4537 using cellstart() function where it should be used.
4539 * src/insets/insettext.C (draw): ditto.
4541 * src/tabular.C: fixed initialization of some missing variables and
4542 made BoxType into an enum.
4544 2000-08-22 Marko Vendelin <markov@ioc.ee>
4545 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
4546 stock menu item using action numerical value, not its string
4550 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4552 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
4553 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
4555 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
4557 * src/frontends/xforms/GUIRunTime.C: new file
4559 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
4560 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4562 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
4564 * src/frontends/kde/GUIRunTime.C: new file
4566 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
4567 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4569 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
4571 * src/frontends/gnome/GUIRunTime.C: new file
4573 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
4576 * src/frontends/GUIRunTime.h: removed constructor and destructor,
4577 small change to documetentation.
4579 * src/frontends/GUIRunTime.C: removed file
4581 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
4583 * src/lyxparagraph.h: enable NEW_TABULAR as default
4585 * src/lyxfunc.C (processKeySym): remove some commented code
4587 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
4588 NEW_TABULAR around the fd_form_table_options.
4590 * src/lyx_gui.C (runTime): call the static member function as
4591 GUIRunTime::runTime().
4593 2000-08-21 Allan Rae <rae@lyx.org>
4595 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
4598 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
4600 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
4602 2000-08-21 Allan Rae <rae@lyx.org>
4604 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
4605 keep Garst happy ;-)
4606 * src/frontends/xforms/FormPreferences.C (build): use setOK
4607 * src/frontends/xforms/FormDocument.C (build): use setOK
4608 (FormDocument): use the appropriate policy.
4610 2000-08-21 Allan Rae <rae@lyx.org>
4612 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
4613 automatic [de]activation of arbitrary objects when in a read-only state.
4615 * src/frontends/ButtonPolicies.h: More documentation
4616 (isReadOnly): added to support the above.
4618 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
4620 2000-08-18 Juergen Vigna <jug@sad.it>
4622 * src/insets/insettabular.C (getStatus): changed to return func_status.
4624 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
4625 display toggle menu entries if they are.
4627 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
4628 new document layout now.
4630 * src/lyxfunc.C: ditto
4632 * src/lyx_gui_misc.C: ditto
4634 * src/lyx_gui.C: ditto
4636 * lib/ui/default.ui: removed paper and quotes layout as they are now
4637 all in the document layout tabbed folder.
4639 * src/frontends/xforms/forms/form_document.fd: added Restore
4640 button and callbacks for all inputs for Allan's ButtonPolicy.
4642 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
4643 (CheckChoiceClass): added missing params setting on class change.
4644 (UpdateLayoutDocument): added for updating the layout on params.
4645 (build): forgot to RETURN_ALWAYS input_doc_spacing.
4646 (FormDocument): Implemented Allan's ButtonPolicy with the
4649 2000-08-17 Allan Rae <rae@lyx.org>
4651 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
4652 so we can at least see the credits again.
4654 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
4655 controller calls for the appropriate callbacks. Note that since Ok
4656 calls apply followed by cancel, and apply isn't a valid input for the
4657 APPLIED state, the bc_ calls have to be made in the static callback not
4658 within each of the real callbacks.
4660 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
4661 (setOk): renamed from setOkay()
4663 2000-08-17 Juergen Vigna <jug@sad.it>
4665 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
4666 in the implementation part.
4667 (composeUIInfo): don't show optional menu-items.
4669 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
4671 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
4673 * src/bufferview_funcs.C (CurrentState): fixed to show also the
4674 text-state when in a text-inset.
4676 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
4678 2000-08-17 Marko Vendelin <markov@ioc.ee>
4679 * src/frontends/gnome/FormIndex.C
4680 * src/frontends/gnome/FormIndex.h
4681 * src/frontends/gnome/FormToc.C
4682 * src/frontends/gnome/FormToc.h
4683 * src/frontends/gnome/dialogs
4684 * src/frontends/gnome/diatoc_callbacks.c
4685 * src/frontends/gnome/diatoc_callbacks.h
4686 * src/frontends/gnome/diainsertindex_callbacks.h
4687 * src/frontends/gnome/diainsertindex_callbacks.c
4688 * src/frontends/gnome/diainsertindex_interface.c
4689 * src/frontends/gnome/diainsertindex_interface.h
4690 * src/frontends/gnome/diatoc_interface.h
4691 * src/frontends/gnome/diatoc_interface.c
4692 * src/frontends/gnome/Makefile.am: Table of Contents and
4693 Insert Index dialogs implementation for Gnome frontend
4695 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
4697 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
4699 * src/frontends/gnome/diainserturl_interface.c: make the dialog
4702 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4704 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
4705 destructor. Don't definde if you don't need it
4706 (processEvents): made static, non-blocking events processing for
4708 (runTime): static method. event loop for xforms
4709 * similar as above for kde and gnome.
4711 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
4712 new Pimpl is correct
4713 (runTime): new method calss the real frontends runtime func.
4715 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
4717 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4719 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
4721 2000-08-16 Juergen Vigna <jug@sad.it>
4723 * src/lyx_gui.C (runTime): added GUII RunTime support.
4725 * src/frontends/Makefile.am:
4726 * src/frontends/GUIRunTime.[Ch]:
4727 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
4728 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
4729 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
4731 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
4733 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
4734 as this is already set in ${FRONTEND_INCLUDE} if needed.
4736 * configure.in (CPPFLAGS): setting the include dir for the frontend
4737 directory and don't set FRONTEND=xforms for now as this is executed
4740 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4742 * src/frontends/kde/Makefile.am:
4743 * src/frontends/kde/FormUrl.C:
4744 * src/frontends/kde/FormUrl.h:
4745 * src/frontends/kde/formurldialog.h:
4746 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4748 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4750 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4752 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4754 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4757 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4759 * src/WorkArea.C (work_area_handler): more work to get te
4760 FL_KEYBOARD to work with xforms 0.88 too, please test.
4762 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4764 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4766 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4769 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4771 * src/Timeout.h: remove Qt::emit hack.
4773 * several files: changes to allo doc++ compilation
4775 * src/lyxfunc.C (processKeySym): new method
4776 (processKeyEvent): comment out if FL_REVISION < 89
4778 * src/WorkArea.C: change some debugging levels.
4779 (WorkArea): set wantkey to FL_KEY_ALL
4780 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4781 clearer code and the use of compose with XForms 0.89. Change to
4782 use signals instead of calling methods in bufferview directly.
4784 * src/Painter.C: change some debugging levels.
4786 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4789 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4790 (workAreaKeyPress): new method
4792 2000-08-14 Juergen Vigna <jug@sad.it>
4794 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4796 * config/kde.m4: addes some features
4798 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4799 include missing xforms dialogs.
4801 * src/Timeout.h: a hack to be able to compile with qt/kde.
4803 * sigc++/.cvsignore: added acinclude.m4
4805 * lib/.cvsignore: added listerros
4807 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4808 xforms tree as objects are needed for other frontends.
4810 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4811 linking with not yet implemented xforms objects.
4813 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4815 2000-08-14 Baruch Even <baruch.even@writeme.com>
4817 * src/frontends/xforms/FormGraphics.h:
4818 * src/frontends/xforms/FormGraphics.C:
4819 * src/frontends/xforms/RadioButtonGroup.h:
4820 * src/frontends/xforms/RadioButtonGroup.C:
4821 * src/insets/insetgraphics.h:
4822 * src/insets/insetgraphics.C:
4823 * src/insets/insetgraphicsParams.h:
4824 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4825 instead of spaces, and various other indentation issues to make the
4826 sources more consistent.
4828 2000-08-14 Marko Vendelin <markov@ioc.ee>
4830 * src/frontends/gnome/dialogs/diaprint.glade
4831 * src/frontends/gnome/FormPrint.C
4832 * src/frontends/gnome/FormPrint.h
4833 * src/frontends/gnome/diaprint_callbacks.c
4834 * src/frontends/gnome/diaprint_callbacks.h
4835 * src/frontends/gnome/diaprint_interface.c
4836 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4839 * src/frontends/gnome/dialogs/diainserturl.glade
4840 * src/frontends/gnome/FormUrl.C
4841 * src/frontends/gnome/FormUrl.h
4842 * src/frontends/gnome/diainserturl_callbacks.c
4843 * src/frontends/gnome/diainserturl_callbacks.h
4844 * src/frontends/gnome/diainserturl_interface.c
4845 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
4846 Gnome implementation
4848 * src/frontends/gnome/Dialogs.C
4849 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
4850 all other dialogs. Copy all unimplemented dialogs from Xforms
4853 * src/frontends/gnome/support.c
4854 * src/frontends/gnome/support.h: support files generated by Glade
4858 * config/gnome.m4: Gnome configuration scripts
4860 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4861 configure --help message
4863 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
4864 only if there are no events pendling in Gnome/Gtk. This enhances
4865 the performance of menus.
4868 2000-08-14 Allan Rae <rae@lyx.org>
4870 * lib/Makefile.am: listerrors cleaning
4872 * lib/listerrors: removed -- generated file
4873 * acinclude.m4: ditto
4874 * sigc++/acinclude.m4: ditto
4876 * src/frontends/xforms/forms/form_citation.fd:
4877 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
4880 * src/frontends/xforms/forms/makefile: I renamed the `install` target
4881 `updatesrc` and now we have a `test` target that does what `updatesrc`
4882 used to do. I didn't like having an install target that wasn't related
4885 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
4886 on all except FormGraphics. This may yet happen. Followed by a major
4887 cleanup including using FL_TRANSIENT for most of the dialogs. More
4888 changes to come when the ButtonController below is introduced.
4890 * src/frontends/xforms/ButtonController.h: New file for managing up to
4891 four buttons on a dialog according to an externally defined policy.
4892 * src/frontends/xforms/Makefile.am: added above
4894 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
4895 Apply and Cancel/Close buttons and everything in between and beyond.
4896 * src/frontends/Makefile.am: added above.
4898 * src/frontends/xforms/forms/form_preferences.fd:
4899 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
4900 and removed variable 'status' as a result. Fixed the set_minsize thing.
4901 Use the new screen-font-update after checking screen fonts were changed
4902 Added a "Restore" button to restore the original lyxrc values while
4903 editing. This restores everything not just the last input changed.
4904 That's still a tricky one. As is the "LyX: this shouldn't happen..."
4906 * src/LyXAction.C: screen-font-update added for updating buffers after
4907 screen font settings have been changed.
4908 * src/commandtags.h: ditto
4909 * src/lyxfunc.C: ditto
4911 * forms/lyx.fd: removed screen fonts dialog.
4912 * src/lyx_gui.C: ditto
4913 * src/menus.[Ch]: ditto
4914 * src/lyx.[Ch]: ditto
4915 * src/lyx_cb.C: ditto + code from here moved to make
4916 screen-font-update. And people wonder why progress on GUII is
4917 slow. Look at how scattered this stuff was! It takes forever
4920 * forms/fdfix.sh: Fixup the spacing after commas.
4921 * forms/makefile: Remove date from generated files. Fewer clashes now.
4922 * forms/bullet_forms.C.patch: included someones handwritten changes
4924 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
4925 once I've discovered why LyXRC was made noncopyable.
4926 * src/lyx_main.C: ditto
4928 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
4930 * src/frontends/xforms/forms/fdfix.sh:
4931 * src/frontends/xforms/forms/fdfixh.sed:
4932 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
4933 * src/frontends/xforms/Form*.[hC]:
4934 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
4935 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
4936 provide a destructor for the struct FD_form_xxxx. Another version of
4937 the set_[max|min]size workaround and a few other cleanups. Actually,
4938 Angus' patch from 20000809.
4940 2000-08-13 Baruch Even <baruch.even@writeme.com>
4942 * src/insets/insetgraphics.C (Clone): Added several fields that needed
4945 2000-08-11 Juergen Vigna <jug@sad.it>
4947 * src/insets/insetgraphics.C (InsetGraphics): changing init
4948 order because of warnings.
4950 * src/frontends/xforms/forms/makefile: adding patching .C with
4953 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
4954 from .C.patch to .c.patch
4956 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
4957 order because of warning.
4959 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
4961 * src/frontends/Liason.C (setMinibuffer): new helper function
4963 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
4965 * src/lyxfunc.C (Dispatch): calling new Document-Layout
4967 * lib/ui/default.ui: commented out PaperLayout entry
4969 * src/frontends/xforms/form_document.[Ch]: new added files
4971 * src/frontends/xforms/FormDocument.[Ch]: ditto
4973 * src/frontends/xforms/forms/form_document.fd: ditto
4975 * src/frontends/xforms/forms/form_document.C.patch: ditto
4977 2000-08-10 Juergen Vigna <jug@sad.it>
4979 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
4980 (InsetGraphics): initialized cacheHandle to 0.
4981 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
4983 2000-08-10 Baruch Even <baruch.even@writeme.com>
4985 * src/graphics/GraphicsCache.h:
4986 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
4987 correctly as a cache.
4989 * src/graphics/GraphicsCacheItem.h:
4990 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
4993 * src/graphics/GraphicsCacheItem_pimpl.h:
4994 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
4997 * src/insets/insetgraphics.h:
4998 * src/insets/insetgraphics.C: Changed from using a signal notification
4999 to polling when image is not loaded.
5001 2000-08-10 Allan Rae <rae@lyx.org>
5003 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
5004 that there are two functions that have to been taken out of line by
5005 hand and aren't taken care of in the script. (Just a reminder note)
5007 * sigc++/macros/*.h.m4: Updated as above.
5009 2000-08-09 Juergen Vigna <jug@sad.it>
5011 * src/insets/insettext.C (draw): small fix for clearing rectangle.
5013 * src/insets/insettabular.C: make drawing of single cell smarter.
5015 2000-08-09 Marko Vendelin <markov@ioc.ee>
5016 * src/frontends/gnome/Menubar_pimpl.C
5017 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
5018 implementation: new files
5020 * src/frontends/gnome/mainapp.C
5021 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
5024 * src/main.C: create Gnome main window
5026 * src/frontends/xforms/Menubar_pimpl.h
5027 * src/frontends/Menubar.C
5028 * src/frontends/Menubar.h: added method Menubar::update that calls
5029 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
5031 * src/LyXView.C: calls Menubar::update to update the state
5034 * src/frontends/gnome/Makefile.am: added new files
5036 * src/frontends/Makefile.am: added frontend compiler options
5038 2000-08-08 Juergen Vigna <jug@sad.it>
5040 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
5042 * src/bufferlist.C (close):
5043 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
5044 documents if exiting without saving.
5046 * src/buffer.C (save): use removeAutosaveFile()
5048 * src/support/filetools.C (removeAutosaveFile): new function.
5050 * src/lyx_cb.C (MenuWrite): returns a bool now.
5051 (MenuWriteAs): check if file could really be saved and revert to the
5053 (MenuWriteAs): removing old autosavefile if existant.
5055 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
5056 before Goto toggle declaration, because of compiler warning.
5058 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
5060 * src/lyxfunc.C (MenuNew): small fix.
5062 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
5064 * src/bufferlist.C (newFile):
5065 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
5067 * src/lyxrc.C: added new_ask_filename tag
5069 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
5071 * src/lyx.fd: removed code pertaining to form_ref
5072 * src/lyx.[Ch]: ditto
5073 * src/lyx_cb.C: ditto
5074 * src/lyx_gui.C: ditto
5075 * src/lyx_gui_misc.C: ditto
5077 * src/BufferView_pimpl.C (restorePosition): update buffer only
5080 * src/commandtags.h (LFUN_REFTOGGLE): removed
5081 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
5082 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
5083 (LFUN_REFBACK): renamed LFUN_REF_BACK
5085 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
5086 * src/menus.C: ditto
5087 * src/lyxfunc.C (Dispatch): ditto.
5088 InsertRef dialog is now GUI-independent.
5090 * src/texrow.C: added using std::endl;
5092 * src/insets/insetref.[Ch]: strip out large amounts of code.
5093 The inset is now a container and this functionality is now
5094 managed by a new FormRef dialog
5096 * src/frontends/Dialogs.h (showRef, createRef): new signals
5098 * src/frontends/xforms/FormIndex.[Ch],
5099 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
5100 when setting dialog's min/max size
5101 * src/frontends/xforms/FormIndex.[Ch]: ditto
5103 * src/frontends/xforms/FormRef.[Ch],
5104 src/frontends/xforms/forms/form_ref.fd: new xforms
5105 implementation of an InsetRef dialog
5107 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
5110 * src/graphics/XPM_Renderer.C (isImageFormatOK):
5111 ios::nocreate is not part of the standard. Removed.
5113 2000-08-07 Baruch Even <baruch.even@writeme.com>
5115 * src/graphics/Renderer.h:
5116 * src/graphics/Renderer.C: Added base class for rendering of different
5117 image formats into Pixmaps.
5119 * src/graphics/XPM_Renderer.h:
5120 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
5121 in a different class.
5123 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
5124 easily add support for other formats.
5126 * src/insets/figinset.C: plugged a leak of an X resource.
5128 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5130 * src/CutAndPaste.[Ch]: make all metods static.
5132 * development/Code_rules/Rules: more work, added section on
5133 Exceptions, and a References section.
5135 * a lot of header files: work to make doc++ able to generate the
5136 source documentation, some workarounds of doc++ problems. Doc++ is
5137 now able to generate the documentation.
5139 2000-08-07 Juergen Vigna <jug@sad.it>
5141 * src/insets/insettabular.C (recomputeTextInsets): removed function
5143 * src/tabular.C (SetWidthOfMulticolCell):
5145 (calculate_width_of_column_NMC): fixed return value so that it really
5146 only returns true if the column-width has changed (there where
5147 problems with muliticolumn-cells in this column).
5149 2000-08-04 Juergen Vigna <jug@sad.it>
5151 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
5152 also on the scrollstatus of the inset.
5153 (workAreaMotionNotify): ditto.
5155 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
5157 2000-08-01 Juergen Vigna <jug@sad.it>
5159 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
5161 * src/commandtags.h:
5162 * src/LyXAction.C (init):
5163 * src/insets/inset.C (LocalDispatch): added support for
5166 * src/insets/inset.C (scroll): new functions.
5168 * src/insets/insettext.C (removeNewlines): new function.
5169 (SetAutoBreakRows): removes forced newlines in the text of the
5170 paragraph if autoBreakRows is set to false.
5172 * src/tabular.C (Latex): generates a parbox around the cell contents
5175 * src/frontends/xforms/FormTabular.C (local_update): removed
5176 the radio_useparbox button.
5178 * src/tabular.C (UseParbox): new function
5180 2000-08-06 Baruch Even <baruch.even@writeme.com>
5182 * src/graphics/GraphicsCache.h:
5183 * src/graphics/GraphicsCache.C:
5184 * src/graphics/GraphicsCacheItem.h:
5185 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
5188 * src/insets/insetgraphics.h:
5189 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
5190 and the drawing of the inline image.
5192 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
5193 loaded into the wrong position.
5195 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
5198 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5200 * src/support/translator.h: move all typedefs to public section
5202 * src/support/filetools.C (MakeLatexName): return string const
5204 (TmpFileName): ditto
5205 (FileOpenSearch): ditto
5207 (LibFileSearch): ditto
5208 (i18nLibFileSearch): ditto
5211 (CreateTmpDir): ditto
5212 (CreateBufferTmpDir): ditto
5213 (CreateLyXTmpDir): ditto
5216 (MakeAbsPath): ditto
5218 (OnlyFilename): ditto
5220 (NormalizePath): ditto
5221 (CleanupPath): ditto
5222 (GetFileContents): ditto
5223 (ReplaceEnvironmentPath): ditto
5224 (MakeRelPath): ditto
5226 (ChangeExtension): ditto
5227 (MakeDisplayPath): ditto
5228 (do_popen): return cmdret const
5229 (findtexfile): return string const
5231 * src/support/DebugStream.h: add some /// to please doc++
5233 * src/frontends/DialogBase.h (endif): add some /// to please doc++
5235 * src/texrow.C (same_rownumber): functor to use with find_if
5236 (getIdFromRow): rewritten to use find_if and to not update the
5237 positions. return true if row is found
5238 (increasePos): new method, use to update positions
5240 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
5242 * src/lyxlex_pimpl.C (verifyTable): new method
5245 (GetString): return string const
5246 (pushTable): rewrite to use std::stack
5248 (setFile): better check
5251 * src/lyxlex.h: make LyXLex noncopyable
5253 * src/lyxlex.C (text): return char const * const
5254 (GetString): return string const
5255 (getLongString): return string const
5257 * src/lyx_gui_misc.C (askForText): return pair<...> const
5259 * src/lastfiles.[Ch] (operator): return string const
5261 * src/buffer.C (parseSingleLyXformat2Token): pass string to
5262 istringstream not char const *.
5263 move token.end() out of loop.
5264 (readFile): move initializaton of token
5266 * src/BufferView2.C (insertErrors): run texrow.increasePos if
5267 getIdFromRow is successful.
5269 * lib/bind/emacs.bind: don't include menus bind
5271 * development/Code_rules/Rules: the beginnings of making this
5272 better and covering more of the unwritten rules that we have.
5274 * development/Code_rules/Recommendations: a couple of wording
5277 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5279 * src/support/strerror.c: remove C++ comment.
5281 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
5283 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
5284 LFUN_INDEX_INSERT_LAST
5286 * src/texrow.C (getIdFromRow): changed from const_iterator to
5287 iterator, allowing code to compile with DEC cxx
5289 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
5290 stores part of the class, as suggested by Allan. Will allow
5292 (apply): test to apply uses InsetCommandParams operator!=
5294 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
5295 (apply): test to apply uses InsetCommandParams operator!=
5297 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
5298 stores part of the class.
5299 (update): removed limits on min/max size.
5301 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
5302 (apply): test to apply uses InsetCommandParams operator!=
5304 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
5305 (Read, Write, scanCommand, getCommand): moved functionality
5306 into InsetCommandParams.
5308 (getScreenLabel): made pure virtual
5309 new InsetCommandParams operators== and !=
5311 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
5312 c-tors based on InsetCommandParams. Removed others.
5313 * src/insets/insetinclude.[Ch]: ditto
5314 * src/insets/insetlabel.[Ch]: ditto
5315 * src/insets/insetparent.[Ch]: ditto
5316 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
5318 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
5319 insets derived from InsetCommand created using similar c-tors
5320 based on InsetCommandParams
5321 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
5322 * src/menus.C (ShowRefsMenu): ditto
5323 * src/paragraph.C (Clone): ditto
5324 * src/text2.C (SetCounter): ditto
5325 * src/lyxfunc.C (Dispatch) ditto
5326 Also recreated old InsetIndex behaviour exactly. Can now
5327 index-insert at the start of a paragraph and index-insert-last
5328 without launching the pop-up.
5330 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5332 * lib/lyxrc.example: mark te pdf options as non functional.
5334 * src/support/lstrings.C (strToInt): move initalization of tmpstr
5335 (isStrDbl): move tmpstr.end() out of loop.
5336 (strToDbl): move intialization of tmpstr
5337 (lowercase): return string const and move tmp.end() out of loop.
5338 (uppercase): return string const and move tmp.edn() out of loop.
5339 (prefixIs): add assertion
5344 (containsOnly): ditto
5345 (containsOnly): ditto
5346 (containsOnly): ditto
5347 (countChar): make last arg char not char const
5348 (token): return string const
5349 (subst): return string const, move tmp.end() out of loop.
5350 (subst): return string const, add assertion
5351 (strip): return string const
5352 (frontStrip): return string const, add assertion
5353 (frontStrip): return string const
5358 * src/support/lstrings.C: add inclde "LAssert.h"
5359 (isStrInt): move tmpstr.end() out of loop.
5361 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
5362 toollist.end() out of loop.
5363 (deactivate): move toollist.end() out of loop.
5364 (update): move toollist.end() out of loop.
5365 (updateLayoutList): move tc.end() out of loop.
5366 (add): move toollist.end() out of loop.
5368 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
5369 md.end() out of loop.
5371 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
5373 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
5376 * src/paragraph.C (Erase): move fontlist.end() out of loop.
5377 (Erase): move insetlist.end() out of loop.
5379 * src/lyx_sendfax_main.C: make show_logfile static and to take a
5380 ref to const string as first arg. Move initialization of some
5381 variables, whitespace changes.
5383 * src/kbmap.C (defkey): move table.end() out of loop.
5384 (kb_keymap): move table.end() out of loop.
5385 (findbinding): move table.end() out of loop.
5387 * src/MenuBackend.C (hasMenu): move end() out of loop.
5388 (getMenu): move end() out of loop.
5389 (getMenu): move menulist_.end() out of loop.
5391 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
5393 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
5396 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
5397 (getFromLyXName): move infotab.end() out of loop.
5399 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
5400 -fvtable-thunks -ffunction-sections -fdata-sections
5402 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
5404 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
5407 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5409 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
5411 * src/frontends/xforms/FormCitation.[Ch],
5412 src/frontends/xforms/FormIndex.[Ch],
5413 src/frontends/xforms/FormToc.[Ch],
5414 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
5416 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5418 * src/commandtags.h: renamed, created some flags for citation
5421 * src/lyx_gui_misc.C: stripped out old FD_index_form code
5423 * src/lyxfunc.C (dispatch): use signals to insert index entry
5425 * src/frontends/Dialogs.h: new signal createIndex
5427 * src/frontends/xforms/FormCommand.[Ch],
5428 src/frontends/xforms/FormCitation.[Ch],
5429 src/frontends/xforms/FormToc.[Ch],
5430 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
5432 * src/insets/insetindex.[Ch]: GUI-independent
5434 * src/frontends/xforms/FormIndex.[Ch],
5435 * src/frontends/xforms/forms/form_index.fd: xforms implementation
5438 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
5440 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
5441 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
5443 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5445 * src/insets/insetref.C (Latex): rewrite so that there is now
5446 question that a initialization is requested.
5448 * src/insets/insetcommand.h: reenable the hide signal
5450 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5452 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
5453 fix handling of shortcuts (many bugs :)
5454 (add_lastfiles): ditto.
5456 * lib/ui/default.ui: fix a few shortcuts.
5458 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
5460 * Makefile.am: Fix ``rpmdist'' target to return the exit
5461 status of the ``rpm'' command, instead of the last command in
5462 the chain (the ``rm lyx.xpm'' command, which always returns
5465 2000-08-02 Allan Rae <rae@lyx.org>
5467 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
5468 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
5469 * src/frontends/xforms/FormToc.C (FormToc): ditto
5471 * src/frontends/xforms/Makefile.am: A few forgotten files
5473 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
5474 Signals-not-copyable-problem Lars' started commenting out.
5476 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
5478 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5480 * src/insets/insetcommand.h: Signals is not copyable so anoter
5481 scheme for automatic hiding of forms must be used.
5483 * src/frontends/xforms/FormCitation.h: don't inerit from
5484 noncopyable, FormCommand already does that.
5485 * src/frontends/xforms/FormToc.h: ditto
5486 * src/frontends/xforms/FormUrl.h: ditto
5488 * src/frontends/xforms/FormCitation.C: add include <algorithm>
5490 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
5492 * src/insets/insetcommand.h (hide): new SigC::Signal0
5493 (d-tor) new virtual destructor emits hide signal
5495 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
5496 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
5498 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
5499 LOF and LOT. Inset is now GUI-independent
5501 * src/insets/insetloa.[Ch]: redundant
5502 * src/insets/insetlof.[Ch]: ditto
5503 * src/insets/insetlot.[Ch]: ditto
5505 * src/frontends/xforms/forms/form_url.fd: tweaked!
5506 * src/frontends/xforms/forms/form_citation.fd: ditto
5508 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
5509 dialogs dealing with InsetCommand insets
5511 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
5512 FormCommand base class
5513 * src/frontends/xforms/FormUrl.[Ch]: ditto
5515 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
5517 * src/frontends/xforms/FormToc.[Ch]: ditto
5519 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
5520 passed a generic InsetCommand pointer
5521 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
5523 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
5524 and modified InsetTOC class
5525 * src/buffer.C: ditto
5527 * forms/lyx.fd: strip out old FD_form_toc code
5528 * src/lyx_gui_misc.C: ditto
5529 * src/lyx_gui.C: ditto
5530 * src/lyx_cb.C: ditto
5531 * src/lyx.[Ch]: ditto
5533 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5535 * src/support/utility.hpp: tr -d '\r'
5537 2000-08-01 Juergen Vigna <jug@sad.it>
5539 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
5541 * src/commandtags.h:
5542 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
5543 LFUN_TABULAR_FEATURES.
5545 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
5546 LFUN_LAYOUT_TABULAR.
5548 * src/insets/insettabular.C (getStatus): implemented helper function.
5550 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
5552 2000-07-31 Juergen Vigna <jug@sad.it>
5554 * src/text.C (draw): fixed screen update problem for text-insets.
5556 * src/text2.C (SetParagrpah): call an update of the inset-owner when
5557 something changed probably this has to be added in various other
5560 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
5562 2000-07-31 Baruch Even <baruch.even@writeme.com>
5564 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
5565 templates to satisfy compaq cxx.
5568 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5570 * src/support/translator.h (equal_1st_in_pair::operator()): take
5571 const ref pair_type as arg.
5572 (equal_2nd_in_pair::operator()): ditto
5573 (Translator::~Translator): remove empty d-tor.
5575 * src/graphics/GraphicsCache.C: move include config.h to top, also
5576 put initialization of GraphicsCache::singleton here.
5577 (~GraphicsCache): move here
5578 (addFile): take const ref as arg
5581 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
5583 * src/BufferView2.C (insertLyXFile): change te with/without header
5586 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5588 * src/frontends/xforms/FormGraphics.C (apply): add some
5589 static_cast. Not very nice, but required by compaq cxx.
5591 * src/frontends/xforms/RadioButtonGroup.h: include header
5592 <utility> instead of <pair.h>
5594 * src/insets/insetgraphicsParams.C: add using directive.
5595 (readResize): change return type to void.
5596 (readOrigin): ditto.
5598 * src/lyxfunc.C (getStatus): add missing break for build-program
5599 function; add test for Literate for export functions.
5601 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
5602 entries in Options menu.
5604 2000-07-31 Baruch Even <baruch.even@writeme.com>
5606 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
5607 protect against auto-allocation; release icon when needed.
5609 2000-07-31 Matej Cepl <CeplM@seznam.cz>
5611 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
5612 on usual typewriter.
5614 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
5615 earlier czech.kmap), useful only for programming.
5617 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5619 * src/frontends/xforms/FormCitation.h: fix conditioning around
5622 2000-07-31 Juergen Vigna <jug@sad.it>
5624 * src/frontends/xforms/FormTabular.C (local_update): changed
5625 radio_linebreaks to radio_useparbox and added radio_useminipage.
5627 * src/tabular.C: made support for using minipages/parboxes.
5629 * src/bufferlist.C (QwriteAll): small fix for asking for save.
5631 * src/insets/insetgraphics.C (draw): just draw the inset so that the
5633 (descent): so the cursor is in the middle.
5634 (width): bit smaller box.
5636 * src/insets/insetgraphics.h: added display() function.
5638 2000-07-31 Baruch Even <baruch.even@writeme.com>
5640 * src/frontends/Dialogs.h: Added showGraphics signals.
5642 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
5643 xforms form definition of the graphics dialog.
5645 * src/frontends/xforms/FormGraphics.h:
5646 * src/frontends/xforms/FormGraphics.C: Added files, the
5647 GUIndependent code of InsetGraphics
5649 * src/insets/insetgraphics.h:
5650 * src/insets/insetgraphics.C: Major writing to make it work.
5652 * src/insets/insetgraphicsParams.h:
5653 * src/insets/insetgraphicsParams.C: Added files, parameter passing
5654 struct between InsetGraphics and GUI.
5656 * src/LaTeXFeatures.h:
5657 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
5658 support for graphicx package.
5660 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
5661 for the graphics inset.
5663 * src/support/translator.h: Added file, used in
5664 InsetGraphicsParams. this is a template to translate between two
5667 * src/frontends/xforms/RadioButtonGroup.h:
5668 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
5669 way to easily control a radio button group.
5671 2000-07-28 Juergen Vigna <jug@sad.it>
5673 * src/insets/insettabular.C (LocalDispatch):
5674 (TabularFeatures): added support for lyx-functions of tabular features.
5675 (cellstart): refixed this function after someone wrongly changed it.
5677 * src/commandtags.h:
5678 * src/LyXAction.C (init): added support for tabular-features
5680 2000-07-28 Allan Rae <rae@lyx.org>
5682 * src/frontends/xforms/FormPreferences.C (build): Setup input return
5683 checking. NOTE: It seems that pressing ESC to cancel the dialog also
5684 triggers the callback for input checking. As a result we sometimes get
5685 "LyX: This shouldn't happen..." printed to cerr.
5686 (input): Started using status variable since I only free() on
5687 destruction. Some input checking for paths and font sizes.
5689 * src/frontends/xforms/FormPreferences.h: Use status to control
5690 activation of Ok and Apply
5692 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
5693 callback. Also resized to stop segfaults with 0.88. The problem is
5694 that xforms-0.88 requires the folder to be wide enough to fit all the
5695 tabs. If it isn't it causes all sorts of problems.
5697 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
5699 * src/frontends/xforms/forms/README: Reflect reality.
5701 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
5702 * src/frontends/xforms/forms/makefile: ditto.
5704 * src/commandtags.h: Get access to new Preferences dialog
5705 * src/LyXAction.C: ditto
5706 * src/lyxfunc.C: ditto
5707 * lib/ui/default.ui: ditto
5709 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5711 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
5713 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
5716 * src/frontends/xforms/form_url.[Ch]: added.
5718 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5720 * src/insets/insetbib.h: fixed bug in previous commit
5722 * src/frontends/xforms/FormUrl.h: ditto
5724 * src/frontends/xforms/FormPrint.h: ditto
5726 * src/frontends/xforms/FormPreferences.h: ditto
5728 * src/frontends/xforms/FormCopyright.h: ditto
5730 * src/frontends/xforms/FormCitation.C: ditto
5732 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
5733 private copyconstructor and private default contructor
5735 * src/support/Makefile.am: add utility.hpp
5737 * src/support/utility.hpp: new file from boost
5739 * src/insets/insetbib.h: set owner in clone
5741 * src/frontends/xforms/FormCitation.C: added missing include
5744 * src/insets/form_url.[Ch]: removed
5746 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5748 * development/lyx.spec.in
5749 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5750 file/directory re-organization.
5752 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5754 * src/insets/insetcommand.[Ch]: moved the string data and
5755 associated manipulation methods into a new stand-alone class
5756 InsetCommandParams. This class has two additional methods
5757 getAsString() and setFromString() allowing the contents to be
5758 moved around as a single string.
5759 (addContents) method removed.
5760 (setContents) method no longer virtual.
5762 * src/buffer.C (readInset): made use of new InsetCitation,
5763 InsetUrl constructors based on InsetCommandParams.
5765 * src/commandtags.h: add LFUN_INSERT_URL
5767 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5768 independent InsetUrl and use InsetCommandParams to extract
5769 string info and create new Insets.
5771 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5773 * src/frontends/xforms/FormCitation.C (apply): uses
5776 * src/frontends/xforms/form_url.C
5777 * src/frontends/xforms/form_url.h
5778 * src/frontends/xforms/FormUrl.h
5779 * src/frontends/xforms/FormUrl.C
5780 * src/frontends/xforms/forms/form_url.fd: new files
5782 * src/insets/insetcite.[Ch]: removed unused constructors.
5784 * src/insets/insetinclude.[Ch]: no longer store filename
5786 * src/insets/inseturl.[Ch]: GUI-independent.
5788 2000-07-26 Juergen Vigna <jug@sad.it>
5789 * renamed frontend from gtk to gnome as it is that what is realized
5790 and did the necessary changes in the files.
5792 2000-07-26 Marko Vendelin <markov@ioc.ee>
5794 * configure.in: cleaning up gnome configuration scripts
5796 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5798 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5799 shortcuts syndrom by redrawing them explicitely (a better solution
5800 would be appreciated).
5802 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5804 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5807 * src/lyx_cb.C (MenuExport): change html export to do the right
5808 thing depending of the document type (instead of having
5809 html-linuxdoc and html-docbook).
5810 * src/lyxfunc.C (getStatus): update for html
5811 * lib/ui/default.ui: simplify due to the above change.
5812 * src/menus.C (ShowFileMenu): update too (in case we need it).
5814 * src/MenuBackend.C (read): if a menu is defined twice, add the
5815 new entries to the exiting one.
5817 2000-07-26 Juergen Vigna <jug@sad.it>
5819 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5821 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5822 and return a bool if it did actual save the file.
5823 (AutoSave): don't autosave a unnamed doc.
5825 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5826 check if this is an UNNAMED new file and react to it.
5827 (newFile): set buffer to unnamed and change to not mark a new
5828 buffer dirty if I didn't do anything with it.
5830 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5832 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5834 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5835 friend as per Angus's patch posted to lyx-devel.
5837 * src/ext_l10n.h: updated
5839 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5840 gettext on the style string right before inserting them into the
5843 * autogen.sh: add code to extract style strings form layout files,
5844 not good enough yet.
5846 * src/frontends/gtk/.cvsignore: add MAKEFILE
5848 * src/MenuBackend.C (read): run the label strings through gettext
5849 before storing them in the containers.
5851 * src/ext_l10n.h: new file
5853 * autogen.sh : generate the ext_l10n.h file here
5855 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5857 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5860 * lib/ui/default.ui: fix a couple of typos.
5862 * config/gnome/gtk.m4: added (and added to the list of files in
5865 * src/insets/insetinclude.C (unique_id): fix when we are using
5866 lyxstring instead of basic_string<>.
5867 * src/insets/insettext.C (LocalDispatch): ditto.
5868 * src/support/filetools.C: ditto.
5870 * lib/configure.m4: create the ui/ directory if necessary.
5872 * src/LyXView.[Ch] (updateToolbar): new method.
5874 * src/BufferView_pimpl.C (buffer): update the toolbar when
5875 opening/closing buffer.
5877 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5879 * src/LyXAction.C (getActionName): enhance to return also the name
5880 and options of pseudo-actions.
5881 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
5883 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
5884 as an example of what is possible). Used in File->Build too (more
5885 useful) and in the import/export menus (to mimick the complicated
5886 handling of linuxdoc and friends). Try to update all the entries.
5888 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
5891 * src/MenuBackend.C (read): Parse the new OptItem tag.
5893 * src/MenuBackend.h: Add a new optional_ data member (used if the
5894 entry should be omitted when the lyxfunc is disabled).
5896 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
5897 function, used as a shortcut.
5898 (create_submenu): align correctly the shortcuts on the widest
5901 * src/MenuBackend.h: MenuItem.label() only returns the label of
5902 the menu without shortcut; new method shortcut().
5904 2000-07-14 Marko Vendelin <markov@ioc.ee>
5906 * src/frontends/gtk/Dialogs.C:
5907 * src/frontends/gtk/FormCopyright.C:
5908 * src/frontends/gtk/FormCopyright.h:
5909 * src/frontends/gtk/Makefile.am: added these source-files for the
5910 Gtk/Gnome support of the Copyright-Dialog.
5912 * src/main.C: added Gnome::Main initialization if using
5913 Gtk/Gnome frontend-GUI.
5915 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
5917 * config/gnome/aclocal-include.m4
5918 * config/gnome/compiler-flags.m4
5919 * config/gnome/curses.m4
5920 * config/gnome/gnome--.m4
5921 * config/gnome/gnome-bonobo-check.m4
5922 * config/gnome/gnome-common.m4
5923 * config/gnome/gnome-fileutils.m4
5924 * config/gnome/gnome-ghttp-check.m4
5925 * config/gnome/gnome-gnorba-check.m4
5926 * config/gnome/gnome-guile-checks.m4
5927 * config/gnome/gnome-libgtop-check.m4
5928 * config/gnome/gnome-objc-checks.m4
5929 * config/gnome/gnome-orbit-check.m4
5930 * config/gnome/gnome-print-check.m4
5931 * config/gnome/gnome-pthread-check.m4
5932 * config/gnome/gnome-support.m4
5933 * config/gnome/gnome-undelfs.m4
5934 * config/gnome/gnome-vfs.m4
5935 * config/gnome/gnome-x-checks.m4
5936 * config/gnome/gnome-xml-check.m4
5937 * config/gnome/gnome.m4
5938 * config/gnome/gperf-check.m4
5939 * config/gnome/gtk--.m4
5940 * config/gnome/linger.m4
5941 * config/gnome/need-declaration.m4: added configuration scripts
5942 for Gtk/Gnome frontend-GUI
5944 * configure.in: added support for the --with-frontend=gtk option
5946 * autogen.sh: added config/gnome/* to list of config-files
5948 * acconfig.h: added define for GTKGUI-support
5950 * config/lyxinclude.m4: added --with-frontend[=value] option value
5951 for Gtk/Gnome frontend-GUI support.
5953 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5955 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
5959 * src/paragraph.C (GetChar): remove non-const version
5961 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
5962 (search_kw): use it.
5964 * src/lyx_main.C (init): if "preferences" exist, read that instead
5966 (ReadRcFile): return bool if the file could be read ok.
5967 (ReadUIFile): add a check to see if lex file is set ok.
5969 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
5970 bastring can be used instead of lyxstring (still uses the old code
5971 if std::string is good enough or if lyxstring is used.)
5973 * src/encoding.C: make the arrays static, move ininle functions
5975 * src/encoding.h: from here.
5977 * src/buffer.C: have last_isnet_read as a file scope variable for now.
5978 (parseSingleLyXformat2Token): move inset parsing to separate method
5979 (readInset): new private method
5981 * src/Variables.h: remove virtual from get().
5983 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
5984 access to NEW_INSETS and NEW_TABULAR
5986 * src/MenuBackend.h: remove superfluous forward declaration of
5987 MenuItem. Add documentations tags "///", remove empty MenuItem
5988 destructor, remove private default contructor.
5990 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
5992 (read): more string mlabel and mname to where they are used
5993 (read): remove unused variables mlabel and mname
5994 (defaults): unconditional clear, make menusetup take advantage of
5995 add returning Menu &.
5997 * src/LyXView.h: define NEW_MENUBAR as default
5999 * src/LyXAction.C: include lyxparagraph.h temporary to get access
6000 to NEW_INSETS and NEW_TABULAR.
6001 (init): commetn out some funcs that is obsolete when NEW_INSETS is
6002 defined. Change some of the "xxxx-inset-insert" functions names to
6005 * several files: more enahncements to NEW_INSETS and the resulting
6008 * lib/lyxrc.example (\date_insert_format): move to misc section
6010 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
6011 bastring and use AC_CACHE_CHECK.
6012 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
6013 the system have the newest methods. uses AC_CACHE_CHECK
6014 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
6015 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
6016 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
6018 * configure.in: add LYX_CXX_GOOD_STD_STRING
6020 * acinclude.m4: recreated
6022 2000-07-24 Amir Karger <karger@lyx.org>
6024 * README: add Hebrew, Arabic kmaps
6027 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6029 * src/buffer.C (writeFileAscii): Define actcell as an int instead
6032 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6034 * Lot of files: add pragma interface/implementation.
6036 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
6038 * lib/ui/default.ui: new file (ans new directory). Contains the
6039 default menu and toolbar.
6041 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
6042 global space. Toolbars are now read (as menus) in ui files.
6044 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
6046 * src/lyxfunc.C (getStatus): do not exit immediately if a command
6047 is disabled because the document is read-only. We want to have the
6048 toggle state of the function anyway.
6049 (getStatus): add code for LFUN_VC* functions (mimicking what is
6050 done in old-style menus)
6052 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
6053 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
6055 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
6056 * src/BufferView_pimpl.C: ditto.
6057 * src/lyxfunc.C: ditto.
6059 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
6060 default). This replaces old-style menus by new ones.
6062 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
6063 MenuItem. Contain the data structure of a menu.
6065 * src/insets/insettext.C: use LyXView::setLayout instead of
6066 accessing directly the toolbar combox.
6067 * src/lyxfunc.C (Dispatch): ditto.
6069 * src/LyXView.C (setLayout): new method, which just calls
6070 Toolbar::setLayout().
6071 (updateLayoutChoice): move part of this method in Toolbar.
6073 * src/toolbar.[Ch]: removed.
6075 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
6076 implementation the toolbar.
6078 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
6079 the toolbar. It might make sense to merge it with ToolbarDefaults
6081 (setLayout): new function.
6082 (updateLayoutList): ditto.
6083 (openLayoutList): ditto.
6085 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
6086 xforms implementation of the toolbar.
6087 (get_toolbar_func): comment out, since I do not
6088 know what it is good for.
6090 * src/ToolbarDefaults.h: Add the ItemType enum.
6092 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
6093 for a list of allocated C strings. Used in Menubar xforms
6094 implementation to avoid memory leaks.
6096 * src/support/lstrings.[Ch] (uppercase): new version taking and
6100 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
6101 * lib/bind/emacs.bind: ditto.
6103 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6105 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
6106 forward decl of LyXView.
6108 * src/toolbar.C (toolbarItem): moved from toolbar.h
6109 (toolbarItem::clean): ditto
6110 (toolbarItem::~toolbarItem): ditto
6111 (toolbarItem::operator): ditto
6113 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
6115 * src/paragraph.h: control the NEW_TABULAR define from here
6117 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
6118 USE_TABULAR_INSETS to NEW_TABULAR
6120 * src/ToolbarDefaults.C: add include "lyxlex.h"
6122 * files using the old table/tabular: use NEW_TABULAR to control
6123 compilation of old tabular stuff.
6125 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
6128 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
6129 planemet in reading of old style floats, fix the \end_deeper
6130 problem when reading old style floats.
6132 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6134 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
6136 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
6138 * lib/bind/sciword.bind: updated.
6140 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6142 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
6143 layout write problem
6145 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6147 * src/Makefile.am (INCLUDES): remove image directory from include
6150 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
6151 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
6153 * src/LyXView.C (create_form_form_main): read the application icon
6156 * lib/images/*.xpm: change the icons to use transparent color for
6159 * src/toolbar.C (update): change the color of the button when it
6162 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6164 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
6165 setting explicitely the minibuffer.
6166 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
6168 * src/LyXView.C (showState): new function. Shows font information
6169 in minibuffer and update toolbar state.
6170 (LyXView): call Toolbar::update after creating the
6173 * src/toolbar.C: change toollist to be a vector instead of a
6175 (BubbleTimerCB): get help string directly from the callback
6176 argument of the corresponding icon (which is the action)
6177 (set): remove unnecessary ugliness.
6178 (update): new function. update the icons (depressed, disabled)
6179 depending of the status of the corresponding action.
6181 * src/toolbar.h: remove help in toolbarItem
6183 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
6185 * src/Painter.C (text): Added code for using symbol glyphs from
6186 iso10646 fonts. Currently diabled.
6188 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
6191 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
6192 magyar,turkish and usorbian.
6194 * src/paragraph.C (isMultiLingual): Made more efficient.
6196 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
6199 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
6200 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
6201 Also changed the prototype to "bool math_insert_greek(char)".
6203 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6205 * lots of files: apply the NEW_INSETS on all code that will not be
6206 needed when we move to use the new insets. Enable the define in
6207 lyxparagrah.h to try it.
6209 * src/insets/insettabular.C (cellstart): change to be a static
6211 (InsetTabular): initialize buffer in the initializer list.
6213 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
6215 * src/frontends/xforms/FormPrint.[Ch] : moved #include
6216 form_print.h out of the header file. Replaced with forward
6217 declarations of the relevant struct.
6219 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
6222 * src/commandtags.h: do not include "debug.h" which does not
6223 belong there. #include it in some other places because of this
6226 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6228 * src/insets/insetcaption.C: add a couple "using" directives.
6230 * src/toolbar.C (add): get the help text directly from lyxaction.
6232 (setPixmap): new function. Loads from disk and sets a pixmap on a
6233 botton; the name of the pixmap file is derived from the command
6236 * src/toolbar.h: remove members isBitmap and pixmap from
6239 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
6240 * lib/images/: move many files from images/banner.xpm.
6242 * src/lyx_gui.C (create_forms): read banner pixmap from file.
6244 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
6245 * src/toolbar.C: ditto.
6246 * configure.in: ditto.
6247 * INSTALL: document.
6249 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
6250 the spellchecker popup is closed from the WM.
6252 2000-07-19 Juergen Vigna <jug@sad.it>
6254 * src/insets/insetfloat.C (Write): small fix because we use the
6255 insetname for the type now!
6257 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
6259 * src/frontends/xforms/forms/form_citation.fd: object sizes are
6262 * src/frontends/Dialogs.h: removed hideCitation signal
6264 * src/insets/insetcite.h: added hide signal
6266 * src/insets/insetcite.C (~InsetCitation): emits new signal
6267 (getScreenLabel): "intelligent" label should now fit on the screen!
6269 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
6271 * src/frontends/xforms/FormCitation.C (showInset): connects
6272 hide() to the inset's hide signal
6273 (show): modified to use fl_set_object_position rather than
6274 fl_set_object_geometry wherever possible
6276 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6278 * src/insets/lyxinset.h: add caption code
6280 * src/insets/insetfloat.C (type): new method
6282 * src/insets/insetcaption.C (Write): new method
6284 (LyxCode): new method
6286 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
6287 to get it right together with using the FloatList.
6289 * src/commandtags.h: add LFUN_INSET_CAPTION
6290 * src/lyxfunc.C (Dispatch): handle it
6292 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
6295 * src/Variables.[Ch]: make expand take a const reference, remove
6296 the destructor, some whitespace changes.
6298 * src/LyXAction.C (init): add caption-inset-insert
6300 * src/FloatList.C (FloatList): update the default floats a bit.
6302 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6304 * src/Variables.[Ch]: new files. Intended to be used for language
6305 specific strings (like \chaptername) and filename substitution in
6308 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
6310 * lib/kbd/american.kmap: update
6312 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
6314 * src/bufferparams.[Ch]: remove member allowAccents.
6316 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
6318 * src/LaTeXLog.C: use the log_form.h header.
6319 * src/lyx_gui.C: ditto.
6320 * src/lyx_gui_misc.C: ditto.
6321 * src/lyxvc.h: ditto.
6323 * forms/log_form.fd: new file, created from latexoptions.fd. I
6324 kept the log popup and nuked the options form.
6326 * src/{la,}texoptions.[Ch]: removed.
6327 * src/lyx_cb.C (LaTeXOptions): ditto
6329 * src/lyx_gui.C (create_forms): do not handle the
6330 fd_latex_options form.
6332 2000-07-18 Juergen Vigna <jug@sad.it>
6334 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
6335 name of the inset so that it can be requested outside (text2.C).
6337 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
6340 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6342 * src/mathed/formula.h (ConvertFont): constify
6344 * src/mathed/formula.C (Read): add warning if \end_inset is not
6345 found on expected place.
6347 * src/insets/lyxinset.h (ConvertFont): consify
6349 * src/insets/insetquotes.C (ConvertFont): constify
6350 * src/insets/insetquotes.h: ditto
6352 * src/insets/insetinfo.h: add labelfont
6354 * src/insets/insetinfo.C (InsetInfo): set the labelfont
6355 (ascent): use labelfont
6359 (Write): make .lyx file a bit nicer
6361 * src/insets/insetfloat.C (Write): simplify somewhat...
6362 (Read): add warning if arg is not found
6364 * src/insets/insetcollapsable.C: add using std::max
6365 (Read): move string token and add warning in arg is not found
6366 (draw): use std::max to get the right ty
6367 (getMaxWidth): simplify by using std::max
6369 * src/insets/insetsection.h: new file
6370 * src/insets/insetsection.C: new file
6371 * src/insets/insetcaption.h: new file
6372 * src/insets/insetcaption.C: new file
6374 * src/insets/inset.C (ConvertFont): constify signature
6376 * src/insets/Makefile.am (libinsets_la_SOURCES): add
6377 insetcaption.[Ch] and insetsection.[Ch]
6379 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
6380 uses to use LABEL_COUNTER_CHAPTER instead.
6381 * src/text2.C (SetCounter): here
6383 * src/counters.h: new file
6384 * src/counters.C: new file
6385 * src/Sectioning.h: new file
6386 * src/Sectioning.C: new file
6388 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
6390 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6392 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
6395 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
6398 2000-07-17 Juergen Vigna <jug@sad.it>
6400 * src/tabular.C (Validate): check if array-package is needed.
6401 (SetVAlignment): added support for vertical alignment.
6402 (SetLTFoot): better support for longtable header/footers
6403 (Latex): modified to support added features.
6405 * src/LaTeXFeatures.[Ch]: added array-package.
6407 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
6409 * src/lyx_gui.C (LyXGUI): make sure that the height is large
6412 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
6414 * configure.in: do not forget to put a space after -isystem.
6416 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
6418 * lib/kbd/arabic.kmap: a few fixes.
6420 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6422 * some whitespace chagnes to a number of files.
6424 * src/support/DebugStream.h: change to make it easier for
6425 doc++ to parse correctly.
6426 * src/support/lyxstring.h: ditto
6428 * src/mathed/math_utils.C (compara): change to have only one
6430 (MathedLookupBOP): change because of the above.
6432 * src/mathed/math_delim.C (math_deco_compare): change to have only
6434 (search_deco): change becasue of the above.
6436 * src/insets/insettabular.C (DrawCellSelection): use std::swap
6437 instead of manually coded one.
6439 * src/insets/insetquotes.C (Read): read the \end_inset too
6441 * src/insets/insetlatex.h: remove file
6442 * src/insets/insetlatex.C: remove file
6444 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
6446 (InsetPrintIndex): remove destructor
6448 * src/insets/insetinclude.h: remove default constructor
6450 * src/insets/insetfloat.C: work to make it work better
6452 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
6454 * src/insets/insetcite.h (InsetCitation): remove default constructor
6456 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
6458 * src/text.C (GetColumnNearX): comment out some currently unused code.
6460 * src/paragraph.C (writeFile): move some initializations closer to
6462 (CutIntoMinibuffer): small change to use new matchIT operator
6466 (InsertInset): ditto
6469 (InsetIterator): ditto
6470 (Erase): small change to use new matchFT operator
6472 (GetFontSettings): ditto
6473 (HighestFontInRange): ditto
6476 * src/lyxparagraph.h: some chars changed to value_type
6477 (matchIT): because of some stronger checking (perhaps too strong)
6478 in SGI STL, the two operator() unified to one.
6481 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
6483 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
6484 the last inset read added
6485 (parseSingleLyXformat2Token): some more (future) compability code added
6486 (parseSingleLyXformat2Token): warning about solitary \end_inset added
6487 (parseSingleLyXformat2Token): set last_inset_read
6488 (parseSingleLyXformat2Token): more code to read new "Float" correctly
6489 (parseSingleLyXformat2Token): don't double intializw string next_token
6491 * src/TextCache.C (text_fits::operator()): add const's to the signature
6492 (has_buffer::operator()): ditto
6494 * src/Floating.h: add some comments on the class
6496 * src/FloatList.[Ch] (typeExist): new method
6499 * src/BackStack.h: added default constructor, wanted by Gcc.
6501 2000-07-14 Juergen Vigna <jug@sad.it>
6503 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
6505 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
6507 * src/insets/insettabular.C (resizeLyXText): need this to be able to
6508 do a redraw when the window is resized!
6509 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
6511 * src/insets/insettext.C (resizeLyXText): added function to correctly
6512 being able to resize the LyXWindow.
6514 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
6516 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
6518 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
6519 crashes when closing dialog to a deleted inset.
6521 * src/insets/insetcite.[Ch] (Edit) : the return of this former
6522 method! Now similar to other insets.
6524 2000-07-13 Juergen Vigna <jug@sad.it>
6526 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
6528 * lib/examples/Literate.lyx: small patch!
6530 * src/insets/insetbib.C (Read): added this function because of wrong
6531 Write (without [begin|end]_inset).
6533 2000-07-11 Juergen Vigna <jug@sad.it>
6535 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
6536 as the insertInset could not be good!
6538 * src/screen.C (ToggleSelection): fixed toggle selection bug as
6539 the bool param should not be last.
6541 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6543 * sigc++/configure.in: fix bug in threading-related code (Yes, I
6544 did submit that to Karl).
6546 * configure.in: use -isystem instead of -I for X headers. This
6547 fixes a problem on solaris with a recent gcc;
6548 put the front-end code after the X detection code;
6549 configure in sigc++ before lib/
6551 * src/lyx_main.C (commandLineHelp): remove -display from command
6554 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
6556 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
6557 Also put in Makefile rules for building the ``listerrors''
6558 program for parsing errors from literate programs written in LyX.
6560 * lib/build-listerrors: Added small shell script as part of compile
6561 process. This builds a working ``listerrors'' binary if noweb is
6562 installed and either 1) the VNC X server is installed on the machine,
6563 or 2) the user is compiling from within a GUI. The existence of a GUI
6564 is necessary to use the ``lyx --export'' feature for now. This
6565 hack can be removed once ``lyx --export'' no longer requires a GUI to
6568 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
6570 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
6571 now passed back correctly from gcc and placed "under" error
6572 buttons in a Literate LyX source.
6574 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6576 * src/text.C (GetColumnNearX): Better behavior when a RTL
6577 paragraph is ended by LTR text.
6579 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
6582 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6584 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
6585 true when clipboard is empty.
6587 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6589 * text.C (Backspace): Prevent rebreaking of a row if it is the last
6590 row of the paragraph.
6591 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
6592 to prevent calculation of bidi tables
6594 2000-07-07 Juergen Vigna <jug@sad.it>
6596 * src/screen.C (ToggleSelection): added y_offset and x_offset
6599 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
6602 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
6604 * src/insets/insettext.C: fixed Layout-Display!
6606 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6608 * configure.in: add check for strings.h header.
6610 * src/spellchecker.C: include <strings.h> in order to have a
6611 definition for bzero().
6613 2000-07-07 Juergen Vigna <jug@sad.it>
6615 * src/insets/insettext.C (draw): set the status of the bv->text to
6616 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
6618 * src/screen.C (DrawOneRow):
6619 (DrawFromTo): redraw the actual row if something has changed in it
6622 * src/text.C (draw): call an update of the toplevel-inset if something
6623 has changed inside while drawing.
6625 * src/lyxtext.h: added CHANGED_IN_DRAW status.
6627 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
6629 * src/insets/insetbib.[Ch] (callback) new method, moving callback
6630 processing inside class.
6632 * src/insets/insetindex.[Ch] (callback) new method, moving callback
6633 processing inside class.
6635 * src/insets/insetindex.h new struct Holder, consistent with other
6638 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
6639 citation dialog from main code and placed it in src/frontends/xforms.
6640 Dialog launched through signals instead of callbacks
6642 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
6644 * lyx.man: update the options description.
6646 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
6648 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
6649 handle neg values, set min width to 590, add doc about -display
6651 2000-07-05 Juergen Vigna <jug@sad.it>
6653 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
6654 calls to BufferView *.
6656 * src/insets/insettext.C (checkAndActivateInset): small fix non
6657 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
6659 * src/insets/insetcommand.C (Read): Fixed as insets should read till
6660 their \end_inset token!
6662 2000-07-04 edscott <edscott@imp.mx>
6664 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
6665 lib/lyxrc.example: added option \wheel_jump
6667 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
6669 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
6670 remove support for -width,-height,-xpos and -ypos.
6672 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
6674 * src/encoding.[Ch]: New files.
6676 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
6677 (text): Call to the underline() method only when needed.
6679 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
6681 * src/buffer.C (makeLaTeXFile): Compute automatically the input
6682 encoding(s) for the document.
6684 * src/bufferparams.C (BufferParams): Changed default value of
6687 * src/language.C (newLang): Removed.
6688 (items[]): Added encoding information for all defined languages.
6690 * src/lyx_gui.C (create_forms): Added "auto" option to the input
6691 encoding choice button.
6693 * src/lyxrc.h (font_norm_type): New member variable.
6694 (set_font_norm_type): New method.
6696 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
6697 paragraphs with different encodings.
6699 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
6700 (TransformChar): Changed to work correctly with Arabic points.
6701 (draw): Added support for drawing Arabic points.
6702 (draw): Removed code for drawing underbars (this is done by
6705 * src/support/textutils.h (IsPrintableNonspace): New function.
6707 * src/BufferView_pimpl.h: Added "using SigC::Object".
6708 * src/LyXView.h: ditto.
6710 * src/insets/insetinclude.h (include_label): Changed to mutable.
6712 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6714 * src/mathed/math_iter.h: remove empty destructor
6716 * src/mathed/math_cursor.h: remove empty destructor
6718 * src/insets/lyxinset.h: add THEOREM_CODE
6720 * src/insets/insettheorem.[Ch]: new files
6722 * src/insets/insetminipage.C: (InsertInset): remove
6724 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
6726 (InsertInset): remove
6728 * src/insets/insetlist.C: (InsertList): remove
6730 * src/insets/insetfootlike.[Ch]: new files
6732 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
6735 (InsertInset): ditto
6737 * src/insets/insetert.C: remove include Painter.h, reindent
6738 (InsertInset): move to header
6740 * src/insets/insetcollapsable.h: remove explicit from default
6741 contructor, remove empty destructor, add InsertInset
6743 * src/insets/insetcollapsable.C (InsertInset): new func
6745 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6747 * src/vspace.h: add explicit to constructor
6749 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6750 \textcompwordmark, please test this.
6752 * src/lyxrc.C: set ascii_linelen to 65 by default
6754 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6756 * src/commandtags.h: add LFUN_INSET_THEOREM
6758 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6759 (makeLinuxDocFile): remove _some_ of the nice logic
6760 (makeDocBookFile): ditto
6762 * src/Painter.[Ch]: (~Painter): removed
6764 * src/LyXAction.C (init): entry for insettheorem added
6766 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6768 (deplog): code to detect files generated by LaTeX, needs testing
6771 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6773 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6775 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6777 * src/LaTeX.C (deplog): Add a check for files that are going to be
6778 created by the first latex run, part of the project to remove the
6781 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6782 contents to the extension list.
6784 2000-07-04 Juergen Vigna <jug@sad.it>
6786 * src/text.C (NextBreakPoint): added support for needFullRow()
6788 * src/insets/lyxinset.h: added needFullRow()
6790 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6793 * src/insets/insettext.C: lots of changes for update!
6795 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6797 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6799 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6801 * src/insets/insetinclude.C (InsetInclude): fixed
6802 initialization of include_label.
6803 (unique_id): now returns a string.
6805 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6807 * src/LaTeXFeatures.h: new member IncludedFiles, for
6808 a map of key, included file name.
6810 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6811 with the included files for inclusion in SGML preamble,
6812 i. e., linuxdoc and docbook.
6815 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6816 nice (is the generated linuxdoc code to be exported?), that
6817 allows to remove column, and only_body that will be true for
6818 slave documents. Insets are allowed inside SGML font type.
6819 New handling of the SGML preamble for included files.
6820 (makeDocBookFile): the same for docbook.
6822 * src/insets/insetinclude.h:
6823 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6825 (DocBook): new export methods.
6827 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6828 and makeDocBookFile.
6830 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6831 formats to export with command line argument -x.
6833 2000-06-29 Juergen Vigna <jug@sad.it>
6835 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6836 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6838 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6839 region could already been cleared by an inset!
6841 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6843 * src/BufferView_pimpl.h: remove member variables lyx_focus and
6846 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
6848 (cursorToggle): remove special handling of lyx focus.
6850 2000-06-28 Juergen Vigna <jug@sad.it>
6852 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
6855 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6857 * src/insets/insetindex.C (Edit): add a callback when popup is
6860 * src/insets/insettext.C (LocalDispatch):
6861 * src/insets/insetmarginal.h:
6862 * src/insets/insetlist.h:
6863 * src/insets/insetfoot.h:
6864 * src/insets/insetfloat.h:
6865 * src/insets/insetert.h: add a missing std:: qualifier.
6867 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6869 * src/support/lyxsum.C (sum): '\0' teminate file read when using
6872 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
6874 * src/insets/insettext.C (Read): remove tmptok unused variable
6875 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
6876 (InsertInset): change for new InsetInset code
6878 * src/insets/insettext.h: add TEXT inline method
6880 * src/insets/insettext.C: remove TEXT macro
6882 * src/insets/insetmarginal.C (Write): new method
6883 (Latex): change output slightly
6885 * src/insets/insetfoot.C (Write): new method
6886 (Latex): change output slightly (don't use endl when no need)
6888 * src/insets/insetert.C (Write): new method
6890 * src/insets/insetcollapsable.h: make button_length, button_top_y
6891 and button_bottm_y protected.
6893 * src/insets/insetcollapsable.C (Write): simplify code by using
6894 tostr. Also do not output the float name, the children class
6895 should to that to get control over own arguments
6897 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
6898 src/insets/insetminipage.[Ch]:
6901 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6903 * src/lyxfunc.C (Dispatch): cases for new insets/commands
6905 * src/Makefile.am (lyx_SOURCES): add the new files
6907 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
6908 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
6909 * src/commandtags.h: ditto
6911 * src/LaTeXFeatures.h: add a std::set of used floattypes
6913 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
6915 * src/FloatList.[Ch] src/Floating.h: new files
6917 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
6919 * src/lyx_cb.C (TableApplyCB): ditto
6921 * src/text2.C: ditto
6922 * src/buffer.C (SimpleLinuxDocOnePar): ditto
6923 (parseSingleLyXformat2Token): ditto + add code for
6924 backwards compability for old float styles + add code for new insets
6926 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
6928 (InsertInset(size_type, Inset *, LyXFont)): new method
6929 (InsetChar(size_type, char)): changed to use the other InsetChar
6930 with a LyXFont(ALL_INHERIT).
6931 (InsetInset(size_type, Inset*)): changed to use InsetChar to
6932 insert the META_INSET.
6934 * sigc++/thread.cc (Privete<int>::operator int&): move definition
6936 * sigc++/thread.h (Threads): from here
6938 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
6939 definition out of line
6940 * sigc++/scope.h: from here
6942 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6944 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
6945 is specified (adapted from a patch from edscott <edscott@imp.mx>).
6947 * Makefile.am (bindist): new target.
6949 * INSTALL: add instructions for doing a binary distribution.
6951 * development/tools/README.bin.example: update a bit.
6953 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
6956 * lib/lyxrc.example: new lyxrc tag \set_color.
6958 * src/lyxfunc.C (Dispatch):
6959 * src/commandtags.h:
6960 * src/LyXAction.C: new lyxfunc "set-color".
6962 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
6963 and an x11name given as strings.
6965 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
6966 cache when a color is changed.
6968 2000-06-26 Juergen Vigna <jug@sad.it>
6970 * src/lyxrow.C (width): added this functions and variable.
6972 * src/insets/insetcite.C (create_form_citation_form): some Gravity
6975 * src/text.C (SetHeightOfRow): fixed calcualting of width.
6977 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6979 * images/undo_bw.xpm: new icon.
6980 * images/redo_bw.xpm: ditto.
6982 * configure.in (INSTALL_SCRIPT): change value to
6983 ${INSTALL} to avoid failures of install-script target.
6984 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
6986 * src/BufferView.h: add a magic "friend" declaration to please
6989 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
6991 * forms/cite.fd: modified to allow resizing without messing
6994 * src/insetcite.C: Uses code from cite.fd almost without
6996 User can now resize dialog in the x-direction.
6997 Resizing the dialog in the y-direction is prevented, as the
6998 code does this intelligently already.
7000 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7002 * INSTALL: remove obsolete entry in "problems" section.
7004 * lib/examples/sl_*.lyx: update of the slovenian examples.
7006 * src/support/FileInfo.[Ch] (getBlockSize): remove.
7008 2000-06-23 Juergen Vigna <jug@sad.it>
7010 * src/lyxtext.h: added a 'cleared' flag to draw() function.
7012 * src/buffer.C (resize): delete the LyXText of textinsets.
7014 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
7016 * src/insets/lyxinset.h: added another parameter 'cleared' to
7017 the draw() function.
7019 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
7020 unlocking inset in inset.
7022 2000-06-22 Juergen Vigna <jug@sad.it>
7024 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
7025 of insets and moved first to LyXText.
7027 * src/mathed/formulamacro.[Ch]:
7028 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
7030 2000-06-21 Juergen Vigna <jug@sad.it>
7032 * src/text.C (GetVisibleRow): look if I should clear the area or not
7033 using Inset::doClearArea() function.
7035 * src/insets/lyxinset.h: added doClearArea() function and
7036 modified draw(Painter &, ...) to draw(BufferView *, ...)
7038 * src/text2.C (UpdateInset): return bool insted of int
7040 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
7042 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
7043 combox in the character popup
7045 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
7046 BufferParams const & params
7048 2000-06-20 Juergen Vigna <jug@sad.it>
7050 * src/insets/insettext.C (SetParagraphData): set insetowner on
7053 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7055 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
7056 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
7058 (form_main_): remove
7060 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
7061 (create_form_form_main): remove FD_form_main stuff, connect to
7062 autosave_timeout signal
7064 * src/LyXView.[Ch] (getMainForm): remove
7065 (UpdateTimerCB): remove
7066 * src/BufferView_pimpl.h: inherit from SigC::Object
7068 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
7069 signal instead of callback
7071 * src/BufferView.[Ch] (cursorToggleCB): remove
7073 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7075 * src/BufferView_pimpl.C: changes because of the one below
7077 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
7078 instead of storing a pointer to a LyXText.
7080 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
7082 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
7084 * src/lyxparagraph.h
7086 * src/paragraph.C: Changed fontlist to a sorted vector.
7088 2000-06-19 Juergen Vigna <jug@sad.it>
7090 * src/BufferView.h: added screen() function.
7092 * src/insets/insettext.C (LocalDispatch): some selection code
7095 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
7097 * src/insets/insettext.C (SetParagraphData):
7099 (InsetText): fixes for multiple paragraphs.
7101 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
7103 * development/lyx.spec.in: Call configure with ``--without-warnings''
7104 to work around a bug with the Makefiles when doing ``make lyxrpm''.
7105 This should be fine, however, since we generally don't want to be
7106 verbose when making an RPM.
7108 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
7110 * lib/scripts/fig2pstex.py: New file
7112 2000-06-16 Juergen Vigna <jug@sad.it>
7114 * src/insets/insettabular.C (UpdateLocal):
7115 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
7116 (LocalDispatch): Changed all functions to use LyXText.
7118 2000-06-15 Juergen Vigna <jug@sad.it>
7120 * src/text.C (SetHeightOfRow): call inset::update before requesting
7123 * src/insets/insettext.C (update):
7124 * src/insets/insettabular.C (update): added implementation
7126 * src/insets/lyxinset.h: added update function
7128 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7130 * src/text.C (SelectNextWord): protect against null pointers with
7131 old-style string streams. (fix from Paul Theo Gonciari
7134 * src/cite.[Ch]: remove erroneous files.
7136 * lib/configure.m4: update the list of created directories.
7138 * src/lyxrow.C: include <config.h>
7139 * src/lyxcursor.C: ditto.
7141 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7143 * lib/examples/decimal.lyx: new example file from Mike.
7145 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
7146 to find template definitions (from Dekel)
7148 * src/frontends/.cvsignore: add a few things.
7150 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
7152 * src/Timeout.C (TimeOut): remove default argument.
7154 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
7157 * src/insets/ExternalTemplate.C: add a "using" directive.
7159 * src/lyx_main.h: remove the act_ struct, which seems unused
7162 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7164 * LyX Developers Meeting: All files changed, due to random C++ (by
7165 coincidence) code generator script.
7167 - external inset (cool!)
7168 - initial online editing of preferences
7169 - insettabular breaks insettext(s contents)
7171 - some DocBook fixes
7172 - example files update
7173 - other cool stuff, create a diff and look for yourself.
7175 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
7177 * src/insets/insettext.C (computeTextRows): if the maxWidth is
7178 -1 this is a non-line-breaking textinset.
7180 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
7181 if there is no width set.
7183 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7185 * Lots of files: Merged the dialogbase branch.
7187 2000-06-09 Allan Rae <rae@lyx.org>
7189 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
7190 and the Dispatch methods that used it.
7192 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
7193 access to functions formerly kept in Dispatch.
7195 2000-05-19 Allan Rae <rae@lyx.org>
7197 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
7198 made to_page and count_copies integers again. from_page remains a
7199 string however because I want to allow entry of a print range like
7200 "1,4,22-25" using this field.
7202 * src/LyXAction.C: added action info and commands for buffer-print-xtl
7203 and printer-params-get. These aren't useful from the minibuffer but
7204 could be used by a script/LyXServer app provided it passes a suitable
7205 auto_mem_buffer. I guess I should take a look at how the LyXServer
7206 works and make it support xtl buffers.
7208 * sigc++/: updated to libsigc++-1.0.1
7210 * src/xtl/: updated to xtl-1.3.pl.11
7212 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
7213 those changes done to the files in src/ are actually recreated when
7214 they get regenerated. Please don't ever accept a patch that changes a
7215 dialog unless that patch includes the changes to the corresponding *.fd
7218 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
7219 stringOnlyContains, renamed it and generalised it.
7221 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
7222 branch. Removed the remaining old form_print code.
7224 2000-04-26 Allan Rae <rae@lyx.org>
7226 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
7227 trap I was trying to fix with the ID: fields in src/xtl/ :-)
7229 2000-04-25 Allan Rae <rae@lyx.org>
7231 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
7232 against a base of xtl-1.3.pl.4
7234 * development/tools/lxtl.sh: fixed a couple of silly typos and now
7235 filter the Id: entries so they still show the xtl version number
7238 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
7239 into the src/xtl code. Patch still pending with José (XTL)
7241 2000-04-24 Allan Rae <rae@lyx.org>
7243 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
7244 both more generic and much safer. Use the new template functions.
7245 * src/buffer.[Ch] (Dispatch): ditto.
7247 * src/frontends/xforms/FormPrint.C (update): Use new template functions
7248 and mem buffer more intelligently. Also a little general cleanup.
7251 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
7252 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
7253 * src/xtl/Makefile.am: ditto.
7254 * src/xtl/.cvsignore: ditto.
7255 * src/Makefile.am: ditto.
7257 * src/PrinterParams.h: Removed the macros member functions. Added a
7258 testInvariant member function. A bit of tidying up and commenting.
7259 Included Angus's idea for fixing operation with egcs-1.1.2.
7261 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
7262 cool expansion of XTL's mem_buffer to support automatic memory
7263 management within the buffer itself. Removed the various macros and
7264 replaced them with template functions that use either auto_mem_buffer
7265 or mem_buffer depending on a #define. The mem_buffer support will
7266 disappear as soon as the auto_mem_buffer is confirmed to be good on
7267 other platforms/compilers. That is, it's there so you've got something
7270 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
7271 effectively forked XTL. However I expect José will include my code
7272 into the next major release. Also fixed a memory leak.
7273 * src/xtl/text.h: ditto.
7274 * src/xtl/xdr.h: ditto.
7275 * src/xtl/giop.h: ditto.
7277 2000-04-16 Allan Rae <rae@lyx.org>
7279 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
7280 by autogen.sh and removed by maintainer-clean anyway.
7281 * .cvsignore, sigc++/.cvsignore: Support the above.
7283 * sigc++/.cvsignore: Forgot that retbind.h was generated.
7285 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
7287 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
7288 macros, renamed static callback-target member functions to suit new
7289 scheme and made them public.
7290 * src/frontends/xforms/forms/form_print.fd: ditto.
7291 * src/frontends/xforms/forms/form_copyright.fd: ditto.
7293 * src/support/lxtl.h: small cleanup to use typedef instead of #define
7296 * src/xtl/: New directory containing a minimal distribution of XTL.
7297 This is XTL-1.3.pl.4.
7299 * development/tools/lxtl.sh: A script to generate the above mini-dist.
7301 2000-04-15 Allan Rae <rae@lyx.org>
7303 * development/tools/makeLyXsigc.sh: Remove the library version numbers
7305 * sigc++/: Updated to libsigc++-1.0.0
7307 2000-04-14 Allan Rae <rae@lyx.org>
7309 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
7310 use the generic ones in future. I'll modify my conversion script.
7312 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
7314 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
7315 (CloseAllBufferRelatedDialogs): Renamed.
7316 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
7318 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
7319 of the generic ones. These are the same ones my conversion script
7322 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
7323 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
7324 * src/buffer.C (Dispatch): ditto
7326 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
7327 functions for updating and hiding buffer dependent dialogs.
7328 * src/BufferView.C (buffer): ditto
7329 * src/buffer.C (setReadonly): ditto
7330 * src/lyxfunc.C (CloseBuffer): ditto
7332 * src/buffer.h: Take setReadonly() out of line so I don't have to include
7333 Dialogs.h, and hence all the SigC stuff, into every file that includes
7334 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
7336 * src/BufferView2.C: reduce the number of headers included by buffer.h
7338 2000-04-11 Allan Rae <rae@lyx.org>
7340 * src/frontends/xforms/xform_macros.h: A small collection of macros
7341 for building C callbacks.
7343 * src/frontends/xforms/Makefile.am: Added above file.
7345 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
7346 scheme again. This time it should work for JMarc. If this is
7347 successful I'll revise my conversion script to automate some of this.
7348 The static member functions in the class also have to be public for
7349 this scheme will work. If the scheme works (it's almost identical to
7350 the way BufferView::cursorToggleCB is handled so it should work) then
7351 FormCopyright and FormPrint will be ready for inclusion into the main
7352 trunk immediately after 1.1.5 is released -- provided we're prepared
7353 for complaints about lame compilers not handling XTL.
7355 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
7357 2000-04-07 Allan Rae <rae@lyx.org>
7359 * config/lyxinclude.m4: A bit more tidying up (Angus)
7361 * src/LString.h: JMarc's <string> header fix
7363 * src/PrinterParams.h: Used string for most data to remove some
7364 ugly code in the Print dialog and avoid even uglier code when
7365 appending the ints to a string for output.
7367 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
7368 and moved "default:" back to the end of switch statement. Cleaned
7369 up the printing so it uses the right function calls and so the
7370 "print to file" option actually puts the file in the right directory.
7372 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
7374 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
7375 and Ok+Apply button control into a separate method: input (Angus).
7376 (input) Cleaned it up and improved it to be very thorough now.
7377 (All CB) static_cast used instead of C style cast (Angus). This will
7378 probably change again once we've worked out how to keep gcc-2.8.1 happy
7379 with real C callbacks.
7380 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
7381 ignore some of the bool settings and has random numbers instead. Needs
7382 some more investigation. Added other input length checks and checking
7383 of file and printer names.
7385 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
7386 would link (Angus). Seems the old code doesn't compile with the pragma
7387 statement either. Separated callback entries from internal methods.
7389 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
7391 2000-03-17 Allan Rae <rae@lyx.org>
7393 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
7394 need it? Maybe it could go in Dialogs instead? I could make it a
7395 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
7396 values to get the bool return value.
7397 (Dispatch): New overloaded method for xtl support.
7399 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
7400 extern "C" callback instead of static member functions. Hopefully,
7401 JMarc will be able to compile this. I haven't changed
7402 forms/form_copyright.fd yet. Breaking one of my own rules already.
7404 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
7405 because they aren't useful from the minibuffer. Maybe a LyXServer
7406 might want a help message though?
7408 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
7410 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
7411 xtl which needs both rtti and exceptions.
7413 * src/support/Makefile.am:
7414 * src/support/lxtl.h: New file. Some helper macros for using XTL.
7416 * src/frontends/xforms/input_validators.[ch]: input filters and
7417 validators. These conrol what keys are valid in input boxes.
7418 Use them and write some more. Much better idea than waiting till
7419 after the user has pressed Ok to say that the input fields don't make
7422 * src/frontends/xforms/Makefile.am:
7423 * src/frontends/xforms/forms/form_print.fd:
7424 * src/frontends/xforms/forms/makefile:
7425 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
7426 new scheme. Still have to make sure I haven't missed anything from
7427 the current implementation.
7429 * src/Makefile.am, src/PrinterParams.h: New data store.
7431 * other files: Added a couple of copyright notices.
7433 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7435 * src/insets/insetbib.h: move Holder struct in public space.
7437 * src/frontends/include/DialogBase.h: use SigC:: only when
7438 SIGC_CXX_NAMESPACES is defined.
7439 * src/frontends/include/Dialogs.h: ditto.
7441 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
7443 * src/frontends/xforms/FormCopyright.[Ch]: do not
7444 mention SigC:: explicitely.
7446 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7448 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
7449 deals with testing KDE in main configure.in
7450 * configure.in: ditto.
7452 2000-02-22 Allan Rae <rae@lyx.org>
7454 * Lots of files: Merged from HEAD
7456 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
7457 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
7459 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
7461 * sigc++/: new minidist.
7463 2000-02-14 Allan Rae <rae@lyx.org>
7465 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
7467 2000-02-08 Juergen Vigna <jug@sad.it>
7469 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
7470 file for the buildin GUI builder of KDevelop of the copyright-dialog.
7472 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
7473 for this port and so it is much easier for other people to port
7474 dialogs in a common development environment.
7476 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
7477 the QT/KDE implementation.
7479 * src/frontends/kde/Dialogs.C:
7480 * src/frontends/kde/FormCopyright.C:
7481 * src/frontends/kde/FormCopyright.h:
7482 * src/frontends/kde/Makefile.am:
7483 * src/frontends/kde/formcopyrightdialog.C:
7484 * src/frontends/kde/formcopyrightdialog.h:
7485 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
7486 for the kde support of the Copyright-Dialog.
7488 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
7489 subdir-substitution instead of hardcoded 'xforms' as we now have also
7492 * src/frontends/include/DialogBase.h (Object): just commented the
7493 label after #endif (nasty warning and I don't like warnings ;)
7495 * src/main.C (main): added KApplication initialization if using
7498 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
7499 For now only the KDE event-loop is added if frontend==kde.
7501 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
7503 * configure.in: added support for the --with-frontend[=value] option
7505 * autogen.sh: added kde.m4 file to list of config-files
7507 * acconfig.h: added define for KDEGUI-support
7509 * config/kde.m4: added configuration functions for KDE-port
7511 * config/lyxinclude.m4: added --with-frontend[=value] option with
7512 support for xforms and KDE.
7514 2000-02-08 Allan Rae <rae@lyx.org>
7516 * all Makefile.am: Fixed up so the make targets dist, distclean,
7517 install and uninstall all work even if builddir != srcdir. Still
7518 have a new sigc++ minidist update to come.
7520 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
7522 2000-02-01 Allan Rae <rae@lyx.org>
7524 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
7525 Many mods to get builddir != srcdir working.
7527 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
7528 for building on NT and so we can do the builddir != srcdir stuff.
7530 2000-01-30 Allan Rae <rae@lyx.org>
7532 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
7533 This will stay in "rae" branch. We probably don't really need it in
7534 the main trunk as anyone who wants to help programming it should get
7535 a full library installed also. So they can check both included and
7536 system supplied library compilation.
7538 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
7539 Added a 'mini' distribution of libsigc++. If you feel the urge to
7540 change something in these directories - Resist it. If you can't
7541 resist the urge then you should modify the following script and rebuild
7542 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
7543 all happen. Still uses a hacked version of libsigc++'s configure.in.
7544 I'm quite happy with the results. I'm not sure the extra work to turn
7545 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
7546 worth the trouble and would probably lead to extra maintenance
7548 I haven't tested the following important make targets: install, dist.
7549 Not ready for prime time but very close. Maybe 1.1.5.
7551 * development/tools/makeLyXsigc.sh: A shell script to automatically
7552 generate our mini-dist of libsigc++. It can only be used with a CVS
7553 checkout of libsigc++ not a tarball distribution. It's well commented.
7554 This will end up as part of the libsigc++ distribution so other apps
7555 can easily have an included mini-dist. If someone makes mods to the
7556 sigc++ subpackage without modifying this script to generate those
7557 changes I'll be very upset!
7559 * src/frontends/: Started the gui/system indep structure.
7561 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
7562 to access the gui-indep dialogs are in this class. Much improved
7563 design compared to previous revision. Lars, please refrain from
7564 moving this header into src/ like you did with Popups.h last time.
7566 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
7568 * src/frontends/xforms/: Started the gui-indep system with a single
7569 dialog: FormCopyright. Initial testing of use of libsigc++ was very
7572 * src/frontends/xforms/forms: Repository for the xforms .fd files.
7573 Here you'll find a very useful makefile and automated fdfix.sh that
7574 makes updating dailogs a no-brainer -- provided you follow the rules
7575 set out in the README. I'm thinking about adding another script to
7576 automatically generate skeleton code for a new dialog given just the
7579 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
7580 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
7581 Made FormCopyright gui-indep and added a lyxfunc to get to it.
7583 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7585 * src/support/LSubstring.C (operator): simplify
7587 * src/lyxtext.h: removed bparams, use buffer_->params instead
7589 * src/lyxrow.h: make Row a real class, move all variables to
7590 private and use accessors.
7592 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
7594 (isRightToLeftPar): ditto
7595 (ChangeLanguage): ditto
7596 (isMultiLingual): ditto
7599 (SimpleTeXOnePar): ditto
7600 (TeXEnvironment): ditto
7601 (GetEndLabel): ditto
7603 (SetOnlyLayout): ditto
7604 (BreakParagraph): ditto
7605 (BreakParagraphConservative): ditto
7606 (GetFontSettings): ditto
7608 (CopyIntoMinibuffer): ditto
7609 (CutIntoMinibuffer): ditto
7610 (PasteParagraph): ditto
7611 (SetPExtraType): ditto
7612 (UnsetPExtraType): ditto
7613 (DocBookContTableRows): ditto
7614 (SimpleDocBookOneTablePar): ditto
7616 (TeXFootnote): ditto
7617 (SimpleTeXOneTablePar): ditto
7618 (TeXContTableRows): ditto
7619 (SimpleTeXSpecialChars): ditto
7622 * src/lyxcursor.h: make LyXCursor a real class, move all variables
7623 to private and use accessors.
7625 * src/lyx_cb.C: remove char updatetimer, and all code that uses
7626 this, we did not use it anymore and has not been for ages. Just a
7627 waste of cpu cycles.
7629 * src/language.h: make Language a real class, move all variables
7630 to private and use accessors.
7632 * src/BufferView_pimpl.C (Pimpl): use new timer code.
7633 (create_view): remove
7634 (update): some changes for new timer
7635 (cursorToggle): use new timer
7636 (beforeChange): change for new timer
7638 * src/BufferView.h (cursorToggleCB): removed last paramter because
7641 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
7642 (cursorToggleCB): change because of new timer code
7644 * lib/CREDITS: updated own mailaddress
7646 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7648 * src/support/filetools.C (PutEnv): fix the code in case neither
7649 putenv() nor setenv() have been found.
7651 * INSTALL: mention the install-strip Makefile target.
7653 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
7654 read-only documents.
7656 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7658 * lib/reLyX/configure.in (VERSION): avoid using a previously
7659 generated reLyX wrapper to find out $prefix.
7661 * lib/examples/eu_adibide_lyx-atua.lyx:
7662 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
7663 translation of the Tutorial (Dooteo)
7665 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
7667 * forms/cite.fd: new citation dialog
7669 * src/insetcite.[Ch]: the new citation dialog is moved into
7672 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
7675 * src/insets/insetcommand.h: data members made private.
7677 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7679 * LyX 1.1.5 released
7681 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7683 * src/version.h (LYX_RELEASE): to 1.1.5
7685 * src/spellchecker.C (RunSpellChecker): return false if the
7686 spellchecker dies upon creation.
7688 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7690 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
7691 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
7695 * lib/CREDITS: update entry for Martin Vermeer.
7697 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
7699 * src/text.C (draw): Draw foreign language bars at the bottom of
7700 the row instead of at the baseline.
7702 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
7704 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7706 * lib/bind/de_menus.bind: updated
7708 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7710 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
7712 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7714 * src/menus.C (Limit_string_length): New function
7715 (ShowTocMenu): Limit the number of items/length of items in the
7718 * src/paragraph.C (String): Correct result for a paragraph inside
7721 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7723 * src/bufferlist.C (close): test of buf->getuser() == NULL
7725 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
7727 * src/BufferView2.C (removeAutoInsets): Fix a bug:
7728 Do not call to SetCursor when the paragraph is a closed footnote!
7730 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
7732 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
7735 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7737 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7740 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7741 reference popup, that activates the reference-back action
7743 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7745 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7746 the menus. Also fixed a bug.
7748 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7749 the math panels when switching buffers (unless new buffer is readonly).
7751 * src/BufferView.C (NoSavedPositions)
7752 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7754 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7756 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7757 less of dvi dirty or not.
7759 * src/trans_mgr.[Ch] (insert): change first parameter to string
7762 * src/chset.[Ch] (encodeString): add const to first parameter
7764 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7766 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7770 * src/LaTeX.C (deplog): better searching for dependency files in
7771 the latex log. Uses now regexps.
7773 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7774 instead of the box hack or \hfill.
7776 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7778 * src/lyxfunc.C (doImportHelper): do not create the file before
7779 doing the actual import.
7780 (doImportASCIIasLines): create a new file before doing the insert.
7781 (doImportASCIIasParagraphs): ditto.
7783 * lib/lyxrc.example: remove mention of non-existing commands
7785 * lyx.man: remove mention of color-related switches.
7787 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7789 * src/lyx_gui.C: remove all the color-related ressources, which
7790 are not used anymore.
7792 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7795 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7797 * src/lyxrc.C (read): Add a missing break in the switch
7799 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7801 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7803 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7806 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7808 * src/text.C (draw): draw bars under foreign language words.
7810 * src/LColor.[Ch]: add LColor::language
7812 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7814 * src/lyxcursor.h (boundary): New member variable
7816 * src/text.C (IsBoundary): New methods
7818 * src/text.C: Use the above for currect cursor movement when there
7819 is both RTL & LTR text.
7821 * src/text2.C: ditto
7823 * src/bufferview_funcs.C (ToggleAndShow): ditto
7825 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7827 * src/text.C (DeleteLineForward): set selection to true to avoid
7828 that DeleteEmptyParagraphMechanism does some magic. This is how it
7829 is done in all other functions, and seems reasonable.
7830 (DeleteWordForward): do not jump over non-word stuff, since
7831 CursorRightOneWord() already does it.
7833 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7834 DeleteWordBackward, since they seem safe to me (since selection is
7835 set to "true") DeleteEmptyParagraphMechanism does nothing.
7837 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7839 * src/lyx_main.C (easyParse): simplify the code by factoring the
7840 part that removes parameters from the command line.
7841 (LyX): check wether wrong command line options have been given.
7843 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7845 * src/lyx_main.C : add support for specifying user LyX
7846 directory via command line option -userdir.
7848 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
7850 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
7851 the number of items per popup.
7852 (Add_to_refs_menu): Ditto.
7854 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7856 * src/lyxparagraph.h: renamed ClearParagraph() to
7857 StripLeadingSpaces() and moved it to paragraph.C. We pass the
7858 textclass as parameter, and do nothing if free_spacing is
7859 true. This fixes part of the line-delete-forward problems.
7861 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
7862 (pasteSelection): ditto.
7863 (SwitchLayoutsBetweenClasses): more translatable strings.
7865 * src/text2.C (CutSelection): use StripLeadingSpaces.
7866 (PasteSelection): ditto.
7867 (DeleteEmptyParagraphMechanism): ditto.
7869 2000-05-26 Juergen Vigna <jug@sad.it>
7871 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
7872 is not needed in tabular insets.
7874 * src/insets/insettabular.C (TabularFeatures): added missing features.
7876 * src/tabular.C (DeleteColumn):
7878 (AppendRow): implemented this functions
7879 (cellsturct::operator=): clone the inset too;
7881 2000-05-23 Juergen Vigna <jug@sad.it>
7883 * src/insets/insettabular.C (LocalDispatch): better selection support
7884 when having multicolumn-cells.
7886 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7888 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
7890 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7892 * src/ColorHandler.C (getGCForeground): put more test into _()
7894 * lib/examples/eu_splash.lyx: new file (Basque translation) from
7897 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
7900 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
7902 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
7903 there are no labels, or when buffer is readonly.
7905 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
7906 there are no labels, buffer is SGML, or when buffer is readonly.
7908 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7910 * src/LColor.C (LColor): change a couple of grey40 to grey60
7911 (LColor): rewore initalization to make compiles go some magnitude
7913 (getGUIName): don't use gettext until we need the string.
7915 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
7917 * src/Bullet.[Ch]: Fixed a small bug.
7919 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
7921 * src/paragraph.C (String): Several fixes/improvements
7923 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
7925 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7927 * src/paragraph.C (String): give more correct output.
7929 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
7931 * src/lyxfont.C (stateText) Do not output the language if it is
7932 eqaul to the language of the document.
7934 * src/paragraph.C (TeXOnePar): Do not put language switch commands
7935 between two paragraphs with the same language.
7937 * src/paragraph.C (getParLanguage) Return a correct answer for an
7938 empty dummy paragraph.
7940 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
7943 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
7946 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
7947 the menus/popup, if requested fonts are unavailable.
7949 2000-05-22 Juergen Vigna <jug@sad.it>
7951 * src/insets/insettabular.C (LocalDispatch): added some more cursor
7952 movement support (Up/Down/Tab/Shift-Tab).
7953 (LocalDispatch): added also preliminari cursor-selection.
7955 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
7957 * src/paragraph.C (PasteParagraph): Hopefully now right!
7959 2000-05-22 Garst R. Reese <reese@isn.net>
7961 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
7962 of list, change all references to Environment to Command
7963 * tex/hollywood.cls : rewrite environments as commands, add
7964 \uppercase to interiorshot and exteriorshot to force uppecase.
7965 * tex/broadway.cls : rewrite environments as commands. Tweak
7968 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7970 * src/menus.C (Add_to_toc_menu): fix the code which limits the
7971 size of items: use a constant intead of the hardcoded 40, and more
7972 importantly do not remove the %m and %x tags added at the end.
7973 (Add_to_refs_menu): use vector::size_type instead of
7974 unsigned int as basic types for the variables. _Please_ do not
7975 assume that size_t is equal to unsigned int. On an alpha, this is
7976 unsigned long, which is _not_ the same.
7978 * src/language.C (initL): remove language "hungarian", since it
7979 seems that "magyar" is better.
7981 2000-05-22 Juergen Vigna <jug@sad.it>
7983 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
7985 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
7988 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
7989 next was deleted but not set to 0.
7991 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7993 * src/language.C (initL): change the initialization of languages
7994 so that compiles goes _fast_.
7996 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
7999 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
8001 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8005 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8007 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
8009 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
8013 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
8016 * src/insets/insetlo*.[Ch]: Made editable
8018 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8020 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
8021 the current selection.
8023 * src/BufferView_pimpl.C (stuffClipboard): new method
8025 * src/BufferView.C (stuffClipboard): new method
8027 * src/paragraph.C (String): new method
8029 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
8030 LColor::ignore when lyxname is not found.
8032 * src/BufferView.C (pasteSelection): new method
8034 * src/BufferView_pimpl.C (pasteSelection): new method
8036 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
8038 * src/WorkArea.C (request_clipboard_cb): new static function
8039 (getClipboard): new method
8040 (putClipboard): new method
8042 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8044 * LyX 1.1.5pre2 released
8046 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8048 * src/vspace.C (operator=): removed
8049 (operator=): removed
8051 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
8053 * src/layout.C (NumberOfClass): manually set the type in make_pair
8054 (NumberOfLayout): ditto
8056 * src/language.C: use the Language constructor for ignore_lang
8058 * src/language.h: add constructors to struct Language
8060 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
8062 * src/text2.C (SetCursorIntern): comment out #warning
8064 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
8066 * src/mathed/math_iter.h: initialize sx and sw to 0
8068 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
8070 * forms/lyx.fd: Redesign of form_ref
8072 * src/LaTeXFeatures.[Ch]
8076 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
8079 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
8080 and Buffer::inset_iterator.
8082 * src/menus.C: Added new menus: TOC and Refs.
8084 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
8086 * src/buffer.C (getTocList): New method.
8088 * src/BufferView2.C (ChangeRefs): New method.
8090 * src/buffer.C (getLabelList): New method. It replaces the old
8091 getReferenceList. The return type is vector<string> instead of
8094 * src/insets/insetinclude.C (getLabelList): New method. Replaces
8095 the old getLabel() and GetNumberOfLabels() methods.
8096 * src/insets/insetlabel.C (getLabelList): ditto
8097 * src/mathed/formula.C (getLabelList): ditto
8099 * src/paragraph.C (String): New method.
8101 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
8102 Uses the new getTocList() method.
8103 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
8104 which automatically updates the contents of the browser.
8105 (RefUpdateCB): Use the new getLabelList method.
8107 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
8109 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
8111 * src/spellchecker.C: Added using std::reverse;
8113 2000-05-19 Juergen Vigna <jug@sad.it>
8115 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
8117 * src/insets/insettext.C (computeTextRows): small fix for display of
8118 1 character after a newline.
8120 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
8123 2000-05-18 Juergen Vigna <jug@sad.it>
8125 * src/insets/insettabular.C (TabularFeatures): fixed update of display
8126 when changing width of column.
8128 * src/tabular.C (set_row_column_number_info): setting of
8129 autobreak rows if necessary.
8131 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8133 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
8135 * src/vc-backend.*: renamed stat() to status() and vcstat to
8136 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
8137 compilation broke. The new name seems more relevant, anyway.
8139 2000-05-17 Juergen Vigna <jug@sad.it>
8141 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
8142 which was wrong if the removing caused removing of rows!
8144 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
8145 (pushToken): new function.
8147 * src/text2.C (CutSelection): fix problem discovered with purify
8149 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8151 * src/debug.C (showTags): enlarge the first column, now that we
8152 have 6-digits debug codes.
8154 * lib/layouts/hollywood.layout:
8155 * lib/tex/hollywood.cls:
8156 * lib/tex/brodway.cls:
8157 * lib/layouts/brodway.layout: more commands and fewer
8158 environments. Preambles moved in the .cls files. Broadway now has
8159 more options on scene numbering and less whitespace (from Garst)
8161 * src/insets/insetbib.C (getKeys): make sure that we are in the
8162 document directory, in case the bib file is there.
8164 * src/insets/insetbib.C (Latex): revert bogus change.
8166 2000-05-16 Juergen Vigna <jug@sad.it>
8168 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
8169 the TabularLayout on cursor move.
8171 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
8173 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
8176 (draw): fixed cursor position and drawing so that the cursor is
8177 visible when before the tabular-inset.
8179 * src/insets/insettext.C (init): drawLockedFrame was not initialized
8180 when creating from old insettext.
8182 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
8184 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8186 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
8187 * lib/tex/brodway.cls: ditto
8189 * lib/layouts/brodway.layout: change alignment of parenthical
8192 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8194 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
8195 versions 0.88 and 0.89 are supported.
8197 2000-05-15 Juergen Vigna <jug@sad.it>
8199 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
8202 * src/insets/insettext.C (computeTextRows): redone completely this
8203 function in a much cleaner way, because of problems when having a
8205 (draw): added a frame border when the inset is locked.
8206 (SetDrawLockedFrame): this sets if we draw the border or not.
8207 (SetFrameColor): this sets the frame color (default=insetframe).
8209 * src/insets/lyxinset.h: added x() and y() functions which return
8210 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
8211 function which is needed to see if we have a locking inset of some
8212 type in this inset (needed for now in insettabular).
8214 * src/vspace.C (inPixels): the same function also without a BufferView
8215 parameter as so it is easier to use it in some ocasions.
8217 * src/lyxfunc.C: changed all places where insertInset was used so
8218 that now if it couldn't be inserted it is deleted!
8220 * src/TabularLayout.C:
8221 * src/TableLayout.C: added support for new tabular-inset!
8223 * src/BufferView2.C (insertInset): this now returns a bool if the
8224 inset was really inserted!!!
8226 * src/tabular.C (GetLastCellInRow):
8227 (GetFirstCellInRow): new helper functions.
8228 (Latex): implemented for new tabular class.
8232 (TeXTopHLine): new Latex() helper functions.
8234 2000-05-12 Juergen Vigna <jug@sad.it>
8236 * src/mathed/formulamacro.C (Read):
8237 * src/mathed/formula.C (Read): read also the \end_inset here!
8239 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
8241 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
8242 crush when saving formulae with unbalanced parenthesis.
8244 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
8246 * src/layout.C: Add new keyword "endlabelstring" to layout file
8248 * src/text.C (GetVisibleRow): Draw endlabel string.
8250 * lib/layouts/broadway.layout
8251 * lib/layouts/hollywood.layout: Added endlabel for the
8252 Parenthetical layout.
8254 * lib/layouts/heb-article.layout: Do not use slanted font shape
8255 for Theorem like environments.
8257 * src/buffer.C (makeLaTeXFile): Always add "american" to
8258 the UsedLanguages list if document language is RTL.
8260 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8262 * add addendum to README.OS2 and small patch (from SMiyata)
8264 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8266 * many files: correct the calls to ChangeExtension().
8268 * src/support/filetools.C (ChangeExtension): remove the no_path
8269 argument, which does not belong there. Use OnlyFileName() instead.
8271 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
8272 files when LaTeXing a non-nice latex file.
8274 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
8275 a chain of "if". Return false when deadkeys are not handled.
8277 * src/lyx_main.C (LyX): adapted the code for default bindings.
8279 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
8280 bindings for basic functionality (except deadkeys).
8281 (deadKeyBindings): new method. Performs the bindings of deadkeys.
8283 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
8284 several methods: handle override_x_deadkeys.
8286 * src/lyxrc.h: remove the "bindings" map, which did not make much
8287 sense anyway. New variable override_x_deadkeys, defaulting to "true".
8289 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8291 * src/lyxfont.C (stateText): use a saner method to determine
8292 whether the font is "default". Seems to fix the crash with DEC
8295 * src/Bullet.[Ch] (Bullet): remove const on parameters.
8297 2000-05-08 Juergen Vigna <jug@sad.it>
8299 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
8300 TabularLayoutMenu with mouse-button-3
8301 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
8303 * src/TabularLayout.C: added this file for having a Layout for
8306 2000-05-05 Juergen Vigna <jug@sad.it>
8308 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
8309 recalculating inset-widths.
8310 (TabularFeatures): activated this function so that I can change
8311 tabular-features via menu.
8313 * src/menus.C (ShowEditMenu): inserted support for insettabular so
8314 that I can test some functions with the Table menu.
8316 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8318 * src/lyxfont.C (stateText): guard against stupid c++libs.
8320 * src/tabular.C: add using std::vector
8321 some whitespace changes, + removed som autogenerated code.
8323 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
8325 2000-05-05 Juergen Vigna <jug@sad.it>
8327 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
8328 row, columns and cellstructures.
8330 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8332 * lib/lyxrc.example: remove obsolete entries.
8334 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
8335 reading of protected_separator for free_spacing.
8337 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8339 * src/text.C (draw): do not display an exclamation mark in the
8340 margin for margin notes. This is confusing, ugly and
8343 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
8344 AMS math' is checked.
8346 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
8347 name to see whether including the amsmath package is needed.
8349 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
8351 * src/paragraph.C (validate): Compute UsedLanguages correctly
8352 (don't insert the american language if it doesn't appear in the
8355 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
8356 The argument of \thanks{} command is considered moving argument
8358 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
8361 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
8363 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
8364 for appendix/minipage/depth. The lines can be now both in the footnote
8365 frame, and outside the frame.
8367 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
8370 2000-05-05 Juergen Vigna <jug@sad.it>
8372 * src/table.[Ch]: removed the inset and buffer stuff as this is now
8373 neede only in tabular.[Ch].
8375 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8377 * src/insets/insetspecialchar.C (Read): allow command == '~' for
8379 (Write): write '~' for PROTECTED_SEPARATOR
8381 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8383 * src/lyxparagraph.h: add a friend struct matchIT after the struct
8386 * src/mathed/formula.C (drawStr): rename size to siz.
8388 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
8389 possibly fix a bug by not changing the pflags = flags to piflags =
8392 2000-05-05 Juergen Vigna <jug@sad.it>
8394 * src/insets/insetbib.C: moved using directive
8396 * src/ImportNoweb.C: small fix for being able to compile (missing
8399 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8401 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
8402 to use clear, since we don't depend on this in the code. Add test
8405 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8407 * (various *.C files): add using std::foo directives to please dec
8410 * replace calls to string::clear() to string::erase() (Angus)
8412 * src/cheaders/cmath: modified to provide std::abs.
8414 2000-05-04 Juergen Vigna <jug@sad.it>
8416 * src/insets/insettext.C: Prepared all for inserting of multiple
8417 paragraphs. Still display stuff to do (alignment and other things),
8418 but I would like to use LyXText to do this when we cleaned out the
8419 table-support stuff.
8421 * src/insets/insettabular.C: Changed lot of stuff and added lots
8422 of functionality still a lot to do.
8424 * src/tabular.C: Various functions changed name and moved to be
8425 const functions. Added new Read and Write functions and changed
8426 lots of things so it works good with tabular-insets (also removed
8427 some stuff which is not needed anymore * hacks *).
8429 * src/lyxcursor.h: added operators == and != which just look if
8430 par and pos are (not) equal.
8432 * src/buffer.C (latexParagraphs): inserted this function to latex
8433 all paragraphs form par to endpar as then I can use this too for
8436 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
8437 so that I can call this to from text insets with their own cursor.
8439 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
8440 output off all paragraphs (because of the fix below)!
8442 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
8443 the very last paragraph (this could be also the last paragraph of an
8446 * src/texrow.h: added rows() call which returns the count-variable.
8448 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
8450 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
8452 * lib/configure.m4: better autodetection of DocBook tools.
8454 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8456 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
8458 * src/lyx_cb.C: add using std::reverse;
8460 * src/LaTeX.C (run): on error always run deleteFilesOnError before
8463 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
8464 selected files. Should fix repeated errors from generated files.
8466 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
8468 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
8470 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
8471 the spellchecker popup.
8473 * lib/lyxrc.example: Removed the \number_inset section
8475 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8477 * src/insets/figinset.C (various): Use IsFileReadable() to make
8478 sure that the file actually exist. Relying on ghostscripts errors
8479 is a bad idea since they can lead to X server crashes.
8481 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
8483 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
8486 * lib/lyxrc.example: smallish typo in description of
8487 \view_dvi_paper_option
8489 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8492 * src/lyxfunc.C: doImportHelper to factor out common code of the
8493 various import methods. New functions doImportASCIIasLines,
8494 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
8495 doImportLinuxDoc for the format specific parts.
8498 * buffer.C: Dispatch returns now a bool to indicate success
8501 * lyx_gui.C: Add getLyXView() for member access
8503 * lyx_main.C: Change logic for batch commands: First try
8504 Buffer::Dispatch (possibly without GUI), if that fails, use
8507 * lyx_main.C: Add support for --import command line switch.
8508 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
8509 Available Formats: Everything accepted by 'buffer-import <format>'
8511 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8513 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
8516 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
8517 documents will be reformatted upon reentry.
8519 2000-04-27 Juergen Vigna <jug@sad.it>
8521 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
8522 correctly only last pos this was a bug.
8524 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8526 * release of lyx-1.1.5pre1
8528 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8530 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
8532 * src/menus.C: revert the change of naming (Figure->Graphic...)
8533 from 2000-04-11. It was incomplete and bad.
8535 * src/LColor.[Ch]: add LColor::depthbar.
8536 * src/text.C (GetVisibleRow): use it.
8538 * README: update the languages list.
8540 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8542 * src/text.C (GetVisibleRow): show the depth of paragraphs using
8545 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8547 * README: remove sections that were just wrong.
8549 * src/text2.C (GetRowNearY): remove currentrow code
8551 * src/text.C (GetRow): remove currentrow code
8553 * src/screen.C (Update): rewritten a bit.
8554 (SmallUpdate): removed func
8556 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
8558 (FullRebreak): return bool
8559 (currentrow): remove var
8560 (currentrow_y): ditto
8562 * src/lyxscreen.h (Draw): change arg to unsigned long
8563 (FitCursor): return bool
8564 (FitManualCursor): ditto
8565 (Smallpdate): remove func
8566 (first): change to unsigned long
8567 (DrawOneRow): change second arg to long (from long &)
8568 (screen_refresh_y): remove var
8569 (scree_refresh_row): ditto
8571 * src/lyxrow.h: change baseline to usigned int from unsigned
8572 short, this brings some implicit/unsigned issues out in the open.
8574 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
8576 (Dispatch): don't call updateScrollbar after fitCursor. Use update
8577 instead of smallUpdate.
8579 * src/lyxcursor.h: change y to unsigned long
8581 * src/buffer.h: don't call updateScrollbar after fitcursor
8583 * src/buffer.C (parseSingleLyXformat2Token): move variables to
8584 where they are used. Removed "\\direction", this was not present
8585 in 1.1.4 and is already obsolete. Commented out some code that I
8586 believe to never be called.
8587 (runLiterate): don't call updateScrollbar after fitCursor
8589 (buildProgram): ditto
8592 * src/WorkArea.h (workWidth): change return val to unsigned
8595 (redraw): remove the button redraws
8596 (setScrollbarValue): change for scrollbar
8597 (getScrollbarValue): change for scrollbar
8598 (getScrollbarBounds): change for scrollbar
8600 * src/WorkArea.C (C_WorkArea_up_cb): removed func
8601 (C_WorkArea_down_cb): removed func
8602 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
8603 (resize): change for scrollbar
8604 (setScrollbar): ditto
8605 (setScrollbarBounds): ditto
8606 (setScrollbarIncrements): ditto
8607 (up_cb): removed func
8608 (down_cb): removed func
8609 (scroll_cb): change for scrollbar
8610 (work_area_handler): ditto
8612 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
8613 when FitCursor did something.
8614 (updateScrollbar): some unsigned changes
8615 (downCB): removed func
8616 (scrollUpOnePage): removed func
8617 (scrollDownOnePage): remvoed func
8618 (workAreaMotionNotify): don't call screen->FitCursor but use
8619 fitCursor instead. and bool return val
8620 (workAreaButtonPress): ditto
8621 (workAreaButtonRelease): some unsigned changes
8622 (checkInsetHit): ditto
8623 (workAreaExpose): ditto
8624 (update): parts rewritten, comments about the signed char arg added
8625 (smallUpdate): removed func
8626 (cursorPrevious): call needed updateScrollbar
8629 * src/BufferView2.C (allFloats): don't call updateScrollbar after
8632 * src/BufferView.[Ch] (upCB): removed func
8633 (downCB): removed func
8634 (smallUpdate): removed func
8636 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8638 * src/lyxtext.h src/text.C src/text2.C: removed support for the
8639 currentrow, currentrow_y optimization. This did not help a lot and
8640 if we want to do this kind of optimization we should rather use
8641 cursor.row instead of the currentrow.
8643 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
8644 buffer spacing and klyx spacing support.
8646 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8648 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
8651 2000-04-26 Juergen Vigna <jug@sad.it>
8653 * src/insets/figinset.C: fixes to Lars sstream changes!
8655 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
8657 * A lot of files: Added Ascii(ostream &) methods to all inset
8658 classes. Used when exporting to ASCII.
8660 * src/buffer.C (writeFileAscii,RoffAsciiTable)
8661 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
8664 * src/text2.C (ToggleFree): Disabled implicit word selection when
8665 there is a change in the language
8667 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
8668 no output was generated for end-of-sentence inset.
8670 * src/insets/lyxinset.h
8673 * src/paragraph.C: Removed the insetnumber code
8675 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
8677 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8679 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
8680 no_babel and no_epsfig completely from the file.
8681 (parseSingleLyXformat2Token): add handling for per-paragraph
8682 spacing as written by klyx.
8684 * src/insets/figinset.C: applied patch by Andre. Made it work with
8687 2000-04-20 Juergen Vigna <jug@sad.it>
8689 * src/insets/insettext.C (cutSelection):
8690 (copySelection): Fixed with selection from right to left.
8691 (draw): now the rows are not recalculated at every draw.
8692 (computeTextRows): for now reset the inset-owner here (this is
8693 important for an undo or copy where the inset-owner is not set
8696 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
8697 motion to the_locking_inset screen->first was forgotten, this was
8698 not important till we got multiline insets.
8700 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8702 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
8703 code seems to be alright (it is code changed by Dekel, and the
8704 intent is indeed that all macros should be defined \protect'ed)
8706 * NEWS: a bit of reorganisation of the new user-visible features.
8708 2000-04-19 Juergen Vigna <jug@sad.it>
8710 * src/insets/insettext.C (init): using a LyXCursor now for cursor
8711 position. Set the inset_owner of the used paragraph so that it knows
8712 that it is inside an inset. Fixed cursor handling with mouse and
8713 cursor keys. Fixed wrong timed inset redraws and lots of other changes
8714 and cleanups to make TextInsets work better.
8716 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
8717 Changed parameters of various functions and added LockInsetInInset().
8719 * src/insets/insettext.C:
8721 * src/insets/insetcollapsable.h:
8722 * src/insets/insetcollapsable.C:
8723 * src/insets/insetfoot.h:
8724 * src/insets/insetfoot.C:
8725 * src/insets/insetert.h:
8726 * src/insets/insetert.C: cleaned up the code so that it works now
8727 correctly with insettext.
8729 * src/insets/inset.C:
8730 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
8731 that insets in insets are supported right.
8734 * src/table.C: lots of changes for use with inset tabular (and cleanup)
8736 * src/paragraph.C: some small fixes
8738 * src/debug.h: inserted INSETS debug info
8740 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8741 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8743 * src/commandtags.h:
8744 * src/LyXAction.C: insert code for InsetTabular.
8746 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8747 not Button1MotionMask.
8748 (workAreaButtonRelease): send always a InsetButtonRelease event to
8750 (checkInsetHit): some setCursor fixes (always with insets).
8752 * src/BufferView2.C (lockInset): returns a bool now and extended for
8753 locking insets inside insets.
8754 (showLockedInsetCursor): it is important to have the cursor always
8755 before the locked inset.
8756 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8758 * src/BufferView.h: made lockInset return a bool.
8760 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8762 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8763 that is used also internally but can be called as public to have back
8764 a cursor pos which is not set internally.
8765 (SetCursorIntern): Changed to use above function.
8767 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8769 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8774 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8775 patches for things that should be in or should be changed.
8777 * src/* [insetfiles]: change "usigned char fragile" to bool
8778 fragile. There was only one point that could that be questioned
8779 and that is commented in formulamacro.C. Grep for "CHECK".
8781 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8782 (DeleteBuffer): take it out of CutAndPaste and make it static.
8784 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8786 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8787 output the spacing envir commands. Also the new commands used in
8788 the LaTeX output makes the result better.
8790 * src/Spacing.C (writeEnvirBegin): new method
8791 (writeEnvirEnd): new method
8793 2000-04-18 Juergen Vigna <jug@sad.it>
8795 * src/CutAndPaste.C: made textclass a static member of the class
8796 as otherwise it is not accesed right!!!
8798 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8800 * forms/layout_forms.fd
8801 * src/layout_forms.h
8802 * src/layout_forms.C (create_form_form_character)
8803 * src/lyx_cb.C (UserFreeFont)
8804 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8805 documents (in the layout->character popup).
8807 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8809 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8810 \spell_command was in fact not honored (from Kevin Atkinson).
8812 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8815 * src/lyx_gui.h: make lyxViews private (Angus)
8817 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8819 * src/mathed/math_write.C
8820 (MathMatrixInset::Write) Put \protect before \begin{array} and
8821 \end{array} if fragile
8822 (MathParInset::Write): Put \protect before \\ if fragile
8824 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8826 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8827 initialization if the LyXColorHandler must be done after the
8828 connections to the XServer has been established.
8830 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8831 get the background pixel from the lyxColorhandler so that the
8832 figures are rendered with the correct background color.
8833 (NextToken): removed functions.
8834 (GetPSSizes): use ifs >> string instead of NextToken.
8836 * src/Painter.[Ch]: the color cache moved out of this file.
8838 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8841 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8843 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8844 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
8846 * src/BufferView.C (enterView): new func
8847 (leaveView): new func
8849 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
8851 (leaveView): new func, undefines xterm cursor when approp.
8853 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
8854 (AllowInput): delete the Workarea cursor handling from this func.
8856 * src/Painter.C (underline): draw a slimer underline in most cases.
8858 * src/lyx_main.C (error_handler): use extern "C"
8860 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8862 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
8863 sent directly to me.
8865 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
8866 to the list by Dekel.
8868 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
8871 * src/bufferview_funcs.[Ch]: two new files, moved several of the
8872 methods from lyx_cb.here.
8874 * src/lyx_cb.C: in addition to the above; removed input_prohibited
8877 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8879 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
8880 instead of using current_view directly.
8882 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
8884 * src/LyXAction.C (init): add the paragraph-spacing command.
8886 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
8888 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
8890 * src/lyx_cb.C (CurrentState): output a string when the spacing is
8891 different from the documents.
8893 * src/text.C (SetHeightOfRow): take paragraph spacing into
8894 account, paragraph spacing takes precedence over buffer spacing
8895 (GetVisibleRow): ditto
8897 * src/paragraph.C (writeFile): output the spacing parameter too.
8898 (validate): set the correct features if spacing is used in the
8900 (Clear): set spacing to default
8901 (MakeSameLayout): spacing too
8902 (HasSameLayout): spacing too
8903 (SetLayout): spacing too
8904 (TeXOnePar): output the spacing commands
8906 * src/lyxparagraph.h: added a spacing variable for use with
8907 per-paragraph spacing.
8909 * src/Spacing.h: add a Default spacing and a method to check if
8910 the current spacing is default. also added an operator==
8912 * src/text2.C (DeleteEmptyParagraphMechanism): added a
8915 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8917 * src/lyxserver.C (callback): fix dispatch of functions
8919 * src/insets/insetlatexaccent.C (checkContents): turn bogus
8920 printf() into lyxerr call.
8922 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
8925 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
8926 "Table" to "Table Box", "Float" to "Floating Material"; deletes
8927 the "Float" from each of the subitems.
8928 (ShowHelpMenu): add entry for "FAQ" and "TOC".
8930 * src/support/DebugStream.h: add an #ifdef to work around a gcc
8931 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
8932 documented the change so that the workaround can be nuked later.
8934 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
8937 * src/lyxlex_pimpl.C (next): do not re-declare the default value
8939 * src/buffer.C (getLatexName): ditto
8940 (setReadonly): ditto
8942 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8944 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
8945 avoid some uses of current_view. Added also a bufferParams()
8946 method to get at this.
8948 * src/lyxtext.h: changed params->buffer and paramters->bparams.
8950 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8952 * src/lyxparagraph.[Ch]: removed
8953 operator<(LyXParagraph::InsetTable..., added a struct matchIT
8954 with operators used by lower_bound and
8955 upper_bound in InsetTable's
8956 Make struct InsetTable private again. Used matchpos.
8958 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
8960 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
8961 document, the language of existing text is changed (unless the
8962 document is multi-lingual)
8964 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
8966 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
8968 * A lot of files: A rewrite of the Right-to-Left support.
8970 2000-04-10 Juergen Vigna <jug@sad.it>
8972 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
8973 misplaced cursor when inset in inset is locked.
8975 * src/insets/insettext.C (LocalDispatch): small fix so that a
8976 BREAKLINE is not inserted if we don't permit it with autBreakRows.
8978 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
8979 footnote font should be decreased in size twice when displaying.
8981 * src/insets/insettext.C (GetDrawFont): inserted this function as
8982 the drawing-font may differ from the real paragraph font.
8984 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
8985 insets (inset in inset!).
8987 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
8988 function here because we don't want footnotes inside footnotes.
8990 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
8992 (init): now set the inset_owner in paragraph.C
8993 (LocalDispatch): added some resetPos() in the right position
8996 (pasteSelection): changed to use the new CutAndPaste-Class.
8998 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
8999 which tells if it is allowed to insert another inset inside this one.
9001 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
9002 SwitchLayoutsBetweenClasses.
9004 * src/text2.C (InsertInset): checking of the new paragraph-function
9006 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
9007 is not needed anymore here!
9010 (PasteSelection): redone (also with #ifdef) so that now this uses
9011 the CutAndPaste-Class.
9012 (SwitchLayoutsBetweenClasses): removed here and implemented in the
9015 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
9016 from/to text/insets.
9018 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
9019 so that the paragraph knows if it is inside an (text)-inset.
9020 (InsertFromMinibuffer): changed return-value to bool as now it
9021 may happen that an inset is not inserted in the paragraph.
9022 (InsertInsetAllowed): this checks if it is allowed to insert an
9023 inset in this paragraph.
9025 (BreakParagraphConservative):
9026 (BreakParagraph) : small change for the above change of the return
9027 value of InsertFromMinibuffer.
9029 * src/lyxparagraph.h: added inset_owner and the functions to handle
9030 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
9032 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9034 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
9035 functions from BufferView to BufferView::Pimpl to ease maintence.
9037 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
9038 correctly. Also use SetCursorIntern instead of SetCursor.
9040 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
9043 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9045 * src/WorkArea.C (belowMouse): manually implement below mouse.
9047 * src/*: Add "explicit" on several constructors, I added probably
9048 some unneeded ones. A couple of changes to code because of this.
9050 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
9051 implementation and private parts from the users of BufferView. Not
9054 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
9055 implementation and private parts from the users of LyXLex. Not
9058 * src/BufferView_pimpl.[Ch]: new files
9060 * src/lyxlex_pimpl.[Ch]: new files
9062 * src/LyXView.[Ch]: some inline functions move out-of-line
9064 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9066 * src/lyxparagraph.h: make struct InsetTable public.
9068 * src/support/lyxstring.h: change lyxstring::difference_type to be
9069 ptrdiff_t. Add std:: modifiers to streams.
9071 * src/font.C: include the <cctype> header, for islower() and
9074 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9076 * src/font.[Ch]: new files. Contains the metric functions for
9077 fonts, takes a LyXFont as parameter. Better separation of concepts.
9079 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
9080 changes because of this.
9082 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
9084 * src/*: compile with -Winline and move functions that don't
9087 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
9090 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9092 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
9093 (various files changed because of this)
9095 * src/Painter.C (text): fixed the drawing of smallcaps.
9097 * src/lyxfont.[Ch] (drawText): removed unused member func.
9100 * src/*.C: added needed "using" statements and "std::" qualifiers.
9102 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
9104 * src/*.h: removed all use of "using" from header files use
9105 qualifier std:: instead.
9107 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9109 * src/text.C (Backspace): some additional cleanups (we already
9110 know whether cursor.pos is 0 or not).
9112 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
9113 automake does not provide one).
9115 * src/bmtable.h: replace C++ comments with C comments.
9117 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
9119 * src/screen.C (ShowCursor): Change the shape of the cursor if
9120 the current language is not equal to the language of the document.
9121 (If the cursor change its shape unexpectedly, then you've found a bug)
9123 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
9126 * src/insets/insetnumber.[Ch]: New files.
9128 * src/LyXAction.C (init)
9129 * src/lyxfunc.C (dispatch): Add command number-inset-insert
9132 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
9134 * src/lyxparagraph.h
9135 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
9136 (the vector is kept sorted).
9138 * src/text.C (GetVisibleRow): Draw selection correctly when there
9139 is both LTR and RTL text.
9141 * src/paragraph.C (Clone): Use the assignment operator for cloning,
9142 which is much faster.
9144 * src/text.C (GetVisibleRow and other): Do not draw the last space
9145 in a row if the direction of the last letter is not equal to the
9146 direction of the paragraph.
9148 * src/lyxfont.C (latexWriteStartChanges):
9149 Check that font language is not equal to basefont language.
9150 (latexWriteEndChanges): ditto
9152 * src/lyx_cb.C (StyleReset): Don't change the language while using
9153 the font-default command.
9155 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
9156 empty paragraph before a footnote.
9158 * src/insets/insetcommand.C (draw): Increase x correctly.
9160 * src/screen.C (ShowCursor): Change cursor shape if
9161 current language != document language.
9163 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
9165 2000-03-31 Juergen Vigna <jug@sad.it>
9167 * src/paragraph.C (GetInset): commented out text[pos] = ' '
9168 (Clone): changed mode how the paragraph-data is copied to the
9169 new clone-paragraph.
9171 * src/lyxfunc.C (Dispatch): fixed small problem when calling
9172 GetInset(pos) with no inset anymore there (in inset UNDO)
9174 * src/insets/insetcommand.C (draw): small fix as here x is
9175 incremented not as much as width() returns (2 before, 2 behind = 4)
9177 2000-03-30 Juergen Vigna <jug@sad.it>
9179 * src/insets/insettext.C (InsetText): small fix in initialize
9180 widthOffset (should not be done in the init() function)
9182 2000-03-29 Amir Karger <karger@lyx.org>
9184 * lib/examples/it_ItemizeBullets.lyx: translation by
9187 * Implemented \textasciitilde and fixed a tiny bug in reLyX
9189 2000-03-29 Juergen Vigna <jug@sad.it>
9191 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
9193 * src/insets/insetfoot.C (Clone): small change as for the below
9194 new init function in the text-inset
9196 * src/insets/insettext.C (init): new function as I've seen that
9197 clone did not copy the Paragraph-Data!
9198 (LocalDispatch): Added code so that now we have some sort of Undo
9199 functionality (well actually we HAVE Undo ;)
9201 * src/text.C (Backspace): Small fix for the a | a Backspace problem
9203 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
9205 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
9208 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9210 * src/main.C: added a runtime check that verifies that the xforms
9211 header used when building LyX and the library used when running
9212 LyX match. Exit with a message if they don't match. This is a
9213 version number check only.
9215 * src/buffer.C (save): Don't allocate memory on the heap for
9216 struct utimbuf times.
9218 * *: some using changes, use iosfwd instead of the real headers.
9220 * src/lyxfont.C use char const * instead of string for the static
9221 strings. Rewrite some functions to use sstream.
9223 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9225 * src/text.C (Backspace): hopefully fix the dreaded backaspace
9228 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9230 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
9231 of Geodesy (from Martin Vermeer)
9233 * lib/layouts/svjour.inc: include file for the Springer svjour
9234 class. It can be used to support journals other than JoG.
9236 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
9237 Miskiewicz <misiek@pld.org.pl>)
9238 * lib/reLyX/Makefile.am: ditto.
9240 2000-03-27 Juergen Vigna <jug@sad.it>
9242 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
9243 also some modifications with operations on selected text.
9245 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
9246 problems with clicking on insets (last famous words ;)
9248 * src/insets/insetcommand.C (draw):
9249 (width): Changed to have a bit of space before and after the inset so
9250 that the blinking cursor can be seen (otherwise it was hidden)
9252 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9254 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
9255 would not be added to the link list when an installed gettext (not
9256 part of libc) is found.
9258 2000-03-24 Juergen Vigna <jug@sad.it>
9260 * src/insets/insetcollapsable.C (Edit):
9261 * src/mathed/formula.C (InsetButtonRelease):
9262 (InsetButtonPress): fixed for new handling of ButtonPress/Release
9265 * src/BufferView.C (workAreaButtonPress):
9266 (workAreaButtonRelease):
9267 (checkInsetHit): Finally fixed the clicking on insets be handled
9270 * src/insets/insetert.C (Edit): inserted this call so that ERT
9271 insets work always with LaTeX-font
9273 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9275 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
9276 caused lyx to startup with no GUI in place, causing in a crash
9277 upon startup when called with arguments.
9279 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9281 * src/FontLoader.C: better initialization of dummyXFontStruct.
9283 2000-03-20 José Abílio Matos <jamatos@lyx.org>
9285 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
9286 for linuxdoc and docbook import and export format options.
9288 * lib/lyxrc.example Example of default values for the previous flags.
9290 * src/lyx_cb.C Use those flags instead of the hardwired values for
9291 linuxdoc and docbook export.
9293 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
9296 * src/menus.C Added menus entries for the new import/exports formats.
9298 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9300 * src/lyxrc.*: Added support for running without Gui
9303 * src/FontLoader.C: sensible defaults if no fonts are needed
9305 * src/lyx_cb.C: New function ShowMessage (writes either to the
9306 minibuffer or cout in case of no gui
9307 New function AskOverwrite for common stuff
9308 Consequently various changes to call these functions
9310 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
9311 wild guess at sensible screen resolution when having no gui
9313 * src/lyxfont.C: no gui, no fonts... set some defaults
9315 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9317 * src/LColor.C: made the command inset background a bit lighter.
9319 2000-03-20 Hartmut Goebel <goebel@noris.net>
9321 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
9322 stdstruct.inc. Koma-Script added some title elements which
9323 otherwise have been listed below "bibliography". This split allows
9324 adding title elements to where they belong.
9326 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
9327 define the additional title elements and then include
9330 * many other layout files: changed to include stdtitle.inc just
9331 before stdstruct.inc.
9333 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
9335 * src/buffer.C: (save) Added the option to store all backup files
9336 in a single directory
9338 * src/lyxrc.[Ch]: Added variable \backupdir_path
9340 * lib/lyxrc.example: Added descriptions of recently added variables
9342 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
9343 bibtex inset, not closing the bibtex popup when deleting the inset)
9345 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9347 * src/lyx_cb.C: add a couple using directives.
9349 2000-03-17 José Abílio Matos <jamatos@lyx.org>
9350 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
9351 import based on the filename.
9353 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
9354 file would be imported at start, if the filename where of a sgml file.
9356 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
9358 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
9360 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
9361 * src/lyxfont.h Replaced the member variable bits.direction by the
9362 member variable lang. Made many changes in other files.
9363 This allows having a multi-lingual document
9365 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
9366 that change the current language to <l>.
9367 Removed the command "font-rtl"
9369 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
9370 format for Hebrew documents)
9372 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
9373 When auto_mathmode is "true", pressing a digit key in normal mode
9374 will cause entering into mathmode.
9375 If auto_mathmode is "rtl" then this behavior will be active only
9376 when writing right-to-left text.
9378 * src/text2.C (InsertStringA) The string is inserted using the
9381 * src/paragraph.C (GetEndLabel) Gives a correct result for
9382 footnote paragraphs.
9384 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
9386 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9388 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
9389 front of PasteParagraph. Never insert a ' '. This should at least
9390 fix some cause for the segfaults that we have been experiencing,
9391 it also fixes backspace behaviour slightly. (Phu!)
9393 * src/support/lstrings.C (compare_no_case): some change to make it
9394 compile with gcc 2.95.2 and stdlibc++-v3
9396 * src/text2.C (MeltFootnoteEnvironment): change type o
9397 first_footnote_par_is_not_empty to bool.
9399 * src/lyxparagraph.h: make text private. Changes in other files
9401 (fitToSize): new function
9402 (setContentsFromPar): new function
9403 (clearContents): new function
9404 (SetChar): new function
9406 * src/paragraph.C (readSimpleWholeFile): deleted.
9408 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
9409 the file, just use a simple string instead. Also read the file in
9410 a more maintainable manner.
9412 * src/text2.C (InsertStringA): deleted.
9413 (InsertStringB): deleted.
9415 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9417 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
9418 RedoParagraphs from the doublespace handling part, just set status
9419 to NEED_MORE_REFRESH. Also don't update cursor position (should be
9420 done, but perhaps not like this.)
9422 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9424 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
9425 character when inserting an inset.
9427 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9429 * src/bufferparams.C (readLanguage): now takes "default" into
9432 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
9433 also initialize the toplevel_keymap with the default bindings from
9436 * src/buffer.C (Buffer): remove lyxrc from the parameters.
9438 * all files using lyxrc: have lyxrc as a real variable and not a
9439 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
9442 * src/lyxrc.C: remove double call to defaultKeyBindings
9444 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
9445 toolbar defauls using lyxlex. Remove enums, structs, functions
9448 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
9449 toolbar defaults. Also store default keybindings in a map.
9451 * src/ToolbarDefaults.[Ch]: New file. This class is used for
9452 storing the toolbar defaults without any xforms dependencies.
9454 * src/insets/figinset.C: patch posted to list by Andre Poenitz
9455 applied. Changed to use iterators.
9457 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9459 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
9460 systems that don't have LINGUAS set to begin with.
9462 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9464 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
9465 the list by Dekel Tsur.
9467 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9469 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
9470 * src/insets/form_graphics.C: ditto.
9472 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
9474 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9476 * src/bufferparams.C (readLanguage): use the new language map
9478 * src/intl.C (InitKeyMapper): use the new language map
9480 * src/lyx_gui.C (create_forms): use the new language map
9482 * src/language.[Ch]: New files. Used for holding the information
9483 about each language. Now! Use this new language map enhance it and
9484 make it really usable for our needs.
9486 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
9488 * screen.C (ShowCursor): Removed duplicate code.
9489 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
9490 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
9492 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
9495 * src/text.C Added TransformChar method. Used for rendering Arabic
9496 text correctly (change the glyphs of the letter according to the
9497 position in the word)
9502 * src/lyxrc.C Added lyxrc command {language_command_begin,
9503 language_command_end,language_command_ltr,language_command_rtl,
9504 language_package} which allows the use of either arabtex or Omega
9507 * src/lyx_gui.C (init)
9509 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
9510 to use encoding for menu fonts which is different than the encoding
9513 * src/buffer.C (makeLaTeXFile): If params.language = "default",
9514 do not load the babel package.
9515 To write an English document with Hebrew/Arabic, change the document
9516 language to "english".
9518 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
9519 (alphaCounter): changed to return char
9520 (loweralphaCounter, hebrewCounter, romanCounter): New functions
9522 * lib/lyxrc.example Added examples for Hebrew/Arabic
9525 * src/layout.C Added layout command endlabeltype
9527 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
9529 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
9531 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9533 * src/mathed/math_delim.C (search_deco): return a
9534 math_deco_struct* instead of index.
9536 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9538 * All files with a USE_OSTREAM_ONLY within: removed all code that
9539 was unused when USE_OSTREAM_ONLY is defined.
9541 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
9542 of any less. Removed header and using.
9544 * src/text.C (GetVisibleRow): draw the string "Page Break
9545 (top/bottom)" on screen when drawing a pagebreak line.
9547 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9549 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
9551 * src/mathed/math_macro.C (draw): do some cast magic.
9554 * src/mathed/math_defs.h: change byte* argument to byte const*.
9556 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
9558 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
9559 know it is right to return InsetFoot* too, but cxx does not like
9562 * src/insets/insetcollapsable.[Ch] (Clone): make const.
9564 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
9566 * src/mathed/math_delim.C: change == to proper assignment.
9568 2000-03-09 Juergen Vigna <jug@sad.it>
9570 * src/insets/insettext.C (setPos): fixed various cursor positioning
9571 problems (via mouse and cursor-keys)
9572 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
9573 inset (still a small display problem but it works ;)
9575 * src/insets/insetcollapsable.C (draw): added button_top_y and
9576 button_bottom_y to have correct values for clicking on the inset.
9578 * src/support/lyxalgo.h: commented out 'using std::less'
9580 2000-03-08 Juergen Vigna <jug@sad.it>
9582 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
9583 Button-Release event closes as it is alos the Release-Event
9586 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
9588 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9590 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
9591 can add multiple spaces in Scrap (literate programming) styles...
9592 which, by the way, is how I got hooked on LyX to begin with.
9594 * src/mathed/formula.C (Write): Added dummy variable to an
9595 inset::Latex() call.
9596 (Latex): Add free_spacing boolean to inset::Latex()
9598 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
9600 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
9601 virtual function to include the free_spacing boolean from
9602 the containing paragraph's style.
9604 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
9605 Added free_spacing boolean arg to match inset.h
9607 * src/insets/insettext.C, src/insets/insettext.h (Latex):
9608 Added free_spacing boolean arg to match inset.h
9610 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
9611 Added free_spacing boolean and made sure that if in a free_spacing
9612 paragraph, that we output normal space if there is a protected space.
9614 * src/insets/insetref.C, src/insets/insetref.h (Latex):
9615 Added free_spacing boolean arg to match inset.h
9617 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
9618 Added free_spacing boolean arg to match inset.h
9620 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
9621 Added free_spacing boolean arg to match inset.h
9623 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
9624 Added free_spacing boolean arg to match inset.h
9626 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
9627 Added free_spacing boolean arg to match inset.h
9629 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
9630 free_spacing boolean arg to match inset.h
9632 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
9633 Added free_spacing boolean arg to match inset.h
9635 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
9636 Added free_spacing boolean arg to match inset.h
9638 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
9639 Added free_spacing boolean arg to match inset.h
9641 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
9642 Added free_spacing boolean arg to match inset.h
9644 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
9645 Added free_spacing boolean arg to match inset.h
9647 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
9648 free_spacing boolean arg to match inset.h
9650 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
9651 free_spacing boolean arg to match inset.h
9653 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
9654 ignore free_spacing paragraphs. The user's spaces are left
9657 * src/text.C (InsertChar): Fixed the free_spacing layout
9658 attribute behavior. Now, if free_spacing is set, you can
9659 add multiple spaces in a paragraph with impunity (and they
9660 get output verbatim).
9661 (SelectSelectedWord): Added dummy argument to inset::Latex()
9664 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
9667 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
9668 paragraph layouts now only input a simple space instead.
9669 Special character insets don't make any sense in free-spacing
9672 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
9673 hard-spaces in the *input* file to simple spaces if the layout
9674 is free-spacing. This converts old files which had to have
9675 hard-spaces in free-spacing layouts where a simple space was
9677 (writeFileAscii): Added free_spacing check to pass to the newly
9678 reworked inset::Latex(...) methods. The inset::Latex() code
9679 ensures that hard-spaces in free-spacing paragraphs get output
9680 as spaces (rather than "~").
9682 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9684 * src/mathed/math_delim.C (draw): draw the empty placeholder
9685 delims with a onoffdash line.
9686 (struct math_deco_compare): struct that holds the "functors" used
9687 for the sort and the binary search in math_deco_table.
9688 (class init_deco_table): class used for initial sort of the
9690 (search_deco): use lower_bound to do a binary search in the
9693 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9695 * src/lyxrc.C: a small secret thingie...
9697 * src/lyxlex.C (printTable): changed to take a ostream as paramter
9698 and to not flush the stream as often as it used to.
9700 * src/support/lyxalgo.h: new file
9701 (sorted): template function used for checking if a sequence is
9702 sorted or not. Two versions with and without user supplied
9703 compare. Uses same compare as std::sort.
9705 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
9706 it and give warning on lyxerr.
9708 (struct compare_tags): struct with function operators used for
9709 checking if sorted, sorting and lower_bound.
9710 (search_kw): use lower_bound instead of manually implemented
9713 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9715 * src/insets/insetcollapsable.h: fix Clone() declaration.
9716 * src/insets/insetfoot.h: ditto.
9718 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
9720 2000-03-08 Juergen Vigna <jug@sad.it>
9722 * src/insets/lyxinset.h: added owner call which tells us if
9723 this inset is inside another inset. Changed also the return-type
9724 of Editable to an enum so it tells clearer what the return-value is.
9726 * src/insets/insettext.C (computeTextRows): fixed computing of
9727 textinsets which split automatically on more rows.
9729 * src/insets/insetert.[Ch]: changed this to be of BaseType
9732 * src/insets/insetfoot.[Ch]: added footnote inset
9734 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
9735 collapsable insets (like footnote, ert, ...)
9737 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9739 * src/lyxdraw.h: remvoe file
9741 * src/lyxdraw.C: remove file
9743 * src/insets/insettext.C: added <algorithm>.
9745 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9747 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9748 (matrix_cb): case MM_OK use string stream
9750 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9753 * src/mathed/math_macro.C (draw): use string stream
9754 (Metrics): use string stream
9756 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9757 directly to the ostream.
9759 * src/vspace.C (asString): use string stream.
9760 (asString): use string stream
9761 (asLatexString): use string stream
9763 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9764 setting Spacing::Other.
9766 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9767 sprintf when creating the stretch vale.
9769 * src/text2.C (alphaCounter): changed to return a string and to
9770 not use a static variable internally. Also fixed a one-off bug.
9771 (SetCounter): changed the drawing of the labels to use string
9772 streams instead of sprintf.
9774 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9775 manipulator to use a scheme that does not require library support.
9776 This is also the way it is done in the new GNU libstdc++. Should
9777 work with DEC cxx now.
9779 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9781 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9782 end. This fixes a bug.
9784 * src/mathed (all files concerned with file writing): apply the
9785 USE_OSTREAM_ONLY changes to mathed too.
9787 * src/support/DebugStream.h: make the constructor explicit.
9789 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9790 count and ostream squashed.
9792 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9794 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9796 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9797 ostringstream uses STL strings, and we might not.
9799 * src/insets/insetspecialchar.C: add using directive.
9800 * src/insets/insettext.C: ditto.
9802 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9804 * lib/layouts/seminar.layout: feeble attempt at a layout for
9805 seminar.cls, far from completet and could really use some looking
9806 at from people used to write layout files.
9808 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9809 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9810 a lot nicer and works nicely with ostreams.
9812 * src/mathed/formula.C (draw): a slightly different solution that
9813 the one posted to the list, but I think this one works too. (font
9814 size wrong in headers.)
9816 * src/insets/insettext.C (computeTextRows): some fiddling on
9817 Jürgens turf, added some comments that he should read.
9819 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9820 used and it gave compiler warnings.
9821 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9824 * src/lyx_gui.C (create_forms): do the right thing when
9825 show_banner is true/false.
9827 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9828 show_banner is false.
9830 * most file writing files: Now use iostreams to do almost all of
9831 the writing. Also instead of passing string &, we now use
9832 stringstreams. mathed output is still not adapted to iostreams.
9833 This change can be turned off by commenting out all the occurences
9834 of the "#define USE_OSTREAM_ONLY 1" lines.
9836 * src/WorkArea.C (createPixmap): don't output debug messages.
9837 (WorkArea): don't output debug messages.
9839 * lib/lyxrc.example: added a comment about the new variable
9842 * development/Code_rules/Rules: Added some more commente about how
9843 to build class interfaces and on how better encapsulation can be
9846 2000-03-03 Juergen Vigna <jug@sad.it>
9848 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
9849 automatically with the width of the LyX-Window
9851 * src/insets/insettext.C (computeTextRows): fixed update bug in
9852 displaying text-insets (scrollvalues where not initialized!)
9854 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9856 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
9857 id in the check of the result from lower_bound is not enough since
9858 lower_bound can return last too, and then res->id will not be a
9861 * all insets and some code that use them: I have conditionalized
9862 removed the Latex(string & out, ...) this means that only the
9863 Latex(ostream &, ...) will be used. This is a work in progress to
9864 move towards using streams for all output of files.
9866 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
9869 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9871 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
9872 routine (this fixes bug where greek letters were surrounded by too
9875 * src/support/filetools.C (findtexfile): change a bit the search
9876 algorithm, to fix bug introduced in 1.1.4. Note that --format is
9877 no longer passed to kpsewhich, we may have to change that later.
9879 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
9880 warning options to avoid problems with X header files (from Angus
9882 * acinclude.m4: regenerated.
9884 2000-03-02 Juergen Vigna <jug@sad.it>
9886 * src/insets/insettext.C (WriteParagraphData): Using the
9887 par->writeFile() function for writing paragraph-data.
9888 (Read): Using buffer->parseSingleLyXformat2Token()-function
9889 for parsing paragraph data!
9891 * src/buffer.C (readLyXformat2): removed all parse data and using
9892 the new parseSingleLyXformat2Token()-function.
9893 (parseSingleLyXformat2Token): added this function to parse (read)
9894 lyx-file-format (this is called also from text-insets now!)
9896 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9898 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
9901 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
9902 directly instead of going through a func. One very bad thing: a
9903 static LyXFindReplace, but I don't know where to place it.
9905 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
9906 string instead of char[]. Also changed to static.
9907 (GetSelectionOrWordAtCursor): changed to static inline
9908 (SetSelectionOverLenChars): ditto.
9910 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
9911 current_view and global variables. both classes has changed names
9912 and LyXFindReplace is not inherited from SearchForm.
9914 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
9915 fl_form_search form.
9917 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
9919 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9921 * lib/bind/*.bind: make sure 'buffer-previous' function is not
9922 bound (from Kayvan).
9924 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
9926 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
9928 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9930 * some things that I should comment but the local pub says head to
9933 * comment out all code that belongs to the Roff code for Ascii
9934 export of tables. (this is unused)
9936 * src/LyXView.C: use correct type for global variable
9937 current_layout. (LyXTextClass::size_type)
9939 * some code to get the new insetgraphics closer to working I'd be
9940 grateful for any help.
9942 * src/BufferView2.C (insertInset): use the return type of
9943 NumberOfLayout properly. (also changes in other files)
9945 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
9946 this as a test. I want to know what breaks because of this.
9948 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
9950 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9952 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
9953 to use a \makebox in the label, this allows proper justification
9954 with out using protected spaces or multiple hfills. Now it is
9955 "label" for left justified, "\hfill label\hfill" for center, and
9956 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
9957 should be changed accordingly.
9959 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9961 * src/lyxtext.h: change SetLayout() to take a
9962 LyXTextClass::size_type instead of a char (when there is more than
9963 127 layouts in a class); also change type of copylayouttype.
9964 * src/text2.C (SetLayout): ditto.
9965 * src/LyXView.C (updateLayoutChoice): ditto.
9967 * src/LaTeX.C (scanLogFile): errors where the line number was not
9968 given just after the '!'-line were ignored (from Dekel Tsur).
9970 * lib/lyxrc.example: fix description of \date_insert_format
9972 * lib/layouts/llncs.layout: new layout, contributed by Martin
9975 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9977 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
9978 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
9979 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
9980 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
9981 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
9982 paragraph.C, text.C, text2.C)
9984 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9986 * src/insets/insettext.C (LocalDispatch): remove extra break
9989 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
9990 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
9992 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
9993 * src/insets/insettext.[Ch] (GetCursorPos): ditto
9995 * src/insets/insetbib.h: move InsetBibkey::Holder and
9996 InsetCitation::Holder in public space.
9998 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10000 * src/insets/insettext.h: small change to get the new files from
10001 Juergen to compile (use "string", not "class string").
10003 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
10004 const & as parameter to LocalDispatch, use LyXFont const & as
10005 paramter to some other func. This also had impacto on lyxinsets.h
10006 and the two mathed insets.
10008 2000-02-24 Juergen Vigna <jug@sad.it>
10011 * src/commandtags.h:
10013 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
10017 * src/BufferView2.C: added/updated code for various inset-functions
10019 * src/insets/insetert.[Ch]: added implementation of InsetERT
10021 * src/insets/insettext.[Ch]: added implementation of InsetText
10023 * src/insets/inset.C (Edit): added "unsigned int button" parameter
10024 (draw): added preliminary code for inset scrolling not finshed yet
10026 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
10027 as it is in lyxfunc.C now
10029 * src/insets/lyxinset.h: Added functions for text-insets
10031 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10033 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
10034 BufferView and reimplement the list as a queue put inside its own
10037 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
10039 * several files: use the new interface to the "updateinsetlist"
10041 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
10043 (work_area_handler): call BufferView::trippleClick on trippleclick.
10045 * src/BufferView.C (doubleClick): new function, selects word on
10047 (trippleClick): new function, selects line on trippleclick.
10049 2000-02-22 Allan Rae <rae@lyx.org>
10051 * lib/bind/xemacs.bind: buffer-previous not supported
10053 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10055 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
10058 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10060 * src/bufferlist.C: get rid of current_view from this file
10062 * src/spellchecker.C: get rid of current_view from this file
10064 * src/vspace.C: get rid of current_view from this file
10065 (inPixels): added BufferView parameter for this func
10066 (asLatexCommand): added a BufferParams for this func
10068 * src/text.C src/text2.C: get rid of current_view from these
10071 * src/lyxfont.C (getFontDirection): move this function here from
10074 * src/bufferparams.C (getDocumentDirection): move this function
10077 * src/paragraph.C (getParDirection): move this function here from
10079 (getLetterDirection): ditto
10081 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
10083 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
10084 resize due to wrong pixmap beeing used. Also took the opurtunity
10085 to make the LyXScreen stateless on regard to WorkArea and some
10086 general cleanup in the same files.
10088 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10090 * src/Makefile.am: add missing direction.h
10092 * src/PainterBase.h: made the width functions const.
10094 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
10097 * src/insets/insetcommand.C (draw): draw Editable as buttons.
10099 * src/insets/insetlatexaccent.C (draw): make the accents draw
10100 better, at present this will only work well with iso8859-1.
10102 * several files: remove the old drawing code, now we use the new
10105 * several files: remove support for mono_video, reverse_video and
10108 2000-02-17 Juergen Vigna <jug@sad.it>
10110 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
10111 int ** as we have to return the pointer, otherwise we have only
10112 NULL pointers in the returning function.
10114 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10116 * src/LaTeX.C (operator()): quote file name when running latex.
10118 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10120 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
10121 (bubble tip), this removes our special handling of this.
10123 * Remove all code that is unused now that we have the new
10124 workarea. (Code that are not active when NEW_WA is defined.)
10126 * Make the uses of XSync not conditionalized on define USE_XSYNC.
10128 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10130 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
10131 nonexisting layout; correctly redirect obsoleted layouts.
10133 * lib/lyxrc.example: document \view_dvi_paper_option
10135 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
10138 * src/lyx_cb.C (RunScript): handle $$FName for command names.
10139 (PreviewDVI): handle the view_dvi_paper_option variable.
10140 [Both from Roland Krause]
10142 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10144 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
10145 char const *, int, LyXFont)
10146 (text(int, int, string, LyXFont)): ditto
10148 * src/text.C (InsertCharInTable): attempt to fix the double-space
10149 feature in tables too.
10150 (BackspaceInTable): ditto.
10151 (GetVisibleRow): make bottom pagebreak line be a onoff line.
10153 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10155 * src/text2.C (owner): only complain if owner_ is set and bv != 0
10157 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
10158 newly found text in textcache to this.
10159 (buffer): set the owner of the text put into the textcache to 0
10161 * src/insets/figinset.C (draw): fixed the drawing of figures with
10164 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
10165 drawing of mathframe, hfills, protected space, table lines. I have
10166 now no outstanding drawing problems with the new Painter code.
10168 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10170 * src/PainterBase.C (ellipse, circle): do not specify the default
10173 * src/LColor.h: add using directive.
10175 * src/Painter.[Ch]: change return type of methods from Painter& to
10176 PainterBase&. Add a using directive.
10178 * src/WorkArea.C: wrap xforms callbacks in C functions
10181 * lib/layouts/foils.layout: font fix and simplifications from Carl
10184 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10186 * a lot of files: The Painter, LColor and WorkArea from the old
10187 devel branch has been ported to lyx-devel. Some new files and a
10188 lot of #ifdeffed code. The new workarea is enabled by default, but
10189 if you want to test the new Painter and LColor you have to compile
10190 with USE_PAINTER defined (do this in config.h f.ex.) There are
10191 still some rought edges, and I'd like some help to clear those
10192 out. It looks stable (loads and displays the Userguide very well).
10195 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10197 * src/buffer.C (pop_tag): revert to the previous implementation
10198 (use a global variable for both loops).
10200 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
10202 * src/lyxrc.C (LyXRC): change slightly default date format.
10204 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
10205 there is an English text with a footnote that starts with a Hebrew
10206 paragraph, or vice versa.
10207 (TeXFootnote): ditto.
10209 * src/text.C (LeftMargin): allow for negative values for
10210 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
10213 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
10214 for input encoding (cyrillic)
10216 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10218 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
10221 * src/toolbar.C (set): ditto
10222 * src/insets/insetbib.C (create_form_citation_form): ditto
10224 * lib/CREDITS: added Dekel Tsur.
10226 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
10227 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
10228 hebrew supports files from Dekel Tsur.
10230 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
10231 <tzafrir@technion.ac.il>
10233 * src/lyxrc.C: put \date_insert_format at the right place.
10235 * src/buffer.C (makeLaTeXFile): fix the handling of
10236 BufferParams::sides when writing out latex files.
10238 * src/BufferView2.C: add a "using" directive.
10240 * src/support/lyxsum.C (sum): when we use lyxstring,
10241 ostringstream::str needs an additional .c_str().
10243 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10245 * src/support/filetools.C (ChangeExtension): patch from Etienne
10248 * src/TextCache.C (show): remove const_cast and make second
10249 parameter non-const LyXText *.
10251 * src/TextCache.h: use non const LyXText in show.
10253 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
10256 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10258 * src/support/lyxsum.C: rework to be more flexible.
10260 * several places: don't check if a pointer is 0 if you are going
10263 * src/text.C: remove some dead code.
10265 * src/insets/figinset.C: remove some dead code
10267 * src/buffer.C: move the BufferView funcs to BufferView2.C
10268 remove all support for insetlatexdel
10269 remove support for oldpapersize stuff
10270 made some member funcs const
10272 * src/kbmap.C: use a std::list to store the bindings in.
10274 * src/BufferView2.C: new file
10276 * src/kbsequence.[Ch]: new files
10278 * src/LyXAction.C + others: remove all trace of buffer-previous
10280 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
10281 only have one copy in the binary of this table.
10283 * hebrew patch: moved some functions from LyXText to more
10284 appropriate places. (LyXParagraph, BufferParams, LyXFont)
10286 * several files: remove support for XForms older than 0.88
10287 whitespace changes.
10288 remove some #if 0 #endif code
10290 * src/TextCache.[Ch]: new file. Holds the textcache.
10292 * src/BufferView.C: changes to use the new TextCache interface.
10293 (waitForX): remove the now unused code.
10295 * src/BackStack.h: remove some commented code
10297 * lib/bind/emacs.bind: remove binding for buffer-previous
10299 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10301 * applied the hebrew patch.
10303 * src/lyxrow.h: make sure that all Row variables are initialized.
10305 * src/text2.C (TextHandleUndo): comment out a delete, this might
10306 introduce a memory leak, but should also help us to not try to
10307 read freed memory. We need to look at this one.
10309 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
10310 (LyXParagraph): initalize footnotekind.
10312 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
10313 forgot this when applying the patch. Please heed the warnings.
10315 * src/BufferView.C (buffer): a fix for the buffer-reload problem
10316 (aka. reformat problem)
10318 * src/bufferlist.C (exists): made const, and use const_iterator
10319 (isLoaded): new func.
10320 (release): use std::find to find the correct buffer.
10322 * src/bufferlist.h: made getState a const func.
10323 made empty a const func.
10324 made exists a const func.
10327 2000-02-01 Juergen Vigna <jug@sad.it>
10329 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
10331 * po/it.po: updated a bit the italian po file and also changed the
10332 'file nuovo' for newfile to 'filenuovo' without a space, this did
10335 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
10336 for the new insert_date command.
10338 * src/lyxfunc.C (Dispatch): added support for a insert_date function
10339 from jdblair, to insert a date into the current text conforming to
10340 a strftime format (for now only considering the locale-set and not
10341 the document-language).
10343 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10345 * src/lyxfont.C (textWidth): hopefully better fix for the Array
10346 Bounds Read error seen by purify. The problem was that islower is
10347 a macros which takes an unsigned char and uses it as an index for
10348 in array of characters properties (and is thus subject to the
10352 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
10353 correctly the paper sides radio buttons.
10354 (UpdateDocumentButtons): ditto.
10356 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10358 * src/kbmap.C (getsym + others): change to return unsigned int,
10359 returning a long can give problems on 64 bit systems. (I assume
10360 that int is 32bit on 64bit systems)
10362 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10364 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
10365 LyXLookupString to be zero-terminated. Really fixes problems seen
10366 by purify, I think.
10368 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10370 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
10371 write a (char*)0 to the lyxerr stream.
10373 * src/lastfiles.C: move algorithm before the using statemets.
10375 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10377 * src/lastfiles.C: move using directives in global scope (egcs 1.x
10378 complains otherwise).
10379 * src/table.C: ditto
10381 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
10384 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
10385 that I removed earlier... It is really needed.
10387 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
10389 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10391 * INSTALL: update xforms home page URL.
10393 * lib/configure.m4: fix a bug with unreadable layout files.
10395 * src/table.C (calculate_width_of_column): add "using std::max"
10398 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10400 * several files: marked several lines with "DEL LINE", this is
10401 lines that can be deleted without changing anything.
10402 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
10403 checks this anyway */
10406 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
10408 * src/DepTable.C (update): add a "+" at the end when the checksum
10409 is different. (debugging string only)
10411 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
10412 the next inset to not be displayed. This should also fix the list
10413 of labels in the "Insert Crossreference" dialog.
10415 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10417 * src/support/LSubstring.C (LSubstring): set pos to string::npos
10418 when regex was not found.
10420 * src/support/lstrings.C (lowercase): use handcoded transform always.
10423 * src/text.C (Delete): fixed the crash. cursor.par->prev and
10424 old_cursor.par->prev could be 0.
10426 * several files: changed post inc/dec to pre inc/dec
10428 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
10429 write the lastfiles to file.
10431 * src/BufferView.C (buffer): only show TextCache info when debugging
10433 (resizeCurrentBuffer): ditto
10434 (workAreaExpose): ditto
10436 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
10438 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
10440 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
10441 a bit better by removing the special case for \i and \j.
10443 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10445 * src/lyx_main.C (easyParse): remove test for bad comand line
10446 options, since this broke all xforms-related parsing.
10448 * src/kbmap.C (getsym): set return type to unsigned long, as
10449 declared in header. On an alpha, long is _not_ the same as int.
10451 * src/support/LOstream.h: add a "using std::flush;"
10453 * src/insets/figinset.C: ditto.
10455 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10457 * src/bufferlist.C (write): use blinding fast file copy instead of
10458 "a char at a time", now we are doing it the C++ way.
10460 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
10461 std::list<int> instead.
10462 (addpidwait): reflect move to std::list<int>
10463 (sigchldchecker): ditto
10465 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
10468 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
10469 that obviously was wrong...
10471 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
10472 c, this avoids warnings with purify and islower.
10474 * src/insets/figinset.C: rename struct queue to struct
10475 queue_element and rewrite to use a std::queue. gsqueue is now a
10476 std::queue<queue_element>
10477 (runqueue): reflect move to std::queue
10480 * src/support/lstrings.h (tostr): specialize for bool, otherwise
10481 we would get "1" "0" instead of "true" "false. Also make the tostr
10484 2000-01-21 Juergen Vigna <jug@sad.it>
10486 * src/buffer.C (writeFileAscii): Disabled code for special groff
10487 handling of tabulars till I fix this in table.C
10489 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10491 * src/support/mkdir.C (mkdir): change second argument of mkdir to
10493 * src/support/lyxlib.h: ditto.
10495 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10497 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
10498 and 'j' look better. This might fix the "macron" bug that has been
10501 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
10502 functions as one template function. Delete the old versions.
10504 * src/support/lyxsum.C: move using std::ifstream inside
10507 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
10510 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
10512 * src/mathed/formula.C: delete #include "bufferlist.h" never used
10514 * src/insets/figinset.C (InitFigures): use new instead of malloc
10515 to allocate memory for figures and bitmaps.
10516 (DoneFigures): use delete[] instead of free to deallocate memory
10517 for figures and bitmaps.
10518 (runqueue): use new to allocate
10519 (getfigdata): use new/delete[] instead of malloc/free
10520 (RegisterFigure): ditto
10522 * some files: moved some declarations closer to first use, small
10523 whitespace changes use preincrement instead of postincrement where
10524 it does not make a difference.
10526 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
10527 step on the way to use stl::containers for key maps.
10529 * src/bufferlist.h: add a typedef for const_iterator and const
10530 versions of begin and end.
10532 * src/bufferlist.[Ch]: change name of member variable _state to
10533 state_. (avoid reserved names)
10535 (getFileNames): returns the filenames of the buffers in a vector.
10537 * configure.in (ALL_LINGUAS): added ro
10539 * src/support/putenv.C: new file
10541 * src/support/mkdir.C: new file
10543 2000-01-20 Allan Rae <rae@lyx.org>
10545 * lib/layouts/IEEEtran.layout: Added several theorem environments
10547 * lib/templates/IEEEtran.lyx: Example theorem environments and a
10548 couple of minor additions.
10550 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
10551 (except for those in footnotes of course)
10553 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10555 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
10557 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
10558 std::sort and std::lower_bound instead of qsort and handwritten
10560 (struct compara): struct that holds the functors used by std::sort
10561 and std::lower_bound in MathedLookupBOP.
10563 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10565 * src/support/LAssert.h: do not do partial specialization. We do
10566 not really need it.
10568 * src/support/lyxlib.h: note that lyx::getUserName() and
10569 lyx::date() are not in use right now. Should these be suppressed?
10571 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
10572 (makeLinuxDocFile): do not put date and user name in linuxdoc
10575 * src/support/lyxlib.h (kill): change first argument to long int,
10576 since that's what solaris uses.
10578 * src/support/kill.C (kill): fix declaration to match prototype.
10580 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
10581 actually check whether namespaces are supported. This is not what
10584 * src/support/lyxsum.C: add a using directive.
10586 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10588 * src/support/kill.C: if we have namespace support we don't have
10589 to include lyxlib.h.
10591 * src/support/lyxlib.h: use namespace lyx if supported.
10593 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10595 * src/support/date.C: new file
10597 * src/support/chdir.C: new file
10599 * src/support/getUserName.C: new file
10601 * src/support/getcwd.C: new file
10603 * src/support/abort.C: new file
10605 * src/support/kill.C: new file
10607 * src/support/lyxlib.h: moved all the functions in this file
10608 insede struct lyx. Added also kill and abort to this struct. This
10609 is a way to avoid the "kill is not defined in <csignal>", we make
10610 C++ wrappers for functions that are not ANSI C or ANSI C++.
10612 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
10613 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
10614 lyx it has been renamed to sum.
10616 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10618 * src/text.C: add using directives for std::min and std::max.
10620 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10622 * src/texrow.C (getIdFromRow): actually return something useful in
10623 id and pos. Hopefully fixes the bug with positionning of errorbox
10626 * src/lyx_main.C (easyParse): output an error and exit if an
10627 incorrect command line option has been given.
10629 * src/spellchecker.C (ispell_check_word): document a memory leak.
10631 * src/bufferlist.C (write): fix mismatched allocation/deletion,
10632 where a "struct utimbuf" is allocated with "new" and deleted with
10635 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10637 * src/text2.C (CutSelection): don't delete double spaces.
10638 (PasteSelection): ditto
10639 (CopySelection): ditto
10641 * src/text.C (Backspace): don't delete double spaces.
10643 * src/lyxlex.C (next): fix a bug that were only present with
10644 conformant std::istream::get to read comment lines, use
10645 std::istream::getline instead. This seems to fix the problem.
10647 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10649 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
10650 allowed to insert space before space" editing problem. Please read
10651 commends at the beginning of the function. Comments about usage
10654 * src/text.C (InsertChar): fix for the "not allowed to insert
10655 space before space" editing problem.
10657 * src/text2.C (DeleteEmptyParagraphMechanism): when
10658 IsEmptyTableRow can only return false this last "else if" will
10659 always be a no-op. Commented out.
10661 * src/text.C (RedoParagraph): As far as I can understand tmp
10662 cursor is not really needed.
10664 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
10665 present it could only return false anyway.
10666 (several functions): Did something not so smart...added a const
10667 specifier on a lot of methods.
10669 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
10670 and add a tmp->text.resize. The LyXParagraph constructor does the
10672 (BreakParagraphConservative): ditto
10674 * src/support/path.h (Path): add a define so that the wrong usage
10675 "Path("/tmp") will be flagged as a compilation error:
10676 "`unnamed_Path' undeclared (first use this function)"
10678 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10680 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
10681 which was bogus for several reasons.
10683 * src/LaTeX.C (scanAux): fix the regular expression used to scan
10685 (runBibTeX): ditto.
10687 * autogen.sh: do not use "type -path" (what's that anyway?).
10689 * src/support/filetools.C (findtexfile): remove extraneous space
10690 which caused a kpsewhich warning (at least with kpathsea version
10693 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10695 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
10697 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
10699 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
10701 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10703 * src/paragraph.C (BreakParagraph): do not reserve space on text
10704 if we don't need to (otherwise, if pos_end < pos, we end up
10705 reserving huge amounts of memory due to bad unsigned karma).
10706 (BreakParagraphConservative): ditto, although I have not seen
10707 evidence the bug can happen here.
10709 * src/lyxparagraph.h: add a using std::list.
10711 2000-01-11 Juergen Vigna <jug@sad.it>
10713 * src/menus.C (MenuDocu): output an Alert if the documentation-file
10714 could not be found.
10716 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10718 * src/vc-backend.C (doVCCommand): change to be static and take one
10719 more parameter: the path to chdir too be fore executing the command.
10720 (retrive): new function equiv to "co -r"
10722 * src/bufferlist.C (loadLyXFile): implement the missing parts if
10723 file_not_found_hook is true.
10725 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
10727 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
10728 if a file is readwrite,readonly...anything else.
10730 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10732 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
10733 (CreatePostscript): name change from MenuRunDVIPS (or something)
10734 (PreviewPostscript): name change from MenuPreviewPS
10735 (PreviewDVI): name change from MenuPreviewDVI
10737 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10738 \view_pdf_command., \pdf_to_ps_command
10740 * lib/configure.m4: added search for PDF viewer, and search for
10741 PDF to PS converter.
10742 (lyxrc.defaults output): add \pdflatex_command,
10743 \view_pdf_command and \pdf_to_ps_command.
10745 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10747 * src/bufferlist.C (write): we don't use blocksize for anything so
10750 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10752 * src/support/block.h: disable operator T* (), since it causes
10753 problems with both compilers I tried. See comments in the file.
10755 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10758 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10759 variable LYX_DIR_10x to LYX_DIR_11x.
10761 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10763 * INSTALL: document --with-lyxname.
10766 * configure.in: new configure flag --with-lyxname which allows to
10767 choose the name under which lyx is installed. Default is "lyx", of
10768 course. It used to be possible to do this with --program-suffix,
10769 but the later has in fact a different meaning for autoconf.
10771 * src/support/lstrings.h (lstrchr): reformat a bit.
10773 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10774 * src/mathed/math_defs.h: ditto.
10776 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10778 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10779 true, decides if we create a backup file or not when saving. New
10780 tag and variable \pdf_mode, defaults to false. New tag and
10781 variable \pdflatex_command, defaults to pdflatex. New tag and
10782 variable \view_pdf_command, defaults to xpdf. New tag and variable
10783 \pdf_to_ps_command, defaults to pdf2ps.
10785 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10787 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10788 does not have a BufferView.
10789 (unlockInset): ditto + don't access the_locking_inset if the
10790 buffer does not have a BufferView.
10792 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10793 certain circumstances so that we don't continue a keyboard
10794 operation long after the key was released. Try f.ex. to load a
10795 large document, press PageDown for some seconds and then release
10796 it. Before this change the document would contine to scroll for
10797 some time, with this change it stops imidiatly.
10799 * src/support/block.h: don't allocate more space than needed. As
10800 long as we don't try to write to the arr[x] in a array_type arr[x]
10801 it is perfectly ok. (if you write to it you might segfault).
10802 added operator value_type*() so that is possible to pass the array
10803 to functions expecting a C-pointer.
10805 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10808 * intl/*: updated to gettext 0.10.35, tried to add our own
10809 required modifications. Please verify.
10811 * po/*: updated to gettext 0.10.35, tried to add our own required
10812 modifications. Please verify.
10814 * src/support/lstrings.C (tostr): go at fixing the problem with
10815 cxx and stringstream. When stringstream is used return
10816 oss.str().c_str() so that problems with lyxstring and basic_string
10817 are avoided. Note that the best solution would be for cxx to use
10818 basic_string all the way, but it is not conformant yet. (it seems)
10820 * src/lyx_cb.C + other files: moved several global functions to
10821 class BufferView, some have been moved to BufferView.[Ch] others
10822 are still located in lyx_cb.C. Code changes because of this. (part
10823 of "get rid of current_view project".)
10825 * src/buffer.C + other files: moved several Buffer functions to
10826 class BufferView, the functions are still present in buffer.C.
10827 Code changes because of this.
10829 * config/lcmessage.m4: updated to most recent. used when creating
10832 * config/progtest.m4: updated to most recent. used when creating
10835 * config/gettext.m4: updated to most recent. applied patch for
10838 * config/gettext.m4.patch: new file that shows what changes we
10839 have done to the local copy of gettext.m4.
10841 * config/libtool.m4: new file, used in creation of acinclude.m4
10843 * config/lyxinclude.m4: new file, this is the lyx created m4
10844 macros, used in making acinclude.m4.
10846 * autogen.sh: GNU m4 discovered as a separate task not as part of
10847 the lib/configure creation.
10848 Generate acinlucde from files in config. Actually cat
10849 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
10850 easier to upgrade .m4 files that really are external.
10852 * src/Spacing.h: moved using std::istringstream to right after
10853 <sstream>. This should fix the problem seen with some compilers.
10855 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10857 * src/lyx_cb.C: began some work to remove the dependency a lot of
10858 functions have on BufferView::text, even if not really needed.
10859 (GetCurrentTextClass): removed this func, it only hid the
10862 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
10863 forgot this in last commit.
10865 * src/Bullet.C (bulletEntry): use static char const *[] for the
10866 tables, becuase of this the return arg had to change to string.
10867 (bulletSize): ditto
10868 (~Bullet): removed unneeded destructor
10870 * src/BufferView.C (beforeChange): moved from lyx_cb.C
10871 (insetSleep): moved from Buffer
10872 (insetWakeup): moved from Buffer
10873 (insetUnlock): moved from Buffer
10875 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
10876 from Buffer to BufferView.
10878 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
10880 * config/ltmain.sh: updated to version 1.3.4 of libtool
10882 * config/ltconfig: updated to version 1.3.4 of libtool
10884 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10887 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
10888 Did I get that right?
10890 * src/lyxlex.h: add a "using" directive or two.
10891 * src/Spacing.h: ditto.
10892 * src/insets/figinset.C: ditto.
10893 * src/support/filetools.C: ditto.
10894 * src/support/lstrings.C: ditto.
10895 * src/BufferView.C: ditto.
10896 * src/bufferlist.C: ditto.
10897 * src/lyx_cb.C: ditto.
10898 * src/lyxlex.C: ditto.
10900 * NEWS: add some changes for 1.1.4.
10902 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10904 * src/BufferView.C: first go at a TextCache to speed up switching
10907 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10909 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
10910 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
10911 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
10912 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
10915 * src/mathed/math_defs.h (MathedRowSt): make sure that all
10916 members of the struct are correctly initialized to 0 (detected by
10918 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
10919 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
10921 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
10922 pidwait, since it was allocated with "new". This was potentially
10923 very bad. Thanks to Michael Schmitt for running purify for us.
10926 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10928 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
10930 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
10932 1999-12-30 Allan Rae <rae@lyx.org>
10934 * lib/templates/IEEEtran.lyx: minor change
10936 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
10937 src/mathed/formula.C (LocalDispatch): askForText changes
10939 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
10940 know when a user has cancelled input. Fixes annoying problems with
10941 inserting labels and version control.
10943 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10945 * src/support/lstrings.C (tostr): rewritten to use strstream and
10948 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10950 * src/support/filetools.C (IsFileWriteable): use fstream to check
10951 (IsDirWriteable): use fileinfo to check
10953 * src/support/filetools.h (FilePtr): whole class deleted
10955 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
10957 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
10959 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
10961 * src/bufferlist.C (write): use ifstream and ofstream instead of
10964 * src/Spacing.h: use istrstream instead of sscanf
10966 * src/mathed/math_defs.h: change first arg to istream from FILE*
10968 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
10970 * src/mathed/math_parser.C: have yyis to be an istream
10971 (LexGetArg): use istream (yyis)
10973 (mathed_parse): ditto
10974 (mathed_parser_file): first arg istream instead of FILE*, set yyis
10976 * src/mathed/formula.C (Read): rewritten to use istream
10978 * src/mathed/formulamacro.C (Read): rewritten to use istream
10980 * src/lyxlex.h (~LyXLex): deleted desturctor
10981 (getStream): new function, returns an istream
10982 (getFile): deleted funtion
10983 (IsOK): return is.good();
10985 * src/lyxlex.C (LyXLex): delete file and owns_file
10986 (setFile): open an filebuf and assign that to a istream instead of
10988 (setStream): new function, takes an istream as arg.
10989 (setFile): deleted function
10990 (EatLine): rewritten us use istream instead of FILE*
10994 * src/table.C (LyXTable): use istream instead of FILE*
10995 (Read): rewritten to take an istream instead of FILE*
10997 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10999 * src/buffer.C (Dispatch): remove an extraneous break statement.
11001 * src/support/filetools.C (QuoteName): change to do simple
11002 'quoting'. More work is necessary. Also changed to do nothing
11003 under emx (needs fix too).
11004 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
11006 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
11007 config.h.in to the AC_DEFINE_UNQUOTED() call.
11008 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
11009 needs char * as argument (because Solaris 7 declares it like
11012 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
11013 remove definition of BZERO.
11015 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11017 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
11018 defined, "lyxregex.h" if not.
11020 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
11022 (REGEX): new variable that is set to regex.c lyxregex.h when
11023 AM_CONDITIONAL USE_REGEX is set.
11024 (libsupport_la_SOURCES): add $(REGEX)
11026 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
11029 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
11032 * configure.in: add call to LYX_REGEX
11034 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
11035 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
11037 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11039 * lib/bind/fi_menus.bind: new file, from
11040 pauli.virtanen@saunalahti.fi.
11042 * src/buffer.C (getBibkeyList): pass the parameter delim to
11043 InsetInclude::getKeys and InsetBibtex::getKeys.
11045 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
11046 is passed to Buffer::getBibkeyList
11048 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
11049 instead of the hardcoded comma.
11051 * src/insets/insetbib.C (getKeys): make sure that there are not
11052 leading blanks in bibtex keys. Normal latex does not care, but
11053 harvard.sty seems to dislike blanks at the beginning of citation
11054 keys. In particular, the retturn value of the function is
11056 * INSTALL: make it clear that libstdc++ is needed and that gcc
11057 2.7.x probably does not work.
11059 * src/support/filetools.C (findtexfile): make debug message go to
11061 * src/insets/insetbib.C (getKeys): ditto
11063 * src/debug.C (showTags): make sure that the output is correctly
11066 * configure.in: add a comment for TWO_COLOR_ICON define.
11068 * acconfig.h: remove all the entries that already defined in
11069 configure.in or acinclude.m4.
11071 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
11072 to avoid user name, date and copyright.
11074 1999-12-21 Juergen Vigna <jug@sad.it>
11076 * src/table.C (Read): Now read bogus row format informations
11077 if the format is < 5 so that afterwards the table can
11078 be read by lyx but without any format-info. Fixed the
11079 crash we experienced when not doing this.
11081 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
11083 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
11084 (RedoDrawingOfParagraph): ditto
11085 (RedoParagraphs): ditto
11086 (RemoveTableRow): ditto
11088 * src/text.C (Fill): rename arg paperwidth -> paper_width
11090 * src/buffer.C (insertLyXFile): rename var filename -> fname
11091 (writeFile): rename arg filename -> fname
11092 (writeFileAscii): ditto
11093 (makeLaTeXFile): ditto
11094 (makeLinuxDocFile): ditto
11095 (makeDocBookFile): ditto
11097 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
11100 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
11102 * src/bmtable.h: add extern "C" on this file when __cplusplus is
11105 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
11106 compiled by a C compiler not C++.
11108 * src/layout.h (LyXTextClass): added typedef for const_iterator
11109 (LyXTextClassList): added typedef for const_iterator + member
11110 functions begin and end.
11112 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
11113 iterators to fill the choice_class.
11114 (updateLayoutChoice): rewritten to use iterators to fill the
11115 layoutlist in the toolbar.
11117 * src/BufferView.h (BufferView::work_area_width): removed unused
11120 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
11122 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
11123 (sgmlCloseTag): ditto
11125 * src/support/lstrings.h: return type of countChar changed to
11128 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
11129 what version of this func to use. Also made to return unsigned int.
11131 * configure.in: call LYX_STD_COUNT
11133 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
11134 conforming std::count.
11136 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11138 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
11139 and a subscript would give bad display (patch from Dekel Tsur
11140 <dekel@math.tau.ac.il>).
11142 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
11144 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
11147 * src/chset.h: add a few 'using' directives
11149 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
11150 triggered when no buffer is active
11152 * src/layout.C: removed `break' after `return' in switch(), since
11155 * src/lyx_main.C (init): make sure LyX can be ran in place even
11156 when libtool has done its magic with shared libraries. Fix the
11157 test for the case when the system directory has not been found.
11159 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
11160 name for the latex file.
11161 (MenuMakeHTML): ditto
11163 * src/buffer.h: add an optional boolean argument, which is passed
11164 to ChangeExtension.
11166 1999-12-20 Allan Rae <rae@lyx.org>
11168 * lib/templates/IEEEtran.lyx: small correction and update.
11170 * configure.in: Attempted to use LYX_PATH_HEADER
11172 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
11174 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
11175 input from JMarc. Now use preprocessor to find the header.
11176 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
11177 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
11178 LYX_STL_STRING_FWD. See comments in file.
11180 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
11182 * The global MiniBuffer * minibuffer variable is dead.
11184 * The global FD_form_main * fd_form_main variable is dead.
11186 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11188 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
11190 * src/table.h: add the LOstream.h header
11191 * src/debug.h: ditto
11193 * src/LyXAction.h: change the explaination of the ReadOnly
11194 attribute: is indicates that the function _can_ be used.
11196 * src/LyXAction.C (init): find-replace _can_ be used in read-only
11199 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11201 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
11207 * src/paragraph.C (GetWord): assert on pos>=0
11210 * src/support/lyxstring.C: condition the use of an invariant on
11212 * src/support/lyxstring.h: ditto
11214 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
11215 Use LAssert.h instead of plain assert().
11217 * src/support/lstrings.h: add LAssert.h, in case it is needed.
11219 * src/lyxfunc.C: do not include LAssert.h, it is not used.
11220 * src/support/filetools.C: ditto
11222 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
11225 * INSTALL: document the new configure flags
11227 * configure.in: suppress --with-debug; add --enable-assertions
11229 * acinclude.m4: various changes in alignment of help strings.
11231 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11233 * src/kbmap.C: commented out the use of the hash map in kb_map,
11234 beginning of movement to a stl::container.
11236 * several files: removed code that was not in effect when
11237 MOVE_TEXT was defined.
11239 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
11240 for escaping should not be used. We can discuss if the string
11241 should be enclosed in f.ex. [] instead of "".
11243 * src/trans_mgr.C (insert): use the new returned value from
11244 encodeString to get deadkeys and keymaps done correctly.
11246 * src/chset.C (encodeString): changed to return a pair, to tell
11247 what to use if we know the string.
11249 * src/lyxscreen.h (fillArc): new function.
11251 * src/FontInfo.C (resize): rewritten to use more std::string like
11252 structore, especially string::replace.
11254 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
11257 * configure.in (chmod +x some scripts): remove config/gcc-hack
11259 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11261 * src/buffer.C (writeFile): change once again the top comment in a
11262 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
11263 instead of an hardcoded version number.
11264 (makeDocBookFile): ditto
11266 * src/version.h: add new define LYX_DOCVERSION
11268 * po/de.po: update from Pit Sütterlin
11269 * lib/bind/de_menus.bind: ditto.
11271 * src/lyxfunc.C (Dispatch): call MenuExport()
11272 * src/buffer.C (Dispatch): ditto
11274 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
11275 LyXFunc::Dispatch().
11276 (MenuExport): new function, moved from
11277 LyXFunc::Dispatch().
11279 * src/trans_mgr.C (insert): small cleanup
11280 * src/chset.C (loadFile): ditto
11282 * lib/kbd/iso8859-1.cdef: add missing backslashes
11284 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11286 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
11287 help with placing the manually drawn accents better.
11289 (Draw): x2 and hg changed to float to minimize rounding errors and
11290 help place the accents better.
11292 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
11293 unsigned short to char is just wrong...cast the char to unsigned
11294 char instead so that the two values can compare sanely. This
11295 should also make the display of insetlatexaccents better and
11296 perhaps also some other insets.
11298 (lbearing): new function
11301 1999-12-15 Allan Rae <rae@lyx.org>
11303 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
11304 header that provides a wrapper around the very annoying SGI STL header
11307 * src/support/lyxstring.C, src/LString.h:
11308 removed old SGI-STL-compatability attempts.
11310 * configure.in: Use LYX_STL_STRING_FWD.
11312 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
11313 stl_string_fwd.h is around and try to determine it's location.
11314 Major improvement over previous SGI STL 3.2 compatability.
11315 Three small problems remain with this function due to my zero
11316 knowledge of autoconf. JMarc and lgb see the comments in the code.
11318 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11320 * src/broken_const.h, config/hack-gcc, config/README: removed
11322 * configure.in: remove --with-gcc-hack option; do not call
11325 * INSTALL: remove documentation of --with-broken-const and
11328 * acconfig.h: remove all trace of BROKEN_CONST define
11330 * src/buffer.C (makeDocBookFile): update version number in output
11332 (SimpleDocBookOnePar): fix an assert when trying to a character
11333 access beyond string length
11336 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11338 * po/de.po: fix the Export menu
11340 * lyx.man: update the description of -dbg
11342 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
11343 (commandLineHelp): updated
11344 (easyParse): show list of available debug levels if -dbg is passed
11347 * src/Makefile.am: add debug.C
11349 * src/debug.h: moved some code to debug.C
11351 * src/debug.C: new file. Contains code to set and show debug
11354 * src/layout.C: remove 'break' after 'continue' in switch
11355 statements, since these cannot be reached.
11357 1999-12-13 Allan Rae <rae@lyx.org>
11359 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
11360 (in_word_set): hash() -> math_hash()
11362 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
11364 * acconfig.h: Added a test for whether we are using exceptions in the
11365 current compilation run. If so USING_EXCEPTIONS is defined.
11367 * config.in: Check for existance of stl_string_fwd.h
11368 * src/LString.h: If compiling --with-included-string and SGI's
11369 STL version 3.2 is present (see above test) we need to block their
11370 forward declaration of string and supply a __get_c_string().
11371 However, it turns out this is only necessary if compiling with
11372 exceptions enabled so I've a bit more to add yet.
11374 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
11375 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
11376 src/support/LRegex.h, src/undo.h:
11377 Shuffle the order of the included files a little to ensure that
11378 LString.h gets included before anything that includes stl_string_fwd.h
11380 * src/support/lyxstring.C: We need to #include LString.h instead of
11381 lyxstring.h to get the necessary definition of __get_c_string.
11382 (__get_c_string): New function. This is defined static just like SGI's
11383 although why they need to do this I'm not sure. Perhaps it should be
11384 in lstrings.C instead.
11386 * lib/templates/IEEEtran.lyx: New template file.
11388 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11390 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
11391 * intl/Makefile.in (MKINSTALLDIRS): ditto
11393 * src/LyXAction.C (init): changed to hold the LFUN data in a
11394 automatic array in stead of in callso to newFunc, this speeds up
11395 compilation a lot. Also all the memory used by the array is
11396 returned when the init is completed.
11398 * a lot of files: compiled with -Wold-style-cast, changed most of
11399 the reported offenders to C++ style casts. Did not change the
11400 offenders in C files.
11402 * src/trans.h (Match): change argument type to unsigned int.
11404 * src/support/DebugStream.C: fix some types on the streambufs so
11405 that it works on a conforming implementation.
11407 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11409 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
11411 * src/support/lyxstring.C: remove the inline added earlier since
11412 they cause a bunch of unsatisfied symbols when linking with dec
11413 cxx. Cxx likes to have the body of inlines at the place where they
11416 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
11417 accessing negative bounds in array. This fixes the crash when
11418 inserting accented characters.
11419 * src/trans.h (Match): ditto
11421 * src/buffer.C (Dispatch): since this is a void, it should not try
11422 to return anything...
11424 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11426 * src/buffer.h: removed the two friends from Buffer. Some changes
11427 because of this. Buffer::getFileName and Buffer::setFileName
11428 renamed to Buffer::fileName() and Buffer::fileName(...).
11430 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11432 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
11433 and Buffer::update(short) to BufferView. This move is currently
11434 controlled by a define MOVE_TEXT, this will be removed when all
11435 shows to be ok. This move paves the way for better separation
11436 between buffer contents and buffer view. One side effect is that
11437 the BufferView needs a rebreak when swiching buffers, if we want
11438 to avoid this we can add a cache that holds pointers to LyXText's
11439 that is not currently in use.
11441 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
11444 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11446 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
11448 * lyx_main.C: new command line option -x (or --execute) and
11449 -e (or --export). Now direct conversion from .lyx to .tex
11450 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
11451 Unfortunately, X is still needed and the GUI pops up during the
11454 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11456 * src/Spacing.C: add a using directive to bring stream stuff into
11458 * src/paragraph.C: ditto
11459 * src/buffer.C: ditto
11461 * NEWS: updated a bit the new features of 1.1.3 (took a few things
11462 from Lars' announcement).
11464 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
11465 example files from Tino Meinen.
11467 1999-12-06 Allan Rae <rae@lyx.org>
11469 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
11471 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11473 * src/support/lyxstring.C: added a lot of inline for no good
11476 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
11477 latexWriteEndChanges, they were not used.
11479 * src/layout.h (operator<<): output operator for PageSides
11481 * src/mathed/math_iter.C (my_memcpy): slightly changed.
11483 * some example files: loaded in LyX 1.0.4 and saved again to update
11484 certain constructs (table format)
11486 * a lot of files: did the change to use fstream/iostream for all
11487 writing of files. Done with a close look at Andre Poenitz's patch.
11489 * some files: whitespace changes.
11491 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11493 * src/mathed/math_iter.C (my_memcpy): new function. Since the
11494 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
11495 architecture, we provide our own. It is used unconditionnally, but
11496 I do not think this is a performance problem. Thanks to Angus
11497 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
11498 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
11500 (GetInset): use my_memcpy.
11504 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
11505 it is easier to understand, but it uses less TeX-only constructs now.
11507 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
11508 elements contain spaces
11510 * lib/configure: regenerated
11512 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
11513 elements contain spaces; display the list of programs that are
11516 * autogen.sh: make sure lib/configure is executable
11518 * lib/examples/*: rename the tutorial examples to begin with the
11519 two-letters language code.
11521 * src/lyxfunc.C (getStatus): do not query current font if no
11524 * src/lyx_cb.C (RunScript): use QuoteName
11525 (MenuRunDvips): ditto
11526 (PrintApplyCB): ditto
11528 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
11529 around argument, so that it works well with the current shell.
11530 Does not work properly with OS/2 shells currently.
11532 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
11533 * src/LyXSendto.C (SendtoApplyCB): ditto
11534 * src/lyxfunc.C (Dispatch): ditto
11535 * src/buffer.C (runLaTeX): ditto
11536 (runLiterate): ditto
11537 (buildProgram): ditto
11539 * src/lyx_cb.C (RunScript): ditto
11540 (MenuMakeLaTeX): ditto
11542 * src/buffer.h (getLatexName): new method
11544 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
11546 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11548 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
11549 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
11550 (create_math_panel): ditto
11552 * src/lyxfunc.C (getStatus): re-activate the code which gets
11553 current font and cursor; add test for export to html.
11555 * src/lyxrc.C (read): remove unreachable break statements; add a
11558 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
11560 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11562 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
11563 introduced by faulty regex.
11564 * src/buffer.C: ditto
11565 * src/lastfiles.C: ditto
11566 * src/paragraph.C: ditto
11567 * src/table.C: ditto
11568 * src/vspace.C: ditto
11569 * src/insets/figinset.C: ditto
11570 Note: most of these is absolutely harmless, except the one in
11571 src/mathed formula.C.
11573 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
11575 * src/ImportNoweb.C (documentclass): fixed bounds for substr
11576 operation, yielding correct results for the reLyX command.
11578 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11580 * src/support/filetools.C (ExpandPath): removed an over eager
11582 (ReplaceEnvironmentPath): ditto
11584 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
11585 shows that we are doing something fishy in our code...
11586 (BubblePost): ditto
11589 * src/lyxrc.C (read): use a double switch trick to get more help
11590 from the compiler. (the same trick is used in layout.C)
11591 (write): new function. opens a ofstream and pass that to output
11592 (output): new function, takes a ostream and writes the lyxrc
11593 elemts to it. uses a dummy switch to make sure no elements are
11596 * src/lyxlex.h: added a struct pushpophelper for use in functions
11597 with more than one exit point.
11599 * src/lyxlex.[Ch] (GetInteger): made it const
11603 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
11605 * src/layout.[hC] : LayoutTags splitted into several enums, new
11606 methods created, better error handling cleaner use of lyxlex. Read
11609 * src/bmtable.[Ch]: change some member prototypes because of the
11610 image const changes.
11612 * commandtags.h, src/LyXAction.C (init): new function:
11613 "preferences-save", saves the lyxrc entries into .lyx/preferences.
11614 This file is not read automatically but you can add \input
11615 preferences to your lyxrc if you want to. We need to discuss how
11618 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
11619 in .aux, also remove .bib and .bst files from dependencies when
11622 * src/BufferView.C, src/LyXView.C: add const_cast several places
11623 because of changes to images.
11625 * lib/images/*: same change as for images/*
11627 * lib/lyxrc.example: Default for accept_compound is false not no.
11629 * images/*: changed to be const, however I have som misgivings
11630 about this change so it might be changed back.
11632 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11634 * lib/configure, po/POTFILES.in: regenerated
11636 * autogen.sh: autogenerate lib/configure from lib/configure.m4
11638 * config/lib_configure.m4: removed
11640 * lib/configure.m4: new file (was config/lib_configure.m4)
11642 * configure.in: do not test for rtti, since we do not use it.
11644 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11646 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
11647 doubling of allocated space scheme. This makes it faster for large
11648 strings end to use less memory for small strings. xtra rememoved.
11650 * src/insets/figinset.C (waitalarm): commented out.
11651 (GhostscriptMsg): use static_cast
11652 (GhostscriptMsg): use new instead of malloc to allocate memory for
11653 cmap. also delete the memory after use.
11655 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
11657 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
11658 for changes in bibtex database or style.
11659 (runBibTeX): remove all .bib and .bst files from dep before we
11661 (run): use scanAuc in when dep file already exist.
11663 * src/DepTable.C (remove_files_with_extension): new method
11664 (exist): new method
11666 * src/DepTable.[Ch]: made many of the methods const.
11668 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11670 * src/bufferparams.C: make sure that the default textclass is
11671 "article". It used to be the first one by description order, but
11672 now the first one is "docbook".
11674 * src/lyx_main.C (setDebuggingLevel): change type of argument to
11675 string; call Debug::value.
11676 (easyParse): pass complete argument to setDebuggingLevel().
11678 * src/debug.h (value): fix the code that parses debug levels.
11680 * src/debug.h: add new debug type ACTION, reserved for LyXAction
11683 * src/LyXAction.C: use Debug::ACTION as debug channel.
11685 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
11687 * NEWS: updated for the future 1.1.3 release.
11689 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
11690 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
11691 it should. This is of course a controversial change (since many
11692 people will find that their lyx workscreen is suddenly full of
11693 red), but done for the sake of correctness.
11695 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
11696 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
11698 * src/insets/inseterror.h, src/insets/inseturl.h,
11699 src/insets/insetinfo.h, src/insets/figinset.h,
11700 src/mathed/formulamacro.h, src/mathed/math_macro.h
11701 (EditMessage): add a missing const and add _() to make sure that
11702 translation happens
11704 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
11705 src/insets/insetbib.C, src/support/filetools.C: add `using'
11706 directives for cxx.
11708 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
11709 doing 'Insert index of last word' at the beginning of a paragraph.
11711 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11713 * several files: white-space changes.
11715 * src/mathed/formula.C: removed IsAlpha and IsDigit
11717 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
11718 .bib file. use a ifstream instead of FilePtr when parsing the .bib
11721 * src/insets/figinset.C (GetPSSizes): don't break when
11722 "EndComments" is seen. But break when a boundingbox is read.
11724 * all classes inherited from Inset: return value of Clone
11725 changed back to Inset *.
11727 * all classes inherited form MathInset: return value of Clone
11728 changed back to MathedInset *.
11730 * src/insets/figinset.C (runqueue): use a ofstream to output the
11731 gs/ps file. Might need some setpresicion or setw. However I can
11732 see no problem with the current code.
11733 (runqueue): use sleep instead of the alarm/signal code. I just
11734 can't see the difference.
11736 * src/paragraph.C (LyXParagraph): reserve space in the new
11737 paragraph and resize the inserted paragraph to just fit.
11739 * src/lyxfunc.h (operator|=): added operator for func_status.
11741 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11742 check for readable file.
11744 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11745 check for readable file.
11746 (MenuMakeLinuxDoc): ditto
11747 (MenuMakeDocBook): ditto
11748 (MenuMakeAscii): ditto
11749 (InsertAsciiFile): split the test for openable and readable
11751 * src/bmtable.C (draw_bitmaptable): use
11752 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11754 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11755 findtexfile from LaTeX to filetools.
11757 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11758 instead of FilePtr. Needs to be verified by a literate user.
11760 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11762 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11763 (EditMessage): likewise.
11765 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11766 respectively as \textasciitilde and \textasciicircum.
11768 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11770 * src/support/lyxstring.h: made the methods that take iterators
11771 use const_iterator.
11773 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11774 (regexMatch): made is use the real regex class.
11776 * src/support/Makefile.am: changed to use libtool
11778 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11780 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11782 (MathIsInset ++): changed several macros to be inline functions
11785 * src/mathed/Makefile.am: changed to use libtool
11787 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11789 * src/insets/inset* : Clone changed to const and return type is
11790 the true insettype not just Inset*.
11792 * src/insets/Makefile.am: changed to use libtool
11794 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11796 * src/undo.[Ch] : added empty() and changed some of the method
11799 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11801 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11802 setID use block<> for the bullets array, added const several places.
11804 * src/lyxfunc.C (getStatus): new function
11806 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11807 LyXAction, added const to several funtions.
11809 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11810 a std::map, and to store the dir items in a vector.
11812 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11815 * src/LyXView.[Ch] + other files : changed currentView to view.
11817 * src/LyXAction.[Ch] : ported from the old devel branch.
11819 * src/.cvsignore: added .libs and a.out
11821 * configure.in : changes to use libtool.
11823 * acinclude.m4 : inserted libtool.m4
11825 * .cvsignore: added libtool
11827 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11829 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11830 file name in insets and mathed directories (otherwise the
11831 dependency is not taken in account under cygwin).
11833 * src/text2.C (InsertString[AB]): make sure that we do not try to
11834 read characters past the string length.
11836 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11838 * lib/doc/LaTeXConfig.lyx.in,
11839 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11841 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11842 file saying who created them and when this heppened; this is
11843 useless and annoys tools like cvs.
11845 * lib/layouts/g-brief-{en,de}.layout,
11846 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
11847 from Thomas Hartkens <thomas@hartkens.de>.
11849 * src/{insets,mathed}/Makefile.am: do not declare an empty
11850 LDFLAGS, so that it can be set at configure time (useful on Irix
11853 * lib/reLyX/configure.in: make sure that the prefix is set
11854 correctly in LYX_DIR.
11856 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11858 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11859 be used by 'command-sequence' this allows to bind a key to a
11860 sequence of LyX-commands
11861 (Example: 'command-sequence math-insert alpha; math-insert beta;")
11863 * src/LyXAction.C: add "command-sequence"
11865 * src/LyXFunction.C: handling of "command-sequence"
11867 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
11868 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
11870 * src/lyxserver.C, src/minibuffer.C: Use this new interface
11872 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11874 * src/buffer.C (writeFile): Do not output a comment giving user
11875 and date at the beginning of a .lyx file. This is useless and
11876 annoys cvs anyway; update version number to 1.1.
11878 * src/Makefile.am (LYX_DIR): add this definition, so that a
11879 default path is hardcoded in LyX.
11881 * configure.in: Use LYX_GNU_GETTEXT.
11883 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
11884 AM_GNU_GETTEXT with a bug fixed.
11886 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
11888 * src/chset.C: add "using std::ifstream;" to please dec cxx.
11890 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
11891 which is used to point to LyX data is now LYX_DIR_11x.
11893 * lyx.man: convert to a unix text file; small updates.
11895 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11897 * src/support/LSubstring.[Ch]: made the second arg of most of the
11898 constructors be a const reference.
11900 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
11903 * src/support/lyxstring.[Ch] (swap): added missing member function
11904 and specialization of swap(str, str);
11906 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
11908 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
11909 trace of the old one.
11911 * src/undo.[Ch]: made the undostack use std::list to store undo's in
11912 put the member definitions in undo.C.
11914 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
11915 NEW_TEXT and have now only code that was included when this was
11918 * src/intl.C (LCombo): use static_cast
11920 (DispatchCallback): ditto
11922 * src/definitions.h: removed whole file
11924 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
11926 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
11927 parsing and stores in a std:map. a regex defines the file format.
11928 removed unneeded members.
11930 * src/bufferparams.h: added several enums from definitions.h here.
11931 Removed unsused destructor. Changed some types to use proper enum
11932 types. use block to have the temp_bullets and user_defined_bullets
11933 and to make the whole class assignable.
11935 * src/bufferparams.C (Copy): removed this functions, use a default
11936 assignment instead.
11938 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
11941 * src/buffer.C (readLyXformat2): commend out all that have with
11942 oldpapersize to do. also comment out all that hve to do with
11943 insetlatex and insetlatexdel.
11944 (setOldPaperStuff): commented out
11946 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
11948 * src/LyXAction.C: remove use of inset-latex-insert
11950 * src/mathed/math_panel.C (button_cb): use static_cast
11952 * src/insets/Makefile.am (insets_o_SOURCES): removed
11955 * src/support/lyxstring.C (helper): use the unsigned long
11956 specifier, UL, instead of a static_cast.
11958 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
11960 * src/support/block.h: new file. to be used as a c-style array in
11961 classes, so that the class can be assignable.
11963 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11965 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
11966 NULL, make sure to return an empty string (it is not possible to
11967 set a string to NULL).
11969 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11971 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
11973 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
11975 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
11976 link line, so that Irix users (for example) can set it explicitely to
11979 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
11980 it can be overidden at make time (static or dynamic link, for
11983 * src/vc-backend.C, src/LaTeXFeatures.h,
11984 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
11985 statements to bring templates to global namespace.
11987 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11989 * src/support/lyxstring.C (operator[] const): make it standard
11992 * src/minibuffer.C (Init): changed to reflect that more
11993 information is given from the lyxvc and need not be provided here.
11995 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
11997 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
11999 * src/LyXView.C (UpdateTimerCB): use static_cast
12000 (KeyPressMask_raw_callback): ditto
12002 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
12003 buffer_, a lot of changes because of this. currentBuffer() ->
12004 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
12005 also changes to other files because of this.
12007 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
12009 * src/vc-backend.[Ch]: new files. The backends for vc handling,
12010 have no support for RCS and partial support for CVS, will be
12013 * src/insets/ several files: changes because of function name
12014 changes in Bufferview and LyXView.
12016 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
12018 * src/support/LSubstring.[Ch]: new files. These implement a
12019 Substring that can be very convenient to use. i.e. is this
12021 string a = "Mary had a little sheep";
12022 Substring(a, "sheep") = "lamb";
12023 a is now "Mary has a little lamb".
12025 * src/support/LRegex.[Ch]: a regex class that can be used to pick
12026 out patterns and subpatterns of strings. It is used by LSubstring
12027 and also by vc-backend.C
12029 * src/support/lyxstring.C: went over all the assertions used and
12030 tried to correct the wrong ones and flag which of them is required
12031 by the standard. some bugs found because of this. Also removed a
12032 couple of assertions.
12034 * src/support/Makefile.am (libsupport_a_SOURCES): added
12035 LSubstring.[Ch] and LRegex.[Ch]
12037 * src/support/FileInfo.h: have struct stat buf as an object and
12038 not a pointer to one, some changes because of this.
12040 * src/LaTeXFeatures.C (getTClassPreamble): also use the
12041 information in layout when adding the layouts preamble to the
12042 textclass preamble.
12044 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
12047 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
12048 because of bug in OS/2.
12050 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12052 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
12053 \verbatim@font instead of \ttfamily, so that it can be redefined.
12055 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
12056 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
12057 src/layout.h, src/text2.C: add 'using' directive to bring the
12058 STL templates we need from the std:: namespace to the global one.
12059 Needed by DEC cxx in strict ansi mode.
12061 * src/support/LIstream.h,src/support/LOstream.h,
12062 src/support/lyxstring.h,src/table.h,
12063 src/lyxlookup.h: do not include <config.h> in header
12064 files. This should be done in the .C files only.
12066 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
12070 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12072 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
12073 from Kayvan to fix the tth invokation.
12075 * development/lyx.spec.in: updates from Kayvan to reflect the
12076 changes of file names.
12078 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12080 * src/text2.C (InsertStringB): use std::copy
12081 (InsertStringA): use std::copy
12083 * src/bufferlist.C: use a vector to store the buffers in. This is
12084 an internal change and should not affect any other thing.
12086 * src/BufferView.C (waitForX): use XSync instead of the lengthy
12089 * src/text.C (Fill): fix potential bug, one off bug.
12091 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12093 * src/Makefile.am (lyx_main.o): add more files it depends on.
12095 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
12097 * src/support/lyxstring.C: use size_t for the reference count,
12098 size, reserved memory and xtra.
12099 (internal_compare): new private member function. Now the compare
12100 functions should work for std::strings that have embedded '\0'
12102 (compare): all compare functions rewritten to use
12105 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
12107 * src/support/lyxstring.C (compare): pass c_str()
12108 (compare): pass c_str
12109 (compare): pass c_str
12111 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12113 * src/support/DebugStream.C: <config.h> was not included correctly.
12115 * lib/configure: forgot to re-generate it :( I'll make this file
12116 auto generated soon.
12118 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
12120 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
12123 * src/support/lyxstring.C: some changes from length() to rep->sz.
12124 avoids a function call.
12126 * src/support/filetools.C (SpaceLess): yet another version of the
12127 algorithm...now per Jean-Marc's suggestions.
12129 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12131 * src/layout.C (less_textclass_desc): functor for use in sorting
12133 (LyXTextClass::Read): sort the textclasses after reading.
12135 * src/support/filetools.C (SpaceLess): new version of the
12136 SpaceLess functions. What problems does this one give? Please
12139 * images/banner_bw.xbm: made the arrays unsigned char *
12141 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12143 * src/support/lyxstring.C (find): remove bogus assertion in the
12144 two versions of find where this has not been done yet.
12146 * src/support/lyxlib.h: add missing int return type to
12149 * src/menus.C (ShowFileMenu): disable exporting to html if no
12150 html export command is present.
12152 * config/lib_configure.m4: add a test for an HTML converter. The
12153 programs checked for are, in this order: tth, latex2html and
12156 * lib/configure: generated from config/lib_configure.m4.
12158 * src/lyxfunc.C (Dispatch): update and improve the execution of an
12159 html converter. The parameters are now passed through $$FName and
12160 $$OutName, instead of standard input/output.
12162 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
12164 * lib/lyxrc.example: update description of \html_command.
12165 add "quotes" around \screen_font_xxx font setting examples to help
12166 people who use fonts with spaces in their names.
12168 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12170 * Distribution files: updates for v1.1.2
12172 * src/support/lyxstring.C (find): remove bogus assert and return
12173 npos for the same condition.
12175 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12177 * added patch for OS/2 from SMiyata.
12179 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12181 * src/text2.C (CutSelection): make space_wrapped a bool
12182 (CutSelection): dont declare int i until we have to.
12183 (alphaCounter): return a char const *.
12185 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12187 * src/support/syscall.C (Systemcalls::kill):
12188 src/support/filetools.C (PutEnv, PutEnvPath):
12189 src/lyx_cb.C (addNewlineAndDepth):
12190 src/FontInfo.C (FontInfo::resize): condition some #warning
12191 directives with WITH_WARNINGS.
12194 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12196 * src/layout.[Ch] + several files: access to class variables
12197 limited and made accessor functions instead a lot of code changed
12198 becuase of this. Also instead of returning pointers often a const
12199 reference is returned instead.
12201 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
12203 * src/Makefile.am (dist-hook): added used to remove the CVS from
12204 cheaders upon creating a dist
12205 (EXTRA_DIST): added cheaders
12207 * src/support/lstrings.C (tostr(char)): fix it to handle param as
12208 a character not as a small integer.
12210 * src/support/lyxstring.C (find): removed Assert and added i >=
12211 rep->sz to the first if.
12213 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12215 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
12216 src/LyXView.C src/buffer.C src/bufferparams.C
12217 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
12218 src/text2.C src/insets/insetinclude.C:
12219 lyxlayout renamed to textclasslist.
12221 * src/layout.C: some lyxerr changes.
12223 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
12224 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
12225 (LyXLayoutList): removed all traces of this class.
12226 (LyXTextClass::Read): rewrote LT_STYLE
12227 (LyXTextClass::hasLayout): new function
12228 (LyXTextClass::GetLayout): rewritten to return an iterator + has
12229 both const and nonconst version.
12230 (LyXTextClass::delete_layout): new function.
12231 (LyXTextClassList::Style): bug fix. do the right thing if layout
12233 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
12234 (LyXTextClassList::NameOfLayout): ditto
12235 (LyXTextClassList::Load): ditto
12237 * src/buffer.C (makeLaTeXFile): new access to layoutlist
12239 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
12241 * src/LyXAction.C (LookupFunc): added a workaround for sun
12242 compiler, on the other hand...we don't know if the current code
12243 compiles on sun at all...
12245 * src/support/filetools.C (CleanupPath): subst fix
12247 * src/insets/insetbib.C (delDatabase): subst fix, this looks
12250 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
12251 complained about this one?
12253 * src/insets/insetinclude.C (Latex): subst fix
12255 * src/insets/insetbib.C (getKeys): subst fix
12257 * src/LyXSendto.C (SendtoApplyCB): subst fix
12259 * src/lyx_main.C (init): subst fix
12261 * src/layout.C (Read): subst fix
12263 * src/lyx_sendfax_main.C (button_send): subst fix
12265 * src/buffer.C (RoffAsciiTable): subst fix
12267 * src/lyx_cb.C (MenuFax): subst fix
12268 (PrintApplyCB): subst fix
12270 1999-10-26 Juergen Vigna <jug@sad.it>
12272 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
12274 (Read): Cleaned up this code so now we read only format vestion >= 5
12276 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
12278 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
12279 come nobody has complained about this one?
12281 * src/insets/insetinclude.C (Latex): subst fix
12283 * src/insets/insetbib.C (getKeys): subst fix
12285 * src/lyx_main.C (init): subst fix
12287 * src/layout.C (Read): subst fix
12289 * src/buffer.C (RoffAsciiTable): subst fix
12291 * src/lyx_cb.C (MenuFax): subst fix.
12293 * src/layout.[hC] + some other files: rewrote to use
12294 std::container to store textclasses and layouts in.
12295 Simplified, removed a lot of code. Make all classes
12296 assignable. Further simplifications and review of type
12297 use still to be one.
12299 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
12300 lastfiles to create the lastfiles partr of the menu.
12302 * src/lastfiles.[Ch]: rewritten to use deque to store the
12303 lastfiles in. Uses fstream for reading and writing. Simplifies
12306 * src/support/syscall.C: remove explicit cast.
12308 * src/BufferView.C (CursorToggleCB): removed code snippets that
12309 were commented out.
12310 use explicat C++ style casts instead of C style casts. also use
12311 u_vdata instea of passing pointers in longs.
12313 * src/PaperLayout.C: removed code snippets that were commented out.
12315 * src/lyx_gui_misc.C: removed code snippets that were commented out.
12317 * src/lyx_main.C: removed code snippets that wer commented out.
12319 * src/paragraph.C: removed code snippets that were commented out.
12321 * src/lyxvc.C (logClose): use static_cast
12323 (viewLog): remove explicit cast to void*
12324 (showLog): removed old commented code
12326 * src/menus.C: use static_cast instead of C style casts. use
12327 u_vdata instead of u_ldata. remove explicit cast to (long) for
12328 pointers. Removed old code that was commented out.
12330 * src/insets/inset.C: removed old commented func
12332 * src/insets/insetref.C (InsetRef): removed old code that had been
12333 commented out for a long time.
12335 (escape): removed C style cast
12337 * src/insets/insetlatexaccent.C (Draw): removed old commented code
12339 * src/insets/insetlatex.C (Draw): removed old commented code
12340 (Read): rewritten to use string
12342 * src/insets/insetlabel.C (escape): removed C style cast
12344 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
12346 * src/insets/insetindex.C: use static_cast and u_vdata, removed
12347 old commented code.
12349 * src/insets/insetinclude.h: removed a couple of stupid bools
12351 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
12352 (Clone): remove C style cast
12353 (getKeys): changed list to lst because of std::list
12355 * src/insets/inseterror.C (Draw): removed som old commented code.
12357 * src/insets/insetcommand.C (Draw): removed some old commented code.
12359 * src/insets/insetbib.C (bibitem_cb): removed code that has been
12360 commented out forever.
12361 (bibitem_cb): use static_cast instead of C style cast
12362 use of vdata changed to u_vdata.
12364 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
12366 (CloseUrlCB): use static_cast instead of C style cast.
12367 (CloseUrlCB): added a fl_free form...it seemed to be missing.
12369 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
12370 (C_InsetInfo_CloseInfoCB): forward the ob parameter
12371 (CloseInfoCB): static_cast from ob->u_vdata instead.
12372 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
12375 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
12376 (C_InsetError_CloseErrorCB): forward the ob parameter
12377 (CloseErrorCB): static_cast from ob->u_vdata instead.
12379 * src/vspace.h: include LString.h since we use string in this class.
12381 * src/vspace.C (lyx_advance): changed name from advance because of
12382 nameclash with stl. And since we cannot use namespaces yet...I
12383 used a lyx_ prefix instead. Expect this to change when we begin
12386 * src/BufferView.[Ch] (BufferView::~BufferView): removed
12388 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
12389 and removed now defunct constructor and deconstructor.
12391 * src/BufferView.h: have backstack as a object not as a pointer.
12392 removed initialization from constructor. added include for BackStack
12394 * development/lyx.spec.in (%build): add CFLAGS also.
12396 * src/screen.C (drawFrame): removed another warning.
12398 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12400 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
12401 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
12402 README and ANNOUNCE a bit for the next release. More work is
12405 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
12406 unbreakable if we are in freespacing mode (LyX-Code), but not in
12409 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
12411 * src/BackStack.h: fixed initialization order in constructor
12413 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
12415 * acinclude.m4 (VERSION): new rules for when a version is
12416 development, added also a variable for prerelease.
12417 (warnings): we set with_warnings=yes for prereleases
12418 (lyx_opt): prereleases compile with same optimization as development
12419 (CXXFLAGS): only use pedantic if we are a development version
12421 * src/BufferView.C (restorePosition): don't do anything if the
12422 backstack is empty.
12424 * src/BackStack.h: added member empty, use this to test if there
12425 is anything to pop...
12427 1999-10-25 Juergen Vigna <jug@sad.it>
12430 * forms/layout_forms.fd +
12431 * forms/latexoptions.fd +
12432 * lyx.fd: changed for various form resize issues
12434 * src/mathed/math_panel.C +
12435 * src/insets/inseterror.C +
12436 * src/insets/insetinfo.C +
12437 * src/insets/inseturl.C +
12438 * src/insets/inseturl.h +
12440 * src/LyXSendto.C +
12441 * src/PaperLayout.C +
12442 * src/ParagraphExtra.C +
12443 * src/TableLayout.C +
12445 * src/layout_forms.C +
12452 * src/menus.C: fixed various resize issues. So now forms can be
12453 resized savely or not be resized at all.
12455 * forms/form_url.fd +
12456 * src/insets/form_url.[Ch]: added because it's cleaner and easier
12459 * src/insets/Makefile.am: added files form_url.[Ch]
12461 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12463 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
12464 (and presumably 6.2).
12466 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
12467 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
12468 remaining static member callbacks.
12470 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
12473 * src/support/lyxstring.h: declare struct Srep as friend of
12474 lyxstring, since DEC cxx complains otherwise.
12476 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12478 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12480 * src/LaTeX.C (run): made run_bibtex also depend on files with
12482 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
12483 are put into the dependency file.
12485 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
12486 the code has shown itself to work
12487 (create_ispell_pipe): removed another warning, added a comment
12490 * src/minibuffer.C (ExecutingCB): removed code that has been
12491 commented out a long time
12493 * src/lyxfunc.C (processKeyEvent): removed some very old commented
12494 out code + a warning.
12496 * src/support/lyxstring.h: comment out the three private
12497 operators, when compiling with string ansi conforming compilers
12498 they make problems.
12500 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
12502 (pixmapFromBitmapData): change type of bdata to be unsigned char *
12503 (pixmapFromBitmapData): add a reinterpret_cast in the call to
12506 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
12509 * src/mathed/math_panel.C (create_math_panel): remove explicit
12512 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
12515 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
12516 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
12517 to XCreatePixmapFromBitmapData
12518 (fl_set_bmtable_data): change the last argument to be unsigned
12520 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
12521 and bh to be unsigned int, remove explicit casts in call to
12522 XReadBitmapFileData.
12524 * images/arrows.xbm: made the arrays unsigned char *
12525 * images/varsz.xbm: ditto
12526 * images/misc.xbm: ditto
12527 * images/greek.xbm: ditto
12528 * images/dots.xbm: ditto
12529 * images/brel.xbm: ditto
12530 * images/bop.xbm: ditto
12532 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
12534 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
12535 (LYX_PROG_CXX): added -pedantic to g++ compile options when
12536 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
12538 (LYX_CXX_CHEADERS): added <clocale> to the test.
12540 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
12542 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
12544 * src/support/lyxstring.C (append): fixed something that must be a
12545 bug, rep->assign was used instead of rep->append.
12547 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
12550 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
12551 lyx insert double chars. Fix spotted by Kayvan.
12553 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12555 * Fixed the tth support. I messed up with the Emacs patch apply feature
12556 and omitted the changes in lyxrc.C.
12558 1999-10-22 Juergen Vigna <jug@sad.it>
12560 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
12562 * src/lyx_cb.C (MenuInsertRef) +
12563 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
12564 the form cannot be resized under it limits (fixes a segfault)
12566 * src/lyx.C (create_form_form_ref) +
12567 * forms/lyx.fd: Changed Gravity on name input field so that it is
12570 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12572 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
12573 <ostream> and <istream>.
12575 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
12576 whether <fstream> provides the latest standard features, or if we
12577 have an oldstyle library (like in egcs).
12578 (LYX_CXX_STL_STRING): fix the test.
12580 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
12581 code on MODERN_STL_STREAM.
12583 * src/support/lyxstring.h: use L{I,O}stream.h.
12585 * src/support/L{I,O}stream.h: new files, designed to setup
12586 correctly streams for our use
12587 - includes the right header depending on STL capabilities
12588 - puts std::ostream and std::endl (for LOStream.h) or
12589 std::istream (LIStream.h) in toplevel namespace.
12591 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12593 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
12594 was a bib file that had been changed we ensure that bibtex is run.
12595 (runBibTeX): enhanced to extract the names of the bib files and
12596 getting their absolute path and enter them into the dep file.
12597 (findtexfile): static func that is used to look for tex-files,
12598 checks for absolute patchs and tries also with kpsewhich.
12599 Alternative ways of finding the correct files are wanted. Will
12601 (do_popen): function that runs a command using popen and returns
12602 the whole output of that command in a string. Should be moved to
12605 * src/DepTable.[Ch] (extchanged): new function that returns true if a
12606 file with extension ext has changed.
12608 * src/insets/figinset.C: added ifdef guards around the fl_free
12609 code that jug commented out. Now it is commented out when
12610 compiling with XForms == 0.89.
12612 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
12613 to lyxstring.C, and only keep a forward declaration in
12614 lyxstring.h. Simplifies the header file a bit and should help a
12615 bit on compile time too. Also changes to Srep will not mandate a
12616 recompile of code just using string.
12617 (~lyxstring): definition moved here since it uses srep.
12618 (size): definition moved here since it uses srep.
12620 * src/support/lyxstring.h: removed a couple of "inline" that should
12623 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12625 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
12628 1999-10-21 Juergen Vigna <jug@sad.it>
12630 * src/table.C (SetPWidth): Just a small fix so the alignment is not
12631 set to left if I just remove the width entry (or it is empty).
12633 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
12634 paragraph when having dummy paragraphs.
12636 1999-10-20 Juergen Vigna <jug@sad.it>
12638 * src/insets/figinset.C: just commented some fl_free_form calls
12639 and added warnings so that this calls should be activated later
12640 again. This avoids for now a segfault, but we have a memory leak!
12642 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
12643 'const char * argument' to 'string argument', this should
12644 fix some Asserts() in lyxstring.C.
12646 * src/lyxfunc.h: Removed the function argAsString(const char *)
12647 as it is not used anymore.
12649 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
12651 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
12654 * src/Literate.h: some funcs moved from public to private to make
12655 interface clearer. Unneeded args removed.
12657 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
12659 (scanBuildLogFile): ditto
12661 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
12662 normal TeX Error. Still room for improvement.
12664 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
12666 * src/buffer.C (insertErrors): changes to make the error
12667 desctription show properly.
12669 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
12672 * src/support/lyxstring.C (helper): changed to use
12673 sizeof(object->rep->ref).
12674 (operator>>): changed to use a pointer instead.
12676 * src/support/lyxstring.h: changed const reference & to value_type
12677 const & lets see if that helps.
12679 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
12681 * Makefile.am (rpmdist): fixed to have non static package and
12684 * src/support/lyxstring.C: removed the compilation guards
12686 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
12689 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
12690 conditional compile of lyxstring.Ch
12692 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
12693 stupid check, but it is a lot better than the bastring hack.
12694 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
12696 * several files: changed string::erase into string::clear. Not
12699 * src/chset.C (encodeString): use a char temporary instead
12701 * src/table.C (TexEndOfCell): added tostr around
12702 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
12703 (TexEndOfCell): ditto
12704 (TexEndOfCell): ditto
12705 (TexEndOfCell): ditto
12706 (DocBookEndOfCell): ditto
12707 (DocBookEndOfCell): ditto
12708 (DocBookEndOfCell): ditto
12709 (DocBookEndOfCell): ditto
12711 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
12713 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
12715 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
12716 (MenuBuildProg): added tostr around ret
12717 (MenuRunChktex): added tostr around ret
12718 (DocumentApplyCB): added tostr around ret
12720 * src/chset.C (encodeString): added tostr around t->ic
12722 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
12723 (makeLaTeXFile): added tostr around tocdepth
12724 (makeLaTeXFile): added tostr around ftcound - 1
12726 * src/insets/insetbib.C (setCounter): added tostr around counter.
12728 * src/support/lyxstring.h: added an operator+=(int) to catch more
12731 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
12732 (lyxstring): We DON'T allow NULL pointers.
12734 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12736 * src/mathed/math_macro.C (MathMacroArgument::Write,
12737 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12738 when writing them out.
12740 * src/LString.C: remove, since it is not used anymore.
12742 * src/support/lyxstring.C: condition the content to
12743 USE_INCLUDED_STRING macro.
12745 * src/mathed/math_symbols.C, src/support/lstrings.C,
12746 src/support/lyxstring.C: add `using' directive to specify what
12747 we need in <algorithm>. I do not think that we need to
12748 conditionalize this, but any thought is appreciated.
12750 * many files: change all callback functions to "C" linkage
12751 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12752 strict_ansi. Those who were static are now global.
12753 The case of callbacks which are static class members is
12754 trickier, since we have to make C wrappers around them (see
12755 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12756 did not finish this yet, since it defeats the purpose of
12757 encapsulation, and I am not sure what the best route is.
12759 1999-10-19 Juergen Vigna <jug@sad.it>
12761 * src/support/lyxstring.C (lyxstring): we permit to have a null
12762 pointer as assignment value and just don't assign it.
12764 * src/vspace.C (nextToken): corrected this function substituting
12765 find_first(_not)_of with find_last_of.
12767 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12768 (TableOptCloseCB) (TableSpeCloseCB):
12769 inserted fl_set_focus call for problem with fl_hide_form() in
12772 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12774 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12777 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12779 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12780 LyXLex::next() and not eatline() to get its argument.
12782 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12784 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12785 instead, use fstreams for io of the depfile, removed unneeded
12786 functions and variables.
12788 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12789 vector instead, removed all functions and variables that is not in
12792 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12794 * src/buffer.C (insertErrors): use new interface to TeXError
12796 * Makefile.am (rpmdist): added a rpmdist target
12798 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12799 per Kayvan's instructions.
12801 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12803 * src/Makefile.am: add a definition for localedir, so that locales
12804 are found after installation (Kayvan)
12806 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12808 * development/.cvsignore: new file.
12810 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12812 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12813 C++ compiler provides wrappers for C headers and use our alternate
12816 * configure.in: use LYX_CXX_CHEADERS.
12818 * src/cheader/: new directory, populated with cname headers from
12819 libstdc++-2.8.1. They are a bit old, but probably good enough for
12820 what we want (support compilers who lack them).
12822 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12823 from includes. It turns out is was stupid.
12825 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12827 * lib/Makefile.am (install-data-local): forgot a ';'
12828 (install-data-local): forgot a '\'
12829 (libinstalldirs): needed after all. reintroduced.
12831 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12833 * configure.in (AC_OUTPUT): added lyx.spec
12835 * development/lyx.spec: removed file
12837 * development/lyx.spec.in: new file
12839 * po/*.po: merged with lyx.pot becuase of make distcheck
12841 * lib/Makefile.am (dist-hook): added dist-hook so that
12842 documentation files will be included when doing a make
12843 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12844 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
12846 more: tried to make install do the right thing, exclude CVS dirs
12849 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
12850 Path would fit in more nicely.
12852 * all files that used to use pathstack: uses now Path instead.
12853 This change was a lot easier than expected.
12855 * src/support/path.h: new file
12857 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12859 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12861 * src/support/lyxstring.C (getline): Default arg was given for
12864 * Configure.cmd: removed file
12866 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12868 * src/support/DebugStream.[Ch]: remove the explicit std:: before
12869 streams classes and types, add the proper 'using' statements when
12870 MODERN_STL is defined.
12872 * src/debug.h: move the << operator definition after the inclusion
12875 * src/support/filetools.C: include "LAssert.h", which is needed
12878 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
12881 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
12882 include "debug.h" to define a proper ostream.
12884 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12886 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
12887 method to the SystemCall class which can kill a process, but it's
12888 not fully implemented yet.
12890 * src/*.C: Changed Systemcalls::Startscript() to startscript()
12892 * src/support/FileInfo.h: Better documentation
12894 * src/lyxfunc.C: Added support for buffer-export html
12896 * src/menus.C: Added Export->As HTML...
12898 * lib/bind/*.bind: Added short-cut for buffer-export html
12900 * src/lyxrc.*: Added support for new \tth_command
12902 * lib/lyxrc.example: Added stuff for new \tth_command
12904 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
12906 * lib/Makefile.am (IMAGES): removed images/README
12907 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
12908 installes in correct place. Check permisions is installed
12911 * src/LaTeX.C: some no-op changes moved declaration of some
12914 * src/LaTeX.h (LATEX_H): changed include guard name
12916 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12918 * lib/reLyX/Makefile.am: install noweb2lyx.
12920 * lib/Makefile.am: install configure.
12922 * lib/reLyX/configure.in: declare a config aux dir; set package
12923 name to lyx (not sure what the best solution is); generate noweb2lyx.
12925 * lib/layouts/egs.layout: fix the bibliography layout.
12927 1999-10-08 Jürgen Vigna <jug@sad.it>
12929 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
12930 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
12931 it returned without continuing to search the path.
12933 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
12935 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
12936 also fixes a bug. It is not allowed to do tricks with std::strings
12937 like: string a("hei"); &a[e]; this will not give what you
12938 think... Any reason for the complexity in this func?
12940 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
12942 * Updated README and INSTALL a bit, mostly to check that my
12943 CVS rights are correctly set up.
12945 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
12947 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
12948 does not allow '\0' chars but lyxstring and std::string does.
12950 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12952 * autogen.sh (AUTOCONF): let the autogen script create the
12953 POTFILES.in file too. POTFILES.in should perhaps now not be
12954 included in the cvs module.
12956 * some more files changed to use C++ includes instead of C ones.
12958 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
12960 (Reread): added tostr to nlink. buggy output otherwise.
12961 (Reread): added a string() around szMode when assigning to Buffer,
12962 without this I got a log of garbled info strings.
12964 * acconfig.h: commented out the PTR_AS_INT macros. They should not
12967 * I have added several ostream & operator<<(ostream &, some_type)
12968 functions. This has been done to avoid casting and warnings when
12969 outputting enums to lyxerr. This as thus eliminated a lot of
12970 explicit casts and has made the code clearer. Among the enums
12971 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
12972 mathed enums, some font enum the Debug::type enum.
12974 * src/support/lyxstring.h (clear): missing method. equivalent of
12977 * all files that contained "stderr": rewrote constructs that used
12978 stderr to use lyxerr instead. (except bmtable)
12980 * src/support/DebugStream.h (level): and the passed t with
12981 Debug::ANY to avoid spurious bits set.
12983 * src/debug.h (Debug::type value): made it accept strings of the
12984 type INFO,INIT,KEY.
12986 * configure.in (Check for programs): Added a check for kpsewhich,
12987 the latex generation will use this later to better the dicovery of
12990 * src/BufferView.C (create_view): we don't need to cast this to
12991 (void*) that is done automatically.
12992 (WorkAreaButtonPress): removed some dead code.
12994 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12996 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
12997 is not overwritten when translated (David Sua'rez de Lis).
12999 * lib/CREDITS: Added David Sua'rez de Lis
13001 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
13003 * src/bufferparams.C (BufferParams): default input encoding is now
13006 * acinclude.m4 (cross_compiling): comment out macro
13007 LYX_GXX_STRENGTH_REDUCE.
13009 * acconfig.h: make sure that const is not defined (to empty) when
13010 we are compiling C++. Remove commented out code using SIZEOF_xx
13013 * configure.in : move the test for const and inline as late as
13014 possible so that these C tests do not interefere with C++ ones.
13015 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
13016 has not been proven.
13018 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
13020 * src/table.C (getDocBookAlign): remove bad default value for
13021 isColumn parameter.
13023 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
13025 (ShowFileMenu2): ditto.
13027 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
13028 of files to ignore.
13030 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
13032 * Most files: finished the change from the old error code to use
13033 DebugStream for all lyxerr debugging. Only minor changes remain
13034 (e.g. the setting of debug levels using strings instead of number)
13036 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
13038 * src/layout.C (Add): Changed to use compare_no_case instead of
13041 * src/FontInfo.C: changed loop variable type too string::size_type.
13043 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
13045 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
13046 set ETAGS_ARGS to --c++
13048 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
13050 * src/table.C (DocBookEndOfCell): commented out two unused variables
13052 * src/paragraph.C: commented out four unused variables.
13054 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
13055 insed a if clause with type string::size_type.
13057 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
13060 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
13062 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
13063 variable, also changed loop to go from 0 to lenght + 1, instead of
13064 -1 to length. This should be correct.
13066 * src/LaTeX.C (scanError): use string::size_type as loop variable
13069 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
13070 (l.896) since y_tmp and row was not used anyway.
13072 * src/insets/insetref.C (escape): use string::size_type as loop
13075 * src/insets/insetquotes.C (Width): use string::size_type as loop
13077 (Draw): use string::size_type as loop variable type.
13079 * src/insets/insetlatexaccent.C (checkContents): use
13080 string::size_type as loop variable type.
13082 * src/insets/insetlabel.C (escape): use string::size_type as loop
13085 * src/insets/insetinfo.C: added an extern for current_view.
13087 * src/insets/insetcommand.C (scanCommand): use string::size_type
13088 as loop variable type.
13090 * most files: removed the RCS tags. With them we had to recompile
13091 a lot of files after a simple cvs commit. Also we have never used
13092 them for anything meaningful.
13094 * most files: tags-query-replace NULL 0. As adviced several plases
13095 we now use "0" instead of "NULL" in our code.
13097 * src/support/filetools.C (SpaceLess): use string::size_type as
13098 loop variable type.
13100 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
13102 * src/paragraph.C: fixed up some more string stuff.
13104 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
13106 * src/support/filetools.h: make modestr a std::string.
13108 * src/filetools.C (GetEnv): made ch really const.
13110 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
13111 made code that used these use max/min from <algorithm> instead.
13113 * changed several c library include files to their equivalent c++
13114 library include files. All is not changed yet.
13116 * created a support subdir in src, put lyxstring and lstrings
13117 there + the extra files atexit, fileblock, strerror. Created
13118 Makefile.am. edited configure.in and src/Makefile.am to use this
13119 new subdir. More files moved to support.
13121 * imported som of the functions from repository lyx, filetools
13123 * ran tags-query-replace on LString -> string, corrected the bogus
13124 cases. Tried to make use of lstrings.[hC], debugged a lot. There
13125 is still some errors in there. This is errors where too much or
13126 too litle get deleted from strings (string::erase, string::substr,
13127 string::replace), there can also be some off by one errors, or
13128 just plain wrong use of functions from lstrings. Viewing of quotes
13131 * LyX is now running fairly well with string, but there are
13132 certainly some bugs yet (see above) also string is quite different
13133 from LString among others in that it does not allow null pointers
13134 passed in and will abort if it gets any.
13136 * Added the revtex4 files I forgot when setting up the repository.
13138 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
13140 * All over: Tried to clean everything up so that only the files
13141 that we really need are included in the cvs repository.
13142 * Switched to use automake.
13143 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
13144 * Install has not been checked.
13146 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
13148 * po/pt.po: Three errors:
13149 l.533 and l.538 format specification error
13150 l. 402 duplicate entry, I just deleted it.